workspace, workspaceThumbnail: Use window content (WIP)

2019-07-16 14:31:30 -03:00
350 changed files with 29129 additions and 74163 deletions
--- a/.eslintrc.json
+++ b/.eslintrc.json
@ -0,0 +1,6 @@
+{
+    "extends": [
+        "./lint/eslintrc-gjs.json",
+        "./lint/eslintrc-shell.json"
+    ]
+}
--- a/.eslintrc.yml
+++ b/.eslintrc.yml
@ -1,3 +0,0 @@
-extends:
- - ./lint/eslintrc-gjs.yml
- - ./lint/eslintrc-shell.yml
--- a/.gitlab-ci.yml
+++ b/.gitlab-ci.yml
@ -1,5 +1,6 @@
 stages:
 - review
+ - source_check
 - build
 - test

@ -14,7 +15,7 @@ variables:
        - merge_requests

 check_commit_log:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: review
    variables:
        GIT_DEPTH: "100"
@ -25,36 +26,28 @@ check_commit_log:

 js_check:
    image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
-    stage: review
+    stage: source_check
    script:
        - find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG
        - (! grep -q . $JS_LOG)
    <<: *only_default
+    only:
+        changes:
+            - js/**/*
    artifacts:
        paths:
            - ${JS_LOG}
        when: on_failure

-eslint:
-    image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
-    stage: review
-    script:
-        - ./.gitlab-ci/run-eslint.sh
-    <<: *only_default
-    artifacts:
-        paths:
-            - reports
-        when: always
-
 build:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: build
    before_script:
        - .gitlab-ci/checkout-mutter.sh
        - meson mutter mutter/build --prefix=/usr -Dtests=false
        - ninja -C mutter/build install
    script:
-        - meson . build -Dbuiltype=debugoptimized -Dman=false --werror
+        - meson . build -Dbuiltype=debugoptimized
        - ninja -C build
        - ninja -C build install
    <<: *only_default
@ -65,15 +58,12 @@ build:
            - build

 test:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: test
-    variables:
-        XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
-        NO_AT_BRIDGE: "1"
    before_script:
        - ninja -C mutter/build install
    script:
-        - dbus-run-session -- xvfb-run meson test -C build --no-rebuild
+        - xvfb-run meson test -C build --no-rebuild
    <<: *only_default
    artifacts:
        expire_in: 1 day
@ -82,7 +72,7 @@ test:
        when: on_failure

 test-pot:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: test
    before_script:
        - ninja -C mutter/build install
--- a/.gitlab-ci/Dockerfile.extension-ci
+++ b/.gitlab-ci/Dockerfile.extension-ci
@ -1,7 +1,7 @@
 FROM registry.fedoraproject.org/fedora:latest

 RUN dnf -y update && dnf -y upgrade && \
-    dnf install -y 'dnf-command(copr)' git && \
+    dnf install -y 'dnf-command(copr)' && \

    # For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'`
    dnf install -y findutils mozjs60-devel && \
--- a/.gitlab-ci/checkout-mutter.sh
+++ b/.gitlab-ci/checkout-mutter.sh
@ -1,5 +1,6 @@
 #!/usr/bin/bash

+shell_branch=$(git describe --contains --all HEAD)
 mutter_target=

 git clone https://gitlab.gnome.org/GNOME/mutter.git
@ -25,7 +26,8 @@ if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
 fi

 if [ -z "$mutter_target" ]; then
-  mutter_target=$(git branch -r -l origin/$CI_COMMIT_REF_NAME)
+  mutter_target=$(git branch -r -l origin/$shell_branch)
+  mutter_target=${mutter_target:-$(git branch -r -l ${shell_branch#remotes/})}
  mutter_target=${mutter_target:-origin/master}
  echo Using $mutter_target instead
 fi
--- a/.gitlab-ci/run-eslint.sh
+++ b/.gitlab-ci/run-eslint.sh
@ -1,114 +0,0 @@
-#!/usr/bin/env bash
-
-OUTPUT_REGULAR=reports/lint-regular-report.txt
-OUTPUT_LEGACY=reports/lint-legacy-report.txt
-OUTPUT_FINAL=reports/lint-common-report.txt
-
-OUTPUT_MR=reports/lint-mr-report.txt
-
-LINE_CHANGES=changed-lines.txt
-
-is_empty() {
-  (! grep -q . $1)
-}
-
-run_eslint() {
-  ARGS_LEGACY='--config lint/eslintrc-legacy.yml'
-
-  local extra_args=ARGS_$1
-  local output_var=OUTPUT_$1
-  local output=${!output_var}
-
-  # ensure output exists even if eslint doesn't report any errors
-  mkdir -p $(dirname $output)
-  touch $output
-
-  eslint -f unix ${!extra_args} -o $output js
-}
-
-list_commit_range_additions() {
-  # Turn raw context-less git-diff into a list of
-  # filename:lineno pairs of new (+) lines
-  git diff -U0 "$@" -- js |
-  awk '
-    BEGIN { file=""; }
-    /^+++ b/ { file=substr($0,7); }
-    /^@@ / {
-        len = split($3,a,",")
-        start=a[1]
-        count=(len > 1) ? a[2] : 1
-
-        for (line=start; line<start+count; line++)
-            printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line;
-    }'
-}
-
-copy_matched_lines() {
-  local source=$1
-  local matches=$2
-  local target=$3
-
-  echo -n > $target
-  for l in $(<$matches); do
-    grep $l $source >> $target
-  done
-}
-
-create_common() {
-  # comm requires sorted input;
-  # we also strip the error message to make the following a "common" error:
-  # regular:
-  #  file.js:42:23 Indentation of 55, expected 42
-  # legacy:
-  #  file.js:42:23 Indentation of 55, extected 24
-  prepare() {
-    sed 's: .*::' $1 | sort
-  }
-
-  comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp
-
-  # Now add back the stripped error messages
-  copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL
-  rm $OUTPUT_FINAL.tmp
-}
-
-# Disable MR handling for now. We aren't ready to enforce
-# non-legacy style just yet ...
-unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME
-
-REMOTE=${1:-$CI_MERGE_REQUEST_PROJECT_URL.git}
-BRANCH_NAME=${2:-$CI_MERGE_REQUEST_TARGET_BRANCH_NAME}
-
-if [ "$BRANCH_NAME" ]; then
-  git fetch $REMOTE $BRANCH_NAME
-  branch_point=$(git merge-base HEAD FETCH_HEAD)
-  commit_range=$branch_point...HEAD
-
-  list_commit_range_additions $commit_range > $LINE_CHANGES
-
-  # Don't bother with running lint when no JS changed
-  if is_empty $LINE_CHANGES; then
-    exit 0
-  fi
-fi
-
-echo Generating lint report using regular configuration
-run_eslint REGULAR
-echo Generating lint report using legacy configuration
-run_eslint LEGACY
-echo Done.
-create_common
-
-if ! is_empty $OUTPUT_FINAL; then
-  cat $OUTPUT_FINAL
-  exit 1
-fi
-
-# Just show the report and succeed when not testing a MR
-if [ -z "$BRANCH_NAME" ]; then
-  exit 0
-fi
-
-copy_matched_lines $OUTPUT_REGULAR $LINE_CHANGES $OUTPUT_MR
-cat $OUTPUT_MR
-is_empty $OUTPUT_MR
--- a/HACKING.md
+++ b/HACKING.md
@ -84,6 +84,7 @@ don't use.

    const Main = imports.ui.main;
    const Params = imports.misc.params;
+    const Tweener = imports.ui.tweener;
    const Util = imports.misc.util;
 ```
 The alphabetical ordering should be done independently of the location of the
@ -163,17 +164,11 @@ you to inherit from a type to use it, you can do so:
             return [100, 100];
        }

-        vfunc_paint(paintContext) {
-             let framebuffer = paintContext.get_framebuffer();
-             let coglContext = framebuffer.get_context();
+        vfunc_paint() {
             let alloc = this.get_allocation_box();
-
-             let pipeline = new Cogl.Pipeline(coglContext);
-             pipeline.set_color4ub(255, 0, 0, 255);
-
-             framebuffer.draw_rectangle(pipeline,
-		 alloc.x1, alloc.y1,
-		 alloc.x2, alloc.y2);
+             Cogl.set_source_color4ub(255, 0, 0, 255);
+             Cogl.rectangle(alloc.x1, alloc.y1,
+                            alloc.x2, alloc.y2);
        }
    });
 ```
@ -192,27 +187,15 @@ and "double quotes" for strings that the user may see. This allows us to
 quickly find untranslated or mistranslated strings by grepping through the
 sources for double quotes without a gettext call around them.

-## `actor` (deprecated) and `_delegate`
+## `actor` and `_delegate`

 gjs allows us to set so-called "expando properties" on introspected objects,
 allowing us to treat them like any other. Because the Shell was built before
-you could inherit from GTypes natively in JS, in some cases we have a wrapper
-class that has a property called `actor` (now deprecated). We call this
-wrapper class the "delegate".
+you could inherit from GTypes natively in JS, we usually have a wrapper class
+that has a property called `actor`. We call this wrapper class the "delegate".

 We sometimes use expando properties to set a property called `_delegate` on
 the actor itself:
-```javascript
-    var MyActor = GObject.registerClass(
-    class MyActor extends Clutter.Actor {
-        _init(params) {
-            super._init(params);
-            this._delegate = this;
-        }
-    });
-```
-
-Or using the deprecated `actor`:
 ```javascript
    var MyClass = class {
        constructor() {
@ -233,7 +216,6 @@ delegate object from an associated actor. For instance, the drag and drop
 system calls the `handleDragOver` function on the delegate of a "drop target"
 when the user drags an item over it. If you do not set the `_delegate`
 property, your actor will not be able to be dropped onto.
-In case the class is an actor itself, the `_delegate` can be just set to `this`.

 ## Functional style

@ -295,49 +277,34 @@ If your usage of an object is like a hash table (and thus conceptually the keys
 can have special chars in them), don't use quotes, but use brackets: `{ bar: 42
 }`, `foo['bar']`.

-## Animations
-
-Most objects that are animated are actors, and most properties used in animations
-are animatable, which means they can use implicit animations:
+## Getters, setters, and Tweener

+Getters and setters should be used when you are dealing with an API that is
+designed around setting properties, like Tweener. If you want to animate an
+arbitrary property, create a getter and setter, and use Tweener to animate the
+property.
 ```javascript
-    moveActor(actor, x, y) {
-        actor.ease({
-            x,
-            y,
-            duration: 500, // ms
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
-    }
-```
-
-The above is a convenience wrapper around the actual Clutter API, and should generally
-be preferred over the more verbose:
-
-```javascript
-    moveActor(actor, x, y) {
-        actor.save_easing_state();
-
-        actor.set_easing_duration(500);
-        actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD);
-        actor.set({
-            x,
-            y
-        });
-
-        actor.restore_easing_state();
-    }
-```
-
-There is a similar convenience API around Clutter.PropertyTransition to animate
-actor (or actor meta) properties that cannot use implicit animations:
-
-```javascript
-    desaturateActor(actor, desaturate) {
-        let factor = desaturate ? 1.0 : 0.0;
-        actor.ease_property('@effects.desaturate.factor', factor, {
-            duration: 500, // ms
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
-    }
+    var ANIMATION_TIME = 2000;
+
+    var MyClass = class {
+        constructor() {
+            this.actor = new St.BoxLayout();
+            this._position = 0;
+        }
+
+        get position() {
+            return this._position;
+        }
+
+        set position(value) {
+            this._position = value;
+            this.actor.set_position(value, value);
+        }
+    };
+
+    let myThing = new MyClass();
+    Tweener.addTween(myThing,
+                     { position: 100,
+                       time: ANIMATION_TIME,
+                       transition: 'easeOutQuad' });
 ```
--- a/216
+++ b/216
@ -1,219 +1,3 @@
-3.35.2
-======
-* Fix unredirection after cancelled animations [Florian; #1788]
-* Include shadow in window screenshots [Robert; !762]
-* Show indicator when microphone is active [Florian; !729]
-* Use inheritance instead of delegate pattern [Marco; !559]
-* Use cached coordinates for window sorting in overview [Andrew; !763]
-* Wiggle login/unlock password entries on failure [Georges; !769]
-* Update window titles in app menu [Florian; #1830]
-* Fix window animations getting stuck by workspace switches [Jonas D.; !784]
-* Fix not-responding dialog size when using geometry scaling [Jonas D.; !783]
-* Handle buggy MPRIS clients more gracefully [Philip; #1362]
-* Deprecate StBoxLayout's child properties [Florian; !780]
-* Remove StBin's align properties [Florian; !803]
-* Use correct timezones for events [Milan, Florian; !806, #1895]
-* Reduce overhead of tracking stylesheet changes [Carlos; !779]
-* Replace action icons in system menu with regular menu items [Florian; #270]
-* Refine polkit dialogs [Jonas D.; !788]
-* Fix battery icon glitch in "100% but charging" case [Philip; !814]
-* Fix windows getting stuck on screen if closed while animating [Florian; !815]
-* Use font from interface settings [Florian; #688288]
-* Show polkit confirmation dialog for users with no password
-  [Joaquim, Jonas D.; !829]
-* Use better OSK layout fallback for unsupported variants [Florian; #1907]
-* Hide stopped spinner in top bar [Joonas; !832]
-* Reuse existing icons when updating the app picker grid [Georges; !841]
-* Show switcher popups immediately on second key press [Florian; #1928]
-* Add position-based animation to page indicators [Alexander; !843]
-* Improve modifier-less keyboard navigation of switcher popups [Florian; #1883]
-* Improve weather integration [Florian; #1927, #1926]
-* Add back sound feedback when scrolling volume indicator [Florian; #53]
-* Fix creating app folders with no pre-existing folders [Jonas D.; #1652]
-* Improve DND page switching in app picker [Florian, Jonas D.; #1693]
-* Fix disable command of gnome-extensions tool [Florian; #1946]
-* Tweak styling of notifications/media constrols [Joonas; !855, !865]
-* Enable clean session shutdown after gnome-shell failure [Benjamin; !858]
-* Also remove scaled keys when texture cache is cleared [Daniel M.; !567]
-* Don't show overflow indicator in switchers that fit screen [Florian; #1834]
-* Move libcroco dependency in-tree [Federico; !861]
-* Move to app folder location when it is created/renamed [Georges; !883]
-* Dismiss switcher popups when a system modal dialogs opens [Florian; #1536]
-* Fix weather forecasts for automatic location when Weather is not sandboxed
-  [Florian; #1823]
-* Place launched applications into a systemd scope [Benjamin; !863]
-* Fixed crashes [Jonas D., Carlos; !787, !813]
-* Misc. bug fixes and cleanups [Marco, Georges, Daniel V., Florian, Robert,
-  Kalev, Philip, Jonas D., Will, Carlos, Jonas Å., cunidev, Joonas, Federico;
-  !747, !765, !421, !759, !749, !730, !770, #1799, !774, !773, !776, !777,
-  !782, !794, !778, !792, !790, !190, !796, !795, !797, !798, !800, !804, !808,
-  !807, !810, !811, !563, !809, !805, !817, !818, !822, !830, !828, !823, !835,
-  !840, !842, !833, !845, !846, !847, !851, #1916, !862, !866, #1979, !827,
-  #1976, !884, !873, !885, !799, !887, !891, !816]
-
-Contributors:
-  Marco Trevisan (Treviño), Benjamin Berg, Philip Chimento, Milan Crha,
-  Jonas Dreßler, Carlos Garnacho, Joonas Henriksson, Kalev Lember, Robert Mader,
-  Alexander Mikhaylenko, Daniel García Moreno, Florian Müllner,
-  Georges Basile Stavracas Neto, Federico Mena Quintero, Joaquim Rocha,
-  Will Thompson, Daniel van Vugt, Andrew Watson, cunidev, Jonas Ådahl
-
-Translators:
-  Daniel Mustieles [es], Goran Vidović [hr], Fabio Tomat [fur],
-  Danial Behzadi [fa], Andika Triwidada [id], Efstathios Iosifidis [el],
-  Ricardo Silva Veloso [pt_BR]
-
-3.35.1
-======
-* Misc. bug fixes and cleanups [Marco; Matthias; !758, #701212]
-
-Contributors:
-  Marco Trevisan (Treviño)
-
-3.34.1
-======
-* Fix "Frequent" view icons disappearing on hover [Jonas D.; #1502]
-* Allow editing app folder names [Georges, Marco; !675, !720]
-* Skip property transitions while hidden [Florian; !708]
-* Make menu animations more consistent [Florian, GB_2; #1595, !717]
-* Improve performance when enabling/disabling all extensions [Jonas D.; !96]
-* Fix extra icons appearing in "Frequent" view animation [Georges; !696]
-* Fix fading out desktop icons [Harshula; #1616]
-* Fix box-shadow glitch with prerendered resources [Daniel; #1186]
-* Fix accidentally skipped animations [Florian; #1572]
-* Fix screenshots and window animations when scaled [Robert; !728]
-* Don't leak NOTIFY_SOCKET environment variable to applications [Benjamin; !741]
-* Fix lock-up on X11 when ibus is already running on startup [Marco; #1712]
-* Fix screen dimming on idle [Marco; #1683]
-* Do not notify systemd before initialization is complete [Iain; !750]
-* Support SAE secrets in network agent [Lubomir; !751]
-* Fix various regressions with dynamic workspaces [Florian; #1497]
-* Fixed crashes [Florian, Marco; #1678, !746]
-* Misc. bug fixes and cleanups [Marco, Jonas D., Florian, Iain, Georges,
-  Jonas Å., Martin, Takao, Carlos; !700, !705, !709, !711, !707, #1538, !710,
-  !713, !699, !715, !718, !716, !719, !721, #1243, !725, !731, #1614, !683,
-  !732, !121, !735, !736, !740, #573, #1641, #1571]
-
-Contributors:
-  Marco Trevisan (Treviño), Benjamin Berg, Jonas Dreßler, Takao Fujiwara, GB_2,
-  Carlos Garnacho, Harshula Jayasuriya, Iain Lane, Robert Mader,
-  Daniel García Moreno, Florian Müllner, Georges Basile Stavracas Neto,
-  Lubomir Rintel, Martin Zurowietz, Jonas Ådahl
-
-Translators:
-  Rafael Fontenelle [pt_BR], Fran Dieguez [gl], Balázs Úr [hu],
-  Milo Casagrande [it], Daniel Șerbănescu [ro], Kukuh Syafaat [id],
-  Jiri Grönroos [fi], Daniel Mustieles [es], Piotr Drąg [pl],
-  Anders Jonsson [sv], Marek Černocký [cs], Jordi Mas [ca],
-  Aurimas Černius [lt], Christian Kirbach [de], Emin Tufan Çetin [tr],
-  Enrico Nicoletto [pt_BR], Danial Behzadi [fa], Марко Костић [sr],
-  Alexandre Franke [fr], Charles Monzat [fr], Kjartan Maraas [nb],
-  Ryuta Fujii [ja], Nathan Follens [nl], Dušan Kazik [sk], Fabio Tomat [fur],
-  Matej Urbančič [sl], Ask Hjorth Larsen [da], Alan Mortensen [da]
-
-3.34.0
-======
-* Handle startup/shutdown of misc X11 services [Carlos; !680]
-* Fix sound volume mute/unmute [Iain; #1557]
-* Correctly terminate pasted text [Carlos; #1570]
-
-Contributors:
-  Carlos Garnacho, Iain Lane
-
-Translators:
-  Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
-  Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
-  Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
-
-3.33.92
-=======
-* Animate pointer a11y pie timer [Jonas D.; !688]
-* Fix restarting shell in systemd user session [Benjamin; !690]
-* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
-  !691, !689, !692, #1552, !698]
-
-Contributors:
-  Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
-  Will Thompson
-
-Translators:
-  Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
-  Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
-  Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
-  Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
-  Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
-  Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
-  Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
-
-3.33.91
-=======
-* Fix regression when adjusting brightness [Florian; #1500]
-* Fix pointer a11y timeout animation [Jonas D.; #1533]
-* Add new extensions CLI tool [Florian; #1234]
-* Only track top-level windows [Carlos; #556]
-* Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian;
-  !678, !682, !686]
-
-Contributors:
-  Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner
-
-Translators:
-  Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv],
-  Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi],
-  Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl],
-  Danial Behzadi [fa]
-
-3.33.90
-=======
-* Implement DND app picker folder management [Georges; !643, !645, !664, !671]
-* Make Clocks/Weather integration work with sandboxed apps [Florian; #1158]
-* Support startup via systemd user instance [Benjamin; !507]
-* Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669]
-* Minimize travel distance in overview animation [Sergey; !267]
-* Rescan icon theme when installed apps changed [Georges; !661]
-* Consistently animate new window actions [Jonas; !662, !673]
-* Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels,
-  Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647,
-  !385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665,
-  !667, !670, #1357, !672, !657, #1507, !674, !677]
-
-Contributors:
-  Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner,
-  Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode,
-  Marco Trevisan (Treviño), verdre, Daniel van Vugt
-
-Translators:
-  Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR],
-  Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es],
-  Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro],
-  Anders Jonsson [sv]
-
-3.33.4
-======
-* Fix unintentional interference between gestures [Jonas; !598]
-* Fix unintentional loop while polkit dialog is active [Ray; !602]
-* Fix alt-tab icon size on HiDPI [Jonas; !587]
-* Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449]
-* Fix style updates for non-background CSS properties [Florian; #1212]
-* Fix cursor visibility in screen recordings [Illya; #1208]
-* Add option for disabling the hot corner [Florian; #688320]
-* Use more fine-grained levels in battery indicator [Florian; !561, #1442]
-* Fix the calculation of the maximum number of app search results [Jonas; !110]
-* Handle horizontal workspace layout with gestures/animations [Florian; !575]
-* Improve handling of session mode extensions [Florian, Didier; #789852]
-* Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin,
-  Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611,
-  !614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626,
-  !491, !631, !632, !633, #1457]
-
-Contributors:
-  Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho,
-  Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada,
-  Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño)
-
-Translators:
-  Jordi Mas [ca], Jor Teron [mjw]
-
 3.33.3
 ======
 * Prepare for optional X11 [Carlos; !378]
--- a/data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
@ -1,15 +0,0 @@
-<node>
-
-  <!--
-      org.gnome.Shell.ClocksIntegration:
-      @short_description: Clocks integration interface
-
-      The interface used for exporting location settings to GNOME Shell's
-      world clocks integration.
-  -->
-  <interface name="org.gnome.Shell.ClocksIntegration">
-
-  <property name="Locations" type="av" access="read"/>
-
-  </interface>
-</node>
--- a/data/dbus-interfaces/org.gnome.Shell.Extensions.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.Extensions.xml
@ -173,30 +173,6 @@
      <arg type="s" direction="in" name="uuid"/>
    </method>

-    <!--
-        EnableExtension:
-        @uuid: The UUID of the extension
-        @success: Whether the operation was successful
-
-        Enable an extension.
-    -->
-    <method name="EnableExtension"> \
-      <arg type="s" direction="in" name="uuid"/> \
-      <arg type="b" direction="out" name="success"/> \
-    </method> \
-
-    <!--
-        DisableExtension:
-        @uuid: The UUID of the extension
-        @success: Whether the operation was successful
-
-        Disable an extension.
-    -->
-    <method name="DisableExtension"> \
-      <arg type="s" direction="in" name="uuid"/> \
-      <arg type="b" direction="out" name="success"/> \
-    </method> \
-
    <!--
        LaunchExtensionPrefs:
        @uuid: The UUID of the extension
@ -213,15 +189,6 @@
    -->
    <method name="CheckForUpdates"/>

-    <signal name="ExtensionStateChanged">
-      <arg type="s" name="uuid"/>
-      <arg type="a{sv}" name="state"/>
-    </signal>
-
-    <!--
-        ExtensionStatusChanged:
-        Deprecated for ExtensionStateChanged
-    -->
    <signal name="ExtensionStatusChanged">
      <arg type="s" name="uuid"/>
      <arg type="i" name="state"/>
--- a/data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
@ -1,16 +0,0 @@
-<node>
-
-  <!--
-      org.gnome.Shell.WeatherIntegration:
-      @short_description: Weather integration interface
-
-      The interface used for exporting location settings to GNOME Shell's
-      weather integration.
-  -->
-  <interface name="org.gnome.Shell.WeatherIntegration">
-
-  <property name="AutomaticLocation" type="b" access="read"/>
-  <property name="Locations" type="av" access="read"/>
-
-  </interface>
-</node>
--- a/data/gnome-shell-dbus-interfaces.gresource.xml
+++ b/data/gnome-shell-dbus-interfaces.gresource.xml
@ -40,7 +40,6 @@
    <file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file>
-    <file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file>
@ -49,7 +48,6 @@
    <file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file>
-    <file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.xml</file>
    <file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file>
    <file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file>
--- a/data/gnome-shell-disable-extensions.service
+++ b/data/gnome-shell-disable-extensions.service
@ -1,15 +0,0 @@
-[Unit]
-Description=Disable GNOME Shell extensions after failure
-# Note that this unit must not conflict with anything, and must
-# be able to run in parallel with the gnome-session-shutdown.target.
-DefaultDependencies=no
-
-# We want to disable extensions only if gnome-shell has flagged the extensions
-# to be a likely cause of trouble.
-ConditionPathExists=%t/gnome-shell-disable-extensions
-
-[Service]
-Type=simple
-# Disable extensions
-ExecStart=gsettings set org.gnome.shell disable-user-extensions true
-Restart=no
--- a/data/gnome-shell-wayland.service.in
+++ b/data/gnome-shell-wayland.service.in
@ -1,27 +0,0 @@
-[Unit]
-Description=GNOME Shell on Wayland
-# On wayland, force a session shutdown
-OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target
-OnFailureJobMode=replace-irreversibly
-CollectMode=inactive-or-failed
-RefuseManualStart=on
-RefuseManualStop=on
-
-After=gnome-session-manager.target
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-# The units already conflict because they use the same BusName
-#Conflicts=gnome-shell-x11.service
-
-[Service]
-Type=notify
-ExecStart=@bindir@/gnome-shell
-# Exit code 1 means we are probably *not* dealing with an extension failure
-SuccessExitStatus=1
-# On wayland we cannot restart
-Restart=no
-# Kill any stubborn child processes after this long
-TimeoutStopSec=5
--- a/data/gnome-shell-wayland.target
+++ b/data/gnome-shell-wayland.target
@ -1,10 +1,5 @@
 [Unit]
-Description=GNOME Shell on Wayland
-DefaultDependencies=no
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-Requires=gnome-shell-wayland.service
-After=gnome-shell-wayland.service
+Description=GNOME Shell (wayland sync point)
+After=gnome-shell.service
+BindsTo=gnome-shell.service
+Conflicts=gnome-shell-x11.target
--- a/data/gnome-shell-x11.service.in
+++ b/data/gnome-shell-x11.service.in
@ -1,33 +0,0 @@
-[Unit]
-Description=GNOME Shell on X11
-# On X11, try to show the GNOME Session Failed screen
-OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target
-OnFailureJobMode=replace
-CollectMode=inactive-or-failed
-RefuseManualStart=on
-RefuseManualStop=on
-
-After=gnome-session-manager.target
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-# The units already conflict because they use the same BusName
-#Conflicts=gnome-shell-wayland.service
-
-# Limit startup frequency more than the default
-StartLimitIntervalSec=15s
-StartLimitBurst=3
-
-[Service]
-Type=notify
-ExecStart=@bindir@/gnome-shell
-# Exit code 1 means we are probably *not* dealing with an extension failure
-SuccessExitStatus=1
-# On X11 we want to restart on-success (Alt+F2 + r) and on-failure.
-Restart=always
-# Do not wait before restarting the shell
-RestartSec=0ms
-# Kill any stubborn child processes after this long
-TimeoutStopSec=5
--- a/data/gnome-shell-x11.target
+++ b/data/gnome-shell-x11.target
@ -1,10 +1,5 @@
 [Unit]
-Description=GNOME Shell on X11
-DefaultDependencies=no
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-Requires=gnome-shell-x11.service
-After=gnome-shell-x11.service
+Description=GNOME Shell (x11 sync point)
+After=gnome-shell.service
+BindsTo=gnome-shell.service
+Conflicts=gnome-shell-wayland.target
--- a/data/gnome-shell.service.in
+++ b/data/gnome-shell.service.in
@ -0,0 +1,11 @@
+[Unit]
+Description=GNOME Shell
+Wants=gnome-session.service
+After=graphical-session-pre.target gnome-session-bus.target
+PartOf=graphical-session.target
+
+[Service]
+Type=dbus
+ExecStart=@bindir@/gnome-shell
+Restart=on-failure
+BusName=org.gnome.Shell
--- a/data/meson.build
+++ b/data/meson.build
@ -14,8 +14,6 @@ desktopconf = configuration_data()
 # file when built in a non-system prefix
 desktopconf.set('bindir', bindir)
 desktopconf.set('VERSION', meson.project_version())
-desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false')
-
 foreach desktop_file : desktop_files
  i18n.merge_file('desktop',
    input: configure_file(
@ -24,7 +22,7 @@ foreach desktop_file : desktop_files
      configuration: desktopconf
    ),
    output: desktop_file,
-    po_dir: po_dir,
+    po_dir: '../po',
    install: true,
    install_dir: desktopdir,
    type: 'desktop'
@ -100,23 +98,15 @@ if have_systemd
  unitconf = configuration_data()
  unitconf.set('bindir', bindir)

-  configure_file(
-    input: 'gnome-shell-x11.service.in',
-    output: 'gnome-shell-x11.service',
+  unit = configure_file(
+    input: 'gnome-shell.service.in',
+    output: 'gnome-shell.service',
    configuration: unitconf,
    install_dir: systemduserunitdir
  )

-  configure_file(
-    input: 'gnome-shell-wayland.service.in',
-    output: 'gnome-shell-wayland.service',
-    configuration: unitconf,
-    install_dir: systemduserunitdir
-  )
-
-  units = files('gnome-shell-x11.target',
-                'gnome-shell-wayland.target',
-                'gnome-shell-disable-extensions.service')
+  units = files('gnome-shell-wayland.target',
+                'gnome-shell-x11.target')

  install_data(units, install_dir: systemduserunitdir)
 endif
--- a/data/org.gnome.Shell.desktop.in.in
+++ b/data/org.gnome.Shell.desktop.in.in
@ -14,4 +14,3 @@ X-GNOME-Autostart-Phase=DisplayServer
 X-GNOME-Provides=panel;windowmanager;
 X-GNOME-Autostart-Notify=true
 X-GNOME-AutoRestart=false
-X-GNOME-HiddenUnderSystemd=@systemd_hidden@
--- a/data/org.gnome.shell.gschema.xml.in
+++ b/data/org.gnome.shell.gschema.xml.in
@ -21,17 +21,6 @@
        EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell.
      </description>
    </key>
-    <key name="disabled-extensions" type="as">
-      <default>[]</default>
-      <summary>UUIDs of extensions to force disabling</summary>
-      <description>
-        GNOME Shell extensions have a UUID property; this key lists extensions
-        which should be disabled, even if loaded as part of the current mode.
-        You can also manipulate this list with the EnableExtension and
-        DisableExtension D-Bus methods on org.gnome.Shell.
-        This key takes precedence over the “enabled-extensions” setting.
-      </description>
-    </key>
    <key name="disable-user-extensions" type="b">
      <default>false</default>
      <summary>Disable user extensions</summary>
@ -50,7 +39,7 @@
      </description>
    </key>
    <key name="favorite-apps" type="as">
-      <default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'org.gnome.Shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default>
+      <default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default>
      <summary>List of desktop file IDs for favorite applications</summary>
      <description>
        The applications corresponding to these identifiers
@ -150,6 +139,11 @@
        Keybinding to focus the active notification.
      </description>
    </key>
+    <key name="pause-resume-tweens" type="as">
+      <default>[]</default>
+      <summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary>
+      <description></description>
+    </key>
    <key name="switch-to-application-1" type="as">
      <default>["&lt;Super&gt;1"]</default>
      <summary>Switch to application 1</summary>
@ -228,36 +222,6 @@
    </key>
  </schema>

-  <schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/"
-          gettext-domain="@GETTEXT_PACKAGE@">
-    <key name="locations" type="av">
-      <summary>Locations</summary>
-      <description>
-        The locations to show in world clocks
-      </description>
-      <default>[]</default>
-    </key>
-  </schema>
-
-  <schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/"
-          gettext-domain="@GETTEXT_PACKAGE@">
-    <key name="automatic-location" type="b">
-      <summary>Automatic location</summary>
-      <description>
-        Whether to fetch the current location or not
-      </description>
-      <default>false</default>
-    </key>
-
-    <key name="locations" type="av">
-      <summary>Location</summary>
-      <description>
-        The location for which to show a forecast
-      </description>
-      <default>[]</default>
-    </key>
-  </schema>
-
  <!-- unused, change 00_org.gnome.shell.gschema.override instead -->
  <schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/"
 	  gettext-domain="@GETTEXT_PACKAGE@">
--- a/data/theme/gnome-shell-sass/_common.scss
+++ b/data/theme/gnome-shell-sass/_common.scss
@ -36,8 +36,10 @@ $_hover_bg_color: lighten($bg_color,if($variant=='light', 5%, 3%));
 $_active_bg_color: if($variant == 'light', darken($bg_color, 14%), darken($bg_color, 9%));

 $font-size: 11;
+$font-family: Cantarell, Sans-Serif;

 stage {
+  font-family: $font-family;
  @include fontsize($font-size);
  color: $fg_color;
 }
@ -608,13 +610,6 @@ StScrollBar {
    border-bottom-style: solid;
  }

-// Rename popup
-.rename-folder-popup {
-  .rename-folder-popup-item {
-    spacing: 6px;
-    &:ltr, &:rtl { padding: 0, 12px; }
-  }
-}

 // Background menu
 .background-menu { -boxpointer-gap: 4px; -arrow-rise: 0px; }
@ -629,12 +624,16 @@ StScrollBar {
 *************/
 /* Outline for low res icons */
 .lowres-icon {
-    icon-shadow: 0 1px 2px rgba(0,0,0,0.3);
+    icon-shadow: 0 -1px rgba(0,0,0,0.05),
+      1px 0 rgba(0,0,0,0.1),
+      0 1px rgba(0,0,0,0.3),
+      -1px 0 rgba(0,0,0,0.1);
 }

 /* Drapshadow for large icons */
 .icon-dropshadow {
-  icon-shadow: 0 1px 2px rgba(0,0,0,0.4);
+  icon-shadow: 0 2px 12px rgba(0,0,0,0.1),
+               0 1px 2px rgba(0,0,0,0.5);
 }

 /* OSD */
@ -745,9 +744,8 @@ StScrollBar {
    spacing: 8px;
  }

-  .ws-switcher-active-up, .ws-switcher-active-down,
-  .ws-switcher-active-left, .ws-switcher-active-right {
-    height: 52px;
+  .ws-switcher-active-up, .ws-switcher-active-down {
+    height: 50px;
    background-color: $selected_bg_color;
    color: $selected_fg_color;
    background-size: 32px;
@ -947,7 +945,7 @@ StScrollBar {
    .world-clocks-button,
    .weather-button,
    .events-section-title {
-      &:hover, &:focus { background-color: $_hover_bg_color }
+      &:hover, focus { background-color: $_hover_bg_color }
      &:active { background-color: $_active_bg_color }
    }

@ -977,7 +975,6 @@ StScrollBar {
      spacing-columns: 0.8em;
    }

-    .weather-header-box,
    .weather-box {
      spacing: 0.4em;
    }
@ -1019,7 +1016,7 @@ StScrollBar {
      background-color: transparent;
      width: 32px;
      border-radius: 4px;
-      &:hover, &:focus { background-color: $_hover_bg_color; }
+      &:hover, focus { background-color: $_hover_bg_color; }
      &:active { background-color: transparentize($fg_color, 0.84); }
    }

@ -1035,7 +1032,7 @@ StScrollBar {
      margin: 2px;
      border-radius: 1.4em;
      font-feature-settings: "tnum";
-      &:hover, &:focus { background-color: $_hover_bg_color; }
+      &:hover, focus { background-color: $_hover_bg_color; }
      &:active,&:selected {
        color: lighten($selected_fg_color,5%);
        background-color: $selected_bg_color;
@ -1060,9 +1057,9 @@ StScrollBar {
      }
      .calendar-today {
        font-weight: bold;
-        color: lighten($fg_color,5%);
-        background-color: darken($bg_color,5%);
-        // border: 1px solid lighten($_bubble_borders_color,20%);
+        //color: lighten($fg_color,10%);
+        //background-color: darken($bg_color,5%);
+        border: 1px solid $_bubble_borders_color;
      }
      .calendar-day-with-events {
        color: lighten($fg_color,10%);
@ -1152,21 +1149,14 @@ StScrollBar {
            padding: 10px;
          }

-          .message-close-button {
-            color: lighten($fg_color, 15%);
-            &:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
-            &:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
-          }
-
          .message-media-control {
            padding: 12px;
            color: lighten($fg_color, 15%);

            &:last-child:ltr { padding-right: 18px; }
            &:last-child:rtl { padding-left: 18px; }
-            &:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
-            &:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
-            &:insensitive { color: if($variant=='light', lighten($fg_color, 50%), darken($fg_color, 40%)); }
+            &:hover { color: $fg_color; }
+            &:insensitive { color: darken($fg_color,40%); }
          }

          .media-message-cover-icon {
@ -1184,6 +1174,7 @@ StScrollBar {
  // a little unstructured mess:

  #appMenu {
+    spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg");
    spacing: 4px;

    .label-shadow { color: transparent; }
@ -1196,8 +1187,7 @@ StScrollBar {

  .aggregate-menu {
    min-width: 21em;
-    .popup-menu-icon { padding: 0 4px;
-                       -st-icon-style: symbolic; }
+    .popup-menu-icon { padding: 0 4px; }
    .popup-sub-menu .popup-menu-item > :first-child {
      &:ltr { /* 12px spacing + 2*4px padding */
              padding-left: 20px; margin-left: 1.09em; }
@ -1206,6 +1196,27 @@ StScrollBar {
    }
  }

+  .system-menu-action {
+    -st-icon-style: symbolic;
+    color: $fg_color;
+    border-radius: 32px; /* wish we could do 50% */
+    padding: 13px;
+    border: 1px solid $_bubble_borders_color;
+
+    &:hover, &:focus {
+      background-color: $_hover_bg_color;
+      color: $fg_color;
+      border: none;
+      padding: 14px;
+    }
+    &:active { 
+      background-color: $selected_bg_color;
+      color: $selected_fg_color;
+    }
+
+    & > StIcon { icon-size: 16px; }
+  }
+
 // Activities Ripples
 .ripple-box {
  width: 52px;
@ -1507,9 +1518,6 @@ StScrollBar {
      border-image: none;
      background-image: none;
    }
-    &:drop .overview-icon {
-      background-color: transparentize($selected_bg_color,.15);
-    }
    &:active .overview-icon,
    &:checked .overview-icon {
      background-color: transparentize(darken($osd_bg_color,10%), 0.5);
@ -1557,14 +1565,20 @@ StScrollBar {
  }

  .page-indicator {
-    padding: 7px 16px;
+    padding: 15px 20px;

    .page-indicator-icon {
      width: 12px;
      height: 12px;
-      background-color: white;
-      border-radius: 6px;
+      background-color: transparent;
+      border: 2px solid rgba(255, 255, 255, 0.4);
+      border-radius: 12px;
    }
+
+    &:hover .page-indicator-icon { border-color: white; }
+    &:active .page-indicator-icon { border: none; margin: 2px; background-color: white; }
+    &:checked .page-indicator-icon,
+    &:checked:active .page-indicator-icon { background-color: white;}
  }

  .no-frequent-applications-label { @extend %status_text; }
@ -1764,8 +1778,8 @@ StScrollBar {
        padding: 4px 4px;

        .page-indicator-icon {
-            width: 8px;
-            height: 8px;
+            width: 6px;
+            height: 6px
        }
    }
 }
--- a/docs/reference/shell/meson.build
+++ b/docs/reference/shell/meson.build
@ -28,7 +28,7 @@ foreach iface : ifaces
    output: 'doc-gen-' + iface[1],
    command: [
      'gdbus-codegen',
-      '--interface-prefix=@0@.'.format(iface[0]),
+      '--interface-prefix=@0@.'.format(iface),
      '--generate-docbook', 'doc-gen',
      '--output-directory', '@OUTDIR@',
      '@INPUT@'
--- a/gnome-shell.doap
+++ b/gnome-shell.doap
@ -31,34 +31,34 @@ its dependencies to build from tarballs.</description>
  <programming-language>JavaScript</programming-language>
  <programming-language>C</programming-language>

-  <author>
+  <maintainer>
    <foaf:Person>
      <foaf:name>William Jon McCann</foaf:name>
      <foaf:mbox rdf:resource="mailto:jmccann@redhat.com" />
      <gnome:userid>mccann</gnome:userid>
    </foaf:Person>
-  </author>
-  <author>
+  </maintainer>
+  <maintainer>
    <foaf:Person>
      <foaf:name>Owen Taylor</foaf:name>
      <foaf:mbox rdf:resource="mailto:otaylor@redhat.com" />
      <gnome:userid>otaylor</gnome:userid>
    </foaf:Person>
-  </author>
-  <author>
+  </maintainer>
+  <maintainer>
    <foaf:Person>
      <foaf:name>Colin Walters</foaf:name>
      <foaf:mbox rdf:resource="mailto:walters@verbum.org" />
      <gnome:userid>walters</gnome:userid>
    </foaf:Person>
-  </author>
-  <author>
+  </maintainer>
+  <maintainer>
    <foaf:Person>
      <foaf:name>Marina Zhurakhinskaya</foaf:name>
      <foaf:mbox rdf:resource="mailto:marinaz@redhat.com" />
      <gnome:userid>marinaz</gnome:userid>
    </foaf:Person>
-  </author>
+  </maintainer>
  <maintainer>
    <foaf:Person>
      <foaf:name>Florian Müllner</foaf:name>
--- a/js/extensionPrefs/main.js
+++ b/js/extensionPrefs/main.js
@ -1,7 +1,3 @@
-/* exported main */
-imports.gi.versions.Gdk = '3.0';
-imports.gi.versions.Gtk = '3.0';
-
 const Gettext = imports.gettext;
 const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi;
 const Format = imports.format;
@ -12,8 +8,6 @@ const Config = imports.misc.config;
 const ExtensionUtils = imports.misc.extensionUtils;
 const { loadInterfaceXML } = imports.misc.fileUtils;

-const { ExtensionState } = ExtensionUtils;
-
 const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions');
 const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface);

@ -23,53 +17,74 @@ function stripPrefix(string, prefix) {
    return string;
 }

-var Application = GObject.registerClass(
-class Application extends Gtk.Application {
-    _init() {
+var Application = class {
+    constructor() {
        GLib.set_prgname('gnome-shell-extension-prefs');
-        super._init({
+        this.application = new Gtk.Application({
            application_id: 'org.gnome.shell.ExtensionPrefs',
-            flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE,
+            flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
        });

+        this.application.connect('activate', this._onActivate.bind(this));
+        this.application.connect('command-line', this._onCommandLine.bind(this));
+        this.application.connect('startup', this._onStartup.bind(this));
+
+        this._extensionPrefsModules = {};
+
        this._startupUuid = null;
        this._loaded = false;
        this._skipMainWindow = false;
-        this._shellProxy = null;
    }

-    get shellProxy() {
-        return this._shellProxy;
-    }
+    _extensionAvailable(uuid) {
+        let extension = ExtensionUtils.extensions[uuid];

-    _showPrefs(uuid) {
-        let row = this._extensionSelector.get_children().find(c => {
-            return c.uuid === uuid && c.hasPrefs;
-        });
-
-        if (!row)
+        if (!extension)
            return false;

+        if (!extension.dir.get_child('prefs.js').query_exists(null))
+            return false;
+
+        return true;
+    }
+
+    _getExtensionPrefsModule(extension) {
+        let uuid = extension.metadata.uuid;
+
+        if (this._extensionPrefsModules.hasOwnProperty(uuid))
+            return this._extensionPrefsModules[uuid];
+
+        ExtensionUtils.installImporter(extension);
+
+        let prefsModule = extension.imports.prefs;
+        prefsModule.init(extension.metadata);
+
+        this._extensionPrefsModules[uuid] = prefsModule;
+        return prefsModule;
+    }
+
+    _selectExtension(uuid) {
+        if (!this._extensionAvailable(uuid))
+            return;
+
+        let extension = ExtensionUtils.extensions[uuid];
        let widget;

        try {
-            widget = row.prefsModule.buildPrefsWidget();
+            let prefsModule = this._getExtensionPrefsModule(extension);
+            widget = prefsModule.buildPrefsWidget();
        } catch (e) {
-            widget = this._buildErrorUI(row, e);
+            widget = this._buildErrorUI(extension, e);
        }

-        let dialog = new Gtk.Window({
-            modal: !this._skipMainWindow,
-            type_hint: Gdk.WindowTypeHint.DIALOG,
-        });
-        dialog.set_titlebar(new Gtk.HeaderBar({
-            show_close_button: true,
-            title: row.name,
-            visible: true,
-        }));
+        let dialog = new Gtk.Window({ modal: !this._skipMainWindow,
+                                      type_hint: Gdk.WindowTypeHint.DIALOG });
+        dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true,
+                                                title: extension.metadata.name,
+                                                visible: true }));

        if (this._skipMainWindow) {
-            this.add_window(dialog);
+            this.application.add_window(dialog);
            if (this._window)
                this._window.destroy();
            this._window = dialog;
@ -81,27 +96,25 @@ class Application extends Gtk.Application {
        dialog.set_default_size(600, 400);
        dialog.add(widget);
        dialog.show();
-
-        return true;
    }

-    _buildErrorUI(row, exc) {
+    _buildErrorUI(extension, exc) {
        let scroll = new Gtk.ScrolledWindow({
            hscrollbar_policy: Gtk.PolicyType.NEVER,
-            propagate_natural_height: true,
+            propagate_natural_height: true
        });

        let box = new Gtk.Box({
            orientation: Gtk.Orientation.VERTICAL,
            spacing: 12,
            margin: 100,
-            margin_bottom: 60,
+            margin_bottom: 60
        });
        scroll.add(box);

        let label = new Gtk.Label({
            label: '<span size="x-large">%s</span>'.format(_("Something’s gone wrong")),
-            use_markup: true,
+            use_markup: true
        });
        label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
        box.add(label);
@ -109,13 +122,13 @@ class Application extends Gtk.Application {
        label = new Gtk.Label({
            label: _("We’re very sorry, but there’s been a problem: the settings for this extension can’t be displayed. We recommend that you report the issue to the extension authors."),
            justify: Gtk.Justification.CENTER,
-            wrap: true,
+            wrap: true
        });
        box.add(label);

        let expander = new Expander({
            label: _("Technical Details"),
-            margin_top: 12,
+            margin_top: 12
        });
        box.add(expander);

@ -126,14 +139,14 @@ class Application extends Gtk.Application {

        let buffer = new Gtk.TextBuffer({ text: errortext });
        let textview = new Gtk.TextView({
-            buffer,
+            buffer: buffer,
            wrap_mode: Gtk.WrapMode.WORD,
            monospace: true,
            editable: false,
            top_margin: 12,
            bottom_margin: 12,
            left_margin: 12,
-            right_margin: 12,
+            right_margin: 12
        });

        let toolbar = new Gtk.Toolbar();
@ -149,7 +162,7 @@ class Application extends Gtk.Application {

        let copyButton = new Gtk.ToolButton({
            icon_name: 'edit-copy-symbolic',
-            tooltip_text: _("Copy Error"),
+            tooltip_text: _("Copy Error")
        });
        toolbar.add(copyButton);

@ -157,16 +170,16 @@ class Application extends Gtk.Application {
            let clipboard = Gtk.Clipboard.get_default(w.get_display());
            // markdown for pasting in gitlab issues
            let lines = [
-                `The settings of extension ${row.uuid} had an error:`,
-                '```', // '`' (xgettext throws up on odd number of backticks)
+                `The settings of extension ${extension.uuid} had an error:`,
+                '```',
                `${exc}`,
-                '```', // '`'
+                '```',
                '',
                'Stack trace:',
-                '```', // '`'
+                '```',
                exc.stack.replace(/\n$/, ''), // stack without trailing newline
-                '```', // '`'
-                '',
+                '```',
+                ''
            ];
            clipboard.set_text(lines.join('\n'), -1);
        });
@ -179,17 +192,17 @@ class Application extends Gtk.Application {
            label: _("Homepage"),
            tooltip_text: _("Visit extension homepage"),
            no_show_all: true,
-            visible: row.url != null,
+            visible: extension.metadata.url != null
        });
        toolbar.add(urlButton);

        urlButton.connect('clicked', w => {
            let context = w.get_display().get_app_launch_context();
-            Gio.AppInfo.launch_default_for_uri(row.url, context);
+            Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context);
        });

        let expandedBox = new Gtk.Box({
-            orientation: Gtk.Orientation.VERTICAL,
+            orientation: Gtk.Orientation.VERTICAL
        });
        expandedBox.add(textview);
        expandedBox.add(toolbar);
@ -200,8 +213,8 @@ class Application extends Gtk.Application {
        return scroll;
    }

-    _buildUI() {
-        this._window = new Gtk.ApplicationWindow({ application: this,
+    _buildUI(app) {
+        this._window = new Gtk.ApplicationWindow({ application: app,
                                                   window_position: Gtk.WindowPosition.CENTER });

        this._window.set_default_size(800, 500);
@ -219,7 +232,7 @@ class Application extends Gtk.Application {
                            Gio.SettingsBindFlags.INVERT_BOOLEAN);

        this._mainStack = new Gtk.Stack({
-            transition_type: Gtk.StackTransitionType.CROSSFADE,
+            transition_type: Gtk.StackTransitionType.CROSSFADE
        });
        this._window.add(this._mainStack);

@ -235,14 +248,18 @@ class Application extends Gtk.Application {
        this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder');

        this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell');
-        this._shellProxy.connectSignal('ExtensionStateChanged',
-            this._onExtensionStateChanged.bind(this));
+        this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => {
+            if (ExtensionUtils.extensions[uuid] !== undefined)
+                this._scanExtensions();
+        });

        this._window.show_all();
    }

    _sortList(row1, row2) {
-        return row1.name.localeCompare(row2.name);
+        let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name;
+        let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name;
+        return name1.localeCompare(name2);
    }

    _updateHeader(row, before) {
@ -253,48 +270,19 @@ class Application extends Gtk.Application {
        row.set_header(sep);
    }

-    _findExtensionRow(uuid) {
-        return this._extensionSelector.get_children().find(c => c.uuid === uuid);
-    }
-
-    _onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
-        let extension = ExtensionUtils.deserializeExtension(newState);
-        let row = this._findExtensionRow(uuid);
-
-        if (row) {
-            if (extension.state === ExtensionState.UNINSTALLED)
-                row.destroy();
-            return; // we only deal with new and deleted extensions here
-        }
-        this._addExtensionRow(extension);
-    }
-
    _scanExtensions() {
-        this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => {
-            if (e) {
-                if (e instanceof Gio.DBusError) {
-                    log(`Failed to connect to shell proxy: ${e}`);
-                    this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
-                    this._mainStack.visible_child_name = 'noshell';
-                } else {
-                    throw e;
-                }
-                return;
-            }
-
-            for (let uuid in extensionsMap) {
-                let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]);
-                this._addExtensionRow(extension);
-            }
-            this._extensionsLoaded();
-        });
+        let finder = new ExtensionUtils.ExtensionFinder();
+        finder.connect('extension-found', this._extensionFound.bind(this));
+        finder.scanExtensions();
+        this._extensionsLoaded();
    }

-    _addExtensionRow(extension) {
-        let row = new ExtensionRow(extension);
+    _extensionFound(finder, extension) {
+        let row = new ExtensionRow(extension.uuid);

+        row.prefsButton.visible = this._extensionAvailable(row.uuid);
        row.prefsButton.connect('clicked', () => {
-            this._showPrefs(row.uuid);
+            this._selectExtension(row.uuid);
        });

        row.show_all();
@ -307,26 +295,24 @@ class Application extends Gtk.Application {
        else
            this._mainStack.visible_child_name = 'placeholder';

-        if (this._startupUuid)
-            this._showPrefs(this._startupUuid);
+        if (this._startupUuid && this._extensionAvailable(this._startupUuid))
+            this._selectExtension(this._startupUuid);
        this._startupUuid = null;
        this._skipMainWindow = false;
        this._loaded = true;
    }

-    vfunc_activate() {
+    _onActivate() {
        this._window.present();
    }

-    vfunc_startup() {
-        super.vfunc_startup();
-
-        this._buildUI();
+    _onStartup(app) {
+        this._buildUI(app);
        this._scanExtensions();
    }

-    vfunc_command_line(commandLine) {
-        this.activate();
+    _onCommandLine(app, commandLine) {
+        app.activate();
        let args = commandLine.get_arguments();

        if (args.length) {
@ -337,14 +323,16 @@ class Application extends Gtk.Application {
            // Strip off "extension:///" prefix which fakes a URI, if it exists
            uuid = stripPrefix(uuid, "extension:///");

-            if (!this._loaded)
+            if (this._extensionAvailable(uuid))
+                this._selectExtension(uuid);
+            else if (!this._loaded)
                this._startupUuid = uuid;
-            else if (!this._showPrefs(uuid))
+            else
                this._skipMainWindow = false;
        }
        return 0;
    }
-});
+};

 var Expander = GObject.registerClass({
    Properties: {
@ -352,20 +340,20 @@ var Expander = GObject.registerClass({
            'label', 'label', 'label',
            GObject.ParamFlags.READWRITE,
            null
-        ),
-    },
+        )
+    }
 }, class Expander extends Gtk.Box {
    _init(params = {}) {
        this._labelText = null;

        super._init(Object.assign(params, {
            orientation: Gtk.Orientation.VERTICAL,
-            spacing: 0,
+            spacing: 0
        }));

        this._frame = new Gtk.Frame({
            shadow_type: Gtk.ShadowType.IN,
-            hexpand: true,
+            hexpand: true
        });

        let eventBox = new Gtk.EventBox();
@ -373,12 +361,12 @@ var Expander = GObject.registerClass({

        let hbox = new Gtk.Box({
            spacing: 6,
-            margin: 12,
+            margin: 12
        });
        eventBox.add(hbox);

        this._arrow = new Gtk.Image({
-            icon_name: 'pan-end-symbolic',
+            icon_name: 'pan-end-symbolic'
        });
        hbox.add(this._arrow);

@ -388,7 +376,7 @@ var Expander = GObject.registerClass({
        this._revealer = new Gtk.Revealer();

        this._childBin = new Gtk.Frame({
-            shadow_type: Gtk.ShadowType.IN,
+            shadow_type: Gtk.ShadowType.IN
        });
        this._revealer.add(this._childBin);

@ -406,7 +394,7 @@ var Expander = GObject.registerClass({
        this._gesture = new Gtk.GestureMultiPress({
            widget: this._frame,
            button: 0,
-            exclusive: true,
+            exclusive: true
        });
        this._gesture.connect('released', (gesture, nPress) => {
            if (nPress == 1)
@ -451,7 +439,7 @@ class EmptyPlaceholder extends Gtk.Box {
        super._init({
            orientation: Gtk.Orientation.VERTICAL,
            spacing: 6,
-            margin: 32,
+            margin: 32
        });

        let image = new Gtk.Image({
@ -459,15 +447,15 @@ class EmptyPlaceholder extends Gtk.Box {
            pixel_size: 96,
            visible: true,
            vexpand: true,
-            valign: Gtk.Align.END,
+            valign: Gtk.Align.END
        });
        image.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
        this.add(image);

        let label = new Gtk.Label({
-            label: `<b><span size="x-large">${_("No Extensions Installed")}</span></b>`,
+            label: `<b><span size="x-large">${_("No Extensions Installed" )}</span></b>`,
            use_markup: true,
-            visible: true,
+            visible: true
        });
        label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
        this.add(label);
@ -482,9 +470,9 @@ class EmptyPlaceholder extends Gtk.Box {
            visible: true,
            max_width_chars: 50,
            hexpand: true,
-            vexpand: appInfo == null,
+            vexpand: (appInfo == null),
            halign: Gtk.Align.CENTER,
-            valign: Gtk.Align.START,
+            valign: Gtk.Align.START
        });
        this.add(desc);

@ -492,14 +480,14 @@ class EmptyPlaceholder extends Gtk.Box {
            let button = new Gtk.Button({
                label: _("Browse in Software"),
                image: new Gtk.Image({
-                    icon_name: "org.gnome.Software-symbolic",
+                    icon_name: "org.gnome.Software-symbolic"
                }),
                always_show_image: true,
                margin_top: 12,
                visible: true,
                halign: Gtk.Align.CENTER,
                valign: Gtk.Align.START,
-                vexpand: true,
+                vexpand: true
            });
            this.add(button);

@ -511,35 +499,6 @@ class EmptyPlaceholder extends Gtk.Box {
    }
 });

-var NoShellPlaceholder = GObject.registerClass(
-class NoShellPlaceholder extends Gtk.Box {
-    _init() {
-        super._init({
-            orientation: Gtk.Orientation.VERTICAL,
-            spacing: 12,
-            margin: 100,
-            margin_bottom: 60,
-        });
-
-        let label = new Gtk.Label({
-            label: '<span size="x-large">%s</span>'.format(
-                _("Something’s gone wrong")),
-            use_markup: true,
-        });
-        label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
-        this.add(label);
-
-        label = new Gtk.Label({
-            label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
-            justify: Gtk.Justification.CENTER,
-            wrap: true,
-        });
-        this.add(label);
-
-        this.show_all();
-    }
-});
-
 var DescriptionLabel = GObject.registerClass(
 class DescriptionLabel extends Gtk.Label {
    vfunc_get_preferred_height_for_width(width) {
@ -552,59 +511,30 @@ class DescriptionLabel extends Gtk.Label {

 var ExtensionRow = GObject.registerClass(
 class ExtensionRow extends Gtk.ListBoxRow {
-    _init(extension) {
+    _init(uuid) {
        super._init();

-        this._app = Gio.Application.get_default();
-        this._extension = extension;
-        this._prefsModule = null;
+        this.uuid = uuid;

-        this.connect('destroy', this._onDestroy.bind(this));
+        this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' });
+        this._settings.connect('changed::enabled-extensions', () => {
+            this._switch.state = this._isEnabled();
+        });
+        this._settings.connect('changed::disable-extension-version-validation',
+            () => {
+                this._switch.sensitive = this._canEnable();
+            });
+        this._settings.connect('changed::disable-user-extensions',
+            () => {
+                this._switch.sensitive = this._canEnable();
+            });

        this._buildUI();
-
-        this._extensionStateChangedId = this._app.shellProxy.connectSignal(
-            'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
-                if (this.uuid !== uuid)
-                    return;
-
-                this._extension = ExtensionUtils.deserializeExtension(newState);
-                let state = this._extension.state == ExtensionState.ENABLED;
-
-                this._switch.block_signal_handler(this._notifyActiveId);
-                this._switch.state = state;
-                this._switch.unblock_signal_handler(this._notifyActiveId);
-
-                this._switch.sensitive = this._canToggle();
-            });
-    }
-
-    get uuid() {
-        return this._extension.uuid;
-    }
-
-    get name() {
-        return this._extension.metadata.name;
-    }
-
-    get hasPrefs() {
-        return this._extension.hasPrefs;
-    }
-
-    get url() {
-        return this._extension.metadata.url;
-    }
-
-    _onDestroy() {
-        if (!this._app.shellProxy)
-            return;
-
-        if (this._extensionStateChangedId)
-            this._app.shellProxy.disconnectSignal(this._extensionStateChangedId);
-        this._extensionStateChangedId = 0;
    }

    _buildUI() {
+        let extension = ExtensionUtils.extensions[this.uuid];
+
        let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL,
                                 hexpand: true, margin_end: 24, spacing: 24,
                                 margin: 12 });
@ -614,20 +544,19 @@ class ExtensionRow extends Gtk.ListBoxRow {
                                 spacing: 6, hexpand: true });
        hbox.add(vbox);

-        let name = GLib.markup_escape_text(this.name, -1);
+        let name = GLib.markup_escape_text(extension.metadata.name, -1);
        let label = new Gtk.Label({ label: '<b>' + name + '</b>',
                                    use_markup: true,
                                    halign: Gtk.Align.START });
        vbox.add(label);

-        let desc = this._extension.metadata.description.split('\n')[0];
+        let desc = extension.metadata.description.split('\n')[0];
        label = new DescriptionLabel({ label: desc, wrap: true, lines: 2,
                                       ellipsize: Pango.EllipsizeMode.END,
                                       xalign: 0, yalign: 0 });
        vbox.add(label);

        let button = new Gtk.Button({ valign: Gtk.Align.CENTER,
-                                      visible: this.hasPrefs,
                                      no_show_all: true });
        button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic',
                                         icon_size: Gtk.IconSize.BUTTON,
@ -637,37 +566,51 @@ class ExtensionRow extends Gtk.ListBoxRow {

        this.prefsButton = button;

-        this._switch = new Gtk.Switch({
-            valign: Gtk.Align.CENTER,
-            sensitive: this._canToggle(),
-            state: this._extension.state === ExtensionState.ENABLED,
-        });
-        this._notifyActiveId = this._switch.connect('notify::active', () => {
+        this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER,
+                                        sensitive: this._canEnable(),
+                                        state: this._isEnabled() });
+        this._switch.connect('notify::active', () => {
            if (this._switch.active)
-                this._app.shellProxy.EnableExtensionRemote(this.uuid);
+                this._enable();
            else
-                this._app.shellProxy.DisableExtensionRemote(this.uuid);
+                this._disable();
        });
        this._switch.connect('state-set', () => true);
        hbox.add(this._switch);
    }

-    _canToggle() {
-        return this._extension.canChange;
+    _canEnable() {
+        let extension = ExtensionUtils.extensions[this.uuid];
+        let checkVersion = !this._settings.get_boolean('disable-extension-version-validation');
+
+        return !this._settings.get_boolean('disable-user-extensions') &&
+               !(checkVersion && ExtensionUtils.isOutOfDate(extension));
    }

-    get prefsModule() {
-        // give extension prefs access to their own extension object
-        ExtensionUtils.getCurrentExtension = () => this._extension;
+    _isEnabled() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        return extensions.includes(this.uuid);
+    }

-        if (!this._prefsModule) {
-            ExtensionUtils.installImporter(this._extension);
+    _enable() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        if (extensions.includes(this.uuid))
+            return;

-            this._prefsModule = this._extension.imports.prefs;
-            this._prefsModule.init(this._extension.metadata);
-        }
+        extensions.push(this.uuid);
+        this._settings.set_strv('enabled-extensions', extensions);
+    }

-        return this._prefsModule;
+    _disable() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        let pos = extensions.indexOf(this.uuid);
+        if (pos == -1)
+            return;
+        do {
+            extensions.splice(pos, 1);
+            pos = extensions.indexOf(this.uuid);
+        } while (pos != -1);
+        this._settings.set_strv('enabled-extensions', extensions);
    }
 });

@ -683,7 +626,7 @@ function initEnvironment() {
            log(`ERROR: ${s}`);
        },

-        userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell']),
+        userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell'])
    };

    String.prototype.format = Format.format;
@ -695,5 +638,6 @@ function main(argv) {
    Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR);
    Gettext.textdomain(Config.GETTEXT_PACKAGE);

-    new Application().run(argv);
+    let app = new Application();
+    app.application.run(argv);
 }
--- a/js/gdm/authPrompt.js
+++ b/js/gdm/authPrompt.js
@ -1,58 +1,41 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported AuthPrompt */

-const { Clutter, GObject, Pango, Shell, St } = imports.gi;
+const { Clutter, Pango, Shell, St } = imports.gi;
+const Signals = imports.signals;

 const Animation = imports.ui.animation;
 const Batch = imports.gdm.batch;
 const GdmUtil = imports.gdm.util;
-const Util = imports.misc.util;
 const Params = imports.misc.params;
 const ShellEntry = imports.ui.shellEntry;
+const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;

 var DEFAULT_BUTTON_WELL_ICON_SIZE = 16;
-var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000;
-var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
+var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0;
+var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3;

-var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
-
-const WIGGLE_OFFSET = 6;
-const WIGGLE_DURATION = 65;
-const N_WIGGLES = 3;
+var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5;

 var AuthPromptMode = {
    UNLOCK_ONLY: 0,
-    UNLOCK_OR_LOG_IN: 1,
+    UNLOCK_OR_LOG_IN: 1
 };

 var AuthPromptStatus = {
    NOT_VERIFYING: 0,
    VERIFYING: 1,
    VERIFICATION_FAILED: 2,
-    VERIFICATION_SUCCEEDED: 3,
+    VERIFICATION_SUCCEEDED: 3
 };

 var BeginRequestType = {
    PROVIDE_USERNAME: 0,
-    DONT_PROVIDE_USERNAME: 1,
+    DONT_PROVIDE_USERNAME: 1
 };

-var AuthPrompt = GObject.registerClass({
-    Signals: {
-        'cancelled': {},
-        'failed': {},
-        'next': {},
-        'prompted': {},
-        'reset': { param_types: [GObject.TYPE_UINT] },
-    },
-}, class AuthPrompt extends St.BoxLayout {
-    _init(gdmClient, mode) {
-        super._init({
-            style_class: 'login-dialog-prompt-layout',
-            vertical: true,
-        });
-
+var AuthPrompt = class {
+    constructor(gdmClient, mode) {
        this.verificationStatus = AuthPromptStatus.NOT_VERIFYING;

        this._gdmClient = gdmClient;
@ -64,7 +47,7 @@ var AuthPrompt = GObject.registerClass({
        else if (this._mode == AuthPromptMode.UNLOCK_OR_LOG_IN)
            reauthenticationOnly = false;

-        this._userVerifier = new GdmUtil.ShellUserVerifier(this._gdmClient, { reauthenticationOnly });
+        this._userVerifier = new GdmUtil.ShellUserVerifier(this._gdmClient, { reauthenticationOnly: reauthenticationOnly });

        this._userVerifier.connect('ask-question', this._onAskQuestion.bind(this));
        this._userVerifier.connect('show-message', this._onShowMessage.bind(this));
@ -78,68 +61,70 @@ var AuthPrompt = GObject.registerClass({
        this.connect('next', () => {
            this.updateSensitivity(false);
            this.startSpinning();
-            if (this._queryingService)
+            if (this._queryingService) {
                this._userVerifier.answerQuery(this._queryingService, this._entry.text);
-            else
+            } else {
                this._preemptiveAnswer = this._entry.text;
+            }
        });

-        this.connect('destroy', this._onDestroy.bind(this));
-
-        this._userWell = new St.Bin({
-            x_expand: true,
-            y_expand: true,
-        });
-        this.add_child(this._userWell);
-        this._label = new St.Label({
-            style_class: 'login-dialog-prompt-label',
-            x_expand: false,
-            y_expand: true,
+        this.actor = new St.BoxLayout({ style_class: 'login-dialog-prompt-layout',
+                                        vertical: true });
+        this.actor.connect('destroy', this._onDestroy.bind(this));
+        this.actor.connect('key-press-event', (actor, event) => {
+            if (event.get_key_symbol() == Clutter.KEY_Escape)
+                this.cancel();
+            return Clutter.EVENT_PROPAGATE;
        });

-        this.add_child(this._label);
-        this._entry = new St.Entry({
-            style_class: 'login-dialog-prompt-entry',
-            can_focus: true,
-            x_expand: false,
-            y_expand: true,
-        });
+        this._userWell = new St.Bin({ x_fill: true,
+                                      x_align: St.Align.START });
+        this.actor.add(this._userWell,
+                       { x_align: St.Align.START,
+                         x_fill: true,
+                         y_fill: true,
+                         expand: true });
+        this._label = new St.Label({ style_class: 'login-dialog-prompt-label' });
+
+        this.actor.add(this._label,
+                       { expand: true,
+                         x_fill: false,
+                         y_fill: true,
+                         x_align: St.Align.START });
+        this._entry = new St.Entry({ style_class: 'login-dialog-prompt-entry',
+                                     can_focus: true });
        ShellEntry.addContextMenu(this._entry, { isPassword: true, actionMode: Shell.ActionMode.NONE });

-        this.add_child(this._entry);
+        this.actor.add(this._entry,
+                       { expand: true,
+                         x_fill: true,
+                         y_fill: false,
+                         x_align: St.Align.START });

        this._entry.grab_key_focus();

-        this._message = new St.Label({
-            opacity: 0,
-            styleClass: 'login-dialog-message',
-            x_expand: false,
-            y_expand: true,
-            y_align: Clutter.ActorAlign.START,
-        });
+        this._message = new St.Label({ opacity: 0,
+                                       styleClass: 'login-dialog-message' });
        this._message.clutter_text.line_wrap = true;
        this._message.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
-        this.add_child(this._message);
+        this.actor.add(this._message, { x_fill: false, x_align: St.Align.START, y_align: St.Align.START });

-        this._buttonBox = new St.BoxLayout({
-            style_class: 'login-dialog-button-box',
-            vertical: false,
-            y_align: Clutter.ActorAlign.END,
-        });
-        this.add_child(this._buttonBox);
+        this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box',
+                                             vertical: false });
+        this.actor.add(this._buttonBox,
+                       { expand: true,
+                         x_align: St.Align.MIDDLE,
+                         y_align: St.Align.END });

-        this._defaultButtonWell = new St.Widget({
-            layout_manager: new Clutter.BinLayout(),
-            x_align: Clutter.ActorAlign.END,
-            y_align: Clutter.ActorAlign.CENTER,
-        });
+        this._defaultButtonWell = new St.Widget({ layout_manager: new Clutter.BinLayout() });
+        this._defaultButtonWellActor = null;

        this._initButtons();

        this._spinner = new Animation.Spinner(DEFAULT_BUTTON_WELL_ICON_SIZE);
-        this._spinner.opacity = 0;
-        this._spinner.show();
-        this._defaultButtonWell.add_child(this._spinner);
+        this._spinner.actor.opacity = 0;
+        this._spinner.actor.show();
+        this._defaultButtonWell.add_child(this._spinner.actor);
    }

    _onDestroy() {
@ -147,39 +132,39 @@ var AuthPrompt = GObject.registerClass({
        this._userVerifier = null;
    }

-    vfunc_key_press_event(keyPressEvent) {
-        if (keyPressEvent.keyval == Clutter.KEY_Escape)
-            this.cancel();
-        return Clutter.EVENT_PROPAGATE;
-    }
-
    _initButtons() {
-        this.cancelButton = new St.Button({
-            style_class: 'modal-dialog-button button',
-            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-            reactive: true,
-            can_focus: true,
-            label: _("Cancel"),
-            x_expand: true,
-            x_align: Clutter.ActorAlign.START,
-            y_align: Clutter.ActorAlign.END,
-        });
+        this.cancelButton = new St.Button({ style_class: 'modal-dialog-button button',
+                                            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
+                                            reactive: true,
+                                            can_focus: true,
+                                            label: _("Cancel") });
        this.cancelButton.connect('clicked', () => this.cancel());
-        this._buttonBox.add_child(this.cancelButton);
+        this._buttonBox.add(this.cancelButton,
+                            { expand: false,
+                              x_fill: false,
+                              y_fill: false,
+                              x_align: St.Align.START,
+                              y_align: St.Align.END });

-        this._buttonBox.add_child(this._defaultButtonWell);
-        this.nextButton = new St.Button({
-            style_class: 'modal-dialog-button button',
-            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-            reactive: true,
-            can_focus: true,
-            label: _("Next"),
-            x_align: Clutter.ActorAlign.END,
-            y_align: Clutter.ActorAlign.END,
-        });
+        this._buttonBox.add(this._defaultButtonWell,
+                            { expand: true,
+                              x_fill: false,
+                              y_fill: false,
+                              x_align: St.Align.END,
+                              y_align: St.Align.MIDDLE });
+        this.nextButton = new St.Button({ style_class: 'modal-dialog-button button',
+                                          button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
+                                          reactive: true,
+                                          can_focus: true,
+                                          label: _("Next") });
        this.nextButton.connect('clicked', () => this.emit('next'));
        this.nextButton.add_style_pseudo_class('default');
-        this._buttonBox.add_child(this.nextButton);
+        this._buttonBox.add(this.nextButton,
+                            { expand: false,
+                              x_fill: false,
+                              y_fill: false,
+                              x_align: St.Align.END,
+                              y_align: St.Align.END });

        this._updateNextButtonSensitivity(this._entry.text.length > 0);

@ -257,12 +242,6 @@ var AuthPrompt = GObject.registerClass({
        this.updateSensitivity(canRetry);
        this.setActorInDefaultButtonWell(null);
        this.verificationStatus = AuthPromptStatus.VERIFICATION_FAILED;
-
-        Util.wiggle(this._entry, {
-            offset: WIGGLE_OFFSET,
-            duration: WIGGLE_DURATION,
-            wiggleCount: N_WIGGLES,
-        });
    }

    _onVerificationComplete() {
@ -288,16 +267,16 @@ var AuthPrompt = GObject.registerClass({
        let oldActor = this._defaultButtonWellActor;

        if (oldActor)
-            oldActor.remove_all_transitions();
+            Tweener.removeTweens(oldActor);

        let wasSpinner;
-        if (oldActor == this._spinner)
+        if (oldActor == this._spinner.actor)
            wasSpinner = true;
        else
            wasSpinner = false;

        let isSpinner;
-        if (actor == this._spinner)
+        if (actor == this._spinner.actor)
            isSpinner = true;
        else
            isSpinner = false;
@ -311,18 +290,18 @@ var AuthPrompt = GObject.registerClass({
                        this._spinner.stop();
                }
            } else {
-                oldActor.ease({
-                    opacity: 0,
-                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                    mode: Clutter.AnimationMode.LINEAR,
-                    onComplete: () => {
-                        if (wasSpinner) {
-                            if (this._spinner)
-                                this._spinner.stop();
-                        }
-                    },
-                });
+                Tweener.addTween(oldActor,
+                                 { opacity: 0,
+                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                                   transition: 'linear',
+                                   onComplete: () => {
+                                       if (wasSpinner) {
+                                           if (this._spinner)
+                                               this._spinner.stop();
+                                       }
+                                   }
+                                 });
            }
        }

@ -330,23 +309,21 @@ var AuthPrompt = GObject.registerClass({
            if (isSpinner)
                this._spinner.play();

-            if (!animate) {
+            if (!animate)
                actor.opacity = 255;
-            } else {
-                actor.ease({
-                    opacity: 255,
-                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                    mode: Clutter.AnimationMode.LINEAR,
-                });
-            }
+            else
+                Tweener.addTween(actor,
+                                 { opacity: 255,
+                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                                   transition: 'linear' });
        }

        this._defaultButtonWellActor = actor;
    }

    startSpinning() {
-        this.setActorInDefaultButtonWell(this._spinner, true);
+        this.setActorInDefaultButtonWell(this._spinner.actor, true);
    }

    stopSpinning() {
@ -388,12 +365,12 @@ var AuthPrompt = GObject.registerClass({
    _fadeOutMessage() {
        if (this._message.opacity == 0)
            return;
-        this._message.remove_all_transitions();
-        this._message.ease({
-            opacity: 0,
-            duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        });
+        Tweener.removeTweens(this._message);
+        Tweener.addTween(this._message,
+                         { opacity: 0,
+                           time: MESSAGE_FADE_OUT_ANIMATION_TIME,
+                           transition: 'easeOutQuad'
+                         });
    }

    setMessage(message, type) {
@ -408,7 +385,7 @@ var AuthPrompt = GObject.registerClass({
            this._message.remove_style_class_name('login-dialog-message-hint');

        if (message) {
-            this._message.remove_all_transitions();
+            Tweener.removeTweens(this._message);
            this._message.text = message;
            this._message.opacity = 255;
        } else {
@ -427,9 +404,9 @@ var AuthPrompt = GObject.registerClass({
        this._entry.clutter_text.editable = sensitive;
    }

-    vfunc_hide() {
+    hide() {
        this.setActorInDefaultButtonWell(null, true);
-        super.vfunc_hide();
+        this.actor.hide();
        this._message.opacity = 0;

        this.setUser(null);
@ -445,8 +422,7 @@ var AuthPrompt = GObject.registerClass({

        if (user) {
            let userWidget = new UserWidget.UserWidget(user);
-            userWidget.x_align = Clutter.ActorAlign.START;
-            this._userWell.set_child(userWidget);
+            this._userWell.set_child(userWidget.actor);
        }
    }

@ -525,10 +501,11 @@ var AuthPrompt = GObject.registerClass({
    }

    cancel() {
-        if (this.verificationStatus == AuthPromptStatus.VERIFICATION_SUCCEEDED)
+        if (this.verificationStatus == AuthPromptStatus.VERIFICATION_SUCCEEDED) {
            return;
-
+        }
        this.reset();
        this.emit('cancelled');
    }
-});
+};
+Signals.addSignalMethods(AuthPrompt.prototype);
--- a/js/gdm/batch.js
+++ b/js/gdm/batch.js
@ -20,7 +20,7 @@
 * In order for transformation animations to look good, they need to be
 * incremental and have some order to them (e.g., fade out hidden items,
 * then shrink to close the void left over). Chaining animations in this way can
- * be error-prone and wordy using just ease() callbacks.
+ * be error-prone and wordy using just Tweener callbacks.
 *
 * The classes in this file help with this:
 *
@ -112,12 +112,13 @@ var Batch = class extends Task {
        for (let i = 0; i < tasks.length; i++) {
            let task;

-            if (tasks[i] instanceof Task)
+            if (tasks[i] instanceof Task) {
                task = tasks[i];
-            else if (typeof tasks[i] == 'function')
+            } else if (typeof tasks[i] == 'function') {
                task = new Task(scope, tasks[i]);
-            else
+            } else {
                throw new Error('Batch tasks must be functions or Task, Hold or Batch objects');
+            }

            this.tasks.push(task);
        }
@ -128,8 +129,9 @@ var Batch = class extends Task {
    }

    runTask() {
-        if (!(this._currentTaskIndex in this.tasks))
+        if (!(this._currentTaskIndex in this.tasks)) {
            return null;
+        }

        return this.tasks[this._currentTaskIndex].run();
    }
@ -177,8 +179,9 @@ var ConcurrentBatch = class extends Batch {
    process() {
        let hold = this.runTask();

-        if (hold)
+        if (hold) {
            this.hold.acquireUntilAfter(hold);
+        }

        // Regardless of the state of the just run task,
        // fire off the next one, so all the tasks can run
@ -199,6 +202,7 @@ var ConsecutiveBatch = class extends Batch {
                hold.disconnect(signalId);
                this.nextTask();
            });
+            return;
        } else {
            // This task finished, process the next one
            this.nextTask();
--- a/js/gdm/fingerprint.js
+++ b/js/gdm/fingerprint.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported FprintManager */

 const Gio = imports.gi.Gio;

@ -20,7 +19,7 @@ function FprintManager() {
                                   g_interface_info: FprintManagerInfo,
                                   g_name: 'net.reactivated.Fprint',
                                   g_object_path: '/net/reactivated/Fprint/Manager',
-                                   g_flags: Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES });
+                                   g_flags: (Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES) });

    try {
        self.init(null);
--- a/js/gdm/loginDialog.js
+++ b/js/gdm/loginDialog.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LoginDialog */
 /*
 * Copyright 2011 Red Hat, Inc
 *
@ -19,6 +18,7 @@

 const { AccountsService, Atk, Clutter, Gdm, Gio,
        GLib, GObject, Meta, Pango, Shell, St } = imports.gi;
+const Signals = imports.signals;

 const AuthPrompt = imports.gdm.authPrompt;
 const Batch = imports.gdm.batch;
@ -30,89 +30,81 @@ const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const PopupMenu = imports.ui.popupMenu;
 const Realmd = imports.gdm.realmd;
+const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;

-const _FADE_ANIMATION_TIME = 250;
-const _SCROLL_ANIMATION_TIME = 500;
+const _FADE_ANIMATION_TIME = 0.25;
+const _SCROLL_ANIMATION_TIME = 0.5;
 const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
 const _LOGO_ICON_HEIGHT = 48;
 const _MAX_BOTTOM_MENU_ITEMS = 5;

-var UserListItem = GObject.registerClass({
-    Signals: { 'activate': {} },
-}, class UserListItem extends St.Button {
-    _init(user) {
-        let layout = new St.BoxLayout({
-            vertical: true,
-            x_align: Clutter.ActorAlign.START,
-        });
-        super._init({
-            style_class: 'login-dialog-user-list-item',
-            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-            can_focus: true,
-            x_expand: true,
-            child: layout,
-            reactive: true,
-        });
-
+var UserListItem = class {
+    constructor(user) {
        this.user = user;
        this._userChangedId = this.user.connect('changed',
                                                this._onUserChanged.bind(this));

-        this.connect('destroy', this._onDestroy.bind(this));
-        this.connect('notify::hover', () => {
-            this._setSelected(this.hover);
+        let layout = new St.BoxLayout({ vertical: true });
+        this.actor = new St.Button({ style_class: 'login-dialog-user-list-item',
+                                     button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
+                                     can_focus: true,
+                                     child: layout,
+                                     reactive: true,
+                                     x_align: St.Align.START,
+                                     x_fill: true });
+        this.actor.connect('destroy', this._onDestroy.bind(this));
+
+        this.actor.connect('key-focus-in', () => {
+            this._setSelected(true);
+        });
+        this.actor.connect('key-focus-out', () => {
+            this._setSelected(false);
+        });
+        this.actor.connect('notify::hover', () => {
+            this._setSelected(this.actor.hover);
        });

        this._userWidget = new UserWidget.UserWidget(this.user);
-        layout.add(this._userWidget);
+        layout.add(this._userWidget.actor);

-        this._userWidget.bind_property('label-actor', this, 'label-actor',
-                                       GObject.BindingFlags.SYNC_CREATE);
+        this._userWidget.actor.bind_property('label-actor', this.actor, 'label-actor',
+                                             GObject.BindingFlags.SYNC_CREATE);

        this._timedLoginIndicator = new St.Bin({ style_class: 'login-dialog-timed-login-indicator',
                                                 scale_x: 0,
                                                 visible: false });
        layout.add(this._timedLoginIndicator);

+        this.actor.connect('clicked', this._onClicked.bind(this));
        this._onUserChanged();
    }

-    vfunc_key_focus_in() {
-        super.vfunc_key_focus_in();
-        this._setSelected(true);
-    }
-
-    vfunc_key_focus_out() {
-        super.vfunc_key_focus_out();
-        this._setSelected(false);
-    }
-
    _onUserChanged() {
        this._updateLoggedIn();
    }

    _updateLoggedIn() {
        if (this.user.is_logged_in())
-            this.add_style_pseudo_class('logged-in');
+            this.actor.add_style_pseudo_class('logged-in');
        else
-            this.remove_style_pseudo_class('logged-in');
+            this.actor.remove_style_pseudo_class('logged-in');
    }

    _onDestroy() {
        this.user.disconnect(this._userChangedId);
    }

-    vfunc_clicked() {
+    _onClicked() {
        this.emit('activate');
    }

    _setSelected(selected) {
        if (selected) {
-            this.add_style_pseudo_class('selected');
-            this.grab_key_focus();
+            this.actor.add_style_pseudo_class('selected');
+            this.actor.grab_key_focus();
        } else {
-            this.remove_style_pseudo_class('selected');
+            this.actor.remove_style_pseudo_class('selected');
        }
    }

@ -125,7 +117,7 @@ var UserListItem = GObject.registerClass({

        let startTime = GLib.get_monotonic_time();

-        this._timedLoginTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 33,
+        this._timedLoginTimeoutId = GLib.timeout_add (GLib.PRIORITY_DEFAULT, 33,
            () => {
                let currentTime = GLib.get_monotonic_time();
                let elapsedTime = (currentTime - startTime) / GLib.USEC_PER_SEC;
@ -153,33 +145,23 @@ var UserListItem = GObject.registerClass({
        this._timedLoginIndicator.visible = false;
        this._timedLoginIndicator.scale_x = 0.;
    }
-});
+};
+Signals.addSignalMethods(UserListItem.prototype);

-var UserList = GObject.registerClass({
-    Signals: {
-        'activate': { param_types: [UserListItem.$gtype] },
-        'item-added': { param_types: [UserListItem.$gtype] },
-    },
-}, class UserList extends St.ScrollView {
-    _init() {
-        super._init({
-            style_class: 'login-dialog-user-list-view',
-            x_expand: true,
-            y_expand: true,
-        });
-        this.set_policy(St.PolicyType.NEVER,
-                        St.PolicyType.AUTOMATIC);
+var UserList = class {
+    constructor() {
+        this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view' });
+        this.actor.set_policy(St.PolicyType.NEVER,
+                              St.PolicyType.AUTOMATIC);

        this._box = new St.BoxLayout({ vertical: true,
                                       style_class: 'login-dialog-user-list',
                                       pseudo_class: 'expanded' });

-        this.add_actor(this._box);
+        this.actor.add_actor(this._box);
        this._items = {};
-    }

-    vfunc_key_focus_in() {
-        this._moveFocusToItems();
+        this.actor.connect('key-focus-in', this._moveFocusToItems.bind(this));
    }

    _moveFocusToItems() {
@ -188,10 +170,10 @@ var UserList = GObject.registerClass({
        if (!hasItems)
            return;

-        if (global.stage.get_key_focus() != this)
+        if (global.stage.get_key_focus() != this.actor)
            return;

-        let focusSet = this.navigate_focus(null, St.DirectionType.TAB_FORWARD, false);
+        let focusSet = this.actor.navigate_focus(null, St.DirectionType.TAB_FORWARD, false);
        if (!focusSet) {
            Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
                this._moveFocusToItems();
@ -212,26 +194,27 @@ var UserList = GObject.registerClass({

        for (let userName in this._items) {
            let item = this._items[userName];
-            item.sync_hover();
+            item.actor.sync_hover();
        }
    }

    scrollToItem(item) {
-        let box = item.get_allocation_box();
+        let box = item.actor.get_allocation_box();

-        let adjustment = this.get_vscroll_bar().get_adjustment();
+        let adjustment = this.actor.get_vscroll_bar().get_adjustment();

        let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
-        adjustment.ease(value, {
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: _SCROLL_ANIMATION_TIME,
-        });
+        Tweener.removeTweens(adjustment);
+        Tweener.addTween (adjustment,
+                          { value: value,
+                            time: _SCROLL_ANIMATION_TIME,
+                            transition: 'easeOutQuad' });
    }

    jumpToItem(item) {
-        let box = item.get_allocation_box();
+        let box = item.actor.get_allocation_box();

-        let adjustment = this.get_vscroll_bar().get_adjustment();
+        let adjustment = this.actor.get_vscroll_bar().get_adjustment();

        let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);

@ -269,14 +252,14 @@ var UserList = GObject.registerClass({
        this.removeUser(user);

        let item = new UserListItem(user);
-        this._box.add_child(item);
+        this._box.add(item.actor, { x_fill: true });

        this._items[userName] = item;

        item.connect('activate', this._onItemActivated.bind(this));

        // Try to keep the focused item front-and-center
-        item.connect('key-focus-in', () => this.scrollToItem(item));
+        item.actor.connect('key-focus-in', () => this.scrollToItem(item));

        this._moveFocusToItems();

@ -297,37 +280,33 @@ var UserList = GObject.registerClass({
        if (!item)
            return;

-        item.destroy();
+        item.actor.destroy();
        delete this._items[userName];
    }

    numItems() {
        return Object.keys(this._items).length;
    }
-});
+};
+Signals.addSignalMethods(UserList.prototype);

-var SessionMenuButton = GObject.registerClass({
-    Signals: { 'session-activated': { param_types: [GObject.TYPE_STRING] } },
-}, class SessionMenuButton extends St.Bin {
-    _init() {
+var SessionMenuButton = class {
+    constructor() {
        let gearIcon = new St.Icon({ icon_name: 'emblem-system-symbolic' });
-        let button = new St.Button({
-            style_class: 'login-dialog-session-list-button',
-            reactive: true,
-            track_hover: true,
-            can_focus: true,
-            accessible_name: _("Choose Session"),
-            accessible_role: Atk.Role.MENU,
-            child: gearIcon,
-        });
+        this._button = new St.Button({ style_class: 'login-dialog-session-list-button',
+                                       reactive: true,
+                                       track_hover: true,
+                                       can_focus: true,
+                                       accessible_name: _("Choose Session"),
+                                       accessible_role: Atk.Role.MENU,
+                                       child: gearIcon });

-        super._init({ child: button });
-        this._button = button;
+        this.actor = new St.Bin({ child: this._button });

        let side = St.Side.TOP;
        let align = 0;
        if (Gdm.get_session_ids().length > _MAX_BOTTOM_MENU_ITEMS) {
-            if (this.text_direction == Clutter.TextDirection.RTL)
+            if (this.actor.text_direction == Clutter.TextDirection.RTL)
                side = St.Side.RIGHT;
            else
                side = St.Side.LEFT;
@ -393,7 +372,7 @@ var SessionMenuButton = GObject.registerClass({
        }

        for (let i = 0; i < ids.length; i++) {
-            let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]);
+            let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]);

            let id = ids[i];
            let item = new PopupMenu.PopupMenuItem(sessionName);
@ -406,13 +385,15 @@ var SessionMenuButton = GObject.registerClass({
            });
        }
    }
-});
+};
+Signals.addSignalMethods(SessionMenuButton.prototype);

 var LoginDialog = GObject.registerClass({
    Signals: { 'failed': {} },
 }, class LoginDialog extends St.Widget {
    _init(parentActor) {
-        super._init({ style_class: 'login-dialog', visible: false });
+        super._init({ style_class: 'login-dialog',
+                      visible: false });

        this.get_accessible().set_role(Atk.Role.WINDOW);

@ -446,35 +427,38 @@ var LoginDialog = GObject.registerClass({
        this.add_child(this._userSelectionBox);

        this._userList = new UserList();
-        this._userSelectionBox.add_child(this._userList);
+        this._userSelectionBox.add(this._userList.actor,
+                                   { expand: true,
+                                     x_fill: true,
+                                     y_fill: true });

        this._authPrompt = new AuthPrompt.AuthPrompt(this._gdmClient, AuthPrompt.AuthPromptMode.UNLOCK_OR_LOG_IN);
        this._authPrompt.connect('prompted', this._onPrompted.bind(this));
        this._authPrompt.connect('reset', this._onReset.bind(this));
        this._authPrompt.hide();
-        this.add_child(this._authPrompt);
+        this.add_child(this._authPrompt.actor);

        // translators: this message is shown below the user list on the
        // login screen. It can be activated to reveal an entry for
        // manually entering the username.
-        let notListedLabel = new St.Label({
-            text: _("Not listed?"),
-            style_class: 'login-dialog-not-listed-label',
-            x_align: Clutter.ActorAlign.START,
-        });
-        this._notListedButton = new St.Button({
-            style_class: 'login-dialog-not-listed-button',
-            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-            can_focus: true,
-            child: notListedLabel,
-            reactive: true,
-        });
+        let notListedLabel = new St.Label({ text: _("Not listed?"),
+                                            style_class: 'login-dialog-not-listed-label' });
+        this._notListedButton = new St.Button({ style_class: 'login-dialog-not-listed-button',
+                                                button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
+                                                can_focus: true,
+                                                child: notListedLabel,
+                                                reactive: true,
+                                                x_align: St.Align.START,
+                                                x_fill: true });

        this._notListedButton.connect('clicked', this._hideUserListAskForUsernameAndBeginVerification.bind(this));

        this._notListedButton.hide();

-        this._userSelectionBox.add_child(this._notListedButton);
+        this._userSelectionBox.add(this._notListedButton,
+                                   { expand: false,
+                                     x_align: St.Align.START,
+                                     x_fill: true });

        this._bannerView = new St.ScrollView({ style_class: 'login-dialog-banner-view',
                                               opacity: 0,
@ -509,11 +493,11 @@ var LoginDialog = GObject.registerClass({
        this._sessionMenuButton = new SessionMenuButton();
        this._sessionMenuButton.connect('session-activated',
            (list, sessionId) => {
-                this._greeter.call_select_session_sync(sessionId, null);
+                this._greeter.call_select_session_sync (sessionId, null);
            });
-        this._sessionMenuButton.opacity = 0;
-        this._sessionMenuButton.show();
-        this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton);
+        this._sessionMenuButton.actor.opacity = 0;
+        this._sessionMenuButton.actor.show();
+        this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton.actor);

        this._disableUserList = undefined;
        this._userListLoaded = false;
@ -534,7 +518,7 @@ var LoginDialog = GObject.registerClass({
    _getBannerAllocation(dialogBox) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = this._bannerView.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;

        actorBox.x1 = Math.floor(centerX - natWidth / 2);
@ -548,7 +532,7 @@ var LoginDialog = GObject.registerClass({
    _getLogoBinAllocation(dialogBox) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = this._logoBin.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;

        actorBox.x1 = Math.floor(centerX - natWidth / 2);
@ -562,7 +546,7 @@ var LoginDialog = GObject.registerClass({
    _getCenterActorAllocation(dialogBox, actor) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = actor.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
        let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2;

@ -596,8 +580,8 @@ var LoginDialog = GObject.registerClass({

        let authPromptAllocation = null;
        let authPromptWidth = 0;
-        if (this._authPrompt.visible) {
-            authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt);
+        if (this._authPrompt.actor.visible) {
+            authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt.actor);
            authPromptWidth = authPromptAllocation.x2 - authPromptAllocation.x1;
        }

@ -664,7 +648,7 @@ var LoginDialog = GObject.registerClass({

                    // figure out how tall it would like to be and try to accommodate
                    // but don't let it get too close to the logo
-                    let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
+                    let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);

                    let maxWideHeight = dialogHeight - 3 * logoHeight;
                    wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
@ -702,11 +686,12 @@ var LoginDialog = GObject.registerClass({
        }

        // Finally hand out the allocations
-        if (bannerAllocation)
+        if (bannerAllocation) {
            this._bannerView.allocate(bannerAllocation, flags);
+        }

        if (authPromptAllocation)
-            this._authPrompt.allocate(authPromptAllocation, flags);
+            this._authPrompt.actor.allocate(authPromptAllocation, flags);

        if (userSelectionAllocation)
            this._userSelectionBox.allocate(userSelectionAllocation, flags);
@ -773,15 +758,14 @@ var LoginDialog = GObject.registerClass({

    _fadeInBannerView() {
        this._bannerView.show();
-        this._bannerView.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        });
+        Tweener.addTween(this._bannerView,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad' });
    }

    _hideBannerView() {
-        this._bannerView.remove_all_transitions();
+        Tweener.removeTweens(this._bannerView);
        this._bannerView.opacity = 0;
        this._bannerView.hide();
    }
@ -810,7 +794,7 @@ var LoginDialog = GObject.registerClass({
    _onPrompted() {
        if (this._shouldShowSessionMenuButton()) {
            this._sessionMenuButton.updateSensitivity(true);
-            this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton);
+            this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton.actor);
        } else {
            this._sessionMenuButton.updateSensitivity(false);
        }
@ -819,9 +803,9 @@ var LoginDialog = GObject.registerClass({

    _resetGreeterProxy() {
        if (GLib.getenv('GDM_GREETER_TEST') != '1') {
-            if (this._greeter)
+            if (this._greeter) {
                this._greeter.run_dispose();
-
+            }
            this._greeter = this._gdmClient.get_greeter_sync(null);

            this._defaultSessionChangedId = this._greeter.connect('default-session-name-changed',
@ -870,15 +854,14 @@ var LoginDialog = GObject.registerClass({
    }

    _showPrompt() {
-        if (this._authPrompt.visible)
+        if (this._authPrompt.actor.visible)
            return;
-        this._authPrompt.opacity = 0;
-        this._authPrompt.show();
-        this._authPrompt.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        });
+        this._authPrompt.actor.opacity = 0;
+        this._authPrompt.actor.show();
+        Tweener.addTween(this._authPrompt.actor,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad' });
        this._fadeInBannerView();
    }

@ -922,31 +905,26 @@ var LoginDialog = GObject.registerClass({
        this._showPrompt();
    }

-    _bindOpacity() {
-        this._bindings = Main.layoutManager.uiGroup.get_children()
-            .filter(c => c != Main.layoutManager.screenShieldGroup)
-            .map(c => this.bind_property('opacity', c, 'opacity', 0));
-    }
-
-    _unbindOpacity() {
-        this._bindings.forEach(b => b.unbind());
-    }
-
    _loginScreenSessionActivated() {
        if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
            return;

-        this._bindOpacity();
-        this.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
-                    this._authPrompt.reset();
-                this._unbindOpacity();
-            },
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onUpdate: () => {
+                               let children = Main.layoutManager.uiGroup.get_children();
+
+                               for (let i = 0; i < children.length; i++) {
+                                   if (children[i] != Main.layoutManager.screenShieldGroup)
+                                       children[i].opacity = this.opacity;
+                               }
+                           },
+                           onComplete: () => {
+                               if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
+                                   this._authPrompt.reset();
+                           } });
    }

    _gotGreeterSessionProxy(proxy) {
@ -959,16 +937,21 @@ var LoginDialog = GObject.registerClass({
    }

    _startSession(serviceName) {
-        this._bindOpacity();
-        this.ease({
-            opacity: 0,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
-                this._unbindOpacity();
-            },
-        });
+        Tweener.addTween(this,
+                         { opacity: 0,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onUpdate: () => {
+                               let children = Main.layoutManager.uiGroup.get_children();
+
+                               for (let i = 0; i < children.length; i++) {
+                                   if (children[i] != Main.layoutManager.screenShieldGroup)
+                                       children[i].opacity = this.opacity;
+                               }
+                           },
+                           onComplete: () => {
+                               this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
+                           } });
    }

    _onSessionOpened(client, serviceName) {
@ -984,7 +967,7 @@ var LoginDialog = GObject.registerClass({
        let hold = new Batch.Hold();
        let signalId = this._userList.connect('item-added',
            () => {
-                item = this._userList.getItemFromUserName(userName);
+                let item = this._userList.getItemFromUserName(userName);

                if (item)
                    hold.release();
@ -1038,8 +1021,9 @@ var LoginDialog = GObject.registerClass({

                     () => {
                         // If we're just starting out, start on the right item.
-                         if (!this._userManager.is_loaded)
+                         if (!this._userManager.is_loaded) {
                             this._userList.jumpToItem(loginItem);
+                         }
                     },

                     () => {
@ -1060,12 +1044,12 @@ var LoginDialog = GObject.registerClass({
                     () => {
                         // If idle timeout is done, make sure the timed login indicator is shown
                         if (delay > _TIMED_LOGIN_IDLE_THRESHOLD &&
-                             this._authPrompt.visible)
+                             this._authPrompt.actor.visible)
                             this._authPrompt.cancel();

                         if (delay > _TIMED_LOGIN_IDLE_THRESHOLD || firstRun) {
                             this._userList.scrollToItem(loginItem);
-                             loginItem.grab_key_focus();
+                             loginItem.actor.grab_key_focus();
                         }
                     },

@ -1090,8 +1074,9 @@ var LoginDialog = GObject.registerClass({
        // Restart timed login on user interaction
        global.stage.connect('captured-event', (actor, event) => {
            if (event.type() == Clutter.EventType.KEY_PRESS ||
-                event.type() == Clutter.EventType.BUTTON_PRESS)
+               event.type() == Clutter.EventType.BUTTON_PRESS) {
                this._startTimedLogin(userName, seconds);
+            }

            return Clutter.EVENT_PROPAGATE;
        });
@ -1125,7 +1110,7 @@ var LoginDialog = GObject.registerClass({
        this._sessionMenuButton.close();
        this._setUserListExpanded(true);
        this._notListedButton.show();
-        this._userList.grab_key_focus();
+        this._userList.actor.grab_key_focus();
    }

    _beginVerificationForItem(item) {
@ -1134,7 +1119,8 @@ var LoginDialog = GObject.registerClass({
        let userName = item.user.get_user_name();
        let hold = new Batch.Hold();

-        this._authPrompt.begin({ userName, hold });
+        this._authPrompt.begin({ userName: userName,
+                                 hold: hold });
        return hold;
    }

@ -1197,8 +1183,9 @@ var LoginDialog = GObject.registerClass({

        let users = this._userManager.list_users();

-        for (let i = 0; i < users.length; i++)
+        for (let i = 0; i < users.length; i++) {
            this._userList.addUser(users[i]);
+        }

        this._updateDisableUserList();

@ -1231,17 +1218,16 @@ var LoginDialog = GObject.registerClass({
                                        _("Login Window"),
                                        'dialog-password-symbolic',
                                        { sortGroup: CtrlAltTab.SortGroup.MIDDLE });
-        this._userList.grab_key_focus();
+        this._userList.actor.grab_key_focus();
        this.show();
        this.opacity = 0;

        Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN });

-        this.ease({
-            opacity: 255,
-            duration: 1000,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD,
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: 1,
+                           transition: 'easeInQuad' });

        return true;
    }
@ -1255,7 +1241,7 @@ var LoginDialog = GObject.registerClass({
        this._authPrompt.cancel();
    }

-    addCharacter(_unichar) {
+    addCharacter(unichar) {
        // Don't allow type ahead at the login screen
    }

--- a/js/gdm/oVirt.js
+++ b/js/gdm/oVirt.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getOVirtCredentialsManager */

 const Gio = imports.gi.Gio;
 const Signals = imports.signals;
@ -23,7 +22,7 @@ function OVirtCredentials() {
                                   g_interface_info: OVirtCredentialsInfo,
                                   g_name: 'org.ovirt.vdsm.Credentials',
                                   g_object_path: '/org/ovirt/vdsm/Credentials',
-                                   g_flags: Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES });
+                                   g_flags: (Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES) });
    self.init(null);
    return self;
 }
--- a/js/gdm/realmd.js
+++ b/js/gdm/realmd.js
@ -15,13 +15,12 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm");
 const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface);

 var Manager = class {
-    constructor() {
+    constructor(parentActor) {
        this._aggregateProvider = Provider(Gio.DBus.system,
                                           'org.freedesktop.realmd',
                                           '/org/freedesktop/realmd',
                                           this._reloadRealms.bind(this));
        this._realms = {};
-        this._loginFormat = null;

        this._signalId = this._aggregateProvider.connect('g-properties-changed',
            (proxy, properties) => {
@ -87,7 +86,7 @@ var Manager = class {
    }

    get loginFormat() {
-        if (this._loginFormat)
+        if (this._loginFormat !== undefined)
            return this._loginFormat;

        this._updateLoginFormat();
--- a/js/gdm/util.js
+++ b/js/gdm/util.js
@ -1,6 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY,
-            DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */

 const { Clutter, Gio, GLib } = imports.gi;
 const Signals = imports.signals;
@ -11,13 +9,14 @@ const OVirt = imports.gdm.oVirt;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
 const SmartcardManager = imports.misc.smartcardManager;
+const Tweener = imports.ui.tweener;

 var PASSWORD_SERVICE_NAME = 'gdm-password';
 var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint';
 var SMARTCARD_SERVICE_NAME = 'gdm-smartcard';
 var OVIRT_SERVICE_NAME = 'gdm-ovirtcred';
-var FADE_ANIMATION_TIME = 160;
-var CLONE_FADE_ANIMATION_TIME = 250;
+var FADE_ANIMATION_TIME = 0.16;
+var CLONE_FADE_ANIMATION_TIME = 0.25;

 var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen';
 var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication';
@ -37,7 +36,7 @@ var MessageType = {
    NONE: 0,
    ERROR: 1,
    INFO: 2,
-    HINT: 3,
+    HINT: 3
 };

 function fadeInActor(actor) {
@ -46,20 +45,20 @@ function fadeInActor(actor) {

    let hold = new Batch.Hold();
    actor.show();
-    let [, naturalHeight] = actor.get_preferred_height(-1);
+    let [minHeight, naturalHeight] = actor.get_preferred_height(-1);

    actor.opacity = 0;
    actor.set_height(0);
-    actor.ease({
-        opacity: 255,
-        height: naturalHeight,
-        duration: FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            this.set_height(-1);
-            hold.release();
-        },
-    });
+    Tweener.addTween(actor,
+                     { opacity: 255,
+                       height: naturalHeight,
+                       time: FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           this.set_height(-1);
+                           hold.release();
+                       },
+                     });

    return hold;
 }
@ -72,17 +71,17 @@ function fadeOutActor(actor) {
    }

    let hold = new Batch.Hold();
-    actor.ease({
-        opacity: 0,
-        height: 0,
-        duration: FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            this.hide();
-            this.set_height(-1);
-            hold.release();
-        },
-    });
+    Tweener.addTween(actor,
+                     { opacity: 0,
+                       height: 0,
+                       time: FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           this.hide();
+                           this.set_height(-1);
+                           hold.release();
+                       },
+                     });
    return hold;
 }

@ -102,15 +101,15 @@ function cloneAndFadeOutActor(actor) {
    clone.set_position(x, y);

    let hold = new Batch.Hold();
-    clone.ease({
-        opacity: 0,
-        duration: CLONE_FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            clone.destroy();
-            hold.release();
-        },
-    });
+    Tweener.addTween(clone,
+                     { opacity: 0,
+                       time: CLONE_FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           clone.destroy();
+                           hold.release();
+                       }
+                     });
    return hold;
 }

@ -272,7 +271,7 @@ var ShellUserVerifier = class {
        let interval = this._getIntervalForMessage(message);

        this.hasPendingMessages = true;
-        this._messageQueue.push({ text: message, type: messageType, interval });
+        this._messageQueue.push({ text: message, type: messageType, interval: interval });
        this._queueMessageTimeout();
    }

@ -304,7 +303,7 @@ var ShellUserVerifier = class {
            });
    }

-    _oVirtUserAuthenticated(_token) {
+    _oVirtUserAuthenticated(token) {
        this._preemptingService = OVIRT_SERVICE_NAME;
        this.emit('ovirt-user-authenticated');
    }
@ -544,7 +543,6 @@ var ShellUserVerifier = class {
                });
            }
        } else {
-            // eslint-disable-next-line no-lonely-if
            if (!this.hasPendingMessages) {
                this._cancelAndReset();
            } else {
@ -572,8 +570,9 @@ var ShellUserVerifier = class {
        // if the password service fails, then cancel everything.
        // But if, e.g., fingerprint fails, still give
        // password authentication a chance to succeed
-        if (this.serviceIsForeground(serviceName))
+        if (this.serviceIsForeground(serviceName)) {
            this._verificationFailed(true);
+        }
    }
 };
 Signals.addSignalMethods(ShellUserVerifier.prototype);
--- a/js/misc/extensionUtils.js
+++ b/js/misc/extensionUtils.js
@ -1,46 +1,31 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ExtensionState, ExtensionType, getCurrentExtension,
-   getSettings, initTranslations, isOutOfDate, installImporter,
-   serializeExtension, deserializeExtension */

 // Common utils for the extension system and the extension
 // preferences tool

-const { Gio, GLib } = imports.gi;
-
 const Gettext = imports.gettext;
-const Lang = imports.lang;
+const Signals = imports.signals;
+
+const Gio = imports.gi.Gio;

 const Config = imports.misc.config;
+const FileUtils = imports.misc.fileUtils;

 var ExtensionType = {
    SYSTEM: 1,
-    PER_USER: 2,
+    PER_USER: 2
 };

-var ExtensionState = {
-    ENABLED: 1,
-    DISABLED: 2,
-    ERROR: 3,
-    OUT_OF_DATE: 4,
-    DOWNLOADING: 5,
-    INITIALIZED: 6,
-
-    // Used as an error state for operations on unknown extensions,
-    // should never be in a real extensionMeta object.
-    UNINSTALLED: 99,
-};
-
-const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
+// Maps uuid -> metadata object
+var extensions = {};

 /**
 * getCurrentExtension:
 *
- * @returns {?object} - The current extension, or null if not called from
- * an extension.
+ * Returns the current extension, or null if not called from an extension.
 */
 function getCurrentExtension() {
-    let stack = new Error().stack.split('\n');
+    let stack = (new Error()).stack.split('\n');
    let extensionStackLine;

    // Search for an occurrence of an extension stack frame
@ -64,17 +49,13 @@ function getCurrentExtension() {
    if (!match)
        return null;

-    // local import, as the module is used from outside the gnome-shell process
-    // as well (not this function though)
-    let extensionManager = imports.ui.main.extensionManager;
-
    let path = match[1];
    let file = Gio.File.new_for_path(path);

    // Walk up the directory tree, looking for an extension with
    // the same UUID as a directory name.
    while (file != null) {
-        let extension = extensionManager.lookup(file.get_basename());
+        let extension = extensions[file.get_basename()];
        if (extension !== undefined)
            return extension;
        file = file.get_parent();
@ -85,7 +66,7 @@ function getCurrentExtension() {

 /**
 * initTranslations:
- * @param {string=} domain - the gettext domain to use
+ * @domain: (optional): the gettext domain to use
 *
 * Initialize Gettext to load translations from extensionsdir/locale.
 * If @domain is not provided, it will be taken from metadata['gettext-domain']
@ -109,8 +90,7 @@ function initTranslations(domain) {

 /**
 * getSettings:
- * @param {string=} schema - the GSettings schema id
- * @returns {Gio.Settings} - a new settings object for @schema
+ * @schema: (optional): the GSettings schema id
 *
 * Builds and returns a GSettings schema for @schema, using schema files
 * in extensionsdir/schemas. If @schema is omitted, it is taken from
@ -130,13 +110,12 @@ function getSettings(schema) {
    // SYSTEM extension that has been installed in the same prefix as the shell
    let schemaDir = extension.dir.get_child('schemas');
    let schemaSource;
-    if (schemaDir.query_exists(null)) {
+    if (schemaDir.query_exists(null))
        schemaSource = GioSSS.new_from_directory(schemaDir.get_path(),
                                                 GioSSS.get_default(),
                                                 false);
-    } else {
+    else
        schemaSource = GioSSS.get_default();
-    }

    let schemaObj = schemaSource.lookup(schema, true);
    if (!schemaObj)
@ -147,9 +126,8 @@ function getSettings(schema) {

 /**
 * versionCheck:
- * @param {string[]} required - an array of versions we're compatible with
- * @param {string} current - the version we have
- * @returns {bool} - true if @current is compatible with @required
+ * @required: an array of versions we're compatible with
+ * @current: the version we have
 *
 * Check if a component is compatible for an extension.
 * @required is an array, and at least one version must match.
@ -169,8 +147,8 @@ function versionCheck(required, current) {
        let requiredArray = required[i].split('.');
        if (requiredArray[0] == major &&
            requiredArray[1] == minor &&
-            ((requiredArray[2] === undefined && parseInt(minor) % 2 == 0) ||
-             requiredArray[2] == point))
+            (requiredArray[2] == point ||
+             (requiredArray[2] == undefined && parseInt(minor) % 2 == 0)))
            return true;
    }
    return false;
@ -183,50 +161,52 @@ function isOutOfDate(extension) {
    return false;
 }

-function serializeExtension(extension) {
-    let obj = {};
-    Lang.copyProperties(extension.metadata, obj);
+function createExtensionObject(uuid, dir, type) {
+    let metadataFile = dir.get_child('metadata.json');
+    if (!metadataFile.query_exists(null)) {
+        throw new Error('Missing metadata.json');
+    }

-    SERIALIZED_PROPERTIES.forEach(prop => {
-        obj[prop] = extension[prop];
-    });
+    let metadataContents, success, tag;
+    try {
+        [success, metadataContents, tag] = metadataFile.load_contents(null);
+        if (metadataContents instanceof Uint8Array)
+            metadataContents = imports.byteArray.toString(metadataContents);
+    } catch (e) {
+        throw new Error(`Failed to load metadata.json: ${e}`);
+    }
+    let meta;
+    try {
+        meta = JSON.parse(metadataContents);
+    } catch (e) {
+        throw new Error(`Failed to parse metadata.json: ${e}`);
+    }

-    let res = {};
-    for (let key in obj) {
-        let val = obj[key];
-        let type;
-        switch (typeof val) {
-        case 'string':
-            type = 's';
-            break;
-        case 'number':
-            type = 'd';
-            break;
-        case 'boolean':
-            type = 'b';
-            break;
-        default:
-            continue;
+    let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
+    for (let i = 0; i < requiredProperties.length; i++) {
+        let prop = requiredProperties[i];
+        if (!meta[prop]) {
+            throw new Error(`missing "${prop}" property in metadata.json`);
        }
-        res[key] = GLib.Variant.new(type, val);
    }

-    return res;
-}
-
-function deserializeExtension(variant) {
-    let res = { metadata: {} };
-    for (let prop in variant) {
-        let val = variant[prop].unpack();
-        if (SERIALIZED_PROPERTIES.includes(prop))
-            res[prop] = val;
-        else
-            res.metadata[prop] = val;
+    if (uuid != meta.uuid) {
+        throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
    }
-    // add the 2 additional properties to create a valid extension object, as createExtensionObject()
-    res.uuid = res.metadata.uuid;
-    res.dir = Gio.File.new_for_path(res.path);
-    return res;
+
+    let extension = {};
+
+    extension.metadata = meta;
+    extension.uuid = meta.uuid;
+    extension.type = type;
+    extension.dir = dir;
+    extension.path = dir.get_path();
+    extension.error = '';
+    extension.hasPrefs = dir.get_child('prefs.js').query_exists(null);
+
+    extensions[uuid] = extension;
+
+    return extension;
 }

 function installImporter(extension) {
@ -237,3 +217,36 @@ function installImporter(extension) {
    extension.imports = imports[extension.uuid];
    imports.searchPath = oldSearchPath;
 }
+
+var ExtensionFinder = class {
+    _loadExtension(extensionDir, info, perUserDir) {
+        let fileType = info.get_file_type();
+        if (fileType != Gio.FileType.DIRECTORY)
+            return;
+        let uuid = info.get_name();
+        let existing = extensions[uuid];
+        if (existing) {
+            log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path()));
+            return;
+        }
+
+        let extension;
+        let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER
+                                                       : ExtensionType.SYSTEM;
+        try {
+            extension = createExtensionObject(uuid, extensionDir, type);
+        } catch (e) {
+            logError(e, 'Could not load extension %s'.format(uuid));
+            return;
+        }
+        this.emit('extension-found', extension);
+    }
+
+    scanExtensions() {
+        let perUserDir = Gio.File.new_for_path(global.userdatadir);
+        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
+            this._loadExtension(dir, info, perUserDir);
+        });
+    }
+};
+Signals.addSignalMethods(ExtensionFinder.prototype);
--- a/js/misc/fileUtils.js
+++ b/js/misc/fileUtils.js
@ -1,6 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported collectFromDatadirs, recursivelyDeleteDir,
-            recursivelyMoveDir, loadInterfaceXML */

 const { Gio, GLib } = imports.gi;
 const Config = imports.misc.config;
@ -29,6 +27,11 @@ function collectFromDatadirs(subdir, includeUserDir, processFile) {
    }
 }

+function deleteGFile(file) {
+    // Work around 'delete' being a keyword in JS.
+    return file['delete'](null);
+}
+
 function recursivelyDeleteDir(dir, deleteParent) {
    let children = dir.enumerate_children('standard::name,standard::type',
                                          Gio.FileQueryInfoFlags.NONE, null);
@ -38,13 +41,13 @@ function recursivelyDeleteDir(dir, deleteParent) {
        let type = info.get_file_type();
        let child = dir.get_child(info.get_name());
        if (type == Gio.FileType.REGULAR)
-            child.delete(null);
+            deleteGFile(child);
        else if (type == Gio.FileType.DIRECTORY)
            recursivelyDeleteDir(child, true);
    }

    if (deleteParent)
-        dir.delete(null);
+        deleteGFile(dir);
 }

 function recursivelyMoveDir(srcDir, destDir) {
@ -70,18 +73,18 @@ let _ifaceResource = null;
 function loadInterfaceXML(iface) {
    if (!_ifaceResource) {
        // don't use global.datadir so the method is usable from tests/tools
-        let dir = GLib.getenv('GNOME_SHELL_DATADIR') || Config.PKGDATADIR;
-        let path = `${dir}/gnome-shell-dbus-interfaces.gresource`;
+        let dir = GLib.getenv ('GNOME_SHELL_DATADIR') || Config.PKGDATADIR;
+        let path = dir + '/gnome-shell-dbus-interfaces.gresource';
        _ifaceResource = Gio.Resource.load(path);
        _ifaceResource._register();
    }

    let xml = null;
-    let uri = `resource:///org/gnome/shell/dbus-interfaces/${iface}.xml`;
+    let uri = 'resource:///org/gnome/shell/dbus-interfaces/' + iface + '.xml';
    let f = Gio.File.new_for_uri(uri);

    try {
-        let [ok_, bytes] = f.load_contents(null);
+        let [ok, bytes] = f.load_contents(null);
        if (bytes instanceof Uint8Array)
            xml = imports.byteArray.toString(bytes);
        else
--- a/js/misc/gnomeSession.js
+++ b/js/misc/gnomeSession.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PresenceStatus, Presence, Inhibitor, SessionManager */

 const Gio = imports.gi.Gio;

@ -11,7 +10,7 @@ var PresenceStatus = {
    AVAILABLE: 0,
    INVISIBLE: 1,
    BUSY: 2,
-    IDLE: 3,
+    IDLE: 3
 };

 var PresenceProxy = Gio.DBusProxy.makeProxyWrapper(PresenceIface);
--- a/js/misc/history.js
+++ b/js/misc/history.js
@ -28,7 +28,7 @@ var HistoryManager = class {
        this._entry = params.entry;

        if (this._entry) {
-            this._entry.connect('key-press-event',
+            this._entry.connect('key-press-event', 
                                this._onEntryKeyPress.bind(this));
        }
    }
@ -82,11 +82,11 @@ var HistoryManager = class {

    _onEntryKeyPress(entry, event) {
        let symbol = event.get_key_symbol();
-        if (symbol == Clutter.KEY_Up)
+        if (symbol == Clutter.KEY_Up) {
            return this._setPrevItem(entry.get_text());
-        else if (symbol == Clutter.KEY_Down)
+        } else if (symbol == Clutter.KEY_Down) {
            return this._setNextItem(entry.get_text());
-
+        }
        return Clutter.EVENT_PROPAGATE;
    }

--- a/js/misc/ibusManager.js
+++ b/js/misc/ibusManager.js
@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getIBusManager */

 const { Gio, GLib, IBus } = imports.gi;
+const Mainloop = imports.mainloop;
 const Signals = imports.signals;

 const IBusCandidatePopup = imports.ui.ibusCandidatePopup;
@ -18,9 +18,9 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) {
         IBus.MICRO_VERSION >= requiredMicro))
        return;

-    throw "Found IBus version %d.%d.%d but required is %d.%d.%d"
-        .format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
-                requiredMajor, requiredMinor, requiredMicro);
+    throw "Found IBus version %d.%d.%d but required is %d.%d.%d".
+        format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
+               requiredMajor, requiredMinor, requiredMicro);
 }

 function getIBusManager() {
@ -58,30 +58,16 @@ var IBusManager = class {
        this._spawn();
    }

-    _spawn(extraArgs = []) {
+    _spawn() {
        try {
-            let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs];
-            Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE);
+            Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
+                               Gio.SubprocessFlags.NONE);
        } catch (e) {
            log(`Failed to launch ibus-daemon: ${e.message}`);
        }
    }

-    restartDaemon(extraArgs = []) {
-        this._spawn(['-r', ...extraArgs]);
-    }
-
    _clear() {
-        if (this._cancellable) {
-            this._cancellable.cancel();
-            this._cancellable = null;
-        }
-
-        if (this._preloadEnginesId) {
-            GLib.source_remove(this._preloadEnginesId);
-            this._preloadEnginesId = 0;
-        }
-
        if (this._panelService)
            this._panelService.destroy();

@ -93,44 +79,33 @@ var IBusManager = class {
        this._currentEngineName = null;

        this.emit('ready', false);
+
+        this._spawn();
    }

    _onConnected() {
-        this._cancellable = new Gio.Cancellable();
-        this._ibus.list_engines_async(-1, this._cancellable,
-            this._initEngines.bind(this));
+        this._ibus.list_engines_async(-1, null, this._initEngines.bind(this));
        this._ibus.request_name_async(IBus.SERVICE_PANEL,
-            IBus.BusNameFlag.REPLACE_EXISTING, -1, this._cancellable,
-            this._initPanelService.bind(this));
+                                      IBus.BusNameFlag.REPLACE_EXISTING,
+                                      -1, null,
+                                      this._initPanelService.bind(this));
    }

    _initEngines(ibus, result) {
-        try {
-            let enginesList = this._ibus.list_engines_async_finish(result);
+        let enginesList = this._ibus.list_engines_async_finish(result);
+        if (enginesList) {
            for (let i = 0; i < enginesList.length; ++i) {
                let name = enginesList[i].get_name();
                this._engines.set(name, enginesList[i]);
            }
            this._updateReadiness();
-        } catch (e) {
-            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
-                return;
-
-            logError(e);
+        } else {
            this._clear();
        }
    }

    _initPanelService(ibus, result) {
-        let success = false;
-        try {
-            success = !!this._ibus.request_name_async_finish(result);
-        } catch (e) {
-            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
-                return;
-            logError(e);
-        }
-
+        let success = this._ibus.request_name_async_finish(result);
        if (success) {
            this._panelService = new IBus.PanelService({ connection: this._ibus.get_connection(),
                                                         object_path: IBus.PATH_PANEL });
@ -142,7 +117,7 @@ var IBusManager = class {
            });
            this._panelService.connect('focus-in', (panel, path) => {
                if (!GLib.str_has_suffix(path, '/InputContext_1'))
-                    this.emit('focus-in');
+                    this.emit ('focus-in');
            });
            this._panelService.connect('focus-out', () => this.emit('focus-out'));

@ -157,10 +132,10 @@ var IBusManager = class {
            } catch (e) {
            }
            // If an engine is already active we need to get its properties
-            this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, res) => {
+            this._ibus.get_global_engine_async(-1, null, (i, result) => {
                let engine;
                try {
-                    engine = this._ibus.get_global_engine_async_finish(res);
+                    engine = this._ibus.get_global_engine_async_finish(result);
                    if (!engine)
                        return;
                } catch (e) {
@ -229,18 +204,8 @@ var IBusManager = class {
            return;
        }

-        this._ibus.set_global_engine_async(id,
-            this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
-            this._cancellable, (_bus, res) => {
-                try {
-                    this._ibus.set_global_engine_async_finish(res);
-                } catch (e) {
-                    if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
-                        logError(e);
-                }
-                if (callback)
-                    callback();
-            });
+        this._ibus.set_global_engine_async(id, this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
+                                           null, callback || null);
    }

    preloadEngines(ids) {
@ -248,23 +213,21 @@ var IBusManager = class {
            return;

        if (this._preloadEnginesId != 0) {
-            GLib.source_remove(this._preloadEnginesId);
+            Mainloop.source_remove(this._preloadEnginesId);
            this._preloadEnginesId = 0;
        }

        this._preloadEnginesId =
-            GLib.timeout_add_seconds(
-                GLib.PRIORITY_DEFAULT,
-                this._PRELOAD_ENGINES_DELAY_TIME,
-                () => {
-                    this._ibus.preload_engines_async(
-                        ids,
-                        -1,
-                        this._cancellable,
-                        null);
-                    this._preloadEnginesId = 0;
-                    return GLib.SOURCE_REMOVE;
-                });
+            Mainloop.timeout_add_seconds(this._PRELOAD_ENGINES_DELAY_TIME,
+                                         () => {
+                                             this._ibus.preload_engines_async(
+                                                 ids,
+                                                 -1,
+                                                 null,
+                                                 null);
+                                             this._preloadEnginesId = 0;
+                                             return GLib.SOURCE_REMOVE;
+                                         });
    }
 };
 Signals.addSignalMethods(IBusManager.prototype);
--- a/js/misc/inputMethod.js
+++ b/js/misc/inputMethod.js
@ -1,6 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported InputMethod */
-const { Clutter, GLib, Gio, GObject, IBus } = imports.gi;
+const { Clutter, GLib, GObject, IBus } = imports.gi;

 const Keyboard = imports.ui.status.keyboard;

@ -36,7 +35,15 @@ class InputMethod extends Clutter.InputMethod {
    }

    _updateCapabilities() {
-        let caps = IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
+        let caps = 0;
+
+        if (this.can_show_preedit)
+            caps |= IBus.Capabilite.PREEDIT_TEXT;
+
+        if (this._currentFocus)
+            caps |= IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
+        else
+            caps |= IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.AUXILIARY_TEXT | IBus.Capabilite.LOOKUP_TABLE | IBus.Capabilite.PROPERTY;

        if (this._context)
            this._context.set_capabilities(caps);
@ -47,39 +54,23 @@ class InputMethod extends Clutter.InputMethod {
    }

    _onConnected() {
-        this._cancellable = new Gio.Cancellable();
-        this._ibus.create_input_context_async('gnome-shell', -1,
-            this._cancellable, this._setContext.bind(this));
+        this._ibus.create_input_context_async ('gnome-shell', -1, null,
+                                               this._setContext.bind(this));
    }

    _setContext(bus, res) {
-        try {
-            this._context = this._ibus.create_input_context_async_finish(res);
-        } catch (e) {
-            if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) {
-                logError(e);
-                this._clear();
-            }
-            return;
-        }
-
+        this._context = this._ibus.create_input_context_async_finish(res);
        this._context.connect('commit-text', this._onCommitText.bind(this));
        this._context.connect('delete-surrounding-text', this._onDeleteSurroundingText.bind(this));
        this._context.connect('update-preedit-text', this._onUpdatePreeditText.bind(this));
        this._context.connect('show-preedit-text', this._onShowPreeditText.bind(this));
        this._context.connect('hide-preedit-text', this._onHidePreeditText.bind(this));
        this._context.connect('forward-key-event', this._onForwardKeyEvent.bind(this));
-        this._context.connect('destroy', this._clear.bind(this));

        this._updateCapabilities();
    }

    _clear() {
-        if (this._cancellable) {
-            this._cancellable.cancel();
-            this._cancellable = null;
-        }
-
        this._context = null;
        this._hints = 0;
        this._purpose = 0;
@ -93,15 +84,15 @@ class InputMethod extends Clutter.InputMethod {
            this.emit('request-surrounding');
    }

-    _onCommitText(_context, text) {
+    _onCommitText(context, text) {
        this.commit(text.get_text());
    }

-    _onDeleteSurroundingText() {
+    _onDeleteSurroundingText(context) {
        this.delete_surrounding();
    }

-    _onUpdatePreeditText(_context, text, pos, visible) {
+    _onUpdatePreeditText(context, text, pos, visible) {
        if (text == null)
            return;

@ -117,19 +108,19 @@ class InputMethod extends Clutter.InputMethod {
        this._preeditVisible = visible;
    }

-    _onShowPreeditText() {
+    _onShowPreeditText(context) {
        this._preeditVisible = true;
        this.set_preedit_text(this._preeditStr, this._preeditPos);
    }

-    _onHidePreeditText() {
+    _onHidePreeditText(context) {
        this.set_preedit_text(null, this._preeditPos);
        this._preeditVisible = false;
    }

-    _onForwardKeyEvent(_context, keyval, keycode, state) {
+    _onForwardKeyEvent(context, keyval, keycode, state) {
        let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
-        state &= ~IBus.ModifierType.RELEASE_MASK;
+        state &= ~(IBus.ModifierType.RELEASE_MASK);

        let curEvent = Clutter.get_current_event();
        let time;
@ -145,6 +136,7 @@ class InputMethod extends Clutter.InputMethod {
        this._currentFocus = focus;
        if (this._context) {
            this._context.focus_in();
+            this._updateCapabilities();
            this._emitRequestSurrounding();
        }

@ -156,8 +148,10 @@ class InputMethod extends Clutter.InputMethod {

    vfunc_focus_out() {
        this._currentFocus = null;
-        if (this._context)
+        if (this._context) {
            this._context.focus_out();
+            this._updateCapabilities();
+        }

        if (this._preeditStr) {
            // Unset any preedit text
@ -260,22 +254,17 @@ class InputMethod extends Clutter.InputMethod {
        if (event.type() == Clutter.EventType.KEY_RELEASE)
            state |= IBus.ModifierType.RELEASE_MASK;

-        this._context.process_key_event_async(
-            event.get_key_symbol(),
-            event.get_key_code() - 8, // Convert XKB keycodes to evcodes
-            state, -1, this._cancellable,
-            (context, res) => {
-                if (context != this._context)
-                    return;
-
-                try {
-                    let retval = context.process_key_event_async_finish(res);
-                    this.notify_key_event(event, retval);
-                } catch (e) {
-                    if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
-                        log(`Error processing key on IM: ${e.message}`);
-                }
-            });
+        this._context.process_key_event_async(event.get_key_symbol(),
+                                              event.get_key_code() - 8, // Convert XKB keycodes to evcodes
+                                              state, -1, null,
+                                              (context, res) => {
+                                                  try {
+                                                      let retval = context.process_key_event_async_finish(res);
+                                                      this.notify_key_event(event, retval);
+                                                  } catch (e) {
+                                                      log(`Error processing key on IM: ${e.message}`);
+                                                  }
+                                              });
        return true;
    }
 });
--- a/js/misc/introspect.js
+++ b/js/misc/introspect.js
@ -1,4 +1,3 @@
-/* exported IntrospectService */
 const { Gio, GLib, Meta, Shell } = imports.gi;

 const INTROSPECT_SCHEMA = 'org.gnome.shell';
@ -40,15 +39,6 @@ var IntrospectService = class {
                        });

        this._syncRunningApplications();
-
-        this._whitelistMap = new Map();
-        APP_WHITELIST.forEach(appName => {
-            Gio.DBus.watch_name(Gio.BusType.SESSION,
-                appName,
-                Gio.BusNameWatcherFlags.NONE,
-                (conn, name, owner) => this._whitelistMap.set(name, owner),
-                (conn, name) => this._whitelistMap.delete(name));
-        });
    }

    _isStandaloneApp(app) {
@ -60,7 +50,7 @@ var IntrospectService = class {
    }

    _isSenderWhitelisted(sender) {
-        return [...this._whitelistMap.values()].includes(sender);
+        return APP_WHITELIST.includes(sender);
    }

    _getSandboxedAppId(app) {
@ -79,7 +69,7 @@ var IntrospectService = class {

        for (let app of apps) {
            let appInfo = {};
-            let isAppActive = focusedApp == app;
+            let isAppActive = (focusedApp == app);

            if (!this._isStandaloneApp(app))
                continue;
@ -113,10 +103,10 @@ var IntrospectService = class {
            return false;

        let type = window.get_window_type();
-        return type == Meta.WindowType.NORMAL ||
+        return (type == Meta.WindowType.NORMAL ||
                type == Meta.WindowType.DIALOG ||
                type == Meta.WindowType.MODAL_DIALOG ||
-                type == Meta.WindowType.UTILITY;
+                type == Meta.WindowType.UTILITY);
    }

    GetRunningApplicationsAsync(params, invocation) {
@ -136,8 +126,7 @@ var IntrospectService = class {
        let apps = this._appSystem.get_running();
        let windowsList = {};

-        if (!this._isIntrospectEnabled() &&
-            !this._isSenderWhitelisted(invocation.get_sender())) {
+        if (!this._isIntrospectEnabled()) {
            invocation.return_error_literal(Gio.DBusError,
                                            Gio.DBusError.ACCESS_DENIED,
                                            'App introspection not allowed');
@ -161,9 +150,9 @@ var IntrospectService = class {
                    'app-id': GLib.Variant.new('s', app.get_id()),
                    'client-type': GLib.Variant.new('u', window.get_client_type()),
                    'is-hidden': GLib.Variant.new('b', window.is_hidden()),
-                    'has-focus': GLib.Variant.new('b', window == focusWindow),
+                    'has-focus': GLib.Variant.new('b', (window == focusWindow)),
                    'width': GLib.Variant.new('u', frameRect.width),
-                    'height': GLib.Variant.new('u', frameRect.height),
+                    'height': GLib.Variant.new('u', frameRect.height)
                };

                // These properties may not be available for all windows:
@ -173,10 +162,9 @@ var IntrospectService = class {
                if (wmClass != null)
                    windowsList[windowId]['wm-class'] = GLib.Variant.new('s', wmClass);

-                if (sandboxedAppId != null) {
+                if (sandboxedAppId != null)
                    windowsList[windowId]['sandboxed-app-id'] =
                        GLib.Variant.new('s', sandboxedAppId);
-                }
            }
        }
        invocation.return_value(new GLib.Variant('(a{ta{sv}})', [windowsList]));
--- a/js/misc/jsParse.js
+++ b/js/misc/jsParse.js
@ -1,5 +1,4 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
-/* exported getCompletions, getCommonPrefix, getDeclaredConstants */

 // Returns a list of potential completions for text. Completions either
 // follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo)
@ -9,10 +8,11 @@
 // This function is likely the one you want to call from external modules
 function getCompletions(text, commandHeader, globalCompletionList) {
    let methods = [];
-    let expr_, base;
+    let expr, base;
    let attrHead = '';
-    if (globalCompletionList == null)
+    if (globalCompletionList == null) {
        globalCompletionList = [];
+    }

    let offset = getExpressionOffset(text, text.length - 1);
    if (offset >= 0) {
@ -21,7 +21,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
        // Look for expressions like "Main.panel.foo" and match Main.panel and foo
        let matches = text.match(/(.*)\.(.*)/);
        if (matches) {
-            [expr_, base, attrHead] = matches;
+            [expr, base, attrHead] = matches;

            methods = getPropertyNamesFromExpression(base, commandHeader).filter(
                attr => attr.slice(0, attrHead.length) == attrHead
@ -32,7 +32,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
        // not proceeded by a dot and match them against global constants
        matches = text.match(/^(\w*)$/);
        if (text == '' || matches) {
-            [expr_, attrHead] = matches;
+            [expr, attrHead] = matches;
            methods = globalCompletionList.filter(
                attr => attr.slice(0, attrHead.length) == attrHead
            );
@ -58,8 +58,9 @@ function isStopChar(c) {
 function findMatchingQuote(expr, offset) {
    let quoteChar = expr.charAt(offset);
    for (let i = offset - 1; i >= 0; --i) {
-        if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\')
+        if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') {
            return i;
+        }
    }
    return -1;
 }
@ -67,8 +68,9 @@ function findMatchingQuote(expr, offset) {
 // Given the ending position of a regex, find where it starts
 function findMatchingSlash(expr, offset) {
    for (let i = offset - 1; i >= 0; --i) {
-        if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\')
+        if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') {
            return i;
+        }
    }
    return -1;
 }
@ -79,30 +81,31 @@ function findMatchingSlash(expr, offset) {
 // findMatchingBrace("[(])", 3) returns 1.
 function findMatchingBrace(expr, offset) {
    let closeBrace = expr.charAt(offset);
-    let openBrace = { ')': '(', ']': '[' }[closeBrace];
+    let openBrace = ({ ')': '(', ']': '[' })[closeBrace];

-    return findTheBrace(expr, offset - 1, openBrace, closeBrace);
-}
+    function findTheBrace(expr, offset) {
+        if (offset < 0) {
+            return -1;
+        }

-function findTheBrace(expr, offset, ...braces) {
-    let [openBrace, closeBrace] = braces;
+        if (expr.charAt(offset) == openBrace) {
+            return offset;
+        }
+        if (expr.charAt(offset).match(/['"]/)) {
+            return findTheBrace(expr, findMatchingQuote(expr, offset) - 1);
+        }
+        if (expr.charAt(offset) == '/') {
+            return findTheBrace(expr, findMatchingSlash(expr, offset) - 1);
+        }
+        if (expr.charAt(offset) == closeBrace) {
+            return findTheBrace(expr, findTheBrace(expr, offset - 1) - 1);
+        }

-    if (offset < 0)
-        return -1;
+        return findTheBrace(expr, offset - 1);

-    if (expr.charAt(offset) == openBrace)
-        return offset;
+    }

-    if (expr.charAt(offset).match(/['"]/))
-        return findTheBrace(expr, findMatchingQuote(expr, offset) - 1, ...braces);
-
-    if (expr.charAt(offset) == '/')
-        return findTheBrace(expr, findMatchingSlash(expr, offset) - 1, ...braces);
-
-    if (expr.charAt(offset) == closeBrace)
-        return findTheBrace(expr, findTheBrace(expr, offset - 1, ...braces) - 1, ...braces);
-
-    return findTheBrace(expr, offset - 1, ...braces);
+    return findTheBrace(expr, offset - 1);
 }

 // Walk expr backwards from offset looking for the beginning of an
@ -114,11 +117,13 @@ function getExpressionOffset(expr, offset) {
    while (offset >= 0) {
        let currChar = expr.charAt(offset);

-        if (isStopChar(currChar))
+        if (isStopChar(currChar)) {
            return offset + 1;
+        }

-        if (currChar.match(/[)\]]/))
+        if (currChar.match(/[)\]]/)) {
            offset = findMatchingBrace(expr, offset);
+        }

        --offset;
    }
@ -135,10 +140,10 @@ function isValidPropertyName(w) {
 // To get all properties (enumerable and not), we need to walk
 // the prototype chain ourselves
 function getAllProps(obj) {
-    if (obj === null || obj === undefined)
+    if (obj === null || obj === undefined) {
        return [];
-
-    return Object.getOwnPropertyNames(obj).concat(getAllProps(Object.getPrototypeOf(obj)));
+    }
+    return Object.getOwnPropertyNames(obj).concat( getAllProps(Object.getPrototypeOf(obj)) );
 }

 // Given a string _expr_, returns all methods
@ -162,11 +167,11 @@ function getPropertyNamesFromExpression(expr, commandHeader = '') {
    if (typeof obj === 'object') {
        let allProps = getAllProps(obj);
        // Get only things we are allowed to complete following a '.'
-        allProps = allProps.filter(isValidPropertyName);
+        allProps = allProps.filter( isValidPropertyName );

        // Make sure propsUnique contains one key for every
        // property so we end up with a unique list of properties
-        allProps.map(p => (propsUnique[p] = null));
+        allProps.map(p => propsUnique[p] = null);
    }
    return Object.keys(propsUnique).sort();
 }
@ -183,26 +188,24 @@ function getCommonPrefix(words) {
    return word;
 }

-// Remove any blocks that are quoted or are in a regex
-function removeLiterals(str) {
-    if (str.length == 0)
-        return '';
-
-    let currChar = str.charAt(str.length - 1);
-    if (currChar == '"' || currChar == '\'') {
-        return removeLiterals(
-            str.slice(0, findMatchingQuote(str, str.length - 1)));
-    } else if (currChar == '/') {
-        return removeLiterals(
-            str.slice(0, findMatchingSlash(str, str.length - 1)));
-    }
-
-    return removeLiterals(str.slice(0, str.length - 1)) + currChar;
-}
-
 // Returns true if there is reason to think that eval(str)
 // will modify the global scope
 function isUnsafeExpression(str) {
+    // Remove any blocks that are quoted or are in a regex
+    function removeLiterals(str) {
+        if (str.length == 0) {
+            return '';
+        }
+
+        let currChar = str.charAt(str.length - 1);
+        if (currChar == '"' || currChar == '\'') {
+            return removeLiterals(str.slice(0, findMatchingQuote(str, str.length - 1)));
+        } else if (currChar == '/') {
+            return removeLiterals(str.slice(0, findMatchingSlash(str, str.length - 1)));
+        }
+
+        return removeLiterals(str.slice(0, str.length - 1)) + currChar;
+    }

    // Check for any sort of assignment
    // The strategy used is dumb: remove any quotes
@ -210,10 +213,10 @@ function isUnsafeExpression(str) {
    // If there is, it might be an unsafe assignment.

    let prunedStr = removeLiterals(str);
-    prunedStr = prunedStr.replace(/[=!]==/g, '');    // replace === and !== with nothing
-    prunedStr = prunedStr.replace(/[=<>!]=/g, '');    // replace ==, <=, >=, != with nothing
+    prunedStr = prunedStr.replace(/[=!]==/g, '');    //replace === and !== with nothing
+    prunedStr = prunedStr.replace(/[=<>!]=/g, '');    //replace ==, <=, >=, != with nothing

-    if (prunedStr.match(/[=]/)) {
+    if (prunedStr.match(/=/)) {
        return true;
    } else if (prunedStr.match(/;/)) {
        // If we contain a semicolon not inside of a quote/regex, assume we're unsafe as well
@ -227,10 +230,10 @@ function isUnsafeExpression(str) {
 function getDeclaredConstants(str) {
    let ret = [];
    str.split(';').forEach(s => {
-        let base_, keyword;
+        let base, keyword;
        let match = s.match(/const\s+(\w+)\s*=/);
        if (match) {
-            [base_, keyword] = match;
+            [base, keyword] = match;
            ret.push(keyword);
        }
    });
--- a/js/misc/keyboardManager.js
+++ b/js/misc/keyboardManager.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getKeyboardManager, holdKeyboard, releaseKeyboard */

 const { GLib, GnomeDesktop, Meta } = imports.gi;

--- a/js/misc/loginManager.js
+++ b/js/misc/loginManager.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported canLock, getLoginManager, registerSessionWithGDM */

 const { GLib, Gio } = imports.gi;
 const Signals = imports.signals;
@ -74,9 +73,8 @@ function registerSessionWithGDM() {
 let _loginManager = null;

 /**
- * getLoginManager:
+ * LoginManager:
 * An abstraction over systemd/logind and ConsoleKit.
- * @returns {object} - the LoginManager singleton
 *
 */
 function getLoginManager() {
@ -104,7 +102,7 @@ var LoginManagerSystemd = class {

    getCurrentSessionProxy(callback) {
        if (this._currentSession) {
-            callback(this._currentSession);
+            callback (this._currentSession);
            return;
        }

@ -118,7 +116,7 @@ var LoginManagerSystemd = class {
            } else {
                log('Failed to find "Display" session; are we the greeter?');

-                for ([session, objectPath] of this._userProxy.Sessions) {
+                for (let [session, objectPath] of this._userProxy.Sessions) {
                    let sessionProxy = new SystemdLoginSession(Gio.DBus.system,
                                                               'org.freedesktop.login1',
                                                               objectPath);
@ -184,9 +182,9 @@ var LoginManagerSystemd = class {
            (proxy, result) => {
                let fd = -1;
                try {
-                    let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
+                    let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result);
                    fd = fdList.steal_fds()[0];
-                    callback(new Gio.UnixInputStream({ fd }));
+                    callback(new Gio.UnixInputStream({ fd: fd }));
                } catch (e) {
                    logError(e, "Error getting systemd inhibitor");
                    callback(null);
@ -201,7 +199,7 @@ var LoginManagerSystemd = class {
 Signals.addSignalMethods(LoginManagerSystemd.prototype);

 var LoginManagerDummy = class {
-    getCurrentSessionProxy(_callback) {
+    getCurrentSessionProxy(callback) {
        // we could return a DummySession object that fakes whatever callers
        // expect (at the time of writing: connect() and connectSignal()
        // methods), but just never calling the callback should be safer
--- a/js/misc/modemManager.js
+++ b/js/misc/modemManager.js
@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ModemBase, ModemGsm, ModemCdma, BroadbandModem  */

-const { Gio, GObject, NM, NMA } = imports.gi;
+const { Gio, NMA } = imports.gi;
+const Signals = imports.signals;

 const { loadInterfaceXML } = imports.misc.fileUtils;

@ -84,9 +84,9 @@ function _findProviderForSid(sid) {
 }


-// ----------------------------------------------------- //
-// Support for the old ModemManager interface (MM < 0.7) //
-// ----------------------------------------------------- //
+//------------------------------------------------------------------------------
+// Support for the old ModemManager interface (MM < 0.7)
+//------------------------------------------------------------------------------


 // The following are not the complete interfaces, just the methods we need
@ -98,46 +98,21 @@ const ModemGsmNetworkProxy = Gio.DBusProxy.makeProxyWrapper(ModemGsmNetworkInter
 const ModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager.Modem.Cdma');
 const ModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(ModemCdmaInterface);

-var ModemBase = GObject.registerClass({
-    GTypeFlags: GObject.TypeFlags.ABSTRACT,
-    Properties: {
-        'operator-name': GObject.ParamSpec.string(
-            'operator-name', 'operator-name', 'operator-name',
-            GObject.ParamFlags.READABLE,
-            null),
-        'signal-quality': GObject.ParamSpec.int(
-            'signal-quality', 'signal-quality', 'signal-quality',
-            GObject.ParamFlags.READABLE,
-            0, 100, 0),
-    },
-}, class ModemBase extends GObject.Object {
-    _setOperatorName(operatorName) {
-        if (this.operator_name == operatorName)
-            return;
-        this.operator_name = operatorName;
-        this.notify('operator-name');
-    }
-
-    _setSignalQuality(signalQuality) {
-        if (this.signal_quality == signalQuality)
-            return;
-        this.signal_quality = signalQuality;
-        this.notify('signal-quality');
-    }
-});
-
-var ModemGsm = GObject.registerClass(
-class ModemGsm extends ModemBase {
-    _init(path) {
-        super._init();
+var ModemGsm = class {
+    constructor(path) {
        this._proxy = new ModemGsmNetworkProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);

+        this.signal_quality = 0;
+        this.operator_name = null;
+
        // Code is duplicated because the function have different signatures
        this._proxy.connectSignal('SignalQuality', (proxy, sender, [quality]) => {
-            this._setSignalQuality(quality);
+            this.signal_quality = quality;
+            this.emit('notify::signal-quality');
        });
-        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
-            this._setOperatorName(_findProviderForMccMnc(name, code));
+        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => {
+            this.operator_name = _findProviderForMccMnc(name, code);
+            this.emit('notify::operator-name');
        });
        this._proxy.GetRegistrationInfoRemote(([result], err) => {
            if (err) {
@ -145,29 +120,33 @@ class ModemGsm extends ModemBase {
                return;
            }

-            let [status_, code, name] = result;
-            this._setOperatorName(_findProviderForMccMnc(name, code));
+            let [status, code, name] = result;
+            this.operator_name = _findProviderForMccMnc(name, code);
+            this.emit('notify::operator-name');
        });
        this._proxy.GetSignalQualityRemote((result, err) => {
            if (err) {
                // it will return an error if the device is not connected
-                this._setSignalQuality(0);
+                this.signal_quality = 0;
            } else {
                let [quality] = result;
-                this._setSignalQuality(quality);
+                this.signal_quality = quality;
            }
+            this.emit('notify::signal-quality');
        });
    }
-});
+};
+Signals.addSignalMethods(ModemGsm.prototype);

-var ModemCdma = GObject.registerClass(
-class ModemCdma extends ModemBase {
-    _init(path) {
-        super._init();
+var ModemCdma = class {
+    constructor(path) {
        this._proxy = new ModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);

+        this.signal_quality = 0;
+        this.operator_name = null;
        this._proxy.connectSignal('SignalQuality', (proxy, sender, params) => {
-            this._setSignalQuality(params[0]);
+            this.signal_quality = params[0];
+            this.emit('notify::signal-quality');

            // receiving this signal means the device got activated
            // and we can finally call GetServingSystem
@ -177,11 +156,12 @@ class ModemCdma extends ModemBase {
        this._proxy.GetSignalQualityRemote((result, err) => {
            if (err) {
                // it will return an error if the device is not connected
-                this._setSignalQuality(0);
+                this.signal_quality = 0;
            } else {
                let [quality] = result;
-                this._setSignalQuality(quality);
+                this.signal_quality = quality;
            }
+            this.emit('notify::signal-quality');
        });
    }

@ -189,19 +169,22 @@ class ModemCdma extends ModemBase {
        this._proxy.GetServingSystemRemote(([result], err) => {
            if (err) {
                // it will return an error if the device is not connected
-                this._setOperatorName(null);
+                this.operator_name = null;
            } else {
-                let [bandClass_, band_, sid] = result;
-                this._setOperatorName(_findProviderForSid(sid));
+                let [bandClass, band, sid] = result;
+
+                this.operator_name = _findProviderForSid(sid);
            }
+            this.emit('notify::operator-name');
        });
    }
-});
+};
+Signals.addSignalMethods(ModemCdma.prototype);


-// ------------------------------------------------------- //
-// Support for the new ModemManager1 interface (MM >= 0.7) //
-// ------------------------------------------------------- //
+//------------------------------------------------------------------------------
+// Support for the new ModemManager1 interface (MM >= 0.7)
+//------------------------------------------------------------------------------

 const BroadbandModemInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem');
 const BroadbandModemProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemInterface);
@ -212,20 +195,12 @@ const BroadbandModem3gppProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModem3gp
 const BroadbandModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem.ModemCdma');
 const BroadbandModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemCdmaInterface);

-var BroadbandModem = GObject.registerClass({
-    Properties: {
-        'capabilities': GObject.ParamSpec.flags(
-            'capabilities', 'capabilities', 'capabilities',
-            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
-            NM.DeviceModemCapabilities.$gtype,
-            NM.DeviceModemCapabilities.NONE),
-    },
-}, class BroadbandModem extends ModemBase {
-    _init(path, capabilities) {
-        super._init({ capabilities });
-        this._proxy = new BroadbandModemProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
+var BroadbandModem = class {
+    constructor(path, capabilities) {
+        this._proxy = new BroadbandModemProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
        this._proxy_3gpp = new BroadbandModem3gppProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
        this._proxy_cdma = new BroadbandModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
+        this._capabilities = capabilities;

        this._proxy.connect('g-properties-changed', (proxy, properties) => {
            if ('SignalQuality' in properties.deep_unpack())
@ -249,8 +224,9 @@ var BroadbandModem = GObject.registerClass({
    }

    _reloadSignalQuality() {
-        let [quality, recent_] = this.SignalQuality;
-        this._setSignalQuality(quality);
+        let [quality, recent] = this._proxy.SignalQuality;
+        this.signal_quality = quality;
+        this.emit('notify::signal-quality');
    }

    _reloadOperatorName() {
@ -264,7 +240,8 @@ var BroadbandModem = GObject.registerClass({
            newName += this.operator_name_cdma;
        }

-        this._setOperatorName(newName);
+        this.operator_name = newName;
+        this.emit('notify::operator-name');
    }

    _reload3gppOperatorName() {
@ -279,4 +256,5 @@ var BroadbandModem = GObject.registerClass({
        this.operator_name_cdma = _findProviderForSid(sid);
        this._reloadOperatorName();
    }
-});
+};
+Signals.addSignalMethods(BroadbandModem.prototype);
--- a/js/misc/objectManager.js
+++ b/js/misc/objectManager.js
@ -192,8 +192,9 @@ var ObjectManager = class {
    _onNameAppeared() {
        this._managerProxy.GetManagedObjectsRemote((result, error) => {
            if (!result) {
-                if (error)
+                if (error) {
                    logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`);
+                }

                this._tryToCompleteLoad();
                return;
--- a/js/misc/params.js
+++ b/js/misc/params.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported parse */

 // parse:
 // @params: caller-provided parameter object, or %null
@ -17,10 +16,9 @@
 // @params and @defaults
 function parse(params = {}, defaults, allowExtras) {
    if (!allowExtras) {
-        for (let prop in params) {
+        for (let prop in params)
            if (!(prop in defaults))
                throw new Error(`Unrecognized parameter "${prop}"`);
-        }
    }

    let defaultsCopy = Object.assign({}, defaults);
--- a/js/misc/permissionStore.js
+++ b/js/misc/permissionStore.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PermissionStore */

 const Gio = imports.gi.Gio;

--- a/js/misc/smartcardManager.js
+++ b/js/misc/smartcardManager.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getSmartcardManager */

 const Gio = imports.gi.Gio;
 const Signals = imports.signals;
@ -72,10 +71,11 @@ var SmartcardManager = class {
            if ('IsInserted' in properties.deep_unpack()) {
                this._updateToken(token);

-                if (token.IsInserted)
+                if (token.IsInserted) {
                    this.emit('smartcard-inserted', token);
-                else
+                } else {
                    this.emit('smartcard-removed', token);
+                }
            }
        });

--- a/js/misc/systemActions.js
+++ b/js/misc/systemActions.js
@ -1,4 +1,3 @@
-/* exported getDefault */
 const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi;

 const GnomeSession = imports.misc.gnomeSession;
@ -74,8 +73,8 @@ const SystemActions = GObject.registerClass({
                                                          'orientation-lock-icon',
                                                          'orientation-lock-icon',
                                                          GObject.ParamFlags.READWRITE,
-                                                          null),
-    },
+                                                          null)
+    }
 }, class SystemActions extends GObject.Object {
    _init() {
        super._init();
@ -90,7 +89,7 @@ const SystemActions = GObject.registerClass({
            iconName: 'system-shutdown-symbolic',
            // Translators: A list of keywords that match the power-off action, separated by semicolons
            keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
-            available: false,
+            available: false
        });
        this._actions.set(LOCK_SCREEN_ACTION_ID, {
            // Translators: The name of the lock screen action in search
@ -98,7 +97,7 @@ const SystemActions = GObject.registerClass({
            iconName: 'system-lock-screen-symbolic',
            // Translators: A list of keywords that match the lock screen action, separated by semicolons
            keywords: _("lock screen").split(/[; ]/),
-            available: false,
+            available: false
        });
        this._actions.set(LOGOUT_ACTION_ID, {
            // Translators: The name of the logout action in search
@ -106,7 +105,7 @@ const SystemActions = GObject.registerClass({
            iconName: 'application-exit-symbolic',
            // Translators: A list of keywords that match the logout action, separated by semicolons
            keywords: _("logout;log out;sign off").split(/[; ]/),
-            available: false,
+            available: false
        });
        this._actions.set(SUSPEND_ACTION_ID, {
            // Translators: The name of the suspend action in search
@ -114,7 +113,7 @@ const SystemActions = GObject.registerClass({
            iconName: 'media-playback-pause-symbolic',
            // Translators: A list of keywords that match the suspend action, separated by semicolons
            keywords: _("suspend;sleep").split(/[; ]/),
-            available: false,
+            available: false
        });
        this._actions.set(SWITCH_USER_ACTION_ID, {
            // Translators: The name of the switch user action in search
@ -122,7 +121,7 @@ const SystemActions = GObject.registerClass({
            iconName: 'system-switch-user-symbolic',
            // Translators: A list of keywords that match the switch user action, separated by semicolons
            keywords: _("switch user").split(/[; ]/),
-            available: false,
+            available: false
        });
        this._actions.set(LOCK_ORIENTATION_ACTION_ID, {
            // Translators: The name of the lock orientation action in search
@ -130,7 +129,7 @@ const SystemActions = GObject.registerClass({
            iconName: '',
            // Translators: A list of keywords that match the lock orientation action, separated by semicolons
            keywords: _("lock orientation;screen;rotation").split(/[; ]/),
-            available: false,
+            available: false
        });

        this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA });
@ -174,21 +173,13 @@ const SystemActions = GObject.registerClass({
                                          });
        Main.layoutManager.connect('monitors-changed',
                                   () => this._updateOrientationLock());
-        this._sensorProxy = new SensorProxy(Gio.DBus.system,
-            SENSOR_BUS_NAME,
-            SENSOR_OBJECT_PATH,
-            (proxy, error)  => {
-                if (error)
-                    log(error.message);
-            },
-            null,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START);
-        this._sensorProxy.connect('g-properties-changed', () => {
-            this._updateOrientationLock();
-        });
-        this._sensorProxy.connect('notify::g-name-owner', () => {
-            this._updateOrientationLock();
-        });
+        Gio.DBus.system.watch_name(SENSOR_BUS_NAME,
+                                   Gio.BusNameWatcherFlags.NONE,
+                                   () => this._sensorProxyAppeared(),
+                                   () => {
+                                       this._sensorProxy = null;
+                                       this._updateOrientationLock();
+                                   });
        this._updateOrientationLock();
        this._updateOrientationLockIcon();

@ -196,47 +187,52 @@ const SystemActions = GObject.registerClass({
        this._sessionUpdated();
    }

-    // eslint-disable-next-line camelcase
    get can_power_off() {
        return this._actions.get(POWER_OFF_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_suspend() {
        return this._actions.get(SUSPEND_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_lock_screen() {
        return this._actions.get(LOCK_SCREEN_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_switch_user() {
        return this._actions.get(SWITCH_USER_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_logout() {
        return this._actions.get(LOGOUT_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_lock_orientation() {
        return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get orientation_lock_icon() {
        return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName;
    }

+    _sensorProxyAppeared() {
+        this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH,
+            (proxy, error)  => {
+                if (error) {
+                    log(error.message);
+                    return;
+                }
+                this._sensorProxy.connect('g-properties-changed',
+                                          () => this._updateOrientationLock());
+                this._updateOrientationLock();
+            });
+    }
+
    _updateOrientationLock() {
        let available = false;
-        if (this._sensorProxy.g_name_owner) {
+        if (this._sensorProxy)
            available = this._sensorProxy.HasAccelerometer &&
                        this._monitorManager.get_is_builtin_display_on();
-        }

        this._actions.get(LOCK_ORIENTATION_ACTION_ID).available = available;

@ -245,9 +241,8 @@ const SystemActions = GObject.registerClass({

    _updateOrientationLockIcon() {
        let locked = this._orientationSettings.get_boolean('orientation-lock');
-        let iconName = locked
-            ? 'rotation-locked-symbolic'
-            : 'rotation-allowed-symbolic';
+        let iconName = locked ? 'rotation-locked-symbolic'
+                              : 'rotation-allowed-symbolic';
        this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName = iconName;

        this.notify('orientation-lock-icon');
@ -270,14 +265,13 @@ const SystemActions = GObject.registerClass({

    getMatchingActions(terms) {
        // terms is a list of strings
-        terms = terms.map(term => term.toLowerCase());
+        terms = terms.map((term) => term.toLowerCase());

        let results = [];

-        for (let [key, { available, keywords }] of this._actions) {
+        for (let [key, { available, keywords }] of this._actions)
            if (available && terms.every(t => keywords.some(k => k.startsWith(t))))
                results.push(key);
-        }

        return results;
    }
--- a/js/misc/util.js
+++ b/js/misc/util.js
@ -1,20 +1,20 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
-            formatTime, formatTimeSpan, createTimeLabel, insertSorted,
-            makeCloseButton, ensureActorVisibleInScrollView, wiggle */

-const { Clutter, Gio, GLib, GObject, Shell, St, GnomeDesktop } = imports.gi;
+const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
 const Gettext = imports.gettext;
+const Mainloop = imports.mainloop;
+const Signals = imports.signals;

 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;
 const Params = imports.misc.params;

-var SCROLL_TIME = 100;
+var SCROLL_TIME = 0.1;

 // http://daringfireball.net/2010/07/improved_regex_for_matching_urls
 const _balancedParens = '\\([^\\s()<>]+\\)';
 const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]';
-const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u200E\u200F\u201C\u201D\u2018\u2019\u202A\u202C]';
+const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u201C\u201D\u2018\u2019]';

 const _urlRegexp = new RegExp(
    `(^|${_leadingJunk})` +
@ -75,7 +75,7 @@ function spawn(argv) {
 // occur when trying to parse or start the program.
 function spawnCommandLine(commandLine) {
    try {
-        let [success_, argv] = GLib.shell_parse_argv(commandLine);
+        let [success, argv] = GLib.shell_parse_argv(commandLine);
        trySpawn(argv);
    } catch (err) {
        _handleSpawnError(commandLine, err);
@ -104,11 +104,11 @@ function spawnApp(argv) {
 // Runs @argv in the background. If launching @argv fails,
 // this will throw an error.
 function trySpawn(argv) {
-    var success_, pid;
+    var success, pid;
    try {
-        [success_, pid] = GLib.spawn_async(null, argv, null,
-                                           GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
-                                           null);
+        [success, pid] = GLib.spawn_async(null, argv, null,
+                                          GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
+                                          null);
    } catch (err) {
        /* Rewrite the error in case of ENOENT */
        if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) {
@ -121,15 +121,12 @@ function trySpawn(argv) {
            // We are only interested in the part in the parentheses. (And
            // we can't pattern match the text, since it gets localized.)
            let message = err.message.replace(/.*\((.+)\)/, '$1');
-            throw new err.constructor({ code: err.code, message });
+            throw new (err.constructor)({ code: err.code,
+                                          message: message });
        } else {
            throw err;
        }
    }
-
-    // Async call, we don't need the reply though
-    GnomeDesktop.start_systemd_scope(argv[0], pid, null, null, null, () => {});
-
    // Dummy child watch; we don't want to double-fork internally
    // because then we lose the parent-child relationship, which
    // can break polkit.  See https://bugzilla.redhat.com//show_bug.cgi?id=819275
@ -142,10 +139,10 @@ function trySpawn(argv) {
 // Runs @commandLine in the background. If launching @commandLine
 // fails, this will throw an error.
 function trySpawnCommandLine(commandLine) {
-    let success_, argv;
+    let success, argv;

    try {
-        [success_, argv] = GLib.shell_parse_argv(commandLine);
+        [success, argv] = GLib.shell_parse_argv(commandLine);
    } catch (err) {
        // Replace "Error invoking GLib.shell_parse_argv: " with
        // something nicer
@ -175,28 +172,23 @@ function formatTimeSpan(date) {

    if (minutesAgo < 5)
        return _("Just now");
-    if (hoursAgo < 1) {
+    if (hoursAgo < 1)
        return Gettext.ngettext("%d minute ago",
                                "%d minutes ago", minutesAgo).format(minutesAgo);
-    }
-    if (daysAgo < 1) {
+    if (daysAgo < 1)
        return Gettext.ngettext("%d hour ago",
                                "%d hours ago", hoursAgo).format(hoursAgo);
-    }
    if (daysAgo < 2)
        return _("Yesterday");
-    if (daysAgo < 15) {
+    if (daysAgo < 15)
        return Gettext.ngettext("%d day ago",
                                "%d days ago", daysAgo).format(daysAgo);
-    }
-    if (weeksAgo < 8) {
+    if (weeksAgo < 8)
        return Gettext.ngettext("%d week ago",
                                "%d weeks ago", weeksAgo).format(weeksAgo);
-    }
-    if (yearsAgo < 1) {
+    if (yearsAgo < 1)
        return Gettext.ngettext("%d month ago",
                                "%d months ago", monthsAgo).format(monthsAgo);
-    }
    return Gettext.ngettext("%d year ago",
                            "%d years ago", yearsAgo).format(yearsAgo);
 }
@ -221,10 +213,7 @@ function formatTime(time, params) {
        _desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
    let clockFormat = _desktopSettings.get_string('clock-format');

-    params = Params.parse(params, {
-        timeOnly: false,
-        ampm: true,
-    });
+    params = Params.parse(params, { timeOnly: false });

    if (clockFormat == '24h') {
        // Show only the time if date is on today
@ -257,7 +246,7 @@ function formatTime(time, params) {
            format = N_("%B %-d %Y, %H\u2236%M");
    } else {
        // Show only the time if date is on today
-        if (daysAgo < 1 || params.timeOnly) // eslint-disable-line no-lonely-if
+        if (daysAgo < 1 || params.timeOnly)
            /* Translators: Time in 12h format */
            format = N_("%l\u2236%M %p");
        // Show the word "Yesterday" and time if date is on yesterday
@ -286,11 +275,6 @@ function formatTime(time, params) {
            format = N_("%B %-d %Y, %l\u2236%M %p");
    }

-    // Time in short 12h format, without the equivalent of "AM" or "PM"; used
-    // when it is clear from the context
-    if (!params.ampm)
-        format = format.replace(/\s*%p/g, '');
-
    let formattedTime = date.format(Shell.util_translate_time_string(format));
    // prepend LTR-mark to colon/ratio to force a text direction on times
    return formattedTime.replace(/([:\u2236])/g, '\u200e$1');
@ -329,8 +313,7 @@ function lowerBound(array, val, cmp) {
    if (array.length == 0)
        return 0;

-    min = 0;
-    max = array.length;
+    min = 0; max = array.length;
    while (min < (max - 1)) {
        mid = Math.floor((min + max) / 2);
        v = cmp(array[mid], val);
@ -341,7 +324,7 @@ function lowerBound(array, val, cmp) {
            max = mid;
    }

-    return min == max || cmp(array[min], val) < 0 ? max : min;
+    return (min == max || cmp(array[min], val) < 0) ? max : min;
 }

 // insertSorted:
@ -362,13 +345,19 @@ function insertSorted(array, val, cmp) {
 var CloseButton = GObject.registerClass(
 class CloseButton extends St.Button {
    _init(boxpointer) {
-        super._init({
-            style_class: 'notification-close',
-            x_expand: true,
-            y_expand: true,
-            x_align: Clutter.ActorAlign.END,
-            y_align: Clutter.ActorAlign.START,
-        });
+        super._init({ style_class: 'notification-close' });
+
+        // This is a bit tricky. St.Bin has its own x-align/y-align properties
+        // that compete with Clutter's properties. This should be fixed for
+        // Clutter 2.0. Since St.Bin doesn't define its own setters, the
+        // setters are a workaround to get Clutter's version.
+        this.set_x_align(Clutter.ActorAlign.END);
+        this.set_y_align(Clutter.ActorAlign.START);
+
+        // XXX Clutter 2.0 workaround: ClutterBinLayout needs expand
+        // to respect the alignments.
+        this.set_x_expand(true);
+        this.set_y_expand(true);

        this._boxPointer = boxpointer;
        if (boxpointer)
@ -406,7 +395,7 @@ function makeCloseButton(boxpointer) {

 function ensureActorVisibleInScrollView(scrollView, actor) {
    let adjustment = scrollView.vscroll.adjustment;
-    let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values();
+    let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values();

    let offset = 0;
    let vfade = scrollView.get_effect("fade");
@ -421,7 +410,7 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
        if (!parent)
            throw new Error("actor not in scroll view");

-        box = parent.get_allocation_box();
+        let box = parent.get_allocation_box();
        y1 += box.y1;
        y2 += box.y1;
        parent = parent.get_parent();
@ -434,42 +423,97 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
    else
        return;

-    adjustment.ease(value, {
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        duration: SCROLL_TIME,
-    });
+    Tweener.addTween(adjustment,
+                     { value: value,
+                       time: SCROLL_TIME,
+                       transition: 'easeOutQuad' });
 }

-function wiggle(actor, params) {
-    params = Params.parse(params, {
-        offset: 0,
-        duration: 0,
-        wiggleCount: 0,
-    });
-    actor.translation_x = 0;
+var AppSettingsMonitor = class {
+    constructor(appId, schemaId) {
+        this._appId = appId;
+        this._schemaId = schemaId;

-    // Accelerate before wiggling
-    actor.ease({
-        translation_x: -params.offset,
-        duration: params.duration,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            // Wiggle
-            actor.ease({
-                translation_x: params.offset,
-                duration: params.duration,
-                mode: Clutter.AnimationMode.LINEAR,
-                repeatCount: params.wiggleCount,
-                autoReverse: true,
-                onComplete: () => {
-                    // Decelerate and return to the original position
-                    actor.ease({
-                        translation_x: 0,
-                        duration: params.duration,
-                        mode: Clutter.AnimationMode.EASE_IN_QUAD,
-                    });
-                },
+        this._app = null;
+        this._settings = null;
+        this._handlers = [];
+
+        this._schemaSource = Gio.SettingsSchemaSource.get_default();
+
+        this._appSystem = Shell.AppSystem.get_default();
+        this._appSystem.connect('installed-changed',
+                                this._onInstalledChanged.bind(this));
+        this._onInstalledChanged();
+    }
+
+    get available() {
+        return this._app != null && this._settings != null;
+    }
+
+    activateApp() {
+        if (this._app)
+            this._app.activate();
+    }
+
+    watchSetting(key, callback) {
+        let handler = { id: 0, key: key, callback: callback };
+        this._handlers.push(handler);
+
+        this._connectHandler(handler);
+    }
+
+    _connectHandler(handler) {
+        if (!this._settings || handler.id > 0)
+            return;
+
+        handler.id = this._settings.connect(`changed::${handler.key}`,
+                                            handler.callback);
+        handler.callback(this._settings, handler.key);
+    }
+
+    _disconnectHandler(handler) {
+        if (this._settings && handler.id > 0)
+            this._settings.disconnect(handler.id);
+        handler.id = 0;
+    }
+
+    _onInstalledChanged() {
+        let hadApp = (this._app != null);
+        this._app = this._appSystem.lookup_app(this._appId);
+        let haveApp = (this._app != null);
+
+        if (hadApp == haveApp)
+            return;
+
+        if (haveApp)
+            this._checkSettings();
+        else
+            this._setSettings(null);
+    }
+
+    _setSettings(settings) {
+        this._handlers.forEach((handler) => this._disconnectHandler(handler));
+
+        let hadSettings = (this._settings != null);
+        this._settings = settings;
+        let haveSettings = (this._settings != null);
+
+        this._handlers.forEach((handler) => this._connectHandler(handler));
+
+        if (hadSettings != haveSettings)
+            this.emit('available-changed');
+    }
+
+    _checkSettings() {
+        let schema = this._schemaSource.lookup(this._schemaId, true);
+        if (schema) {
+            this._setSettings(new Gio.Settings({ settings_schema: schema }));
+        } else if (this._app) {
+            Mainloop.timeout_add_seconds(1, () => {
+                this._checkSettings();
+                return GLib.SOURCE_REMOVE;
            });
-        },
-    });
-}
+        }
+    }
+};
+Signals.addSignalMethods(AppSettingsMonitor.prototype);
--- a/js/misc/weather.js
+++ b/js/misc/weather.js
@ -1,19 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-

-const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi;
+const { Geoclue, Gio, GLib, GWeather } = imports.gi;
 const Signals = imports.signals;

 const PermissionStore = imports.misc.permissionStore;
-
-const { loadInterfaceXML } = imports.misc.fileUtils;
-
-const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration');
-
-const WEATHER_BUS_NAME = 'org.gnome.Weather';
-const WEATHER_OBJECT_PATH = '/org/gnome/Weather';
-const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration';
-
-const WEATHER_APP_ID = 'org.gnome.Weather.desktop';
+const Util = imports.misc.util;

 // Minimum time between updates to show loading indication
 var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE;
@ -32,7 +23,6 @@ var WeatherClient = class {
        this._gclueStarting = false;
        this._gclueLocationChangedId = 0;

-        this._needsAuth = true;
        this._weatherAuthorized = false;
        this._permStore = new PermissionStore.PermissionStore((proxy, error) => {
            if (error) {
@ -48,11 +38,11 @@ var WeatherClient = class {
                return;
            }

-            this._permStore.LookupRemote('gnome', 'geolocation', (res, err) => {
-                if (err)
-                    log(`Error looking up permission: ${err.message}`);
+            this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => {
+                if (error)
+                    log(`Error looking up permission: ${error.message}`);

-                let [perms, data] = err ? [{}, null] : res;
+                let [perms, data] = error ? [{}, null] : res;
                let  params = ['gnome', 'geolocation', false, data, perms];
                this._onPermStoreChanged(this._permStore, '', params);
            });
@ -76,38 +66,17 @@ var WeatherClient = class {
            this.emit('changed');
        });

-        this._weatherApp = null;
-        this._weatherProxy = null;
-
-        let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface);
-        Gio.DBusProxy.new(
-            Gio.DBus.session,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES,
-            nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE),
-            WEATHER_BUS_NAME,
-            WEATHER_OBJECT_PATH,
-            WEATHER_INTEGRATION_IFACE,
-            null,
-            this._onWeatherProxyReady.bind(this));
-
-        this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.weather',
-        });
-        this._settings.connect('changed::automatic-location',
-            this._onAutomaticLocationChanged.bind(this));
-        this._onAutomaticLocationChanged();
-        this._settings.connect('changed::locations',
-            this._onLocationsChanged.bind(this));
-        this._onLocationsChanged();
-
-        this._appSystem = Shell.AppSystem.get_default();
-        this._appSystem.connect('installed-changed',
-            this._onInstalledChanged.bind(this));
-        this._onInstalledChanged();
+        this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop',
+                                                          'org.gnome.Weather');
+        this._weatherAppMon.connect('available-changed', () => this.emit('changed'));
+        this._weatherAppMon.watchSetting('automatic-location',
+                                         this._onAutomaticLocationChanged.bind(this));
+        this._weatherAppMon.watchSetting('locations',
+                                         this._onLocationsChanged.bind(this));
    }

    get available() {
-        return this._weatherApp != null;
+        return this._weatherAppMon.available;
    }

    get loading() {
@ -123,8 +92,7 @@ var WeatherClient = class {
    }

    activateApp() {
-        if (this._weatherApp)
-            this._weatherApp.activate();
+        this._weatherAppMon.activateApp();
    }

    update() {
@ -143,46 +111,7 @@ var WeatherClient = class {
    get _useAutoLocation() {
        return this._autoLocationRequested &&
               this._locationSettings.get_boolean('enabled') &&
-               (!this._needsAuth || this._weatherAuthorized);
-    }
-
-    _onWeatherProxyReady(o, res) {
-        try {
-            this._weatherProxy = Gio.DBusProxy.new_finish(res);
-        } catch (e) {
-            log(`Failed to create GNOME Weather proxy: ${e}`);
-            return;
-        }
-
-        this._weatherProxy.connect('g-properties-changed',
-            this._onWeatherPropertiesChanged.bind(this));
-        this._onWeatherPropertiesChanged();
-    }
-
-    _onWeatherPropertiesChanged() {
-        if (this._weatherProxy.g_name_owner == null)
-            return;
-
-        this._settings.set_boolean('automatic-location',
-            this._weatherProxy.AutomaticLocation);
-        this._settings.set_value('locations',
-            new GLib.Variant('av', this._weatherProxy.Locations));
-    }
-
-    _onInstalledChanged() {
-        let hadApp = this._weatherApp != null;
-        this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
-        let haveApp = this._weatherApp != null;
-
-        if (hadApp !== haveApp)
-            this.emit('changed');
-
-        let neededAuth = this._needsAuth;
-        this._needsAuth = this._weatherApp === null ||
-                          this._weatherApp.app_info.has_key('X-Flatpak');
-
-        if (neededAuth !== this._needsAuth)
-            this._updateAutoLocation();
+               this._weatherAuthorized;
    }

    _loadInfo() {
@ -213,7 +142,7 @@ var WeatherClient = class {

        this._weatherInfo.abort();
        this._weatherInfo.set_location(location);
-        this._locationValid = location != null;
+        this._locationValid = (location != null);

        this._weatherInfo.set_enabled_providers(location ? this._providers : 0);

@ -269,8 +198,8 @@ var WeatherClient = class {
        this._setLocation(location);
    }

-    _onAutomaticLocationChanged() {
-        let useAutoLocation = this._settings.get_boolean('automatic-location');
+    _onAutomaticLocationChanged(settings, key) {
+        let useAutoLocation = settings.get_boolean(key);
        if (this._autoLocationRequested == useAutoLocation)
            return;

@ -288,9 +217,8 @@ var WeatherClient = class {
            this._setLocation(this._mostRecentLocation);
    }

-    _onLocationsChanged() {
-        let locations = this._settings.get_value('locations').deep_unpack();
-        let serialized = locations.shift();
+    _onLocationsChanged(settings, key) {
+        let serialized = settings.get_value(key).deep_unpack().shift();
        let mostRecentLocation = null;

        if (serialized)
@ -306,7 +234,7 @@ var WeatherClient = class {
    }

    _onPermStoreChanged(proxy, sender, params) {
-        let [table, id, deleted_, data_, perms] = params;
+        let [table, id, deleted, data, perms] = params;

        if (table != 'gnome' || id != 'geolocation')
            return;
--- a/js/perf/core.js
+++ b/js/perf/core.js
@ -1,9 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported run, script_overviewShowStart, script_overviewShowDone,
-            script_applicationsShowStart, script_applicationsShowDone,
-            script_afterShowHide, malloc_usedSize, glx_swapComplete,
-            clutter_stagePaintDone */
-/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */

 const System = imports.system;

@ -57,7 +52,7 @@ var METRICS = {
      units: "us" },
    applicationsShowTimeSubsequent:
    { description: "Time to switch to applications view, second time",
-      units: "us" },
+      units: "us" }
 };

 let WINDOW_CONFIGS = [
@ -67,7 +62,7 @@ let WINDOW_CONFIGS = [
    { width: 640, height: 480, alpha: false, maximized: true,  count: 5,  metric: 'overviewFps5Maximized' },
    { width: 640, height: 480, alpha: false, maximized: true,  count: 10, metric: 'overviewFps10Maximized' },
    { width: 640, height: 480, alpha: true,  maximized: false, count: 5,  metric: 'overviewFps5Alpha' },
-    { width: 640, height: 480, alpha: true,  maximized: false, count: 10, metric: 'overviewFps10Alpha' },
+    { width: 640, height: 480, alpha: true,  maximized: false, count: 10, metric: 'overviewFps10Alpha' }
 ];

 function *run() {
@ -94,12 +89,11 @@ function *run() {
            let config = WINDOW_CONFIGS[i / 2];
            yield Scripting.destroyTestWindows();

-            for (let k = 0; k < config.count; k++) {
+            for (let k = 0; k < config.count; k++)
                yield Scripting.createTestWindow({ width: config.width,
                                                   height: config.height,
                                                   alpha: config.alpha,
                                                   maximized: config.maximized });
-            }

            yield Scripting.waitTestWindows();
            yield Scripting.sleep(1000);
@ -127,12 +121,10 @@ function *run() {

    for (let i = 0; i < 2; i++) {
        Scripting.scriptEvent('applicationsShowStart');
-        // eslint-disable-next-line require-atomic-updates
-        Main.overview.dash.showAppsButton.checked = true;
+        Main.overview._dash.showAppsButton.checked = true;
        yield Scripting.waitLeisure();
        Scripting.scriptEvent('applicationsShowDone');
-        // eslint-disable-next-line require-atomic-updates
-        Main.overview.dash.showAppsButton.checked = false;
+        Main.overview._dash.showAppsButton.checked = false;
        yield Scripting.waitLeisure();
    }
 }
@ -155,7 +147,7 @@ function script_overviewShowStart(time) {
    overviewFrames = 0;
 }

-function script_overviewShowDone(_time) {
+function script_overviewShowDone(time) {
    // We've set up the state at the end of the zoom out, but we
    // need to wait for one more frame to paint before we count
    // ourselves as done.
@ -174,11 +166,12 @@ function script_applicationsShowDone(time) {
        METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart;
 }

-function script_afterShowHide(_time) {
-    if (overviewShowCount == 1)
+function script_afterShowHide(time) {
+    if (overviewShowCount == 1) {
        METRICS.usedAfterOverview.value = mallocUsedSize;
-    else
+    } else {
        METRICS.leakedAfterOverview.value = mallocUsedSize - METRICS.usedAfterOverview.value;
+    }
 }

 function malloc_usedSize(time, bytes) {
--- a/js/perf/hwtest.js
+++ b/js/perf/hwtest.js
@ -1,12 +1,3 @@
-/* exported run, script_desktopShown, script_overviewShowStart,
-            script_overviewShowDone, script_applicationsShowStart,
-            script_applicationsShowDone, script_mainViewDrawStart,
-            script_mainViewDrawDone, script_overviewDrawStart,
-            script_overviewDrawDone, script_redrawTestStart,
-            script_redrawTestDone, script_collectTimings,
-            script_geditLaunch, script_geditFirstFrame,
-            clutter_stagePaintStart, clutter_paintCompletedTimestamp */
-/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */
 const { Clutter, Gio, Shell } = imports.gi;
 const Main = imports.ui.main;
 const Scripting = imports.ui.scripting;
@ -47,7 +38,7 @@ function waitAndDraw(milliseconds) {
    let timeline = new Clutter.Timeline({ duration: milliseconds });
    timeline.start();

-    timeline.connect('new-frame', (_timeline, _frame) => {
+    timeline.connect('new-frame', (timeline, frame) => {
        global.stage.queue_redraw();
    });

@ -57,7 +48,7 @@ function waitAndDraw(milliseconds) {
            cb();
    });

-    return callback => (cb = callback);
+    return callback => cb = callback;
 }

 function waitSignal(object, signal) {
@ -69,7 +60,7 @@ function waitSignal(object, signal) {
            cb();
    });

-    return callback => (cb = callback);
+    return callback => cb = callback;
 }

 function extractBootTimestamp() {
@ -82,8 +73,8 @@ function extractBootTimestamp() {
    let result = null;

    let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe());
-    while (true) { // eslint-disable-line no-constant-condition
-        let [line, length_] = datastream.read_line_utf8(null);
+    while (true) {
+        let [line, length] = datastream.read_line_utf8(null);
        if (line === null)
            break;

@ -114,7 +105,7 @@ function *run() {
    Scripting.scriptEvent('desktopShown');

    let interfaceSettings = new Gio.Settings({
-        schema_id: 'org.gnome.desktop.interface',
+        schema_id: 'org.gnome.desktop.interface'
    });
    interfaceSettings.set_boolean('enable-animations', false);

@ -126,8 +117,7 @@ function *run() {
    yield Scripting.sleep(1000);

    Scripting.scriptEvent('applicationsShowStart');
-    // eslint-disable-next-line require-atomic-updates
-    Main.overview.dash.showAppsButton.checked = true;
+    Main.overview._dash.showAppsButton.checked = true;

    yield Scripting.waitLeisure();
    Scripting.scriptEvent('applicationsShowDone');
@ -137,9 +127,9 @@ function *run() {
    Main.overview.hide();
    yield Scripting.waitLeisure();

-    // --------------------- //
-    // Tests of redraw speed //
-    // --------------------- //
+    ////////////////////////////////////////
+    // Tests of redraw speed
+    ////////////////////////////////////////

    global.frame_timestamps = true;
    global.frame_finish_timestamp = true;
@ -186,6 +176,8 @@ function *run() {

    yield Scripting.sleep(1000);

+    ////////////////////////////////////////
+
    let appSys = Shell.AppSystem.get_default();
    let app = appSys.lookup_app('org.gnome.gedit.desktop');

@ -242,31 +234,31 @@ function script_applicationsShowDone(time) {
    METRICS.applicationsShowTime.value = time - applicationsShowStart;
 }

-function script_mainViewDrawStart(_time) {
+function script_mainViewDrawStart(time) {
    redrawTiming = 'mainView';
 }

-function script_mainViewDrawDone(_time) {
+function script_mainViewDrawDone(time) {
    redrawTiming = null;
 }

-function script_overviewDrawStart(_time) {
+function script_overviewDrawStart(time) {
    redrawTiming = 'overview';
 }

-function script_overviewDrawDone(_time) {
+function script_overviewDrawDone(time) {
    redrawTiming = null;
 }

-function script_redrawTestStart(_time) {
+function script_redrawTestStart(time) {
    redrawTiming = 'application';
 }

-function script_redrawTestDone(_time) {
+function script_redrawTestDone(time) {
    redrawTiming = null;
 }

-function script_collectTimings(_time) {
+function script_collectTimings(time) {
    for (let timing in redrawTimes) {
        let times = redrawTimes[timing];
        times.sort((a, b) => a - b);
--- a/js/portalHelper/main.js
+++ b/js/portalHelper/main.js
@ -1,4 +1,3 @@
-/* exported main */
 const Format = imports.format;
 const Gettext = imports.gettext;
 const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi;
@ -11,17 +10,17 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
 const PortalHelperResult = {
    CANCELLED: 0,
    COMPLETED: 1,
-    RECHECK: 2,
+    RECHECK: 2
 };

 const PortalHelperSecurityLevel = {
    NOT_YET_DETERMINED: 0,
    SECURE: 1,
-    INSECURE: 2,
+    INSECURE: 2
 };

 const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org';
-const CONNECTIVITY_CHECK_URI = `http://${CONNECTIVITY_CHECK_HOST}`;
+const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST;
 const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC;

 const HelperDBusInterface = loadInterfaceXML('org.gnome.Shell.PortalHelper');
@ -92,7 +91,7 @@ class PortalHeaderBar extends Gtk.HeaderBar {
 var PortalWindow = GObject.registerClass(
 class PortalWindow extends Gtk.ApplicationWindow {
    _init(application, url, timestamp, doneCallback) {
-        super._init({ application });
+        super._init({ application: application });

        this.connect('delete-event', this.destroyWindow.bind(this));
        this._headerBar = new PortalHeaderBar();
@ -152,7 +151,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
        this._webView.load_uri(this._originalUrl);
    }

-    vfunc_delete_event(_event) {
+    vfunc_delete_event(event) {
        if (this._recheckAtExit)
            this._doneCallback(PortalHelperResult.RECHECK);
        else
@ -178,7 +177,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
        this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
    }

-    _onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) {
+    _onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) {
        this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
        let uri = new Soup.URI(failingURI);
        this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host());
@ -287,7 +286,7 @@ class WebPortalHelper extends Gtk.Application {
    }

    Authenticate(connection, url, timestamp) {
-        this._queue.push({ connection, url, timestamp });
+        this._queue.push({ connection: connection, url: url, timestamp: timestamp });

        this._processQueue();
    }
--- a/js/ui/accessDialog.js
+++ b/js/ui/accessDialog.js
@ -1,4 +1,3 @@
-/* exported AccessDialogDBus */
 const { Clutter, Gio, GLib, GObject, Shell } = imports.gi;

 const CheckBox = imports.ui.checkBox;
@ -13,7 +12,7 @@ const AccessIface = loadInterfaceXML('org.freedesktop.impl.portal.Access');
 var DialogResponse = {
    OK: 0,
    CANCEL: 1,
-    CLOSED: 2,
+    CLOSED: 2
 };

 var AccessDialog = GObject.registerClass(
@ -35,7 +34,7 @@ class AccessDialog extends ModalDialog.ModalDialog {

    _buildLayout(title, subtitle, body, options) {
        // No support for non-modal system dialogs, so ignore the option
-        // let modal = options['modal'] || true;
+        //let modal = options['modal'] || true;
        let denyLabel = options['deny_label'] || _("Deny Access");
        let grantLabel = options['grant_label'] || _("Grant Access");
        let iconName = options['icon'] || null;
@ -56,8 +55,8 @@ class AccessDialog extends ModalDialog.ModalDialog {

            let check = new CheckBox.CheckBox();
            check.getLabelActor().text = name;
-            check.checked = selected == "true";
-            content.insertBeforeBody(check);
+            check.actor.checked = selected == "true";
+            content.insertBeforeBody(check.actor);

            this._choices.set(id, check);
        }
@ -80,7 +79,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
        this._requestExported = this._request.export(connection, this._handle);
    }

-    CloseAsync(invocation, _params) {
+    CloseAsync(invocation, params) {
        if (this._invocation.get_sender() != invocation.get_sender()) {
            invocation.return_error_literal(Gio.DBusError,
                                            Gio.DBusError.ACCESS_DENIED,
@ -99,7 +98,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
        let results = {};
        if (response == DialogResponse.OK) {
            for (let [id, check] of this._choices) {
-                let checked = check.checked ? 'true' : 'false';
+                let checked = check.actor.checked ? 'true' : 'false';
                results[id] = new GLib.Variant('s', checked);
            }
        }
@ -133,7 +132,7 @@ var AccessDialogDBus = class {
            return;
        }

-        let [handle, appId, parentWindow_, title, subtitle, body, options] = params;
+        let [handle, appId, parentWindow, title, subtitle, body, options] = params;
        // We probably want to use parentWindow and global.display.focus_window
        // for this check in the future
        if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) {
@ -147,7 +146,7 @@ var AccessDialogDBus = class {
                                      subtitle, body, options);
        dialog.open();

-        dialog.connect('closed', () => (this._accessDialog = null));
+        dialog.connect('closed', () => this._accessDialog = null);

        this._accessDialog = dialog;
    }
--- a/js/ui/altTab.js
+++ b/js/ui/altTab.js
@ -1,17 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup,
-            WindowCyclerPopup */

 const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
+const Mainloop = imports.mainloop;

 const Main = imports.ui.main;
 const SwitcherPopup = imports.ui.switcherPopup;
+const Tweener = imports.ui.tweener;

 var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds

 var THUMBNAIL_DEFAULT_SIZE = 256;
 var THUMBNAIL_POPUP_TIME = 500; // milliseconds
-var THUMBNAIL_FADE_TIME = 100; // milliseconds
+var THUMBNAIL_FADE_TIME = 0.1; // seconds

 var WINDOW_PREVIEW_SIZE = 128;
 var APP_ICON_SIZE = 96;
@ -62,7 +62,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {

        this.thumbnailsVisible = false;

-        let apps = Shell.AppSystem.get_default().get_running();
+        let apps = Shell.AppSystem.get_default().get_running ();

        if (apps.length == 0)
            return;
@ -87,9 +87,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
            let hPadding = leftPadding + rightPadding;

            let icon = this._items[this._selectedIndex];
-            let [posX] = icon.get_transformed_position();
+            let [posX, posY] = icon.get_transformed_position();
            let thumbnailCenter = posX + icon.width / 2;
-            let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
+            let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
            childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2));
            if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) {
                let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding;
@ -103,7 +103,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
                childBox.x2 = primary.x + primary.width - rightPadding;
            childBox.y1 = this._switcherList.allocation.y2 + spacing;
            this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1);
-            let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
+            let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
            childBox.y2 = childBox.y1 + childNaturalHeight;
            this._thumbnails.allocate(childBox, flags);
        }
@ -111,12 +111,14 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {

    _initialSelection(backward, binding) {
        if (binding == 'switch-group') {
-            if (backward)
+            if (backward) {
                this._select(0, this._items[0].cachedWindows.length - 1);
-            else if (this._items[0].cachedWindows.length > 1)
-                this._select(0, 1);
-            else
-                this._select(0, 0);
+            } else {
+                if (this._items[0].cachedWindows.length > 1)
+                    this._select(0, 1);
+                else
+                    this._select(0, 0);
+            }
        } else if (binding == 'switch-group-backward') {
            this._select(0, this._items[0].cachedWindows.length - 1);
        } else if (binding == 'switch-applications-backward') {
@ -178,27 +180,28 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
            this._select(this._next());
        } else if (action == Meta.KeyBindingAction.SWITCH_APPLICATIONS_BACKWARD) {
            this._select(this._previous());
-        } else if (keysym === Clutter.KEY_q) {
+        } else if (keysym == Clutter.q) {
            this._quitApplication(this._selectedIndex);
        } else if (this._thumbnailsFocused) {
-            if (keysym === Clutter.KEY_Left)
+            if (keysym == Clutter.Left)
                this._select(this._selectedIndex, this._previousWindow());
-            else if (keysym === Clutter.KEY_Right)
+            else if (keysym == Clutter.Right)
                this._select(this._selectedIndex, this._nextWindow());
-            else if (keysym === Clutter.KEY_Up)
+            else if (keysym == Clutter.Up)
                this._select(this._selectedIndex, null, true);
-            else if (keysym === Clutter.KEY_w || keysym === Clutter.KEY_F4)
+            else if (keysym == Clutter.w || keysym == Clutter.F4)
                this._closeAppWindow(this._selectedIndex, this._currentWindow);
            else
                return Clutter.EVENT_PROPAGATE;
-        } else if (keysym == Clutter.KEY_Left) {
-            this._select(this._previous());
-        } else if (keysym == Clutter.KEY_Right) {
-            this._select(this._next());
-        } else if (keysym == Clutter.KEY_Down) {
-            this._select(this._selectedIndex, 0);
        } else {
-            return Clutter.EVENT_PROPAGATE;
+            if (keysym == Clutter.Left)
+                this._select(this._previous());
+            else if (keysym == Clutter.Right)
+                this._select(this._next());
+            else if (keysym == Clutter.Down)
+                this._select(this._selectedIndex, 0);
+            else
+                return Clutter.EVENT_PROPAGATE;
        }

        return Clutter.EVENT_STOP;
@ -288,14 +291,14 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
        if (this._thumbnails)
            this._destroyThumbnails();
        if (this._thumbnailTimeoutId != 0)
-            GLib.source_remove(this._thumbnailTimeoutId);
+            Mainloop.source_remove(this._thumbnailTimeoutId);
    }

    /**
     * _select:
-     * @param {number} app: index of the app to select
-     * @param {number=} window: index of which of @app's windows to select
-     * @param {bool} forceAppFocus: optional flag, see below
+     * @app: index of the app to select
+     * @window: (optional) index of which of @app's windows to select
+     * @forceAppFocus: optional flag, see below
     *
     * Selects the indicated @app, and optional @window, and sets
     * this._thumbnailsFocused appropriately to indicate whether the
@ -323,7 +326,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
        }

        if (this._thumbnailTimeoutId != 0) {
-            GLib.source_remove(this._thumbnailTimeoutId);
+            Mainloop.source_remove(this._thumbnailTimeoutId);
            this._thumbnailTimeoutId = 0;
        }

@ -340,8 +343,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
            this._thumbnails.highlight(window, forceAppFocus);
        } else if (this._items[this._selectedIndex].cachedWindows.length > 1 &&
                   !forceAppFocus) {
-            this._thumbnailTimeoutId = GLib.timeout_add(
-                GLib.PRIORITY_DEFAULT,
+            this._thumbnailTimeoutId = Mainloop.timeout_add (
                THUMBNAIL_POPUP_TIME,
                this._timeoutPopupThumbnails.bind(this));
            GLib.Source.set_name_by_id(this._thumbnailTimeoutId, '[gnome-shell] this._timeoutPopupThumbnails');
@ -358,22 +360,22 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {

    _destroyThumbnails() {
        let thumbnailsActor = this._thumbnails;
-        this._thumbnails.ease({
-            opacity: 0,
-            duration: THUMBNAIL_FADE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                thumbnailsActor.destroy();
-                this.thumbnailsVisible = false;
-            },
-        });
+        Tweener.addTween(thumbnailsActor,
+                         { opacity: 0,
+                           time: THUMBNAIL_FADE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               thumbnailsActor.destroy();
+                               this.thumbnailsVisible = false;
+                           }
+                         });
        this._thumbnails = null;
        if (this._switcherList._items[this._selectedIndex])
-            this._switcherList._items[this._selectedIndex].remove_accessible_state(Atk.StateType.EXPANDED);
+            this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
    }

    _createThumbnails() {
-        this._thumbnails = new ThumbnailList(this._items[this._selectedIndex].cachedWindows);
+        this._thumbnails = new ThumbnailList (this._items[this._selectedIndex].cachedWindows);
        this._thumbnails.connect('item-activated', this._windowActivated.bind(this));
        this._thumbnails.connect('item-entered', this._windowEntered.bind(this));
        this._thumbnails.connect('item-removed', this._windowRemoved.bind(this));
@ -389,39 +391,38 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
        this._thumbnails.get_allocation_box();

        this._thumbnails.opacity = 0;
-        this._thumbnails.ease({
-            opacity: 255,
-            duration: THUMBNAIL_FADE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this.thumbnailsVisible = true;
-            },
-        });
+        Tweener.addTween(this._thumbnails,
+                         { opacity: 255,
+                           time: THUMBNAIL_FADE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => this.thumbnailsVisible = true
+                         });

-        this._switcherList._items[this._selectedIndex].add_accessible_state(Atk.StateType.EXPANDED);
+        this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
    }
 });

-var CyclerHighlight = GObject.registerClass(
-class CyclerHighlight extends St.Widget {
-    _init() {
-        super._init({ layout_manager: new Clutter.BinLayout() });
+class CyclerHighlight {
+    constructor() {
        this._window = null;

+        this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout() });
+
        this._clone = new Clutter.Clone();
-        this.add_actor(this._clone);
+        this.actor.add_actor(this._clone);

        this._highlight = new St.Widget({ style_class: 'cycler-highlight' });
-        this.add_actor(this._highlight);
+        this.actor.add_actor(this._highlight);

        let coordinate = Clutter.BindCoordinate.ALL;
-        let constraint = new Clutter.BindConstraint({ coordinate });
+        let constraint = new Clutter.BindConstraint({ coordinate: coordinate });
        this._clone.bind_property('source', constraint, 'source', 0);

-        this.add_constraint(constraint);
+        this.actor.add_constraint(constraint);

-        this.connect('notify::allocation', this._onAllocationChanged.bind(this));
-        this.connect('destroy', this._onDestroy.bind(this));
+        this.actor.connect('notify::allocation',
+                           this._onAllocationChanged.bind(this));
+        this.actor.connect('destroy', this._onDestroy.bind(this));
    }

    set window(w) {
@ -433,8 +434,8 @@ class CyclerHighlight extends St.Widget {
        if (this._clone.source)
            this._clone.source.sync_visibility();

-        let windowActor = this._window
-            ? this._window.get_compositor_private() : null;
+        let windowActor = this._window ? this._window.get_compositor_private()
+                                       : null;

        if (windowActor)
            windowActor.hide();
@ -447,7 +448,7 @@ class CyclerHighlight extends St.Widget {
            this._highlight.set_size(0, 0);
            this._highlight.hide();
        } else {
-            let [x, y] = this.allocation.get_origin();
+            let [x, y] = this.actor.allocation.get_origin();
            let rect = this._window.get_frame_rect();
            this._highlight.set_size(rect.width, rect.height);
            this._highlight.set_position(rect.x - x, rect.y - y);
@ -458,7 +459,7 @@ class CyclerHighlight extends St.Widget {
    _onDestroy() {
        this.window = null;
    }
-});
+}

 // We don't show an actual popup, so just provide what SwitcherPopup
 // expects instead of inheriting from SwitcherList
@ -468,13 +469,13 @@ var CyclerList = GObject.registerClass({
               'item-removed': { param_types: [GObject.TYPE_INT] },
               'item-highlighted': { param_types: [GObject.TYPE_INT] } },
 }, class CyclerList extends St.Widget {
-    highlight(index, _justOutline) {
+    highlight(index, justOutline) {
        this.emit('item-highlighted', index);
    }
 });

 var CyclerPopup = GObject.registerClass({
-    GTypeFlags: GObject.TypeFlags.ABSTRACT,
+    GTypeFlags: GObject.TypeFlags.ABSTRACT
 }, class CyclerPopup extends SwitcherPopup.SwitcherPopup {
    _init() {
        super._init();
@ -485,7 +486,7 @@ var CyclerPopup = GObject.registerClass({
            return;

        this._highlight = new CyclerHighlight();
-        global.window_group.add_actor(this._highlight);
+        global.window_group.add_actor(this._highlight.actor);

        this._switcherList = new CyclerList();
        this._switcherList.connect('item-highlighted', (list, index) => {
@ -493,9 +494,9 @@ var CyclerPopup = GObject.registerClass({
        });
    }

-    _highlightItem(index, _justOutline) {
+    _highlightItem(index, justOutline) {
        this._highlight.window = this._items[index];
-        global.window_group.set_child_above_sibling(this._highlight, null);
+        global.window_group.set_child_above_sibling(this._highlight.actor, null);
    }

    _finish() {
@ -525,7 +526,7 @@ var CyclerPopup = GObject.registerClass({
    }

    _onDestroy() {
-        this._highlight.destroy();
+        this._highlight.actor.destroy();

        super._onDestroy();
    }
@ -588,18 +589,20 @@ class WindowSwitcherPopup extends SwitcherPopup.SwitcherPopup {
    }

    _keyPressHandler(keysym, action) {
-        if (action == Meta.KeyBindingAction.SWITCH_WINDOWS)
+        if (action == Meta.KeyBindingAction.SWITCH_WINDOWS) {
            this._select(this._next());
-        else if (action == Meta.KeyBindingAction.SWITCH_WINDOWS_BACKWARD)
+        } else if (action == Meta.KeyBindingAction.SWITCH_WINDOWS_BACKWARD) {
            this._select(this._previous());
-        else if (keysym == Clutter.KEY_Left)
-            this._select(this._previous());
-        else if (keysym == Clutter.KEY_Right)
-            this._select(this._next());
-        else if (keysym == Clutter.KEY_w || keysym == Clutter.KEY_F4)
-            this._closeWindow(this._selectedIndex);
-        else
-            return Clutter.EVENT_PROPAGATE;
+        } else {
+            if (keysym == Clutter.Left)
+                this._select(this._previous());
+            else if (keysym == Clutter.Right)
+                this._select(this._next());
+            else if (keysym == Clutter.w || keysym == Clutter.F4)
+                this._closeWindow(this._selectedIndex);
+            else
+                return Clutter.EVENT_PROPAGATE;
+        }

        return Clutter.EVENT_STOP;
    }
@ -650,17 +653,13 @@ class AppIcon extends St.BoxLayout {

        this.app = app;
        this.icon = null;
-        this._iconBin = new St.Bin();
+        this._iconBin = new St.Bin({ x_fill: true, y_fill: true });

-        this.add_child(this._iconBin);
-        this.label = new St.Label({
-            text: this.app.get_name(),
-            x_align: Clutter.ActorAlign.CENTER,
-        });
-        this.add_child(this.label);
+        this.add(this._iconBin, { x_fill: false, y_fill: false } );
+        this.label = new St.Label({ text: this.app.get_name() });
+        this.add(this.label, { x_fill: false });
    }

-    // eslint-disable-next-line camelcase
    set_size(size) {
        this.icon = this.app.create_icon_texture(size);
        this._iconBin.child = this.icon;
@ -693,7 +692,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
            // Cache the window list now; we don't handle dynamic changes here,
            // and we don't want to be continually retrieving it
            appIcon.cachedWindows = allWindows.filter(
-                w => windowTracker.get_window_app(w) == appIcon.app
+                w => windowTracker.get_window_app (w) == appIcon.app
            );
            if (appIcon.cachedWindows.length > 0)
                this._addIcon(appIcon);
@ -708,7 +707,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {

    _onDestroy() {
        if (this._mouseTimeOutId != 0)
-            GLib.source_remove(this._mouseTimeOutId);
+            Mainloop.source_remove(this._mouseTimeOutId);

        this.icons.forEach(icon => {
            icon.app.disconnect(icon._stateChangedId);
@ -717,9 +716,9 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {

    _setIconSize() {
        let j = 0;
-        while (this._items.length > 1 && this._items[j].style_class != 'item-box')
+        while (this._items.length > 1 && this._items[j].style_class != 'item-box') {
            j++;
-
+        }
        let themeNode = this._items[j].get_theme_node();
        this._list.ensure_style();

@ -787,16 +786,14 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
    // activation when the thumbnail list is open
    _onItemEnter(index) {
        if (this._mouseTimeOutId != 0)
-            GLib.source_remove(this._mouseTimeOutId);
+            Mainloop.source_remove(this._mouseTimeOutId);
        if (this._altTabPopup.thumbnailsVisible) {
-            this._mouseTimeOutId = GLib.timeout_add(
-                GLib.PRIORITY_DEFAULT,
-                APP_ICON_HOVER_TIMEOUT,
-                () => {
-                    this._enterItem(index);
-                    this._mouseTimeOutId = 0;
-                    return GLib.SOURCE_REMOVE;
-                });
+            this._mouseTimeOutId = Mainloop.timeout_add(APP_ICON_HOVER_TIMEOUT,
+                                                        () => {
+                                                            this._enterItem(index);
+                                                            this._mouseTimeOutId = 0;
+                                                            return GLib.SOURCE_REMOVE;
+                                                        });
            GLib.Source.set_name_by_id(this._mouseTimeOutId, '[gnome-shell] this._enterItem');
        } else {
            this._itemEntered(index);
@ -804,7 +801,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
    }

    _enterItem(index) {
-        let [x, y] = global.get_pointer();
+        let [x, y, mask] = global.get_pointer();
        let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y);
        if (this._items[index].contains(pickedActor))
            this._itemEntered(index);
@ -853,7 +850,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
        if (appIcon.cachedWindows.length == 1)
            arrow.hide();
        else
-            item.add_accessible_state(Atk.StateType.EXPANDABLE);
+            item.add_accessible_state (Atk.StateType.EXPANDABLE);
    }

    _removeIcon(app) {
@ -873,9 +870,9 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
    _init(windows) {
        super._init(false);

-        this._labels = [];
-        this._thumbnailBins = [];
-        this._clones = [];
+        this._labels = new Array();
+        this._thumbnailBins = new Array();
+        this._clones = new Array();
        this._windows = windows;

        for (let i = 0; i < windows.length; i++) {
@ -889,13 +886,12 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {

            let title = windows[i].get_title();
            if (title) {
-                let name = new St.Label({
-                    text: title,
-                    // St.Label doesn't support text-align
-                    x_align: Clutter.ActorAlign.CENTER,
-                });
-                this._labels.push(name);
-                box.add_actor(name);
+                let name = new St.Label({ text: title });
+                // St.Label doesn't support text-align so use a Bin
+                let bin = new St.Bin({ x_align: St.Align.MIDDLE });
+                this._labels.push(bin);
+                bin.add_actor(name);
+                box.add_actor(bin);

                this.addItem(box, name);
            } else {
@ -912,7 +908,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
            return;
        let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding();
        totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding();
-        let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
+        let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
        let spacing = this._items[0].child.get_theme_node().get_length('spacing');
        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
        let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor;
@ -937,7 +933,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
        }

        // Make sure we only do this once
-        this._thumbnailBins = [];
+        this._thumbnailBins = new Array();
    }

    _removeThumbnail(source, clone) {
@ -974,7 +970,7 @@ class WindowIcon extends St.BoxLayout {

        this._icon = new St.Widget({ layout_manager: new Clutter.BinLayout() });

-        this.add_child(this._icon);
+        this.add(this._icon, { x_fill: false, y_fill: false } );
        this.label = new St.Label({ text: window.get_title() });

        let tracker = Shell.WindowTracker.get_default();
@ -997,10 +993,9 @@ class WindowIcon extends St.BoxLayout {
            size = WINDOW_PREVIEW_SIZE;
            this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));

-            if (this.app) {
+            if (this.app)
                this._icon.add_actor(this._createAppIcon(this.app,
                                                         APP_ICON_SIZE_SMALL));
-            }
            break;

        case AppIconMode.APP_ICON_ONLY:
@ -1012,9 +1007,9 @@ class WindowIcon extends St.BoxLayout {
    }

    _createAppIcon(app, size) {
-        let appIcon = app
-            ? app.create_icon_texture(size)
-            : new St.Icon({ icon_name: 'icon-missing', icon_size: size });
+        let appIcon = app ? app.create_icon_texture(size)
+                          : new St.Icon({ icon_name: 'icon-missing',
+                                          icon_size: size });
        appIcon.x_expand = appIcon.y_expand = true;
        appIcon.x_align = appIcon.y_align = Clutter.ActorAlign.END;

@ -1041,7 +1036,7 @@ class WindowList extends SwitcherPopup.SwitcherList {
            this.addItem(icon, icon.label);
            this.icons.push(icon);

-            icon._unmanagedSignalId = icon.window.connect('unmanaged', window => {
+            icon._unmanagedSignalId = icon.window.connect('unmanaged', (window) => {
                this._removeWindow(window);
            });
        }
--- a/js/ui/animation.js
+++ b/js/ui/animation.js
@ -1,20 +1,21 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Animation, AnimatedIcon, Spinner */

-const { Clutter, GLib, GObject, Gio, St } = imports.gi;
+const { GLib, Gio, St } = imports.gi;
+const Mainloop = imports.mainloop;

-const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
-var SPINNER_ANIMATION_TIME = 300;
-var SPINNER_ANIMATION_DELAY = 1000;
+var SPINNER_ANIMATION_TIME = 0.3;
+var SPINNER_ANIMATION_DELAY = 1.0;

-var Animation = GObject.registerClass(
-class Animation extends St.Bin {
-    _init(file, width, height, speed) {
-        super._init({ width, height });
-        this.connect('destroy', this._onDestroy.bind(this));
-        this.connect('resource-scale-changed',
+var Animation = class {
+    constructor(file, width, height, speed) {
+        this.actor = new St.Bin();
+        this.actor.set_size(width, height);
+        this.actor.connect('destroy', this._onDestroy.bind(this));
+        this.actor.connect('notify::size', this._syncAnimationSize.bind(this));
+        this.actor.connect('resource-scale-changed',
            this._loadFile.bind(this, file, width, height));

        let themeContext = St.ThemeContext.get_for_stage(global.stage);
@ -45,7 +46,7 @@ class Animation extends St.Bin {

    stop() {
        if (this._timeoutId > 0) {
-            GLib.source_remove(this._timeoutId);
+            Mainloop.source_remove(this._timeoutId);
            this._timeoutId = 0;
        }

@ -53,34 +54,20 @@ class Animation extends St.Bin {
    }

    _loadFile(file, width, height) {
-        let [validResourceScale, resourceScale] = this.get_resource_scale();
-        let wasPlaying = this._isPlaying;
-
-        if (this._isPlaying)
-            this.stop();
+        let [validResourceScale, resourceScale] = this.actor.get_resource_scale();

        this._isLoaded = false;
-        this.destroy_all_children();
+        this.actor.destroy_all_children();

-        if (!validResourceScale) {
-            if (wasPlaying)
-                this.play();
+        if (!validResourceScale)
            return;
-        }

        let textureCache = St.TextureCache.get_default();
        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
        this._animations = textureCache.load_sliced_image(file, width, height,
                                                          scaleFactor, resourceScale,
                                                          this._animationsLoaded.bind(this));
-        this._animations.set({
-            x_align: Clutter.ActorAlign.CENTER,
-            y_align: Clutter.ActorAlign.CENTER,
-        });
-        this.set_child(this._animations);
-
-        if (wasPlaying)
-            this.play();
+        this.actor.set_child(this._animations);
    }

    _showFrame(frame) {
@ -88,7 +75,7 @@ class Animation extends St.Bin {
        if (oldFrameActor)
            oldFrameActor.hide();

-        this._frame = frame % this._animations.get_n_children();
+        this._frame = (frame % this._animations.get_n_children());

        let newFrameActor = this._animations.get_child_at_index(this._frame);
        if (newFrameActor)
@ -104,7 +91,7 @@ class Animation extends St.Bin {
        if (!this._isLoaded)
            return;

-        let [width, height] = this.get_size();
+        let [width, height] = this.actor.get_size();

        for (let i = 0; i < this._animations.get_n_children(); ++i)
            this._animations.get_child_at_index(i).set_size(width, height);
@ -127,29 +114,21 @@ class Animation extends St.Bin {
            themeContext.disconnect(this._scaleChangedId);
        this._scaleChangedId = 0;
    }
-});
+};

-var AnimatedIcon = GObject.registerClass(
-class AnimatedIcon extends Animation {
-    _init(file, size) {
-        super._init(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT);
+var AnimatedIcon = class extends Animation {
+    constructor(file, size) {
+        super(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT);
    }
-});
+};

-var Spinner = GObject.registerClass(
-class Spinner extends AnimatedIcon {
-    _init(size, params) {
-        params = Params.parse(params, {
-            animate: false,
-            hideOnStop: false,
-        });
+var Spinner = class extends AnimatedIcon {
+    constructor(size, animate = false) {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg');
-        super._init(file, size);
+        super(file, size);

-        this.opacity = 0;
-        this._animate = params.animate;
-        this._hideOnStop = params.hideOnStop;
-        this.visible = !this._hideOnStop;
+        this.actor.opacity = 0;
+        this._animate = animate;
    }

    _onDestroy() {
@ -158,43 +137,37 @@ class Spinner extends AnimatedIcon {
    }

    play() {
-        this.remove_all_transitions();
-        this.show();
+        Tweener.removeTweens(this.actor);

        if (this._animate) {
            super.play();
-            this.ease({
+            Tweener.addTween(this.actor, {
                opacity: 255,
                delay: SPINNER_ANIMATION_DELAY,
-                duration: SPINNER_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.LINEAR,
+                time: SPINNER_ANIMATION_TIME,
+                transition: 'linear'
            });
        } else {
-            this.opacity = 255;
+            this.actor.opacity = 255;
            super.play();
        }
    }

    stop() {
-        this.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        if (this._animate) {
-            this.ease({
+            Tweener.addTween(this.actor, {
                opacity: 0,
-                duration: SPINNER_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.LINEAR,
+                time: SPINNER_ANIMATION_TIME,
+                transition: 'linear',
                onComplete: () => {
                    super.stop();
-                    if (this._hideOnStop)
-                        this.hide();
-                },
+                }
            });
        } else {
-            this.opacity = 0;
+            this.actor.opacity = 0;
            super.stop();
-
-            if (this._hideOnStop)
-                this.hide();
        }
    }
-});
+};
--- a/js/ui/appDisplay.js
+++ b/js/ui/appDisplay.js
--- a/js/ui/appFavorites.js
+++ b/js/ui/appFavorites.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getAppFavorites */

 const Shell = imports.gi.Shell;
 const Signals = imports.signals;
@ -55,7 +54,6 @@ const RENAMED_DESKTOP_IDS = {
    'org.gnome.taquin.desktop': 'org.gnome.Taquin.desktop',
    'org.gnome.Weather.Application.desktop': 'org.gnome.Weather.desktop',
    'polari.desktop': 'org.gnome.Polari.desktop',
-    'shotwell.desktop': 'org.gnome.Shotwell.desktop',
    'tali.desktop': 'org.gnome.Tali.desktop',
    'totem.desktop': 'org.gnome.Totem.desktop',
    'evince.desktop': 'org.gnome.Evince.desktop',
@ -148,11 +146,12 @@ class AppFavorites {

        let app = Shell.AppSystem.get_default().lookup_app(appId);

-        let msg = _("%s has been added to your favorites.").format(app.get_name());
-        Main.overview.setMessage(msg, {
-            forFeedback: true,
-            undoCallback: () => this._removeFavorite(appId),
-        });
+        Main.overview.setMessage(_("%s has been added to your favorites.").format(app.get_name()),
+                                 { forFeedback: true,
+                                   undoCallback: () => {
+                                       this._removeFavorite(appId);
+                                   }
+                                 });
    }

    addFavorite(appId) {
@ -181,11 +180,12 @@ class AppFavorites {
        if (!this._removeFavorite(appId))
            return;

-        let msg = _("%s has been removed from your favorites.").format(app.get_name());
-        Main.overview.setMessage(msg, {
-            forFeedback: true,
-            undoCallback: () => this._addFavorite(appId, pos),
-        });
+        Main.overview.setMessage(_("%s has been removed from your favorites.").format(app.get_name()),
+                                 { forFeedback: true,
+                                   undoCallback: () => {
+                                       this._addFavorite(appId, pos);
+                                   }
+                                 });
    }
 }
 Signals.addSignalMethods(AppFavorites.prototype);
--- a/js/ui/audioDeviceSelection.js
+++ b/js/ui/audioDeviceSelection.js
@ -1,4 +1,3 @@
-/* exported AudioDeviceSelectionDBus */
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;

 const Main = imports.ui.main;
@ -9,13 +8,13 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
 var AudioDevice = {
    HEADPHONES: 1 << 0,
    HEADSET:    1 << 1,
-    MICROPHONE: 1 << 2,
+    MICROPHONE: 1 << 2
 };

 const AudioDeviceSelectionIface = loadInterfaceXML('org.gnome.Shell.AudioDeviceSelection');

 var AudioDeviceSelectionDialog = GObject.registerClass({
-    Signals: { 'device-selected': { param_types: [GObject.TYPE_UINT] } },
+    Signals: { 'device-selected': { param_types: [GObject.TYPE_UINT] } }
 }, class AudioDeviceSelectionDialog extends ModalDialog.ModalDialog {
    _init(devices) {
        super._init({ styleClass: 'audio-device-selection-dialog' });
@ -35,7 +34,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
            throw new Error('Too few devices for a selection');
    }

-    _buildLayout() {
+    _buildLayout(devices) {
        let title = new St.Label({ style_class: 'audio-selection-title',
                                   text: _("Select Audio Device"),
                                   x_align: Clutter.ActorAlign.CENTER });
@ -43,19 +42,15 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
        this.contentLayout.style_class = 'audio-selection-content';
        this.contentLayout.add(title);

-        this._selectionBox = new St.BoxLayout({
-            style_class: 'audio-selection-box',
-            x_expand: true,
-        });
-        this.contentLayout.add_child(this._selectionBox);
+        this._selectionBox = new St.BoxLayout({ style_class: 'audio-selection-box' });
+        this.contentLayout.add(this._selectionBox, { expand: true });

-        if (Main.sessionMode.allowSettings) {
+        if (Main.sessionMode.allowSettings)
            this.addButton({ action: this._openSettings.bind(this),
                             label: _("Sound Settings") });
-        }
        this.addButton({ action: this.close.bind(this),
                         label: _("Cancel"),
-                         key: Clutter.KEY_Escape });
+                         key: Clutter.Escape });
    }

    _getDeviceLabel(device) {
@ -90,7 +85,6 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
        box.connect('notify::height', () => {
            Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
                box.width = box.height;
-                return GLib.SOURCE_REMOVE;
            });
        });

@ -165,7 +159,7 @@ var AudioDeviceSelectionDBus = class AudioDeviceSelectionDBus {

        let [deviceNames] = params;
        let devices = 0;
-        deviceNames.forEach(n => (devices |= AudioDevice[n.toUpperCase()]));
+        deviceNames.forEach(n => devices |= AudioDevice[n.toUpperCase()]);

        let dialog;
        try {
--- a/js/ui/background.js
+++ b/js/ui/background.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported SystemBackground */

 // READ THIS FIRST
 // Background handling is a maze of objects, both objects in this file, and
@ -94,12 +93,13 @@
 //     MetaBackgroundImage         MetaBackgroundImage
 //     MetaBackgroundImage         MetaBackgroundImage

-const { Clutter, GDesktopEnums, Gio, GLib, GObject, GnomeDesktop, Meta } = imports.gi;
+const { Clutter, GDesktopEnums, Gio, GLib, GnomeDesktop, Meta } = imports.gi;
 const Signals = imports.signals;

 const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff);

@ -110,7 +110,7 @@ const COLOR_SHADING_TYPE_KEY = 'color-shading-type';
 const BACKGROUND_STYLE_KEY = 'picture-options';
 const PICTURE_URI_KEY = 'picture-uri';

-var FADE_ANIMATION_TIME = 1000;
+var FADE_ANIMATION_TIME = 1.0;

 // These parameters affect how often we redraw.
 // The first is how different (percent crossfaded) the slide show
@ -145,7 +145,7 @@ var BackgroundCache = class BackgroundCache {

        let monitor = file.monitor(Gio.FileMonitorFlags.NONE, null);
        monitor.connect('changed',
-                        (obj, theFile, otherFile, eventType) => {
+                        (obj, file, otherFile, eventType) => {
                            // Ignore CHANGED and CREATED events, since in both cases
                            // we'll get a CHANGES_DONE_HINT event when done.
                            if (eventType != Gio.FileMonitorEvent.CHANGED &&
@ -221,17 +221,16 @@ function getBackgroundCache() {
    return _backgroundCache;
 }

-var Background = GObject.registerClass({
-    Signals: { 'loaded': {}, 'bg-changed': {} },
-}, class Background extends Meta.Background {
-    _init(params) {
+var Background = class Background {
+    constructor(params) {
        params = Params.parse(params, { monitorIndex: 0,
                                        layoutManager: Main.layoutManager,
                                        settings: null,
                                        file: null,
                                        style: null });

-        super._init({ meta_display: global.display });
+        this.background = new Meta.Background({ meta_display: global.display });
+        this.background._delegate = this;

        this._settings = params.settings;
        this._file = params.file;
@ -264,14 +263,16 @@ var Background = GObject.registerClass({
    }

    destroy() {
+        this.background = null;
+
        this._cancellable.cancel();
        this._removeAnimationTimeout();

        let i;
        let keys = Object.keys(this._fileWatches);
-        for (i = 0; i < keys.length; i++)
+        for (i = 0; i < keys.length; i++) {
            this._cache.disconnect(this._fileWatches[keys[i]]);
-
+        }
        this._fileWatches = null;

        if (this._timezoneChangedId != 0)
@ -300,11 +301,9 @@ var Background = GObject.registerClass({

        this._changedIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
            this._changedIdleId = 0;
-            this.emit('bg-changed');
+            this.emit('changed');
            return GLib.SOURCE_REMOVE;
        });
-        GLib.Source.set_name_by_id(this._changedIdleId,
-            '[gnome-shell] Background._emitChangedSignal');
    }

    updateResolution() {
@ -330,23 +329,23 @@ var Background = GObject.registerClass({
            this.emit('loaded');
            return GLib.SOURCE_REMOVE;
        });
-        GLib.Source.set_name_by_id(id, '[gnome-shell] Background._setLoaded Idle');
+        GLib.Source.set_name_by_id(id, '[gnome-shell] this.emit');
    }

    _loadPattern() {
-        let colorString, res_, color, secondColor;
+        let colorString, res, color, secondColor;

        colorString = this._settings.get_string(PRIMARY_COLOR_KEY);
-        [res_, color] = Clutter.Color.from_string(colorString);
+        [res, color] = Clutter.Color.from_string(colorString);
        colorString = this._settings.get_string(SECONDARY_COLOR_KEY);
-        [res_, secondColor] = Clutter.Color.from_string(colorString);
+        [res, secondColor] = Clutter.Color.from_string(colorString);

        let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);

        if (shadingType == GDesktopEnums.BackgroundShading.SOLID)
-            this.set_color(color);
+            this.background.set_color(color);
        else
-            this.set_gradient(shadingType, color, secondColor);
+            this.background.set_gradient(shadingType, color, secondColor);
    }

    _watchFile(file) {
@ -382,13 +381,13 @@ var Background = GObject.registerClass({
        let finish = () => {
            this._setLoaded();
            if (files.length > 1) {
-                this.set_blend(files[0], files[1],
-                               this._animation.transitionProgress,
-                               this._style);
+                this.background.set_blend(files[0], files[1],
+                                          this._animation.transitionProgress,
+                                          this._style);
            } else if (files.length > 0) {
-                this.set_file(files[0], this._style);
+                this.background.set_file(files[0], this._style);
            } else {
-                this.set_file(null, this._style);
+                this.background.set_file(null, this._style);
            }
            this._queueUpdateAnimation();
        };
@ -403,7 +402,6 @@ var Background = GObject.registerClass({
                if (numPendingImages == 0)
                    finish();
            } else {
-                // eslint-disable-next-line no-loop-func
                let id = image.connect('loaded', () => {
                    image.disconnect(id);
                    numPendingImages--;
@ -444,25 +442,24 @@ var Background = GObject.registerClass({
    }

    _loadAnimation(file) {
-        this._cache.getAnimation({
-            file,
-            settingsSchema: this._settings.schema_id,
-            onLoaded: animation => {
-                this._animation = animation;
+        this._cache.getAnimation({ file: file,
+                                   settingsSchema: this._settings.schema_id,
+                                   onLoaded: animation => {
+                                       this._animation = animation;

-                if (!this._animation || this._cancellable.is_cancelled()) {
-                    this._setLoaded();
-                    return;
-                }
+                                       if (!this._animation || this._cancellable.is_cancelled()) {
+                                           this._setLoaded();
+                                           return;
+                                       }

-                this._updateAnimation();
-                this._watchFile(file);
-            },
-        });
+                                       this._updateAnimation();
+                                       this._watchFile(file);
+                                   }
+                                 });
    }

    _loadImage(file) {
-        this.set_file(file, this._style);
+        this.background.set_file(file, this._style);
        this._watchFile(file);

        let cache = Meta.BackgroundImageCache.get_default();
@ -496,14 +493,13 @@ var Background = GObject.registerClass({

        this._loadFile(this._file);
    }
-});
+};
+Signals.addSignalMethods(Background.prototype);

 let _systemBackground;

-var SystemBackground = GObject.registerClass({
-    Signals: { 'loaded': {} },
-}, class SystemBackground extends Meta.BackgroundActor {
-    _init() {
+var SystemBackground = class SystemBackground {
+    constructor() {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/noise-texture.png');

        if (_systemBackground == null) {
@ -512,11 +508,9 @@ var SystemBackground = GObject.registerClass({
            _systemBackground.set_file(file, GDesktopEnums.BackgroundStyle.WALLPAPER);
        }

-        super._init({
-            meta_display: global.display,
-            monitor: 0,
-            background: _systemBackground,
-        });
+        this.actor = new Meta.BackgroundActor({ meta_display: global.display,
+                                                monitor: 0,
+                                                background: _systemBackground });

        let cache = Meta.BackgroundImageCache.get_default();
        let image = cache.load(file);
@ -535,7 +529,8 @@ var SystemBackground = GObject.registerClass({
            });
        }
    }
-});
+};
+Signals.addSignalMethods(SystemBackground.prototype);

 var BackgroundSource = class BackgroundSource {
    constructor(layoutManager, settingsSchema) {
@ -571,7 +566,7 @@ var BackgroundSource = class BackgroundSource {

        // We don't watch changes to settings here,
        // instead we rely on Background to watch those
-        // and emit 'bg-changed' at the right time
+        // and emit 'changed' at the right time

        if (this._overrideImage != null) {
            file = Gio.File.new_for_path(this._overrideImage);
@ -593,14 +588,14 @@ var BackgroundSource = class BackgroundSource {

        if (!(monitorIndex in this._backgrounds)) {
            let background = new Background({
-                monitorIndex,
+                monitorIndex: monitorIndex,
                layoutManager: this._layoutManager,
                settings: this._settings,
-                file,
-                style,
+                file: file,
+                style: style
            });

-            background._changedId = background.connect('bg-changed', () => {
+            background._changedId = background.connect('changed', () => {
                background.disconnect(background._changedId);
                background.destroy();
                delete this._backgrounds[monitorIndex];
@ -626,11 +621,11 @@ var BackgroundSource = class BackgroundSource {
    }
 };

-var Animation = GObject.registerClass(
-class Animation extends GnomeDesktop.BGSlideShow {
-    _init(params) {
-        super._init(params);
+var Animation = class Animation {
+    constructor(params) {
+        params = Params.parse(params, { file: null });

+        this.file = params.file;
        this.keyFrameFiles = [];
        this.transitionProgress = 0.0;
        this.transitionDuration = 0.0;
@ -638,7 +633,9 @@ class Animation extends GnomeDesktop.BGSlideShow {
    }

    load(callback) {
-        this.load_async(null, () => {
+        this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() });
+
+        this._show.load_async(null, (object, result) => {
            this.loaded = true;
            if (callback)
                callback();
@ -648,11 +645,13 @@ class Animation extends GnomeDesktop.BGSlideShow {
    update(monitor) {
        this.keyFrameFiles = [];

-        if (this.get_num_slides() < 1)
+        if (!this._show)
            return;

-        let [progress, duration, isFixed_, filename1, filename2] =
-            this.get_current_slide(monitor.width, monitor.height);
+        if (this._show.get_num_slides() < 1)
+            return;
+
+        let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);

        this.transitionDuration = duration;
        this.transitionProgress = progress;
@ -663,7 +662,8 @@ class Animation extends GnomeDesktop.BGSlideShow {
        if (filename2)
            this.keyFrameFiles.push(Gio.File.new_for_path(filename2));
    }
-});
+};
+Signals.addSignalMethods(Animation.prototype);

 var BackgroundManager = class BackgroundManager {
    constructor(params) {
@ -710,12 +710,14 @@ var BackgroundManager = class BackgroundManager {
        this._newBackgroundActor = null;
        this.emit('changed');

-        oldBackgroundActor.ease({
-            opacity: 0,
-            duration: FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => oldBackgroundActor.destroy(),
-        });
+        Tweener.addTween(oldBackgroundActor,
+                         { opacity: 0,
+                           time: FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete() {
+                               oldBackgroundActor.destroy();
+                           }
+                         });
    }

    _updateBackgroundActor() {
@ -732,7 +734,7 @@ var BackgroundManager = class BackgroundManager {

        this._newBackgroundActor = newBackgroundActor;

-        let background = newBackgroundActor.background;
+        let background = newBackgroundActor.background._delegate;

        if (background.isLoaded) {
            this._swapBackgroundActor();
@ -749,24 +751,23 @@ var BackgroundManager = class BackgroundManager {

    _createBackgroundActor() {
        let background = this._backgroundSource.getBackground(this._monitorIndex);
-        let backgroundActor = new Meta.BackgroundActor({
-            meta_display: global.display,
-            monitor: this._monitorIndex,
-            background,
-            vignette: this._vignette,
-            vignette_sharpness: 0.5,
-            brightness: 0.5,
-        });
+        let backgroundActor = new Meta.BackgroundActor({ meta_display: global.display,
+                                                         monitor: this._monitorIndex,
+                                                         background: background.background,
+                                                         vignette: this._vignette,
+                                                         vignette_sharpness: 0.5,
+                                                         brightness: 0.5,
+                                                       });

        this._container.add_child(backgroundActor);

        if (this._controlPosition) {
            let monitor = this._layoutManager.monitors[this._monitorIndex];
            backgroundActor.set_position(monitor.x, monitor.y);
-            this._container.set_child_below_sibling(backgroundActor, null);
+            backgroundActor.lower_bottom();
        }

-        let changeSignalId = background.connect('bg-changed', () => {
+        let changeSignalId = background.connect('changed', () => {
            background.disconnect(changeSignalId);
            changeSignalId = null;
            this._updateBackgroundActor();
--- a/js/ui/backgroundMenu.js
+++ b/js/ui/backgroundMenu.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported addBackgroundMenu */

 const { Clutter, St } = imports.gi;

@ -31,16 +30,15 @@ function addBackgroundMenu(actor, layoutManager) {

    function openMenu(x, y) {
        Main.layoutManager.setDummyCursorGeometry(x, y, 0, 0);
-        actor._backgroundMenu.open(BoxPointer.PopupAnimation.FULL);
+        actor._backgroundMenu.open(BoxPointer.PopupAnimation.NONE);
    }

    let clickAction = new Clutter.ClickAction();
-    clickAction.connect('long-press', (action, theActor, state) => {
-        if (state == Clutter.LongPressState.QUERY) {
-            return (action.get_button() == 0 ||
+    clickAction.connect('long-press', (action, actor, state) => {
+        if (state == Clutter.LongPressState.QUERY)
+            return ((action.get_button() == 0 ||
                     action.get_button() == 1) &&
-                    !actor._backgroundMenu.isOpen;
-        }
+                    !actor._backgroundMenu.isOpen);
        if (state == Clutter.LongPressState.ACTIVATE) {
            let [x, y] = action.get_coords();
            openMenu(x, y);
--- a/js/ui/barLevel.js
+++ b/js/ui/barLevel.js
@ -1,107 +1,71 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
-/* exported BarLevel */

-const { Atk, Clutter, GObject, St } = imports.gi;
+const { Atk, Clutter, St } = imports.gi;
+const Signals = imports.signals;

-var BarLevel = GObject.registerClass({
-    Properties: {
-        'value': GObject.ParamSpec.double(
-            'value', 'value', 'value',
-            GObject.ParamFlags.READWRITE,
-            0, 2, 0),
-        'maximum-value': GObject.ParamSpec.double(
-            'maximum-value', 'maximum-value', 'maximum-value',
-            GObject.ParamFlags.READWRITE,
-            1, 2, 1),
-        'overdrive-start': GObject.ParamSpec.double(
-            'overdrive-start', 'overdrive-start', 'overdrive-start',
-            GObject.ParamFlags.READWRITE,
-            1, 2, 1),
-    },
-}, class BarLevel extends St.DrawingArea {
-    _init(params) {
+var BarLevel = class {
+    constructor(value, params = {}) {
+        if (isNaN(value))
+            // Avoid spreading NaNs around
+            throw TypeError('The bar level value must be a number');
        this._maxValue = 1;
-        this._value = 0;
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
        this._overdriveStart = 1;
        this._barLevelWidth = 0;

-        let defaultParams = {
-            style_class: 'barlevel',
-            accessible_role: Atk.Role.LEVEL_BAR,
-        };
-        super._init(Object.assign(defaultParams, params));
-        this.connect('allocation-changed', (actor, box) => {
+        this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel',
+                                          can_focus: params['canFocus'] || false,
+                                          reactive: params['reactive'] || false,
+                                          accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR });
+        this.actor.connect('repaint', this._barLevelRepaint.bind(this));
+        this.actor.connect('allocation-changed', (actor, box) => {
            this._barLevelWidth = box.get_width();
        });

-        this._customAccessible = St.GenericAccessible.new_for_actor(this);
-        this.set_accessible(this._customAccessible);
+        this._customAccessible = St.GenericAccessible.new_for_actor(this.actor);
+        this.actor.set_accessible(this._customAccessible);

        this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this));
        this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this));
        this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this));
        this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this));

-        this.connect('notify::value', this._valueChanged.bind(this));
+        this.connect('value-changed', this._valueChanged.bind(this));
    }

-    get value() {
-        return this._value;
+    setValue(value) {
+        if (isNaN(value))
+            throw TypeError('The bar level value must be a number');
+
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
+        this.actor.queue_repaint();
    }

-    set value(value) {
-        value = Math.max(Math.min(value, this._maxValue), 0);
+    setMaximumValue(value) {
+        if (isNaN(value))
+            throw TypeError('The bar level max value must be a number');

-        if (this._value == value)
-            return;
-
-        this._value = value;
-        this.notify('value');
-        this.queue_repaint();
-    }
-
-    // eslint-disable-next-line camelcase
-    get maximum_value() {
-        return this._maxValue;
-    }
-
-    // eslint-disable-next-line camelcase
-    set maximum_value(value) {
-        value = Math.max(value, 1);
-
-        if (this._maxValue == value)
-            return;
-
-        this._maxValue = value;
+        this._maxValue = Math.max(value, 1);
        this._overdriveStart = Math.min(this._overdriveStart, this._maxValue);
-        this.notify('maximum-value');
-        this.queue_repaint();
+        this.actor.queue_repaint();
    }

-    // eslint-disable-next-line camelcase
-    get overdrive_start() {
-        return this._overdriveStart;
-    }
-
-    // eslint-disable-next-line camelcase
-    set overdrive_start(value) {
-        if (this._overdriveStart == value)
-            return;
-
-        if (value > this._maxValue) {
+    setOverdriveStart(value) {
+        if (isNaN(value))
+            throw TypeError('The overdrive limit value must be a number');
+        if (value > this._maxValue)
            throw new Error(`Tried to set overdrive value to ${value}, ` +
                `which is a number greater than the maximum allowed value ${this._maxValue}`);
-        }

        this._overdriveStart = value;
-        this.notify('overdrive-start');
-        this.queue_repaint();
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
+        this.actor.queue_repaint();
    }

-    vfunc_repaint() {
-        let cr = this.get_context();
-        let themeNode = this.get_theme_node();
-        let [width, height] = this.get_surface_size();
+    _barLevelRepaint(area) {
+        let cr = area.get_context();
+        let themeNode = area.get_theme_node();
+        let [width, height] = area.get_surface_size();

        let barLevelHeight = themeNode.get_length('-barlevel-height');
        let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2;
@ -208,27 +172,32 @@ var BarLevel = GObject.registerClass({
        cr.$dispose();
    }

-    _getCurrentValue() {
+    _getCurrentValue(actor) {
        return this._value;
    }

-    _getOverdriveStart() {
+    _getOverdriveStart(actor) {
        return this._overdriveStart;
    }

-    _getMinimumValue() {
+    _getMinimumValue(actor) {
        return 0;
    }

-    _getMaximumValue() {
+    _getMaximumValue(actor) {
        return this._maxValue;
    }

-    _setCurrentValue(_actor, value) {
+    _setCurrentValue(actor, value) {
        this._value = value;
    }

-    _valueChanged() {
+    _valueChanged(barLevel, value, property) {
        this._customAccessible.notify("accessible-value");
    }
-});
+
+    get value() {
+        return this._value;
+    }
+};
+Signals.addSignalMethods(BarLevel.prototype);
--- a/js/ui/boxpointer.js
+++ b/js/ui/boxpointer.js
@ -1,9 +1,9 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BoxPointer */

 const { Clutter, GObject, Shell, St } = imports.gi;

 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

 var PopupAnimation = {
    NONE:  0,
@ -12,7 +12,7 @@ var PopupAnimation = {
    FULL:  ~0,
 };

-var POPUP_ANIMATION_TIME = 150;
+var POPUP_ANIMATION_TIME = 0.15;

 /**
 * BoxPointer:
@ -44,20 +44,14 @@ var BoxPointer = GObject.registerClass({
        this._border = new St.DrawingArea();
        this._border.connect('repaint', this._drawBorder.bind(this));
        this.add_actor(this._border);
-        this.set_child_above_sibling(this.bin, this._border);
+        this.bin.raise(this._border);
        this._sourceAlignment = 0.5;
-        this._muteInput = true;
+        this._capturedEventId = 0;
+        this._muteInput();

        this.connect('destroy', this._onDestroy.bind(this));
    }

-    vfunc_captured_event() {
-        if (this._muteInput)
-            return Clutter.EVENT_STOP;
-
-        return Clutter.EVENT_PROPAGATE;
-    }
-
    _onDestroy() {
        if (this._sourceActorDestroyId) {
            this._sourceActor.disconnect(this._sourceActorDestroyId);
@ -69,10 +63,23 @@ var BoxPointer = GObject.registerClass({
        return this._arrowSide;
    }

+    _muteInput() {
+        if (this._capturedEventId == 0)
+            this._capturedEventId = this.connect('captured-event',
+                                                 () => Clutter.EVENT_STOP);
+    }
+
+    _unmuteInput() {
+        if (this._capturedEventId != 0) {
+            this.disconnect(this._capturedEventId);
+            this._capturedEventId = 0;
+        }
+    }
+
    open(animate, onComplete) {
        let themeNode = this.get_theme_node();
        let rise = themeNode.get_length('-arrow-rise');
-        let animationTime = animate & PopupAnimation.FULL ? POPUP_ANIMATION_TIME : 0;
+        let animationTime = (animate & PopupAnimation.FULL) ? POPUP_ANIMATION_TIME : 0;

        if (animate & PopupAnimation.FADE)
            this.opacity = 0;
@ -98,18 +105,16 @@ var BoxPointer = GObject.registerClass({
            }
        }

-        this.ease({
-            opacity: 255,
-            translation_x: 0,
-            translation_y: 0,
-            duration: animationTime,
-            mode: Clutter.AnimationMode.LINEAR,
-            onComplete: () => {
-                this._muteInput = false;
-                if (onComplete)
-                    onComplete();
-            },
-        });
+        Tweener.addTween(this, { opacity: 255,
+                                 translation_x: 0,
+                                 translation_y: 0,
+                                 transition: 'linear',
+                                 onComplete: () => {
+                                     this._unmuteInput();
+                                     if (onComplete)
+                                         onComplete();
+                                 },
+                                 time: animationTime });
    }

    close(animate, onComplete) {
@ -120,8 +125,8 @@ var BoxPointer = GObject.registerClass({
        let translationY = 0;
        let themeNode = this.get_theme_node();
        let rise = themeNode.get_length('-arrow-rise');
-        let fade = animate & PopupAnimation.FADE;
-        let animationTime = animate & PopupAnimation.FULL ? POPUP_ANIMATION_TIME : 0;
+        let fade = (animate & PopupAnimation.FADE);
+        let animationTime = (animate & PopupAnimation.FULL) ? POPUP_ANIMATION_TIME : 0;

        if (animate & PopupAnimation.SLIDE) {
            switch (this._arrowSide) {
@ -140,24 +145,23 @@ var BoxPointer = GObject.registerClass({
            }
        }

-        this._muteInput = true;
+        this._muteInput();

-        this.remove_all_transitions();
-        this.ease({
-            opacity: fade ? 0 : 255,
-            translation_x: translationX,
-            translation_y: translationY,
-            duration: animationTime,
-            mode: Clutter.AnimationMode.LINEAR,
-            onComplete: () => {
-                this.hide();
-                this.opacity = 0;
-                this.translation_x = 0;
-                this.translation_y = 0;
-                if (onComplete)
-                    onComplete();
-            },
-        });
+        Tweener.removeTweens(this);
+        Tweener.addTween(this, { opacity: fade ? 0 : 255,
+                                 translation_x: translationX,
+                                 translation_y: translationY,
+                                 transition: 'linear',
+                                 time: animationTime,
+                                 onComplete: () => {
+                                     this.hide();
+                                     this.opacity = 0;
+                                     this.translation_x = 0;
+                                     this.translation_y = 0;
+                                     if (onComplete)
+                                         onComplete();
+                                 }
+                               });
    }

    _adjustAllocationForArrow(isWidth, minSize, natSize) {
@ -165,8 +169,8 @@ var BoxPointer = GObject.registerClass({
        let borderWidth = themeNode.get_length('-arrow-border-width');
        minSize += borderWidth * 2;
        natSize += borderWidth * 2;
-        if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)) ||
-            (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
+        if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM))
+            || (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
            let rise = themeNode.get_length('-arrow-rise');
            minSize += rise;
            natSize += rise;
@ -247,10 +251,11 @@ var BoxPointer = GObject.registerClass({
            let [absX, absY] = this.get_transformed_position();

            if (this._arrowSide == St.Side.TOP ||
-                this._arrowSide == St.Side.BOTTOM)
+                this._arrowSide == St.Side.BOTTOM) {
                this._arrowOrigin = sourceX - absX + sourceWidth / 2;
-            else
+            } else {
                this._arrowOrigin = sourceY - absY + sourceHeight / 2;
+            }
        }

        let borderWidth = themeNode.get_length('-arrow-border-width');
@ -265,19 +270,20 @@ var BoxPointer = GObject.registerClass({

        let [width, height] = area.get_surface_size();
        let [boxWidth, boxHeight] = [width, height];
-        if (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)
+        if (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM) {
            boxHeight -= rise;
-        else
+        } else {
            boxWidth -= rise;
-
+        }
        let cr = area.get_context();

        // Translate so that box goes from 0,0 to boxWidth,boxHeight,
        // with the arrow poking out of that
-        if (this._arrowSide == St.Side.TOP)
+        if (this._arrowSide == St.Side.TOP) {
            cr.translate(0, rise);
-        else if (this._arrowSide == St.Side.LEFT)
+        } else if (this._arrowSide == St.Side.LEFT) {
            cr.translate(rise, 0);
+        }

        let [x1, y1] = [halfBorder, halfBorder];
        let [x2, y2] = [boxWidth - halfBorder, boxHeight - halfBorder];
@ -463,7 +469,7 @@ var BoxPointer = GObject.registerClass({
        let sourceAllocation = this._sourceAllocation;
        let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment;
        let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment;
-        let [, , natWidth, natHeight] = this.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size();

        // We also want to keep it onscreen, and separated from the
        // edge by the same distance as the main part of the box is
@ -473,7 +479,7 @@ var BoxPointer = GObject.registerClass({
        let borderWidth = themeNode.get_length('-arrow-border-width');
        let arrowBase = themeNode.get_length('-arrow-base');
        let borderRadius = themeNode.get_length('-arrow-border-radius');
-        let margin = 4 * borderRadius + borderWidth + arrowBase;
+        let margin = (4 * borderRadius + borderWidth + arrowBase);

        let gap = themeNode.get_length('-boxpointer-gap');
        let padding = themeNode.get_length('-arrow-rise');
@ -524,11 +530,11 @@ var BoxPointer = GObject.registerClass({
            arrowOrigin = sourceCenterX - resX;
            if (arrowOrigin <= (x1 + (borderRadius + halfBase))) {
                if (arrowOrigin > x1)
-                    resX += arrowOrigin - x1;
+                    resX += (arrowOrigin - x1);
                arrowOrigin = x1;
            } else if (arrowOrigin >= (x2 - (borderRadius + halfBase))) {
                if (arrowOrigin < x2)
-                    resX -= x2 - arrowOrigin;
+                    resX -= (x2 - arrowOrigin);
                arrowOrigin = x2;
            }
            break;
@ -543,11 +549,11 @@ var BoxPointer = GObject.registerClass({
            arrowOrigin = sourceCenterY - resY;
            if (arrowOrigin <= (y1 + (borderRadius + halfBase))) {
                if (arrowOrigin > y1)
-                    resY += arrowOrigin - y1;
+                    resY += (arrowOrigin - y1);
                arrowOrigin = y1;
            } else if (arrowOrigin >= (y2 - (borderRadius + halfBase))) {
                if (arrowOrigin < y2)
-                    resX -= y2 - arrowOrigin;
+                    resX -= (y2 - arrowOrigin);
                arrowOrigin = y2;
            }
            break;
@ -588,7 +594,7 @@ var BoxPointer = GObject.registerClass({

    _calculateArrowSide(arrowSide) {
        let sourceAllocation = this._sourceAllocation;
-        let [, , boxWidth, boxHeight] = this.get_preferred_size();
+        let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size();
        let workarea = this._workArea;

        switch (arrowSide) {
--- a/js/ui/calendar.js
+++ b/js/ui/calendar.js
@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Calendar, CalendarMessageList, DBusEventSource */

-const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
+const { Clutter, Gio, GLib, Shell, St } = imports.gi;
+const Signals = imports.signals;

 const Main = imports.ui.main;
 const MessageList = imports.ui.messageList;
@ -20,7 +20,7 @@ var MESSAGE_ICON_SIZE = -1; // pick up from CSS
 var NC_ = (context, str) => `${context}\u0004${str}`;

 function sameYear(dateA, dateB) {
-    return dateA.getYear() == dateB.getYear();
+    return (dateA.getYear() == dateB.getYear());
 }

 function sameMonth(dateA, dateB) {
@ -78,7 +78,7 @@ function _getCalendarDayAbbreviation(dayNumber) {
        /* Translators: Calendar grid abbreviation for Friday */
        NC_("grid friday", "F"),
        /* Translators: Calendar grid abbreviation for Saturday */
-        NC_("grid saturday", "S"),
+        NC_("grid saturday", "S")
    ];
    return Shell.util_translate_time_string(abbreviations[dayNumber]);
 }
@ -98,66 +98,30 @@ var CalendarEvent = class CalendarEvent {
 // Interface for appointments/events - e.g. the contents of a calendar
 //

-var EventSourceBase = GObject.registerClass({
-    GTypeFlags: GObject.TypeFlags.ABSTRACT,
-    Properties: {
-        'has-calendars': GObject.ParamSpec.boolean(
-            'has-calendars', 'has-calendars', 'has-calendars',
-            GObject.ParamFlags.READABLE,
-            false),
-        'is-loading': GObject.ParamSpec.boolean(
-            'is-loading', 'is-loading', 'is-loading',
-            GObject.ParamFlags.READABLE,
-            false),
-    },
-    Signals: { 'changed': {} },
-}, class EventSourceBase extends GObject.Object {
-    get isLoading() {
-        throw new GObject.NotImplementedError(`isLoading in ${this.constructor.name}`);
-    }
-
-    get hasCalendars() {
-        throw new GObject.NotImplementedError(`hasCalendars in ${this.constructor.name}`);
+// First, an implementation with no events
+var EmptyEventSource = class EmptyEventSource {
+    constructor() {
+        this.isLoading = false;
+        this.isDummy = true;
+        this.hasCalendars = false;
    }

    destroy() {
    }

-    requestRange(_begin, _end) {
-        throw new GObject.NotImplementedError(`requestRange in ${this.constructor.name}`);
+    requestRange(begin, end) {
    }

-    getEvents(_begin, _end) {
-        throw new GObject.NotImplementedError(`getEvents in ${this.constructor.name}`);
-    }
-
-    hasEvents(_day) {
-        throw new GObject.NotImplementedError(`hasEvents in ${this.constructor.name}`);
-    }
-});
-
-var EmptyEventSource = GObject.registerClass(
-class EmptyEventSource extends EventSourceBase {
-    get isLoading() {
-        return false;
-    }
-
-    get hasCalendars() {
-        return false;
-    }
-
-    requestRange(_begin, _end) {
-    }
-
-    getEvents(_begin, _end) {
+    getEvents(begin, end) {
        let result = [];
        return result;
    }

-    hasEvents(_day) {
+    hasEvents(day) {
        return false;
    }
-});
+};
+Signals.addSignalMethods(EmptyEventSource.prototype);

 const CalendarServerIface = loadInterfaceXML('org.gnome.Shell.CalendarServer');

@ -189,12 +153,11 @@ function _dateIntervalsOverlap(a0, a1, b0, b1) {
 }

 // an implementation that reads data from a session bus service
-var DBusEventSource = GObject.registerClass(
-class DBusEventSource extends EventSourceBase {
-    _init() {
-        super._init();
+var DBusEventSource = class DBusEventSource {
+    constructor() {
        this._resetCache();
-        this._isLoading = false;
+        this.isLoading = false;
+        this.isDummy = false;

        this._initialized = false;
        this._dbusProxy = new CalendarServer();
@ -229,12 +192,12 @@ class DBusEventSource extends EventSourceBase {
            });

            this._dbusProxy.connect('g-properties-changed', () => {
-                this.notify('has-calendars');
+                this.emit('notify::has-calendars');
            });

            this._initialized = loaded;
            if (loaded) {
-                this.notify('has-calendars');
+                this.emit('notify::has-calendars');
                this._onNameAppeared();
            }
        });
@ -251,23 +214,19 @@ class DBusEventSource extends EventSourceBase {
            return false;
    }

-    get isLoading() {
-        return this._isLoading;
-    }
-
    _resetCache() {
        this._events = [];
        this._lastRequestBegin = null;
        this._lastRequestEnd = null;
    }

-    _onNameAppeared() {
+    _onNameAppeared(owner) {
        this._initialized = true;
        this._resetCache();
        this._loadEvents(true);
    }

-    _onNameVanished() {
+    _onNameVanished(oldOwner) {
        this._resetCache();
        this.emit('changed');
    }
@ -276,7 +235,7 @@ class DBusEventSource extends EventSourceBase {
        this._loadEvents(false);
    }

-    _onEventsReceived(results, _error) {
+    _onEventsReceived(results, error) {
        let newEvents = [];
        let appointments = results[0] || [];
        for (let n = 0; n < appointments.length; n++) {
@ -292,7 +251,7 @@ class DBusEventSource extends EventSourceBase {
        newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());

        this._events = newEvents;
-        this._isLoading = false;
+        this.isLoading = false;
        this.emit('changed');
    }

@ -312,7 +271,7 @@ class DBusEventSource extends EventSourceBase {

    requestRange(begin, end) {
        if (!(_datesEqual(begin, this._lastRequestBegin) && _datesEqual(end, this._lastRequestEnd))) {
-            this._isLoading = true;
+            this.isLoading = true;
            this._lastRequestBegin = begin;
            this._lastRequestEnd = end;
            this._curRequestBegin = begin;
@ -326,8 +285,9 @@ class DBusEventSource extends EventSourceBase {
        for (let n = 0; n < this._events.length; n++) {
            let event = this._events[n];

-            if (_dateIntervalsOverlap(event.date, event.end, begin, end))
+            if (_dateIntervalsOverlap (event.date, event.end, begin, end)) {
                result.push(event);
+            }
        }
        result.sort((event1, event2) => {
            // sort events by end time on ending day
@ -349,12 +309,11 @@ class DBusEventSource extends EventSourceBase {

        return true;
    }
-});
+};
+Signals.addSignalMethods(DBusEventSource.prototype);

-var Calendar = GObject.registerClass({
-    Signals: { 'selected-date-changed': { param_types: [GLib.DateTime.$gtype] } },
-}, class Calendar extends St.Widget {
-    _init() {
+var Calendar = class Calendar {
+    constructor() {
        this._weekStart = Shell.util_get_week_start();
        this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.calendar' });

@ -384,19 +343,19 @@ var Calendar = GObject.registerClass({

        this._shouldDateGrabFocus = false;

-        super._init({
-            style_class: 'calendar',
-            layout_manager: new Clutter.GridLayout(),
-            reactive: true,
-        });
+        this.actor = new St.Widget({ style_class: 'calendar',
+                                     layout_manager: new Clutter.TableLayout(),
+                                     reactive: true });

-        this._buildHeader();
+        this.actor.connect('scroll-event',
+                           this._onScroll.bind(this));
+
+        this._buildHeader ();
    }

+    // @eventSource: is an object implementing the EventSource API, e.g. the
+    // requestRange(), getEvents(), hasEvents() methods and the ::changed signal.
    setEventSource(eventSource) {
-        if (!(eventSource instanceof EventSourceBase))
-            throw new Error('Event source is not valid type');
-
        this._eventSource = eventSource;
        this._eventSource.connect('changed', () => {
            this._rebuildCalendar();
@ -413,10 +372,7 @@ var Calendar = GObject.registerClass({

        this._selectedDate = date;
        this._update();
-
-        let datetime = GLib.DateTime.new_from_unix_local(
-            this._selectedDate.getTime() / 1000);
-        this.emit('selected-date-changed', datetime);
+        this.emit('selected-date-changed', new Date(this._selectedDate));
    }

    updateTimeZone() {
@ -427,13 +383,14 @@ var Calendar = GObject.registerClass({
    }

    _buildHeader() {
-        let layout = this.layout_manager;
+        let layout = this.actor.layout_manager;
        let offsetCols = this._useWeekdate ? 1 : 0;
-        this.destroy_all_children();
+        this.actor.destroy_all_children();

        // Top line of the calendar '<| September 2009 |>'
        this._topBox = new St.BoxLayout();
-        layout.attach(this._topBox, 0, 0, offsetCols + 7, 1);
+        layout.pack(this._topBox, 0, 0);
+        layout.set_span(this._topBox, offsetCols + 7, 1);

        this._backButton = new St.Button({ style_class: 'calendar-change-month-back pager-button',
                                           accessible_name: _("Previous month"),
@ -442,13 +399,9 @@ var Calendar = GObject.registerClass({
        this._topBox.add(this._backButton);
        this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this));

-        this._monthLabel = new St.Label({
-            style_class: 'calendar-month-label',
-            can_focus: true,
-            x_align: Clutter.ActorAlign.CENTER,
-            x_expand: true,
-        });
-        this._topBox.add_child(this._monthLabel);
+        this._monthLabel = new St.Label({ style_class: 'calendar-month-label',
+                                          can_focus: true });
+        this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE });

        this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button',
                                              accessible_name: _("Next month"),
@ -474,20 +427,20 @@ var Calendar = GObject.registerClass({
                                       can_focus: true });
            label.accessible_name = iter.toLocaleFormat('%A');
            let col;
-            if (this.get_text_direction() == Clutter.TextDirection.RTL)
+            if (this.actor.get_text_direction() == Clutter.TextDirection.RTL)
                col = 6 - (7 + iter.getDay() - this._weekStart) % 7;
            else
                col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7;
-            layout.attach(label, col, 1, 1, 1);
+            layout.pack(label, col, 1);
            iter.setTime(iter.getTime() + MSECS_IN_DAY);
        }

        // All the children after this are days, and get removed when we update the calendar
-        this._firstDayIndex = this.get_n_children();
+        this._firstDayIndex = this.actor.get_n_children();
    }

-    vfunc_scroll_event(scrollEvent) {
-        switch (scrollEvent.direction) {
+    _onScroll(actor, event) {
+        switch (event.get_scroll_direction()) {
        case Clutter.ScrollDirection.UP:
        case Clutter.ScrollDirection.LEFT:
            this._onPrevMonthButtonClicked();
@ -557,7 +510,7 @@ var Calendar = GObject.registerClass({
        let now = new Date();

        // Remove everything but the topBox and the weekday labels
-        let children = this.get_children();
+        let children = this.actor.get_children();
        for (let i = this._firstDayIndex; i < children.length; i++)
            children[i].destroy();

@ -594,7 +547,7 @@ var Calendar = GObject.registerClass({

        beginDate.setTime(beginDate.getTime() - (weekPadding + daysToWeekStart) * MSECS_IN_DAY);

-        let layout = this.layout_manager;
+        let layout = this.actor.layout_manager;
        let iter = new Date(beginDate);
        let row = 2;
        // nRows here means 6 weeks + one header + one navbar
@ -605,7 +558,7 @@ var Calendar = GObject.registerClass({
                                         can_focus: true });
            let rtl = button.get_text_direction() == Clutter.TextDirection.RTL;

-            if (this._eventSource instanceof EmptyEventSource)
+            if (this._eventSource.isDummy)
                button.reactive = false;

            button._date = new Date(iter);
@ -627,9 +580,8 @@ var Calendar = GObject.registerClass({
            if (row == 2)
                styleClass = `calendar-day-top ${styleClass}`;

-            let leftMost = rtl
-                ? iter.getDay() == (this._weekStart + 6) % 7
-                : iter.getDay() == this._weekStart;
+            let leftMost = rtl ? iter.getDay() == (this._weekStart + 6) % 7
+                               : iter.getDay() == this._weekStart;
            if (leftMost)
                styleClass = `calendar-day-left ${styleClass}`;

@ -649,7 +601,7 @@ var Calendar = GObject.registerClass({
                col = 6 - (7 + iter.getDay() - this._weekStart) % 7;
            else
                col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7;
-            layout.attach(button, col, row, 1, 1);
+            layout.pack(button, col, row);

            this._buttons.push(button);

@ -659,7 +611,7 @@ var Calendar = GObject.registerClass({
                                           can_focus: true });
                let weekFormat = Shell.util_translate_time_string(N_("Week %V"));
                label.accessible_name = iter.toLocaleFormat(weekFormat);
-                layout.attach(label, rtl ? 7 : 0, row, 1, 1);
+                layout.pack(label, rtl ? 7 : 0, row);
            }

            iter.setTime(iter.getTime() + MSECS_IN_DAY);
@ -694,12 +646,12 @@ var Calendar = GObject.registerClass({
            }
        });
    }
-});
+};
+Signals.addSignalMethods(Calendar.prototype);

-var EventMessage = GObject.registerClass(
-class EventMessage extends MessageList.Message {
-    _init(event, date) {
-        super._init('', event.summary);
+var EventMessage = class EventMessage extends MessageList.Message {
+    constructor(event, date) {
+        super('', event.summary);

        this._event = event;
        this._date = date;
@ -708,19 +660,18 @@ class EventMessage extends MessageList.Message {

        this._icon = new St.Icon({ icon_name: 'x-office-calendar-symbolic' });
        this.setIcon(this._icon);
-    }

-    vfunc_style_changed() {
-        let iconVisible = this.get_parent().has_style_pseudo_class('first-child');
-        this._icon.opacity = iconVisible ? 255 : 0;
-        super.vfunc_style_changed();
+        this.actor.connect('style-changed', () => {
+            let iconVisible = this.actor.get_parent().has_style_pseudo_class('first-child');
+            this._icon.opacity = (iconVisible ? 255 : 0);
+        });
    }

    _formatEventTime() {
        let periodBegin = _getBeginningOfDay(this._date);
        let periodEnd = _getEndOfDay(this._date);
-        let allDay = this._event.allDay || (this._event.date <= periodBegin &&
-                                             this._event.end >= periodEnd);
+        let allDay = (this._event.allDay || (this._event.date <= periodBegin &&
+                                             this._event.end >= periodEnd));
        let title;
        if (allDay) {
            /* Translators: Shown in calendar event list for all day events
@ -728,33 +679,32 @@ class EventMessage extends MessageList.Message {
             */
            title = C_("event list time", "All Day");
        } else {
-            let date = this._event.date >= periodBegin
-                ? this._event.date
-                : this._event.end;
+            let date = this._event.date >= periodBegin ? this._event.date
+                                                       : this._event.end;
            title = Util.formatTime(date, { timeOnly: true });
        }

        let rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL;
        if (this._event.date < periodBegin && !this._event.allDay) {
            if (rtl)
-                title = `${title}${ELLIPSIS_CHAR}`;
+                title = title + ELLIPSIS_CHAR;
            else
-                title = `${ELLIPSIS_CHAR}${title}`;
+                title = ELLIPSIS_CHAR + title;
        }
        if (this._event.end > periodEnd && !this._event.allDay) {
            if (rtl)
-                title = `${ELLIPSIS_CHAR}${title}`;
+                title = ELLIPSIS_CHAR + title;
            else
-                title = `${title}${ELLIPSIS_CHAR}`;
+                title = title + ELLIPSIS_CHAR;
        }
        return title;
    }
-});
+};

-var NotificationMessage = GObject.registerClass(
+var NotificationMessage =
 class NotificationMessage extends MessageList.Message {
-    _init(notification) {
-        super._init(notification.title, notification.bannerBodyText);
+    constructor(notification) {
+        super(notification.title, notification.bannerBodyText);
        this.setUseBodyMarkup(notification.bannerBodyMarkup);

        this.notification = notification;
@ -777,22 +727,21 @@ class NotificationMessage extends MessageList.Message {
    }

    _getIcon() {
-        if (this.notification.gicon) {
+        if (this.notification.gicon)
            return new St.Icon({ gicon: this.notification.gicon,
                                 icon_size: MESSAGE_ICON_SIZE });
-        } else {
+        else
            return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
-        }
    }

-    _onUpdated(n, _clear) {
+    _onUpdated(n, clear) {
        this.setIcon(this._getIcon());
        this.setTitle(n.title);
        this.setBody(n.bannerBodyText);
        this.setUseBodyMarkup(n.bannerBodyMarkup);
    }

-    vfunc_clicked() {
+    _onClicked() {
        this.notification.activate();
    }

@ -814,12 +763,11 @@ class NotificationMessage extends MessageList.Message {
    canClose() {
        return true;
    }
-});
+};

-var EventsSection = GObject.registerClass(
-class EventsSection extends MessageList.MessageListSection {
-    _init() {
-        super._init();
+var EventsSection = class EventsSection extends MessageList.MessageListSection {
+    constructor() {
+        super();

        this._desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
        this._desktopSettings.connect('changed', this._reloadEvents.bind(this));
@ -829,9 +777,9 @@ class EventsSection extends MessageList.MessageListSection {

        this._title = new St.Button({ style_class: 'events-section-title',
                                      label: '',
+                                      x_align: St.Align.START,
                                      can_focus: true });
-        this._title.child.x_align = Clutter.ActorAlign.START;
-        this.insert_child_below(this._title, null);
+        this.actor.insert_child_below(this._title, null);

        this._title.connect('clicked', this._onTitleClicked.bind(this));
        this._title.connect('key-focus-in', this._onKeyFocusIn.bind(this));
@ -842,9 +790,6 @@ class EventsSection extends MessageList.MessageListSection {
    }

    setEventSource(eventSource) {
-        if (!(eventSource instanceof EventSourceBase))
-            throw new Error('Event source is not valid type');
-
        this._eventSource = eventSource;
        this._eventSource.connect('changed', this._reloadEvents.bind(this));
    }
@ -861,15 +806,14 @@ class EventsSection extends MessageList.MessageListSection {

        let dayFormat;
        let now = new Date();
-        if (sameYear(this._date, now)) {
+        if (sameYear(this._date, now))
            /* Translators: Shown on calendar heading when selected day occurs on current year */
            dayFormat = Shell.util_translate_time_string(NC_("calendar heading",
                                                             "%A, %B %-d"));
-        } else {
+        else
            /* Translators: Shown on calendar heading when selected day occurs on different year */
            dayFormat = Shell.util_translate_time_string(NC_("calendar heading",
                                                             "%A, %B %-d, %Y"));
-        }
        this._title.label = this._date.toLocaleFormat(dayFormat);
    }

@ -910,7 +854,7 @@ class EventsSection extends MessageList.MessageListSection {

    _appInstalledChanged() {
        this._calendarApp = undefined;
-        this._title.reactive = this._getCalendarApp() != null;
+        this._title.reactive = (this._getCalendarApp() != null);
    }

    _getCalendarApp() {
@ -954,29 +898,12 @@ class EventsSection extends MessageList.MessageListSection {

        super._sync();
    }
-});
+};

-var TimeLabel = GObject.registerClass(
-class NotificationTimeLabel extends St.Label {
-    _init(datetime) {
-        super._init({
-            style_class: 'event-time',
-            x_align: Clutter.ActorAlign.START,
-            y_align: Clutter.ActorAlign.END,
-        });
-        this._datetime = datetime;
-    }
-
-    vfunc_map() {
-        this.text = Util.formatTimeSpan(this._datetime);
-        super.vfunc_map();
-    }
-});
-
-var NotificationSection = GObject.registerClass(
+var NotificationSection =
 class NotificationSection extends MessageList.MessageListSection {
-    _init() {
-        super._init();
+    constructor() {
+        super();

        this._sources = new Map();
        this._nUrgent = 0;
@ -985,6 +912,8 @@ class NotificationSection extends MessageList.MessageListSection {
        Main.messageTray.getSources().forEach(source => {
            this._sourceAdded(Main.messageTray, source);
        });
+
+        this.actor.connect('notify::mapped', this._onMapped.bind(this));
    }

    get allowed() {
@ -992,13 +921,24 @@ class NotificationSection extends MessageList.MessageListSection {
               !Main.sessionMode.isGreeter;
    }

+    _createTimeLabel(datetime) {
+        let label = new St.Label({ style_class: 'event-time',
+                                   x_align: Clutter.ActorAlign.START,
+                                   y_align: Clutter.ActorAlign.END });
+        label.connect('notify::mapped', () => {
+            if (label.mapped)
+                label.text = Util.formatTimeSpan(datetime);
+        });
+        return label;
+    }
+
    _sourceAdded(tray, source) {
        let obj = {
            destroyId: 0,
            notificationAddedId: 0,
        };

-        obj.destroyId = source.connect('destroy', () => {
+        obj.destroyId = source.connect('destroy', source => {
            this._onSourceDestroy(source, obj);
        });
        obj.notificationAddedId = source.connect('notification-added',
@ -1009,13 +949,13 @@ class NotificationSection extends MessageList.MessageListSection {

    _onNotificationAdded(source, notification) {
        let message = new NotificationMessage(notification);
-        message.setSecondaryActor(new TimeLabel(notification.datetime));
+        message.setSecondaryActor(this._createTimeLabel(notification.datetime));

        let isUrgent = notification.urgency == MessageTray.Urgency.CRITICAL;

        let updatedId = notification.connect('updated', () => {
-            message.setSecondaryActor(new TimeLabel(notification.datetime));
-            this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.mapped);
+            message.setSecondaryActor(this._createTimeLabel(notification.datetime));
+            this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.actor.mapped);
        });
        let destroyId = notification.connect('destroy', () => {
            notification.disconnect(destroyId);
@ -1035,7 +975,7 @@ class NotificationSection extends MessageList.MessageListSection {
        }

        let index = isUrgent ? 0 : this._nUrgent;
-        this.addMessageAtIndex(message, index, this.mapped);
+        this.addMessageAtIndex(message, index, this.actor.mapped);
    }

    _onSourceDestroy(source, obj) {
@ -1045,23 +985,25 @@ class NotificationSection extends MessageList.MessageListSection {
        this._sources.delete(source);
    }

-    vfunc_map() {
-        this._messages.forEach(message => {
+    _onMapped() {
+        if (!this.actor.mapped)
+            return;
+
+        for (let message of this._messages.keys())
            if (message.notification.urgency != MessageTray.Urgency.CRITICAL)
                message.notification.acknowledged = true;
-        });
-        super.vfunc_map();
    }

    _shouldShow() {
        return !this.empty && isToday(this._date);
    }
-});
+};
+
+var Placeholder = class Placeholder {
+    constructor() {
+        this.actor = new St.BoxLayout({ style_class: 'message-list-placeholder',
+                                        vertical: true });

-var Placeholder = GObject.registerClass(
-class Placeholder extends St.BoxLayout {
-    _init() {
-        super._init({ style_class: 'message-list-placeholder', vertical: true });
        this._date = new Date();

        let todayFile = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/no-notifications.svg');
@ -1070,10 +1012,10 @@ class Placeholder extends St.BoxLayout {
        this._otherIcon = new Gio.FileIcon({ file: otherFile });

        this._icon = new St.Icon();
-        this.add_actor(this._icon);
+        this.actor.add_actor(this._icon);

        this._label = new St.Label();
-        this.add_actor(this._label);
+        this.actor.add_actor(this._label);

        this._sync();
    }
@ -1100,56 +1042,44 @@ class Placeholder extends St.BoxLayout {
            this._label.text = _("No Events");
        }
    }
-});
+};

-var CalendarMessageList = GObject.registerClass(
-class CalendarMessageList extends St.Widget {
-    _init() {
-        super._init({
-            style_class: 'message-list',
-            layout_manager: new Clutter.BinLayout(),
-            x_expand: true,
-            y_expand: true,
-        });
+var CalendarMessageList = class CalendarMessageList {
+    constructor() {
+        this.actor = new St.Widget({ style_class: 'message-list',
+                                     layout_manager: new Clutter.BinLayout(),
+                                     x_expand: true, y_expand: true });

        this._placeholder = new Placeholder();
-        this.add_actor(this._placeholder);
+        this.actor.add_actor(this._placeholder.actor);

        let box = new St.BoxLayout({ vertical: true,
                                     x_expand: true, y_expand: true });
-        this.add_actor(box);
+        this.actor.add_actor(box);

-        this._scrollView = new St.ScrollView({
-            style_class: 'vfade',
-            overlay_scrollbars: true,
-            x_expand: true, y_expand: true,
-        });
+        this._scrollView = new St.ScrollView({ style_class: 'vfade',
+                                               overlay_scrollbars: true,
+                                               x_expand: true, y_expand: true,
+                                               x_fill: true, y_fill: true });
        this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
        box.add_actor(this._scrollView);

-        this._clearButton = new St.Button({
-            style_class: 'message-list-clear-button button',
-            label: _('Clear'),
-            can_focus: true,
-            x_align: Clutter.ActorAlign.END,
-        });
+        this._clearButton = new St.Button({ style_class: 'message-list-clear-button button',
+                                            label: _("Clear"),
+                                            can_focus: true });
+        this._clearButton.set_x_align(Clutter.ActorAlign.END);
        this._clearButton.connect('clicked', () => {
-            this._sectionList.get_children().forEach(s => s.clear());
+            let sections = [...this._sections.keys()];
+            sections.forEach((s) => s.clear());
        });
        box.add_actor(this._clearButton);

-        this._placeholder.bind_property('visible',
-            this._clearButton, 'visible',
-            GObject.BindingFlags.INVERT_BOOLEAN);
-
        this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections',
                                               vertical: true,
-                                               x_expand: true,
                                               y_expand: true,
                                               y_align: Clutter.ActorAlign.START });
-        this._sectionList.connect('actor-added', this._sync.bind(this));
-        this._sectionList.connect('actor-removed', this._sync.bind(this));
        this._scrollView.add_actor(this._sectionList);
+        this._sections = new Map();

        this._mediaSection = new Mpris.MediaSection();
        this._addSection(this._mediaSection);
@ -1164,35 +1094,59 @@ class CalendarMessageList extends St.Widget {
    }

    _addSection(section) {
-        let connectionsIds = [];
+        let obj = {
+            destroyId: 0,
+            visibleId: 0,
+            emptyChangedId: 0,
+            canClearChangedId: 0,
+            keyFocusId: 0
+        };
+        obj.destroyId = section.actor.connect('destroy', () => {
+            this._removeSection(section);
+        });
+        obj.visibleId = section.actor.connect('notify::visible',
+                                              this._sync.bind(this));
+        obj.emptyChangedId = section.connect('empty-changed',
+                                             this._sync.bind(this));
+        obj.canClearChangedId = section.connect('can-clear-changed',
+                                                this._sync.bind(this));
+        obj.keyFocusId = section.connect('key-focus-in',
+                                         this._onKeyFocusIn.bind(this));

-        for (let prop of ['visible', 'empty', 'can-clear']) {
-            connectionsIds.push(
-                section.connect(`notify::${prop}`, this._sync.bind(this)));
-        }
-        connectionsIds.push(section.connect('message-focused', (_s, messageActor) => {
-            Util.ensureActorVisibleInScrollView(this._scrollView, messageActor);
-        }));
+        this._sections.set(section, obj);
+        this._sectionList.add_actor(section.actor);
+        this._sync();
+    }

-        connectionsIds.push(section.connect('destroy', () => {
-            connectionsIds.forEach(id => section.disconnect(id));
-            this._sectionList.remove_actor(section);
-        }));
+    _removeSection(section) {
+        let obj = this._sections.get(section);
+        section.actor.disconnect(obj.destroyId);
+        section.actor.disconnect(obj.visibleId);
+        section.disconnect(obj.emptyChangedId);
+        section.disconnect(obj.canClearChangedId);
+        section.disconnect(obj.keyFocusId);

-        this._sectionList.add_actor(section);
+        this._sections.delete(section);
+        this._sectionList.remove_actor(section.actor);
+        this._sync();
+    }
+
+    _onKeyFocusIn(section, actor) {
+        Util.ensureActorVisibleInScrollView(this._scrollView, actor);
    }

    _sync() {
-        let sections = this._sectionList.get_children();
+        let sections = [...this._sections.keys()];
        let visible = sections.some(s => s.allowed);
-        this.visible = visible;
+        this.actor.visible = visible;
        if (!visible)
            return;

-        let empty = sections.every(s => s.empty || !s.visible);
-        this._placeholder.visible = empty;
+        let empty = sections.every(s => s.empty || !s.actor.visible);
+        this._placeholder.actor.visible = empty;
+        this._clearButton.visible = !empty;

-        let canClear = sections.some(s => s.canClear && s.visible);
+        let canClear = sections.some(s => s.canClear && s.actor.visible);
        this._clearButton.reactive = canClear;
    }

@ -1201,7 +1155,8 @@ class CalendarMessageList extends St.Widget {
    }

    setDate(date) {
-        this._sectionList.get_children().forEach(s => s.setDate(date));
+        for (let section of this._sections.keys())
+            section.setDate(date);
        this._placeholder.setDate(date);
    }
-});
+};
--- a/js/ui/checkBox.js
+++ b/js/ui/checkBox.js
@ -1,22 +1,18 @@
-/* exported CheckBox */
-const { Clutter, GObject, Pango, St } = imports.gi;
+const { Clutter, Pango, St } = imports.gi;

-var CheckBox = GObject.registerClass(
-class CheckBox extends St.Button {
-    _init(label) {
-        let container = new St.BoxLayout({
-            x_expand: true,
-            y_expand: true,
-        });
-        super._init({
-            style_class: 'check-box',
-            child: container,
-            button_mask: St.ButtonMask.ONE,
-            toggle_mode: true,
-            can_focus: true,
-        });
+var CheckBox = class CheckBox {
+    constructor(label) {
+        let container = new St.BoxLayout();
+        this.actor = new St.Button({ style_class: 'check-box',
+                                     child: container,
+                                     button_mask: St.ButtonMask.ONE,
+                                     toggle_mode: true,
+                                     can_focus: true,
+                                     x_fill: true,
+                                     y_fill: true });

-        this._box = new St.Bin({ y_align: Clutter.ActorAlign.START });
+        this._box = new St.Bin();
+        this._box.set_y_align(Clutter.ActorAlign.START);
        container.add_actor(this._box);

        this._label = new St.Label();
@ -35,4 +31,4 @@ class CheckBox extends St.Button {
    getLabelActor() {
        return this._label;
    }
-});
+};
--- a/js/ui/closeDialog.js
+++ b/js/ui/closeDialog.js
@ -1,19 +1,19 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CloseDialog */

-const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
+const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;

 const Dialog = imports.ui.dialog;
 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

 var FROZEN_WINDOW_BRIGHTNESS = -0.3;
-var DIALOG_TRANSITION_TIME = 150;
+var DIALOG_TRANSITION_TIME = 0.15;
 var ALIVE_TIMEOUT = 5000;

 var CloseDialog = GObject.registerClass({
    Implements: [Meta.CloseDialog],
    Properties: {
-        'window': GObject.ParamSpec.override('window', Meta.CloseDialog),
+        'window': GObject.ParamSpec.override('window', Meta.CloseDialog)
    },
 }, class CloseDialog extends GObject.Object {
    _init(window) {
@ -46,18 +46,6 @@ var CloseDialog = GObject.registerClass({
        return new Dialog.MessageDialogContent({ icon, title, subtitle });
    }

-    _updateScale() {
-        // Since this is a child of MetaWindowActor (which, for Wayland clients,
-        // applies the geometry scale factor to its children itself, see
-        // meta_window_actor_set_geometry_scale()), make sure we don't apply
-        // the factor twice in the end.
-        if (this._window.get_client_type() !== Meta.WindowClientType.WAYLAND)
-            return;
-
-        let { scaleFactor } = St.ThemeContext.get_for_stage(global.stage);
-        this._dialog.set_scale(1 / scaleFactor, 1 / scaleFactor);
-    }
-
    _initDialog() {
        if (this._dialog)
            return;
@ -73,14 +61,9 @@ var CloseDialog = GObject.registerClass({
                                 default: true });
        this._dialog.addButton({ label: _('Wait'),
                                 action: this._onWait.bind(this),
-                                 key: Clutter.KEY_Escape });
+                                 key: Clutter.Escape });

        global.focus_manager.add_group(this._dialog);
-
-        let themeContext = St.ThemeContext.get_for_stage(global.stage);
-        themeContext.connect('notify::scale-factor', this._updateScale.bind(this));
-
-        this._updateScale();
    }

    _addWindowEffect() {
@ -124,12 +107,11 @@ var CloseDialog = GObject.registerClass({
        if (this._tracked === shouldTrack)
            return;

-        if (shouldTrack) {
+        if (shouldTrack)
            Main.layoutManager.trackChrome(this._dialog,
                                           { affectsInputRegion: true });
-        } else {
+        else
            Main.layoutManager.untrackChrome(this._dialog);
-        }

        // The buttons are broken when they aren't added to the input region,
        // so disable them properly in that case
@ -163,15 +145,15 @@ var CloseDialog = GObject.registerClass({
        this._addWindowEffect();
        this._initDialog();

-        this._dialog._dialog.scale_y = 0;
-        this._dialog._dialog.set_pivot_point(0.5, 0.5);
+        this._dialog.scale_y = 0;
+        this._dialog.set_pivot_point(0.5, 0.5);

-        this._dialog._dialog.ease({
-            scale_y: 1,
-            mode: Clutter.AnimationMode.LINEAR,
-            duration: DIALOG_TRANSITION_TIME,
-            onComplete: this._onFocusChanged.bind(this),
-        });
+        Tweener.addTween(this._dialog,
+                         { scale_y: 1,
+                           transition: 'linear',
+                           time: DIALOG_TRANSITION_TIME,
+                           onComplete: this._onFocusChanged.bind(this)
+                         });
    }

    vfunc_hide() {
@ -193,12 +175,14 @@ var CloseDialog = GObject.registerClass({
        this._dialog = null;
        this._removeWindowEffect();

-        dialog._dialog.ease({
-            scale_y: 0,
-            mode: Clutter.AnimationMode.LINEAR,
-            duration: DIALOG_TRANSITION_TIME,
-            onComplete: () => dialog.destroy(),
-        });
+        Tweener.addTween(dialog,
+                         { scale_y: 0,
+                           transition: 'linear',
+                           time: DIALOG_TRANSITION_TIME,
+                           onComplete: () => {
+                               dialog.destroy();
+                           }
+                         });
    }

    vfunc_focus() {
--- a/js/ui/components/init.js
+++ b/js/ui/components/init.js
@ -1,4 +1,3 @@
-/* exported ComponentManager */
 const Main = imports.ui.main;

 var ComponentManager = class {
--- a/js/ui/components/automountManager.js
+++ b/js/ui/components/automountManager.js
@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Gio, GLib } = imports.gi;
+const Mainloop = imports.mainloop;
 const Params = imports.misc.params;

 const GnomeSession = imports.misc.gnomeSession;
@ -38,7 +38,7 @@ var AutomountManager = class {
        this._driveDisconnectedId = this._volumeMonitor.connect('drive-disconnected', this._onDriveDisconnected.bind(this));
        this._driveEjectButtonId = this._volumeMonitor.connect('drive-eject-button', this._onDriveEjectButton.bind(this));

-        this._mountAllId = GLib.idle_add(GLib.PRIORITY_DEFAULT, this._startupMountAll.bind(this));
+        this._mountAllId = Mainloop.idle_add(this._startupMountAll.bind(this));
        GLib.Source.set_name_by_id(this._mountAllId, '[gnome-shell] this._startupMountAll');
    }

@ -50,16 +50,17 @@ var AutomountManager = class {
        this._volumeMonitor.disconnect(this._driveEjectButtonId);

        if (this._mountAllId > 0) {
-            GLib.source_remove(this._mountAllId);
+            Mainloop.source_remove(this._mountAllId);
            this._mountAllId = 0;
        }
    }

-    _InhibitorsChanged(_object, _senderName, [_inhibitor]) {
+    _InhibitorsChanged(object, senderName, [inhibtor]) {
        this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
            (result, error) => {
-                if (!error)
+                if (!error) {
                    this._inhibited = result[0];
+                }
            });
    }

@ -109,7 +110,7 @@ var AutomountManager = class {
        // mount operation object
        if (drive.can_stop()) {
            drive.stop(Gio.MountUnmountFlags.FORCE, null, null,
-                (o, res) => {
+                (drive, res) => {
                    try {
                        drive.stop_finish(res);
                    } catch (e) {
@ -118,7 +119,7 @@ var AutomountManager = class {
                });
        } else if (drive.can_eject()) {
            drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null,
-                (o, res) => {
+                (drive, res) => {
                    try {
                        drive.eject_with_operation_finish(res);
                    } catch (e) {
@ -155,7 +156,7 @@ var AutomountManager = class {
            !volume.should_automount() ||
            !volume.can_mount()) {
            // allow the autorun to run anyway; this can happen if the
-            // mount gets added programmatically later, even if
+            // mount gets added programmatically later, even if 
            // should_automount() or can_mount() are false, like for
            // blank optical media.
            this._allowAutorun(volume);
@ -218,19 +219,19 @@ var AutomountManager = class {

    _onVolumeRemoved(monitor, volume) {
        if (volume._allowAutorunExpireId && volume._allowAutorunExpireId > 0) {
-            GLib.source_remove(volume._allowAutorunExpireId);
+            Mainloop.source_remove(volume._allowAutorunExpireId);
            delete volume._allowAutorunExpireId;
        }
-        this._volumeQueue =
-            this._volumeQueue.filter(element => element != volume);
+        this._volumeQueue = 
+            this._volumeQueue.filter(element => (element != volume));
    }

    _reaskPassword(volume) {
        let prevOperation = this._activeOperations.get(volume);
        let existingDialog = prevOperation ? prevOperation.borrowDialog() : null;
-        let operation =
+        let operation = 
            new ShellMountOperation.ShellMountOperation(volume,
-                                                        { existingDialog });
+                                                        { existingDialog: existingDialog });
        this._mountVolume(volume, operation);
    }

@ -247,7 +248,7 @@ var AutomountManager = class {
    }

    _allowAutorunExpire(volume) {
-        let id = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
+        let id = Mainloop.timeout_add_seconds(AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
            volume.allowAutorun = false;
            delete volume._allowAutorunExpireId;
            return GLib.SOURCE_REMOVE;
--- a/js/ui/components/autorunManager.js
+++ b/js/ui/components/autorunManager.js
@ -1,7 +1,6 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

-const { Clutter, Gio, GObject, St } = imports.gi;
+const { Gio, St } = imports.gi;

 const GnomeSession = imports.misc.gnomeSession;
 const Main = imports.ui.main;
@ -20,7 +19,7 @@ var AutorunSetting = {
    RUN: 0,
    IGNORE: 1,
    FILES: 2,
-    ASK: 3,
+    ASK: 3
 };

 // misc utils
@ -41,7 +40,7 @@ function isMountRootHidden(root) {
    let path = root.get_path();

    // skip any mounts in hidden directory hierarchies
-    return path.includes('/.');
+    return (path.includes('/.'));
 }

 function isMountNonLocal(mount) {
@ -52,7 +51,7 @@ function isMountNonLocal(mount) {
    if (volume == null)
        return true;

-    return volume.get_identifier("class") == "network";
+    return (volume.get_identifier("class") == "network");
 }

 function startAppForMount(app, mount) {
@ -63,7 +62,7 @@ function startAppForMount(app, mount) {
    files.push(root);

    try {
-        retval = app.launch(files,
+        retval = app.launch(files, 
                            global.create_app_launch_context(0, -1));
    } catch (e) {
        log(`Unable to launch the application ${app.get_name()}: ${e}`);
@ -72,6 +71,8 @@ function startAppForMount(app, mount) {
    return retval;
 }

+/******************************************/
+
 const HotplugSnifferIface = loadInterfaceXML('org.gnome.Shell.HotplugSniffer');
 const HotplugSnifferProxy = Gio.DBusProxy.makeProxyWrapper(HotplugSnifferIface);
 function HotplugSniffer() {
@ -115,17 +116,16 @@ var ContentTypeDiscoverer = class {

            let hotplugSniffer = new HotplugSniffer();
            hotplugSniffer.SniffURIRemote(root.get_uri(),
-                result => {
-                    [contentTypes] = result;
-                    this._emitCallback(mount, contentTypes);
-                });
+                 ([contentTypes]) => {
+                     this._emitCallback(mount, contentTypes);
+                 });
        }
    }

    _emitCallback(mount, contentTypes = []) {
        // we're not interested in win32 software content types here
        contentTypes = contentTypes.filter(
-            type => type != 'x-content/win32-software'
+            type => (type != 'x-content/win32-software')
        );

        let apps = [];
@ -167,7 +167,7 @@ var AutorunManager = class {
        if (!this._session.SessionIsActive)
            return;

-        let discoverer = new ContentTypeDiscoverer((m, apps, contentTypes) => {
+        let discoverer = new ContentTypeDiscoverer((mount, apps, contentTypes) => {
            this._dispatcher.addMount(mount, apps, contentTypes);
        });
        discoverer.guessContentTypes(mount);
@ -202,7 +202,7 @@ var AutorunDispatcher = class {
    }

    _getSourceForMount(mount) {
-        let filtered = this._sources.filter(source => source.mount == mount);
+        let filtered = this._sources.filter(source => (source.mount == mount));

        // we always make sure not to add two sources for the same
        // mount in addMount(), so it's safe to assume filtered.length
@ -214,11 +214,11 @@ var AutorunDispatcher = class {
    }

    _addSource(mount, apps) {
-        // if we already have a source showing for this
+        // if we already have a source showing for this 
        // mount, return
        if (this._getSourceForMount(mount))
            return;
-
+     
        // add a new source
        this._sources.push(new AutorunSource(this._manager, mount, apps));
    }
@ -246,10 +246,11 @@ var AutorunDispatcher = class {
        let success = false;
        let app = null;

-        if (setting == AutorunSetting.RUN)
+        if (setting == AutorunSetting.RUN) {
            app = Gio.app_info_get_default_for_type(contentTypes[0], false);
-        else if (setting == AutorunSetting.FILES)
+        } else if (setting == AutorunSetting.FILES) {
            app = Gio.app_info_get_default_for_type('inode/directory', false);
+        }

        if (app)
            success = startAppForMount(app, mount);
@ -262,7 +263,7 @@ var AutorunDispatcher = class {

    removeMount(mount) {
        let source = this._getSourceForMount(mount);
-
+        
        // if we aren't tracking this mount, don't do anything
        if (!source)
            return;
@ -272,10 +273,9 @@ var AutorunDispatcher = class {
    }
 };

-var AutorunSource = GObject.registerClass(
-class AutorunSource extends MessageTray.Source {
-    _init(manager, mount, apps) {
-        super._init(mount.get_name());
+var AutorunSource = class extends MessageTray.Source {
+    constructor(manager, mount, apps) {
+        super(mount.get_name());

        this._manager = manager;
        this.mount = mount;
@ -285,7 +285,7 @@ class AutorunSource extends MessageTray.Source {

        // add ourselves as a source, and popup the notification
        Main.messageTray.add(this);
-        this.showNotification(this._notification);
+        this.notify(this._notification);
    }

    getIcon() {
@ -295,12 +295,11 @@ class AutorunSource extends MessageTray.Source {
    _createPolicy() {
        return new MessageTray.NotificationApplicationPolicy('org.gnome.Nautilus');
    }
-});
+};

-var AutorunNotification = GObject.registerClass(
-class AutorunNotification extends MessageTray.Notification {
-    _init(manager, source) {
-        super._init(source, source.title);
+var AutorunNotification = class extends MessageTray.Notification {
+    constructor(manager, source) {
+        super(source, source.title);

        this._manager = manager;
        this._mount = source.mount;
@ -320,23 +319,20 @@ class AutorunNotification extends MessageTray.Notification {
    }

    _buttonForApp(app) {
-        let box = new St.BoxLayout({
-            x_expand: true,
-            x_align: Clutter.ActorAlign.START,
-        });
+        let box = new St.BoxLayout();
        let icon = new St.Icon({ gicon: app.get_icon(),
                                 style_class: 'hotplug-notification-item-icon' });
        box.add(icon);

-        let label = new St.Bin({
-            child: new St.Label({
-                text: _("Open with %s").format(app.get_name()),
-                y_align: Clutter.ActorAlign.CENTER,
-            }),
-        });
+        let label = new St.Bin({ y_align: St.Align.MIDDLE,
+                                 child: new St.Label
+                                 ({ text: _("Open with %s").format(app.get_name()) })
+                               });
        box.add(label);

        let button = new St.Button({ child: box,
+                                     x_fill: true,
+                                     x_align: St.Align.START,
                                     x_expand: true,
                                     button_mask: St.ButtonMask.ONE,
                                     style_class: 'hotplug-notification-item button' });
@ -355,6 +351,6 @@ class AutorunNotification extends MessageTray.Notification {
        let app = Gio.app_info_get_default_for_type('inode/directory', false);
        startAppForMount(app, this._mount);
    }
-});
+};

 var Component = AutorunManager;
--- a/js/ui/components/keyring.js
+++ b/js/ui/components/keyring.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi;

@ -33,7 +32,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {

        this._cancelButton = this.addButton({ label: '',
                                              action: this._onCancelButton.bind(this),
-                                              key: Clutter.KEY_Escape });
+                                              key: Clutter.Escape });
        this._continueButton = this.addButton({ label: '',
                                                action: this._onContinueButton.bind(this),
                                                default: true });
@ -54,12 +53,8 @@ class KeyringDialog extends ModalDialog.ModalDialog {

    _buildControlTable() {
        let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
-        let table = new St.Widget({
-            style_class: 'keyring-dialog-control-table',
-            layout_manager: layout,
-            x_expand: true,
-            y_expand: true,
-        });
+        let table = new St.Widget({ style_class: 'keyring-dialog-control-table',
+                                    layout_manager: layout });
        layout.hookup_style(table);
        let rtl = table.get_text_direction() == Clutter.TextDirection.RTL;
        let row = 0;
@ -78,18 +73,16 @@ class KeyringDialog extends ModalDialog.ModalDialog {
            ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
            this._passwordEntry.clutter_text.connect('activate', this._onPasswordActivate.bind(this));

-            this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, {
-                animate: true,
-            });
+            this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);

            if (rtl) {
-                layout.attach(this._workSpinner, 0, row, 1, 1);
+                layout.attach(this._workSpinner.actor, 0, row, 1, 1);
                layout.attach(this._passwordEntry, 1, row, 1, 1);
                layout.attach(label, 2, row, 1, 1);
            } else {
                layout.attach(label, 0, row, 1, 1);
                layout.attach(this._passwordEntry, 1, row, 1, 1);
-                layout.attach(this._workSpinner, 2, row, 1, 1);
+                layout.attach(this._workSpinner.actor, 2, row, 1, 1);
            }
            row++;
        } else {
@ -98,9 +91,9 @@ class KeyringDialog extends ModalDialog.ModalDialog {
        }

        if (this.prompt.confirm_visible) {
-            var label = new St.Label({ style_class: 'prompt-dialog-password-label',
-                                       x_align: Clutter.ActorAlign.START,
-                                       y_align: Clutter.ActorAlign.CENTER });
+            var label = new St.Label(({ style_class: 'prompt-dialog-password-label',
+                                        x_align: Clutter.ActorAlign.START,
+                                        y_align: Clutter.ActorAlign.CENTER }));
            label.set_text(_("Type again:"));
            this._confirmEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
                                                text: '',
@ -127,8 +120,8 @@ class KeyringDialog extends ModalDialog.ModalDialog {
        if (this.prompt.choice_visible) {
            let choice = new CheckBox.CheckBox();
            this.prompt.bind_property('choice-label', choice.getLabelActor(), 'text', GObject.BindingFlags.SYNC_CREATE);
-            this.prompt.bind_property('choice-chosen', choice, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL);
-            layout.attach(choice, rtl ? 0 : 1, row, 1, 1);
+            this.prompt.bind_property('choice-chosen', choice.actor, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL);
+            layout.attach(choice.actor, rtl ? 0 : 1, row, 1, 1);
            row++;
        }

@ -146,7 +139,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
        }

        this._controlTable = table;
-        this._content.messageBox.add_child(table);
+        this._content.messageBox.add(table, { x_fill: true, y_fill: true });
    }

    _updateSensitivity(sensitive) {
@ -183,21 +176,21 @@ class KeyringDialog extends ModalDialog.ModalDialog {
        return false;
    }

-    _onShowPassword() {
+    _onShowPassword(prompt) {
        this._buildControlTable();
        this._ensureOpen();
        this._updateSensitivity(true);
        this._passwordEntry.grab_key_focus();
    }

-    _onShowConfirm() {
+    _onShowConfirm(prompt) {
        this._buildControlTable();
        this._ensureOpen();
        this._updateSensitivity(true);
        this._continueButton.grab_key_focus();
    }

-    _onHidePrompt() {
+    _onHidePrompt(prompt) {
        this.close();
    }

@ -234,14 +227,12 @@ var KeyringDummyDialog = class {
    }
 };

-var KeyringPrompter = GObject.registerClass(
-class KeyringPrompter extends Gcr.SystemPrompter {
-    _init() {
-        super._init();
-        this.connect('new-prompt', () => {
-            let dialog = this._enabled
-                ? new KeyringDialog()
-                : new KeyringDummyDialog();
+var KeyringPrompter = class {
+    constructor() {
+        this._prompter = new Gcr.SystemPrompter();
+        this._prompter.connect('new-prompt', () => {
+            let dialog = this._enabled ? new KeyringDialog()
+                                       : new KeyringDummyDialog();
            this._currentPrompt = dialog.prompt;
            return this._currentPrompt;
        });
@ -253,7 +244,7 @@ class KeyringPrompter extends Gcr.SystemPrompter {

    enable() {
        if (!this._registered) {
-            this.register(Gio.DBus.session);
+            this._prompter.register(Gio.DBus.session);
            this._dbusId = Gio.DBus.session.own_name('org.gnome.keyring.SystemPrompter',
                                                     Gio.BusNameOwnerFlags.ALLOW_REPLACEMENT, null, null);
            this._registered = true;
@ -264,10 +255,10 @@ class KeyringPrompter extends Gcr.SystemPrompter {
    disable() {
        this._enabled = false;

-        if (this.prompting)
+        if (this._prompter.prompting)
            this._currentPrompt.cancel();
        this._currentPrompt = null;
    }
-});
+};

 var Component = KeyringPrompter;
--- a/js/ui/components/networkAgent.js
+++ b/js/ui/components/networkAgent.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi;
 const Signals = imports.signals;
@ -56,7 +55,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {

            secret.entry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
                                          text: secret.value, can_focus: reactive,
-                                          reactive,
+                                          reactive: reactive,
                                          x_expand: true });
            ShellEntry.addContextMenu(secret.entry,
                                      { isPassword: secret.password });
@ -106,20 +105,22 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
            descriptionLabel.clutter_text.line_wrap = true;
            descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;

-            contentBox.messageBox.add_child(descriptionLabel);
+            contentBox.messageBox.add(descriptionLabel,
+                                      { y_fill: true,
+                                        y_align: St.Align.START,
+                                        expand: true });
        }

-        this._okButton = {
-            label: _("Connect"),
-            action: this._onOk.bind(this),
-            default: true,
-        };
+        this._okButton = { label: _("Connect"),
+                           action: this._onOk.bind(this),
+                           default: true
+                         };

-        this.setButtons([{
-            label: _("Cancel"),
-            action: this.cancel.bind(this),
-            key: Clutter.KEY_Escape,
-        }, this._okButton]);
+        this.setButtons([{ label: _("Cancel"),
+                           action: this.cancel.bind(this),
+                           key: Clutter.KEY_Escape,
+                         },
+                         this._okButton]);

        this._updateOkButton();
    }
@ -161,15 +162,15 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
        if (value.length == 64) {
            // must be composed of hexadecimal digits only
            for (let i = 0; i < 64; i++) {
-                if (!((value[i] >= 'a' && value[i] <= 'f') ||
-                      (value[i] >= 'A' && value[i] <= 'F') ||
-                      (value[i] >= '0' && value[i] <= '9')))
+                if (!((value[i] >= 'a' && value[i] <= 'f')
+                      || (value[i] >= 'A' && value[i] <= 'F')
+                      || (value[i] >= '0' && value[i] <= '9')))
                    return false;
            }
            return true;
        }

-        return value.length >= 8 && value.length <= 63;
+        return (value.length >= 8 && value.length <= 63);
    }

    _validateStaticWep(secret) {
@ -177,15 +178,15 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
        if (secret.wep_key_type == NM.WepKeyType.KEY) {
            if (value.length == 10 || value.length == 26) {
                for (let i = 0; i < value.length; i++) {
-                    if (!((value[i] >= 'a' && value[i] <= 'f') ||
-                          (value[i] >= 'A' && value[i] <= 'F') ||
-                          (value[i] >= '0' && value[i] <= '9')))
+                    if (!((value[i] >= 'a' && value[i] <= 'f')
+                          || (value[i] >= 'A' && value[i] <= 'F')
+                          || (value[i] >= '0' && value[i] <= '9')))
                        return false;
                }
            } else if (value.length == 5 || value.length == 13) {
                for (let i = 0; i < value.length; i++) {
-                    if (!((value[i] >= 'a' && value[i] <= 'z') ||
-                          (value[i] >= 'A' && value[i] <= 'Z')))
+                    if (!((value[i] >= 'a' && value[i] <= 'z')
+                          || (value[i] >= 'A' && value[i] <= 'Z')))
                        return false;
                }
            } else {
@ -198,7 +199,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
        return true;
    }

-    _getWirelessSecrets(secrets, _wirelessSetting) {
+    _getWirelessSecrets(secrets, wirelessSetting) {
        let wirelessSecuritySetting = this._connection.get_setting_wireless_security();

        if (this._settingName == '802-1x') {
@ -210,7 +211,6 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
        // First the easy ones
        case 'wpa-none':
        case 'wpa-psk':
-        case 'sae':
            secrets.push({ label: _("Password: "), key: 'psk',
                           value: wirelessSecuritySetting.psk || '',
                           validate: this._validateWpaPsk, password: true });
@ -222,12 +222,11 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
                           validate: this._validateStaticWep, password: true });
            break;
        case 'ieee8021x':
-            if (wirelessSecuritySetting.auth_alg == 'leap') { // Cisco LEAP
+            if (wirelessSecuritySetting.auth_alg == 'leap') // Cisco LEAP
                secrets.push({ label: _("Password: "), key: 'leap-password',
                               value: wirelessSecuritySetting.leap_password || '', password: true });
-            } else { // Dynamic (IEEE 802.1x) WEP
+            else // Dynamic (IEEE 802.1x) WEP
                this._get8021xSecrets(secrets);
-            }
            break;
        case 'wpa-eap':
            this._get8021xSecrets(secrets);
@ -242,18 +241,15 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {

        /* If hints were given we know exactly what we need to ask */
        if (this._settingName == "802-1x" && this._hints.length) {
-            if (this._hints.includes('identity')) {
+            if (this._hints.includes('identity'))
                secrets.push({ label: _("Username: "), key: 'identity',
                               value: ieee8021xSetting.identity || '', password: false });
-            }
-            if (this._hints.includes('password')) {
+            if (this._hints.includes('password'))
                secrets.push({ label: _("Password: "), key: 'password',
                               value: ieee8021xSetting.password || '', password: true });
-            }
-            if (this._hints.includes('private-key-password')) {
+            if (this._hints.includes('private-key-password'))
                secrets.push({ label: _("Private key password: "), key: 'private-key-password',
                               value: ieee8021xSetting.private_key_password || '', password: true });
-            }
            return;
        }

@ -389,7 +385,7 @@ var VPNRequestHandler = class {
        this._newStylePlugin = authHelper.externalUIMode;

        try {
-            let [success_, pid, stdin, stdout, stderr] =
+            let [success, pid, stdin, stdout, stderr] =
                GLib.spawn_async_with_pipes(null, /* pwd */
                                            argv,
                                            null, /* envp */
@ -448,7 +444,7 @@ var VPNRequestHandler = class {
        this._destroyed = true;
    }

-    _vpnChildFinished(pid, status, _requestObj) {
+    _vpnChildFinished(pid, status, requestObj) {
        this._childWatch = 0;
        if (this._newStylePlugin) {
            // For new style plugin, all work is done in the async reading functions
@ -490,7 +486,7 @@ var VPNRequestHandler = class {

    _readStdoutOldStyle() {
        this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => {
-            let [line, len_] = this._dataStdout.read_line_finish_utf8(result);
+            let [line, len] = this._dataStdout.read_line_finish_utf8(result);

            if (line == null) {
                // end of file
@ -545,7 +541,7 @@ var VPNRequestHandler = class {
                                message: keyfile.get_string(VPN_UI_GROUP, 'Description'),
                                secrets: [] };

-            let [groups, len_] = keyfile.get_groups();
+            let [groups, len] = keyfile.get_groups();
            for (let i = 0; i < groups.length; i++) {
                if (groups[i] == VPN_UI_GROUP)
                    continue;
@ -554,12 +550,11 @@ var VPNRequestHandler = class {
                let shouldAsk = keyfile.get_boolean(groups[i], 'ShouldAsk');

                if (shouldAsk) {
-                    contentOverride.secrets.push({
-                        label: keyfile.get_string(groups[i], 'Label'),
-                        key: groups[i],
-                        value,
-                        password: keyfile.get_boolean(groups[i], 'IsSecret'),
-                    });
+                    contentOverride.secrets.push({ label: keyfile.get_string(groups[i], 'Label'),
+                                                   key: groups[i],
+                                                   value: value,
+                                                   password: keyfile.get_boolean(groups[i], 'IsSecret')
+                                                 });
                } else {
                    if (!value.length) // Ignore empty secrets
                        continue;
@ -613,11 +608,10 @@ Signals.addSignalMethods(VPNRequestHandler.prototype);

 var NetworkAgent = class {
    constructor() {
-        this._native = new Shell.NetworkAgent({
-            identifier: 'org.gnome.Shell.NetworkAgent',
-            capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
-            auto_register: false,
-        });
+        this._native = new Shell.NetworkAgent({ identifier: 'org.gnome.Shell.NetworkAgent',
+                                                capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
+                                                auto_register: false
+                                              });

        this._dialogs = { };
        this._vpnRequests = { };
@ -626,7 +620,7 @@ var NetworkAgent = class {
        this._pluginDir = Gio.file_new_for_path(Config.VPNDIR);
        try {
            let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null);
-            monitor.connect('changed', () => (this._vpnCacheBuilt = false));
+            monitor.connect('changed', () => this._vpnCacheBuilt = false);
        } catch (e) {
            log(`Failed to create monitor for VPN plugin dir: ${e.message}`);
        }
@ -735,7 +729,7 @@ var NetworkAgent = class {
        });

        Main.messageTray.add(source);
-        source.showNotification(notification);
+        source.notify(notification);
    }

    _newRequest(agent, requestId, connection, settingName, hints, flags) {
--- a/js/ui/components/polkitAgent.js
+++ b/js/ui/components/polkitAgent.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { AccountsService, Clutter, Gio, GLib,
        GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi;
@ -11,19 +10,12 @@ const ModalDialog = imports.ui.modalDialog;
 const ShellEntry = imports.ui.shellEntry;
 const UserWidget = imports.ui.userWidget;

-const DialogMode = {
-    AUTH: 0,
-    CONFIRM: 1,
-};
-
 var DIALOG_ICON_SIZE = 48;

 var WORK_SPINNER_ICON_SIZE = 16;

-const DELAYED_RESET_TIMEOUT = 200;
-
 var AuthenticationDialog = GObject.registerClass({
-    Signals: { 'done': { param_types: [GObject.TYPE_BOOLEAN] } },
+    Signals: { 'done': { param_types: [GObject.TYPE_BOOLEAN] } }
 }, class AuthenticationDialog extends ModalDialog.ModalDialog {
    _init(actionId, body, cookie, userNames) {
        super._init({ styleClass: 'prompt-dialog' });
@ -31,6 +23,7 @@ var AuthenticationDialog = GObject.registerClass({
        this.actionId = actionId;
        this.message = body;
        this.userNames = userNames;
+        this._wasDismissed = false;

        this._sessionUpdatedId = Main.sessionMode.connect('updated', () => {
            this.visible = !Main.sessionMode.isLocked;
@ -57,63 +50,70 @@ var AuthenticationDialog = GObject.registerClass({
            userName = userNames[0];

        this._user = AccountsService.UserManager.get_default().get_user(userName);
+        let userRealName = this._user.get_real_name();
+        this._userLoadedId = this._user.connect('notify::is_loaded',
+                                                this._onUserChanged.bind(this));
+        this._userChangedId = this._user.connect('changed',
+                                                 this._onUserChanged.bind(this));

-        let userBox = new St.BoxLayout({
-            style_class: 'polkit-dialog-user-layout',
-            vertical: false,
-        });
-        content.messageBox.add(userBox);
+        // Special case 'root'
+        let userIsRoot = false;
+        if (userName == 'root') {
+            userIsRoot = true;
+            userRealName = _("Administrator");
+        }

-        this._userAvatar = new UserWidget.Avatar(this._user, {
-            iconSize: DIALOG_ICON_SIZE,
-            styleClass: 'polkit-dialog-user-icon',
-        });
-        userBox.add_child(this._userAvatar);
+        if (userIsRoot) {
+            let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-root-label',
+                                            text: userRealName }));
+            content.messageBox.add(userLabel, { x_fill: false,
+                                                x_align: St.Align.START });
+        } else {
+            let userBox = new St.BoxLayout({ style_class: 'polkit-dialog-user-layout',
+                                             vertical: false });
+            content.messageBox.add(userBox);
+            this._userAvatar = new UserWidget.Avatar(this._user,
+                                                     { iconSize: DIALOG_ICON_SIZE,
+                                                       styleClass: 'polkit-dialog-user-icon' });
+            this._userAvatar.actor.hide();
+            userBox.add(this._userAvatar.actor,
+                        { x_fill: true,
+                          y_fill: false,
+                          x_align: St.Align.END,
+                          y_align: St.Align.START });
+            let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label',
+                                            text: userRealName }));
+            userBox.add(userLabel,
+                        { x_fill: true,
+                          y_fill: false,
+                          x_align: St.Align.END,
+                          y_align: St.Align.MIDDLE });
+        }

-        this._userLabel = new St.Label({
-            style_class: userName === 'root'
-                ? 'polkit-dialog-user-root-label'
-                : 'polkit-dialog-user-label',
-            x_expand: true,
-            y_align: Clutter.ActorAlign.CENTER,
-        });
-
-        if (userName === 'root')
-            this._userLabel.text = _('Administrator');
-
-        userBox.add_child(this._userLabel);
+        this._onUserChanged();

        this._passwordBox = new St.BoxLayout({ vertical: false, style_class: 'prompt-dialog-password-box' });
        content.messageBox.add(this._passwordBox);
-        this._passwordLabel = new St.Label({
-            style_class: 'prompt-dialog-password-label',
-            y_align: Clutter.ActorAlign.CENTER,
-        });
-        this._passwordBox.add_child(this._passwordLabel);
-        this._passwordEntry = new St.Entry({
-            style_class: 'prompt-dialog-password-entry',
-            text: "",
-            can_focus: true,
-            x_expand: true,
-        });
+        this._passwordLabel = new St.Label(({ style_class: 'prompt-dialog-password-label' }));
+        this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE });
+        this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
+                                             text: "",
+                                             can_focus: true });
        ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
        this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this));
-        this._passwordEntry.bind_property('reactive',
-            this._passwordEntry.clutter_text, 'editable',
-            GObject.BindingFlags.SYNC_CREATE);
-        this._passwordBox.add_child(this._passwordEntry);
+        this._passwordBox.add(this._passwordEntry,
+                              { expand: true });

-        this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, {
-            animate: true,
-        });
-        this._passwordBox.add(this._workSpinner);
+        this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
+        this._passwordBox.add(this._workSpinner.actor);

+        this.setInitialKeyFocus(this._passwordEntry);
        this._passwordBox.hide();

        this._errorMessageLabel = new St.Label({ style_class: 'prompt-dialog-error-label' });
        this._errorMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
        this._errorMessageLabel.clutter_text.line_wrap = true;
-        content.messageBox.add_child(this._errorMessageLabel);
+        content.messageBox.add(this._errorMessageLabel, { x_fill: false, x_align: St.Align.START });
        this._errorMessageLabel.hide();

        this._infoMessageLabel = new St.Label({ style_class: 'prompt-dialog-info-label' });
@ -136,30 +136,15 @@ var AuthenticationDialog = GObject.registerClass({

        this._cancelButton = this.addButton({ label: _("Cancel"),
                                              action: this.cancel.bind(this),
-                                              key: Clutter.KEY_Escape });
+                                              key: Clutter.Escape });
        this._okButton = this.addButton({ label: _("Authenticate"),
                                          action: this._onAuthenticateButtonPressed.bind(this),
-                                          reactive: false });
-        this._okButton.bind_property('reactive',
-            this._okButton, 'can-focus',
-            GObject.BindingFlags.SYNC_CREATE);
-
-        this._passwordEntry.clutter_text.connect('text-changed', text => {
-            this._okButton.reactive = text.get_text().length > 0;
-        });
+                                          default: true });

        this._doneEmitted = false;

-        this._mode = -1;
-
        this._identityToAuth = Polkit.UnixUser.new_for_name(userName);
        this._cookie = cookie;
-
-        this._userLoadedId = this._user.connect('notify::is-loaded',
-            this._onUserChanged.bind(this));
-        this._userChangedId = this._user.connect('changed',
-            this._onUserChanged.bind(this));
-        this._onUserChanged();
    }

    _setWorking(working) {
@ -169,9 +154,8 @@ var AuthenticationDialog = GObject.registerClass({
            this._workSpinner.stop();
    }

-    _initiateSession() {
-        this._destroySession(DELAYED_RESET_TIMEOUT);
-
+    performAuthentication() {
+        this._destroySession();
        this._session = new PolkitAgent.Session({ identity: this._identityToAuth,
                                                  cookie: this._cookie });
        this._sessionCompletedId = this._session.connect('completed', this._onSessionCompleted.bind(this));
@ -210,15 +194,18 @@ var AuthenticationDialog = GObject.registerClass({
        }
    }

+    _updateSensitivity(sensitive) {
+        this._passwordEntry.reactive = sensitive;
+        this._passwordEntry.clutter_text.editable = sensitive;
+
+        this._okButton.can_focus = sensitive;
+        this._okButton.reactive = sensitive;
+        this._setWorking(!sensitive);
+    }
+
    _onEntryActivate() {
        let response = this._passwordEntry.get_text();
-        if (response.length === 0)
-            return;
-
-        this._passwordEntry.reactive = false;
-        this._okButton.reactive = false;
-        this._setWorking(true);
-
+        this._updateSensitivity(false);
        this._session.response(response);
        // When the user responds, dismiss already shown info and
        // error texts (if any)
@ -228,10 +215,7 @@ var AuthenticationDialog = GObject.registerClass({
    }

    _onAuthenticateButtonPressed() {
-        if (this._mode === DialogMode.CONFIRM)
-            this._initiateSession();
-        else
-            this._onEntryActivate();
+        this._onEntryActivate();
    }

    _onSessionCompleted(session, gainedAuthorization) {
@ -250,7 +234,7 @@ var AuthenticationDialog = GObject.registerClass({
             * error providing authentication-method specific information),
             * show "Sorry, that didn't work. Please try again."
             */
-            if (!this._errorMessageLabel.visible) {
+            if (!this._errorMessageLabel.visible && !this._wasDismissed) {
                /* Translators: "that didn't work" refers to the fact that the
                 * requested authentication was not gained; this can happen
                 * because of an authentication error (like invalid password),
@ -262,16 +246,11 @@ var AuthenticationDialog = GObject.registerClass({
            }

            /* Try and authenticate again */
-            this._initiateSession();
+            this.performAuthentication();
        }
    }

    _onSessionRequest(session, request, echoOn) {
-        if (this._sessionRequestTimeoutId) {
-            GLib.source_remove(this._sessionRequestTimeoutId);
-            this._sessionRequestTimeoutId = 0;
-        }
-
        // Cheap localization trick
        if (request == 'Password:' || request == 'Password: ')
            this._passwordLabel.set_text(_("Password:"));
@ -285,12 +264,9 @@ var AuthenticationDialog = GObject.registerClass({

        this._passwordBox.show();
        this._passwordEntry.set_text('');
-        this._passwordEntry.reactive  = true;
-        this._okButton.reactive = false;
-        this._setWorking(false);
-
-        this._ensureOpen();
        this._passwordEntry.grab_key_focus();
+        this._updateSensitivity(true);
+        this._ensureOpen();
    }

    _onSessionShowError(session, text) {
@ -311,78 +287,29 @@ var AuthenticationDialog = GObject.registerClass({
        this._ensureOpen();
    }

-    _destroySession(delay = 0) {
+    _destroySession() {
        if (this._session) {
+            if (!this._completed)
+                this._session.cancel();
+            this._completed = false;
+
            this._session.disconnect(this._sessionCompletedId);
            this._session.disconnect(this._sessionRequestId);
            this._session.disconnect(this._sessionShowErrorId);
            this._session.disconnect(this._sessionShowInfoId);
-
-            if (!this._completed)
-                this._session.cancel();
-
-            this._completed = false;
            this._session = null;
        }
-
-        if (this._sessionRequestTimeoutId) {
-            GLib.source_remove(this._sessionRequestTimeoutId);
-            this._sessionRequestTimeoutId = 0;
-        }
-
-        let resetDialog = () => {
-            if (this.state != ModalDialog.State.OPENED)
-                return;
-
-            this._passwordBox.hide();
-            this._cancelButton.grab_key_focus();
-            this._okButton.reactive = false;
-        };
-
-        if (delay) {
-            this._sessionRequestTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, delay, resetDialog);
-            GLib.Source.set_name_by_id(this._sessionRequestTimeoutId, '[gnome-shell] this._sessionRequestTimeoutId');
-        } else {
-            resetDialog();
-        }
    }

    _onUserChanged() {
-        if (!this._user.is_loaded)
-            return;
-
-        let userName = this._user.get_user_name();
-        let realName = this._user.get_real_name();
-
-        if (userName !== 'root')
-            this._userLabel.set_text(realName);
-
-        this._userAvatar.update();
-
-        if (this._user.get_password_mode() === AccountsService.UserPasswordMode.NONE) {
-            if (this._mode === DialogMode.CONFIRM)
-                return;
-
-            this._mode = DialogMode.CONFIRM;
-            this._destroySession();
-
-            this._okButton.reactive = true;
-
-            /* We normally open the dialog when we get a "request" signal, but
-             * since in this case initiating a session would perform the
-             * authentication, only open the dialog and initiate the session
-             * when the user confirmed. */
-            this._ensureOpen();
-        } else {
-            if (this._mode === DialogMode.AUTH)
-                return;
-
-            this._mode = DialogMode.AUTH;
-            this._initiateSession();
+        if (this._user.is_loaded && this._userAvatar) {
+            this._userAvatar.update();
+            this._userAvatar.actor.show();
        }
    }

    cancel() {
+        this._wasDismissed = true;
        this.close(global.get_current_time());
        this._emitDone(true);
    }
@ -390,10 +317,7 @@ var AuthenticationDialog = GObject.registerClass({
    _onDialogClosed() {
        if (this._sessionUpdatedId)
            Main.sessionMode.disconnect(this._sessionUpdatedId);
-
-        if (this._sessionRequestTimeoutId)
-            GLib.source_remove(this._sessionRequestTimeoutId);
-        this._sessionRequestTimeoutId = 0;
+        this._sessionUpdatedId = 0;

        if (this._user) {
            this._user.disconnect(this._userLoadedId);
@ -405,20 +329,19 @@ var AuthenticationDialog = GObject.registerClass({
    }
 });

-var AuthenticationAgent = GObject.registerClass(
-class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {
-    _init() {
-        super._init();
-
+var AuthenticationAgent = class {
+    constructor() {
        this._currentDialog = null;
-        this.connect('initiate', this._onInitiate.bind(this));
-        this.connect('cancel', this._onCancel.bind(this));
+        this._handle = null;
+        this._native = new Shell.PolkitAuthenticationAgent();
+        this._native.connect('initiate', this._onInitiate.bind(this));
+        this._native.connect('cancel', this._onCancel.bind(this));
        this._sessionUpdatedId = 0;
    }

    enable() {
        try {
-            this.register();
+            this._native.register();
        } catch (e) {
            log('Failed to register AuthenticationAgent');
        }
@ -426,7 +349,7 @@ class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {

    disable() {
        try {
-            this.unregister();
+            this._native.unregister();
        } catch (e) {
            log('Failed to unregister AuthenticationAgent');
        }
@ -445,14 +368,26 @@ class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {
        }

        this._currentDialog = new AuthenticationDialog(actionId, message, cookie, userNames);
+
+        // We actually don't want to open the dialog until we know for
+        // sure that we're going to interact with the user. For
+        // example, if the password for the identity to auth is blank
+        // (which it will be on a live CD) then there will be no
+        // conversation at all... of course, we don't *know* that
+        // until we actually try it.
+        //
+        // See https://bugzilla.gnome.org/show_bug.cgi?id=643062 for more
+        // discussion.
+
        this._currentDialog.connect('done', this._onDialogDone.bind(this));
+        this._currentDialog.performAuthentication();
    }

-    _onCancel(_nativeAgent) {
+    _onCancel(nativeAgent) {
        this._completeRequest(false);
    }

-    _onDialogDone(_dialog, dismissed) {
+    _onDialogDone(dialog, dismissed) {
        this._completeRequest(dismissed);
    }

@ -464,8 +399,8 @@ class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {
            Main.sessionMode.disconnect(this._sessionUpdatedId);
        this._sessionUpdatedId = 0;

-        this.complete(dismissed);
+        this._native.complete(dismissed);
    }
-});
+};

 var Component = AuthenticationAgent;
--- a/js/ui/components/telepathyClient.js
+++ b/js/ui/components/telepathyClient.js
@ -1,8 +1,8 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gio, GLib, GObject, St } = imports.gi;
 const Lang = imports.lang;
+const Mainloop = imports.mainloop;

 var Tpl = null;
 var Tp = null;
@ -19,7 +19,7 @@ const MessageTray = imports.ui.messageTray;
 const Params = imports.misc.params;
 const Util = imports.misc.util;

-const HAVE_TP = Tp != null && Tpl != null;
+const HAVE_TP = (Tp != null && Tpl != null);

 // See Notification.appendMessage
 var SCROLLBACK_IMMEDIATE_TIME = 3 * 60; // 3 minutes
@ -37,11 +37,11 @@ var CHAT_EXPAND_LINES = 12;

 var NotificationDirection = {
    SENT: 'chat-sent',
-    RECEIVED: 'chat-received',
+    RECEIVED: 'chat-received'
 };

 function makeMessageFromTpMessage(tpMessage, direction) {
-    let [text, flags_] = tpMessage.to_text();
+    let [text, flags] = tpMessage.to_text();

    let timestamp = tpMessage.get_sent_timestamp();
    if (timestamp == 0)
@ -49,10 +49,10 @@ function makeMessageFromTpMessage(tpMessage, direction) {

    return {
        messageType: tpMessage.get_message_type(),
-        text,
+        text: text,
        sender: tpMessage.sender.alias,
-        timestamp,
-        direction,
+        timestamp: timestamp,
+        direction: direction
    };
 }

@ -66,7 +66,7 @@ function makeMessageFromTplEvent(event) {
        text: event.get_message(),
        sender: event.get_sender().get_alias(),
        timestamp: event.get_timestamp(),
-        direction,
+        direction: direction
    };
 }

@ -148,17 +148,17 @@ class TelepathyClient extends Tp.BaseClient {
    }

    vfunc_observe_channels(...args) {
-        let [account, conn, channels, dispatchOp_, requests_, context] = args;
+        let [account, conn, channels, dispatchOp, requests, context] = args;
        let len = channels.length;
        for (let i = 0; i < len; i++) {
            let channel = channels[i];
-            let [targetHandle_, targetHandleType] = channel.get_handle();
+            let [targetHandle, targetHandleType] = channel.get_handle();

            if (channel.get_invalidated())
                continue;

            /* Only observe contact text channels */
-            if (!(channel instanceof Tp.TextChannel) ||
+            if ((!(channel instanceof Tp.TextChannel)) ||
               targetHandleType != Tp.HandleType.CONTACT)
                continue;

@ -181,7 +181,7 @@ class TelepathyClient extends Tp.BaseClient {
    }

    vfunc_handle_channels(...args) {
-        let [account, conn, channels, requests_, userActionTime_, context] = args;
+        let [account, conn, channels, requests, userActionTime, context] = args;
        this._handlingChannels(account, conn, channels, true);
        context.accept();
    }
@ -215,7 +215,7 @@ class TelepathyClient extends Tp.BaseClient {
                // We are already handling the channel, display the source
                let source = this._chatSources[channel.get_object_path()];
                if (source)
-                    source.showNotification();
+                    source.notify();
            }
        }
    }
@ -231,16 +231,15 @@ class TelepathyClient extends Tp.BaseClient {
            return;
        }

-        if (chanType == Tp.IFACE_CHANNEL_TYPE_TEXT) {
+        if (chanType == Tp.IFACE_CHANNEL_TYPE_TEXT)
            this._approveTextChannel(account, conn, channel, dispatchOp, context);
-        } else {
+        else
            context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
                                        message: 'Unsupported channel type' }));
-        }
    }

    _approveTextChannel(account, conn, channel, dispatchOp, context) {
-        let [targetHandle_, targetHandleType] = channel.get_handle();
+        let [targetHandle, targetHandleType] = channel.get_handle();

        if (targetHandleType != Tp.HandleType.CONTACT) {
            context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
@ -249,7 +248,7 @@ class TelepathyClient extends Tp.BaseClient {
        }

        // Approve private text channels right away as we are going to handle it
-        dispatchOp.claim_with_async(this, (o, result) => {
+        dispatchOp.claim_with_async(this, (dispatchOp, result) => {
            try {
                dispatchOp.claim_with_finish(result);
                this._handlingChannels(account, conn, [channel], false);
@ -261,16 +260,15 @@ class TelepathyClient extends Tp.BaseClient {
        context.accept();
    }

-    _delegatedChannelsCb(_client, _channels) {
+    _delegatedChannelsCb(client, channels) {
        // Nothing to do as we don't make a distinction between observed and
        // handled channels.
    }
 }) : null;

-var ChatSource = HAVE_TP ? GObject.registerClass(
-class ChatSource extends MessageTray.Source {
-    _init(account, conn, channel, contact, client) {
-        super._init(contact.get_alias());
+var ChatSource = class extends MessageTray.Source {
+    constructor(account, conn, channel, contact, client) {
+        super(contact.get_alias());

        this._account = account;
        this._contact = contact;
@ -328,7 +326,7 @@ class ChatSource extends MessageTray.Source {

        // We ack messages when the user expands the new notification
        let id = this._banner.connect('expanded', this._ackMessages.bind(this));
-        this._banner.connect('destroy', () => {
+        this._banner.actor.connect('destroy', () => {
            this._banner.disconnect(id);
            this._banner = null;
        });
@ -350,10 +348,11 @@ class ChatSource extends MessageTray.Source {

    getIcon() {
        let file = this._contact.get_avatar_file();
-        if (file)
-            return new Gio.FileIcon({ file });
-        else
+        if (file) {
+            return new Gio.FileIcon({ file: file });
+        } else {
            return new Gio.ThemedIcon({ name: 'avatar-default' });
+        }
    }

    getSecondaryIcon() {
@ -387,11 +386,10 @@ class ChatSource extends MessageTray.Source {

    _updateAvatarIcon() {
        this.iconUpdated();
-        if (this._notifiction) {
+        if (this._notifiction)
            this._notification.update(this._notification.title,
                                      this._notification.bannerBodyText,
                                      { gicon: this.getIcon() });
-        }
    }

    open() {
@ -429,7 +427,7 @@ class ChatSource extends MessageTray.Source {
    }

    _displayPendingMessages(logManager, result) {
-        let [success_, events] = logManager.get_filtered_events_finish(result);
+        let [success, events] = logManager.get_filtered_events_finish(result);

        let logMessages = events.map(makeMessageFromTplEvent);
        this._ensureNotification();
@ -478,7 +476,7 @@ class ChatSource extends MessageTray.Source {
            this._notification.appendMessage(pendingMessages[i], true);

        if (pendingMessages.length > 0)
-            this.showNotification();
+            this.notify();
    }

    destroy(reason) {
@ -547,15 +545,15 @@ class ChatSource extends MessageTray.Source {
        // Wait a bit before notifying for the received message, a handler
        // could ack it in the meantime.
        if (this._notifyTimeoutId != 0)
-            GLib.source_remove(this._notifyTimeoutId);
-        this._notifyTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500,
+            Mainloop.source_remove(this._notifyTimeoutId);
+        this._notifyTimeoutId = Mainloop.timeout_add(500,
            this._notifyTimeout.bind(this));
        GLib.Source.set_name_by_id(this._notifyTimeoutId, '[gnome-shell] this._notifyTimeout');
    }

    _notifyTimeout() {
        if (this._pendingMessages.length != 0)
-            this.showNotification();
+            this.notify();

        this._notifyTimeoutId = 0;

@ -564,14 +562,14 @@ class ChatSource extends MessageTray.Source {

    // This is called for both messages we send from
    // our client and other clients as well.
-    _messageSent(channel, message, _flags, _token) {
+    _messageSent(channel, message, flags, token) {
        this._ensureNotification();
        message = makeMessageFromTpMessage(message, NotificationDirection.SENT);
        this._notification.appendMessage(message);
    }

-    showNotification() {
-        super.showNotification(this._notification);
+    notify() {
+        super.notify(this._notification);
    }

    respond(text) {
@ -585,7 +583,7 @@ class ChatSource extends MessageTray.Source {

        let msg = Tp.ClientMessage.new_text(type, text);
        this._channel.send_message_async(msg, 0, (src, result) => {
-            this._channel.send_message_finish(result);
+            this._channel.send_message_finish(result); 
        });
    }

@ -602,12 +600,11 @@ class ChatSource extends MessageTray.Source {
        }
    }

-    _presenceChanged(_contact, _presence, _status, _message) {
-        if (this._notification) {
+    _presenceChanged(contact, presence, status, message) {
+        if (this._notification)
            this._notification.update(this._notification.title,
                                      this._notification.bannerBodyText,
                                      { secondaryGIcon: this.getSecondaryIcon() });
-        }
    }

    _pendingRemoved(channel, message) {
@ -628,18 +625,12 @@ class ChatSource extends MessageTray.Source {
        // 'pending-message-removed' for each one.
        this._channel.ack_all_pending_messages_async(null);
    }
-}) : null;
+};

-var ChatNotification = HAVE_TP ? GObject.registerClass({
-    Signals: {
-        'message-removed': { param_types: [Tp.Message.$gtype] },
-        'message-added': { param_types: [Tp.Message.$gtype] },
-        'timestamp-changed': { param_types: [Tp.Message.$gtype] },
-    },
-}, class ChatNotification extends MessageTray.Notification {
-    _init(source) {
-        super._init(source, source.title, null,
-            { secondaryGIcon: source.getSecondaryIcon() });
+var ChatNotification = class extends MessageTray.Notification {
+    constructor(source) {
+        super(source, source.title, null,
+              { secondaryGIcon: source.getSecondaryIcon() });
        this.setUrgency(MessageTray.Urgency.HIGH);
        this.setResident(true);

@ -649,23 +640,23 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({

    destroy(reason) {
        if (this._timestampTimeoutId)
-            GLib.source_remove(this._timestampTimeoutId);
+            Mainloop.source_remove(this._timestampTimeoutId);
        this._timestampTimeoutId = 0;
        super.destroy(reason);
    }

    /**
     * appendMessage:
-     * @param {Object} message: An object with the properties
-     *   {string} message.text: the body of the message,
-     *   {Tp.ChannelTextMessageType} message.messageType: the type
-     *   {string} message.sender: the name of the sender,
-     *   {number} message.timestamp: the time the message was sent
-     *   {NotificationDirection} message.direction: a #NotificationDirection
-     *
-     * @param {bool} noTimestamp: Whether to add a timestamp. If %true,
-     *   no timestamp will be added, regardless of the difference since
-     *   the last timestamp
+     * @message: An object with the properties:
+     *   text: the body of the message,
+     *   messageType: a #Tp.ChannelTextMessageType,
+     *   sender: the name of the sender,
+     *   timestamp: the time the message was sent
+     *   direction: a #NotificationDirection
+     * 
+     * @noTimestamp: Whether to add a timestamp. If %true, no timestamp
+     *   will be added, regardless of the difference since the
+     *   last timestamp
     */
    appendMessage(message, noTimestamp) {
        let messageBody = GLib.markup_escape_text(message.text, -1);
@ -677,20 +668,19 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
            styles.push('chat-action');
        }

-        if (message.direction == NotificationDirection.RECEIVED) {
+        if (message.direction == NotificationDirection.RECEIVED)
            this.update(this.source.title, messageBody,
-                        { datetime: GLib.DateTime.new_from_unix_local(message.timestamp),
+                        { datetime: GLib.DateTime.new_from_unix_local (message.timestamp),
                          bannerMarkup: true });
-        }

-        let group = message.direction == NotificationDirection.RECEIVED
-            ? 'received' : 'sent';
+        let group = (message.direction == NotificationDirection.RECEIVED ?
+                     'received' : 'sent');

        this._append({ body: messageBody,
-                       group,
-                       styles,
+                       group: group,
+                       styles: styles,
                       timestamp: message.timestamp,
-                       noTimestamp });
+                       noTimestamp: noTimestamp });
    }

    _filterMessages() {
@ -698,7 +688,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
            return;

        let lastMessageTime = this.messages[0].timestamp;
-        let currentTime = Date.now() / 1000;
+        let currentTime = (Date.now() / 1000);

        // Keep the scrollback from growing too long. If the most
        // recent message (before the one we just added) is within
@ -706,8 +696,8 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
        // SCROLLBACK_RECENT_LENGTH previous messages. Otherwise
        // we'll keep SCROLLBACK_IDLE_LENGTH messages.

-        let maxLength = lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME
-            ? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
+        let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) ?
+            SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;

        let filteredHistory = this.messages.filter(item => item.realMessage);
        if (filteredHistory.length > maxLength) {
@ -720,16 +710,16 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({

    /**
     * _append:
-     * @param {Object} props: An object with the properties:
-     *  {string} props.body: The text of the message.
-     *  {string} props.group: The group of the message, one of:
+     * @props: An object with the properties:
+     *  body: The text of the message.
+     *  group: The group of the message, one of:
     *         'received', 'sent', 'meta'.
-     *  {string[]} props.styles: Style class names for the message to have.
-     *  {number} props.timestamp: The timestamp of the message.
-     *  {bool} props.noTimestamp: suppress timestamp signal?
+     *  styles: Style class names for the message to have.
+     *  timestamp: The timestamp of the message.
+     *  noTimestamp: suppress timestamp signal?
     */
    _append(props) {
-        let currentTime = Date.now() / 1000;
+        let currentTime = (Date.now() / 1000);
        props = Params.parse(props, { body: null,
                                      group: null,
                                      styles: [],
@ -738,7 +728,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({

        // Reset the old message timeout
        if (this._timestampTimeoutId)
-            GLib.source_remove(this._timestampTimeoutId);
+            Mainloop.source_remove(this._timestampTimeoutId);
        this._timestampTimeoutId = 0;

        let message = { realMessage: props.group != 'meta',
@ -756,8 +746,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
            } else {
                // Schedule a new timestamp in SCROLLBACK_IMMEDIATE_TIME
                // from the timestamp of the message.
-                this._timestampTimeoutId = GLib.timeout_add_seconds(
-                    GLib.PRIORITY_DEFAULT,
+                this._timestampTimeoutId = Mainloop.timeout_add_seconds(
                    SCROLLBACK_IMMEDIATE_TIME - (currentTime - timestamp),
                    this.appendTimestamp.bind(this));
                GLib.Source.set_name_by_id(this._timestampTimeoutId, '[gnome-shell] this.appendTimestamp');
@ -792,7 +781,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({

        this._filterMessages();
    }
-}) : null;
+};

 var ChatLineBox = GObject.registerClass(
 class ChatLineBox extends St.BoxLayout {
@ -802,10 +791,9 @@ class ChatLineBox extends St.BoxLayout {
    }
 });

-var ChatNotificationBanner = GObject.registerClass(
-class ChatNotificationBanner extends MessageTray.NotificationBanner {
-    _init(notification) {
-        super._init(notification);
+var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
+    constructor(notification) {
+        super(notification);

        this._responseEntry = new St.Entry({ style_class: 'chat-response',
                                             x_expand: true,
@ -890,7 +878,8 @@ class ChatNotificationBanner extends MessageTray.NotificationBanner {
    }

    _addMessage(message) {
-        let body = new MessageList.URLHighlighter(message.body, true, true);
+        let highlighter = new MessageList.URLHighlighter(message.body, true, true);
+        let body = highlighter.actor;

        let styles = message.styles;
        for (let i = 0; i < styles.length; i++)
@ -962,15 +951,14 @@ class ChatNotificationBanner extends MessageTray.NotificationBanner {

        // Remove composing timeout.
        if (this._composingTimeoutId > 0) {
-            GLib.source_remove(this._composingTimeoutId);
+            Mainloop.source_remove(this._composingTimeoutId);
            this._composingTimeoutId = 0;
        }

        if (text != '') {
            this.notification.source.setChatState(Tp.ChannelChatState.COMPOSING);

-            this._composingTimeoutId = GLib.timeout_add_seconds(
-                GLib.PRIORITY_DEFAULT,
+            this._composingTimeoutId = Mainloop.timeout_add_seconds(
                COMPOSING_STOP_TIMEOUT,
                this._composingStopTimeout.bind(this));
            GLib.Source.set_name_by_id(this._composingTimeoutId, '[gnome-shell] this._composingStopTimeout');
@ -978,6 +966,6 @@ class ChatNotificationBanner extends MessageTray.NotificationBanner {
            this.notification.source.setChatState(Tp.ChannelChatState.ACTIVE);
        }
    }
-});
+};

 var Component = TelepathyComponent;
--- a/js/ui/ctrlAltTab.js
+++ b/js/ui/ctrlAltTab.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CtrlAltTabManager */

 const { Clutter, GObject, Meta, Shell, St } = imports.gi;

@ -12,7 +11,7 @@ var POPUP_APPICON_SIZE = 96;
 var SortGroup = {
    TOP:    0,
    MIDDLE: 1,
-    BOTTOM: 2,
+    BOTTOM: 2
 };

 var CtrlAltTabManager = class CtrlAltTabManager {
@ -64,8 +63,9 @@ var CtrlAltTabManager = class CtrlAltTabManager {
        if (a.sortGroup != b.sortGroup)
            return a.sortGroup - b.sortGroup;

-        let [ax] = a.proxy.get_transformed_position();
-        let [bx] = b.proxy.get_transformed_position();
+        let ax, bx, y;
+        [ax, y] = a.proxy.get_transformed_position();
+        [bx, y] = b.proxy.get_transformed_position();

        return ax - bx;
    }
@ -86,26 +86,25 @@ var CtrlAltTabManager = class CtrlAltTabManager {
            for (let i = 0; i < windows.length; i++) {
                let icon = null;
                let iconName = null;
-                if (windows[i].get_window_type() == Meta.WindowType.DESKTOP) {
+                if (windows[i].get_window_type () == Meta.WindowType.DESKTOP) {
                    iconName = 'video-display-symbolic';
                } else {
                    let app = windowTracker.get_window_app(windows[i]);
-                    if (app) {
+                    if (app)
                        icon = app.create_icon_texture(POPUP_APPICON_SIZE);
-                    } else {
+                    else
                        icon = textureCache.bind_cairo_surface_property(windows[i],
                                                                        'icon',
                                                                        POPUP_APPICON_SIZE);
-                    }
                }

                items.push({ name: windows[i].title,
                             proxy: windows[i].get_compositor_private(),
-                             focusCallback: timestamp => {
-                                 Main.activateWindow(windows[i], timestamp);
-                             },
+                             focusCallback: function(timestamp) {
+                                 Main.activateWindow(this, timestamp);
+                             }.bind(windows[i]),
                             iconActor: icon,
-                             iconName,
+                             iconName: iconName,
                             sortGroup: SortGroup.MIDDLE });
            }
        }
@ -144,9 +143,9 @@ class CtrlAltTabPopup extends SwitcherPopup.SwitcherPopup {
            this._select(this._next());
        else if (action == Meta.KeyBindingAction.SWITCH_PANELS_BACKWARD)
            this._select(this._previous());
-        else if (keysym == Clutter.KEY_Left)
+        else if (keysym == Clutter.Left)
            this._select(this._previous());
-        else if (keysym == Clutter.KEY_Right)
+        else if (keysym == Clutter.Right)
            this._select(this._next());
        else
            return Clutter.EVENT_PROPAGATE;
@ -178,13 +177,10 @@ class CtrlAltTabSwitcher extends SwitcherPopup.SwitcherList {
            icon = new St.Icon({ icon_name: item.iconName,
                                 icon_size: POPUP_APPICON_SIZE });
        }
-        box.add_child(icon);
+        box.add(icon, { x_fill: false, y_fill: false } );

-        let text = new St.Label({
-            text: item.name,
-            x_align: Clutter.ActorAlign.CENTER,
-        });
-        box.add_child(text);
+        let text = new St.Label({ text: item.name });
+        box.add(text, { x_fill: false });

        this.addItem(box, text);
    }
--- a/js/ui/dash.js
+++ b/js/ui/dash.js
@ -1,62 +1,36 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Dash */

-const { Clutter, GLib, GObject,
-        Graphene, Meta, Shell, St } = imports.gi;
+const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
+const Mainloop = imports.mainloop;
+const Signals = imports.signals;

 const AppDisplay = imports.ui.appDisplay;
 const AppFavorites = imports.ui.appFavorites;
 const DND = imports.ui.dnd;
 const IconGrid = imports.ui.iconGrid;
 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

-var DASH_ANIMATION_TIME = 200;
-var DASH_ITEM_LABEL_SHOW_TIME = 150;
-var DASH_ITEM_LABEL_HIDE_TIME = 100;
+var DASH_ANIMATION_TIME = 0.2;
+var DASH_ITEM_LABEL_SHOW_TIME = 0.15;
+var DASH_ITEM_LABEL_HIDE_TIME = 0.1;
 var DASH_ITEM_HOVER_TIMEOUT = 300;

 function getAppFromSource(source) {
-    if (source instanceof AppDisplay.AppIcon)
+    if (source instanceof AppDisplay.AppIcon) {
        return source.app;
-    else
+    } else {
        return null;
+    }
 }

-var DashIcon = GObject.registerClass(
-class DashIcon extends AppDisplay.AppIcon {
-    _init(app) {
-        super._init(app, {
-            setSizeManually: true,
-            showLabel: false,
-        });
-    }
-
-    // Disable all DnD methods
-    _onDragBegin() {
-    }
-
-    _onDragEnd() {
-    }
-
-    handleDragOver() {
-        return DND.DragMotionResult.CONTINUE;
-    }
-
-    acceptDrop() {
-        return false;
-    }
-});
-
 // A container like StBin, but taking the child's scale into account
 // when requesting a size
 var DashItemContainer = GObject.registerClass(
 class DashItemContainer extends St.Widget {
    _init() {
        super._init({ style_class: 'dash-item-container',
-                      pivot_point: new Graphene.Point({ x: .5, y: .5 }),
-                      scale_x: 0,
-                      scale_y: 0,
-                      opacity: 0,
+                      pivot_point: new Clutter.Point({ x: .5, y: .5 }),
                      x_expand: true,
                      x_align: Clutter.ActorAlign.CENTER });

@ -67,11 +41,10 @@ class DashItemContainer extends St.Widget {
        this.label_actor = this.label;

        this.child = null;
+        this._childScale = 0;
+        this._childOpacity = 0;
        this.animatingOut = false;

-        this.connect('notify::scale-x', () => this.queue_relayout());
-        this.connect('notify::scale-y', () => this.queue_relayout());
-
        this.connect('destroy', () => {
            if (this.child != null)
                this.child.destroy();
@ -122,11 +95,11 @@ class DashItemContainer extends St.Widget {
            x = stageX + this.get_width() + xOffset;

        this.label.set_position(x, y);
-        this.label.ease({
-            opacity: 255,
-            duration: DASH_ITEM_LABEL_SHOW_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        });
+        Tweener.addTween(this.label,
+                         { opacity: 255,
+                           time: DASH_ITEM_LABEL_SHOW_TIME,
+                           transition: 'easeOutQuad',
+                         });
    }

    setLabelText(text) {
@ -135,12 +108,14 @@ class DashItemContainer extends St.Widget {
    }

    hideLabel() {
-        this.label.ease({
-            opacity: 0,
-            duration: DASH_ITEM_LABEL_HIDE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.label.hide(),
-        });
+        Tweener.addTween(this.label,
+                         { opacity: 0,
+                           time: DASH_ITEM_LABEL_HIDE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this.label.hide();
+                           }
+                         });
    }

    setChild(actor) {
@ -151,6 +126,9 @@ class DashItemContainer extends St.Widget {

        this.child = actor;
        this.add_actor(this.child);
+
+        this.set_scale(this._childScale, this._childScale);
+        this.set_opacity(this._childOpacity);
    }

    show(animate) {
@ -158,13 +136,12 @@ class DashItemContainer extends St.Widget {
            return;

        let time = animate ? DASH_ANIMATION_TIME : 0;
-        this.ease({
-            scale_x: 1,
-            scale_y: 1,
-            opacity: 255,
-            duration: time,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        });
+        Tweener.addTween(this,
+                         { childScale: 1.0,
+                           childOpacity: 255,
+                           time: time,
+                           transition: 'easeOutQuad'
+                         });
    }

    animateOutAndDestroy() {
@ -176,14 +153,37 @@ class DashItemContainer extends St.Widget {
        }

        this.animatingOut = true;
-        this.ease({
-            scale_x: 0,
-            scale_y: 0,
-            opacity: 0,
-            duration: DASH_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.destroy(),
-        });
+        Tweener.addTween(this,
+                         { childScale: 0.0,
+                           childOpacity: 0,
+                           time: DASH_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this.destroy();
+                           }
+                         });
+    }
+
+    set childScale(scale) {
+        this._childScale = scale;
+
+        this.set_scale(scale, scale);
+        this.queue_relayout();
+    }
+
+    get childScale() {
+        return this._childScale;
+    }
+
+    set childOpacity(opacity) {
+        this._childOpacity = opacity;
+
+        this.set_opacity(opacity);
+        this.queue_redraw();
+    }
+
+    get childOpacity() {
+        return this._childOpacity;
    }
 });

@ -241,14 +241,14 @@ class ShowAppsIcon extends DashItemContainer {
            this.setLabelText(_("Show Applications"));
    }

-    handleDragOver(source, _actor, _x, _y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        if (!this._canRemoveApp(getAppFromSource(source)))
            return DND.DragMotionResult.NO_DROP;

        return DND.DragMotionResult.MOVE_DROP;
    }

-    acceptDrop(source, _actor, _x, _y, _time) {
+    acceptDrop(source, actor, x, y, time) {
        let app = getAppFromSource(source);
        if (!this._canRemoveApp(app))
            return false;
@ -284,12 +284,9 @@ var DashActor = GObject.registerClass(
 class DashActor extends St.Widget {
    _init() {
        let layout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.VERTICAL });
-        super._init({
-            name: 'dash',
-            layout_manager: layout,
-            clip_to_allocation: true,
-            y_align: Clutter.ActorAlign.CENTER,
-        });
+        super._init({ name: 'dash',
+                      layout_manager: layout,
+                      clip_to_allocation: true });
    }

    vfunc_allocate(box, flags) {
@ -299,7 +296,7 @@ class DashActor extends St.Widget {
        this.set_allocation(box, flags);

        let [appIcons, showAppsButton] = this.get_children();
-        let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
+        let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);

        let childBox = new Clutter.ActorBox();
        childBox.x1 = contentBox.x1;
@ -333,10 +330,8 @@ class DashActor extends St.Widget {

 const baseIconSizes = [16, 22, 24, 32, 48, 64];

-var Dash = GObject.registerClass({
-    Signals: { 'icon-size-changed': {} },
-}, class Dash extends St.Bin {
-    _init() {
+var Dash = class Dash {
+    constructor() {
        this._maxHeight = -1;
        this.iconSize = 64;
        this._shownInitially = false;
@ -356,7 +351,8 @@ var Dash = GObject.registerClass({
        this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);

        this._showAppsIcon = new ShowAppsIcon();
-        this._showAppsIcon.show(false);
+        this._showAppsIcon.childScale = 1;
+        this._showAppsIcon.childOpacity = 255;
        this._showAppsIcon.icon.setIconSize(this.iconSize);
        this._hookUpLabel(this._showAppsIcon);

@ -364,11 +360,11 @@ var Dash = GObject.registerClass({

        this._container.add_actor(this._showAppsIcon);

-        super._init({ child: this._container });
-        this.connect('notify::height', () => {
-            if (this._maxHeight != this.height)
+        this.actor = new St.Bin({ child: this._container });
+        this.actor.connect('notify::height', () => {
+            if (this._maxHeight != this.actor.height)
                this._queueRedisplay();
-            this._maxHeight = this.height;
+            this._maxHeight = this.actor.height;
        });

        this._workId = Main.initializeDeferredWork(this._box, this._redisplay.bind(this));
@ -391,13 +387,13 @@ var Dash = GObject.registerClass({

        // Translators: this is the name of the dock/favorites area on
        // the left of the overview
-        Main.ctrlAltTabManager.addGroup(this, _("Dash"), 'user-bookmarks-symbolic');
+        Main.ctrlAltTabManager.addGroup(this.actor, _("Dash"), 'user-bookmarks-symbolic');
    }

    _onDragBegin() {
        this._dragCancelled = false;
        this._dragMonitor = {
-            dragMotion: this._onDragMotion.bind(this),
+            dragMotion: this._onDragMotion.bind(this)
        };
        DND.addDragMonitor(this._dragMonitor);

@ -478,19 +474,31 @@ var Dash = GObject.registerClass({
    }

    _createAppItem(app) {
-        let appIcon = new DashIcon(app);
+        let appIcon = new AppDisplay.AppIcon(app,
+                                             { setSizeManually: true,
+                                               showLabel: false });
+        if (appIcon._draggable) {
+            appIcon._draggable.connect('drag-begin',
+                                       () => {
+                                           appIcon.actor.opacity = 50;
+                                       });
+            appIcon._draggable.connect('drag-end',
+                                       () => {
+                                           appIcon.actor.opacity = 255;
+                                       });
+        }

        appIcon.connect('menu-state-changed',
-                        (o, opened) => {
+                        (appIcon, opened) => {
                            this._itemMenuStateChanged(item, opened);
                        });

        let item = new DashItemContainer();
-        item.setChild(appIcon);
+        item.setChild(appIcon.actor);

        // Override default AppIcon label_actor, now the
        // accessible_name is set at DashItemContainer.setLabelText
-        appIcon.label_actor = null;
+        appIcon.actor.label_actor = null;
        item.setLabelText(app.get_name());

        appIcon.icon.setIconSize(this.iconSize);
@ -504,7 +512,7 @@ var Dash = GObject.registerClass({
        // that the notify::hover handler does everything we need to.
        if (opened) {
            if (this._showLabelTimeoutId > 0) {
-                GLib.source_remove(this._showLabelTimeoutId);
+                Mainloop.source_remove(this._showLabelTimeoutId);
                this._showLabelTimeoutId = 0;
            }

@ -518,7 +526,7 @@ var Dash = GObject.registerClass({
        if (shouldShow) {
            if (this._showLabelTimeoutId == 0) {
                let timeout = this._labelShowing ? 0 : DASH_ITEM_HOVER_TIMEOUT;
-                this._showLabelTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
+                this._showLabelTimeoutId = Mainloop.timeout_add(timeout,
                    () => {
                        this._labelShowing = true;
                        item.showLabel();
@ -527,17 +535,17 @@ var Dash = GObject.registerClass({
                    });
                GLib.Source.set_name_by_id(this._showLabelTimeoutId, '[gnome-shell] item.showLabel');
                if (this._resetHoverTimeoutId > 0) {
-                    GLib.source_remove(this._resetHoverTimeoutId);
+                    Mainloop.source_remove(this._resetHoverTimeoutId);
                    this._resetHoverTimeoutId = 0;
                }
            }
        } else {
            if (this._showLabelTimeoutId > 0)
-                GLib.source_remove(this._showLabelTimeoutId);
+                Mainloop.source_remove(this._showLabelTimeoutId);
            this._showLabelTimeoutId = 0;
            item.hideLabel();
            if (this._labelShowing) {
-                this._resetHoverTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, DASH_ITEM_HOVER_TIMEOUT,
+                this._resetHoverTimeoutId = Mainloop.timeout_add(DASH_ITEM_HOVER_TIMEOUT,
                    () => {
                        this._labelShowing = false;
                        this._resetHoverTimeoutId = 0;
@ -625,12 +633,12 @@ var Dash = GObject.registerClass({
            icon.icon.set_size(icon.icon.width * scale,
                               icon.icon.height * scale);

-            icon.icon.ease({
-                width: targetWidth,
-                height: targetHeight,
-                duration: DASH_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            });
+            Tweener.addTween(icon.icon,
+                             { width: targetWidth,
+                               height: targetHeight,
+                               time: DASH_ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                             });
        }
    }

@ -708,8 +716,8 @@ var Dash = GObject.registerClass({
            }

            // App moved
-            let nextApp = newApps.length > newIndex + 1
-                ? newApps[newIndex + 1] : null;
+            let nextApp = newApps.length > newIndex + 1 ? newApps[newIndex + 1]
+                                                        : null;
            let insertHere = nextApp && nextApp == oldApp;
            let alreadyRemoved = removedActors.reduce((result, actor) => {
                let removedApp = actor.child._delegate.app;
@ -728,10 +736,9 @@ var Dash = GObject.registerClass({
            }
        }

-        for (let i = 0; i < addedItems.length; i++) {
+        for (let i = 0; i < addedItems.length; i++)
            this._box.insert_child_at_index(addedItems[i].item,
                                            addedItems[i].pos);
-        }

        for (let i = 0; i < removedActors.length; i++) {
            let item = removedActors[i];
@ -755,8 +762,9 @@ var Dash = GObject.registerClass({
        if (!this._shownInitially)
            this._shownInitially = true;

-        for (let i = 0; i < addedItems.length; i++)
+        for (let i = 0; i < addedItems.length; i++) {
            addedItems[i].item.show(animate);
+        }

        // Workaround for https://bugzilla.gnome.org/show_bug.cgi?id=692744
        // Without it, StBoxLayout may use a stale size cache
@ -782,7 +790,7 @@ var Dash = GObject.registerClass({
        }
    }

-    handleDragOver(source, actor, x, y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        let app = getAppFromSource(source);

        // Don't allow favoriting of transient apps
@ -836,8 +844,8 @@ var Dash = GObject.registerClass({
            }

            this._dragPlaceholder = new DragPlaceholderItem();
-            this._dragPlaceholder.child.set_width(this.iconSize);
-            this._dragPlaceholder.child.set_height(this.iconSize / 2);
+            this._dragPlaceholder.child.set_width (this.iconSize);
+            this._dragPlaceholder.child.set_height (this.iconSize / 2);
            this._box.insert_child_at_index(this._dragPlaceholder,
                                            this._dragPlaceholderPos);
            this._dragPlaceholder.show(fadeIn);
@ -851,7 +859,7 @@ var Dash = GObject.registerClass({
        if (!this._dragPlaceholder)
            return DND.DragMotionResult.NO_DROP;

-        let srcIsFavorite = favPos != -1;
+        let srcIsFavorite = (favPos != -1);

        if (srcIsFavorite)
            return DND.DragMotionResult.MOVE_DROP;
@ -860,12 +868,13 @@ var Dash = GObject.registerClass({
    }

    // Draggable target interface
-    acceptDrop(source, _actor, _x, _y, _time) {
+    acceptDrop(source, actor, x, y, time) {
        let app = getAppFromSource(source);

        // Don't allow favoriting of transient apps
-        if (app == null || app.is_window_backed())
+        if (app == null || app.is_window_backed()) {
            return false;
+        }

        if (!global.settings.is_writable('favorite-apps'))
            return false;
@ -874,7 +883,7 @@ var Dash = GObject.registerClass({

        let favorites = AppFavorites.getAppFavorites().getFavoriteMap();

-        let srcIsFavorite = id in favorites;
+        let srcIsFavorite = (id in favorites);

        let favPos = 0;
        let children = this._box.get_children();
@ -906,4 +915,5 @@ var Dash = GObject.registerClass({

        return true;
    }
-});
+};
+Signals.addSignalMethods(Dash.prototype);
--- a/js/ui/dateMenu.js
+++ b/js/ui/dateMenu.js
@ -1,8 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported DateMenuButton */

-const { Clutter, Gio, GLib, GnomeDesktop,
-        GObject, GWeather, Pango, Shell, St } = imports.gi;
+const { Clutter, GLib, GnomeDesktop,
+        GObject, GWeather, Shell, St } = imports.gi;

 const Util = imports.misc.util;
 const Main = imports.ui.main;
@ -11,13 +10,8 @@ const Calendar = imports.ui.calendar;
 const Weather = imports.misc.weather;
 const System = imports.system;

-const { loadInterfaceXML } = imports.misc.fileUtils;
-
 const MAX_FORECASTS = 5;

-const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration');
-const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface);
-
 function _isToday(date) {
    let now = new Date();
    return now.getYear() == date.getYear() &&
@ -25,25 +19,22 @@ function _isToday(date) {
           now.getDate() == date.getDate();
 }

-function _gDateTimeToDate(datetime) {
-    return new Date(datetime.to_unix() * 1000 + datetime.get_microsecond() / 1000);
-}
-
-var TodayButton = GObject.registerClass(
-class TodayButton extends St.Button {
-    _init(calendar) {
+var TodayButton = class TodayButton {
+    constructor(calendar) {
        // Having the ability to go to the current date if the user is already
        // on the current date can be confusing. So don't make the button reactive
        // until the selected date changes.
-        super._init({
-            style_class: 'datemenu-today-button',
-            x_expand: true,
-            can_focus: true,
-            reactive: false,
+        this.actor = new St.Button({ style_class: 'datemenu-today-button',
+                                     x_expand: true, x_align: St.Align.START,
+                                     can_focus: true,
+                                     reactive: false
+                                   });
+        this.actor.connect('clicked', () => {
+            this._calendar.setDate(new Date(), false);
        });

        let hbox = new St.BoxLayout({ vertical: true });
-        this.add_actor(hbox);
+        this.actor.add_actor(hbox);

        this._dayLabel = new St.Label({ style_class: 'day-label',
                                        x_align: Clutter.ActorAlign.START });
@ -53,17 +44,13 @@ class TodayButton extends St.Button {
        hbox.add_actor(this._dateLabel);

        this._calendar = calendar;
-        this._calendar.connect('selected-date-changed', (_calendar, datetime) => {
+        this._calendar.connect('selected-date-changed', (calendar, date) => {
            // Make the button reactive only if the selected date is not the
            // current date.
-            this.reactive = !_isToday(_gDateTimeToDate(datetime));
+            this.actor.reactive = !_isToday(date);
        });
    }

-    vfunc_clicked() {
-        this._calendar.setDate(new Date(), false);
-    }
-
    setDate(date) {
        this._dayLabel.set_text(date.toLocaleFormat('%A'));

@ -72,81 +59,65 @@ class TodayButton extends St.Button {
         * "Tue 9:29 AM").  The string itself should become a full date, e.g.,
         * "February 17 2015".
         */
-        let dateFormat = Shell.util_translate_time_string(N_("%B %-d %Y"));
+        let dateFormat = Shell.util_translate_time_string (N_("%B %-d %Y"));
        this._dateLabel.set_text(date.toLocaleFormat(dateFormat));

        /* Translators: This is the accessible name of the date button shown
         * below the time in the shell; it should combine the weekday and the
         * date, e.g. "Tuesday February 17 2015".
         */
-        dateFormat = Shell.util_translate_time_string(N_("%A %B %e %Y"));
-        this.accessible_name = date.toLocaleFormat(dateFormat);
+        dateFormat = Shell.util_translate_time_string (N_("%A %B %e %Y"));
+        this.actor.accessible_name = date.toLocaleFormat(dateFormat);
    }
-});
+};

-var WorldClocksSection = GObject.registerClass(
-class WorldClocksSection extends St.Button {
-    _init() {
-        super._init({
-            style_class: 'world-clocks-button',
-            can_focus: true,
-            x_expand: true,
-        });
+var WorldClocksSection = class WorldClocksSection {
+    constructor() {
        this._clock = new GnomeDesktop.WallClock();
        this._clockNotifyId = 0;

        this._locations = [];

+        this.actor = new St.Button({ style_class: 'world-clocks-button',
+                                     x_fill: true,
+                                     can_focus: true });
+        this.actor.connect('clicked', () => {
+            this._clockAppMon.activateApp();
+
+            Main.overview.hide();
+            Main.panel.closeCalendar();
+        });
+
        let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
        this._grid = new St.Widget({ style_class: 'world-clocks-grid',
-                                     x_expand: true,
                                     layout_manager: layout });
        layout.hookup_style(this._grid);

-        this.child = this._grid;
+        this.actor.child = this._grid;

-        this._clocksApp = null;
-        this._clocksProxy = new ClocksProxy(
-            Gio.DBus.session,
-            'org.gnome.clocks',
-            '/org/gnome/clocks',
-            this._onProxyReady.bind(this),
-            null /* cancellable */,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
-
-        this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.world-clocks',
-        });
-        this._settings.connect('changed', this._clocksChanged.bind(this));
-        this._clocksChanged();
-
-        this._appSystem = Shell.AppSystem.get_default();
-        this._appSystem.connect('installed-changed',
-            this._sync.bind(this));
+        this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop',
+                                                        'org.gnome.clocks');
+        this._clockAppMon.connect('available-changed',
+                                  this._sync.bind(this));
+        this._clockAppMon.watchSetting('world-clocks',
+                                       this._clocksChanged.bind(this));
        this._sync();
    }

-    vfunc_clicked() {
-        if (this._clocksApp)
-            this._clocksApp.activate();
-
-        Main.overview.hide();
-        Main.panel.closeCalendar();
-    }
-
    _sync() {
-        this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop');
-        this.visible = this._clocksApp != null;
+        this.actor.visible = this._clockAppMon.available;
    }

-    _clocksChanged() {
+    _clocksChanged(settings) {
        this._grid.destroy_all_children();
        this._locations = [];

        let world = GWeather.Location.get_world();
-        let clocks = this._settings.get_value('locations').deep_unpack();
+        let clocks = settings.get_value('world-clocks').deep_unpack();
        for (let i = 0; i < clocks.length; i++) {
-            let l = world.deserialize(clocks[i]);
+            if (!clocks[i].location)
+                continue;
+            let l = world.deserialize(clocks[i].location);
            if (l && l.get_timezone() != null)
                this._locations.push({ location: l });
        }
@ -157,14 +128,13 @@ class WorldClocksSection extends St.Button {
        });

        let layout = this._grid.layout_manager;
-        let title = this._locations.length == 0
-            ? _("Add world clocks…")
-            : _("World Clocks");
+        let title = (this._locations.length == 0) ? _("Add world clocks…")
+                                                  : _("World Clocks");
        let header = new St.Label({ style_class: 'world-clocks-header',
                                    x_align: Clutter.ActorAlign.START,
                                    text: title });
        layout.attach(header, 0, 0, 2, 1);
-        this.label_actor = header;
+        this.actor.label_actor = header;

        let localOffset = GLib.DateTime.new_now_local().get_utc_offset();

@ -182,8 +152,8 @@ class WorldClocksSection extends St.Button {

            let otherOffset = this._getTimeAtLocation(l).get_utc_offset();
            let offset = (otherOffset - localOffset) / GLib.TIME_SPAN_HOUR;
-            let fmt = Math.trunc(offset) == offset ? '%s%.0f' : '%s%.1f';
-            let prefix = offset >= 0 ? '+' : '-';
+            let fmt = (Math.trunc(offset) == offset) ? '%s%.0f' : '%s%.1f';
+            let prefix = (offset >= 0) ? '+' : '-';
            let tz = new St.Label({ style_class: 'world-clocks-timezone',
                                    text: fmt.format(prefix, Math.abs(offset)),
                                    x_align: Clutter.ActorAlign.END,
@ -203,10 +173,9 @@ class WorldClocksSection extends St.Button {
        }

        if (this._grid.get_n_children() > 1) {
-            if (!this._clockNotifyId) {
+            if (!this._clockNotifyId)
                this._clockNotifyId =
                    this._clock.connect('notify::clock', this._updateLabels.bind(this));
-            }
            this._updateLabels();
        } else {
            if (this._clockNotifyId)
@ -227,68 +196,45 @@ class WorldClocksSection extends St.Button {
            l.actor.text = Util.formatTime(now, { timeOnly: true });
        }
    }
+};

-    _onProxyReady(proxy, error) {
-        if (error) {
-            log(`Failed to create GNOME Clocks proxy: ${error}`);
-            return;
-        }
-
-        this._clocksProxy.connect('g-properties-changed',
-            this._onClocksPropertiesChanged.bind(this));
-        this._onClocksPropertiesChanged();
-    }
-
-    _onClocksPropertiesChanged() {
-        if (this._clocksProxy.g_name_owner == null)
-            return;
-
-        this._settings.set_value('locations',
-            new GLib.Variant('av', this._clocksProxy.Locations));
-    }
-});
-
-var WeatherSection = GObject.registerClass(
-class WeatherSection extends St.Button {
-    _init() {
-        super._init({
-            style_class: 'weather-button',
-            can_focus: true,
-            x_expand: true,
-        });
-
+var WeatherSection = class WeatherSection {
+    constructor() {
        this._weatherClient = new Weather.WeatherClient();

-        let box = new St.BoxLayout({
-            style_class: 'weather-box',
-            vertical: true,
-            x_expand: true,
+        this.actor = new St.Button({ style_class: 'weather-button',
+                                     x_fill: true,
+                                     can_focus: true });
+        this.actor.connect('clicked', () => {
+            this._weatherClient.activateApp();
+
+            Main.overview.hide();
+            Main.panel.closeCalendar();
+        });
+        this.actor.connect('notify::mapped', () => {
+            if (this.actor.mapped)
+                this._weatherClient.update();
        });

-        this.child = box;
+        let box = new St.BoxLayout({ style_class: 'weather-box',
+                                     vertical: true });

-        let titleBox = new St.BoxLayout({ style_class: 'weather-header-box' });
-        titleBox.add_child(new St.Label({
-            style_class: 'weather-header',
-            x_align: Clutter.ActorAlign.START,
-            x_expand: true,
-            y_align: Clutter.ActorAlign.END,
-            text: _('Weather'),
-        }));
+        this.actor.child = box;
+
+        let titleBox = new St.BoxLayout();
+        titleBox.add_child(new St.Label({ style_class: 'weather-header',
+                                          x_align: Clutter.ActorAlign.START,
+                                          x_expand: true,
+                                          text: _("Weather") }));
        box.add_child(titleBox);

-        this._titleLocation = new St.Label({
-            style_class: 'weather-header location',
-            x_align: Clutter.ActorAlign.END,
-            y_align: Clutter.ActorAlign.END,
-        });
+        this._titleLocation = new St.Label({ style_class: 'weather-header location',
+                                             x_align: Clutter.ActorAlign.END });
        titleBox.add_child(this._titleLocation);

        let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
-        this._forecastGrid = new St.Widget({
-            style_class: 'weather-grid',
-            layout_manager: layout,
-        });
+        this._forecastGrid = new St.Widget({ style_class: 'weather-grid',
+                                             layout_manager: layout });
        layout.hookup_style(this._forecastGrid);
        box.add_child(this._forecastGrid);

@ -296,40 +242,26 @@ class WeatherSection extends St.Button {
        this._sync();
    }

-    vfunc_map() {
-        this._weatherClient.update();
-        super.vfunc_map();
-    }
-
-    vfunc_clicked() {
-        this._weatherClient.activateApp();
-
-        Main.overview.hide();
-        Main.panel.closeCalendar();
-    }
-
    _getInfos() {
-        let forecasts = this._weatherClient.info.get_forecast_list();
+        let info = this._weatherClient.info;
+        let forecasts = info.get_forecast_list();

-        let now = GLib.DateTime.new_now_local();
-        let current = GLib.DateTime.new_from_unix_local(0);
-        let infos = [];
+        let current = info;
+        let infos = [info];
        for (let i = 0; i < forecasts.length; i++) {
-            const [valid, timestamp] = forecasts[i].get_value_update();
-            if (!valid || timestamp === 0)
-                continue;  // 0 means 'never updated'
+            let [ok, timestamp] = forecasts[i].get_value_update();
+            let datetime = new Date(timestamp * 1000);
+            if (!_isToday(datetime))
+                continue; // Ignore forecasts from other days

-            const datetime = GLib.DateTime.new_from_unix_local(timestamp);
-            if (now.difference(datetime) > 0)
-                continue; // Ignore earlier forecasts
-
-            if (datetime.difference(current) < GLib.TIME_SPAN_HOUR)
+            [ok, timestamp] = current.get_value_update();
+            let currenttime = new Date(timestamp * 1000);
+            if (currenttime.getHours() == datetime.getHours())
                continue; // Enforce a minimum interval of 1h

-            if (infos.push(forecasts[i]) == MAX_FORECASTS)
+            current = forecasts[i];
+            if (infos.push(current) == MAX_FORECASTS)
                break; // Use a maximum of five forecasts
-
-            current = datetime;
        }
        return infos;
    }
@ -343,31 +275,21 @@ class WeatherSection extends St.Button {

        let col = 0;
        infos.forEach(fc => {
-            const [valid_, timestamp] = fc.get_value_update();
+            let [ok, timestamp] = fc.get_value_update();
            let timeStr = Util.formatTime(new Date(timestamp * 1000), {
-                timeOnly: true,
-                ampm: false,
+                timeOnly: true
            });

-            let icon = new St.Icon({
-                style_class: 'weather-forecast-icon',
-                icon_name: fc.get_symbolic_icon_name(),
-                x_align: Clutter.ActorAlign.CENTER,
-                x_expand: true,
-            });
-            let temp = new St.Label({
-                style_class: 'weather-forecast-temp',
-                text: fc.get_temp_summary(),
-                x_align: Clutter.ActorAlign.CENTER,
-            });
-            let time = new St.Label({
-                style_class: 'weather-forecast-time',
-                text: timeStr,
-                x_align: Clutter.ActorAlign.CENTER,
-            });
-
-            temp.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
-            time.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
+            let icon = new St.Icon({ style_class: 'weather-forecast-icon',
+                                     icon_name: fc.get_symbolic_icon_name(),
+                                     x_align: Clutter.ActorAlign.CENTER,
+                                     x_expand: true });
+            let temp = new St.Label({ style_class: 'weather-forecast-temp',
+                                      text: fc.get_temp_summary(),
+                                      x_align: Clutter.ActorAlign.CENTER });
+            let time = new St.Label({ style_class: 'weather-forecast-time',
+                                      text: timeStr,
+                                      x_align: Clutter.ActorAlign.CENTER });

            layout.attach(icon, col, 0, 1, 1);
            layout.attach(temp, col, 1, 1, 1);
@ -391,12 +313,7 @@ class WeatherSection extends St.Button {
        }

        let info = this._weatherClient.info;
-        let loc = info.get_location();
-        if (loc.get_level() !== GWeather.LocationLevel.CITY && loc.has_coords()) {
-            let world = GWeather.Location.get_world();
-            loc = world.find_nearest_city(...loc.get_coords());
-        }
-        this._titleLocation.text = loc.get_name();
+        this._titleLocation.text = info.get_location().get_name();

        if (this._weatherClient.loading) {
            this._setStatusLabel(_("Loading…"));
@ -415,27 +332,23 @@ class WeatherSection extends St.Button {
    }

    _sync() {
-        this.visible = this._weatherClient.available;
+        this.actor.visible = this._weatherClient.available;

-        if (!this.visible)
+        if (!this.actor.visible)
            return;

        this._titleLocation.visible = this._weatherClient.hasLocation;

        this._updateForecasts();
    }
-});
+};

-var MessagesIndicator = GObject.registerClass(
-class MessagesIndicator extends St.Icon {
-    _init() {
-        super._init({
-            icon_name: 'message-indicator-symbolic',
-            icon_size: 16,
-            visible: false,
-            y_expand: true,
-            y_align: Clutter.ActorAlign.CENTER,
-        });
+var MessagesIndicator = class MessagesIndicator {
+    constructor() {
+        this.actor = new St.Icon({ icon_name: 'message-indicator-symbolic',
+                                   icon_size: 16,
+                                   visible: false, y_expand: true,
+                                   y_align: Clutter.ActorAlign.CENTER });

        this._sources = [];

@ -448,7 +361,7 @@ class MessagesIndicator extends St.Icon {
    }

    _onSourceAdded(tray, source) {
-        source.connect('notify::count', this._updateCount.bind(this));
+        source.connect('count-updated', this._updateCount.bind(this));
        this._sources.push(source);
        this._updateCount();
    }
@ -460,12 +373,12 @@ class MessagesIndicator extends St.Icon {

    _updateCount() {
        let count = 0;
-        this._sources.forEach(source => (count += source.unseenCount));
+        this._sources.forEach(source => count += source.unseenCount);
        count -= Main.messageTray.queueCount;

-        this.visible = count > 0;
+        this.actor.visible = (count > 0);
    }
-});
+};

 var IndicatorPad = GObject.registerClass(
 class IndicatorPad extends St.Widget {
@ -558,13 +471,13 @@ class DateMenuButton extends PanelMenu.Button {
        this._indicator = new MessagesIndicator();

        let box = new St.BoxLayout();
-        box.add_actor(new IndicatorPad(this._indicator));
+        box.add_actor(new IndicatorPad(this._indicator.actor));
        box.add_actor(this._clockDisplay);
-        box.add_actor(this._indicator);
+        box.add_actor(this._indicator.actor);

        this.label_actor = this._clockDisplay;
        this.add_actor(box);
-        this.add_style_class_name('clock-display');
+        this.add_style_class_name ('clock-display');

        let layout = new FreezableBinLayout();
        let bin = new St.Widget({ layout_manager: layout });
@ -576,11 +489,11 @@ class DateMenuButton extends PanelMenu.Button {
        bin.add_actor(hbox);

        this._calendar = new Calendar.Calendar();
-        this._calendar.connect('selected-date-changed', (_calendar, datetime) => {
-            let date = _gDateTimeToDate(datetime);
-            layout.frozen = !_isToday(date);
-            this._messageList.setDate(date);
-        });
+        this._calendar.connect('selected-date-changed',
+                               (calendar, date) => {
+                                   layout.frozen = !_isToday(date);
+                                   this._messageList.setDate(date);
+                               });

        this.menu.connect('open-state-changed', (menu, isOpen) => {
            // Whenever the menu is opened, select today
@ -594,36 +507,35 @@ class DateMenuButton extends PanelMenu.Button {

        // Fill up the first column
        this._messageList = new Calendar.CalendarMessageList();
-        hbox.add_child(this._messageList);
+        hbox.add(this._messageList.actor, { expand: true, y_fill: false, y_align: St.Align.START });

        // Fill up the second column
-        let boxLayout = new CalendarColumnLayout(this._calendar);
+        let boxLayout = new CalendarColumnLayout(this._calendar.actor);
        vbox = new St.Widget({ style_class: 'datemenu-calendar-column',
                               layout_manager: boxLayout });
        boxLayout.hookup_style(vbox);
        hbox.add(vbox);

        this._date = new TodayButton(this._calendar);
-        vbox.add_actor(this._date);
+        vbox.add_actor(this._date.actor);

-        vbox.add_actor(this._calendar);
+        vbox.add_actor(this._calendar.actor);

        this._displaysSection = new St.ScrollView({ style_class: 'datemenu-displays-section vfade',
-                                                    x_expand: true,
+                                                    x_expand: true, x_fill: true,
                                                    overlay_scrollbars: true });
        this._displaysSection.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
        vbox.add_actor(this._displaysSection);

        let displaysBox = new St.BoxLayout({ vertical: true,
-                                             x_expand: true,
                                             style_class: 'datemenu-displays-box' });
        this._displaysSection.add_actor(displaysBox);

        this._clocksItem = new WorldClocksSection();
-        displaysBox.add_child(this._clocksItem);
+        displaysBox.add(this._clocksItem.actor, { x_fill: true });

        this._weatherItem = new WeatherSection();
-        displaysBox.add_child(this._weatherItem);
+        displaysBox.add(this._weatherItem.actor, { x_fill: true });

        // Done with hbox for calendar and event list

@ -661,11 +573,11 @@ class DateMenuButton extends PanelMenu.Button {
    _sessionUpdated() {
        let eventSource;
        let showEvents = Main.sessionMode.showCalendarEvents;
-        if (showEvents)
+        if (showEvents) {
            eventSource = this._getEventSource();
-        else
+        } else {
            eventSource = new Calendar.EmptyEventSource();
-
+        }
        this._setEventSource(eventSource);

        // Displays are not actually expected to launch Settings when activated
--- a/js/ui/dialog.js
+++ b/js/ui/dialog.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Dialog, MessageDialogContent */

 const { Clutter, Gio, GObject, Pango, St } = imports.gi;

@ -36,15 +35,19 @@ class Dialog extends St.Widget {
        this._dialog.request_mode = Clutter.RequestMode.HEIGHT_FOR_WIDTH;
        this._dialog.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);

-        this.contentLayout = new St.BoxLayout({
-            vertical: true,
-            style_class: 'modal-dialog-content-box',
-            y_expand: true,
-        });
-        this._dialog.add_child(this.contentLayout);
+        this.contentLayout = new St.BoxLayout({ vertical: true,
+                                                style_class: "modal-dialog-content-box" });
+        this._dialog.add(this.contentLayout,
+                         { expand: true,
+                           x_fill: true,
+                           y_fill: true,
+                           x_align: St.Align.MIDDLE,
+                           y_align: St.Align.START });

-        this.buttonLayout = new St.Widget({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) });
-        this._dialog.add_child(this.buttonLayout);
+        this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) });
+        this._dialog.add(this.buttonLayout,
+                         { x_align: St.Align.MIDDLE,
+                           y_align: St.Align.START });
    }

    _onDestroy() {
@ -96,7 +99,7 @@ class Dialog extends St.Widget {
    }

    addContent(actor) {
-        this.contentLayout.add(actor, { expand: true });
+        this.contentLayout.add (actor, { expand: true });
    }

    addButton(buttonInfo) {
@ -117,7 +120,7 @@ class Dialog extends St.Widget {
                                     can_focus: true,
                                     x_expand: true,
                                     y_expand: true,
-                                     label });
+                                     label: label });
        button.connect('clicked', action);

        buttonInfo['button'] = button;
@ -159,8 +162,8 @@ var MessageDialogContent = GObject.registerClass({
        'body': GObject.ParamSpec.string('body', 'body', 'body',
                                         GObject.ParamFlags.READWRITE |
                                         GObject.ParamFlags.CONSTRUCT,
-                                         null),
-    },
+                                         null)
+    }
 }, class MessageDialogContent extends St.BoxLayout {
    _init(params) {
        this._icon = new St.Icon({ y_align: Clutter.ActorAlign.START });
@ -211,7 +214,7 @@ var MessageDialogContent = GObject.registerClass({
    set icon(icon) {
        this._icon.set({
            gicon: icon,
-            visible: icon != null,
+            visible: icon != null
        });
        this.notify('icon');
    }
@ -231,7 +234,7 @@ var MessageDialogContent = GObject.registerClass({
    _setLabel(label, prop, value) {
        label.set({
            text: value || '',
-            visible: value != null,
+            visible: value != null
        });
        this.notify(prop);
    }
--- a/js/ui/dnd.js
+++ b/js/ui/dnd.js
@ -1,24 +1,24 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported addDragMonitor, removeDragMonitor, makeDraggable */

 const { Clutter, GLib, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;

 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 // Time to scale down to maxDragActorSize
-var SCALE_ANIMATION_TIME = 250;
+var SCALE_ANIMATION_TIME = 0.25;
 // Time to animate to original position on cancel
-var SNAP_BACK_ANIMATION_TIME = 250;
+var SNAP_BACK_ANIMATION_TIME = 0.25;
 // Time to animate to original position on success
-var REVERT_ANIMATION_TIME = 750;
+var REVERT_ANIMATION_TIME = 0.75;

 var DragMotionResult = {
    NO_DROP:   0,
    COPY_DROP: 1,
    MOVE_DROP: 2,
-    CONTINUE:  3,
+    CONTINUE:  3
 };

 var DragState = {
@ -30,13 +30,13 @@ var DragState = {
 var DRAG_CURSOR_MAP = {
    0: Meta.Cursor.DND_UNSUPPORTED_TARGET,
    1: Meta.Cursor.DND_COPY,
-    2: Meta.Cursor.DND_MOVE,
+    2: Meta.Cursor.DND_MOVE
 };

 var DragDropResult = {
    FAILURE:  0,
    SUCCESS:  1,
-    CONTINUE: 2,
+    CONTINUE: 2
 };
 var dragMonitors = [];

@ -61,12 +61,11 @@ function addDragMonitor(monitor) {
 }

 function removeDragMonitor(monitor) {
-    for (let i = 0; i < dragMonitors.length; i++) {
+    for (let i = 0; i < dragMonitors.length; i++)
        if (dragMonitors[i] == monitor) {
            dragMonitors.splice(i, 1);
            return;
        }
-    }
 }

 var _Draggable = class _Draggable {
@ -112,6 +111,9 @@ var _Draggable = class _Draggable {
        if (event.get_button() != 1)
            return Clutter.EVENT_PROPAGATE;

+        if (Tweener.getTweenCount(actor))
+            return Clutter.EVENT_PROPAGATE;
+
        this._buttonDown = true;
        this._grabActor(event.get_device());

@ -137,6 +139,9 @@ var _Draggable = class _Draggable {
            !global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
            return Clutter.EVENT_PROPAGATE;

+        if (Tweener.getTweenCount(actor))
+            return Clutter.EVENT_PROPAGATE;
+
        this._buttonDown = true;
        this._grabActor(event.get_device(), event.get_event_sequence());

@ -151,12 +156,12 @@ var _Draggable = class _Draggable {
        if (touchSequence)
            pointer.sequence_grab(touchSequence, actor);
        else if (pointer)
-            pointer.grab(actor);
+            pointer.grab (actor);

        this._grabbedDevice = pointer;
        this._touchSequence = touchSequence;

-        this._capturedEventId = global.stage.connect('captured-event', (o, event) => {
+        this._capturedEventId = global.stage.connect('captured-event', (actor, event) => {
            let device = event.get_device();
            if (device != this._grabbedDevice &&
                device.get_device_type() != Clutter.InputDeviceType.KEYBOARD_DEVICE)
@ -172,7 +177,7 @@ var _Draggable = class _Draggable {
        }

        if (this._touchSequence)
-            this._grabbedDevice.sequence_ungrab(this._touchSequence);
+            this._grabbedDevice.sequence_ungrab (this._touchSequence);
        else
            this._grabbedDevice.ungrab();

@ -213,9 +218,9 @@ var _Draggable = class _Draggable {

    _eventIsRelease(event) {
        if (event.type() == Clutter.EventType.BUTTON_RELEASE) {
-            let buttonMask = Clutter.ModifierType.BUTTON1_MASK |
+            let buttonMask = (Clutter.ModifierType.BUTTON1_MASK |
                              Clutter.ModifierType.BUTTON2_MASK |
-                              Clutter.ModifierType.BUTTON3_MASK;
+                              Clutter.ModifierType.BUTTON3_MASK);
            /* We only obey the last button release from the device,
             * other buttons may get pressed/released during the DnD op.
             */
@ -259,16 +264,16 @@ var _Draggable = class _Draggable {
        } else if (event.type() == Clutter.EventType.MOTION ||
                   (event.type() == Clutter.EventType.TOUCH_UPDATE &&
                    global.display.is_pointer_emulating_sequence(event.get_event_sequence()))) {
-            if (this._dragActor && this._dragState == DragState.DRAGGING)
+            if (this._dragActor && this._dragState == DragState.DRAGGING) {
                return this._updateDragPosition(event);
-            else if (this._dragActor == null && this._dragState != DragState.CANCELLED)
+            } else if (this._dragActor == null && this._dragState != DragState.CANCELLED) {
                return this._maybeStartDrag(event);
-
+            }
        // We intercept KEY_PRESS event so that we can process Esc key press to cancel
        // dragging and ignore all other key presses.
        } else if (event.type() == Clutter.EventType.KEY_PRESS && this._dragState == DragState.DRAGGING) {
            let symbol = event.get_key_symbol();
-            if (symbol == Clutter.KEY_Escape) {
+            if (symbol == Clutter.Escape) {
                this._cancelDrag(event.get_time());
                return Clutter.EVENT_STOP;
            }
@ -292,11 +297,9 @@ var _Draggable = class _Draggable {

    /**
     * startDrag:
-     * @param {number} stageX: X coordinate of event
-     * @param {number} stageY: Y coordinate of event
-     * @param {number} time: Event timestamp
-     * @param {Clutter.EventSequence=} sequence: Event sequence
-     * @param {Clutter.InputDevice=} device: device that originated the event
+     * @stageX: X coordinate of event
+     * @stageY: Y coordinate of event
+     * @time: Event timestamp
     *
     * Directly initiate a drag and drop operation from the given actor.
     * This function is useful to call if you've specified manualMode
@ -341,7 +344,7 @@ var _Draggable = class _Draggable {
        if (this.actor._delegate && this.actor._delegate.getDragActor) {
            this._dragActor = this.actor._delegate.getDragActor();
            Main.uiGroup.add_child(this._dragActor);
-            Main.uiGroup.set_child_above_sibling(this._dragActor, null);
+            this._dragActor.raise_top();
            Shell.util_set_hidden_from_pick(this._dragActor, true);

            // Drag actor does not always have to be the same as actor. For example drag actor
@ -391,7 +394,7 @@ var _Draggable = class _Draggable {

            this._dragOrigParent.remove_actor(this._dragActor);
            Main.uiGroup.add_child(this._dragActor);
-            Main.uiGroup.set_child_above_sibling(this._dragActor, null);
+            this._dragActor.raise_top();
            Shell.util_set_hidden_from_pick(this._dragActor, true);
        }

@ -425,22 +428,19 @@ var _Draggable = class _Draggable {
                // to the final position because that tween would
                // fight with updates as the user continues dragging
                // the mouse; instead we do the position computations in
-                // a ::new-frame handler.
-                this._dragActor.ease({
-                    scale_x: scale * origScale,
-                    scale_y: scale * origScale,
-                    duration: SCALE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                });
-
-                this._dragActor.get_transition('scale-x').connect('new-frame', () => {
-                    let currentScale = this._dragActor.scale_x / origScale;
-                    this._dragOffsetX = currentScale * origDragOffsetX;
-                    this._dragOffsetY = currentScale * origDragOffsetY;
-                    this._dragActor.set_position(
-                        this._dragX + this._dragOffsetX,
-                        this._dragY + this._dragOffsetY);
-                });
+                // an onUpdate() function.
+                Tweener.addTween(this._dragActor,
+                                 { scale_x: scale * origScale,
+                                   scale_y: scale * origScale,
+                                   time: SCALE_ANIMATION_TIME,
+                                   transition: 'easeOutQuad',
+                                   onUpdate: () => {
+                                       let currentScale = this._dragActor.scale_x / origScale;
+                                       this._dragOffsetX = currentScale * origDragOffsetX;
+                                       this._dragOffsetY = currentScale * origDragOffsetY;
+                                       this._dragActor.set_position(this._dragX + this._dragOffsetX,
+                                                                    this._dragY + this._dragOffsetY);
+                                   } });
            }
        }
    }
@ -475,7 +475,7 @@ var _Draggable = class _Draggable {
            y: this._dragY,
            dragActor: this._dragActor,
            source: this.actor._delegate,
-            targetActor: target,
+            targetActor: target
        };

        let targetActorDestroyHandlerId;
@ -503,7 +503,7 @@ var _Draggable = class _Draggable {

        while (target) {
            if (target._delegate && target._delegate.handleDragOver) {
-                let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
+                let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
                // We currently loop through all parents on drag-over even if one of the children has handled it.
                // We can check the return value of the function and break the loop if it's true if we don't want
                // to continue checking the parents.
@ -554,11 +554,11 @@ var _Draggable = class _Draggable {
        let dropEvent = {
            dropActor: this._dragActor,
            targetActor: target,
-            clutterEvent: event,
+            clutterEvent: event
        };
        for (let i = 0; i < dragMonitors.length; i++) {
            let dropFunc = dragMonitors[i].dragDrop;
-            if (dropFunc) {
+            if (dropFunc)
                switch (dropFunc(dropEvent)) {
                case DragDropResult.FAILURE:
                case DragDropResult.SUCCESS:
@ -566,7 +566,6 @@ var _Draggable = class _Draggable {
                case DragDropResult.CONTINUE:
                    continue;
                }
-            }
        }

        // At this point it is too late to cancel a drag by destroying
@ -576,16 +575,12 @@ var _Draggable = class _Draggable {

        while (target) {
            if (target._delegate && target._delegate.acceptDrop) {
-                let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
-                let accepted = false;
-                try {
-                    accepted = target._delegate.acceptDrop(this.actor._delegate,
-                        this._dragActor, targX, targY, event.get_time());
-                } catch (e) {
-                    // On error, skip this target
-                    logError(e, "Skipping drag target");
-                }
-                if (accepted) {
+                let [r, targX, targY] = target.transform_stage_point(dropX, dropY);
+                if (target._delegate.acceptDrop(this.actor._delegate,
+                                                this._dragActor,
+                                                targX,
+                                                targY,
+                                                event.get_time())) {
                    // If it accepted the drop without taking the actor,
                    // handle it ourselves.
                    if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) {
@ -618,15 +613,15 @@ var _Draggable = class _Draggable {
        if (this._dragActorSource && this._dragActorSource.visible) {
            // Snap the clone back to its source
            [x, y] = this._dragActorSource.get_transformed_position();
-            let [sourceScaledWidth] = this._dragActorSource.get_transformed_size();
-            scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0;
+            let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size();
+            scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0;
        } else if (this._dragOrigParent) {
            // Snap the actor back to its original position within
            // its parent, adjusting for the fact that the parent
            // may have been moved or scaled
            let [parentX, parentY] = this._dragOrigParent.get_transformed_position();
-            let [parentWidth] = this._dragOrigParent.get_size();
-            let [parentScaledWidth] = this._dragOrigParent.get_transformed_size();
+            let [parentWidth, parentHeight] = this._dragOrigParent.get_size();
+            let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size();
            let parentScale = 1.0;
            if (parentWidth != 0)
                parentScale = parentScaledWidth / parentWidth;
@ -646,7 +641,7 @@ var _Draggable = class _Draggable {

    _cancelDrag(eventTime) {
        this.emit('drag-cancelled', eventTime);
-        let wasCancelled = this._dragState == DragState.CANCELLED;
+        let wasCancelled = (this._dragState == DragState.CANCELLED);
        this._dragState = DragState.CANCELLED;

        if (this._actorDestroyed || wasCancelled) {
@ -662,13 +657,13 @@ var _Draggable = class _Draggable {

        let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation();

-        this._animateDragEnd(eventTime, {
-            x: snapBackX,
-            y: snapBackY,
-            scale_x: snapBackScale,
-            scale_y: snapBackScale,
-            duration: SNAP_BACK_ANIMATION_TIME,
-        });
+        this._animateDragEnd(eventTime,
+                             { x: snapBackX,
+                               y: snapBackY,
+                               scale_x: snapBackScale,
+                               scale_y: snapBackScale,
+                               time: SNAP_BACK_ANIMATION_TIME,
+                             });
    }

    _restoreDragActor(eventTime) {
@ -680,22 +675,21 @@ var _Draggable = class _Draggable {
        this._dragActor.set_scale(restoreScale, restoreScale);
        this._dragActor.opacity = 0;

-        this._animateDragEnd(eventTime, {
-            duration: REVERT_ANIMATION_TIME,
-        });
+        this._animateDragEnd(eventTime,
+                             { time: REVERT_ANIMATION_TIME });
    }

    _animateDragEnd(eventTime, params) {
        this._animationInProgress = true;

+        params['opacity']          = this._dragOrigOpacity;
+        params['transition']       = 'easeOutQuad';
+        params['onComplete']       = this._onAnimationComplete;
+        params['onCompleteScope']  = this;
+        params['onCompleteParams'] = [this._dragActor, eventTime];
+
        // start the animation
-        this._dragActor.ease(Object.assign(params, {
-            opacity: this._dragOrigOpacity,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._onAnimationComplete(this._dragActor, eventTime);
-            },
-        }));
+        Tweener.addTween(this._dragActor, params);
    }

    _finishAnimation() {
@ -748,9 +742,8 @@ Signals.addSignalMethods(_Draggable.prototype);

 /**
 * makeDraggable:
- * @param {Clutter.Actor} actor: Source actor
- * @param {Object=} params: Additional parameters
- * @returns {Object} a new Draggable
+ * @actor: Source actor
+ * @params: (optional) Additional parameters
 *
 * Create an object which controls drag and drop for the given actor.
 *
--- a/js/ui/edgeDragAction.js
+++ b/js/ui/edgeDragAction.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported EdgeDragAction */

 const { Clutter, GObject, Meta, St } = imports.gi;

@ -27,7 +26,7 @@ var EdgeDragAction = GObject.registerClass({
        return global.display.get_monitor_geometry(monitorIndex);
    }

-    vfunc_gesture_prepare(_actor) {
+    vfunc_gesture_prepare(actor) {
        if (this.get_n_current_points() == 0)
            return false;

@ -37,17 +36,17 @@ var EdgeDragAction = GObject.registerClass({
        let [x, y] = this.get_press_coords(0);
        let monitorRect = this._getMonitorRect(x, y);

-        return (this._side == St.Side.LEFT && x < monitorRect.x + EDGE_THRESHOLD) ||
+        return ((this._side == St.Side.LEFT && x < monitorRect.x + EDGE_THRESHOLD) ||
                (this._side == St.Side.RIGHT && x > monitorRect.x + monitorRect.width - EDGE_THRESHOLD) ||
                (this._side == St.Side.TOP && y < monitorRect.y + EDGE_THRESHOLD) ||
-                (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD);
+                (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
    }

-    vfunc_gesture_progress(_actor) {
+    vfunc_gesture_progress(actor) {
        let [startX, startY] = this.get_press_coords(0);
        let [x, y] = this.get_motion_coords(0);
-        let offsetX = Math.abs(x - startX);
-        let offsetY = Math.abs(y - startY);
+        let offsetX = Math.abs (x - startX);
+        let offsetY = Math.abs (y - startY);

        if (offsetX < EDGE_THRESHOLD && offsetY < EDGE_THRESHOLD)
            return true;
@ -63,7 +62,7 @@ var EdgeDragAction = GObject.registerClass({
        return true;
    }

-    vfunc_gesture_end(_actor) {
+    vfunc_gesture_end(actor) {
        let [startX, startY] = this.get_press_coords(0);
        let [x, y] = this.get_motion_coords(0);
        let monitorRect = this._getMonitorRect(startX, startY);
--- a/js/ui/endSessionDialog.js
+++ b/js/ui/endSessionDialog.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init, EndSessionDialog */
 /*
 * Copyright 2010-2016 Red Hat, Inc
 *
@ -17,6 +16,8 @@
 * along with this program; if not, see <http://www.gnu.org/licenses/>.
 */

+const Mainloop = imports.mainloop;
+
 const { AccountsService, Clutter, Gio,
        GLib, GObject, Pango, Polkit, Shell, St }  = imports.gi;

@ -128,7 +129,7 @@ const DialogType = {
    SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
    RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
    UPDATE_RESTART: 3,
-    UPGRADE_RESTART: 4,
+    UPGRADE_RESTART: 4
 };

 const DialogContent = {
@ -136,7 +137,7 @@ const DialogContent = {
    1 /* DialogType.SHUTDOWN */: shutdownDialogContent,
    2 /* DialogType.RESTART */: restartDialogContent,
    3 /* DialogType.UPDATE_RESTART */: restartUpdateDialogContent,
-    4 /* DialogType.UPGRADE_RESTART */: restartUpgradeDialogContent,
+    4 /* DialogType.UPGRADE_RESTART */: restartUpgradeDialogContent
 };

 var MAX_USERS_IN_SESSION_DIALOG = 5;
@ -207,10 +208,10 @@ function _setCheckBoxLabel(checkBox, text) {

    if (text) {
        label.set_text(text);
-        checkBox.show();
+        checkBox.actor.show();
    } else {
        label.set_text('');
-        checkBox.hide();
+        checkBox.actor.hide();
    }
 }

@ -218,7 +219,7 @@ function init() {
    // This always returns the same singleton object
    // By instantiating it initially, we register the
    // bus object, etc.
-    new EndSessionDialog();
+    (new EndSessionDialog());
 }

 var EndSessionDialog = GObject.registerClass(
@ -263,39 +264,42 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._userLoadedId = this._user.connect('notify::is_loaded', this._sync.bind(this));
        this._userChangedId = this._user.connect('changed', this._sync.bind(this));

-        let mainContentLayout = new St.BoxLayout({
-            vertical: false,
-            x_expand: true,
-            y_expand: false,
-        });
-        this.contentLayout.add_child(mainContentLayout);
+        let mainContentLayout = new St.BoxLayout({ vertical: false });
+        this.contentLayout.add(mainContentLayout,
+                               { x_fill: true,
+                                 y_fill: false });

-        this._iconBin = new St.Bin({
-            x_expand: true,
-            x_align: Clutter.ActorAlign.END,
-        });
-        mainContentLayout.add_child(this._iconBin);
+        this._iconBin = new St.Bin();
+        mainContentLayout.add(this._iconBin,
+                              { x_fill: true,
+                                y_fill: false,
+                                x_align: St.Align.END,
+                                y_align: St.Align.START });

        let messageLayout = new St.BoxLayout({ vertical: true,
                                               style_class: 'end-session-dialog-layout' });
-        mainContentLayout.add_child(messageLayout);
+        mainContentLayout.add(messageLayout,
+                              { y_align: St.Align.START });

        this._subjectLabel = new St.Label({ style_class: 'end-session-dialog-subject' });

-        messageLayout.add_child(this._subjectLabel);
+        messageLayout.add(this._subjectLabel,
+                          { x_fill: false,
+                            y_fill: false,
+                            x_align: St.Align.START,
+                            y_align: St.Align.START });

-        this._descriptionLabel = new St.Label({
-            style_class: 'end-session-dialog-description',
-            y_expand: true,
-        });
+        this._descriptionLabel = new St.Label({ style_class: 'end-session-dialog-description' });
        this._descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
        this._descriptionLabel.clutter_text.line_wrap = true;

-        messageLayout.add_child(this._descriptionLabel);
+        messageLayout.add(this._descriptionLabel,
+                          { y_fill: true,
+                            y_align: St.Align.START });

        this._checkBox = new CheckBox.CheckBox();
-        this._checkBox.connect('clicked', this._sync.bind(this));
-        messageLayout.add(this._checkBox);
+        this._checkBox.actor.connect('clicked', this._sync.bind(this));
+        messageLayout.add(this._checkBox.actor);

        this._batteryWarning = new St.Label({ style_class: 'end-session-dialog-warning',
                                              text: _("Running on battery power: please plug in before installing updates.") });
@ -303,13 +307,11 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._batteryWarning.clutter_text.line_wrap = true;
        messageLayout.add(this._batteryWarning);

-        this._scrollView = new St.ScrollView({
-            style_class: 'end-session-dialog-list',
-            x_expand: true,
-            y_expand: true,
-        });
+        this._scrollView = new St.ScrollView({ style_class: 'end-session-dialog-list' });
        this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
-        this.contentLayout.add_child(this._scrollView);
+        this.contentLayout.add(this._scrollView,
+                               { x_fill: true,
+                                 y_fill: true });
        this._scrollView.hide();

        this._inhibitorSection = new St.BoxLayout({ vertical: true,
@ -349,15 +351,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        }

        // It only makes sense to check for this permission if PackageKit is available.
-        Polkit.Permission.new(
-            'org.freedesktop.packagekit.trigger-offline-update', null, null,
-            (source, res) => {
-                try {
-                    this._updatesPermission = Polkit.Permission.new_finish(res);
-                } catch (e) {
-                    log(`No permission to trigger offline updates: ${e}`);
-                }
-            });
+        try {
+            this._updatesPermission = Polkit.Permission.new_sync(
+                'org.freedesktop.packagekit.trigger-offline-update', null, null);
+        } catch (e) {
+            log('No permission to trigger offline updates: %s'.format(e.toString()));
+        }
    }

    _onDestroy() {
@ -366,7 +365,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
    }

    _sync() {
-        let open = this.state == ModalDialog.State.OPENING || this.state == ModalDialog.State.OPENED;
+        let open = (this.state == ModalDialog.State.OPENING || this.state == ModalDialog.State.OPENED);
        if (!open)
            return;

@ -375,12 +374,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        let subject = dialogContent.subject;

        // Use different title when we are installing updates
-        if (dialogContent.subjectWithUpdates && this._checkBox.checked)
+        if (dialogContent.subjectWithUpdates && this._checkBox.actor.checked)
            subject = dialogContent.subjectWithUpdates;

        if (dialogContent.showBatteryWarning) {
            // Warn when running on battery power
-            if (this._powerProxy.OnBattery && this._checkBox.checked)
+            if (this._powerProxy.OnBattery && this._checkBox.actor.checked)
                this._batteryWarning.opacity = 255;
            else
                this._batteryWarning.opacity = 0;
@ -428,7 +427,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
            let avatarWidget = new UserWidget.Avatar(this._user,
                                                     { iconSize: _DIALOG_ICON_SIZE,
                                                       styleClass: dialogContent.iconStyleClass });
-            this._iconBin.child = avatarWidget;
+            this._iconBin.child = avatarWidget.actor;
            avatarWidget.update();
        }

@ -443,21 +442,19 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        let dialogContent = DialogContent[this._type];
        let buttons = [{ action: this.cancel.bind(this),
                         label: _("Cancel"),
-                         key: Clutter.KEY_Escape }];
+                         key: Clutter.Escape }];

        for (let i = 0; i < dialogContent.confirmButtons.length; i++) {
            let signal = dialogContent.confirmButtons[i].signal;
            let label = dialogContent.confirmButtons[i].label;
-            buttons.push({
-                action: () => {
-                    this.close(true);
-                    let signalId = this.connect('closed', () => {
-                        this.disconnect(signalId);
-                        this._confirm(signal);
-                    });
-                },
-                label,
-            });
+            buttons.push({ action: () => {
+                               this.close(true);
+                               let signalId = this.connect('closed', () => {
+                                   this.disconnect(signalId);
+                                   this._confirm(signal);
+                               });
+                           },
+                           label: label });
        }

        this.setButtons(buttons);
@ -484,13 +481,13 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        };

        // Offline update not available; just emit the signal
-        if (!this._checkBox.visible) {
+        if (!this._checkBox.actor.visible) {
            callback();
            return;
        }

        // Trigger the offline update as requested
-        if (this._checkBox.checked) {
+        if (this._checkBox.actor.checked) {
            switch (signal) {
            case "ConfirmedReboot":
                this._triggerOfflineUpdateReboot(callback);
@ -564,9 +561,9 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        let startTime = GLib.get_monotonic_time();
        this._secondsLeft = this._totalSecondsToStayOpen;

-        this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => {
+        this._timerId = Mainloop.timeout_add_seconds(1, () => {
            let currentTime = GLib.get_monotonic_time();
-            let secondsElapsed = (currentTime - startTime) / 1000000;
+            let secondsElapsed = ((currentTime - startTime) / 1000000);

            this._secondsLeft = this._totalSecondsToStayOpen - secondsElapsed;
            if (this._secondsLeft > 0) {
@ -586,7 +583,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {

    _stopTimer() {
        if (this._timerId > 0) {
-            GLib.source_remove(this._timerId);
+            Mainloop.source_remove(this._timerId);
            this._timerId = 0;
        }

@ -655,7 +652,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {

        let actor = new St.BoxLayout({ style_class: 'end-session-dialog-session-list-item',
                                       can_focus: true });
-        actor.add(avatar);
+        actor.add(avatar.actor);

        let nameLabel = new St.Label({ text: userLabelText,
                                       style_class: 'end-session-dialog-session-list-item-name',
@ -671,7 +668,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._loginManager.listSessions(result => {
            let n = 0;
            for (let i = 0; i < result.length; i++) {
-                let [id_, uid_, userName, seat_, sessionPath] = result[i];
+                let [id, uid, userName, seat, sessionPath] = result[i];
                let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath);

                if (proxy.Class != 'user')
@ -681,12 +678,11 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
                    continue;

                let sessionId = GLib.getenv('XDG_SESSION_ID');
-                if (!sessionId) {
+                if (!sessionId)
                    this._loginManager.getCurrentSessionProxy(currentSessionProxy => {
                        sessionId = currentSessionProxy.Id;
                        log(`endSessionDialog: No XDG_SESSION_ID, fetched from logind: ${sessionId}`);
                    });
-                }

                if (proxy.Id == sessionId)
                    continue;
@ -738,7 +734,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        let dialogContent = DialogContent[this._type];

        for (let i = 0; i < inhibitorObjectPaths.length; i++) {
-            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => {
+            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => {
                this._onInhibitorLoaded(proxy);
            });

@ -754,14 +750,14 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed;

        _setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || '');
-        this._checkBox.visible = dialogContent.checkBoxText && updatePrepared && updatesAllowed;
-        this._checkBox.checked = updatePrepared && updateTriggered;
+        this._checkBox.actor.visible = (dialogContent.checkBoxText && updatePrepared && updatesAllowed);
+        this._checkBox.actor.checked = (updatePrepared && updateTriggered);

        // We show the warning either together with the checkbox, or when
        // updates have already been triggered, but the user doesn't have
        // enough permissions to cancel them.
-        this._batteryWarning.visible = dialogContent.showBatteryWarning &&
-                                        (this._checkBox.visible || updatePrepared && updateTriggered && !updatesAllowed);
+        this._batteryWarning.visible = (dialogContent.showBatteryWarning &&
+                                        (this._checkBox.actor.visible || updatePrepared && updateTriggered && !updatesAllowed));

        this._updateButtons();

@ -782,7 +778,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        });
    }

-    Close(_parameters, _invocation) {
+    Close(parameters, invocation) {
        this.close();
    }
 });
--- a/js/ui/environment.js
+++ b/js/ui/environment.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init */

 const Config = imports.misc.config;

@ -10,7 +9,7 @@ imports.gi.versions.Gtk = '3.0';
 imports.gi.versions.TelepathyGLib = '0.12';
 imports.gi.versions.TelepathyLogger = '0.2';

-const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
+const { Clutter, GLib, Shell, St } = imports.gi;
 const Gettext = imports.gettext;

 // We can't import shell JS modules yet, because they may have
@ -23,7 +22,7 @@ const Gettext = imports.gettext;
 // of interfaces in Javascript
 function _patchContainerClass(containerClass) {
    // This one is a straightforward mapping of the C method
-    containerClass.prototype.child_set = function (actor, props) {
+    containerClass.prototype.child_set = function(actor, props) {
        let meta = this.get_child_meta(actor);
        for (let prop in props)
            meta[prop] = props[prop];
@ -32,7 +31,7 @@ function _patchContainerClass(containerClass) {
    // clutter_container_add() actually is a an add-many-actors
    // method. We conveniently, but somewhat dubiously, take the
    // this opportunity to make it do something more useful.
-    containerClass.prototype.add = function (actor, props) {
+    containerClass.prototype.add = function(actor, props) {
        this.add_actor(actor);
        if (props)
            this.child_set(actor, props);
@ -40,8 +39,8 @@ function _patchContainerClass(containerClass) {
 }

 function _patchLayoutClass(layoutClass, styleProps) {
-    if (styleProps) {
-        layoutClass.prototype.hookup_style = function (container) {
+    if (styleProps)
+        layoutClass.prototype.hookup_style = function(container) {
            container.connect('style-changed', () => {
                let node = container.get_theme_node();
                for (let prop in styleProps) {
@ -51,157 +50,13 @@ function _patchLayoutClass(layoutClass, styleProps) {
                }
            });
        };
-    }
-}
-
-function _makeEaseCallback(params, cleanup) {
-    let onComplete = params.onComplete;
-    delete params.onComplete;
-
-    let onStopped = params.onStopped;
-    delete params.onStopped;
-
-    return isFinished => {
-        cleanup();
-
-        if (onStopped)
-            onStopped(isFinished);
-        if (onComplete && isFinished)
-            onComplete();
+    layoutClass.prototype.child_set = function(actor, props) {
+        let meta = this.get_child_meta(actor.get_parent(), actor);
+        for (let prop in props)
+            meta[prop] = props[prop];
    };
 }

-function _getPropertyTarget(actor, propName) {
-    if (!propName.startsWith('@'))
-        return [actor, propName];
-
-    let [type, name, prop] = propName.split('.');
-    switch (type) {
-    case '@layout':
-        return [actor.layout_manager, name];
-    case '@actions':
-        return [actor.get_action(name), prop];
-    case '@constraints':
-        return [actor.get_constraint(name), prop];
-    case '@effects':
-        return [actor.get_effect(name), prop];
-    }
-
-    throw new Error(`Invalid property name ${propName}`);
-}
-
-function _easeActor(actor, params) {
-    actor.save_easing_state();
-
-    if (params.duration != undefined)
-        actor.set_easing_duration(params.duration);
-    delete params.duration;
-
-    if (params.delay != undefined)
-        actor.set_easing_delay(params.delay);
-    delete params.delay;
-
-    let repeatCount = 0;
-    if (params.repeatCount != undefined)
-        repeatCount = params.repeatCount;
-    delete params.repeatCount;
-
-    let autoReverse = false;
-    if (params.autoReverse != undefined)
-        autoReverse = params.autoReverse;
-    delete params.autoReverse;
-
-    if (params.mode != undefined)
-        actor.set_easing_mode(params.mode);
-    delete params.mode;
-
-    let cleanup = () => Meta.enable_unredirect_for_display(global.display);
-    let callback = _makeEaseCallback(params, cleanup);
-
-    // cancel overwritten transitions
-    let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
-    animatedProps.forEach(p => actor.remove_transition(p));
-
-    actor.set(params);
-    actor.restore_easing_state();
-
-    let transition = animatedProps.map(p => actor.get_transition(p))
-        .find(t => t !== null);
-
-    if (transition && transition.delay)
-        transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
-    else
-        Meta.disable_unredirect_for_display(global.display);
-
-    if (transition) {
-        transition.set({ repeatCount, autoReverse });
-        transition.connect('stopped', (t, finished) => callback(finished));
-    } else {
-        callback(true);
-    }
-}
-
-function _easeActorProperty(actor, propName, target, params) {
-    // Avoid pointless difference with ease()
-    if (params.mode)
-        params.progress_mode = params.mode;
-    delete params.mode;
-
-    if (params.duration)
-        params.duration = adjustAnimationTime(params.duration);
-    let duration = Math.floor(params.duration || 0);
-
-    let repeatCount = 0;
-    if (params.repeatCount != undefined)
-        repeatCount = params.repeatCount;
-    delete params.repeatCount;
-
-    let autoReverse = false;
-    if (params.autoReverse != undefined)
-        autoReverse = params.autoReverse;
-    delete params.autoReverse;
-
-    // Copy Clutter's behavior for implicit animations, see
-    // should_skip_implicit_transition()
-    if (actor instanceof Clutter.Actor && !actor.mapped)
-        duration = 0;
-
-    let cleanup = () => Meta.enable_unredirect_for_display(global.display);
-    let callback = _makeEaseCallback(params, cleanup);
-
-    // cancel overwritten transition
-    actor.remove_transition(propName);
-
-    if (duration == 0) {
-        let [obj, prop] = _getPropertyTarget(actor, propName);
-        obj[prop] = target;
-
-        Meta.disable_unredirect_for_display(global.display);
-        callback(true);
-
-        return;
-    }
-
-    let pspec = actor.find_property(propName);
-    let transition = new Clutter.PropertyTransition(Object.assign({
-        property_name: propName,
-        interval: new Clutter.Interval({ value_type: pspec.value_type }),
-        remove_on_complete: true,
-        repeat_count: repeatCount,
-        auto_reverse: autoReverse,
-    }, params));
-    actor.add_transition(propName, transition);
-
-    transition.set_to(target);
-
-    if (transition.delay)
-        transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
-    else
-        Meta.disable_unredirect_for_display(global.display);
-
-    transition.connect('stopped', (t, finished) => callback(finished));
-}
-
 function _loggingFunc(...args) {
    let fields = { 'MESSAGE': args.join(', ') };
    let domain = "GNOME Shell";
@ -229,37 +84,16 @@ function init() {
    window.ngettext = Gettext.ngettext;
    window.N_ = s => s;

-    GObject.gtypeNameBasedOnJSPath = true;
-
    // Miscellaneous monkeypatching
    _patchContainerClass(St.BoxLayout);

+    _patchLayoutClass(Clutter.TableLayout, { row_spacing: 'spacing-rows',
+                                             column_spacing: 'spacing-columns' });
    _patchLayoutClass(Clutter.GridLayout, { row_spacing: 'spacing-rows',
                                            column_spacing: 'spacing-columns' });
    _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });

-    let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
-    Clutter.Actor.prototype.set_easing_duration = function (msecs) {
-        origSetEasingDuration.call(this, adjustAnimationTime(msecs));
-    };
-    let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
-    Clutter.Actor.prototype.set_easing_delay = function (msecs) {
-        origSetEasingDelay.call(this, adjustAnimationTime(msecs));
-    };
-
-    Clutter.Actor.prototype.ease = function (props, easingParams) {
-        _easeActor(this, props, easingParams);
-    };
-    Clutter.Actor.prototype.ease_property = function (propName, target, params) {
-        _easeActorProperty(this, propName, target, params);
-    };
-    St.Adjustment.prototype.ease = function (target, params) {
-        // we're not an actor of course, but we implement the same
-        // transition API as Clutter.Actor, so this works anyway
-        _easeActorProperty(this, 'value', target, params);
-    };
-
-    Clutter.Actor.prototype.toString = function () {
+    Clutter.Actor.prototype.toString = function() {
        return St.describe_actor(this);
    };
    // Deprecation warning for former JS classes turned into an actor subclass
@ -269,17 +103,11 @@ function init() {
            let { stack } = new Error();
            log(`Usage of object.actor is deprecated for ${klass}\n${stack}`);
            return this;
-        },
+        }
    });

-    St.set_slow_down_factor = function (factor) {
-        let { stack } = new Error();
-        log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
-        St.Settings.get().slow_down_factor = factor;
-    };
-
    let origToString = Object.prototype.toString;
-    Object.prototype.toString = function () {
+    Object.prototype.toString = function() {
        let base = origToString.call(this);
        try {
            if ('actor' in this && this.actor instanceof Clutter.Actor)
@ -292,16 +120,15 @@ function init() {
    };

    // Work around https://bugzilla.mozilla.org/show_bug.cgi?id=508783
-    Date.prototype.toLocaleFormat = function (format) {
-        let dt = GLib.DateTime.new_from_unix_local(this.getTime() / 1000);
-        return dt ? dt.format(format) : '';
+    Date.prototype.toLocaleFormat = function(format) {
+        return Shell.util_format_date(format, this.getTime());
    };

    let slowdownEnv = GLib.getenv('GNOME_SHELL_SLOWDOWN_FACTOR');
    if (slowdownEnv) {
        let factor = parseFloat(slowdownEnv);
        if (!isNaN(factor) && factor > 0.0)
-            St.Settings.get().slow_down_factor = factor;
+            St.set_slow_down_factor(factor);
    }

    // OK, now things are initialized enough that we can import shell JS
@ -311,17 +138,3 @@ function init() {
    Tweener.init();
    String.prototype.format = Format.format;
 }
-
-// adjustAnimationTime:
-// @msecs: time in milliseconds
-//
-// Adjust @msecs to account for St's enable-animations
-// and slow-down-factor settings
-function adjustAnimationTime(msecs) {
-    let settings = St.Settings.get();
-
-    if (!settings.enable_animations)
-        return 1;
-    return settings.slow_down_factor * msecs;
-}
-
--- a/js/ui/extensionDownloader.js
+++ b/js/ui/extensionDownloader.js
@ -1,14 +1,12 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init, installExtension, uninstallExtension,
-            checkForUpdates, updateExtension */

 const { Clutter, Gio, GLib, GObject, Soup } = imports.gi;

 const Config = imports.misc.config;
 const Dialog = imports.ui.dialog;
 const ExtensionUtils = imports.misc.extensionUtils;
+const ExtensionSystem = imports.ui.extensionSystem;
 const FileUtils = imports.misc.fileUtils;
-const Main = imports.ui.main;
 const ModalDialog = imports.ui.modalDialog;

 var REPOSITORY_URL_BASE = 'https://extensions.gnome.org';
@ -19,14 +17,14 @@ var REPOSITORY_URL_UPDATE   = `${REPOSITORY_URL_BASE}/update-info/`;
 let _httpSession;

 function installExtension(uuid, invocation) {
-    let params = { uuid,
+    let params = { uuid: uuid,
                   shell_version: Config.PACKAGE_VERSION };

    let message = Soup.form_request_new_from_hash('GET', REPOSITORY_URL_INFO, params);

-    _httpSession.queue_message(message, () => {
+    _httpSession.queue_message(message, (session, message) => {
        if (message.status_code != Soup.KnownStatusCode.OK) {
-            Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
+            ExtensionSystem.logExtensionError(uuid, `downloading info: ${message.status_code}`);
            invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
            return;
        }
@ -35,7 +33,7 @@ function installExtension(uuid, invocation) {
        try {
            info = JSON.parse(message.response_body.data);
        } catch (e) {
-            Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`);
+            ExtensionSystem.logExtensionError(uuid, `parsing info: ${e}`);
            invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString());
            return;
        }
@ -46,7 +44,7 @@ function installExtension(uuid, invocation) {
 }

 function uninstallExtension(uuid) {
-    let extension = Main.extensionManager.lookup(uuid);
+    let extension = ExtensionUtils.extensions[uuid];
    if (!extension)
        return false;

@ -54,7 +52,7 @@ function uninstallExtension(uuid) {
    if (extension.type != ExtensionUtils.ExtensionType.PER_USER)
        return false;

-    if (!Main.extensionManager.unloadExtension(extension))
+    if (!ExtensionSystem.unloadExtension(extension))
        return false;

    FileUtils.recursivelyDeleteDir(extension.dir, true);
@ -90,7 +88,7 @@ function gotExtensionZipFile(session, message, uuid, dir, callback, errback) {
        return;
    }

-    GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, (o, status) => {
+    GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, (pid, status) => {
        GLib.spawn_close_pid(pid);

        if (status != 0)
@ -113,12 +111,12 @@ function updateExtension(uuid) {
    let url = REPOSITORY_URL_DOWNLOAD.format(uuid);
    let message = Soup.form_request_new_from_hash('GET', url, params);

-    _httpSession.queue_message(message, session => {
+    _httpSession.queue_message(message, (session, message) => {
        gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
-            let oldExtension = Main.extensionManager.lookup(uuid);
+            let oldExtension = ExtensionUtils.extensions[uuid];
            let extensionDir = oldExtension.dir;

-            if (!Main.extensionManager.unloadExtension(oldExtension))
+            if (!ExtensionSystem.unloadExtension(oldExtension))
                return;

            FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir);
@ -127,11 +125,11 @@ function updateExtension(uuid) {
            let extension = null;

            try {
-                extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
-                Main.extensionManager.loadExtension(extension);
+                extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
+                ExtensionSystem.loadExtension(extension);
            } catch (e) {
                if (extension)
-                    Main.extensionManager.unloadExtension(extension);
+                    ExtensionSystem.unloadExtension(extension);

                logError(e, 'Error loading extension %s'.format(uuid));

@ -140,29 +138,29 @@ function updateExtension(uuid) {

                // Restore what was there before. We can't do much if we
                // fail here.
-                Main.extensionManager.loadExtension(oldExtension);
+                ExtensionSystem.loadExtension(oldExtension);
                return;
            }

            FileUtils.recursivelyDeleteDir(oldExtensionTmpDir, true);
-        }, (code, msg) => {
-            log(`Error while updating extension ${uuid}: ${code} (${msg})`);
+        }, (code, message) => {
+            log('Error while updating extension %s: %s (%s)'.format(uuid, code, message ? message : ''));
        });
    });
 }

 function checkForUpdates() {
    let metadatas = {};
-    Main.extensionManager.getUuids().forEach(uuid => {
-        metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata;
-    });
+    for (let uuid in ExtensionUtils.extensions) {
+        metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata;
+    }

    let params = { shell_version: Config.PACKAGE_VERSION,
                   installed: JSON.stringify(metadatas) };

    let url = REPOSITORY_URL_UPDATE;
    let message = Soup.form_request_new_from_hash('GET', url, params);
-    _httpSession.queue_message(message, () => {
+    _httpSession.queue_message(message, (session, message) => {
        if (message.status_code != Soup.KnownStatusCode.OK)
            return;

@ -186,32 +184,31 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
        this._info = info;
        this._invocation = invocation;

-        this.setButtons([{
-            label: _("Cancel"),
-            action: this._onCancelButtonPressed.bind(this),
-            key: Clutter.KEY_Escape,
-        }, {
-            label: _("Install"),
-            action: this._onInstallButtonPressed.bind(this),
-            default: true,
-        }]);
+        this.setButtons([{ label: _("Cancel"),
+                           action: this._onCancelButtonPressed.bind(this),
+                           key: Clutter.Escape
+                         },
+                         { label: _("Install"),
+                           action: this._onInstallButtonPressed.bind(this),
+                           default: true
+                         }]);

        let content = new Dialog.MessageDialogContent({
            title: _("Download and install “%s” from extensions.gnome.org?").format(info.name),
            icon: new Gio.FileIcon({
-                file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`),
-            }),
+                file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`)
+            })
        });

        this.contentLayout.add(content);
    }

-    _onCancelButtonPressed() {
+    _onCancelButtonPressed(button, event) {
        this.close();
        this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled']));
    }

-    _onInstallButtonPressed() {
+    _onInstallButtonPressed(button, event) {
        let params = { shell_version: Config.PACKAGE_VERSION };

        let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid);
@ -220,17 +217,23 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
        let uuid = this._uuid;
        let dir = Gio.File.new_for_path(GLib.build_filenamev([global.userdatadir, 'extensions', uuid]));
        let invocation = this._invocation;
-        function errback(code, msg) {
-            log(`Error while installing ${uuid}: ${code} (${msg})`);
-            invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg || '');
+        function errback(code, message) {
+            let msg = message ? message.toString() : '';
+            log('Error while installing %s: %s (%s)'.format(uuid, code, msg));
+            invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg);
        }

        function callback() {
+            // Add extension to 'enabled-extensions' for the user, always...
+            let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY);
+            if (!enabledExtensions.includes(uuid)) {
+                enabledExtensions.push(uuid);
+                global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions);
+            }
+
            try {
-                let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
-                Main.extensionManager.loadExtension(extension);
-                if (!Main.extensionManager.enableExtension(uuid))
-                    throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`);
+                let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
+                ExtensionSystem.loadExtension(extension);
            } catch (e) {
                uninstallExtension(uuid);
                errback('LoadExtensionError', e);
@ -240,7 +243,7 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
            invocation.return_value(GLib.Variant.new('(s)', ['successful']));
        }

-        _httpSession.queue_message(message, session => {
+        _httpSession.queue_message(message, (session, message) => {
            gotExtensionZipFile(session, message, uuid, dir, callback, errback);
        });

--- a/js/ui/extensionSystem.js
+++ b/js/ui/extensionSystem.js
@ -1,533 +1,374 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init connect disconnect */

-const { GLib, Gio, St } = imports.gi;
+const { Gio, St } = imports.gi;
 const Signals = imports.signals;

 const ExtensionUtils = imports.misc.extensionUtils;
-const FileUtils = imports.misc.fileUtils;
 const Main = imports.ui.main;

-const { ExtensionState, ExtensionType } = ExtensionUtils;
+var ExtensionState = {
+    ENABLED: 1,
+    DISABLED: 2,
+    ERROR: 3,
+    OUT_OF_DATE: 4,
+    DOWNLOADING: 5,
+    INITIALIZED: 6,
+
+    // Used as an error state for operations on unknown extensions,
+    // should never be in a real extensionMeta object.
+    UNINSTALLED: 99
+};
+
+// Arrays of uuids
+var enabledExtensions;
+// Contains the order that extensions were enabled in.
+var extensionOrder = [];
+
+// We don't really have a class to add signals on. So, create
+// a simple dummy object, add the signal methods, and export those
+// publically.
+var _signals = {};
+Signals.addSignalMethods(_signals);
+
+var connect = _signals.connect.bind(_signals);
+var disconnect = _signals.disconnect.bind(_signals);

 const ENABLED_EXTENSIONS_KEY = 'enabled-extensions';
-const DISABLED_EXTENSIONS_KEY = 'disabled-extensions';
 const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions';
 const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation';

-var ExtensionManager = class {
-    constructor() {
-        this._initialized = false;
-        this._enabled = false;
+var initted = false;
+var enabled;

-        this._extensions = new Map();
-        this._enabledExtensions = [];
-        this._extensionOrder = [];
+function disableExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;

-        Main.sessionMode.connect('updated', this._sessionUpdated.bind(this));
-    }
+    if (extension.state != ExtensionState.ENABLED)
+        return;

-    init() {
-        // The following file should exist for a period of time when extensions
-        // are enabled after start. If it exists, then the systemd unit will
-        // disable extensions should gnome-shell crash.
-        // Should the file already exist from a previous login, then this is OK.
-        let disableFilename = GLib.build_filenamev([GLib.get_user_runtime_dir(), 'gnome-shell-disable-extensions']);
-        let disableFile = Gio.File.new_for_path(disableFilename);
+    // "Rebase" the extension order by disabling and then enabling extensions
+    // in order to help prevent conflicts.
+
+    // Example:
+    //   order = [A, B, C, D, E]
+    //   user disables C
+    //   this should: disable E, disable D, disable C, enable D, enable E
+
+    let orderIdx = extensionOrder.indexOf(uuid);
+    let order = extensionOrder.slice(orderIdx + 1);
+    let orderReversed = order.slice().reverse();
+
+    for (let i = 0; i < orderReversed.length; i++) {
+        let uuid = orderReversed[i];
        try {
-            disableFile.create(Gio.FileCreateFlags.REPLACE_DESTINATION, null);
+            ExtensionUtils.extensions[uuid].stateObj.disable();
        } catch (e) {
-            log(`Failed to create file ${disableFilename}: ${e.message}`);
+            logExtensionError(uuid, e);
        }
-
-        GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 60, () => {
-            disableFile.delete(null);
-            return GLib.SOURCE_REMOVE;
-        });
-
-        this._sessionUpdated();
    }

-    lookup(uuid) {
-        return this._extensions.get(uuid);
+    if (extension.stylesheet) {
+        let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
+        theme.unload_stylesheet(extension.stylesheet);
+        delete extension.stylesheet;
    }

-    getUuids() {
-        return [...this._extensions.keys()];
+    try {
+        extension.stateObj.disable();
+    } catch (e) {
+        logExtensionError(uuid, e);
    }

-    _callExtensionDisable(uuid) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
-
-        if (extension.state != ExtensionState.ENABLED)
-            return;
-
-        // "Rebase" the extension order by disabling and then enabling extensions
-        // in order to help prevent conflicts.
-
-        // Example:
-        //   order = [A, B, C, D, E]
-        //   user disables C
-        //   this should: disable E, disable D, disable C, enable D, enable E
-
-        let orderIdx = this._extensionOrder.indexOf(uuid);
-        let order = this._extensionOrder.slice(orderIdx + 1);
-        let orderReversed = order.slice().reverse();
-
-        for (let i = 0; i < orderReversed.length; i++) {
-            let otherUuid = orderReversed[i];
-            try {
-                this.lookup(otherUuid).stateObj.disable();
-            } catch (e) {
-                this.logExtensionError(otherUuid, e);
-            }
+    for (let i = 0; i < order.length; i++) {
+        let uuid = order[i];
+        try {
+            ExtensionUtils.extensions[uuid].stateObj.enable();
+        } catch (e) {
+            logExtensionError(uuid, e);
        }
+    }

+    extensionOrder.splice(orderIdx, 1);
+
+    if ( extension.state != ExtensionState.ERROR ) {
+        extension.state = ExtensionState.DISABLED;
+        _signals.emit('extension-state-changed', extension);
+    }
+}
+
+function enableExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;
+
+    if (extension.state == ExtensionState.INITIALIZED)
+        initExtension(uuid);
+
+    if (extension.state != ExtensionState.DISABLED)
+        return;
+
+    extensionOrder.push(uuid);
+
+    let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
+    let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
+    for (let i = 0; i < stylesheetNames.length; i++) {
+        try {
+            let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
+            theme.load_stylesheet(stylesheetFile);
+            extension.stylesheet = stylesheetFile;
+            break;
+        } catch (e) {
+            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
+                continue; // not an error
+            log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+            return;
+        }
+    }
+
+    try {
+        extension.stateObj.enable();
+        extension.state = ExtensionState.ENABLED;
+        _signals.emit('extension-state-changed', extension);
+        return;
+    } catch (e) {
        if (extension.stylesheet) {
-            let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
            theme.unload_stylesheet(extension.stylesheet);
            delete extension.stylesheet;
        }
-
-        try {
-            extension.stateObj.disable();
-        } catch (e) {
-            this.logExtensionError(uuid, e);
-        }
-
-        for (let i = 0; i < order.length; i++) {
-            let otherUuid = order[i];
-            try {
-                this.lookup(otherUuid).stateObj.enable();
-            } catch (e) {
-                this.logExtensionError(otherUuid, e);
-            }
-        }
-
-        this._extensionOrder.splice(orderIdx, 1);
-
-        if (extension.state != ExtensionState.ERROR) {
-            extension.state = ExtensionState.DISABLED;
-            this.emit('extension-state-changed', extension);
-        }
+        logExtensionError(uuid, e);
+        return;
    }
+}

-    _callExtensionEnable(uuid) {
-        if (!Main.sessionMode.allowExtensions)
-            return;
+function logExtensionError(uuid, error) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;

-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
+    let message = `${error}`;

-        if (extension.state == ExtensionState.INITIALIZED)
-            this._callExtensionInit(uuid);
+    extension.state = ExtensionState.ERROR;
+    if (!extension.errors)
+        extension.errors = [];
+    extension.errors.push(message);

-        if (extension.state != ExtensionState.DISABLED)
-            return;
+    log('Extension "%s" had error: %s'.format(uuid, message));
+    _signals.emit('extension-state-changed', { uuid: uuid,
+                                               error: message,
+                                               state: extension.state });
+}

-        let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
-        let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
-        for (let i = 0; i < stylesheetNames.length; i++) {
-            try {
-                let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
-                theme.load_stylesheet(stylesheetFile);
-                extension.stylesheet = stylesheetFile;
-                break;
-            } catch (e) {
-                if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
-                    continue; // not an error
-                this.logExtensionError(uuid, e);
+function loadExtension(extension) {
+    // Default to error, we set success as the last step
+    extension.state = ExtensionState.ERROR;
+
+    let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
+
+    if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
+        extension.state = ExtensionState.OUT_OF_DATE;
+    } else {
+        let enabled = enabledExtensions.includes(extension.uuid);
+        if (enabled) {
+            if (!initExtension(extension.uuid))
                return;
-            }
-        }
-
-        try {
-            extension.stateObj.enable();
-            extension.state = ExtensionState.ENABLED;
-            this._extensionOrder.push(uuid);
-            this.emit('extension-state-changed', extension);
-        } catch (e) {
-            if (extension.stylesheet) {
-                theme.unload_stylesheet(extension.stylesheet);
-                delete extension.stylesheet;
-            }
-            this.logExtensionError(uuid, e);
-        }
-    }
-
-    enableExtension(uuid) {
-        if (!this._extensions.has(uuid))
-            return false;
-
-        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-
-        if (disabledExtensions.includes(uuid)) {
-            disabledExtensions = disabledExtensions.filter(item => item !== uuid);
-            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
-        }
-
-        if (!enabledExtensions.includes(uuid)) {
-            enabledExtensions.push(uuid);
-            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
-        }
-
-        return true;
-    }
-
-    disableExtension(uuid) {
-        if (!this._extensions.has(uuid))
-            return false;
-
-        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-
-        if (enabledExtensions.includes(uuid)) {
-            enabledExtensions = enabledExtensions.filter(item => item !== uuid);
-            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
-        }
-
-        if (!disabledExtensions.includes(uuid)) {
-            disabledExtensions.push(uuid);
-            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
-        }
-
-        return true;
-    }
-
-    logExtensionError(uuid, error) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
-
-        let message = `${error}`;
-
-        extension.error = message;
-        extension.state = ExtensionState.ERROR;
-        if (!extension.errors)
-            extension.errors = [];
-        extension.errors.push(message);
-
-        logError(error, `Extension ${uuid}`);
-        this.emit('extension-state-changed', extension);
-    }
-
-    createExtensionObject(uuid, dir, type) {
-        let metadataFile = dir.get_child('metadata.json');
-        if (!metadataFile.query_exists(null))
-            throw new Error('Missing metadata.json');
-
-        let metadataContents, success_;
-        try {
-            [success_, metadataContents] = metadataFile.load_contents(null);
-            if (metadataContents instanceof Uint8Array)
-                metadataContents = imports.byteArray.toString(metadataContents);
-        } catch (e) {
-            throw new Error(`Failed to load metadata.json: ${e}`);
-        }
-        let meta;
-        try {
-            meta = JSON.parse(metadataContents);
-        } catch (e) {
-            throw new Error(`Failed to parse metadata.json: ${e}`);
-        }
-
-        let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
-        for (let i = 0; i < requiredProperties.length; i++) {
-            let prop = requiredProperties[i];
-            if (!meta[prop])
-                throw new Error(`missing "${prop}" property in metadata.json`);
-        }
-
-        if (uuid != meta.uuid)
-            throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
-
-        let extension = {
-            metadata: meta,
-            uuid: meta.uuid,
-            type,
-            dir,
-            path: dir.get_path(),
-            error: '',
-            hasPrefs: dir.get_child('prefs.js').query_exists(null),
-            canChange: false,
-        };
-        this._extensions.set(uuid, extension);
-
-        return extension;
-    }
-
-    loadExtension(extension) {
-        // Default to error, we set success as the last step
-        extension.state = ExtensionState.ERROR;
-
-        let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
-
-        if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
-            extension.state = ExtensionState.OUT_OF_DATE;
+            if (extension.state == ExtensionState.DISABLED)
+                enableExtension(extension.uuid);
        } else {
-            let enabled = this._enabledExtensions.includes(extension.uuid);
-            if (enabled) {
-                if (!this._callExtensionInit(extension.uuid))
-                    return;
-                if (extension.state == ExtensionState.DISABLED)
-                    this._callExtensionEnable(extension.uuid);
-            } else {
-                extension.state = ExtensionState.INITIALIZED;
-            }
+            extension.state = ExtensionState.INITIALIZED;
        }
-
-        this._updateCanChange(extension);
-        this.emit('extension-state-changed', extension);
    }

-    unloadExtension(extension) {
-        // Try to disable it -- if it's ERROR'd, we can't guarantee that,
-        // but it will be removed on next reboot, and hopefully nothing
-        // broke too much.
-        this._callExtensionDisable(extension.uuid);
+    _signals.emit('extension-state-changed', extension);
+}

-        extension.state = ExtensionState.UNINSTALLED;
-        this.emit('extension-state-changed', extension);
+function unloadExtension(extension) {
+    // Try to disable it -- if it's ERROR'd, we can't guarantee that,
+    // but it will be removed on next reboot, and hopefully nothing
+    // broke too much.
+    disableExtension(extension.uuid);

-        this._extensions.delete(extension.uuid);
-        return true;
+    extension.state = ExtensionState.UNINSTALLED;
+    _signals.emit('extension-state-changed', extension);
+
+    delete ExtensionUtils.extensions[extension.uuid];
+    return true;
+}
+
+function reloadExtension(oldExtension) {
+    // Grab the things we'll need to pass to createExtensionObject
+    // to reload it.
+    let { uuid: uuid, dir: dir, type: type } = oldExtension;
+
+    // Then unload the old extension.
+    unloadExtension(oldExtension);
+
+    // Now, recreate the extension and load it.
+    let newExtension;
+    try {
+        newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type);
+    } catch (e) {
+        logExtensionError(uuid, e);
+        return;
    }

-    reloadExtension(oldExtension) {
-        // Grab the things we'll need to pass to createExtensionObject
-        // to reload it.
-        let { uuid, dir, type } = oldExtension;
+    loadExtension(newExtension);
+}

-        // Then unload the old extension.
-        this.unloadExtension(oldExtension);
+function initExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    let dir = extension.dir;

-        // Now, recreate the extension and load it.
-        let newExtension;
+    if (!extension)
+        throw new Error("Extension was not properly created. Call loadExtension first");
+
+    let extensionJs = dir.get_child('extension.js');
+    if (!extensionJs.query_exists(null)) {
+        logExtensionError(uuid, new Error('Missing extension.js'));
+        return false;
+    }
+
+    let extensionModule;
+    let extensionState = null;
+
+    ExtensionUtils.installImporter(extension);
+    try {
+        extensionModule = extension.imports.extension;
+    } catch (e) {
+        logExtensionError(uuid, e);
+        return false;
+    }
+
+    if (extensionModule.init) {
        try {
-            newExtension = this.createExtensionObject(uuid, dir, type);
+            extensionState = extensionModule.init(extension);
        } catch (e) {
-            this.logExtensionError(uuid, e);
-            return;
-        }
-
-        this.loadExtension(newExtension);
-    }
-
-    _callExtensionInit(uuid) {
-        if (!Main.sessionMode.allowExtensions)
-            return false;
-
-        let extension = this.lookup(uuid);
-        if (!extension)
-            throw new Error("Extension was not properly created. Call createExtensionObject first");
-
-        let dir = extension.dir;
-        let extensionJs = dir.get_child('extension.js');
-        if (!extensionJs.query_exists(null)) {
-            this.logExtensionError(uuid, new Error('Missing extension.js'));
+            logExtensionError(uuid, e);
            return false;
        }
-
-        let extensionModule;
-        let extensionState = null;
-
-        ExtensionUtils.installImporter(extension);
-        try {
-            extensionModule = extension.imports.extension;
-        } catch (e) {
-            this.logExtensionError(uuid, e);
-            return false;
-        }
-
-        if (extensionModule.init) {
-            try {
-                extensionState = extensionModule.init(extension);
-            } catch (e) {
-                this.logExtensionError(uuid, e);
-                return false;
-            }
-        }
-
-        if (!extensionState)
-            extensionState = extensionModule;
-        extension.stateObj = extensionState;
-
-        extension.state = ExtensionState.DISABLED;
-        this.emit('extension-loaded', uuid);
-        return true;
    }

-    _getModeExtensions() {
-        if (Array.isArray(Main.sessionMode.enabledExtensions))
-            return Main.sessionMode.enabledExtensions;
-        return [];
-    }
+    if (!extensionState)
+        extensionState = extensionModule;
+    extension.stateObj = extensionState;

-    _updateCanChange(extension) {
-        let hasError =
-            extension.state == ExtensionState.ERROR ||
-            extension.state == ExtensionState.OUT_OF_DATE;
+    extension.state = ExtensionState.DISABLED;
+    _signals.emit('extension-loaded', uuid);
+    return true;
+}

-        let isMode = this._getModeExtensions().includes(extension.uuid);
-        let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY);
+function getEnabledExtensions() {
+    let extensions;
+    if (Array.isArray(Main.sessionMode.enabledExtensions))
+        extensions = Main.sessionMode.enabledExtensions;
+    else
+        extensions = [];

-        let changeKey = isMode
-            ? DISABLE_USER_EXTENSIONS_KEY
-            : ENABLED_EXTENSIONS_KEY;
+    if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
+        return extensions;

-        extension.canChange =
-            !hasError &&
-            global.settings.is_writable(changeKey) &&
-            (isMode || !modeOnly);
-    }
+    return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
+}

-    _getEnabledExtensions() {
-        let extensions = this._getModeExtensions();
+function onEnabledExtensionsChanged() {
+    let newEnabledExtensions = getEnabledExtensions();

-        if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
-            extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
+    if (!enabled)
+        return;

-        // filter out 'disabled-extensions' which takes precedence
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-        return extensions.filter(item => !disabledExtensions.includes(item));
-    }
+    // Find and enable all the newly enabled extensions: UUIDs found in the
+    // new setting, but not in the old one.
+    newEnabledExtensions.filter(
+        uuid => !enabledExtensions.includes(uuid)
+    ).forEach(uuid => {
+        enableExtension(uuid);
+    });

-    _onUserExtensionsEnabledChanged() {
-        this._onEnabledExtensionsChanged();
-        this._onSettingsWritableChanged();
-    }
+    // Find and disable all the newly disabled extensions: UUIDs found in the
+    // old setting, but not in the new one.
+    enabledExtensions.filter(
+        item => !newEnabledExtensions.includes(item)
+    ).forEach(uuid => {
+        disableExtension(uuid);
+    });

-    _onEnabledExtensionsChanged() {
-        let newEnabledExtensions = this._getEnabledExtensions();
+    enabledExtensions = newEnabledExtensions;
+}

-        // Find and enable all the newly enabled extensions: UUIDs found in the
-        // new setting, but not in the old one.
-        newEnabledExtensions.filter(
-            uuid => !this._enabledExtensions.includes(uuid)
-        ).forEach(uuid => {
-            this._callExtensionEnable(uuid);
+function _onVersionValidationChanged() {
+    // we want to reload all extensions, but only enable
+    // extensions when allowed by the sessionMode, so
+    // temporarily disable them all
+    enabledExtensions = [];
+    for (let uuid in ExtensionUtils.extensions)
+        reloadExtension(ExtensionUtils.extensions[uuid]);
+    enabledExtensions = getEnabledExtensions();
+
+    if (Main.sessionMode.allowExtensions) {
+        enabledExtensions.forEach(uuid => {
+            enableExtension(uuid);
        });
+    }
+}

-        // Find and disable all the newly disabled extensions: UUIDs found in the
-        // old setting, but not in the new one.
-        this._extensionOrder.filter(
-            uuid => !newEnabledExtensions.includes(uuid)
-        ).reverse().forEach(uuid => {
-            this._callExtensionDisable(uuid);
+function _loadExtensions() {
+    global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
+    global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
+    global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`, _onVersionValidationChanged);
+
+    enabledExtensions = getEnabledExtensions();
+
+    let finder = new ExtensionUtils.ExtensionFinder();
+    finder.connect('extension-found', (finder, extension) => {
+        loadExtension(extension);
+    });
+    finder.scanExtensions();
+}
+
+function enableAllExtensions() {
+    if (enabled)
+        return;
+
+    if (!initted) {
+        _loadExtensions();
+        initted = true;
+    } else {
+        enabledExtensions.forEach(uuid => {
+            enableExtension(uuid);
        });
-
-        this._enabledExtensions = newEnabledExtensions;
    }
+    enabled = true;
+}

-    _onSettingsWritableChanged() {
-        for (let extension of this._extensions.values()) {
-            this._updateCanChange(extension);
-            this.emit('extension-state-changed', extension);
-        }
-    }
+function disableAllExtensions() {
+    if (!enabled)
+        return;

-    _onVersionValidationChanged() {
-        // Disabling extensions modifies the order array, so use a copy
-        let extensionOrder = this._extensionOrder.slice();
-
-        // Disable enabled extensions in the reverse order first to avoid
-        // the "rebasing" done in _callExtensionDisable...
+    if (initted) {
        extensionOrder.slice().reverse().forEach(uuid => {
-            this._callExtensionDisable(uuid);
-        });
-
-        // ...and then reload and enable extensions in the correct order again.
-        [...this._extensions.values()].sort((a, b) => {
-            return extensionOrder.indexOf(a.uuid) - extensionOrder.indexOf(b.uuid);
-        }).forEach(extension => this.reloadExtension(extension));
-    }
-
-    _loadExtensions() {
-        global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`,
-            this._onEnabledExtensionsChanged.bind(this));
-        global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`,
-            this._onEnabledExtensionsChanged.bind(this));
-        global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`,
-            this._onUserExtensionsEnabledChanged.bind(this));
-        global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`,
-            this._onVersionValidationChanged.bind(this));
-        global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`,
-            this._onSettingsWritableChanged.bind(this));
-        global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`,
-            this._onSettingsWritableChanged.bind(this));
-
-        this._enabledExtensions = this._getEnabledExtensions();
-
-        let perUserDir = Gio.File.new_for_path(global.userdatadir);
-        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
-            let fileType = info.get_file_type();
-            if (fileType != Gio.FileType.DIRECTORY)
-                return;
-            let uuid = info.get_name();
-            let existing = this.lookup(uuid);
-            if (existing) {
-                log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`);
-                return;
-            }
-
-            let extension;
-            let type = dir.has_prefix(perUserDir)
-                ? ExtensionType.PER_USER
-                : ExtensionType.SYSTEM;
-            try {
-                extension = this.createExtensionObject(uuid, dir, type);
-            } catch (e) {
-                logError(e, `Could not load extension ${uuid}`);
-                return;
-            }
-            this.loadExtension(extension);
+            disableExtension(uuid);
        });
    }

-    _enableAllExtensions() {
-        if (this._enabled)
-            return;
+    enabled = false;
+}

-        if (!this._initialized) {
-            this._loadExtensions();
-            this._initialized = true;
-        } else {
-            this._enabledExtensions.forEach(uuid => {
-                this._callExtensionEnable(uuid);
-            });
-        }
-        this._enabled = true;
+function _sessionUpdated() {
+    // For now sessionMode.allowExtensions controls extensions from both the
+    // 'enabled-extensions' preference and the sessionMode.enabledExtensions
+    // property; it might make sense to make enabledExtensions independent
+    // from allowExtensions in the future
+    if (Main.sessionMode.allowExtensions) {
+        if (initted)
+            enabledExtensions = getEnabledExtensions();
+        enableAllExtensions();
+    } else {
+        disableAllExtensions();
    }
+}

-    _disableAllExtensions() {
-        if (!this._enabled)
-            return;
-
-        if (this._initialized) {
-            this._extensionOrder.slice().reverse().forEach(uuid => {
-                this._callExtensionDisable(uuid);
-            });
-        }
-
-        this._enabled = false;
-    }
-
-    _sessionUpdated() {
-        // For now sessionMode.allowExtensions controls extensions from both the
-        // 'enabled-extensions' preference and the sessionMode.enabledExtensions
-        // property; it might make sense to make enabledExtensions independent
-        // from allowExtensions in the future
-        if (Main.sessionMode.allowExtensions) {
-            // Take care of added or removed sessionMode extensions
-            this._onEnabledExtensionsChanged();
-            this._enableAllExtensions();
-        } else {
-            this._disableAllExtensions();
-        }
-    }
-};
-Signals.addSignalMethods(ExtensionManager.prototype);
+function init() {
+    Main.sessionMode.connect('updated', _sessionUpdated);
+    _sessionUpdated();
+}
--- a/js/ui/grabHelper.js
+++ b/js/ui/grabHelper.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported GrabHelper */

 const { Clutter, St } = imports.gi;

@ -195,7 +194,7 @@ var GrabHelper = class GrabHelper {
    }

    _takeModalGrab() {
-        let firstGrab = this._modalCount == 0;
+        let firstGrab = (this._modalCount == 0);
        if (firstGrab) {
            if (!Main.pushModal(this._owner, this._modalParams))
                return false;
@ -292,7 +291,7 @@ var GrabHelper = class GrabHelper {
        let touchEnd = type == Clutter.EventType.TOUCH_END;
        let touch = touchUpdate || touchBegin || touchEnd;

-        if (touch && !global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
+        if (touch && !global.display.is_pointer_emulating_sequence (event.get_event_sequence()))
            return Clutter.EVENT_PROPAGATE;

        if (this._ignoreUntilRelease && (motion || release || touch)) {
--- a/js/ui/ibusCandidatePopup.js
+++ b/js/ui/ibusCandidatePopup.js
@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CandidatePopup */

-const { Clutter, GObject, IBus, St } = imports.gi;
+const { Clutter, IBus, St } = imports.gi;
+const Signals = imports.signals;

 const BoxPointer = imports.ui.boxpointer;
 const Main = imports.ui.main;
@ -11,23 +11,11 @@ var MAX_CANDIDATES_PER_PAGE = 16;
 var DEFAULT_INDEX_LABELS = ['1', '2', '3', '4', '5', '6', '7', '8',
                            '9', '0', 'a', 'b', 'c', 'd', 'e', 'f'];

-var CandidateArea = GObject.registerClass({
-    Signals: {
-        'candidate-clicked': { param_types: [GObject.TYPE_UINT,
-                                             GObject.TYPE_UINT,
-                                             Clutter.ModifierType.$gtype] },
-        'cursor-down': {},
-        'cursor-up': {},
-        'next-page': {},
-        'previous-page': {},
-    },
-}, class CandidateArea extends St.BoxLayout {
-    _init() {
-        super._init({
-            vertical: true,
-            reactive: true,
-            visible: false,
-        });
+var CandidateArea = class CandidateArea {
+    constructor() {
+        this.actor = new St.BoxLayout({ vertical: true,
+                                        reactive: true,
+                                        visible: false });
        this._candidateBoxes = [];
        for (let i = 0; i < MAX_CANDIDATES_PER_PAGE; ++i) {
            let box = new St.BoxLayout({ style_class: 'candidate-box',
@ -35,10 +23,10 @@ var CandidateArea = GObject.registerClass({
                                         track_hover: true });
            box._indexLabel = new St.Label({ style_class: 'candidate-index' });
            box._candidateLabel = new St.Label({ style_class: 'candidate-label' });
-            box.add_child(box._indexLabel);
-            box.add_child(box._candidateLabel);
+            box.add(box._indexLabel, { y_fill: false });
+            box.add(box._candidateLabel, { y_fill: false });
            this._candidateBoxes.push(box);
-            this.add(box);
+            this.actor.add(box);

            let j = i;
            box.connect('button-release-event', (actor, event) => {
@ -47,23 +35,30 @@ var CandidateArea = GObject.registerClass({
            });
        }

+        this.actor.connect('scroll-event', (actor, event) => {
+            let direction = event.get_scroll_direction();
+            switch (direction) {
+            case Clutter.ScrollDirection.UP:
+                this.emit('cursor-up');
+                break;
+            case Clutter.ScrollDirection.DOWN:
+                this.emit('cursor-down');
+                break;
+            }
+            return Clutter.EVENT_PROPAGATE;
+        });
+
        this._buttonBox = new St.BoxLayout({ style_class: 'candidate-page-button-box' });

-        this._previousButton = new St.Button({
-            style_class: 'candidate-page-button candidate-page-button-previous button',
-            x_expand: true,
-        });
+        this._previousButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-previous button' });
        this._previousButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' });
-        this._buttonBox.add_child(this._previousButton);
+        this._buttonBox.add(this._previousButton, { expand: true });

-        this._nextButton = new St.Button({
-            style_class: 'candidate-page-button candidate-page-button-next button',
-            x_expand: true,
-        });
+        this._nextButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-next button' });
        this._nextButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' });
-        this._buttonBox.add_child(this._nextButton);
+        this._buttonBox.add(this._nextButton, { expand: true });

-        this.add(this._buttonBox);
+        this.actor.add(this._buttonBox);

        this._previousButton.connect('clicked', () => {
            this.emit('previous-page');
@ -76,18 +71,6 @@ var CandidateArea = GObject.registerClass({
        this._cursorPosition = 0;
    }

-    vfunc_scroll_event(scrollEvent) {
-        switch (scrollEvent.direction) {
-        case Clutter.ScrollDirection.UP:
-            this.emit('cursor-up');
-            break;
-        case Clutter.ScrollDirection.DOWN:
-            this.emit('cursor-down');
-            break;
-        }
-        return Clutter.EVENT_PROPAGATE;
-    }
-
    setOrientation(orientation) {
        if (this._orientation == orientation)
            return;
@ -95,15 +78,15 @@ var CandidateArea = GObject.registerClass({
        this._orientation = orientation;

        if (this._orientation == IBus.Orientation.HORIZONTAL) {
-            this.vertical = false;
-            this.remove_style_class_name('vertical');
-            this.add_style_class_name('horizontal');
+            this.actor.vertical = false;
+            this.actor.remove_style_class_name('vertical');
+            this.actor.add_style_class_name('horizontal');
            this._previousButton.child.icon_name = 'go-previous-symbolic';
            this._nextButton.child.icon_name = 'go-next-symbolic';
        } else {                // VERTICAL || SYSTEM
-            this.vertical = true;
-            this.add_style_class_name('vertical');
-            this.remove_style_class_name('horizontal');
+            this.actor.vertical = true;
+            this.actor.add_style_class_name('vertical');
+            this.actor.remove_style_class_name('horizontal');
            this._previousButton.child.icon_name = 'go-up-symbolic';
            this._nextButton.child.icon_name = 'go-down-symbolic';
        }
@ -118,7 +101,7 @@ var CandidateArea = GObject.registerClass({
            if (!visible)
                continue;

-            box._indexLabel.text = indexes && indexes[i] ? indexes[i] : DEFAULT_INDEX_LABELS[i];
+            box._indexLabel.text = ((indexes && indexes[i]) ? indexes[i] : DEFAULT_INDEX_LABELS[i]);
            box._candidateLabel.text = candidates[i];
        }

@ -137,23 +120,19 @@ var CandidateArea = GObject.registerClass({
        this._previousButton.reactive = wrapsAround || page > 0;
        this._nextButton.reactive = wrapsAround || page < nPages - 1;
    }
-});
+};
+Signals.addSignalMethods(CandidateArea.prototype);

-var CandidatePopup = GObject.registerClass(
-class IbusCandidatePopup extends BoxPointer.BoxPointer {
-    _init() {
-        super._init(St.Side.TOP);
-        this.visible = false;
-        this.style_class = 'candidate-popup-boxpointer';
-
-        this._dummyCursor = new St.Widget({ opacity: 0 });
-        Main.layoutManager.uiGroup.add_actor(this._dummyCursor);
-
-        Main.layoutManager.addChrome(this);
+var CandidatePopup = class CandidatePopup {
+    constructor() {
+        this._boxPointer = new BoxPointer.BoxPointer(St.Side.TOP);
+        this._boxPointer.visible = false;
+        this._boxPointer.style_class = 'candidate-popup-boxpointer';
+        Main.layoutManager.addChrome(this._boxPointer);

        let box = new St.BoxLayout({ style_class: 'candidate-popup-content',
                                     vertical: true });
-        this.bin.set_child(box);
+        this._boxPointer.bin.set_child(box);

        this._preeditText = new St.Label({ style_class: 'candidate-popup-text',
                                           visible: false });
@ -164,7 +143,7 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer {
        box.add(this._auxText);

        this._candidateArea = new CandidateArea();
-        box.add(this._candidateArea);
+        box.add(this._candidateArea.actor);

        this._candidateArea.connect('previous-page', () => {
            this._panelService.page_up();
@ -215,42 +194,41 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer {
            this._preeditText.text = text.get_text();

            let attrs = text.get_attributes();
-            if (attrs) {
+            if (attrs)
                this._setTextAttributes(this._preeditText.clutter_text,
                                        attrs);
-            }
        });
-        panelService.connect('show-preedit-text', () => {
+        panelService.connect('show-preedit-text', ps => {
            this._preeditText.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-preedit-text', () => {
+        panelService.connect('hide-preedit-text', ps => {
            this._preeditText.hide();
            this._updateVisibility();
        });
-        panelService.connect('update-auxiliary-text', (_ps, text, visible) => {
+        panelService.connect('update-auxiliary-text', (ps, text, visible) => {
            this._auxText.visible = visible;
            this._updateVisibility();

            this._auxText.text = text.get_text();
        });
-        panelService.connect('show-auxiliary-text', () => {
+        panelService.connect('show-auxiliary-text', ps => {
            this._auxText.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-auxiliary-text', () => {
+        panelService.connect('hide-auxiliary-text', ps => {
            this._auxText.hide();
            this._updateVisibility();
        });
-        panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => {
-            this._candidateArea.visible = visible;
+        panelService.connect('update-lookup-table', (ps, lookupTable, visible) => {
+            this._candidateArea.actor.visible = visible;
            this._updateVisibility();

            let nCandidates = lookupTable.get_number_of_candidates();
            let cursorPos = lookupTable.get_cursor_pos();
            let pageSize = lookupTable.get_page_size();
            let nPages = Math.ceil(nCandidates / pageSize);
-            let page = cursorPos == 0 ? 0 : Math.floor(cursorPos / pageSize);
+            let page = ((cursorPos == 0) ? 0 : Math.floor(cursorPos / pageSize));
            let startIndex = page * pageSize;
            let endIndex = Math.min((page + 1) * pageSize, nCandidates);

@ -278,48 +256,45 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer {
            this._candidateArea.setOrientation(lookupTable.get_orientation());
            this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
        });
-        panelService.connect('show-lookup-table', () => {
-            this._candidateArea.show();
+        panelService.connect('show-lookup-table', ps => {
+            this._candidateArea.actor.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-lookup-table', () => {
-            this._candidateArea.hide();
+        panelService.connect('hide-lookup-table', ps => {
+            this._candidateArea.actor.hide();
            this._updateVisibility();
        });
-        panelService.connect('focus-out', () => {
-            this.close(BoxPointer.PopupAnimation.NONE);
+        panelService.connect('focus-out', ps => {
+            this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
            Main.keyboard.resetSuggestions();
        });
    }

    _setDummyCursorGeometry(x, y, w, h) {
-        this._dummyCursor.set_position(Math.round(x), Math.round(y));
-        this._dummyCursor.set_size(Math.round(w), Math.round(h));
-
-        if (this.visible)
-            this.setPosition(this._dummyCursor, 0);
+        Main.layoutManager.setDummyCursorGeometry(x, y, w, h);
+        if (this._boxPointer.visible)
+            this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
    }

    _updateVisibility() {
-        let isVisible = !Main.keyboard.visible &&
+        let isVisible = (!Main.keyboard.visible &&
                         (this._preeditText.visible ||
                          this._auxText.visible ||
-                          this._candidateArea.visible);
+                          this._candidateArea.actor.visible));

        if (isVisible) {
-            this.setPosition(this._dummyCursor, 0);
-            this.open(BoxPointer.PopupAnimation.NONE);
-            this.get_parent().set_child_above_sibling(this, null);
+            this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
+            this._boxPointer.open(BoxPointer.PopupAnimation.NONE);
+            this._boxPointer.raise_top();
        } else {
-            this.close(BoxPointer.PopupAnimation.NONE);
+            this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
        }
    }

    _setTextAttributes(clutterText, ibusAttrList) {
        let attr;
-        for (let i = 0; (attr = ibusAttrList.get(i)); ++i) {
+        for (let i = 0; (attr = ibusAttrList.get(i)); ++i)
            if (attr.get_attr_type() == IBus.AttrType.BACKGROUND)
                clutterText.set_selection(attr.get_start_index(), attr.get_end_index());
-        }
    }
-});
+};
--- a/js/ui/iconGrid.js
+++ b/js/ui/iconGrid.js
@ -1,17 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BaseIcon, IconGrid, PaginatedIconGrid */

-const { Clutter, GLib, GObject, Graphene, Meta, St } = imports.gi;
+const { Clutter, GObject, Meta, St } = imports.gi;

 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;

 var ICON_SIZE = 96;
 var MIN_ICON_SIZE = 16;

-var EXTRA_SPACE_ANIMATION_TIME = 250;
+var EXTRA_SPACE_ANIMATION_TIME = 0.25;

-var ANIMATION_TIME_IN = 350;
+var ANIMATION_TIME_IN = 0.350;
 var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN;
 var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN;
 var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM;
@ -22,11 +22,11 @@ var ANIMATION_BOUNCE_ICON_SCALE = 1.1;

 var AnimationDirection = {
    IN: 0,
-    OUT: 1,
+    OUT: 1
 };

 var APPICON_ANIMATION_OUT_SCALE = 3;
-var APPICON_ANIMATION_OUT_TIME = 250;
+var APPICON_ANIMATION_OUT_TIME = 0.25;

 var BaseIcon = GObject.registerClass(
 class BaseIcon extends St.Bin {
@ -39,28 +39,23 @@ class BaseIcon extends St.Bin {
        if (params.showLabel)
            styleClass += ' overview-icon-with-label';

-        super._init({ style_class: styleClass });
+        super._init({ style_class: styleClass,
+                      x_fill: true,
+                      y_fill: true });

        this.connect('destroy', this._onDestroy.bind(this));

-        this._box = new St.BoxLayout({
-            vertical: true,
-            x_expand: true,
-            y_expand: true,
-        });
+        this._box = new St.BoxLayout({ vertical: true });
        this.set_child(this._box);

        this.iconSize = ICON_SIZE;
-        this._iconBin = new St.Bin();
+        this._iconBin = new St.Bin({ x_align: St.Align.MIDDLE,
+                                     y_align: St.Align.MIDDLE });

        this._box.add_actor(this._iconBin);

        if (params.showLabel) {
            this.label = new St.Label({ text: label });
-            this.label.clutter_text.set({
-                x_align: Clutter.ActorAlign.CENTER,
-                y_align: Clutter.ActorAlign.CENTER,
-            });
            this._box.add_actor(this.label);
        } else {
            this.label = null;
@ -76,14 +71,14 @@ class BaseIcon extends St.Bin {
        this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this));
    }

-    vfunc_get_preferred_width(_forHeight) {
+    vfunc_get_preferred_width(forHeight) {
        // Return the actual height to keep the squared aspect
        return this.get_preferred_height(-1);
    }

    // This can be overridden by a subclass, or by the createIcon
    // parameter to _init()
-    createIcon(_size) {
+    createIcon(size) {
        throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`);
    }

@ -142,14 +137,6 @@ class BaseIcon extends St.Bin {
        // animating.
        zoomOutActor(this.child);
    }
-
-    animateZoomOutAtPos(x, y) {
-        zoomOutActorAtPos(this.child, x, y);
-    }
-
-    update() {
-        this._createIconTexture(this.iconSize);
-    }
 });

 function clamp(value, min, max) {
@ -157,15 +144,10 @@ function clamp(value, min, max) {
 }

 function zoomOutActor(actor) {
-    let [x, y] = actor.get_transformed_position();
-    zoomOutActorAtPos(actor, x, y);
-}
-
-function zoomOutActorAtPos(actor, x, y) {
    let actorClone = new Clutter.Clone({ source: actor,
                                         reactive: false });
    let [width, height] = actor.get_transformed_size();
-
+    let [x, y] = actor.get_transformed_position();
    actorClone.set_size(width, height);
    actorClone.set_position(x, y);
    actorClone.opacity = 255;
@ -182,16 +164,18 @@ function zoomOutActorAtPos(actor, x, y) {
    let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth);
    let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight);

-    actorClone.ease({
-        scale_x: APPICON_ANIMATION_OUT_SCALE,
-        scale_y: APPICON_ANIMATION_OUT_SCALE,
-        translation_x: containedX - scaledX,
-        translation_y: containedY - scaledY,
-        opacity: 0,
-        duration: APPICON_ANIMATION_OUT_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => actorClone.destroy(),
-    });
+    Tweener.addTween(actorClone,
+                     { time: APPICON_ANIMATION_OUT_TIME,
+                       scale_x: APPICON_ANIMATION_OUT_SCALE,
+                       scale_y: APPICON_ANIMATION_OUT_SCALE,
+                       translation_x: containedX - scaledX,
+                       translation_y: containedY - scaledY,
+                       opacity: 0,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           actorClone.destroy();
+                       }
+                    });
 }

 var IconGrid = GObject.registerClass({
@ -222,8 +206,6 @@ var IconGrid = GObject.registerClass({
        this.rightPadding = 0;
        this.leftPadding = 0;

-        this._updateIconSizesLaterId = 0;
-
        this._items = [];
        this._clonesAnimating = [];
        // Pulled from CSS, but hardcode some defaults here
@ -232,23 +214,15 @@ var IconGrid = GObject.registerClass({
        this._fixedHItemSize = this._fixedVItemSize = undefined;
        this.connect('style-changed', this._onStyleChanged.bind(this));

-        this.connect('actor-added', this._childAdded.bind(this));
-        this.connect('actor-removed', this._childRemoved.bind(this));
-        this.connect('destroy', this._onDestroy.bind(this));
-    }
-
-    vfunc_unmap() {
        // Cancel animations when hiding the overview, to avoid icons
        // swarming into the void ...
-        this._resetAnimationActors();
-        super.vfunc_unmap();
-    }
+        this.connect('notify::mapped', () => {
+            if (!this.mapped)
+                this._cancelAnimation();
+        });

-    _onDestroy() {
-        if (this._updateIconSizesLaterId) {
-            Meta.later_remove(this._updateIconSizesLaterId);
-            this._updateIconSizesLaterId = 0;
-        }
+        this.connect('actor-added', this._childAdded.bind(this));
+        this.connect('actor-removed', this._childRemoved.bind(this));
    }

    _keyFocusIn(actor) {
@ -257,35 +231,22 @@ var IconGrid = GObject.registerClass({

    _childAdded(grid, child) {
        child._iconGridKeyFocusInId = child.connect('key-focus-in', this._keyFocusIn.bind(this));
-
-        child._paintVisible = child.opacity > 0;
-        child._opacityChangedId = child.connect('notify::opacity', () => {
-            let paintVisible = child._paintVisible;
-            child._paintVisible = child.opacity > 0;
-            if (paintVisible !== child._paintVisible)
-                this.queue_relayout();
-        });
    }

    _childRemoved(grid, child) {
        child.disconnect(child._iconGridKeyFocusInId);
-        delete child._iconGridKeyFocusInId;
-
-        child.disconnect(child._opacityChangedId);
-        delete child._opacityChangedId;
-        delete child._paintVisible;
    }

-    vfunc_get_preferred_width(_forHeight) {
+    vfunc_get_preferred_width(forHeight) {
        if (this._fillParent)
            // Ignore all size requests of children and request a size of 0;
            // later we'll allocate as many children as fit the parent
            return [0, 0];

        let nChildren = this.get_n_children();
-        let nColumns = this._colLimit
-            ? Math.min(this._colLimit, nChildren)
-            : nChildren;
+        let nColumns = this._colLimit ? Math.min(this._colLimit,
+                                                 nChildren)
+                                      : nChildren;
        let totalSpacing = Math.max(0, nColumns - 1) * this._getSpacing();
        // Kind of a lie, but not really an issue right now.  If
        // we wanted to support some sort of hidden/overflow that would
@ -403,7 +364,7 @@ var IconGrid = GObject.registerClass({
        let allocationBox = this.get_allocation_box();
        let paintBox = themeNode.get_paint_box(allocationBox);

-        let origin = new Graphene.Point3D();
+        let origin = new Clutter.Vertex();
        origin.x = paintBox.x1 - allocationBox.x1;
        origin.y = paintBox.y1 - allocationBox.y1;
        origin.z = 0.0;
@ -432,35 +393,35 @@ var IconGrid = GObject.registerClass({
        return true;
    }

-    /*
+    /**
     * Intended to be override by subclasses if they need a different
     * set of items to be animated.
     */
    _getChildrenToAnimate() {
-        return this._getVisibleChildren().filter(child => child.opacity > 0);
+        return this._getVisibleChildren();
    }

-    _resetAnimationActors() {
+    _cancelAnimation() {
+        this._clonesAnimating.forEach(clone => clone.destroy());
+        this._clonesAnimating = [];
+    }
+
+    _animationDone() {
        this._clonesAnimating.forEach(clone => {
            clone.source.reactive = true;
            clone.source.opacity = 255;
            clone.destroy();
        });
        this._clonesAnimating = [];
-    }
-
-    _animationDone() {
-        this._resetAnimationActors();
        this.emit('animation-done');
    }

    animatePulse(animationDirection) {
-        if (animationDirection != AnimationDirection.IN) {
+        if (animationDirection != AnimationDirection.IN)
            throw new GObject.NotImplementedError("Pulse animation only implements " +
                                                  "'in' animation direction");
-        }

-        this._resetAnimationActors();
+        this._cancelAnimation();

        let actors = this._getChildrenToAnimate();
        if (actors.length == 0) {
@ -483,32 +444,30 @@ var IconGrid = GObject.registerClass({
            let delay = index / actors.length * maxDelay;
            let bounceUpTime = ANIMATION_TIME_IN / 4;
            let isLastItem = index == actors.length - 1;
-            actor.ease({
-                scale_x: ANIMATION_BOUNCE_ICON_SCALE,
-                scale_y: ANIMATION_BOUNCE_ICON_SCALE,
-                duration: bounceUpTime,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                delay,
-                onComplete: () => {
-                    let duration = ANIMATION_TIME_IN - bounceUpTime;
-                    actor.ease({
-                        scale_x: 1,
-                        scale_y: 1,
-                        duration,
-                        mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                        onComplete: () => {
-                            if (isLastItem)
-                                this._animationDone();
-                            actor.reactive = true;
-                        },
-                    });
-                },
-            });
+            Tweener.addTween(actor,
+                             { time: bounceUpTime,
+                               transition: 'easeInOutQuad',
+                               delay: delay,
+                               scale_x: ANIMATION_BOUNCE_ICON_SCALE,
+                               scale_y: ANIMATION_BOUNCE_ICON_SCALE,
+                               onComplete: () => {
+                                   Tweener.addTween(actor,
+                                                    { time: ANIMATION_TIME_IN - bounceUpTime,
+                                                      transition: 'easeInOutQuad',
+                                                      scale_x: 1,
+                                                      scale_y: 1,
+                                                      onComplete: () => {
+                                                          if (isLastItem)
+                                                              this._animationDone();
+                                                      }
+                                                    });
+                               }
+                             });
        }
    }

    animateSpring(animationDirection, sourceActor) {
-        this._resetAnimationActors();
+        this._cancelAnimation();

        let actors = this._getChildrenToAnimate();
        if (actors.length == 0) {
@ -562,25 +521,21 @@ var IconGrid = GObject.registerClass({

                let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM;
                let [finalX, finalY]  = actor._transformedPosition;
-                movementParams = {
-                    x: finalX,
-                    y: finalY,
-                    scale_x: 1,
-                    scale_y: 1,
-                    duration: ANIMATION_TIME_IN,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay,
-                };
-
-                if (isLastItem)
-                    movementParams.onComplete = this._animationDone.bind(this);
-
-                fadeParams = {
-                    opacity: 255,
-                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay,
-                };
+                movementParams = { time: ANIMATION_TIME_IN,
+                                   transition: 'easeInOutQuad',
+                                   delay: delay,
+                                   x: finalX,
+                                   y: finalY,
+                                   scale_x: 1,
+                                   scale_y: 1,
+                                   onComplete: () => {
+                                       if (isLastItem)
+                                           this._animationDone();
+                                   } };
+                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               transition: 'easeInOutQuad',
+                               delay: delay,
+                               opacity: 255 };
            } else {
                let isLastItem = actor._distance == maxDist;

@ -588,29 +543,26 @@ var IconGrid = GObject.registerClass({
                actorClone.set_position(startX, startY);

                let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM;
-                movementParams = {
-                    x: adjustedSourcePositionX,
-                    y: adjustedSourcePositionY,
-                    scale_x: scaleX,
-                    scale_y: scaleY,
-                    duration: ANIMATION_TIME_OUT,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay,
-                };
-
-                if (isLastItem)
-                    movementParams.onComplete = this._animationDone.bind(this);
-
-                fadeParams = {
-                    opacity: 0,
-                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                };
+                movementParams = { time: ANIMATION_TIME_OUT,
+                                   transition: 'easeInOutQuad',
+                                   delay: delay,
+                                   x: adjustedSourcePositionX,
+                                   y: adjustedSourcePositionY,
+                                   scale_x: scaleX,
+                                   scale_y: scaleY,
+                                   onComplete: () => {
+                                       if (isLastItem)
+                                           this._animationDone();
+                                   } };
+                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               transition: 'easeInOutQuad',
+                               delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               opacity: 0 };
            }

-            actorClone.ease(movementParams);
-            actorClone.ease(fadeParams);
+
+            Tweener.addTween(actorClone, movementParams);
+            Tweener.addTween(actorClone, fadeParams);
        }
    }

@ -678,8 +630,8 @@ var IconGrid = GObject.registerClass({

    nRows(forWidth) {
        let children = this._getVisibleChildren();
-        let nColumns = forWidth < 0 ? children.length : this._computeLayout(forWidth)[0];
-        let nRows = nColumns > 0 ? Math.ceil(children.length / nColumns) : 0;
+        let nColumns = (forWidth < 0) ? children.length : this._computeLayout(forWidth)[0];
+        let nRows = (nColumns > 0) ? Math.ceil(children.length / nColumns) : 0;
        if (this._rowLimit)
            nRows = Math.min(nRows, this._rowLimit);
        return nRows;
@ -719,13 +671,13 @@ var IconGrid = GObject.registerClass({

        this._items.push(item);
        if (index !== undefined)
-            this.insert_child_at_index(item, index);
+            this.insert_child_at_index(item.actor, index);
        else
-            this.add_actor(item);
+            this.add_actor(item.actor);
    }

    removeItem(item) {
-        this.remove_child(item);
+        this.remove_child(item.actor);
    }

    getItemAtIndex(index) {
@ -785,7 +737,7 @@ var IconGrid = GObject.registerClass({
            this.topPadding = this.rightPadding = this.bottomPadding = this.leftPadding = spacing;
    }

-    /*
+    /**
     * This function must to be called before iconGrid allocation,
     * to know how much spacing can the grid has
     */
@ -798,29 +750,24 @@ var IconGrid = GObject.registerClass({
            let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth;
            let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight;

-            let neededSpacePerItem = neededWidth > neededHeight
-                ? Math.ceil(neededWidth / this._minColumns)
-                : Math.ceil(neededHeight / this._minRows);
+            let neededSpacePerItem = (neededWidth > neededHeight) ? Math.ceil(neededWidth / this._minColumns)
+                                                                  : Math.ceil(neededHeight / this._minRows);
            this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE);
            this._fixedVItemSize = Math.max(this._vItemSize - neededSpacePerItem, MIN_ICON_SIZE);

            this._updateSpacingForSize(availWidth, availHeight);
        }
-        if (!this._updateIconSizesLaterId) {
-            this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
-                                                          this._updateIconSizes.bind(this));
-        }
+        Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
+                       this._updateIconSizes.bind(this));
    }

    // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
    _updateIconSizes() {
-        this._updateIconSizesLaterId = 0;
        let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
        let newIconSize = Math.floor(ICON_SIZE * scale);
-        for (let i in this._items)
+        for (let i in this._items) {
            this._items[i].icon.setIconSize(newIconSize);
-
-        return GLib.SOURCE_REMOVE;
+        }
    }
 });

@ -837,7 +784,7 @@ var PaginatedIconGrid = GObject.registerClass({
        this._childrenPerPage = 0;
    }

-    vfunc_get_preferred_height(_forWidth) {
+    vfunc_get_preferred_height(forWidth) {
        let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages;
        return [height, height];
    }
@ -881,9 +828,9 @@ var PaginatedIconGrid = GObject.registerClass({
            children[i].show();

            columnIndex++;
-            if (columnIndex == nColumns)
+            if (columnIndex == nColumns) {
                columnIndex = 0;
-
+            }
            if (columnIndex == 0) {
                y += this._getVItemSize() + spacing;
                if ((i + 1) % this._childrenPerPage == 0)
@ -897,7 +844,7 @@ var PaginatedIconGrid = GObject.registerClass({

    // Overridden from IconGrid
    _getChildrenToAnimate() {
-        let children = super._getChildrenToAnimate();
+        let children = this._getVisibleChildren();
        let firstIndex = this._childrenPerPage * this.currentPage;
        let lastIndex = firstIndex + this._childrenPerPage;

@ -905,7 +852,7 @@ var PaginatedIconGrid = GObject.registerClass({
    }

    _computePages(availWidthPerPage, availHeightPerPage) {
-        let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage);
+        let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage);
        let nRows;
        let children = this._getVisibleChildren();
        if (nColumns > 0)
@ -958,16 +905,15 @@ var PaginatedIconGrid = GObject.registerClass({

    /**
    * openExtraSpace:
-    * @param {Clutter.Actor} sourceItem: item for which to create extra space
-    * @param {St.Side} side: where @sourceItem should be located relative to
-    *   the created space
-    * @param {number} nRows: the amount of space to create
+    * @sourceItem: the item for which to create extra space
+    * @side: where @sourceItem should be located relative to the created space
+    * @nRows: the amount of space to create
    *
    * Pan view to create extra space for @nRows above or below @sourceItem.
    */
    openExtraSpace(sourceItem, side, nRows) {
        let children = this._getVisibleChildren();
-        let index = children.indexOf(sourceItem);
+        let index = children.indexOf(sourceItem.actor);
        if (index == -1)
            throw new Error('Item not found.');

@ -977,7 +923,8 @@ var PaginatedIconGrid = GObject.registerClass({
        let childrenPerRow = this._childrenPerPage / this._rowsPerPage;
        let sourceRow = Math.floor((index - pageOffset) / childrenPerRow);

-        let nRowsAbove = side == St.Side.TOP ? sourceRow + 1 : sourceRow;
+        let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1
+                                               : sourceRow;
        let nRowsBelow = this._rowsPerPage - nRowsAbove;

        let nRowsUp, nRowsDown;
@ -1017,14 +964,13 @@ var PaginatedIconGrid = GObject.registerClass({

        for (let i = 0; i < children.length; i++) {
            children[i].translation_y = 0;
-            let params = {
-                translation_y: translationY,
-                duration: EXTRA_SPACE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-            };
+            let params = { translation_y: translationY,
+                           time: EXTRA_SPACE_ANIMATION_TIME,
+                           transition: 'easeInOutQuad'
+                         };
            if (i == (children.length - 1))
                params.onComplete = () => this.emit('space-opened');
-            children[i].ease(params);
+            Tweener.addTween(children[i], params);
        }
    }

@ -1037,12 +983,12 @@ var PaginatedIconGrid = GObject.registerClass({
        for (let i = 0; i < this._translatedChildren.length; i++) {
            if (!this._translatedChildren[i].translation_y)
                continue;
-            this._translatedChildren[i].ease({
-                translation_y: 0,
-                duration: EXTRA_SPACE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                onComplete: () => this.emit('space-closed'),
-            });
+            Tweener.addTween(this._translatedChildren[i],
+                             { translation_y: 0,
+                               time: EXTRA_SPACE_ANIMATION_TIME,
+                               transition: 'easeInOutQuad',
+                               onComplete: () => this.emit('space-closed')
+                             });
        }
    }
 });
--- a/js/ui/inhibitShortcutsDialog.js
+++ b/js/ui/inhibitShortcutsDialog.js
@ -1,4 +1,3 @@
-/* exported InhibitShortcutsDialog */
 const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi;

 const Dialog = imports.ui.dialog;
@ -18,8 +17,8 @@ var DialogResponse = Meta.InhibitShortcutsDialogResponse;
 var InhibitShortcutsDialog = GObject.registerClass({
    Implements: [Meta.InhibitShortcutsDialog],
    Properties: {
-        'window': GObject.ParamSpec.override('window', Meta.InhibitShortcutsDialog),
-    },
+        'window': GObject.ParamSpec.override('window', Meta.InhibitShortcutsDialog)
+    }
 }, class InhibitShortcutsDialog extends GObject.Object {
    _init(window) {
        super._init();
@ -76,19 +75,17 @@ var InhibitShortcutsDialog = GObject.registerClass({
        let name = this._app ? this._app.get_name() : this._window.title;

        /* Translators: %s is an application name like "Settings" */
-        let title = name
-            ? _("%s wants to inhibit shortcuts").format(name)
-            : _("Application wants to inhibit shortcuts");
+        let title = name ? _("%s wants to inhibit shortcuts").format(name)
+                         : _("Application wants to inhibit shortcuts");
        let icon = new Gio.ThemedIcon({ name: 'dialog-warning-symbolic' });

        let contentParams = { icon, title };

        let restoreAccel = this._getRestoreAccel();
-        if (restoreAccel) {
+        if (restoreAccel)
            contentParams.subtitle =
                /* Translators: %s is a keyboard shortcut like "Super+x" */
                _("You can restore shortcuts by pressing %s.").format(restoreAccel);
-        }

        let content = new Dialog.MessageDialogContent(contentParams);
        this._dialog.contentLayout.add_actor(content);
@ -135,14 +132,14 @@ var InhibitShortcutsDialog = GObject.registerClass({

            this._permStore.LookupRemote(APP_PERMISSIONS_TABLE,
                                         APP_PERMISSIONS_ID,
-                (res, err) => {
-                    if (err) {
+                (res, error) => {
+                    if (error) {
                        this._dialog.open();
-                        log(err.message);
+                        log(error.message);
                        return;
                    }

-                    let [permissions] = res;
+                    let [permissions, data] = res;
                    if (permissions[appId] === undefined) // Not found
                        this._dialog.open();
                    else if (permissions[appId] == GRANTED)
--- a/js/ui/kbdA11yDialog.js
+++ b/js/ui/kbdA11yDialog.js
@ -1,4 +1,3 @@
-/* exported KbdA11yDialog */
 const { Clutter, Gio, GObject } = imports.gi;

 const Dialog = imports.ui.dialog;
@ -27,24 +26,24 @@ class KbdA11yDialog extends GObject.Object {

        if (whatChanged & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) {
            key = KEY_SLOW_KEYS_ENABLED;
-            enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) > 0;
-            title = enabled
-                ? _("Slow Keys Turned On")
-                : _("Slow Keys Turned Off");
+            enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) ? true : false;
+            title = enabled ?
+                    _("Slow Keys Turned On") :
+                    _("Slow Keys Turned Off");
            body = _("You just held down the Shift key for 8 seconds. This is the shortcut " +
                     "for the Slow Keys feature, which affects the way your keyboard works.");

        } else  if (whatChanged & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) {
            key = KEY_STICKY_KEYS_ENABLED;
-            enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) > 0;
-            title = enabled
-                ? _("Sticky Keys Turned On")
-                : _("Sticky Keys Turned Off");
-            body = enabled
-                ? _("You just pressed the Shift key 5 times in a row. This is the shortcut " +
-                  "for the Sticky Keys feature, which affects the way your keyboard works.")
-                : _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
-                  "This turns off the Sticky Keys feature, which affects the way your keyboard works.");
+            enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) ? true : false;
+            title = enabled ?
+                    _("Sticky Keys Turned On") :
+                    _("Sticky Keys Turned Off");
+            body = enabled ?
+                   _("You just pressed the Shift key 5 times in a row. This is the shortcut " +
+                     "for the Sticky Keys feature, which affects the way your keyboard works.") :
+                   _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
+                     "This turns off the Sticky Keys feature, which affects the way your keyboard works.");
        } else {
            return;
        }
@ -61,7 +60,7 @@ class KbdA11yDialog extends GObject.Object {
                               dialog.close();
                           },
                           default: enabled,
-                           key: !enabled ? Clutter.KEY_Escape : null });
+                           key: !enabled ? Clutter.Escape : null });

        dialog.addButton({ label: enabled ? _("Turn Off") : _("Leave Off"),
                           action: () => {
@ -69,7 +68,7 @@ class KbdA11yDialog extends GObject.Object {
                               dialog.close();
                           },
                           default: !enabled,
-                           key: enabled ? Clutter.KEY_Escape : null });
+                           key: enabled ? Clutter.Escape : null });

        dialog.open();
    }
--- a/js/ui/keyboard.js
+++ b/js/ui/keyboard.js
--- a/js/ui/layout.js
+++ b/js/ui/layout.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported MonitorConstraint, LayoutManager */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;
@ -11,11 +10,12 @@ const LoginManager = imports.misc.loginManager;
 const DND = imports.ui.dnd;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const Ripples = imports.ui.ripples;

-var STARTUP_ANIMATION_TIME = 500;
-var KEYBOARD_ANIMATION_TIME = 150;
-var BACKGROUND_FADE_ANIMATION_TIME = 1000;
+var STARTUP_ANIMATION_TIME = 0.5;
+var KEYBOARD_ANIMATION_TIME = 0.15;
+var BACKGROUND_FADE_ANIMATION_TIME = 1.0;

 var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels
 var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms
@ -44,7 +44,7 @@ var MonitorConstraint = GObject.registerClass({
        'work-area': GObject.ParamSpec.boolean('work-area',
                                               'Work-area', 'Track monitor\'s work-area',
                                               GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                               false),
+                                               false)
    },
 }, class MonitorConstraint extends Clutter.Constraint {
    _init(props) {
@ -80,12 +80,10 @@ var MonitorConstraint = GObject.registerClass({
        this.notify('index');
    }

-    // eslint-disable-next-line camelcase
    get work_area() {
        return this._workArea;
    }

-    // eslint-disable-next-line camelcase
    set work_area(v) {
        if (v == this._workArea)
            return;
@ -167,12 +165,12 @@ var Monitor = class Monitor {

 const UiActor = GObject.registerClass(
 class UiActor extends St.Widget {
-    vfunc_get_preferred_width(_forHeight) {
+    vfunc_get_preferred_width (forHeight) {
        let width = global.stage.width;
        return [width, width];
    }

-    vfunc_get_preferred_height(_forWidth) {
+    vfunc_get_preferred_height (forWidth) {
        let height = global.stage.height;
        return [height, height];
    }
@ -181,7 +179,7 @@ class UiActor extends St.Widget {
 const defaultParams = {
    trackFullscreen: false,
    affectsStruts: false,
-    affectsInputRegion: true,
+    affectsInputRegion: true
 };

 var LayoutManager = GObject.registerClass({
@ -189,13 +187,12 @@ var LayoutManager = GObject.registerClass({
               'startup-complete': {},
               'startup-prepared': {},
               'monitors-changed': {},
-               'system-modal-opened': {},
               'keyboard-visible-changed': { param_types: [GObject.TYPE_BOOLEAN] } },
 }, class LayoutManager extends GObject.Object {
    _init() {
        super._init();

-        this._rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL;
+        this._rtl = (Clutter.get_default_text_direction() == Clutter.TextDirection.RTL);
        this.monitors = [];
        this.primaryMonitor = null;
        this.primaryIndex = -1;
@ -213,6 +210,11 @@ var LayoutManager = GObject.registerClass({
        this._startingUp = true;
        this._pendingLoadBackground = false;

+        // We don't want to paint the stage background color because either
+        // the SystemBackground we create or the MetaBackgroundActor inside
+        // global.window_group covers the entirety of the screen.
+        global.stage.no_clear_hint = true;
+
        // Set up stage hierarchy to group all UI actors under one container.
        this.uiGroup = new UiActor({ name: 'uiGroup' });
        this.uiGroup.set_flags(Clutter.ActorFlags.NO_LAYOUT);
@ -234,12 +236,11 @@ var LayoutManager = GObject.registerClass({
                                             reactive: true });
        this.addChrome(this.overviewGroup);

-        this.screenShieldGroup = new St.Widget({
-            name: 'screenShieldGroup',
-            visible: false,
-            clip_to_allocation: true,
-            layout_manager: new Clutter.BinLayout(),
-        });
+        this.screenShieldGroup = new St.Widget({ name: 'screenShieldGroup',
+                                                 visible: false,
+                                                 clip_to_allocation: true,
+                                                 layout_manager: new Clutter.BinLayout(),
+                                               });
        this.addChrome(this.screenShieldGroup);

        this.panelBox = new St.BoxLayout({ name: 'panelBox',
@ -270,11 +271,11 @@ var LayoutManager = GObject.registerClass({

        this._backgroundGroup = new Meta.BackgroundGroup();
        global.window_group.add_child(this._backgroundGroup);
-        global.window_group.set_child_below_sibling(this._backgroundGroup, null);
+        this._backgroundGroup.lower_bottom();
        this._bgManagers = [];

        this._interfaceSettings = new Gio.Settings({
-            schema_id: 'org.gnome.desktop.interface',
+            schema_id: 'org.gnome.desktop.interface'
        });

        this._interfaceSettings.connect('changed::enable-hot-corners',
@ -340,11 +341,10 @@ var LayoutManager = GObject.registerClass({

        this.monitors = [];
        let nMonitors = display.get_n_monitors();
-        for (let i = 0; i < nMonitors; i++) {
+        for (let i = 0; i < nMonitors; i++)
            this.monitors.push(new Monitor(i,
                                           display.get_monitor_geometry(i),
                                           display.get_monitor_scale(i)));
-        }

        if (nMonitors == 0) {
            this.primaryIndex = this.bottomIndex = -1;
@ -447,7 +447,7 @@ var LayoutManager = GObject.registerClass({
    _createBackgroundManager(monitorIndex) {
        let bgManager = new Background.BackgroundManager({ container: this._backgroundGroup,
                                                           layoutManager: this,
-                                                           monitorIndex });
+                                                           monitorIndex: monitorIndex });

        bgManager.connect('changed', this._addBackgroundMenu.bind(this));
        this._addBackgroundMenu(bgManager);
@ -461,17 +461,17 @@ var LayoutManager = GObject.registerClass({
                let backgroundActor = this._bgManagers[i].backgroundActor;
                backgroundActor.show();
                backgroundActor.opacity = 0;
-                backgroundActor.ease({
-                    opacity: 255,
-                    duration: BACKGROUND_FADE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                });
+                Tweener.addTween(backgroundActor,
+                                 { opacity: 255,
+                                   time: BACKGROUND_FADE_ANIMATION_TIME,
+                                   transition: 'easeOutQuad' });
            }
        }
    }

    _updateBackgrounds() {
-        for (let i = 0; i < this._bgManagers.length; i++)
+        let i;
+        for (i = 0; i < this._bgManagers.length; i++)
            this._bgManagers[i].destroy();

        this._bgManagers = [];
@ -602,17 +602,17 @@ var LayoutManager = GObject.registerClass({
            return;
        }
        this._systemBackground = new Background.SystemBackground();
-        this._systemBackground.hide();
+        this._systemBackground.actor.hide();

-        global.stage.insert_child_below(this._systemBackground, null);
+        global.stage.insert_child_below(this._systemBackground.actor, null);

        let constraint = new Clutter.BindConstraint({ source: global.stage,
                                                      coordinate: Clutter.BindCoordinate.ALL });
-        this._systemBackground.add_constraint(constraint);
+        this._systemBackground.actor.add_constraint(constraint);

        let signalId = this._systemBackground.connect('loaded', () => {
            this._systemBackground.disconnect(signalId);
-            this._systemBackground.show();
+            this._systemBackground.actor.show();
            global.stage.show();

            this._prepareStartupAnimation();
@ -695,30 +695,30 @@ var LayoutManager = GObject.registerClass({
    }

    _startupAnimationGreeter() {
-        this.panelBox.ease({
-            translation_y: 0,
-            duration: STARTUP_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete(),
-        });
+        Tweener.addTween(this.panelBox,
+                         { translation_y: 0,
+                           time: STARTUP_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._startupAnimationComplete,
+                           onCompleteScope: this });
    }

    _startupAnimationSession() {
-        this.uiGroup.ease({
-            scale_x: 1,
-            scale_y: 1,
-            opacity: 255,
-            duration: STARTUP_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete(),
-        });
+        Tweener.addTween(this.uiGroup,
+                         { scale_x: 1,
+                           scale_y: 1,
+                           opacity: 255,
+                           time: STARTUP_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._startupAnimationComplete,
+                           onCompleteScope: this });
    }

    _startupAnimationComplete() {
        this._coverPane.destroy();
        this._coverPane = null;

-        this._systemBackground.destroy();
+        this._systemBackground.actor.destroy();
        this._systemBackground = null;

        this._startingUp = false;
@ -737,15 +737,14 @@ var LayoutManager = GObject.registerClass({

    showKeyboard() {
        this.keyboardBox.show();
-        this.keyboardBox.ease({
-            anchor_y: this.keyboardBox.height,
-            opacity: 255,
-            duration: KEYBOARD_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._showKeyboardComplete();
-            },
-        });
+        Tweener.addTween(this.keyboardBox,
+                         { anchor_y: this.keyboardBox.height,
+                           opacity: 255,
+                           time: KEYBOARD_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._showKeyboardComplete,
+                           onCompleteScope: this
+                         });
        this.emit('keyboard-visible-changed', true);
    }

@ -764,15 +763,14 @@ var LayoutManager = GObject.registerClass({
            this.keyboardBox.disconnect(this._keyboardHeightNotifyId);
            this._keyboardHeightNotifyId = 0;
        }
-        this.keyboardBox.ease({
-            anchor_y: 0,
-            opacity: 0,
-            duration: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD,
-            onComplete: () => {
-                this._hideKeyboardComplete();
-            },
-        });
+        Tweener.addTween(this.keyboardBox,
+                         { anchor_y: 0,
+                           opacity: 0,
+                           time: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
+                           transition: 'easeInQuad',
+                           onComplete: this._hideKeyboardComplete,
+                           onCompleteScope: this
+                         });

        this.emit('keyboard-visible-changed', false);
    }
@ -851,13 +849,12 @@ var LayoutManager = GObject.registerClass({
            index = this._findActor(ancestor);
        }

-        let ancestorData = ancestor
-            ? this._trackedActors[index]
-            : defaultParams;
+        let ancestorData = ancestor ? this._trackedActors[index]
+                                    : defaultParams;
        // We can't use Params.parse here because we want to drop
        // the extra values like ancestorData.actor
        for (let prop in defaultParams) {
-            if (!Object.prototype.hasOwnProperty.call(params, prop))
+            if (!params.hasOwnProperty(prop))
                params[prop] = ancestorData[prop];
        }

@ -957,7 +954,7 @@ var LayoutManager = GObject.registerClass({
    findIndexForActor(actor) {
        let [x, y] = actor.get_transformed_position();
        let [w, h] = actor.get_transformed_size();
-        let rect = new Meta.Rectangle({ x, y, width: w, height: h });
+        let rect = new Meta.Rectangle({ x: x, y: y, width: w, height: h });
        return global.display.get_monitor_index_for_rect(rect);
    }

@ -972,10 +969,9 @@ var LayoutManager = GObject.registerClass({
        if (this._startingUp)
            return;

-        if (!this._updateRegionIdle) {
+        if (!this._updateRegionIdle)
            this._updateRegionIdle = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
                                                    this._updateRegions.bind(this));
-        }
    }

    _getWindowActorsForWorkspace(workspace) {
@ -1012,6 +1008,11 @@ var LayoutManager = GObject.registerClass({
        if (Main.modalCount > 0)
            return GLib.SOURCE_REMOVE;

+        // Bug workaround - get_transformed_position()/get_transformed_size() don't work after
+        // a change in stage size until the first pick or paint.
+        // https://bugzilla.gnome.org/show_bug.cgi?id=761565
+        global.stage.get_actor_at_pos(Clutter.PickMode.ALL, 0, 0);
+
        let rects = [], struts = [], i;
        let isPopupMenuVisible = global.top_window_group.get_children().some(isPopupMetaWindow);
        let wantsInputRegion = !isPopupMenuVisible;
@ -1029,7 +1030,7 @@ var LayoutManager = GObject.registerClass({
            h = Math.round(h);

            if (actorData.affectsInputRegion && wantsInputRegion && actorData.actor.get_paint_visibility())
-                rects.push(new Meta.Rectangle({ x, y, width: w, height: h }));
+                rects.push(new Meta.Rectangle({ x: x, y: y, width: w, height: h }));

            let monitor = null;
            if (actorData.affectsStruts)
@ -1067,20 +1068,19 @@ var LayoutManager = GObject.registerClass({
                        side = Meta.Side.RIGHT;
                    else
                        continue;
-                } else if (x1 <= monitor.x) {
+                } else if (x1 <= monitor.x)
                    side = Meta.Side.LEFT;
-                } else if (y1 <= monitor.y) {
+                else if (y1 <= monitor.y)
                    side = Meta.Side.TOP;
-                } else if (x2 >= monitor.x + monitor.width) {
+                else if (x2 >= monitor.x + monitor.width)
                    side = Meta.Side.RIGHT;
-                } else if (y2 >= monitor.y + monitor.height) {
+                else if (y2 >= monitor.y + monitor.height)
                    side = Meta.Side.BOTTOM;
-                } else {
+                else
                    continue;
-                }

                let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 });
-                let strut = new Meta.Strut({ rect: strutRect, side });
+                let strut = new Meta.Strut({ rect: strutRect, side: side });
                struts.push(strut);
            }
        }
@ -1109,11 +1109,8 @@ var LayoutManager = GObject.registerClass({
 //
 // This class manages a "hot corner" that can toggle switching to
 // overview.
-var HotCorner = GObject.registerClass(
-class HotCorner extends Clutter.Actor {
-    _init(layoutManager, monitor, x, y) {
-        super._init();
-
+var HotCorner = class HotCorner {
+    constructor(layoutManager, monitor, x, y) {
        // We use this flag to mark the case where the user has entered the
        // hot corner and has not left both the hot corner and a surrounding
        // guard area (the "environs"). This avoids triggering the hot corner
@ -1142,8 +1139,6 @@ class HotCorner extends Clutter.Actor {

        this._ripples = new Ripples.Ripples(px, py, 'ripple-box');
        this._ripples.addTo(layoutManager.uiGroup);
-
-        this.connect('destroy', this._onDestroy.bind(this));
    }

    setBarrierSize(size) {
@ -1183,14 +1178,11 @@ class HotCorner extends Clutter.Actor {

    _setupFallbackCornerIfNeeded(layoutManager) {
        if (!global.display.supports_extended_barriers()) {
-            this.set({
-                name: 'hot-corner-environs',
-                x: this._x,
-                y: this._y,
-                width: 3,
-                height: 3,
-                reactive: true,
-            });
+            this.actor = new Clutter.Actor({ name: 'hot-corner-environs',
+                                             x: this._x, y: this._y,
+                                             width: 3,
+                                             height: 3,
+                                             reactive: true });

            this._corner = new Clutter.Actor({ name: 'hot-corner',
                                               width: 1,
@ -1199,16 +1191,19 @@ class HotCorner extends Clutter.Actor {
                                               reactive: true });
            this._corner._delegate = this;

-            this.add_child(this._corner);
-            layoutManager.addChrome(this);
+            this.actor.add_child(this._corner);
+            layoutManager.addChrome(this.actor);

            if (Clutter.get_default_text_direction() == Clutter.TextDirection.RTL) {
-                this._corner.set_position(this.width - this._corner.width, 0);
-                this.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST);
+                this._corner.set_position(this.actor.width - this._corner.width, 0);
+                this.actor.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST);
            } else {
                this._corner.set_position(0, 0);
            }

+            this.actor.connect('leave-event',
+                               this._onEnvironsLeft.bind(this));
+
            this._corner.connect('enter-event',
                                 this._onCornerEntered.bind(this));
            this._corner.connect('leave-event',
@ -1216,12 +1211,13 @@ class HotCorner extends Clutter.Actor {
        }
    }

-    _onDestroy() {
+    destroy() {
        this.setBarrierSize(0);
        this._pressureBarrier.destroy();
        this._pressureBarrier = null;

-        this._ripples.destroy();
+        if (this.actor)
+            this.actor.destroy();
    }

    _toggleOverview() {
@ -1234,7 +1230,7 @@ class HotCorner extends Clutter.Actor {
        }
    }

-    handleDragOver(source, _actor, _x, _y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        if (source != Main.xdndHandler)
            return DND.DragMotionResult.CONTINUE;

@ -1252,18 +1248,18 @@ class HotCorner extends Clutter.Actor {
    }

    _onCornerLeft(actor, event) {
-        if (event.get_related() != this)
+        if (event.get_related() != this.actor)
            this._entered = false;
        // Consume event, otherwise this will confuse onEnvironsLeft
        return Clutter.EVENT_STOP;
    }

-    vfunc_leave_event(crossingEvent) {
-        if (crossingEvent.related != this._corner)
+    _onEnvironsLeft(actor, event) {
+        if (event.get_related() != this._corner)
            this._entered = false;
        return Clutter.EVENT_PROPAGATE;
    }
-});
+};

 var PressureBarrier = class PressureBarrier {
    constructor(threshold, timeout, actionMode) {
@ -1335,7 +1331,7 @@ var PressureBarrier = class PressureBarrier {
        let threshold = this._lastTime - this._timeout;

        while (i < this._barrierEvents.length) {
-            let [time, distance_] = this._barrierEvents[i];
+            let [time, distance] = this._barrierEvents[i];
            if (time >= threshold)
                break;
            i++;
@ -1344,14 +1340,14 @@ var PressureBarrier = class PressureBarrier {
        let firstNewEvent = i;

        for (i = 0; i < firstNewEvent; i++) {
-            let [time_, distance] = this._barrierEvents[i];
+            let [time, distance] = this._barrierEvents[i];
            this._currentPressure -= distance;
        }

        this._barrierEvents = this._barrierEvents.slice(firstNewEvent);
    }

-    _onBarrierLeft(barrier, _event) {
+    _onBarrierLeft(barrier, event) {
        barrier._isHit = false;
        if (this._barriers.every(b => !b._isHit)) {
            this._reset();
--- a/js/ui/lightbox.js
+++ b/js/ui/lightbox.js
@ -1,9 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Lightbox */

 const { Clutter, GObject, Shell, St } = imports.gi;
+const Signals = imports.signals;

 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 var DEFAULT_FADE_FACTOR = 0.4;
 var VIGNETTE_BRIGHTNESS = 0.2;
@ -22,31 +23,16 @@ t = clamp(t, 0.0, 1.0);\n\
 float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\
 cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);';

-var RadialShaderEffect = GObject.registerClass({
-    Properties: {
-        'brightness': GObject.ParamSpec.float(
-            'brightness', 'brightness', 'brightness',
-            GObject.ParamFlags.READWRITE,
-            0, 1, 1
-        ),
-        'sharpness': GObject.ParamSpec.float(
-            'sharpness', 'sharpness', 'sharpness',
-            GObject.ParamFlags.READWRITE,
-            0, 1, 0
-        ),
-    },
-}, class RadialShaderEffect extends Shell.GLSLEffect {
+var RadialShaderQuad = GObject.registerClass(
+class RadialShaderQuad extends Shell.GLSLQuad {
    _init(params) {
-        this._brightness = undefined;
-        this._sharpness = undefined;
-
        super._init(params);

        this._brightnessLocation = this.get_uniform_location('brightness');
        this._sharpnessLocation = this.get_uniform_location('vignette_sharpness');

        this.brightness = 1.0;
-        this.sharpness = 0.0;
+        this.vignetteSharpness = 0.0;
    }

    vfunc_build_pipeline() {
@ -59,25 +45,19 @@ var RadialShaderEffect = GObject.registerClass({
    }

    set brightness(v) {
-        if (this._brightness == v)
-            return;
        this._brightness = v;
        this.set_uniform_float(this._brightnessLocation,
                               1, [this._brightness]);
-        this.notify('brightness');
    }

-    get sharpness() {
+    get vignetteSharpness() {
        return this._sharpness;
    }

-    set sharpness(v) {
-        if (this._sharpness == v)
-            return;
+    set vignetteSharpness(v) {
        this._sharpness = v;
        this.set_uniform_float(this._sharpnessLocation,
                               1, [this._sharpness]);
-        this.notify('sharpness');
    }
 });

@ -88,8 +68,8 @@ var RadialShaderEffect = GObject.registerClass({
 *           - inhibitEvents: whether to inhibit events for @container
 *           - width: shade actor width
 *           - height: shade actor height
- *           - fadeFactor: fading opacity factor
- *           - radialEffect: whether to enable the GLSL radial effect
+ *           - fadeInTime: seconds used to fade in
+ *           - fadeOutTime: seconds used to fade out
 *
 * Lightbox creates a dark translucent "shade" actor to hide the
 * contents of @container, and allows you to specify particular actors
@ -105,49 +85,44 @@ var RadialShaderEffect = GObject.registerClass({
 * @container and will track any changes in its size. You can override
 * this by passing an explicit width and height in @params.
 */
-var Lightbox = GObject.registerClass({
-    Properties: {
-        'active': GObject.ParamSpec.boolean(
-            'active', 'active', 'active', GObject.ParamFlags.READABLE, false),
-    },
-}, class Lightbox extends St.Bin {
-    _init(container, params) {
-        params = Params.parse(params, {
-            inhibitEvents: false,
-            width: null,
-            height: null,
-            fadeFactor: DEFAULT_FADE_FACTOR,
-            radialEffect: false,
-        });
+var Lightbox = class Lightbox {
+    constructor(container, params) {
+        params = Params.parse(params, { inhibitEvents: false,
+                                        width: null,
+                                        height: null,
+                                        fadeFactor: DEFAULT_FADE_FACTOR,
+                                        radialEffect: false,
+                                      });

-        super._init({
-            reactive: params.inhibitEvents,
-            width: params.width,
-            height: params.height,
-            visible: false,
-        });
-
-        this._active = false;
        this._container = container;
        this._children = container.get_children();
        this._fadeFactor = params.fadeFactor;
        this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
-
        if (this._radialEffect)
-            this.add_effect(new RadialShaderEffect({ name: 'radial' }));
+            this.actor = new RadialShaderQuad({ x: 0,
+                                                y: 0,
+                                                reactive: params.inhibitEvents });
        else
-            this.set({ opacity: 0, style_class: 'lightbox' });
+            this.actor = new St.Bin({ x: 0,
+                                      y: 0,
+                                      opacity: 0,
+                                      style_class: 'lightbox',
+                                      reactive: params.inhibitEvents });

-        container.add_actor(this);
-        container.set_child_above_sibling(this, null);
+        container.add_actor(this.actor);
+        this.actor.raise_top();
+        this.actor.hide();
+        this.shown = false;

-        this.connect('destroy', this._onDestroy.bind(this));
+        this.actor.connect('destroy', this._onDestroy.bind(this));

-        if (!params.width || !params.height) {
-            this.add_constraint(new Clutter.BindConstraint({
-                source: container,
-                coordinate: Clutter.BindCoordinate.ALL,
-            }));
+        if (params.width && params.height) {
+            this.actor.width = params.width;
+            this.actor.height = params.height;
+        } else {
+            let constraint = new Clutter.BindConstraint({ source: container,
+                                                          coordinate: Clutter.BindCoordinate.ALL });
+            this.actor.add_constraint(constraint);
        }

        this._actorAddedSignalId = container.connect('actor-added', this._actorAdded.bind(this));
@ -156,20 +131,16 @@ var Lightbox = GObject.registerClass({
        this._highlighted = null;
    }

-    get active() {
-        return this._active;
-    }
-
    _actorAdded(container, newChild) {
        let children = this._container.get_children();
-        let myIndex = children.indexOf(this);
+        let myIndex = children.indexOf(this.actor);
        let newChildIndex = children.indexOf(newChild);

        if (newChildIndex > myIndex) {
            // The child was added above the shade (presumably it was
            // made the new top-most child). Move it below the shade,
            // and add it to this._children as the new topmost actor.
-            this._container.set_child_above_sibling(this, newChild);
+            newChild.lower(this.actor);
            this._children.push(newChild);
        } else if (newChildIndex == 0) {
            // Bottom of stack
@ -182,55 +153,61 @@ var Lightbox = GObject.registerClass({
        }
    }

-    lightOn(fadeInTime) {
-        this.remove_all_transitions();
-
-        let easeProps = {
-            duration: fadeInTime || 0,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        };
-
-        let onComplete = () => {
-            this._active = true;
-            this.notify('active');
-        };
-
-        this.show();
+    show(fadeInTime) {
+        fadeInTime = fadeInTime || 0;

+        Tweener.removeTweens(this.actor);
        if (this._radialEffect) {
-            this.ease_property(
-                '@effects.radial.brightness', VIGNETTE_BRIGHTNESS, easeProps);
-            this.ease_property(
-                '@effects.radial.sharpness', VIGNETTE_SHARPNESS,
-                Object.assign({ onComplete }, easeProps));
+            Tweener.addTween(this.actor,
+                             { brightness: VIGNETTE_BRIGHTNESS,
+                               vignetteSharpness: VIGNETTE_SHARPNESS,
+                               time: fadeInTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.shown = true;
+                                   this.emit('shown');
+                               }
+                             });
        } else {
-            this.ease(Object.assign(easeProps, {
-                opacity: 255 * this._fadeFactor,
-                onComplete,
-            }));
+            Tweener.addTween(this.actor,
+                             { opacity: 255 * this._fadeFactor,
+                               time: fadeInTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.shown = true;
+                                   this.emit('shown');
+                               }
+                             });
        }
+
+        this.actor.show();
    }

-    lightOff(fadeOutTime) {
-        this.remove_all_transitions();
-
-        this._active = false;
-        this.notify('active');
-
-        let easeProps = {
-            duration: fadeOutTime || 0,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        };
-
-        let onComplete = () => this.hide();
+    hide(fadeOutTime) {
+        fadeOutTime = fadeOutTime || 0;

+        this.shown = false;
+        Tweener.removeTweens(this.actor);
        if (this._radialEffect) {
-            this.ease_property(
-                '@effects.radial.brightness', 1.0, easeProps);
-            this.ease_property(
-                '@effects.radial.sharpness', 0.0, Object.assign({ onComplete }, easeProps));
+            Tweener.addTween(this.actor,
+                             { brightness: 1.0,
+                               vignetteSharpness: 0.0,
+                               opacity: 0,
+                               time: fadeOutTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.actor.hide();
+                               }
+                             });
        } else {
-            this.ease(Object.assign(easeProps, { opacity: 0, onComplete }));
+            Tweener.addTween(this.actor,
+                             { opacity: 0,
+                               time: fadeOutTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.actor.hide();
+                               }
+                             });
        }
    }

@ -245,7 +222,7 @@ var Lightbox = GObject.registerClass({

    /**
     * highlight:
-     * @param {Clutter.Actor=} window: actor to highlight
+     * @window: actor to highlight
     *
     * Highlights the indicated actor and unhighlights any other
     * currently-highlighted actor. With no arguments or a false/null
@ -261,12 +238,12 @@ var Lightbox = GObject.registerClass({
        // case we may need to indicate some *other* actor as the new
        // sibling of the to-be-lowered one.

-        let below = this;
+        let below = this.actor;
        for (let i = this._children.length - 1; i >= 0; i--) {
            if (this._children[i] == window)
-                this._container.set_child_above_sibling(this._children[i], null);
+                this._children[i].raise_top();
            else if (this._children[i] == this._highlighted)
-                this._container.set_child_below_sibling(this._children[i], below);
+                this._children[i].lower(below);
            else
                below = this._children[i];
        }
@ -274,6 +251,15 @@ var Lightbox = GObject.registerClass({
        this._highlighted = window;
    }

+    /**
+     * destroy:
+     *
+     * Destroys the lightbox.
+     */
+    destroy() {
+        this.actor.destroy();
+    }
+
    /**
     * _onDestroy:
     *
@ -281,15 +267,10 @@ var Lightbox = GObject.registerClass({
     * by destroying its container or by explicitly calling this.destroy().
     */
    _onDestroy() {
-        if (this._actorAddedSignalId) {
-            this._container.disconnect(this._actorAddedSignalId);
-            this._actorAddedSignalId = 0;
-        }
-        if (this._actorRemovedSignalId) {
-            this._container.disconnect(this._actorRemovedSignalId);
-            this._actorRemovedSignalId = 0;
-        }
+        this._container.disconnect(this._actorAddedSignalId);
+        this._container.disconnect(this._actorRemovedSignalId);

        this.highlight(null);
    }
-});
+};
+Signals.addSignalMethods(Lightbox.prototype);
--- a/js/ui/locatePointer.js
+++ b/js/ui/locatePointer.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LocatePointer */

 const { Gio } = imports.gi;
 const Ripples = imports.ui.ripples;
@ -11,29 +10,15 @@ const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface";
 var LocatePointer = class {
    constructor() {
        this._settings = new Gio.Settings({ schema_id: LOCATE_POINTER_SCHEMA });
-        this._settings.connect(`changed::${LOCATE_POINTER_KEY}`, () => this._syncEnabled());
-        this._syncEnabled();
-    }
-
-    _syncEnabled() {
-        let enabled = this._settings.get_boolean(LOCATE_POINTER_KEY);
-        if (enabled == !!this._ripples)
-            return;
-
-        if (enabled) {
-            this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
-            this._ripples.addTo(Main.uiGroup);
-        } else {
-            this._ripples.destroy();
-            this._ripples = null;
-        }
+        this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
+        this._ripples.addTo(Main.uiGroup);
    }

    show() {
-        if (!this._ripples)
+        if (!this._settings.get_boolean(LOCATE_POINTER_KEY))
            return;

-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        this._ripples.playAnimation(x, y);
    }
 };
--- a/js/ui/lookingGlass.js
+++ b/js/ui/lookingGlass.js
@ -1,24 +1,26 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LookingGlass */

-const { Clutter, Cogl, Gio, GLib, GObject,
-        Graphene, Meta, Pango, Shell, St } = imports.gi;
+const { Clutter, Cogl, Gio, GLib,
+        GObject, Meta, Pango, Shell, St } = imports.gi;
+const Mainloop = imports.mainloop;
 const Signals = imports.signals;
 const System = imports.system;

 const History = imports.misc.history;
+const ExtensionSystem = imports.ui.extensionSystem;
 const ExtensionUtils = imports.misc.extensionUtils;
 const ShellEntry = imports.ui.shellEntry;
+const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;
 const JsParse = imports.misc.jsParse;

-const { ExtensionState } = ExtensionUtils;
-
 const CHEVRON = '>>> ';

 /* Imports...feel free to add here as needed */
 var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
                    'const Main = imports.ui.main; ' +
+                    'const Mainloop = imports.mainloop; ' +
+                    'const Tweener = imports.ui.tweener; ' +
                    /* Utility functions...we should probably be able to use these
                     * in the shell core code too. */
                    'const stage = global.stage; ' +
@ -30,11 +32,9 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im
 const HISTORY_KEY = 'looking-glass-history';
 // Time between tabs for them to count as a double-tab event
 var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500;
-var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200;
+var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2;
 var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords();

-const LG_ANIMATION_TIME = 500;
-
 function _getAutoCompleteGlobalKeywords() {
    const keywords = ['true', 'false', 'null', 'new'];
    // Don't add the private properties of window (i.e., ones starting with '_')
@ -54,9 +54,9 @@ var AutoComplete = class AutoComplete {
    }

    _processCompletionRequest(event) {
-        if (event.completions.length == 0)
+        if (event.completions.length == 0) {
            return;
-
+        }
        // Unique match = go ahead and complete; multiple matches + single tab = complete the common starting string;
        // multiple matches + double tab = emit a suggest event with all possible options
        if (event.completions.length == 1) {
@ -78,20 +78,20 @@ var AutoComplete = class AutoComplete {
    _entryKeyPressEvent(actor, event) {
        let cursorPos = this._entry.clutter_text.get_cursor_position();
        let text = this._entry.get_text();
-        if (cursorPos != -1)
+        if (cursorPos != -1) {
            text = text.slice(0, cursorPos);
-
-        if (event.get_key_symbol() == Clutter.KEY_Tab) {
+        }
+        if (event.get_key_symbol() == Clutter.Tab) {
            let [completions, attrHead] = JsParse.getCompletions(text, commandHeader, AUTO_COMPLETE_GLOBAL_KEYWORDS);
            let currTime = global.get_current_time();
            if ((currTime - this._lastTabTime) < AUTO_COMPLETE_DOUBLE_TAB_DELAY) {
                this._processCompletionRequest({ tabType: 'double',
-                                                 completions,
-                                                 attrHead });
+                                                 completions: completions,
+                                                 attrHead: attrHead });
            } else {
                this._processCompletionRequest({ tabType: 'single',
-                                                 completions,
-                                                 attrHead });
+                                                 completions: completions,
+                                                 attrHead: attrHead });
            }
            this._lastTabTime = currTime;
        }
@ -110,14 +110,9 @@ var AutoComplete = class AutoComplete {
 Signals.addSignalMethods(AutoComplete.prototype);


-var Notebook = GObject.registerClass({
-    Signals: { 'selection': { param_types: [Clutter.Actor.$gtype] } },
-}, class Notebook extends St.BoxLayout {
-    _init() {
-        super._init({
-            vertical: true,
-            y_expand: true,
-        });
+var Notebook = class Notebook {
+    constructor() {
+        this.actor = new St.BoxLayout({ vertical: true });

        this.tabControls = new St.BoxLayout({ style_class: 'labels' });

@ -134,21 +129,21 @@ var Notebook = GObject.registerClass({
            this.selectChild(child);
            return true;
        });
-        labelBox.add_child(label);
+        labelBox.add(label, { expand: true });
        this.tabControls.add(labelBox);

-        let scrollview = new St.ScrollView({ y_expand: true });
+        let scrollview = new St.ScrollView({ x_fill: true, y_fill: true });
        scrollview.get_hscroll_bar().hide();
        scrollview.add_actor(child);

-        let tabData = { child,
-                        labelBox,
-                        label,
+        let tabData = { child: child,
+                        labelBox: labelBox,
+                        label: label,
                        scrollView: scrollview,
                        _scrollToBottom: false };
        this._tabs.push(tabData);
        scrollview.hide();
-        this.add_child(scrollview);
+        this.actor.add(scrollview, { expand: true });

        let vAdjust = scrollview.vscroll.adjustment;
        vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData));
@ -179,7 +174,7 @@ var Notebook = GObject.registerClass({
        // Focus the new tab before unmapping the old one
        let tabData = this._tabs[index];
        if (!tabData.scrollView.navigate_focus(null, St.DirectionType.TAB_FORWARD, false))
-            this.grab_key_focus();
+            this.actor.grab_key_focus();

        this._unselect();

@ -224,23 +219,26 @@ var Notebook = GObject.registerClass({

    nextTab() {
        let nextIndex = this._selectedIndex;
-        if (nextIndex < this._tabs.length - 1)
+        if (nextIndex < this._tabs.length - 1) {
            ++nextIndex;
+        }

        this.selectIndex(nextIndex);
    }

    prevTab() {
        let prevIndex = this._selectedIndex;
-        if (prevIndex > 0)
+        if (prevIndex > 0) {
            --prevIndex;
+        }

        this.selectIndex(prevIndex);
    }
-});
+};
+Signals.addSignalMethods(Notebook.prototype);

 function objectToString(o) {
-    if (typeof o == typeof objectToString) {
+    if (typeof(o) == typeof(objectToString)) {
        // special case this since the default is way, way too verbose
        return '<js function>';
    } else {
@ -248,63 +246,57 @@ function objectToString(o) {
    }
 }

-var ObjLink = GObject.registerClass(
-class ObjLink extends St.Button {
-    _init(lookingGlass, o, title) {
+var ObjLink = class ObjLink {
+    constructor(lookingGlass, o, title) {
        let text;
        if (title)
            text = title;
        else
            text = objectToString(o);
        text = GLib.markup_escape_text(text, -1);
-
-        super._init({
-            reactive: true,
-            track_hover: true,
-            style_class: 'shell-link',
-            label: text,
-            x_align: Clutter.ActorAlign.START,
-        });
-        this.get_child().single_line_mode = true;
-
        this._obj = o;
+
+        this.actor = new St.Button({ reactive: true,
+                                     track_hover: true,
+                                     style_class: 'shell-link',
+                                     label: text });
+        this.actor.get_child().single_line_mode = true;
+        this.actor.connect('clicked', this._onClicked.bind(this));
+
        this._lookingGlass = lookingGlass;
    }

-    vfunc_clicked() {
-        this._lookingGlass.inspectObject(this._obj, this);
+    _onClicked(link) {
+        this._lookingGlass.inspectObject(this._obj, this.actor);
    }
-});
-
-var Result = GObject.registerClass(
-class Result extends St.BoxLayout {
-    _init(lookingGlass, command, o, index) {
-        super._init({ vertical: true });
+};

+var Result = class Result {
+    constructor(lookingGlass, command, o, index) {
        this.index = index;
        this.o = o;

+        this.actor = new St.BoxLayout({ vertical: true });
        this._lookingGlass = lookingGlass;

        let cmdTxt = new St.Label({ text: command });
        cmdTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
-        this.add(cmdTxt);
+        this.actor.add(cmdTxt);
        let box = new St.BoxLayout({});
-        this.add(box);
+        this.actor.add(box);
        let resultTxt = new St.Label({ text: `r(${index}) = ` });
        resultTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
        box.add(resultTxt);
        let objLink = new ObjLink(this._lookingGlass, o);
-        box.add(objLink);
+        box.add(objLink.actor);
    }
-});
+};

-var WindowList = GObject.registerClass({
-}, class WindowList extends St.BoxLayout {
-    _init(lookingGlass) {
-        super._init({ name: 'Windows', vertical: true, style: 'spacing: 8px' });
+var WindowList = class WindowList {
+    constructor(lookingGlass) {
+        this.actor = new St.BoxLayout({ name: 'Windows', vertical: true, style: 'spacing: 8px' });
        let tracker = Shell.WindowTracker.get_default();
-        this._updateId = Main.initializeDeferredWork(this, this._updateWindowList.bind(this));
+        this._updateId = Main.initializeDeferredWork(this.actor, this._updateWindowList.bind(this));
        global.display.connect('window-created', this._updateWindowList.bind(this));
        tracker.connect('tracked-windows-changed', this._updateWindowList.bind(this));

@ -312,10 +304,7 @@ var WindowList = GObject.registerClass({
    }

    _updateWindowList() {
-        if (!this._lookingGlass.isOpen)
-            return;
-
-        this.destroy_all_children();
+        this.actor.destroy_all_children();
        let windows = global.get_window_actors();
        let tracker = Shell.WindowTracker.get_default();
        for (let i = 0; i < windows.length; i++) {
@ -326,9 +315,9 @@ var WindowList = GObject.registerClass({
                metaWindow._lookingGlassManaged = true;
            }
            let box = new St.BoxLayout({ vertical: true });
-            this.add(box);
+            this.actor.add(box);
            let windowLink = new ObjLink(this._lookingGlass, metaWindow, metaWindow.title);
-            box.add_child(windowLink);
+            box.add(windowLink.actor, { x_align: St.Align.START, x_fill: false });
            let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' });
            box.add(propsBox);
            propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` }));
@ -337,42 +326,32 @@ var WindowList = GObject.registerClass({
                let icon = app.create_icon_texture(22);
                let propBox = new St.BoxLayout({ style: 'spacing: 6px; ' });
                propsBox.add(propBox);
-                propBox.add_child(new St.Label({ text: 'app: ' }));
+                propBox.add(new St.Label({ text: 'app: ' }), { y_fill: false });
                let appLink = new ObjLink(this._lookingGlass, app, app.get_id());
-                propBox.add_child(appLink);
-                propBox.add_child(icon);
+                propBox.add(appLink.actor, { y_fill: false });
+                propBox.add(icon, { y_fill: false });
            } else {
                propsBox.add(new St.Label({ text: '<untracked>' }));
            }
        }
    }
+};
+Signals.addSignalMethods(WindowList.prototype);

-    update() {
-        this._updateWindowList();
-    }
-});
-
-var ObjInspector = GObject.registerClass(
-class ObjInspector extends St.ScrollView {
-    _init(lookingGlass) {
-        super._init({
-            pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }),
-        });
-
+var ObjInspector = class ObjInspector {
+    constructor(lookingGlass) {
        this._obj = null;
        this._previousObj = null;

        this._parentList = [];

-        this.get_hscroll_bar().hide();
-        this._container = new St.BoxLayout({
-            name: 'LookingGlassPropertyInspector',
-            style_class: 'lg-dialog',
-            vertical: true,
-            x_expand: true,
-            y_expand: true,
-        });
-        this.add_actor(this._container);
+        this.actor = new St.ScrollView({ pivot_point: new Clutter.Point({ x: 0.5, y: 0.5 }),
+                                         x_fill: true, y_fill: true });
+        this.actor.get_hscroll_bar().hide();
+        this._container = new St.BoxLayout({ name: 'LookingGlassPropertyInspector',
+                                             style_class: 'lg-dialog',
+                                             vertical: true });
+        this.actor.add_actor(this._container);

        this._lookingGlass = lookingGlass;
    }
@ -388,12 +367,10 @@ class ObjInspector extends St.ScrollView {

        let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' });
        this._container.add_actor(hbox);
-        let label = new St.Label({
-            text: 'Inspecting: %s: %s'.format(typeof obj, objectToString(obj)),
-            x_expand: true,
-        });
+        let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof(obj),
+                                                                     objectToString(obj)) });
        label.single_line_mode = true;
-        hbox.add_child(label);
+        hbox.add(label, { expand: true, y_fill: false });
        let button = new St.Button({ label: 'Insert', style_class: 'lg-obj-inspector-button' });
        button.connect('clicked', this._onInsert.bind(this));
        hbox.add(button);
@ -408,10 +385,11 @@ class ObjInspector extends St.ScrollView {
        button.add_actor(new St.Icon({ icon_name: 'window-close-symbolic' }));
        button.connect('clicked', this.close.bind(this));
        hbox.add(button);
-        if (typeof obj == typeof {}) {
+        if (typeof(obj) == typeof({})) {
            let properties = [];
-            for (let propName in obj)
+            for (let propName in obj) {
                properties.push(propName);
+            }
            properties.sort();

            for (let i = 0; i < properties.length; i++) {
@ -419,14 +397,14 @@ class ObjInspector extends St.ScrollView {
                let link;
                try {
                    let prop = obj[propName];
-                    link = new ObjLink(this._lookingGlass, prop);
+                    link = new ObjLink(this._lookingGlass, prop).actor;
                } catch (e) {
                    link = new St.Label({ text: '<error>' });
                }
-                let box = new St.BoxLayout();
-                box.add(new St.Label({ text: `${propName}: ` }));
-                box.add(link);
-                this._container.add_actor(box);
+                let hbox = new St.BoxLayout();
+                hbox.add(new St.Label({ text: `${propName}: ` }));
+                hbox.add(link);
+                this._container.add_actor(hbox);
            }
        }
    }
@ -436,17 +414,14 @@ class ObjInspector extends St.ScrollView {
            return;
        this._previousObj = null;
        this._open = true;
-        this.show();
+        this.actor.show();
        if (sourceActor) {
-            this.set_scale(0, 0);
-            this.ease({
-                scale_x: 1,
-                scale_y: 1,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                duration: 200,
-            });
+            this.actor.set_scale(0, 0);
+            Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1,
+                                           transition: 'easeOutQuad',
+                                           time: 0.2 });
        } else {
-            this.set_scale(1, 1);
+            this.actor.set_scale(1, 1);
        }
    }

@ -454,7 +429,7 @@ class ObjInspector extends St.ScrollView {
        if (!this._open)
            return;
        this._open = false;
-        this.hide();
+        this.actor.hide();
        this._previousObj = null;
        this._obj = null;
    }
@ -468,44 +443,29 @@ class ObjInspector extends St.ScrollView {
    _onBack() {
        this.selectObject(this._previousObj, true);
    }
-});
+};

 var RedBorderEffect = GObject.registerClass(
 class RedBorderEffect extends Clutter.Effect {
-    _init() {
-        super._init();
-        this._pipeline = null;
-    }
-
-    vfunc_paint(paintContext) {
-        let framebuffer = paintContext.get_framebuffer();
-        let coglContext = framebuffer.get_context();
+    vfunc_paint() {
        let actor = this.get_actor();
-        actor.continue_paint(paintContext);
+        actor.continue_paint();

-        if (!this._pipeline) {
-            let color = new Cogl.Color();
-            color.init_from_4ub(0xff, 0, 0, 0xc4);
+        let color = new Cogl.Color();
+        color.init_from_4ub(0xff, 0, 0, 0xc4);
+        Cogl.set_source_color(color);

-            this._pipeline = new Cogl.Pipeline(coglContext);
-            this._pipeline.set_color(color);
-        }
-
-        let alloc = actor.get_allocation_box();
+        let geom = actor.get_allocation_geometry();
        let width = 2;

        // clockwise order
-        framebuffer.draw_rectangle(this._pipeline,
-            0, 0, alloc.get_width(), width);
-        framebuffer.draw_rectangle(this._pipeline,
-            alloc.get_width() - width, width,
-            alloc.get_width(), alloc.get_height());
-        framebuffer.draw_rectangle(this._pipeline,
-            0, alloc.get_height(),
-            alloc.get_width() - width, alloc.get_height() - width);
-        framebuffer.draw_rectangle(this._pipeline,
-            0, alloc.get_height() - width,
-            width, width);
+        Cogl.rectangle(0, 0, geom.width, width);
+        Cogl.rectangle(geom.width - width, width,
+                       geom.width, geom.height);
+        Cogl.rectangle(0, geom.height,
+                       geom.width - width, geom.height - width);
+        Cogl.rectangle(0, geom.height - width,
+                       width, width);
    }
 });

@ -514,7 +474,8 @@ var Inspector = GObject.registerClass({
               'target': { param_types: [Clutter.Actor.$gtype, GObject.TYPE_DOUBLE, GObject.TYPE_DOUBLE] } },
 }, class Inspector extends Clutter.Actor {
    _init(lookingGlass) {
-        super._init({ width: 0, height: 0 });
+        super._init({ width: 0,
+                      height: 0 });

        Main.uiGroup.add_actor(this);

@ -523,8 +484,8 @@ var Inspector = GObject.registerClass({
                                              reactive: true });
        this._eventHandler = eventHandler;
        this.add_actor(eventHandler);
-        this._displayText = new St.Label({ x_expand: true });
-        eventHandler.add_child(this._displayText);
+        this._displayText = new St.Label();
+        eventHandler.add(this._displayText, { expand: true });

        eventHandler.connect('key-press-event', this._onKeyPressEvent.bind(this));
        eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this));
@ -557,7 +518,7 @@ var Inspector = GObject.registerClass({

        let primary = Main.layoutManager.primaryMonitor;

-        let [, , natWidth, natHeight] =
+        let [minWidth, minHeight, natWidth, natHeight] =
            this._eventHandler.get_preferred_size();

        let childBox = new Clutter.ActorBox();
@ -577,7 +538,7 @@ var Inspector = GObject.registerClass({
    }

    _onKeyPressEvent(actor, event) {
-        if (event.get_key_symbol() === Clutter.KEY_Escape)
+        if (event.get_key_symbol() == Clutter.Escape)
            this._close();
        return Clutter.EVENT_STOP;
    }
@ -649,30 +610,28 @@ var Inspector = GObject.registerClass({
    }
 });

-var Extensions = GObject.registerClass({
-}, class Extensions extends St.BoxLayout {
-    _init(lookingGlass) {
-        super._init({ vertical: true, name: 'lookingGlassExtensions' });
-
+var Extensions = class Extensions {
+    constructor(lookingGlass) {
        this._lookingGlass = lookingGlass;
+        this.actor = new St.BoxLayout({ vertical: true,
+                                        name: 'lookingGlassExtensions' });
        this._noExtensions = new St.Label({ style_class: 'lg-extensions-none',
                                            text: _("No extensions installed") });
        this._numExtensions = 0;
        this._extensionsList = new St.BoxLayout({ vertical: true,
                                                  style_class: 'lg-extensions-list' });
        this._extensionsList.add(this._noExtensions);
-        this.add(this._extensionsList);
+        this.actor.add(this._extensionsList);

-        Main.extensionManager.getUuids().forEach(uuid => {
+        for (let uuid in ExtensionUtils.extensions)
            this._loadExtension(null, uuid);
-        });

-        Main.extensionManager.connect('extension-loaded',
-                                      this._loadExtension.bind(this));
+        ExtensionSystem.connect('extension-loaded',
+                                this._loadExtension.bind(this));
    }

    _loadExtension(o, uuid) {
-        let extension = Main.extensionManager.lookup(uuid);
+        let extension = ExtensionUtils.extensions[uuid];
        // There can be cases where we create dummy extension metadata
        // that's not really a proper extension. Don't bother with these.
        if (!extension.metadata.name)
@ -682,7 +641,7 @@ var Extensions = GObject.registerClass({
        if (this._numExtensions == 0)
            this._extensionsList.remove_actor(this._noExtensions);

-        this._numExtensions++;
+        this._numExtensions ++;
        this._extensionsList.add(extensionDisplay);
    }

@ -707,7 +666,7 @@ var Extensions = GObject.registerClass({
            let errors = extension.errors;
            let errorDisplay = new St.BoxLayout({ vertical: true });
            if (errors && errors.length) {
-                for (let i = 0; i < errors.length; i++)
+                for (let i = 0; i < errors.length; i ++)
                    errorDisplay.add(new St.Label({ text: errors[i] }));
            } else {
                /* Translators: argument is an extension UUID. */
@ -729,16 +688,16 @@ var Extensions = GObject.registerClass({

    _stateToString(extensionState) {
        switch (extensionState) {
-        case ExtensionState.ENABLED:
+        case ExtensionSystem.ExtensionState.ENABLED:
            return _("Enabled");
-        case ExtensionState.DISABLED:
-        case ExtensionState.INITIALIZED:
+        case ExtensionSystem.ExtensionState.DISABLED:
+        case ExtensionSystem.ExtensionState.INITIALIZED:
            return _("Disabled");
-        case ExtensionState.ERROR:
+        case ExtensionSystem.ExtensionState.ERROR:
            return _("Error");
-        case ExtensionState.OUT_OF_DATE:
+        case ExtensionSystem.ExtensionState.OUT_OF_DATE:
            return _("Out of date");
-        case ExtensionState.DOWNLOADING:
+        case ExtensionSystem.ExtensionState.DOWNLOADING:
            return _("Downloading");
        }
        return 'Unknown'; // Not translated, shouldn't appear
@ -746,18 +705,12 @@ var Extensions = GObject.registerClass({

    _createExtensionDisplay(extension) {
        let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true });
-        let name = new St.Label({
-            style_class: 'lg-extension-name',
-            text: extension.metadata.name,
-            x_expand: true,
-        });
-        box.add_child(name);
-        let description = new St.Label({
-            style_class: 'lg-extension-description',
-            text: extension.metadata.description || 'No description',
-            x_expand: true,
-        });
-        box.add_child(description);
+        let name = new St.Label({ style_class: 'lg-extension-name',
+                                  text: extension.metadata.name });
+        box.add(name, { expand: true });
+        let description = new St.Label({ style_class: 'lg-extension-description',
+                                         text: extension.metadata.description || 'No description' });
+        box.add(description, { expand: true });

        let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' });
        box.add(metaBox);
@ -795,19 +748,10 @@ var Extensions = GObject.registerClass({

        return box;
    }
-});
-
-var LookingGlass = GObject.registerClass(
-class LookingGlass extends St.BoxLayout {
-    _init() {
-        super._init({
-            name: 'LookingGlassDialog',
-            style_class: 'lg-dialog',
-            vertical: true,
-            visible: false,
-            reactive: true,
-        });
+};

+var LookingGlass = class LookingGlass {
+    constructor() {
        this._borderPaintTarget = null;
        this._redBorderEffect = new RedBorderEffect();

@ -815,18 +759,26 @@ class LookingGlass extends St.BoxLayout {

        this._it = null;
        this._offset = 0;
+        this._results = [];

        // Sort of magic, but...eh.
        this._maxItems = 150;

+        this.actor = new St.BoxLayout({ name: 'LookingGlassDialog',
+                                        style_class: 'lg-dialog',
+                                        vertical: true,
+                                        visible: false,
+                                        reactive: true });
+        this.actor.connect('key-press-event', this._globalKeyPressEvent.bind(this));
+
        this._interfaceSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
        this._interfaceSettings.connect('changed::monospace-font-name',
                                        this._updateFont.bind(this));
        this._updateFont();

        // We want it to appear to slide out from underneath the panel
-        Main.uiGroup.add_actor(this);
-        Main.uiGroup.set_child_below_sibling(this,
+        Main.uiGroup.add_actor(this.actor);
+        Main.uiGroup.set_child_below_sibling(this.actor,
                                             Main.layoutManager.panelBox);
        Main.layoutManager.panelBox.connect('allocation-changed',
                                            this._queueResize.bind(this));
@ -834,11 +786,11 @@ class LookingGlass extends St.BoxLayout {
                                               this._queueResize.bind(this));

        this._objInspector = new ObjInspector(this);
-        Main.uiGroup.add_actor(this._objInspector);
-        this._objInspector.hide();
+        Main.uiGroup.add_actor(this._objInspector.actor);
+        this._objInspector.actor.hide();

        let toolbar = new St.BoxLayout({ name: 'Toolbar' });
-        this.add_actor(toolbar);
+        this.actor.add_actor(toolbar);
        let inspectIcon = new St.Icon({ icon_name: 'gtk-color-picker',
                                        icon_size: 24 });
        toolbar.add_actor(inspectIcon);
@ -849,10 +801,10 @@ class LookingGlass extends St.BoxLayout {
                this._pushResult(`inspect(${Math.round(stageX)}, ${Math.round(stageY)})`, target);
            });
            inspector.connect('closed', () => {
-                this.show();
+                this.actor.show();
                global.stage.set_key_focus(this._entry);
            });
-            this.hide();
+            this.actor.hide();
            return Clutter.EVENT_STOP;
        });

@ -863,7 +815,7 @@ class LookingGlass extends St.BoxLayout {
        gcIcon.connect('button-press-event', () => {
            gcIcon.icon_name = 'user-trash';
            System.gc();
-            this._timeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, () => {
+            this._timeoutId = Mainloop.timeout_add(500, () => {
                gcIcon.icon_name = 'user-trash-full';
                this._timeoutId = 0;
                return GLib.SOURCE_REMOVE;
@ -874,45 +826,35 @@ class LookingGlass extends St.BoxLayout {

        let notebook = new Notebook();
        this._notebook = notebook;
-        this.add_child(notebook);
+        this.actor.add(notebook.actor, { expand: true });

-        let emptyBox = new St.Bin({ x_expand: true });
-        toolbar.add_child(emptyBox);
+        let emptyBox = new St.Bin();
+        toolbar.add(emptyBox, { expand: true });
        toolbar.add_actor(notebook.tabControls);

        this._evalBox = new St.BoxLayout({ name: 'EvalBox', vertical: true });
        notebook.appendPage('Evaluator', this._evalBox);

-        this._resultsArea = new St.BoxLayout({
-            name: 'ResultsArea',
-            vertical: true,
-            y_expand: true,
-        });
-        this._evalBox.add_child(this._resultsArea);
+        this._resultsArea = new St.BoxLayout({ name: 'ResultsArea', vertical: true });
+        this._evalBox.add(this._resultsArea, { expand: true });

-        this._entryArea = new St.BoxLayout({
-            name: 'EntryArea',
-            y_align: Clutter.ActorAlign.END,
-        });
+        this._entryArea = new St.BoxLayout({ name: 'EntryArea' });
        this._evalBox.add_actor(this._entryArea);

        let label = new St.Label({ text: CHEVRON });
        this._entryArea.add(label);

-        this._entry = new St.Entry({
-            can_focus: true,
-            x_expand: true,
-        });
+        this._entry = new St.Entry({ can_focus: true });
        ShellEntry.addContextMenu(this._entry);
-        this._entryArea.add_child(this._entry);
+        this._entryArea.add(this._entry, { expand: true });

        this._windowList = new WindowList(this);
-        notebook.appendPage('Windows', this._windowList);
+        notebook.appendPage('Windows', this._windowList.actor);

        this._extensions = new Extensions(this);
-        notebook.appendPage('Extensions', this._extensions);
+        notebook.appendPage('Extensions', this._extensions.actor);

-        this._entry.clutter_text.connect('activate', (o, _e) => {
+        this._entry.clutter_text.connect('activate', (o, e) => {
            // Hide any completions we are currently showing
            this._hideCompletions();

@ -928,7 +870,7 @@ class LookingGlass extends St.BoxLayout {
            return true;
        });

-        this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY,
+        this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY, 
                                                     entry: this._entry.clutter_text });

        this._autoComplete = new AutoComplete(this._entry);
@ -952,7 +894,7 @@ class LookingGlass extends St.BoxLayout {
        // monospace font to be bold/oblique/etc. Could easily be added here.
        let size = fontDesc.get_size() / 1024.;
        let unit = fontDesc.get_size_is_absolute() ? 'px' : 'pt';
-        this.style = `
+        this.actor.style = `
            font-size: ${size}${unit};
            font-family: "${fontDesc.get_family()}";`;
    }
@ -966,14 +908,17 @@ class LookingGlass extends St.BoxLayout {
    }

    _pushResult(command, obj) {
-        let index = this._resultsArea.get_n_children() + this._offset;
+        let index = this._results.length + this._offset;
        let result = new Result(this, CHEVRON + command, obj, index);
-        this._resultsArea.add(result);
+        this._results.push(result);
+        this._resultsArea.add(result.actor);
        if (obj instanceof Clutter.Actor)
            this.setBorderPaintTarget(obj);

-        if (this._resultsArea.get_n_children() > this._maxItems) {
-            this._resultsArea.get_first_child().destroy();
+        let children = this._resultsArea.get_children();
+        if (children.length > this._maxItems) {
+            this._results.shift();
+            children[0].destroy();
            this._offset++;
        }
        this._it = obj;
@ -993,41 +938,35 @@ class LookingGlass extends St.BoxLayout {
        this._completionActor.set_text(completions.join(', '));

        // Setting the height to -1 allows us to get its actual preferred height rather than
-        // whatever was last set when animating
+        // whatever was last given in set_height by Tweener.
        this._completionActor.set_height(-1);
-        let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
+        let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());

        // Don't reanimate if we are already visible
        if (this._completionActor.visible) {
            this._completionActor.height = naturalHeight;
        } else {
-            let settings = St.Settings.get();
-            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
            this._completionActor.show();
-            this._completionActor.remove_all_transitions();
-            this._completionActor.ease({
-                height: naturalHeight,
-                opacity: 255,
-                duration,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            });
+            Tweener.removeTweens(this._completionActor);
+            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
+                                                      transition: 'easeOutQuad',
+                                                      height: naturalHeight,
+                                                      opacity: 255
+                                                    });
        }
    }

    _hideCompletions() {
        if (this._completionActor) {
-            let settings = St.Settings.get();
-            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
-            this._completionActor.remove_all_transitions();
-            this._completionActor.ease({
-                height: 0,
-                opacity: 0,
-                duration,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._completionActor.hide();
-                },
-            });
+            Tweener.removeTweens(this._completionActor);
+            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
+                                                      transition: 'easeOutQuad',
+                                                      height: 0,
+                                                      opacity: 0,
+                                                      onComplete: () => {
+                                                          this._completionActor.hide();
+                                                      }
+                                                    });
        }
    }

@ -1059,11 +998,7 @@ class LookingGlass extends St.BoxLayout {
    }

    getResult(idx) {
-        try {
-            return this._resultsArea.get_child_at_index(idx - this._offset).o;
-        } catch (e) {
-            throw new Error(`Unknown result at index ${idx}`);
-        }
+        return this._results[idx - this._offset].o;
    }

    toggle() {
@ -1074,10 +1009,7 @@ class LookingGlass extends St.BoxLayout {
    }

    _queueResize() {
-        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
-            this._resize();
-            return GLib.SOURCE_REMOVE;
-        });
+        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => this._resize());
    }

    _resize() {
@ -1085,15 +1017,15 @@ class LookingGlass extends St.BoxLayout {
        let myWidth = primary.width * 0.7;
        let availableHeight = primary.height - Main.layoutManager.keyboardBox.height;
        let myHeight = Math.min(primary.height * 0.7, availableHeight * 0.9);
-        this.x = primary.x + (primary.width - myWidth) / 2;
+        this.actor.x = primary.x + (primary.width - myWidth) / 2;
        this._hiddenY = primary.y + Main.layoutManager.panelBox.height - myHeight;
        this._targetY = this._hiddenY + myHeight;
-        this.y = this._hiddenY;
-        this.width = myWidth;
-        this.height = myHeight;
-        this._objInspector.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8));
-        this._objInspector.set_position(this.x + Math.floor(myWidth * 0.1),
-                                        this._targetY + Math.floor(myHeight * 0.1));
+        this.actor.y = this._hiddenY;
+        this.actor.width = myWidth;
+        this.actor.height = myHeight;
+        this._objInspector.actor.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8));
+        this._objInspector.actor.set_position(this.actor.x + Math.floor(myWidth * 0.1),
+                                              this._targetY + Math.floor(myHeight * 0.1));
    }

    insertObject(obj) {
@ -1106,21 +1038,24 @@ class LookingGlass extends St.BoxLayout {
    }

    // Handle key events which are relevant for all tabs of the LookingGlass
-    vfunc_key_press_event(keyPressEvent) {
-        let symbol = keyPressEvent.keyval;
-        if (symbol == Clutter.KEY_Escape) {
-            if (this._objInspector.visible)
+    _globalKeyPressEvent(actor, event) {
+        let symbol = event.get_key_symbol();
+        let modifierState = event.get_state();
+        if (symbol == Clutter.Escape) {
+            if (this._objInspector.actor.visible) {
                this._objInspector.close();
-            else
+            } else {
                this.close();
+            }
            return Clutter.EVENT_STOP;
        }
        // Ctrl+PgUp and Ctrl+PgDown switches tabs in the notebook view
-        if (keyPressEvent.modifier_state & Clutter.ModifierType.CONTROL_MASK) {
-            if (symbol == Clutter.KEY_Page_Up)
+        if (modifierState & Clutter.ModifierType.CONTROL_MASK) {
+            if (symbol == Clutter.KEY_Page_Up) {
                this._notebook.prevTab();
-            else if (symbol == Clutter.KEY_Page_Down)
+            } else if (symbol == Clutter.KEY_Page_Down) {
                this._notebook.nextTab();
+            }
        }
        return Clutter.EVENT_PROPAGATE;
    }
@ -1133,49 +1068,40 @@ class LookingGlass extends St.BoxLayout {
            return;

        this._notebook.selectIndex(0);
-        this.show();
+        this.actor.show();
        this._open = true;
        this._history.lastItem();

-        this.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        // We inverse compensate for the slow-down so you can change the factor
        // through LookingGlass without long waits.
-        let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor;
-        this.ease({
-            y: this._targetY,
-            duration,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        });
-
-        this._windowList.update();
+        Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(),
+                                       transition: 'easeOutQuad',
+                                       y: this._targetY
+                                     });
    }

    close() {
        if (!this._open)
            return;

-        this._objInspector.hide();
+        this._objInspector.actor.hide();

        this._open = false;
-        this.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        this.setBorderPaintTarget(null);

        Main.popModal(this._entry);

-        let settings = St.Settings.get();
-        let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor,
-                                LG_ANIMATION_TIME);
-        this.ease({
-            y: this._hiddenY,
-            duration,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.hide(),
-        });
+        Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5),
+                                       transition: 'easeOutQuad',
+                                       y: this._hiddenY,
+                                       onComplete: () => {
+                                           this.actor.hide();
+                                       }
+                                     });
    }
-
-    get isOpen() {
-        return this._open;
-    }
-});
+};
+Signals.addSignalMethods(LookingGlass.prototype);
--- a/js/ui/magnifier.js
+++ b/js/ui/magnifier.js
@ -2,6 +2,7 @@

 const { Atspi, Clutter, GDesktopEnums,
        Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
+const Mainloop = imports.mainloop;
 const Signals = imports.signals;

 const Background = imports.ui.background;
@ -55,7 +56,7 @@ var MouseSpriteContent = GObject.registerClass({
        return [true, this._texture.get_width(), this._texture.get_height()];
    }

-    vfunc_paint_content(actor, node, _paintContext) {
+    vfunc_paint_content(actor, node) {
        if (!this._texture)
            return;

@ -106,7 +107,8 @@ var Magnifier = class Magnifier {
        // Create the first ZoomRegion and initialize it according to the
        // magnification settings.

-        [this.xMouse, this.yMouse] = global.get_pointer();
+        let mask;
+        [this.xMouse, this.yMouse, mask] = global.get_pointer();

        let aZoomRegion = new ZoomRegion(this, this._cursorRoot);
        this._zoomRegions.push(aZoomRegion);
@ -118,7 +120,7 @@ var Magnifier = class Magnifier {
        });

        // Export to dbus.
-        new MagnifierDBus.ShellMagnifier();
+        (new MagnifierDBus.ShellMagnifier());
        this.setActive(St.Settings.get().magnifier_active);
    }

@ -141,12 +143,12 @@ var Magnifier = class Magnifier {
    /**
     * setActive:
     * Show/hide all the zoom regions.
-     * @param {bool} activate: Boolean to activate or de-activate the magnifier.
+     * @activate:   Boolean to activate or de-activate the magnifier.
     */
    setActive(activate) {
        let isActive = this.isActive();

-        this._zoomRegions.forEach(zoomRegion => {
+        this._zoomRegions.forEach((zoomRegion, index, array) => {
            zoomRegion.setActive(activate);
        });

@ -177,7 +179,7 @@ var Magnifier = class Magnifier {

    /**
     * isActive:
-     * @returns {bool} Whether the magnifier is active.
+     * @return  Whether the magnifier is active (boolean).
     */
    isActive() {
        // Sufficient to check one ZoomRegion since Magnifier's active
@ -212,7 +214,7 @@ var Magnifier = class Magnifier {

    /**
     * isTrackingMouse:
-     * @returns {bool} whether the magnifier is currently tracking the mouse
+     * Is the magnifier tracking the mouse currently?
     */
    isTrackingMouse() {
        return !!this._mouseTrackingId;
@ -222,17 +224,17 @@ var Magnifier = class Magnifier {
     * scrollToMousePos:
     * Position all zoom regions' ROI relative to the current location of the
     * system pointer.
-     * @returns {bool} true.
+     * @return      true.
     */
    scrollToMousePos() {
-        let [xMouse, yMouse] = global.get_pointer();
+        let [xMouse, yMouse, mask] = global.get_pointer();

        if (xMouse != this.xMouse || yMouse != this.yMouse) {
            this.xMouse = xMouse;
            this.yMouse = yMouse;

            let sysMouseOverAny = false;
-            this._zoomRegions.forEach(zoomRegion => {
+            this._zoomRegions.forEach((zoomRegion, index, array) => {
                if (zoomRegion.scrollToMousePos())
                    sysMouseOverAny = true;
            });
@ -247,24 +249,24 @@ var Magnifier = class Magnifier {
    /**
     * createZoomRegion:
     * Create a ZoomRegion instance with the given properties.
-     * @param {number} xMagFactor:
-     *     The power to set horizontal magnification of the ZoomRegion. A value
-     *     of 1.0 means no magnification, a value of 2.0 doubles the size.
-     * @param {number} yMagFactor:
-     *    The power to set the vertical magnification of the ZoomRegion.
-     * @param {{x: number, y: number, width: number, height: number}} roi:
-     *    The reg Object that defines the region to magnify, given in
-     *    unmagnified coordinates.
-     * @param {{x: number, y: number, width: number, height: number}} viewPort:
-     *     Object that defines the position of the ZoomRegion on screen.
-     * @returns {ZoomRegion} the newly created ZoomRegion.
+     * @xMagFactor:     The power to set horizontal magnification of the
+     *                  ZoomRegion.  A value of 1.0 means no magnification.  A
+     *                  value of 2.0 doubles the size.
+     * @yMagFactor:     The power to set the vertical magnification of the
+     *                  ZoomRegion.
+     * @roi             Object in the form { x, y, width, height } that
+     *                  defines the region to magnify.  Given in unmagnified
+     *                  coordinates.
+     * @viewPort        Object in the form { x, y, width, height } that defines
+     *                  the position of the ZoomRegion on screen.
+     * @return          The newly created ZoomRegion.
     */
    createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) {
        let zoomRegion = new ZoomRegion(this, this._cursorRoot);
        zoomRegion.setViewPort(viewPort);

        // We ignore the redundant width/height on the ROI
-        let fixedROI = Object.create(roi);
+        let fixedROI = new Object(roi);
        fixedROI.width = viewPort.width / xMagFactor;
        fixedROI.height = viewPort.height / yMagFactor;
        zoomRegion.setROI(fixedROI);
@ -277,7 +279,7 @@ var Magnifier = class Magnifier {
     * addZoomRegion:
     * Append the given ZoomRegion to the list of currently defined ZoomRegions
     * for this Magnifier instance.
-     * @param {ZoomRegion} zoomRegion: The zoomRegion to add.
+     * @zoomRegion:     The zoomRegion to add.
     */
    addZoomRegion(zoomRegion) {
        if (zoomRegion) {
@ -290,7 +292,7 @@ var Magnifier = class Magnifier {
    /**
     * getZoomRegions:
     * Return a list of ZoomRegion's for this Magnifier.
-     * @returns {number[]} The Magnifier's zoom region list.
+     * @return:     The Magnifier's zoom region list (array).
     */
    getZoomRegions() {
        return this._zoomRegions;
@ -330,7 +332,7 @@ var Magnifier = class Magnifier {
        this.setCrosshairsClip(clip);

        let theCrossHairs = this._crossHairs;
-        this._zoomRegions.forEach(zoomRegion => {
+        this._zoomRegions.forEach ((zoomRegion, index, array) => {
            zoomRegion.addCrosshairs(theCrossHairs);
        });
    }
@ -338,7 +340,7 @@ var Magnifier = class Magnifier {
    /**
     * setCrosshairsVisible:
     * Show or hide the cross hair.
-     * @param {bool} visible: Flag that indicates show (true) or hide (false).
+     * @visible    Flag that indicates show (true) or hide (false).
     */
    setCrosshairsVisible(visible) {
        if (visible) {
@ -346,7 +348,6 @@ var Magnifier = class Magnifier {
                this.addCrosshairs();
            this._crossHairs.show();
        } else {
-            // eslint-disable-next-line no-lonely-if
            if (this._crossHairs)
                this._crossHairs.hide();
        }
@ -355,11 +356,11 @@ var Magnifier = class Magnifier {
    /**
     * setCrosshairsColor:
     * Set the color of the crosshairs for all ZoomRegions.
-     * @param {string} color: The color as a string, e.g. '#ff0000ff' or 'red'.
+     * @color:  The color as a string, e.g. '#ff0000ff' or 'red'.
     */
    setCrosshairsColor(color) {
        if (this._crossHairs) {
-            let [res_, clutterColor] = Clutter.Color.from_string(color);
+            let [res, clutterColor] = Clutter.Color.from_string(color);
            this._crossHairs.setColor(clutterColor);
        }
    }
@ -367,7 +368,7 @@ var Magnifier = class Magnifier {
    /**
     * getCrosshairsColor:
     * Get the color of the crosshairs.
-     * @returns {string} The color as a string, e.g. '#0000ffff' or 'blue'.
+     * @return: The color as a string, e.g. '#0000ffff' or 'blue'.
     */
    getCrosshairsColor() {
        if (this._crossHairs) {
@ -381,8 +382,8 @@ var Magnifier = class Magnifier {
    /**
     * setCrosshairsThickness:
     * Set the crosshairs thickness for all ZoomRegions.
-     * @param {number} thickness: The width of the vertical and
-     *     horizontal lines of the crosshairs.
+     * @thickness:  The width of the vertical and horizontal lines of the
+     *              crosshairs.
     */
    setCrosshairsThickness(thickness) {
        if (this._crossHairs)
@ -392,8 +393,8 @@ var Magnifier = class Magnifier {
    /**
     * getCrosshairsThickness:
     * Get the crosshairs thickness.
-     * @returns {number} The width of the vertical and horizontal
-     *     lines of the crosshairs.
+     * @return: The width of the vertical and horizontal lines of the
+     *          crosshairs.
     */
    getCrosshairsThickness() {
        if (this._crossHairs)
@ -404,8 +405,7 @@ var Magnifier = class Magnifier {

    /**
     * setCrosshairsOpacity:
-     * @param {number} opacity: Value between 0.0 (transparent)
-     *     and 1.0 (fully opaque).
+     * @opacity:    Value between 0.0 (transparent) and 1.0 (fully opaque).
     */
    setCrosshairsOpacity(opacity) {
        if (this._crossHairs)
@ -414,7 +414,7 @@ var Magnifier = class Magnifier {

    /**
     * getCrosshairsOpacity:
-     * @returns {number} Value between 0.0 (transparent) and 1.0 (fully opaque).
+     * @return:     Value between 0.0 (transparent) and 1.0 (fully opaque).
     */
    getCrosshairsOpacity() {
        if (this._crossHairs)
@ -426,8 +426,8 @@ var Magnifier = class Magnifier {
    /**
     * setCrosshairsLength:
     * Set the crosshairs length for all ZoomRegions.
-     * @param {number} length: The length of the vertical and horizontal
-     *     lines making up the crosshairs.
+     * @length: The length of the vertical and horizontal lines making up the
+     *          crosshairs.
     */
    setCrosshairsLength(length) {
        if (this._crossHairs)
@ -437,8 +437,8 @@ var Magnifier = class Magnifier {
    /**
     * getCrosshairsLength:
     * Get the crosshairs length.
-     * @returns {number} The length of the vertical and horizontal
-     *     lines making up the crosshairs.
+     * @return: The length of the vertical and horizontal lines making up the
+     *          crosshairs.
     */
    getCrosshairsLength() {
        if (this._crossHairs)
@ -450,31 +450,35 @@ var Magnifier = class Magnifier {
    /**
     * setCrosshairsClip:
     * Set whether the crosshairs are clipped at their intersection.
-     * @param {bool} clip: Flag to indicate whether to clip the crosshairs.
+     * @clip:   Flag to indicate whether to clip the crosshairs.
     */
    setCrosshairsClip(clip) {
-        if (!this._crossHairs)
-            return;
-
-        // Setting no clipping on crosshairs means a zero sized clip rectangle.
-        this._crossHairs.setClip(clip ? CROSSHAIRS_CLIP_SIZE : [0, 0]);
+        if (clip) {
+            if (this._crossHairs)
+                this._crossHairs.setClip(CROSSHAIRS_CLIP_SIZE);
+        } else {
+            // Setting no clipping on crosshairs means a zero sized clip
+            // rectangle.
+            if (this._crossHairs)
+                this._crossHairs.setClip([0, 0]);
+        }
    }

    /**
     * getCrosshairsClip:
     * Get whether the crosshairs are clipped by the mouse image.
-     * @returns {bool} Whether the crosshairs are clipped.
+     * @return:   Whether the crosshairs are clipped.
     */
    getCrosshairsClip() {
        if (this._crossHairs) {
            let [clipWidth, clipHeight] = this._crossHairs.getClip();
-            return clipWidth > 0 && clipHeight > 0;
+            return (clipWidth > 0 && clipHeight > 0);
        } else {
            return false;
        }
    }

-    // Private methods //
+    //// Private methods ////

    _updateMouseSprite() {
        this._updateSpriteTexture();
@ -625,8 +629,9 @@ var Magnifier = class Magnifier {

    _updateLensMode() {
        // Applies only to the first zoom region.
-        if (this._zoomRegions.length)
+        if (this._zoomRegions.length) {
            this._zoomRegions[0].setLensMode(this._settings.get_boolean(LENS_MODE_KEY));
+        }
    }

    _updateClampMode() {
@ -773,16 +778,15 @@ var ZoomRegion = class ZoomRegion {
    }

    _updateScreenPosition() {
-        if (this._screenPosition == GDesktopEnums.MagnifierScreenPosition.NONE) {
+        if (this._screenPosition == GDesktopEnums.MagnifierScreenPosition.NONE)
            this._setViewPort({
                x: this._viewPortX,
                y: this._viewPortY,
                width: this._viewPortWidth,
-                height: this._viewPortHeight,
+                height: this._viewPortHeight
            });
-        } else {
+        else
            this.setScreenPosition(this._screenPosition);
-        }
    }

    _updateFocus(caller, event) {
@ -820,7 +824,7 @@ var ZoomRegion = class ZoomRegion {

    /**
     * setActive:
-     * @param {bool} activate: Boolean to show/hide the ZoomRegion.
+     * @activate:   Boolean to show/hide the ZoomRegion.
     */
    setActive(activate) {
        if (activate == this.isActive())
@ -846,7 +850,7 @@ var ZoomRegion = class ZoomRegion {

    /**
     * isActive:
-     * @returns {bool} Whether this ZoomRegion is active
+     * @return  Whether this ZoomRegion is active (boolean).
     */
    isActive() {
        return this._magView != null;
@ -854,24 +858,24 @@ var ZoomRegion = class ZoomRegion {

    /**
     * setMagFactor:
-     * @param {number} xMagFactor: The power to set the horizontal
-     *     magnification factor to of the magnified view. A value of 1.0
-     *     means no magnification. A value of 2.0 doubles the size.
-     * @param {number} yMagFactor: The power to set the vertical
-     *     magnification factor to of the magnified view.
+     * @xMagFactor:     The power to set the horizontal magnification factor to
+     *                  of the magnified view.  A value of 1.0 means no
+     *                  magnification.  A value of 2.0 doubles the size.
+     * @yMagFactor:     The power to set the vertical magnification factor to
+     *                  of the magnified view.
     */
    setMagFactor(xMagFactor, yMagFactor) {
-        this._changeROI({ xMagFactor,
-                          yMagFactor,
+        this._changeROI({ xMagFactor: xMagFactor,
+                          yMagFactor: yMagFactor,
                          redoCursorTracking: this._followingCursor });
    }

    /**
     * getMagFactor:
-     * @returns {number[]} an array, [xMagFactor, yMagFactor], containing
-     *     the horizontal and vertical magnification powers. A value of
-     *     1.0 means no magnification. A value of 2.0 means the contents
-     *     are doubled in size, and so on.
+     * @return  an array, [xMagFactor, yMagFactor], containing the horizontal
+     *          and vertical magnification powers.  A value of 1.0 means no
+     *          magnification.  A value of 2.0 means the contents are doubled
+     *          in size, and so on.
     */
    getMagFactor() {
        return [this._xMagFactor, this._yMagFactor];
@ -879,7 +883,7 @@ var ZoomRegion = class ZoomRegion {

    /**
     * setMouseTrackingMode
-     * @param {GDesktopEnums.MagnifierMouseTrackingMode} mode: the new mode
+     * @mode:     One of the enum MouseTrackingMode values.
     */
    setMouseTrackingMode(mode) {
        if (mode >= GDesktopEnums.MagnifierMouseTrackingMode.NONE &&
@ -889,7 +893,7 @@ var ZoomRegion = class ZoomRegion {

    /**
     * getMouseTrackingMode
-     * @returns {GDesktopEnums.MagnifierMouseTrackingMode} the current mode
+     * @return:     One of the enum MouseTrackingMode values.
     */
    getMouseTrackingMode() {
        return this._mouseTrackingMode;
@ -897,7 +901,7 @@ var ZoomRegion = class ZoomRegion {

    /**
     * setFocusTrackingMode
-     * @param {GDesktopEnums.MagnifierFocusTrackingMode} mode: the new mode
+     * @mode:     One of the enum FocusTrackingMode values.
     */
    setFocusTrackingMode(mode) {
        this._focusTrackingMode = mode;
@ -906,7 +910,7 @@ var ZoomRegion = class ZoomRegion {

    /**
     * setCaretTrackingMode
-     * @param {GDesktopEnums.MagnifierCaretTrackingMode} mode: the new mode
+     * @mode:     One of the enum CaretTrackingMode values.
     */
    setCaretTrackingMode(mode) {
        this._caretTrackingMode = mode;
@ -936,9 +940,9 @@ var ZoomRegion = class ZoomRegion {
    /**
     * setViewPort
     * Sets the position and size of the ZoomRegion on screen.
-     * @param {{x: number, y: number, width: number, height: number}} viewPort:
-     *     Object defining the position and size of the view port.
-     *     The values are in stage coordinate space.
+     * @viewPort:   Object defining the position and size of the view port.
+     *              It has members x, y, width, height.  The values are in
+     *              stage coordinate space.
     */
    setViewPort(viewPort) {
        this._setViewPort(viewPort);
@ -948,9 +952,9 @@ var ZoomRegion = class ZoomRegion {
    /**
     * setROI
     * Sets the "region of interest" that the ZoomRegion is magnifying.
-     * @param {{x: number, y: number, width: number, height: number}} roi:
-     *     Object that defines the region of the screen to magnify.
-     *     The values are in screen (unmagnified) coordinate space.
+     * @roi:    Object that defines the region of the screen to magnify.  It
+     *          has members x, y, width, height.  The values are in
+     *          screen (unmagnified) coordinate space.
     */
    setROI(roi) {
        if (roi.width <= 0 || roi.height <= 0)
@ -968,8 +972,8 @@ var ZoomRegion = class ZoomRegion {
     * Retrieves the "region of interest" -- the rectangular bounds of that part
     * of the desktop that the magnified view is showing (x, y, width, height).
     * The bounds are given in non-magnified coordinates.
-     * @returns {number[]} an array, [x, y, width, height], representing
-     *     the bounding rectangle of what is shown in the magnified view.
+     * @return  an array, [x, y, width, height], representing the bounding
+     *          rectangle of what is shown in the magnified view.
     */
    getROI() {
        let roiWidth = this._viewPortWidth / this._xMagFactor;
@ -984,18 +988,18 @@ var ZoomRegion = class ZoomRegion {
     * setLensMode:
     * Turn lens mode on/off.  In full screen mode, lens mode does nothing since
     * a lens the size of the screen is pointless.
-     * @param {bool} lensMode: Whether lensMode should be active
+     * @lensMode:   A boolean to set the sense of lens mode.
     */
    setLensMode(lensMode) {
        this._lensMode = lensMode;
        if (!this._lensMode)
-            this.setScreenPosition(this._screenPosition);
+            this.setScreenPosition (this._screenPosition);
    }

    /**
     * isLensMode:
     * Is lens mode on or off?
-     * @returns {bool} The lens mode state.
+     * @return  The lens mode state as a boolean.
     */
    isLensMode() {
        return this._lensMode;
@ -1005,7 +1009,7 @@ var ZoomRegion = class ZoomRegion {
     * setClampScrollingAtEdges:
     * Stop vs. allow scrolling of the magnified contents when it scroll beyond
     * the edges of the screen.
-     * @param {bool} clamp: Boolean to turn on/off clamping.
+     * @clamp:   Boolean to turn on/off clamping.
     */
    setClampScrollingAtEdges(clamp) {
        this._clampScrollingAtEdges = clamp;
@ -1089,7 +1093,9 @@ var ZoomRegion = class ZoomRegion {
     * setScreenPosition:
     * Positions the zoom region to one of the enumerated positions on the
     * screen.
-     * @param {GDesktopEnums.MagnifierScreenPosition} inPosition: the position
+     * @position:   one of Magnifier.FULL_SCREEN, Magnifier.TOP_HALF,
+     *              Magnifier.BOTTOM_HALF,Magnifier.LEFT_HALF, or
+     *              Magnifier.RIGHT_HALF.
     */
    setScreenPosition(inPosition) {
        switch (inPosition) {
@ -1115,7 +1121,7 @@ var ZoomRegion = class ZoomRegion {
     * getScreenPosition:
     * Tell the outside world what the current mode is -- magnifiying the
     * top half, bottom half, etc.
-     * @returns {GDesktopEnums.MagnifierScreenPosition}: the current position.
+     * @return:  the current mode.
     */
    getScreenPosition() {
        return this._screenPosition;
@ -1124,8 +1130,7 @@ var ZoomRegion = class ZoomRegion {
    /**
     * scrollToMousePos:
     * Set the region of interest based on the position of the system pointer.
-     * @returns {bool}: Whether the system mouse pointer is over the
-     *     magnified view.
+     * @return:     Whether the system mouse pointer is over the magnified view.
     */
    scrollToMousePos() {
        this._followingCursor = true;
@ -1140,7 +1145,7 @@ var ZoomRegion = class ZoomRegion {

    _clearScrollContentsTimer() {
        if (this._scrollContentsTimerId != 0) {
-            GLib.source_remove(this._scrollContentsTimerId);
+            Mainloop.source_remove(this._scrollContentsTimerId);
            this._scrollContentsTimerId = 0;
        }
    }
@ -1152,7 +1157,7 @@ var ZoomRegion = class ZoomRegion {
        }

        this._clearScrollContentsTimer();
-        this._scrollContentsTimerId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, POINTER_REST_TIME, () => {
+        this._scrollContentsTimerId = Mainloop.timeout_add(POINTER_REST_TIME, () => {
            this._scrollContentsToDelayed(x, y);
            return GLib.SOURCE_REMOVE;
        });
@ -1162,8 +1167,8 @@ var ZoomRegion = class ZoomRegion {
     * scrollContentsTo:
     * Shift the contents of the magnified view such it is centered on the given
     * coordinate.
-     * @param {number} x: The x-coord of the point to center on.
-     * @param {number} y: The y-coord of the point to center on.
+     * @x:      The x-coord of the point to center on.
+     * @y:      The y-coord of the point to center on.
     */
    scrollContentsTo(x, y) {
        this._clearScrollContentsTimer();
@ -1176,21 +1181,22 @@ var ZoomRegion = class ZoomRegion {
    /**
     * addCrosshairs:
     * Add crosshairs centered on the magnified mouse.
-     * @param {Crosshairs} crossHairs: Crosshairs instance
+     * @crossHairs: Crosshairs instance
     */
    addCrosshairs(crossHairs) {
        this._crossHairs = crossHairs;

        // If the crossHairs is not already within a larger container, add it
        // to this zoom region.  Otherwise, add a clone.
-        if (crossHairs && this.isActive())
+        if (crossHairs && this.isActive()) {
            this._crossHairsActor = crossHairs.addToZoomRegion(this, this._mouseActor);
+        }
    }

    /**
     * setInvertLightness:
     * Set whether to invert the lightness of the magnified view.
-     * @param {bool} flag: whether brightness should be inverted
+     * @flag    Boolean to either invert brightness (true), or not (false).
     */
    setInvertLightness(flag) {
        this._invertLightness = flag;
@ -1201,7 +1207,7 @@ var ZoomRegion = class ZoomRegion {
    /**
     * getInvertLightness:
     * Retrieve whether the lightness is inverted.
-     * @returns {bool} whether brightness should be inverted
+     * @return    Boolean indicating inversion (true), or not (false).
     */
    getInvertLightness() {
        return this._invertLightness;
@ -1210,9 +1216,9 @@ var ZoomRegion = class ZoomRegion {
    /**
     * setColorSaturation:
     * Set the color saturation of the magnified view.
-     * @param {number} saturation: A value from 0.0 to 1.0 that defines
-     *     the color saturation, with 0.0 defining no color (grayscale),
-     *     and 1.0 defining full color.
+     * @sauration  A value from 0.0 to 1.0 that defines the color
+     *             saturation, with 0.0 defining no color (grayscale),
+     *             and 1.0 defining full color.
     */
    setColorSaturation(saturation) {
        this._colorSaturation = saturation;
@ -1223,7 +1229,6 @@ var ZoomRegion = class ZoomRegion {
    /**
     * getColorSaturation:
     * Retrieve the color saturation of the magnified view.
-     * @returns {number} the color saturation
     */
    getColorSaturation() {
        return this._colorSaturation;
@ -1232,14 +1237,10 @@ var ZoomRegion = class ZoomRegion {
    /**
     * setBrightness:
     * Alter the brightness of the magnified view.
-     * @param {Object} brightness: Object containing the contrast for the
-     *     red, green, and blue channels. Values of 0.0 represent "standard"
-     *     brightness (no change), whereas values less or greater than
-     *     0.0 indicate decreased or incresaed brightness, respectively.
-     *
-     *     {number} brightness.r - the red component
-     *     {number} brightness.g - the green component
-     *     {number} brightness.b - the blue component
+     * @brightness  Object containing the contrast for the red, green,
+     *              and blue channels.  Values of 0.0 represent "standard"
+     *              brightness (no change), whereas values less or greater than
+     *              0.0 indicate decreased or incresaed brightness, respectively.
     */
    setBrightness(brightness) {
        this._brightness.r = brightness.r;
@ -1252,14 +1253,10 @@ var ZoomRegion = class ZoomRegion {
    /**
     * setContrast:
     * Alter the contrast of the magnified view.
-     * @param {Object} contrast: Object containing the contrast for the
-     *     red, green, and blue channels. Values of 0.0 represent "standard"
-     *     contrast (no change), whereas values less or greater than
-     *     0.0 indicate decreased or incresaed contrast, respectively.
-     *
-     *     {number} contrast.r - the red component
-     *     {number} contrast.g - the green component
-     *     {number} contrast.b - the blue component
+     * @contrast    Object containing the contrast for the red, green,
+     *              and blue channels.  Values of 0.0 represent "standard"
+     *              contrast (no change), whereas values less or greater than
+     *              0.0 indicate decreased or incresaed contrast, respectively.
     */
    setContrast(contrast) {
        this._contrast.r = contrast.r;
@ -1272,8 +1269,8 @@ var ZoomRegion = class ZoomRegion {
    /**
     * getContrast:
     * Retrieve the contrast of the magnified view.
-     * @returns {{r: number, g: number, b: number}}: Object containing
-     *     the contrast for the red, green, and blue channels.
+     * @return  Object containing the contrast for the red, green,
+     *          and blue channels.
     */
    getContrast() {
        let contrast = {};
@ -1283,15 +1280,15 @@ var ZoomRegion = class ZoomRegion {
        return contrast;
    }

-    // Private methods //
+    //// Private methods ////

    _createActors() {
        // The root actor for the zoom region
-        this._magView = new St.Bin({ style_class: 'magnifier-zoom-region' });
+        this._magView = new St.Bin({ style_class: 'magnifier-zoom-region', x_fill: true, y_fill: true });
        global.stage.add_actor(this._magView);

        // hide the magnified region from CLUTTER_PICK_ALL
-        Shell.util_set_hidden_from_pick(this._magView, true);
+        Shell.util_set_hidden_from_pick (this._magView, true);

        // Add a group to clip the contents of the magnified view.
        let mainGroup = new Clutter.Actor({ clip_to_allocation: true });
@ -1299,7 +1296,7 @@ var ZoomRegion = class ZoomRegion {

        // Add a background for when the magnified uiGroup is scrolled
        // out of view (don't want to see desktop showing through).
-        this._background = new Background.SystemBackground();
+        this._background = (new Background.SystemBackground()).actor;
        mainGroup.add_actor(this._background);

        // Clone the group that contains all of UI on the screen.  This is the
@ -1331,7 +1328,7 @@ var ZoomRegion = class ZoomRegion {

    _destroyActors() {
        if (this._mouseActor == this._mouseSourceActor)
-            this._mouseActor.get_parent().remove_actor(this._mouseActor);
+            this._mouseActor.get_parent().remove_actor (this._mouseActor);
        if (this._crossHairs)
            this._crossHairs.removeFromParent(this._crossHairsActor);

@ -1411,12 +1408,11 @@ var ZoomRegion = class ZoomRegion {
        // If in lens mode, move the magnified view such that it is centered
        // over the actual mouse. However, in full screen mode, the "lens" is
        // the size of the screen -- pointless to move such a large lens around.
-        if (this._lensMode && !this._isFullScreen()) {
+        if (this._lensMode && !this._isFullScreen())
            this._setViewPort({ x: this._xCenter - this._viewPortWidth / 2,
                                y: this._yCenter - this._viewPortHeight / 2,
                                width: this._viewPortWidth,
                                height: this._viewPortHeight }, true);
-        }

        this._updateCloneGeometry();
        this._updateMousePosition();
@ -1430,9 +1426,10 @@ var ZoomRegion = class ZoomRegion {
            let xMouse = this._magnifier.xMouse;
            let yMouse = this._magnifier.yMouse;

-            mouseIsOver =
+            mouseIsOver = (
                xMouse >= this._viewPortX && xMouse < (this._viewPortX + this._viewPortWidth) &&
-                yMouse >= this._viewPortY && yMouse < (this._viewPortY + this._viewPortHeight);
+                yMouse >= this._viewPortY && yMouse < (this._viewPortY + this._viewPortHeight)
+            );
        }
        return mouseIsOver;
    }
@ -1457,12 +1454,13 @@ var ZoomRegion = class ZoomRegion {
        let xMouse = this._magnifier.xMouse;
        let yMouse = this._magnifier.yMouse;

-        if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL)
+        if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) {
            return this._centerFromPointProportional(xMouse, yMouse);
-        else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH)
+        } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
            return this._centerFromPointPush(xMouse, yMouse);
-        else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED)
+        } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
            return this._centerFromPointCentered(xMouse, yMouse);
+        }

        return null; // Should never be hit
    }
@ -1504,20 +1502,20 @@ var ZoomRegion = class ZoomRegion {
        let yRoiBottom = yRoi + heightRoi - cursorHeight;

        if (xPoint < xRoi)
-            xPos -= xRoi - xPoint;
+            xPos -= (xRoi - xPoint);
        else if (xPoint > xRoiRight)
-            xPos += xPoint - xRoiRight;
+            xPos += (xPoint - xRoiRight);

        if (yPoint < yRoi)
-            yPos -= yRoi - yPoint;
+            yPos -= (yRoi - yPoint);
        else if (yPoint > yRoiBottom)
-            yPos += yPoint - yRoiBottom;
+            yPos += (yPoint - yRoiBottom);

        return [xPos, yPos];
    }

    _centerFromPointProportional(xPoint, yPoint) {
-        let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI();
+        let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI();
        let halfScreenWidth = global.screen_width / 2;
        let halfScreenHeight = global.screen_height / 2;
        // We want to pad with a constant distance after zooming, so divide
@ -1595,9 +1593,8 @@ var ZoomRegion = class ZoomRegion {
    }
 };

-var Crosshairs = GObject.registerClass(
-class Crosshairs extends Clutter.Actor {
-    _init() {
+var Crosshairs = class Crosshairs {
+    constructor() {

        // Set the group containing the crosshairs to three times the desktop
        // size in case the crosshairs need to appear to be infinite in
@ -1605,19 +1602,19 @@ class Crosshairs extends Clutter.Actor {
        let groupWidth = global.screen_width * 3;
        let groupHeight = global.screen_height * 3;

-        super._init({
+        this._actor = new Clutter.Actor({
            clip_to_allocation: false,
            width: groupWidth,
-            height: groupHeight,
+            height: groupHeight
        });
        this._horizLeftHair = new Clutter.Actor();
        this._horizRightHair = new Clutter.Actor();
        this._vertTopHair = new Clutter.Actor();
        this._vertBottomHair = new Clutter.Actor();
-        this.add_actor(this._horizLeftHair);
-        this.add_actor(this._horizRightHair);
-        this.add_actor(this._vertTopHair);
-        this.add_actor(this._vertBottomHair);
+        this._actor.add_actor(this._horizLeftHair);
+        this._actor.add_actor(this._horizRightHair);
+        this._actor.add_actor(this._vertTopHair);
+        this._actor.add_actor(this._vertBottomHair);
        this._clipSize = [0, 0];
        this._clones = [];
        this.reCenter();
@ -1627,7 +1624,7 @@ class Crosshairs extends Clutter.Actor {
    }

    _monitorsChanged() {
-        this.set_size(global.screen_width * 3, global.screen_height * 3);
+        this._actor.set_size(global.screen_width * 3, global.screen_height * 3);
        this.reCenter();
    }

@ -1637,30 +1634,26 @@ class Crosshairs extends Clutter.Actor {
    * already part of some other ZoomRegion, create a clone of the crosshairs
    * actor, and add the clone instead.  Returns either the original or the
    * clone.
-    * @param {ZoomRegion} zoomRegion: The container to add the crosshairs
-    *     group to.
-    * @param {Clutter.Actor} magnifiedMouse: The mouse actor for the
-    *     zoom region -- used to position the crosshairs and properly
-    *     layer them below the mouse.
-    * @returns {Clutter.Actor} The crosshairs actor, or its clone.
+    * @zoomRegion:      The container to add the crosshairs group to.
+    * @magnifiedMouse:  The mouse actor for the zoom region -- used to
+    *                   position the crosshairs and properly layer them below
+    *                   the mouse.
+    * @return           The crosshairs actor, or its clone.
    */
    addToZoomRegion(zoomRegion, magnifiedMouse) {
        let crosshairsActor = null;
        if (zoomRegion && magnifiedMouse) {
            let container = magnifiedMouse.get_parent();
            if (container) {
-                crosshairsActor = this;
-                if (this.get_parent() != null) {
-                    crosshairsActor = new Clutter.Clone({ source: this });
+                crosshairsActor = this._actor;
+                if (this._actor.get_parent() != null) {
+                    crosshairsActor = new Clutter.Clone({ source: this._actor });
                    this._clones.push(crosshairsActor);
-
-                    // Clones don't share visibility.
-                    this.bind_property('visible', crosshairsActor, 'visible',
-                                       GObject.BindingFlags.SYNC_CREATE);
                }
+                crosshairsActor.visible = this._actor.visible;

                container.add_actor(crosshairsActor);
-                container.set_child_above_sibling(magnifiedMouse, crosshairsActor);
+                container.raise_child(magnifiedMouse, crosshairsActor);
                let [xMouse, yMouse] = magnifiedMouse.get_position();
                let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size();
                crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2);
@ -1671,13 +1664,12 @@ class Crosshairs extends Clutter.Actor {

    /**
     * removeFromParent:
-     * @param {Clutter.Actor} childActor: the actor returned from
-     *     addToZoomRegion
+     * @childActor: the actor returned from addToZoomRegion
     * Remove the crosshairs actor from its parent container, or destroy the
     * child actor if it was just a clone of the crosshairs actor.
     */
    removeFromParent(childActor) {
-        if (childActor == this)
+        if (childActor == this._actor)
            childActor.get_parent().remove_actor(childActor);
        else
            childActor.destroy();
@ -1686,7 +1678,7 @@ class Crosshairs extends Clutter.Actor {
    /**
     * setColor:
     * Set the color of the crosshairs.
-     * @param {Clutter.Color} clutterColor: The color
+     * @clutterColor:   The color as a Clutter.Color.
     */
    setColor(clutterColor) {
        this._horizLeftHair.background_color = clutterColor;
@ -1698,7 +1690,7 @@ class Crosshairs extends Clutter.Actor {
    /**
     * getColor:
     * Get the color of the crosshairs.
-     * @returns {ClutterColor} the crosshairs color
+     * @color:  The color as a Clutter.Color.
     */
    getColor() {
        return this._horizLeftHair.get_color();
@ -1707,7 +1699,7 @@ class Crosshairs extends Clutter.Actor {
    /**
     * setThickness:
     * Set the width of the vertical and horizontal lines of the crosshairs.
-     * @param {number} thickness: the new thickness value
+     * @thickness
     */
    setThickness(thickness) {
        this._horizLeftHair.set_height(thickness);
@ -1720,7 +1712,7 @@ class Crosshairs extends Clutter.Actor {
    /**
     * getThickness:
     * Get the width of the vertical and horizontal lines of the crosshairs.
-     * @returns {number} The thickness of the crosshairs.
+     * @return:     The thickness of the crosshairs.
     */
    getThickness() {
        return this._horizLeftHair.get_height();
@ -1729,8 +1721,7 @@ class Crosshairs extends Clutter.Actor {
    /**
     * setOpacity:
     * Set how opaque the crosshairs are.
-     * @param {number} opacity: Value between 0 (fully transparent)
-     *     and 255 (full opaque).
+     * @opacity:    Value between 0 (fully transparent) and 255 (full opaque).
     */
    setOpacity(opacity) {
        // set_opacity() throws an exception for values outside the range
@ -1749,7 +1740,7 @@ class Crosshairs extends Clutter.Actor {
    /**
     * setLength:
     * Set the length of the vertical and horizontal lines in the crosshairs.
-     * @param {number} length: The length of the crosshairs.
+     * @length: The length of the crosshairs.
     */
    setLength(length) {
        this._horizLeftHair.set_width(length);
@ -1762,7 +1753,7 @@ class Crosshairs extends Clutter.Actor {
    /**
     * getLength:
     * Get the length of the vertical and horizontal lines in the crosshairs.
-     * @returns {number} The length of the crosshairs.
+     * @return: The length of the crosshairs.
     */
    getLength() {
        return this._horizLeftHair.get_width();
@ -1772,8 +1763,8 @@ class Crosshairs extends Clutter.Actor {
     * setClip:
     * Set the width and height of the rectangle that clips the crosshairs at
     * their intersection
-     * @param {number[]} size: Array of [width, height] defining the size
-     *     of the clip rectangle.
+     * @size:   Array of [width, height] defining the size of the clip
+     *          rectangle.
     */
    setClip(size) {
        if (size) {
@ -1788,15 +1779,37 @@ class Crosshairs extends Clutter.Actor {
        }
    }

+    /**
+     * show:
+     * Show the crosshairs.
+     */
+    show() {
+        this._actor.show();
+        // Clones don't share visibility.
+        for (let i = 0; i < this._clones.length; i++)
+            this._clones[i].show();
+    }
+
+    /**
+     * hide:
+     * Hide the crosshairs.
+     */
+    hide() {
+        this._actor.hide();
+        // Clones don't share visibility.
+        for (let i = 0; i < this._clones.length; i++)
+            this._clones[i].hide();
+    }
+
    /**
     * reCenter:
     * Reposition the horizontal and vertical hairs such that they cross at
     * the center of crosshairs group.  If called with the dimensions of
     * the clip rectangle, these are used to update the size of the clip.
-     * @param {number[]=} clipSize: If present, the clip's [width, height].
+     * @clipSize:  Optional.  If present, an array of the form [width, height].
     */
    reCenter(clipSize) {
-        let [groupWidth, groupHeight] = this.get_size();
+        let [groupWidth, groupHeight] = this._actor.get_size();
        let leftLength = this._horizLeftHair.get_width();
        let topLength = this._vertTopHair.get_height();
        let thickness = this._horizLeftHair.get_height();
@ -1818,7 +1831,7 @@ class Crosshairs extends Clutter.Actor {
        this._vertTopHair.set_position((groupWidth - thickness) / 2, top);
        this._vertBottomHair.set_position((groupWidth - thickness) / 2, bottom);
    }
-});
+};

 var MagShaderEffects = class MagShaderEffects {
    constructor(uiGroupClone) {
@ -1851,7 +1864,7 @@ var MagShaderEffects = class MagShaderEffects {
    /**
     * setInvertLightness:
     * Enable/disable invert lightness effect.
-     * @param {bool} invertFlag: Enabled flag.
+     * @invertFlag:     Enabled flag.
     */
    setInvertLightness(invertFlag) {
        this._inverse.set_enabled(invertFlag);
@ -1864,14 +1877,11 @@ var MagShaderEffects = class MagShaderEffects {
    /**
     * setBrightness:
     * Set the brightness of the magnified view.
-     * @param {Object} brightness: Object containing the contrast for the
-     *     red, green, and blue channels. Values of 0.0 represent "standard"
-     *     brightness (no change), whereas values less or greater than
-     *     0.0 indicate decreased or incresaed brightness, respectively.
-     *
-     *     {number} brightness.r - the red component
-     *     {number} brightness.g - the green component
-     *     {number} brightness.b - the blue component
+     * @brightness: Object containing the brightness for the red, green,
+     *              and blue channels.  Values of 0.0 represent "standard"
+     *              brightness (no change), whereas values less or greater than
+     *              0.0 indicate decreased or incresaed brightness,
+     *              respectively.
     */
    setBrightness(brightness) {
        let bRed = brightness.r;
@ -1883,21 +1893,17 @@ var MagShaderEffects = class MagShaderEffects {
        // it modifies the brightness and/or contrast.
        let [cRed, cGreen, cBlue] = this._brightnessContrast.get_contrast();
        this._brightnessContrast.set_enabled(
-            bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE ||
-             cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE
+            (bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE ||
+             cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE)
        );
    }

    /**
     * Set the contrast of the magnified view.
-     * @param {Object} contrast: Object containing the contrast for the
-     *     red, green, and blue channels. Values of 0.0 represent "standard"
-     *     contrast (no change), whereas values less or greater than
-     *     0.0 indicate decreased or incresaed contrast, respectively.
-     *
-     *     {number} contrast.r - the red component
-     *     {number} contrast.g - the green component
-     *     {number} contrast.b - the blue component
+     * @contrast:   Object containing the contrast for the red, green,
+     *              and blue channels.  Values of 0.0 represent "standard"
+     *              contrast (no change), whereas values less or greater than
+     *              0.0 indicate decreased or incresaed contrast, respectively.
     */
    setContrast(contrast) {
        let cRed = contrast.r;
--- a/js/ui/magnifierDBus.js
+++ b/js/ui/magnifierDBus.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ShellMagnifier */

 const Gio = imports.gi.Gio;
 const Main = imports.ui.main;
@ -32,7 +31,7 @@ var ShellMagnifier = class ShellMagnifier {

    /**
     * setActive:
-     * @param {bool} activate: activate or de-activate the magnifier.
+     * @activate:   Boolean to activate or de-activate the magnifier.
     */
    setActive(activate) {
        Main.magnifier.setActive(activate);
@ -40,7 +39,7 @@ var ShellMagnifier = class ShellMagnifier {

    /**
     * isActive:
-     * @returns {bool} Whether the magnifier is active.
+     * @return  Whether the magnifier is active (boolean).
     */
    isActive() {
        return Main.magnifier.isActive();
@ -65,25 +64,22 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * createZoomRegion:
     * Create a new ZoomRegion and return its object path.
-     * @param {number} xMagFactor:
-     *     The power to set horizontal magnification of the ZoomRegion.
-     *     A value of 1.0 means no magnification. A value of 2.0 doubles
-     *     the size.
-     * @param {number} yMagFactor:
-     *     The power to set the vertical magnification of the
-     *     ZoomRegion.
-     * @param {number[]} roi
-     *     Array of integers defining the region of the screen/desktop
-     *     to magnify.  The array has the form [left, top, right, bottom].
-     * @param {number[]} viewPort
-     *     Array of integers, [left, top, right, bottom] that defines
-     *     the position of the ZoomRegion on screen.
+     * @xMagFactor:     The power to set horizontal magnification of the
+     *                  ZoomRegion.  A value of 1.0 means no magnification.  A
+     *                  value of 2.0 doubles the size.
+     * @yMagFactor:     The power to set the vertical magnification of the
+     *                  ZoomRegion.
+     * @roi             Array of integers defining the region of the
+     *                  screen/desktop to magnify.  The array has the form
+     *                  [left, top, right, bottom].
+     * @viewPort        Array of integers, [left, top, right, bottom] that defines
+     *                  the position of the ZoomRegion on screen.
     *
     * FIXME: The arguments here are redundant, since the width and height of
     *   the ROI are determined by the viewport and magnification factors.
     *   We ignore the passed in width and height.
     *
-     * @returns {ZoomRegion} The newly created ZoomRegion.
+     * @return          The newly created ZoomRegion.
     */
    createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) {
        let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
@ -103,9 +99,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * addZoomRegion:
     * Append the given ZoomRegion to the magnifier's list of ZoomRegions.
-     * @param {string} zoomerObjectPath: The object path for the zoom
-     *     region proxy.
-     * @returns {bool} whether the region was added successfully
+     * @zoomerObjectPath:   The object path for the zoom region proxy.
     */
    addZoomRegion(zoomerObjectPath) {
        let proxyAndZoomRegion = this._zoomers[zoomerObjectPath];
@ -120,8 +114,8 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * getZoomRegions:
     * Return a list of ZoomRegion object paths for this Magnifier.
-     * @returns {string[]}: The Magnifier's zoom region list as an array
-     *     of DBus object paths.
+     * @return:     The Magnifier's zoom region list as an array of DBus object
+     *              paths.
     */
    getZoomRegions() {
        // There may be more ZoomRegions in the magnifier itself than have
@ -130,7 +124,7 @@ var ShellMagnifier = class ShellMagnifier {
        let zoomRegions = Main.magnifier.getZoomRegions();
        let objectPaths = [];
        let thoseZoomers = this._zoomers;
-        zoomRegions.forEach(aZoomRegion => {
+        zoomRegions.forEach ((aZoomRegion, index, array) => {
            let found = false;
            for (let objectPath in thoseZoomers) {
                let proxyAndZoomRegion = thoseZoomers[objectPath];
@ -142,7 +136,7 @@ var ShellMagnifier = class ShellMagnifier {
            }
            if (!found) {
                // Got a ZoomRegion with no DBus proxy, make one.
-                let newPath = `${ZOOM_SERVICE_PATH}/zoomer${_zoomRegionInstanceCount}`;
+                let newPath =  ZOOM_SERVICE_PATH + '/zoomer' + _zoomRegionInstanceCount;
                _zoomRegionInstanceCount++;
                let zoomRegionProxy = new ShellMagnifierZoomRegion(newPath, aZoomRegion);
                let proxyAndZoomer = {};
@ -174,7 +168,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * fullScreenCapable:
     * Consult if the Magnifier can magnify in full-screen mode.
-     * @returns {bool} Always return true.
+     * @return  Always return true.
     */
    fullScreenCapable() {
        return true;
@ -183,7 +177,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * setCrosswireSize:
     * Set the crosswire size of all ZoomRegions.
-     * @param {number} size: The thickness of each line in the cross wire.
+     * @size:   The thickness of each line in the cross wire.
     */
    setCrosswireSize(size) {
        Main.magnifier.setCrosshairsThickness(size);
@ -192,7 +186,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * getCrosswireSize:
     * Get the crosswire size of all ZoomRegions.
-     * @returns {number}: The thickness of each line in the cross wire.
+     * @return:   The thickness of each line in the cross wire.
     */
    getCrosswireSize() {
        return Main.magnifier.getCrosshairsThickness();
@ -201,16 +195,16 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * setCrosswireLength:
     * Set the crosswire length of all zoom-regions..
-     * @param {number} length: The length of each line in the cross wire.
+     * @size:   The length of each line in the cross wire.
     */
    setCrosswireLength(length) {
        Main.magnifier.setCrosshairsLength(length);
    }

    /**
-     * getCrosswireSize:
-     * Get the crosswire length of all zoom-regions.
-     * @returns {number} size: The length of each line in the cross wire.
+     * setCrosswireSize:
+     * Set the crosswire size of all zoom-regions.
+     * @size:   The thickness of each line in the cross wire.
     */
    getCrosswireLength() {
        return Main.magnifier.getCrosshairsLength();
@ -219,7 +213,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * setCrosswireClip:
     * Set if the crosswire will be clipped by the cursor image..
-     * @param {bool} clip: Flag to indicate whether to clip the crosswire.
+     * @clip:   Flag to indicate whether to clip the crosswire.
     */
    setCrosswireClip(clip) {
        Main.magnifier.setCrosshairsClip(clip);
@ -228,7 +222,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * getCrosswireClip:
     * Get the crosswire clip value.
-     * @returns {bool}: Whether the crosswire is clipped by the cursor image.
+     * @return:   Whether the crosswire is clipped by the cursor image.
     */
    getCrosswireClip() {
        return Main.magnifier.getCrosshairsClip();
@ -237,7 +231,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * setCrosswireColor:
     * Set the crosswire color of all ZoomRegions.
-     * @param {number} color: Unsigned int of the form rrggbbaa.
+     * @color:   Unsigned int of the form rrggbbaa.
     */
    setCrosswireColor(color) {
        Main.magnifier.setCrosshairsColor('#%08x'.format(color));
@ -246,8 +240,7 @@ var ShellMagnifier = class ShellMagnifier {
    /**
     * getCrosswireClip:
     * Get the crosswire color of all ZoomRegions.
-     * @returns {number}: The crosswire color as an unsigned int in
-     *     the form rrggbbaa.
+     * @return:   The crosswire color as an unsigned int in the form rrggbbaa.
     */
    getCrosswireColor() {
        let colorString = Main.magnifier.getCrosshairsColor();
@ -272,11 +265,11 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {

    /**
     * setMagFactor:
-     * @param {number} xMagFactor: The power to set the horizontal
-     *     magnification factor to of the magnified view. A value of
-     *     1.0 means no magnification. A value of 2.0 doubles the size.
-     * @param {number} yMagFactor: The power to set the vertical
-     *     magnification factor to of the magnified view.
+     * @xMagFactor:     The power to set the horizontal magnification factor to
+     *                  of the magnified view.  A value of 1.0 means no
+     *                  magnification.  A value of 2.0 doubles the size.
+     * @yMagFactor:     The power to set the vertical magnification factor to
+     *                  of the magnified view.
     */
    setMagFactor(xMagFactor, yMagFactor) {
        this._zoomRegion.setMagFactor(xMagFactor, yMagFactor);
@ -284,7 +277,7 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {

    /**
     * getMagFactor:
-     * @returns {number[]}: [xMagFactor, yMagFactor], containing the horizontal
+     * @return  an array, [xMagFactor, yMagFactor], containing the horizontal
     *          and vertical magnification powers.  A value of 1.0 means no
     *          magnification.  A value of 2.0 means the contents are doubled
     *          in size, and so on.
@ -296,9 +289,9 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
    /**
     * setRoi:
     * Sets the "region of interest" that the ZoomRegion is magnifying.
-     * @param {number[]} roi: [left, top, right, bottom], defining the
-     *     region of the screen to magnify.
-     *     The values are in screen (unmagnified) coordinate space.
+     * @roi     Array, [left, top, right, bottom], defining the region of the
+     *          screen to magnify. The values are in screen (unmagnified)
+     *          coordinate space.
     */
    setRoi(roi) {
        let roiObject = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
@ -310,7 +303,7 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
     * Retrieves the "region of interest" -- the rectangular bounds of that part
     * of the desktop that the magnified view is showing (x, y, width, height).
     * The bounds are given in non-magnified coordinates.
-     * @returns {Array}: [left, top, right, bottom], representing the bounding
+     * @return  an array, [left, top, right, bottom], representing the bounding
     *          rectangle of what is shown in the magnified view.
     */
    getRoi() {
@ -323,11 +316,10 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
    /**
     * Set the "region of interest" by centering the given screen coordinate
     * within the zoom region.
-     * @param {number} x: The x-coord of the point to place at the
-     *     center of the zoom region.
-     * @param {number} y: The y-coord.
-     * @returns {bool} Whether the shift was successful (for GS-mag, this
-     *     is always true).
+     * @x       The x-coord of the point to place at the center of the zoom region.
+     * @y       The y-coord.
+     * @return  Whether the shift was successful (for GS-mag, this is always
+     *          true).
     */
    shiftContentsTo(x, y) {
        this._zoomRegion.scrollContentsTo(x, y);
@ -337,8 +329,8 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
    /**
     * moveResize
     * Sets the position and size of the ZoomRegion on screen.
-     * @param {number[]} viewPort: [left, top, right, bottom], defining
-     *     the position and size on screen to place the zoom region.
+     * @viewPort    Array, [left, top, right, bottom], defining the position and
+     *              size on screen to place the zoom region.
     */
    moveResize(viewPort) {
        let viewRect = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] };
--- a/js/ui/main.js
+++ b/js/ui/main.js
@ -1,14 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported componentManager, notificationDaemon, windowAttentionHandler,
-            ctrlAltTabManager, padOsdService, osdWindowManager,
-            osdMonitorLabeler, shellMountOpDBusService, shellDBusService,
-            shellAccessDialogDBusService, shellAudioSelectionDBusService,
-            screenSaverDBus, screencastService, uiGroup, magnifier,
-            xdndHandler, keyboard, kbdA11yDialog, introspectService,
-            start, pushModal, popModal, activateWindow, createLookingGlass,
-            initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
+const Mainloop = imports.mainloop;

 const AccessDialog = imports.ui.accessDialog;
 const AudioDeviceSelection = imports.ui.audioDeviceSelection;
@ -53,7 +46,6 @@ const LOG_DOMAIN = 'GNOME Shell';
 const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a';

 var componentManager = null;
-var extensionManager = null;
 var panel = null;
 var overview = null;
 var runDialog = null;
@ -189,7 +181,7 @@ function _initializeUI() {

    messageTray = new MessageTray.MessageTray();
    panel = new Panel.Panel();
-    keyboard = new Keyboard.KeyboardManager();
+    keyboard = new Keyboard.Keyboard();
    notificationDaemon = new NotificationDaemon.NotificationDaemon();
    windowAttentionHandler = new WindowAttentionHandler.WindowAttentionHandler();
    componentManager = new Components.ComponentManager();
@ -199,12 +191,12 @@ function _initializeUI() {
    layoutManager.init();
    overview.init();

-    new PointerA11yTimeout.PointerA11yTimeout();
+    (new PointerA11yTimeout.PointerA11yTimeout());

    _a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA });

    global.display.connect('overlay-key', () => {
-        if (!_a11ySettings.get_boolean(STICKY_KEYS_ENABLE))
+        if (!_a11ySettings.get_boolean (STICKY_KEYS_ENABLE))
            overview.toggle();
    });

@ -229,17 +221,12 @@ function _initializeUI() {
    EndSessionDialog.init();

    // We're ready for the session manager to move to the next phase
-    GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
-        Shell.util_sd_notify();
-        Meta.register_with_session();
-        return GLib.SOURCE_REMOVE;
-    });
+    Meta.register_with_session();

    _startDate = new Date();

    ExtensionDownloader.init();
-    extensionManager = new ExtensionSystem.ExtensionManager();
-    extensionManager.init();
+    ExtensionSystem.init();

    if (sessionMode.isGreeter && screenShield) {
        layoutManager.connect('startup-prepared', () => {
@ -248,33 +235,20 @@ function _initializeUI() {
    }

    layoutManager.connect('startup-complete', () => {
-        if (actionMode == Shell.ActionMode.NONE)
+        if (actionMode == Shell.ActionMode.NONE) {
            actionMode = Shell.ActionMode.NORMAL;
-
-        if (screenShield)
+        }
+        if (screenShield) {
            screenShield.lockIfWasLocked();
-
+        }
        if (sessionMode.currentMode != 'gdm' &&
            sessionMode.currentMode != 'initial-setup') {
            GLib.log_structured(LOG_DOMAIN, GLib.LogLevelFlags.LEVEL_MESSAGE, {
                'MESSAGE': `GNOME Shell started at ${_startDate}`,
-                'MESSAGE_ID': GNOMESHELL_STARTED_MESSAGE_ID,
+                'MESSAGE_ID': GNOMESHELL_STARTED_MESSAGE_ID
            });
        }

-        let credentials = new Gio.Credentials();
-        if (credentials.get_unix_user() === 0) {
-            notify(_('Logged in as a privileged user'),
-                   _('Running a session as a privileged user should be avoided for security reasons. If possible, you should log in as a normal user.'));
-        }
-
-        if (sessionMode.currentMode !== 'gdm' &&
-            sessionMode.currentMode !== 'initial-setup' &&
-            screenShield === null) {
-            notify(_('Screen Lock disabled'),
-                   _('Screen Locking requires the GNOME display manager.'));
-        }
-
        LoginManager.registerSessionWithGDM();

        let perfModuleName = GLib.getenv("SHELL_PERF_MODULE");
@ -289,19 +263,19 @@ function _initializeUI() {
 function _getStylesheet(name) {
    let stylesheet;

-    stylesheet = Gio.File.new_for_uri(`resource:///org/gnome/shell/theme/${name}`);
+    stylesheet = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/' + name);
    if (stylesheet.query_exists(null))
        return stylesheet;

    let dataDirs = GLib.get_system_data_dirs();
    for (let i = 0; i < dataDirs.length; i++) {
        let path = GLib.build_filenamev([dataDirs[i], 'gnome-shell', 'theme', name]);
-        stylesheet = Gio.file_new_for_path(path);
+        let stylesheet = Gio.file_new_for_path(path);
        if (stylesheet.query_exists(null))
            return stylesheet;
    }

-    stylesheet = Gio.File.new_for_path(`${global.datadir}/theme/${name}`);
+    stylesheet = Gio.File.new_for_path(global.datadir + '/theme/' + name);
    if (stylesheet.query_exists(null))
        return stylesheet;

@ -337,7 +311,7 @@ function _loadDefaultStylesheet() {
 *
 * Get the theme CSS file that the shell will load
 *
- * @returns {?Gio.File}: A #GFile that contains the theme CSS,
+ * Returns: A #GFile that contains the theme CSS,
 *          null if using the default
 */
 function getThemeStylesheet() {
@ -346,8 +320,8 @@ function getThemeStylesheet() {

 /**
 * setThemeStylesheet:
- * @param {string=} cssStylesheet: A file path that contains the theme CSS,
- *     set it to null to use the default
+ * @cssStylesheet: A file path that contains the theme CSS,
+ *                 set it to null to use the default
 *
 * Set the theme CSS file that the shell will load
 */
@ -359,12 +333,12 @@ function reloadThemeResource() {
    if (_themeResource)
        _themeResource._unregister();

-    _themeResource = Gio.Resource.load(`${global.datadir}/gnome-shell-theme.gresource`);
+    _themeResource = Gio.Resource.load(global.datadir + '/gnome-shell-theme.gresource');
    _themeResource._register();
 }

 function _loadOskLayouts() {
-    _oskResource = Gio.Resource.load(`${global.datadir}/gnome-shell-osk-layouts.gresource`);
+    _oskResource = Gio.Resource.load(global.datadir + '/gnome-shell-osk-layouts.gresource');
    _oskResource._register();
 }

@ -374,13 +348,11 @@ function _loadOskLayouts() {
 * Reloads the theme CSS file
 */
 function loadTheme() {
-    let themeContext = St.ThemeContext.get_for_stage(global.stage);
+    let themeContext = St.ThemeContext.get_for_stage (global.stage);
    let previousTheme = themeContext.get_theme();

-    let theme = new St.Theme({
-        application_stylesheet: _cssStylesheet,
-        default_stylesheet: _defaultCssStylesheet,
-    });
+    let theme = new St.Theme ({ application_stylesheet: _cssStylesheet,
+                                default_stylesheet: _defaultCssStylesheet });

    if (theme.default_stylesheet == null)
        throw new Error("No valid stylesheet found for '%s'".format(sessionMode.stylesheetName));
@ -392,26 +364,26 @@ function loadTheme() {
            theme.load_stylesheet(customStylesheets[i]);
    }

-    themeContext.set_theme(theme);
+    themeContext.set_theme (theme);
 }

 /**
 * notify:
- * @param {string} msg: A message
- * @param {string} details: Additional information
+ * @msg: A message
+ * @details: Additional information
 */
 function notify(msg, details) {
    let source = new MessageTray.SystemNotificationSource();
    messageTray.add(source);
    let notification = new MessageTray.Notification(source, msg, details);
    notification.setTransient(true);
-    source.showNotification(notification);
+    source.notify(notification);
 }

 /**
 * notifyError:
- * @param {string} msg: An error message
- * @param {string} details: Additional information
+ * @msg: An error message
+ * @details: Additional information
 *
 * See shell_global_notify_problem().
 */
@ -435,8 +407,8 @@ function _findModal(actor) {

 /**
 * pushModal:
- * @param {Clutter.Actor} actor: actor which will be given keyboard focus
- * @param {Object=} params: optional parameters
+ * @actor: #ClutterActor which will be given keyboard focus
+ * @params: optional parameters
 *
 * Ensure we are in a mode where all keyboard and mouse input goes to
 * the stage, and focus @actor. Multiple calls to this function act in
@ -459,7 +431,7 @@ function _findModal(actor) {
 *                global keybindings; the default of NONE will filter
 *                out all keybindings
 *
- * @returns {bool}: true iff we successfully acquired a grab or already had one
+ * Returns: true iff we successfully acquired a grab or already had one
 */
 function pushModal(actor, params) {
    params = Params.parse(params, { timestamp: global.get_current_time(),
@ -490,11 +462,11 @@ function pushModal(actor, params) {
                modalActorFocusStack[index].prevFocus = null;
        });
    }
-    modalActorFocusStack.push({ actor,
+    modalActorFocusStack.push({ actor: actor,
                                destroyId: actorDestroyId,
-                                prevFocus,
-                                prevFocusDestroyId,
-                                actionMode });
+                                prevFocus: prevFocus,
+                                prevFocusDestroyId: prevFocusDestroyId,
+                                actionMode: actionMode });

    actionMode = params.actionMode;
    global.stage.set_key_focus(actor);
@ -503,9 +475,8 @@ function pushModal(actor, params) {

 /**
 * popModal:
- * @param {Clutter.Actor} actor: the actor passed to original invocation
- *     of pushModal()
- * @param {number=} timestamp: optional timestamp
+ * @actor: #ClutterActor passed to original invocation of pushModal()
+ * @timestamp: optional timestamp
 *
 * Reverse the effect of pushModal(). If this invocation is undoing
 * the topmost invocation, then the focus will be restored to the
@ -576,24 +547,24 @@ function popModal(actor, timestamp) {
 }

 function createLookingGlass() {
-    if (lookingGlass == null)
+    if (lookingGlass == null) {
        lookingGlass = new LookingGlass.LookingGlass();
-
+    }
    return lookingGlass;
 }

 function openRunDialog() {
-    if (runDialog == null)
+    if (runDialog == null) {
        runDialog = new RunDialog.RunDialog();
-
+    }
    runDialog.open();
 }

 /**
 * activateWindow:
- * @param {Meta.Window} window: the window to activate
- * @param {number=} time: current event time
- * @param {number=} workspaceNum:  window's workspace number
+ * @window: the Meta.Window to activate
+ * @time: (optional) current event time
+ * @workspaceNum: (optional) window's workspace number
 *
 * Activates @window, switching to its workspace first if necessary,
 * and switching out of the overview if it's currently active
@ -601,7 +572,7 @@ function openRunDialog() {
 function activateWindow(window, time, workspaceNum) {
    let workspaceManager = global.workspace_manager;
    let activeWorkspaceNum = workspaceManager.get_active_workspace_index();
-    let windowWorkspaceNum = workspaceNum !== undefined ? workspaceNum : window.get_workspace().index();
+    let windowWorkspaceNum = (workspaceNum !== undefined) ? workspaceNum : window.get_workspace().index();

    if (!time)
        time = global.get_current_time();
@ -639,7 +610,7 @@ function _runDeferredWork(workId) {
    _deferredWorkQueue.splice(index, 1);
    _deferredWorkData[workId].callback();
    if (_deferredWorkQueue.length == 0 && _deferredTimeoutId > 0) {
-        GLib.source_remove(_deferredTimeoutId);
+        Mainloop.source_remove(_deferredTimeoutId);
        _deferredTimeoutId = 0;
    }
 }
@ -669,8 +640,8 @@ function _queueBeforeRedraw(workId) {

 /**
 * initializeDeferredWork:
- * @param {Clutter.Actor} actor: an actor
- * @param {callback} callback: Function to invoke to perform work
+ * @actor: A #ClutterActor
+ * @callback: Function to invoke to perform work
 *
 * This function sets up a callback to be invoked when either the
 * given actor is mapped, or after some period of time when the machine
@ -683,13 +654,13 @@ function _queueBeforeRedraw(workId) {
 * initialization as well, under the assumption that new actors
 * will need it.
 *
- * @returns {string}: A string work identifier
+ * Returns: A string work identifier
 */
-function initializeDeferredWork(actor, callback) {
+function initializeDeferredWork(actor, callback, props) {
    // Turn into a string so we can use as an object property
-    let workId = `${++_deferredWorkSequence}`;
-    _deferredWorkData[workId] = { actor,
-                                  callback };
+    let workId = `${(++_deferredWorkSequence)}`;
+    _deferredWorkData[workId] = { 'actor': actor,
+                                  'callback': callback };
    actor.connect('notify::mapped', () => {
        if (!(actor.mapped && _deferredWorkQueue.includes(workId)))
            return;
@ -707,7 +678,7 @@ function initializeDeferredWork(actor, callback) {

 /**
 * queueDeferredWork:
- * @param {string} workId: work identifier
+ * @workId: work identifier
 *
 * Ensure that the work identified by @workId will be
 * run on map or timeout. You should call this function
@ -725,8 +696,9 @@ function queueDeferredWork(workId) {
        _deferredWorkQueue.push(workId);
    if (data.actor.mapped) {
        _queueBeforeRedraw(workId);
+        return;
    } else if (_deferredTimeoutId == 0) {
-        _deferredTimeoutId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, DEFERRED_TIMEOUT_SECONDS, () => {
+        _deferredTimeoutId = Mainloop.timeout_add_seconds(DEFERRED_TIMEOUT_SECONDS, () => {
            _runAllDeferredWork();
            _deferredTimeoutId = 0;
            return GLib.SOURCE_REMOVE;
@ -743,13 +715,12 @@ class RestartMessage extends ModalDialog.ModalDialog {
                      shouldFadeIn: false,
                      destroyOnClose: true });

-        let label = new St.Label({
-            text: message,
-            x_align: Clutter.ActorAlign.CENTER,
-            y_align: Clutter.ActorAlign.CENTER,
-        });
+        let label = new St.Label({ text: message });

-        this.contentLayout.add_child(label);
+        this.contentLayout.add(label, { x_fill: false,
+                                        y_fill: false,
+                                        x_align: St.Align.MIDDLE,
+                                        y_align: St.Align.MIDDLE });
        this.buttonLayout.hide();
    }
 });
--- a/js/ui/messageList.js
+++ b/js/ui/messageList.js
@ -1,13 +1,13 @@
-/* exported MessageListSection */
-const { Atk, Clutter, Gio, GLib,
-        GObject, Graphene, Meta, Pango, St } = imports.gi;
+const { Atk, Clutter, Gio, GLib, GObject, Meta, Pango, St } = imports.gi;
 const Main = imports.ui.main;
 const MessageTray = imports.ui.messageTray;
+const Signals = imports.signals;

 const Calendar = imports.ui.calendar;
+const Tweener = imports.ui.tweener;
 const Util = imports.misc.util;

-var MESSAGE_ANIMATION_TIME = 100;
+var MESSAGE_ANIMATION_TIME = 0.1;

 var DEFAULT_EXPAND_LINES = 6;

@ -32,18 +32,13 @@ function _fixMarkup(text, allowMarkup) {
    return GLib.markup_escape_text(text, -1);
 }

-var URLHighlighter = GObject.registerClass(
-class URLHighlighter extends St.Label {
-    _init(text = '', lineWrap, allowMarkup) {
-        super._init({
-            reactive: true,
-            style_class: 'url-highlighter',
-            x_expand: true,
-            x_align: Clutter.ActorAlign.START,
-        });
+var URLHighlighter = class URLHighlighter {
+    constructor(text = '', lineWrap, allowMarkup) {
+        this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter',
+                                    x_expand: true, x_align: Clutter.ActorAlign.START });
        this._linkColor = '#ccccff';
-        this.connect('style-changed', () => {
-            let [hasColor, color] = this.get_theme_node().lookup_color('link-color', false);
+        this.actor.connect('style-changed', () => {
+            let [hasColor, color] = this.actor.get_theme_node().lookup_color('link-color', false);
            if (hasColor) {
                let linkColor = color.to_string().substr(0, 7);
                if (linkColor != this._linkColor) {
@ -52,75 +47,70 @@ class URLHighlighter extends St.Label {
                }
            }
        });
-        this.clutter_text.line_wrap = lineWrap;
-        this.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR;
+        this.actor.clutter_text.line_wrap = lineWrap;
+        this.actor.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR;

        this.setMarkup(text, allowMarkup);
-    }
+        this.actor.connect('button-press-event', (actor, event) => {
+            // Don't try to URL highlight when invisible.
+            // The MessageTray doesn't actually hide us, so
+            // we need to check for paint opacities as well.
+            if (!actor.visible || actor.get_paint_opacity() == 0)
+                return Clutter.EVENT_PROPAGATE;

-    vfunc_button_press_event(buttonEvent) {
-        // Don't try to URL highlight when invisible.
-        // The MessageTray doesn't actually hide us, so
-        // we need to check for paint opacities as well.
-        if (!this.visible || this.get_paint_opacity() == 0)
+            // Keep Notification.actor from seeing this and taking
+            // a pointer grab, which would block our button-release-event
+            // handler, if an URL is clicked
+            return this._findUrlAtPos(event) != -1;
+        });
+        this.actor.connect('button-release-event', (actor, event) => {
+            if (!actor.visible || actor.get_paint_opacity() == 0)
+                return Clutter.EVENT_PROPAGATE;
+
+            let urlId = this._findUrlAtPos(event);
+            if (urlId != -1) {
+                let url = this._urls[urlId].url;
+                if (!url.includes(':'))
+                    url = 'http://' + url;
+
+                Gio.app_info_launch_default_for_uri(url, global.create_app_launch_context(0, -1));
+                return Clutter.EVENT_STOP;
+            }
            return Clutter.EVENT_PROPAGATE;
+        });
+        this.actor.connect('motion-event', (actor, event) => {
+            if (!actor.visible || actor.get_paint_opacity() == 0)
+                return Clutter.EVENT_PROPAGATE;

-        // Keep Notification from seeing this and taking
-        // a pointer grab, which would block our button-release-event
-        // handler, if an URL is clicked
-        return this._findUrlAtPos(buttonEvent) != -1;
-    }
-
-    vfunc_button_release_event(buttonEvent) {
-        if (!this.visible || this.get_paint_opacity() == 0)
+            let urlId = this._findUrlAtPos(event);
+            if (urlId != -1 && !this._cursorChanged) {
+                global.display.set_cursor(Meta.Cursor.POINTING_HAND);
+                this._cursorChanged = true;
+            } else if (urlId == -1) {
+                global.display.set_cursor(Meta.Cursor.DEFAULT);
+                this._cursorChanged = false;
+            }
            return Clutter.EVENT_PROPAGATE;
+        });
+        this.actor.connect('leave-event', () => {
+            if (!this.actor.visible || this.actor.get_paint_opacity() == 0)
+                return Clutter.EVENT_PROPAGATE;

-        let urlId = this._findUrlAtPos(buttonEvent);
-        if (urlId != -1) {
-            let url = this._urls[urlId].url;
-            if (!url.includes(':'))
-                url = `http://${url}`;
-
-            Gio.app_info_launch_default_for_uri(
-                url, global.create_app_launch_context(0, -1));
-            return Clutter.EVENT_STOP;
-        }
-        return Clutter.EVENT_PROPAGATE;
-    }
-
-    vfunc_motion_event(motionEvent) {
-        if (!this.visible || this.get_paint_opacity() == 0)
+            if (this._cursorChanged) {
+                this._cursorChanged = false;
+                global.display.set_cursor(Meta.Cursor.DEFAULT);
+            }
            return Clutter.EVENT_PROPAGATE;
-
-        let urlId = this._findUrlAtPos(motionEvent);
-        if (urlId != -1 && !this._cursorChanged) {
-            global.display.set_cursor(Meta.Cursor.POINTING_HAND);
-            this._cursorChanged = true;
-        } else if (urlId == -1) {
-            global.display.set_cursor(Meta.Cursor.DEFAULT);
-            this._cursorChanged = false;
-        }
-        return Clutter.EVENT_PROPAGATE;
-    }
-
-    vfunc_leave_event(crossingEvent) {
-        if (!this.visible || this.get_paint_opacity() == 0)
-            return Clutter.EVENT_PROPAGATE;
-
-        if (this._cursorChanged) {
-            this._cursorChanged = false;
-            global.display.set_cursor(Meta.Cursor.DEFAULT);
-        }
-        return super.vfunc_leave_event(crossingEvent);
+        });
    }

    setMarkup(text, allowMarkup) {
        text = text ? _fixMarkup(text, allowMarkup) : '';
        this._text = text;

-        this.clutter_text.set_markup(text);
+        this.actor.clutter_text.set_markup(text);
        /* clutter_text.text contain text without markup */
-        this._urls = Util.findUrls(this.clutter_text.text);
+        this._urls = Util.findUrls(this.actor.clutter_text.text);
        this._highlightUrls();
    }

@ -132,33 +122,33 @@ class URLHighlighter extends St.Label {
        for (let i = 0; i < urls.length; i++) {
            let url = urls[i];
            let str = this._text.substr(pos, url.pos - pos);
-            markup += `${str}<span foreground="${this._linkColor}"><u>${url.url}</u></span>`;
+            markup += str + '<span foreground="' + this._linkColor + '"><u>' + url.url + '</u></span>';
            pos = url.pos + url.url.length;
        }
        markup += this._text.substr(pos);
-        this.clutter_text.set_markup(markup);
+        this.actor.clutter_text.set_markup(markup);
    }

    _findUrlAtPos(event) {
-        let { x, y } = event;
-        [, x, y] = this.transform_stage_point(x, y);
+        let success;
+        let [x, y] = event.get_coords();
+        [success, x, y] = this.actor.transform_stage_point(x, y);
        let findPos = -1;
-        for (let i = 0; i < this.clutter_text.text.length; i++) {
-            let [, px, py, lineHeight] = this.clutter_text.position_to_coords(i);
+        for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
+            let [success, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
            if (py > y || py + lineHeight < y || x < px)
                continue;
            findPos = i;
        }
        if (findPos != -1) {
-            for (let i = 0; i < this._urls.length; i++) {
+            for (let i = 0; i < this._urls.length; i++)
                if (findPos >= this._urls[i].pos &&
                    this._urls[i].pos + this._urls[i].url.length > findPos)
                    return i;
-            }
        }
        return -1;
    }
-});
+};

 var ScaleLayout = GObject.registerClass(
 class ScaleLayout extends Clutter.BinLayout {
@ -171,22 +161,20 @@ class ScaleLayout extends Clutter.BinLayout {
        if (this._container == container)
            return;

-        if (this._container) {
+        if (this._container)
            for (let id of this._signals)
                this._container.disconnect(id);
-        }

        this._container = container;
        this._signals = [];

-        if (this._container) {
+        if (this._container)
            for (let signal of ['notify::scale-x', 'notify::scale-y']) {
                let id = this._container.connect(signal, () => {
                    this.layout_changed();
                });
                this._signals.push(id);
            }
-        }
    }

    vfunc_get_preferred_width(container, forHeight) {
@ -213,7 +201,7 @@ var LabelExpanderLayout = GObject.registerClass({
                                              'Expansion of the layout, between 0 (collapsed) ' +
                                              'and 1 (fully expanded',
                                              GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                              0, 1, 0),
+                                              0, 1, 0)
    },
 }, class LabelExpanderLayout extends Clutter.LayoutManager {
    _init(params) {
@ -235,7 +223,7 @@ var LabelExpanderLayout = GObject.registerClass({

        let visibleIndex = this._expansion > 0 ? 1 : 0;
        for (let i = 0; this._container && i < this._container.get_n_children(); i++)
-            this._container.get_child_at_index(i).visible = i == visibleIndex;
+            this._container.get_child_at_index(i).visible = (i == visibleIndex);

        this.layout_changed();
    }
@ -296,31 +284,21 @@ var LabelExpanderLayout = GObject.registerClass({
    }
 });

-
-var Message = GObject.registerClass({
-    Signals: {
-        'close': {},
-        'expanded': {},
-        'unexpanded': {},
-    },
-}, class Message extends St.Button {
-    _init(title, body) {
-        super._init({
-            style_class: 'message',
-            accessible_role: Atk.Role.NOTIFICATION,
-            can_focus: true,
-            x_expand: true,
-            y_expand: true,
-        });
-
+var Message = class Message {
+    constructor(title, body) {
        this.expanded = false;
+
        this._useBodyMarkup = false;

-        let vbox = new St.BoxLayout({
-            vertical: true,
-            x_expand: true,
-        });
-        this.set_child(vbox);
+        this.actor = new St.Button({ style_class: 'message',
+                                     accessible_role: Atk.Role.NOTIFICATION,
+                                     can_focus: true,
+                                     x_expand: true, x_fill: true });
+        this.actor.connect('key-press-event',
+                           this._onKeyPressed.bind(this));
+
+        let vbox = new St.BoxLayout({ vertical: true });
+        this.actor.set_child(vbox);

        let hbox = new St.BoxLayout();
        vbox.add_actor(hbox);
@ -331,7 +309,7 @@ var Message = GObject.registerClass({

        this._iconBin = new St.Bin({ style_class: 'message-icon-bin',
                                     y_expand: true,
-                                     y_align: Clutter.ActorAlign.START,
+                                     y_align: St.Align.START,
                                     visible: false });
        hbox.add_actor(this._iconBin);

@ -349,18 +327,14 @@ var Message = GObject.registerClass({
        this.setTitle(title);
        titleBox.add_actor(this.titleLabel);

-        this._secondaryBin = new St.Bin({
-            style_class: 'message-secondary-bin',
-            x_expand: true, y_expand: true,
-        });
+        this._secondaryBin = new St.Bin({ style_class: 'message-secondary-bin',
+                                          x_expand: true, y_expand: true,
+                                          x_fill: true, y_fill: true });
        titleBox.add_actor(this._secondaryBin);

        let closeIcon = new St.Icon({ icon_name: 'window-close-symbolic',
                                      icon_size: 16 });
-        this._closeButton = new St.Button({
-            style_class: 'message-close-button',
-            child: closeIcon, opacity: 0,
-        });
+        this._closeButton = new St.Button({ child: closeIcon, opacity: 0 });
        titleBox.add_actor(this._closeButton);

        this._bodyStack = new St.Widget({ x_expand: true });
@ -368,14 +342,15 @@ var Message = GObject.registerClass({
        contentBox.add_actor(this._bodyStack);

        this.bodyLabel = new URLHighlighter('', false, this._useBodyMarkup);
-        this.bodyLabel.add_style_class_name('message-body');
-        this._bodyStack.add_actor(this.bodyLabel);
+        this.bodyLabel.actor.add_style_class_name('message-body');
+        this._bodyStack.add_actor(this.bodyLabel.actor);
        this.setBody(body);

        this._closeButton.connect('clicked', this.close.bind(this));
-        let actorHoverId = this.connect('notify::hover', this._sync.bind(this));
-        this._closeButton.connect('destroy', this.disconnect.bind(this, actorHoverId));
-        this.connect('destroy', this._onDestroy.bind(this));
+        let actorHoverId = this.actor.connect('notify::hover', this._sync.bind(this));
+        this._closeButton.connect('destroy', this.actor.disconnect.bind(this.actor, actorHoverId));
+        this.actor.connect('clicked', this._onClicked.bind(this));
+        this.actor.connect('destroy', this._onDestroy.bind(this));
        this._sync();
    }

@ -385,7 +360,7 @@ var Message = GObject.registerClass({

    setIcon(actor) {
        this._iconBin.child = actor;
-        this._iconBin.visible = actor != null;
+        this._iconBin.visible = (actor != null);
    }

    setSecondaryActor(actor) {
@ -456,26 +431,24 @@ var Message = GObject.registerClass({
    expand(animate) {
        this.expanded = true;

-        this._actionBin.visible = this._actionBin.get_n_children() > 0;
+        this._actionBin.visible = (this._actionBin.get_n_children() > 0);

        if (this._bodyStack.get_n_children() < 2) {
            this._expandedLabel = new URLHighlighter(this._bodyText,
                                                     true, this._useBodyMarkup);
-            this.setExpandedBody(this._expandedLabel);
+            this.setExpandedBody(this._expandedLabel.actor);
        }

        if (animate) {
-            this._bodyStack.ease_property('@layout.expansion', 1, {
-                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                duration: MessageTray.ANIMATION_TIME,
-            });
-
+            Tweener.addTween(this._bodyStack.layout_manager,
+                             { expansion: 1,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
            this._actionBin.scale_y = 0;
-            this._actionBin.ease({
-                scale_y: 1,
-                duration: MessageTray.ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            });
+            Tweener.addTween(this._actionBin,
+                             { scale_y: 1,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
        } else {
            this._bodyStack.layout_manager.expansion = 1;
            this._actionBin.scale_y = 1;
@ -486,20 +459,18 @@ var Message = GObject.registerClass({

    unexpand(animate) {
        if (animate) {
-            this._bodyStack.ease_property('@layout.expansion', 0, {
-                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                duration: MessageTray.ANIMATION_TIME,
-            });
-
-            this._actionBin.ease({
-                scale_y: 0,
-                duration: MessageTray.ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._actionBin.hide();
-                    this.expanded = false;
-                },
-            });
+            Tweener.addTween(this._bodyStack.layout_manager,
+                             { expansion: 0,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
+            Tweener.addTween(this._actionBin,
+                             { scale_y: 0,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this._actionBin.hide();
+                                   this.expanded = false;
+                               } });
        } else {
            this._bodyStack.layout_manager.expansion = 0;
            this._actionBin.scale_y = 0;
@ -514,16 +485,19 @@ var Message = GObject.registerClass({
    }

    _sync() {
-        let visible = this.hover && this.canClose();
+        let visible = this.actor.hover && this.canClose();
        this._closeButton.opacity = visible ? 255 : 0;
        this._closeButton.reactive = visible;
    }

+    _onClicked() {
+    }
+
    _onDestroy() {
    }

-    vfunc_key_press_event(keyEvent) {
-        let keysym = keyEvent.keyval;
+    _onKeyPressed(a, event) {
+        let keysym = event.get_key_symbol();

        if (keysym == Clutter.KEY_Delete ||
            keysym == Clutter.KEY_KP_Delete) {
@ -532,66 +506,37 @@ var Message = GObject.registerClass({
        }
        return Clutter.EVENT_PROPAGATE;
    }
-});
+};
+Signals.addSignalMethods(Message.prototype);

-var MessageListSection = GObject.registerClass({
-    Properties: {
-        'can-clear': GObject.ParamSpec.boolean(
-            'can-clear', 'can-clear', 'can-clear',
-            GObject.ParamFlags.READABLE,
-            false),
-        'empty': GObject.ParamSpec.boolean(
-            'empty', 'empty', 'empty',
-            GObject.ParamFlags.READABLE,
-            true),
-    },
-    Signals: {
-        'can-clear-changed': {},
-        'empty-changed': {},
-        'message-focused': { param_types: [Message.$gtype] },
-    },
-}, class MessageListSection extends St.BoxLayout {
-    _init() {
-        super._init({
-            style_class: 'message-list-section',
-            clip_to_allocation: true,
-            vertical: true,
-            x_expand: true,
-        });
+var MessageListSection = class MessageListSection {
+    constructor() {
+        this.actor = new St.BoxLayout({ style_class: 'message-list-section',
+                                        clip_to_allocation: true,
+                                        x_expand: true, vertical: true });

        this._list = new St.BoxLayout({ style_class: 'message-list-section-list',
                                        vertical: true });
-        this.add_actor(this._list);
+        this.actor.add_actor(this._list);

        this._list.connect('actor-added', this._sync.bind(this));
        this._list.connect('actor-removed', this._sync.bind(this));

        let id = Main.sessionMode.connect('updated',
                                          this._sync.bind(this));
-        this.connect('destroy', () => {
+        this.actor.connect('destroy', () => {
            Main.sessionMode.disconnect(id);
        });

+        this._messages = new Map();
        this._date = new Date();
-        this._empty = true;
-        this._canClear = false;
+        this.empty = true;
+        this.canClear = false;
        this._sync();
    }

-    get empty() {
-        return this._empty;
-    }
-
-    get canClear() {
-        return this._canClear;
-    }
-
-    get _messages() {
-        return this._list.get_children().map(i => i.child);
-    }
-
-    _onKeyFocusIn(messageActor) {
-        this.emit('message-focused', messageActor);
+    _onKeyFocusIn(actor) {
+        this.emit('key-focus-in', actor);
    }

    get allowed() {
@ -610,94 +555,85 @@ var MessageListSection = GObject.registerClass({
    }

    addMessageAtIndex(message, index, animate) {
-        if (this._messages.includes(message))
-            throw new Error('Message was already added previously');
-
-        let listItem = new St.Bin({
-            child: message,
-            layout_manager: new ScaleLayout(),
-            pivot_point: new Graphene.Point({ x: .5, y: .5 }),
+        let obj = {
+            container: null,
+            destroyId: 0,
+            keyFocusId: 0,
+            closeId: 0
+        };
+        let pivot = new Clutter.Point({ x: .5, y: .5 });
+        let scale = animate ? 0 : 1;
+        obj.container = new St.Widget({ layout_manager: new ScaleLayout(),
+                                        pivot_point: pivot,
+                                        scale_x: scale, scale_y: scale });
+        obj.keyFocusId = message.actor.connect('key-focus-in',
+            this._onKeyFocusIn.bind(this));
+        obj.destroyId = message.actor.connect('destroy', () => {
+            this.removeMessage(message, false);
        });
-        listItem._connectionsIds = [];
-
-        listItem._connectionsIds.push(message.connect('key-focus-in',
-            this._onKeyFocusIn.bind(this)));
-        listItem._connectionsIds.push(message.connect('close', () => {
+        obj.closeId = message.connect('close', () => {
            this.removeMessage(message, true);
-        }));
-        listItem._connectionsIds.push(message.connect('destroy', () => {
-            listItem._connectionsIds.forEach(id => message.disconnect(id));
-            listItem.destroy();
-        }));
+        });

-        this._list.insert_child_at_index(listItem, index);
+        this._messages.set(message, obj);
+        obj.container.add_actor(message.actor);

-        if (animate) {
-            listItem.set({ scale_x: 0, scale_y: 0 });
-            listItem.ease({
-                scale_x: 1,
-                scale_y: 1,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            });
-        }
+        this._list.insert_child_at_index(obj.container, index);
+
+        if (animate)
+            Tweener.addTween(obj.container, { scale_x: 1,
+                                              scale_y: 1,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad' });
    }

    moveMessage(message, index, animate) {
-        if (!this._messages.includes(message))
-            throw new Error(`Impossible to move untracked message`);
-
-        let listItem = message.get_parent();
+        let obj = this._messages.get(message);

        if (!animate) {
-            this._list.set_child_at_index(listItem, index);
+            this._list.set_child_at_index(obj.container, index);
            return;
        }

        let onComplete = () => {
-            this._list.set_child_at_index(listItem, index);
-            listItem.ease({
-                scale_x: 1,
-                scale_y: 1,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            });
+            this._list.set_child_at_index(obj.container, index);
+            Tweener.addTween(obj.container, { scale_x: 1,
+                                              scale_y: 1,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad' });
        };
-        listItem.ease({
-            scale_x: 0,
-            scale_y: 0,
-            duration: MESSAGE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete,
-        });
+        Tweener.addTween(obj.container, { scale_x: 0,
+                                          scale_y: 0,
+                                          time: MESSAGE_ANIMATION_TIME,
+                                          transition: 'easeOutQuad',
+                                          onComplete: onComplete });
    }

    removeMessage(message, animate) {
-        if (!this._messages.includes(message))
-            throw new Error(`Impossible to remove untracked message`);
+        let obj = this._messages.get(message);

-        let listItem = message.get_parent();
-        listItem._connectionsIds.forEach(id => message.disconnect(id));
+        message.actor.disconnect(obj.destroyId);
+        message.actor.disconnect(obj.keyFocusId);
+        message.disconnect(obj.closeId);
+
+        this._messages.delete(message);

        if (animate) {
-            listItem.ease({
-                scale_x: 0,
-                scale_y: 0,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    listItem.destroy();
-                    global.sync_pointer();
-                },
-            });
+            Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad',
+                                              onComplete() {
+                                                  obj.container.destroy();
+                                                  global.sync_pointer();
+                                              } });
        } else {
-            listItem.destroy();
+            obj.container.destroy();
            global.sync_pointer();
        }
    }

    clear() {
-        let messages = this._messages.filter(msg => msg.canClose());
+        let messages = [...this._messages.keys()].filter(msg => msg.canClose());

        // If there are few messages, letting them all zoom out looks OK
        if (messages.length < 2) {
@ -710,37 +646,47 @@ var MessageListSection = GObject.registerClass({
            let delay = MESSAGE_ANIMATION_TIME / Math.max(messages.length, 5);
            for (let i = 0; i < messages.length; i++) {
                let message = messages[i];
-                message.get_parent().ease({
-                    translation_x: this._list.width,
-                    opacity: 0,
-                    duration: MESSAGE_ANIMATION_TIME,
-                    delay: i * delay,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete: () => message.close(),
-                });
+                let obj = this._messages.get(message);
+                Tweener.addTween(obj.container,
+                                 { anchor_x: this._list.width,
+                                   opacity: 0,
+                                   time: MESSAGE_ANIMATION_TIME,
+                                   delay: i * delay,
+                                   transition: 'easeOutQuad',
+                                   onComplete() {
+                                       message.close();
+                                   } });
            }
        }
    }

+    _canClear() {
+        for (let message of this._messages.keys())
+            if (message.canClose())
+                return true;
+        return false;
+    }
+
    _shouldShow() {
        return !this.empty;
    }

    _sync() {
-        let messages = this._messages;
-        let empty = messages.length == 0;
+        let empty = this._list.get_n_children() == 0;
+        let changed = this.empty !== empty;
+        this.empty = empty;

-        if (this._empty != empty) {
-            this._empty = empty;
-            this.notify('empty');
-        }
+        if (changed)
+            this.emit('empty-changed');

-        let canClear = messages.some(m => m.canClose());
-        if (this._canClear != canClear) {
-            this._canClear = canClear;
-            this.notify('can-clear');
-        }
+        let canClear = this._canClear();
+        changed = this.canClear !== canClear;
+        this.canClear = canClear;

-        this.visible = this.allowed && this._shouldShow();
+        if (changed)
+            this.emit('can-clear-changed');
+
+        this.actor.visible = this.allowed && this._shouldShow();
    }
-});
+};
+Signals.addSignalMethods(MessageListSection.prototype);
--- a/js/ui/messageTray.js
+++ b/js/ui/messageTray.js
@ -1,23 +1,23 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported NotificationPolicy, NotificationGenericPolicy,
-   NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel,
-   SystemNotificationSource, MessageTray */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
+const Mainloop = imports.mainloop;
+const Signals = imports.signals;

 const Calendar = imports.ui.calendar;
 const GnomeSession = imports.misc.gnomeSession;
 const Layout = imports.ui.layout;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings';

-var ANIMATION_TIME = 200;
-var NOTIFICATION_TIMEOUT = 4000;
+var ANIMATION_TIME = 0.2;
+var NOTIFICATION_TIMEOUT = 4;

-var HIDE_TIMEOUT = 200;
-var LONGER_HIDE_TIMEOUT = 600;
+var HIDE_TIMEOUT = 0.2;
+var LONGER_HIDE_TIMEOUT = 0.6;

 var MAX_NOTIFICATIONS_IN_QUEUE = 3;
 var MAX_NOTIFICATIONS_PER_SOURCE = 3;
@ -33,7 +33,7 @@ var State = {
    HIDDEN:  0,
    SHOWING: 1,
    SHOWN:   2,
-    HIDING:  3,
+    HIDING:  3
 };

 // These reasons are useful when we destroy the notifications received through
@ -47,7 +47,7 @@ var NotificationDestroyedReason = {
    EXPIRED: 1,
    DISMISSED: 2,
    SOURCE_CLOSED: 3,
-    REPLACED: 4,
+    REPLACED: 4
 };

 // Message tray has its custom Urgency enumeration. LOW, NORMAL and CRITICAL
@ -58,7 +58,7 @@ var Urgency = {
    LOW: 0,
    NORMAL: 1,
    HIGH: 2,
-    CRITICAL: 3,
+    CRITICAL: 3
 };

 // The privacy of the details of a notification. USER is for notifications which
@ -133,82 +133,70 @@ var FocusGrabber = class FocusGrabber {
 // source, such as whether to play sound or honour the critical bit.
 //
 // A notification without a policy object will inherit the default one.
-var NotificationPolicy = GObject.registerClass({
-    Properties: {
-        'enable': GObject.ParamSpec.boolean(
-            'enable', 'enable', 'enable',
-            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
-            true),
-        'enable-sound': GObject.ParamSpec.boolean(
-            'enable-sound', 'enable-sound', 'enable-sound',
-            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
-            true),
-        'show-banners': GObject.ParamSpec.boolean(
-            'show-banners', 'show-banners', 'show-banners',
-            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
-            true),
-        'force-expanded': GObject.ParamSpec.boolean(
-            'force-expanded', 'force-expanded', 'force-expanded',
-            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
-            false),
-        'show-in-lock-screen': GObject.ParamSpec.boolean(
-            'show-in-lock-screen', 'show-in-lock-screen', 'show-in-lock-screen',
-            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
-            false),
-        'details-in-lock-screen': GObject.ParamSpec.boolean(
-            'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen',
-            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
-            false),
-    },
-}, class NotificationPolicy extends GObject.Object {
+var NotificationPolicy = class NotificationPolicy {
+    constructor(params) {
+        params = Params.parse(params, { enable: true,
+                                        enableSound: true,
+                                        showBanners: true,
+                                        forceExpanded: false,
+                                        showInLockScreen: true,
+                                        detailsInLockScreen: false
+                                      });
+        Object.getOwnPropertyNames(params).forEach(key => {
+            let desc = Object.getOwnPropertyDescriptor(params, key);
+            Object.defineProperty(this, `_${key}`, desc);
+        });
+    }
+
    // Do nothing for the default policy. These methods are only useful for the
    // GSettings policy.
    store() { }
+    destroy() { }

-    destroy() {
-        this.run_dispose();
+    get enable() {
+        return this._enable;
    }

    get enableSound() {
-        return this.enable_sound;
+        return this._enableSound;
    }

    get showBanners() {
-        return this.show_banners;
+        return this._showBanners;
    }

    get forceExpanded() {
-        return this.force_expanded;
+        return this._forceExpanded;
    }

    get showInLockScreen() {
-        return this.show_in_lock_screen;
+        return this._showInLockScreen;
    }

    get detailsInLockScreen() {
-        return this.details_in_lock_screen;
+        return this._detailsInLockScreen;
    }
-});
+};
+Signals.addSignalMethods(NotificationPolicy.prototype);

-var NotificationGenericPolicy = GObject.registerClass({
-}, class NotificationGenericPolicy extends NotificationPolicy {
-    _init() {
-        super._init();
+var NotificationGenericPolicy =
+class NotificationGenericPolicy extends NotificationPolicy {
+    constructor() {
+        super();
        this.id = 'generic';

        this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' });
        this._masterSettings.connect('changed', this._changed.bind(this));
    }

+    store() { }
+
    destroy() {
        this._masterSettings.run_dispose();
-
-        super.destroy();
    }

    _changed(settings, key) {
-        if (this.constructor.find_property(key))
-            this.notify(key);
+        this.emit('policy-changed', key);
    }

    get showBanners() {
@ -218,12 +206,12 @@ var NotificationGenericPolicy = GObject.registerClass({
    get showInLockScreen() {
        return this._masterSettings.get_boolean('show-in-lock-screen');
    }
-});
+};

-var NotificationApplicationPolicy = GObject.registerClass({
-}, class NotificationApplicationPolicy extends NotificationPolicy {
-    _init(id) {
-        super._init();
+var NotificationApplicationPolicy =
+class NotificationApplicationPolicy extends NotificationPolicy {
+    constructor(id) {
+        super();

        this.id = id;
        this._canonicalId = this._canonicalizeId(id);
@ -249,13 +237,12 @@ var NotificationApplicationPolicy = GObject.registerClass({
    destroy() {
        this._masterSettings.run_dispose();
        this._settings.run_dispose();
-
-        super.destroy();
    }

    _changed(settings, key) {
-        if (this.constructor.find_property(key))
-            this.notify(key);
+        this.emit('policy-changed', key);
+        if (key == 'enable')
+            this.emit('enable-changed');
    }

    _canonicalizeId(id) {
@ -289,7 +276,7 @@ var NotificationApplicationPolicy = GObject.registerClass({
    get detailsInLockScreen() {
        return this._settings.get_boolean('details-in-lock-screen');
    }
-});
+};

 // Notification:
 // @source: the notification's Source
@ -345,26 +332,13 @@ var NotificationApplicationPolicy = GObject.registerClass({
 // event sound is played when the notification is shown (if the policy for
 // @source allows playing sounds).
 //
-// [1] https://developer.gnome.org/notification-spec/#markup
-var Notification = GObject.registerClass({
-    Properties: {
-        'acknowledged': GObject.ParamSpec.boolean(
-            'acknowledged', 'acknowledged', 'acknowledged',
-            GObject.ParamFlags.READWRITE,
-            false),
-    },
-    Signals: {
-        'activated': {},
-        'destroy': { param_types: [GObject.TYPE_UINT] },
-        'updated': { param_types: [GObject.TYPE_BOOLEAN] },
-    },
-}, class Notification extends GObject.Object {
-    _init(source, title, banner, params) {
-        super._init();
-
+// [1] https://developer.gnome.org/notification-spec/#markup 
+var Notification = class Notification {
+    constructor(source, title, banner, params) {
        this.source = source;
        this.title = title;
        this.urgency = Urgency.NORMAL;
+        this.resident = false;
        // 'transient' is a reserved keyword in JS, so we have to use an alternate variable name
        this.isTransient = false;
        this.privacyScope = PrivacyScope.USER;
@ -376,7 +350,6 @@ var Notification = GObject.registerClass({
        this._soundFile = null;
        this._soundPlayed = false;
        this.actions = [];
-        this.setResident(false);

        // If called with only one argument we assume the caller
        // will call .update() later on. This is the case of
@ -435,7 +408,7 @@ var Notification = GObject.registerClass({
    // @label: the label for the action's button
    // @callback: the callback for the action
    addAction(label, callback) {
-        this.actions.push({ label, callback });
+        this.actions.push({ label: label, callback: callback });
    }

    get acknowledged() {
@ -446,7 +419,7 @@ var Notification = GObject.registerClass({
        if (this._acknowledged == v)
            return;
        this._acknowledged = v;
-        this.notify('acknowledged');
+        this.emit('acknowledged-changed');
    }

    setUrgency(urgency) {
@ -455,15 +428,6 @@ var Notification = GObject.registerClass({

    setResident(resident) {
        this.resident = resident;
-
-        if (this.resident) {
-            if (this._activatedId) {
-                this.disconnect(this._activatedId);
-                this._activatedId = 0;
-            }
-        } else if (!this._activatedId) {
-            this._activatedId = this.connect_after('activated', () => this.destroy());
-        }
    }

    setTransient(isTransient) {
@ -505,30 +469,23 @@ var Notification = GObject.registerClass({

    activate() {
        this.emit('activated');
+        if (!this.resident)
+            this.destroy();
    }

    destroy(reason = NotificationDestroyedReason.DISMISSED) {
-        if (this._activatedId) {
-            this.disconnect(this._activatedId);
-            delete this._activatedId;
-        }
-
        this.emit('destroy', reason);
-        this.run_dispose();
    }
-});
+};
+Signals.addSignalMethods(Notification.prototype);

-var NotificationBanner = GObject.registerClass({
-    Signals: {
-        'done-displaying': {},
-        'unfocused': {},
-    },
-}, class NotificationBanner extends Calendar.NotificationMessage {
-    _init(notification) {
-        super._init(notification);
+var NotificationBanner =
+class NotificationBanner extends Calendar.NotificationMessage {
+    constructor(notification) {
+        super(notification);

-        this.can_focus = false;
-        this.add_style_class_name('notification-banner');
+        this.actor.can_focus = false;
+        this.actor.add_style_class_name('notification-banner');

        this._buttonBox = null;

@ -609,13 +566,13 @@ var NotificationBanner = GObject.registerClass({

    addAction(label, callback) {
        let button = new St.Button({ style_class: 'notification-button',
-                                     label,
+                                     label: label,
                                     x_expand: true,
                                     can_focus: true });

        return this.addButton(button, callback);
    }
-});
+};

 var SourceActor = GObject.registerClass(
 class SourceActor extends St.Widget {
@ -632,7 +589,8 @@ class SourceActor extends St.Widget {
        this._actorDestroyed = false;

        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
-        this._iconBin = new St.Bin({ x_expand: true,
+        this._iconBin = new St.Bin({ x_fill: true,
+                                     x_expand: true,
                                     height: size * scaleFactor,
                                     width: size * scaleFactor });

@ -679,7 +637,7 @@ class SourceActorWithLabel extends SourceActor {

        this.add_actor(this._counterBin);

-        this._countUpdatedId = this._source.connect('notify::count', this._updateCount.bind(this));
+        this._countUpdatedId = this._source.connect('count-updated', this._updateCount.bind(this));
        this._updateCount();

        this.connect('destroy', () => {
@ -692,7 +650,7 @@ class SourceActorWithLabel extends SourceActor {

        let childBox = new Clutter.ActorBox();

-        let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
+        let [minWidth, minHeight, naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
        let direction = this.get_text_direction();

        if (direction == Clutter.TextDirection.LTR) {
@ -727,33 +685,11 @@ class SourceActorWithLabel extends SourceActor {
    }
 });

-var Source = GObject.registerClass({
-    Properties: {
-        'count': GObject.ParamSpec.int(
-            'count', 'count', 'count',
-            GObject.ParamFlags.READABLE,
-            0, GLib.MAXINT32, 0),
-        'policy': GObject.ParamSpec.object(
-            'policy', 'policy', 'policy',
-            GObject.ParamFlags.READWRITE,
-            NotificationPolicy.$gtype),
-        'title': GObject.ParamSpec.string(
-            'title', 'title', 'title',
-            GObject.ParamFlags.READWRITE,
-            null),
-    },
-    Signals: {
-        'destroy': { param_types: [GObject.TYPE_UINT] },
-        'icon-updated': {},
-        'notification-added': { param_types: [Notification.$gtype] },
-        'notification-show': { param_types: [Notification.$gtype] },
-    },
-}, class Source extends GObject.Object {
-    _init(title, iconName) {
-        super._init({ title });
-
+var Source = class Source {
+    constructor(title, iconName) {
        this.SOURCE_ICON_SIZE = 48;

+        this.title = title;
        this.iconName = iconName;

        this.isChat = false;
@ -788,7 +724,7 @@ var Source = GObject.registerClass({
    }

    countUpdated() {
-        super.notify('count');
+        this.emit('count-updated');
    }

    _createPolicy() {
@ -796,17 +732,13 @@ var Source = GObject.registerClass({
    }

    get narrowestPrivacyScope() {
-        return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM)
-            ? PrivacyScope.SYSTEM
-            : PrivacyScope.USER;
+        return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) ? PrivacyScope.SYSTEM
+                                                                                    : PrivacyScope.USER;
    }

    setTitle(newTitle) {
-        if (this.title == newTitle)
-            return;
-
        this.title = newTitle;
-        this.notify('title');
+        this.emit('title-changed');
    }

    createBanner(notification) {
@ -831,10 +763,10 @@ var Source = GObject.registerClass({
            return;

        this.notifications.splice(index, 1);
-        this.countUpdated();
-
        if (this.notifications.length == 0)
            this.destroy();
+
+        this.countUpdated();
    }

    pushNotification(notification) {
@ -845,36 +777,22 @@ var Source = GObject.registerClass({
            this.notifications.shift().destroy(NotificationDestroyedReason.EXPIRED);

        notification.connect('destroy', this._onNotificationDestroy.bind(this));
-        notification.connect('notify::acknowledged', this.countUpdated.bind(this));
+        notification.connect('acknowledged-changed', this.countUpdated.bind(this));
        this.notifications.push(notification);
        this.emit('notification-added', notification);

        this.countUpdated();
    }

-    showNotification(notification) {
+    notify(notification) {
        notification.acknowledged = false;
        this.pushNotification(notification);

-        if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL)
-            this.emit('notification-show', notification);
-        else
+        if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL) {
+            this.emit('notify', notification);
+        } else {
            notification.playSound();
-    }
-
-    notify(propName) {
-        if (propName instanceof Notification) {
-            try {
-                throw new Error('Source.notify() has been moved to Source.showNotification()' +
-                                'this code will break in the future');
-            } catch (e) {
-                logError(e);
-                this.showNotification(propName);
-                return;
-            }
        }
-
-        super.notify(propName);
    }

    destroy(reason) {
@ -887,8 +805,6 @@ var Source = GObject.registerClass({
            notifications[i].destroy(reason);

        this.emit('destroy', reason);
-
-        this.run_dispose();
    }

    iconUpdated() {
@ -900,28 +816,18 @@ var Source = GObject.registerClass({
    }

    destroyNonResidentNotifications() {
-        for (let i = this.notifications.length - 1; i >= 0; i--) {
+        for (let i = this.notifications.length - 1; i >= 0; i--)
            if (!this.notifications[i].resident)
                this.notifications[i].destroy();
-        }
+
+        this.countUpdated();
    }
-});
+};
+Signals.addSignalMethods(Source.prototype);

-var MessageTray = GObject.registerClass({
-    Signals: {
-        'queue-changed': {},
-        'source-added': { param_types: [Source.$gtype] },
-        'source-removed': { param_types: [Source.$gtype] },
-    },
-}, class MessageTray extends St.Widget {
-    _init() {
-        super._init({
-            visible: false,
-            clip_to_allocation: true,
-            layout_manager: new Clutter.BinLayout(),
-        });
-
-        this._presence = new GnomeSession.Presence((proxy, _error) => {
+var MessageTray = class MessageTray {
+    constructor() {
+        this._presence = new GnomeSession.Presence((proxy, error) => {
            this._onStatusChanged(proxy.status);
        });
        this._busy = false;
@ -937,15 +843,18 @@ var MessageTray = GObject.registerClass({
            // so fix up Clutter's view of the pointer position in
            // that case.
            let related = ev.get_related();
-            if (!related || this.contains(related))
+            if (!related || this.actor.contains(related))
                global.sync_pointer();
        });

+        this.actor = new St.Widget({ visible: false,
+                                     clip_to_allocation: true,
+                                     layout_manager: new Clutter.BinLayout() });
        let constraint = new Layout.MonitorConstraint({ primary: true });
        Main.layoutManager.panelBox.bind_property('visible',
                                                  constraint, 'work-area',
                                                  GObject.BindingFlags.SYNC_CREATE);
-        this.add_constraint(constraint);
+        this.actor.add_constraint(constraint);

        this._bannerBin = new St.Widget({ name: 'notification-container',
                                          reactive: true,
@ -959,7 +868,7 @@ var MessageTray = GObject.registerClass({
                                this._onNotificationKeyRelease.bind(this));
        this._bannerBin.connect('notify::hover',
                                this._onNotificationHoverChanged.bind(this));
-        this.add_actor(this._bannerBin);
+        this.actor.add_actor(this._bannerBin);

        this._notificationFocusGrabber = new FocusGrabber(this._bannerBin);
        this._notificationQueue = [];
@ -988,7 +897,7 @@ var MessageTray = GObject.registerClass({
        this._notificationTimeoutId = 0;
        this._notificationRemoved = false;

-        Main.layoutManager.addChrome(this, { affectsInputRegion: false });
+        Main.layoutManager.addChrome(this.actor, { affectsInputRegion: false });
        Main.layoutManager.trackChrome(this._bannerBin, { affectsInputRegion: true });

        global.display.connect('in-fullscreen-changed', this._updateState.bind(this));
@ -1031,11 +940,11 @@ var MessageTray = GObject.registerClass({
    }

    _onDragBegin() {
-        Shell.util_set_hidden_from_pick(this, true);
+        Shell.util_set_hidden_from_pick(this.actor, true);
    }

    _onDragEnd() {
-        Shell.util_set_hidden_from_pick(this, false);
+        Shell.util_set_hidden_from_pick(this.actor, false);
    }

    get bannerAlignment() {
@ -1084,22 +993,23 @@ var MessageTray = GObject.registerClass({
        // Register that we got a notification for this source
        source.policy.store();

-        source.policy.connect('notify::enable', () => {
+        source.policy.connect('enable-changed', () => {
            this._onSourceEnableChanged(source.policy, source);
        });
-        source.policy.connect('notify', this._updateState.bind(this));
+        source.policy.connect('policy-changed', this._updateState.bind(this));
        this._onSourceEnableChanged(source.policy, source);
    }

    _addSource(source) {
        let obj = {
-            showId: 0,
+            source: source,
+            notifyId: 0,
            destroyId: 0,
        };

        this._sources.set(source, obj);

-        obj.showId = source.connect('notification-show', this._onNotificationShow.bind(this));
+        obj.notifyId = source.connect('notify', this._onNotify.bind(this));
        obj.destroyId = source.connect('destroy', this._onSourceDestroy.bind(this));

        this.emit('source-added', source);
@ -1109,7 +1019,7 @@ var MessageTray = GObject.registerClass({
        let obj = this._sources.get(source);
        this._sources.delete(source);

-        source.disconnect(obj.showId);
+        source.disconnect(obj.notifyId);
        source.disconnect(obj.destroyId);

        this.emit('source-removed', source);
@ -1150,7 +1060,7 @@ var MessageTray = GObject.registerClass({
        }
    }

-    _onNotificationShow(_source, notification) {
+    _onNotify(source, notification) {
        if (this._notification == notification) {
            // If a notification that is being shown is updated, we update
            // how it is shown and extend the time until it auto-hides.
@ -1162,7 +1072,7 @@ var MessageTray = GObject.registerClass({
            // indicator in the panel; however do make an exception for CRITICAL
            // notifications, as only banner mode allows expansion.
            let bannerCount = this._notification ? 1 : 0;
-            let full = this.queueCount + bannerCount >= MAX_NOTIFICATIONS_IN_QUEUE;
+            let full = (this.queueCount + bannerCount >= MAX_NOTIFICATIONS_IN_QUEUE);
            if (!full || notification.urgency == Urgency.CRITICAL) {
                notification.connect('destroy',
                                     this._onNotificationDestroy.bind(this));
@ -1179,7 +1089,7 @@ var MessageTray = GObject.registerClass({
    _resetNotificationLeftTimeout() {
        this._useLongerNotificationLeftTimeout = false;
        if (this._notificationLeftTimeoutId) {
-            GLib.source_remove(this._notificationLeftTimeoutId);
+            Mainloop.source_remove(this._notificationLeftTimeoutId);
            this._notificationLeftTimeoutId = 0;
            this._notificationLeftMouseX = -1;
            this._notificationLeftMouseY = -1;
@ -1217,15 +1127,15 @@ var MessageTray = GObject.registerClass({
            // this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us
            // to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still
            // close to its previous position, we extend the timeout once.
-            let [x, y] = global.get_pointer();
+            let [x, y, mods] = global.get_pointer();
            this._notificationLeftMouseX = x;
            this._notificationLeftMouseY = y;

            // We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it.
            // We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
            // That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
-            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT;
-            this._notificationLeftTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, this._onNotificationLeftTimeout.bind(this));
+            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000;
+            this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
            GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
        }
    }
@ -1246,7 +1156,7 @@ var MessageTray = GObject.registerClass({
    }

    _onNotificationLeftTimeout() {
-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        // We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side.
        if (this._notificationLeftMouseX > -1 &&
            y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD &&
@ -1254,10 +1164,8 @@ var MessageTray = GObject.registerClass({
            x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
            x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
            this._notificationLeftMouseX = -1;
-            this._notificationLeftTimeoutId = GLib.timeout_add(
-                GLib.PRIORITY_DEFAULT,
-                LONGER_HIDE_TIMEOUT,
-                this._onNotificationLeftTimeout.bind(this));
+            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000,
+                                                                   this._onNotificationLeftTimeout.bind(this));
            GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
        } else {
            this._notificationLeftTimeoutId = 0;
@ -1282,7 +1190,7 @@ var MessageTray = GObject.registerClass({
    // at the present time.
    _updateState() {
        let hasMonitor = Main.layoutManager.primaryMonitor != null;
-        this.visible = !this._bannerBlocked && hasMonitor && this._banner != null;
+        this.actor.visible = !this._bannerBlocked && hasMonitor && this._banner != null;
        if (this._bannerBlocked || !hasMonitor)
            return;

@ -1309,7 +1217,7 @@ var MessageTray = GObject.registerClass({
            let nextNotification = this._notificationQueue[0] || null;
            if (hasNotifications && nextNotification) {
                let limited = this._busy || Main.layoutManager.primaryMonitor.inFullscreen;
-                let showNextNotification = !limited || nextNotification.forFeedback || nextNotification.urgency == Urgency.CRITICAL;
+                let showNextNotification = (!limited || nextNotification.forFeedback || nextNotification.urgency == Urgency.CRITICAL);
                if (showNextNotification)
                    this._showNotification();
            }
@ -1319,7 +1227,7 @@ var MessageTray = GObject.registerClass({
                           this._notification.urgency != Urgency.CRITICAL &&
                           !this._banner.focused &&
                           !this._pointerInNotification) || this._notificationExpired;
-            let mustClose = this._notificationRemoved || !hasNotifications || expired;
+            let mustClose = (this._notificationRemoved || !hasNotifications || expired);

            if (mustClose) {
                let animate = hasNotifications && !this._notificationRemoved;
@ -1338,6 +1246,34 @@ var MessageTray = GObject.registerClass({
        this._notificationExpired = false;
    }

+    _tween(actor, statevar, value, params) {
+        let onComplete = params.onComplete;
+        let onCompleteScope = params.onCompleteScope;
+        let onCompleteParams = params.onCompleteParams;
+
+        params.onComplete = this._tweenComplete;
+        params.onCompleteScope = this;
+        params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams];
+
+        // Remove other tweens that could mess with the state machine
+        Tweener.removeTweens(actor);
+        Tweener.addTween(actor, params);
+
+        let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING;
+        this[statevar] = valuing;
+    }
+
+    _tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) {
+        this[statevar] = value;
+        if (onComplete)
+            onComplete.apply(onCompleteScope, onCompleteParams);
+        this._updateState();
+    }
+
+    _clampOpacity() {
+        this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255));
+    }
+
    _onIdleMonitorBecameActive() {
        this._userActiveWhileNotificationShown = true;
        this._updateNotificationTimeout(2000);
@ -1362,16 +1298,17 @@ var MessageTray = GObject.registerClass({
            this._updateState();
        });

-        this._bannerBin.add_actor(this._banner);
+        this._bannerBin.add_actor(this._banner.actor);

+        this._bannerBin._opacity = 0;
        this._bannerBin.opacity = 0;
-        this._bannerBin.y = -this._banner.height;
-        this.show();
+        this._bannerBin.y = -this._banner.actor.height;
+        this.actor.show();

        Meta.disable_unredirect_for_display(global.display);
        this._updateShowingNotification();

-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        // We save the position of the mouse at the time when we started showing the notification
        // in order to determine if the notification popped up under it. We make that check if
        // the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't
@ -1409,45 +1346,39 @@ var MessageTray = GObject.registerClass({
        // We use this._showNotificationCompleted() onComplete callback to extend the time the updated
        // notification is being shown.

-        this._notificationState = State.SHOWING;
-        this._bannerBin.remove_all_transitions();
-        this._bannerBin.ease({
-            opacity: 255,
-            duration: ANIMATION_TIME,
-            mode: Clutter.AnimationMode.LINEAR,
-        });
-        this._bannerBin.ease({
-            y: 0,
-            duration: ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_BACK,
-            onComplete: () => {
-                this._notificationState = State.SHOWN;
-                this._showNotificationCompleted();
-                this._updateState();
-            },
-        });
+        let tweenParams = { y: 0,
+                            _opacity: 255,
+                            time: ANIMATION_TIME,
+                            transition: 'easeOutBack',
+                            onUpdate: this._clampOpacity,
+                            onUpdateScope: this,
+                            onComplete: this._showNotificationCompleted,
+                            onCompleteScope: this
+                          };
+
+        this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams);
    }

    _showNotificationCompleted() {
        if (this._notification.urgency != Urgency.CRITICAL)
-            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT);
+            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000);
    }

    _updateNotificationTimeout(timeout) {
        if (this._notificationTimeoutId) {
-            GLib.source_remove(this._notificationTimeoutId);
+            Mainloop.source_remove(this._notificationTimeoutId);
            this._notificationTimeoutId = 0;
        }
        if (timeout > 0) {
            this._notificationTimeoutId =
-                GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
-                    this._notificationTimeout.bind(this));
+                Mainloop.timeout_add(timeout,
+                                     this._notificationTimeout.bind(this));
            GLib.Source.set_name_by_id(this._notificationTimeoutId, '[gnome-shell] this._notificationTimeout');
        }
    }

    _notificationTimeout() {
-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) {
            // The mouse is moving towards the notification, so don't
            // hide it yet. (We just create a new timeout (and destroy
@ -1483,26 +1414,20 @@ var MessageTray = GObject.registerClass({
        }

        this._resetNotificationLeftTimeout();
-        this._bannerBin.remove_all_transitions();

        if (animate) {
-            this._notificationState = State.HIDING;
-            this._bannerBin.ease({
-                opacity: 0,
-                duration: ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_BACK,
-            });
-            this._bannerBin.ease({
-                y: -this._bannerBin.height,
-                duration: ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_BACK,
-                onComplete: () => {
-                    this._notificationState = State.HIDDEN;
-                    this._hideNotificationCompleted();
-                    this._updateState();
-                },
-            });
+            this._tween(this._bannerBin, '_notificationState', State.HIDDEN,
+                        { y: -this._bannerBin.height,
+                          _opacity: 0,
+                          time: ANIMATION_TIME,
+                          transition: 'easeOutBack',
+                          onUpdate: this._clampOpacity,
+                          onUpdateScope: this,
+                          onComplete: this._hideNotificationCompleted,
+                          onCompleteScope: this
+                        });
        } else {
+            Tweener.removeTweens(this._bannerBin);
            this._bannerBin.y = -this._bannerBin.height;
            this._bannerBin.opacity = 0;
            this._notificationState = State.HIDDEN;
@ -1513,16 +1438,16 @@ var MessageTray = GObject.registerClass({
    _hideNotificationCompleted() {
        let notification = this._notification;
        this._notification = null;
-        if (!this._notificationRemoved && notification.isTransient)
+        if (notification.isTransient)
            notification.destroy(NotificationDestroyedReason.EXPIRED);

        this._pointerInNotification = false;
        this._notificationRemoved = false;
        Meta.enable_unredirect_for_display(global.display);

-        this._banner.destroy();
+        this._banner.actor.destroy();
        this._banner = null;
-        this.hide();
+        this.actor.hide();
    }

    _expandActiveNotification() {
@ -1544,15 +1469,15 @@ var MessageTray = GObject.registerClass({
    _ensureBannerFocused() {
        this._notificationFocusGrabber.grabFocus();
    }
-});
+};
+Signals.addSignalMethods(MessageTray.prototype);

-var SystemNotificationSource = GObject.registerClass(
-class SystemNotificationSource extends Source {
-    _init() {
-        super._init(_("System Information"), 'dialog-information-symbolic');
+var SystemNotificationSource = class SystemNotificationSource extends Source {
+    constructor() {
+        super(_("System Information"), 'dialog-information-symbolic');
    }

    open() {
        this.destroy();
    }
-});
+};
--- a/js/ui/modalDialog.js
+++ b/js/ui/modalDialog.js
@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ModalDialog */

 const { Atk, Clutter, GObject, Shell, St } = imports.gi;

@ -8,16 +7,17 @@ const Layout = imports.ui.layout;
 const Lightbox = imports.ui.lightbox;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

-var OPEN_AND_CLOSE_TIME = 100;
-var FADE_OUT_DIALOG_TIME = 1000;
+var OPEN_AND_CLOSE_TIME = 0.1;
+var FADE_OUT_DIALOG_TIME = 1.0;

 var State = {
    OPENED: 0,
    CLOSED: 1,
    OPENING: 2,
    CLOSING: 3,
-    FADED_OUT: 4,
+    FADED_OUT: 4
 };

 var ModalDialog = GObject.registerClass({
@ -26,9 +26,9 @@ var ModalDialog = GObject.registerClass({
                                       GObject.ParamFlags.READABLE,
                                       Math.min(...Object.values(State)),
                                       Math.max(...Object.values(State)),
-                                       State.CLOSED),
+                                       State.CLOSED)
    },
-    Signals: { 'opened': {}, 'closed': {} },
+    Signals: { 'opened': {}, 'closed': {} }
 }, class ModalDialog extends St.Widget {
    _init(params) {
        super._init({ visible: false,
@ -57,12 +57,9 @@ var ModalDialog = GObject.registerClass({
                                                      coordinate: Clutter.BindCoordinate.ALL });
        this.add_constraint(constraint);

-        this.backgroundStack = new St.Widget({
-            layout_manager: new Clutter.BinLayout(),
-            x_expand: true,
-            y_expand: true,
-        });
-        this._backgroundBin = new St.Bin({ child: this.backgroundStack });
+        this.backgroundStack = new St.Widget({ layout_manager: new Clutter.BinLayout() });
+        this._backgroundBin = new St.Bin({ child: this.backgroundStack,
+                                           x_fill: true, y_fill: true });
        this._monitorConstraint = new Layout.MonitorConstraint();
        this._backgroundBin.add_constraint(this._monitorConstraint);
        this.add_actor(this._backgroundBin);
@ -124,18 +121,18 @@ var ModalDialog = GObject.registerClass({

        this.dialogLayout.opacity = 255;
        if (this._lightbox)
-            this._lightbox.lightOn();
+            this._lightbox.show();
        this.opacity = 0;
        this.show();
-        this.ease({
-            opacity: 255,
-            duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._setState(State.OPENED);
-                this.emit('opened');
-            },
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this._setState(State.OPENED);
+                               this.emit('opened');
+                           }
+                         });
    }

    setInitialKeyFocus(actor) {
@ -178,16 +175,15 @@ var ModalDialog = GObject.registerClass({
        this.popModal(timestamp);
        this._savedKeyFocus = null;

-        if (this._shouldFadeOut) {
-            this.ease({
-                opacity: 0,
-                duration: OPEN_AND_CLOSE_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => this._closeComplete(),
-            });
-        } else {
+        if (this._shouldFadeOut)
+            Tweener.addTween(this,
+                             { opacity: 0,
+                               time: OPEN_AND_CLOSE_TIME,
+                               transition: 'easeOutQuad',
+                               onComplete: this._closeComplete.bind(this)
+                             });
+        else
            this._closeComplete();
-        }
    }

    // Drop modal status without closing the dialog; this makes the
@ -206,7 +202,7 @@ var ModalDialog = GObject.registerClass({
        this._hasModal = false;

        if (!this._shellReactive)
-            this.backgroundStack.set_child_above_sibling(this._eventBlocker, null);
+            this._eventBlocker.raise_top();
    }

    pushModal(timestamp) {
@ -219,8 +215,6 @@ var ModalDialog = GObject.registerClass({
        if (!Main.pushModal(this, params))
            return false;

-        Main.layoutManager.emit('system-modal-opened');
-
        this._hasModal = true;
        if (this._savedKeyFocus) {
            this._savedKeyFocus.grab_key_focus();
@ -231,7 +225,7 @@ var ModalDialog = GObject.registerClass({
        }

        if (!this._shellReactive)
-            this.backgroundStack.set_child_below_sibling(this._eventBlocker, null);
+            this._eventBlocker.lower_bottom();
        return true;
    }

@ -254,11 +248,13 @@ var ModalDialog = GObject.registerClass({
            return;

        this.popModal(timestamp);
-        this.dialogLayout.ease({
-            opacity: 0,
-            duration: FADE_OUT_DIALOG_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => (this.state = State.FADED_OUT),
-        });
+        Tweener.addTween(this.dialogLayout,
+                         { opacity: 0,
+                           time: FADE_OUT_DIALOG_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this._setState(State.FADED_OUT);
+                           }
+                         });
    }
 });
--- a/js/ui/mpris.js
+++ b/js/ui/mpris.js
@ -1,5 +1,4 @@
-/* exported MediaSection */
-const { Gio, GObject, Shell, St } = imports.gi;
+const { Gio, Shell, St } = imports.gi;
 const Signals = imports.signals;

 const Calendar = imports.ui.calendar;
@ -19,10 +18,9 @@ const MprisPlayerProxy = Gio.DBusProxy.makeProxyWrapper(MprisPlayerIface);

 const MPRIS_PLAYER_PREFIX = 'org.mpris.MediaPlayer2.';

-var MediaMessage = GObject.registerClass(
-class MediaMessage extends MessageList.Message {
-    _init(player) {
-        super._init('', '');
+var MediaMessage = class MediaMessage extends MessageList.Message {
+    constructor(player) {
+        super('', '');

        this._player = player;

@ -44,20 +42,12 @@ class MediaMessage extends MessageList.Message {
                this._player.next();
            });

-        this._updateHandlerId =
-            this._player.connect('changed', this._update.bind(this));
-        this._closedHandlerId =
-            this._player.connect('closed', this.close.bind(this));
+        this._player.connect('changed', this._update.bind(this));
+        this._player.connect('closed', this.close.bind(this));
        this._update();
    }

-    _onDestroy() {
-        super._onDestroy();
-        this._player.disconnect(this._updateHandlerId);
-        this._player.disconnect(this._closedHandlerId);
-    }
-
-    vfunc_clicked() {
+    _onClicked() {
        this._player.raise();
        Main.panel.closeCalendar();
    }
@ -72,7 +62,7 @@ class MediaMessage extends MessageList.Message {

        if (this._player.trackCoverUrl) {
            let file = Gio.File.new_for_uri(this._player.trackCoverUrl);
-            this._icon.gicon = new Gio.FileIcon({ file });
+            this._icon.gicon = new Gio.FileIcon({ file: file });
            this._icon.remove_style_class_name('fallback');
        } else {
            this._icon.icon_name = 'audio-x-generic-symbolic';
@ -80,15 +70,14 @@ class MediaMessage extends MessageList.Message {
        }

        let isPlaying = this._player.status == 'Playing';
-        let iconName = isPlaying
-            ? 'media-playback-pause-symbolic'
-            : 'media-playback-start-symbolic';
+        let iconName = isPlaying ? 'media-playback-pause-symbolic'
+                                 : 'media-playback-start-symbolic';
        this._playPauseButton.child.icon_name = iconName;

        this._updateNavButton(this._prevButton, this._player.canGoPrevious);
        this._updateNavButton(this._nextButton, this._player.canGoNext);
    }
-});
+};

 var MprisPlayer = class MprisPlayer {
    constructor(busName) {
@ -103,7 +92,6 @@ var MprisPlayer = class MprisPlayer {
        this._trackArtists = [];
        this._trackTitle = '';
        this._trackCoverUrl = '';
-        this._busName = busName;
    }

    get status() {
@ -186,39 +174,9 @@ var MprisPlayer = class MprisPlayer {
        for (let prop in this._playerProxy.Metadata)
            metadata[prop] = this._playerProxy.Metadata[prop].deep_unpack();

-        // Validate according to the spec; some clients send buggy metadata:
-        // https://www.freedesktop.org/wiki/Specifications/mpris-spec/metadata
-        this._trackArtists = metadata['xesam:artist'];
-        if (!Array.isArray(this._trackArtists) ||
-            !this._trackArtists.every(artist => typeof artist === 'string')) {
-            if (typeof this._trackArtists !== 'undefined') {
-                log(`Received faulty track artist metadata from ${
-                    this._busName}; expected an array of strings, got ${
-                    this._trackArtists} (${typeof this._trackArtists})`);
-            }
-            this._trackArtists =  [_("Unknown artist")];
-        }
-
-        this._trackTitle = metadata['xesam:title'];
-        if (typeof this._trackTitle !== 'string') {
-            if (typeof this._trackTitle !== 'undefined') {
-                log(`Received faulty track title metadata from ${
-                    this._busName}; expected a string, got ${
-                    this._trackTitle} (${typeof this._trackTitle})`);
-            }
-            this._trackTitle = _("Unknown title");
-        }
-
-        this._trackCoverUrl = metadata['mpris:artUrl'];
-        if (typeof this._trackCoverUrl !== 'string') {
-            if (typeof this._trackCoverUrl !== 'undefined') {
-                log(`Received faulty track cover art metadata from ${
-                    this._busName}; expected a string, got ${
-                    this._trackCoverUrl} (${typeof this._trackCoverUrl})`);
-            }
-            this._trackCoverUrl = '';
-        }
-
+        this._trackArtists = metadata['xesam:artist'] || [_("Unknown artist")];
+        this._trackTitle = metadata['xesam:title'] || _("Unknown title");
+        this._trackCoverUrl = metadata['mpris:artUrl'] || '';
        this.emit('changed');

        let visible = this._playerProxy.CanPlay;
@ -228,16 +186,15 @@ var MprisPlayer = class MprisPlayer {
            if (visible)
                this.emit('show');
            else
-                this.emit('hide');
+                this._close();
        }
    }
 };
 Signals.addSignalMethods(MprisPlayer.prototype);

-var MediaSection = GObject.registerClass(
-class MediaSection extends MessageList.MessageListSection {
-    _init() {
-        super._init();
+var MediaSection = class MediaSection extends MessageList.MessageListSection {
+    constructor() {
+        super();

        this._players = new Map();

@ -256,20 +213,15 @@ class MediaSection extends MessageList.MessageListSection {
            return;

        let player = new MprisPlayer(busName);
-        let message = null;
        player.connect('closed',
            () => {
                this._players.delete(busName);
            });
-        player.connect('show', () => {
-            message = new MediaMessage(player);
-            this.addMessage(message, true);
-        });
-        player.connect('hide', () => {
-            this.removeMessage(message, true);
-            message = null;
-        });
-
+        player.connect('show',
+            () => {
+                let message = new MediaMessage(player);
+                this.addMessage(message, true);
+            });
        this._players.set(busName, player);
    }

@ -293,4 +245,4 @@ class MediaSection extends MessageList.MessageListSection {
        if (newOwner && !oldOwner)
            this._addPlayer(name);
    }
-});
+};
--- a/Show More
+++ b/Show More