workspace, workspaceThumbnail: Use window content (WIP)

2019-07-16 14:31:30 -03:00
257 changed files with 20364 additions and 37508 deletions
--- a/.gitlab-ci.yml
+++ b/.gitlab-ci.yml
@@ -1,5 +1,6 @@
 stages:
 - review
+ - source_check
 - build
 - test

@@ -25,27 +26,19 @@ check_commit_log:

 js_check:
    image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
-    stage: review
+    stage: source_check
    script:
        - find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG
        - (! grep -q . $JS_LOG)
    <<: *only_default
+    only:
+        changes:
+            - js/**/*
    artifacts:
        paths:
            - ${JS_LOG}
        when: on_failure

-eslint:
-    image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
-    stage: review
-    script:
-        - ./.gitlab-ci/run-eslint.sh
-    <<: *only_default
-    artifacts:
-        paths:
-            - reports
-        when: always
-
 build:
    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: build
@@ -54,7 +47,7 @@ build:
        - meson mutter mutter/build --prefix=/usr -Dtests=false
        - ninja -C mutter/build install
    script:
-        - meson . build -Dbuiltype=debugoptimized -Dman=false
+        - meson . build -Dbuiltype=debugoptimized
        - ninja -C build
        - ninja -C build install
    <<: *only_default
@@ -67,8 +60,6 @@ build:
 test:
    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: test
-    variables:
-        XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
    before_script:
        - ninja -C mutter/build install
    script:
--- a/.gitlab-ci/Dockerfile.extension-ci
+++ b/.gitlab-ci/Dockerfile.extension-ci
@@ -1,7 +1,7 @@
 FROM registry.fedoraproject.org/fedora:latest

 RUN dnf -y update && dnf -y upgrade && \
-    dnf install -y 'dnf-command(copr)' git && \
+    dnf install -y 'dnf-command(copr)' && \

    # For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'`
    dnf install -y findutils mozjs60-devel && \
--- a/.gitlab-ci/run-eslint.sh
+++ b/.gitlab-ci/run-eslint.sh
@@ -1,97 +0,0 @@
-#!/usr/bin/env bash
-
-OUTPUT_REGULAR=reports/lint-regular-report.txt
-OUTPUT_LEGACY=reports/lint-legacy-report.txt
-OUTPUT_FINAL=reports/lint-common-report.txt
-
-OUTPUT_MR=reports/lint-mr-report.txt
-
-LINE_CHANGES=changed-lines.txt
-
-is_empty() {
-  (! grep -q . $1)
-}
-
-run_eslint() {
-  ARGS_LEGACY='--config lint/eslintrc-legacy.json'
-
-  local extra_args=ARGS_$1
-  local output=OUTPUT_$1
-  eslint -f unix ${!extra_args} -o ${!output} js
-}
-
-list_commit_range_additions() {
-  # Turn raw context-less git-diff into a list of
-  # filename:lineno pairs of new (+) lines
-  git diff -U0 "$@" -- js |
-  awk '
-    BEGIN { file=""; }
-    /^+++ b/ { file=substr($0,7); }
-    /^@@ / {
-        len = split($3,a,",")
-        start=a[1]
-        count=(len > 1) ? a[2] : 1
-
-        for (line=start; line<start+count; line++)
-            printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line;
-    }'
-}
-
-copy_matched_lines() {
-  local source=$1
-  local matches=$2
-  local target=$3
-
-  echo -n > $target
-  for l in $(<$matches); do
-    grep $l $source >> $target
-  done
-}
-
-create_common() {
-  # comm requires sorted input;
-  # we also strip the error message to make the following a "common" error:
-  # regular:
-  #  file.js:42:23 Indentation of 55, expected 42
-  # legacy:
-  #  file.js:42:23 Indentation of 55, extected 24
-  prepare() {
-    sed 's: .*::' $1 | sort
-  }
-
-  comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp
-
-  # Now add back the stripped error messages
-  copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL
-  rm $OUTPUT_FINAL.tmp
-}
-
-if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
-  git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME
-  branch_point=$(git merge-base HEAD FETCH_HEAD)
-  commit_range=$branch_point...$CI_COMMIT_SHA
-
-  list_commit_range_additions $commit_range > $LINE_CHANGES
-
-  # Don't bother with running lint when no JS changed
-  if is_empty $LINE_CHANGES; then
-    exit 0
-  fi
-fi
-
-echo Generating lint report using regular configuration
-run_eslint REGULAR
-echo Generating lint report using legacy configuration
-run_eslint LEGACY
-echo Done.
-create_common
-
-# Just show the report and succeed when not testing a MR
-if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
-  cat $OUTPUT_FINAL
-  exit 0
-fi
-
-copy_matched_lines $OUTPUT_FINAL $LINE_CHANGES $OUTPUT_MR
-cat $OUTPUT_MR
-is_empty $OUTPUT_MR
--- a/HACKING.md
+++ b/HACKING.md
@@ -84,6 +84,7 @@ don't use.

    const Main = imports.ui.main;
    const Params = imports.misc.params;
+    const Tweener = imports.ui.tweener;
    const Util = imports.misc.util;
 ```
 The alphabetical ordering should be done independently of the location of the
@@ -276,49 +277,34 @@ If your usage of an object is like a hash table (and thus conceptually the keys
 can have special chars in them), don't use quotes, but use brackets: `{ bar: 42
 }`, `foo['bar']`.

-## Animations
-
-Most objects that are animated are actors, and most properties used in animations
-are animatable, which means they can use implicit animations:
+## Getters, setters, and Tweener

+Getters and setters should be used when you are dealing with an API that is
+designed around setting properties, like Tweener. If you want to animate an
+arbitrary property, create a getter and setter, and use Tweener to animate the
+property.
 ```javascript
-    moveActor(actor, x, y) {
-        actor.ease({
-            x,
-            y,
-            duration: 500, // ms
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
-    }
-```
-
-The above is a convenience wrapper around the actual Clutter API, and should generally
-be preferred over the more verbose:
-
-```javascript
-    moveActor(actor, x, y) {
-        actor.save_easing_state();
-
-        actor.set_easing_duration(500);
-        actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD);
-        actor.set({
-            x,
-            y
-        });
-
-        actor.restore_easing_state();
-    }
-```
-
-There is a similar convenience API around Clutter.PropertyTransition to animate
-actor (or actor meta) properties that cannot use implicit animations:
-
-```javascript
-    desaturateActor(actor, desaturate) {
-        let factor = desaturate ? 1.0 : 0.0;
-        actor.ease_property('@effects.desaturate.factor', factor, {
-            duration: 500, // ms
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
-    }
+    var ANIMATION_TIME = 2000;
+
+    var MyClass = class {
+        constructor() {
+            this.actor = new St.BoxLayout();
+            this._position = 0;
+        }
+
+        get position() {
+            return this._position;
+        }
+
+        set position(value) {
+            this._position = value;
+            this.actor.set_position(value, value);
+        }
+    };
+
+    let myThing = new MyClass();
+    Tweener.addTween(myThing,
+                     { position: 100,
+                       time: ANIMATION_TIME,
+                       transition: 'easeOutQuad' });
 ```
--- a/103
+++ b/103
@@ -1,106 +1,3 @@
-3.34.0
-======
-* Handle startup/shutdown of misc X11 services [Carlos; !680]
-* Fix sound volume mute/unmute [Iain; #1557]
-* Correctly terminate pasted text [Carlos; #1570]
-
-Contributors:
-  Carlos Garnacho, Iain Lane
-
-Translators:
-  Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
-  Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
-  Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
-
-3.33.92
-=======
-* Animate pointer a11y pie timer [Jonas D.; !688]
-* Fix restarting shell in systemd user session [Benjamin; !690]
-* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
-  !691, !689, !692, #1552, !698]
-
-Contributors:
-  Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
-  Will Thompson
-
-Translators:
-  Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
-  Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
-  Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
-  Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
-  Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
-  Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
-  Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
-
-3.33.91
-=======
-* Fix regression when adjusting brightness [Florian; #1500]
-* Fix pointer a11y timeout animation [Jonas D.; #1533]
-* Add new extensions CLI tool [Florian; #1234]
-* Only track top-level windows [Carlos; #556]
-* Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian;
-  !678, !682, !686]
-
-Contributors:
-  Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner
-
-Translators:
-  Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv],
-  Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi],
-  Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl],
-  Danial Behzadi [fa]
-
-3.33.90
-=======
-* Implement DND app picker folder management [Georges; !643, !645, !664, !671]
-* Make Clocks/Weather integration work with sandboxed apps [Florian; #1158]
-* Support startup via systemd user instance [Benjamin; !507]
-* Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669]
-* Minimize travel distance in overview animation [Sergey; !267]
-* Rescan icon theme when installed apps changed [Georges; !661]
-* Consistently animate new window actions [Jonas; !662, !673]
-* Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels,
-  Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647,
-  !385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665,
-  !667, !670, #1357, !672, !657, #1507, !674, !677]
-
-Contributors:
-  Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner,
-  Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode,
-  Marco Trevisan (Treviño), verdre, Daniel van Vugt
-
-Translators:
-  Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR],
-  Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es],
-  Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro],
-  Anders Jonsson [sv]
-
-3.33.4
-======
-* Fix unintentional interference between gestures [Jonas; !598]
-* Fix unintentional loop while polkit dialog is active [Ray; !602]
-* Fix alt-tab icon size on HiDPI [Jonas; !587]
-* Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449]
-* Fix style updates for non-background CSS properties [Florian; #1212]
-* Fix cursor visibility in screen recordings [Illya; #1208]
-* Add option for disabling the hot corner [Florian; #688320]
-* Use more fine-grained levels in battery indicator [Florian; !561, #1442]
-* Fix the calculation of the maximum number of app search results [Jonas; !110]
-* Handle horizontal workspace layout with gestures/animations [Florian; !575]
-* Improve handling of session mode extensions [Florian, Didier; #789852]
-* Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin,
-  Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611,
-  !614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626,
-  !491, !631, !632, !633, #1457]
-
-Contributors:
-  Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho,
-  Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada,
-  Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño)
-
-Translators:
-  Jordi Mas [ca], Jor Teron [mjw]
-
 3.33.3
 ======
 * Prepare for optional X11 [Carlos; !378]
--- a/data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
@@ -1,15 +0,0 @@
-<node>
-
-  <!--
-      org.gnome.Shell.ClocksIntegration:
-      @short_description: Clocks integration interface
-
-      The interface used for exporting location settings to GNOME Shell's
-      world clocks integration.
-  -->
-  <interface name="org.gnome.Shell.ClocksIntegration">
-
-  <property name="Locations" type="av" access="read"/>
-
-  </interface>
-</node>
--- a/data/dbus-interfaces/org.gnome.Shell.Extensions.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.Extensions.xml
@@ -173,30 +173,6 @@
      <arg type="s" direction="in" name="uuid"/>
    </method>

-    <!--
-        EnableExtension:
-        @uuid: The UUID of the extension
-        @success: Whether the operation was successful
-
-        Enable an extension.
-    -->
-    <method name="EnableExtension"> \
-      <arg type="s" direction="in" name="uuid"/> \
-      <arg type="b" direction="out" name="success"/> \
-    </method> \
-
-    <!--
-        DisableExtension:
-        @uuid: The UUID of the extension
-        @success: Whether the operation was successful
-
-        Disable an extension.
-    -->
-    <method name="DisableExtension"> \
-      <arg type="s" direction="in" name="uuid"/> \
-      <arg type="b" direction="out" name="success"/> \
-    </method> \
-
    <!--
        LaunchExtensionPrefs:
        @uuid: The UUID of the extension
@@ -213,15 +189,6 @@
    -->
    <method name="CheckForUpdates"/>

-    <signal name="ExtensionStateChanged">
-      <arg type="s" name="uuid"/>
-      <arg type="a{sv}" name="state"/>
-    </signal>
-
-    <!--
-        ExtensionStatusChanged:
-        Deprecated for ExtensionStateChanged
-    -->
    <signal name="ExtensionStatusChanged">
      <arg type="s" name="uuid"/>
      <arg type="i" name="state"/>
--- a/data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
@@ -1,16 +0,0 @@
-<node>
-
-  <!--
-      org.gnome.Shell.WeatherIntegration:
-      @short_description: Weather integration interface
-
-      The interface used for exporting location settings to GNOME Shell's
-      weather integration.
-  -->
-  <interface name="org.gnome.Shell.WeatherIntegration">
-
-  <property name="AutomaticLocation" type="b" access="read"/>
-  <property name="Locations" type="av" access="read"/>
-
-  </interface>
-</node>
--- a/data/gnome-shell-dbus-interfaces.gresource.xml
+++ b/data/gnome-shell-dbus-interfaces.gresource.xml
@@ -40,7 +40,6 @@
    <file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file>
-    <file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file>
@@ -49,7 +48,6 @@
    <file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file>
-    <file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.xml</file>
    <file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file>
    <file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file>
--- a/data/gnome-shell-disable-extensions.service
+++ b/data/gnome-shell-disable-extensions.service
@@ -1,14 +0,0 @@
-[Unit]
-Description=Disable GNOME Shell extensions after failure
-DefaultDependencies=no
-
-# Only disable extensions for a short period of time after login.
-# This means we err on the side of failing the first login after a broken
-# extension was installed.
-Requisite=gnome-session-stable.timer
-
-[Service]
-Type=simple
-# Disable extensions
-ExecStart=gsettings set org.gnome.shell disable-user-extensions true
-Restart=no
--- a/data/gnome-shell-wayland.service.in
+++ b/data/gnome-shell-wayland.service.in
@@ -1,25 +0,0 @@
-[Unit]
-Description=GNOME Shell on Wayland
-# On wayland, force a session shutdown
-OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target
-OnFailureJobMode=replace-irreversibly
-CollectMode=inactive-or-failed
-RefuseManualStart=on
-RefuseManualStop=on
-
-After=gnome-session-manager.target
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-# The units already conflict because they use the same BusName
-#Conflicts=gnome-shell-x11.service
-
-[Service]
-Type=notify
-ExecStart=@bindir@/gnome-shell
-# Exit code 1 means we are probably *not* dealing with an extension failure
-SuccessExitStatus=1
-# On wayland we cannot restart
-Restart=no
--- a/data/gnome-shell-wayland.target
+++ b/data/gnome-shell-wayland.target
@@ -1,10 +1,5 @@
 [Unit]
-Description=GNOME Shell on Wayland
-DefaultDependencies=no
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-Requires=gnome-shell-wayland.service
-After=gnome-shell-wayland.service
+Description=GNOME Shell (wayland sync point)
+After=gnome-shell.service
+BindsTo=gnome-shell.service
+Conflicts=gnome-shell-x11.target
--- a/data/gnome-shell-x11.service.in
+++ b/data/gnome-shell-x11.service.in
@@ -1,31 +0,0 @@
-[Unit]
-Description=GNOME Shell on X11
-# On X11, try to show the GNOME Session Failed screen
-OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target
-OnFailureJobMode=replace
-CollectMode=inactive-or-failed
-RefuseManualStart=on
-RefuseManualStop=on
-
-After=gnome-session-manager.target
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-# The units already conflict because they use the same BusName
-#Conflicts=gnome-shell-wayland.service
-
-# Limit startup frequency more than the default
-StartLimitIntervalSec=15s
-StartLimitBurst=3
-
-[Service]
-Type=notify
-ExecStart=@bindir@/gnome-shell
-# Exit code 1 means we are probably *not* dealing with an extension failure
-SuccessExitStatus=1
-# On X11 we want to restart on-success (Alt+F2 + r) and on-failure.
-Restart=always
-# Do not wait before restarting the shell
-RestartSec=0ms
--- a/data/gnome-shell-x11.target
+++ b/data/gnome-shell-x11.target
@@ -1,10 +1,5 @@
 [Unit]
-Description=GNOME Shell on X11
-DefaultDependencies=no
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-Requires=gnome-shell-x11.service
-After=gnome-shell-x11.service
+Description=GNOME Shell (x11 sync point)
+After=gnome-shell.service
+BindsTo=gnome-shell.service
+Conflicts=gnome-shell-wayland.target
--- a/data/gnome-shell.service.in
+++ b/data/gnome-shell.service.in
@@ -0,0 +1,11 @@
+[Unit]
+Description=GNOME Shell
+Wants=gnome-session.service
+After=graphical-session-pre.target gnome-session-bus.target
+PartOf=graphical-session.target
+
+[Service]
+Type=dbus
+ExecStart=@bindir@/gnome-shell
+Restart=on-failure
+BusName=org.gnome.Shell
--- a/data/meson.build
+++ b/data/meson.build
@@ -14,8 +14,6 @@ desktopconf = configuration_data()
 # file when built in a non-system prefix
 desktopconf.set('bindir', bindir)
 desktopconf.set('VERSION', meson.project_version())
-desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false')
-
 foreach desktop_file : desktop_files
  i18n.merge_file('desktop',
    input: configure_file(
@@ -24,7 +22,7 @@ foreach desktop_file : desktop_files
      configuration: desktopconf
    ),
    output: desktop_file,
-    po_dir: po_dir,
+    po_dir: '../po',
    install: true,
    install_dir: desktopdir,
    type: 'desktop'
@@ -100,23 +98,15 @@ if have_systemd
  unitconf = configuration_data()
  unitconf.set('bindir', bindir)

-  configure_file(
-    input: 'gnome-shell-x11.service.in',
-    output: 'gnome-shell-x11.service',
+  unit = configure_file(
+    input: 'gnome-shell.service.in',
+    output: 'gnome-shell.service',
    configuration: unitconf,
    install_dir: systemduserunitdir
  )

-  configure_file(
-    input: 'gnome-shell-wayland.service.in',
-    output: 'gnome-shell-wayland.service',
-    configuration: unitconf,
-    install_dir: systemduserunitdir
-  )
-
-  units = files('gnome-shell-x11.target',
-                'gnome-shell-wayland.target',
-                'gnome-shell-disable-extensions.service')
+  units = files('gnome-shell-wayland.target',
+                'gnome-shell-x11.target')

  install_data(units, install_dir: systemduserunitdir)
 endif
--- a/data/org.gnome.Shell.desktop.in.in
+++ b/data/org.gnome.Shell.desktop.in.in
@@ -14,4 +14,3 @@ X-GNOME-Autostart-Phase=DisplayServer
 X-GNOME-Provides=panel;windowmanager;
 X-GNOME-Autostart-Notify=true
 X-GNOME-AutoRestart=false
-X-GNOME-HiddenUnderSystemd=@systemd_hidden@
--- a/data/org.gnome.shell.gschema.xml.in
+++ b/data/org.gnome.shell.gschema.xml.in
@@ -21,17 +21,6 @@
        EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell.
      </description>
    </key>
-    <key name="disabled-extensions" type="as">
-      <default>[]</default>
-      <summary>UUIDs of extensions to force disabling</summary>
-      <description>
-        GNOME Shell extensions have a UUID property; this key lists extensions
-        which should be disabled, even if loaded as part of the current mode.
-        You can also manipulate this list with the EnableExtension and
-        DisableExtension D-Bus methods on org.gnome.Shell.
-        This key takes precedence over the “enabled-extensions” setting.
-      </description>
-    </key>
    <key name="disable-user-extensions" type="b">
      <default>false</default>
      <summary>Disable user extensions</summary>
@@ -150,6 +139,11 @@
        Keybinding to focus the active notification.
      </description>
    </key>
+    <key name="pause-resume-tweens" type="as">
+      <default>[]</default>
+      <summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary>
+      <description></description>
+    </key>
    <key name="switch-to-application-1" type="as">
      <default>["&lt;Super&gt;1"]</default>
      <summary>Switch to application 1</summary>
@@ -228,36 +222,6 @@
    </key>
  </schema>

-  <schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/"
-          gettext-domain="@GETTEXT_PACKAGE@">
-    <key name="locations" type="av">
-      <summary>Locations</summary>
-      <description>
-        The locations to show in world clocks
-      </description>
-      <default>[]</default>
-    </key>
-  </schema>
-
-  <schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/"
-          gettext-domain="@GETTEXT_PACKAGE@">
-    <key name="automatic-location" type="b">
-      <summary>Automatic location</summary>
-      <description>
-        Whether to fetch the current location or not
-      </description>
-      <default>false</default>
-    </key>
-
-    <key name="locations" type="av">
-      <summary>Location</summary>
-      <description>
-        The location for which to show a forecast
-      </description>
-      <default>[]</default>
-    </key>
-  </schema>
-
  <!-- unused, change 00_org.gnome.shell.gschema.override instead -->
  <schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/"
 	  gettext-domain="@GETTEXT_PACKAGE@">
--- a/data/theme/gnome-shell-sass/_common.scss
+++ b/data/theme/gnome-shell-sass/_common.scss
@@ -624,12 +624,16 @@ StScrollBar {
 *************/
 /* Outline for low res icons */
 .lowres-icon {
-    icon-shadow: 0 1px 2px rgba(0,0,0,0.3);
+    icon-shadow: 0 -1px rgba(0,0,0,0.05),
+      1px 0 rgba(0,0,0,0.1),
+      0 1px rgba(0,0,0,0.3),
+      -1px 0 rgba(0,0,0,0.1);
 }

 /* Drapshadow for large icons */
 .icon-dropshadow {
-  icon-shadow: 0 1px 2px rgba(0,0,0,0.4);
+  icon-shadow: 0 2px 12px rgba(0,0,0,0.1),
+               0 1px 2px rgba(0,0,0,0.5);
 }

 /* OSD */
@@ -740,8 +744,7 @@ StScrollBar {
    spacing: 8px;
  }

-  .ws-switcher-active-up, .ws-switcher-active-down,
-  .ws-switcher-active-left, .ws-switcher-active-right {
+  .ws-switcher-active-up, .ws-switcher-active-down {
    height: 50px;
    background-color: $selected_bg_color;
    color: $selected_fg_color;
@@ -942,7 +945,7 @@ StScrollBar {
    .world-clocks-button,
    .weather-button,
    .events-section-title {
-      &:hover, &:focus { background-color: $_hover_bg_color }
+      &:hover, focus { background-color: $_hover_bg_color }
      &:active { background-color: $_active_bg_color }
    }

@@ -1013,7 +1016,7 @@ StScrollBar {
      background-color: transparent;
      width: 32px;
      border-radius: 4px;
-      &:hover, &:focus { background-color: $_hover_bg_color; }
+      &:hover, focus { background-color: $_hover_bg_color; }
      &:active { background-color: transparentize($fg_color, 0.84); }
    }

@@ -1029,7 +1032,7 @@ StScrollBar {
      margin: 2px;
      border-radius: 1.4em;
      font-feature-settings: "tnum";
-      &:hover, &:focus { background-color: $_hover_bg_color; }
+      &:hover, focus { background-color: $_hover_bg_color; }
      &:active,&:selected {
        color: lighten($selected_fg_color,5%);
        background-color: $selected_bg_color;
@@ -1171,6 +1174,7 @@ StScrollBar {
  // a little unstructured mess:

  #appMenu {
+    spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg");
    spacing: 4px;

    .label-shadow { color: transparent; }
@@ -1514,9 +1518,6 @@ StScrollBar {
      border-image: none;
      background-image: none;
    }
-    &:drop .overview-icon {
-      background-color: transparentize($selected_bg_color,.15);
-    }
    &:active .overview-icon,
    &:checked .overview-icon {
      background-color: transparentize(darken($osd_bg_color,10%), 0.5);
--- a/docs/reference/shell/meson.build
+++ b/docs/reference/shell/meson.build
@@ -28,7 +28,7 @@ foreach iface : ifaces
    output: 'doc-gen-' + iface[1],
    command: [
      'gdbus-codegen',
-      '--interface-prefix=@0@.'.format(iface[0]),
+      '--interface-prefix=@0@.'.format(iface),
      '--generate-docbook', 'doc-gen',
      '--output-directory', '@OUTDIR@',
      '@INPUT@'
--- a/js/extensionPrefs/main.js
+++ b/js/extensionPrefs/main.js
@@ -1,7 +1,3 @@
-/* exported main */
-imports.gi.versions.Gdk = '3.0';
-imports.gi.versions.Gtk = '3.0';
-
 const Gettext = imports.gettext;
 const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi;
 const Format = imports.format;
@@ -12,8 +8,6 @@ const Config = imports.misc.config;
 const ExtensionUtils = imports.misc.extensionUtils;
 const { loadInterfaceXML } = imports.misc.fileUtils;

-const { ExtensionState } = ExtensionUtils;
-
 const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions');
 const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface);

@@ -23,54 +17,74 @@ function stripPrefix(string, prefix) {
    return string;
 }

-var Application = GObject.registerClass({
-    GTypeName: 'ExtensionPrefs_Application'
-}, class Application extends Gtk.Application {
-    _init() {
+var Application = class {
+    constructor() {
        GLib.set_prgname('gnome-shell-extension-prefs');
-        super._init({
+        this.application = new Gtk.Application({
            application_id: 'org.gnome.shell.ExtensionPrefs',
            flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
        });

+        this.application.connect('activate', this._onActivate.bind(this));
+        this.application.connect('command-line', this._onCommandLine.bind(this));
+        this.application.connect('startup', this._onStartup.bind(this));
+
+        this._extensionPrefsModules = {};
+
        this._startupUuid = null;
        this._loaded = false;
        this._skipMainWindow = false;
-        this._shellProxy = null;
    }

-    get shellProxy() {
-        return this._shellProxy;
-    }
+    _extensionAvailable(uuid) {
+        let extension = ExtensionUtils.extensions[uuid];

-    _showPrefs(uuid) {
-        let row = this._extensionSelector.get_children().find(c => {
-            return c.uuid === uuid && c.hasPrefs;
-        });
-
-        if (!row)
+        if (!extension)
            return false;

+        if (!extension.dir.get_child('prefs.js').query_exists(null))
+            return false;
+
+        return true;
+    }
+
+    _getExtensionPrefsModule(extension) {
+        let uuid = extension.metadata.uuid;
+
+        if (this._extensionPrefsModules.hasOwnProperty(uuid))
+            return this._extensionPrefsModules[uuid];
+
+        ExtensionUtils.installImporter(extension);
+
+        let prefsModule = extension.imports.prefs;
+        prefsModule.init(extension.metadata);
+
+        this._extensionPrefsModules[uuid] = prefsModule;
+        return prefsModule;
+    }
+
+    _selectExtension(uuid) {
+        if (!this._extensionAvailable(uuid))
+            return;
+
+        let extension = ExtensionUtils.extensions[uuid];
        let widget;

        try {
-            widget = row.prefsModule.buildPrefsWidget();
+            let prefsModule = this._getExtensionPrefsModule(extension);
+            widget = prefsModule.buildPrefsWidget();
        } catch (e) {
-            widget = this._buildErrorUI(row, e);
+            widget = this._buildErrorUI(extension, e);
        }

-        let dialog = new Gtk.Window({
-            modal: !this._skipMainWindow,
-            type_hint: Gdk.WindowTypeHint.DIALOG
-        });
-        dialog.set_titlebar(new Gtk.HeaderBar({
-            show_close_button: true,
-            title: row.name,
-            visible: true
-        }));
+        let dialog = new Gtk.Window({ modal: !this._skipMainWindow,
+                                      type_hint: Gdk.WindowTypeHint.DIALOG });
+        dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true,
+                                                title: extension.metadata.name,
+                                                visible: true }));

        if (this._skipMainWindow) {
-            this.add_window(dialog);
+            this.application.add_window(dialog);
            if (this._window)
                this._window.destroy();
            this._window = dialog;
@@ -82,11 +96,9 @@ var Application = GObject.registerClass({
        dialog.set_default_size(600, 400);
        dialog.add(widget);
        dialog.show();
-
-        return true;
    }

-    _buildErrorUI(row, exc) {
+    _buildErrorUI(extension, exc) {
        let scroll = new Gtk.ScrolledWindow({
            hscrollbar_policy: Gtk.PolicyType.NEVER,
            propagate_natural_height: true
@@ -158,7 +170,7 @@ var Application = GObject.registerClass({
            let clipboard = Gtk.Clipboard.get_default(w.get_display());
            // markdown for pasting in gitlab issues
            let lines = [
-                `The settings of extension ${row.uuid} had an error:`,
+                `The settings of extension ${extension.uuid} had an error:`,
                '```',
                `${exc}`,
                '```',
@@ -180,13 +192,13 @@ var Application = GObject.registerClass({
            label: _("Homepage"),
            tooltip_text: _("Visit extension homepage"),
            no_show_all: true,
-            visible: row.url != null
+            visible: extension.metadata.url != null
        });
        toolbar.add(urlButton);

        urlButton.connect('clicked', w => {
            let context = w.get_display().get_app_launch_context();
-            Gio.AppInfo.launch_default_for_uri(row.url, context);
+            Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context);
        });

        let expandedBox = new Gtk.Box({
@@ -201,8 +213,8 @@ var Application = GObject.registerClass({
        return scroll;
    }

-    _buildUI() {
-        this._window = new Gtk.ApplicationWindow({ application: this,
+    _buildUI(app) {
+        this._window = new Gtk.ApplicationWindow({ application: app,
                                                   window_position: Gtk.WindowPosition.CENTER });

        this._window.set_default_size(800, 500);
@@ -236,14 +248,18 @@ var Application = GObject.registerClass({
        this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder');

        this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell');
-        this._shellProxy.connectSignal('ExtensionStateChanged',
-            this._onExtensionStateChanged.bind(this));
+        this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => {
+            if (ExtensionUtils.extensions[uuid] !== undefined)
+                this._scanExtensions();
+        });

        this._window.show_all();
    }

    _sortList(row1, row2) {
-        return row1.name.localeCompare(row2.name);
+        let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name;
+        let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name;
+        return name1.localeCompare(name2);
    }

    _updateHeader(row, before) {
@@ -254,55 +270,19 @@ var Application = GObject.registerClass({
        row.set_header(sep);
    }

-    _findExtensionRow(uuid) {
-        return this._extensionSelector.get_children().find(c => c.uuid === uuid);
-    }
-
-    _onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
-        let row = this._findExtensionRow(uuid);
-        if (row) {
-            let { state } = ExtensionUtils.deserializeExtension(newState);
-            if (state == ExtensionState.UNINSTALLED)
-                row.destroy();
-            return; // we only deal with new and deleted extensions here
-        }
-
-        this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
-            let extension = ExtensionUtils.deserializeExtension(serialized);
-            if (!extension)
-                return;
-            // check the extension wasn't added in between
-            if (this._findExtensionRow(uuid) != null)
-                return;
-            this._addExtensionRow(extension);
-        });
-    }
-
    _scanExtensions() {
-        this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => {
-            if (e) {
-                if (e instanceof Gio.DBusError) {
-                    log(`Failed to connect to shell proxy: ${e}`);
-                    this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
-                    this._mainStack.visible_child_name = 'noshell';
-                } else
-                    throw e;
-                return;
-            }
-
-            for (let uuid in extensionsMap) {
-                let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]);
-                this._addExtensionRow(extension);
-            }
-            this._extensionsLoaded();
-        });
+        let finder = new ExtensionUtils.ExtensionFinder();
+        finder.connect('extension-found', this._extensionFound.bind(this));
+        finder.scanExtensions();
+        this._extensionsLoaded();
    }

-    _addExtensionRow(extension) {
-        let row = new ExtensionRow(extension);
+    _extensionFound(finder, extension) {
+        let row = new ExtensionRow(extension.uuid);

+        row.prefsButton.visible = this._extensionAvailable(row.uuid);
        row.prefsButton.connect('clicked', () => {
-            this._showPrefs(row.uuid);
+            this._selectExtension(row.uuid);
        });

        row.show_all();
@@ -315,26 +295,24 @@ var Application = GObject.registerClass({
        else
            this._mainStack.visible_child_name = 'placeholder';

-        if (this._startupUuid)
-            this._showPrefs(this._startupUuid);
+        if (this._startupUuid && this._extensionAvailable(this._startupUuid))
+            this._selectExtension(this._startupUuid);
        this._startupUuid = null;
        this._skipMainWindow = false;
        this._loaded = true;
    }

-    vfunc_activate() {
+    _onActivate() {
        this._window.present();
    }

-    vfunc_startup() {
-        super.vfunc_startup();
-
-        this._buildUI();
+    _onStartup(app) {
+        this._buildUI(app);
        this._scanExtensions();
    }

-    vfunc_command_line(commandLine) {
-        this.activate();
+    _onCommandLine(app, commandLine) {
+        app.activate();
        let args = commandLine.get_arguments();

        if (args.length) {
@@ -345,14 +323,16 @@ var Application = GObject.registerClass({
            // Strip off "extension:///" prefix which fakes a URI, if it exists
            uuid = stripPrefix(uuid, "extension:///");

-            if (!this._loaded)
+            if (this._extensionAvailable(uuid))
+                this._selectExtension(uuid);
+            else if (!this._loaded)
                this._startupUuid = uuid;
-            else if (!this._showPrefs(uuid))
+            else
                this._skipMainWindow = false;
        }
        return 0;
    }
-});
+};

 var Expander = GObject.registerClass({
    Properties: {
@@ -519,35 +499,6 @@ class EmptyPlaceholder extends Gtk.Box {
    }
 });

-var NoShellPlaceholder = GObject.registerClass(
-class NoShellPlaceholder extends Gtk.Box {
-    _init() {
-        super._init({
-            orientation: Gtk.Orientation.VERTICAL,
-            spacing: 12,
-            margin: 100,
-            margin_bottom: 60
-        });
-
-        let label = new Gtk.Label({
-            label: '<span size="x-large">%s</span>'.format(
-                _("Something’s gone wrong")),
-            use_markup: true
-        });
-        label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
-        this.add(label);
-
-        label = new Gtk.Label({
-            label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
-            justify: Gtk.Justification.CENTER,
-            wrap: true
-        });
-        this.add(label);
-
-        this.show_all();
-    }
-});
-
 var DescriptionLabel = GObject.registerClass(
 class DescriptionLabel extends Gtk.Label {
    vfunc_get_preferred_height_for_width(width) {
@@ -560,55 +511,30 @@ class DescriptionLabel extends Gtk.Label {

 var ExtensionRow = GObject.registerClass(
 class ExtensionRow extends Gtk.ListBoxRow {
-    _init(extension) {
+    _init(uuid) {
        super._init();

-        this._app = Gio.Application.get_default();
-        this._extension = extension;
-        this._prefsModule = null;
+        this.uuid = uuid;

-        this._extensionStateChangedId = this._app.shellProxy.connectSignal(
-            'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
-                if (this.uuid !== uuid)
-                    return;
-
-                this._extension = ExtensionUtils.deserializeExtension(newState);
-                let state = (this._extension.state == ExtensionState.ENABLED);
-                this._switch.state = state;
-                this._switch.sensitive = this._canToggle();
+        this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' });
+        this._settings.connect('changed::enabled-extensions', () => {
+            this._switch.state = this._isEnabled();
+        });
+        this._settings.connect('changed::disable-extension-version-validation',
+            () => {
+                this._switch.sensitive = this._canEnable();
+            });
+        this._settings.connect('changed::disable-user-extensions',
+            () => {
+                this._switch.sensitive = this._canEnable();
            });
-
-        this.connect('destroy', this._onDestroy.bind(this));

        this._buildUI();
    }

-    get uuid() {
-        return this._extension.uuid;
-    }
-
-    get name() {
-        return this._extension.metadata.name;
-    }
-
-    get hasPrefs() {
-        return this._extension.hasPrefs;
-    }
-
-    get url() {
-        return this._extension.metadata.url;
-    }
-
-    _onDestroy() {
-        if (!this._app.shellProxy)
-            return;
-
-        if (this._extensionStateChangedId)
-            this._app.shellProxy.disconnectSignal(this._extensionStateChangedId);
-        this._extensionStateChangedId = 0;
-    }
-
    _buildUI() {
+        let extension = ExtensionUtils.extensions[this.uuid];
+
        let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL,
                                 hexpand: true, margin_end: 24, spacing: 24,
                                 margin: 12 });
@@ -618,20 +544,19 @@ class ExtensionRow extends Gtk.ListBoxRow {
                                 spacing: 6, hexpand: true });
        hbox.add(vbox);

-        let name = GLib.markup_escape_text(this.name, -1);
+        let name = GLib.markup_escape_text(extension.metadata.name, -1);
        let label = new Gtk.Label({ label: '<b>' + name + '</b>',
                                    use_markup: true,
                                    halign: Gtk.Align.START });
        vbox.add(label);

-        let desc = this._extension.metadata.description.split('\n')[0];
+        let desc = extension.metadata.description.split('\n')[0];
        label = new DescriptionLabel({ label: desc, wrap: true, lines: 2,
                                       ellipsize: Pango.EllipsizeMode.END,
                                       xalign: 0, yalign: 0 });
        vbox.add(label);

        let button = new Gtk.Button({ valign: Gtk.Align.CENTER,
-                                      visible: this.hasPrefs,
                                      no_show_all: true });
        button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic',
                                         icon_size: Gtk.IconSize.BUTTON,
@@ -641,37 +566,51 @@ class ExtensionRow extends Gtk.ListBoxRow {

        this.prefsButton = button;

-        this._switch = new Gtk.Switch({
-            valign: Gtk.Align.CENTER,
-            sensitive: this._canToggle(),
-            state: this._extension.state === ExtensionState.ENABLED
-        });
+        this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER,
+                                        sensitive: this._canEnable(),
+                                        state: this._isEnabled() });
        this._switch.connect('notify::active', () => {
            if (this._switch.active)
-                this._app.shellProxy.EnableExtensionRemote(this.uuid);
+                this._enable();
            else
-                this._app.shellProxy.DisableExtensionRemote(this.uuid);
+                this._disable();
        });
        this._switch.connect('state-set', () => true);
        hbox.add(this._switch);
    }

-    _canToggle() {
-        return this._extension.canChange;
+    _canEnable() {
+        let extension = ExtensionUtils.extensions[this.uuid];
+        let checkVersion = !this._settings.get_boolean('disable-extension-version-validation');
+
+        return !this._settings.get_boolean('disable-user-extensions') &&
+               !(checkVersion && ExtensionUtils.isOutOfDate(extension));
    }

-    get prefsModule() {
-        if (!this._prefsModule) {
-            ExtensionUtils.installImporter(this._extension);
+    _isEnabled() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        return extensions.includes(this.uuid);
+    }

-            // give extension prefs access to their own extension object
-            ExtensionUtils.getCurrentExtension = () => this._extension;
+    _enable() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        if (extensions.includes(this.uuid))
+            return;

-            this._prefsModule = this._extension.imports.prefs;
-            this._prefsModule.init(this._extension.metadata);
-        }
+        extensions.push(this.uuid);
+        this._settings.set_strv('enabled-extensions', extensions);
+    }

-        return this._prefsModule;
+    _disable() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        let pos = extensions.indexOf(this.uuid);
+        if (pos == -1)
+            return;
+        do {
+            extensions.splice(pos, 1);
+            pos = extensions.indexOf(this.uuid);
+        } while (pos != -1);
+        this._settings.set_strv('enabled-extensions', extensions);
    }
 });

@@ -699,5 +638,6 @@ function main(argv) {
    Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR);
    Gettext.textdomain(Config.GETTEXT_PACKAGE);

-    new Application().run(argv);
+    let app = new Application();
+    app.application.run(argv);
 }
--- a/js/gdm/authPrompt.js
+++ b/js/gdm/authPrompt.js
@@ -8,13 +8,14 @@ const Batch = imports.gdm.batch;
 const GdmUtil = imports.gdm.util;
 const Params = imports.misc.params;
 const ShellEntry = imports.ui.shellEntry;
+const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;

 var DEFAULT_BUTTON_WELL_ICON_SIZE = 16;
-var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000;
-var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
+var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0;
+var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3;

-var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
+var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5;

 var AuthPromptMode = {
    UNLOCK_ONLY: 0,
@@ -266,7 +267,7 @@ var AuthPrompt = class {
        let oldActor = this._defaultButtonWellActor;

        if (oldActor)
-            oldActor.remove_all_transitions();
+            Tweener.removeTweens(oldActor);

        let wasSpinner;
        if (oldActor == this._spinner.actor)
@@ -289,18 +290,18 @@ var AuthPrompt = class {
                        this._spinner.stop();
                }
            } else {
-                oldActor.ease({
-                    opacity: 0,
-                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                    mode: Clutter.AnimationMode.LINEAR,
-                    onComplete: () => {
-                        if (wasSpinner) {
-                            if (this._spinner)
-                                this._spinner.stop();
-                        }
-                    }
-                });
+                Tweener.addTween(oldActor,
+                                 { opacity: 0,
+                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                                   transition: 'linear',
+                                   onComplete: () => {
+                                       if (wasSpinner) {
+                                           if (this._spinner)
+                                               this._spinner.stop();
+                                       }
+                                   }
+                                 });
            }
        }

@@ -311,12 +312,11 @@ var AuthPrompt = class {
            if (!animate)
                actor.opacity = 255;
            else
-                actor.ease({
-                    opacity: 255,
-                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                    mode: Clutter.AnimationMode.LINEAR
-                });
+                Tweener.addTween(actor,
+                                 { opacity: 255,
+                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                                   transition: 'linear' });
        }

        this._defaultButtonWellActor = actor;
@@ -365,12 +365,12 @@ var AuthPrompt = class {
    _fadeOutMessage() {
        if (this._message.opacity == 0)
            return;
-        this._message.remove_all_transitions();
-        this._message.ease({
-            opacity: 0,
-            duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.removeTweens(this._message);
+        Tweener.addTween(this._message,
+                         { opacity: 0,
+                           time: MESSAGE_FADE_OUT_ANIMATION_TIME,
+                           transition: 'easeOutQuad'
+                         });
    }

    setMessage(message, type) {
@@ -385,7 +385,7 @@ var AuthPrompt = class {
            this._message.remove_style_class_name('login-dialog-message-hint');

        if (message) {
-            this._message.remove_all_transitions();
+            Tweener.removeTweens(this._message);
            this._message.text = message;
            this._message.opacity = 255;
        } else {
--- a/js/gdm/batch.js
+++ b/js/gdm/batch.js
@@ -20,7 +20,7 @@
 * In order for transformation animations to look good, they need to be
 * incremental and have some order to them (e.g., fade out hidden items,
 * then shrink to close the void left over). Chaining animations in this way can
- * be error-prone and wordy using just ease() callbacks.
+ * be error-prone and wordy using just Tweener callbacks.
 *
 * The classes in this file help with this:
 *
--- a/js/gdm/fingerprint.js
+++ b/js/gdm/fingerprint.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported FprintManager */

 const Gio = imports.gi.Gio;

--- a/js/gdm/loginDialog.js
+++ b/js/gdm/loginDialog.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LoginDialog */
 /*
 * Copyright 2011 Red Hat, Inc
 *
@@ -31,10 +30,11 @@ const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const PopupMenu = imports.ui.popupMenu;
 const Realmd = imports.gdm.realmd;
+const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;

-const _FADE_ANIMATION_TIME = 250;
-const _SCROLL_ANIMATION_TIME = 500;
+const _FADE_ANIMATION_TIME = 0.25;
+const _SCROLL_ANIMATION_TIME = 0.5;
 const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
 const _LOGO_ICON_HEIGHT = 48;
 const _MAX_BOTTOM_MENU_ITEMS = 5;
@@ -204,10 +204,11 @@ var UserList = class {
        let adjustment = this.actor.get_vscroll_bar().get_adjustment();

        let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
-        adjustment.ease(value, {
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: _SCROLL_ANIMATION_TIME
-        });
+        Tweener.removeTweens(adjustment);
+        Tweener.addTween (adjustment,
+                          { value: value,
+                            time: _SCROLL_ANIMATION_TIME,
+                            transition: 'easeOutQuad' });
    }

    jumpToItem(item) {
@@ -371,7 +372,7 @@ var SessionMenuButton = class {
        }

        for (let i = 0; i < ids.length; i++) {
-            let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]);
+            let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]);

            let id = ids[i];
            let item = new PopupMenu.PopupMenuItem(sessionName);
@@ -517,7 +518,7 @@ var LoginDialog = GObject.registerClass({
    _getBannerAllocation(dialogBox) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = this._bannerView.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;

        actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -531,7 +532,7 @@ var LoginDialog = GObject.registerClass({
    _getLogoBinAllocation(dialogBox) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = this._logoBin.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;

        actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -545,7 +546,7 @@ var LoginDialog = GObject.registerClass({
    _getCenterActorAllocation(dialogBox, actor) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = actor.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
        let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2;

@@ -647,7 +648,7 @@ var LoginDialog = GObject.registerClass({

                    // figure out how tall it would like to be and try to accommodate
                    // but don't let it get too close to the logo
-                    let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
+                    let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);

                    let maxWideHeight = dialogHeight - 3 * logoHeight;
                    wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
@@ -757,15 +758,14 @@ var LoginDialog = GObject.registerClass({

    _fadeInBannerView() {
        this._bannerView.show();
-        this._bannerView.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this._bannerView,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad' });
    }

    _hideBannerView() {
-        this._bannerView.remove_all_transitions();
+        Tweener.removeTweens(this._bannerView);
        this._bannerView.opacity = 0;
        this._bannerView.hide();
    }
@@ -858,11 +858,10 @@ var LoginDialog = GObject.registerClass({
            return;
        this._authPrompt.actor.opacity = 0;
        this._authPrompt.actor.show();
-        this._authPrompt.actor.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this._authPrompt.actor,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad' });
        this._fadeInBannerView();
    }

@@ -906,31 +905,26 @@ var LoginDialog = GObject.registerClass({
        this._showPrompt();
    }

-    _bindOpacity() {
-        this._bindings = Main.layoutManager.uiGroup.get_children()
-            .filter(c => c != Main.layoutManager.screenShieldGroup)
-            .map(c => this.bind_property('opacity', c, 'opacity', 0));
-    }
-
-    _unbindOpacity() {
-        this._bindings.forEach(b => b.unbind());
-    }
-
    _loginScreenSessionActivated() {
        if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
            return;

-        this._bindOpacity();
-        this.actor.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
-                    this._authPrompt.reset();
-                this._unbindOpacity();
-            }
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onUpdate: () => {
+                               let children = Main.layoutManager.uiGroup.get_children();
+
+                               for (let i = 0; i < children.length; i++) {
+                                   if (children[i] != Main.layoutManager.screenShieldGroup)
+                                       children[i].opacity = this.opacity;
+                               }
+                           },
+                           onComplete: () => {
+                               if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
+                                   this._authPrompt.reset();
+                           } });
    }

    _gotGreeterSessionProxy(proxy) {
@@ -943,16 +937,21 @@ var LoginDialog = GObject.registerClass({
    }

    _startSession(serviceName) {
-        this._bindOpacity();
-        this.actor.ease({
-            opacity: 0,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
-                this._unbindOpacity();
-            }
-        });
+        Tweener.addTween(this,
+                         { opacity: 0,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onUpdate: () => {
+                               let children = Main.layoutManager.uiGroup.get_children();
+
+                               for (let i = 0; i < children.length; i++) {
+                                   if (children[i] != Main.layoutManager.screenShieldGroup)
+                                       children[i].opacity = this.opacity;
+                               }
+                           },
+                           onComplete: () => {
+                               this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
+                           } });
    }

    _onSessionOpened(client, serviceName) {
@@ -1225,11 +1224,10 @@ var LoginDialog = GObject.registerClass({

        Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN });

-        this.ease({
-            opacity: 255,
-            duration: 1000,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: 1,
+                           transition: 'easeInQuad' });

        return true;
    }
@@ -1243,7 +1241,7 @@ var LoginDialog = GObject.registerClass({
        this._authPrompt.cancel();
    }

-    addCharacter(_unichar) {
+    addCharacter(unichar) {
        // Don't allow type ahead at the login screen
    }

--- a/js/gdm/oVirt.js
+++ b/js/gdm/oVirt.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getOVirtCredentialsManager */

 const Gio = imports.gi.Gio;
 const Signals = imports.signals;
--- a/js/gdm/realmd.js
+++ b/js/gdm/realmd.js
@@ -15,7 +15,7 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm");
 const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface);

 var Manager = class {
-    constructor() {
+    constructor(parentActor) {
        this._aggregateProvider = Provider(Gio.DBus.system,
                                           'org.freedesktop.realmd',
                                           '/org/freedesktop/realmd',
--- a/js/gdm/util.js
+++ b/js/gdm/util.js
@@ -1,6 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY,
-            DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */

 const { Clutter, Gio, GLib } = imports.gi;
 const Signals = imports.signals;
@@ -11,13 +9,14 @@ const OVirt = imports.gdm.oVirt;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
 const SmartcardManager = imports.misc.smartcardManager;
+const Tweener = imports.ui.tweener;

 var PASSWORD_SERVICE_NAME = 'gdm-password';
 var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint';
 var SMARTCARD_SERVICE_NAME = 'gdm-smartcard';
 var OVIRT_SERVICE_NAME = 'gdm-ovirtcred';
-var FADE_ANIMATION_TIME = 160;
-var CLONE_FADE_ANIMATION_TIME = 250;
+var FADE_ANIMATION_TIME = 0.16;
+var CLONE_FADE_ANIMATION_TIME = 0.25;

 var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen';
 var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication';
@@ -46,20 +45,20 @@ function fadeInActor(actor) {

    let hold = new Batch.Hold();
    actor.show();
-    let [, naturalHeight] = actor.get_preferred_height(-1);
+    let [minHeight, naturalHeight] = actor.get_preferred_height(-1);

    actor.opacity = 0;
    actor.set_height(0);
-    actor.ease({
-        opacity: 255,
-        height: naturalHeight,
-        duration: FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            this.set_height(-1);
-            hold.release();
-        }
-    });
+    Tweener.addTween(actor,
+                     { opacity: 255,
+                       height: naturalHeight,
+                       time: FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           this.set_height(-1);
+                           hold.release();
+                       },
+                     });

    return hold;
 }
@@ -72,17 +71,17 @@ function fadeOutActor(actor) {
    }

    let hold = new Batch.Hold();
-    actor.ease({
-        opacity: 0,
-        height: 0,
-        duration: FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            this.hide();
-            this.set_height(-1);
-            hold.release();
-        }
-    });
+    Tweener.addTween(actor,
+                     { opacity: 0,
+                       height: 0,
+                       time: FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           this.hide();
+                           this.set_height(-1);
+                           hold.release();
+                       },
+                     });
    return hold;
 }

@@ -102,15 +101,15 @@ function cloneAndFadeOutActor(actor) {
    clone.set_position(x, y);

    let hold = new Batch.Hold();
-    clone.ease({
-        opacity: 0,
-        duration: CLONE_FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            clone.destroy();
-            hold.release();
-        }
-    });
+    Tweener.addTween(clone,
+                     { opacity: 0,
+                       time: CLONE_FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           clone.destroy();
+                           hold.release();
+                       }
+                     });
    return hold;
 }

@@ -304,7 +303,7 @@ var ShellUserVerifier = class {
            });
    }

-    _oVirtUserAuthenticated(_token) {
+    _oVirtUserAuthenticated(token) {
        this._preemptingService = OVIRT_SERVICE_NAME;
        this.emit('ovirt-user-authenticated');
    }
--- a/js/misc/extensionUtils.js
+++ b/js/misc/extensionUtils.js
@@ -1,37 +1,23 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ExtensionState, ExtensionType, getCurrentExtension,
-   getSettings, initTranslations, isOutOfDate, installImporter,
-   serializeExtension, deserializeExtension */

 // Common utils for the extension system and the extension
 // preferences tool

-const { Gio, GLib } = imports.gi;
-
 const Gettext = imports.gettext;
-const Lang = imports.lang;
+const Signals = imports.signals;
+
+const Gio = imports.gi.Gio;

 const Config = imports.misc.config;
+const FileUtils = imports.misc.fileUtils;

 var ExtensionType = {
    SYSTEM: 1,
    PER_USER: 2
 };

-var ExtensionState = {
-    ENABLED: 1,
-    DISABLED: 2,
-    ERROR: 3,
-    OUT_OF_DATE: 4,
-    DOWNLOADING: 5,
-    INITIALIZED: 6,
-
-    // Used as an error state for operations on unknown extensions,
-    // should never be in a real extensionMeta object.
-    UNINSTALLED: 99
-};
-
-const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
+// Maps uuid -> metadata object
+var extensions = {};

 /**
 * getCurrentExtension:
@@ -63,17 +49,13 @@ function getCurrentExtension() {
    if (!match)
        return null;

-    // local import, as the module is used from outside the gnome-shell process
-    // as well (not this function though)
-    let extensionManager = imports.ui.main.extensionManager;
-
    let path = match[1];
    let file = Gio.File.new_for_path(path);

    // Walk up the directory tree, looking for an extension with
    // the same UUID as a directory name.
    while (file != null) {
-        let extension = extensionManager.lookup(file.get_basename());
+        let extension = extensions[file.get_basename()];
        if (extension !== undefined)
            return extension;
        file = file.get_parent();
@@ -179,50 +161,52 @@ function isOutOfDate(extension) {
    return false;
 }

-function serializeExtension(extension) {
-    let obj = {};
-    Lang.copyProperties(extension.metadata, obj);
+function createExtensionObject(uuid, dir, type) {
+    let metadataFile = dir.get_child('metadata.json');
+    if (!metadataFile.query_exists(null)) {
+        throw new Error('Missing metadata.json');
+    }

-    SERIALIZED_PROPERTIES.forEach(prop => {
-        obj[prop] = extension[prop];
-    });
+    let metadataContents, success, tag;
+    try {
+        [success, metadataContents, tag] = metadataFile.load_contents(null);
+        if (metadataContents instanceof Uint8Array)
+            metadataContents = imports.byteArray.toString(metadataContents);
+    } catch (e) {
+        throw new Error(`Failed to load metadata.json: ${e}`);
+    }
+    let meta;
+    try {
+        meta = JSON.parse(metadataContents);
+    } catch (e) {
+        throw new Error(`Failed to parse metadata.json: ${e}`);
+    }

-    let res = {};
-    for (let key in obj) {
-        let val = obj[key];
-        let type;
-        switch (typeof val) {
-        case 'string':
-            type = 's';
-            break;
-        case 'number':
-            type = 'd';
-            break;
-        case 'boolean':
-            type = 'b';
-            break;
-        default:
-            continue;
+    let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
+    for (let i = 0; i < requiredProperties.length; i++) {
+        let prop = requiredProperties[i];
+        if (!meta[prop]) {
+            throw new Error(`missing "${prop}" property in metadata.json`);
        }
-        res[key] = GLib.Variant.new(type, val);
    }

-    return res;
-}
-
-function deserializeExtension(variant) {
-    let res = { metadata: {} };
-    for (let prop in variant) {
-        let val = variant[prop].unpack();
-        if (SERIALIZED_PROPERTIES.includes(prop))
-            res[prop] = val;
-        else
-            res.metadata[prop] = val;
+    if (uuid != meta.uuid) {
+        throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
    }
-    // add the 2 additional properties to create a valid extension object, as createExtensionObject()
-    res.uuid = res.metadata.uuid;
-    res.dir = Gio.File.new_for_path(res.path);
-    return res;
+
+    let extension = {};
+
+    extension.metadata = meta;
+    extension.uuid = meta.uuid;
+    extension.type = type;
+    extension.dir = dir;
+    extension.path = dir.get_path();
+    extension.error = '';
+    extension.hasPrefs = dir.get_child('prefs.js').query_exists(null);
+
+    extensions[uuid] = extension;
+
+    return extension;
 }

 function installImporter(extension) {
@@ -233,3 +217,36 @@ function installImporter(extension) {
    extension.imports = imports[extension.uuid];
    imports.searchPath = oldSearchPath;
 }
+
+var ExtensionFinder = class {
+    _loadExtension(extensionDir, info, perUserDir) {
+        let fileType = info.get_file_type();
+        if (fileType != Gio.FileType.DIRECTORY)
+            return;
+        let uuid = info.get_name();
+        let existing = extensions[uuid];
+        if (existing) {
+            log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path()));
+            return;
+        }
+
+        let extension;
+        let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER
+                                                       : ExtensionType.SYSTEM;
+        try {
+            extension = createExtensionObject(uuid, extensionDir, type);
+        } catch (e) {
+            logError(e, 'Could not load extension %s'.format(uuid));
+            return;
+        }
+        this.emit('extension-found', extension);
+    }
+
+    scanExtensions() {
+        let perUserDir = Gio.File.new_for_path(global.userdatadir);
+        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
+            this._loadExtension(dir, info, perUserDir);
+        });
+    }
+};
+Signals.addSignalMethods(ExtensionFinder.prototype);
--- a/js/misc/fileUtils.js
+++ b/js/misc/fileUtils.js
@@ -1,6 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
-            recursivelyMoveDir, loadInterfaceXML */

 const { Gio, GLib } = imports.gi;
 const Config = imports.misc.config;
@@ -86,7 +84,7 @@ function loadInterfaceXML(iface) {
    let f = Gio.File.new_for_uri(uri);

    try {
-        let [ok_, bytes] = f.load_contents(null);
+        let [ok, bytes] = f.load_contents(null);
        if (bytes instanceof Uint8Array)
            xml = imports.byteArray.toString(bytes);
        else
--- a/js/misc/gnomeSession.js
+++ b/js/misc/gnomeSession.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PresenceStatus, Presence, Inhibitor, SessionManager */

 const Gio = imports.gi.Gio;

--- a/js/misc/ibusManager.js
+++ b/js/misc/ibusManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getIBusManager */

 const { Gio, GLib, IBus } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -59,19 +58,15 @@ var IBusManager = class {
        this._spawn();
    }

-    _spawn(extraArgs = []) {
+    _spawn() {
        try {
-            let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs];
-            Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE);
+            Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
+                               Gio.SubprocessFlags.NONE);
        } catch (e) {
            log(`Failed to launch ibus-daemon: ${e.message}`);
        }
    }

-    restartDaemon(extraArgs = []) {
-        this._spawn(['-r', ...extraArgs]);
-    }
-
    _clear() {
        if (this._panelService)
            this._panelService.destroy();
@@ -84,6 +79,8 @@ var IBusManager = class {
        this._currentEngineName = null;

        this.emit('ready', false);
+
+        this._spawn();
    }

    _onConnected() {
--- a/js/misc/inputMethod.js
+++ b/js/misc/inputMethod.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported InputMethod */
 const { Clutter, GLib, GObject, IBus } = imports.gi;

 const Keyboard = imports.ui.status.keyboard;
@@ -85,15 +84,15 @@ class InputMethod extends Clutter.InputMethod {
            this.emit('request-surrounding');
    }

-    _onCommitText(_context, text) {
+    _onCommitText(context, text) {
        this.commit(text.get_text());
    }

-    _onDeleteSurroundingText() {
+    _onDeleteSurroundingText(context) {
        this.delete_surrounding();
    }

-    _onUpdatePreeditText(_context, text, pos, visible) {
+    _onUpdatePreeditText(context, text, pos, visible) {
        if (text == null)
            return;

@@ -109,17 +108,17 @@ class InputMethod extends Clutter.InputMethod {
        this._preeditVisible = visible;
    }

-    _onShowPreeditText() {
+    _onShowPreeditText(context) {
        this._preeditVisible = true;
        this.set_preedit_text(this._preeditStr, this._preeditPos);
    }

-    _onHidePreeditText() {
+    _onHidePreeditText(context) {
        this.set_preedit_text(null, this._preeditPos);
        this._preeditVisible = false;
    }

-    _onForwardKeyEvent(_context, keyval, keycode, state) {
+    _onForwardKeyEvent(context, keyval, keycode, state) {
        let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
        state &= ~(IBus.ModifierType.RELEASE_MASK);

--- a/js/misc/introspect.js
+++ b/js/misc/introspect.js
@@ -1,4 +1,3 @@
-/* exported IntrospectService */
 const { Gio, GLib, Meta, Shell } = imports.gi;

 const INTROSPECT_SCHEMA = 'org.gnome.shell';
--- a/js/misc/jsParse.js
+++ b/js/misc/jsParse.js
@@ -1,5 +1,4 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
-/* exported getCompletions, getCommonPrefix, getDeclaredConstants */

 // Returns a list of potential completions for text. Completions either
 // follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo)
@@ -9,7 +8,7 @@
 // This function is likely the one you want to call from external modules
 function getCompletions(text, commandHeader, globalCompletionList) {
    let methods = [];
-    let expr_, base;
+    let expr, base;
    let attrHead = '';
    if (globalCompletionList == null) {
        globalCompletionList = [];
@@ -22,7 +21,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
        // Look for expressions like "Main.panel.foo" and match Main.panel and foo
        let matches = text.match(/(.*)\.(.*)/);
        if (matches) {
-            [expr_, base, attrHead] = matches;
+            [expr, base, attrHead] = matches;

            methods = getPropertyNamesFromExpression(base, commandHeader).filter(
                attr => attr.slice(0, attrHead.length) == attrHead
@@ -33,7 +32,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
        // not proceeded by a dot and match them against global constants
        matches = text.match(/^(\w*)$/);
        if (text == '' || matches) {
-            [expr_, attrHead] = matches;
+            [expr, attrHead] = matches;
            methods = globalCompletionList.filter(
                attr => attr.slice(0, attrHead.length) == attrHead
            );
@@ -231,10 +230,10 @@ function isUnsafeExpression(str) {
 function getDeclaredConstants(str) {
    let ret = [];
    str.split(';').forEach(s => {
-        let base_, keyword;
+        let base, keyword;
        let match = s.match(/const\s+(\w+)\s*=/);
        if (match) {
-            [base_, keyword] = match;
+            [base, keyword] = match;
            ret.push(keyword);
        }
    });
--- a/js/misc/keyboardManager.js
+++ b/js/misc/keyboardManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getKeyboardManager, holdKeyboard, releaseKeyboard */

 const { GLib, GnomeDesktop, Meta } = imports.gi;

--- a/js/misc/loginManager.js
+++ b/js/misc/loginManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported canLock, getLoginManager, registerSessionWithGDM */

 const { GLib, Gio } = imports.gi;
 const Signals = imports.signals;
@@ -110,7 +109,7 @@ var LoginManagerSystemd = class {
        let sessionId = GLib.getenv('XDG_SESSION_ID');
        if (!sessionId) {
            log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
-            let [session, objectPath_] = this._userProxy.Display;
+            let [session, objectPath] = this._userProxy.Display;
            if (session) {
                log(`Will monitor session ${session}`);
                sessionId = session;
@@ -183,7 +182,7 @@ var LoginManagerSystemd = class {
            (proxy, result) => {
                let fd = -1;
                try {
-                    let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
+                    let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result);
                    fd = fdList.steal_fds()[0];
                    callback(new Gio.UnixInputStream({ fd: fd }));
                } catch (e) {
@@ -200,7 +199,7 @@ var LoginManagerSystemd = class {
 Signals.addSignalMethods(LoginManagerSystemd.prototype);

 var LoginManagerDummy = class {
-    getCurrentSessionProxy(_callback) {
+    getCurrentSessionProxy(callback) {
        // we could return a DummySession object that fakes whatever callers
        // expect (at the time of writing: connect() and connectSignal()
        // methods), but just never calling the callback should be safer
--- a/js/misc/modemManager.js
+++ b/js/misc/modemManager.js
@@ -110,7 +110,7 @@ var ModemGsm = class {
            this.signal_quality = quality;
            this.emit('notify::signal-quality');
        });
-        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
+        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => {
            this.operator_name = _findProviderForMccMnc(name, code);
            this.emit('notify::operator-name');
        });
@@ -120,7 +120,7 @@ var ModemGsm = class {
                return;
            }

-            let [status_, code, name] = result;
+            let [status, code, name] = result;
            this.operator_name = _findProviderForMccMnc(name, code);
            this.emit('notify::operator-name');
        });
@@ -171,7 +171,7 @@ var ModemCdma = class {
                // it will return an error if the device is not connected
                this.operator_name = null;
            } else {
-                let [bandClass_, band_, sid] = result;
+                let [bandClass, band, sid] = result;

                this.operator_name = _findProviderForSid(sid);
            }
@@ -224,7 +224,7 @@ var BroadbandModem = class {
    }

    _reloadSignalQuality() {
-        let [quality, recent_] = this._proxy.SignalQuality;
+        let [quality, recent] = this._proxy.SignalQuality;
        this.signal_quality = quality;
        this.emit('notify::signal-quality');
    }
--- a/js/misc/params.js
+++ b/js/misc/params.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported parse */

 // parse:
 // @params: caller-provided parameter object, or %null
--- a/js/misc/permissionStore.js
+++ b/js/misc/permissionStore.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PermissionStore */

 const Gio = imports.gi.Gio;

--- a/js/misc/smartcardManager.js
+++ b/js/misc/smartcardManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getSmartcardManager */

 const Gio = imports.gi.Gio;
 const Signals = imports.signals;
--- a/js/misc/systemActions.js
+++ b/js/misc/systemActions.js
@@ -1,4 +1,3 @@
-/* exported getDefault */
 const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi;

 const GnomeSession = imports.misc.gnomeSession;
@@ -174,21 +173,13 @@ const SystemActions = GObject.registerClass({
                                          });
        Main.layoutManager.connect('monitors-changed',
                                   () => this._updateOrientationLock());
-        this._sensorProxy = new SensorProxy(Gio.DBus.system,
-            SENSOR_BUS_NAME,
-            SENSOR_OBJECT_PATH,
-            (proxy, error)  => {
-                if (error)
-                    log(error.message);
-            },
-            null,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START);
-        this._sensorProxy.connect('g-properties-changed', () => {
-            this._updateOrientationLock();
-        });
-        this._sensorProxy.connect('notify::g-name-owner', () => {
-            this._updateOrientationLock();
-        });
+        Gio.DBus.system.watch_name(SENSOR_BUS_NAME,
+                                   Gio.BusNameWatcherFlags.NONE,
+                                   () => this._sensorProxyAppeared(),
+                                   () => {
+                                       this._sensorProxy = null;
+                                       this._updateOrientationLock();
+                                   });
        this._updateOrientationLock();
        this._updateOrientationLockIcon();

@@ -196,44 +187,50 @@ const SystemActions = GObject.registerClass({
        this._sessionUpdated();
    }

-    // eslint-disable-next-line camelcase
    get can_power_off() {
        return this._actions.get(POWER_OFF_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_suspend() {
        return this._actions.get(SUSPEND_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_lock_screen() {
        return this._actions.get(LOCK_SCREEN_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_switch_user() {
        return this._actions.get(SWITCH_USER_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_logout() {
        return this._actions.get(LOGOUT_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_lock_orientation() {
        return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get orientation_lock_icon() {
        return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName;
    }

+    _sensorProxyAppeared() {
+        this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH,
+            (proxy, error)  => {
+                if (error) {
+                    log(error.message);
+                    return;
+                }
+                this._sensorProxy.connect('g-properties-changed',
+                                          () => this._updateOrientationLock());
+                this._updateOrientationLock();
+            });
+    }
+
    _updateOrientationLock() {
        let available = false;
-        if (this._sensorProxy.g_name_owner)
+        if (this._sensorProxy)
            available = this._sensorProxy.HasAccelerometer &&
                        this._monitorManager.get_is_builtin_display_on();

--- a/js/misc/util.js
+++ b/js/misc/util.js
@@ -1,16 +1,15 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
-            formatTime, formatTimeSpan, createTimeLabel, insertSorted,
-            makeCloseButton, ensureActorVisibleInScrollView */

 const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
 const Gettext = imports.gettext;
 const Mainloop = imports.mainloop;
+const Signals = imports.signals;

 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;
 const Params = imports.misc.params;

-var SCROLL_TIME = 100;
+var SCROLL_TIME = 0.1;

 // http://daringfireball.net/2010/07/improved_regex_for_matching_urls
 const _balancedParens = '\\([^\\s()<>]+\\)';
@@ -76,7 +75,7 @@ function spawn(argv) {
 // occur when trying to parse or start the program.
 function spawnCommandLine(commandLine) {
    try {
-        let [success_, argv] = GLib.shell_parse_argv(commandLine);
+        let [success, argv] = GLib.shell_parse_argv(commandLine);
        trySpawn(argv);
    } catch (err) {
        _handleSpawnError(commandLine, err);
@@ -105,11 +104,11 @@ function spawnApp(argv) {
 // Runs @argv in the background. If launching @argv fails,
 // this will throw an error.
 function trySpawn(argv) {
-    var success_, pid;
+    var success, pid;
    try {
-        [success_, pid] = GLib.spawn_async(null, argv, null,
-                                           GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
-                                           null);
+        [success, pid] = GLib.spawn_async(null, argv, null,
+                                          GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
+                                          null);
    } catch (err) {
        /* Rewrite the error in case of ENOENT */
        if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) {
@@ -140,10 +139,10 @@ function trySpawn(argv) {
 // Runs @commandLine in the background. If launching @commandLine
 // fails, this will throw an error.
 function trySpawnCommandLine(commandLine) {
-    let success_, argv;
+    let success, argv;

    try {
-        [success_, argv] = GLib.shell_parse_argv(commandLine);
+        [success, argv] = GLib.shell_parse_argv(commandLine);
    } catch (err) {
        // Replace "Error invoking GLib.shell_parse_argv: " with
        // something nicer
@@ -396,7 +395,7 @@ function makeCloseButton(boxpointer) {

 function ensureActorVisibleInScrollView(scrollView, actor) {
    let adjustment = scrollView.vscroll.adjustment;
-    let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values();
+    let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values();

    let offset = 0;
    let vfade = scrollView.get_effect("fade");
@@ -424,8 +423,97 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
    else
        return;

-    adjustment.ease(value, {
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        duration: SCROLL_TIME
-    });
+    Tweener.addTween(adjustment,
+                     { value: value,
+                       time: SCROLL_TIME,
+                       transition: 'easeOutQuad' });
 }
+
+var AppSettingsMonitor = class {
+    constructor(appId, schemaId) {
+        this._appId = appId;
+        this._schemaId = schemaId;
+
+        this._app = null;
+        this._settings = null;
+        this._handlers = [];
+
+        this._schemaSource = Gio.SettingsSchemaSource.get_default();
+
+        this._appSystem = Shell.AppSystem.get_default();
+        this._appSystem.connect('installed-changed',
+                                this._onInstalledChanged.bind(this));
+        this._onInstalledChanged();
+    }
+
+    get available() {
+        return this._app != null && this._settings != null;
+    }
+
+    activateApp() {
+        if (this._app)
+            this._app.activate();
+    }
+
+    watchSetting(key, callback) {
+        let handler = { id: 0, key: key, callback: callback };
+        this._handlers.push(handler);
+
+        this._connectHandler(handler);
+    }
+
+    _connectHandler(handler) {
+        if (!this._settings || handler.id > 0)
+            return;
+
+        handler.id = this._settings.connect(`changed::${handler.key}`,
+                                            handler.callback);
+        handler.callback(this._settings, handler.key);
+    }
+
+    _disconnectHandler(handler) {
+        if (this._settings && handler.id > 0)
+            this._settings.disconnect(handler.id);
+        handler.id = 0;
+    }
+
+    _onInstalledChanged() {
+        let hadApp = (this._app != null);
+        this._app = this._appSystem.lookup_app(this._appId);
+        let haveApp = (this._app != null);
+
+        if (hadApp == haveApp)
+            return;
+
+        if (haveApp)
+            this._checkSettings();
+        else
+            this._setSettings(null);
+    }
+
+    _setSettings(settings) {
+        this._handlers.forEach((handler) => this._disconnectHandler(handler));
+
+        let hadSettings = (this._settings != null);
+        this._settings = settings;
+        let haveSettings = (this._settings != null);
+
+        this._handlers.forEach((handler) => this._connectHandler(handler));
+
+        if (hadSettings != haveSettings)
+            this.emit('available-changed');
+    }
+
+    _checkSettings() {
+        let schema = this._schemaSource.lookup(this._schemaId, true);
+        if (schema) {
+            this._setSettings(new Gio.Settings({ settings_schema: schema }));
+        } else if (this._app) {
+            Mainloop.timeout_add_seconds(1, () => {
+                this._checkSettings();
+                return GLib.SOURCE_REMOVE;
+            });
+        }
+    }
+};
+Signals.addSignalMethods(AppSettingsMonitor.prototype);
--- a/js/misc/weather.js
+++ b/js/misc/weather.js
@@ -1,19 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-

-const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi;
+const { Geoclue, Gio, GLib, GWeather } = imports.gi;
 const Signals = imports.signals;

 const PermissionStore = imports.misc.permissionStore;
-
-const { loadInterfaceXML } = imports.misc.fileUtils;
-
-const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration');
-
-const WEATHER_BUS_NAME = 'org.gnome.Weather';
-const WEATHER_OBJECT_PATH = '/org/gnome/Weather';
-const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration';
-
-const WEATHER_APP_ID = 'org.gnome.Weather.desktop';
+const Util = imports.misc.util;

 // Minimum time between updates to show loading indication
 var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE;
@@ -75,38 +66,17 @@ var WeatherClient = class {
            this.emit('changed');
        });

-        this._weatherApp = null;
-        this._weatherProxy = null;
-
-        let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface);
-        Gio.DBusProxy.new(
-            Gio.DBus.session,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES,
-            nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE),
-            WEATHER_BUS_NAME,
-            WEATHER_OBJECT_PATH,
-            WEATHER_INTEGRATION_IFACE,
-            null,
-            this._onWeatherProxyReady.bind(this));
-
-        this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.weather'
-        });
-        this._settings.connect('changed::automatic-location',
-            this._onAutomaticLocationChanged.bind(this));
-        this._onAutomaticLocationChanged();
-        this._settings.connect('changed::locations',
-            this._onLocationsChanged.bind(this));
-        this._onLocationsChanged();
-
-        this._appSystem = Shell.AppSystem.get_default();
-        this._appSystem.connect('installed-changed',
-            this._onInstalledChanged.bind(this));
-        this._onInstalledChanged();
+        this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop',
+                                                          'org.gnome.Weather');
+        this._weatherAppMon.connect('available-changed', () => this.emit('changed'));
+        this._weatherAppMon.watchSetting('automatic-location',
+                                         this._onAutomaticLocationChanged.bind(this));
+        this._weatherAppMon.watchSetting('locations',
+                                         this._onLocationsChanged.bind(this));
    }

    get available() {
-        return this._weatherApp != null;
+        return this._weatherAppMon.available;
    }

    get loading() {
@@ -122,8 +92,7 @@ var WeatherClient = class {
    }

    activateApp() {
-        if (this._weatherApp)
-            this._weatherApp.activate();
+        this._weatherAppMon.activateApp();
    }

    update() {
@@ -145,38 +114,6 @@ var WeatherClient = class {
               this._weatherAuthorized;
    }

-    _onWeatherProxyReady(o, res) {
-        try {
-            this._weatherProxy = Gio.DBusProxy.new_finish(res);
-        } catch (e) {
-            log(`Failed to create GNOME Weather proxy: ${e}`);
-            return;
-        }
-
-        this._weatherProxy.connect('g-properties-changed',
-            this._onWeatherPropertiesChanged.bind(this));
-        this._onWeatherPropertiesChanged();
-    }
-
-    _onWeatherPropertiesChanged() {
-        if (this._weatherProxy.g_name_owner == null)
-            return;
-
-        this._settings.set_boolean('automatic-location',
-            this._weatherProxy.AutomaticLocation);
-        this._settings.set_value('locations',
-            new GLib.Variant('av', this._weatherProxy.Locations));
-    }
-
-    _onInstalledChanged() {
-        let hadApp = (this._weatherApp != null);
-        this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
-        let haveApp = (this._weatherApp != null);
-
-        if (hadApp !== haveApp)
-            this.emit('changed');
-    }
-
    _loadInfo() {
        let id = this._weatherInfo.connect('updated', () => {
            this._weatherInfo.disconnect(id);
@@ -261,8 +198,8 @@ var WeatherClient = class {
        this._setLocation(location);
    }

-    _onAutomaticLocationChanged() {
-        let useAutoLocation = this._settings.get_boolean('automatic-location');
+    _onAutomaticLocationChanged(settings, key) {
+        let useAutoLocation = settings.get_boolean(key);
        if (this._autoLocationRequested == useAutoLocation)
            return;

@@ -280,9 +217,8 @@ var WeatherClient = class {
            this._setLocation(this._mostRecentLocation);
    }

-    _onLocationsChanged() {
-        let locations = this._settings.get_value('locations').deep_unpack();
-        let serialized = locations.shift();
+    _onLocationsChanged(settings, key) {
+        let serialized = settings.get_value(key).deep_unpack().shift();
        let mostRecentLocation = null;

        if (serialized)
@@ -298,7 +234,7 @@ var WeatherClient = class {
    }

    _onPermStoreChanged(proxy, sender, params) {
-        let [table, id, deleted_, data_, perms] = params;
+        let [table, id, deleted, data, perms] = params;

        if (table != 'gnome' || id != 'geolocation')
            return;
--- a/js/perf/core.js
+++ b/js/perf/core.js
@@ -1,9 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported run, script_overviewShowStart, script_overviewShowDone,
-            script_applicationsShowStart, script_applicationsShowDone,
-            script_afterShowHide, malloc_usedSize, glx_swapComplete,
-            clutter_stagePaintDone */
-/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */

 const System = imports.system;

@@ -126,11 +121,9 @@ function *run() {

    for (let i = 0; i < 2; i++) {
        Scripting.scriptEvent('applicationsShowStart');
-        // eslint-disable-next-line require-atomic-updates
        Main.overview._dash.showAppsButton.checked = true;
        yield Scripting.waitLeisure();
        Scripting.scriptEvent('applicationsShowDone');
-        // eslint-disable-next-line require-atomic-updates
        Main.overview._dash.showAppsButton.checked = false;
        yield Scripting.waitLeisure();
    }
@@ -154,7 +147,7 @@ function script_overviewShowStart(time) {
    overviewFrames = 0;
 }

-function script_overviewShowDone(_time) {
+function script_overviewShowDone(time) {
    // We've set up the state at the end of the zoom out, but we
    // need to wait for one more frame to paint before we count
    // ourselves as done.
@@ -173,7 +166,7 @@ function script_applicationsShowDone(time) {
        METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart;
 }

-function script_afterShowHide(_time) {
+function script_afterShowHide(time) {
    if (overviewShowCount == 1) {
        METRICS.usedAfterOverview.value = mallocUsedSize;
    } else {
--- a/js/perf/hwtest.js
+++ b/js/perf/hwtest.js
@@ -1,12 +1,3 @@
-/* exported run, script_desktopShown, script_overviewShowStart,
-            script_overviewShowDone, script_applicationsShowStart,
-            script_applicationsShowDone, script_mainViewDrawStart,
-            script_mainViewDrawDone, script_overviewDrawStart,
-            script_overviewDrawDone, script_redrawTestStart,
-            script_redrawTestDone, script_collectTimings,
-            script_geditLaunch, script_geditFirstFrame,
-            clutter_stagePaintStart, clutter_paintCompletedTimestamp */
-/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */
 const { Clutter, Gio, Shell } = imports.gi;
 const Main = imports.ui.main;
 const Scripting = imports.ui.scripting;
@@ -47,7 +38,7 @@ function waitAndDraw(milliseconds) {
    let timeline = new Clutter.Timeline({ duration: milliseconds });
    timeline.start();

-    timeline.connect('new-frame', (_timeline, _frame) => {
+    timeline.connect('new-frame', (timeline, frame) => {
        global.stage.queue_redraw();
    });

@@ -82,8 +73,8 @@ function extractBootTimestamp() {
    let result = null;

    let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe());
-    while (true) { // eslint-disable-line no-constant-condition
-        let [line, length_] = datastream.read_line_utf8(null);
+    while (true) {
+        let [line, length] = datastream.read_line_utf8(null);
        if (line === null)
            break;

@@ -126,7 +117,6 @@ function *run() {
    yield Scripting.sleep(1000);

    Scripting.scriptEvent('applicationsShowStart');
-    // eslint-disable-next-line require-atomic-updates
    Main.overview._dash.showAppsButton.checked = true;

    yield Scripting.waitLeisure();
@@ -244,31 +234,31 @@ function script_applicationsShowDone(time) {
    METRICS.applicationsShowTime.value = time - applicationsShowStart;
 }

-function script_mainViewDrawStart(_time) {
+function script_mainViewDrawStart(time) {
    redrawTiming = 'mainView';
 }

-function script_mainViewDrawDone(_time) {
+function script_mainViewDrawDone(time) {
    redrawTiming = null;
 }

-function script_overviewDrawStart(_time) {
+function script_overviewDrawStart(time) {
    redrawTiming = 'overview';
 }

-function script_overviewDrawDone(_time) {
+function script_overviewDrawDone(time) {
    redrawTiming = null;
 }

-function script_redrawTestStart(_time) {
+function script_redrawTestStart(time) {
    redrawTiming = 'application';
 }

-function script_redrawTestDone(_time) {
+function script_redrawTestDone(time) {
    redrawTiming = null;
 }

-function script_collectTimings(_time) {
+function script_collectTimings(time) {
    for (let timing in redrawTimes) {
        let times = redrawTimes[timing];
        times.sort((a, b) => a - b);
--- a/js/portalHelper/main.js
+++ b/js/portalHelper/main.js
@@ -1,4 +1,3 @@
-/* exported main */
 const Format = imports.format;
 const Gettext = imports.gettext;
 const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi;
@@ -152,7 +151,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
        this._webView.load_uri(this._originalUrl);
    }

-    vfunc_delete_event(_event) {
+    vfunc_delete_event(event) {
        if (this._recheckAtExit)
            this._doneCallback(PortalHelperResult.RECHECK);
        else
@@ -178,7 +177,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
        this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
    }

-    _onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) {
+    _onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) {
        this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
        let uri = new Soup.URI(failingURI);
        this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host());
--- a/js/ui/accessDialog.js
+++ b/js/ui/accessDialog.js
@@ -1,4 +1,3 @@
-/* exported AccessDialogDBus */
 const { Clutter, Gio, GLib, GObject, Shell } = imports.gi;

 const CheckBox = imports.ui.checkBox;
@@ -80,7 +79,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
        this._requestExported = this._request.export(connection, this._handle);
    }

-    CloseAsync(invocation, _params) {
+    CloseAsync(invocation, params) {
        if (this._invocation.get_sender() != invocation.get_sender()) {
            invocation.return_error_literal(Gio.DBusError,
                                            Gio.DBusError.ACCESS_DENIED,
@@ -133,7 +132,7 @@ var AccessDialogDBus = class {
            return;
        }

-        let [handle, appId, parentWindow_, title, subtitle, body, options] = params;
+        let [handle, appId, parentWindow, title, subtitle, body, options] = params;
        // We probably want to use parentWindow and global.display.focus_window
        // for this check in the future
        if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) {
--- a/js/ui/altTab.js
+++ b/js/ui/altTab.js
@@ -1,18 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup,
-            WindowCyclerPopup */

 const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;

 const Main = imports.ui.main;
 const SwitcherPopup = imports.ui.switcherPopup;
+const Tweener = imports.ui.tweener;

 var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds

 var THUMBNAIL_DEFAULT_SIZE = 256;
 var THUMBNAIL_POPUP_TIME = 500; // milliseconds
-var THUMBNAIL_FADE_TIME = 100; // milliseconds
+var THUMBNAIL_FADE_TIME = 0.1; // seconds

 var WINDOW_PREVIEW_SIZE = 128;
 var APP_ICON_SIZE = 96;
@@ -88,9 +87,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
            let hPadding = leftPadding + rightPadding;

            let icon = this._items[this._selectedIndex];
-            let [posX] = icon.get_transformed_position();
+            let [posX, posY] = icon.get_transformed_position();
            let thumbnailCenter = posX + icon.width / 2;
-            let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
+            let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
            childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2));
            if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) {
                let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding;
@@ -104,7 +103,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
                childBox.x2 = primary.x + primary.width - rightPadding;
            childBox.y1 = this._switcherList.allocation.y2 + spacing;
            this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1);
-            let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
+            let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
            childBox.y2 = childBox.y1 + childNaturalHeight;
            this._thumbnails.allocate(childBox, flags);
        }
@@ -361,15 +360,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {

    _destroyThumbnails() {
        let thumbnailsActor = this._thumbnails;
-        this._thumbnails.ease({
-            opacity: 0,
-            duration: THUMBNAIL_FADE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                thumbnailsActor.destroy();
-                this.thumbnailsVisible = false;
-            }
-        });
+        Tweener.addTween(thumbnailsActor,
+                         { opacity: 0,
+                           time: THUMBNAIL_FADE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               thumbnailsActor.destroy();
+                               this.thumbnailsVisible = false;
+                           }
+                         });
        this._thumbnails = null;
        if (this._switcherList._items[this._selectedIndex])
            this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
@@ -392,14 +391,12 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
        this._thumbnails.get_allocation_box();

        this._thumbnails.opacity = 0;
-        this._thumbnails.ease({
-            opacity: 255,
-            duration: THUMBNAIL_FADE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this.thumbnailsVisible = true;
-            }
-        });
+        Tweener.addTween(this._thumbnails,
+                         { opacity: 255,
+                           time: THUMBNAIL_FADE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => this.thumbnailsVisible = true
+                         });

        this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
    }
@@ -472,7 +469,7 @@ var CyclerList = GObject.registerClass({
               'item-removed': { param_types: [GObject.TYPE_INT] },
               'item-highlighted': { param_types: [GObject.TYPE_INT] } },
 }, class CyclerList extends St.Widget {
-    highlight(index, _justOutline) {
+    highlight(index, justOutline) {
        this.emit('item-highlighted', index);
    }
 });
@@ -497,7 +494,7 @@ var CyclerPopup = GObject.registerClass({
        });
    }

-    _highlightItem(index, _justOutline) {
+    _highlightItem(index, justOutline) {
        this._highlight.window = this._items[index];
        global.window_group.set_child_above_sibling(this._highlight.actor, null);
    }
@@ -663,7 +660,6 @@ class AppIcon extends St.BoxLayout {
        this.add(this.label, { x_fill: false });
    }

-    // eslint-disable-next-line camelcase
    set_size(size) {
        this.icon = this.app.create_icon_texture(size);
        this._iconBin.child = this.icon;
@@ -805,7 +801,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
    }

    _enterItem(index) {
-        let [x, y] = global.get_pointer();
+        let [x, y, mask] = global.get_pointer();
        let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y);
        if (this._items[index].contains(pickedActor))
            this._itemEntered(index);
@@ -912,7 +908,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
            return;
        let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding();
        totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding();
-        let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
+        let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
        let spacing = this._items[0].child.get_theme_node().get_length('spacing');
        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
        let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor;
--- a/js/ui/animation.js
+++ b/js/ui/animation.js
@@ -1,12 +1,13 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Animation, AnimatedIcon, Spinner */

-const { Clutter, GLib, Gio, St } = imports.gi;
+const { GLib, Gio, St } = imports.gi;
 const Mainloop = imports.mainloop;

+const Tweener = imports.ui.tweener;
+
 var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
-var SPINNER_ANIMATION_TIME = 300;
-var SPINNER_ANIMATION_DELAY = 1000;
+var SPINNER_ANIMATION_TIME = 0.3;
+var SPINNER_ANIMATION_DELAY = 1.0;

 var Animation = class {
    constructor(file, width, height, speed) {
@@ -136,15 +137,15 @@ var Spinner = class extends AnimatedIcon {
    }

    play() {
-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        if (this._animate) {
            super.play();
-            this.actor.ease({
+            Tweener.addTween(this.actor, {
                opacity: 255,
                delay: SPINNER_ANIMATION_DELAY,
-                duration: SPINNER_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.LINEAR
+                time: SPINNER_ANIMATION_TIME,
+                transition: 'linear'
            });
        } else {
            this.actor.opacity = 255;
@@ -153,14 +154,16 @@ var Spinner = class extends AnimatedIcon {
    }

    stop() {
-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        if (this._animate) {
-            this.actor.ease({
+            Tweener.addTween(this.actor, {
                opacity: 0,
                time: SPINNER_ANIMATION_TIME,
                transition: 'linear',
-                onComplete: () => super.stop()
+                onComplete: () => {
+                    super.stop();
+                }
            });
        } else {
            this.actor.opacity = 0;
--- a/js/ui/appDisplay.js
+++ b/js/ui/appDisplay.js
--- a/js/ui/appFavorites.js
+++ b/js/ui/appFavorites.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getAppFavorites */

 const Shell = imports.gi.Shell;
 const Signals = imports.signals;
--- a/js/ui/audioDeviceSelection.js
+++ b/js/ui/audioDeviceSelection.js
@@ -1,4 +1,3 @@
-/* exported AudioDeviceSelectionDBus */
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;

 const Main = imports.ui.main;
@@ -35,7 +34,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
            throw new Error('Too few devices for a selection');
    }

-    _buildLayout() {
+    _buildLayout(devices) {
        let title = new St.Label({ style_class: 'audio-selection-title',
                                   text: _("Select Audio Device"),
                                   x_align: Clutter.ActorAlign.CENTER });
@@ -86,7 +85,6 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
        box.connect('notify::height', () => {
            Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
                box.width = box.height;
-                return GLib.SOURCE_REMOVE;
            });
        });

--- a/js/ui/background.js
+++ b/js/ui/background.js
@@ -99,6 +99,7 @@ const Signals = imports.signals;
 const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff);

@@ -109,7 +110,7 @@ const COLOR_SHADING_TYPE_KEY = 'color-shading-type';
 const BACKGROUND_STYLE_KEY = 'picture-options';
 const PICTURE_URI_KEY = 'picture-uri';

-var FADE_ANIMATION_TIME = 1000;
+var FADE_ANIMATION_TIME = 1.0;

 // These parameters affect how often we redraw.
 // The first is how different (percent crossfaded) the slide show
@@ -332,12 +333,12 @@ var Background = class Background {
    }

    _loadPattern() {
-        let colorString, res_, color, secondColor;
+        let colorString, res, color, secondColor;

        colorString = this._settings.get_string(PRIMARY_COLOR_KEY);
-        [res_, color] = Clutter.Color.from_string(colorString);
+        [res, color] = Clutter.Color.from_string(colorString);
        colorString = this._settings.get_string(SECONDARY_COLOR_KEY);
-        [res_, secondColor] = Clutter.Color.from_string(colorString);
+        [res, secondColor] = Clutter.Color.from_string(colorString);

        let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);

@@ -632,9 +633,9 @@ var Animation = class Animation {
    }

    load(callback) {
-        this._show = new GnomeDesktop.BGSlideShow({ file: this.file });
+        this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() });

-        this._show.load_async(null, () => {
+        this._show.load_async(null, (object, result) => {
            this.loaded = true;
            if (callback)
                callback();
@@ -650,7 +651,7 @@ var Animation = class Animation {
        if (this._show.get_num_slides() < 1)
            return;

-        let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
+        let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);

        this.transitionDuration = duration;
        this.transitionProgress = progress;
@@ -709,12 +710,14 @@ var BackgroundManager = class BackgroundManager {
        this._newBackgroundActor = null;
        this.emit('changed');

-        oldBackgroundActor.ease({
-            opacity: 0,
-            duration: FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => oldBackgroundActor.destroy()
-        });
+        Tweener.addTween(oldBackgroundActor,
+                         { opacity: 0,
+                           time: FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete() {
+                               oldBackgroundActor.destroy();
+                           }
+                         });
    }

    _updateBackgroundActor() {
--- a/js/ui/backgroundMenu.js
+++ b/js/ui/backgroundMenu.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported addBackgroundMenu */

 const { Clutter, St } = imports.gi;

--- a/js/ui/barLevel.js
+++ b/js/ui/barLevel.js
@@ -1,106 +1,71 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
-/* exported BarLevel */

-const { Atk, Clutter, GObject, St } = imports.gi;
+const { Atk, Clutter, St } = imports.gi;
+const Signals = imports.signals;

-var BarLevel = GObject.registerClass({
-    Properties: {
-        'value': GObject.ParamSpec.double(
-            'value', 'value', 'value',
-            GObject.ParamFlags.READWRITE,
-            0, 2, 0),
-        'maximum-value': GObject.ParamSpec.double(
-            'maximum-value', 'maximum-value', 'maximum-value',
-            GObject.ParamFlags.READWRITE,
-            1, 2, 1),
-        'overdrive-start': GObject.ParamSpec.double(
-            'overdrive-start', 'overdrive-start', 'overdrive-start',
-            GObject.ParamFlags.READWRITE,
-            1, 2, 1)
-    }
-}, class BarLevel extends St.DrawingArea {
-    _init(params) {
+var BarLevel = class {
+    constructor(value, params = {}) {
+        if (isNaN(value))
+            // Avoid spreading NaNs around
+            throw TypeError('The bar level value must be a number');
        this._maxValue = 1;
-        this._value = 0;
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
        this._overdriveStart = 1;
        this._barLevelWidth = 0;

-        let defaultParams = {
-            style_class: 'barlevel',
-            accessible_role: Atk.Role.LEVEL_BAR
-        };
-        super._init(Object.assign(defaultParams, params));
-        this.connect('allocation-changed', (actor, box) => {
+        this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel',
+                                          can_focus: params['canFocus'] || false,
+                                          reactive: params['reactive'] || false,
+                                          accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR });
+        this.actor.connect('repaint', this._barLevelRepaint.bind(this));
+        this.actor.connect('allocation-changed', (actor, box) => {
            this._barLevelWidth = box.get_width();
        });

-        this._customAccessible = St.GenericAccessible.new_for_actor(this);
-        this.set_accessible(this._customAccessible);
+        this._customAccessible = St.GenericAccessible.new_for_actor(this.actor);
+        this.actor.set_accessible(this._customAccessible);

        this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this));
        this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this));
        this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this));
        this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this));

-        this.connect('notify::value', this._valueChanged.bind(this));
+        this.connect('value-changed', this._valueChanged.bind(this));
    }

-    get value() {
-        return this._value;
+    setValue(value) {
+        if (isNaN(value))
+            throw TypeError('The bar level value must be a number');
+
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
+        this.actor.queue_repaint();
    }

-    set value(value) {
-        value = Math.max(Math.min(value, this._maxValue), 0);
+    setMaximumValue(value) {
+        if (isNaN(value))
+            throw TypeError('The bar level max value must be a number');

-        if (this._value == value)
-            return;
-
-        this._value = value;
-        this.notify('value');
-        this.queue_repaint();
-    }
-
-    // eslint-disable-next-line camelcase
-    get maximum_value() {
-        return this._maxValue;
-    }
-
-    // eslint-disable-next-line camelcase
-    set maximum_value(value) {
-        value = Math.max(value, 1);
-
-        if (this._maxValue == value)
-            return;
-
-        this._maxValue = value;
+        this._maxValue = Math.max(value, 1);
        this._overdriveStart = Math.min(this._overdriveStart, this._maxValue);
-        this.notify('maximum-value');
-        this.queue_repaint();
+        this.actor.queue_repaint();
    }

-    // eslint-disable-next-line camelcase
-    get overdrive_start() {
-        return this._overdriveStart;
-    }
-
-    // eslint-disable-next-line camelcase
-    set overdrive_start(value) {
-        if (this._overdriveStart == value)
-            return;
-
+    setOverdriveStart(value) {
+        if (isNaN(value))
+            throw TypeError('The overdrive limit value must be a number');
        if (value > this._maxValue)
            throw new Error(`Tried to set overdrive value to ${value}, ` +
                `which is a number greater than the maximum allowed value ${this._maxValue}`);

        this._overdriveStart = value;
-        this.notify('overdrive-start');
-        this.queue_repaint();
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
+        this.actor.queue_repaint();
    }

-    vfunc_repaint() {
-        let cr = this.get_context();
-        let themeNode = this.get_theme_node();
-        let [width, height] = this.get_surface_size();
+    _barLevelRepaint(area) {
+        let cr = area.get_context();
+        let themeNode = area.get_theme_node();
+        let [width, height] = area.get_surface_size();

        let barLevelHeight = themeNode.get_length('-barlevel-height');
        let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2;
@@ -207,27 +172,32 @@ var BarLevel = GObject.registerClass({
        cr.$dispose();
    }

-    _getCurrentValue() {
+    _getCurrentValue(actor) {
        return this._value;
    }

-    _getOverdriveStart() {
+    _getOverdriveStart(actor) {
        return this._overdriveStart;
    }

-    _getMinimumValue() {
+    _getMinimumValue(actor) {
        return 0;
    }

-    _getMaximumValue() {
+    _getMaximumValue(actor) {
        return this._maxValue;
    }

-    _setCurrentValue(_actor, value) {
+    _setCurrentValue(actor, value) {
        this._value = value;
    }

-    _valueChanged() {
+    _valueChanged(barLevel, value, property) {
        this._customAccessible.notify("accessible-value");
    }
-});
+
+    get value() {
+        return this._value;
+    }
+};
+Signals.addSignalMethods(BarLevel.prototype);
--- a/js/ui/boxpointer.js
+++ b/js/ui/boxpointer.js
@@ -1,9 +1,9 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BoxPointer */

 const { Clutter, GObject, Shell, St } = imports.gi;

 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

 var PopupAnimation = {
    NONE:  0,
@@ -12,7 +12,7 @@ var PopupAnimation = {
    FULL:  ~0,
 };

-var POPUP_ANIMATION_TIME = 150;
+var POPUP_ANIMATION_TIME = 0.15;

 /**
 * BoxPointer:
@@ -105,18 +105,16 @@ var BoxPointer = GObject.registerClass({
            }
        }

-        this.ease({
-            opacity: 255,
-            translation_x: 0,
-            translation_y: 0,
-            duration: animationTime,
-            mode: Clutter.AnimationMode.LINEAR,
-            onComplete: () => {
-                this._unmuteInput();
-                if (onComplete)
-                    onComplete();
-            }
-        });
+        Tweener.addTween(this, { opacity: 255,
+                                 translation_x: 0,
+                                 translation_y: 0,
+                                 transition: 'linear',
+                                 onComplete: () => {
+                                     this._unmuteInput();
+                                     if (onComplete)
+                                         onComplete();
+                                 },
+                                 time: animationTime });
    }

    close(animate, onComplete) {
@@ -149,22 +147,21 @@ var BoxPointer = GObject.registerClass({

        this._muteInput();

-        this.remove_all_transitions();
-        this.ease({
-            opacity: fade ? 0 : 255,
-            translation_x: translationX,
-            translation_y: translationY,
-            duration: animationTime,
-            mode: Clutter.AnimationMode.LINEAR,
-            onComplete: () => {
-                this.hide();
-                this.opacity = 0;
-                this.translation_x = 0;
-                this.translation_y = 0;
-                if (onComplete)
-                    onComplete();
-            }
-        });
+        Tweener.removeTweens(this);
+        Tweener.addTween(this, { opacity: fade ? 0 : 255,
+                                 translation_x: translationX,
+                                 translation_y: translationY,
+                                 transition: 'linear',
+                                 time: animationTime,
+                                 onComplete: () => {
+                                     this.hide();
+                                     this.opacity = 0;
+                                     this.translation_x = 0;
+                                     this.translation_y = 0;
+                                     if (onComplete)
+                                         onComplete();
+                                 }
+                               });
    }

    _adjustAllocationForArrow(isWidth, minSize, natSize) {
@@ -472,7 +469,7 @@ var BoxPointer = GObject.registerClass({
        let sourceAllocation = this._sourceAllocation;
        let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment;
        let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment;
-        let [, , natWidth, natHeight] = this.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size();

        // We also want to keep it onscreen, and separated from the
        // edge by the same distance as the main part of the box is
@@ -597,7 +594,7 @@ var BoxPointer = GObject.registerClass({

    _calculateArrowSide(arrowSide) {
        let sourceAllocation = this._sourceAllocation;
-        let [, , boxWidth, boxHeight] = this.get_preferred_size();
+        let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size();
        let workarea = this._workArea;

        switch (arrowSide) {
--- a/js/ui/calendar.js
+++ b/js/ui/calendar.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Calendar, CalendarMessageList */

 const { Clutter, Gio, GLib, Shell, St } = imports.gi;
 const Signals = imports.signals;
@@ -110,15 +109,15 @@ var EmptyEventSource = class EmptyEventSource {
    destroy() {
    }

-    requestRange(_begin, _end) {
+    requestRange(begin, end) {
    }

-    getEvents(_begin, _end) {
+    getEvents(begin, end) {
        let result = [];
        return result;
    }

-    hasEvents(_day) {
+    hasEvents(day) {
        return false;
    }
 };
@@ -221,13 +220,13 @@ var DBusEventSource = class DBusEventSource {
        this._lastRequestEnd = null;
    }

-    _onNameAppeared() {
+    _onNameAppeared(owner) {
        this._initialized = true;
        this._resetCache();
        this._loadEvents(true);
    }

-    _onNameVanished() {
+    _onNameVanished(oldOwner) {
        this._resetCache();
        this.emit('changed');
    }
@@ -236,7 +235,7 @@ var DBusEventSource = class DBusEventSource {
        this._loadEvents(false);
    }

-    _onEventsReceived(results, _error) {
+    _onEventsReceived(results, error) {
        let newEvents = [];
        let appointments = results[0] || [];
        for (let n = 0; n < appointments.length; n++) {
@@ -735,7 +734,7 @@ class NotificationMessage extends MessageList.Message {
            return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
    }

-    _onUpdated(n, _clear) {
+    _onUpdated(n, clear) {
        this.setIcon(this._getIcon());
        this.setTitle(n.title);
        this.setBody(n.bannerBodyText);
--- a/js/ui/checkBox.js
+++ b/js/ui/checkBox.js
@@ -1,4 +1,3 @@
-/* exported CheckBox */
 const { Clutter, Pango, St } = imports.gi;

 var CheckBox = class CheckBox {
--- a/js/ui/closeDialog.js
+++ b/js/ui/closeDialog.js
@@ -1,13 +1,13 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CloseDialog */

 const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;

 const Dialog = imports.ui.dialog;
 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

 var FROZEN_WINDOW_BRIGHTNESS = -0.3;
-var DIALOG_TRANSITION_TIME = 150;
+var DIALOG_TRANSITION_TIME = 0.15;
 var ALIVE_TIMEOUT = 5000;

 var CloseDialog = GObject.registerClass({
@@ -148,12 +148,12 @@ var CloseDialog = GObject.registerClass({
        this._dialog.scale_y = 0;
        this._dialog.set_pivot_point(0.5, 0.5);

-        this._dialog.ease({
-            scale_y: 1,
-            mode: Clutter.AnimationMode.LINEAR,
-            duration: DIALOG_TRANSITION_TIME,
-            onComplete: this._onFocusChanged.bind(this)
-        });
+        Tweener.addTween(this._dialog,
+                         { scale_y: 1,
+                           transition: 'linear',
+                           time: DIALOG_TRANSITION_TIME,
+                           onComplete: this._onFocusChanged.bind(this)
+                         });
    }

    vfunc_hide() {
@@ -175,12 +175,14 @@ var CloseDialog = GObject.registerClass({
        this._dialog = null;
        this._removeWindowEffect();

-        dialog.ease({
-            scale_y: 0,
-            mode: Clutter.AnimationMode.LINEAR,
-            duration: DIALOG_TRANSITION_TIME,
-            onComplete: () => dialog.destroy()
-        });
+        Tweener.addTween(dialog,
+                         { scale_y: 0,
+                           transition: 'linear',
+                           time: DIALOG_TRANSITION_TIME,
+                           onComplete: () => {
+                               dialog.destroy();
+                           }
+                         });
    }

    vfunc_focus() {
--- a/js/ui/components/init.js
+++ b/js/ui/components/init.js
@@ -1,4 +1,3 @@
-/* exported ComponentManager */
 const Main = imports.ui.main;

 var ComponentManager = class {
--- a/js/ui/components/automountManager.js
+++ b/js/ui/components/automountManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Gio, GLib } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -56,7 +55,7 @@ var AutomountManager = class {
        }
    }

-    _InhibitorsChanged(_object, _senderName, [_inhibitor]) {
+    _InhibitorsChanged(object, senderName, [inhibtor]) {
        this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
            (result, error) => {
                if (!error) {
--- a/js/ui/components/autorunManager.js
+++ b/js/ui/components/autorunManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Gio, St } = imports.gi;

--- a/js/ui/components/keyring.js
+++ b/js/ui/components/keyring.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi;

@@ -177,21 +176,21 @@ class KeyringDialog extends ModalDialog.ModalDialog {
        return false;
    }

-    _onShowPassword() {
+    _onShowPassword(prompt) {
        this._buildControlTable();
        this._ensureOpen();
        this._updateSensitivity(true);
        this._passwordEntry.grab_key_focus();
    }

-    _onShowConfirm() {
+    _onShowConfirm(prompt) {
        this._buildControlTable();
        this._ensureOpen();
        this._updateSensitivity(true);
        this._continueButton.grab_key_focus();
    }

-    _onHidePrompt() {
+    _onHidePrompt(prompt) {
        this.close();
    }

--- a/js/ui/components/networkAgent.js
+++ b/js/ui/components/networkAgent.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi;
 const Signals = imports.signals;
@@ -200,7 +199,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
        return true;
    }

-    _getWirelessSecrets(secrets, _wirelessSetting) {
+    _getWirelessSecrets(secrets, wirelessSetting) {
        let wirelessSecuritySetting = this._connection.get_setting_wireless_security();

        if (this._settingName == '802-1x') {
@@ -386,7 +385,7 @@ var VPNRequestHandler = class {
        this._newStylePlugin = authHelper.externalUIMode;

        try {
-            let [success_, pid, stdin, stdout, stderr] =
+            let [success, pid, stdin, stdout, stderr] =
                GLib.spawn_async_with_pipes(null, /* pwd */
                                            argv,
                                            null, /* envp */
@@ -445,7 +444,7 @@ var VPNRequestHandler = class {
        this._destroyed = true;
    }

-    _vpnChildFinished(pid, status, _requestObj) {
+    _vpnChildFinished(pid, status, requestObj) {
        this._childWatch = 0;
        if (this._newStylePlugin) {
            // For new style plugin, all work is done in the async reading functions
@@ -487,7 +486,7 @@ var VPNRequestHandler = class {

    _readStdoutOldStyle() {
        this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => {
-            let [line, len_] = this._dataStdout.read_line_finish_utf8(result);
+            let [line, len] = this._dataStdout.read_line_finish_utf8(result);

            if (line == null) {
                // end of file
@@ -542,7 +541,7 @@ var VPNRequestHandler = class {
                                message: keyfile.get_string(VPN_UI_GROUP, 'Description'),
                                secrets: [] };

-            let [groups, len_] = keyfile.get_groups();
+            let [groups, len] = keyfile.get_groups();
            for (let i = 0; i < groups.length; i++) {
                if (groups[i] == VPN_UI_GROUP)
                    continue;
--- a/js/ui/components/polkitAgent.js
+++ b/js/ui/components/polkitAgent.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { AccountsService, Clutter, Gio, GLib,
        GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi;
@@ -384,11 +383,11 @@ var AuthenticationAgent = class {
        this._currentDialog.performAuthentication();
    }

-    _onCancel(_nativeAgent) {
+    _onCancel(nativeAgent) {
        this._completeRequest(false);
    }

-    _onDialogDone(_dialog, dismissed) {
+    _onDialogDone(dialog, dismissed) {
        this._completeRequest(dismissed);
    }

--- a/js/ui/components/telepathyClient.js
+++ b/js/ui/components/telepathyClient.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gio, GLib, GObject, St } = imports.gi;
 const Lang = imports.lang;
@@ -42,7 +41,7 @@ var NotificationDirection = {
 };

 function makeMessageFromTpMessage(tpMessage, direction) {
-    let [text, flags_] = tpMessage.to_text();
+    let [text, flags] = tpMessage.to_text();

    let timestamp = tpMessage.get_sent_timestamp();
    if (timestamp == 0)
@@ -149,11 +148,11 @@ class TelepathyClient extends Tp.BaseClient {
    }

    vfunc_observe_channels(...args) {
-        let [account, conn, channels, dispatchOp_, requests_, context] = args;
+        let [account, conn, channels, dispatchOp, requests, context] = args;
        let len = channels.length;
        for (let i = 0; i < len; i++) {
            let channel = channels[i];
-            let [targetHandle_, targetHandleType] = channel.get_handle();
+            let [targetHandle, targetHandleType] = channel.get_handle();

            if (channel.get_invalidated())
                continue;
@@ -182,7 +181,7 @@ class TelepathyClient extends Tp.BaseClient {
    }

    vfunc_handle_channels(...args) {
-        let [account, conn, channels, requests_, userActionTime_, context] = args;
+        let [account, conn, channels, requests, userActionTime, context] = args;
        this._handlingChannels(account, conn, channels, true);
        context.accept();
    }
@@ -240,7 +239,7 @@ class TelepathyClient extends Tp.BaseClient {
    }

    _approveTextChannel(account, conn, channel, dispatchOp, context) {
-        let [targetHandle_, targetHandleType] = channel.get_handle();
+        let [targetHandle, targetHandleType] = channel.get_handle();

        if (targetHandleType != Tp.HandleType.CONTACT) {
            context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
@@ -261,7 +260,7 @@ class TelepathyClient extends Tp.BaseClient {
        context.accept();
    }

-    _delegatedChannelsCb(_client, _channels) {
+    _delegatedChannelsCb(client, channels) {
        // Nothing to do as we don't make a distinction between observed and
        // handled channels.
    }
@@ -428,7 +427,7 @@ var ChatSource = class extends MessageTray.Source {
    }

    _displayPendingMessages(logManager, result) {
-        let [success_, events] = logManager.get_filtered_events_finish(result);
+        let [success, events] = logManager.get_filtered_events_finish(result);

        let logMessages = events.map(makeMessageFromTplEvent);
        this._ensureNotification();
@@ -563,7 +562,7 @@ var ChatSource = class extends MessageTray.Source {

    // This is called for both messages we send from
    // our client and other clients as well.
-    _messageSent(channel, message, _flags, _token) {
+    _messageSent(channel, message, flags, token) {
        this._ensureNotification();
        message = makeMessageFromTpMessage(message, NotificationDirection.SENT);
        this._notification.appendMessage(message);
@@ -601,7 +600,7 @@ var ChatSource = class extends MessageTray.Source {
        }
    }

-    _presenceChanged(_contact, _presence, _status, _message) {
+    _presenceChanged(contact, presence, status, message) {
        if (this._notification)
            this._notification.update(this._notification.title,
                                      this._notification.bannerBodyText,
--- a/js/ui/ctrlAltTab.js
+++ b/js/ui/ctrlAltTab.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CtrlAltTabManager */

 const { Clutter, GObject, Meta, Shell, St } = imports.gi;

@@ -64,8 +63,9 @@ var CtrlAltTabManager = class CtrlAltTabManager {
        if (a.sortGroup != b.sortGroup)
            return a.sortGroup - b.sortGroup;

-        let [ax] = a.proxy.get_transformed_position();
-        let [bx] = b.proxy.get_transformed_position();
+        let ax, bx, y;
+        [ax, y] = a.proxy.get_transformed_position();
+        [bx, y] = b.proxy.get_transformed_position();

        return ax - bx;
    }
--- a/js/ui/dash.js
+++ b/js/ui/dash.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Dash */

 const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -10,10 +9,11 @@ const AppFavorites = imports.ui.appFavorites;
 const DND = imports.ui.dnd;
 const IconGrid = imports.ui.iconGrid;
 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

-var DASH_ANIMATION_TIME = 200;
-var DASH_ITEM_LABEL_SHOW_TIME = 150;
-var DASH_ITEM_LABEL_HIDE_TIME = 100;
+var DASH_ANIMATION_TIME = 0.2;
+var DASH_ITEM_LABEL_SHOW_TIME = 0.15;
+var DASH_ITEM_LABEL_HIDE_TIME = 0.1;
 var DASH_ITEM_HOVER_TIMEOUT = 300;

 function getAppFromSource(source) {
@@ -24,30 +24,6 @@ function getAppFromSource(source) {
    }
 }

-var DashIcon = class DashIcon extends AppDisplay.AppIcon {
-    constructor(app) {
-        super(app, {
-            setSizeManually: true,
-            showLabel: false
-        });
-    }
-
-    // Disable all DnD methods
-    _onDragBegin() {
-    }
-
-    _onDragEnd() {
-    }
-
-    handleDragOver() {
-        return DND.DragMotionResult.CONTINUE;
-    }
-
-    acceptDrop() {
-        return false;
-    }
-};
-
 // A container like StBin, but taking the child's scale into account
 // when requesting a size
 var DashItemContainer = GObject.registerClass(
@@ -55,9 +31,6 @@ class DashItemContainer extends St.Widget {
    _init() {
        super._init({ style_class: 'dash-item-container',
                      pivot_point: new Clutter.Point({ x: .5, y: .5 }),
-                      scale_x: 0,
-                      scale_y: 0,
-                      opacity: 0,
                      x_expand: true,
                      x_align: Clutter.ActorAlign.CENTER });

@@ -68,11 +41,10 @@ class DashItemContainer extends St.Widget {
        this.label_actor = this.label;

        this.child = null;
+        this._childScale = 0;
+        this._childOpacity = 0;
        this.animatingOut = false;

-        this.connect('notify::scale-x', () => this.queue_relayout());
-        this.connect('notify::scale-y', () => this.queue_relayout());
-
        this.connect('destroy', () => {
            if (this.child != null)
                this.child.destroy();
@@ -123,11 +95,11 @@ class DashItemContainer extends St.Widget {
            x = stageX + this.get_width() + xOffset;

        this.label.set_position(x, y);
-        this.label.ease({
-            opacity: 255,
-            duration: DASH_ITEM_LABEL_SHOW_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this.label,
+                         { opacity: 255,
+                           time: DASH_ITEM_LABEL_SHOW_TIME,
+                           transition: 'easeOutQuad',
+                         });
    }

    setLabelText(text) {
@@ -136,12 +108,14 @@ class DashItemContainer extends St.Widget {
    }

    hideLabel() {
-        this.label.ease({
-            opacity: 0,
-            duration: DASH_ITEM_LABEL_HIDE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.label.hide()
-        });
+        Tweener.addTween(this.label,
+                         { opacity: 0,
+                           time: DASH_ITEM_LABEL_HIDE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this.label.hide();
+                           }
+                         });
    }

    setChild(actor) {
@@ -152,6 +126,9 @@ class DashItemContainer extends St.Widget {

        this.child = actor;
        this.add_actor(this.child);
+
+        this.set_scale(this._childScale, this._childScale);
+        this.set_opacity(this._childOpacity);
    }

    show(animate) {
@@ -159,13 +136,12 @@ class DashItemContainer extends St.Widget {
            return;

        let time = animate ? DASH_ANIMATION_TIME : 0;
-        this.ease({
-            scale_x: 1,
-            scale_y: 1,
-            opacity: 255,
-            duration: time,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this,
+                         { childScale: 1.0,
+                           childOpacity: 255,
+                           time: time,
+                           transition: 'easeOutQuad'
+                         });
    }

    animateOutAndDestroy() {
@@ -177,14 +153,37 @@ class DashItemContainer extends St.Widget {
        }

        this.animatingOut = true;
-        this.ease({
-            scale_x: 0,
-            scale_y: 0,
-            opacity: 0,
-            duration: DASH_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.destroy()
-        });
+        Tweener.addTween(this,
+                         { childScale: 0.0,
+                           childOpacity: 0,
+                           time: DASH_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this.destroy();
+                           }
+                         });
+    }
+
+    set childScale(scale) {
+        this._childScale = scale;
+
+        this.set_scale(scale, scale);
+        this.queue_relayout();
+    }
+
+    get childScale() {
+        return this._childScale;
+    }
+
+    set childOpacity(opacity) {
+        this._childOpacity = opacity;
+
+        this.set_opacity(opacity);
+        this.queue_redraw();
+    }
+
+    get childOpacity() {
+        return this._childOpacity;
    }
 });

@@ -242,14 +241,14 @@ class ShowAppsIcon extends DashItemContainer {
            this.setLabelText(_("Show Applications"));
    }

-    handleDragOver(source, _actor, _x, _y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        if (!this._canRemoveApp(getAppFromSource(source)))
            return DND.DragMotionResult.NO_DROP;

        return DND.DragMotionResult.MOVE_DROP;
    }

-    acceptDrop(source, _actor, _x, _y, _time) {
+    acceptDrop(source, actor, x, y, time) {
        let app = getAppFromSource(source);
        if (!this._canRemoveApp(app))
            return false;
@@ -297,7 +296,7 @@ class DashActor extends St.Widget {
        this.set_allocation(box, flags);

        let [appIcons, showAppsButton] = this.get_children();
-        let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
+        let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);

        let childBox = new Clutter.ActorBox();
        childBox.x1 = contentBox.x1;
@@ -352,7 +351,8 @@ var Dash = class Dash {
        this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);

        this._showAppsIcon = new ShowAppsIcon();
-        this._showAppsIcon.show(false);
+        this._showAppsIcon.childScale = 1;
+        this._showAppsIcon.childOpacity = 255;
        this._showAppsIcon.icon.setIconSize(this.iconSize);
        this._hookUpLabel(this._showAppsIcon);

@@ -474,7 +474,19 @@ var Dash = class Dash {
    }

    _createAppItem(app) {
-        let appIcon = new DashIcon(app);
+        let appIcon = new AppDisplay.AppIcon(app,
+                                             { setSizeManually: true,
+                                               showLabel: false });
+        if (appIcon._draggable) {
+            appIcon._draggable.connect('drag-begin',
+                                       () => {
+                                           appIcon.actor.opacity = 50;
+                                       });
+            appIcon._draggable.connect('drag-end',
+                                       () => {
+                                           appIcon.actor.opacity = 255;
+                                       });
+        }

        appIcon.connect('menu-state-changed',
                        (appIcon, opened) => {
@@ -621,12 +633,12 @@ var Dash = class Dash {
            icon.icon.set_size(icon.icon.width * scale,
                               icon.icon.height * scale);

-            icon.icon.ease({
-                width: targetWidth,
-                height: targetHeight,
-                time: DASH_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(icon.icon,
+                             { width: targetWidth,
+                               height: targetHeight,
+                               time: DASH_ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                             });
        }
    }

@@ -778,7 +790,7 @@ var Dash = class Dash {
        }
    }

-    handleDragOver(source, actor, x, y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        let app = getAppFromSource(source);

        // Don't allow favoriting of transient apps
@@ -856,7 +868,7 @@ var Dash = class Dash {
    }

    // Draggable target interface
-    acceptDrop(source, _actor, _x, _y, _time) {
+    acceptDrop(source, actor, x, y, time) {
        let app = getAppFromSource(source);

        // Don't allow favoriting of transient apps
--- a/js/ui/dateMenu.js
+++ b/js/ui/dateMenu.js
@@ -1,7 +1,6 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported DateMenuButton */

-const { Clutter, Gio, GLib, GnomeDesktop,
+const { Clutter, GLib, GnomeDesktop,
        GObject, GWeather, Shell, St } = imports.gi;

 const Util = imports.misc.util;
@@ -11,13 +10,8 @@ const Calendar = imports.ui.calendar;
 const Weather = imports.misc.weather;
 const System = imports.system;

-const { loadInterfaceXML } = imports.misc.fileUtils;
-
 const MAX_FORECASTS = 5;

-const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration');
-const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface);
-
 function _isToday(date) {
    let now = new Date();
    return now.getYear() == date.getYear() &&
@@ -88,8 +82,7 @@ var WorldClocksSection = class WorldClocksSection {
                                     x_fill: true,
                                     can_focus: true });
        this.actor.connect('clicked', () => {
-            if (this._clocksApp)
-                this._clocksApp.activate();
+            this._clockAppMon.activateApp();

            Main.overview.hide();
            Main.panel.closeCalendar();
@@ -102,40 +95,29 @@ var WorldClocksSection = class WorldClocksSection {

        this.actor.child = this._grid;

-        this._clocksApp = null;
-        this._clocksProxy = new ClocksProxy(
-            Gio.DBus.session,
-            'org.gnome.clocks',
-            '/org/gnome/clocks',
-            this._onProxyReady.bind(this),
-            null /* cancellable */,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
-
-        this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.world-clocks'
-        });
-        this._settings.connect('changed', this._clocksChanged.bind(this));
-        this._clocksChanged();
-
-        this._appSystem = Shell.AppSystem.get_default();
-        this._appSystem.connect('installed-changed',
-            this._sync.bind(this));
+        this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop',
+                                                        'org.gnome.clocks');
+        this._clockAppMon.connect('available-changed',
+                                  this._sync.bind(this));
+        this._clockAppMon.watchSetting('world-clocks',
+                                       this._clocksChanged.bind(this));
        this._sync();
    }

    _sync() {
-        this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop');
-        this.actor.visible = this._clocksApp != null;
+        this.actor.visible = this._clockAppMon.available;
    }

-    _clocksChanged() {
+    _clocksChanged(settings) {
        this._grid.destroy_all_children();
        this._locations = [];

        let world = GWeather.Location.get_world();
-        let clocks = this._settings.get_value('locations').deep_unpack();
+        let clocks = settings.get_value('world-clocks').deep_unpack();
        for (let i = 0; i < clocks.length; i++) {
-            let l = world.deserialize(clocks[i]);
+            if (!clocks[i].location)
+                continue;
+            let l = world.deserialize(clocks[i].location);
            if (l && l.get_timezone() != null)
                this._locations.push({ location: l });
        }
@@ -214,25 +196,6 @@ var WorldClocksSection = class WorldClocksSection {
            l.actor.text = Util.formatTime(now, { timeOnly: true });
        }
    }
-
-    _onProxyReady(proxy, error) {
-        if (error) {
-            log(`Failed to create GNOME Clocks proxy: ${error}`);
-            return;
-        }
-
-        this._clocksProxy.connect('g-properties-changed',
-            this._onClocksPropertiesChanged.bind(this));
-        this._onClocksPropertiesChanged();
-    }
-
-    _onClocksPropertiesChanged() {
-        if (this._clocksProxy.g_name_owner == null)
-            return;
-
-        this._settings.set_value('locations',
-            new GLib.Variant('av', this._clocksProxy.Locations));
-    }
 };

 var WeatherSection = class WeatherSection {
@@ -286,12 +249,12 @@ var WeatherSection = class WeatherSection {
        let current = info;
        let infos = [info];
        for (let i = 0; i < forecasts.length; i++) {
-            let [ok_, timestamp] = forecasts[i].get_value_update();
+            let [ok, timestamp] = forecasts[i].get_value_update();
            let datetime = new Date(timestamp * 1000);
            if (!_isToday(datetime))
                continue; // Ignore forecasts from other days

-            [ok_, timestamp] = current.get_value_update();
+            [ok, timestamp] = current.get_value_update();
            let currenttime = new Date(timestamp * 1000);
            if (currenttime.getHours() == datetime.getHours())
                continue; // Enforce a minimum interval of 1h
@@ -312,7 +275,7 @@ var WeatherSection = class WeatherSection {

        let col = 0;
        infos.forEach(fc => {
-            let [ok_, timestamp] = fc.get_value_update();
+            let [ok, timestamp] = fc.get_value_update();
            let timeStr = Util.formatTime(new Date(timestamp * 1000), {
                timeOnly: true
            });
--- a/js/ui/dialog.js
+++ b/js/ui/dialog.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Dialog, MessageDialogContent */

 const { Clutter, Gio, GObject, Pango, St } = imports.gi;

--- a/js/ui/dnd.js
+++ b/js/ui/dnd.js
@@ -1,18 +1,18 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported addDragMonitor, removeDragMonitor, makeDraggable */

 const { Clutter, GLib, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;

 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 // Time to scale down to maxDragActorSize
-var SCALE_ANIMATION_TIME = 250;
+var SCALE_ANIMATION_TIME = 0.25;
 // Time to animate to original position on cancel
-var SNAP_BACK_ANIMATION_TIME = 250;
+var SNAP_BACK_ANIMATION_TIME = 0.25;
 // Time to animate to original position on success
-var REVERT_ANIMATION_TIME = 750;
+var REVERT_ANIMATION_TIME = 0.75;

 var DragMotionResult = {
    NO_DROP:   0,
@@ -111,6 +111,9 @@ var _Draggable = class _Draggable {
        if (event.get_button() != 1)
            return Clutter.EVENT_PROPAGATE;

+        if (Tweener.getTweenCount(actor))
+            return Clutter.EVENT_PROPAGATE;
+
        this._buttonDown = true;
        this._grabActor(event.get_device());

@@ -136,6 +139,9 @@ var _Draggable = class _Draggable {
            !global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
            return Clutter.EVENT_PROPAGATE;

+        if (Tweener.getTweenCount(actor))
+            return Clutter.EVENT_PROPAGATE;
+
        this._buttonDown = true;
        this._grabActor(event.get_device(), event.get_event_sequence());

@@ -422,22 +428,19 @@ var _Draggable = class _Draggable {
                // to the final position because that tween would
                // fight with updates as the user continues dragging
                // the mouse; instead we do the position computations in
-                // a ::new-frame handler.
-                this._dragActor.ease({
-                    scale_x: scale * origScale,
-                    scale_y: scale * origScale,
-                    duration: SCALE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-
-                this._dragActor.get_transition('scale-x').connect('new-frame', () => {
-                    let currentScale = this._dragActor.scale_x / origScale;
-                    this._dragOffsetX = currentScale * origDragOffsetX;
-                    this._dragOffsetY = currentScale * origDragOffsetY;
-                    this._dragActor.set_position(
-                        this._dragX + this._dragOffsetX,
-                        this._dragY + this._dragOffsetY);
-                });
+                // an onUpdate() function.
+                Tweener.addTween(this._dragActor,
+                                 { scale_x: scale * origScale,
+                                   scale_y: scale * origScale,
+                                   time: SCALE_ANIMATION_TIME,
+                                   transition: 'easeOutQuad',
+                                   onUpdate: () => {
+                                       let currentScale = this._dragActor.scale_x / origScale;
+                                       this._dragOffsetX = currentScale * origDragOffsetX;
+                                       this._dragOffsetY = currentScale * origDragOffsetY;
+                                       this._dragActor.set_position(this._dragX + this._dragOffsetX,
+                                                                    this._dragY + this._dragOffsetY);
+                                   } });
            }
        }
    }
@@ -500,7 +503,7 @@ var _Draggable = class _Draggable {

        while (target) {
            if (target._delegate && target._delegate.handleDragOver) {
-                let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
+                let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
                // We currently loop through all parents on drag-over even if one of the children has handled it.
                // We can check the return value of the function and break the loop if it's true if we don't want
                // to continue checking the parents.
@@ -572,7 +575,7 @@ var _Draggable = class _Draggable {

        while (target) {
            if (target._delegate && target._delegate.acceptDrop) {
-                let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
+                let [r, targX, targY] = target.transform_stage_point(dropX, dropY);
                if (target._delegate.acceptDrop(this.actor._delegate,
                                                this._dragActor,
                                                targX,
@@ -610,15 +613,15 @@ var _Draggable = class _Draggable {
        if (this._dragActorSource && this._dragActorSource.visible) {
            // Snap the clone back to its source
            [x, y] = this._dragActorSource.get_transformed_position();
-            let [sourceScaledWidth] = this._dragActorSource.get_transformed_size();
-            scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0;
+            let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size();
+            scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0;
        } else if (this._dragOrigParent) {
            // Snap the actor back to its original position within
            // its parent, adjusting for the fact that the parent
            // may have been moved or scaled
            let [parentX, parentY] = this._dragOrigParent.get_transformed_position();
-            let [parentWidth] = this._dragOrigParent.get_size();
-            let [parentScaledWidth] = this._dragOrigParent.get_transformed_size();
+            let [parentWidth, parentHeight] = this._dragOrigParent.get_size();
+            let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size();
            let parentScale = 1.0;
            if (parentWidth != 0)
                parentScale = parentScaledWidth / parentWidth;
@@ -654,13 +657,13 @@ var _Draggable = class _Draggable {

        let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation();

-        this._animateDragEnd(eventTime, {
-            x: snapBackX,
-            y: snapBackY,
-            scale_x: snapBackScale,
-            scale_y: snapBackScale,
-            duration: SNAP_BACK_ANIMATION_TIME
-        });
+        this._animateDragEnd(eventTime,
+                             { x: snapBackX,
+                               y: snapBackY,
+                               scale_x: snapBackScale,
+                               scale_y: snapBackScale,
+                               time: SNAP_BACK_ANIMATION_TIME,
+                             });
    }

    _restoreDragActor(eventTime) {
@@ -672,22 +675,21 @@ var _Draggable = class _Draggable {
        this._dragActor.set_scale(restoreScale, restoreScale);
        this._dragActor.opacity = 0;

-        this._animateDragEnd(eventTime, {
-            duration: REVERT_ANIMATION_TIME
-        });
+        this._animateDragEnd(eventTime,
+                             { time: REVERT_ANIMATION_TIME });
    }

    _animateDragEnd(eventTime, params) {
        this._animationInProgress = true;

+        params['opacity']          = this._dragOrigOpacity;
+        params['transition']       = 'easeOutQuad';
+        params['onComplete']       = this._onAnimationComplete;
+        params['onCompleteScope']  = this;
+        params['onCompleteParams'] = [this._dragActor, eventTime];
+
        // start the animation
-        this._dragActor.ease(Object.assign(params, {
-            opacity: this._dragOrigOpacity,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._onAnimationComplete(this._dragActor, eventTime);
-            }
-        }));
+        Tweener.addTween(this._dragActor, params);
    }

    _finishAnimation() {
--- a/js/ui/edgeDragAction.js
+++ b/js/ui/edgeDragAction.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported EdgeDragAction */

 const { Clutter, GObject, Meta, St } = imports.gi;

@@ -27,7 +26,7 @@ var EdgeDragAction = GObject.registerClass({
        return global.display.get_monitor_geometry(monitorIndex);
    }

-    vfunc_gesture_prepare(_actor) {
+    vfunc_gesture_prepare(actor) {
        if (this.get_n_current_points() == 0)
            return false;

@@ -43,7 +42,7 @@ var EdgeDragAction = GObject.registerClass({
                (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
    }

-    vfunc_gesture_progress(_actor) {
+    vfunc_gesture_progress(actor) {
        let [startX, startY] = this.get_press_coords(0);
        let [x, y] = this.get_motion_coords(0);
        let offsetX = Math.abs (x - startX);
@@ -63,7 +62,7 @@ var EdgeDragAction = GObject.registerClass({
        return true;
    }

-    vfunc_gesture_end(_actor) {
+    vfunc_gesture_end(actor) {
        let [startX, startY] = this.get_press_coords(0);
        let [x, y] = this.get_motion_coords(0);
        let monitorRect = this._getMonitorRect(startX, startY);
--- a/js/ui/endSessionDialog.js
+++ b/js/ui/endSessionDialog.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init, EndSessionDialog */
 /*
 * Copyright 2010-2016 Red Hat, Inc
 *
@@ -352,15 +351,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        }

        // It only makes sense to check for this permission if PackageKit is available.
-        Polkit.Permission.new(
-            'org.freedesktop.packagekit.trigger-offline-update', null, null,
-            (source, res) => {
-                try {
-                    this._updatesPermission = Polkit.Permission.new_finish(res);
-                } catch (e) {
-                    log(`No permission to trigger offline updates: ${e}`);
-                }
-            });
+        try {
+            this._updatesPermission = Polkit.Permission.new_sync(
+                'org.freedesktop.packagekit.trigger-offline-update', null, null);
+        } catch (e) {
+            log('No permission to trigger offline updates: %s'.format(e.toString()));
+        }
    }

    _onDestroy() {
@@ -672,7 +668,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._loginManager.listSessions(result => {
            let n = 0;
            for (let i = 0; i < result.length; i++) {
-                let [id_, uid_, userName, seat_, sessionPath] = result[i];
+                let [id, uid, userName, seat, sessionPath] = result[i];
                let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath);

                if (proxy.Class != 'user')
@@ -738,7 +734,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        let dialogContent = DialogContent[this._type];

        for (let i = 0; i < inhibitorObjectPaths.length; i++) {
-            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => {
+            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => {
                this._onInhibitorLoaded(proxy);
            });

@@ -782,7 +778,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        });
    }

-    Close(_parameters, _invocation) {
+    Close(parameters, invocation) {
        this.close();
    }
 });
--- a/js/ui/environment.js
+++ b/js/ui/environment.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init */

 const Config = imports.misc.config;

@@ -58,116 +57,6 @@ function _patchLayoutClass(layoutClass, styleProps) {
    };
 }

-function _makeEaseCallback(params) {
-    let onComplete = params.onComplete;
-    delete params.onComplete;
-
-    let onStopped = params.onStopped;
-    delete params.onStopped;
-
-    if (!onComplete && !onStopped)
-        return null;
-
-    return isFinished => {
-        if (onStopped)
-            onStopped(isFinished);
-        if (onComplete && isFinished)
-            onComplete();
-    };
-}
-
-function _getPropertyTarget(actor, propName) {
-    if (!propName.startsWith('@'))
-        return [actor, propName];
-
-    let [type, name, prop] = propName.split('.');
-    switch (type) {
-    case '@layout':
-        return [actor.layout_manager, name];
-    case '@actions':
-        return [actor.get_action(name), prop];
-    case '@constraints':
-        return [actor.get_constraint(name), prop];
-    case '@effects':
-        return [actor.get_effect(name), prop];
-    }
-
-    throw new Error(`Invalid property name ${propName}`);
-}
-
-function _easeActor(actor, params) {
-    actor.save_easing_state();
-
-    if (params.duration != undefined)
-        actor.set_easing_duration(params.duration);
-    delete params.duration;
-
-    if (params.delay != undefined)
-        actor.set_easing_delay(params.delay);
-    delete params.delay;
-
-    if (params.mode != undefined)
-        actor.set_easing_mode(params.mode);
-    delete params.mode;
-
-    let callback = _makeEaseCallback(params);
-
-    // cancel overwritten transitions
-    let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
-    animatedProps.forEach(p => actor.remove_transition(p));
-
-    actor.set(params);
-    actor.restore_easing_state();
-
-    if (callback) {
-        let transition = actor.get_transition(animatedProps[0]);
-
-        if (transition)
-            transition.connect('stopped', (t, finished) => callback(finished));
-        else
-            callback(true);
-    }
-}
-
-function _easeActorProperty(actor, propName, target, params) {
-    // Avoid pointless difference with ease()
-    if (params.mode)
-        params.progress_mode = params.mode;
-    delete params.mode;
-
-    if (params.duration)
-        params.duration = adjustAnimationTime(params.duration);
-    let duration = Math.floor(params.duration || 0);
-
-    let callback = _makeEaseCallback(params);
-
-    // cancel overwritten transition
-    actor.remove_transition(propName);
-
-    if (duration == 0) {
-        let [obj, prop] = _getPropertyTarget(actor, propName);
-        obj[prop] = target;
-
-        if (callback)
-            callback(true);
-
-        return;
-    }
-
-    let pspec = actor.find_property(propName);
-    let transition = new Clutter.PropertyTransition(Object.assign({
-        property_name: propName,
-        interval: new Clutter.Interval({ value_type: pspec.value_type }),
-        remove_on_complete: true
-    }, params));
-    actor.add_transition(propName, transition);
-
-    transition.set_to(target);
-
-    if (callback)
-        transition.connect('stopped', (t, finished) => callback(finished));
-}
-
 function _loggingFunc(...args) {
    let fields = { 'MESSAGE': args.join(', ') };
    let domain = "GNOME Shell";
@@ -204,27 +93,6 @@ function init() {
                                            column_spacing: 'spacing-columns' });
    _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });

-    let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
-    Clutter.Actor.prototype.set_easing_duration = function(msecs) {
-        origSetEasingDuration.call(this, adjustAnimationTime(msecs));
-    };
-    let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
-    Clutter.Actor.prototype.set_easing_delay = function(msecs) {
-        origSetEasingDelay.call(this, adjustAnimationTime(msecs));
-    };
-
-    Clutter.Actor.prototype.ease = function(props, easingParams) {
-        _easeActor(this, props, easingParams);
-    };
-    Clutter.Actor.prototype.ease_property = function(propName, target, params) {
-        _easeActorProperty(this, propName, target, params);
-    };
-    St.Adjustment.prototype.ease = function(target, params) {
-        // we're not an actor of course, but we implement the same
-        // transition API as Clutter.Actor, so this works anyway
-        _easeActorProperty(this, 'value', target, params);
-    };
-
    Clutter.Actor.prototype.toString = function() {
        return St.describe_actor(this);
    };
@@ -238,12 +106,6 @@ function init() {
        }
    });

-    St.set_slow_down_factor = function(factor) {
-        let { stack } = new Error();
-        log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
-        St.Settings.get().slow_down_factor = factor;
-    };
-
    let origToString = Object.prototype.toString;
    Object.prototype.toString = function() {
        let base = origToString.call(this);
@@ -266,7 +128,7 @@ function init() {
    if (slowdownEnv) {
        let factor = parseFloat(slowdownEnv);
        if (!isNaN(factor) && factor > 0.0)
-            St.Settings.get().slow_down_factor = factor;
+            St.set_slow_down_factor(factor);
    }

    // OK, now things are initialized enough that we can import shell JS
@@ -276,17 +138,3 @@ function init() {
    Tweener.init();
    String.prototype.format = Format.format;
 }
-
-// adjustAnimationTime:
-// @msecs: time in milliseconds
-//
-// Adjust @msecs to account for St's enable-animations
-// and slow-down-factor settings
-function adjustAnimationTime(msecs) {
-    let settings = St.Settings.get();
-
-    if (!settings.enable_animations)
-        return 1;
-    return settings.slow_down_factor * msecs;
-}
-
--- a/js/ui/extensionDownloader.js
+++ b/js/ui/extensionDownloader.js
@@ -1,14 +1,12 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init, installExtension, uninstallExtension,
-            checkForUpdates, updateExtension */

 const { Clutter, Gio, GLib, GObject, Soup } = imports.gi;

 const Config = imports.misc.config;
 const Dialog = imports.ui.dialog;
 const ExtensionUtils = imports.misc.extensionUtils;
+const ExtensionSystem = imports.ui.extensionSystem;
 const FileUtils = imports.misc.fileUtils;
-const Main = imports.ui.main;
 const ModalDialog = imports.ui.modalDialog;

 var REPOSITORY_URL_BASE = 'https://extensions.gnome.org';
@@ -26,7 +24,7 @@ function installExtension(uuid, invocation) {

    _httpSession.queue_message(message, (session, message) => {
        if (message.status_code != Soup.KnownStatusCode.OK) {
-            Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
+            ExtensionSystem.logExtensionError(uuid, `downloading info: ${message.status_code}`);
            invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
            return;
        }
@@ -35,7 +33,7 @@ function installExtension(uuid, invocation) {
        try {
            info = JSON.parse(message.response_body.data);
        } catch (e) {
-            Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`);
+            ExtensionSystem.logExtensionError(uuid, `parsing info: ${e}`);
            invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString());
            return;
        }
@@ -46,7 +44,7 @@ function installExtension(uuid, invocation) {
 }

 function uninstallExtension(uuid) {
-    let extension = Main.extensionManager.lookup(uuid);
+    let extension = ExtensionUtils.extensions[uuid];
    if (!extension)
        return false;

@@ -54,7 +52,7 @@ function uninstallExtension(uuid) {
    if (extension.type != ExtensionUtils.ExtensionType.PER_USER)
        return false;

-    if (!Main.extensionManager.unloadExtension(extension))
+    if (!ExtensionSystem.unloadExtension(extension))
        return false;

    FileUtils.recursivelyDeleteDir(extension.dir, true);
@@ -115,10 +113,10 @@ function updateExtension(uuid) {

    _httpSession.queue_message(message, (session, message) => {
        gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
-            let oldExtension = Main.extensionManager.lookup(uuid);
+            let oldExtension = ExtensionUtils.extensions[uuid];
            let extensionDir = oldExtension.dir;

-            if (!Main.extensionManager.unloadExtension(oldExtension))
+            if (!ExtensionSystem.unloadExtension(oldExtension))
                return;

            FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir);
@@ -127,11 +125,11 @@ function updateExtension(uuid) {
            let extension = null;

            try {
-                extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
-                Main.extensionManager.loadExtension(extension);
+                extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
+                ExtensionSystem.loadExtension(extension);
            } catch (e) {
                if (extension)
-                    Main.extensionManager.unloadExtension(extension);
+                    ExtensionSystem.unloadExtension(extension);

                logError(e, 'Error loading extension %s'.format(uuid));

@@ -140,7 +138,7 @@ function updateExtension(uuid) {

                // Restore what was there before. We can't do much if we
                // fail here.
-                Main.extensionManager.loadExtension(oldExtension);
+                ExtensionSystem.loadExtension(oldExtension);
                return;
            }

@@ -153,9 +151,9 @@ function updateExtension(uuid) {

 function checkForUpdates() {
    let metadatas = {};
-    Main.extensionManager.getUuids().forEach(uuid => {
-        metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata;
-    });
+    for (let uuid in ExtensionUtils.extensions) {
+        metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata;
+    }

    let params = { shell_version: Config.PACKAGE_VERSION,
                   installed: JSON.stringify(metadatas) };
@@ -205,12 +203,12 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
        this.contentLayout.add(content);
    }

-    _onCancelButtonPressed() {
+    _onCancelButtonPressed(button, event) {
        this.close();
        this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled']));
    }

-    _onInstallButtonPressed() {
+    _onInstallButtonPressed(button, event) {
        let params = { shell_version: Config.PACKAGE_VERSION };

        let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid);
@@ -226,11 +224,16 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
        }

        function callback() {
+            // Add extension to 'enabled-extensions' for the user, always...
+            let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY);
+            if (!enabledExtensions.includes(uuid)) {
+                enabledExtensions.push(uuid);
+                global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions);
+            }
+
            try {
-                let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
-                Main.extensionManager.loadExtension(extension);
-                if (!Main.extensionManager.enableExtension(uuid))
-                    throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`);
+                let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
+                ExtensionSystem.loadExtension(extension);
            } catch (e) {
                uninstallExtension(uuid);
                errback('LoadExtensionError', e);
--- a/js/ui/extensionSystem.js
+++ b/js/ui/extensionSystem.js
@@ -1,523 +1,374 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init connect disconnect */

 const { Gio, St } = imports.gi;
 const Signals = imports.signals;

 const ExtensionUtils = imports.misc.extensionUtils;
-const FileUtils = imports.misc.fileUtils;
 const Main = imports.ui.main;

-const { ExtensionState, ExtensionType } = ExtensionUtils;
+var ExtensionState = {
+    ENABLED: 1,
+    DISABLED: 2,
+    ERROR: 3,
+    OUT_OF_DATE: 4,
+    DOWNLOADING: 5,
+    INITIALIZED: 6,
+
+    // Used as an error state for operations on unknown extensions,
+    // should never be in a real extensionMeta object.
+    UNINSTALLED: 99
+};
+
+// Arrays of uuids
+var enabledExtensions;
+// Contains the order that extensions were enabled in.
+var extensionOrder = [];
+
+// We don't really have a class to add signals on. So, create
+// a simple dummy object, add the signal methods, and export those
+// publically.
+var _signals = {};
+Signals.addSignalMethods(_signals);
+
+var connect = _signals.connect.bind(_signals);
+var disconnect = _signals.disconnect.bind(_signals);

 const ENABLED_EXTENSIONS_KEY = 'enabled-extensions';
-const DISABLED_EXTENSIONS_KEY = 'disabled-extensions';
 const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions';
 const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation';

-var ExtensionManager = class {
-    constructor() {
-        this._initted = false;
-        this._enabled = false;
+var initted = false;
+var enabled;

-        this._extensions = new Map();
-        this._enabledExtensions = [];
-        this._extensionOrder = [];
+function disableExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;

-        Main.sessionMode.connect('updated', this._sessionUpdated.bind(this));
-    }
+    if (extension.state != ExtensionState.ENABLED)
+        return;

-    init() {
-        this._sessionUpdated();
-    }
+    // "Rebase" the extension order by disabling and then enabling extensions
+    // in order to help prevent conflicts.

-    lookup(uuid) {
-        return this._extensions.get(uuid);
-    }
+    // Example:
+    //   order = [A, B, C, D, E]
+    //   user disables C
+    //   this should: disable E, disable D, disable C, enable D, enable E

-    getUuids() {
-        return [...this._extensions.keys()];
-    }
+    let orderIdx = extensionOrder.indexOf(uuid);
+    let order = extensionOrder.slice(orderIdx + 1);
+    let orderReversed = order.slice().reverse();

-    _callExtensionDisable(uuid) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
-
-        if (extension.state != ExtensionState.ENABLED)
-            return;
-
-        // "Rebase" the extension order by disabling and then enabling extensions
-        // in order to help prevent conflicts.
-
-        // Example:
-        //   order = [A, B, C, D, E]
-        //   user disables C
-        //   this should: disable E, disable D, disable C, enable D, enable E
-
-        let orderIdx = this._extensionOrder.indexOf(uuid);
-        let order = this._extensionOrder.slice(orderIdx + 1);
-        let orderReversed = order.slice().reverse();
-
-        for (let i = 0; i < orderReversed.length; i++) {
-            let uuid = orderReversed[i];
-            try {
-                this.lookup(uuid).stateObj.disable();
-            } catch (e) {
-                this.logExtensionError(uuid, e);
-            }
+    for (let i = 0; i < orderReversed.length; i++) {
+        let uuid = orderReversed[i];
+        try {
+            ExtensionUtils.extensions[uuid].stateObj.disable();
+        } catch (e) {
+            logExtensionError(uuid, e);
        }
+    }

+    if (extension.stylesheet) {
+        let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
+        theme.unload_stylesheet(extension.stylesheet);
+        delete extension.stylesheet;
+    }
+
+    try {
+        extension.stateObj.disable();
+    } catch (e) {
+        logExtensionError(uuid, e);
+    }
+
+    for (let i = 0; i < order.length; i++) {
+        let uuid = order[i];
+        try {
+            ExtensionUtils.extensions[uuid].stateObj.enable();
+        } catch (e) {
+            logExtensionError(uuid, e);
+        }
+    }
+
+    extensionOrder.splice(orderIdx, 1);
+
+    if ( extension.state != ExtensionState.ERROR ) {
+        extension.state = ExtensionState.DISABLED;
+        _signals.emit('extension-state-changed', extension);
+    }
+}
+
+function enableExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;
+
+    if (extension.state == ExtensionState.INITIALIZED)
+        initExtension(uuid);
+
+    if (extension.state != ExtensionState.DISABLED)
+        return;
+
+    extensionOrder.push(uuid);
+
+    let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
+    let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
+    for (let i = 0; i < stylesheetNames.length; i++) {
+        try {
+            let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
+            theme.load_stylesheet(stylesheetFile);
+            extension.stylesheet = stylesheetFile;
+            break;
+        } catch (e) {
+            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
+                continue; // not an error
+            log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+            return;
+        }
+    }
+
+    try {
+        extension.stateObj.enable();
+        extension.state = ExtensionState.ENABLED;
+        _signals.emit('extension-state-changed', extension);
+        return;
+    } catch (e) {
        if (extension.stylesheet) {
-            let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
            theme.unload_stylesheet(extension.stylesheet);
            delete extension.stylesheet;
        }
-
-        try {
-            extension.stateObj.disable();
-        } catch (e) {
-            this.logExtensionError(uuid, e);
-        }
-
-        for (let i = 0; i < order.length; i++) {
-            let uuid = order[i];
-            try {
-                this.lookup(uuid).stateObj.enable();
-            } catch (e) {
-                this.logExtensionError(uuid, e);
-            }
-        }
-
-        this._extensionOrder.splice(orderIdx, 1);
-
-        if (extension.state != ExtensionState.ERROR) {
-            extension.state = ExtensionState.DISABLED;
-            this.emit('extension-state-changed', extension);
-        }
+        logExtensionError(uuid, e);
+        return;
    }
+}

-    _callExtensionEnable(uuid) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
+function logExtensionError(uuid, error) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;

-        if (extension.state == ExtensionState.INITIALIZED)
-            this._callExtensionInit(uuid);
+    let message = `${error}`;

-        if (extension.state != ExtensionState.DISABLED)
-            return;
+    extension.state = ExtensionState.ERROR;
+    if (!extension.errors)
+        extension.errors = [];
+    extension.errors.push(message);

-        this._extensionOrder.push(uuid);
+    log('Extension "%s" had error: %s'.format(uuid, message));
+    _signals.emit('extension-state-changed', { uuid: uuid,
+                                               error: message,
+                                               state: extension.state });
+}

-        let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
-        let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
-        for (let i = 0; i < stylesheetNames.length; i++) {
-            try {
-                let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
-                theme.load_stylesheet(stylesheetFile);
-                extension.stylesheet = stylesheetFile;
-                break;
-            } catch (e) {
-                if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
-                    continue; // not an error
-                log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+function loadExtension(extension) {
+    // Default to error, we set success as the last step
+    extension.state = ExtensionState.ERROR;
+
+    let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
+
+    if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
+        extension.state = ExtensionState.OUT_OF_DATE;
+    } else {
+        let enabled = enabledExtensions.includes(extension.uuid);
+        if (enabled) {
+            if (!initExtension(extension.uuid))
                return;
-            }
-        }
-
-        try {
-            extension.stateObj.enable();
-            extension.state = ExtensionState.ENABLED;
-            this.emit('extension-state-changed', extension);
-            return;
-        } catch (e) {
-            if (extension.stylesheet) {
-                theme.unload_stylesheet(extension.stylesheet);
-                delete extension.stylesheet;
-            }
-            this.logExtensionError(uuid, e);
-            return;
-        }
-    }
-
-    enableExtension(uuid) {
-        if (!this._extensions.has(uuid))
-            return false;
-
-        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-
-        if (disabledExtensions.includes(uuid)) {
-            disabledExtensions = disabledExtensions.filter(item => item !== uuid);
-            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
-        }
-
-        if (!enabledExtensions.includes(uuid)) {
-            enabledExtensions.push(uuid);
-            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
-        }
-
-        return true;
-    }
-
-    disableExtension(uuid) {
-        if (!this._extensions.has(uuid))
-            return false;
-
-        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-
-        if (enabledExtensions.includes(uuid)) {
-            enabledExtensions = enabledExtensions.filter(item => item !== uuid);
-            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
-        }
-
-        if (!disabledExtensions.includes(uuid)) {
-            disabledExtensions.push(uuid);
-            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
-        }
-
-        return true;
-    }
-
-    logExtensionError(uuid, error) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
-
-        let message = `${error}`;
-
-        extension.error = message;
-        extension.state = ExtensionState.ERROR;
-        if (!extension.errors)
-            extension.errors = [];
-        extension.errors.push(message);
-
-        log('Extension "%s" had error: %s'.format(uuid, message));
-        this.emit('extension-state-changed', extension);
-    }
-
-    createExtensionObject(uuid, dir, type) {
-        let metadataFile = dir.get_child('metadata.json');
-        if (!metadataFile.query_exists(null)) {
-            throw new Error('Missing metadata.json');
-        }
-
-        let metadataContents, success_;
-        try {
-            [success_, metadataContents] = metadataFile.load_contents(null);
-            if (metadataContents instanceof Uint8Array)
-                metadataContents = imports.byteArray.toString(metadataContents);
-        } catch (e) {
-            throw new Error(`Failed to load metadata.json: ${e}`);
-        }
-        let meta;
-        try {
-            meta = JSON.parse(metadataContents);
-        } catch (e) {
-            throw new Error(`Failed to parse metadata.json: ${e}`);
-        }
-
-        let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
-        for (let i = 0; i < requiredProperties.length; i++) {
-            let prop = requiredProperties[i];
-            if (!meta[prop]) {
-                throw new Error(`missing "${prop}" property in metadata.json`);
-            }
-        }
-
-        if (uuid != meta.uuid) {
-            throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
-        }
-
-        let extension = {
-            metadata: meta,
-            uuid: meta.uuid,
-            type,
-            dir,
-            path: dir.get_path(),
-            error: '',
-            hasPrefs: dir.get_child('prefs.js').query_exists(null),
-            canChange: false
-        };
-        this._extensions.set(uuid, extension);
-
-        return extension;
-    }
-
-    loadExtension(extension) {
-        // Default to error, we set success as the last step
-        extension.state = ExtensionState.ERROR;
-
-        let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
-
-        if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
-            extension.state = ExtensionState.OUT_OF_DATE;
+            if (extension.state == ExtensionState.DISABLED)
+                enableExtension(extension.uuid);
        } else {
-            let enabled = this._enabledExtensions.includes(extension.uuid);
-            if (enabled) {
-                if (!this._callExtensionInit(extension.uuid))
-                    return;
-                if (extension.state == ExtensionState.DISABLED)
-                    this._callExtensionEnable(extension.uuid);
-            } else {
-                extension.state = ExtensionState.INITIALIZED;
-            }
+            extension.state = ExtensionState.INITIALIZED;
        }
-
-        this._updateCanChange(extension);
-        this.emit('extension-state-changed', extension);
    }

-    unloadExtension(extension) {
-        // Try to disable it -- if it's ERROR'd, we can't guarantee that,
-        // but it will be removed on next reboot, and hopefully nothing
-        // broke too much.
-        this._callExtensionDisable(extension.uuid);
+    _signals.emit('extension-state-changed', extension);
+}

-        extension.state = ExtensionState.UNINSTALLED;
-        this.emit('extension-state-changed', extension);
+function unloadExtension(extension) {
+    // Try to disable it -- if it's ERROR'd, we can't guarantee that,
+    // but it will be removed on next reboot, and hopefully nothing
+    // broke too much.
+    disableExtension(extension.uuid);

-        this._extensions.delete(extension.uuid);
-        return true;
+    extension.state = ExtensionState.UNINSTALLED;
+    _signals.emit('extension-state-changed', extension);
+
+    delete ExtensionUtils.extensions[extension.uuid];
+    return true;
+}
+
+function reloadExtension(oldExtension) {
+    // Grab the things we'll need to pass to createExtensionObject
+    // to reload it.
+    let { uuid: uuid, dir: dir, type: type } = oldExtension;
+
+    // Then unload the old extension.
+    unloadExtension(oldExtension);
+
+    // Now, recreate the extension and load it.
+    let newExtension;
+    try {
+        newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type);
+    } catch (e) {
+        logExtensionError(uuid, e);
+        return;
    }

-    reloadExtension(oldExtension) {
-        // Grab the things we'll need to pass to createExtensionObject
-        // to reload it.
-        let { uuid: uuid, dir: dir, type: type } = oldExtension;
+    loadExtension(newExtension);
+}

-        // Then unload the old extension.
-        this.unloadExtension(oldExtension);
+function initExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    let dir = extension.dir;

-        // Now, recreate the extension and load it.
-        let newExtension;
+    if (!extension)
+        throw new Error("Extension was not properly created. Call loadExtension first");
+
+    let extensionJs = dir.get_child('extension.js');
+    if (!extensionJs.query_exists(null)) {
+        logExtensionError(uuid, new Error('Missing extension.js'));
+        return false;
+    }
+
+    let extensionModule;
+    let extensionState = null;
+
+    ExtensionUtils.installImporter(extension);
+    try {
+        extensionModule = extension.imports.extension;
+    } catch (e) {
+        logExtensionError(uuid, e);
+        return false;
+    }
+
+    if (extensionModule.init) {
        try {
-            newExtension = this.createExtensionObject(uuid, dir, type);
+            extensionState = extensionModule.init(extension);
        } catch (e) {
-            this.logExtensionError(uuid, e);
-            return;
-        }
-
-        this.loadExtension(newExtension);
-    }
-
-    _callExtensionInit(uuid) {
-        let extension = this.lookup(uuid);
-        let dir = extension.dir;
-
-        if (!extension)
-            throw new Error("Extension was not properly created. Call loadExtension first");
-
-        let extensionJs = dir.get_child('extension.js');
-        if (!extensionJs.query_exists(null)) {
-            this.logExtensionError(uuid, new Error('Missing extension.js'));
+            logExtensionError(uuid, e);
            return false;
        }
-
-        let extensionModule;
-        let extensionState = null;
-
-        ExtensionUtils.installImporter(extension);
-        try {
-            extensionModule = extension.imports.extension;
-        } catch (e) {
-            this.logExtensionError(uuid, e);
-            return false;
-        }
-
-        if (extensionModule.init) {
-            try {
-                extensionState = extensionModule.init(extension);
-            } catch (e) {
-                this.logExtensionError(uuid, e);
-                return false;
-            }
-        }
-
-        if (!extensionState)
-            extensionState = extensionModule;
-        extension.stateObj = extensionState;
-
-        extension.state = ExtensionState.DISABLED;
-        this.emit('extension-loaded', uuid);
-        return true;
    }

-    _getModeExtensions() {
-        if (Array.isArray(Main.sessionMode.enabledExtensions))
-            return Main.sessionMode.enabledExtensions;
-        return [];
-    }
+    if (!extensionState)
+        extensionState = extensionModule;
+    extension.stateObj = extensionState;

-    _updateCanChange(extension) {
-        let hasError =
-            extension.state == ExtensionState.ERROR ||
-            extension.state == ExtensionState.OUT_OF_DATE;
+    extension.state = ExtensionState.DISABLED;
+    _signals.emit('extension-loaded', uuid);
+    return true;
+}

-        let isMode = this._getModeExtensions().includes(extension.uuid);
-        let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY);
+function getEnabledExtensions() {
+    let extensions;
+    if (Array.isArray(Main.sessionMode.enabledExtensions))
+        extensions = Main.sessionMode.enabledExtensions;
+    else
+        extensions = [];

-        let changeKey = isMode
-            ? DISABLE_USER_EXTENSIONS_KEY
-            : ENABLED_EXTENSIONS_KEY;
+    if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
+        return extensions;

-        extension.canChange =
-            !hasError &&
-            global.settings.is_writable(changeKey) &&
-            (isMode || !modeOnly);
-    }
+    return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
+}

-    _getEnabledExtensions() {
-        let extensions = this._getModeExtensions();
+function onEnabledExtensionsChanged() {
+    let newEnabledExtensions = getEnabledExtensions();

-        if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
-            extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
+    if (!enabled)
+        return;

-        // filter out 'disabled-extensions' which takes precedence
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-        return extensions.filter(item => !disabledExtensions.includes(item));
-    }
+    // Find and enable all the newly enabled extensions: UUIDs found in the
+    // new setting, but not in the old one.
+    newEnabledExtensions.filter(
+        uuid => !enabledExtensions.includes(uuid)
+    ).forEach(uuid => {
+        enableExtension(uuid);
+    });

-    _onUserExtensionsEnabledChanged() {
-        this._onEnabledExtensionsChanged();
-        this._onSettingsWritableChanged();
-    }
+    // Find and disable all the newly disabled extensions: UUIDs found in the
+    // old setting, but not in the new one.
+    enabledExtensions.filter(
+        item => !newEnabledExtensions.includes(item)
+    ).forEach(uuid => {
+        disableExtension(uuid);
+    });

-    _onEnabledExtensionsChanged() {
-        let newEnabledExtensions = this._getEnabledExtensions();
+    enabledExtensions = newEnabledExtensions;
+}

-        if (!this._enabled)
-            return;
+function _onVersionValidationChanged() {
+    // we want to reload all extensions, but only enable
+    // extensions when allowed by the sessionMode, so
+    // temporarily disable them all
+    enabledExtensions = [];
+    for (let uuid in ExtensionUtils.extensions)
+        reloadExtension(ExtensionUtils.extensions[uuid]);
+    enabledExtensions = getEnabledExtensions();

-        // Find and enable all the newly enabled extensions: UUIDs found in the
-        // new setting, but not in the old one.
-        newEnabledExtensions.filter(
-            uuid => !this._enabledExtensions.includes(uuid)
-        ).forEach(uuid => {
-            this._callExtensionEnable(uuid);
+    if (Main.sessionMode.allowExtensions) {
+        enabledExtensions.forEach(uuid => {
+            enableExtension(uuid);
        });
+    }
+}

-        // Find and disable all the newly disabled extensions: UUIDs found in the
-        // old setting, but not in the new one.
-        this._enabledExtensions.filter(
-            item => !newEnabledExtensions.includes(item)
-        ).forEach(uuid => {
-            this._callExtensionDisable(uuid);
+function _loadExtensions() {
+    global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
+    global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
+    global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`, _onVersionValidationChanged);
+
+    enabledExtensions = getEnabledExtensions();
+
+    let finder = new ExtensionUtils.ExtensionFinder();
+    finder.connect('extension-found', (finder, extension) => {
+        loadExtension(extension);
+    });
+    finder.scanExtensions();
+}
+
+function enableAllExtensions() {
+    if (enabled)
+        return;
+
+    if (!initted) {
+        _loadExtensions();
+        initted = true;
+    } else {
+        enabledExtensions.forEach(uuid => {
+            enableExtension(uuid);
        });
-
-        this._enabledExtensions = newEnabledExtensions;
    }
+    enabled = true;
+}

-    _onSettingsWritableChanged() {
-        for (let extension of this._extensions.values()) {
-            this._updateCanChange(extension);
-            this.emit('extension-state-changed', extension);
-        }
-    }
+function disableAllExtensions() {
+    if (!enabled)
+        return;

-    _onVersionValidationChanged() {
-        // we want to reload all extensions, but only enable
-        // extensions when allowed by the sessionMode, so
-        // temporarily disable them all
-        this._enabledExtensions = [];
-
-        // The loop modifies the extensions map, so iterate over a copy
-        let extensions = [...this._extensions.values()];
-        for (let extension of extensions)
-            this.reloadExtension(extension);
-        this._enabledExtensions = this._getEnabledExtensions();
-
-        if (Main.sessionMode.allowExtensions) {
-            this._enabledExtensions.forEach(uuid => {
-                this._callExtensionEnable(uuid);
-            });
-        }
-    }
-
-    _loadExtensions() {
-        global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`,
-            this._onEnabledExtensionsChanged.bind(this));
-        global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`,
-            this._onEnabledExtensionsChanged.bind(this));
-        global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`,
-            this._onUserExtensionsEnabledChanged.bind(this));
-        global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`,
-            this._onVersionValidationChanged.bind(this));
-        global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`,
-            this._onSettingsWritableChanged.bind(this));
-        global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`,
-            this._onSettingsWritableChanged.bind(this));
-
-        this._enabledExtensions = this._getEnabledExtensions();
-
-        let perUserDir = Gio.File.new_for_path(global.userdatadir);
-        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
-            let fileType = info.get_file_type();
-            if (fileType != Gio.FileType.DIRECTORY)
-                return;
-            let uuid = info.get_name();
-            let existing = this.lookup(uuid);
-            if (existing) {
-                log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`);
-                return;
-            }
-
-            let extension;
-            let type = dir.has_prefix(perUserDir)
-                ? ExtensionType.PER_USER
-                : ExtensionType.SYSTEM;
-            try {
-                extension = this.createExtensionObject(uuid, dir, type);
-            } catch (e) {
-                logError(e, `Could not load extension ${uuid}`);
-                return;
-            }
-            this.loadExtension(extension);
+    if (initted) {
+        extensionOrder.slice().reverse().forEach(uuid => {
+            disableExtension(uuid);
        });
    }

-    _enableAllExtensions() {
-        if (this._enabled)
-            return;
+    enabled = false;
+}

-        if (!this._initted) {
-            this._loadExtensions();
-            this._initted = true;
-        } else {
-            this._enabledExtensions.forEach(uuid => {
-                this._callExtensionEnable(uuid);
-            });
-        }
-        this._enabled = true;
+function _sessionUpdated() {
+    // For now sessionMode.allowExtensions controls extensions from both the
+    // 'enabled-extensions' preference and the sessionMode.enabledExtensions
+    // property; it might make sense to make enabledExtensions independent
+    // from allowExtensions in the future
+    if (Main.sessionMode.allowExtensions) {
+        if (initted)
+            enabledExtensions = getEnabledExtensions();
+        enableAllExtensions();
+    } else {
+        disableAllExtensions();
    }
+}

-    _disableAllExtensions() {
-        if (!this._enabled)
-            return;
-
-        if (this._initted) {
-            this._extensionOrder.slice().reverse().forEach(uuid => {
-                this._callExtensionDisable(uuid);
-            });
-        }
-
-        this._enabled = false;
-    }
-
-    _sessionUpdated() {
-        // For now sessionMode.allowExtensions controls extensions from both the
-        // 'enabled-extensions' preference and the sessionMode.enabledExtensions
-        // property; it might make sense to make enabledExtensions independent
-        // from allowExtensions in the future
-        if (Main.sessionMode.allowExtensions) {
-            if (this._initted)
-                this._enabledExtensions = this._getEnabledExtensions();
-            this._enableAllExtensions();
-        } else {
-            this._disableAllExtensions();
-        }
-    }
-};
-Signals.addSignalMethods(ExtensionManager.prototype);
+function init() {
+    Main.sessionMode.connect('updated', _sessionUpdated);
+    _sessionUpdated();
+}
--- a/js/ui/grabHelper.js
+++ b/js/ui/grabHelper.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported GrabHelper */

 const { Clutter, St } = imports.gi;

--- a/js/ui/ibusCandidatePopup.js
+++ b/js/ui/ibusCandidatePopup.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CandidatePopup */

 const { Clutter, IBus, St } = imports.gi;
 const Signals = imports.signals;
@@ -199,29 +198,29 @@ var CandidatePopup = class CandidatePopup {
                this._setTextAttributes(this._preeditText.clutter_text,
                                        attrs);
        });
-        panelService.connect('show-preedit-text', () => {
+        panelService.connect('show-preedit-text', ps => {
            this._preeditText.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-preedit-text', () => {
+        panelService.connect('hide-preedit-text', ps => {
            this._preeditText.hide();
            this._updateVisibility();
        });
-        panelService.connect('update-auxiliary-text', (_ps, text, visible) => {
+        panelService.connect('update-auxiliary-text', (ps, text, visible) => {
            this._auxText.visible = visible;
            this._updateVisibility();

            this._auxText.text = text.get_text();
        });
-        panelService.connect('show-auxiliary-text', () => {
+        panelService.connect('show-auxiliary-text', ps => {
            this._auxText.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-auxiliary-text', () => {
+        panelService.connect('hide-auxiliary-text', ps => {
            this._auxText.hide();
            this._updateVisibility();
        });
-        panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => {
+        panelService.connect('update-lookup-table', (ps, lookupTable, visible) => {
            this._candidateArea.actor.visible = visible;
            this._updateVisibility();

@@ -257,15 +256,15 @@ var CandidatePopup = class CandidatePopup {
            this._candidateArea.setOrientation(lookupTable.get_orientation());
            this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
        });
-        panelService.connect('show-lookup-table', () => {
+        panelService.connect('show-lookup-table', ps => {
            this._candidateArea.actor.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-lookup-table', () => {
+        panelService.connect('hide-lookup-table', ps => {
            this._candidateArea.actor.hide();
            this._updateVisibility();
        });
-        panelService.connect('focus-out', () => {
+        panelService.connect('focus-out', ps => {
            this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
            Main.keyboard.resetSuggestions();
        });
--- a/js/ui/iconGrid.js
+++ b/js/ui/iconGrid.js
@@ -1,17 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BaseIcon, IconGrid, PaginatedIconGrid */

-const { Clutter, GLib, GObject, Meta, St } = imports.gi;
+const { Clutter, GObject, Meta, St } = imports.gi;

 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;

 var ICON_SIZE = 96;
 var MIN_ICON_SIZE = 16;

-var EXTRA_SPACE_ANIMATION_TIME = 250;
+var EXTRA_SPACE_ANIMATION_TIME = 0.25;

-var ANIMATION_TIME_IN = 350;
+var ANIMATION_TIME_IN = 0.350;
 var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN;
 var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN;
 var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM;
@@ -26,7 +26,7 @@ var AnimationDirection = {
 };

 var APPICON_ANIMATION_OUT_SCALE = 3;
-var APPICON_ANIMATION_OUT_TIME = 250;
+var APPICON_ANIMATION_OUT_TIME = 0.25;

 var BaseIcon = GObject.registerClass(
 class BaseIcon extends St.Bin {
@@ -56,10 +56,6 @@ class BaseIcon extends St.Bin {

        if (params.showLabel) {
            this.label = new St.Label({ text: label });
-            this.label.clutter_text.set({
-                x_align: Clutter.ActorAlign.CENTER,
-                y_align: Clutter.ActorAlign.CENTER
-            });
            this._box.add_actor(this.label);
        } else {
            this.label = null;
@@ -75,14 +71,14 @@ class BaseIcon extends St.Bin {
        this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this));
    }

-    vfunc_get_preferred_width(_forHeight) {
+    vfunc_get_preferred_width(forHeight) {
        // Return the actual height to keep the squared aspect
        return this.get_preferred_height(-1);
    }

    // This can be overridden by a subclass, or by the createIcon
    // parameter to _init()
-    createIcon(_size) {
+    createIcon(size) {
        throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`);
    }

@@ -141,10 +137,6 @@ class BaseIcon extends St.Bin {
        // animating.
        zoomOutActor(this.child);
    }
-
-    update() {
-        this._createIconTexture(this.iconSize);
-    }
 });

 function clamp(value, min, max) {
@@ -172,16 +164,18 @@ function zoomOutActor(actor) {
    let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth);
    let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight);

-    actorClone.ease({
-        scale_x: APPICON_ANIMATION_OUT_SCALE,
-        scale_y: APPICON_ANIMATION_OUT_SCALE,
-        translation_x: containedX - scaledX,
-        translation_y: containedY - scaledY,
-        opacity: 0,
-        duration: APPICON_ANIMATION_OUT_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => actorClone.destroy()
-    });
+    Tweener.addTween(actorClone,
+                     { time: APPICON_ANIMATION_OUT_TIME,
+                       scale_x: APPICON_ANIMATION_OUT_SCALE,
+                       scale_y: APPICON_ANIMATION_OUT_SCALE,
+                       translation_x: containedX - scaledX,
+                       translation_y: containedY - scaledY,
+                       opacity: 0,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           actorClone.destroy();
+                       }
+                    });
 }

 var IconGrid = GObject.registerClass({
@@ -212,8 +206,6 @@ var IconGrid = GObject.registerClass({
        this.rightPadding = 0;
        this.leftPadding = 0;

-        this._updateIconSizesLaterId = 0;
-
        this._items = [];
        this._clonesAnimating = [];
        // Pulled from CSS, but hardcode some defaults here
@@ -226,19 +218,11 @@ var IconGrid = GObject.registerClass({
        // swarming into the void ...
        this.connect('notify::mapped', () => {
            if (!this.mapped)
-                this._resetAnimationActors();
+                this._cancelAnimation();
        });

        this.connect('actor-added', this._childAdded.bind(this));
        this.connect('actor-removed', this._childRemoved.bind(this));
-        this.connect('destroy', this._onDestroy.bind(this));
-    }
-
-    _onDestroy() {
-        if (this._updateIconSizesLaterId) {
-            Meta.later_remove (this._updateIconSizesLaterId);
-            this._updateIconSizesLaterId = 0;
-        }
    }

    _keyFocusIn(actor) {
@@ -253,7 +237,7 @@ var IconGrid = GObject.registerClass({
        child.disconnect(child._iconGridKeyFocusInId);
    }

-    vfunc_get_preferred_width(_forHeight) {
+    vfunc_get_preferred_width(forHeight) {
        if (this._fillParent)
            // Ignore all size requests of children and request a size of 0;
            // later we'll allocate as many children as fit the parent
@@ -417,17 +401,18 @@ var IconGrid = GObject.registerClass({
        return this._getVisibleChildren();
    }

-    _resetAnimationActors() {
+    _cancelAnimation() {
+        this._clonesAnimating.forEach(clone => clone.destroy());
+        this._clonesAnimating = [];
+    }
+
+    _animationDone() {
        this._clonesAnimating.forEach(clone => {
            clone.source.reactive = true;
            clone.source.opacity = 255;
            clone.destroy();
        });
        this._clonesAnimating = [];
-    }
-
-    _animationDone() {
-        this._resetAnimationActors();
        this.emit('animation-done');
    }

@@ -436,7 +421,7 @@ var IconGrid = GObject.registerClass({
            throw new GObject.NotImplementedError("Pulse animation only implements " +
                                                  "'in' animation direction");

-        this._resetAnimationActors();
+        this._cancelAnimation();

        let actors = this._getChildrenToAnimate();
        if (actors.length == 0) {
@@ -459,32 +444,30 @@ var IconGrid = GObject.registerClass({
            let delay = index / actors.length * maxDelay;
            let bounceUpTime = ANIMATION_TIME_IN / 4;
            let isLastItem = index == actors.length - 1;
-            actor.ease({
-                scale_x: ANIMATION_BOUNCE_ICON_SCALE,
-                scale_y: ANIMATION_BOUNCE_ICON_SCALE,
-                duration: bounceUpTime,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                delay: delay,
-                onComplete: () => {
-                    let duration = ANIMATION_TIME_IN - bounceUpTime;
-                    actor.ease({
-                        scale_x: 1,
-                        scale_y: 1,
-                        duration,
-                        mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                        onComplete: () => {
-                            if (isLastItem)
-                                this._animationDone();
-                            actor.reactive = true;
-                        }
-                    });
-                }
-            });
+            Tweener.addTween(actor,
+                             { time: bounceUpTime,
+                               transition: 'easeInOutQuad',
+                               delay: delay,
+                               scale_x: ANIMATION_BOUNCE_ICON_SCALE,
+                               scale_y: ANIMATION_BOUNCE_ICON_SCALE,
+                               onComplete: () => {
+                                   Tweener.addTween(actor,
+                                                    { time: ANIMATION_TIME_IN - bounceUpTime,
+                                                      transition: 'easeInOutQuad',
+                                                      scale_x: 1,
+                                                      scale_y: 1,
+                                                      onComplete: () => {
+                                                          if (isLastItem)
+                                                              this._animationDone();
+                                                      }
+                                                    });
+                               }
+                             });
        }
    }

    animateSpring(animationDirection, sourceActor) {
-        this._resetAnimationActors();
+        this._cancelAnimation();

        let actors = this._getChildrenToAnimate();
        if (actors.length == 0) {
@@ -538,25 +521,21 @@ var IconGrid = GObject.registerClass({

                let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM;
                let [finalX, finalY]  = actor._transformedPosition;
-                movementParams = {
-                    x: finalX,
-                    y: finalY,
-                    scale_x: 1,
-                    scale_y: 1,
-                    duration: ANIMATION_TIME_IN,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
-                };
-
-                if (isLastItem)
-                    movementParams.onComplete = this._animationDone.bind(this);
-
-                fadeParams = {
-                    opacity: 255,
-                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
-                };
+                movementParams = { time: ANIMATION_TIME_IN,
+                                   transition: 'easeInOutQuad',
+                                   delay: delay,
+                                   x: finalX,
+                                   y: finalY,
+                                   scale_x: 1,
+                                   scale_y: 1,
+                                   onComplete: () => {
+                                       if (isLastItem)
+                                           this._animationDone();
+                                   } };
+                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               transition: 'easeInOutQuad',
+                               delay: delay,
+                               opacity: 255 };
            } else {
                let isLastItem = actor._distance == maxDist;

@@ -564,29 +543,26 @@ var IconGrid = GObject.registerClass({
                actorClone.set_position(startX, startY);

                let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM;
-                movementParams = {
-                    x: adjustedSourcePositionX,
-                    y: adjustedSourcePositionY,
-                    scale_x: scaleX,
-                    scale_y: scaleY,
-                    duration: ANIMATION_TIME_OUT,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
-                };
-
-                if (isLastItem)
-                    movementParams.onComplete = this._animationDone.bind(this);
-
-                fadeParams = {
-                    opacity: 0,
-                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
-                };
+                movementParams = { time: ANIMATION_TIME_OUT,
+                                   transition: 'easeInOutQuad',
+                                   delay: delay,
+                                   x: adjustedSourcePositionX,
+                                   y: adjustedSourcePositionY,
+                                   scale_x: scaleX,
+                                   scale_y: scaleY,
+                                   onComplete: () => {
+                                       if (isLastItem)
+                                           this._animationDone();
+                                   } };
+                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               transition: 'easeInOutQuad',
+                               delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               opacity: 0 };
            }

-            actorClone.ease(movementParams);
-            actorClone.ease(fadeParams);
+
+            Tweener.addTween(actorClone, movementParams);
+            Tweener.addTween(actorClone, fadeParams);
        }
    }

@@ -781,20 +757,17 @@ var IconGrid = GObject.registerClass({

            this._updateSpacingForSize(availWidth, availHeight);
        }
-        if (!this._updateIconSizesLaterId)
-            this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
-                                                          this._updateIconSizes.bind(this));
+        Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
+                       this._updateIconSizes.bind(this));
    }

    // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
    _updateIconSizes() {
-        this._updateIconSizesLaterId = 0;
        let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
        let newIconSize = Math.floor(ICON_SIZE * scale);
        for (let i in this._items) {
            this._items[i].icon.setIconSize(newIconSize);
        }
-        return GLib.SOURCE_REMOVE;
    }
 });

@@ -811,7 +784,7 @@ var PaginatedIconGrid = GObject.registerClass({
        this._childrenPerPage = 0;
    }

-    vfunc_get_preferred_height(_forWidth) {
+    vfunc_get_preferred_height(forWidth) {
        let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages;
        return [height, height];
    }
@@ -879,7 +852,7 @@ var PaginatedIconGrid = GObject.registerClass({
    }

    _computePages(availWidthPerPage, availHeightPerPage) {
-        let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage);
+        let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage);
        let nRows;
        let children = this._getVisibleChildren();
        if (nColumns > 0)
@@ -991,14 +964,13 @@ var PaginatedIconGrid = GObject.registerClass({

        for (let i = 0; i < children.length; i++) {
            children[i].translation_y = 0;
-            let params = {
-                translation_y: translationY,
-                duration: EXTRA_SPACE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD
-            };
+            let params = { translation_y: translationY,
+                           time: EXTRA_SPACE_ANIMATION_TIME,
+                           transition: 'easeInOutQuad'
+                         };
            if (i == (children.length - 1))
                params.onComplete = () => this.emit('space-opened');
-            children[i].ease(params);
+            Tweener.addTween(children[i], params);
        }
    }

@@ -1011,12 +983,12 @@ var PaginatedIconGrid = GObject.registerClass({
        for (let i = 0; i < this._translatedChildren.length; i++) {
            if (!this._translatedChildren[i].translation_y)
                continue;
-            this._translatedChildren[i].ease({
-                translation_y: 0,
-                duration: EXTRA_SPACE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                onComplete: () => this.emit('space-closed')
-            });
+            Tweener.addTween(this._translatedChildren[i],
+                             { translation_y: 0,
+                               time: EXTRA_SPACE_ANIMATION_TIME,
+                               transition: 'easeInOutQuad',
+                               onComplete: () => this.emit('space-closed')
+                             });
        }
    }
 });
--- a/js/ui/inhibitShortcutsDialog.js
+++ b/js/ui/inhibitShortcutsDialog.js
@@ -1,4 +1,3 @@
-/* exported InhibitShortcutsDialog */
 const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi;

 const Dialog = imports.ui.dialog;
@@ -140,7 +139,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
                        return;
                    }

-                    let [permissions] = res;
+                    let [permissions, data] = res;
                    if (permissions[appId] === undefined) // Not found
                        this._dialog.open();
                    else if (permissions[appId] == GRANTED)
--- a/js/ui/kbdA11yDialog.js
+++ b/js/ui/kbdA11yDialog.js
@@ -1,4 +1,3 @@
-/* exported KbdA11yDialog */
 const { Clutter, Gio, GObject } = imports.gi;

 const Dialog = imports.ui.dialog;
--- a/js/ui/keyboard.js
+++ b/js/ui/keyboard.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Keyboard */

 const { Clutter, Gio, GLib, GObject, Meta, St } = imports.gi;
 const Signals = imports.signals;
@@ -11,10 +10,11 @@ const Layout = imports.ui.layout;
 const Main = imports.ui.main;
 const PageIndicators = imports.ui.pageIndicators;
 const PopupMenu = imports.ui.popupMenu;
+const Tweener = imports.ui.tweener;

-var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2;
+var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2 * 1000;
 var KEY_LONG_PRESS_TIME = 250;
-var PANEL_SWITCH_ANIMATION_TIME = 500;
+var PANEL_SWITCH_ANIMATION_TIME = 0.5;
 var PANEL_SWITCH_RELATIVE_DISTANCE = 1 / 3; /* A third of the actor width */

 const A11Y_APPLICATIONS_SCHEMA = 'org.gnome.desktop.a11y.applications';
@@ -100,7 +100,7 @@ class KeyContainer extends St.Widget {
        this._rows = [];
    }

-    appendRow() {
+    appendRow(length) {
        this._currentRow++;
        this._currentCol = 0;

@@ -474,7 +474,7 @@ var KeyboardModel = class {

    _loadModel(groupName) {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/%s.json'.format(groupName));
-        let [success_, contents] = file.load_contents(null);
+        let [success, contents] = file.load_contents(null);
        if (contents instanceof Uint8Array)
            contents = imports.byteArray.toString(contents);

@@ -569,27 +569,11 @@ var FocusTracker = class {
 };
 Signals.addSignalMethods(FocusTracker.prototype);

-var EmojiPager = GObject.registerClass({
-    Properties: {
-        'delta': GObject.ParamSpec.int(
-            'delta', 'delta', 'delta',
-            GObject.ParamFlags.READWRITE,
-            GLib.MININT32, GLib.MAXINT32, 0)
-    },
-    Signals: {
-        'emoji': { param_types: [GObject.TYPE_STRING] },
-        'page-changed': {
-            param_types: [GObject.TYPE_INT, GObject.TYPE_INT, GObject.TYPE_INT]
-        }
-    }
-}, class EmojiPager extends St.Widget {
-    _init(sections, nCols, nRows) {
-        super._init({
-            layout_manager: new Clutter.BinLayout(),
-            reactive: true,
-            clip_to_allocation: true
-        });
-
+var EmojiPager = class EmojiPager {
+    constructor(sections, nCols, nRows) {
+        this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout(),
+                                     reactive: true,
+                                     clip_to_allocation: true });
        this._sections = sections;
        this._nCols = nCols;
        this._nRows = nRows;
@@ -611,7 +595,7 @@ var EmojiPager = GObject.registerClass({
        panAction.connect('gesture-cancel', this._onPanCancel.bind(this));
        panAction.connect('gesture-end', this._onPanEnd.bind(this));
        this._panAction = panAction;
-        this.add_action(panAction);
+        this.actor.add_action(panAction);
    }

    get delta() {
@@ -624,11 +608,7 @@ var EmojiPager = GObject.registerClass({
        else if (value < -this._width)
            value = -this._width;

-        if (this._delta == value)
-            return;
-
        this._delta = value;
-        this.notify('delta');

        if (value == 0)
            return;
@@ -645,8 +625,8 @@ var EmojiPager = GObject.registerClass({
            if (followingPage != null) {
                this._followingPanel = this._generatePanel(followingPage);
                this._followingPanel.set_pivot_point(0.5, 0.5);
-                this.add_child(this._followingPanel);
-                this.set_child_below_sibling(this._followingPanel, this._panel);
+                this.actor.add_child(this._followingPanel);
+                this.actor.set_child_below_sibling(this._followingPanel, this._panel);
            }

            this._followingPage = followingPage;
@@ -682,7 +662,7 @@ var EmojiPager = GObject.registerClass({
    }

    _onPan(action) {
-        let [dist_, dx, dy_] = action.get_motion_delta(0);
+        let [dist, dx, dy] = action.get_motion_delta(0);
        this.delta = this.delta + dx;

        if (this._currentKey != null) {
@@ -694,12 +674,12 @@ var EmojiPager = GObject.registerClass({
    }

    _onPanBegin() {
-        this._width = this.width;
+        this._width = this.actor.width;
        return true;
    }

    _onPanEnd() {
-        if (Math.abs(this._delta) < this.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
+        if (Math.abs(this._delta) < this.actor.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
            this._onPanCancel();
        } else {
            let value;
@@ -711,24 +691,28 @@ var EmojiPager = GObject.registerClass({
            let relDelta = Math.abs(this._delta - value) / this._width;
            let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);

-            this.remove_all_transitions();
-            this.ease_property('delta', value, {
-                duration: time,
-                onComplete: () => {
-                    this.setCurrentPage(this.getFollowingPage());
-                }
-            });
+            Tweener.removeTweens(this);
+            Tweener.addTween(this,
+                             { delta: value,
+                               time: time,
+                               transition: 'easeInOutQuad',
+                               onComplete() {
+                                   this.setCurrentPage(this.getFollowingPage());
+                               }
+                             });
        }
    }

    _onPanCancel() {
-        let relDelta = Math.abs(this._delta) / this.width;
+        let relDelta = Math.abs(this._delta) / this.actor.width;
        let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);

-        this.remove_all_transitions();
-        this.ease_property('delta', 0, {
-            duration: time,
-        });
+        Tweener.removeTweens(this);
+        Tweener.addTween(this,
+                         { delta: 0,
+                           time: time,
+                           transition: 'easeInOutQuad',
+                         });
    }

    _initPagingInfo() {
@@ -838,7 +822,7 @@ var EmojiPager = GObject.registerClass({

        if (!this._panel) {
            this._panel = this._generatePanel(nPage);
-            this.add_child(this._panel);
+            this.actor.add_child(this._panel);
        }

        let page = this._pages[nPage];
@@ -855,7 +839,8 @@ var EmojiPager = GObject.registerClass({
            }
        }
    }
-});
+};
+Signals.addSignalMethods(EmojiPager.prototype);

 var EmojiSelection = class EmojiSelection {
    constructor() {
@@ -919,7 +904,7 @@ var EmojiSelection = class EmojiSelection {

    _populateSections() {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/emoji.json');
-        let [success_, contents] = file.load_contents(null);
+        let [success, contents] = file.load_contents(null);

        if (contents instanceof Uint8Array)
            contents = imports.byteArray.toString(contents);
@@ -1186,7 +1171,7 @@ var Keyboard = class Keyboard {

        this._emojiSelection = new EmojiSelection();
        this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this));
-        this._emojiSelection.connect('hide', () => this.hide());
+        this._emojiSelection.connect('hide', (selection) => this.hide());
        this._emojiSelection.connect('emoji-selected', (selection, emoji) => {
            this._keyboardController.commitString(emoji);
        });
@@ -1297,7 +1282,7 @@ var Keyboard = class Keyboard {
                    }
                }
            });
-            button.connect('released', (actor, keyval, _str) => {
+            button.connect('released', (actor, keyval, str) => {
                if (keyval != 0) {
                    if (button._keyvalPress)
                        this._keyboardController.keyvalRelease(keyval);
@@ -1482,7 +1467,7 @@ var Keyboard = class Keyboard {
        this._setActiveLayer(0);
    }

-    _onKeyboardGroupsChanged() {
+    _onKeyboardGroupsChanged(keyboard) {
        let nonGroupActors = [this._emojiSelection.actor, this._keypad.actor];
        this._aspectContainer.get_children().filter(c => !nonGroupActors.includes(c)).forEach(c => {
            c.destroy();
@@ -1668,23 +1653,19 @@ var Keyboard = class Keyboard {
            return;

        if (show) {
-            windowActor.ease({
-                y: windowActor.y - deltaY,
-                duration: Layout.KEYBOARD_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._windowSlideAnimationComplete(window, -deltaY);
-                }
-            });
+            Tweener.addTween(windowActor,
+                             { y: windowActor.y - deltaY,
+                               time: Layout.KEYBOARD_ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                               onComplete: this._windowSlideAnimationComplete,
+                               onCompleteParams: [window, -deltaY] });
        } else {
-            windowActor.ease({
-                y: windowActor.y + deltaY,
-                duration: Layout.KEYBOARD_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_QUAD,
-                onComplete: () => {
-                    this._windowSlideAnimationComplete(window, deltaY);
-                }
-            });
+            Tweener.addTween(windowActor,
+                             { y: windowActor.y + deltaY,
+                               time: Layout.KEYBOARD_ANIMATION_TIME,
+                               transition: 'easeInQuad',
+                               onComplete: this._windowSlideAnimationComplete,
+                               onCompleteParams: [window, deltaY] });
        }
    }

@@ -1748,7 +1729,7 @@ var KeyboardController = class {
        this.emit('groups-changed');
    }

-    _onSourceChanged(inputSourceManager, _oldSource) {
+    _onSourceChanged(inputSourceManager, oldSource) {
        let source = inputSourceManager.currentSource;
        this._currentSource = source;
        this.emit('active-group', source.id);
--- a/js/ui/layout.js
+++ b/js/ui/layout.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported MonitorConstraint, LayoutManager */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;
@@ -11,11 +10,12 @@ const LoginManager = imports.misc.loginManager;
 const DND = imports.ui.dnd;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const Ripples = imports.ui.ripples;

-var STARTUP_ANIMATION_TIME = 500;
-var KEYBOARD_ANIMATION_TIME = 150;
-var BACKGROUND_FADE_ANIMATION_TIME = 1000;
+var STARTUP_ANIMATION_TIME = 0.5;
+var KEYBOARD_ANIMATION_TIME = 0.15;
+var BACKGROUND_FADE_ANIMATION_TIME = 1.0;

 var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels
 var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms
@@ -80,12 +80,10 @@ var MonitorConstraint = GObject.registerClass({
        this.notify('index');
    }

-    // eslint-disable-next-line camelcase
    get work_area() {
        return this._workArea;
    }

-    // eslint-disable-next-line camelcase
    set work_area(v) {
        if (v == this._workArea)
            return;
@@ -167,12 +165,12 @@ var Monitor = class Monitor {

 const UiActor = GObject.registerClass(
 class UiActor extends St.Widget {
-    vfunc_get_preferred_width (_forHeight) {
+    vfunc_get_preferred_width (forHeight) {
        let width = global.stage.width;
        return [width, width];
    }

-    vfunc_get_preferred_height (_forWidth) {
+    vfunc_get_preferred_height (forWidth) {
        let height = global.stage.height;
        return [height, height];
    }
@@ -463,11 +461,10 @@ var LayoutManager = GObject.registerClass({
                let backgroundActor = this._bgManagers[i].backgroundActor;
                backgroundActor.show();
                backgroundActor.opacity = 0;
-                backgroundActor.ease({
-                    opacity: 255,
-                    duration: BACKGROUND_FADE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
+                Tweener.addTween(backgroundActor,
+                                 { opacity: 255,
+                                   time: BACKGROUND_FADE_ANIMATION_TIME,
+                                   transition: 'easeOutQuad' });
            }
        }
    }
@@ -698,23 +695,23 @@ var LayoutManager = GObject.registerClass({
    }

    _startupAnimationGreeter() {
-        this.panelBox.ease({
-            translation_y: 0,
-            duration: STARTUP_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete()
-        });
+        Tweener.addTween(this.panelBox,
+                         { translation_y: 0,
+                           time: STARTUP_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._startupAnimationComplete,
+                           onCompleteScope: this });
    }

    _startupAnimationSession() {
-        this.uiGroup.ease({
-            scale_x: 1,
-            scale_y: 1,
-            opacity: 255,
-            duration: STARTUP_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete()
-        });
+        Tweener.addTween(this.uiGroup,
+                         { scale_x: 1,
+                           scale_y: 1,
+                           opacity: 255,
+                           time: STARTUP_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._startupAnimationComplete,
+                           onCompleteScope: this });
    }

    _startupAnimationComplete() {
@@ -740,15 +737,14 @@ var LayoutManager = GObject.registerClass({

    showKeyboard() {
        this.keyboardBox.show();
-        this.keyboardBox.ease({
-            anchor_y: this.keyboardBox.height,
-            opacity: 255,
-            duration: KEYBOARD_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._showKeyboardComplete();
-            }
-        });
+        Tweener.addTween(this.keyboardBox,
+                         { anchor_y: this.keyboardBox.height,
+                           opacity: 255,
+                           time: KEYBOARD_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._showKeyboardComplete,
+                           onCompleteScope: this
+                         });
        this.emit('keyboard-visible-changed', true);
    }

@@ -767,16 +763,14 @@ var LayoutManager = GObject.registerClass({
            this.keyboardBox.disconnect(this._keyboardHeightNotifyId);
            this._keyboardHeightNotifyId = 0;
        }
-        this.keyboardBox.ease({
-            anchor_y: 0,
-            opacity: 0,
-            duration: immediate ? 0
-                                : KEYBOARD_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD,
-            onComplete: () => {
-                this._hideKeyboardComplete();
-            }
-        });
+        Tweener.addTween(this.keyboardBox,
+                         { anchor_y: 0,
+                           opacity: 0,
+                           time: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
+                           transition: 'easeInQuad',
+                           onComplete: this._hideKeyboardComplete,
+                           onCompleteScope: this
+                         });

        this.emit('keyboard-visible-changed', false);
    }
@@ -1236,7 +1230,7 @@ var HotCorner = class HotCorner {
        }
    }

-    handleDragOver(source, _actor, _x, _y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        if (source != Main.xdndHandler)
            return DND.DragMotionResult.CONTINUE;

@@ -1337,7 +1331,7 @@ var PressureBarrier = class PressureBarrier {
        let threshold = this._lastTime - this._timeout;

        while (i < this._barrierEvents.length) {
-            let [time, distance_] = this._barrierEvents[i];
+            let [time, distance] = this._barrierEvents[i];
            if (time >= threshold)
                break;
            i++;
@@ -1346,14 +1340,14 @@ var PressureBarrier = class PressureBarrier {
        let firstNewEvent = i;

        for (i = 0; i < firstNewEvent; i++) {
-            let [time_, distance] = this._barrierEvents[i];
+            let [time, distance] = this._barrierEvents[i];
            this._currentPressure -= distance;
        }

        this._barrierEvents = this._barrierEvents.slice(firstNewEvent);
    }

-    _onBarrierLeft(barrier, _event) {
+    _onBarrierLeft(barrier, event) {
        barrier._isHit = false;
        if (this._barriers.every(b => !b._isHit)) {
            this._reset();
--- a/js/ui/lightbox.js
+++ b/js/ui/lightbox.js
@@ -1,10 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Lightbox */

 const { Clutter, GObject, Shell, St } = imports.gi;
 const Signals = imports.signals;

 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 var DEFAULT_FADE_FACTOR = 0.4;
 var VIGNETTE_BRIGHTNESS = 0.2;
@@ -23,31 +23,16 @@ t = clamp(t, 0.0, 1.0);\n\
 float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\
 cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);';

-var RadialShaderEffect = GObject.registerClass({
-    Properties: {
-        'brightness': GObject.ParamSpec.float(
-            'brightness', 'brightness', 'brightness',
-            GObject.ParamFlags.READWRITE,
-            0, 1, 1
-        ),
-        'sharpness': GObject.ParamSpec.float(
-            'sharpness', 'sharpness', 'sharpness',
-            GObject.ParamFlags.READWRITE,
-            0, 1, 0
-        )
-    }
-}, class RadialShaderEffect extends Shell.GLSLEffect {
+var RadialShaderQuad = GObject.registerClass(
+class RadialShaderQuad extends Shell.GLSLQuad {
    _init(params) {
-        this._brightness = undefined;
-        this._sharpness = undefined;
-
        super._init(params);

        this._brightnessLocation = this.get_uniform_location('brightness');
        this._sharpnessLocation = this.get_uniform_location('vignette_sharpness');

        this.brightness = 1.0;
-        this.sharpness = 0.0;
+        this.vignetteSharpness = 0.0;
    }

    vfunc_build_pipeline() {
@@ -60,25 +45,19 @@ var RadialShaderEffect = GObject.registerClass({
    }

    set brightness(v) {
-        if (this._brightness == v)
-            return;
        this._brightness = v;
        this.set_uniform_float(this._brightnessLocation,
                               1, [this._brightness]);
-        this.notify('brightness');
    }

-    get sharpness() {
+    get vignetteSharpness() {
        return this._sharpness;
    }

-    set sharpness(v) {
-        if (this._sharpness == v)
-            return;
+    set vignetteSharpness(v) {
        this._sharpness = v;
        this.set_uniform_float(this._sharpnessLocation,
                               1, [this._sharpness]);
-        this.notify('sharpness');
    }
 });

@@ -89,8 +68,8 @@ var RadialShaderEffect = GObject.registerClass({
 *           - inhibitEvents: whether to inhibit events for @container
 *           - width: shade actor width
 *           - height: shade actor height
- *           - fadeInTime: milliseconds used to fade in
- *           - fadeOutTime: milliseconds used to fade out
+ *           - fadeInTime: seconds used to fade in
+ *           - fadeOutTime: seconds used to fade out
 *
 * Lightbox creates a dark translucent "shade" actor to hide the
 * contents of @container, and allows you to specify particular actors
@@ -119,13 +98,16 @@ var Lightbox = class Lightbox {
        this._children = container.get_children();
        this._fadeFactor = params.fadeFactor;
        this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
-
-        this.actor = new St.Bin({ reactive: params.inhibitEvents });
-
        if (this._radialEffect)
-            this.actor.add_effect(new RadialShaderEffect({ name: 'radial' }));
+            this.actor = new RadialShaderQuad({ x: 0,
+                                                y: 0,
+                                                reactive: params.inhibitEvents });
        else
-            this.actor.set({ opacity: 0, style_class: 'lightbox' });
+            this.actor = new St.Bin({ x: 0,
+                                      y: 0,
+                                      opacity: 0,
+                                      style_class: 'lightbox',
+                                      reactive: params.inhibitEvents });

        container.add_actor(this.actor);
        this.actor.raise_top();
@@ -174,32 +156,28 @@ var Lightbox = class Lightbox {
    show(fadeInTime) {
        fadeInTime = fadeInTime || 0;

-        this.actor.remove_all_transitions();
-
-        let onComplete = () => {
-            this.shown = true;
-            this.emit('shown');
-        };
-
+        Tweener.removeTweens(this.actor);
        if (this._radialEffect) {
-            this.actor.ease_property(
-                '@effects.radial.brightness', VIGNETTE_BRIGHTNESS, {
-                    duration: fadeInTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-            this.actor.ease_property(
-                '@effects.radial.sharpness', VIGNETTE_SHARPNESS, {
-                    duration: fadeInTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete
-                });
+            Tweener.addTween(this.actor,
+                             { brightness: VIGNETTE_BRIGHTNESS,
+                               vignetteSharpness: VIGNETTE_SHARPNESS,
+                               time: fadeInTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.shown = true;
+                                   this.emit('shown');
+                               }
+                             });
        } else {
-            this.actor.ease({
-                opacity: 255 * this._fadeFactor,
-                duration: fadeInTime,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete
-            });
+            Tweener.addTween(this.actor,
+                             { opacity: 255 * this._fadeFactor,
+                               time: fadeInTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.shown = true;
+                                   this.emit('shown');
+                               }
+                             });
        }

        this.actor.show();
@@ -209,29 +187,27 @@ var Lightbox = class Lightbox {
        fadeOutTime = fadeOutTime || 0;

        this.shown = false;
-        this.actor.remove_all_transitions();
-
-        let onComplete = () => this.actor.hide();
-
+        Tweener.removeTweens(this.actor);
        if (this._radialEffect) {
-            this.actor.ease_property(
-                '@effects.radial.brightness', 1.0, {
-                    duration: fadeOutTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-            this.actor.ease_property(
-                '@effects.radial.sharpness', 0.0, {
-                    duration: fadeOutTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete
-                });
+            Tweener.addTween(this.actor,
+                             { brightness: 1.0,
+                               vignetteSharpness: 0.0,
+                               opacity: 0,
+                               time: fadeOutTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.actor.hide();
+                               }
+                             });
        } else {
-            this.actor.ease({
-                opacity: 0,
-                duration: fadeOutTime,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete
-            });
+            Tweener.addTween(this.actor,
+                             { opacity: 0,
+                               time: fadeOutTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.actor.hide();
+                               }
+                             });
        }
    }

--- a/js/ui/locatePointer.js
+++ b/js/ui/locatePointer.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LocatePointer */

 const { Gio } = imports.gi;
 const Ripples = imports.ui.ripples;
@@ -19,7 +18,7 @@ var LocatePointer = class {
        if (!this._settings.get_boolean(LOCATE_POINTER_KEY))
            return;

-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        this._ripples.playAnimation(x, y);
    }
 };
--- a/js/ui/lookingGlass.js
+++ b/js/ui/lookingGlass.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LookingGlass */

 const { Clutter, Cogl, Gio, GLib,
        GObject, Meta, Pango, Shell, St } = imports.gi;
@@ -8,19 +7,20 @@ const Signals = imports.signals;
 const System = imports.system;

 const History = imports.misc.history;
+const ExtensionSystem = imports.ui.extensionSystem;
 const ExtensionUtils = imports.misc.extensionUtils;
 const ShellEntry = imports.ui.shellEntry;
+const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;
 const JsParse = imports.misc.jsParse;

-const { ExtensionState } = ExtensionUtils;
-
 const CHEVRON = '>>> ';

 /* Imports...feel free to add here as needed */
 var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
                    'const Main = imports.ui.main; ' +
                    'const Mainloop = imports.mainloop; ' +
+                    'const Tweener = imports.ui.tweener; ' +
                    /* Utility functions...we should probably be able to use these
                     * in the shell core code too. */
                    'const stage = global.stage; ' +
@@ -32,11 +32,9 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im
 const HISTORY_KEY = 'looking-glass-history';
 // Time between tabs for them to count as a double-tab event
 var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500;
-var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200;
+var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2;
 var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords();

-const LG_ANIMATION_TIME = 500;
-
 function _getAutoCompleteGlobalKeywords() {
    const keywords = ['true', 'false', 'null', 'new'];
    // Don't add the private properties of window (i.e., ones starting with '_')
@@ -268,7 +266,7 @@ var ObjLink = class ObjLink {
        this._lookingGlass = lookingGlass;
    }

-    _onClicked() {
+    _onClicked(link) {
        this._lookingGlass.inspectObject(this._obj, this.actor);
    }
 };
@@ -419,12 +417,9 @@ var ObjInspector = class ObjInspector {
        this.actor.show();
        if (sourceActor) {
            this.actor.set_scale(0, 0);
-            this.actor.ease({
-                scale_x: 1,
-                scale_y: 1,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                time: 200
-            });
+            Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1,
+                                           transition: 'easeOutQuad',
+                                           time: 0.2 });
        } else {
            this.actor.set_scale(1, 1);
        }
@@ -523,7 +518,7 @@ var Inspector = GObject.registerClass({

        let primary = Main.layoutManager.primaryMonitor;

-        let [, , natWidth, natHeight] =
+        let [minWidth, minHeight, natWidth, natHeight] =
            this._eventHandler.get_preferred_size();

        let childBox = new Clutter.ActorBox();
@@ -628,16 +623,15 @@ var Extensions = class Extensions {
        this._extensionsList.add(this._noExtensions);
        this.actor.add(this._extensionsList);

-        Main.extensionManager.getUuids().forEach(uuid => {
+        for (let uuid in ExtensionUtils.extensions)
            this._loadExtension(null, uuid);
-        });

-        Main.extensionManager.connect('extension-loaded',
-                                      this._loadExtension.bind(this));
+        ExtensionSystem.connect('extension-loaded',
+                                this._loadExtension.bind(this));
    }

    _loadExtension(o, uuid) {
-        let extension = Main.extensionManager.lookup(uuid);
+        let extension = ExtensionUtils.extensions[uuid];
        // There can be cases where we create dummy extension metadata
        // that's not really a proper extension. Don't bother with these.
        if (!extension.metadata.name)
@@ -694,16 +688,16 @@ var Extensions = class Extensions {

    _stateToString(extensionState) {
        switch (extensionState) {
-        case ExtensionState.ENABLED:
+        case ExtensionSystem.ExtensionState.ENABLED:
            return _("Enabled");
-        case ExtensionState.DISABLED:
-        case ExtensionState.INITIALIZED:
+        case ExtensionSystem.ExtensionState.DISABLED:
+        case ExtensionSystem.ExtensionState.INITIALIZED:
            return _("Disabled");
-        case ExtensionState.ERROR:
+        case ExtensionSystem.ExtensionState.ERROR:
            return _("Error");
-        case ExtensionState.OUT_OF_DATE:
+        case ExtensionSystem.ExtensionState.OUT_OF_DATE:
            return _("Out of date");
-        case ExtensionState.DOWNLOADING:
+        case ExtensionSystem.ExtensionState.DOWNLOADING:
            return _("Downloading");
        }
        return 'Unknown'; // Not translated, shouldn't appear
@@ -860,7 +854,7 @@ var LookingGlass = class LookingGlass {
        this._extensions = new Extensions(this);
        notebook.appendPage('Extensions', this._extensions.actor);

-        this._entry.clutter_text.connect('activate', (o, _e) => {
+        this._entry.clutter_text.connect('activate', (o, e) => {
            // Hide any completions we are currently showing
            this._hideCompletions();

@@ -944,41 +938,35 @@ var LookingGlass = class LookingGlass {
        this._completionActor.set_text(completions.join(', '));

        // Setting the height to -1 allows us to get its actual preferred height rather than
-        // whatever was last set when animating
+        // whatever was last given in set_height by Tweener.
        this._completionActor.set_height(-1);
-        let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
+        let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());

        // Don't reanimate if we are already visible
        if (this._completionActor.visible) {
            this._completionActor.height = naturalHeight;
        } else {
-            let settings = St.Settings.get();
-            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
            this._completionActor.show();
-            this._completionActor.remove_all_transitions();
-            this._completionActor.ease({
-                height: naturalHeight,
-                opacity: 255,
-                duration,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.removeTweens(this._completionActor);
+            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
+                                                      transition: 'easeOutQuad',
+                                                      height: naturalHeight,
+                                                      opacity: 255
+                                                    });
        }
    }

    _hideCompletions() {
        if (this._completionActor) {
-            let settings = St.Settings.get();
-            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
-            this._completionActor.remove_all_transitions();
-            this._completionActor.ease({
-                height: 0,
-                opacity: 0,
-                duration,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._completionActor.hide();
-                }
-            });
+            Tweener.removeTweens(this._completionActor);
+            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
+                                                      transition: 'easeOutQuad',
+                                                      height: 0,
+                                                      opacity: 0,
+                                                      onComplete: () => {
+                                                          this._completionActor.hide();
+                                                      }
+                                                    });
        }
    }

@@ -1021,10 +1009,7 @@ var LookingGlass = class LookingGlass {
    }

    _queueResize() {
-        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
-            this._resize();
-            return GLib.SOURCE_REMOVE;
-        });
+        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => this._resize());
    }

    _resize() {
@@ -1087,16 +1072,14 @@ var LookingGlass = class LookingGlass {
        this._open = true;
        this._history.lastItem();

-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        // We inverse compensate for the slow-down so you can change the factor
        // through LookingGlass without long waits.
-        let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor;
-        this.actor.ease({
-            y: this._targetY,
-            duration,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(),
+                                       transition: 'easeOutQuad',
+                                       y: this._targetY
+                                     });
    }

    close() {
@@ -1106,21 +1089,19 @@ var LookingGlass = class LookingGlass {
        this._objInspector.actor.hide();

        this._open = false;
-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        this.setBorderPaintTarget(null);

        Main.popModal(this._entry);

-        let settings = St.Settings.get();
-        let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor,
-                                LG_ANIMATION_TIME);
-        this.actor.ease({
-            y: this._hiddenY,
-            duration,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.actor.hide()
-        });
+        Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5),
+                                       transition: 'easeOutQuad',
+                                       y: this._hiddenY,
+                                       onComplete: () => {
+                                           this.actor.hide();
+                                       }
+                                     });
    }
 };
 Signals.addSignalMethods(LookingGlass.prototype);
--- a/js/ui/magnifier.js
+++ b/js/ui/magnifier.js
@@ -107,7 +107,8 @@ var Magnifier = class Magnifier {
        // Create the first ZoomRegion and initialize it according to the
        // magnification settings.

-        [this.xMouse, this.yMouse] = global.get_pointer();
+        let mask;
+        [this.xMouse, this.yMouse, mask] = global.get_pointer();

        let aZoomRegion = new ZoomRegion(this, this._cursorRoot);
        this._zoomRegions.push(aZoomRegion);
@@ -147,7 +148,7 @@ var Magnifier = class Magnifier {
    setActive(activate) {
        let isActive = this.isActive();

-        this._zoomRegions.forEach(zoomRegion => {
+        this._zoomRegions.forEach((zoomRegion, index, array) => {
            zoomRegion.setActive(activate);
        });

@@ -226,14 +227,14 @@ var Magnifier = class Magnifier {
     * @return      true.
     */
    scrollToMousePos() {
-        let [xMouse, yMouse] = global.get_pointer();
+        let [xMouse, yMouse, mask] = global.get_pointer();

        if (xMouse != this.xMouse || yMouse != this.yMouse) {
            this.xMouse = xMouse;
            this.yMouse = yMouse;

            let sysMouseOverAny = false;
-            this._zoomRegions.forEach(zoomRegion => {
+            this._zoomRegions.forEach((zoomRegion, index, array) => {
                if (zoomRegion.scrollToMousePos())
                    sysMouseOverAny = true;
            });
@@ -331,7 +332,7 @@ var Magnifier = class Magnifier {
        this.setCrosshairsClip(clip);

        let theCrossHairs = this._crossHairs;
-        this._zoomRegions.forEach (zoomRegion => {
+        this._zoomRegions.forEach ((zoomRegion, index, array) => {
            zoomRegion.addCrosshairs(theCrossHairs);
        });
    }
@@ -359,7 +360,7 @@ var Magnifier = class Magnifier {
     */
    setCrosshairsColor(color) {
        if (this._crossHairs) {
-            let [res_, clutterColor] = Clutter.Color.from_string(color);
+            let [res, clutterColor] = Clutter.Color.from_string(color);
            this._crossHairs.setColor(clutterColor);
        }
    }
@@ -1514,7 +1515,7 @@ var ZoomRegion = class ZoomRegion {
    }

    _centerFromPointProportional(xPoint, yPoint) {
-        let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI();
+        let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI();
        let halfScreenWidth = global.screen_width / 2;
        let halfScreenHeight = global.screen_height / 2;
        // We want to pad with a constant distance after zooming, so divide
--- a/js/ui/magnifierDBus.js
+++ b/js/ui/magnifierDBus.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ShellMagnifier */

 const Gio = imports.gi.Gio;
 const Main = imports.ui.main;
@@ -125,7 +124,7 @@ var ShellMagnifier = class ShellMagnifier {
        let zoomRegions = Main.magnifier.getZoomRegions();
        let objectPaths = [];
        let thoseZoomers = this._zoomers;
-        zoomRegions.forEach (aZoomRegion => {
+        zoomRegions.forEach ((aZoomRegion, index, array) => {
            let found = false;
            for (let objectPath in thoseZoomers) {
                let proxyAndZoomRegion = thoseZoomers[objectPath];
--- a/js/ui/main.js
+++ b/js/ui/main.js
@@ -1,12 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported componentManager, notificationDaemon, windowAttentionHandler,
-            ctrlAltTabManager, padOsdService, osdWindowManager,
-            osdMonitorLabeler, shellMountOpDBusService, shellDBusService,
-            shellAccessDialogDBusService, shellAudioSelectionDBusService,
-            screenSaverDBus, screencastService, uiGroup, magnifier,
-            xdndHandler, keyboard, kbdA11yDialog, introspectService,
-            start, pushModal, popModal, activateWindow, createLookingGlass,
-            initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -54,7 +46,6 @@ const LOG_DOMAIN = 'GNOME Shell';
 const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a';

 var componentManager = null;
-var extensionManager = null;
 var panel = null;
 var overview = null;
 var runDialog = null;
@@ -235,8 +226,7 @@ function _initializeUI() {
    _startDate = new Date();

    ExtensionDownloader.init();
-    extensionManager = new ExtensionSystem.ExtensionManager();
-    extensionManager.init();
+    ExtensionSystem.init();

    if (sessionMode.isGreeter && screenShield) {
        layoutManager.connect('startup-prepared', () => {
@@ -666,7 +656,7 @@ function _queueBeforeRedraw(workId) {
 *
 * Returns: A string work identifier
 */
-function initializeDeferredWork(actor, callback) {
+function initializeDeferredWork(actor, callback, props) {
    // Turn into a string so we can use as an object property
    let workId = `${(++_deferredWorkSequence)}`;
    _deferredWorkData[workId] = { 'actor': actor,
--- a/js/ui/messageList.js
+++ b/js/ui/messageList.js
@@ -4,9 +4,10 @@ const MessageTray = imports.ui.messageTray;
 const Signals = imports.signals;

 const Calendar = imports.ui.calendar;
+const Tweener = imports.ui.tweener;
 const Util = imports.misc.util;

-var MESSAGE_ANIMATION_TIME = 100;
+var MESSAGE_ANIMATION_TIME = 0.1;

 var DEFAULT_EXPAND_LINES = 6;

@@ -129,12 +130,12 @@ var URLHighlighter = class URLHighlighter {
    }

    _findUrlAtPos(event) {
-        let success_;
+        let success;
        let [x, y] = event.get_coords();
-        [success_, x, y] = this.actor.transform_stage_point(x, y);
+        [success, x, y] = this.actor.transform_stage_point(x, y);
        let findPos = -1;
        for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
-            let [success_, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
+            let [success, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
            if (py > y || py + lineHeight < y || x < px)
                continue;
            findPos = i;
@@ -439,17 +440,15 @@ var Message = class Message {
        }

        if (animate) {
-            this._bodyStack.ease_property('@layout.expansion', 1, {
-                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                duration: MessageTray.ANIMATION_TIME,
-            });
-
+            Tweener.addTween(this._bodyStack.layout_manager,
+                             { expansion: 1,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
            this._actionBin.scale_y = 0;
-            this._actionBin.ease({
-                scale_y: 1,
-                duration: MessageTray.ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(this._actionBin,
+                             { scale_y: 1,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
        } else {
            this._bodyStack.layout_manager.expansion = 1;
            this._actionBin.scale_y = 1;
@@ -460,20 +459,18 @@ var Message = class Message {

    unexpand(animate) {
        if (animate) {
-            this._bodyStack.ease_property('@layout.expansion', 0, {
-                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                duration: MessageTray.ANIMATION_TIME,
-            });
-
-            this._actionBin.ease({
-                scale_y: 0,
-                duration: MessageTray.ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._actionBin.hide();
-                    this.expanded = false;
-                }
-            });
+            Tweener.addTween(this._bodyStack.layout_manager,
+                             { expansion: 0,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
+            Tweener.addTween(this._actionBin,
+                             { scale_y: 0,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this._actionBin.hide();
+                                   this.expanded = false;
+                               } });
        } else {
            this._bodyStack.layout_manager.expansion = 0;
            this._actionBin.scale_y = 0;
@@ -584,12 +581,10 @@ var MessageListSection = class MessageListSection {
        this._list.insert_child_at_index(obj.container, index);

        if (animate)
-            obj.container.ease({
-                scale_x: 1,
-                scale_y: 1,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(obj.container, { scale_x: 1,
+                                              scale_y: 1,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad' });
    }

    moveMessage(message, index, animate) {
@@ -602,20 +597,16 @@ var MessageListSection = class MessageListSection {

        let onComplete = () => {
            this._list.set_child_at_index(obj.container, index);
-            obj.container.ease({
-                scale_x: 1,
-                scale_y: 1,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(obj.container, { scale_x: 1,
+                                              scale_y: 1,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad' });
        };
-        obj.container.ease({
-            scale_x: 0,
-            scale_y: 0,
-            duration: MESSAGE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete
-        });
+        Tweener.addTween(obj.container, { scale_x: 0,
+                                          scale_y: 0,
+                                          time: MESSAGE_ANIMATION_TIME,
+                                          transition: 'easeOutQuad',
+                                          onComplete: onComplete });
    }

    removeMessage(message, animate) {
@@ -628,16 +619,13 @@ var MessageListSection = class MessageListSection {
        this._messages.delete(message);

        if (animate) {
-            obj.container.ease({
-                scale_x: 0,
-                scale_y: 0,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    obj.container.destroy();
-                    global.sync_pointer();
-                }
-            });
+            Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad',
+                                              onComplete() {
+                                                  obj.container.destroy();
+                                                  global.sync_pointer();
+                                              } });
        } else {
            obj.container.destroy();
            global.sync_pointer();
@@ -659,14 +647,15 @@ var MessageListSection = class MessageListSection {
            for (let i = 0; i < messages.length; i++) {
                let message = messages[i];
                let obj = this._messages.get(message);
-                obj.container.ease({
-                    anchor_x: this._list.width,
-                    opacity: 0,
-                    duration: MESSAGE_ANIMATION_TIME,
-                    delay: i * delay,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete: () => message.close()
-                });
+                Tweener.addTween(obj.container,
+                                 { anchor_x: this._list.width,
+                                   opacity: 0,
+                                   time: MESSAGE_ANIMATION_TIME,
+                                   delay: i * delay,
+                                   transition: 'easeOutQuad',
+                                   onComplete() {
+                                       message.close();
+                                   } });
            }
        }
    }
--- a/js/ui/messageTray.js
+++ b/js/ui/messageTray.js
@@ -1,7 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported NotificationPolicy, NotificationGenericPolicy,
-   NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel,
-   SystemNotificationSource, MessageTray */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -12,14 +9,15 @@ const GnomeSession = imports.misc.gnomeSession;
 const Layout = imports.ui.layout;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings';

-var ANIMATION_TIME = 200;
-var NOTIFICATION_TIMEOUT = 4000;
+var ANIMATION_TIME = 0.2;
+var NOTIFICATION_TIMEOUT = 4;

-var HIDE_TIMEOUT = 200;
-var LONGER_HIDE_TIMEOUT = 600;
+var HIDE_TIMEOUT = 0.2;
+var LONGER_HIDE_TIMEOUT = 0.6;

 var MAX_NOTIFICATIONS_IN_QUEUE = 3;
 var MAX_NOTIFICATIONS_PER_SOURCE = 3;
@@ -652,7 +650,7 @@ class SourceActorWithLabel extends SourceActor {

        let childBox = new Clutter.ActorBox();

-        let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
+        let [minWidth, minHeight, naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
        let direction = this.get_text_direction();

        if (direction == Clutter.TextDirection.LTR) {
@@ -829,7 +827,7 @@ Signals.addSignalMethods(Source.prototype);

 var MessageTray = class MessageTray {
    constructor() {
-        this._presence = new GnomeSession.Presence((proxy, _error) => {
+        this._presence = new GnomeSession.Presence((proxy, error) => {
            this._onStatusChanged(proxy.status);
        });
        this._busy = false;
@@ -1129,14 +1127,14 @@ var MessageTray = class MessageTray {
            // this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us
            // to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still
            // close to its previous position, we extend the timeout once.
-            let [x, y] = global.get_pointer();
+            let [x, y, mods] = global.get_pointer();
            this._notificationLeftMouseX = x;
            this._notificationLeftMouseY = y;

            // We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it.
            // We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
            // That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
-            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT;
+            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000;
            this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
            GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
        }
@@ -1158,7 +1156,7 @@ var MessageTray = class MessageTray {
    }

    _onNotificationLeftTimeout() {
-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        // We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side.
        if (this._notificationLeftMouseX > -1 &&
            y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD &&
@@ -1166,7 +1164,7 @@ var MessageTray = class MessageTray {
            x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
            x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
            this._notificationLeftMouseX = -1;
-            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT,
+            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000,
                                                                   this._onNotificationLeftTimeout.bind(this));
            GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
        } else {
@@ -1248,6 +1246,34 @@ var MessageTray = class MessageTray {
        this._notificationExpired = false;
    }

+    _tween(actor, statevar, value, params) {
+        let onComplete = params.onComplete;
+        let onCompleteScope = params.onCompleteScope;
+        let onCompleteParams = params.onCompleteParams;
+
+        params.onComplete = this._tweenComplete;
+        params.onCompleteScope = this;
+        params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams];
+
+        // Remove other tweens that could mess with the state machine
+        Tweener.removeTweens(actor);
+        Tweener.addTween(actor, params);
+
+        let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING;
+        this[statevar] = valuing;
+    }
+
+    _tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) {
+        this[statevar] = value;
+        if (onComplete)
+            onComplete.apply(onCompleteScope, onCompleteParams);
+        this._updateState();
+    }
+
+    _clampOpacity() {
+        this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255));
+    }
+
    _onIdleMonitorBecameActive() {
        this._userActiveWhileNotificationShown = true;
        this._updateNotificationTimeout(2000);
@@ -1274,6 +1300,7 @@ var MessageTray = class MessageTray {

        this._bannerBin.add_actor(this._banner.actor);

+        this._bannerBin._opacity = 0;
        this._bannerBin.opacity = 0;
        this._bannerBin.y = -this._banner.actor.height;
        this.actor.show();
@@ -1281,7 +1308,7 @@ var MessageTray = class MessageTray {
        Meta.disable_unredirect_for_display(global.display);
        this._updateShowingNotification();

-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        // We save the position of the mouse at the time when we started showing the notification
        // in order to determine if the notification popped up under it. We make that check if
        // the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't
@@ -1319,28 +1346,22 @@ var MessageTray = class MessageTray {
        // We use this._showNotificationCompleted() onComplete callback to extend the time the updated
        // notification is being shown.

-        this._notificationState = State.SHOWING;
-        this._bannerBin.remove_all_transitions();
-        this._bannerBin.ease({
-            opacity: 255,
-            duration: ANIMATION_TIME,
-            mode: Clutter.AnimationMode.LINEAR
-        });
-        this._bannerBin.ease({
-            y: 0,
-            duration: ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_BACK,
-            onComplete: () => {
-                this._notificationState = State.SHOWN;
-                this._showNotificationCompleted();
-                this._updateState();
-            }
-        });
+        let tweenParams = { y: 0,
+                            _opacity: 255,
+                            time: ANIMATION_TIME,
+                            transition: 'easeOutBack',
+                            onUpdate: this._clampOpacity,
+                            onUpdateScope: this,
+                            onComplete: this._showNotificationCompleted,
+                            onCompleteScope: this
+                          };
+
+        this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams);
    }

    _showNotificationCompleted() {
        if (this._notification.urgency != Urgency.CRITICAL)
-            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT);
+            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000);
    }

    _updateNotificationTimeout(timeout) {
@@ -1357,7 +1378,7 @@ var MessageTray = class MessageTray {
    }

    _notificationTimeout() {
-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) {
            // The mouse is moving towards the notification, so don't
            // hide it yet. (We just create a new timeout (and destroy
@@ -1393,26 +1414,20 @@ var MessageTray = class MessageTray {
        }

        this._resetNotificationLeftTimeout();
-        this._bannerBin.remove_all_transitions();

        if (animate) {
-            this._notificationState = State.HIDING;
-            this._bannerBin.ease({
-                opacity: 0,
-                duration: ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_BACK
-            });
-            this._bannerBin.ease({
-                y: -this._bannerBin.height,
-                duration: ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_BACK,
-                onComplete: () => {
-                    this._notificationState = State.HIDDEN;
-                    this._hideNotificationCompleted();
-                    this._updateState();
-                }
-            });
+            this._tween(this._bannerBin, '_notificationState', State.HIDDEN,
+                        { y: -this._bannerBin.height,
+                          _opacity: 0,
+                          time: ANIMATION_TIME,
+                          transition: 'easeOutBack',
+                          onUpdate: this._clampOpacity,
+                          onUpdateScope: this,
+                          onComplete: this._hideNotificationCompleted,
+                          onCompleteScope: this
+                        });
        } else {
+            Tweener.removeTweens(this._bannerBin);
            this._bannerBin.y = -this._bannerBin.height;
            this._bannerBin.opacity = 0;
            this._notificationState = State.HIDDEN;
--- a/js/ui/modalDialog.js
+++ b/js/ui/modalDialog.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ModalDialog */

 const { Atk, Clutter, GObject, Shell, St } = imports.gi;

@@ -8,9 +7,10 @@ const Layout = imports.ui.layout;
 const Lightbox = imports.ui.lightbox;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

-var OPEN_AND_CLOSE_TIME = 100;
-var FADE_OUT_DIALOG_TIME = 1000;
+var OPEN_AND_CLOSE_TIME = 0.1;
+var FADE_OUT_DIALOG_TIME = 1.0;

 var State = {
    OPENED: 0,
@@ -124,15 +124,15 @@ var ModalDialog = GObject.registerClass({
            this._lightbox.show();
        this.opacity = 0;
        this.show();
-        this.ease({
-            opacity: 255,
-            duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._setState(State.OPENED);
-                this.emit('opened');
-            }
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this._setState(State.OPENED);
+                               this.emit('opened');
+                           }
+                         });
    }

    setInitialKeyFocus(actor) {
@@ -175,16 +175,15 @@ var ModalDialog = GObject.registerClass({
        this.popModal(timestamp);
        this._savedKeyFocus = null;

-        if (this._shouldFadeOut) {
-            this.ease({
-                opacity: 0,
-                duration: OPEN_AND_CLOSE_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => this._closeComplete()
-            });
-        } else {
+        if (this._shouldFadeOut)
+            Tweener.addTween(this,
+                             { opacity: 0,
+                               time: OPEN_AND_CLOSE_TIME,
+                               transition: 'easeOutQuad',
+                               onComplete: this._closeComplete.bind(this)
+                             });
+        else
            this._closeComplete();
-        }
    }

    // Drop modal status without closing the dialog; this makes the
@@ -249,11 +248,13 @@ var ModalDialog = GObject.registerClass({
            return;

        this.popModal(timestamp);
-        this.dialogLayout.ease({
-            opacity: 0,
-            duration: FADE_OUT_DIALOG_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.state = State.FADED_OUT
-        });
+        Tweener.addTween(this.dialogLayout,
+                         { opacity: 0,
+                           time: FADE_OUT_DIALOG_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this._setState(State.FADED_OUT);
+                           }
+                         });
    }
 });
--- a/js/ui/mpris.js
+++ b/js/ui/mpris.js
@@ -1,4 +1,3 @@
-/* exported MediaSection */
 const { Gio, Shell, St } = imports.gi;
 const Signals = imports.signals;

--- a/js/ui/notificationDaemon.js
+++ b/js/ui/notificationDaemon.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported NotificationDaemon */

 const { GdkPixbuf, Gio, GLib, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -65,7 +64,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
    _imageForNotificationData(hints) {
        if (hints['image-data']) {
            let [width, height, rowStride, hasAlpha,
-                 bitsPerSample, nChannels_, data] = hints['image-data'];
+                 bitsPerSample, nChannels, data] = hints['image-data'];
            return Shell.util_create_pixbuf_from_data(data, GdkPixbuf.Colorspace.RGB, hasAlpha,
                                                      bitsPerSample, width, height, rowStride);
        } else if (hints['image-path']) {
@@ -260,7 +259,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
    }

    _notifyForSource(source, ndata) {
-        let [id_, icon, summary, body, actions, hints, notification] =
+        let [id, icon, summary, body, actions, hints, notification] =
            [ndata.id, ndata.icon, ndata.summary, ndata.body,
             ndata.actions, ndata.hints, ndata.notification];

@@ -750,33 +749,29 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
    _loadNotifications() {
        this._isLoading = true;

-        try {
-            let value = global.get_persistent_state('a(sa(sv))', 'notifications');
-            if (value) {
-                let sources = value.deep_unpack();
-                sources.forEach(([appId, notifications]) => {
-                    if (notifications.length == 0)
+        let value = global.get_persistent_state('a(sa(sv))', 'notifications');
+        if (value) {
+            let sources = value.deep_unpack();
+            sources.forEach(([appId, notifications]) => {
+                if (notifications.length == 0)
+                    return;
+
+                let source;
+                try {
+                    source = this._ensureAppSource(appId);
+                } catch (e) {
+                    if (e instanceof InvalidAppError)
                        return;
+                    throw e;
+                }

-                    let source;
-                    try {
-                        source = this._ensureAppSource(appId);
-                    } catch (e) {
-                        if (e instanceof InvalidAppError)
-                            return;
-                        throw e;
-                    }
-
-                    notifications.forEach(([notificationId, notification]) => {
-                        source.addNotification(notificationId, notification.deep_unpack(), false);
-                    });
+                notifications.forEach(([notificationId, notification]) => {
+                    source.addNotification(notificationId, notification.deep_unpack(), false);
                });
-            }
-        } catch (e) {
-            logError(e, 'Failed to load saved notifications');
-        } finally {
-            this._isLoading = false;
+            });
        }
+
+        this._isLoading = false;
    }

    _saveNotifications() {
--- a/js/ui/osdMonitorLabeler.js
+++ b/js/ui/osdMonitorLabeler.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported OsdMonitorLabeler */

 const { Clutter, Gio, Meta, St } = imports.gi;

--- a/js/ui/osdWindow.js
+++ b/js/ui/osdWindow.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported OsdWindowManager */

 const { Clutter, GLib, GObject, Meta, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -7,10 +6,44 @@ const Mainloop = imports.mainloop;
 const BarLevel = imports.ui.barLevel;
 const Layout = imports.ui.layout;
 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

 var HIDE_TIMEOUT = 1500;
-var FADE_TIME = 100;
-var LEVEL_ANIMATION_TIME = 100;
+var FADE_TIME = 0.1;
+var LEVEL_ANIMATION_TIME = 0.1;
+
+var LevelBar = class extends BarLevel.BarLevel {
+    constructor() {
+        super(0, { styleClass: 'level' });
+
+        this._level = 0;
+        this._maxLevel = 100;
+
+        this.actor.accessible_name = _("Volume");
+
+        this.actor.connect('notify::width', () => this.level = this.level);
+    }
+
+    get level() {
+        return this._level;
+    }
+
+    set level(value) {
+        this._level = Math.max(0, Math.min(value, this._maxLevel));
+
+        this.setValue(this._level / 100);
+    }
+
+    get maxLevel() {
+        return this._maxLevel;
+    }
+
+    set maxLevel(value) {
+        this._maxLevel = Math.max(100, value);
+
+        this.setMaximumValue(this._maxLevel / 100);
+    }
+};

 var OsdWindowConstraint = GObject.registerClass(
 class OsdWindowConstraint extends Clutter.Constraint {
@@ -65,11 +98,8 @@ var OsdWindow = class {
        this._label = new St.Label();
        this._box.add(this._label);

-        this._level = new BarLevel.BarLevel({
-            style_class: 'level',
-            value: 0
-        });
-        this._box.add(this._level);
+        this._level = new LevelBar();
+        this._box.add(this._level.actor);

        this._hideTimeoutId = 0;
        this._reset();
@@ -108,21 +138,21 @@ var OsdWindow = class {
            this._label.text = label;
    }

-    setLevel(value) {
-        this._level.visible = (value != undefined);
-        if (value != undefined) {
+    setLevel(level) {
+        this._level.actor.visible = (level != undefined);
+        if (level != undefined) {
            if (this.actor.visible)
-                this._level.ease_property('value', value, {
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    duration: LEVEL_ANIMATION_TIME
-                });
+                Tweener.addTween(this._level,
+                                 { level: level,
+                                   time: LEVEL_ANIMATION_TIME,
+                                   transition: 'easeOutQuad' });
            else
-                this._level.value = value;
+                this._level.level = level;
        }
    }

-    setMaxLevel(maxLevel = 1) {
-        this._level.maximum_value = maxLevel;
+    setMaxLevel(maxLevel = 100) {
+        this._level.maxLevel = maxLevel;
    }

    show() {
@@ -135,11 +165,10 @@ var OsdWindow = class {
            this.actor.opacity = 0;
            this.actor.get_parent().set_child_above_sibling(this.actor, null);

-            this.actor.ease({
-                opacity: 255,
-                duration: FADE_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(this.actor,
+                             { opacity: 255,
+                               time: FADE_TIME,
+                               transition: 'easeOutQuad' });
        }

        if (this._hideTimeoutId)
@@ -159,15 +188,15 @@ var OsdWindow = class {

    _hide() {
        this._hideTimeoutId = 0;
-        this.actor.ease({
-            opacity: 0,
-            duration: FADE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._reset();
-                Meta.enable_unredirect_for_display(global.display);
-            }
-        });
+        Tweener.addTween(this.actor,
+                         { opacity: 0,
+                           time: FADE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this._reset();
+                               Meta.enable_unredirect_for_display(global.display);
+                           }
+                         });
        return GLib.SOURCE_REMOVE;
    }

--- a/js/ui/overview.js
+++ b/js/ui/overview.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Overview */

 const { Clutter, GLib, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -13,15 +12,16 @@ const Main = imports.ui.main;
 const MessageTray = imports.ui.messageTray;
 const OverviewControls = imports.ui.overviewControls;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const WorkspaceThumbnail = imports.ui.workspaceThumbnail;

 // Time for initial animation going into Overview mode
-var ANIMATION_TIME = 250;
+var ANIMATION_TIME = 0.25;

 // Must be less than ANIMATION_TIME, since we switch to
 // or from the overview completely after ANIMATION_TIME,
 // and don't want the shading animation to get cut off
-var SHADE_ANIMATION_TIME = 200;
+var SHADE_ANIMATION_TIME = .20;

 var DND_WINDOW_SWITCH_TIMEOUT = 750;

@@ -173,28 +173,24 @@ var Overview = class {
    _unshadeBackgrounds() {
        let backgrounds = this._backgroundGroup.get_children();
        for (let i = 0; i < backgrounds.length; i++) {
-            backgrounds[i].ease_property('brightness', 1.0, {
-                duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
-            backgrounds[i].ease_property('vignette-sharpness', 0.0, {
-                duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(backgrounds[i],
+                             { brightness: 1.0,
+                               vignette_sharpness: 0.0,
+                               time: SHADE_ANIMATION_TIME,
+                               transition: 'easeOutQuad'
+                             });
        }
    }

    _shadeBackgrounds() {
        let backgrounds = this._backgroundGroup.get_children();
        for (let i = 0; i < backgrounds.length; i++) {
-            backgrounds[i].ease_property('brightness', Lightbox.VIGNETTE_BRIGHTNESS, {
-                duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
-            backgrounds[i].ease_property('vignette-sharpness', Lightbox.VIGNETTE_SHARPNESS, {
-                duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(backgrounds[i],
+                             { brightness: Lightbox.VIGNETTE_BRIGHTNESS,
+                               vignette_sharpness: Lightbox.VIGNETTE_SHARPNESS,
+                               time: SHADE_ANIMATION_TIME,
+                               transition: 'easeOutQuad'
+                             });
        }
    }

@@ -390,16 +386,16 @@ var Overview = class {
        this.emit('windows-restacked', stackIndices);
    }

-    beginItemDrag(_source) {
+    beginItemDrag(source) {
        this.emit('item-drag-begin');
        this._inItemDrag = true;
    }

-    cancelledItemDrag(_source) {
+    cancelledItemDrag(source) {
        this.emit('item-drag-cancelled');
    }

-    endItemDrag(_source) {
+    endItemDrag(source) {
        if (!this._inItemDrag)
            return;
        this.emit('item-drag-end');
@@ -430,11 +426,10 @@ var Overview = class {
    fadeInDesktop() {
        this._desktopFade.opacity = 0;
        this._desktopFade.show();
-        this._desktopFade.ease({
-            opacity: 255,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: ANIMATION_TIME
-        });
+        Tweener.addTween(this._desktopFade,
+                         { opacity: 255,
+                           time: ANIMATION_TIME,
+                           transition: 'easeOutQuad' });
    }

    fadeOutDesktop() {
@@ -448,11 +443,11 @@ var Overview = class {

        this._desktopFade.opacity = 255;
        this._desktopFade.show();
-        this._desktopFade.ease({
-            opacity: 0,
-            mode: Clutter.Animates.EASE_OUT_QUAD,
-            duration: ANIMATION_TIME
-        });
+        Tweener.addTween(this._desktopFade,
+                         { opacity: 0,
+                           time: ANIMATION_TIME,
+                           transition: 'easeOutQuad'
+                         });
    }

    // Checks if the Activities button is currently sensitive to
@@ -532,12 +527,13 @@ var Overview = class {
        this.viewSelector.show();

        this._overview.opacity = 0;
-        this._overview.ease({
-            opacity: 255,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: ANIMATION_TIME,
-            onComplete: () => this._showDone()
-        });
+        Tweener.addTween(this._overview,
+                         { opacity: 255,
+                           transition: 'easeOutQuad',
+                           time: ANIMATION_TIME,
+                           onComplete: this._showDone,
+                           onCompleteScope: this
+                         });
        this._shadeBackgrounds();

        this._coverPane.raise_top();
@@ -595,12 +591,13 @@ var Overview = class {
        this.viewSelector.animateFromOverview();

        // Make other elements fade out.
-        this._overview.ease({
-            opacity: 0,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: ANIMATION_TIME,
-            onComplete: () => this._hideDone()
-        });
+        Tweener.addTween(this._overview,
+                         { opacity: 0,
+                           transition: 'easeOutQuad',
+                           time: ANIMATION_TIME,
+                           onComplete: this._hideDone,
+                           onCompleteScope: this
+                         });
        this._unshadeBackgrounds();

        this._coverPane.raise_top();
--- a/js/ui/overviewControls.js
+++ b/js/ui/overviewControls.js
@@ -1,15 +1,15 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ControlsManager */

 const { Clutter, GObject, Meta, St } = imports.gi;

 const Dash = imports.ui.dash;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const ViewSelector = imports.ui.viewSelector;
 const WorkspaceThumbnail = imports.ui.workspaceThumbnail;

-var SIDE_CONTROLS_ANIMATION_TIME = 160;
+var SIDE_CONTROLS_ANIMATION_TIME = 0.16;

 function getRtlSlideDirection(direction, actor) {
    let rtl = (actor.text_direction == Clutter.TextDirection.RTL);
@@ -25,21 +25,11 @@ var SlideDirection = {
    RIGHT: 1
 };

-var SlideLayout = GObject.registerClass({
-    Properties: {
-        'slide-x': GObject.ParamSpec.double(
-            'slide-x', 'slide-x', 'slide-x',
-            GObject.ParamFlags.READWRITE,
-            0, 1, 1),
-        'translation-x': GObject.ParamSpec.double(
-            'translation-x', 'translation-x', 'translation-x',
-            GObject.ParamFlags.READWRITE,
-            -Infinity, Infinity, 0)
-    }
-}, class SlideLayout extends Clutter.FixedLayout {
+var SlideLayout = GObject.registerClass(
+class SlideLayout extends Clutter.FixedLayout {
    _init(params) {
        this._slideX = 1;
-        this._translationX = 0;
+        this._translationX = undefined;
        this._direction = SlideDirection.LEFT;

        super._init(params);
@@ -79,17 +69,12 @@ var SlideLayout = GObject.registerClass({
        child.allocate(actorBox, flags);
    }

-    // eslint-disable-next-line camelcase
-    set slide_x(value) {
-        if (this._slideX == value)
-            return;
+    set slideX(value) {
        this._slideX = value;
-        this.notify('slide-x');
        this.layout_changed();
    }

-    // eslint-disable-next-line camelcase
-    get slide_x() {
+    get slideX() {
        return this._slideX;
    }

@@ -102,17 +87,12 @@ var SlideLayout = GObject.registerClass({
        return this._direction;
    }

-    // eslint-disable-next-line camelcase
-    set translation_x(value) {
-        if (this._translationX == value)
-            return;
+    set translationX(value) {
        this._translationX = value;
-        this.notify('translation-x');
        this.layout_changed();
    }

-    // eslint-disable-next-line camelcase
-    get translation_x() {
+    get translationX() {
        return this._translationX;
    }
 });
@@ -146,10 +126,9 @@ var SlidingControl = class {
    }

    _updateSlide() {
-        this.actor.ease_property('@layout.slide-x', this._getSlide(), {
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: SIDE_CONTROLS_ANIMATION_TIME,
-        });
+        Tweener.addTween(this.layout, { slideX: this._getSlide(),
+                                        time: SIDE_CONTROLS_ANIMATION_TIME,
+                                        transition: 'easeOutQuad' });
    }

    getVisibleWidth() {
@@ -181,14 +160,13 @@ var SlidingControl = class {
            translationEnd = translation;
        }

-        if (this.layout.translation_x == translationEnd)
+        if (this.layout.translationX == translationEnd)
            return;

-        this.layout.translation_x = translationStart;
-        this.actor.ease_property('@layout.translation-x', translationEnd, {
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: SIDE_CONTROLS_ANIMATION_TIME,
-        });
+        this.layout.translationX = translationStart;
+        Tweener.addTween(this.layout, { translationX: translationEnd,
+                                        time: SIDE_CONTROLS_ANIMATION_TIME,
+                                        transition: 'easeOutQuad' });
    }

    _onOverviewHiding() {
@@ -217,30 +195,28 @@ var SlidingControl = class {
    }

    fadeIn() {
-        this.actor.ease({
-            opacity: 255,
-            duration: SIDE_CONTROLS_ANIMATION_TIME / 2,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD
-        });
+        Tweener.addTween(this.actor, { opacity: 255,
+                                       time: SIDE_CONTROLS_ANIMATION_TIME / 2,
+                                       transition: 'easeInQuad'
+                                     });
    }

    fadeHalf() {
-        this.actor.ease({
-            opacity: 128,
-            duration: SIDE_CONTROLS_ANIMATION_TIME / 2,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this.actor, { opacity: 128,
+                                       time: SIDE_CONTROLS_ANIMATION_TIME / 2,
+                                       transition: 'easeOutQuad'
+                                     });
    }

    slideIn() {
        this._visible = true;
-        // we will update slide_x and the translation from pageEmpty
+        // we will update slideX and the translation from pageEmpty
    }

    slideOut() {
        this._visible = false;
        this._updateTranslation();
-        // we will update slide_x from pageEmpty
+        // we will update slideX from pageEmpty
    }

    pageEmpty() {
@@ -248,7 +224,7 @@ var SlidingControl = class {
        // selector; this means we can now safely set the full slide for
        // the next page, since slideIn or slideOut might have been called,
        // changing the visiblity
-        this.layout.slide_x = this._getSlide();
+        this.layout.slideX = this._getSlide();
        this._updateTranslation();
    }
 };
@@ -447,6 +423,17 @@ var ControlsManager = class {
        layout.connect('allocation-changed', this._updateWorkspacesGeometry.bind(this));

        Main.overview.connect('showing', this._updateSpacerVisibility.bind(this));
+        Main.overview.connect('item-drag-begin', () => {
+            let activePage = this.viewSelector.getActivePage();
+            if (activePage != ViewSelector.ViewPage.WINDOWS)
+                this.viewSelector.fadeHalf();
+        });
+        Main.overview.connect('item-drag-end', () => {
+            this.viewSelector.fadeIn();
+        });
+        Main.overview.connect('item-drag-cancelled', () => {
+            this.viewSelector.fadeIn();
+        });
    }

    _updateWorkspacesGeometry() {
--- a/js/ui/padOsd.js
+++ b/js/ui/padOsd.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PadOsdService */

 const { Atk, Clutter, GDesktopEnums, Gio,
        GLib, GObject, Gtk, Meta, Rsvg, St } = imports.gi;
@@ -296,7 +295,7 @@ var PadDiagram = GObject.registerClass({
 }, class PadDiagram extends St.DrawingArea {
    _init(params) {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/pad-osd.css');
-        let [success_, css] = file.load_contents(null);
+        let [success, css, etag] = file.load_contents(null);
        if (css instanceof Uint8Array)
            css = imports.byteArray.toString(css);
        this._curEdited = null;
@@ -307,12 +306,10 @@ var PadDiagram = GObject.registerClass({
        super._init(params);
    }

-    // eslint-disable-next-line camelcase
    get left_handed() {
        return this._leftHanded;
    }

-    // eslint-disable-next-line camelcase
    set left_handed(leftHanded) {
        this._leftHanded = leftHanded;
    }
@@ -331,12 +328,10 @@ var PadDiagram = GObject.registerClass({
        this._handle = this._composeStyledDiagram();
    }

-    // eslint-disable-next-line camelcase
    get editor_actor() {
        return this._editorActor;
    }

-    // eslint-disable-next-line camelcase
    set editor_actor(actor) {
        actor.hide();
        this._editorActor = actor;
@@ -401,8 +396,8 @@ var PadDiagram = GObject.registerClass({
    }

    _allocateChild(child, x, y, direction) {
-        let [, natHeight] = child.get_preferred_height(-1);
-        let [, natWidth] = child.get_preferred_width(natHeight);
+        let [prefHeight, natHeight] = child.get_preferred_height(-1);
+        let [prefWidth, natWidth] = child.get_preferred_width(natHeight);
        let childBox = new Clutter.ActorBox();

        if (direction == LTR) {
@@ -424,13 +419,13 @@ var PadDiagram = GObject.registerClass({

        for (let i = 0; i < this._labels.length; i++) {
            let [label, action, idx, dir] = this._labels[i];
-            let [found_, x, y, arrangement] = this.getLabelCoords(action, idx, dir);
+            let [found, x, y, arrangement] = this.getLabelCoords(action, idx, dir);
            this._allocateChild(label, x, y, arrangement);
        }

        if (this._editorActor && this._curEdited) {
-            let [label_, action, idx, dir] = this._curEdited;
-            let [found_, x, y, arrangement] = this.getLabelCoords(action, idx, dir);
+            let [label, action, idx, dir] = this._curEdited;
+            let [found, x, y, arrangement] = this.getLabelCoords(action, idx, dir);
            this._allocateChild(this._editorActor, x, y, arrangement);
        }
    }
@@ -566,7 +561,7 @@ var PadDiagram = GObject.registerClass({
        if (str != null) {
            label.set_text(str);

-            let [found_, x, y, arrangement] = this.getLabelCoords(action, idx, dir);
+            let [found, x, y, arrangement] = this.getLabelCoords(action, idx, dir);
            this._allocateChild(label, x, y, arrangement);
        }
        label.show();
@@ -794,13 +789,13 @@ var PadOsd = class {
        } else if (event.get_source_device() == this.padDevice &&
                   event.type() == Clutter.EventType.PAD_STRIP) {
            if (this._editionMode) {
-                let [retval_, number, mode] = event.get_pad_event_details();
+                let [retval, number, mode] = event.get_pad_event_details();
                this._startStripActionEdition(number, UP, mode);
            }
        } else if (event.get_source_device() == this.padDevice &&
                   event.type() == Clutter.EventType.PAD_RING) {
            if (this._editionMode) {
-                let [retval_, number, mode] = event.get_pad_event_details();
+                let [retval, number, mode] = event.get_pad_event_details();
                this._startRingActionEdition(number, CCW, mode);
            }
        }
--- a/Show More
+++ b/Show More