Bump version to 3.34.0

Update NEWS.

.eslintrc.json

@@ -0,0 +1,6 @@
+{
+    "extends": [
+        "./lint/eslintrc-gjs.json",
+        "./lint/eslintrc-shell.json"
+    ]
+}

.gitlab-ci.yml

@@ -1,6 +1,5 @@
 stages:
  - review
- - source_check
  - build
  - test
 
@@ -26,19 +25,27 @@ check_commit_log:
 
 js_check:
     image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
-    stage: source_check
+    stage: review
     script:
         - find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG
         - (! grep -q . $JS_LOG)
     <<: *only_default
-    only:
-        changes:
-            - js/**/*
     artifacts:
         paths:
             - ${JS_LOG}
         when: on_failure
 
+eslint:
+    image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
+    stage: review
+    script:
+        - ./.gitlab-ci/run-eslint.sh
+    <<: *only_default
+    artifacts:
+        paths:
+            - reports
+        when: always
+
 build:
     image: registry.gitlab.gnome.org/gnome/mutter/master:v2
     stage: build
@@ -47,7 +54,7 @@ build:
         - meson mutter mutter/build --prefix=/usr -Dtests=false
         - ninja -C mutter/build install
     script:
-        - meson . build -Dbuiltype=debugoptimized
+        - meson . build -Dbuiltype=debugoptimized -Dman=false
         - ninja -C build
         - ninja -C build install
     <<: *only_default
@@ -60,6 +67,8 @@ build:
 test:
     image: registry.gitlab.gnome.org/gnome/mutter/master:v2
     stage: test
+    variables:
+        XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
     before_script:
         - ninja -C mutter/build install
     script:

.gitlab-ci/Dockerfile.extension-ci

@@ -1,7 +1,7 @@
 FROM registry.fedoraproject.org/fedora:latest
 
 RUN dnf -y update && dnf -y upgrade && \
-    dnf install -y 'dnf-command(copr)' && \
+    dnf install -y 'dnf-command(copr)' git && \
 
     # For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'`
     dnf install -y findutils mozjs60-devel && \

.gitlab-ci/run-eslint.sh

@@ -0,0 +1,97 @@
+#!/usr/bin/env bash
+
+OUTPUT_REGULAR=reports/lint-regular-report.txt
+OUTPUT_LEGACY=reports/lint-legacy-report.txt
+OUTPUT_FINAL=reports/lint-common-report.txt
+
+OUTPUT_MR=reports/lint-mr-report.txt
+
+LINE_CHANGES=changed-lines.txt
+
+is_empty() {
+  (! grep -q . $1)
+}
+
+run_eslint() {
+  ARGS_LEGACY='--config lint/eslintrc-legacy.json'
+
+  local extra_args=ARGS_$1
+  local output=OUTPUT_$1
+  eslint -f unix ${!extra_args} -o ${!output} js
+}
+
+list_commit_range_additions() {
+  # Turn raw context-less git-diff into a list of
+  # filename:lineno pairs of new (+) lines
+  git diff -U0 "$@" -- js |
+  awk '
+    BEGIN { file=""; }
+    /^+++ b/ { file=substr($0,7); }
+    /^@@ / {
+        len = split($3,a,",")
+        start=a[1]
+        count=(len > 1) ? a[2] : 1
+
+        for (line=start; line<start+count; line++)
+            printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line;
+    }'
+}
+
+copy_matched_lines() {
+  local source=$1
+  local matches=$2
+  local target=$3
+
+  echo -n > $target
+  for l in $(<$matches); do
+    grep $l $source >> $target
+  done
+}
+
+create_common() {
+  # comm requires sorted input;
+  # we also strip the error message to make the following a "common" error:
+  # regular:
+  #  file.js:42:23 Indentation of 55, expected 42
+  # legacy:
+  #  file.js:42:23 Indentation of 55, extected 24
+  prepare() {
+    sed 's: .*::' $1 | sort
+  }
+
+  comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp
+
+  # Now add back the stripped error messages
+  copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL
+  rm $OUTPUT_FINAL.tmp
+}
+
+if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
+  git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME
+  branch_point=$(git merge-base HEAD FETCH_HEAD)
+  commit_range=$branch_point...$CI_COMMIT_SHA
+
+  list_commit_range_additions $commit_range > $LINE_CHANGES
+
+  # Don't bother with running lint when no JS changed
+  if is_empty $LINE_CHANGES; then
+    exit 0
+  fi
+fi
+
+echo Generating lint report using regular configuration
+run_eslint REGULAR
+echo Generating lint report using legacy configuration
+run_eslint LEGACY
+echo Done.
+create_common
+
+# Just show the report and succeed when not testing a MR
+if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
+  cat $OUTPUT_FINAL
+  exit 0
+fi
+
+copy_matched_lines $OUTPUT_FINAL $LINE_CHANGES $OUTPUT_MR
+cat $OUTPUT_MR
+is_empty $OUTPUT_MR

HACKING.md

@@ -84,7 +84,6 @@ don't use.
 
     const Main = imports.ui.main;
     const Params = imports.misc.params;
-    const Tweener = imports.ui.tweener;
     const Util = imports.misc.util;
 ```
 The alphabetical ordering should be done independently of the location of the
@@ -277,34 +276,49 @@ If your usage of an object is like a hash table (and thus conceptually the keys
 can have special chars in them), don't use quotes, but use brackets: `{ bar: 42
 }`, `foo['bar']`.
 
-## Getters, setters, and Tweener
+## Animations
+
+Most objects that are animated are actors, and most properties used in animations
+are animatable, which means they can use implicit animations:
 
-Getters and setters should be used when you are dealing with an API that is
-designed around setting properties, like Tweener. If you want to animate an
-arbitrary property, create a getter and setter, and use Tweener to animate the
-property.
 ```javascript
-    var ANIMATION_TIME = 2000;
-
-    var MyClass = class {
-        constructor() {
-            this.actor = new St.BoxLayout();
-            this._position = 0;
-        }
-
-        get position() {
-            return this._position;
-        }
-
-        set position(value) {
-            this._position = value;
-            this.actor.set_position(value, value);
-        }
-    };
-
-    let myThing = new MyClass();
-    Tweener.addTween(myThing,
-                     { position: 100,
-                       time: ANIMATION_TIME,
-                       transition: 'easeOutQuad' });
+    moveActor(actor, x, y) {
+        actor.ease({
+            x,
+            y,
+            duration: 500, // ms
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
+    }
+```
+
+The above is a convenience wrapper around the actual Clutter API, and should generally
+be preferred over the more verbose:
+
+```javascript
+    moveActor(actor, x, y) {
+        actor.save_easing_state();
+
+        actor.set_easing_duration(500);
+        actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD);
+        actor.set({
+            x,
+            y
+        });
+
+        actor.restore_easing_state();
+    }
+```
+
+There is a similar convenience API around Clutter.PropertyTransition to animate
+actor (or actor meta) properties that cannot use implicit animations:
+
+```javascript
+    desaturateActor(actor, desaturate) {
+        let factor = desaturate ? 1.0 : 0.0;
+        actor.ease_property('@effects.desaturate.factor', factor, {
+            duration: 500, // ms
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
+    }
 ```

NEWS

@@ -1,3 +1,106 @@
+3.34.0
+======
+* Handle startup/shutdown of misc X11 services [Carlos; !680]
+* Fix sound volume mute/unmute [Iain; #1557]
+* Correctly terminate pasted text [Carlos; #1570]
+
+Contributors:
+  Carlos Garnacho, Iain Lane
+
+Translators:
+  Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
+  Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
+  Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
+
+3.33.92
+=======
+* Animate pointer a11y pie timer [Jonas D.; !688]
+* Fix restarting shell in systemd user session [Benjamin; !690]
+* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
+  !691, !689, !692, #1552, !698]
+
+Contributors:
+  Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
+  Will Thompson
+
+Translators:
+  Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
+  Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
+  Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
+  Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
+  Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
+  Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
+  Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
+
+3.33.91
+=======
+* Fix regression when adjusting brightness [Florian; #1500]
+* Fix pointer a11y timeout animation [Jonas D.; #1533]
+* Add new extensions CLI tool [Florian; #1234]
+* Only track top-level windows [Carlos; #556]
+* Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian;
+  !678, !682, !686]
+
+Contributors:
+  Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner
+
+Translators:
+  Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv],
+  Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi],
+  Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl],
+  Danial Behzadi [fa]
+
+3.33.90
+=======
+* Implement DND app picker folder management [Georges; !643, !645, !664, !671]
+* Make Clocks/Weather integration work with sandboxed apps [Florian; #1158]
+* Support startup via systemd user instance [Benjamin; !507]
+* Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669]
+* Minimize travel distance in overview animation [Sergey; !267]
+* Rescan icon theme when installed apps changed [Georges; !661]
+* Consistently animate new window actions [Jonas; !662, !673]
+* Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels,
+  Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647,
+  !385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665,
+  !667, !670, #1357, !672, !657, #1507, !674, !677]
+
+Contributors:
+  Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner,
+  Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode,
+  Marco Trevisan (Treviño), verdre, Daniel van Vugt
+
+Translators:
+  Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR],
+  Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es],
+  Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro],
+  Anders Jonsson [sv]
+
+3.33.4
+======
+* Fix unintentional interference between gestures [Jonas; !598]
+* Fix unintentional loop while polkit dialog is active [Ray; !602]
+* Fix alt-tab icon size on HiDPI [Jonas; !587]
+* Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449]
+* Fix style updates for non-background CSS properties [Florian; #1212]
+* Fix cursor visibility in screen recordings [Illya; #1208]
+* Add option for disabling the hot corner [Florian; #688320]
+* Use more fine-grained levels in battery indicator [Florian; !561, #1442]
+* Fix the calculation of the maximum number of app search results [Jonas; !110]
+* Handle horizontal workspace layout with gestures/animations [Florian; !575]
+* Improve handling of session mode extensions [Florian, Didier; #789852]
+* Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin,
+  Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611,
+  !614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626,
+  !491, !631, !632, !633, #1457]
+
+Contributors:
+  Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho,
+  Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada,
+  Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño)
+
+Translators:
+  Jordi Mas [ca], Jor Teron [mjw]
+
 3.33.3
 ======
 * Prepare for optional X11 [Carlos; !378]

data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml

@@ -0,0 +1,15 @@
+<node>
+
+  <!--
+      org.gnome.Shell.ClocksIntegration:
+      @short_description: Clocks integration interface
+
+      The interface used for exporting location settings to GNOME Shell's
+      world clocks integration.
+  -->
+  <interface name="org.gnome.Shell.ClocksIntegration">
+
+  <property name="Locations" type="av" access="read"/>
+
+  </interface>
+</node>

data/dbus-interfaces/org.gnome.Shell.Extensions.xml

@@ -173,6 +173,30 @@
       <arg type="s" direction="in" name="uuid"/>
     </method>
 
+    <!--
+        EnableExtension:
+        @uuid: The UUID of the extension
+        @success: Whether the operation was successful
+
+        Enable an extension.
+    -->
+    <method name="EnableExtension"> \
+      <arg type="s" direction="in" name="uuid"/> \
+      <arg type="b" direction="out" name="success"/> \
+    </method> \
+
+    <!--
+        DisableExtension:
+        @uuid: The UUID of the extension
+        @success: Whether the operation was successful
+
+        Disable an extension.
+    -->
+    <method name="DisableExtension"> \
+      <arg type="s" direction="in" name="uuid"/> \
+      <arg type="b" direction="out" name="success"/> \
+    </method> \
+
     <!--
         LaunchExtensionPrefs:
         @uuid: The UUID of the extension
@@ -189,6 +213,15 @@
     -->
     <method name="CheckForUpdates"/>
 
+    <signal name="ExtensionStateChanged">
+      <arg type="s" name="uuid"/>
+      <arg type="a{sv}" name="state"/>
+    </signal>
+
+    <!--
+        ExtensionStatusChanged:
+        Deprecated for ExtensionStateChanged
+    -->
     <signal name="ExtensionStatusChanged">
       <arg type="s" name="uuid"/>
       <arg type="i" name="state"/>

data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml

@@ -0,0 +1,16 @@
+<node>
+
+  <!--
+      org.gnome.Shell.WeatherIntegration:
+      @short_description: Weather integration interface
+
+      The interface used for exporting location settings to GNOME Shell's
+      weather integration.
+  -->
+  <interface name="org.gnome.Shell.WeatherIntegration">
+
+  <property name="AutomaticLocation" type="b" access="read"/>
+  <property name="Locations" type="av" access="read"/>
+
+  </interface>
+</node>

data/dbus-interfaces/org.gnome.Shell.xml

@@ -9,7 +9,7 @@
     <method name="ShowOSD">
       <arg type="a{sv}" direction="in" name="params"/>
     </method>
-    <method name="ShowMonitorLabels2">
+    <method name="ShowMonitorLabels">
       <arg type="a{sv}" direction="in" name="params"/>
     </method>
     <method name="HideMonitorLabels"/>

data/gnome-shell-dbus-interfaces.gresource.xml

@@ -40,6 +40,7 @@
     <file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file>
+    <file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file>
@@ -48,6 +49,7 @@
     <file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file>
+    <file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file>
     <file preprocess="xml-stripblanks">org.gnome.Shell.xml</file>
     <file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file>
     <file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file>

data/gnome-shell-disable-extensions.service

@@ -0,0 +1,14 @@
+[Unit]
+Description=Disable GNOME Shell extensions after failure
+DefaultDependencies=no
+
+# Only disable extensions for a short period of time after login.
+# This means we err on the side of failing the first login after a broken
+# extension was installed.
+Requisite=gnome-session-stable.timer
+
+[Service]
+Type=simple
+# Disable extensions
+ExecStart=gsettings set org.gnome.shell disable-user-extensions true
+Restart=no

data/gnome-shell-wayland.service.in

@@ -0,0 +1,25 @@
+[Unit]
+Description=GNOME Shell on Wayland
+# On wayland, force a session shutdown
+OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target
+OnFailureJobMode=replace-irreversibly
+CollectMode=inactive-or-failed
+RefuseManualStart=on
+RefuseManualStop=on
+
+After=gnome-session-manager.target
+
+Requisite=gnome-session-initialized.target
+PartOf=gnome-session-initialized.target
+Before=gnome-session-initialized.target
+
+# The units already conflict because they use the same BusName
+#Conflicts=gnome-shell-x11.service
+
+[Service]
+Type=notify
+ExecStart=@bindir@/gnome-shell
+# Exit code 1 means we are probably *not* dealing with an extension failure
+SuccessExitStatus=1
+# On wayland we cannot restart
+Restart=no

data/gnome-shell-wayland.target

@@ -1,5 +1,10 @@
 [Unit]
-Description=GNOME Shell (wayland sync point)
-After=gnome-shell.service
-BindsTo=gnome-shell.service
-Conflicts=gnome-shell-x11.target
+Description=GNOME Shell on Wayland
+DefaultDependencies=no
+
+Requisite=gnome-session-initialized.target
+PartOf=gnome-session-initialized.target
+Before=gnome-session-initialized.target
+
+Requires=gnome-shell-wayland.service
+After=gnome-shell-wayland.service

data/gnome-shell-x11.service.in

@@ -0,0 +1,31 @@
+[Unit]
+Description=GNOME Shell on X11
+# On X11, try to show the GNOME Session Failed screen
+OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target
+OnFailureJobMode=replace
+CollectMode=inactive-or-failed
+RefuseManualStart=on
+RefuseManualStop=on
+
+After=gnome-session-manager.target
+
+Requisite=gnome-session-initialized.target
+PartOf=gnome-session-initialized.target
+Before=gnome-session-initialized.target
+
+# The units already conflict because they use the same BusName
+#Conflicts=gnome-shell-wayland.service
+
+# Limit startup frequency more than the default
+StartLimitIntervalSec=15s
+StartLimitBurst=3
+
+[Service]
+Type=notify
+ExecStart=@bindir@/gnome-shell
+# Exit code 1 means we are probably *not* dealing with an extension failure
+SuccessExitStatus=1
+# On X11 we want to restart on-success (Alt+F2 + r) and on-failure.
+Restart=always
+# Do not wait before restarting the shell
+RestartSec=0ms

data/gnome-shell-x11.target

@@ -1,5 +1,10 @@
 [Unit]
-Description=GNOME Shell (x11 sync point)
-After=gnome-shell.service
-BindsTo=gnome-shell.service
-Conflicts=gnome-shell-wayland.target
+Description=GNOME Shell on X11
+DefaultDependencies=no
+
+Requisite=gnome-session-initialized.target
+PartOf=gnome-session-initialized.target
+Before=gnome-session-initialized.target
+
+Requires=gnome-shell-x11.service
+After=gnome-shell-x11.service

data/gnome-shell.service.in

@@ -1,11 +0,0 @@
-[Unit]
-Description=GNOME Shell
-Wants=gnome-session.service
-After=graphical-session-pre.target gnome-session-bus.target
-PartOf=graphical-session.target
-
-[Service]
-Type=dbus
-ExecStart=@bindir@/gnome-shell
-Restart=on-failure
-BusName=org.gnome.Shell

data/meson.build

@@ -14,6 +14,8 @@ desktopconf = configuration_data()
 # file when built in a non-system prefix
 desktopconf.set('bindir', bindir)
 desktopconf.set('VERSION', meson.project_version())
+desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false')
+
 foreach desktop_file : desktop_files
   i18n.merge_file('desktop',
     input: configure_file(
@@ -22,7 +24,7 @@ foreach desktop_file : desktop_files
       configuration: desktopconf
     ),
     output: desktop_file,
-    po_dir: '../po',
+    po_dir: po_dir,
     install: true,
     install_dir: desktopdir,
     type: 'desktop'
@@ -98,15 +100,23 @@ if have_systemd
   unitconf = configuration_data()
   unitconf.set('bindir', bindir)
 
-  unit = configure_file(
-    input: 'gnome-shell.service.in',
-    output: 'gnome-shell.service',
+  configure_file(
+    input: 'gnome-shell-x11.service.in',
+    output: 'gnome-shell-x11.service',
     configuration: unitconf,
     install_dir: systemduserunitdir
   )
 
-  units = files('gnome-shell-wayland.target',
-                'gnome-shell-x11.target')
+  configure_file(
+    input: 'gnome-shell-wayland.service.in',
+    output: 'gnome-shell-wayland.service',
+    configuration: unitconf,
+    install_dir: systemduserunitdir
+  )
+
+  units = files('gnome-shell-x11.target',
+                'gnome-shell-wayland.target',
+                'gnome-shell-disable-extensions.service')
 
   install_data(units, install_dir: systemduserunitdir)
 endif

data/org.gnome.Shell.desktop.in.in

@@ -14,3 +14,4 @@ X-GNOME-Autostart-Phase=DisplayServer
 X-GNOME-Provides=panel;windowmanager;
 X-GNOME-Autostart-Notify=true
 X-GNOME-AutoRestart=false
+X-GNOME-HiddenUnderSystemd=@systemd_hidden@

data/org.gnome.shell.gschema.xml.in

@@ -21,6 +21,17 @@
         EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell.
       </description>
     </key>
+    <key name="disabled-extensions" type="as">
+      <default>[]</default>
+      <summary>UUIDs of extensions to force disabling</summary>
+      <description>
+        GNOME Shell extensions have a UUID property; this key lists extensions
+        which should be disabled, even if loaded as part of the current mode.
+        You can also manipulate this list with the EnableExtension and
+        DisableExtension D-Bus methods on org.gnome.Shell.
+        This key takes precedence over the “enabled-extensions” setting.
+      </description>
+    </key>
     <key name="disable-user-extensions" type="b">
       <default>false</default>
       <summary>Disable user extensions</summary>
@@ -139,11 +150,6 @@
         Keybinding to focus the active notification.
       </description>
     </key>
-    <key name="pause-resume-tweens" type="as">
-      <default>[]</default>
-      <summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary>
-      <description></description>
-    </key>
     <key name="switch-to-application-1" type="as">
       <default>["&lt;Super&gt;1"]</default>
       <summary>Switch to application 1</summary>
@@ -222,6 +228,36 @@
     </key>
   </schema>
 
+  <schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/"
+          gettext-domain="@GETTEXT_PACKAGE@">
+    <key name="locations" type="av">
+      <summary>Locations</summary>
+      <description>
+        The locations to show in world clocks
+      </description>
+      <default>[]</default>
+    </key>
+  </schema>
+
+  <schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/"
+          gettext-domain="@GETTEXT_PACKAGE@">
+    <key name="automatic-location" type="b">
+      <summary>Automatic location</summary>
+      <description>
+        Whether to fetch the current location or not
+      </description>
+      <default>false</default>
+    </key>
+
+    <key name="locations" type="av">
+      <summary>Location</summary>
+      <description>
+        The location for which to show a forecast
+      </description>
+      <default>[]</default>
+    </key>
+  </schema>
+
   <!-- unused, change 00_org.gnome.shell.gschema.override instead -->
   <schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/"
 	  gettext-domain="@GETTEXT_PACKAGE@">

data/theme/gnome-shell-sass/_common.scss

@@ -619,6 +619,18 @@ StScrollBar {
   app menu inside the main app window itself rather than the top bar
 */
 
+/*************
+ * App Icons *
+ *************/
+/* Outline for low res icons */
+.lowres-icon {
+    icon-shadow: 0 1px 2px rgba(0,0,0,0.3);
+}
+
+/* Drapshadow for large icons */
+.icon-dropshadow {
+  icon-shadow: 0 1px 2px rgba(0,0,0,0.4);
+}
 
 /* OSD */
 .osd-window {
@@ -728,7 +740,8 @@ StScrollBar {
     spacing: 8px;
   }
 
-  .ws-switcher-active-up, .ws-switcher-active-down {
+  .ws-switcher-active-up, .ws-switcher-active-down,
+  .ws-switcher-active-left, .ws-switcher-active-right {
     height: 50px;
     background-color: $selected_bg_color;
     color: $selected_fg_color;
@@ -929,7 +942,7 @@ StScrollBar {
     .world-clocks-button,
     .weather-button,
     .events-section-title {
-      &:hover, focus { background-color: $_hover_bg_color }
+      &:hover, &:focus { background-color: $_hover_bg_color }
       &:active { background-color: $_active_bg_color }
     }
 
@@ -1000,7 +1013,7 @@ StScrollBar {
       background-color: transparent;
       width: 32px;
       border-radius: 4px;
-      &:hover, focus { background-color: $_hover_bg_color; }
+      &:hover, &:focus { background-color: $_hover_bg_color; }
       &:active { background-color: transparentize($fg_color, 0.84); }
     }
 
@@ -1016,7 +1029,7 @@ StScrollBar {
       margin: 2px;
       border-radius: 1.4em;
       font-feature-settings: "tnum";
-      &:hover, focus { background-color: $_hover_bg_color; }
+      &:hover, &:focus { background-color: $_hover_bg_color; }
       &:active,&:selected {
         color: lighten($selected_fg_color,5%);
         background-color: $selected_bg_color;
@@ -1158,7 +1171,6 @@ StScrollBar {
   // a little unstructured mess:
 
   #appMenu {
-    spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg");
     spacing: 4px;
 
     .label-shadow { color: transparent; }
@@ -1326,8 +1338,8 @@ StScrollBar {
 
   .window-clone-border {
     $_bg: transparentize(white, 0.65);
-    border: 5px solid $_bg;
-    border-radius: 6px;
+    border: 7px solid $_bg;
+    border-radius: $modal_radius;
     // For window decorations with round corners we can't match
     // the exact shape when the window is scaled. So apply a shadow
     // to fix that case
@@ -1364,11 +1376,8 @@ StScrollBar {
 
   //search results
 
-  #searchResultsBin {
-    max-width: 1000px;
-  }
-
   #searchResultsContent {
+    max-width: 1000px;
     padding-left: 20px;
     padding-right: 20px;
     spacing: 16px;
@@ -1484,11 +1493,11 @@ StScrollBar {
   .search-provider-icon,
   .list-search-result {
     @extend %icon_tile;
-    &:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
     &:focus, &:selected, &:hover {
       background-color: transparentize($osd_fg_color,.9);
       transition-duration: 200ms;
     }
+    &:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
   }
   .app-well-app,
   .app-well-app.app-folder,
@@ -1497,10 +1506,6 @@ StScrollBar {
     & .overview-icon {
       @extend %icon_tile;
     }
-    &:active .overview-icon,
-    &:checked .overview-icon {
-      background-color: transparentize(darken($osd_bg_color,10%), 0.5);
-    }
     &:hover .overview-icon,
     &:focus .overview-icon,
     &:selected .overview-icon {
@@ -1509,7 +1514,13 @@ StScrollBar {
       border-image: none;
       background-image: none;
     }
-
+    &:drop .overview-icon {
+      background-color: transparentize($selected_bg_color,.15);
+    }
+    &:active .overview-icon,
+    &:checked .overview-icon {
+      background-color: transparentize(darken($osd_bg_color,10%), 0.5);
+    }
   }
 
   .app-well-app-running-dot { //running apps indicator
@@ -1599,7 +1610,6 @@ StScrollBar {
   }
 
   //Some hacks I don't even
-  .search-display > StBoxLayout,
   .all-apps,
   .frequent-apps > StBoxLayout {
     // horizontal padding to make sure scrollbars or dash don't overlap content

docs/reference/shell/meson.build

@@ -28,7 +28,7 @@ foreach iface : ifaces
     output: 'doc-gen-' + iface[1],
     command: [
       'gdbus-codegen',
-      '--interface-prefix=@0@.'.format(iface),
+      '--interface-prefix=@0@.'.format(iface[0]),
       '--generate-docbook', 'doc-gen',
       '--output-directory', '@OUTDIR@',
       '@INPUT@'

js/extensionPrefs/main.js

@@ -1,3 +1,7 @@
+/* exported main */
+imports.gi.versions.Gdk = '3.0';
+imports.gi.versions.Gtk = '3.0';
+
 const Gettext = imports.gettext;
 const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi;
 const Format = imports.format;
@@ -8,6 +12,8 @@ const Config = imports.misc.config;
 const ExtensionUtils = imports.misc.extensionUtils;
 const { loadInterfaceXML } = imports.misc.fileUtils;
 
+const { ExtensionState } = ExtensionUtils;
+
 const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions');
 const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface);
 
@@ -17,74 +23,54 @@ function stripPrefix(string, prefix) {
     return string;
 }
 
-var Application = class {
-    constructor() {
+var Application = GObject.registerClass({
+    GTypeName: 'ExtensionPrefs_Application'
+}, class Application extends Gtk.Application {
+    _init() {
         GLib.set_prgname('gnome-shell-extension-prefs');
-        this.application = new Gtk.Application({
+        super._init({
             application_id: 'org.gnome.shell.ExtensionPrefs',
             flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
         });
 
-        this.application.connect('activate', this._onActivate.bind(this));
-        this.application.connect('command-line', this._onCommandLine.bind(this));
-        this.application.connect('startup', this._onStartup.bind(this));
-
-        this._extensionPrefsModules = {};
-
         this._startupUuid = null;
         this._loaded = false;
         this._skipMainWindow = false;
+        this._shellProxy = null;
     }
 
-    _extensionAvailable(uuid) {
-        let extension = ExtensionUtils.extensions[uuid];
+    get shellProxy() {
+        return this._shellProxy;
+    }
 
-        if (!extension)
+    _showPrefs(uuid) {
+        let row = this._extensionSelector.get_children().find(c => {
+            return c.uuid === uuid && c.hasPrefs;
+        });
+
+        if (!row)
             return false;
 
-        if (!extension.dir.get_child('prefs.js').query_exists(null))
-            return false;
-
-        return true;
-    }
-
-    _getExtensionPrefsModule(extension) {
-        let uuid = extension.metadata.uuid;
-
-        if (this._extensionPrefsModules.hasOwnProperty(uuid))
-            return this._extensionPrefsModules[uuid];
-
-        ExtensionUtils.installImporter(extension);
-
-        let prefsModule = extension.imports.prefs;
-        prefsModule.init(extension.metadata);
-
-        this._extensionPrefsModules[uuid] = prefsModule;
-        return prefsModule;
-    }
-
-    _selectExtension(uuid) {
-        if (!this._extensionAvailable(uuid))
-            return;
-
-        let extension = ExtensionUtils.extensions[uuid];
         let widget;
 
         try {
-            let prefsModule = this._getExtensionPrefsModule(extension);
-            widget = prefsModule.buildPrefsWidget();
+            widget = row.prefsModule.buildPrefsWidget();
         } catch (e) {
-            widget = this._buildErrorUI(extension, e);
+            widget = this._buildErrorUI(row, e);
         }
 
-        let dialog = new Gtk.Window({ modal: !this._skipMainWindow,
-                                      type_hint: Gdk.WindowTypeHint.DIALOG });
-        dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true,
-                                                title: extension.metadata.name,
-                                                visible: true }));
+        let dialog = new Gtk.Window({
+            modal: !this._skipMainWindow,
+            type_hint: Gdk.WindowTypeHint.DIALOG
+        });
+        dialog.set_titlebar(new Gtk.HeaderBar({
+            show_close_button: true,
+            title: row.name,
+            visible: true
+        }));
 
         if (this._skipMainWindow) {
-            this.application.add_window(dialog);
+            this.add_window(dialog);
             if (this._window)
                 this._window.destroy();
             this._window = dialog;
@@ -96,9 +82,11 @@ var Application = class {
         dialog.set_default_size(600, 400);
         dialog.add(widget);
         dialog.show();
+
+        return true;
     }
 
-    _buildErrorUI(extension, exc) {
+    _buildErrorUI(row, exc) {
         let scroll = new Gtk.ScrolledWindow({
             hscrollbar_policy: Gtk.PolicyType.NEVER,
             propagate_natural_height: true
@@ -170,7 +158,7 @@ var Application = class {
             let clipboard = Gtk.Clipboard.get_default(w.get_display());
             // markdown for pasting in gitlab issues
             let lines = [
-                `The settings of extension ${extension.uuid} had an error:`,
+                `The settings of extension ${row.uuid} had an error:`,
                 '```',
                 `${exc}`,
                 '```',
@@ -192,13 +180,13 @@ var Application = class {
             label: _("Homepage"),
             tooltip_text: _("Visit extension homepage"),
             no_show_all: true,
-            visible: extension.metadata.url != null
+            visible: row.url != null
         });
         toolbar.add(urlButton);
 
         urlButton.connect('clicked', w => {
             let context = w.get_display().get_app_launch_context();
-            Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context);
+            Gio.AppInfo.launch_default_for_uri(row.url, context);
         });
 
         let expandedBox = new Gtk.Box({
@@ -213,8 +201,8 @@ var Application = class {
         return scroll;
     }
 
-    _buildUI(app) {
-        this._window = new Gtk.ApplicationWindow({ application: app,
+    _buildUI() {
+        this._window = new Gtk.ApplicationWindow({ application: this,
                                                    window_position: Gtk.WindowPosition.CENTER });
 
         this._window.set_default_size(800, 500);
@@ -248,18 +236,14 @@ var Application = class {
         this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder');
 
         this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell');
-        this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => {
-            if (ExtensionUtils.extensions[uuid] !== undefined)
-                this._scanExtensions();
-        });
+        this._shellProxy.connectSignal('ExtensionStateChanged',
+            this._onExtensionStateChanged.bind(this));
 
         this._window.show_all();
     }
 
     _sortList(row1, row2) {
-        let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name;
-        let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name;
-        return name1.localeCompare(name2);
+        return row1.name.localeCompare(row2.name);
     }
 
     _updateHeader(row, before) {
@@ -270,19 +254,55 @@ var Application = class {
         row.set_header(sep);
     }
 
-    _scanExtensions() {
-        let finder = new ExtensionUtils.ExtensionFinder();
-        finder.connect('extension-found', this._extensionFound.bind(this));
-        finder.scanExtensions();
-        this._extensionsLoaded();
+    _findExtensionRow(uuid) {
+        return this._extensionSelector.get_children().find(c => c.uuid === uuid);
     }
 
-    _extensionFound(finder, extension) {
-        let row = new ExtensionRow(extension.uuid);
+    _onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
+        let row = this._findExtensionRow(uuid);
+        if (row) {
+            let { state } = ExtensionUtils.deserializeExtension(newState);
+            if (state == ExtensionState.UNINSTALLED)
+                row.destroy();
+            return; // we only deal with new and deleted extensions here
+        }
+
+        this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
+            let extension = ExtensionUtils.deserializeExtension(serialized);
+            if (!extension)
+                return;
+            // check the extension wasn't added in between
+            if (this._findExtensionRow(uuid) != null)
+                return;
+            this._addExtensionRow(extension);
+        });
+    }
+
+    _scanExtensions() {
+        this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => {
+            if (e) {
+                if (e instanceof Gio.DBusError) {
+                    log(`Failed to connect to shell proxy: ${e}`);
+                    this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
+                    this._mainStack.visible_child_name = 'noshell';
+                } else
+                    throw e;
+                return;
+            }
+
+            for (let uuid in extensionsMap) {
+                let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]);
+                this._addExtensionRow(extension);
+            }
+            this._extensionsLoaded();
+        });
+    }
+
+    _addExtensionRow(extension) {
+        let row = new ExtensionRow(extension);
 
-        row.prefsButton.visible = this._extensionAvailable(row.uuid);
         row.prefsButton.connect('clicked', () => {
-            this._selectExtension(row.uuid);
+            this._showPrefs(row.uuid);
         });
 
         row.show_all();
@@ -295,24 +315,26 @@ var Application = class {
         else
             this._mainStack.visible_child_name = 'placeholder';
 
-        if (this._startupUuid && this._extensionAvailable(this._startupUuid))
-            this._selectExtension(this._startupUuid);
+        if (this._startupUuid)
+            this._showPrefs(this._startupUuid);
         this._startupUuid = null;
         this._skipMainWindow = false;
         this._loaded = true;
     }
 
-    _onActivate() {
+    vfunc_activate() {
         this._window.present();
     }
 
-    _onStartup(app) {
-        this._buildUI(app);
+    vfunc_startup() {
+        super.vfunc_startup();
+
+        this._buildUI();
         this._scanExtensions();
     }
 
-    _onCommandLine(app, commandLine) {
-        app.activate();
+    vfunc_command_line(commandLine) {
+        this.activate();
         let args = commandLine.get_arguments();
 
         if (args.length) {
@@ -323,16 +345,14 @@ var Application = class {
             // Strip off "extension:///" prefix which fakes a URI, if it exists
             uuid = stripPrefix(uuid, "extension:///");
 
-            if (this._extensionAvailable(uuid))
-                this._selectExtension(uuid);
-            else if (!this._loaded)
+            if (!this._loaded)
                 this._startupUuid = uuid;
-            else
+            else if (!this._showPrefs(uuid))
                 this._skipMainWindow = false;
         }
         return 0;
     }
-};
+});
 
 var Expander = GObject.registerClass({
     Properties: {
@@ -499,6 +519,35 @@ class EmptyPlaceholder extends Gtk.Box {
     }
 });
 
+var NoShellPlaceholder = GObject.registerClass(
+class NoShellPlaceholder extends Gtk.Box {
+    _init() {
+        super._init({
+            orientation: Gtk.Orientation.VERTICAL,
+            spacing: 12,
+            margin: 100,
+            margin_bottom: 60
+        });
+
+        let label = new Gtk.Label({
+            label: '<span size="x-large">%s</span>'.format(
+                _("Something’s gone wrong")),
+            use_markup: true
+        });
+        label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
+        this.add(label);
+
+        label = new Gtk.Label({
+            label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
+            justify: Gtk.Justification.CENTER,
+            wrap: true
+        });
+        this.add(label);
+
+        this.show_all();
+    }
+});
+
 var DescriptionLabel = GObject.registerClass(
 class DescriptionLabel extends Gtk.Label {
     vfunc_get_preferred_height_for_width(width) {
@@ -511,30 +560,55 @@ class DescriptionLabel extends Gtk.Label {
 
 var ExtensionRow = GObject.registerClass(
 class ExtensionRow extends Gtk.ListBoxRow {
-    _init(uuid) {
+    _init(extension) {
         super._init();
 
-        this.uuid = uuid;
+        this._app = Gio.Application.get_default();
+        this._extension = extension;
+        this._prefsModule = null;
 
-        this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' });
-        this._settings.connect('changed::enabled-extensions', () => {
-            this._switch.state = this._isEnabled();
-        });
-        this._settings.connect('changed::disable-extension-version-validation',
-            () => {
-                this._switch.sensitive = this._canEnable();
-            });
-        this._settings.connect('changed::disable-user-extensions',
-            () => {
-                this._switch.sensitive = this._canEnable();
+        this._extensionStateChangedId = this._app.shellProxy.connectSignal(
+            'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
+                if (this.uuid !== uuid)
+                    return;
+
+                this._extension = ExtensionUtils.deserializeExtension(newState);
+                let state = (this._extension.state == ExtensionState.ENABLED);
+                this._switch.state = state;
+                this._switch.sensitive = this._canToggle();
             });
 
+        this.connect('destroy', this._onDestroy.bind(this));
+
         this._buildUI();
     }
 
-    _buildUI() {
-        let extension = ExtensionUtils.extensions[this.uuid];
+    get uuid() {
+        return this._extension.uuid;
+    }
 
+    get name() {
+        return this._extension.metadata.name;
+    }
+
+    get hasPrefs() {
+        return this._extension.hasPrefs;
+    }
+
+    get url() {
+        return this._extension.metadata.url;
+    }
+
+    _onDestroy() {
+        if (!this._app.shellProxy)
+            return;
+
+        if (this._extensionStateChangedId)
+            this._app.shellProxy.disconnectSignal(this._extensionStateChangedId);
+        this._extensionStateChangedId = 0;
+    }
+
+    _buildUI() {
         let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL,
                                  hexpand: true, margin_end: 24, spacing: 24,
                                  margin: 12 });
@@ -544,19 +618,20 @@ class ExtensionRow extends Gtk.ListBoxRow {
                                  spacing: 6, hexpand: true });
         hbox.add(vbox);
 
-        let name = GLib.markup_escape_text(extension.metadata.name, -1);
+        let name = GLib.markup_escape_text(this.name, -1);
         let label = new Gtk.Label({ label: '<b>' + name + '</b>',
                                     use_markup: true,
                                     halign: Gtk.Align.START });
         vbox.add(label);
 
-        let desc = extension.metadata.description.split('\n')[0];
+        let desc = this._extension.metadata.description.split('\n')[0];
         label = new DescriptionLabel({ label: desc, wrap: true, lines: 2,
                                        ellipsize: Pango.EllipsizeMode.END,
                                        xalign: 0, yalign: 0 });
         vbox.add(label);
 
         let button = new Gtk.Button({ valign: Gtk.Align.CENTER,
+                                      visible: this.hasPrefs,
                                       no_show_all: true });
         button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic',
                                          icon_size: Gtk.IconSize.BUTTON,
@@ -566,51 +641,37 @@ class ExtensionRow extends Gtk.ListBoxRow {
 
         this.prefsButton = button;
 
-        this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER,
-                                        sensitive: this._canEnable(),
-                                        state: this._isEnabled() });
+        this._switch = new Gtk.Switch({
+            valign: Gtk.Align.CENTER,
+            sensitive: this._canToggle(),
+            state: this._extension.state === ExtensionState.ENABLED
+        });
         this._switch.connect('notify::active', () => {
             if (this._switch.active)
-                this._enable();
+                this._app.shellProxy.EnableExtensionRemote(this.uuid);
             else
-                this._disable();
+                this._app.shellProxy.DisableExtensionRemote(this.uuid);
         });
         this._switch.connect('state-set', () => true);
         hbox.add(this._switch);
     }
 
-    _canEnable() {
-        let extension = ExtensionUtils.extensions[this.uuid];
-        let checkVersion = !this._settings.get_boolean('disable-extension-version-validation');
-
-        return !this._settings.get_boolean('disable-user-extensions') &&
-               !(checkVersion && ExtensionUtils.isOutOfDate(extension));
+    _canToggle() {
+        return this._extension.canChange;
     }
 
-    _isEnabled() {
-        let extensions = this._settings.get_strv('enabled-extensions');
-        return extensions.includes(this.uuid);
-    }
+    get prefsModule() {
+        if (!this._prefsModule) {
+            ExtensionUtils.installImporter(this._extension);
 
-    _enable() {
-        let extensions = this._settings.get_strv('enabled-extensions');
-        if (extensions.includes(this.uuid))
-            return;
+            // give extension prefs access to their own extension object
+            ExtensionUtils.getCurrentExtension = () => this._extension;
 
-        extensions.push(this.uuid);
-        this._settings.set_strv('enabled-extensions', extensions);
-    }
+            this._prefsModule = this._extension.imports.prefs;
+            this._prefsModule.init(this._extension.metadata);
+        }
 
-    _disable() {
-        let extensions = this._settings.get_strv('enabled-extensions');
-        let pos = extensions.indexOf(this.uuid);
-        if (pos == -1)
-            return;
-        do {
-            extensions.splice(pos, 1);
-            pos = extensions.indexOf(this.uuid);
-        } while (pos != -1);
-        this._settings.set_strv('enabled-extensions', extensions);
+        return this._prefsModule;
     }
 });
 
@@ -638,6 +699,5 @@ function main(argv) {
     Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR);
     Gettext.textdomain(Config.GETTEXT_PACKAGE);
 
-    let app = new Application();
-    app.application.run(argv);
+    new Application().run(argv);
 }

js/gdm/authPrompt.js

@@ -8,14 +8,13 @@ const Batch = imports.gdm.batch;
 const GdmUtil = imports.gdm.util;
 const Params = imports.misc.params;
 const ShellEntry = imports.ui.shellEntry;
-const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;
 
 var DEFAULT_BUTTON_WELL_ICON_SIZE = 16;
-var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0;
-var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3;
+var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000;
+var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
 
-var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5;
+var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
 
 var AuthPromptMode = {
     UNLOCK_ONLY: 0,
@@ -267,7 +266,7 @@ var AuthPrompt = class {
         let oldActor = this._defaultButtonWellActor;
 
         if (oldActor)
-            Tweener.removeTweens(oldActor);
+            oldActor.remove_all_transitions();
 
         let wasSpinner;
         if (oldActor == this._spinner.actor)
@@ -290,18 +289,18 @@ var AuthPrompt = class {
                         this._spinner.stop();
                 }
             } else {
-                Tweener.addTween(oldActor,
-                                 { opacity: 0,
-                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                                   transition: 'linear',
-                                   onComplete: () => {
-                                       if (wasSpinner) {
-                                           if (this._spinner)
-                                               this._spinner.stop();
-                                       }
-                                   }
-                                 });
+                oldActor.ease({
+                    opacity: 0,
+                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                    mode: Clutter.AnimationMode.LINEAR,
+                    onComplete: () => {
+                        if (wasSpinner) {
+                            if (this._spinner)
+                                this._spinner.stop();
+                        }
+                    }
+                });
             }
         }
 
@@ -312,11 +311,12 @@ var AuthPrompt = class {
             if (!animate)
                 actor.opacity = 255;
             else
-                Tweener.addTween(actor,
-                                 { opacity: 255,
-                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                                   transition: 'linear' });
+                actor.ease({
+                    opacity: 255,
+                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                    mode: Clutter.AnimationMode.LINEAR
+                });
         }
 
         this._defaultButtonWellActor = actor;
@@ -365,12 +365,12 @@ var AuthPrompt = class {
     _fadeOutMessage() {
         if (this._message.opacity == 0)
             return;
-        Tweener.removeTweens(this._message);
-        Tweener.addTween(this._message,
-                         { opacity: 0,
-                           time: MESSAGE_FADE_OUT_ANIMATION_TIME,
-                           transition: 'easeOutQuad'
-                         });
+        this._message.remove_all_transitions();
+        this._message.ease({
+            opacity: 0,
+            duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
     }
 
     setMessage(message, type) {
@@ -385,7 +385,7 @@ var AuthPrompt = class {
             this._message.remove_style_class_name('login-dialog-message-hint');
 
         if (message) {
-            Tweener.removeTweens(this._message);
+            this._message.remove_all_transitions();
             this._message.text = message;
             this._message.opacity = 255;
         } else {

js/gdm/batch.js

@@ -20,7 +20,7 @@
  * In order for transformation animations to look good, they need to be
  * incremental and have some order to them (e.g., fade out hidden items,
  * then shrink to close the void left over). Chaining animations in this way can
- * be error-prone and wordy using just Tweener callbacks.
+ * be error-prone and wordy using just ease() callbacks.
  *
  * The classes in this file help with this:
  *

js/gdm/fingerprint.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported FprintManager */
 
 const Gio = imports.gi.Gio;
 

js/gdm/loginDialog.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported LoginDialog */
 /*
  * Copyright 2011 Red Hat, Inc
  *
@@ -30,11 +31,10 @@ const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const PopupMenu = imports.ui.popupMenu;
 const Realmd = imports.gdm.realmd;
-const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;
 
-const _FADE_ANIMATION_TIME = 0.25;
-const _SCROLL_ANIMATION_TIME = 0.5;
+const _FADE_ANIMATION_TIME = 250;
+const _SCROLL_ANIMATION_TIME = 500;
 const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
 const _LOGO_ICON_HEIGHT = 48;
 const _MAX_BOTTOM_MENU_ITEMS = 5;
@@ -204,11 +204,10 @@ var UserList = class {
         let adjustment = this.actor.get_vscroll_bar().get_adjustment();
 
         let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
-        Tweener.removeTweens(adjustment);
-        Tweener.addTween (adjustment,
-                          { value: value,
-                            time: _SCROLL_ANIMATION_TIME,
-                            transition: 'easeOutQuad' });
+        adjustment.ease(value, {
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            duration: _SCROLL_ANIMATION_TIME
+        });
     }
 
     jumpToItem(item) {
@@ -372,7 +371,7 @@ var SessionMenuButton = class {
         }
 
         for (let i = 0; i < ids.length; i++) {
-            let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]);
+            let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]);
 
             let id = ids[i];
             let item = new PopupMenu.PopupMenuItem(sessionName);
@@ -518,7 +517,7 @@ var LoginDialog = GObject.registerClass({
     _getBannerAllocation(dialogBox) {
         let actorBox = new Clutter.ActorBox();
 
-        let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size();
+        let [, , natWidth, natHeight] = this._bannerView.get_preferred_size();
         let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
 
         actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -532,7 +531,7 @@ var LoginDialog = GObject.registerClass({
     _getLogoBinAllocation(dialogBox) {
         let actorBox = new Clutter.ActorBox();
 
-        let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size();
+        let [, , natWidth, natHeight] = this._logoBin.get_preferred_size();
         let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
 
         actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -546,7 +545,7 @@ var LoginDialog = GObject.registerClass({
     _getCenterActorAllocation(dialogBox, actor) {
         let actorBox = new Clutter.ActorBox();
 
-        let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size();
+        let [, , natWidth, natHeight] = actor.get_preferred_size();
         let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
         let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2;
 
@@ -648,7 +647,7 @@ var LoginDialog = GObject.registerClass({
 
                     // figure out how tall it would like to be and try to accommodate
                     // but don't let it get too close to the logo
-                    let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
+                    let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
 
                     let maxWideHeight = dialogHeight - 3 * logoHeight;
                     wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
@@ -758,14 +757,15 @@ var LoginDialog = GObject.registerClass({
 
     _fadeInBannerView() {
         this._bannerView.show();
-        Tweener.addTween(this._bannerView,
-                         { opacity: 255,
-                           time: _FADE_ANIMATION_TIME,
-                           transition: 'easeOutQuad' });
+        this._bannerView.ease({
+            opacity: 255,
+            duration: _FADE_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
     }
 
     _hideBannerView() {
-        Tweener.removeTweens(this._bannerView);
+        this._bannerView.remove_all_transitions();
         this._bannerView.opacity = 0;
         this._bannerView.hide();
     }
@@ -858,10 +858,11 @@ var LoginDialog = GObject.registerClass({
             return;
         this._authPrompt.actor.opacity = 0;
         this._authPrompt.actor.show();
-        Tweener.addTween(this._authPrompt.actor,
-                         { opacity: 255,
-                           time: _FADE_ANIMATION_TIME,
-                           transition: 'easeOutQuad' });
+        this._authPrompt.actor.ease({
+            opacity: 255,
+            duration: _FADE_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
         this._fadeInBannerView();
     }
 
@@ -905,26 +906,31 @@ var LoginDialog = GObject.registerClass({
         this._showPrompt();
     }
 
+    _bindOpacity() {
+        this._bindings = Main.layoutManager.uiGroup.get_children()
+            .filter(c => c != Main.layoutManager.screenShieldGroup)
+            .map(c => this.bind_property('opacity', c, 'opacity', 0));
+    }
+
+    _unbindOpacity() {
+        this._bindings.forEach(b => b.unbind());
+    }
+
     _loginScreenSessionActivated() {
         if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
             return;
 
-        Tweener.addTween(this,
-                         { opacity: 255,
-                           time: _FADE_ANIMATION_TIME,
-                           transition: 'easeOutQuad',
-                           onUpdate: () => {
-                               let children = Main.layoutManager.uiGroup.get_children();
-
-                               for (let i = 0; i < children.length; i++) {
-                                   if (children[i] != Main.layoutManager.screenShieldGroup)
-                                       children[i].opacity = this.opacity;
-                               }
-                           },
-                           onComplete: () => {
-                               if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
-                                   this._authPrompt.reset();
-                           } });
+        this._bindOpacity();
+        this.actor.ease({
+            opacity: 255,
+            duration: _FADE_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
+                    this._authPrompt.reset();
+                this._unbindOpacity();
+            }
+        });
     }
 
     _gotGreeterSessionProxy(proxy) {
@@ -937,21 +943,16 @@ var LoginDialog = GObject.registerClass({
     }
 
     _startSession(serviceName) {
-        Tweener.addTween(this,
-                         { opacity: 0,
-                           time: _FADE_ANIMATION_TIME,
-                           transition: 'easeOutQuad',
-                           onUpdate: () => {
-                               let children = Main.layoutManager.uiGroup.get_children();
-
-                               for (let i = 0; i < children.length; i++) {
-                                   if (children[i] != Main.layoutManager.screenShieldGroup)
-                                       children[i].opacity = this.opacity;
-                               }
-                           },
-                           onComplete: () => {
-                               this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
-                           } });
+        this._bindOpacity();
+        this.actor.ease({
+            opacity: 0,
+            duration: _FADE_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
+                this._unbindOpacity();
+            }
+        });
     }
 
     _onSessionOpened(client, serviceName) {
@@ -1224,10 +1225,11 @@ var LoginDialog = GObject.registerClass({
 
         Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN });
 
-        Tweener.addTween(this,
-                         { opacity: 255,
-                           time: 1,
-                           transition: 'easeInQuad' });
+        this.ease({
+            opacity: 255,
+            duration: 1000,
+            mode: Clutter.AnimationMode.EASE_IN_QUAD
+        });
 
         return true;
     }
@@ -1241,7 +1243,7 @@ var LoginDialog = GObject.registerClass({
         this._authPrompt.cancel();
     }
 
-    addCharacter(unichar) {
+    addCharacter(_unichar) {
         // Don't allow type ahead at the login screen
     }
 

js/gdm/oVirt.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported getOVirtCredentialsManager */
 
 const Gio = imports.gi.Gio;
 const Signals = imports.signals;

js/gdm/realmd.js

@@ -15,7 +15,7 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm");
 const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface);
 
 var Manager = class {
-    constructor(parentActor) {
+    constructor() {
         this._aggregateProvider = Provider(Gio.DBus.system,
                                            'org.freedesktop.realmd',
                                            '/org/freedesktop/realmd',

js/gdm/util.js

@@ -1,4 +1,6 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY,
+            DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */
 
 const { Clutter, Gio, GLib } = imports.gi;
 const Signals = imports.signals;
@@ -9,14 +11,13 @@ const OVirt = imports.gdm.oVirt;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
 const SmartcardManager = imports.misc.smartcardManager;
-const Tweener = imports.ui.tweener;
 
 var PASSWORD_SERVICE_NAME = 'gdm-password';
 var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint';
 var SMARTCARD_SERVICE_NAME = 'gdm-smartcard';
 var OVIRT_SERVICE_NAME = 'gdm-ovirtcred';
-var FADE_ANIMATION_TIME = 0.16;
-var CLONE_FADE_ANIMATION_TIME = 0.25;
+var FADE_ANIMATION_TIME = 160;
+var CLONE_FADE_ANIMATION_TIME = 250;
 
 var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen';
 var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication';
@@ -45,20 +46,20 @@ function fadeInActor(actor) {
 
     let hold = new Batch.Hold();
     actor.show();
-    let [minHeight, naturalHeight] = actor.get_preferred_height(-1);
+    let [, naturalHeight] = actor.get_preferred_height(-1);
 
     actor.opacity = 0;
     actor.set_height(0);
-    Tweener.addTween(actor,
-                     { opacity: 255,
-                       height: naturalHeight,
-                       time: FADE_ANIMATION_TIME,
-                       transition: 'easeOutQuad',
-                       onComplete() {
-                           this.set_height(-1);
-                           hold.release();
-                       },
-                     });
+    actor.ease({
+        opacity: 255,
+        height: naturalHeight,
+        duration: FADE_ANIMATION_TIME,
+        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+        onComplete: () => {
+            this.set_height(-1);
+            hold.release();
+        }
+    });
 
     return hold;
 }
@@ -71,17 +72,17 @@ function fadeOutActor(actor) {
     }
 
     let hold = new Batch.Hold();
-    Tweener.addTween(actor,
-                     { opacity: 0,
-                       height: 0,
-                       time: FADE_ANIMATION_TIME,
-                       transition: 'easeOutQuad',
-                       onComplete() {
-                           this.hide();
-                           this.set_height(-1);
-                           hold.release();
-                       },
-                     });
+    actor.ease({
+        opacity: 0,
+        height: 0,
+        duration: FADE_ANIMATION_TIME,
+        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+        onComplete: () => {
+            this.hide();
+            this.set_height(-1);
+            hold.release();
+        }
+    });
     return hold;
 }
 
@@ -101,15 +102,15 @@ function cloneAndFadeOutActor(actor) {
     clone.set_position(x, y);
 
     let hold = new Batch.Hold();
-    Tweener.addTween(clone,
-                     { opacity: 0,
-                       time: CLONE_FADE_ANIMATION_TIME,
-                       transition: 'easeOutQuad',
-                       onComplete() {
-                           clone.destroy();
-                           hold.release();
-                       }
-                     });
+    clone.ease({
+        opacity: 0,
+        duration: CLONE_FADE_ANIMATION_TIME,
+        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+        onComplete: () => {
+            clone.destroy();
+            hold.release();
+        }
+    });
     return hold;
 }
 
@@ -303,7 +304,7 @@ var ShellUserVerifier = class {
             });
     }
 
-    _oVirtUserAuthenticated(token) {
+    _oVirtUserAuthenticated(_token) {
         this._preemptingService = OVIRT_SERVICE_NAME;
         this.emit('ovirt-user-authenticated');
     }

js/misc/extensionUtils.js

@@ -1,23 +1,37 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported ExtensionState, ExtensionType, getCurrentExtension,
+   getSettings, initTranslations, isOutOfDate, installImporter,
+   serializeExtension, deserializeExtension */
 
 // Common utils for the extension system and the extension
 // preferences tool
 
-const Gettext = imports.gettext;
-const Signals = imports.signals;
+const { Gio, GLib } = imports.gi;
 
-const Gio = imports.gi.Gio;
+const Gettext = imports.gettext;
+const Lang = imports.lang;
 
 const Config = imports.misc.config;
-const FileUtils = imports.misc.fileUtils;
 
 var ExtensionType = {
     SYSTEM: 1,
     PER_USER: 2
 };
 
-// Maps uuid -> metadata object
-var extensions = {};
+var ExtensionState = {
+    ENABLED: 1,
+    DISABLED: 2,
+    ERROR: 3,
+    OUT_OF_DATE: 4,
+    DOWNLOADING: 5,
+    INITIALIZED: 6,
+
+    // Used as an error state for operations on unknown extensions,
+    // should never be in a real extensionMeta object.
+    UNINSTALLED: 99
+};
+
+const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
 
 /**
  * getCurrentExtension:
@@ -49,13 +63,17 @@ function getCurrentExtension() {
     if (!match)
         return null;
 
+    // local import, as the module is used from outside the gnome-shell process
+    // as well (not this function though)
+    let extensionManager = imports.ui.main.extensionManager;
+
     let path = match[1];
     let file = Gio.File.new_for_path(path);
 
     // Walk up the directory tree, looking for an extension with
     // the same UUID as a directory name.
     while (file != null) {
-        let extension = extensions[file.get_basename()];
+        let extension = extensionManager.lookup(file.get_basename());
         if (extension !== undefined)
             return extension;
         file = file.get_parent();
@@ -161,52 +179,50 @@ function isOutOfDate(extension) {
     return false;
 }
 
-function createExtensionObject(uuid, dir, type) {
-    let metadataFile = dir.get_child('metadata.json');
-    if (!metadataFile.query_exists(null)) {
-        throw new Error('Missing metadata.json');
-    }
+function serializeExtension(extension) {
+    let obj = {};
+    Lang.copyProperties(extension.metadata, obj);
 
-    let metadataContents, success, tag;
-    try {
-        [success, metadataContents, tag] = metadataFile.load_contents(null);
-        if (metadataContents instanceof Uint8Array)
-            metadataContents = imports.byteArray.toString(metadataContents);
-    } catch (e) {
-        throw new Error(`Failed to load metadata.json: ${e}`);
-    }
-    let meta;
-    try {
-        meta = JSON.parse(metadataContents);
-    } catch (e) {
-        throw new Error(`Failed to parse metadata.json: ${e}`);
-    }
+    SERIALIZED_PROPERTIES.forEach(prop => {
+        obj[prop] = extension[prop];
+    });
 
-    let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
-    for (let i = 0; i < requiredProperties.length; i++) {
-        let prop = requiredProperties[i];
-        if (!meta[prop]) {
-            throw new Error(`missing "${prop}" property in metadata.json`);
+    let res = {};
+    for (let key in obj) {
+        let val = obj[key];
+        let type;
+        switch (typeof val) {
+        case 'string':
+            type = 's';
+            break;
+        case 'number':
+            type = 'd';
+            break;
+        case 'boolean':
+            type = 'b';
+            break;
+        default:
+            continue;
         }
+        res[key] = GLib.Variant.new(type, val);
     }
 
-    if (uuid != meta.uuid) {
-        throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
+    return res;
+}
+
+function deserializeExtension(variant) {
+    let res = { metadata: {} };
+    for (let prop in variant) {
+        let val = variant[prop].unpack();
+        if (SERIALIZED_PROPERTIES.includes(prop))
+            res[prop] = val;
+        else
+            res.metadata[prop] = val;
     }
-
-    let extension = {};
-
-    extension.metadata = meta;
-    extension.uuid = meta.uuid;
-    extension.type = type;
-    extension.dir = dir;
-    extension.path = dir.get_path();
-    extension.error = '';
-    extension.hasPrefs = dir.get_child('prefs.js').query_exists(null);
-
-    extensions[uuid] = extension;
-
-    return extension;
+    // add the 2 additional properties to create a valid extension object, as createExtensionObject()
+    res.uuid = res.metadata.uuid;
+    res.dir = Gio.File.new_for_path(res.path);
+    return res;
 }
 
 function installImporter(extension) {
@@ -217,36 +233,3 @@ function installImporter(extension) {
     extension.imports = imports[extension.uuid];
     imports.searchPath = oldSearchPath;
 }
-
-var ExtensionFinder = class {
-    _loadExtension(extensionDir, info, perUserDir) {
-        let fileType = info.get_file_type();
-        if (fileType != Gio.FileType.DIRECTORY)
-            return;
-        let uuid = info.get_name();
-        let existing = extensions[uuid];
-        if (existing) {
-            log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path()));
-            return;
-        }
-
-        let extension;
-        let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER
-                                                       : ExtensionType.SYSTEM;
-        try {
-            extension = createExtensionObject(uuid, extensionDir, type);
-        } catch (e) {
-            logError(e, 'Could not load extension %s'.format(uuid));
-            return;
-        }
-        this.emit('extension-found', extension);
-    }
-
-    scanExtensions() {
-        let perUserDir = Gio.File.new_for_path(global.userdatadir);
-        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
-            this._loadExtension(dir, info, perUserDir);
-        });
-    }
-};
-Signals.addSignalMethods(ExtensionFinder.prototype);

js/misc/fileUtils.js

@@ -1,4 +1,6 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
+            recursivelyMoveDir, loadInterfaceXML */
 
 const { Gio, GLib } = imports.gi;
 const Config = imports.misc.config;
@@ -84,7 +86,7 @@ function loadInterfaceXML(iface) {
     let f = Gio.File.new_for_uri(uri);
 
     try {
-        let [ok, bytes] = f.load_contents(null);
+        let [ok_, bytes] = f.load_contents(null);
         if (bytes instanceof Uint8Array)
             xml = imports.byteArray.toString(bytes);
         else

js/misc/gnomeSession.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported PresenceStatus, Presence, Inhibitor, SessionManager */
 
 const Gio = imports.gi.Gio;
 

js/misc/ibusManager.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported getIBusManager */
 
 const { Gio, GLib, IBus } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -58,15 +59,19 @@ var IBusManager = class {
         this._spawn();
     }
 
-    _spawn() {
+    _spawn(extraArgs = []) {
         try {
-            Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
-                               Gio.SubprocessFlags.NONE);
+            let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs];
+            Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE);
         } catch (e) {
             log(`Failed to launch ibus-daemon: ${e.message}`);
         }
     }
 
+    restartDaemon(extraArgs = []) {
+        this._spawn(['-r', ...extraArgs]);
+    }
+
     _clear() {
         if (this._panelService)
             this._panelService.destroy();
@@ -79,8 +84,6 @@ var IBusManager = class {
         this._currentEngineName = null;
 
         this.emit('ready', false);
-
-        this._spawn();
     }
 
     _onConnected() {

js/misc/inputMethod.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported InputMethod */
 const { Clutter, GLib, GObject, IBus } = imports.gi;
 
 const Keyboard = imports.ui.status.keyboard;
@@ -84,15 +85,15 @@ class InputMethod extends Clutter.InputMethod {
             this.emit('request-surrounding');
     }
 
-    _onCommitText(context, text) {
+    _onCommitText(_context, text) {
         this.commit(text.get_text());
     }
 
-    _onDeleteSurroundingText(context) {
+    _onDeleteSurroundingText() {
         this.delete_surrounding();
     }
 
-    _onUpdatePreeditText(context, text, pos, visible) {
+    _onUpdatePreeditText(_context, text, pos, visible) {
         if (text == null)
             return;
 
@@ -108,17 +109,17 @@ class InputMethod extends Clutter.InputMethod {
         this._preeditVisible = visible;
     }
 
-    _onShowPreeditText(context) {
+    _onShowPreeditText() {
         this._preeditVisible = true;
         this.set_preedit_text(this._preeditStr, this._preeditPos);
     }
 
-    _onHidePreeditText(context) {
+    _onHidePreeditText() {
         this.set_preedit_text(null, this._preeditPos);
         this._preeditVisible = false;
     }
 
-    _onForwardKeyEvent(context, keyval, keycode, state) {
+    _onForwardKeyEvent(_context, keyval, keycode, state) {
         let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
         state &= ~(IBus.ModifierType.RELEASE_MASK);
 

js/misc/introspect.js

@@ -1,3 +1,4 @@
+/* exported IntrospectService */
 const { Gio, GLib, Meta, Shell } = imports.gi;
 
 const INTROSPECT_SCHEMA = 'org.gnome.shell';

js/misc/jsParse.js

@@ -1,4 +1,5 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
+/* exported getCompletions, getCommonPrefix, getDeclaredConstants */
 
 // Returns a list of potential completions for text. Completions either
 // follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo)
@@ -8,7 +9,7 @@
 // This function is likely the one you want to call from external modules
 function getCompletions(text, commandHeader, globalCompletionList) {
     let methods = [];
-    let expr, base;
+    let expr_, base;
     let attrHead = '';
     if (globalCompletionList == null) {
         globalCompletionList = [];
@@ -21,7 +22,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
         // Look for expressions like "Main.panel.foo" and match Main.panel and foo
         let matches = text.match(/(.*)\.(.*)/);
         if (matches) {
-            [expr, base, attrHead] = matches;
+            [expr_, base, attrHead] = matches;
 
             methods = getPropertyNamesFromExpression(base, commandHeader).filter(
                 attr => attr.slice(0, attrHead.length) == attrHead
@@ -32,7 +33,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
         // not proceeded by a dot and match them against global constants
         matches = text.match(/^(\w*)$/);
         if (text == '' || matches) {
-            [expr, attrHead] = matches;
+            [expr_, attrHead] = matches;
             methods = globalCompletionList.filter(
                 attr => attr.slice(0, attrHead.length) == attrHead
             );
@@ -151,11 +152,7 @@ function getAllProps(obj) {
 // e.g., expr="({ foo: null, bar: null, 4: null })" will
 // return ["foo", "bar", ...] but the list will not include "4",
 // since methods accessed with '.' notation must star with a letter or _.
-function getPropertyNamesFromExpression(expr, commandHeader) {
-    if (commandHeader == null) {
-        commandHeader = '';
-    }
-
+function getPropertyNamesFromExpression(expr, commandHeader = '') {
     let obj = {};
     if (!isUnsafeExpression(expr)) {
         try {
@@ -234,10 +231,10 @@ function isUnsafeExpression(str) {
 function getDeclaredConstants(str) {
     let ret = [];
     str.split(';').forEach(s => {
-        let base, keyword;
+        let base_, keyword;
         let match = s.match(/const\s+(\w+)\s*=/);
         if (match) {
-            [base, keyword] = match;
+            [base_, keyword] = match;
             ret.push(keyword);
         }
     });

js/misc/keyboardManager.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported getKeyboardManager, holdKeyboard, releaseKeyboard */
 
 const { GLib, GnomeDesktop, Meta } = imports.gi;
 

js/misc/loginManager.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported canLock, getLoginManager, registerSessionWithGDM */
 
 const { GLib, Gio } = imports.gi;
 const Signals = imports.signals;
@@ -109,7 +110,7 @@ var LoginManagerSystemd = class {
         let sessionId = GLib.getenv('XDG_SESSION_ID');
         if (!sessionId) {
             log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
-            let [session, objectPath] = this._userProxy.Display;
+            let [session, objectPath_] = this._userProxy.Display;
             if (session) {
                 log(`Will monitor session ${session}`);
                 sessionId = session;
@@ -182,7 +183,7 @@ var LoginManagerSystemd = class {
             (proxy, result) => {
                 let fd = -1;
                 try {
-                    let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result);
+                    let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
                     fd = fdList.steal_fds()[0];
                     callback(new Gio.UnixInputStream({ fd: fd }));
                 } catch (e) {
@@ -199,7 +200,7 @@ var LoginManagerSystemd = class {
 Signals.addSignalMethods(LoginManagerSystemd.prototype);
 
 var LoginManagerDummy = class {
-    getCurrentSessionProxy(callback) {
+    getCurrentSessionProxy(_callback) {
         // we could return a DummySession object that fakes whatever callers
         // expect (at the time of writing: connect() and connectSignal()
         // methods), but just never calling the callback should be safer

js/misc/modemManager.js

@@ -110,7 +110,7 @@ var ModemGsm = class {
             this.signal_quality = quality;
             this.emit('notify::signal-quality');
         });
-        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => {
+        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
             this.operator_name = _findProviderForMccMnc(name, code);
             this.emit('notify::operator-name');
         });
@@ -120,7 +120,7 @@ var ModemGsm = class {
                 return;
             }
 
-            let [status, code, name] = result;
+            let [status_, code, name] = result;
             this.operator_name = _findProviderForMccMnc(name, code);
             this.emit('notify::operator-name');
         });
@@ -171,7 +171,7 @@ var ModemCdma = class {
                 // it will return an error if the device is not connected
                 this.operator_name = null;
             } else {
-                let [bandClass, band, sid] = result;
+                let [bandClass_, band_, sid] = result;
 
                 this.operator_name = _findProviderForSid(sid);
             }
@@ -224,7 +224,7 @@ var BroadbandModem = class {
     }
 
     _reloadSignalQuality() {
-        let [quality, recent] = this._proxy.SignalQuality;
+        let [quality, recent_] = this._proxy.SignalQuality;
         this.signal_quality = quality;
         this.emit('notify::signal-quality');
     }

js/misc/params.js

@@ -1,6 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-
-const Lang = imports.lang;
+/* exported parse */
 
 // parse:
 // @params: caller-provided parameter object, or %null
@@ -23,7 +22,6 @@ function parse(params = {}, defaults, allowExtras) {
                 throw new Error(`Unrecognized parameter "${prop}"`);
     }
 
-    let defaultsCopy = {};
-    Lang.copyProperties(defaults, defaultsCopy);
+    let defaultsCopy = Object.assign({}, defaults);
     return Object.assign(defaultsCopy, params);
 }

js/misc/permissionStore.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported PermissionStore */
 
 const Gio = imports.gi.Gio;
 

js/misc/smartcardManager.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported getSmartcardManager */
 
 const Gio = imports.gi.Gio;
 const Signals = imports.signals;

js/misc/systemActions.js

@@ -1,3 +1,4 @@
+/* exported getDefault */
 const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi;
 
 const GnomeSession = imports.misc.gnomeSession;
@@ -173,13 +174,21 @@ const SystemActions = GObject.registerClass({
                                           });
         Main.layoutManager.connect('monitors-changed',
                                    () => this._updateOrientationLock());
-        Gio.DBus.system.watch_name(SENSOR_BUS_NAME,
-                                   Gio.BusNameWatcherFlags.NONE,
-                                   () => this._sensorProxyAppeared(),
-                                   () => {
-                                       this._sensorProxy = null;
-                                       this._updateOrientationLock();
-                                   });
+        this._sensorProxy = new SensorProxy(Gio.DBus.system,
+            SENSOR_BUS_NAME,
+            SENSOR_OBJECT_PATH,
+            (proxy, error)  => {
+                if (error)
+                    log(error.message);
+            },
+            null,
+            Gio.DBusProxyFlags.DO_NOT_AUTO_START);
+        this._sensorProxy.connect('g-properties-changed', () => {
+            this._updateOrientationLock();
+        });
+        this._sensorProxy.connect('notify::g-name-owner', () => {
+            this._updateOrientationLock();
+        });
         this._updateOrientationLock();
         this._updateOrientationLockIcon();
 
@@ -187,50 +196,44 @@ const SystemActions = GObject.registerClass({
         this._sessionUpdated();
     }
 
+    // eslint-disable-next-line camelcase
     get can_power_off() {
         return this._actions.get(POWER_OFF_ACTION_ID).available;
     }
 
+    // eslint-disable-next-line camelcase
     get can_suspend() {
         return this._actions.get(SUSPEND_ACTION_ID).available;
     }
 
+    // eslint-disable-next-line camelcase
     get can_lock_screen() {
         return this._actions.get(LOCK_SCREEN_ACTION_ID).available;
     }
 
+    // eslint-disable-next-line camelcase
     get can_switch_user() {
         return this._actions.get(SWITCH_USER_ACTION_ID).available;
     }
 
+    // eslint-disable-next-line camelcase
     get can_logout() {
         return this._actions.get(LOGOUT_ACTION_ID).available;
     }
 
+    // eslint-disable-next-line camelcase
     get can_lock_orientation() {
         return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available;
     }
 
+    // eslint-disable-next-line camelcase
     get orientation_lock_icon() {
         return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName;
     }
 
-    _sensorProxyAppeared() {
-        this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH,
-            (proxy, error)  => {
-                if (error) {
-                    log(error.message);
-                    return;
-                }
-                this._sensorProxy.connect('g-properties-changed',
-                                          () => this._updateOrientationLock());
-                this._updateOrientationLock();
-            });
-    }
-
     _updateOrientationLock() {
         let available = false;
-        if (this._sensorProxy)
+        if (this._sensorProxy.g_name_owner)
             available = this._sensorProxy.HasAccelerometer &&
                         this._monitorManager.get_is_builtin_display_on();
 

js/misc/util.js

@@ -1,15 +1,16 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
+            formatTime, formatTimeSpan, createTimeLabel, insertSorted,
+            makeCloseButton, ensureActorVisibleInScrollView */
 
 const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
 const Gettext = imports.gettext;
 const Mainloop = imports.mainloop;
-const Signals = imports.signals;
 
 const Main = imports.ui.main;
-const Tweener = imports.ui.tweener;
 const Params = imports.misc.params;
 
-var SCROLL_TIME = 0.1;
+var SCROLL_TIME = 100;
 
 // http://daringfireball.net/2010/07/improved_regex_for_matching_urls
 const _balancedParens = '\\([^\\s()<>]+\\)';
@@ -75,7 +76,7 @@ function spawn(argv) {
 // occur when trying to parse or start the program.
 function spawnCommandLine(commandLine) {
     try {
-        let [success, argv] = GLib.shell_parse_argv(commandLine);
+        let [success_, argv] = GLib.shell_parse_argv(commandLine);
         trySpawn(argv);
     } catch (err) {
         _handleSpawnError(commandLine, err);
@@ -104,11 +105,11 @@ function spawnApp(argv) {
 // Runs @argv in the background. If launching @argv fails,
 // this will throw an error.
 function trySpawn(argv) {
-    var success, pid;
+    var success_, pid;
     try {
-        [success, pid] = GLib.spawn_async(null, argv, null,
-                                          GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
-                                          null);
+        [success_, pid] = GLib.spawn_async(null, argv, null,
+                                           GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
+                                           null);
     } catch (err) {
         /* Rewrite the error in case of ENOENT */
         if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) {
@@ -139,10 +140,10 @@ function trySpawn(argv) {
 // Runs @commandLine in the background. If launching @commandLine
 // fails, this will throw an error.
 function trySpawnCommandLine(commandLine) {
-    let success, argv;
+    let success_, argv;
 
     try {
-        [success, argv] = GLib.shell_parse_argv(commandLine);
+        [success_, argv] = GLib.shell_parse_argv(commandLine);
     } catch (err) {
         // Replace "Error invoking GLib.shell_parse_argv: " with
         // something nicer
@@ -395,7 +396,7 @@ function makeCloseButton(boxpointer) {
 
 function ensureActorVisibleInScrollView(scrollView, actor) {
     let adjustment = scrollView.vscroll.adjustment;
-    let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values();
+    let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values();
 
     let offset = 0;
     let vfade = scrollView.get_effect("fade");
@@ -423,97 +424,8 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
     else
         return;
 
-    Tweener.addTween(adjustment,
-                     { value: value,
-                       time: SCROLL_TIME,
-                       transition: 'easeOutQuad' });
+    adjustment.ease(value, {
+        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+        duration: SCROLL_TIME
+    });
 }
-
-var AppSettingsMonitor = class {
-    constructor(appId, schemaId) {
-        this._appId = appId;
-        this._schemaId = schemaId;
-
-        this._app = null;
-        this._settings = null;
-        this._handlers = [];
-
-        this._schemaSource = Gio.SettingsSchemaSource.get_default();
-
-        this._appSystem = Shell.AppSystem.get_default();
-        this._appSystem.connect('installed-changed',
-                                this._onInstalledChanged.bind(this));
-        this._onInstalledChanged();
-    }
-
-    get available() {
-        return this._app != null && this._settings != null;
-    }
-
-    activateApp() {
-        if (this._app)
-            this._app.activate();
-    }
-
-    watchSetting(key, callback) {
-        let handler = { id: 0, key: key, callback: callback };
-        this._handlers.push(handler);
-
-        this._connectHandler(handler);
-    }
-
-    _connectHandler(handler) {
-        if (!this._settings || handler.id > 0)
-            return;
-
-        handler.id = this._settings.connect(`changed::${handler.key}`,
-                                            handler.callback);
-        handler.callback(this._settings, handler.key);
-    }
-
-    _disconnectHandler(handler) {
-        if (this._settings && handler.id > 0)
-            this._settings.disconnect(handler.id);
-        handler.id = 0;
-    }
-
-    _onInstalledChanged() {
-        let hadApp = (this._app != null);
-        this._app = this._appSystem.lookup_app(this._appId);
-        let haveApp = (this._app != null);
-
-        if (hadApp == haveApp)
-            return;
-
-        if (haveApp)
-            this._checkSettings();
-        else
-            this._setSettings(null);
-    }
-
-    _setSettings(settings) {
-        this._handlers.forEach((handler) => this._disconnectHandler(handler));
-
-        let hadSettings = (this._settings != null);
-        this._settings = settings;
-        let haveSettings = (this._settings != null);
-
-        this._handlers.forEach((handler) => this._connectHandler(handler));
-
-        if (hadSettings != haveSettings)
-            this.emit('available-changed');
-    }
-
-    _checkSettings() {
-        let schema = this._schemaSource.lookup(this._schemaId, true);
-        if (schema) {
-            this._setSettings(new Gio.Settings({ settings_schema: schema }));
-        } else if (this._app) {
-            Mainloop.timeout_add_seconds(1, () => {
-                this._checkSettings();
-                return GLib.SOURCE_REMOVE;
-            });
-        }
-    }
-};
-Signals.addSignalMethods(AppSettingsMonitor.prototype);

js/misc/weather.js

@@ -1,10 +1,19 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 
-const { Geoclue, Gio, GLib, GWeather } = imports.gi;
+const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi;
 const Signals = imports.signals;
 
 const PermissionStore = imports.misc.permissionStore;
-const Util = imports.misc.util;
+
+const { loadInterfaceXML } = imports.misc.fileUtils;
+
+const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration');
+
+const WEATHER_BUS_NAME = 'org.gnome.Weather';
+const WEATHER_OBJECT_PATH = '/org/gnome/Weather';
+const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration';
+
+const WEATHER_APP_ID = 'org.gnome.Weather.desktop';
 
 // Minimum time between updates to show loading indication
 var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE;
@@ -66,17 +75,38 @@ var WeatherClient = class {
             this.emit('changed');
         });
 
-        this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop',
-                                                          'org.gnome.Weather');
-        this._weatherAppMon.connect('available-changed', () => this.emit('changed'));
-        this._weatherAppMon.watchSetting('automatic-location',
-                                         this._onAutomaticLocationChanged.bind(this));
-        this._weatherAppMon.watchSetting('locations',
-                                         this._onLocationsChanged.bind(this));
+        this._weatherApp = null;
+        this._weatherProxy = null;
+
+        let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface);
+        Gio.DBusProxy.new(
+            Gio.DBus.session,
+            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES,
+            nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE),
+            WEATHER_BUS_NAME,
+            WEATHER_OBJECT_PATH,
+            WEATHER_INTEGRATION_IFACE,
+            null,
+            this._onWeatherProxyReady.bind(this));
+
+        this._settings = new Gio.Settings({
+            schema_id: 'org.gnome.shell.weather'
+        });
+        this._settings.connect('changed::automatic-location',
+            this._onAutomaticLocationChanged.bind(this));
+        this._onAutomaticLocationChanged();
+        this._settings.connect('changed::locations',
+            this._onLocationsChanged.bind(this));
+        this._onLocationsChanged();
+
+        this._appSystem = Shell.AppSystem.get_default();
+        this._appSystem.connect('installed-changed',
+            this._onInstalledChanged.bind(this));
+        this._onInstalledChanged();
     }
 
     get available() {
-        return this._weatherAppMon.available;
+        return this._weatherApp != null;
     }
 
     get loading() {
@@ -92,7 +122,8 @@ var WeatherClient = class {
     }
 
     activateApp() {
-        this._weatherAppMon.activateApp();
+        if (this._weatherApp)
+            this._weatherApp.activate();
     }
 
     update() {
@@ -114,6 +145,38 @@ var WeatherClient = class {
                this._weatherAuthorized;
     }
 
+    _onWeatherProxyReady(o, res) {
+        try {
+            this._weatherProxy = Gio.DBusProxy.new_finish(res);
+        } catch (e) {
+            log(`Failed to create GNOME Weather proxy: ${e}`);
+            return;
+        }
+
+        this._weatherProxy.connect('g-properties-changed',
+            this._onWeatherPropertiesChanged.bind(this));
+        this._onWeatherPropertiesChanged();
+    }
+
+    _onWeatherPropertiesChanged() {
+        if (this._weatherProxy.g_name_owner == null)
+            return;
+
+        this._settings.set_boolean('automatic-location',
+            this._weatherProxy.AutomaticLocation);
+        this._settings.set_value('locations',
+            new GLib.Variant('av', this._weatherProxy.Locations));
+    }
+
+    _onInstalledChanged() {
+        let hadApp = (this._weatherApp != null);
+        this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
+        let haveApp = (this._weatherApp != null);
+
+        if (hadApp !== haveApp)
+            this.emit('changed');
+    }
+
     _loadInfo() {
         let id = this._weatherInfo.connect('updated', () => {
             this._weatherInfo.disconnect(id);
@@ -198,8 +261,8 @@ var WeatherClient = class {
         this._setLocation(location);
     }
 
-    _onAutomaticLocationChanged(settings, key) {
-        let useAutoLocation = settings.get_boolean(key);
+    _onAutomaticLocationChanged() {
+        let useAutoLocation = this._settings.get_boolean('automatic-location');
         if (this._autoLocationRequested == useAutoLocation)
             return;
 
@@ -217,8 +280,9 @@ var WeatherClient = class {
             this._setLocation(this._mostRecentLocation);
     }
 
-    _onLocationsChanged(settings, key) {
-        let serialized = settings.get_value(key).deep_unpack().shift();
+    _onLocationsChanged() {
+        let locations = this._settings.get_value('locations').deep_unpack();
+        let serialized = locations.shift();
         let mostRecentLocation = null;
 
         if (serialized)
@@ -234,7 +298,7 @@ var WeatherClient = class {
     }
 
     _onPermStoreChanged(proxy, sender, params) {
-        let [table, id, deleted, data, perms] = params;
+        let [table, id, deleted_, data_, perms] = params;
 
         if (table != 'gnome' || id != 'geolocation')
             return;

js/perf/core.js

@@ -1,4 +1,9 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported run, script_overviewShowStart, script_overviewShowDone,
+            script_applicationsShowStart, script_applicationsShowDone,
+            script_afterShowHide, malloc_usedSize, glx_swapComplete,
+            clutter_stagePaintDone */
+/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */
 
 const System = imports.system;
 
@@ -121,9 +126,11 @@ function *run() {
 
     for (let i = 0; i < 2; i++) {
         Scripting.scriptEvent('applicationsShowStart');
+        // eslint-disable-next-line require-atomic-updates
         Main.overview._dash.showAppsButton.checked = true;
         yield Scripting.waitLeisure();
         Scripting.scriptEvent('applicationsShowDone');
+        // eslint-disable-next-line require-atomic-updates
         Main.overview._dash.showAppsButton.checked = false;
         yield Scripting.waitLeisure();
     }
@@ -147,7 +154,7 @@ function script_overviewShowStart(time) {
     overviewFrames = 0;
 }
 
-function script_overviewShowDone(time) {
+function script_overviewShowDone(_time) {
     // We've set up the state at the end of the zoom out, but we
     // need to wait for one more frame to paint before we count
     // ourselves as done.
@@ -166,7 +173,7 @@ function script_applicationsShowDone(time) {
         METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart;
 }
 
-function script_afterShowHide(time) {
+function script_afterShowHide(_time) {
     if (overviewShowCount == 1) {
         METRICS.usedAfterOverview.value = mallocUsedSize;
     } else {

js/perf/hwtest.js

@@ -1,3 +1,12 @@
+/* exported run, script_desktopShown, script_overviewShowStart,
+            script_overviewShowDone, script_applicationsShowStart,
+            script_applicationsShowDone, script_mainViewDrawStart,
+            script_mainViewDrawDone, script_overviewDrawStart,
+            script_overviewDrawDone, script_redrawTestStart,
+            script_redrawTestDone, script_collectTimings,
+            script_geditLaunch, script_geditFirstFrame,
+            clutter_stagePaintStart, clutter_paintCompletedTimestamp */
+/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */
 const { Clutter, Gio, Shell } = imports.gi;
 const Main = imports.ui.main;
 const Scripting = imports.ui.scripting;
@@ -38,7 +47,7 @@ function waitAndDraw(milliseconds) {
     let timeline = new Clutter.Timeline({ duration: milliseconds });
     timeline.start();
 
-    timeline.connect('new-frame', (timeline, frame) => {
+    timeline.connect('new-frame', (_timeline, _frame) => {
         global.stage.queue_redraw();
     });
 
@@ -73,8 +82,8 @@ function extractBootTimestamp() {
     let result = null;
 
     let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe());
-    while (true) {
-        let [line, length] = datastream.read_line_utf8(null);
+    while (true) { // eslint-disable-line no-constant-condition
+        let [line, length_] = datastream.read_line_utf8(null);
         if (line === null)
             break;
 
@@ -117,6 +126,7 @@ function *run() {
     yield Scripting.sleep(1000);
 
     Scripting.scriptEvent('applicationsShowStart');
+    // eslint-disable-next-line require-atomic-updates
     Main.overview._dash.showAppsButton.checked = true;
 
     yield Scripting.waitLeisure();
@@ -234,31 +244,31 @@ function script_applicationsShowDone(time) {
     METRICS.applicationsShowTime.value = time - applicationsShowStart;
 }
 
-function script_mainViewDrawStart(time) {
+function script_mainViewDrawStart(_time) {
     redrawTiming = 'mainView';
 }
 
-function script_mainViewDrawDone(time) {
+function script_mainViewDrawDone(_time) {
     redrawTiming = null;
 }
 
-function script_overviewDrawStart(time) {
+function script_overviewDrawStart(_time) {
     redrawTiming = 'overview';
 }
 
-function script_overviewDrawDone(time) {
+function script_overviewDrawDone(_time) {
     redrawTiming = null;
 }
 
-function script_redrawTestStart(time) {
+function script_redrawTestStart(_time) {
     redrawTiming = 'application';
 }
 
-function script_redrawTestDone(time) {
+function script_redrawTestDone(_time) {
     redrawTiming = null;
 }
 
-function script_collectTimings(time) {
+function script_collectTimings(_time) {
     for (let timing in redrawTimes) {
         let times = redrawTimes[timing];
         times.sort((a, b) => a - b);

js/portalHelper/main.js

@@ -1,3 +1,4 @@
+/* exported main */
 const Format = imports.format;
 const Gettext = imports.gettext;
 const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi;
@@ -151,7 +152,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
         this._webView.load_uri(this._originalUrl);
     }
 
-    vfunc_delete_event(event) {
+    vfunc_delete_event(_event) {
         if (this._recheckAtExit)
             this._doneCallback(PortalHelperResult.RECHECK);
         else
@@ -177,7 +178,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
         this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
     }
 
-    _onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) {
+    _onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) {
         this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
         let uri = new Soup.URI(failingURI);
         this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host());

js/ui/accessDialog.js

@@ -1,3 +1,4 @@
+/* exported AccessDialogDBus */
 const { Clutter, Gio, GLib, GObject, Shell } = imports.gi;
 
 const CheckBox = imports.ui.checkBox;
@@ -79,7 +80,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
         this._requestExported = this._request.export(connection, this._handle);
     }
 
-    CloseAsync(invocation, params) {
+    CloseAsync(invocation, _params) {
         if (this._invocation.get_sender() != invocation.get_sender()) {
             invocation.return_error_literal(Gio.DBusError,
                                             Gio.DBusError.ACCESS_DENIED,
@@ -132,7 +133,7 @@ var AccessDialogDBus = class {
             return;
         }
 
-        let [handle, appId, parentWindow, title, subtitle, body, options] = params;
+        let [handle, appId, parentWindow_, title, subtitle, body, options] = params;
         // We probably want to use parentWindow and global.display.focus_window
         // for this check in the future
         if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) {

js/ui/altTab.js

@@ -1,17 +1,18 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup,
+            WindowCyclerPopup */
 
 const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
 
 const Main = imports.ui.main;
 const SwitcherPopup = imports.ui.switcherPopup;
-const Tweener = imports.ui.tweener;
 
 var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds
 
 var THUMBNAIL_DEFAULT_SIZE = 256;
 var THUMBNAIL_POPUP_TIME = 500; // milliseconds
-var THUMBNAIL_FADE_TIME = 0.1; // seconds
+var THUMBNAIL_FADE_TIME = 100; // milliseconds
 
 var WINDOW_PREVIEW_SIZE = 128;
 var APP_ICON_SIZE = 96;
@@ -87,9 +88,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
             let hPadding = leftPadding + rightPadding;
 
             let icon = this._items[this._selectedIndex];
-            let [posX, posY] = icon.get_transformed_position();
+            let [posX] = icon.get_transformed_position();
             let thumbnailCenter = posX + icon.width / 2;
-            let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
+            let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
             childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2));
             if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) {
                 let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding;
@@ -103,7 +104,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
                 childBox.x2 = primary.x + primary.width - rightPadding;
             childBox.y1 = this._switcherList.allocation.y2 + spacing;
             this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1);
-            let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
+            let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
             childBox.y2 = childBox.y1 + childNaturalHeight;
             this._thumbnails.allocate(childBox, flags);
         }
@@ -360,15 +361,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
 
     _destroyThumbnails() {
         let thumbnailsActor = this._thumbnails;
-        Tweener.addTween(thumbnailsActor,
-                         { opacity: 0,
-                           time: THUMBNAIL_FADE_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: () => {
-                               thumbnailsActor.destroy();
-                               this.thumbnailsVisible = false;
-                           }
-                         });
+        this._thumbnails.ease({
+            opacity: 0,
+            duration: THUMBNAIL_FADE_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                thumbnailsActor.destroy();
+                this.thumbnailsVisible = false;
+            }
+        });
         this._thumbnails = null;
         if (this._switcherList._items[this._selectedIndex])
             this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
@@ -391,12 +392,14 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
         this._thumbnails.get_allocation_box();
 
         this._thumbnails.opacity = 0;
-        Tweener.addTween(this._thumbnails,
-                         { opacity: 255,
-                           time: THUMBNAIL_FADE_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: () => this.thumbnailsVisible = true
-                         });
+        this._thumbnails.ease({
+            opacity: 255,
+            duration: THUMBNAIL_FADE_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                this.thumbnailsVisible = true;
+            }
+        });
 
         this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
     }
@@ -469,7 +472,7 @@ var CyclerList = GObject.registerClass({
                'item-removed': { param_types: [GObject.TYPE_INT] },
                'item-highlighted': { param_types: [GObject.TYPE_INT] } },
 }, class CyclerList extends St.Widget {
-    highlight(index, justOutline) {
+    highlight(index, _justOutline) {
         this.emit('item-highlighted', index);
     }
 });
@@ -494,7 +497,7 @@ var CyclerPopup = GObject.registerClass({
         });
     }
 
-    _highlightItem(index, justOutline) {
+    _highlightItem(index, _justOutline) {
         this._highlight.window = this._items[index];
         global.window_group.set_child_above_sibling(this._highlight.actor, null);
     }
@@ -660,6 +663,7 @@ class AppIcon extends St.BoxLayout {
         this.add(this.label, { x_fill: false });
     }
 
+    // eslint-disable-next-line camelcase
     set_size(size) {
         this.icon = this.app.create_icon_texture(size);
         this._iconBin.child = this.icon;
@@ -801,7 +805,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
     }
 
     _enterItem(index) {
-        let [x, y, mask] = global.get_pointer();
+        let [x, y] = global.get_pointer();
         let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y);
         if (this._items[index].contains(pickedActor))
             this._itemEntered(index);
@@ -908,7 +912,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
             return;
         let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding();
         totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding();
-        let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
+        let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
         let spacing = this._items[0].child.get_theme_node().get_length('spacing');
         let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
         let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor;

js/ui/animation.js

@@ -1,13 +1,12 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Animation, AnimatedIcon, Spinner */
 
-const { GLib, Gio, St } = imports.gi;
+const { Clutter, GLib, Gio, St } = imports.gi;
 const Mainloop = imports.mainloop;
 
-const Tweener = imports.ui.tweener;
-
 var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
-var SPINNER_ANIMATION_TIME = 0.3;
-var SPINNER_ANIMATION_DELAY = 1.0;
+var SPINNER_ANIMATION_TIME = 300;
+var SPINNER_ANIMATION_DELAY = 1000;
 
 var Animation = class {
     constructor(file, width, height, speed) {
@@ -137,15 +136,15 @@ var Spinner = class extends AnimatedIcon {
     }
 
     play() {
-        Tweener.removeTweens(this.actor);
+        this.actor.remove_all_transitions();
 
         if (this._animate) {
             super.play();
-            Tweener.addTween(this.actor, {
+            this.actor.ease({
                 opacity: 255,
                 delay: SPINNER_ANIMATION_DELAY,
-                time: SPINNER_ANIMATION_TIME,
-                transition: 'linear'
+                duration: SPINNER_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.LINEAR
             });
         } else {
             this.actor.opacity = 255;
@@ -154,16 +153,14 @@ var Spinner = class extends AnimatedIcon {
     }
 
     stop() {
-        Tweener.removeTweens(this.actor);
+        this.actor.remove_all_transitions();
 
         if (this._animate) {
-            Tweener.addTween(this.actor, {
+            this.actor.ease({
                 opacity: 0,
                 time: SPINNER_ANIMATION_TIME,
                 transition: 'linear',
-                onComplete: () => {
-                    super.stop();
-                }
+                onComplete: () => super.stop()
             });
         } else {
             this.actor.opacity = 0;

js/ui/appFavorites.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported getAppFavorites */
 
 const Shell = imports.gi.Shell;
 const Signals = imports.signals;

js/ui/audioDeviceSelection.js

@@ -1,3 +1,4 @@
+/* exported AudioDeviceSelectionDBus */
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 
 const Main = imports.ui.main;
@@ -34,7 +35,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
             throw new Error('Too few devices for a selection');
     }
 
-    _buildLayout(devices) {
+    _buildLayout() {
         let title = new St.Label({ style_class: 'audio-selection-title',
                                    text: _("Select Audio Device"),
                                    x_align: Clutter.ActorAlign.CENTER });
@@ -85,6 +86,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
         box.connect('notify::height', () => {
             Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
                 box.width = box.height;
+                return GLib.SOURCE_REMOVE;
             });
         });
 

js/ui/background.js

@@ -99,7 +99,6 @@ const Signals = imports.signals;
 const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 
 var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff);
 
@@ -110,7 +109,7 @@ const COLOR_SHADING_TYPE_KEY = 'color-shading-type';
 const BACKGROUND_STYLE_KEY = 'picture-options';
 const PICTURE_URI_KEY = 'picture-uri';
 
-var FADE_ANIMATION_TIME = 1.0;
+var FADE_ANIMATION_TIME = 1000;
 
 // These parameters affect how often we redraw.
 // The first is how different (percent crossfaded) the slide show
@@ -333,12 +332,12 @@ var Background = class Background {
     }
 
     _loadPattern() {
-        let colorString, res, color, secondColor;
+        let colorString, res_, color, secondColor;
 
         colorString = this._settings.get_string(PRIMARY_COLOR_KEY);
-        [res, color] = Clutter.Color.from_string(colorString);
+        [res_, color] = Clutter.Color.from_string(colorString);
         colorString = this._settings.get_string(SECONDARY_COLOR_KEY);
-        [res, secondColor] = Clutter.Color.from_string(colorString);
+        [res_, secondColor] = Clutter.Color.from_string(colorString);
 
         let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);
 
@@ -633,9 +632,9 @@ var Animation = class Animation {
     }
 
     load(callback) {
-        this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() });
+        this._show = new GnomeDesktop.BGSlideShow({ file: this.file });
 
-        this._show.load_async(null, (object, result) => {
+        this._show.load_async(null, () => {
             this.loaded = true;
             if (callback)
                 callback();
@@ -651,7 +650,7 @@ var Animation = class Animation {
         if (this._show.get_num_slides() < 1)
             return;
 
-        let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
+        let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
 
         this.transitionDuration = duration;
         this.transitionProgress = progress;
@@ -710,14 +709,12 @@ var BackgroundManager = class BackgroundManager {
         this._newBackgroundActor = null;
         this.emit('changed');
 
-        Tweener.addTween(oldBackgroundActor,
-                         { opacity: 0,
-                           time: FADE_ANIMATION_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete() {
-                               oldBackgroundActor.destroy();
-                           }
-                         });
+        oldBackgroundActor.ease({
+            opacity: 0,
+            duration: FADE_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => oldBackgroundActor.destroy()
+        });
     }
 
     _updateBackgroundActor() {

js/ui/backgroundMenu.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported addBackgroundMenu */
 
 const { Clutter, St } = imports.gi;
 

js/ui/barLevel.js

@@ -1,74 +1,106 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
+/* exported BarLevel */
 
-const { Atk, Clutter, St } = imports.gi;
-const Signals = imports.signals;
+const { Atk, Clutter, GObject, St } = imports.gi;
 
-var BarLevel = class {
-    constructor(value, params) {
-        if (isNaN(value))
-            // Avoid spreading NaNs around
-            throw TypeError('The bar level value must be a number');
+var BarLevel = GObject.registerClass({
+    Properties: {
+        'value': GObject.ParamSpec.double(
+            'value', 'value', 'value',
+            GObject.ParamFlags.READWRITE,
+            0, 2, 0),
+        'maximum-value': GObject.ParamSpec.double(
+            'maximum-value', 'maximum-value', 'maximum-value',
+            GObject.ParamFlags.READWRITE,
+            1, 2, 1),
+        'overdrive-start': GObject.ParamSpec.double(
+            'overdrive-start', 'overdrive-start', 'overdrive-start',
+            GObject.ParamFlags.READWRITE,
+            1, 2, 1)
+    }
+}, class BarLevel extends St.DrawingArea {
+    _init(params) {
         this._maxValue = 1;
-        this._value = Math.max(Math.min(value, this._maxValue), 0);
+        this._value = 0;
         this._overdriveStart = 1;
         this._barLevelWidth = 0;
 
-        if (params == undefined)
-            params = {};
-
-        this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel',
-                                          can_focus: params['canFocus'] || false,
-                                          reactive: params['reactive'] || false,
-                                          accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR });
-        this.actor.connect('repaint', this._barLevelRepaint.bind(this));
-        this.actor.connect('allocation-changed', (actor, box) => {
+        let defaultParams = {
+            style_class: 'barlevel',
+            accessible_role: Atk.Role.LEVEL_BAR
+        };
+        super._init(Object.assign(defaultParams, params));
+        this.connect('allocation-changed', (actor, box) => {
             this._barLevelWidth = box.get_width();
         });
 
-        this._customAccessible = St.GenericAccessible.new_for_actor(this.actor);
-        this.actor.set_accessible(this._customAccessible);
+        this._customAccessible = St.GenericAccessible.new_for_actor(this);
+        this.set_accessible(this._customAccessible);
 
         this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this));
         this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this));
         this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this));
         this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this));
 
-        this.connect('value-changed', this._valueChanged.bind(this));
+        this.connect('notify::value', this._valueChanged.bind(this));
     }
 
-    setValue(value) {
-        if (isNaN(value))
-            throw TypeError('The bar level value must be a number');
-
-        this._value = Math.max(Math.min(value, this._maxValue), 0);
-        this.actor.queue_repaint();
+    get value() {
+        return this._value;
     }
 
-    setMaximumValue(value) {
-        if (isNaN(value))
-            throw TypeError('The bar level max value must be a number');
+    set value(value) {
+        value = Math.max(Math.min(value, this._maxValue), 0);
 
-        this._maxValue = Math.max(value, 1);
+        if (this._value == value)
+            return;
+
+        this._value = value;
+        this.notify('value');
+        this.queue_repaint();
+    }
+
+    // eslint-disable-next-line camelcase
+    get maximum_value() {
+        return this._maxValue;
+    }
+
+    // eslint-disable-next-line camelcase
+    set maximum_value(value) {
+        value = Math.max(value, 1);
+
+        if (this._maxValue == value)
+            return;
+
+        this._maxValue = value;
         this._overdriveStart = Math.min(this._overdriveStart, this._maxValue);
-        this.actor.queue_repaint();
+        this.notify('maximum-value');
+        this.queue_repaint();
     }
 
-    setOverdriveStart(value) {
-        if (isNaN(value))
-            throw TypeError('The overdrive limit value must be a number');
+    // eslint-disable-next-line camelcase
+    get overdrive_start() {
+        return this._overdriveStart;
+    }
+
+    // eslint-disable-next-line camelcase
+    set overdrive_start(value) {
+        if (this._overdriveStart == value)
+            return;
+
         if (value > this._maxValue)
             throw new Error(`Tried to set overdrive value to ${value}, ` +
                 `which is a number greater than the maximum allowed value ${this._maxValue}`);
 
         this._overdriveStart = value;
-        this._value = Math.max(Math.min(value, this._maxValue), 0);
-        this.actor.queue_repaint();
+        this.notify('overdrive-start');
+        this.queue_repaint();
     }
 
-    _barLevelRepaint(area) {
-        let cr = area.get_context();
-        let themeNode = area.get_theme_node();
-        let [width, height] = area.get_surface_size();
+    vfunc_repaint() {
+        let cr = this.get_context();
+        let themeNode = this.get_theme_node();
+        let [width, height] = this.get_surface_size();
 
         let barLevelHeight = themeNode.get_length('-barlevel-height');
         let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2;
@@ -175,32 +207,27 @@ var BarLevel = class {
         cr.$dispose();
     }
 
-    _getCurrentValue(actor) {
+    _getCurrentValue() {
         return this._value;
     }
 
-    _getOverdriveStart(actor) {
+    _getOverdriveStart() {
         return this._overdriveStart;
     }
 
-    _getMinimumValue(actor) {
+    _getMinimumValue() {
         return 0;
     }
 
-    _getMaximumValue(actor) {
+    _getMaximumValue() {
         return this._maxValue;
     }
 
-    _setCurrentValue(actor, value) {
+    _setCurrentValue(_actor, value) {
         this._value = value;
     }
 
-    _valueChanged(barLevel, value, property) {
+    _valueChanged() {
         this._customAccessible.notify("accessible-value");
     }
-
-    get value() {
-        return this._value;
-    }
-};
-Signals.addSignalMethods(BarLevel.prototype);
+});

js/ui/boxpointer.js

@@ -1,9 +1,9 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported BoxPointer */
 
 const { Clutter, GObject, Shell, St } = imports.gi;
 
 const Main = imports.ui.main;
-const Tweener = imports.ui.tweener;
 
 var PopupAnimation = {
     NONE:  0,
@@ -12,7 +12,7 @@ var PopupAnimation = {
     FULL:  ~0,
 };
 
-var POPUP_ANIMATION_TIME = 0.15;
+var POPUP_ANIMATION_TIME = 150;
 
 /**
  * BoxPointer:
@@ -105,16 +105,18 @@ var BoxPointer = GObject.registerClass({
             }
         }
 
-        Tweener.addTween(this, { opacity: 255,
-                                 translation_x: 0,
-                                 translation_y: 0,
-                                 transition: 'linear',
-                                 onComplete: () => {
-                                     this._unmuteInput();
-                                     if (onComplete)
-                                         onComplete();
-                                 },
-                                 time: animationTime });
+        this.ease({
+            opacity: 255,
+            translation_x: 0,
+            translation_y: 0,
+            duration: animationTime,
+            mode: Clutter.AnimationMode.LINEAR,
+            onComplete: () => {
+                this._unmuteInput();
+                if (onComplete)
+                    onComplete();
+            }
+        });
     }
 
     close(animate, onComplete) {
@@ -147,21 +149,22 @@ var BoxPointer = GObject.registerClass({
 
         this._muteInput();
 
-        Tweener.removeTweens(this);
-        Tweener.addTween(this, { opacity: fade ? 0 : 255,
-                                 translation_x: translationX,
-                                 translation_y: translationY,
-                                 transition: 'linear',
-                                 time: animationTime,
-                                 onComplete: () => {
-                                     this.hide();
-                                     this.opacity = 0;
-                                     this.translation_x = 0;
-                                     this.translation_y = 0;
-                                     if (onComplete)
-                                         onComplete();
-                                 }
-                               });
+        this.remove_all_transitions();
+        this.ease({
+            opacity: fade ? 0 : 255,
+            translation_x: translationX,
+            translation_y: translationY,
+            duration: animationTime,
+            mode: Clutter.AnimationMode.LINEAR,
+            onComplete: () => {
+                this.hide();
+                this.opacity = 0;
+                this.translation_x = 0;
+                this.translation_y = 0;
+                if (onComplete)
+                    onComplete();
+            }
+        });
     }
 
     _adjustAllocationForArrow(isWidth, minSize, natSize) {
@@ -469,7 +472,7 @@ var BoxPointer = GObject.registerClass({
         let sourceAllocation = this._sourceAllocation;
         let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment;
         let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment;
-        let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size();
+        let [, , natWidth, natHeight] = this.get_preferred_size();
 
         // We also want to keep it onscreen, and separated from the
         // edge by the same distance as the main part of the box is
@@ -594,7 +597,7 @@ var BoxPointer = GObject.registerClass({
 
     _calculateArrowSide(arrowSide) {
         let sourceAllocation = this._sourceAllocation;
-        let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size();
+        let [, , boxWidth, boxHeight] = this.get_preferred_size();
         let workarea = this._workArea;
 
         switch (arrowSide) {

js/ui/calendar.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Calendar, CalendarMessageList */
 
 const { Clutter, Gio, GLib, Shell, St } = imports.gi;
 const Signals = imports.signals;
@@ -109,15 +110,15 @@ var EmptyEventSource = class EmptyEventSource {
     destroy() {
     }
 
-    requestRange(begin, end) {
+    requestRange(_begin, _end) {
     }
 
-    getEvents(begin, end) {
+    getEvents(_begin, _end) {
         let result = [];
         return result;
     }
 
-    hasEvents(day) {
+    hasEvents(_day) {
         return false;
     }
 };
@@ -220,13 +221,13 @@ var DBusEventSource = class DBusEventSource {
         this._lastRequestEnd = null;
     }
 
-    _onNameAppeared(owner) {
+    _onNameAppeared() {
         this._initialized = true;
         this._resetCache();
         this._loadEvents(true);
     }
 
-    _onNameVanished(oldOwner) {
+    _onNameVanished() {
         this._resetCache();
         this.emit('changed');
     }
@@ -235,22 +236,20 @@ var DBusEventSource = class DBusEventSource {
         this._loadEvents(false);
     }
 
-    _onEventsReceived(results, error) {
+    _onEventsReceived(results, _error) {
         let newEvents = [];
-        let appointments = results ? results[0] : null;
-        if (appointments != null) {
-            for (let n = 0; n < appointments.length; n++) {
-                let a = appointments[n];
-                let date = new Date(a[4] * 1000);
-                let end = new Date(a[5] * 1000);
-                let id = a[0];
-                let summary = a[1];
-                let allDay = a[3];
-                let event = new CalendarEvent(id, date, end, summary, allDay);
-                newEvents.push(event);
-            }
-            newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
+        let appointments = results[0] || [];
+        for (let n = 0; n < appointments.length; n++) {
+            let a = appointments[n];
+            let date = new Date(a[4] * 1000);
+            let end = new Date(a[5] * 1000);
+            let id = a[0];
+            let summary = a[1];
+            let allDay = a[3];
+            let event = new CalendarEvent(id, date, end, summary, allDay);
+            newEvents.push(event);
         }
+        newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
 
         this._events = newEvents;
         this.isLoading = false;
@@ -736,7 +735,7 @@ class NotificationMessage extends MessageList.Message {
             return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
     }
 
-    _onUpdated(n, clear) {
+    _onUpdated(n, _clear) {
         this.setIcon(this._getIcon());
         this.setTitle(n.title);
         this.setBody(n.bannerBodyText);

js/ui/checkBox.js

@@ -1,3 +1,4 @@
+/* exported CheckBox */
 const { Clutter, Pango, St } = imports.gi;
 
 var CheckBox = class CheckBox {

js/ui/closeDialog.js

@@ -1,13 +1,13 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported CloseDialog */
 
 const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;
 
 const Dialog = imports.ui.dialog;
 const Main = imports.ui.main;
-const Tweener = imports.ui.tweener;
 
 var FROZEN_WINDOW_BRIGHTNESS = -0.3;
-var DIALOG_TRANSITION_TIME = 0.15;
+var DIALOG_TRANSITION_TIME = 150;
 var ALIVE_TIMEOUT = 5000;
 
 var CloseDialog = GObject.registerClass({
@@ -148,12 +148,12 @@ var CloseDialog = GObject.registerClass({
         this._dialog.scale_y = 0;
         this._dialog.set_pivot_point(0.5, 0.5);
 
-        Tweener.addTween(this._dialog,
-                         { scale_y: 1,
-                           transition: 'linear',
-                           time: DIALOG_TRANSITION_TIME,
-                           onComplete: this._onFocusChanged.bind(this)
-                         });
+        this._dialog.ease({
+            scale_y: 1,
+            mode: Clutter.AnimationMode.LINEAR,
+            duration: DIALOG_TRANSITION_TIME,
+            onComplete: this._onFocusChanged.bind(this)
+        });
     }
 
     vfunc_hide() {
@@ -175,14 +175,12 @@ var CloseDialog = GObject.registerClass({
         this._dialog = null;
         this._removeWindowEffect();
 
-        Tweener.addTween(dialog,
-                         { scale_y: 0,
-                           transition: 'linear',
-                           time: DIALOG_TRANSITION_TIME,
-                           onComplete: () => {
-                               dialog.destroy();
-                           }
-                         });
+        dialog.ease({
+            scale_y: 0,
+            mode: Clutter.AnimationMode.LINEAR,
+            duration: DIALOG_TRANSITION_TIME,
+            onComplete: () => dialog.destroy()
+        });
     }
 
     vfunc_focus() {

js/ui/components/__init__.js

@@ -1,3 +1,4 @@
+/* exported ComponentManager */
 const Main = imports.ui.main;
 
 var ComponentManager = class {

js/ui/components/automountManager.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Component */
 
 const { Gio, GLib } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -55,7 +56,7 @@ var AutomountManager = class {
         }
     }
 
-    _InhibitorsChanged(object, senderName, [inhibtor]) {
+    _InhibitorsChanged(_object, _senderName, [_inhibitor]) {
         this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
             (result, error) => {
                 if (!error) {

js/ui/components/autorunManager.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Component */
 
 const { Gio, St } = imports.gi;
 
@@ -122,10 +123,7 @@ var ContentTypeDiscoverer = class {
         }
     }
 
-    _emitCallback(mount, contentTypes) {
-        if (!contentTypes)
-            contentTypes = [];
-
+    _emitCallback(mount, contentTypes = []) {
         // we're not interested in win32 software content types here
         contentTypes = contentTypes.filter(
             type => (type != 'x-content/win32-software')

js/ui/components/keyring.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Component */
 
 const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi;
 
@@ -176,21 +177,21 @@ class KeyringDialog extends ModalDialog.ModalDialog {
         return false;
     }
 
-    _onShowPassword(prompt) {
+    _onShowPassword() {
         this._buildControlTable();
         this._ensureOpen();
         this._updateSensitivity(true);
         this._passwordEntry.grab_key_focus();
     }
 
-    _onShowConfirm(prompt) {
+    _onShowConfirm() {
         this._buildControlTable();
         this._ensureOpen();
         this._updateSensitivity(true);
         this._continueButton.grab_key_focus();
     }
 
-    _onHidePrompt(prompt) {
+    _onHidePrompt() {
         this.close();
     }
 

js/ui/components/networkAgent.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Component */
 
 const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi;
 const Signals = imports.signals;
@@ -199,7 +200,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
         return true;
     }
 
-    _getWirelessSecrets(secrets, wirelessSetting) {
+    _getWirelessSecrets(secrets, _wirelessSetting) {
         let wirelessSecuritySetting = this._connection.get_setting_wireless_security();
 
         if (this._settingName == '802-1x') {
@@ -385,7 +386,7 @@ var VPNRequestHandler = class {
         this._newStylePlugin = authHelper.externalUIMode;
 
         try {
-            let [success, pid, stdin, stdout, stderr] =
+            let [success_, pid, stdin, stdout, stderr] =
                 GLib.spawn_async_with_pipes(null, /* pwd */
                                             argv,
                                             null, /* envp */
@@ -444,7 +445,7 @@ var VPNRequestHandler = class {
         this._destroyed = true;
     }
 
-    _vpnChildFinished(pid, status, requestObj) {
+    _vpnChildFinished(pid, status, _requestObj) {
         this._childWatch = 0;
         if (this._newStylePlugin) {
             // For new style plugin, all work is done in the async reading functions
@@ -486,7 +487,7 @@ var VPNRequestHandler = class {
 
     _readStdoutOldStyle() {
         this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => {
-            let [line, len] = this._dataStdout.read_line_finish_utf8(result);
+            let [line, len_] = this._dataStdout.read_line_finish_utf8(result);
 
             if (line == null) {
                 // end of file
@@ -541,7 +542,7 @@ var VPNRequestHandler = class {
                                 message: keyfile.get_string(VPN_UI_GROUP, 'Description'),
                                 secrets: [] };
 
-            let [groups, len] = keyfile.get_groups();
+            let [groups, len_] = keyfile.get_groups();
             for (let i = 0; i < groups.length; i++) {
                 if (groups[i] == VPN_UI_GROUP)
                     continue;

js/ui/components/polkitAgent.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Component */
 
 const { AccountsService, Clutter, Gio, GLib,
         GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi;
@@ -383,11 +384,11 @@ var AuthenticationAgent = class {
         this._currentDialog.performAuthentication();
     }
 
-    _onCancel(nativeAgent) {
+    _onCancel(_nativeAgent) {
         this._completeRequest(false);
     }
 
-    _onDialogDone(dialog, dismissed) {
+    _onDialogDone(_dialog, dismissed) {
         this._completeRequest(dismissed);
     }
 

js/ui/components/telepathyClient.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Component */
 
 const { Clutter, Gio, GLib, GObject, St } = imports.gi;
 const Lang = imports.lang;
@@ -41,7 +42,7 @@ var NotificationDirection = {
 };
 
 function makeMessageFromTpMessage(tpMessage, direction) {
-    let [text, flags] = tpMessage.to_text();
+    let [text, flags_] = tpMessage.to_text();
 
     let timestamp = tpMessage.get_sent_timestamp();
     if (timestamp == 0)
@@ -148,11 +149,11 @@ class TelepathyClient extends Tp.BaseClient {
     }
 
     vfunc_observe_channels(...args) {
-        let [account, conn, channels, dispatchOp, requests, context] = args;
+        let [account, conn, channels, dispatchOp_, requests_, context] = args;
         let len = channels.length;
         for (let i = 0; i < len; i++) {
             let channel = channels[i];
-            let [targetHandle, targetHandleType] = channel.get_handle();
+            let [targetHandle_, targetHandleType] = channel.get_handle();
 
             if (channel.get_invalidated())
                 continue;
@@ -181,7 +182,7 @@ class TelepathyClient extends Tp.BaseClient {
     }
 
     vfunc_handle_channels(...args) {
-        let [account, conn, channels, requests, userActionTime, context] = args;
+        let [account, conn, channels, requests_, userActionTime_, context] = args;
         this._handlingChannels(account, conn, channels, true);
         context.accept();
     }
@@ -239,7 +240,7 @@ class TelepathyClient extends Tp.BaseClient {
     }
 
     _approveTextChannel(account, conn, channel, dispatchOp, context) {
-        let [targetHandle, targetHandleType] = channel.get_handle();
+        let [targetHandle_, targetHandleType] = channel.get_handle();
 
         if (targetHandleType != Tp.HandleType.CONTACT) {
             context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
@@ -260,7 +261,7 @@ class TelepathyClient extends Tp.BaseClient {
         context.accept();
     }
 
-    _delegatedChannelsCb(client, channels) {
+    _delegatedChannelsCb(_client, _channels) {
         // Nothing to do as we don't make a distinction between observed and
         // handled channels.
     }
@@ -427,7 +428,7 @@ var ChatSource = class extends MessageTray.Source {
     }
 
     _displayPendingMessages(logManager, result) {
-        let [success, events] = logManager.get_filtered_events_finish(result);
+        let [success_, events] = logManager.get_filtered_events_finish(result);
 
         let logMessages = events.map(makeMessageFromTplEvent);
         this._ensureNotification();
@@ -562,7 +563,7 @@ var ChatSource = class extends MessageTray.Source {
 
     // This is called for both messages we send from
     // our client and other clients as well.
-    _messageSent(channel, message, flags, token) {
+    _messageSent(channel, message, _flags, _token) {
         this._ensureNotification();
         message = makeMessageFromTpMessage(message, NotificationDirection.SENT);
         this._notification.appendMessage(message);
@@ -600,7 +601,7 @@ var ChatSource = class extends MessageTray.Source {
         }
     }
 
-    _presenceChanged(contact, presence, status, message) {
+    _presenceChanged(_contact, _presence, _status, _message) {
         if (this._notification)
             this._notification.update(this._notification.title,
                                       this._notification.bannerBodyText,

js/ui/ctrlAltTab.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported CtrlAltTabManager */
 
 const { Clutter, GObject, Meta, Shell, St } = imports.gi;
 
@@ -63,9 +64,8 @@ var CtrlAltTabManager = class CtrlAltTabManager {
         if (a.sortGroup != b.sortGroup)
             return a.sortGroup - b.sortGroup;
 
-        let ax, bx, y;
-        [ax, y] = a.proxy.get_transformed_position();
-        [bx, y] = b.proxy.get_transformed_position();
+        let [ax] = a.proxy.get_transformed_position();
+        let [bx] = b.proxy.get_transformed_position();
 
         return ax - bx;
     }

js/ui/dash.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Dash */
 
 const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -9,11 +10,10 @@ const AppFavorites = imports.ui.appFavorites;
 const DND = imports.ui.dnd;
 const IconGrid = imports.ui.iconGrid;
 const Main = imports.ui.main;
-const Tweener = imports.ui.tweener;
 
-var DASH_ANIMATION_TIME = 0.2;
-var DASH_ITEM_LABEL_SHOW_TIME = 0.15;
-var DASH_ITEM_LABEL_HIDE_TIME = 0.1;
+var DASH_ANIMATION_TIME = 200;
+var DASH_ITEM_LABEL_SHOW_TIME = 150;
+var DASH_ITEM_LABEL_HIDE_TIME = 100;
 var DASH_ITEM_HOVER_TIMEOUT = 300;
 
 function getAppFromSource(source) {
@@ -24,6 +24,30 @@ function getAppFromSource(source) {
     }
 }
 
+var DashIcon = class DashIcon extends AppDisplay.AppIcon {
+    constructor(app) {
+        super(app, {
+            setSizeManually: true,
+            showLabel: false
+        });
+    }
+
+    // Disable all DnD methods
+    _onDragBegin() {
+    }
+
+    _onDragEnd() {
+    }
+
+    handleDragOver() {
+        return DND.DragMotionResult.CONTINUE;
+    }
+
+    acceptDrop() {
+        return false;
+    }
+};
+
 // A container like StBin, but taking the child's scale into account
 // when requesting a size
 var DashItemContainer = GObject.registerClass(
@@ -31,6 +55,9 @@ class DashItemContainer extends St.Widget {
     _init() {
         super._init({ style_class: 'dash-item-container',
                       pivot_point: new Clutter.Point({ x: .5, y: .5 }),
+                      scale_x: 0,
+                      scale_y: 0,
+                      opacity: 0,
                       x_expand: true,
                       x_align: Clutter.ActorAlign.CENTER });
 
@@ -41,10 +68,11 @@ class DashItemContainer extends St.Widget {
         this.label_actor = this.label;
 
         this.child = null;
-        this._childScale = 0;
-        this._childOpacity = 0;
         this.animatingOut = false;
 
+        this.connect('notify::scale-x', () => this.queue_relayout());
+        this.connect('notify::scale-y', () => this.queue_relayout());
+
         this.connect('destroy', () => {
             if (this.child != null)
                 this.child.destroy();
@@ -95,11 +123,11 @@ class DashItemContainer extends St.Widget {
             x = stageX + this.get_width() + xOffset;
 
         this.label.set_position(x, y);
-        Tweener.addTween(this.label,
-                         { opacity: 255,
-                           time: DASH_ITEM_LABEL_SHOW_TIME,
-                           transition: 'easeOutQuad',
-                         });
+        this.label.ease({
+            opacity: 255,
+            duration: DASH_ITEM_LABEL_SHOW_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
     }
 
     setLabelText(text) {
@@ -108,14 +136,12 @@ class DashItemContainer extends St.Widget {
     }
 
     hideLabel() {
-        Tweener.addTween(this.label,
-                         { opacity: 0,
-                           time: DASH_ITEM_LABEL_HIDE_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: () => {
-                               this.label.hide();
-                           }
-                         });
+        this.label.ease({
+            opacity: 0,
+            duration: DASH_ITEM_LABEL_HIDE_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => this.label.hide()
+        });
     }
 
     setChild(actor) {
@@ -126,9 +152,6 @@ class DashItemContainer extends St.Widget {
 
         this.child = actor;
         this.add_actor(this.child);
-
-        this.set_scale(this._childScale, this._childScale);
-        this.set_opacity(this._childOpacity);
     }
 
     show(animate) {
@@ -136,12 +159,13 @@ class DashItemContainer extends St.Widget {
             return;
 
         let time = animate ? DASH_ANIMATION_TIME : 0;
-        Tweener.addTween(this,
-                         { childScale: 1.0,
-                           childOpacity: 255,
-                           time: time,
-                           transition: 'easeOutQuad'
-                         });
+        this.ease({
+            scale_x: 1,
+            scale_y: 1,
+            opacity: 255,
+            duration: time,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
     }
 
     animateOutAndDestroy() {
@@ -153,37 +177,14 @@ class DashItemContainer extends St.Widget {
         }
 
         this.animatingOut = true;
-        Tweener.addTween(this,
-                         { childScale: 0.0,
-                           childOpacity: 0,
-                           time: DASH_ANIMATION_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: () => {
-                               this.destroy();
-                           }
-                         });
-    }
-
-    set childScale(scale) {
-        this._childScale = scale;
-
-        this.set_scale(scale, scale);
-        this.queue_relayout();
-    }
-
-    get childScale() {
-        return this._childScale;
-    }
-
-    set childOpacity(opacity) {
-        this._childOpacity = opacity;
-
-        this.set_opacity(opacity);
-        this.queue_redraw();
-    }
-
-    get childOpacity() {
-        return this._childOpacity;
+        this.ease({
+            scale_x: 0,
+            scale_y: 0,
+            opacity: 0,
+            duration: DASH_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => this.destroy()
+        });
     }
 });
 
@@ -241,14 +242,14 @@ class ShowAppsIcon extends DashItemContainer {
             this.setLabelText(_("Show Applications"));
     }
 
-    handleDragOver(source, actor, x, y, time) {
+    handleDragOver(source, _actor, _x, _y, _time) {
         if (!this._canRemoveApp(getAppFromSource(source)))
             return DND.DragMotionResult.NO_DROP;
 
         return DND.DragMotionResult.MOVE_DROP;
     }
 
-    acceptDrop(source, actor, x, y, time) {
+    acceptDrop(source, _actor, _x, _y, _time) {
         let app = getAppFromSource(source);
         if (!this._canRemoveApp(app))
             return false;
@@ -296,7 +297,7 @@ class DashActor extends St.Widget {
         this.set_allocation(box, flags);
 
         let [appIcons, showAppsButton] = this.get_children();
-        let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
+        let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
 
         let childBox = new Clutter.ActorBox();
         childBox.x1 = contentBox.x1;
@@ -351,8 +352,7 @@ var Dash = class Dash {
         this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
 
         this._showAppsIcon = new ShowAppsIcon();
-        this._showAppsIcon.childScale = 1;
-        this._showAppsIcon.childOpacity = 255;
+        this._showAppsIcon.show(false);
         this._showAppsIcon.icon.setIconSize(this.iconSize);
         this._hookUpLabel(this._showAppsIcon);
 
@@ -474,19 +474,7 @@ var Dash = class Dash {
     }
 
     _createAppItem(app) {
-        let appIcon = new AppDisplay.AppIcon(app,
-                                             { setSizeManually: true,
-                                               showLabel: false });
-        if (appIcon._draggable) {
-            appIcon._draggable.connect('drag-begin',
-                                       () => {
-                                           appIcon.actor.opacity = 50;
-                                       });
-            appIcon._draggable.connect('drag-end',
-                                       () => {
-                                           appIcon.actor.opacity = 255;
-                                       });
-        }
+        let appIcon = new DashIcon(app);
 
         appIcon.connect('menu-state-changed',
                         (appIcon, opened) => {
@@ -633,12 +621,12 @@ var Dash = class Dash {
             icon.icon.set_size(icon.icon.width * scale,
                                icon.icon.height * scale);
 
-            Tweener.addTween(icon.icon,
-                             { width: targetWidth,
-                               height: targetHeight,
-                               time: DASH_ANIMATION_TIME,
-                               transition: 'easeOutQuad',
-                             });
+            icon.icon.ease({
+                width: targetWidth,
+                height: targetHeight,
+                time: DASH_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
         }
     }
 
@@ -790,7 +778,7 @@ var Dash = class Dash {
         }
     }
 
-    handleDragOver(source, actor, x, y, time) {
+    handleDragOver(source, actor, x, y, _time) {
         let app = getAppFromSource(source);
 
         // Don't allow favoriting of transient apps
@@ -868,7 +856,7 @@ var Dash = class Dash {
     }
 
     // Draggable target interface
-    acceptDrop(source, actor, x, y, time) {
+    acceptDrop(source, _actor, _x, _y, _time) {
         let app = getAppFromSource(source);
 
         // Don't allow favoriting of transient apps

js/ui/dateMenu.js

@@ -1,6 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported DateMenuButton */
 
-const { Clutter, GLib, GnomeDesktop,
+const { Clutter, Gio, GLib, GnomeDesktop,
         GObject, GWeather, Shell, St } = imports.gi;
 
 const Util = imports.misc.util;
@@ -10,8 +11,13 @@ const Calendar = imports.ui.calendar;
 const Weather = imports.misc.weather;
 const System = imports.system;
 
+const { loadInterfaceXML } = imports.misc.fileUtils;
+
 const MAX_FORECASTS = 5;
 
+const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration');
+const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface);
+
 function _isToday(date) {
     let now = new Date();
     return now.getYear() == date.getYear() &&
@@ -82,7 +88,8 @@ var WorldClocksSection = class WorldClocksSection {
                                      x_fill: true,
                                      can_focus: true });
         this.actor.connect('clicked', () => {
-            this._clockAppMon.activateApp();
+            if (this._clocksApp)
+                this._clocksApp.activate();
 
             Main.overview.hide();
             Main.panel.closeCalendar();
@@ -95,29 +102,40 @@ var WorldClocksSection = class WorldClocksSection {
 
         this.actor.child = this._grid;
 
-        this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop',
-                                                        'org.gnome.clocks');
-        this._clockAppMon.connect('available-changed',
-                                  this._sync.bind(this));
-        this._clockAppMon.watchSetting('world-clocks',
-                                       this._clocksChanged.bind(this));
+        this._clocksApp = null;
+        this._clocksProxy = new ClocksProxy(
+            Gio.DBus.session,
+            'org.gnome.clocks',
+            '/org/gnome/clocks',
+            this._onProxyReady.bind(this),
+            null /* cancellable */,
+            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
+
+        this._settings = new Gio.Settings({
+            schema_id: 'org.gnome.shell.world-clocks'
+        });
+        this._settings.connect('changed', this._clocksChanged.bind(this));
+        this._clocksChanged();
+
+        this._appSystem = Shell.AppSystem.get_default();
+        this._appSystem.connect('installed-changed',
+            this._sync.bind(this));
         this._sync();
     }
 
     _sync() {
-        this.actor.visible = this._clockAppMon.available;
+        this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop');
+        this.actor.visible = this._clocksApp != null;
     }
 
-    _clocksChanged(settings) {
+    _clocksChanged() {
         this._grid.destroy_all_children();
         this._locations = [];
 
         let world = GWeather.Location.get_world();
-        let clocks = settings.get_value('world-clocks').deep_unpack();
+        let clocks = this._settings.get_value('locations').deep_unpack();
         for (let i = 0; i < clocks.length; i++) {
-            if (!clocks[i].location)
-                continue;
-            let l = world.deserialize(clocks[i].location);
+            let l = world.deserialize(clocks[i]);
             if (l && l.get_timezone() != null)
                 this._locations.push({ location: l });
         }
@@ -196,6 +214,25 @@ var WorldClocksSection = class WorldClocksSection {
             l.actor.text = Util.formatTime(now, { timeOnly: true });
         }
     }
+
+    _onProxyReady(proxy, error) {
+        if (error) {
+            log(`Failed to create GNOME Clocks proxy: ${error}`);
+            return;
+        }
+
+        this._clocksProxy.connect('g-properties-changed',
+            this._onClocksPropertiesChanged.bind(this));
+        this._onClocksPropertiesChanged();
+    }
+
+    _onClocksPropertiesChanged() {
+        if (this._clocksProxy.g_name_owner == null)
+            return;
+
+        this._settings.set_value('locations',
+            new GLib.Variant('av', this._clocksProxy.Locations));
+    }
 };
 
 var WeatherSection = class WeatherSection {
@@ -249,12 +286,12 @@ var WeatherSection = class WeatherSection {
         let current = info;
         let infos = [info];
         for (let i = 0; i < forecasts.length; i++) {
-            let [ok, timestamp] = forecasts[i].get_value_update();
+            let [ok_, timestamp] = forecasts[i].get_value_update();
             let datetime = new Date(timestamp * 1000);
             if (!_isToday(datetime))
                 continue; // Ignore forecasts from other days
 
-            [ok, timestamp] = current.get_value_update();
+            [ok_, timestamp] = current.get_value_update();
             let currenttime = new Date(timestamp * 1000);
             if (currenttime.getHours() == datetime.getHours())
                 continue; // Enforce a minimum interval of 1h
@@ -275,7 +312,7 @@ var WeatherSection = class WeatherSection {
 
         let col = 0;
         infos.forEach(fc => {
-            let [ok, timestamp] = fc.get_value_update();
+            let [ok_, timestamp] = fc.get_value_update();
             let timeStr = Util.formatTime(new Date(timestamp * 1000), {
                 timeOnly: true
             });

js/ui/dialog.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Dialog, MessageDialogContent */
 
 const { Clutter, Gio, GObject, Pango, St } = imports.gi;
 
@@ -180,10 +181,8 @@ var MessageDialogContent = GObject.registerClass({
         this._subtitle.clutter_text.set(textProps);
         this._body.clutter_text.set(textProps);
 
-        if (!params.hasOwnProperty('style_class'))
-            params.style_class = 'message-dialog-main-layout';
-
-        super._init(params);
+        let defaultParams = { style_class: 'message-dialog-main-layout' };
+        super._init(Object.assign(defaultParams, params));
 
         this.messageBox = new St.BoxLayout({ style_class: 'message-dialog-content',
                                              x_expand: true,

js/ui/dnd.js

@@ -1,18 +1,18 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported addDragMonitor, removeDragMonitor, makeDraggable */
 
 const { Clutter, GLib, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;
 
 const Main = imports.ui.main;
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 
 // Time to scale down to maxDragActorSize
-var SCALE_ANIMATION_TIME = 0.25;
+var SCALE_ANIMATION_TIME = 250;
 // Time to animate to original position on cancel
-var SNAP_BACK_ANIMATION_TIME = 0.25;
+var SNAP_BACK_ANIMATION_TIME = 250;
 // Time to animate to original position on success
-var REVERT_ANIMATION_TIME = 0.75;
+var REVERT_ANIMATION_TIME = 750;
 
 var DragMotionResult = {
     NO_DROP:   0,
@@ -111,9 +111,6 @@ var _Draggable = class _Draggable {
         if (event.get_button() != 1)
             return Clutter.EVENT_PROPAGATE;
 
-        if (Tweener.getTweenCount(actor))
-            return Clutter.EVENT_PROPAGATE;
-
         this._buttonDown = true;
         this._grabActor(event.get_device());
 
@@ -139,9 +136,6 @@ var _Draggable = class _Draggable {
             !global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
             return Clutter.EVENT_PROPAGATE;
 
-        if (Tweener.getTweenCount(actor))
-            return Clutter.EVENT_PROPAGATE;
-
         this._buttonDown = true;
         this._grabActor(event.get_device(), event.get_event_sequence());
 
@@ -428,19 +422,22 @@ var _Draggable = class _Draggable {
                 // to the final position because that tween would
                 // fight with updates as the user continues dragging
                 // the mouse; instead we do the position computations in
-                // an onUpdate() function.
-                Tweener.addTween(this._dragActor,
-                                 { scale_x: scale * origScale,
-                                   scale_y: scale * origScale,
-                                   time: SCALE_ANIMATION_TIME,
-                                   transition: 'easeOutQuad',
-                                   onUpdate: () => {
-                                       let currentScale = this._dragActor.scale_x / origScale;
-                                       this._dragOffsetX = currentScale * origDragOffsetX;
-                                       this._dragOffsetY = currentScale * origDragOffsetY;
-                                       this._dragActor.set_position(this._dragX + this._dragOffsetX,
-                                                                    this._dragY + this._dragOffsetY);
-                                   } });
+                // a ::new-frame handler.
+                this._dragActor.ease({
+                    scale_x: scale * origScale,
+                    scale_y: scale * origScale,
+                    duration: SCALE_ANIMATION_TIME,
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                });
+
+                this._dragActor.get_transition('scale-x').connect('new-frame', () => {
+                    let currentScale = this._dragActor.scale_x / origScale;
+                    this._dragOffsetX = currentScale * origDragOffsetX;
+                    this._dragOffsetY = currentScale * origDragOffsetY;
+                    this._dragActor.set_position(
+                        this._dragX + this._dragOffsetX,
+                        this._dragY + this._dragOffsetY);
+                });
             }
         }
     }
@@ -503,7 +500,7 @@ var _Draggable = class _Draggable {
 
         while (target) {
             if (target._delegate && target._delegate.handleDragOver) {
-                let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
+                let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
                 // We currently loop through all parents on drag-over even if one of the children has handled it.
                 // We can check the return value of the function and break the loop if it's true if we don't want
                 // to continue checking the parents.
@@ -575,7 +572,7 @@ var _Draggable = class _Draggable {
 
         while (target) {
             if (target._delegate && target._delegate.acceptDrop) {
-                let [r, targX, targY] = target.transform_stage_point(dropX, dropY);
+                let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
                 if (target._delegate.acceptDrop(this.actor._delegate,
                                                 this._dragActor,
                                                 targX,
@@ -613,15 +610,15 @@ var _Draggable = class _Draggable {
         if (this._dragActorSource && this._dragActorSource.visible) {
             // Snap the clone back to its source
             [x, y] = this._dragActorSource.get_transformed_position();
-            let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size();
-            scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0;
+            let [sourceScaledWidth] = this._dragActorSource.get_transformed_size();
+            scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0;
         } else if (this._dragOrigParent) {
             // Snap the actor back to its original position within
             // its parent, adjusting for the fact that the parent
             // may have been moved or scaled
             let [parentX, parentY] = this._dragOrigParent.get_transformed_position();
-            let [parentWidth, parentHeight] = this._dragOrigParent.get_size();
-            let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size();
+            let [parentWidth] = this._dragOrigParent.get_size();
+            let [parentScaledWidth] = this._dragOrigParent.get_transformed_size();
             let parentScale = 1.0;
             if (parentWidth != 0)
                 parentScale = parentScaledWidth / parentWidth;
@@ -657,13 +654,13 @@ var _Draggable = class _Draggable {
 
         let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation();
 
-        this._animateDragEnd(eventTime,
-                             { x: snapBackX,
-                               y: snapBackY,
-                               scale_x: snapBackScale,
-                               scale_y: snapBackScale,
-                               time: SNAP_BACK_ANIMATION_TIME,
-                             });
+        this._animateDragEnd(eventTime, {
+            x: snapBackX,
+            y: snapBackY,
+            scale_x: snapBackScale,
+            scale_y: snapBackScale,
+            duration: SNAP_BACK_ANIMATION_TIME
+        });
     }
 
     _restoreDragActor(eventTime) {
@@ -675,21 +672,22 @@ var _Draggable = class _Draggable {
         this._dragActor.set_scale(restoreScale, restoreScale);
         this._dragActor.opacity = 0;
 
-        this._animateDragEnd(eventTime,
-                             { time: REVERT_ANIMATION_TIME });
+        this._animateDragEnd(eventTime, {
+            duration: REVERT_ANIMATION_TIME
+        });
     }
 
     _animateDragEnd(eventTime, params) {
         this._animationInProgress = true;
 
-        params['opacity']          = this._dragOrigOpacity;
-        params['transition']       = 'easeOutQuad';
-        params['onComplete']       = this._onAnimationComplete;
-        params['onCompleteScope']  = this;
-        params['onCompleteParams'] = [this._dragActor, eventTime];
-
         // start the animation
-        Tweener.addTween(this._dragActor, params);
+        this._dragActor.ease(Object.assign(params, {
+            opacity: this._dragOrigOpacity,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                this._onAnimationComplete(this._dragActor, eventTime);
+            }
+        }));
     }
 
     _finishAnimation() {

js/ui/edgeDragAction.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported EdgeDragAction */
 
 const { Clutter, GObject, Meta, St } = imports.gi;
 
@@ -26,7 +27,7 @@ var EdgeDragAction = GObject.registerClass({
         return global.display.get_monitor_geometry(monitorIndex);
     }
 
-    vfunc_gesture_prepare(actor) {
+    vfunc_gesture_prepare(_actor) {
         if (this.get_n_current_points() == 0)
             return false;
 
@@ -42,7 +43,7 @@ var EdgeDragAction = GObject.registerClass({
                 (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
     }
 
-    vfunc_gesture_progress(actor) {
+    vfunc_gesture_progress(_actor) {
         let [startX, startY] = this.get_press_coords(0);
         let [x, y] = this.get_motion_coords(0);
         let offsetX = Math.abs (x - startX);
@@ -62,7 +63,7 @@ var EdgeDragAction = GObject.registerClass({
         return true;
     }
 
-    vfunc_gesture_end(actor) {
+    vfunc_gesture_end(_actor) {
         let [startX, startY] = this.get_press_coords(0);
         let [x, y] = this.get_motion_coords(0);
         let monitorRect = this._getMonitorRect(startX, startY);

js/ui/endSessionDialog.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported init, EndSessionDialog */
 /*
  * Copyright 2010-2016 Red Hat, Inc
  *
@@ -351,12 +352,15 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         }
 
         // It only makes sense to check for this permission if PackageKit is available.
-        try {
-            this._updatesPermission = Polkit.Permission.new_sync(
-                "org.freedesktop.packagekit.trigger-offline-update", null, null);
-        } catch(e) {
-            log('No permission to trigger offline updates: %s'.format(e.toString()));
-        }
+        Polkit.Permission.new(
+            'org.freedesktop.packagekit.trigger-offline-update', null, null,
+            (source, res) => {
+                try {
+                    this._updatesPermission = Polkit.Permission.new_finish(res);
+                } catch (e) {
+                    log(`No permission to trigger offline updates: ${e}`);
+                }
+            });
     }
 
     _onDestroy() {
@@ -668,7 +672,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         this._loginManager.listSessions(result => {
             let n = 0;
             for (let i = 0; i < result.length; i++) {
-                let [id, uid, userName, seat, sessionPath] = result[i];
+                let [id_, uid_, userName, seat_, sessionPath] = result[i];
                 let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath);
 
                 if (proxy.Class != 'user')
@@ -734,7 +738,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         let dialogContent = DialogContent[this._type];
 
         for (let i = 0; i < inhibitorObjectPaths.length; i++) {
-            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => {
+            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => {
                 this._onInhibitorLoaded(proxy);
             });
 
@@ -778,7 +782,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         });
     }
 
-    Close(parameters, invocation) {
+    Close(_parameters, _invocation) {
         this.close();
     }
 });

js/ui/environment.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported init */
 
 const Config = imports.misc.config;
 
@@ -57,6 +58,116 @@ function _patchLayoutClass(layoutClass, styleProps) {
     };
 }
 
+function _makeEaseCallback(params) {
+    let onComplete = params.onComplete;
+    delete params.onComplete;
+
+    let onStopped = params.onStopped;
+    delete params.onStopped;
+
+    if (!onComplete && !onStopped)
+        return null;
+
+    return isFinished => {
+        if (onStopped)
+            onStopped(isFinished);
+        if (onComplete && isFinished)
+            onComplete();
+    };
+}
+
+function _getPropertyTarget(actor, propName) {
+    if (!propName.startsWith('@'))
+        return [actor, propName];
+
+    let [type, name, prop] = propName.split('.');
+    switch (type) {
+    case '@layout':
+        return [actor.layout_manager, name];
+    case '@actions':
+        return [actor.get_action(name), prop];
+    case '@constraints':
+        return [actor.get_constraint(name), prop];
+    case '@effects':
+        return [actor.get_effect(name), prop];
+    }
+
+    throw new Error(`Invalid property name ${propName}`);
+}
+
+function _easeActor(actor, params) {
+    actor.save_easing_state();
+
+    if (params.duration != undefined)
+        actor.set_easing_duration(params.duration);
+    delete params.duration;
+
+    if (params.delay != undefined)
+        actor.set_easing_delay(params.delay);
+    delete params.delay;
+
+    if (params.mode != undefined)
+        actor.set_easing_mode(params.mode);
+    delete params.mode;
+
+    let callback = _makeEaseCallback(params);
+
+    // cancel overwritten transitions
+    let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
+    animatedProps.forEach(p => actor.remove_transition(p));
+
+    actor.set(params);
+    actor.restore_easing_state();
+
+    if (callback) {
+        let transition = actor.get_transition(animatedProps[0]);
+
+        if (transition)
+            transition.connect('stopped', (t, finished) => callback(finished));
+        else
+            callback(true);
+    }
+}
+
+function _easeActorProperty(actor, propName, target, params) {
+    // Avoid pointless difference with ease()
+    if (params.mode)
+        params.progress_mode = params.mode;
+    delete params.mode;
+
+    if (params.duration)
+        params.duration = adjustAnimationTime(params.duration);
+    let duration = Math.floor(params.duration || 0);
+
+    let callback = _makeEaseCallback(params);
+
+    // cancel overwritten transition
+    actor.remove_transition(propName);
+
+    if (duration == 0) {
+        let [obj, prop] = _getPropertyTarget(actor, propName);
+        obj[prop] = target;
+
+        if (callback)
+            callback(true);
+
+        return;
+    }
+
+    let pspec = actor.find_property(propName);
+    let transition = new Clutter.PropertyTransition(Object.assign({
+        property_name: propName,
+        interval: new Clutter.Interval({ value_type: pspec.value_type }),
+        remove_on_complete: true
+    }, params));
+    actor.add_transition(propName, transition);
+
+    transition.set_to(target);
+
+    if (callback)
+        transition.connect('stopped', (t, finished) => callback(finished));
+}
+
 function _loggingFunc(...args) {
     let fields = { 'MESSAGE': args.join(', ') };
     let domain = "GNOME Shell";
@@ -93,6 +204,27 @@ function init() {
                                             column_spacing: 'spacing-columns' });
     _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });
 
+    let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
+    Clutter.Actor.prototype.set_easing_duration = function(msecs) {
+        origSetEasingDuration.call(this, adjustAnimationTime(msecs));
+    };
+    let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
+    Clutter.Actor.prototype.set_easing_delay = function(msecs) {
+        origSetEasingDelay.call(this, adjustAnimationTime(msecs));
+    };
+
+    Clutter.Actor.prototype.ease = function(props, easingParams) {
+        _easeActor(this, props, easingParams);
+    };
+    Clutter.Actor.prototype.ease_property = function(propName, target, params) {
+        _easeActorProperty(this, propName, target, params);
+    };
+    St.Adjustment.prototype.ease = function(target, params) {
+        // we're not an actor of course, but we implement the same
+        // transition API as Clutter.Actor, so this works anyway
+        _easeActorProperty(this, 'value', target, params);
+    };
+
     Clutter.Actor.prototype.toString = function() {
         return St.describe_actor(this);
     };
@@ -106,6 +238,12 @@ function init() {
         }
     });
 
+    St.set_slow_down_factor = function(factor) {
+        let { stack } = new Error();
+        log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
+        St.Settings.get().slow_down_factor = factor;
+    };
+
     let origToString = Object.prototype.toString;
     Object.prototype.toString = function() {
         let base = origToString.call(this);
@@ -128,7 +266,7 @@ function init() {
     if (slowdownEnv) {
         let factor = parseFloat(slowdownEnv);
         if (!isNaN(factor) && factor > 0.0)
-            St.set_slow_down_factor(factor);
+            St.Settings.get().slow_down_factor = factor;
     }
 
     // OK, now things are initialized enough that we can import shell JS
@@ -138,3 +276,17 @@ function init() {
     Tweener.init();
     String.prototype.format = Format.format;
 }
+
+// adjustAnimationTime:
+// @msecs: time in milliseconds
+//
+// Adjust @msecs to account for St's enable-animations
+// and slow-down-factor settings
+function adjustAnimationTime(msecs) {
+    let settings = St.Settings.get();
+
+    if (!settings.enable_animations)
+        return 1;
+    return settings.slow_down_factor * msecs;
+}
+

js/ui/extensionDownloader.js

@@ -1,12 +1,14 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported init, installExtension, uninstallExtension,
+            checkForUpdates, updateExtension */
 
 const { Clutter, Gio, GLib, GObject, Soup } = imports.gi;
 
 const Config = imports.misc.config;
 const Dialog = imports.ui.dialog;
 const ExtensionUtils = imports.misc.extensionUtils;
-const ExtensionSystem = imports.ui.extensionSystem;
 const FileUtils = imports.misc.fileUtils;
+const Main = imports.ui.main;
 const ModalDialog = imports.ui.modalDialog;
 
 var REPOSITORY_URL_BASE = 'https://extensions.gnome.org';
@@ -24,7 +26,7 @@ function installExtension(uuid, invocation) {
 
     _httpSession.queue_message(message, (session, message) => {
         if (message.status_code != Soup.KnownStatusCode.OK) {
-            ExtensionSystem.logExtensionError(uuid, `downloading info: ${message.status_code}`);
+            Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
             invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
             return;
         }
@@ -33,7 +35,7 @@ function installExtension(uuid, invocation) {
         try {
             info = JSON.parse(message.response_body.data);
         } catch (e) {
-            ExtensionSystem.logExtensionError(uuid, `parsing info: ${e}`);
+            Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`);
             invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString());
             return;
         }
@@ -44,7 +46,7 @@ function installExtension(uuid, invocation) {
 }
 
 function uninstallExtension(uuid) {
-    let extension = ExtensionUtils.extensions[uuid];
+    let extension = Main.extensionManager.lookup(uuid);
     if (!extension)
         return false;
 
@@ -52,7 +54,7 @@ function uninstallExtension(uuid) {
     if (extension.type != ExtensionUtils.ExtensionType.PER_USER)
         return false;
 
-    if (!ExtensionSystem.unloadExtension(extension))
+    if (!Main.extensionManager.unloadExtension(extension))
         return false;
 
     FileUtils.recursivelyDeleteDir(extension.dir, true);
@@ -113,10 +115,10 @@ function updateExtension(uuid) {
 
     _httpSession.queue_message(message, (session, message) => {
         gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
-            let oldExtension = ExtensionUtils.extensions[uuid];
+            let oldExtension = Main.extensionManager.lookup(uuid);
             let extensionDir = oldExtension.dir;
 
-            if (!ExtensionSystem.unloadExtension(oldExtension))
+            if (!Main.extensionManager.unloadExtension(oldExtension))
                 return;
 
             FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir);
@@ -125,11 +127,11 @@ function updateExtension(uuid) {
             let extension = null;
 
             try {
-                extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
-                ExtensionSystem.loadExtension(extension);
+                extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
+                Main.extensionManager.loadExtension(extension);
             } catch (e) {
                 if (extension)
-                    ExtensionSystem.unloadExtension(extension);
+                    Main.extensionManager.unloadExtension(extension);
 
                 logError(e, 'Error loading extension %s'.format(uuid));
 
@@ -138,7 +140,7 @@ function updateExtension(uuid) {
 
                 // Restore what was there before. We can't do much if we
                 // fail here.
-                ExtensionSystem.loadExtension(oldExtension);
+                Main.extensionManager.loadExtension(oldExtension);
                 return;
             }
 
@@ -151,9 +153,9 @@ function updateExtension(uuid) {
 
 function checkForUpdates() {
     let metadatas = {};
-    for (let uuid in ExtensionUtils.extensions) {
-        metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata;
-    }
+    Main.extensionManager.getUuids().forEach(uuid => {
+        metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata;
+    });
 
     let params = { shell_version: Config.PACKAGE_VERSION,
                    installed: JSON.stringify(metadatas) };
@@ -203,12 +205,12 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
         this.contentLayout.add(content);
     }
 
-    _onCancelButtonPressed(button, event) {
+    _onCancelButtonPressed() {
         this.close();
         this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled']));
     }
 
-    _onInstallButtonPressed(button, event) {
+    _onInstallButtonPressed() {
         let params = { shell_version: Config.PACKAGE_VERSION };
 
         let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid);
@@ -224,16 +226,11 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
         }
 
         function callback() {
-            // Add extension to 'enabled-extensions' for the user, always...
-            let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY);
-            if (!enabledExtensions.includes(uuid)) {
-                enabledExtensions.push(uuid);
-                global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions);
-            }
-
             try {
-                let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
-                ExtensionSystem.loadExtension(extension);
+                let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
+                Main.extensionManager.loadExtension(extension);
+                if (!Main.extensionManager.enableExtension(uuid))
+                    throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`);
             } catch (e) {
                 uninstallExtension(uuid);
                 errback('LoadExtensionError', e);

js/ui/extensionSystem.js

@@ -1,374 +1,523 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported init connect disconnect */
 
 const { Gio, St } = imports.gi;
 const Signals = imports.signals;
 
 const ExtensionUtils = imports.misc.extensionUtils;
+const FileUtils = imports.misc.fileUtils;
 const Main = imports.ui.main;
 
-var ExtensionState = {
-    ENABLED: 1,
-    DISABLED: 2,
-    ERROR: 3,
-    OUT_OF_DATE: 4,
-    DOWNLOADING: 5,
-    INITIALIZED: 6,
-
-    // Used as an error state for operations on unknown extensions,
-    // should never be in a real extensionMeta object.
-    UNINSTALLED: 99
-};
-
-// Arrays of uuids
-var enabledExtensions;
-// Contains the order that extensions were enabled in.
-var extensionOrder = [];
-
-// We don't really have a class to add signals on. So, create
-// a simple dummy object, add the signal methods, and export those
-// publically.
-var _signals = {};
-Signals.addSignalMethods(_signals);
-
-var connect = _signals.connect.bind(_signals);
-var disconnect = _signals.disconnect.bind(_signals);
+const { ExtensionState, ExtensionType } = ExtensionUtils;
 
 const ENABLED_EXTENSIONS_KEY = 'enabled-extensions';
+const DISABLED_EXTENSIONS_KEY = 'disabled-extensions';
 const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions';
 const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation';
 
-var initted = false;
-var enabled;
+var ExtensionManager = class {
+    constructor() {
+        this._initted = false;
+        this._enabled = false;
 
-function disableExtension(uuid) {
-    let extension = ExtensionUtils.extensions[uuid];
-    if (!extension)
-        return;
+        this._extensions = new Map();
+        this._enabledExtensions = [];
+        this._extensionOrder = [];
 
-    if (extension.state != ExtensionState.ENABLED)
-        return;
+        Main.sessionMode.connect('updated', this._sessionUpdated.bind(this));
+    }
 
-    // "Rebase" the extension order by disabling and then enabling extensions
-    // in order to help prevent conflicts.
+    init() {
+        this._sessionUpdated();
+    }
 
-    // Example:
-    //   order = [A, B, C, D, E]
-    //   user disables C
-    //   this should: disable E, disable D, disable C, enable D, enable E
+    lookup(uuid) {
+        return this._extensions.get(uuid);
+    }
 
-    let orderIdx = extensionOrder.indexOf(uuid);
-    let order = extensionOrder.slice(orderIdx + 1);
-    let orderReversed = order.slice().reverse();
+    getUuids() {
+        return [...this._extensions.keys()];
+    }
+
+    _callExtensionDisable(uuid) {
+        let extension = this.lookup(uuid);
+        if (!extension)
+            return;
+
+        if (extension.state != ExtensionState.ENABLED)
+            return;
+
+        // "Rebase" the extension order by disabling and then enabling extensions
+        // in order to help prevent conflicts.
+
+        // Example:
+        //   order = [A, B, C, D, E]
+        //   user disables C
+        //   this should: disable E, disable D, disable C, enable D, enable E
+
+        let orderIdx = this._extensionOrder.indexOf(uuid);
+        let order = this._extensionOrder.slice(orderIdx + 1);
+        let orderReversed = order.slice().reverse();
+
+        for (let i = 0; i < orderReversed.length; i++) {
+            let uuid = orderReversed[i];
+            try {
+                this.lookup(uuid).stateObj.disable();
+            } catch (e) {
+                this.logExtensionError(uuid, e);
+            }
+        }
+
+        if (extension.stylesheet) {
+            let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
+            theme.unload_stylesheet(extension.stylesheet);
+            delete extension.stylesheet;
+        }
 
-    for (let i = 0; i < orderReversed.length; i++) {
-        let uuid = orderReversed[i];
         try {
-            ExtensionUtils.extensions[uuid].stateObj.disable();
+            extension.stateObj.disable();
         } catch (e) {
-            logExtensionError(uuid, e);
+            this.logExtensionError(uuid, e);
+        }
+
+        for (let i = 0; i < order.length; i++) {
+            let uuid = order[i];
+            try {
+                this.lookup(uuid).stateObj.enable();
+            } catch (e) {
+                this.logExtensionError(uuid, e);
+            }
+        }
+
+        this._extensionOrder.splice(orderIdx, 1);
+
+        if (extension.state != ExtensionState.ERROR) {
+            extension.state = ExtensionState.DISABLED;
+            this.emit('extension-state-changed', extension);
         }
     }
 
-    if (extension.stylesheet) {
+    _callExtensionEnable(uuid) {
+        let extension = this.lookup(uuid);
+        if (!extension)
+            return;
+
+        if (extension.state == ExtensionState.INITIALIZED)
+            this._callExtensionInit(uuid);
+
+        if (extension.state != ExtensionState.DISABLED)
+            return;
+
+        this._extensionOrder.push(uuid);
+
+        let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
         let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
-        theme.unload_stylesheet(extension.stylesheet);
-        delete extension.stylesheet;
-    }
-
-    try {
-        extension.stateObj.disable();
-    } catch (e) {
-        logExtensionError(uuid, e);
-    }
-
-    for (let i = 0; i < order.length; i++) {
-        let uuid = order[i];
-        try {
-            ExtensionUtils.extensions[uuid].stateObj.enable();
-        } catch (e) {
-            logExtensionError(uuid, e);
+        for (let i = 0; i < stylesheetNames.length; i++) {
+            try {
+                let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
+                theme.load_stylesheet(stylesheetFile);
+                extension.stylesheet = stylesheetFile;
+                break;
+            } catch (e) {
+                if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
+                    continue; // not an error
+                log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+                return;
+            }
         }
-    }
 
-    extensionOrder.splice(orderIdx, 1);
-
-    if ( extension.state != ExtensionState.ERROR ) {
-        extension.state = ExtensionState.DISABLED;
-        _signals.emit('extension-state-changed', extension);
-    }
-}
-
-function enableExtension(uuid) {
-    let extension = ExtensionUtils.extensions[uuid];
-    if (!extension)
-        return;
-
-    if (extension.state == ExtensionState.INITIALIZED)
-        initExtension(uuid);
-
-    if (extension.state != ExtensionState.DISABLED)
-        return;
-
-    extensionOrder.push(uuid);
-
-    let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
-    let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
-    for (let i = 0; i < stylesheetNames.length; i++) {
         try {
-            let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
-            theme.load_stylesheet(stylesheetFile);
-            extension.stylesheet = stylesheetFile;
-            break;
+            extension.stateObj.enable();
+            extension.state = ExtensionState.ENABLED;
+            this.emit('extension-state-changed', extension);
+            return;
         } catch (e) {
-            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
-                continue; // not an error
-            log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+            if (extension.stylesheet) {
+                theme.unload_stylesheet(extension.stylesheet);
+                delete extension.stylesheet;
+            }
+            this.logExtensionError(uuid, e);
             return;
         }
     }
 
-    try {
-        extension.stateObj.enable();
-        extension.state = ExtensionState.ENABLED;
-        _signals.emit('extension-state-changed', extension);
-        return;
-    } catch (e) {
-        if (extension.stylesheet) {
-            theme.unload_stylesheet(extension.stylesheet);
-            delete extension.stylesheet;
+    enableExtension(uuid) {
+        if (!this._extensions.has(uuid))
+            return false;
+
+        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
+        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
+
+        if (disabledExtensions.includes(uuid)) {
+            disabledExtensions = disabledExtensions.filter(item => item !== uuid);
+            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
         }
-        logExtensionError(uuid, e);
-        return;
-    }
-}
 
-function logExtensionError(uuid, error) {
-    let extension = ExtensionUtils.extensions[uuid];
-    if (!extension)
-        return;
-
-    let message = `${error}`;
-
-    extension.state = ExtensionState.ERROR;
-    if (!extension.errors)
-        extension.errors = [];
-    extension.errors.push(message);
-
-    log('Extension "%s" had error: %s'.format(uuid, message));
-    _signals.emit('extension-state-changed', { uuid: uuid,
-                                               error: message,
-                                               state: extension.state });
-}
-
-function loadExtension(extension) {
-    // Default to error, we set success as the last step
-    extension.state = ExtensionState.ERROR;
-
-    let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
-
-    if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
-        extension.state = ExtensionState.OUT_OF_DATE;
-    } else {
-        let enabled = enabledExtensions.includes(extension.uuid);
-        if (enabled) {
-            if (!initExtension(extension.uuid))
-                return;
-            if (extension.state == ExtensionState.DISABLED)
-                enableExtension(extension.uuid);
-        } else {
-            extension.state = ExtensionState.INITIALIZED;
+        if (!enabledExtensions.includes(uuid)) {
+            enabledExtensions.push(uuid);
+            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
         }
+
+        return true;
     }
 
-    _signals.emit('extension-state-changed', extension);
-}
+    disableExtension(uuid) {
+        if (!this._extensions.has(uuid))
+            return false;
 
-function unloadExtension(extension) {
-    // Try to disable it -- if it's ERROR'd, we can't guarantee that,
-    // but it will be removed on next reboot, and hopefully nothing
-    // broke too much.
-    disableExtension(extension.uuid);
+        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
+        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
 
-    extension.state = ExtensionState.UNINSTALLED;
-    _signals.emit('extension-state-changed', extension);
+        if (enabledExtensions.includes(uuid)) {
+            enabledExtensions = enabledExtensions.filter(item => item !== uuid);
+            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
+        }
 
-    delete ExtensionUtils.extensions[extension.uuid];
-    return true;
-}
+        if (!disabledExtensions.includes(uuid)) {
+            disabledExtensions.push(uuid);
+            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
+        }
 
-function reloadExtension(oldExtension) {
-    // Grab the things we'll need to pass to createExtensionObject
-    // to reload it.
-    let { uuid: uuid, dir: dir, type: type } = oldExtension;
-
-    // Then unload the old extension.
-    unloadExtension(oldExtension);
-
-    // Now, recreate the extension and load it.
-    let newExtension;
-    try {
-        newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type);
-    } catch (e) {
-        logExtensionError(uuid, e);
-        return;
+        return true;
     }
 
-    loadExtension(newExtension);
-}
+    logExtensionError(uuid, error) {
+        let extension = this.lookup(uuid);
+        if (!extension)
+            return;
 
-function initExtension(uuid) {
-    let extension = ExtensionUtils.extensions[uuid];
-    let dir = extension.dir;
+        let message = `${error}`;
 
-    if (!extension)
-        throw new Error("Extension was not properly created. Call loadExtension first");
+        extension.error = message;
+        extension.state = ExtensionState.ERROR;
+        if (!extension.errors)
+            extension.errors = [];
+        extension.errors.push(message);
 
-    let extensionJs = dir.get_child('extension.js');
-    if (!extensionJs.query_exists(null)) {
-        logExtensionError(uuid, new Error('Missing extension.js'));
-        return false;
+        log('Extension "%s" had error: %s'.format(uuid, message));
+        this.emit('extension-state-changed', extension);
     }
 
-    let extensionModule;
-    let extensionState = null;
+    createExtensionObject(uuid, dir, type) {
+        let metadataFile = dir.get_child('metadata.json');
+        if (!metadataFile.query_exists(null)) {
+            throw new Error('Missing metadata.json');
+        }
 
-    ExtensionUtils.installImporter(extension);
-    try {
-        extensionModule = extension.imports.extension;
-    } catch (e) {
-        logExtensionError(uuid, e);
-        return false;
-    }
-
-    if (extensionModule.init) {
+        let metadataContents, success_;
         try {
-            extensionState = extensionModule.init(extension);
+            [success_, metadataContents] = metadataFile.load_contents(null);
+            if (metadataContents instanceof Uint8Array)
+                metadataContents = imports.byteArray.toString(metadataContents);
         } catch (e) {
-            logExtensionError(uuid, e);
+            throw new Error(`Failed to load metadata.json: ${e}`);
+        }
+        let meta;
+        try {
+            meta = JSON.parse(metadataContents);
+        } catch (e) {
+            throw new Error(`Failed to parse metadata.json: ${e}`);
+        }
+
+        let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
+        for (let i = 0; i < requiredProperties.length; i++) {
+            let prop = requiredProperties[i];
+            if (!meta[prop]) {
+                throw new Error(`missing "${prop}" property in metadata.json`);
+            }
+        }
+
+        if (uuid != meta.uuid) {
+            throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
+        }
+
+        let extension = {
+            metadata: meta,
+            uuid: meta.uuid,
+            type,
+            dir,
+            path: dir.get_path(),
+            error: '',
+            hasPrefs: dir.get_child('prefs.js').query_exists(null),
+            canChange: false
+        };
+        this._extensions.set(uuid, extension);
+
+        return extension;
+    }
+
+    loadExtension(extension) {
+        // Default to error, we set success as the last step
+        extension.state = ExtensionState.ERROR;
+
+        let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
+
+        if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
+            extension.state = ExtensionState.OUT_OF_DATE;
+        } else {
+            let enabled = this._enabledExtensions.includes(extension.uuid);
+            if (enabled) {
+                if (!this._callExtensionInit(extension.uuid))
+                    return;
+                if (extension.state == ExtensionState.DISABLED)
+                    this._callExtensionEnable(extension.uuid);
+            } else {
+                extension.state = ExtensionState.INITIALIZED;
+            }
+        }
+
+        this._updateCanChange(extension);
+        this.emit('extension-state-changed', extension);
+    }
+
+    unloadExtension(extension) {
+        // Try to disable it -- if it's ERROR'd, we can't guarantee that,
+        // but it will be removed on next reboot, and hopefully nothing
+        // broke too much.
+        this._callExtensionDisable(extension.uuid);
+
+        extension.state = ExtensionState.UNINSTALLED;
+        this.emit('extension-state-changed', extension);
+
+        this._extensions.delete(extension.uuid);
+        return true;
+    }
+
+    reloadExtension(oldExtension) {
+        // Grab the things we'll need to pass to createExtensionObject
+        // to reload it.
+        let { uuid: uuid, dir: dir, type: type } = oldExtension;
+
+        // Then unload the old extension.
+        this.unloadExtension(oldExtension);
+
+        // Now, recreate the extension and load it.
+        let newExtension;
+        try {
+            newExtension = this.createExtensionObject(uuid, dir, type);
+        } catch (e) {
+            this.logExtensionError(uuid, e);
+            return;
+        }
+
+        this.loadExtension(newExtension);
+    }
+
+    _callExtensionInit(uuid) {
+        let extension = this.lookup(uuid);
+        let dir = extension.dir;
+
+        if (!extension)
+            throw new Error("Extension was not properly created. Call loadExtension first");
+
+        let extensionJs = dir.get_child('extension.js');
+        if (!extensionJs.query_exists(null)) {
+            this.logExtensionError(uuid, new Error('Missing extension.js'));
             return false;
         }
+
+        let extensionModule;
+        let extensionState = null;
+
+        ExtensionUtils.installImporter(extension);
+        try {
+            extensionModule = extension.imports.extension;
+        } catch (e) {
+            this.logExtensionError(uuid, e);
+            return false;
+        }
+
+        if (extensionModule.init) {
+            try {
+                extensionState = extensionModule.init(extension);
+            } catch (e) {
+                this.logExtensionError(uuid, e);
+                return false;
+            }
+        }
+
+        if (!extensionState)
+            extensionState = extensionModule;
+        extension.stateObj = extensionState;
+
+        extension.state = ExtensionState.DISABLED;
+        this.emit('extension-loaded', uuid);
+        return true;
     }
 
-    if (!extensionState)
-        extensionState = extensionModule;
-    extension.stateObj = extensionState;
+    _getModeExtensions() {
+        if (Array.isArray(Main.sessionMode.enabledExtensions))
+            return Main.sessionMode.enabledExtensions;
+        return [];
+    }
 
-    extension.state = ExtensionState.DISABLED;
-    _signals.emit('extension-loaded', uuid);
-    return true;
-}
+    _updateCanChange(extension) {
+        let hasError =
+            extension.state == ExtensionState.ERROR ||
+            extension.state == ExtensionState.OUT_OF_DATE;
 
-function getEnabledExtensions() {
-    let extensions;
-    if (Array.isArray(Main.sessionMode.enabledExtensions))
-        extensions = Main.sessionMode.enabledExtensions;
-    else
-        extensions = [];
+        let isMode = this._getModeExtensions().includes(extension.uuid);
+        let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY);
 
-    if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
-        return extensions;
+        let changeKey = isMode
+            ? DISABLE_USER_EXTENSIONS_KEY
+            : ENABLED_EXTENSIONS_KEY;
 
-    return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
-}
+        extension.canChange =
+            !hasError &&
+            global.settings.is_writable(changeKey) &&
+            (isMode || !modeOnly);
+    }
 
-function onEnabledExtensionsChanged() {
-    let newEnabledExtensions = getEnabledExtensions();
+    _getEnabledExtensions() {
+        let extensions = this._getModeExtensions();
 
-    if (!enabled)
-        return;
+        if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
+            extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
 
-    // Find and enable all the newly enabled extensions: UUIDs found in the
-    // new setting, but not in the old one.
-    newEnabledExtensions.filter(
-        uuid => !enabledExtensions.includes(uuid)
-    ).forEach(uuid => {
-        enableExtension(uuid);
-    });
+        // filter out 'disabled-extensions' which takes precedence
+        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
+        return extensions.filter(item => !disabledExtensions.includes(item));
+    }
 
-    // Find and disable all the newly disabled extensions: UUIDs found in the
-    // old setting, but not in the new one.
-    enabledExtensions.filter(
-        item => !newEnabledExtensions.includes(item)
-    ).forEach(uuid => {
-        disableExtension(uuid);
-    });
+    _onUserExtensionsEnabledChanged() {
+        this._onEnabledExtensionsChanged();
+        this._onSettingsWritableChanged();
+    }
 
-    enabledExtensions = newEnabledExtensions;
-}
+    _onEnabledExtensionsChanged() {
+        let newEnabledExtensions = this._getEnabledExtensions();
 
-function _onVersionValidationChanged() {
-    // we want to reload all extensions, but only enable
-    // extensions when allowed by the sessionMode, so
-    // temporarily disable them all
-    enabledExtensions = [];
-    for (let uuid in ExtensionUtils.extensions)
-        reloadExtension(ExtensionUtils.extensions[uuid]);
-    enabledExtensions = getEnabledExtensions();
+        if (!this._enabled)
+            return;
 
-    if (Main.sessionMode.allowExtensions) {
-        enabledExtensions.forEach(uuid => {
-            enableExtension(uuid);
+        // Find and enable all the newly enabled extensions: UUIDs found in the
+        // new setting, but not in the old one.
+        newEnabledExtensions.filter(
+            uuid => !this._enabledExtensions.includes(uuid)
+        ).forEach(uuid => {
+            this._callExtensionEnable(uuid);
         });
-    }
-}
 
-function _loadExtensions() {
-    global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
-    global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
-    global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`, _onVersionValidationChanged);
-
-    enabledExtensions = getEnabledExtensions();
-
-    let finder = new ExtensionUtils.ExtensionFinder();
-    finder.connect('extension-found', (finder, extension) => {
-        loadExtension(extension);
-    });
-    finder.scanExtensions();
-}
-
-function enableAllExtensions() {
-    if (enabled)
-        return;
-
-    if (!initted) {
-        _loadExtensions();
-        initted = true;
-    } else {
-        enabledExtensions.forEach(uuid => {
-            enableExtension(uuid);
+        // Find and disable all the newly disabled extensions: UUIDs found in the
+        // old setting, but not in the new one.
+        this._enabledExtensions.filter(
+            item => !newEnabledExtensions.includes(item)
+        ).forEach(uuid => {
+            this._callExtensionDisable(uuid);
         });
+
+        this._enabledExtensions = newEnabledExtensions;
     }
-    enabled = true;
-}
 
-function disableAllExtensions() {
-    if (!enabled)
-        return;
+    _onSettingsWritableChanged() {
+        for (let extension of this._extensions.values()) {
+            this._updateCanChange(extension);
+            this.emit('extension-state-changed', extension);
+        }
+    }
 
-    if (initted) {
-        extensionOrder.slice().reverse().forEach(uuid => {
-            disableExtension(uuid);
+    _onVersionValidationChanged() {
+        // we want to reload all extensions, but only enable
+        // extensions when allowed by the sessionMode, so
+        // temporarily disable them all
+        this._enabledExtensions = [];
+
+        // The loop modifies the extensions map, so iterate over a copy
+        let extensions = [...this._extensions.values()];
+        for (let extension of extensions)
+            this.reloadExtension(extension);
+        this._enabledExtensions = this._getEnabledExtensions();
+
+        if (Main.sessionMode.allowExtensions) {
+            this._enabledExtensions.forEach(uuid => {
+                this._callExtensionEnable(uuid);
+            });
+        }
+    }
+
+    _loadExtensions() {
+        global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`,
+            this._onEnabledExtensionsChanged.bind(this));
+        global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`,
+            this._onEnabledExtensionsChanged.bind(this));
+        global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`,
+            this._onUserExtensionsEnabledChanged.bind(this));
+        global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`,
+            this._onVersionValidationChanged.bind(this));
+        global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`,
+            this._onSettingsWritableChanged.bind(this));
+        global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`,
+            this._onSettingsWritableChanged.bind(this));
+
+        this._enabledExtensions = this._getEnabledExtensions();
+
+        let perUserDir = Gio.File.new_for_path(global.userdatadir);
+        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
+            let fileType = info.get_file_type();
+            if (fileType != Gio.FileType.DIRECTORY)
+                return;
+            let uuid = info.get_name();
+            let existing = this.lookup(uuid);
+            if (existing) {
+                log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`);
+                return;
+            }
+
+            let extension;
+            let type = dir.has_prefix(perUserDir)
+                ? ExtensionType.PER_USER
+                : ExtensionType.SYSTEM;
+            try {
+                extension = this.createExtensionObject(uuid, dir, type);
+            } catch (e) {
+                logError(e, `Could not load extension ${uuid}`);
+                return;
+            }
+            this.loadExtension(extension);
         });
     }
 
-    enabled = false;
-}
+    _enableAllExtensions() {
+        if (this._enabled)
+            return;
 
-function _sessionUpdated() {
-    // For now sessionMode.allowExtensions controls extensions from both the
-    // 'enabled-extensions' preference and the sessionMode.enabledExtensions
-    // property; it might make sense to make enabledExtensions independent
-    // from allowExtensions in the future
-    if (Main.sessionMode.allowExtensions) {
-        if (initted)
-            enabledExtensions = getEnabledExtensions();
-        enableAllExtensions();
-    } else {
-        disableAllExtensions();
+        if (!this._initted) {
+            this._loadExtensions();
+            this._initted = true;
+        } else {
+            this._enabledExtensions.forEach(uuid => {
+                this._callExtensionEnable(uuid);
+            });
+        }
+        this._enabled = true;
     }
-}
 
-function init() {
-    Main.sessionMode.connect('updated', _sessionUpdated);
-    _sessionUpdated();
-}
+    _disableAllExtensions() {
+        if (!this._enabled)
+            return;
+
+        if (this._initted) {
+            this._extensionOrder.slice().reverse().forEach(uuid => {
+                this._callExtensionDisable(uuid);
+            });
+        }
+
+        this._enabled = false;
+    }
+
+    _sessionUpdated() {
+        // For now sessionMode.allowExtensions controls extensions from both the
+        // 'enabled-extensions' preference and the sessionMode.enabledExtensions
+        // property; it might make sense to make enabledExtensions independent
+        // from allowExtensions in the future
+        if (Main.sessionMode.allowExtensions) {
+            if (this._initted)
+                this._enabledExtensions = this._getEnabledExtensions();
+            this._enableAllExtensions();
+        } else {
+            this._disableAllExtensions();
+        }
+    }
+};
+Signals.addSignalMethods(ExtensionManager.prototype);

js/ui/grabHelper.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported GrabHelper */
 
 const { Clutter, St } = imports.gi;
 

js/ui/ibusCandidatePopup.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported CandidatePopup */
 
 const { Clutter, IBus, St } = imports.gi;
 const Signals = imports.signals;
@@ -198,29 +199,29 @@ var CandidatePopup = class CandidatePopup {
                 this._setTextAttributes(this._preeditText.clutter_text,
                                         attrs);
         });
-        panelService.connect('show-preedit-text', ps => {
+        panelService.connect('show-preedit-text', () => {
             this._preeditText.show();
             this._updateVisibility();
         });
-        panelService.connect('hide-preedit-text', ps => {
+        panelService.connect('hide-preedit-text', () => {
             this._preeditText.hide();
             this._updateVisibility();
         });
-        panelService.connect('update-auxiliary-text', (ps, text, visible) => {
+        panelService.connect('update-auxiliary-text', (_ps, text, visible) => {
             this._auxText.visible = visible;
             this._updateVisibility();
 
             this._auxText.text = text.get_text();
         });
-        panelService.connect('show-auxiliary-text', ps => {
+        panelService.connect('show-auxiliary-text', () => {
             this._auxText.show();
             this._updateVisibility();
         });
-        panelService.connect('hide-auxiliary-text', ps => {
+        panelService.connect('hide-auxiliary-text', () => {
             this._auxText.hide();
             this._updateVisibility();
         });
-        panelService.connect('update-lookup-table', (ps, lookupTable, visible) => {
+        panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => {
             this._candidateArea.actor.visible = visible;
             this._updateVisibility();
 
@@ -256,15 +257,15 @@ var CandidatePopup = class CandidatePopup {
             this._candidateArea.setOrientation(lookupTable.get_orientation());
             this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
         });
-        panelService.connect('show-lookup-table', ps => {
+        panelService.connect('show-lookup-table', () => {
             this._candidateArea.actor.show();
             this._updateVisibility();
         });
-        panelService.connect('hide-lookup-table', ps => {
+        panelService.connect('hide-lookup-table', () => {
             this._candidateArea.actor.hide();
             this._updateVisibility();
         });
-        panelService.connect('focus-out', ps => {
+        panelService.connect('focus-out', () => {
             this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
             Main.keyboard.resetSuggestions();
         });

js/ui/iconGrid.js

@@ -1,17 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported BaseIcon, IconGrid, PaginatedIconGrid */
 
-const { Clutter, GObject, Meta, St } = imports.gi;
+const { Clutter, GLib, GObject, Meta, St } = imports.gi;
 
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;
 
 var ICON_SIZE = 96;
 var MIN_ICON_SIZE = 16;
 
-var EXTRA_SPACE_ANIMATION_TIME = 0.25;
+var EXTRA_SPACE_ANIMATION_TIME = 250;
 
-var ANIMATION_TIME_IN = 0.350;
+var ANIMATION_TIME_IN = 350;
 var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN;
 var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN;
 var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM;
@@ -26,7 +26,7 @@ var AnimationDirection = {
 };
 
 var APPICON_ANIMATION_OUT_SCALE = 3;
-var APPICON_ANIMATION_OUT_TIME = 0.25;
+var APPICON_ANIMATION_OUT_TIME = 250;
 
 var BaseIcon = GObject.registerClass(
 class BaseIcon extends St.Bin {
@@ -56,6 +56,10 @@ class BaseIcon extends St.Bin {
 
         if (params.showLabel) {
             this.label = new St.Label({ text: label });
+            this.label.clutter_text.set({
+                x_align: Clutter.ActorAlign.CENTER,
+                y_align: Clutter.ActorAlign.CENTER
+            });
             this._box.add_actor(this.label);
         } else {
             this.label = null;
@@ -71,14 +75,14 @@ class BaseIcon extends St.Bin {
         this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this));
     }
 
-    vfunc_get_preferred_width(forHeight) {
+    vfunc_get_preferred_width(_forHeight) {
         // Return the actual height to keep the squared aspect
         return this.get_preferred_height(-1);
     }
 
     // This can be overridden by a subclass, or by the createIcon
     // parameter to _init()
-    createIcon(size) {
+    createIcon(_size) {
         throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`);
     }
 
@@ -137,6 +141,10 @@ class BaseIcon extends St.Bin {
         // animating.
         zoomOutActor(this.child);
     }
+
+    update() {
+        this._createIconTexture(this.iconSize);
+    }
 });
 
 function clamp(value, min, max) {
@@ -164,18 +172,16 @@ function zoomOutActor(actor) {
     let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth);
     let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight);
 
-    Tweener.addTween(actorClone,
-                     { time: APPICON_ANIMATION_OUT_TIME,
-                       scale_x: APPICON_ANIMATION_OUT_SCALE,
-                       scale_y: APPICON_ANIMATION_OUT_SCALE,
-                       translation_x: containedX - scaledX,
-                       translation_y: containedY - scaledY,
-                       opacity: 0,
-                       transition: 'easeOutQuad',
-                       onComplete() {
-                           actorClone.destroy();
-                       }
-                    });
+    actorClone.ease({
+        scale_x: APPICON_ANIMATION_OUT_SCALE,
+        scale_y: APPICON_ANIMATION_OUT_SCALE,
+        translation_x: containedX - scaledX,
+        translation_y: containedY - scaledY,
+        opacity: 0,
+        duration: APPICON_ANIMATION_OUT_TIME,
+        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+        onComplete: () => actorClone.destroy()
+    });
 }
 
 var IconGrid = GObject.registerClass({
@@ -206,6 +212,8 @@ var IconGrid = GObject.registerClass({
         this.rightPadding = 0;
         this.leftPadding = 0;
 
+        this._updateIconSizesLaterId = 0;
+
         this._items = [];
         this._clonesAnimating = [];
         // Pulled from CSS, but hardcode some defaults here
@@ -218,11 +226,19 @@ var IconGrid = GObject.registerClass({
         // swarming into the void ...
         this.connect('notify::mapped', () => {
             if (!this.mapped)
-                this._cancelAnimation();
+                this._resetAnimationActors();
         });
 
         this.connect('actor-added', this._childAdded.bind(this));
         this.connect('actor-removed', this._childRemoved.bind(this));
+        this.connect('destroy', this._onDestroy.bind(this));
+    }
+
+    _onDestroy() {
+        if (this._updateIconSizesLaterId) {
+            Meta.later_remove (this._updateIconSizesLaterId);
+            this._updateIconSizesLaterId = 0;
+        }
     }
 
     _keyFocusIn(actor) {
@@ -237,7 +253,7 @@ var IconGrid = GObject.registerClass({
         child.disconnect(child._iconGridKeyFocusInId);
     }
 
-    vfunc_get_preferred_width(forHeight) {
+    vfunc_get_preferred_width(_forHeight) {
         if (this._fillParent)
             // Ignore all size requests of children and request a size of 0;
             // later we'll allocate as many children as fit the parent
@@ -401,18 +417,17 @@ var IconGrid = GObject.registerClass({
         return this._getVisibleChildren();
     }
 
-    _cancelAnimation() {
-        this._clonesAnimating.forEach(clone => clone.destroy());
-        this._clonesAnimating = [];
-    }
-
-    _animationDone() {
+    _resetAnimationActors() {
         this._clonesAnimating.forEach(clone => {
             clone.source.reactive = true;
             clone.source.opacity = 255;
             clone.destroy();
         });
         this._clonesAnimating = [];
+    }
+
+    _animationDone() {
+        this._resetAnimationActors();
         this.emit('animation-done');
     }
 
@@ -421,7 +436,7 @@ var IconGrid = GObject.registerClass({
             throw new GObject.NotImplementedError("Pulse animation only implements " +
                                                   "'in' animation direction");
 
-        this._cancelAnimation();
+        this._resetAnimationActors();
 
         let actors = this._getChildrenToAnimate();
         if (actors.length == 0) {
@@ -444,30 +459,32 @@ var IconGrid = GObject.registerClass({
             let delay = index / actors.length * maxDelay;
             let bounceUpTime = ANIMATION_TIME_IN / 4;
             let isLastItem = index == actors.length - 1;
-            Tweener.addTween(actor,
-                             { time: bounceUpTime,
-                               transition: 'easeInOutQuad',
-                               delay: delay,
-                               scale_x: ANIMATION_BOUNCE_ICON_SCALE,
-                               scale_y: ANIMATION_BOUNCE_ICON_SCALE,
-                               onComplete: () => {
-                                   Tweener.addTween(actor,
-                                                    { time: ANIMATION_TIME_IN - bounceUpTime,
-                                                      transition: 'easeInOutQuad',
-                                                      scale_x: 1,
-                                                      scale_y: 1,
-                                                      onComplete: () => {
-                                                          if (isLastItem)
-                                                              this._animationDone();
-                                                      }
-                                                    });
-                               }
-                             });
+            actor.ease({
+                scale_x: ANIMATION_BOUNCE_ICON_SCALE,
+                scale_y: ANIMATION_BOUNCE_ICON_SCALE,
+                duration: bounceUpTime,
+                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
+                delay: delay,
+                onComplete: () => {
+                    let duration = ANIMATION_TIME_IN - bounceUpTime;
+                    actor.ease({
+                        scale_x: 1,
+                        scale_y: 1,
+                        duration,
+                        mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
+                        onComplete: () => {
+                            if (isLastItem)
+                                this._animationDone();
+                            actor.reactive = true;
+                        }
+                    });
+                }
+            });
         }
     }
 
     animateSpring(animationDirection, sourceActor) {
-        this._cancelAnimation();
+        this._resetAnimationActors();
 
         let actors = this._getChildrenToAnimate();
         if (actors.length == 0) {
@@ -521,21 +538,25 @@ var IconGrid = GObject.registerClass({
 
                 let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM;
                 let [finalX, finalY]  = actor._transformedPosition;
-                movementParams = { time: ANIMATION_TIME_IN,
-                                   transition: 'easeInOutQuad',
-                                   delay: delay,
-                                   x: finalX,
-                                   y: finalY,
-                                   scale_x: 1,
-                                   scale_y: 1,
-                                   onComplete: () => {
-                                       if (isLastItem)
-                                           this._animationDone();
-                                   } };
-                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                               transition: 'easeInOutQuad',
-                               delay: delay,
-                               opacity: 255 };
+                movementParams = {
+                    x: finalX,
+                    y: finalY,
+                    scale_x: 1,
+                    scale_y: 1,
+                    duration: ANIMATION_TIME_IN,
+                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
+                    delay
+                };
+
+                if (isLastItem)
+                    movementParams.onComplete = this._animationDone.bind(this);
+
+                fadeParams = {
+                    opacity: 255,
+                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
+                    delay
+                };
             } else {
                 let isLastItem = actor._distance == maxDist;
 
@@ -543,26 +564,29 @@ var IconGrid = GObject.registerClass({
                 actorClone.set_position(startX, startY);
 
                 let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM;
-                movementParams = { time: ANIMATION_TIME_OUT,
-                                   transition: 'easeInOutQuad',
-                                   delay: delay,
-                                   x: adjustedSourcePositionX,
-                                   y: adjustedSourcePositionY,
-                                   scale_x: scaleX,
-                                   scale_y: scaleY,
-                                   onComplete: () => {
-                                       if (isLastItem)
-                                           this._animationDone();
-                                   } };
-                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                               transition: 'easeInOutQuad',
-                               delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                               opacity: 0 };
+                movementParams = {
+                    x: adjustedSourcePositionX,
+                    y: adjustedSourcePositionY,
+                    scale_x: scaleX,
+                    scale_y: scaleY,
+                    duration: ANIMATION_TIME_OUT,
+                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
+                    delay
+                };
+
+                if (isLastItem)
+                    movementParams.onComplete = this._animationDone.bind(this);
+
+                fadeParams = {
+                    opacity: 0,
+                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
+                    delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
+                };
             }
 
-
-            Tweener.addTween(actorClone, movementParams);
-            Tweener.addTween(actorClone, fadeParams);
+            actorClone.ease(movementParams);
+            actorClone.ease(fadeParams);
         }
     }
 
@@ -602,6 +626,8 @@ var IconGrid = GObject.registerClass({
     }
 
     _computeLayout(forWidth) {
+        this.ensure_style();
+
         let nColumns = 0;
         let usedWidth = this.leftPadding + this.rightPadding;
         let spacing = this._getSpacing();
@@ -755,17 +781,20 @@ var IconGrid = GObject.registerClass({
 
             this._updateSpacingForSize(availWidth, availHeight);
         }
-        Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
-                       this._updateIconSizes.bind(this));
+        if (!this._updateIconSizesLaterId)
+            this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
+                                                          this._updateIconSizes.bind(this));
     }
 
     // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
     _updateIconSizes() {
+        this._updateIconSizesLaterId = 0;
         let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
         let newIconSize = Math.floor(ICON_SIZE * scale);
         for (let i in this._items) {
             this._items[i].icon.setIconSize(newIconSize);
         }
+        return GLib.SOURCE_REMOVE;
     }
 });
 
@@ -782,7 +811,7 @@ var PaginatedIconGrid = GObject.registerClass({
         this._childrenPerPage = 0;
     }
 
-    vfunc_get_preferred_height(forWidth) {
+    vfunc_get_preferred_height(_forWidth) {
         let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages;
         return [height, height];
     }
@@ -850,7 +879,7 @@ var PaginatedIconGrid = GObject.registerClass({
     }
 
     _computePages(availWidthPerPage, availHeightPerPage) {
-        let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage);
+        let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage);
         let nRows;
         let children = this._getVisibleChildren();
         if (nColumns > 0)
@@ -962,13 +991,14 @@ var PaginatedIconGrid = GObject.registerClass({
 
         for (let i = 0; i < children.length; i++) {
             children[i].translation_y = 0;
-            let params = { translation_y: translationY,
-                           time: EXTRA_SPACE_ANIMATION_TIME,
-                           transition: 'easeInOutQuad'
-                         };
+            let params = {
+                translation_y: translationY,
+                duration: EXTRA_SPACE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD
+            };
             if (i == (children.length - 1))
                 params.onComplete = () => this.emit('space-opened');
-            Tweener.addTween(children[i], params);
+            children[i].ease(params);
         }
     }
 
@@ -981,12 +1011,12 @@ var PaginatedIconGrid = GObject.registerClass({
         for (let i = 0; i < this._translatedChildren.length; i++) {
             if (!this._translatedChildren[i].translation_y)
                 continue;
-            Tweener.addTween(this._translatedChildren[i],
-                             { translation_y: 0,
-                               time: EXTRA_SPACE_ANIMATION_TIME,
-                               transition: 'easeInOutQuad',
-                               onComplete: () => this.emit('space-closed')
-                             });
+            this._translatedChildren[i].ease({
+                translation_y: 0,
+                duration: EXTRA_SPACE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
+                onComplete: () => this.emit('space-closed')
+            });
         }
     }
 });

js/ui/inhibitShortcutsDialog.js

@@ -1,3 +1,4 @@
+/* exported InhibitShortcutsDialog */
 const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi;
 
 const Dialog = imports.ui.dialog;
@@ -139,7 +140,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
                         return;
                     }
 
-                    let [permissions, data] = res;
+                    let [permissions] = res;
                     if (permissions[appId] === undefined) // Not found
                         this._dialog.open();
                     else if (permissions[appId] == GRANTED)

js/ui/kbdA11yDialog.js

@@ -1,3 +1,4 @@
+/* exported KbdA11yDialog */
 const { Clutter, Gio, GObject } = imports.gi;
 
 const Dialog = imports.ui.dialog;

js/ui/keyboard.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Keyboard */
 
 const { Clutter, Gio, GLib, GObject, Meta, St } = imports.gi;
 const Signals = imports.signals;
@@ -10,11 +11,10 @@ const Layout = imports.ui.layout;
 const Main = imports.ui.main;
 const PageIndicators = imports.ui.pageIndicators;
 const PopupMenu = imports.ui.popupMenu;
-const Tweener = imports.ui.tweener;
 
-var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2 * 1000;
+var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2;
 var KEY_LONG_PRESS_TIME = 250;
-var PANEL_SWITCH_ANIMATION_TIME = 0.5;
+var PANEL_SWITCH_ANIMATION_TIME = 500;
 var PANEL_SWITCH_RELATIVE_DISTANCE = 1 / 3; /* A third of the actor width */
 
 const A11Y_APPLICATIONS_SCHEMA = 'org.gnome.desktop.a11y.applications';
@@ -100,7 +100,7 @@ class KeyContainer extends St.Widget {
         this._rows = [];
     }
 
-    appendRow(length) {
+    appendRow() {
         this._currentRow++;
         this._currentCol = 0;
 
@@ -474,7 +474,7 @@ var KeyboardModel = class {
 
     _loadModel(groupName) {
         let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/%s.json'.format(groupName));
-        let [success, contents] = file.load_contents(null);
+        let [success_, contents] = file.load_contents(null);
         if (contents instanceof Uint8Array)
             contents = imports.byteArray.toString(contents);
 
@@ -569,11 +569,27 @@ var FocusTracker = class {
 };
 Signals.addSignalMethods(FocusTracker.prototype);
 
-var EmojiPager = class EmojiPager {
-    constructor(sections, nCols, nRows) {
-        this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout(),
-                                     reactive: true,
-                                     clip_to_allocation: true });
+var EmojiPager = GObject.registerClass({
+    Properties: {
+        'delta': GObject.ParamSpec.int(
+            'delta', 'delta', 'delta',
+            GObject.ParamFlags.READWRITE,
+            GLib.MININT32, GLib.MAXINT32, 0)
+    },
+    Signals: {
+        'emoji': { param_types: [GObject.TYPE_STRING] },
+        'page-changed': {
+            param_types: [GObject.TYPE_INT, GObject.TYPE_INT, GObject.TYPE_INT]
+        }
+    }
+}, class EmojiPager extends St.Widget {
+    _init(sections, nCols, nRows) {
+        super._init({
+            layout_manager: new Clutter.BinLayout(),
+            reactive: true,
+            clip_to_allocation: true
+        });
+
         this._sections = sections;
         this._nCols = nCols;
         this._nRows = nRows;
@@ -595,7 +611,7 @@ var EmojiPager = class EmojiPager {
         panAction.connect('gesture-cancel', this._onPanCancel.bind(this));
         panAction.connect('gesture-end', this._onPanEnd.bind(this));
         this._panAction = panAction;
-        this.actor.add_action(panAction);
+        this.add_action(panAction);
     }
 
     get delta() {
@@ -608,7 +624,11 @@ var EmojiPager = class EmojiPager {
         else if (value < -this._width)
             value = -this._width;
 
+        if (this._delta == value)
+            return;
+
         this._delta = value;
+        this.notify('delta');
 
         if (value == 0)
             return;
@@ -625,8 +645,8 @@ var EmojiPager = class EmojiPager {
             if (followingPage != null) {
                 this._followingPanel = this._generatePanel(followingPage);
                 this._followingPanel.set_pivot_point(0.5, 0.5);
-                this.actor.add_child(this._followingPanel);
-                this.actor.set_child_below_sibling(this._followingPanel, this._panel);
+                this.add_child(this._followingPanel);
+                this.set_child_below_sibling(this._followingPanel, this._panel);
             }
 
             this._followingPage = followingPage;
@@ -662,7 +682,7 @@ var EmojiPager = class EmojiPager {
     }
 
     _onPan(action) {
-        let [dist, dx, dy] = action.get_motion_delta(0);
+        let [dist_, dx, dy_] = action.get_motion_delta(0);
         this.delta = this.delta + dx;
 
         if (this._currentKey != null) {
@@ -674,12 +694,12 @@ var EmojiPager = class EmojiPager {
     }
 
     _onPanBegin() {
-        this._width = this.actor.width;
+        this._width = this.width;
         return true;
     }
 
     _onPanEnd() {
-        if (Math.abs(this._delta) < this.actor.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
+        if (Math.abs(this._delta) < this.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
             this._onPanCancel();
         } else {
             let value;
@@ -691,28 +711,24 @@ var EmojiPager = class EmojiPager {
             let relDelta = Math.abs(this._delta - value) / this._width;
             let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);
 
-            Tweener.removeTweens(this);
-            Tweener.addTween(this,
-                             { delta: value,
-                               time: time,
-                               transition: 'easeInOutQuad',
-                               onComplete() {
-                                   this.setCurrentPage(this.getFollowingPage());
-                               }
-                             });
+            this.remove_all_transitions();
+            this.ease_property('delta', value, {
+                duration: time,
+                onComplete: () => {
+                    this.setCurrentPage(this.getFollowingPage());
+                }
+            });
         }
     }
 
     _onPanCancel() {
-        let relDelta = Math.abs(this._delta) / this.actor.width;
+        let relDelta = Math.abs(this._delta) / this.width;
         let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);
 
-        Tweener.removeTweens(this);
-        Tweener.addTween(this,
-                         { delta: 0,
-                           time: time,
-                           transition: 'easeInOutQuad',
-                         });
+        this.remove_all_transitions();
+        this.ease_property('delta', 0, {
+            duration: time,
+        });
     }
 
     _initPagingInfo() {
@@ -822,7 +838,7 @@ var EmojiPager = class EmojiPager {
 
         if (!this._panel) {
             this._panel = this._generatePanel(nPage);
-            this.actor.add_child(this._panel);
+            this.add_child(this._panel);
         }
 
         let page = this._pages[nPage];
@@ -839,8 +855,7 @@ var EmojiPager = class EmojiPager {
             }
         }
     }
-};
-Signals.addSignalMethods(EmojiPager.prototype);
+});
 
 var EmojiSelection = class EmojiSelection {
     constructor() {
@@ -904,7 +919,7 @@ var EmojiSelection = class EmojiSelection {
 
     _populateSections() {
         let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/emoji.json');
-        let [success, contents] = file.load_contents(null);
+        let [success_, contents] = file.load_contents(null);
 
         if (contents instanceof Uint8Array)
             contents = imports.byteArray.toString(contents);
@@ -1171,7 +1186,7 @@ var Keyboard = class Keyboard {
 
         this._emojiSelection = new EmojiSelection();
         this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this));
-        this._emojiSelection.connect('hide', (selection) => this.hide());
+        this._emojiSelection.connect('hide', () => this.hide());
         this._emojiSelection.connect('emoji-selected', (selection, emoji) => {
             this._keyboardController.commitString(emoji);
         });
@@ -1282,7 +1297,7 @@ var Keyboard = class Keyboard {
                     }
                 }
             });
-            button.connect('released', (actor, keyval, str) => {
+            button.connect('released', (actor, keyval, _str) => {
                 if (keyval != 0) {
                     if (button._keyvalPress)
                         this._keyboardController.keyvalRelease(keyval);
@@ -1467,7 +1482,7 @@ var Keyboard = class Keyboard {
         this._setActiveLayer(0);
     }
 
-    _onKeyboardGroupsChanged(keyboard) {
+    _onKeyboardGroupsChanged() {
         let nonGroupActors = [this._emojiSelection.actor, this._keypad.actor];
         this._aspectContainer.get_children().filter(c => !nonGroupActors.includes(c)).forEach(c => {
             c.destroy();
@@ -1653,19 +1668,23 @@ var Keyboard = class Keyboard {
             return;
 
         if (show) {
-            Tweener.addTween(windowActor,
-                             { y: windowActor.y - deltaY,
-                               time: Layout.KEYBOARD_ANIMATION_TIME,
-                               transition: 'easeOutQuad',
-                               onComplete: this._windowSlideAnimationComplete,
-                               onCompleteParams: [window, -deltaY] });
+            windowActor.ease({
+                y: windowActor.y - deltaY,
+                duration: Layout.KEYBOARD_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                onComplete: () => {
+                    this._windowSlideAnimationComplete(window, -deltaY);
+                }
+            });
         } else {
-            Tweener.addTween(windowActor,
-                             { y: windowActor.y + deltaY,
-                               time: Layout.KEYBOARD_ANIMATION_TIME,
-                               transition: 'easeInQuad',
-                               onComplete: this._windowSlideAnimationComplete,
-                               onCompleteParams: [window, deltaY] });
+            windowActor.ease({
+                y: windowActor.y + deltaY,
+                duration: Layout.KEYBOARD_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_IN_QUAD,
+                onComplete: () => {
+                    this._windowSlideAnimationComplete(window, deltaY);
+                }
+            });
         }
     }
 
@@ -1729,7 +1748,7 @@ var KeyboardController = class {
         this.emit('groups-changed');
     }
 
-    _onSourceChanged(inputSourceManager, oldSource) {
+    _onSourceChanged(inputSourceManager, _oldSource) {
         let source = inputSourceManager.currentSource;
         this._currentSource = source;
         this.emit('active-group', source.id);

js/ui/layout.js

@@ -1,6 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported MonitorConstraint, LayoutManager */
 
-const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
+const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;
 
 const Background = imports.ui.background;
@@ -10,12 +11,11 @@ const LoginManager = imports.misc.loginManager;
 const DND = imports.ui.dnd;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 const Ripples = imports.ui.ripples;
 
-var STARTUP_ANIMATION_TIME = 0.5;
-var KEYBOARD_ANIMATION_TIME = 0.15;
-var BACKGROUND_FADE_ANIMATION_TIME = 1.0;
+var STARTUP_ANIMATION_TIME = 500;
+var KEYBOARD_ANIMATION_TIME = 150;
+var BACKGROUND_FADE_ANIMATION_TIME = 1000;
 
 var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels
 var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms
@@ -80,10 +80,12 @@ var MonitorConstraint = GObject.registerClass({
         this.notify('index');
     }
 
+    // eslint-disable-next-line camelcase
     get work_area() {
         return this._workArea;
     }
 
+    // eslint-disable-next-line camelcase
     set work_area(v) {
         if (v == this._workArea)
             return;
@@ -165,12 +167,12 @@ var Monitor = class Monitor {
 
 const UiActor = GObject.registerClass(
 class UiActor extends St.Widget {
-    vfunc_get_preferred_width (forHeight) {
+    vfunc_get_preferred_width (_forHeight) {
         let width = global.stage.width;
         return [width, width];
     }
 
-    vfunc_get_preferred_height (forWidth) {
+    vfunc_get_preferred_height (_forWidth) {
         let height = global.stage.height;
         return [height, height];
     }
@@ -274,6 +276,13 @@ var LayoutManager = GObject.registerClass({
         this._backgroundGroup.lower_bottom();
         this._bgManagers = [];
 
+        this._interfaceSettings = new Gio.Settings({
+            schema_id: 'org.gnome.desktop.interface'
+        });
+
+        this._interfaceSettings.connect('changed::enable-hot-corners',
+                                        this._updateHotCorners.bind(this));
+
         // Need to update struts on new workspaces when they are added
         let workspaceManager = global.workspace_manager;
         workspaceManager.connect('notify::n-workspaces',
@@ -377,6 +386,11 @@ var LayoutManager = GObject.registerClass({
         });
         this.hotCorners = [];
 
+        if (!this._interfaceSettings.get_boolean('enable-hot-corners')) {
+            this.emit('hot-corners-changed');
+            return;
+        }
+
         let size = this.panelBox.height;
 
         // build new hot corners
@@ -449,10 +463,11 @@ var LayoutManager = GObject.registerClass({
                 let backgroundActor = this._bgManagers[i].backgroundActor;
                 backgroundActor.show();
                 backgroundActor.opacity = 0;
-                Tweener.addTween(backgroundActor,
-                                 { opacity: 255,
-                                   time: BACKGROUND_FADE_ANIMATION_TIME,
-                                   transition: 'easeOutQuad' });
+                backgroundActor.ease({
+                    opacity: 255,
+                    duration: BACKGROUND_FADE_ANIMATION_TIME,
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                });
             }
         }
     }
@@ -683,23 +698,23 @@ var LayoutManager = GObject.registerClass({
     }
 
     _startupAnimationGreeter() {
-        Tweener.addTween(this.panelBox,
-                         { translation_y: 0,
-                           time: STARTUP_ANIMATION_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: this._startupAnimationComplete,
-                           onCompleteScope: this });
+        this.panelBox.ease({
+            translation_y: 0,
+            duration: STARTUP_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => this._startupAnimationComplete()
+        });
     }
 
     _startupAnimationSession() {
-        Tweener.addTween(this.uiGroup,
-                         { scale_x: 1,
-                           scale_y: 1,
-                           opacity: 255,
-                           time: STARTUP_ANIMATION_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: this._startupAnimationComplete,
-                           onCompleteScope: this });
+        this.uiGroup.ease({
+            scale_x: 1,
+            scale_y: 1,
+            opacity: 255,
+            duration: STARTUP_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => this._startupAnimationComplete()
+        });
     }
 
     _startupAnimationComplete() {
@@ -725,14 +740,15 @@ var LayoutManager = GObject.registerClass({
 
     showKeyboard() {
         this.keyboardBox.show();
-        Tweener.addTween(this.keyboardBox,
-                         { anchor_y: this.keyboardBox.height,
-                           opacity: 255,
-                           time: KEYBOARD_ANIMATION_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: this._showKeyboardComplete,
-                           onCompleteScope: this
-                         });
+        this.keyboardBox.ease({
+            anchor_y: this.keyboardBox.height,
+            opacity: 255,
+            duration: KEYBOARD_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                this._showKeyboardComplete();
+            }
+        });
         this.emit('keyboard-visible-changed', true);
     }
 
@@ -751,14 +767,16 @@ var LayoutManager = GObject.registerClass({
             this.keyboardBox.disconnect(this._keyboardHeightNotifyId);
             this._keyboardHeightNotifyId = 0;
         }
-        Tweener.addTween(this.keyboardBox,
-                         { anchor_y: 0,
-                           opacity: 0,
-                           time: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
-                           transition: 'easeInQuad',
-                           onComplete: this._hideKeyboardComplete,
-                           onCompleteScope: this
-                         });
+        this.keyboardBox.ease({
+            anchor_y: 0,
+            opacity: 0,
+            duration: immediate ? 0
+                                : KEYBOARD_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_IN_QUAD,
+            onComplete: () => {
+                this._hideKeyboardComplete();
+            }
+        });
 
         this.emit('keyboard-visible-changed', false);
     }
@@ -829,7 +847,7 @@ var LayoutManager = GObject.registerClass({
     // @params can have any of the same values as in addChrome(),
     // though some possibilities don't make sense. By default, @actor has
     // the same params as its chrome ancestor.
-    trackChrome(actor, params) {
+    trackChrome(actor, params = {}) {
         let ancestor = actor.get_parent();
         let index = this._findActor(ancestor);
         while (ancestor && index == -1) {
@@ -839,8 +857,6 @@ var LayoutManager = GObject.registerClass({
 
         let ancestorData = ancestor ? this._trackedActors[index]
                                     : defaultParams;
-        if (!params)
-            params = {};
         // We can't use Params.parse here because we want to drop
         // the extra values like ancestorData.actor
         for (let prop in defaultParams) {
@@ -1220,7 +1236,7 @@ var HotCorner = class HotCorner {
         }
     }
 
-    handleDragOver(source, actor, x, y, time) {
+    handleDragOver(source, _actor, _x, _y, _time) {
         if (source != Main.xdndHandler)
             return DND.DragMotionResult.CONTINUE;
 
@@ -1321,7 +1337,7 @@ var PressureBarrier = class PressureBarrier {
         let threshold = this._lastTime - this._timeout;
 
         while (i < this._barrierEvents.length) {
-            let [time, distance] = this._barrierEvents[i];
+            let [time, distance_] = this._barrierEvents[i];
             if (time >= threshold)
                 break;
             i++;
@@ -1330,14 +1346,14 @@ var PressureBarrier = class PressureBarrier {
         let firstNewEvent = i;
 
         for (i = 0; i < firstNewEvent; i++) {
-            let [time, distance] = this._barrierEvents[i];
+            let [time_, distance] = this._barrierEvents[i];
             this._currentPressure -= distance;
         }
 
         this._barrierEvents = this._barrierEvents.slice(firstNewEvent);
     }
 
-    _onBarrierLeft(barrier, event) {
+    _onBarrierLeft(barrier, _event) {
         barrier._isHit = false;
         if (this._barriers.every(b => !b._isHit)) {
             this._reset();

js/ui/lightbox.js

@@ -1,10 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Lightbox */
 
 const { Clutter, GObject, Shell, St } = imports.gi;
 const Signals = imports.signals;
 
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 
 var DEFAULT_FADE_FACTOR = 0.4;
 var VIGNETTE_BRIGHTNESS = 0.2;
@@ -23,16 +23,31 @@ t = clamp(t, 0.0, 1.0);\n\
 float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\
 cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);';
 
-var RadialShaderQuad = GObject.registerClass(
-class RadialShaderQuad extends Shell.GLSLQuad {
+var RadialShaderEffect = GObject.registerClass({
+    Properties: {
+        'brightness': GObject.ParamSpec.float(
+            'brightness', 'brightness', 'brightness',
+            GObject.ParamFlags.READWRITE,
+            0, 1, 1
+        ),
+        'sharpness': GObject.ParamSpec.float(
+            'sharpness', 'sharpness', 'sharpness',
+            GObject.ParamFlags.READWRITE,
+            0, 1, 0
+        )
+    }
+}, class RadialShaderEffect extends Shell.GLSLEffect {
     _init(params) {
+        this._brightness = undefined;
+        this._sharpness = undefined;
+
         super._init(params);
 
         this._brightnessLocation = this.get_uniform_location('brightness');
         this._sharpnessLocation = this.get_uniform_location('vignette_sharpness');
 
         this.brightness = 1.0;
-        this.vignetteSharpness = 0.0;
+        this.sharpness = 0.0;
     }
 
     vfunc_build_pipeline() {
@@ -45,19 +60,25 @@ class RadialShaderQuad extends Shell.GLSLQuad {
     }
 
     set brightness(v) {
+        if (this._brightness == v)
+            return;
         this._brightness = v;
         this.set_uniform_float(this._brightnessLocation,
                                1, [this._brightness]);
+        this.notify('brightness');
     }
 
-    get vignetteSharpness() {
+    get sharpness() {
         return this._sharpness;
     }
 
-    set vignetteSharpness(v) {
+    set sharpness(v) {
+        if (this._sharpness == v)
+            return;
         this._sharpness = v;
         this.set_uniform_float(this._sharpnessLocation,
                                1, [this._sharpness]);
+        this.notify('sharpness');
     }
 });
 
@@ -68,8 +89,8 @@ class RadialShaderQuad extends Shell.GLSLQuad {
  *           - inhibitEvents: whether to inhibit events for @container
  *           - width: shade actor width
  *           - height: shade actor height
- *           - fadeInTime: seconds used to fade in
- *           - fadeOutTime: seconds used to fade out
+ *           - fadeInTime: milliseconds used to fade in
+ *           - fadeOutTime: milliseconds used to fade out
  *
  * Lightbox creates a dark translucent "shade" actor to hide the
  * contents of @container, and allows you to specify particular actors
@@ -98,16 +119,13 @@ var Lightbox = class Lightbox {
         this._children = container.get_children();
         this._fadeFactor = params.fadeFactor;
         this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
+
+        this.actor = new St.Bin({ reactive: params.inhibitEvents });
+
         if (this._radialEffect)
-            this.actor = new RadialShaderQuad({ x: 0,
-                                                y: 0,
-                                                reactive: params.inhibitEvents });
+            this.actor.add_effect(new RadialShaderEffect({ name: 'radial' }));
         else
-            this.actor = new St.Bin({ x: 0,
-                                      y: 0,
-                                      opacity: 0,
-                                      style_class: 'lightbox',
-                                      reactive: params.inhibitEvents });
+            this.actor.set({ opacity: 0, style_class: 'lightbox' });
 
         container.add_actor(this.actor);
         this.actor.raise_top();
@@ -156,28 +174,32 @@ var Lightbox = class Lightbox {
     show(fadeInTime) {
         fadeInTime = fadeInTime || 0;
 
-        Tweener.removeTweens(this.actor);
+        this.actor.remove_all_transitions();
+
+        let onComplete = () => {
+            this.shown = true;
+            this.emit('shown');
+        };
+
         if (this._radialEffect) {
-            Tweener.addTween(this.actor,
-                             { brightness: VIGNETTE_BRIGHTNESS,
-                               vignetteSharpness: VIGNETTE_SHARPNESS,
-                               time: fadeInTime,
-                               transition: 'easeOutQuad',
-                               onComplete: () => {
-                                   this.shown = true;
-                                   this.emit('shown');
-                               }
-                             });
+            this.actor.ease_property(
+                '@effects.radial.brightness', VIGNETTE_BRIGHTNESS, {
+                    duration: fadeInTime,
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                });
+            this.actor.ease_property(
+                '@effects.radial.sharpness', VIGNETTE_SHARPNESS, {
+                    duration: fadeInTime,
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                    onComplete
+                });
         } else {
-            Tweener.addTween(this.actor,
-                             { opacity: 255 * this._fadeFactor,
-                               time: fadeInTime,
-                               transition: 'easeOutQuad',
-                               onComplete: () => {
-                                   this.shown = true;
-                                   this.emit('shown');
-                               }
-                             });
+            this.actor.ease({
+                opacity: 255 * this._fadeFactor,
+                duration: fadeInTime,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                onComplete
+            });
         }
 
         this.actor.show();
@@ -187,27 +209,29 @@ var Lightbox = class Lightbox {
         fadeOutTime = fadeOutTime || 0;
 
         this.shown = false;
-        Tweener.removeTweens(this.actor);
+        this.actor.remove_all_transitions();
+
+        let onComplete = () => this.actor.hide();
+
         if (this._radialEffect) {
-            Tweener.addTween(this.actor,
-                             { brightness: 1.0,
-                               vignetteSharpness: 0.0,
-                               opacity: 0,
-                               time: fadeOutTime,
-                               transition: 'easeOutQuad',
-                               onComplete: () => {
-                                   this.actor.hide();
-                               }
-                             });
+            this.actor.ease_property(
+                '@effects.radial.brightness', 1.0, {
+                    duration: fadeOutTime,
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                });
+            this.actor.ease_property(
+                '@effects.radial.sharpness', 0.0, {
+                    duration: fadeOutTime,
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                    onComplete
+                });
         } else {
-            Tweener.addTween(this.actor,
-                             { opacity: 0,
-                               time: fadeOutTime,
-                               transition: 'easeOutQuad',
-                               onComplete: () => {
-                                   this.actor.hide();
-                               }
-                             });
+            this.actor.ease({
+                opacity: 0,
+                duration: fadeOutTime,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                onComplete
+            });
         }
     }
 

js/ui/locatePointer.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported LocatePointer */
 
 const { Gio } = imports.gi;
 const Ripples = imports.ui.ripples;
@@ -18,7 +19,7 @@ var LocatePointer = class {
         if (!this._settings.get_boolean(LOCATE_POINTER_KEY))
             return;
 
-        let [x, y, mods] = global.get_pointer();
+        let [x, y] = global.get_pointer();
         this._ripples.playAnimation(x, y);
     }
 };

js/ui/lookingGlass.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported LookingGlass */
 
 const { Clutter, Cogl, Gio, GLib,
         GObject, Meta, Pango, Shell, St } = imports.gi;
@@ -7,20 +8,19 @@ const Signals = imports.signals;
 const System = imports.system;
 
 const History = imports.misc.history;
-const ExtensionSystem = imports.ui.extensionSystem;
 const ExtensionUtils = imports.misc.extensionUtils;
 const ShellEntry = imports.ui.shellEntry;
-const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;
 const JsParse = imports.misc.jsParse;
 
+const { ExtensionState } = ExtensionUtils;
+
 const CHEVRON = '>>> ';
 
 /* Imports...feel free to add here as needed */
 var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
                     'const Main = imports.ui.main; ' +
                     'const Mainloop = imports.mainloop; ' +
-                    'const Tweener = imports.ui.tweener; ' +
                     /* Utility functions...we should probably be able to use these
                      * in the shell core code too. */
                     'const stage = global.stage; ' +
@@ -32,9 +32,11 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im
 const HISTORY_KEY = 'looking-glass-history';
 // Time between tabs for them to count as a double-tab event
 var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500;
-var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2;
+var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200;
 var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords();
 
+const LG_ANIMATION_TIME = 500;
+
 function _getAutoCompleteGlobalKeywords() {
     const keywords = ['true', 'false', 'null', 'new'];
     // Don't add the private properties of window (i.e., ones starting with '_')
@@ -266,7 +268,7 @@ var ObjLink = class ObjLink {
         this._lookingGlass = lookingGlass;
     }
 
-    _onClicked(link) {
+    _onClicked() {
         this._lookingGlass.inspectObject(this._obj, this.actor);
     }
 };
@@ -417,9 +419,12 @@ var ObjInspector = class ObjInspector {
         this.actor.show();
         if (sourceActor) {
             this.actor.set_scale(0, 0);
-            Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1,
-                                           transition: 'easeOutQuad',
-                                           time: 0.2 });
+            this.actor.ease({
+                scale_x: 1,
+                scale_y: 1,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                time: 200
+            });
         } else {
             this.actor.set_scale(1, 1);
         }
@@ -518,7 +523,7 @@ var Inspector = GObject.registerClass({
 
         let primary = Main.layoutManager.primaryMonitor;
 
-        let [minWidth, minHeight, natWidth, natHeight] =
+        let [, , natWidth, natHeight] =
             this._eventHandler.get_preferred_size();
 
         let childBox = new Clutter.ActorBox();
@@ -623,15 +628,16 @@ var Extensions = class Extensions {
         this._extensionsList.add(this._noExtensions);
         this.actor.add(this._extensionsList);
 
-        for (let uuid in ExtensionUtils.extensions)
+        Main.extensionManager.getUuids().forEach(uuid => {
             this._loadExtension(null, uuid);
+        });
 
-        ExtensionSystem.connect('extension-loaded',
-                                this._loadExtension.bind(this));
+        Main.extensionManager.connect('extension-loaded',
+                                      this._loadExtension.bind(this));
     }
 
     _loadExtension(o, uuid) {
-        let extension = ExtensionUtils.extensions[uuid];
+        let extension = Main.extensionManager.lookup(uuid);
         // There can be cases where we create dummy extension metadata
         // that's not really a proper extension. Don't bother with these.
         if (!extension.metadata.name)
@@ -688,16 +694,16 @@ var Extensions = class Extensions {
 
     _stateToString(extensionState) {
         switch (extensionState) {
-        case ExtensionSystem.ExtensionState.ENABLED:
+        case ExtensionState.ENABLED:
             return _("Enabled");
-        case ExtensionSystem.ExtensionState.DISABLED:
-        case ExtensionSystem.ExtensionState.INITIALIZED:
+        case ExtensionState.DISABLED:
+        case ExtensionState.INITIALIZED:
             return _("Disabled");
-        case ExtensionSystem.ExtensionState.ERROR:
+        case ExtensionState.ERROR:
             return _("Error");
-        case ExtensionSystem.ExtensionState.OUT_OF_DATE:
+        case ExtensionState.OUT_OF_DATE:
             return _("Out of date");
-        case ExtensionSystem.ExtensionState.DOWNLOADING:
+        case ExtensionState.DOWNLOADING:
             return _("Downloading");
         }
         return 'Unknown'; // Not translated, shouldn't appear
@@ -854,7 +860,7 @@ var LookingGlass = class LookingGlass {
         this._extensions = new Extensions(this);
         notebook.appendPage('Extensions', this._extensions.actor);
 
-        this._entry.clutter_text.connect('activate', (o, e) => {
+        this._entry.clutter_text.connect('activate', (o, _e) => {
             // Hide any completions we are currently showing
             this._hideCompletions();
 
@@ -938,35 +944,41 @@ var LookingGlass = class LookingGlass {
         this._completionActor.set_text(completions.join(', '));
 
         // Setting the height to -1 allows us to get its actual preferred height rather than
-        // whatever was last given in set_height by Tweener.
+        // whatever was last set when animating
         this._completionActor.set_height(-1);
-        let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
+        let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
 
         // Don't reanimate if we are already visible
         if (this._completionActor.visible) {
             this._completionActor.height = naturalHeight;
         } else {
+            let settings = St.Settings.get();
+            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
             this._completionActor.show();
-            Tweener.removeTweens(this._completionActor);
-            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
-                                                      transition: 'easeOutQuad',
-                                                      height: naturalHeight,
-                                                      opacity: 255
-                                                    });
+            this._completionActor.remove_all_transitions();
+            this._completionActor.ease({
+                height: naturalHeight,
+                opacity: 255,
+                duration,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
         }
     }
 
     _hideCompletions() {
         if (this._completionActor) {
-            Tweener.removeTweens(this._completionActor);
-            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
-                                                      transition: 'easeOutQuad',
-                                                      height: 0,
-                                                      opacity: 0,
-                                                      onComplete: () => {
-                                                          this._completionActor.hide();
-                                                      }
-                                                    });
+            let settings = St.Settings.get();
+            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
+            this._completionActor.remove_all_transitions();
+            this._completionActor.ease({
+                height: 0,
+                opacity: 0,
+                duration,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                onComplete: () => {
+                    this._completionActor.hide();
+                }
+            });
         }
     }
 
@@ -1009,7 +1021,10 @@ var LookingGlass = class LookingGlass {
     }
 
     _queueResize() {
-        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => this._resize());
+        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
+            this._resize();
+            return GLib.SOURCE_REMOVE;
+        });
     }
 
     _resize() {
@@ -1072,14 +1087,16 @@ var LookingGlass = class LookingGlass {
         this._open = true;
         this._history.lastItem();
 
-        Tweener.removeTweens(this.actor);
+        this.actor.remove_all_transitions();
 
         // We inverse compensate for the slow-down so you can change the factor
         // through LookingGlass without long waits.
-        Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(),
-                                       transition: 'easeOutQuad',
-                                       y: this._targetY
-                                     });
+        let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor;
+        this.actor.ease({
+            y: this._targetY,
+            duration,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+        });
     }
 
     close() {
@@ -1089,19 +1106,21 @@ var LookingGlass = class LookingGlass {
         this._objInspector.actor.hide();
 
         this._open = false;
-        Tweener.removeTweens(this.actor);
+        this.actor.remove_all_transitions();
 
         this.setBorderPaintTarget(null);
 
         Main.popModal(this._entry);
 
-        Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5),
-                                       transition: 'easeOutQuad',
-                                       y: this._hiddenY,
-                                       onComplete: () => {
-                                           this.actor.hide();
-                                       }
-                                     });
+        let settings = St.Settings.get();
+        let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor,
+                                LG_ANIMATION_TIME);
+        this.actor.ease({
+            y: this._hiddenY,
+            duration,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => this.actor.hide()
+        });
     }
 };
 Signals.addSignalMethods(LookingGlass.prototype);

js/ui/magnifier.js

@@ -107,8 +107,7 @@ var Magnifier = class Magnifier {
         // Create the first ZoomRegion and initialize it according to the
         // magnification settings.
 
-        let mask;
-        [this.xMouse, this.yMouse, mask] = global.get_pointer();
+        [this.xMouse, this.yMouse] = global.get_pointer();
 
         let aZoomRegion = new ZoomRegion(this, this._cursorRoot);
         this._zoomRegions.push(aZoomRegion);
@@ -148,7 +147,7 @@ var Magnifier = class Magnifier {
     setActive(activate) {
         let isActive = this.isActive();
 
-        this._zoomRegions.forEach((zoomRegion, index, array) => {
+        this._zoomRegions.forEach(zoomRegion => {
             zoomRegion.setActive(activate);
         });
 
@@ -227,14 +226,14 @@ var Magnifier = class Magnifier {
      * @return      true.
      */
     scrollToMousePos() {
-        let [xMouse, yMouse, mask] = global.get_pointer();
+        let [xMouse, yMouse] = global.get_pointer();
 
         if (xMouse != this.xMouse || yMouse != this.yMouse) {
             this.xMouse = xMouse;
             this.yMouse = yMouse;
 
             let sysMouseOverAny = false;
-            this._zoomRegions.forEach((zoomRegion, index, array) => {
+            this._zoomRegions.forEach(zoomRegion => {
                 if (zoomRegion.scrollToMousePos())
                     sysMouseOverAny = true;
             });
@@ -332,7 +331,7 @@ var Magnifier = class Magnifier {
         this.setCrosshairsClip(clip);
 
         let theCrossHairs = this._crossHairs;
-        this._zoomRegions.forEach ((zoomRegion, index, array) => {
+        this._zoomRegions.forEach (zoomRegion => {
             zoomRegion.addCrosshairs(theCrossHairs);
         });
     }
@@ -360,7 +359,7 @@ var Magnifier = class Magnifier {
      */
     setCrosshairsColor(color) {
         if (this._crossHairs) {
-            let [res, clutterColor] = Clutter.Color.from_string(color);
+            let [res_, clutterColor] = Clutter.Color.from_string(color);
             this._crossHairs.setColor(clutterColor);
         }
     }
@@ -1515,7 +1514,7 @@ var ZoomRegion = class ZoomRegion {
     }
 
     _centerFromPointProportional(xPoint, yPoint) {
-        let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI();
+        let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI();
         let halfScreenWidth = global.screen_width / 2;
         let halfScreenHeight = global.screen_height / 2;
         // We want to pad with a constant distance after zooming, so divide

js/ui/magnifierDBus.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported ShellMagnifier */
 
 const Gio = imports.gi.Gio;
 const Main = imports.ui.main;
@@ -124,7 +125,7 @@ var ShellMagnifier = class ShellMagnifier {
         let zoomRegions = Main.magnifier.getZoomRegions();
         let objectPaths = [];
         let thoseZoomers = this._zoomers;
-        zoomRegions.forEach ((aZoomRegion, index, array) => {
+        zoomRegions.forEach (aZoomRegion => {
             let found = false;
             for (let objectPath in thoseZoomers) {
                 let proxyAndZoomRegion = thoseZoomers[objectPath];

js/ui/main.js

@@ -1,4 +1,12 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported componentManager, notificationDaemon, windowAttentionHandler,
+            ctrlAltTabManager, padOsdService, osdWindowManager,
+            osdMonitorLabeler, shellMountOpDBusService, shellDBusService,
+            shellAccessDialogDBusService, shellAudioSelectionDBusService,
+            screenSaverDBus, screencastService, uiGroup, magnifier,
+            xdndHandler, keyboard, kbdA11yDialog, introspectService,
+            start, pushModal, popModal, activateWindow, createLookingGlass,
+            initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */
 
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -46,6 +54,7 @@ const LOG_DOMAIN = 'GNOME Shell';
 const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a';
 
 var componentManager = null;
+var extensionManager = null;
 var panel = null;
 var overview = null;
 var runDialog = null;
@@ -226,7 +235,8 @@ function _initializeUI() {
     _startDate = new Date();
 
     ExtensionDownloader.init();
-    ExtensionSystem.init();
+    extensionManager = new ExtensionSystem.ExtensionManager();
+    extensionManager.init();
 
     if (sessionMode.isGreeter && screenShield) {
         layoutManager.connect('startup-prepared', () => {
@@ -656,7 +666,7 @@ function _queueBeforeRedraw(workId) {
  *
  * Returns: A string work identifier
  */
-function initializeDeferredWork(actor, callback, props) {
+function initializeDeferredWork(actor, callback) {
     // Turn into a string so we can use as an object property
     let workId = `${(++_deferredWorkSequence)}`;
     _deferredWorkData[workId] = { 'actor': actor,

js/ui/messageList.js

@@ -4,10 +4,9 @@ const MessageTray = imports.ui.messageTray;
 const Signals = imports.signals;
 
 const Calendar = imports.ui.calendar;
-const Tweener = imports.ui.tweener;
 const Util = imports.misc.util;
 
-var MESSAGE_ANIMATION_TIME = 0.1;
+var MESSAGE_ANIMATION_TIME = 100;
 
 var DEFAULT_EXPAND_LINES = 6;
 
@@ -33,9 +32,7 @@ function _fixMarkup(text, allowMarkup) {
 }
 
 var URLHighlighter = class URLHighlighter {
-    constructor(text, lineWrap, allowMarkup) {
-        if (!text)
-            text = '';
+    constructor(text = '', lineWrap, allowMarkup) {
         this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter',
                                     x_expand: true, x_align: Clutter.ActorAlign.START });
         this._linkColor = '#ccccff';
@@ -132,12 +129,12 @@ var URLHighlighter = class URLHighlighter {
     }
 
     _findUrlAtPos(event) {
-        let success;
+        let success_;
         let [x, y] = event.get_coords();
-        [success, x, y] = this.actor.transform_stage_point(x, y);
+        [success_, x, y] = this.actor.transform_stage_point(x, y);
         let findPos = -1;
         for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
-            let [success, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
+            let [success_, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
             if (py > y || py + lineHeight < y || x < px)
                 continue;
             findPos = i;
@@ -442,15 +439,17 @@ var Message = class Message {
         }
 
         if (animate) {
-            Tweener.addTween(this._bodyStack.layout_manager,
-                             { expansion: 1,
-                               time: MessageTray.ANIMATION_TIME,
-                               transition: 'easeOutQuad' });
+            this._bodyStack.ease_property('@layout.expansion', 1, {
+                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                duration: MessageTray.ANIMATION_TIME,
+            });
+
             this._actionBin.scale_y = 0;
-            Tweener.addTween(this._actionBin,
-                             { scale_y: 1,
-                               time: MessageTray.ANIMATION_TIME,
-                               transition: 'easeOutQuad' });
+            this._actionBin.ease({
+                scale_y: 1,
+                duration: MessageTray.ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
         } else {
             this._bodyStack.layout_manager.expansion = 1;
             this._actionBin.scale_y = 1;
@@ -461,18 +460,20 @@ var Message = class Message {
 
     unexpand(animate) {
         if (animate) {
-            Tweener.addTween(this._bodyStack.layout_manager,
-                             { expansion: 0,
-                               time: MessageTray.ANIMATION_TIME,
-                               transition: 'easeOutQuad' });
-            Tweener.addTween(this._actionBin,
-                             { scale_y: 0,
-                               time: MessageTray.ANIMATION_TIME,
-                               transition: 'easeOutQuad',
-                               onComplete: () => {
-                                   this._actionBin.hide();
-                                   this.expanded = false;
-                               } });
+            this._bodyStack.ease_property('@layout.expansion', 0, {
+                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                duration: MessageTray.ANIMATION_TIME,
+            });
+
+            this._actionBin.ease({
+                scale_y: 0,
+                duration: MessageTray.ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                onComplete: () => {
+                    this._actionBin.hide();
+                    this.expanded = false;
+                }
+            });
         } else {
             this._bodyStack.layout_manager.expansion = 0;
             this._actionBin.scale_y = 0;
@@ -583,10 +584,12 @@ var MessageListSection = class MessageListSection {
         this._list.insert_child_at_index(obj.container, index);
 
         if (animate)
-            Tweener.addTween(obj.container, { scale_x: 1,
-                                              scale_y: 1,
-                                              time: MESSAGE_ANIMATION_TIME,
-                                              transition: 'easeOutQuad' });
+            obj.container.ease({
+                scale_x: 1,
+                scale_y: 1,
+                duration: MESSAGE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
     }
 
     moveMessage(message, index, animate) {
@@ -599,16 +602,20 @@ var MessageListSection = class MessageListSection {
 
         let onComplete = () => {
             this._list.set_child_at_index(obj.container, index);
-            Tweener.addTween(obj.container, { scale_x: 1,
-                                              scale_y: 1,
-                                              time: MESSAGE_ANIMATION_TIME,
-                                              transition: 'easeOutQuad' });
+            obj.container.ease({
+                scale_x: 1,
+                scale_y: 1,
+                duration: MESSAGE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
         };
-        Tweener.addTween(obj.container, { scale_x: 0,
-                                          scale_y: 0,
-                                          time: MESSAGE_ANIMATION_TIME,
-                                          transition: 'easeOutQuad',
-                                          onComplete: onComplete });
+        obj.container.ease({
+            scale_x: 0,
+            scale_y: 0,
+            duration: MESSAGE_ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete
+        });
     }
 
     removeMessage(message, animate) {
@@ -621,13 +628,16 @@ var MessageListSection = class MessageListSection {
         this._messages.delete(message);
 
         if (animate) {
-            Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0,
-                                              time: MESSAGE_ANIMATION_TIME,
-                                              transition: 'easeOutQuad',
-                                              onComplete() {
-                                                  obj.container.destroy();
-                                                  global.sync_pointer();
-                                              } });
+            obj.container.ease({
+                scale_x: 0,
+                scale_y: 0,
+                duration: MESSAGE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                onComplete: () => {
+                    obj.container.destroy();
+                    global.sync_pointer();
+                }
+            });
         } else {
             obj.container.destroy();
             global.sync_pointer();
@@ -649,15 +659,14 @@ var MessageListSection = class MessageListSection {
             for (let i = 0; i < messages.length; i++) {
                 let message = messages[i];
                 let obj = this._messages.get(message);
-                Tweener.addTween(obj.container,
-                                 { anchor_x: this._list.width,
-                                   opacity: 0,
-                                   time: MESSAGE_ANIMATION_TIME,
-                                   delay: i * delay,
-                                   transition: 'easeOutQuad',
-                                   onComplete() {
-                                       message.close();
-                                   } });
+                obj.container.ease({
+                    anchor_x: this._list.width,
+                    opacity: 0,
+                    duration: MESSAGE_ANIMATION_TIME,
+                    delay: i * delay,
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                    onComplete: () => message.close()
+                });
             }
         }
     }

js/ui/messageTray.js

@@ -1,4 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported NotificationPolicy, NotificationGenericPolicy,
+   NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel,
+   SystemNotificationSource, MessageTray */
 
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -9,15 +12,14 @@ const GnomeSession = imports.misc.gnomeSession;
 const Layout = imports.ui.layout;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 
 const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings';
 
-var ANIMATION_TIME = 0.2;
-var NOTIFICATION_TIMEOUT = 4;
+var ANIMATION_TIME = 200;
+var NOTIFICATION_TIMEOUT = 4000;
 
-var HIDE_TIMEOUT = 0.2;
-var LONGER_HIDE_TIMEOUT = 0.6;
+var HIDE_TIMEOUT = 200;
+var LONGER_HIDE_TIMEOUT = 600;
 
 var MAX_NOTIFICATIONS_IN_QUEUE = 3;
 var MAX_NOTIFICATIONS_PER_SOURCE = 3;
@@ -473,9 +475,7 @@ var Notification = class Notification {
             this.destroy();
     }
 
-    destroy(reason) {
-        if (!reason)
-            reason = NotificationDestroyedReason.DISMISSED;
+    destroy(reason = NotificationDestroyedReason.DISMISSED) {
         this.emit('destroy', reason);
     }
 };
@@ -652,7 +652,7 @@ class SourceActorWithLabel extends SourceActor {
 
         let childBox = new Clutter.ActorBox();
 
-        let [minWidth, minHeight, naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
+        let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
         let direction = this.get_text_direction();
 
         if (direction == Clutter.TextDirection.LTR) {
@@ -829,7 +829,7 @@ Signals.addSignalMethods(Source.prototype);
 
 var MessageTray = class MessageTray {
     constructor() {
-        this._presence = new GnomeSession.Presence((proxy, error) => {
+        this._presence = new GnomeSession.Presence((proxy, _error) => {
             this._onStatusChanged(proxy.status);
         });
         this._busy = false;
@@ -1129,14 +1129,14 @@ var MessageTray = class MessageTray {
             // this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us
             // to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still
             // close to its previous position, we extend the timeout once.
-            let [x, y, mods] = global.get_pointer();
+            let [x, y] = global.get_pointer();
             this._notificationLeftMouseX = x;
             this._notificationLeftMouseY = y;
 
             // We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it.
             // We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
             // That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
-            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000;
+            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT;
             this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
             GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
         }
@@ -1158,7 +1158,7 @@ var MessageTray = class MessageTray {
     }
 
     _onNotificationLeftTimeout() {
-        let [x, y, mods] = global.get_pointer();
+        let [x, y] = global.get_pointer();
         // We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side.
         if (this._notificationLeftMouseX > -1 &&
             y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD &&
@@ -1166,7 +1166,7 @@ var MessageTray = class MessageTray {
             x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
             x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
             this._notificationLeftMouseX = -1;
-            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000,
+            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT,
                                                                    this._onNotificationLeftTimeout.bind(this));
             GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
         } else {
@@ -1248,34 +1248,6 @@ var MessageTray = class MessageTray {
         this._notificationExpired = false;
     }
 
-    _tween(actor, statevar, value, params) {
-        let onComplete = params.onComplete;
-        let onCompleteScope = params.onCompleteScope;
-        let onCompleteParams = params.onCompleteParams;
-
-        params.onComplete = this._tweenComplete;
-        params.onCompleteScope = this;
-        params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams];
-
-        // Remove other tweens that could mess with the state machine
-        Tweener.removeTweens(actor);
-        Tweener.addTween(actor, params);
-
-        let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING;
-        this[statevar] = valuing;
-    }
-
-    _tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) {
-        this[statevar] = value;
-        if (onComplete)
-            onComplete.apply(onCompleteScope, onCompleteParams);
-        this._updateState();
-    }
-
-    _clampOpacity() {
-        this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255));
-    }
-
     _onIdleMonitorBecameActive() {
         this._userActiveWhileNotificationShown = true;
         this._updateNotificationTimeout(2000);
@@ -1302,7 +1274,6 @@ var MessageTray = class MessageTray {
 
         this._bannerBin.add_actor(this._banner.actor);
 
-        this._bannerBin._opacity = 0;
         this._bannerBin.opacity = 0;
         this._bannerBin.y = -this._banner.actor.height;
         this.actor.show();
@@ -1310,7 +1281,7 @@ var MessageTray = class MessageTray {
         Meta.disable_unredirect_for_display(global.display);
         this._updateShowingNotification();
 
-        let [x, y, mods] = global.get_pointer();
+        let [x, y] = global.get_pointer();
         // We save the position of the mouse at the time when we started showing the notification
         // in order to determine if the notification popped up under it. We make that check if
         // the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't
@@ -1348,22 +1319,28 @@ var MessageTray = class MessageTray {
         // We use this._showNotificationCompleted() onComplete callback to extend the time the updated
         // notification is being shown.
 
-        let tweenParams = { y: 0,
-                            _opacity: 255,
-                            time: ANIMATION_TIME,
-                            transition: 'easeOutBack',
-                            onUpdate: this._clampOpacity,
-                            onUpdateScope: this,
-                            onComplete: this._showNotificationCompleted,
-                            onCompleteScope: this
-                          };
-
-        this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams);
+        this._notificationState = State.SHOWING;
+        this._bannerBin.remove_all_transitions();
+        this._bannerBin.ease({
+            opacity: 255,
+            duration: ANIMATION_TIME,
+            mode: Clutter.AnimationMode.LINEAR
+        });
+        this._bannerBin.ease({
+            y: 0,
+            duration: ANIMATION_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_BACK,
+            onComplete: () => {
+                this._notificationState = State.SHOWN;
+                this._showNotificationCompleted();
+                this._updateState();
+            }
+        });
     }
 
     _showNotificationCompleted() {
         if (this._notification.urgency != Urgency.CRITICAL)
-            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000);
+            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT);
     }
 
     _updateNotificationTimeout(timeout) {
@@ -1380,7 +1357,7 @@ var MessageTray = class MessageTray {
     }
 
     _notificationTimeout() {
-        let [x, y, mods] = global.get_pointer();
+        let [x, y] = global.get_pointer();
         if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) {
             // The mouse is moving towards the notification, so don't
             // hide it yet. (We just create a new timeout (and destroy
@@ -1416,20 +1393,26 @@ var MessageTray = class MessageTray {
         }
 
         this._resetNotificationLeftTimeout();
+        this._bannerBin.remove_all_transitions();
 
         if (animate) {
-            this._tween(this._bannerBin, '_notificationState', State.HIDDEN,
-                        { y: -this._bannerBin.height,
-                          _opacity: 0,
-                          time: ANIMATION_TIME,
-                          transition: 'easeOutBack',
-                          onUpdate: this._clampOpacity,
-                          onUpdateScope: this,
-                          onComplete: this._hideNotificationCompleted,
-                          onCompleteScope: this
-                        });
+            this._notificationState = State.HIDING;
+            this._bannerBin.ease({
+                opacity: 0,
+                duration: ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_BACK
+            });
+            this._bannerBin.ease({
+                y: -this._bannerBin.height,
+                duration: ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_BACK,
+                onComplete: () => {
+                    this._notificationState = State.HIDDEN;
+                    this._hideNotificationCompleted();
+                    this._updateState();
+                }
+            });
         } else {
-            Tweener.removeTweens(this._bannerBin);
             this._bannerBin.y = -this._bannerBin.height;
             this._bannerBin.opacity = 0;
             this._notificationState = State.HIDDEN;

js/ui/modalDialog.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported ModalDialog */
 
 const { Atk, Clutter, GObject, Shell, St } = imports.gi;
 
@@ -7,10 +8,9 @@ const Layout = imports.ui.layout;
 const Lightbox = imports.ui.lightbox;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 
-var OPEN_AND_CLOSE_TIME = 0.1;
-var FADE_OUT_DIALOG_TIME = 1.0;
+var OPEN_AND_CLOSE_TIME = 100;
+var FADE_OUT_DIALOG_TIME = 1000;
 
 var State = {
     OPENED: 0,
@@ -124,15 +124,15 @@ var ModalDialog = GObject.registerClass({
             this._lightbox.show();
         this.opacity = 0;
         this.show();
-        Tweener.addTween(this,
-                         { opacity: 255,
-                           time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
-                           transition: 'easeOutQuad',
-                           onComplete: () => {
-                               this._setState(State.OPENED);
-                               this.emit('opened');
-                           }
-                         });
+        this.ease({
+            opacity: 255,
+            duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                this._setState(State.OPENED);
+                this.emit('opened');
+            }
+        });
     }
 
     setInitialKeyFocus(actor) {
@@ -175,15 +175,16 @@ var ModalDialog = GObject.registerClass({
         this.popModal(timestamp);
         this._savedKeyFocus = null;
 
-        if (this._shouldFadeOut)
-            Tweener.addTween(this,
-                             { opacity: 0,
-                               time: OPEN_AND_CLOSE_TIME,
-                               transition: 'easeOutQuad',
-                               onComplete: this._closeComplete.bind(this)
-                             });
-        else
+        if (this._shouldFadeOut) {
+            this.ease({
+                opacity: 0,
+                duration: OPEN_AND_CLOSE_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                onComplete: () => this._closeComplete()
+            });
+        } else {
             this._closeComplete();
+        }
     }
 
     // Drop modal status without closing the dialog; this makes the
@@ -248,13 +249,11 @@ var ModalDialog = GObject.registerClass({
             return;
 
         this.popModal(timestamp);
-        Tweener.addTween(this.dialogLayout,
-                         { opacity: 0,
-                           time: FADE_OUT_DIALOG_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: () => {
-                               this._setState(State.FADED_OUT);
-                           }
-                         });
+        this.dialogLayout.ease({
+            opacity: 0,
+            duration: FADE_OUT_DIALOG_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => this.state = State.FADED_OUT
+        });
     }
 });

js/ui/mpris.js

@@ -1,3 +1,4 @@
+/* exported MediaSection */
 const { Gio, Shell, St } = imports.gi;
 const Signals = imports.signals;
 

js/ui/notificationDaemon.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported NotificationDaemon */
 
 const { GdkPixbuf, Gio, GLib, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -64,7 +65,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
     _imageForNotificationData(hints) {
         if (hints['image-data']) {
             let [width, height, rowStride, hasAlpha,
-                 bitsPerSample, nChannels, data] = hints['image-data'];
+                 bitsPerSample, nChannels_, data] = hints['image-data'];
             return Shell.util_create_pixbuf_from_data(data, GdkPixbuf.Colorspace.RGB, hasAlpha,
                                                       bitsPerSample, width, height, rowStride);
         } else if (hints['image-path']) {
@@ -259,7 +260,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
     }
 
     _notifyForSource(source, ndata) {
-        let [id, icon, summary, body, actions, hints, notification] =
+        let [id_, icon, summary, body, actions, hints, notification] =
             [ndata.id, ndata.icon, ndata.summary, ndata.body,
              ndata.actions, ndata.hints, ndata.notification];
 
@@ -749,29 +750,33 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
     _loadNotifications() {
         this._isLoading = true;
 
-        let value = global.get_persistent_state('a(sa(sv))', 'notifications');
-        if (value) {
-            let sources = value.deep_unpack();
-            sources.forEach(([appId, notifications]) => {
-                if (notifications.length == 0)
-                    return;
-
-                let source;
-                try {
-                    source = this._ensureAppSource(appId);
-                } catch (e) {
-                    if (e instanceof InvalidAppError)
+        try {
+            let value = global.get_persistent_state('a(sa(sv))', 'notifications');
+            if (value) {
+                let sources = value.deep_unpack();
+                sources.forEach(([appId, notifications]) => {
+                    if (notifications.length == 0)
                         return;
-                    throw e;
-                }
 
-                notifications.forEach(([notificationId, notification]) => {
-                    source.addNotification(notificationId, notification.deep_unpack(), false);
+                    let source;
+                    try {
+                        source = this._ensureAppSource(appId);
+                    } catch (e) {
+                        if (e instanceof InvalidAppError)
+                            return;
+                        throw e;
+                    }
+
+                    notifications.forEach(([notificationId, notification]) => {
+                        source.addNotification(notificationId, notification.deep_unpack(), false);
+                    });
                 });
-            });
+            }
+        } catch (e) {
+            logError(e, 'Failed to load saved notifications');
+        } finally {
+            this._isLoading = false;
         }
-
-        this._isLoading = false;
     }
 
     _saveNotifications() {

js/ui/osdMonitorLabeler.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported OsdMonitorLabeler */
 
 const { Clutter, Gio, Meta, St } = imports.gi;
 

js/ui/osdWindow.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported OsdWindowManager */
 
 const { Clutter, GLib, GObject, Meta, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -6,44 +7,10 @@ const Mainloop = imports.mainloop;
 const BarLevel = imports.ui.barLevel;
 const Layout = imports.ui.layout;
 const Main = imports.ui.main;
-const Tweener = imports.ui.tweener;
 
 var HIDE_TIMEOUT = 1500;
-var FADE_TIME = 0.1;
-var LEVEL_ANIMATION_TIME = 0.1;
-
-var LevelBar = class extends BarLevel.BarLevel {
-    constructor() {
-        super(0, { styleClass: 'level' });
-
-        this._level = 0;
-        this._maxLevel = 100;
-
-        this.actor.accessible_name = _("Volume");
-
-        this.actor.connect('notify::width', () => this.level = this.level);
-    }
-
-    get level() {
-        return this._level;
-    }
-
-    set level(value) {
-        this._level = Math.max(0, Math.min(value, this._maxLevel));
-
-        this.setValue(this._level / 100);
-    }
-
-    get maxLevel() {
-        return this._maxLevel;
-    }
-
-    set maxLevel(value) {
-        this._maxLevel = Math.max(100, value);
-
-        this.setMaximumValue(this._maxLevel / 100);
-    }
-};
+var FADE_TIME = 100;
+var LEVEL_ANIMATION_TIME = 100;
 
 var OsdWindowConstraint = GObject.registerClass(
 class OsdWindowConstraint extends Clutter.Constraint {
@@ -98,8 +65,11 @@ var OsdWindow = class {
         this._label = new St.Label();
         this._box.add(this._label);
 
-        this._level = new LevelBar();
-        this._box.add(this._level.actor);
+        this._level = new BarLevel.BarLevel({
+            style_class: 'level',
+            value: 0
+        });
+        this._box.add(this._level);
 
         this._hideTimeoutId = 0;
         this._reset();
@@ -138,23 +108,21 @@ var OsdWindow = class {
             this._label.text = label;
     }
 
-    setLevel(level) {
-        this._level.actor.visible = (level != undefined);
-        if (level != undefined) {
+    setLevel(value) {
+        this._level.visible = (value != undefined);
+        if (value != undefined) {
             if (this.actor.visible)
-                Tweener.addTween(this._level,
-                                 { level: level,
-                                   time: LEVEL_ANIMATION_TIME,
-                                   transition: 'easeOutQuad' });
+                this._level.ease_property('value', value, {
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+                    duration: LEVEL_ANIMATION_TIME
+                });
             else
-                this._level.level = level;
+                this._level.value = value;
         }
     }
 
-    setMaxLevel(maxLevel) {
-        if (maxLevel === undefined)
-            maxLevel = 100;
-        this._level.maxLevel = maxLevel;
+    setMaxLevel(maxLevel = 1) {
+        this._level.maximum_value = maxLevel;
     }
 
     show() {
@@ -167,10 +135,11 @@ var OsdWindow = class {
             this.actor.opacity = 0;
             this.actor.get_parent().set_child_above_sibling(this.actor, null);
 
-            Tweener.addTween(this.actor,
-                             { opacity: 255,
-                               time: FADE_TIME,
-                               transition: 'easeOutQuad' });
+            this.actor.ease({
+                opacity: 255,
+                duration: FADE_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
         }
 
         if (this._hideTimeoutId)
@@ -190,15 +159,15 @@ var OsdWindow = class {
 
     _hide() {
         this._hideTimeoutId = 0;
-        Tweener.addTween(this.actor,
-                         { opacity: 0,
-                           time: FADE_TIME,
-                           transition: 'easeOutQuad',
-                           onComplete: () => {
-                               this._reset();
-                               Meta.enable_unredirect_for_display(global.display);
-                           }
-                         });
+        this.actor.ease({
+            opacity: 0,
+            duration: FADE_TIME,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            onComplete: () => {
+                this._reset();
+                Meta.enable_unredirect_for_display(global.display);
+            }
+        });
         return GLib.SOURCE_REMOVE;
     }
 

js/ui/overview.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported Overview */
 
 const { Clutter, GLib, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -12,16 +13,15 @@ const Main = imports.ui.main;
 const MessageTray = imports.ui.messageTray;
 const OverviewControls = imports.ui.overviewControls;
 const Params = imports.misc.params;
-const Tweener = imports.ui.tweener;
 const WorkspaceThumbnail = imports.ui.workspaceThumbnail;
 
 // Time for initial animation going into Overview mode
-var ANIMATION_TIME = 0.25;
+var ANIMATION_TIME = 250;
 
 // Must be less than ANIMATION_TIME, since we switch to
 // or from the overview completely after ANIMATION_TIME,
 // and don't want the shading animation to get cut off
-var SHADE_ANIMATION_TIME = .20;
+var SHADE_ANIMATION_TIME = 200;
 
 var DND_WINDOW_SWITCH_TIMEOUT = 750;
 
@@ -173,24 +173,28 @@ var Overview = class {
     _unshadeBackgrounds() {
         let backgrounds = this._backgroundGroup.get_children();
         for (let i = 0; i < backgrounds.length; i++) {
-            Tweener.addTween(backgrounds[i],
-                             { brightness: 1.0,
-                               vignette_sharpness: 0.0,
-                               time: SHADE_ANIMATION_TIME,
-                               transition: 'easeOutQuad'
-                             });
+            backgrounds[i].ease_property('brightness', 1.0, {
+                duration: SHADE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
+            backgrounds[i].ease_property('vignette-sharpness', 0.0, {
+                duration: SHADE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
         }
     }
 
     _shadeBackgrounds() {
         let backgrounds = this._backgroundGroup.get_children();
         for (let i = 0; i < backgrounds.length; i++) {
-            Tweener.addTween(backgrounds[i],
-                             { brightness: Lightbox.VIGNETTE_BRIGHTNESS,
-                               vignette_sharpness: Lightbox.VIGNETTE_SHARPNESS,
-                               time: SHADE_ANIMATION_TIME,
-                               transition: 'easeOutQuad'
-                             });
+            backgrounds[i].ease_property('brightness', Lightbox.VIGNETTE_BRIGHTNESS, {
+                duration: SHADE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
+            backgrounds[i].ease_property('vignette-sharpness', Lightbox.VIGNETTE_SHARPNESS, {
+                duration: SHADE_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            });
         }
     }
 
@@ -386,16 +390,16 @@ var Overview = class {
         this.emit('windows-restacked', stackIndices);
     }
 
-    beginItemDrag(source) {
+    beginItemDrag(_source) {
         this.emit('item-drag-begin');
         this._inItemDrag = true;
     }
 
-    cancelledItemDrag(source) {
+    cancelledItemDrag(_source) {
         this.emit('item-drag-cancelled');
     }
 
-    endItemDrag(source) {
+    endItemDrag(_source) {
         if (!this._inItemDrag)
             return;
         this.emit('item-drag-end');
@@ -426,10 +430,11 @@ var Overview = class {
     fadeInDesktop() {
         this._desktopFade.opacity = 0;
         this._desktopFade.show();
-        Tweener.addTween(this._desktopFade,
-                         { opacity: 255,
-                           time: ANIMATION_TIME,
-                           transition: 'easeOutQuad' });
+        this._desktopFade.ease({
+            opacity: 255,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            duration: ANIMATION_TIME
+        });
     }
 
     fadeOutDesktop() {
@@ -443,11 +448,11 @@ var Overview = class {
 
         this._desktopFade.opacity = 255;
         this._desktopFade.show();
-        Tweener.addTween(this._desktopFade,
-                         { opacity: 0,
-                           time: ANIMATION_TIME,
-                           transition: 'easeOutQuad'
-                         });
+        this._desktopFade.ease({
+            opacity: 0,
+            mode: Clutter.Animates.EASE_OUT_QUAD,
+            duration: ANIMATION_TIME
+        });
     }
 
     // Checks if the Activities button is currently sensitive to
@@ -527,13 +532,12 @@ var Overview = class {
         this.viewSelector.show();
 
         this._overview.opacity = 0;
-        Tweener.addTween(this._overview,
-                         { opacity: 255,
-                           transition: 'easeOutQuad',
-                           time: ANIMATION_TIME,
-                           onComplete: this._showDone,
-                           onCompleteScope: this
-                         });
+        this._overview.ease({
+            opacity: 255,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            duration: ANIMATION_TIME,
+            onComplete: () => this._showDone()
+        });
         this._shadeBackgrounds();
 
         this._coverPane.raise_top();
@@ -591,13 +595,12 @@ var Overview = class {
         this.viewSelector.animateFromOverview();
 
         // Make other elements fade out.
-        Tweener.addTween(this._overview,
-                         { opacity: 0,
-                           transition: 'easeOutQuad',
-                           time: ANIMATION_TIME,
-                           onComplete: this._hideDone,
-                           onCompleteScope: this
-                         });
+        this._overview.ease({
+            opacity: 0,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            duration: ANIMATION_TIME,
+            onComplete: () => this._hideDone()
+        });
         this._unshadeBackgrounds();
 
         this._coverPane.raise_top();