Compare commits
1 Commits
3.34.5
...
gbsneto/mo
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
602cec9b8e |
@@ -1,5 +1,6 @@
|
||||
stages:
|
||||
- review
|
||||
- source_check
|
||||
- build
|
||||
- test
|
||||
|
||||
@@ -25,27 +26,19 @@ check_commit_log:
|
||||
|
||||
js_check:
|
||||
image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
|
||||
stage: review
|
||||
stage: source_check
|
||||
script:
|
||||
- find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG
|
||||
- (! grep -q . $JS_LOG)
|
||||
<<: *only_default
|
||||
only:
|
||||
changes:
|
||||
- js/**/*
|
||||
artifacts:
|
||||
paths:
|
||||
- ${JS_LOG}
|
||||
when: on_failure
|
||||
|
||||
eslint:
|
||||
image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
|
||||
stage: review
|
||||
script:
|
||||
- ./.gitlab-ci/run-eslint.sh
|
||||
<<: *only_default
|
||||
artifacts:
|
||||
paths:
|
||||
- reports
|
||||
when: always
|
||||
|
||||
build:
|
||||
image: registry.gitlab.gnome.org/gnome/mutter/master:v2
|
||||
stage: build
|
||||
@@ -54,7 +47,7 @@ build:
|
||||
- meson mutter mutter/build --prefix=/usr -Dtests=false
|
||||
- ninja -C mutter/build install
|
||||
script:
|
||||
- meson . build -Dbuiltype=debugoptimized -Dman=false --werror
|
||||
- meson . build -Dbuiltype=debugoptimized
|
||||
- ninja -C build
|
||||
- ninja -C build install
|
||||
<<: *only_default
|
||||
@@ -67,8 +60,6 @@ build:
|
||||
test:
|
||||
image: registry.gitlab.gnome.org/gnome/mutter/master:v2
|
||||
stage: test
|
||||
variables:
|
||||
XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
|
||||
before_script:
|
||||
- ninja -C mutter/build install
|
||||
script:
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
FROM registry.fedoraproject.org/fedora:latest
|
||||
|
||||
RUN dnf -y update && dnf -y upgrade && \
|
||||
dnf install -y 'dnf-command(copr)' git && \
|
||||
dnf install -y 'dnf-command(copr)' && \
|
||||
|
||||
# For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'`
|
||||
dnf install -y findutils mozjs60-devel && \
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
#!/usr/bin/bash
|
||||
|
||||
shell_branch=$(git describe --contains --all HEAD)
|
||||
mutter_target=
|
||||
|
||||
git clone https://gitlab.gnome.org/GNOME/mutter.git
|
||||
@@ -25,7 +26,8 @@ if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
|
||||
fi
|
||||
|
||||
if [ -z "$mutter_target" ]; then
|
||||
mutter_target=$(git branch -r -l origin/$CI_COMMIT_REF_NAME)
|
||||
mutter_target=$(git branch -r -l origin/$shell_branch)
|
||||
mutter_target=${mutter_target:-$(git branch -r -l ${shell_branch#remotes/})}
|
||||
mutter_target=${mutter_target:-origin/master}
|
||||
echo Using $mutter_target instead
|
||||
fi
|
||||
|
||||
@@ -1,105 +0,0 @@
|
||||
#!/usr/bin/env bash
|
||||
|
||||
OUTPUT_REGULAR=reports/lint-regular-report.txt
|
||||
OUTPUT_LEGACY=reports/lint-legacy-report.txt
|
||||
OUTPUT_FINAL=reports/lint-common-report.txt
|
||||
|
||||
OUTPUT_MR=reports/lint-mr-report.txt
|
||||
|
||||
LINE_CHANGES=changed-lines.txt
|
||||
|
||||
is_empty() {
|
||||
(! grep -q . $1)
|
||||
}
|
||||
|
||||
run_eslint() {
|
||||
ARGS_LEGACY='--config lint/eslintrc-legacy.json'
|
||||
|
||||
local extra_args=ARGS_$1
|
||||
local output=OUTPUT_$1
|
||||
eslint -f unix ${!extra_args} -o ${!output} js
|
||||
}
|
||||
|
||||
list_commit_range_additions() {
|
||||
# Turn raw context-less git-diff into a list of
|
||||
# filename:lineno pairs of new (+) lines
|
||||
git diff -U0 "$@" -- js |
|
||||
awk '
|
||||
BEGIN { file=""; }
|
||||
/^+++ b/ { file=substr($0,7); }
|
||||
/^@@ / {
|
||||
len = split($3,a,",")
|
||||
start=a[1]
|
||||
count=(len > 1) ? a[2] : 1
|
||||
|
||||
for (line=start; line<start+count; line++)
|
||||
printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line;
|
||||
}'
|
||||
}
|
||||
|
||||
copy_matched_lines() {
|
||||
local source=$1
|
||||
local matches=$2
|
||||
local target=$3
|
||||
|
||||
echo -n > $target
|
||||
for l in $(<$matches); do
|
||||
grep $l $source >> $target
|
||||
done
|
||||
}
|
||||
|
||||
create_common() {
|
||||
# comm requires sorted input;
|
||||
# we also strip the error message to make the following a "common" error:
|
||||
# regular:
|
||||
# file.js:42:23 Indentation of 55, expected 42
|
||||
# legacy:
|
||||
# file.js:42:23 Indentation of 55, extected 24
|
||||
prepare() {
|
||||
sed 's: .*::' $1 | sort
|
||||
}
|
||||
|
||||
comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp
|
||||
|
||||
# Now add back the stripped error messages
|
||||
copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL
|
||||
rm $OUTPUT_FINAL.tmp
|
||||
}
|
||||
|
||||
# Disable MR handling for now. We aren't ready to enforce
|
||||
# non-legacy style just yet ...
|
||||
unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME
|
||||
|
||||
if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
|
||||
git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME
|
||||
branch_point=$(git merge-base HEAD FETCH_HEAD)
|
||||
commit_range=$branch_point...$CI_COMMIT_SHA
|
||||
|
||||
list_commit_range_additions $commit_range > $LINE_CHANGES
|
||||
|
||||
# Don't bother with running lint when no JS changed
|
||||
if is_empty $LINE_CHANGES; then
|
||||
exit 0
|
||||
fi
|
||||
fi
|
||||
|
||||
echo Generating lint report using regular configuration
|
||||
run_eslint REGULAR
|
||||
echo Generating lint report using legacy configuration
|
||||
run_eslint LEGACY
|
||||
echo Done.
|
||||
create_common
|
||||
|
||||
if ! is_empty $OUTPUT_FINAL; then
|
||||
cat $OUTPUT_FINAL
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# Just show the report and succeed when not testing a MR
|
||||
if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
|
||||
exit 0
|
||||
fi
|
||||
|
||||
copy_matched_lines $OUTPUT_REGULAR $LINE_CHANGES $OUTPUT_MR
|
||||
cat $OUTPUT_MR
|
||||
is_empty $OUTPUT_MR
|
||||
62
HACKING.md
62
HACKING.md
@@ -84,6 +84,7 @@ don't use.
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Util = imports.misc.util;
|
||||
```
|
||||
The alphabetical ordering should be done independently of the location of the
|
||||
@@ -276,49 +277,34 @@ If your usage of an object is like a hash table (and thus conceptually the keys
|
||||
can have special chars in them), don't use quotes, but use brackets: `{ bar: 42
|
||||
}`, `foo['bar']`.
|
||||
|
||||
## Animations
|
||||
|
||||
Most objects that are animated are actors, and most properties used in animations
|
||||
are animatable, which means they can use implicit animations:
|
||||
## Getters, setters, and Tweener
|
||||
|
||||
Getters and setters should be used when you are dealing with an API that is
|
||||
designed around setting properties, like Tweener. If you want to animate an
|
||||
arbitrary property, create a getter and setter, and use Tweener to animate the
|
||||
property.
|
||||
```javascript
|
||||
moveActor(actor, x, y) {
|
||||
actor.ease({
|
||||
x,
|
||||
y,
|
||||
duration: 500, // ms
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
var ANIMATION_TIME = 2000;
|
||||
|
||||
var MyClass = class {
|
||||
constructor() {
|
||||
this.actor = new St.BoxLayout();
|
||||
this._position = 0;
|
||||
}
|
||||
```
|
||||
|
||||
The above is a convenience wrapper around the actual Clutter API, and should generally
|
||||
be preferred over the more verbose:
|
||||
|
||||
```javascript
|
||||
moveActor(actor, x, y) {
|
||||
actor.save_easing_state();
|
||||
|
||||
actor.set_easing_duration(500);
|
||||
actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD);
|
||||
actor.set({
|
||||
x,
|
||||
y
|
||||
});
|
||||
|
||||
actor.restore_easing_state();
|
||||
get position() {
|
||||
return this._position;
|
||||
}
|
||||
```
|
||||
|
||||
There is a similar convenience API around Clutter.PropertyTransition to animate
|
||||
actor (or actor meta) properties that cannot use implicit animations:
|
||||
|
||||
```javascript
|
||||
desaturateActor(actor, desaturate) {
|
||||
let factor = desaturate ? 1.0 : 0.0;
|
||||
actor.ease_property('@effects.desaturate.factor', factor, {
|
||||
duration: 500, // ms
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
set position(value) {
|
||||
this._position = value;
|
||||
this.actor.set_position(value, value);
|
||||
}
|
||||
};
|
||||
|
||||
let myThing = new MyClass();
|
||||
Tweener.addTween(myThing,
|
||||
{ position: 100,
|
||||
time: ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
```
|
||||
|
||||
219
NEWS
219
NEWS
@@ -1,222 +1,3 @@
|
||||
3.34.5
|
||||
======
|
||||
* Leave overview when locking the screen [Jonas D.; !1043]
|
||||
* Avoid IO on the main thread [Christian; !1050]
|
||||
* Fix OSK layout fallback for unsupported variants [Florian; #2471]
|
||||
* Fix high-contrast/symbolic icon mix-up [Florian; #2414]
|
||||
* Misc. bug fixes and cleanups [Jonas Å., Florian; !1032, #2386]
|
||||
|
||||
Contributors:
|
||||
Jonas Dreßler, Christian Hergert, Florian Müllner, Jwtiyar Nariman,
|
||||
Jonas Ådahl
|
||||
|
||||
Translators:
|
||||
Jwtiyar Nariman [ckb]
|
||||
|
||||
3.34.4
|
||||
======
|
||||
* Switch screen-recorder back to VP8 [Björn; #256]
|
||||
|
||||
Contributors:
|
||||
Björn Daase
|
||||
|
||||
Translators:
|
||||
Jor Teron [mjw], Dušan Kazik [sk]
|
||||
|
||||
3.34.3
|
||||
======
|
||||
* polkitAgent: Fix confirming via keyboard when password-less [Jonas; #2066]
|
||||
* Misc. bug fixes and cleanups [Florian; !906]
|
||||
|
||||
Contributors:
|
||||
Jonas Dreßler, Florian Müllner
|
||||
|
||||
3.34.2
|
||||
======
|
||||
* Fix unredirection after cancelled animations [Florian; #1788]
|
||||
* Use cached coordinates for window sorting in overview [Andrew; !763]
|
||||
* Include shadow in window screenshots [Robert; !762]
|
||||
* Use correct timezones for events [Milan, Florian; !806, #1895]
|
||||
* Adjust style of system menu action buttons [monday; !802]
|
||||
* Fix windows getting stuck on screen if closed while animating [Florian; !815]
|
||||
* Hide stopped spinner in top bar [Joonas; !834]
|
||||
* Reuse existing icons when updating the app picker grid [Georges; !841]
|
||||
* Fix not-responding dialog size when using geometry scaling [Jonas; !783]
|
||||
* Fix battery icon glitch in "100% but charging" case [Philip; !814]
|
||||
* Update window titles in app menu [Florian; #1830]
|
||||
* Improve modifier-less keyboard navigation of switcher popups [Florian; #1883]
|
||||
* Use better OSK layout fallback for unsupported variants [Florian; #1907]
|
||||
* Fix creating app folders with no pre-existing folders [Jonas; #1652]
|
||||
* Improve DND page switching in app picker [Florian, Jonas; #1693]
|
||||
* Show polkit confirmation dialog for users with no password [Joaquim; !829]
|
||||
* Fix interacting with applications when magnifier is enabled [Jonas; !754]
|
||||
* Tweak styling of notifications/media constrols [Joonas; !855, !865]
|
||||
* Fix disable command of gnome-extensions tool [Florian; #1946]
|
||||
* Enable clean session shutdown after gnome-shell failure [Benjamin; !858]
|
||||
* Also remove scaled keys when texture cache is cleared [Daniel; !567]
|
||||
* Don't show overflow indicator in switchers that fit screen [Florian; #1834]
|
||||
* Place launched applications into a systemd scope [Benjamin; !863]
|
||||
* Fix weather forecasts for automatic location when Weather is not sandboxed
|
||||
[Florian; #1823]
|
||||
* Dismiss switcher popups when a system modal dialogs opens [Florian; #1536]
|
||||
* Misc. bug fixes and cleanups [Marco, Philip, Florian, cunidev, Jonas, Joonas;
|
||||
!758, !749, !777, !811, #1884, !823, !840, !782, !847, #1836, !852, !851,
|
||||
!788, #1916, !866, !884]
|
||||
|
||||
Contributors:
|
||||
Marco Trevisan (Treviño), Benjamin Berg, Philip Chimento, Milan Crha,
|
||||
Jonas Dreßler, Joonas Henriksson, Robert Mader, Daniel García Moreno,
|
||||
Florian Müllner, Georges Basile Stavracas Neto, Joaquim Rocha, Andrew Watson,
|
||||
cunidev, monday
|
||||
|
||||
Translators:
|
||||
Stas Solovey [ru], Ricardo Silva Veloso [pt_BR], Yi-Jyun Pan [zh_TW],
|
||||
Umarzuki Bin Mochlis Moktar [ms]
|
||||
|
||||
3.34.1
|
||||
======
|
||||
* Fix "Frequent" view icons disappearing on hover [Jonas D.; #1502]
|
||||
* Allow editing app folder names [Georges, Marco; !675, !720]
|
||||
* Skip property transitions while hidden [Florian; !708]
|
||||
* Make menu animations more consistent [Florian, GB_2; #1595, !717]
|
||||
* Improve performance when enabling/disabling all extensions [Jonas D.; !96]
|
||||
* Fix extra icons appearing in "Frequent" view animation [Georges; !696]
|
||||
* Fix fading out desktop icons [Harshula; #1616]
|
||||
* Fix box-shadow glitch with prerendered resources [Daniel; #1186]
|
||||
* Fix accidentally skipped animations [Florian; #1572]
|
||||
* Fix screenshots and window animations when scaled [Robert; !728]
|
||||
* Don't leak NOTIFY_SOCKET environment variable to applications [Benjamin; !741]
|
||||
* Fix lock-up on X11 when ibus is already running on startup [Marco; #1712]
|
||||
* Fix screen dimming on idle [Marco; #1683]
|
||||
* Do not notify systemd before initialization is complete [Iain; !750]
|
||||
* Support SAE secrets in network agent [Lubomir; !751]
|
||||
* Fix various regressions with dynamic workspaces [Florian; #1497]
|
||||
* Fixed crashes [Florian, Marco; #1678, !746]
|
||||
* Misc. bug fixes and cleanups [Marco, Jonas D., Florian, Iain, Georges,
|
||||
Jonas Å., Martin, Takao, Carlos; !700, !705, !709, !711, !707, #1538, !710,
|
||||
!713, !699, !715, !718, !716, !719, !721, #1243, !725, !731, #1614, !683,
|
||||
!732, !121, !735, !736, !740, #573, #1641, #1571]
|
||||
|
||||
Contributors:
|
||||
Marco Trevisan (Treviño), Benjamin Berg, Jonas Dreßler, Takao Fujiwara, GB_2,
|
||||
Carlos Garnacho, Harshula Jayasuriya, Iain Lane, Robert Mader,
|
||||
Daniel García Moreno, Florian Müllner, Georges Basile Stavracas Neto,
|
||||
Lubomir Rintel, Martin Zurowietz, Jonas Ådahl
|
||||
|
||||
Translators:
|
||||
Rafael Fontenelle [pt_BR], Fran Dieguez [gl], Balázs Úr [hu],
|
||||
Milo Casagrande [it], Daniel Șerbănescu [ro], Kukuh Syafaat [id],
|
||||
Jiri Grönroos [fi], Daniel Mustieles [es], Piotr Drąg [pl],
|
||||
Anders Jonsson [sv], Marek Černocký [cs], Jordi Mas [ca],
|
||||
Aurimas Černius [lt], Christian Kirbach [de], Emin Tufan Çetin [tr],
|
||||
Enrico Nicoletto [pt_BR], Danial Behzadi [fa], Марко Костић [sr],
|
||||
Alexandre Franke [fr], Charles Monzat [fr], Kjartan Maraas [nb],
|
||||
Ryuta Fujii [ja], Nathan Follens [nl], Dušan Kazik [sk], Fabio Tomat [fur],
|
||||
Matej Urbančič [sl], Ask Hjorth Larsen [da], Alan Mortensen [da]
|
||||
|
||||
3.34.0
|
||||
======
|
||||
* Handle startup/shutdown of misc X11 services [Carlos; !680]
|
||||
* Fix sound volume mute/unmute [Iain; #1557]
|
||||
* Correctly terminate pasted text [Carlos; #1570]
|
||||
|
||||
Contributors:
|
||||
Carlos Garnacho, Iain Lane
|
||||
|
||||
Translators:
|
||||
Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
|
||||
Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
|
||||
Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
|
||||
|
||||
3.33.92
|
||||
=======
|
||||
* Animate pointer a11y pie timer [Jonas D.; !688]
|
||||
* Fix restarting shell in systemd user session [Benjamin; !690]
|
||||
* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
|
||||
!691, !689, !692, #1552, !698]
|
||||
|
||||
Contributors:
|
||||
Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
|
||||
Will Thompson
|
||||
|
||||
Translators:
|
||||
Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
|
||||
Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
|
||||
Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
|
||||
Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
|
||||
Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
|
||||
Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
|
||||
Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
|
||||
|
||||
3.33.91
|
||||
=======
|
||||
* Fix regression when adjusting brightness [Florian; #1500]
|
||||
* Fix pointer a11y timeout animation [Jonas D.; #1533]
|
||||
* Add new extensions CLI tool [Florian; #1234]
|
||||
* Only track top-level windows [Carlos; #556]
|
||||
* Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian;
|
||||
!678, !682, !686]
|
||||
|
||||
Contributors:
|
||||
Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner
|
||||
|
||||
Translators:
|
||||
Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv],
|
||||
Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi],
|
||||
Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl],
|
||||
Danial Behzadi [fa]
|
||||
|
||||
3.33.90
|
||||
=======
|
||||
* Implement DND app picker folder management [Georges; !643, !645, !664, !671]
|
||||
* Make Clocks/Weather integration work with sandboxed apps [Florian; #1158]
|
||||
* Support startup via systemd user instance [Benjamin; !507]
|
||||
* Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669]
|
||||
* Minimize travel distance in overview animation [Sergey; !267]
|
||||
* Rescan icon theme when installed apps changed [Georges; !661]
|
||||
* Consistently animate new window actions [Jonas; !662, !673]
|
||||
* Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels,
|
||||
Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647,
|
||||
!385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665,
|
||||
!667, !670, #1357, !672, !657, #1507, !674, !677]
|
||||
|
||||
Contributors:
|
||||
Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner,
|
||||
Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode,
|
||||
Marco Trevisan (Treviño), verdre, Daniel van Vugt
|
||||
|
||||
Translators:
|
||||
Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR],
|
||||
Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es],
|
||||
Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro],
|
||||
Anders Jonsson [sv]
|
||||
|
||||
3.33.4
|
||||
======
|
||||
* Fix unintentional interference between gestures [Jonas; !598]
|
||||
* Fix unintentional loop while polkit dialog is active [Ray; !602]
|
||||
* Fix alt-tab icon size on HiDPI [Jonas; !587]
|
||||
* Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449]
|
||||
* Fix style updates for non-background CSS properties [Florian; #1212]
|
||||
* Fix cursor visibility in screen recordings [Illya; #1208]
|
||||
* Add option for disabling the hot corner [Florian; #688320]
|
||||
* Use more fine-grained levels in battery indicator [Florian; !561, #1442]
|
||||
* Fix the calculation of the maximum number of app search results [Jonas; !110]
|
||||
* Handle horizontal workspace layout with gestures/animations [Florian; !575]
|
||||
* Improve handling of session mode extensions [Florian, Didier; #789852]
|
||||
* Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin,
|
||||
Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611,
|
||||
!614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626,
|
||||
!491, !631, !632, !633, #1457]
|
||||
|
||||
Contributors:
|
||||
Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho,
|
||||
Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada,
|
||||
Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño)
|
||||
|
||||
Translators:
|
||||
Jordi Mas [ca], Jor Teron [mjw]
|
||||
|
||||
3.33.3
|
||||
======
|
||||
* Prepare for optional X11 [Carlos; !378]
|
||||
|
||||
@@ -30,6 +30,3 @@
|
||||
|
||||
/* Define if fdwalk is available in libc */
|
||||
#mesondefine HAVE_FDWALK
|
||||
|
||||
/* Define if we have gnome-desktop systemd utils */
|
||||
#mesondefine HAVE_GNOME_SYSTEMD
|
||||
|
||||
@@ -1,15 +0,0 @@
|
||||
<node>
|
||||
|
||||
<!--
|
||||
org.gnome.Shell.ClocksIntegration:
|
||||
@short_description: Clocks integration interface
|
||||
|
||||
The interface used for exporting location settings to GNOME Shell's
|
||||
world clocks integration.
|
||||
-->
|
||||
<interface name="org.gnome.Shell.ClocksIntegration">
|
||||
|
||||
<property name="Locations" type="av" access="read"/>
|
||||
|
||||
</interface>
|
||||
</node>
|
||||
@@ -173,30 +173,6 @@
|
||||
<arg type="s" direction="in" name="uuid"/>
|
||||
</method>
|
||||
|
||||
<!--
|
||||
EnableExtension:
|
||||
@uuid: The UUID of the extension
|
||||
@success: Whether the operation was successful
|
||||
|
||||
Enable an extension.
|
||||
-->
|
||||
<method name="EnableExtension"> \
|
||||
<arg type="s" direction="in" name="uuid"/> \
|
||||
<arg type="b" direction="out" name="success"/> \
|
||||
</method> \
|
||||
|
||||
<!--
|
||||
DisableExtension:
|
||||
@uuid: The UUID of the extension
|
||||
@success: Whether the operation was successful
|
||||
|
||||
Disable an extension.
|
||||
-->
|
||||
<method name="DisableExtension"> \
|
||||
<arg type="s" direction="in" name="uuid"/> \
|
||||
<arg type="b" direction="out" name="success"/> \
|
||||
</method> \
|
||||
|
||||
<!--
|
||||
LaunchExtensionPrefs:
|
||||
@uuid: The UUID of the extension
|
||||
@@ -213,15 +189,6 @@
|
||||
-->
|
||||
<method name="CheckForUpdates"/>
|
||||
|
||||
<signal name="ExtensionStateChanged">
|
||||
<arg type="s" name="uuid"/>
|
||||
<arg type="a{sv}" name="state"/>
|
||||
</signal>
|
||||
|
||||
<!--
|
||||
ExtensionStatusChanged:
|
||||
Deprecated for ExtensionStateChanged
|
||||
-->
|
||||
<signal name="ExtensionStatusChanged">
|
||||
<arg type="s" name="uuid"/>
|
||||
<arg type="i" name="state"/>
|
||||
|
||||
@@ -1,16 +0,0 @@
|
||||
<node>
|
||||
|
||||
<!--
|
||||
org.gnome.Shell.WeatherIntegration:
|
||||
@short_description: Weather integration interface
|
||||
|
||||
The interface used for exporting location settings to GNOME Shell's
|
||||
weather integration.
|
||||
-->
|
||||
<interface name="org.gnome.Shell.WeatherIntegration">
|
||||
|
||||
<property name="AutomaticLocation" type="b" access="read"/>
|
||||
<property name="Locations" type="av" access="read"/>
|
||||
|
||||
</interface>
|
||||
</node>
|
||||
@@ -40,7 +40,6 @@
|
||||
<file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file>
|
||||
@@ -49,7 +48,6 @@
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file>
|
||||
|
||||
@@ -1,15 +0,0 @@
|
||||
[Unit]
|
||||
Description=Disable GNOME Shell extensions after failure
|
||||
# Note that this unit must not conflict with anything, and must
|
||||
# be able to run in parallel with the gnome-session-shutdown.target.
|
||||
DefaultDependencies=no
|
||||
|
||||
# We want to disable extensions only if gnome-shell has flagged the extensions
|
||||
# to be a likely cause of trouble.
|
||||
ConditionPathExists=%t/gnome-shell-disable-extensions
|
||||
|
||||
[Service]
|
||||
Type=simple
|
||||
# Disable extensions
|
||||
ExecStart=gsettings set org.gnome.shell disable-user-extensions true
|
||||
Restart=no
|
||||
@@ -1,27 +0,0 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell on Wayland
|
||||
# On wayland, force a session shutdown
|
||||
OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target
|
||||
OnFailureJobMode=replace-irreversibly
|
||||
CollectMode=inactive-or-failed
|
||||
RefuseManualStart=on
|
||||
RefuseManualStop=on
|
||||
|
||||
After=gnome-session-manager.target
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
# The units already conflict because they use the same BusName
|
||||
#Conflicts=gnome-shell-x11.service
|
||||
|
||||
[Service]
|
||||
Type=notify
|
||||
ExecStart=@bindir@/gnome-shell
|
||||
# Exit code 1 means we are probably *not* dealing with an extension failure
|
||||
SuccessExitStatus=1
|
||||
# On wayland we cannot restart
|
||||
Restart=no
|
||||
# Kill any stubborn child processes after this long
|
||||
TimeoutStopSec=5
|
||||
@@ -1,10 +1,5 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell on Wayland
|
||||
DefaultDependencies=no
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
Requires=gnome-shell-wayland.service
|
||||
After=gnome-shell-wayland.service
|
||||
Description=GNOME Shell (wayland sync point)
|
||||
After=gnome-shell.service
|
||||
BindsTo=gnome-shell.service
|
||||
Conflicts=gnome-shell-x11.target
|
||||
|
||||
@@ -1,33 +0,0 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell on X11
|
||||
# On X11, try to show the GNOME Session Failed screen
|
||||
OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target
|
||||
OnFailureJobMode=replace
|
||||
CollectMode=inactive-or-failed
|
||||
RefuseManualStart=on
|
||||
RefuseManualStop=on
|
||||
|
||||
After=gnome-session-manager.target
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
# The units already conflict because they use the same BusName
|
||||
#Conflicts=gnome-shell-wayland.service
|
||||
|
||||
# Limit startup frequency more than the default
|
||||
StartLimitIntervalSec=15s
|
||||
StartLimitBurst=3
|
||||
|
||||
[Service]
|
||||
Type=notify
|
||||
ExecStart=@bindir@/gnome-shell
|
||||
# Exit code 1 means we are probably *not* dealing with an extension failure
|
||||
SuccessExitStatus=1
|
||||
# On X11 we want to restart on-success (Alt+F2 + r) and on-failure.
|
||||
Restart=always
|
||||
# Do not wait before restarting the shell
|
||||
RestartSec=0ms
|
||||
# Kill any stubborn child processes after this long
|
||||
TimeoutStopSec=5
|
||||
@@ -1,10 +1,5 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell on X11
|
||||
DefaultDependencies=no
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
Requires=gnome-shell-x11.service
|
||||
After=gnome-shell-x11.service
|
||||
Description=GNOME Shell (x11 sync point)
|
||||
After=gnome-shell.service
|
||||
BindsTo=gnome-shell.service
|
||||
Conflicts=gnome-shell-wayland.target
|
||||
|
||||
11
data/gnome-shell.service.in
Normal file
11
data/gnome-shell.service.in
Normal file
@@ -0,0 +1,11 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell
|
||||
Wants=gnome-session.service
|
||||
After=graphical-session-pre.target gnome-session-bus.target
|
||||
PartOf=graphical-session.target
|
||||
|
||||
[Service]
|
||||
Type=dbus
|
||||
ExecStart=@bindir@/gnome-shell
|
||||
Restart=on-failure
|
||||
BusName=org.gnome.Shell
|
||||
@@ -14,8 +14,6 @@ desktopconf = configuration_data()
|
||||
# file when built in a non-system prefix
|
||||
desktopconf.set('bindir', bindir)
|
||||
desktopconf.set('VERSION', meson.project_version())
|
||||
desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false')
|
||||
|
||||
foreach desktop_file : desktop_files
|
||||
i18n.merge_file('desktop',
|
||||
input: configure_file(
|
||||
@@ -24,7 +22,7 @@ foreach desktop_file : desktop_files
|
||||
configuration: desktopconf
|
||||
),
|
||||
output: desktop_file,
|
||||
po_dir: po_dir,
|
||||
po_dir: '../po',
|
||||
install: true,
|
||||
install_dir: desktopdir,
|
||||
type: 'desktop'
|
||||
@@ -100,23 +98,15 @@ if have_systemd
|
||||
unitconf = configuration_data()
|
||||
unitconf.set('bindir', bindir)
|
||||
|
||||
configure_file(
|
||||
input: 'gnome-shell-x11.service.in',
|
||||
output: 'gnome-shell-x11.service',
|
||||
unit = configure_file(
|
||||
input: 'gnome-shell.service.in',
|
||||
output: 'gnome-shell.service',
|
||||
configuration: unitconf,
|
||||
install_dir: systemduserunitdir
|
||||
)
|
||||
|
||||
configure_file(
|
||||
input: 'gnome-shell-wayland.service.in',
|
||||
output: 'gnome-shell-wayland.service',
|
||||
configuration: unitconf,
|
||||
install_dir: systemduserunitdir
|
||||
)
|
||||
|
||||
units = files('gnome-shell-x11.target',
|
||||
'gnome-shell-wayland.target',
|
||||
'gnome-shell-disable-extensions.service')
|
||||
units = files('gnome-shell-wayland.target',
|
||||
'gnome-shell-x11.target')
|
||||
|
||||
install_data(units, install_dir: systemduserunitdir)
|
||||
endif
|
||||
|
||||
@@ -14,4 +14,3 @@ X-GNOME-Autostart-Phase=DisplayServer
|
||||
X-GNOME-Provides=panel;windowmanager;
|
||||
X-GNOME-Autostart-Notify=true
|
||||
X-GNOME-AutoRestart=false
|
||||
X-GNOME-HiddenUnderSystemd=@systemd_hidden@
|
||||
|
||||
@@ -21,17 +21,6 @@
|
||||
EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell.
|
||||
</description>
|
||||
</key>
|
||||
<key name="disabled-extensions" type="as">
|
||||
<default>[]</default>
|
||||
<summary>UUIDs of extensions to force disabling</summary>
|
||||
<description>
|
||||
GNOME Shell extensions have a UUID property; this key lists extensions
|
||||
which should be disabled, even if loaded as part of the current mode.
|
||||
You can also manipulate this list with the EnableExtension and
|
||||
DisableExtension D-Bus methods on org.gnome.Shell.
|
||||
This key takes precedence over the “enabled-extensions” setting.
|
||||
</description>
|
||||
</key>
|
||||
<key name="disable-user-extensions" type="b">
|
||||
<default>false</default>
|
||||
<summary>Disable user extensions</summary>
|
||||
@@ -150,6 +139,11 @@
|
||||
Keybinding to focus the active notification.
|
||||
</description>
|
||||
</key>
|
||||
<key name="pause-resume-tweens" type="as">
|
||||
<default>[]</default>
|
||||
<summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary>
|
||||
<description></description>
|
||||
</key>
|
||||
<key name="switch-to-application-1" type="as">
|
||||
<default>["<Super>1"]</default>
|
||||
<summary>Switch to application 1</summary>
|
||||
@@ -228,36 +222,6 @@
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
<key name="locations" type="av">
|
||||
<summary>Locations</summary>
|
||||
<description>
|
||||
The locations to show in world clocks
|
||||
</description>
|
||||
<default>[]</default>
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
<key name="automatic-location" type="b">
|
||||
<summary>Automatic location</summary>
|
||||
<description>
|
||||
Whether to fetch the current location or not
|
||||
</description>
|
||||
<default>false</default>
|
||||
</key>
|
||||
|
||||
<key name="locations" type="av">
|
||||
<summary>Location</summary>
|
||||
<description>
|
||||
The location for which to show a forecast
|
||||
</description>
|
||||
<default>[]</default>
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<!-- unused, change 00_org.gnome.shell.gschema.override instead -->
|
||||
<schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
|
||||
@@ -610,13 +610,6 @@ StScrollBar {
|
||||
border-bottom-style: solid;
|
||||
}
|
||||
|
||||
// Rename popup
|
||||
.rename-folder-popup {
|
||||
.rename-folder-popup-item {
|
||||
spacing: 6px;
|
||||
&:ltr, &:rtl { padding: 0, 12px; }
|
||||
}
|
||||
}
|
||||
|
||||
// Background menu
|
||||
.background-menu { -boxpointer-gap: 4px; -arrow-rise: 0px; }
|
||||
@@ -631,12 +624,16 @@ StScrollBar {
|
||||
*************/
|
||||
/* Outline for low res icons */
|
||||
.lowres-icon {
|
||||
icon-shadow: 0 1px 2px rgba(0,0,0,0.3);
|
||||
icon-shadow: 0 -1px rgba(0,0,0,0.05),
|
||||
1px 0 rgba(0,0,0,0.1),
|
||||
0 1px rgba(0,0,0,0.3),
|
||||
-1px 0 rgba(0,0,0,0.1);
|
||||
}
|
||||
|
||||
/* Drapshadow for large icons */
|
||||
.icon-dropshadow {
|
||||
icon-shadow: 0 1px 2px rgba(0,0,0,0.4);
|
||||
icon-shadow: 0 2px 12px rgba(0,0,0,0.1),
|
||||
0 1px 2px rgba(0,0,0,0.5);
|
||||
}
|
||||
|
||||
/* OSD */
|
||||
@@ -747,9 +744,8 @@ StScrollBar {
|
||||
spacing: 8px;
|
||||
}
|
||||
|
||||
.ws-switcher-active-up, .ws-switcher-active-down,
|
||||
.ws-switcher-active-left, .ws-switcher-active-right {
|
||||
height: 52px;
|
||||
.ws-switcher-active-up, .ws-switcher-active-down {
|
||||
height: 50px;
|
||||
background-color: $selected_bg_color;
|
||||
color: $selected_fg_color;
|
||||
background-size: 32px;
|
||||
@@ -949,7 +945,7 @@ StScrollBar {
|
||||
.world-clocks-button,
|
||||
.weather-button,
|
||||
.events-section-title {
|
||||
&:hover, &:focus { background-color: $_hover_bg_color }
|
||||
&:hover, focus { background-color: $_hover_bg_color }
|
||||
&:active { background-color: $_active_bg_color }
|
||||
}
|
||||
|
||||
@@ -1020,7 +1016,7 @@ StScrollBar {
|
||||
background-color: transparent;
|
||||
width: 32px;
|
||||
border-radius: 4px;
|
||||
&:hover, &:focus { background-color: $_hover_bg_color; }
|
||||
&:hover, focus { background-color: $_hover_bg_color; }
|
||||
&:active { background-color: transparentize($fg_color, 0.84); }
|
||||
}
|
||||
|
||||
@@ -1036,7 +1032,7 @@ StScrollBar {
|
||||
margin: 2px;
|
||||
border-radius: 1.4em;
|
||||
font-feature-settings: "tnum";
|
||||
&:hover, &:focus { background-color: $_hover_bg_color; }
|
||||
&:hover, focus { background-color: $_hover_bg_color; }
|
||||
&:active,&:selected {
|
||||
color: lighten($selected_fg_color,5%);
|
||||
background-color: $selected_bg_color;
|
||||
@@ -1061,9 +1057,9 @@ StScrollBar {
|
||||
}
|
||||
.calendar-today {
|
||||
font-weight: bold;
|
||||
color: lighten($fg_color,5%);
|
||||
background-color: darken($bg_color,5%);
|
||||
// border: 1px solid lighten($_bubble_borders_color,20%);
|
||||
//color: lighten($fg_color,10%);
|
||||
//background-color: darken($bg_color,5%);
|
||||
border: 1px solid $_bubble_borders_color;
|
||||
}
|
||||
.calendar-day-with-events {
|
||||
color: lighten($fg_color,10%);
|
||||
@@ -1153,21 +1149,14 @@ StScrollBar {
|
||||
padding: 10px;
|
||||
}
|
||||
|
||||
.message-close-button {
|
||||
color: lighten($fg_color, 15%);
|
||||
&:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
|
||||
&:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
|
||||
}
|
||||
|
||||
.message-media-control {
|
||||
padding: 12px;
|
||||
color: lighten($fg_color, 15%);
|
||||
|
||||
&:last-child:ltr { padding-right: 18px; }
|
||||
&:last-child:rtl { padding-left: 18px; }
|
||||
&:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
|
||||
&:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
|
||||
&:insensitive { color: if($variant=='light', lighten($fg_color, 50%), darken($fg_color, 40%)); }
|
||||
&:hover { color: $fg_color; }
|
||||
&:insensitive { color: darken($fg_color,40%); }
|
||||
}
|
||||
|
||||
.media-message-cover-icon {
|
||||
@@ -1185,6 +1174,7 @@ StScrollBar {
|
||||
// a little unstructured mess:
|
||||
|
||||
#appMenu {
|
||||
spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg");
|
||||
spacing: 4px;
|
||||
|
||||
.label-shadow { color: transparent; }
|
||||
@@ -1216,11 +1206,12 @@ StScrollBar {
|
||||
&:hover, &:focus {
|
||||
background-color: $_hover_bg_color;
|
||||
color: $fg_color;
|
||||
border: none;
|
||||
padding: 14px;
|
||||
}
|
||||
&:active {
|
||||
background-color: $selected_bg_color;
|
||||
color: $selected_fg_color;
|
||||
border-color: $selected_borders_color;
|
||||
}
|
||||
|
||||
& > StIcon { icon-size: 16px; }
|
||||
@@ -1527,9 +1518,6 @@ StScrollBar {
|
||||
border-image: none;
|
||||
background-image: none;
|
||||
}
|
||||
&:drop .overview-icon {
|
||||
background-color: transparentize($selected_bg_color,.15);
|
||||
}
|
||||
&:active .overview-icon,
|
||||
&:checked .overview-icon {
|
||||
background-color: transparentize(darken($osd_bg_color,10%), 0.5);
|
||||
|
||||
@@ -28,7 +28,7 @@ foreach iface : ifaces
|
||||
output: 'doc-gen-' + iface[1],
|
||||
command: [
|
||||
'gdbus-codegen',
|
||||
'--interface-prefix=@0@.'.format(iface[0]),
|
||||
'--interface-prefix=@0@.'.format(iface),
|
||||
'--generate-docbook', 'doc-gen',
|
||||
'--output-directory', '@OUTDIR@',
|
||||
'@INPUT@'
|
||||
|
||||
@@ -1,7 +1,3 @@
|
||||
/* exported main */
|
||||
imports.gi.versions.Gdk = '3.0';
|
||||
imports.gi.versions.Gtk = '3.0';
|
||||
|
||||
const Gettext = imports.gettext;
|
||||
const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi;
|
||||
const Format = imports.format;
|
||||
@@ -12,8 +8,6 @@ const Config = imports.misc.config;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const { ExtensionState } = ExtensionUtils;
|
||||
|
||||
const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions');
|
||||
const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface);
|
||||
|
||||
@@ -23,54 +17,74 @@ function stripPrefix(string, prefix) {
|
||||
return string;
|
||||
}
|
||||
|
||||
var Application = GObject.registerClass({
|
||||
GTypeName: 'ExtensionPrefs_Application'
|
||||
}, class Application extends Gtk.Application {
|
||||
_init() {
|
||||
var Application = class {
|
||||
constructor() {
|
||||
GLib.set_prgname('gnome-shell-extension-prefs');
|
||||
super._init({
|
||||
this.application = new Gtk.Application({
|
||||
application_id: 'org.gnome.shell.ExtensionPrefs',
|
||||
flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
|
||||
});
|
||||
|
||||
this.application.connect('activate', this._onActivate.bind(this));
|
||||
this.application.connect('command-line', this._onCommandLine.bind(this));
|
||||
this.application.connect('startup', this._onStartup.bind(this));
|
||||
|
||||
this._extensionPrefsModules = {};
|
||||
|
||||
this._startupUuid = null;
|
||||
this._loaded = false;
|
||||
this._skipMainWindow = false;
|
||||
this._shellProxy = null;
|
||||
}
|
||||
|
||||
get shellProxy() {
|
||||
return this._shellProxy;
|
||||
}
|
||||
_extensionAvailable(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
|
||||
_showPrefs(uuid) {
|
||||
let row = this._extensionSelector.get_children().find(c => {
|
||||
return c.uuid === uuid && c.hasPrefs;
|
||||
});
|
||||
|
||||
if (!row)
|
||||
if (!extension)
|
||||
return false;
|
||||
|
||||
if (!extension.dir.get_child('prefs.js').query_exists(null))
|
||||
return false;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
_getExtensionPrefsModule(extension) {
|
||||
let uuid = extension.metadata.uuid;
|
||||
|
||||
if (this._extensionPrefsModules.hasOwnProperty(uuid))
|
||||
return this._extensionPrefsModules[uuid];
|
||||
|
||||
ExtensionUtils.installImporter(extension);
|
||||
|
||||
let prefsModule = extension.imports.prefs;
|
||||
prefsModule.init(extension.metadata);
|
||||
|
||||
this._extensionPrefsModules[uuid] = prefsModule;
|
||||
return prefsModule;
|
||||
}
|
||||
|
||||
_selectExtension(uuid) {
|
||||
if (!this._extensionAvailable(uuid))
|
||||
return;
|
||||
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
let widget;
|
||||
|
||||
try {
|
||||
widget = row.prefsModule.buildPrefsWidget();
|
||||
let prefsModule = this._getExtensionPrefsModule(extension);
|
||||
widget = prefsModule.buildPrefsWidget();
|
||||
} catch (e) {
|
||||
widget = this._buildErrorUI(row, e);
|
||||
widget = this._buildErrorUI(extension, e);
|
||||
}
|
||||
|
||||
let dialog = new Gtk.Window({
|
||||
modal: !this._skipMainWindow,
|
||||
type_hint: Gdk.WindowTypeHint.DIALOG
|
||||
});
|
||||
dialog.set_titlebar(new Gtk.HeaderBar({
|
||||
show_close_button: true,
|
||||
title: row.name,
|
||||
visible: true
|
||||
}));
|
||||
let dialog = new Gtk.Window({ modal: !this._skipMainWindow,
|
||||
type_hint: Gdk.WindowTypeHint.DIALOG });
|
||||
dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true,
|
||||
title: extension.metadata.name,
|
||||
visible: true }));
|
||||
|
||||
if (this._skipMainWindow) {
|
||||
this.add_window(dialog);
|
||||
this.application.add_window(dialog);
|
||||
if (this._window)
|
||||
this._window.destroy();
|
||||
this._window = dialog;
|
||||
@@ -82,11 +96,9 @@ var Application = GObject.registerClass({
|
||||
dialog.set_default_size(600, 400);
|
||||
dialog.add(widget);
|
||||
dialog.show();
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
_buildErrorUI(row, exc) {
|
||||
_buildErrorUI(extension, exc) {
|
||||
let scroll = new Gtk.ScrolledWindow({
|
||||
hscrollbar_policy: Gtk.PolicyType.NEVER,
|
||||
propagate_natural_height: true
|
||||
@@ -158,7 +170,7 @@ var Application = GObject.registerClass({
|
||||
let clipboard = Gtk.Clipboard.get_default(w.get_display());
|
||||
// markdown for pasting in gitlab issues
|
||||
let lines = [
|
||||
`The settings of extension ${row.uuid} had an error:`,
|
||||
`The settings of extension ${extension.uuid} had an error:`,
|
||||
'```',
|
||||
`${exc}`,
|
||||
'```',
|
||||
@@ -180,13 +192,13 @@ var Application = GObject.registerClass({
|
||||
label: _("Homepage"),
|
||||
tooltip_text: _("Visit extension homepage"),
|
||||
no_show_all: true,
|
||||
visible: row.url != null
|
||||
visible: extension.metadata.url != null
|
||||
});
|
||||
toolbar.add(urlButton);
|
||||
|
||||
urlButton.connect('clicked', w => {
|
||||
let context = w.get_display().get_app_launch_context();
|
||||
Gio.AppInfo.launch_default_for_uri(row.url, context);
|
||||
Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context);
|
||||
});
|
||||
|
||||
let expandedBox = new Gtk.Box({
|
||||
@@ -201,8 +213,8 @@ var Application = GObject.registerClass({
|
||||
return scroll;
|
||||
}
|
||||
|
||||
_buildUI() {
|
||||
this._window = new Gtk.ApplicationWindow({ application: this,
|
||||
_buildUI(app) {
|
||||
this._window = new Gtk.ApplicationWindow({ application: app,
|
||||
window_position: Gtk.WindowPosition.CENTER });
|
||||
|
||||
this._window.set_default_size(800, 500);
|
||||
@@ -236,14 +248,18 @@ var Application = GObject.registerClass({
|
||||
this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder');
|
||||
|
||||
this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell');
|
||||
this._shellProxy.connectSignal('ExtensionStateChanged',
|
||||
this._onExtensionStateChanged.bind(this));
|
||||
this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => {
|
||||
if (ExtensionUtils.extensions[uuid] !== undefined)
|
||||
this._scanExtensions();
|
||||
});
|
||||
|
||||
this._window.show_all();
|
||||
}
|
||||
|
||||
_sortList(row1, row2) {
|
||||
return row1.name.localeCompare(row2.name);
|
||||
let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name;
|
||||
let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name;
|
||||
return name1.localeCompare(name2);
|
||||
}
|
||||
|
||||
_updateHeader(row, before) {
|
||||
@@ -254,56 +270,19 @@ var Application = GObject.registerClass({
|
||||
row.set_header(sep);
|
||||
}
|
||||
|
||||
_findExtensionRow(uuid) {
|
||||
return this._extensionSelector.get_children().find(c => c.uuid === uuid);
|
||||
}
|
||||
|
||||
_onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
|
||||
let row = this._findExtensionRow(uuid);
|
||||
if (row) {
|
||||
let { state } = ExtensionUtils.deserializeExtension(newState);
|
||||
if (state == ExtensionState.UNINSTALLED)
|
||||
row.destroy();
|
||||
return; // we only deal with new and deleted extensions here
|
||||
}
|
||||
|
||||
this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
|
||||
let extension = ExtensionUtils.deserializeExtension(serialized);
|
||||
if (!extension)
|
||||
return;
|
||||
// check the extension wasn't added in between
|
||||
if (this._findExtensionRow(uuid) != null)
|
||||
return;
|
||||
this._addExtensionRow(extension);
|
||||
});
|
||||
}
|
||||
|
||||
_scanExtensions() {
|
||||
this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => {
|
||||
if (e) {
|
||||
if (e instanceof Gio.DBusError) {
|
||||
log(`Failed to connect to shell proxy: ${e}`);
|
||||
this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
|
||||
this._mainStack.visible_child_name = 'noshell';
|
||||
} else {
|
||||
throw e;
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
for (let uuid in extensionsMap) {
|
||||
let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]);
|
||||
this._addExtensionRow(extension);
|
||||
}
|
||||
let finder = new ExtensionUtils.ExtensionFinder();
|
||||
finder.connect('extension-found', this._extensionFound.bind(this));
|
||||
finder.scanExtensions();
|
||||
this._extensionsLoaded();
|
||||
});
|
||||
}
|
||||
|
||||
_addExtensionRow(extension) {
|
||||
let row = new ExtensionRow(extension);
|
||||
_extensionFound(finder, extension) {
|
||||
let row = new ExtensionRow(extension.uuid);
|
||||
|
||||
row.prefsButton.visible = this._extensionAvailable(row.uuid);
|
||||
row.prefsButton.connect('clicked', () => {
|
||||
this._showPrefs(row.uuid);
|
||||
this._selectExtension(row.uuid);
|
||||
});
|
||||
|
||||
row.show_all();
|
||||
@@ -316,26 +295,24 @@ var Application = GObject.registerClass({
|
||||
else
|
||||
this._mainStack.visible_child_name = 'placeholder';
|
||||
|
||||
if (this._startupUuid)
|
||||
this._showPrefs(this._startupUuid);
|
||||
if (this._startupUuid && this._extensionAvailable(this._startupUuid))
|
||||
this._selectExtension(this._startupUuid);
|
||||
this._startupUuid = null;
|
||||
this._skipMainWindow = false;
|
||||
this._loaded = true;
|
||||
}
|
||||
|
||||
vfunc_activate() {
|
||||
_onActivate() {
|
||||
this._window.present();
|
||||
}
|
||||
|
||||
vfunc_startup() {
|
||||
super.vfunc_startup();
|
||||
|
||||
this._buildUI();
|
||||
_onStartup(app) {
|
||||
this._buildUI(app);
|
||||
this._scanExtensions();
|
||||
}
|
||||
|
||||
vfunc_command_line(commandLine) {
|
||||
this.activate();
|
||||
_onCommandLine(app, commandLine) {
|
||||
app.activate();
|
||||
let args = commandLine.get_arguments();
|
||||
|
||||
if (args.length) {
|
||||
@@ -346,14 +323,16 @@ var Application = GObject.registerClass({
|
||||
// Strip off "extension:///" prefix which fakes a URI, if it exists
|
||||
uuid = stripPrefix(uuid, "extension:///");
|
||||
|
||||
if (!this._loaded)
|
||||
if (this._extensionAvailable(uuid))
|
||||
this._selectExtension(uuid);
|
||||
else if (!this._loaded)
|
||||
this._startupUuid = uuid;
|
||||
else if (!this._showPrefs(uuid))
|
||||
else
|
||||
this._skipMainWindow = false;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
});
|
||||
};
|
||||
|
||||
var Expander = GObject.registerClass({
|
||||
Properties: {
|
||||
@@ -520,35 +499,6 @@ class EmptyPlaceholder extends Gtk.Box {
|
||||
}
|
||||
});
|
||||
|
||||
var NoShellPlaceholder = GObject.registerClass(
|
||||
class NoShellPlaceholder extends Gtk.Box {
|
||||
_init() {
|
||||
super._init({
|
||||
orientation: Gtk.Orientation.VERTICAL,
|
||||
spacing: 12,
|
||||
margin: 100,
|
||||
margin_bottom: 60
|
||||
});
|
||||
|
||||
let label = new Gtk.Label({
|
||||
label: '<span size="x-large">%s</span>'.format(
|
||||
_("Something’s gone wrong")),
|
||||
use_markup: true
|
||||
});
|
||||
label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
|
||||
this.add(label);
|
||||
|
||||
label = new Gtk.Label({
|
||||
label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
|
||||
justify: Gtk.Justification.CENTER,
|
||||
wrap: true
|
||||
});
|
||||
this.add(label);
|
||||
|
||||
this.show_all();
|
||||
}
|
||||
});
|
||||
|
||||
var DescriptionLabel = GObject.registerClass(
|
||||
class DescriptionLabel extends Gtk.Label {
|
||||
vfunc_get_preferred_height_for_width(width) {
|
||||
@@ -561,59 +511,30 @@ class DescriptionLabel extends Gtk.Label {
|
||||
|
||||
var ExtensionRow = GObject.registerClass(
|
||||
class ExtensionRow extends Gtk.ListBoxRow {
|
||||
_init(extension) {
|
||||
_init(uuid) {
|
||||
super._init();
|
||||
|
||||
this._app = Gio.Application.get_default();
|
||||
this._extension = extension;
|
||||
this._prefsModule = null;
|
||||
this.uuid = uuid;
|
||||
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' });
|
||||
this._settings.connect('changed::enabled-extensions', () => {
|
||||
this._switch.state = this._isEnabled();
|
||||
});
|
||||
this._settings.connect('changed::disable-extension-version-validation',
|
||||
() => {
|
||||
this._switch.sensitive = this._canEnable();
|
||||
});
|
||||
this._settings.connect('changed::disable-user-extensions',
|
||||
() => {
|
||||
this._switch.sensitive = this._canEnable();
|
||||
});
|
||||
|
||||
this._buildUI();
|
||||
|
||||
this._extensionStateChangedId = this._app.shellProxy.connectSignal(
|
||||
'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
|
||||
if (this.uuid !== uuid)
|
||||
return;
|
||||
|
||||
this._extension = ExtensionUtils.deserializeExtension(newState);
|
||||
let state = (this._extension.state == ExtensionState.ENABLED);
|
||||
|
||||
GObject.signal_handler_block(this._switch, this._notifyActiveId);
|
||||
this._switch.state = state;
|
||||
GObject.signal_handler_unblock(this._switch, this._notifyActiveId);
|
||||
|
||||
this._switch.sensitive = this._canToggle();
|
||||
});
|
||||
}
|
||||
|
||||
get uuid() {
|
||||
return this._extension.uuid;
|
||||
}
|
||||
|
||||
get name() {
|
||||
return this._extension.metadata.name;
|
||||
}
|
||||
|
||||
get hasPrefs() {
|
||||
return this._extension.hasPrefs;
|
||||
}
|
||||
|
||||
get url() {
|
||||
return this._extension.metadata.url;
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
if (!this._app.shellProxy)
|
||||
return;
|
||||
|
||||
if (this._extensionStateChangedId)
|
||||
this._app.shellProxy.disconnectSignal(this._extensionStateChangedId);
|
||||
this._extensionStateChangedId = 0;
|
||||
}
|
||||
|
||||
_buildUI() {
|
||||
let extension = ExtensionUtils.extensions[this.uuid];
|
||||
|
||||
let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL,
|
||||
hexpand: true, margin_end: 24, spacing: 24,
|
||||
margin: 12 });
|
||||
@@ -623,20 +544,19 @@ class ExtensionRow extends Gtk.ListBoxRow {
|
||||
spacing: 6, hexpand: true });
|
||||
hbox.add(vbox);
|
||||
|
||||
let name = GLib.markup_escape_text(this.name, -1);
|
||||
let name = GLib.markup_escape_text(extension.metadata.name, -1);
|
||||
let label = new Gtk.Label({ label: '<b>' + name + '</b>',
|
||||
use_markup: true,
|
||||
halign: Gtk.Align.START });
|
||||
vbox.add(label);
|
||||
|
||||
let desc = this._extension.metadata.description.split('\n')[0];
|
||||
let desc = extension.metadata.description.split('\n')[0];
|
||||
label = new DescriptionLabel({ label: desc, wrap: true, lines: 2,
|
||||
ellipsize: Pango.EllipsizeMode.END,
|
||||
xalign: 0, yalign: 0 });
|
||||
vbox.add(label);
|
||||
|
||||
let button = new Gtk.Button({ valign: Gtk.Align.CENTER,
|
||||
visible: this.hasPrefs,
|
||||
no_show_all: true });
|
||||
button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic',
|
||||
icon_size: Gtk.IconSize.BUTTON,
|
||||
@@ -646,37 +566,51 @@ class ExtensionRow extends Gtk.ListBoxRow {
|
||||
|
||||
this.prefsButton = button;
|
||||
|
||||
this._switch = new Gtk.Switch({
|
||||
valign: Gtk.Align.CENTER,
|
||||
sensitive: this._canToggle(),
|
||||
state: this._extension.state === ExtensionState.ENABLED
|
||||
});
|
||||
this._notifyActiveId = this._switch.connect('notify::active', () => {
|
||||
this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER,
|
||||
sensitive: this._canEnable(),
|
||||
state: this._isEnabled() });
|
||||
this._switch.connect('notify::active', () => {
|
||||
if (this._switch.active)
|
||||
this._app.shellProxy.EnableExtensionRemote(this.uuid);
|
||||
this._enable();
|
||||
else
|
||||
this._app.shellProxy.DisableExtensionRemote(this.uuid);
|
||||
this._disable();
|
||||
});
|
||||
this._switch.connect('state-set', () => true);
|
||||
hbox.add(this._switch);
|
||||
}
|
||||
|
||||
_canToggle() {
|
||||
return this._extension.canChange;
|
||||
_canEnable() {
|
||||
let extension = ExtensionUtils.extensions[this.uuid];
|
||||
let checkVersion = !this._settings.get_boolean('disable-extension-version-validation');
|
||||
|
||||
return !this._settings.get_boolean('disable-user-extensions') &&
|
||||
!(checkVersion && ExtensionUtils.isOutOfDate(extension));
|
||||
}
|
||||
|
||||
get prefsModule() {
|
||||
if (!this._prefsModule) {
|
||||
ExtensionUtils.installImporter(this._extension);
|
||||
|
||||
// give extension prefs access to their own extension object
|
||||
ExtensionUtils.getCurrentExtension = () => this._extension;
|
||||
|
||||
this._prefsModule = this._extension.imports.prefs;
|
||||
this._prefsModule.init(this._extension.metadata);
|
||||
_isEnabled() {
|
||||
let extensions = this._settings.get_strv('enabled-extensions');
|
||||
return extensions.includes(this.uuid);
|
||||
}
|
||||
|
||||
return this._prefsModule;
|
||||
_enable() {
|
||||
let extensions = this._settings.get_strv('enabled-extensions');
|
||||
if (extensions.includes(this.uuid))
|
||||
return;
|
||||
|
||||
extensions.push(this.uuid);
|
||||
this._settings.set_strv('enabled-extensions', extensions);
|
||||
}
|
||||
|
||||
_disable() {
|
||||
let extensions = this._settings.get_strv('enabled-extensions');
|
||||
let pos = extensions.indexOf(this.uuid);
|
||||
if (pos == -1)
|
||||
return;
|
||||
do {
|
||||
extensions.splice(pos, 1);
|
||||
pos = extensions.indexOf(this.uuid);
|
||||
} while (pos != -1);
|
||||
this._settings.set_strv('enabled-extensions', extensions);
|
||||
}
|
||||
});
|
||||
|
||||
@@ -704,5 +638,6 @@ function main(argv) {
|
||||
Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR);
|
||||
Gettext.textdomain(Config.GETTEXT_PACKAGE);
|
||||
|
||||
new Application().run(argv);
|
||||
let app = new Application();
|
||||
app.application.run(argv);
|
||||
}
|
||||
|
||||
@@ -8,13 +8,14 @@ const Batch = imports.gdm.batch;
|
||||
const GdmUtil = imports.gdm.util;
|
||||
const Params = imports.misc.params;
|
||||
const ShellEntry = imports.ui.shellEntry;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const UserWidget = imports.ui.userWidget;
|
||||
|
||||
var DEFAULT_BUTTON_WELL_ICON_SIZE = 16;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3;
|
||||
|
||||
var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
|
||||
var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5;
|
||||
|
||||
var AuthPromptMode = {
|
||||
UNLOCK_ONLY: 0,
|
||||
@@ -266,7 +267,7 @@ var AuthPrompt = class {
|
||||
let oldActor = this._defaultButtonWellActor;
|
||||
|
||||
if (oldActor)
|
||||
oldActor.remove_all_transitions();
|
||||
Tweener.removeTweens(oldActor);
|
||||
|
||||
let wasSpinner;
|
||||
if (oldActor == this._spinner.actor)
|
||||
@@ -289,11 +290,11 @@ var AuthPrompt = class {
|
||||
this._spinner.stop();
|
||||
}
|
||||
} else {
|
||||
oldActor.ease({
|
||||
opacity: 0,
|
||||
duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
Tweener.addTween(oldActor,
|
||||
{ opacity: 0,
|
||||
time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
transition: 'linear',
|
||||
onComplete: () => {
|
||||
if (wasSpinner) {
|
||||
if (this._spinner)
|
||||
@@ -311,12 +312,11 @@ var AuthPrompt = class {
|
||||
if (!animate)
|
||||
actor.opacity = 255;
|
||||
else
|
||||
actor.ease({
|
||||
opacity: 255,
|
||||
duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
Tweener.addTween(actor,
|
||||
{ opacity: 255,
|
||||
time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
|
||||
mode: Clutter.AnimationMode.LINEAR
|
||||
});
|
||||
transition: 'linear' });
|
||||
}
|
||||
|
||||
this._defaultButtonWellActor = actor;
|
||||
@@ -365,11 +365,11 @@ var AuthPrompt = class {
|
||||
_fadeOutMessage() {
|
||||
if (this._message.opacity == 0)
|
||||
return;
|
||||
this._message.remove_all_transitions();
|
||||
this._message.ease({
|
||||
opacity: 0,
|
||||
duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
Tweener.removeTweens(this._message);
|
||||
Tweener.addTween(this._message,
|
||||
{ opacity: 0,
|
||||
time: MESSAGE_FADE_OUT_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad'
|
||||
});
|
||||
}
|
||||
|
||||
@@ -385,7 +385,7 @@ var AuthPrompt = class {
|
||||
this._message.remove_style_class_name('login-dialog-message-hint');
|
||||
|
||||
if (message) {
|
||||
this._message.remove_all_transitions();
|
||||
Tweener.removeTweens(this._message);
|
||||
this._message.text = message;
|
||||
this._message.opacity = 255;
|
||||
} else {
|
||||
|
||||
@@ -20,7 +20,7 @@
|
||||
* In order for transformation animations to look good, they need to be
|
||||
* incremental and have some order to them (e.g., fade out hidden items,
|
||||
* then shrink to close the void left over). Chaining animations in this way can
|
||||
* be error-prone and wordy using just ease() callbacks.
|
||||
* be error-prone and wordy using just Tweener callbacks.
|
||||
*
|
||||
* The classes in this file help with this:
|
||||
*
|
||||
@@ -202,6 +202,7 @@ var ConsecutiveBatch = class extends Batch {
|
||||
hold.disconnect(signalId);
|
||||
this.nextTask();
|
||||
});
|
||||
return;
|
||||
} else {
|
||||
// This task finished, process the next one
|
||||
this.nextTask();
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported FprintManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported LoginDialog */
|
||||
/*
|
||||
* Copyright 2011 Red Hat, Inc
|
||||
*
|
||||
@@ -31,10 +30,11 @@ const LoginManager = imports.misc.loginManager;
|
||||
const Main = imports.ui.main;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
const Realmd = imports.gdm.realmd;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const UserWidget = imports.ui.userWidget;
|
||||
|
||||
const _FADE_ANIMATION_TIME = 250;
|
||||
const _SCROLL_ANIMATION_TIME = 500;
|
||||
const _FADE_ANIMATION_TIME = 0.25;
|
||||
const _SCROLL_ANIMATION_TIME = 0.5;
|
||||
const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
|
||||
const _LOGO_ICON_HEIGHT = 48;
|
||||
const _MAX_BOTTOM_MENU_ITEMS = 5;
|
||||
@@ -204,10 +204,11 @@ var UserList = class {
|
||||
let adjustment = this.actor.get_vscroll_bar().get_adjustment();
|
||||
|
||||
let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
|
||||
adjustment.ease(value, {
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: _SCROLL_ANIMATION_TIME
|
||||
});
|
||||
Tweener.removeTweens(adjustment);
|
||||
Tweener.addTween (adjustment,
|
||||
{ value: value,
|
||||
time: _SCROLL_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
}
|
||||
|
||||
jumpToItem(item) {
|
||||
@@ -371,7 +372,7 @@ var SessionMenuButton = class {
|
||||
}
|
||||
|
||||
for (let i = 0; i < ids.length; i++) {
|
||||
let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]);
|
||||
let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]);
|
||||
|
||||
let id = ids[i];
|
||||
let item = new PopupMenu.PopupMenuItem(sessionName);
|
||||
@@ -517,7 +518,7 @@ var LoginDialog = GObject.registerClass({
|
||||
_getBannerAllocation(dialogBox) {
|
||||
let actorBox = new Clutter.ActorBox();
|
||||
|
||||
let [, , natWidth, natHeight] = this._bannerView.get_preferred_size();
|
||||
let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size();
|
||||
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
|
||||
|
||||
actorBox.x1 = Math.floor(centerX - natWidth / 2);
|
||||
@@ -531,7 +532,7 @@ var LoginDialog = GObject.registerClass({
|
||||
_getLogoBinAllocation(dialogBox) {
|
||||
let actorBox = new Clutter.ActorBox();
|
||||
|
||||
let [, , natWidth, natHeight] = this._logoBin.get_preferred_size();
|
||||
let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size();
|
||||
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
|
||||
|
||||
actorBox.x1 = Math.floor(centerX - natWidth / 2);
|
||||
@@ -545,7 +546,7 @@ var LoginDialog = GObject.registerClass({
|
||||
_getCenterActorAllocation(dialogBox, actor) {
|
||||
let actorBox = new Clutter.ActorBox();
|
||||
|
||||
let [, , natWidth, natHeight] = actor.get_preferred_size();
|
||||
let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size();
|
||||
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
|
||||
let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2;
|
||||
|
||||
@@ -647,7 +648,7 @@ var LoginDialog = GObject.registerClass({
|
||||
|
||||
// figure out how tall it would like to be and try to accommodate
|
||||
// but don't let it get too close to the logo
|
||||
let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
|
||||
let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
|
||||
|
||||
let maxWideHeight = dialogHeight - 3 * logoHeight;
|
||||
wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
|
||||
@@ -757,15 +758,14 @@ var LoginDialog = GObject.registerClass({
|
||||
|
||||
_fadeInBannerView() {
|
||||
this._bannerView.show();
|
||||
this._bannerView.ease({
|
||||
opacity: 255,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
Tweener.addTween(this._bannerView,
|
||||
{ opacity: 255,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
}
|
||||
|
||||
_hideBannerView() {
|
||||
this._bannerView.remove_all_transitions();
|
||||
Tweener.removeTweens(this._bannerView);
|
||||
this._bannerView.opacity = 0;
|
||||
this._bannerView.hide();
|
||||
}
|
||||
@@ -858,11 +858,10 @@ var LoginDialog = GObject.registerClass({
|
||||
return;
|
||||
this._authPrompt.actor.opacity = 0;
|
||||
this._authPrompt.actor.show();
|
||||
this._authPrompt.actor.ease({
|
||||
opacity: 255,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
Tweener.addTween(this._authPrompt.actor,
|
||||
{ opacity: 255,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
this._fadeInBannerView();
|
||||
}
|
||||
|
||||
@@ -906,31 +905,26 @@ var LoginDialog = GObject.registerClass({
|
||||
this._showPrompt();
|
||||
}
|
||||
|
||||
_bindOpacity() {
|
||||
this._bindings = Main.layoutManager.uiGroup.get_children()
|
||||
.filter(c => c != Main.layoutManager.screenShieldGroup)
|
||||
.map(c => this.bind_property('opacity', c, 'opacity', 0));
|
||||
}
|
||||
|
||||
_unbindOpacity() {
|
||||
this._bindings.forEach(b => b.unbind());
|
||||
}
|
||||
|
||||
_loginScreenSessionActivated() {
|
||||
if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
|
||||
return;
|
||||
|
||||
this._bindOpacity();
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 255,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onUpdate: () => {
|
||||
let children = Main.layoutManager.uiGroup.get_children();
|
||||
|
||||
for (let i = 0; i < children.length; i++) {
|
||||
if (children[i] != Main.layoutManager.screenShieldGroup)
|
||||
children[i].opacity = this.opacity;
|
||||
}
|
||||
},
|
||||
onComplete: () => {
|
||||
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
|
||||
this._authPrompt.reset();
|
||||
this._unbindOpacity();
|
||||
}
|
||||
});
|
||||
} });
|
||||
}
|
||||
|
||||
_gotGreeterSessionProxy(proxy) {
|
||||
@@ -943,16 +937,21 @@ var LoginDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
_startSession(serviceName) {
|
||||
this._bindOpacity();
|
||||
this.ease({
|
||||
opacity: 0,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 0,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onUpdate: () => {
|
||||
let children = Main.layoutManager.uiGroup.get_children();
|
||||
|
||||
for (let i = 0; i < children.length; i++) {
|
||||
if (children[i] != Main.layoutManager.screenShieldGroup)
|
||||
children[i].opacity = this.opacity;
|
||||
}
|
||||
},
|
||||
onComplete: () => {
|
||||
this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
|
||||
this._unbindOpacity();
|
||||
}
|
||||
});
|
||||
} });
|
||||
}
|
||||
|
||||
_onSessionOpened(client, serviceName) {
|
||||
@@ -1225,11 +1224,10 @@ var LoginDialog = GObject.registerClass({
|
||||
|
||||
Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN });
|
||||
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
duration: 1000,
|
||||
mode: Clutter.AnimationMode.EASE_IN_QUAD
|
||||
});
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 255,
|
||||
time: 1,
|
||||
transition: 'easeInQuad' });
|
||||
|
||||
return true;
|
||||
}
|
||||
@@ -1243,7 +1241,7 @@ var LoginDialog = GObject.registerClass({
|
||||
this._authPrompt.cancel();
|
||||
}
|
||||
|
||||
addCharacter(_unichar) {
|
||||
addCharacter(unichar) {
|
||||
// Don't allow type ahead at the login screen
|
||||
}
|
||||
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getOVirtCredentialsManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
const Signals = imports.signals;
|
||||
|
||||
@@ -15,13 +15,12 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm");
|
||||
const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface);
|
||||
|
||||
var Manager = class {
|
||||
constructor() {
|
||||
constructor(parentActor) {
|
||||
this._aggregateProvider = Provider(Gio.DBus.system,
|
||||
'org.freedesktop.realmd',
|
||||
'/org/freedesktop/realmd',
|
||||
this._reloadRealms.bind(this));
|
||||
this._realms = {};
|
||||
this._loginFormat = null;
|
||||
|
||||
this._signalId = this._aggregateProvider.connect('g-properties-changed',
|
||||
(proxy, properties) => {
|
||||
@@ -87,7 +86,7 @@ var Manager = class {
|
||||
}
|
||||
|
||||
get loginFormat() {
|
||||
if (this._loginFormat)
|
||||
if (this._loginFormat !== undefined)
|
||||
return this._loginFormat;
|
||||
|
||||
this._updateLoginFormat();
|
||||
|
||||
@@ -1,6 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY,
|
||||
DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */
|
||||
|
||||
const { Clutter, Gio, GLib } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -11,13 +9,14 @@ const OVirt = imports.gdm.oVirt;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const SmartcardManager = imports.misc.smartcardManager;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var PASSWORD_SERVICE_NAME = 'gdm-password';
|
||||
var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint';
|
||||
var SMARTCARD_SERVICE_NAME = 'gdm-smartcard';
|
||||
var OVIRT_SERVICE_NAME = 'gdm-ovirtcred';
|
||||
var FADE_ANIMATION_TIME = 160;
|
||||
var CLONE_FADE_ANIMATION_TIME = 250;
|
||||
var FADE_ANIMATION_TIME = 0.16;
|
||||
var CLONE_FADE_ANIMATION_TIME = 0.25;
|
||||
|
||||
var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen';
|
||||
var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication';
|
||||
@@ -46,19 +45,19 @@ function fadeInActor(actor) {
|
||||
|
||||
let hold = new Batch.Hold();
|
||||
actor.show();
|
||||
let [, naturalHeight] = actor.get_preferred_height(-1);
|
||||
let [minHeight, naturalHeight] = actor.get_preferred_height(-1);
|
||||
|
||||
actor.opacity = 0;
|
||||
actor.set_height(0);
|
||||
actor.ease({
|
||||
opacity: 255,
|
||||
Tweener.addTween(actor,
|
||||
{ opacity: 255,
|
||||
height: naturalHeight,
|
||||
duration: FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
time: FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
this.set_height(-1);
|
||||
hold.release();
|
||||
}
|
||||
},
|
||||
});
|
||||
|
||||
return hold;
|
||||
@@ -72,16 +71,16 @@ function fadeOutActor(actor) {
|
||||
}
|
||||
|
||||
let hold = new Batch.Hold();
|
||||
actor.ease({
|
||||
opacity: 0,
|
||||
Tweener.addTween(actor,
|
||||
{ opacity: 0,
|
||||
height: 0,
|
||||
duration: FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
time: FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
this.hide();
|
||||
this.set_height(-1);
|
||||
hold.release();
|
||||
}
|
||||
},
|
||||
});
|
||||
return hold;
|
||||
}
|
||||
@@ -102,11 +101,11 @@ function cloneAndFadeOutActor(actor) {
|
||||
clone.set_position(x, y);
|
||||
|
||||
let hold = new Batch.Hold();
|
||||
clone.ease({
|
||||
opacity: 0,
|
||||
duration: CLONE_FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
Tweener.addTween(clone,
|
||||
{ opacity: 0,
|
||||
time: CLONE_FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
clone.destroy();
|
||||
hold.release();
|
||||
}
|
||||
@@ -304,7 +303,7 @@ var ShellUserVerifier = class {
|
||||
});
|
||||
}
|
||||
|
||||
_oVirtUserAuthenticated(_token) {
|
||||
_oVirtUserAuthenticated(token) {
|
||||
this._preemptingService = OVIRT_SERVICE_NAME;
|
||||
this.emit('ovirt-user-authenticated');
|
||||
}
|
||||
|
||||
@@ -15,5 +15,6 @@ var LOCALEDIR = '@datadir@/locale';
|
||||
/* other standard directories */
|
||||
var LIBEXECDIR = '@libexecdir@';
|
||||
var PKGDATADIR = '@datadir@/@PACKAGE_NAME@';
|
||||
var VPNDIR = '@vpndir@';
|
||||
/* g-i package versions */
|
||||
var LIBMUTTER_API_VERSION = '@LIBMUTTER_API_VERSION@'
|
||||
|
||||
@@ -1,37 +1,23 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported ExtensionState, ExtensionType, getCurrentExtension,
|
||||
getSettings, initTranslations, isOutOfDate, installImporter,
|
||||
serializeExtension, deserializeExtension */
|
||||
|
||||
// Common utils for the extension system and the extension
|
||||
// preferences tool
|
||||
|
||||
const { Gio, GLib } = imports.gi;
|
||||
|
||||
const Gettext = imports.gettext;
|
||||
const Lang = imports.lang;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
|
||||
const Config = imports.misc.config;
|
||||
const FileUtils = imports.misc.fileUtils;
|
||||
|
||||
var ExtensionType = {
|
||||
SYSTEM: 1,
|
||||
PER_USER: 2
|
||||
};
|
||||
|
||||
var ExtensionState = {
|
||||
ENABLED: 1,
|
||||
DISABLED: 2,
|
||||
ERROR: 3,
|
||||
OUT_OF_DATE: 4,
|
||||
DOWNLOADING: 5,
|
||||
INITIALIZED: 6,
|
||||
|
||||
// Used as an error state for operations on unknown extensions,
|
||||
// should never be in a real extensionMeta object.
|
||||
UNINSTALLED: 99
|
||||
};
|
||||
|
||||
const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
|
||||
// Maps uuid -> metadata object
|
||||
var extensions = {};
|
||||
|
||||
/**
|
||||
* getCurrentExtension:
|
||||
@@ -63,17 +49,13 @@ function getCurrentExtension() {
|
||||
if (!match)
|
||||
return null;
|
||||
|
||||
// local import, as the module is used from outside the gnome-shell process
|
||||
// as well (not this function though)
|
||||
let extensionManager = imports.ui.main.extensionManager;
|
||||
|
||||
let path = match[1];
|
||||
let file = Gio.File.new_for_path(path);
|
||||
|
||||
// Walk up the directory tree, looking for an extension with
|
||||
// the same UUID as a directory name.
|
||||
while (file != null) {
|
||||
let extension = extensionManager.lookup(file.get_basename());
|
||||
let extension = extensions[file.get_basename()];
|
||||
if (extension !== undefined)
|
||||
return extension;
|
||||
file = file.get_parent();
|
||||
@@ -165,8 +147,8 @@ function versionCheck(required, current) {
|
||||
let requiredArray = required[i].split('.');
|
||||
if (requiredArray[0] == major &&
|
||||
requiredArray[1] == minor &&
|
||||
((requiredArray[2] === undefined && parseInt(minor) % 2 == 0) ||
|
||||
requiredArray[2] == point))
|
||||
(requiredArray[2] == point ||
|
||||
(requiredArray[2] == undefined && parseInt(minor) % 2 == 0)))
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
@@ -179,50 +161,52 @@ function isOutOfDate(extension) {
|
||||
return false;
|
||||
}
|
||||
|
||||
function serializeExtension(extension) {
|
||||
let obj = {};
|
||||
Lang.copyProperties(extension.metadata, obj);
|
||||
|
||||
SERIALIZED_PROPERTIES.forEach(prop => {
|
||||
obj[prop] = extension[prop];
|
||||
});
|
||||
|
||||
let res = {};
|
||||
for (let key in obj) {
|
||||
let val = obj[key];
|
||||
let type;
|
||||
switch (typeof val) {
|
||||
case 'string':
|
||||
type = 's';
|
||||
break;
|
||||
case 'number':
|
||||
type = 'd';
|
||||
break;
|
||||
case 'boolean':
|
||||
type = 'b';
|
||||
break;
|
||||
default:
|
||||
continue;
|
||||
}
|
||||
res[key] = GLib.Variant.new(type, val);
|
||||
function createExtensionObject(uuid, dir, type) {
|
||||
let metadataFile = dir.get_child('metadata.json');
|
||||
if (!metadataFile.query_exists(null)) {
|
||||
throw new Error('Missing metadata.json');
|
||||
}
|
||||
|
||||
return res;
|
||||
let metadataContents, success, tag;
|
||||
try {
|
||||
[success, metadataContents, tag] = metadataFile.load_contents(null);
|
||||
if (metadataContents instanceof Uint8Array)
|
||||
metadataContents = imports.byteArray.toString(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error(`Failed to load metadata.json: ${e}`);
|
||||
}
|
||||
let meta;
|
||||
try {
|
||||
meta = JSON.parse(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error(`Failed to parse metadata.json: ${e}`);
|
||||
}
|
||||
|
||||
function deserializeExtension(variant) {
|
||||
let res = { metadata: {} };
|
||||
for (let prop in variant) {
|
||||
let val = variant[prop].unpack();
|
||||
if (SERIALIZED_PROPERTIES.includes(prop))
|
||||
res[prop] = val;
|
||||
else
|
||||
res.metadata[prop] = val;
|
||||
let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
|
||||
for (let i = 0; i < requiredProperties.length; i++) {
|
||||
let prop = requiredProperties[i];
|
||||
if (!meta[prop]) {
|
||||
throw new Error(`missing "${prop}" property in metadata.json`);
|
||||
}
|
||||
// add the 2 additional properties to create a valid extension object, as createExtensionObject()
|
||||
res.uuid = res.metadata.uuid;
|
||||
res.dir = Gio.File.new_for_path(res.path);
|
||||
return res;
|
||||
}
|
||||
|
||||
if (uuid != meta.uuid) {
|
||||
throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
|
||||
}
|
||||
|
||||
let extension = {};
|
||||
|
||||
extension.metadata = meta;
|
||||
extension.uuid = meta.uuid;
|
||||
extension.type = type;
|
||||
extension.dir = dir;
|
||||
extension.path = dir.get_path();
|
||||
extension.error = '';
|
||||
extension.hasPrefs = dir.get_child('prefs.js').query_exists(null);
|
||||
|
||||
extensions[uuid] = extension;
|
||||
|
||||
return extension;
|
||||
}
|
||||
|
||||
function installImporter(extension) {
|
||||
@@ -233,3 +217,36 @@ function installImporter(extension) {
|
||||
extension.imports = imports[extension.uuid];
|
||||
imports.searchPath = oldSearchPath;
|
||||
}
|
||||
|
||||
var ExtensionFinder = class {
|
||||
_loadExtension(extensionDir, info, perUserDir) {
|
||||
let fileType = info.get_file_type();
|
||||
if (fileType != Gio.FileType.DIRECTORY)
|
||||
return;
|
||||
let uuid = info.get_name();
|
||||
let existing = extensions[uuid];
|
||||
if (existing) {
|
||||
log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path()));
|
||||
return;
|
||||
}
|
||||
|
||||
let extension;
|
||||
let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER
|
||||
: ExtensionType.SYSTEM;
|
||||
try {
|
||||
extension = createExtensionObject(uuid, extensionDir, type);
|
||||
} catch (e) {
|
||||
logError(e, 'Could not load extension %s'.format(uuid));
|
||||
return;
|
||||
}
|
||||
this.emit('extension-found', extension);
|
||||
}
|
||||
|
||||
scanExtensions() {
|
||||
let perUserDir = Gio.File.new_for_path(global.userdatadir);
|
||||
FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
|
||||
this._loadExtension(dir, info, perUserDir);
|
||||
});
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(ExtensionFinder.prototype);
|
||||
|
||||
@@ -1,6 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
|
||||
recursivelyMoveDir, loadInterfaceXML */
|
||||
|
||||
const { Gio, GLib } = imports.gi;
|
||||
const Config = imports.misc.config;
|
||||
@@ -86,7 +84,7 @@ function loadInterfaceXML(iface) {
|
||||
let f = Gio.File.new_for_uri(uri);
|
||||
|
||||
try {
|
||||
let [ok_, bytes] = f.load_contents(null);
|
||||
let [ok, bytes] = f.load_contents(null);
|
||||
if (bytes instanceof Uint8Array)
|
||||
xml = imports.byteArray.toString(bytes);
|
||||
else
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported PresenceStatus, Presence, Inhibitor, SessionManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getIBusManager */
|
||||
|
||||
const { Gio, GLib, IBus } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const IBusCandidatePopup = imports.ui.ibusCandidatePopup;
|
||||
@@ -18,8 +18,8 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) {
|
||||
IBus.MICRO_VERSION >= requiredMicro))
|
||||
return;
|
||||
|
||||
throw "Found IBus version %d.%d.%d but required is %d.%d.%d"
|
||||
.format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
|
||||
throw "Found IBus version %d.%d.%d but required is %d.%d.%d".
|
||||
format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
|
||||
requiredMajor, requiredMinor, requiredMicro);
|
||||
}
|
||||
|
||||
@@ -58,30 +58,16 @@ var IBusManager = class {
|
||||
this._spawn();
|
||||
}
|
||||
|
||||
_spawn(extraArgs = []) {
|
||||
_spawn() {
|
||||
try {
|
||||
let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs];
|
||||
Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE);
|
||||
Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
|
||||
Gio.SubprocessFlags.NONE);
|
||||
} catch (e) {
|
||||
log(`Failed to launch ibus-daemon: ${e.message}`);
|
||||
}
|
||||
}
|
||||
|
||||
restartDaemon(extraArgs = []) {
|
||||
this._spawn(['-r', ...extraArgs]);
|
||||
}
|
||||
|
||||
_clear() {
|
||||
if (this._cancellable) {
|
||||
this._cancellable.cancel();
|
||||
this._cancellable = null;
|
||||
}
|
||||
|
||||
if (this._preloadEnginesId) {
|
||||
GLib.source_remove(this._preloadEnginesId);
|
||||
this._preloadEnginesId = 0;
|
||||
}
|
||||
|
||||
if (this._panelService)
|
||||
this._panelService.destroy();
|
||||
|
||||
@@ -93,44 +79,33 @@ var IBusManager = class {
|
||||
this._currentEngineName = null;
|
||||
|
||||
this.emit('ready', false);
|
||||
|
||||
this._spawn();
|
||||
}
|
||||
|
||||
_onConnected() {
|
||||
this._cancellable = new Gio.Cancellable();
|
||||
this._ibus.list_engines_async(-1, this._cancellable,
|
||||
this._initEngines.bind(this));
|
||||
this._ibus.list_engines_async(-1, null, this._initEngines.bind(this));
|
||||
this._ibus.request_name_async(IBus.SERVICE_PANEL,
|
||||
IBus.BusNameFlag.REPLACE_EXISTING, -1, this._cancellable,
|
||||
IBus.BusNameFlag.REPLACE_EXISTING,
|
||||
-1, null,
|
||||
this._initPanelService.bind(this));
|
||||
}
|
||||
|
||||
_initEngines(ibus, result) {
|
||||
try {
|
||||
let enginesList = this._ibus.list_engines_async_finish(result);
|
||||
if (enginesList) {
|
||||
for (let i = 0; i < enginesList.length; ++i) {
|
||||
let name = enginesList[i].get_name();
|
||||
this._engines.set(name, enginesList[i]);
|
||||
}
|
||||
this._updateReadiness();
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
|
||||
logError(e);
|
||||
} else {
|
||||
this._clear();
|
||||
}
|
||||
}
|
||||
|
||||
_initPanelService(ibus, result) {
|
||||
let success = false;
|
||||
try {
|
||||
success = !!this._ibus.request_name_async_finish(result);
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
logError(e);
|
||||
}
|
||||
|
||||
let success = this._ibus.request_name_async_finish(result);
|
||||
if (success) {
|
||||
this._panelService = new IBus.PanelService({ connection: this._ibus.get_connection(),
|
||||
object_path: IBus.PATH_PANEL });
|
||||
@@ -157,7 +132,7 @@ var IBusManager = class {
|
||||
} catch (e) {
|
||||
}
|
||||
// If an engine is already active we need to get its properties
|
||||
this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, result) => {
|
||||
this._ibus.get_global_engine_async(-1, null, (i, result) => {
|
||||
let engine;
|
||||
try {
|
||||
engine = this._ibus.get_global_engine_async_finish(result);
|
||||
@@ -229,18 +204,8 @@ var IBusManager = class {
|
||||
return;
|
||||
}
|
||||
|
||||
this._ibus.set_global_engine_async(id,
|
||||
this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
|
||||
this._cancellable, (_bus, res) => {
|
||||
try {
|
||||
this._ibus.set_global_engine_async_finish(res);
|
||||
} catch (e) {
|
||||
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
logError(e);
|
||||
}
|
||||
if (callback)
|
||||
callback();
|
||||
});
|
||||
this._ibus.set_global_engine_async(id, this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
|
||||
null, callback || null);
|
||||
}
|
||||
|
||||
preloadEngines(ids) {
|
||||
@@ -248,19 +213,17 @@ var IBusManager = class {
|
||||
return;
|
||||
|
||||
if (this._preloadEnginesId != 0) {
|
||||
GLib.source_remove(this._preloadEnginesId);
|
||||
Mainloop.source_remove(this._preloadEnginesId);
|
||||
this._preloadEnginesId = 0;
|
||||
}
|
||||
|
||||
this._preloadEnginesId =
|
||||
GLib.timeout_add_seconds(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
this._PRELOAD_ENGINES_DELAY_TIME,
|
||||
Mainloop.timeout_add_seconds(this._PRELOAD_ENGINES_DELAY_TIME,
|
||||
() => {
|
||||
this._ibus.preload_engines_async(
|
||||
ids,
|
||||
-1,
|
||||
this._cancellable,
|
||||
null,
|
||||
null);
|
||||
this._preloadEnginesId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
|
||||
@@ -1,6 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported InputMethod */
|
||||
const { Clutter, GLib, Gio, GObject, IBus } = imports.gi;
|
||||
const { Clutter, GLib, GObject, IBus } = imports.gi;
|
||||
|
||||
const Keyboard = imports.ui.status.keyboard;
|
||||
|
||||
@@ -36,7 +35,15 @@ class InputMethod extends Clutter.InputMethod {
|
||||
}
|
||||
|
||||
_updateCapabilities() {
|
||||
let caps = IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
|
||||
let caps = 0;
|
||||
|
||||
if (this.can_show_preedit)
|
||||
caps |= IBus.Capabilite.PREEDIT_TEXT;
|
||||
|
||||
if (this._currentFocus)
|
||||
caps |= IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
|
||||
else
|
||||
caps |= IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.AUXILIARY_TEXT | IBus.Capabilite.LOOKUP_TABLE | IBus.Capabilite.PROPERTY;
|
||||
|
||||
if (this._context)
|
||||
this._context.set_capabilities(caps);
|
||||
@@ -47,22 +54,12 @@ class InputMethod extends Clutter.InputMethod {
|
||||
}
|
||||
|
||||
_onConnected() {
|
||||
this._cancellable = new Gio.Cancellable();
|
||||
this._ibus.create_input_context_async ('gnome-shell', -1,
|
||||
this._cancellable, this._setContext.bind(this));
|
||||
this._ibus.create_input_context_async ('gnome-shell', -1, null,
|
||||
this._setContext.bind(this));
|
||||
}
|
||||
|
||||
_setContext(bus, res) {
|
||||
try {
|
||||
this._context = this._ibus.create_input_context_async_finish(res);
|
||||
} catch (e) {
|
||||
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) {
|
||||
logError(e);
|
||||
this._clear();
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
this._context.connect('commit-text', this._onCommitText.bind(this));
|
||||
this._context.connect('delete-surrounding-text', this._onDeleteSurroundingText.bind(this));
|
||||
this._context.connect('update-preedit-text', this._onUpdatePreeditText.bind(this));
|
||||
@@ -74,11 +71,6 @@ class InputMethod extends Clutter.InputMethod {
|
||||
}
|
||||
|
||||
_clear() {
|
||||
if (this._cancellable) {
|
||||
this._cancellable.cancel();
|
||||
this._cancellable = null;
|
||||
}
|
||||
|
||||
this._context = null;
|
||||
this._hints = 0;
|
||||
this._purpose = 0;
|
||||
@@ -92,15 +84,15 @@ class InputMethod extends Clutter.InputMethod {
|
||||
this.emit('request-surrounding');
|
||||
}
|
||||
|
||||
_onCommitText(_context, text) {
|
||||
_onCommitText(context, text) {
|
||||
this.commit(text.get_text());
|
||||
}
|
||||
|
||||
_onDeleteSurroundingText() {
|
||||
_onDeleteSurroundingText(context) {
|
||||
this.delete_surrounding();
|
||||
}
|
||||
|
||||
_onUpdatePreeditText(_context, text, pos, visible) {
|
||||
_onUpdatePreeditText(context, text, pos, visible) {
|
||||
if (text == null)
|
||||
return;
|
||||
|
||||
@@ -116,17 +108,17 @@ class InputMethod extends Clutter.InputMethod {
|
||||
this._preeditVisible = visible;
|
||||
}
|
||||
|
||||
_onShowPreeditText() {
|
||||
_onShowPreeditText(context) {
|
||||
this._preeditVisible = true;
|
||||
this.set_preedit_text(this._preeditStr, this._preeditPos);
|
||||
}
|
||||
|
||||
_onHidePreeditText() {
|
||||
_onHidePreeditText(context) {
|
||||
this.set_preedit_text(null, this._preeditPos);
|
||||
this._preeditVisible = false;
|
||||
}
|
||||
|
||||
_onForwardKeyEvent(_context, keyval, keycode, state) {
|
||||
_onForwardKeyEvent(context, keyval, keycode, state) {
|
||||
let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
|
||||
state &= ~(IBus.ModifierType.RELEASE_MASK);
|
||||
|
||||
@@ -144,6 +136,7 @@ class InputMethod extends Clutter.InputMethod {
|
||||
this._currentFocus = focus;
|
||||
if (this._context) {
|
||||
this._context.focus_in();
|
||||
this._updateCapabilities();
|
||||
this._emitRequestSurrounding();
|
||||
}
|
||||
|
||||
@@ -155,8 +148,10 @@ class InputMethod extends Clutter.InputMethod {
|
||||
|
||||
vfunc_focus_out() {
|
||||
this._currentFocus = null;
|
||||
if (this._context)
|
||||
if (this._context) {
|
||||
this._context.focus_out();
|
||||
this._updateCapabilities();
|
||||
}
|
||||
|
||||
if (this._preeditStr) {
|
||||
// Unset any preedit text
|
||||
@@ -259,16 +254,14 @@ class InputMethod extends Clutter.InputMethod {
|
||||
if (event.type() == Clutter.EventType.KEY_RELEASE)
|
||||
state |= IBus.ModifierType.RELEASE_MASK;
|
||||
|
||||
this._context.process_key_event_async(
|
||||
event.get_key_symbol(),
|
||||
this._context.process_key_event_async(event.get_key_symbol(),
|
||||
event.get_key_code() - 8, // Convert XKB keycodes to evcodes
|
||||
state, -1, this._cancellable,
|
||||
state, -1, null,
|
||||
(context, res) => {
|
||||
try {
|
||||
let retval = context.process_key_event_async_finish(res);
|
||||
this.notify_key_event(event, retval);
|
||||
} catch (e) {
|
||||
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
log(`Error processing key on IM: ${e.message}`);
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported IntrospectService */
|
||||
const { Gio, GLib, Meta, Shell } = imports.gi;
|
||||
|
||||
const INTROSPECT_SCHEMA = 'org.gnome.shell';
|
||||
@@ -40,15 +39,6 @@ var IntrospectService = class {
|
||||
});
|
||||
|
||||
this._syncRunningApplications();
|
||||
|
||||
this._whitelistMap = new Map();
|
||||
APP_WHITELIST.forEach(appName => {
|
||||
Gio.DBus.watch_name(Gio.BusType.SESSION,
|
||||
appName,
|
||||
Gio.BusNameWatcherFlags.NONE,
|
||||
(conn, name, owner) => this._whitelistMap.set(name, owner),
|
||||
(conn, name) => this._whitelistMap.delete(name));
|
||||
});
|
||||
}
|
||||
|
||||
_isStandaloneApp(app) {
|
||||
@@ -60,7 +50,7 @@ var IntrospectService = class {
|
||||
}
|
||||
|
||||
_isSenderWhitelisted(sender) {
|
||||
return [...this._whitelistMap.values()].includes(sender);
|
||||
return APP_WHITELIST.includes(sender);
|
||||
}
|
||||
|
||||
_getSandboxedAppId(app) {
|
||||
@@ -136,8 +126,7 @@ var IntrospectService = class {
|
||||
let apps = this._appSystem.get_running();
|
||||
let windowsList = {};
|
||||
|
||||
if (!this._isIntrospectEnabled() &&
|
||||
!this._isSenderWhitelisted(invocation.get_sender())) {
|
||||
if (!this._isIntrospectEnabled()) {
|
||||
invocation.return_error_literal(Gio.DBusError,
|
||||
Gio.DBusError.ACCESS_DENIED,
|
||||
'App introspection not allowed');
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
/* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
|
||||
/* exported getCompletions, getCommonPrefix, getDeclaredConstants */
|
||||
|
||||
// Returns a list of potential completions for text. Completions either
|
||||
// follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo)
|
||||
@@ -9,7 +8,7 @@
|
||||
// This function is likely the one you want to call from external modules
|
||||
function getCompletions(text, commandHeader, globalCompletionList) {
|
||||
let methods = [];
|
||||
let expr_, base;
|
||||
let expr, base;
|
||||
let attrHead = '';
|
||||
if (globalCompletionList == null) {
|
||||
globalCompletionList = [];
|
||||
@@ -22,7 +21,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
|
||||
// Look for expressions like "Main.panel.foo" and match Main.panel and foo
|
||||
let matches = text.match(/(.*)\.(.*)/);
|
||||
if (matches) {
|
||||
[expr_, base, attrHead] = matches;
|
||||
[expr, base, attrHead] = matches;
|
||||
|
||||
methods = getPropertyNamesFromExpression(base, commandHeader).filter(
|
||||
attr => attr.slice(0, attrHead.length) == attrHead
|
||||
@@ -33,7 +32,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
|
||||
// not proceeded by a dot and match them against global constants
|
||||
matches = text.match(/^(\w*)$/);
|
||||
if (text == '' || matches) {
|
||||
[expr_, attrHead] = matches;
|
||||
[expr, attrHead] = matches;
|
||||
methods = globalCompletionList.filter(
|
||||
attr => attr.slice(0, attrHead.length) == attrHead
|
||||
);
|
||||
@@ -172,7 +171,7 @@ function getPropertyNamesFromExpression(expr, commandHeader = '') {
|
||||
|
||||
// Make sure propsUnique contains one key for every
|
||||
// property so we end up with a unique list of properties
|
||||
allProps.map(p => (propsUnique[p] = null));
|
||||
allProps.map(p => propsUnique[p] = null);
|
||||
}
|
||||
return Object.keys(propsUnique).sort();
|
||||
}
|
||||
@@ -217,7 +216,7 @@ function isUnsafeExpression(str) {
|
||||
prunedStr = prunedStr.replace(/[=!]==/g, ''); //replace === and !== with nothing
|
||||
prunedStr = prunedStr.replace(/[=<>!]=/g, ''); //replace ==, <=, >=, != with nothing
|
||||
|
||||
if (prunedStr.match(/[=]/)) {
|
||||
if (prunedStr.match(/=/)) {
|
||||
return true;
|
||||
} else if (prunedStr.match(/;/)) {
|
||||
// If we contain a semicolon not inside of a quote/regex, assume we're unsafe as well
|
||||
@@ -231,10 +230,10 @@ function isUnsafeExpression(str) {
|
||||
function getDeclaredConstants(str) {
|
||||
let ret = [];
|
||||
str.split(';').forEach(s => {
|
||||
let base_, keyword;
|
||||
let base, keyword;
|
||||
let match = s.match(/const\s+(\w+)\s*=/);
|
||||
if (match) {
|
||||
[base_, keyword] = match;
|
||||
[base, keyword] = match;
|
||||
ret.push(keyword);
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getKeyboardManager, holdKeyboard, releaseKeyboard */
|
||||
|
||||
const { GLib, GnomeDesktop, Meta } = imports.gi;
|
||||
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported canLock, getLoginManager, registerSessionWithGDM */
|
||||
|
||||
const { GLib, Gio } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -110,7 +109,7 @@ var LoginManagerSystemd = class {
|
||||
let sessionId = GLib.getenv('XDG_SESSION_ID');
|
||||
if (!sessionId) {
|
||||
log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
|
||||
let [session, objectPath_] = this._userProxy.Display;
|
||||
let [session, objectPath] = this._userProxy.Display;
|
||||
if (session) {
|
||||
log(`Will monitor session ${session}`);
|
||||
sessionId = session;
|
||||
@@ -183,7 +182,7 @@ var LoginManagerSystemd = class {
|
||||
(proxy, result) => {
|
||||
let fd = -1;
|
||||
try {
|
||||
let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
|
||||
let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result);
|
||||
fd = fdList.steal_fds()[0];
|
||||
callback(new Gio.UnixInputStream({ fd: fd }));
|
||||
} catch (e) {
|
||||
@@ -200,7 +199,7 @@ var LoginManagerSystemd = class {
|
||||
Signals.addSignalMethods(LoginManagerSystemd.prototype);
|
||||
|
||||
var LoginManagerDummy = class {
|
||||
getCurrentSessionProxy(_callback) {
|
||||
getCurrentSessionProxy(callback) {
|
||||
// we could return a DummySession object that fakes whatever callers
|
||||
// expect (at the time of writing: connect() and connectSignal()
|
||||
// methods), but just never calling the callback should be safer
|
||||
|
||||
@@ -7,6 +7,7 @@ jsconf.set10('HAVE_BLUETOOTH', bt_dep.found())
|
||||
jsconf.set10('HAVE_NETWORKMANAGER', have_networkmanager)
|
||||
jsconf.set('datadir', datadir)
|
||||
jsconf.set('libexecdir', libexecdir)
|
||||
jsconf.set('vpndir', vpndir)
|
||||
|
||||
config_js = configure_file(
|
||||
input: 'config.js.in',
|
||||
|
||||
@@ -84,9 +84,9 @@ function _findProviderForSid(sid) {
|
||||
}
|
||||
|
||||
|
||||
// ----------------------------------------------------- //
|
||||
// Support for the old ModemManager interface (MM < 0.7) //
|
||||
// ----------------------------------------------------- //
|
||||
//------------------------------------------------------------------------------
|
||||
// Support for the old ModemManager interface (MM < 0.7)
|
||||
//------------------------------------------------------------------------------
|
||||
|
||||
|
||||
// The following are not the complete interfaces, just the methods we need
|
||||
@@ -110,7 +110,7 @@ var ModemGsm = class {
|
||||
this.signal_quality = quality;
|
||||
this.emit('notify::signal-quality');
|
||||
});
|
||||
this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
|
||||
this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => {
|
||||
this.operator_name = _findProviderForMccMnc(name, code);
|
||||
this.emit('notify::operator-name');
|
||||
});
|
||||
@@ -120,7 +120,7 @@ var ModemGsm = class {
|
||||
return;
|
||||
}
|
||||
|
||||
let [status_, code, name] = result;
|
||||
let [status, code, name] = result;
|
||||
this.operator_name = _findProviderForMccMnc(name, code);
|
||||
this.emit('notify::operator-name');
|
||||
});
|
||||
@@ -171,7 +171,7 @@ var ModemCdma = class {
|
||||
// it will return an error if the device is not connected
|
||||
this.operator_name = null;
|
||||
} else {
|
||||
let [bandClass_, band_, sid] = result;
|
||||
let [bandClass, band, sid] = result;
|
||||
|
||||
this.operator_name = _findProviderForSid(sid);
|
||||
}
|
||||
@@ -182,9 +182,9 @@ var ModemCdma = class {
|
||||
Signals.addSignalMethods(ModemCdma.prototype);
|
||||
|
||||
|
||||
// ------------------------------------------------------- //
|
||||
// Support for the new ModemManager1 interface (MM >= 0.7) //
|
||||
// ------------------------------------------------------- //
|
||||
//------------------------------------------------------------------------------
|
||||
// Support for the new ModemManager1 interface (MM >= 0.7)
|
||||
//------------------------------------------------------------------------------
|
||||
|
||||
const BroadbandModemInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem');
|
||||
const BroadbandModemProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemInterface);
|
||||
@@ -224,7 +224,7 @@ var BroadbandModem = class {
|
||||
}
|
||||
|
||||
_reloadSignalQuality() {
|
||||
let [quality, recent_] = this._proxy.SignalQuality;
|
||||
let [quality, recent] = this._proxy.SignalQuality;
|
||||
this.signal_quality = quality;
|
||||
this.emit('notify::signal-quality');
|
||||
}
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported parse */
|
||||
|
||||
// parse:
|
||||
// @params: caller-provided parameter object, or %null
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported PermissionStore */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getSmartcardManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
const Signals = imports.signals;
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported getDefault */
|
||||
const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi;
|
||||
|
||||
const GnomeSession = imports.misc.gnomeSession;
|
||||
@@ -174,19 +173,11 @@ const SystemActions = GObject.registerClass({
|
||||
});
|
||||
Main.layoutManager.connect('monitors-changed',
|
||||
() => this._updateOrientationLock());
|
||||
this._sensorProxy = new SensorProxy(Gio.DBus.system,
|
||||
SENSOR_BUS_NAME,
|
||||
SENSOR_OBJECT_PATH,
|
||||
(proxy, error) => {
|
||||
if (error)
|
||||
log(error.message);
|
||||
},
|
||||
null,
|
||||
Gio.DBusProxyFlags.DO_NOT_AUTO_START);
|
||||
this._sensorProxy.connect('g-properties-changed', () => {
|
||||
this._updateOrientationLock();
|
||||
});
|
||||
this._sensorProxy.connect('notify::g-name-owner', () => {
|
||||
Gio.DBus.system.watch_name(SENSOR_BUS_NAME,
|
||||
Gio.BusNameWatcherFlags.NONE,
|
||||
() => this._sensorProxyAppeared(),
|
||||
() => {
|
||||
this._sensorProxy = null;
|
||||
this._updateOrientationLock();
|
||||
});
|
||||
this._updateOrientationLock();
|
||||
@@ -196,44 +187,50 @@ const SystemActions = GObject.registerClass({
|
||||
this._sessionUpdated();
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_power_off() {
|
||||
return this._actions.get(POWER_OFF_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_suspend() {
|
||||
return this._actions.get(SUSPEND_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_lock_screen() {
|
||||
return this._actions.get(LOCK_SCREEN_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_switch_user() {
|
||||
return this._actions.get(SWITCH_USER_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_logout() {
|
||||
return this._actions.get(LOGOUT_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_lock_orientation() {
|
||||
return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get orientation_lock_icon() {
|
||||
return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName;
|
||||
}
|
||||
|
||||
_sensorProxyAppeared() {
|
||||
this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH,
|
||||
(proxy, error) => {
|
||||
if (error) {
|
||||
log(error.message);
|
||||
return;
|
||||
}
|
||||
this._sensorProxy.connect('g-properties-changed',
|
||||
() => this._updateOrientationLock());
|
||||
this._updateOrientationLock();
|
||||
});
|
||||
}
|
||||
|
||||
_updateOrientationLock() {
|
||||
let available = false;
|
||||
if (this._sensorProxy.g_name_owner)
|
||||
if (this._sensorProxy)
|
||||
available = this._sensorProxy.HasAccelerometer &&
|
||||
this._monitorManager.get_is_builtin_display_on();
|
||||
|
||||
@@ -244,8 +241,7 @@ const SystemActions = GObject.registerClass({
|
||||
|
||||
_updateOrientationLockIcon() {
|
||||
let locked = this._orientationSettings.get_boolean('orientation-lock');
|
||||
let iconName = locked
|
||||
? 'rotation-locked-symbolic'
|
||||
let iconName = locked ? 'rotation-locked-symbolic'
|
||||
: 'rotation-allowed-symbolic';
|
||||
this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName = iconName;
|
||||
|
||||
@@ -269,7 +265,7 @@ const SystemActions = GObject.registerClass({
|
||||
|
||||
getMatchingActions(terms) {
|
||||
// terms is a list of strings
|
||||
terms = terms.map(term => term.toLowerCase());
|
||||
terms = terms.map((term) => term.toLowerCase());
|
||||
|
||||
let results = [];
|
||||
|
||||
|
||||
130
js/misc/util.js
130
js/misc/util.js
@@ -1,20 +1,20 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
|
||||
formatTime, formatTimeSpan, createTimeLabel, insertSorted,
|
||||
makeCloseButton, ensureActorVisibleInScrollView */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Shell, St, GnomeDesktop } = imports.gi;
|
||||
const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
|
||||
const Gettext = imports.gettext;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Params = imports.misc.params;
|
||||
|
||||
var SCROLL_TIME = 100;
|
||||
var SCROLL_TIME = 0.1;
|
||||
|
||||
// http://daringfireball.net/2010/07/improved_regex_for_matching_urls
|
||||
const _balancedParens = '\\([^\\s()<>]+\\)';
|
||||
const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]';
|
||||
const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u200E\u200F\u201C\u201D\u2018\u2019\u202A\u202C]';
|
||||
const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u201C\u201D\u2018\u2019]';
|
||||
|
||||
const _urlRegexp = new RegExp(
|
||||
`(^|${_leadingJunk})` +
|
||||
@@ -75,7 +75,7 @@ function spawn(argv) {
|
||||
// occur when trying to parse or start the program.
|
||||
function spawnCommandLine(commandLine) {
|
||||
try {
|
||||
let [success_, argv] = GLib.shell_parse_argv(commandLine);
|
||||
let [success, argv] = GLib.shell_parse_argv(commandLine);
|
||||
trySpawn(argv);
|
||||
} catch (err) {
|
||||
_handleSpawnError(commandLine, err);
|
||||
@@ -104,9 +104,9 @@ function spawnApp(argv) {
|
||||
// Runs @argv in the background. If launching @argv fails,
|
||||
// this will throw an error.
|
||||
function trySpawn(argv) {
|
||||
var success_, pid;
|
||||
var success, pid;
|
||||
try {
|
||||
[success_, pid] = GLib.spawn_async(null, argv, null,
|
||||
[success, pid] = GLib.spawn_async(null, argv, null,
|
||||
GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
|
||||
null);
|
||||
} catch (err) {
|
||||
@@ -127,14 +127,6 @@ function trySpawn(argv) {
|
||||
throw err;
|
||||
}
|
||||
}
|
||||
|
||||
// Async call, we don't need the reply though
|
||||
try {
|
||||
GnomeDesktop.start_systemd_scope(argv[0], pid, null, null, null, () => {});
|
||||
} catch (err) {
|
||||
// Ignore error; it likely means GnomeDesktop is too old
|
||||
}
|
||||
|
||||
// Dummy child watch; we don't want to double-fork internally
|
||||
// because then we lose the parent-child relationship, which
|
||||
// can break polkit. See https://bugzilla.redhat.com//show_bug.cgi?id=819275
|
||||
@@ -147,10 +139,10 @@ function trySpawn(argv) {
|
||||
// Runs @commandLine in the background. If launching @commandLine
|
||||
// fails, this will throw an error.
|
||||
function trySpawnCommandLine(commandLine) {
|
||||
let success_, argv;
|
||||
let success, argv;
|
||||
|
||||
try {
|
||||
[success_, argv] = GLib.shell_parse_argv(commandLine);
|
||||
[success, argv] = GLib.shell_parse_argv(commandLine);
|
||||
} catch (err) {
|
||||
// Replace "Error invoking GLib.shell_parse_argv: " with
|
||||
// something nicer
|
||||
@@ -321,8 +313,7 @@ function lowerBound(array, val, cmp) {
|
||||
if (array.length == 0)
|
||||
return 0;
|
||||
|
||||
min = 0;
|
||||
max = array.length;
|
||||
min = 0; max = array.length;
|
||||
while (min < (max - 1)) {
|
||||
mid = Math.floor((min + max) / 2);
|
||||
v = cmp(array[mid], val);
|
||||
@@ -404,7 +395,7 @@ function makeCloseButton(boxpointer) {
|
||||
|
||||
function ensureActorVisibleInScrollView(scrollView, actor) {
|
||||
let adjustment = scrollView.vscroll.adjustment;
|
||||
let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values();
|
||||
let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values();
|
||||
|
||||
let offset = 0;
|
||||
let vfade = scrollView.get_effect("fade");
|
||||
@@ -432,8 +423,97 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
|
||||
else
|
||||
return;
|
||||
|
||||
adjustment.ease(value, {
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: SCROLL_TIME
|
||||
Tweener.addTween(adjustment,
|
||||
{ value: value,
|
||||
time: SCROLL_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
}
|
||||
|
||||
var AppSettingsMonitor = class {
|
||||
constructor(appId, schemaId) {
|
||||
this._appId = appId;
|
||||
this._schemaId = schemaId;
|
||||
|
||||
this._app = null;
|
||||
this._settings = null;
|
||||
this._handlers = [];
|
||||
|
||||
this._schemaSource = Gio.SettingsSchemaSource.get_default();
|
||||
|
||||
this._appSystem = Shell.AppSystem.get_default();
|
||||
this._appSystem.connect('installed-changed',
|
||||
this._onInstalledChanged.bind(this));
|
||||
this._onInstalledChanged();
|
||||
}
|
||||
|
||||
get available() {
|
||||
return this._app != null && this._settings != null;
|
||||
}
|
||||
|
||||
activateApp() {
|
||||
if (this._app)
|
||||
this._app.activate();
|
||||
}
|
||||
|
||||
watchSetting(key, callback) {
|
||||
let handler = { id: 0, key: key, callback: callback };
|
||||
this._handlers.push(handler);
|
||||
|
||||
this._connectHandler(handler);
|
||||
}
|
||||
|
||||
_connectHandler(handler) {
|
||||
if (!this._settings || handler.id > 0)
|
||||
return;
|
||||
|
||||
handler.id = this._settings.connect(`changed::${handler.key}`,
|
||||
handler.callback);
|
||||
handler.callback(this._settings, handler.key);
|
||||
}
|
||||
|
||||
_disconnectHandler(handler) {
|
||||
if (this._settings && handler.id > 0)
|
||||
this._settings.disconnect(handler.id);
|
||||
handler.id = 0;
|
||||
}
|
||||
|
||||
_onInstalledChanged() {
|
||||
let hadApp = (this._app != null);
|
||||
this._app = this._appSystem.lookup_app(this._appId);
|
||||
let haveApp = (this._app != null);
|
||||
|
||||
if (hadApp == haveApp)
|
||||
return;
|
||||
|
||||
if (haveApp)
|
||||
this._checkSettings();
|
||||
else
|
||||
this._setSettings(null);
|
||||
}
|
||||
|
||||
_setSettings(settings) {
|
||||
this._handlers.forEach((handler) => this._disconnectHandler(handler));
|
||||
|
||||
let hadSettings = (this._settings != null);
|
||||
this._settings = settings;
|
||||
let haveSettings = (this._settings != null);
|
||||
|
||||
this._handlers.forEach((handler) => this._connectHandler(handler));
|
||||
|
||||
if (hadSettings != haveSettings)
|
||||
this.emit('available-changed');
|
||||
}
|
||||
|
||||
_checkSettings() {
|
||||
let schema = this._schemaSource.lookup(this._schemaId, true);
|
||||
if (schema) {
|
||||
this._setSettings(new Gio.Settings({ settings_schema: schema }));
|
||||
} else if (this._app) {
|
||||
Mainloop.timeout_add_seconds(1, () => {
|
||||
this._checkSettings();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(AppSettingsMonitor.prototype);
|
||||
|
||||
@@ -1,19 +1,10 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
|
||||
const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi;
|
||||
const { Geoclue, Gio, GLib, GWeather } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const PermissionStore = imports.misc.permissionStore;
|
||||
|
||||
const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration');
|
||||
|
||||
const WEATHER_BUS_NAME = 'org.gnome.Weather';
|
||||
const WEATHER_OBJECT_PATH = '/org/gnome/Weather';
|
||||
const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration';
|
||||
|
||||
const WEATHER_APP_ID = 'org.gnome.Weather.desktop';
|
||||
const Util = imports.misc.util;
|
||||
|
||||
// Minimum time between updates to show loading indication
|
||||
var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE;
|
||||
@@ -32,7 +23,6 @@ var WeatherClient = class {
|
||||
this._gclueStarting = false;
|
||||
this._gclueLocationChangedId = 0;
|
||||
|
||||
this._needsAuth = true;
|
||||
this._weatherAuthorized = false;
|
||||
this._permStore = new PermissionStore.PermissionStore((proxy, error) => {
|
||||
if (error) {
|
||||
@@ -76,38 +66,17 @@ var WeatherClient = class {
|
||||
this.emit('changed');
|
||||
});
|
||||
|
||||
this._weatherApp = null;
|
||||
this._weatherProxy = null;
|
||||
|
||||
let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface);
|
||||
Gio.DBusProxy.new(
|
||||
Gio.DBus.session,
|
||||
Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES,
|
||||
nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE),
|
||||
WEATHER_BUS_NAME,
|
||||
WEATHER_OBJECT_PATH,
|
||||
WEATHER_INTEGRATION_IFACE,
|
||||
null,
|
||||
this._onWeatherProxyReady.bind(this));
|
||||
|
||||
this._settings = new Gio.Settings({
|
||||
schema_id: 'org.gnome.shell.weather'
|
||||
});
|
||||
this._settings.connect('changed::automatic-location',
|
||||
this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop',
|
||||
'org.gnome.Weather');
|
||||
this._weatherAppMon.connect('available-changed', () => this.emit('changed'));
|
||||
this._weatherAppMon.watchSetting('automatic-location',
|
||||
this._onAutomaticLocationChanged.bind(this));
|
||||
this._onAutomaticLocationChanged();
|
||||
this._settings.connect('changed::locations',
|
||||
this._weatherAppMon.watchSetting('locations',
|
||||
this._onLocationsChanged.bind(this));
|
||||
this._onLocationsChanged();
|
||||
|
||||
this._appSystem = Shell.AppSystem.get_default();
|
||||
this._appSystem.connect('installed-changed',
|
||||
this._onInstalledChanged.bind(this));
|
||||
this._onInstalledChanged();
|
||||
}
|
||||
|
||||
get available() {
|
||||
return this._weatherApp != null;
|
||||
return this._weatherAppMon.available;
|
||||
}
|
||||
|
||||
get loading() {
|
||||
@@ -123,8 +92,7 @@ var WeatherClient = class {
|
||||
}
|
||||
|
||||
activateApp() {
|
||||
if (this._weatherApp)
|
||||
this._weatherApp.activate();
|
||||
this._weatherAppMon.activateApp();
|
||||
}
|
||||
|
||||
update() {
|
||||
@@ -143,46 +111,7 @@ var WeatherClient = class {
|
||||
get _useAutoLocation() {
|
||||
return this._autoLocationRequested &&
|
||||
this._locationSettings.get_boolean('enabled') &&
|
||||
(!this._needsAuth || this._weatherAuthorized);
|
||||
}
|
||||
|
||||
_onWeatherProxyReady(o, res) {
|
||||
try {
|
||||
this._weatherProxy = Gio.DBusProxy.new_finish(res);
|
||||
} catch (e) {
|
||||
log(`Failed to create GNOME Weather proxy: ${e}`);
|
||||
return;
|
||||
}
|
||||
|
||||
this._weatherProxy.connect('g-properties-changed',
|
||||
this._onWeatherPropertiesChanged.bind(this));
|
||||
this._onWeatherPropertiesChanged();
|
||||
}
|
||||
|
||||
_onWeatherPropertiesChanged() {
|
||||
if (this._weatherProxy.g_name_owner == null)
|
||||
return;
|
||||
|
||||
this._settings.set_boolean('automatic-location',
|
||||
this._weatherProxy.AutomaticLocation);
|
||||
this._settings.set_value('locations',
|
||||
new GLib.Variant('av', this._weatherProxy.Locations));
|
||||
}
|
||||
|
||||
_onInstalledChanged() {
|
||||
let hadApp = (this._weatherApp != null);
|
||||
this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
|
||||
let haveApp = (this._weatherApp != null);
|
||||
|
||||
if (hadApp !== haveApp)
|
||||
this.emit('changed');
|
||||
|
||||
let neededAuth = this._needsAuth;
|
||||
this._needsAuth = this._weatherApp === null ||
|
||||
this._weatherApp.app_info.has_key('X-Flatpak');
|
||||
|
||||
if (neededAuth !== this._needsAuth)
|
||||
this._updateAutoLocation();
|
||||
this._weatherAuthorized;
|
||||
}
|
||||
|
||||
_loadInfo() {
|
||||
@@ -269,8 +198,8 @@ var WeatherClient = class {
|
||||
this._setLocation(location);
|
||||
}
|
||||
|
||||
_onAutomaticLocationChanged() {
|
||||
let useAutoLocation = this._settings.get_boolean('automatic-location');
|
||||
_onAutomaticLocationChanged(settings, key) {
|
||||
let useAutoLocation = settings.get_boolean(key);
|
||||
if (this._autoLocationRequested == useAutoLocation)
|
||||
return;
|
||||
|
||||
@@ -288,9 +217,8 @@ var WeatherClient = class {
|
||||
this._setLocation(this._mostRecentLocation);
|
||||
}
|
||||
|
||||
_onLocationsChanged() {
|
||||
let locations = this._settings.get_value('locations').deep_unpack();
|
||||
let serialized = locations.shift();
|
||||
_onLocationsChanged(settings, key) {
|
||||
let serialized = settings.get_value(key).deep_unpack().shift();
|
||||
let mostRecentLocation = null;
|
||||
|
||||
if (serialized)
|
||||
@@ -306,7 +234,7 @@ var WeatherClient = class {
|
||||
}
|
||||
|
||||
_onPermStoreChanged(proxy, sender, params) {
|
||||
let [table, id, deleted_, data_, perms] = params;
|
||||
let [table, id, deleted, data, perms] = params;
|
||||
|
||||
if (table != 'gnome' || id != 'geolocation')
|
||||
return;
|
||||
|
||||
@@ -1,9 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported run, script_overviewShowStart, script_overviewShowDone,
|
||||
script_applicationsShowStart, script_applicationsShowDone,
|
||||
script_afterShowHide, malloc_usedSize, glx_swapComplete,
|
||||
clutter_stagePaintDone */
|
||||
/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */
|
||||
|
||||
const System = imports.system;
|
||||
|
||||
@@ -126,11 +121,9 @@ function *run() {
|
||||
|
||||
for (let i = 0; i < 2; i++) {
|
||||
Scripting.scriptEvent('applicationsShowStart');
|
||||
// eslint-disable-next-line require-atomic-updates
|
||||
Main.overview._dash.showAppsButton.checked = true;
|
||||
yield Scripting.waitLeisure();
|
||||
Scripting.scriptEvent('applicationsShowDone');
|
||||
// eslint-disable-next-line require-atomic-updates
|
||||
Main.overview._dash.showAppsButton.checked = false;
|
||||
yield Scripting.waitLeisure();
|
||||
}
|
||||
@@ -154,7 +147,7 @@ function script_overviewShowStart(time) {
|
||||
overviewFrames = 0;
|
||||
}
|
||||
|
||||
function script_overviewShowDone(_time) {
|
||||
function script_overviewShowDone(time) {
|
||||
// We've set up the state at the end of the zoom out, but we
|
||||
// need to wait for one more frame to paint before we count
|
||||
// ourselves as done.
|
||||
@@ -173,7 +166,7 @@ function script_applicationsShowDone(time) {
|
||||
METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart;
|
||||
}
|
||||
|
||||
function script_afterShowHide(_time) {
|
||||
function script_afterShowHide(time) {
|
||||
if (overviewShowCount == 1) {
|
||||
METRICS.usedAfterOverview.value = mallocUsedSize;
|
||||
} else {
|
||||
|
||||
@@ -1,12 +1,3 @@
|
||||
/* exported run, script_desktopShown, script_overviewShowStart,
|
||||
script_overviewShowDone, script_applicationsShowStart,
|
||||
script_applicationsShowDone, script_mainViewDrawStart,
|
||||
script_mainViewDrawDone, script_overviewDrawStart,
|
||||
script_overviewDrawDone, script_redrawTestStart,
|
||||
script_redrawTestDone, script_collectTimings,
|
||||
script_geditLaunch, script_geditFirstFrame,
|
||||
clutter_stagePaintStart, clutter_paintCompletedTimestamp */
|
||||
/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */
|
||||
const { Clutter, Gio, Shell } = imports.gi;
|
||||
const Main = imports.ui.main;
|
||||
const Scripting = imports.ui.scripting;
|
||||
@@ -47,7 +38,7 @@ function waitAndDraw(milliseconds) {
|
||||
let timeline = new Clutter.Timeline({ duration: milliseconds });
|
||||
timeline.start();
|
||||
|
||||
timeline.connect('new-frame', (_timeline, _frame) => {
|
||||
timeline.connect('new-frame', (timeline, frame) => {
|
||||
global.stage.queue_redraw();
|
||||
});
|
||||
|
||||
@@ -57,7 +48,7 @@ function waitAndDraw(milliseconds) {
|
||||
cb();
|
||||
});
|
||||
|
||||
return callback => (cb = callback);
|
||||
return callback => cb = callback;
|
||||
}
|
||||
|
||||
function waitSignal(object, signal) {
|
||||
@@ -69,7 +60,7 @@ function waitSignal(object, signal) {
|
||||
cb();
|
||||
});
|
||||
|
||||
return callback => (cb = callback);
|
||||
return callback => cb = callback;
|
||||
}
|
||||
|
||||
function extractBootTimestamp() {
|
||||
@@ -82,8 +73,8 @@ function extractBootTimestamp() {
|
||||
let result = null;
|
||||
|
||||
let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe());
|
||||
while (true) { // eslint-disable-line no-constant-condition
|
||||
let [line, length_] = datastream.read_line_utf8(null);
|
||||
while (true) {
|
||||
let [line, length] = datastream.read_line_utf8(null);
|
||||
if (line === null)
|
||||
break;
|
||||
|
||||
@@ -126,7 +117,6 @@ function *run() {
|
||||
yield Scripting.sleep(1000);
|
||||
|
||||
Scripting.scriptEvent('applicationsShowStart');
|
||||
// eslint-disable-next-line require-atomic-updates
|
||||
Main.overview._dash.showAppsButton.checked = true;
|
||||
|
||||
yield Scripting.waitLeisure();
|
||||
@@ -137,9 +127,9 @@ function *run() {
|
||||
Main.overview.hide();
|
||||
yield Scripting.waitLeisure();
|
||||
|
||||
// --------------------- //
|
||||
// Tests of redraw speed //
|
||||
// --------------------- //
|
||||
////////////////////////////////////////
|
||||
// Tests of redraw speed
|
||||
////////////////////////////////////////
|
||||
|
||||
global.frame_timestamps = true;
|
||||
global.frame_finish_timestamp = true;
|
||||
@@ -186,6 +176,8 @@ function *run() {
|
||||
|
||||
yield Scripting.sleep(1000);
|
||||
|
||||
////////////////////////////////////////
|
||||
|
||||
let appSys = Shell.AppSystem.get_default();
|
||||
let app = appSys.lookup_app('org.gnome.gedit.desktop');
|
||||
|
||||
@@ -242,31 +234,31 @@ function script_applicationsShowDone(time) {
|
||||
METRICS.applicationsShowTime.value = time - applicationsShowStart;
|
||||
}
|
||||
|
||||
function script_mainViewDrawStart(_time) {
|
||||
function script_mainViewDrawStart(time) {
|
||||
redrawTiming = 'mainView';
|
||||
}
|
||||
|
||||
function script_mainViewDrawDone(_time) {
|
||||
function script_mainViewDrawDone(time) {
|
||||
redrawTiming = null;
|
||||
}
|
||||
|
||||
function script_overviewDrawStart(_time) {
|
||||
function script_overviewDrawStart(time) {
|
||||
redrawTiming = 'overview';
|
||||
}
|
||||
|
||||
function script_overviewDrawDone(_time) {
|
||||
function script_overviewDrawDone(time) {
|
||||
redrawTiming = null;
|
||||
}
|
||||
|
||||
function script_redrawTestStart(_time) {
|
||||
function script_redrawTestStart(time) {
|
||||
redrawTiming = 'application';
|
||||
}
|
||||
|
||||
function script_redrawTestDone(_time) {
|
||||
function script_redrawTestDone(time) {
|
||||
redrawTiming = null;
|
||||
}
|
||||
|
||||
function script_collectTimings(_time) {
|
||||
function script_collectTimings(time) {
|
||||
for (let timing in redrawTimes) {
|
||||
let times = redrawTimes[timing];
|
||||
times.sort((a, b) => a - b);
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported main */
|
||||
const Format = imports.format;
|
||||
const Gettext = imports.gettext;
|
||||
const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi;
|
||||
@@ -152,7 +151,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
|
||||
this._webView.load_uri(this._originalUrl);
|
||||
}
|
||||
|
||||
vfunc_delete_event(_event) {
|
||||
vfunc_delete_event(event) {
|
||||
if (this._recheckAtExit)
|
||||
this._doneCallback(PortalHelperResult.RECHECK);
|
||||
else
|
||||
@@ -178,7 +177,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
|
||||
this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
|
||||
}
|
||||
|
||||
_onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) {
|
||||
_onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) {
|
||||
this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
|
||||
let uri = new Soup.URI(failingURI);
|
||||
this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host());
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported AccessDialogDBus */
|
||||
const { Clutter, Gio, GLib, GObject, Shell } = imports.gi;
|
||||
|
||||
const CheckBox = imports.ui.checkBox;
|
||||
@@ -80,7 +79,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
|
||||
this._requestExported = this._request.export(connection, this._handle);
|
||||
}
|
||||
|
||||
CloseAsync(invocation, _params) {
|
||||
CloseAsync(invocation, params) {
|
||||
if (this._invocation.get_sender() != invocation.get_sender()) {
|
||||
invocation.return_error_literal(Gio.DBusError,
|
||||
Gio.DBusError.ACCESS_DENIED,
|
||||
@@ -133,7 +132,7 @@ var AccessDialogDBus = class {
|
||||
return;
|
||||
}
|
||||
|
||||
let [handle, appId, parentWindow_, title, subtitle, body, options] = params;
|
||||
let [handle, appId, parentWindow, title, subtitle, body, options] = params;
|
||||
// We probably want to use parentWindow and global.display.focus_window
|
||||
// for this check in the future
|
||||
if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) {
|
||||
@@ -147,7 +146,7 @@ var AccessDialogDBus = class {
|
||||
subtitle, body, options);
|
||||
dialog.open();
|
||||
|
||||
dialog.connect('closed', () => (this._accessDialog = null));
|
||||
dialog.connect('closed', () => this._accessDialog = null);
|
||||
|
||||
this._accessDialog = dialog;
|
||||
}
|
||||
|
||||
@@ -1,17 +1,17 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup,
|
||||
WindowCyclerPopup */
|
||||
|
||||
const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const SwitcherPopup = imports.ui.switcherPopup;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds
|
||||
|
||||
var THUMBNAIL_DEFAULT_SIZE = 256;
|
||||
var THUMBNAIL_POPUP_TIME = 500; // milliseconds
|
||||
var THUMBNAIL_FADE_TIME = 100; // milliseconds
|
||||
var THUMBNAIL_FADE_TIME = 0.1; // seconds
|
||||
|
||||
var WINDOW_PREVIEW_SIZE = 128;
|
||||
var APP_ICON_SIZE = 96;
|
||||
@@ -87,9 +87,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
let hPadding = leftPadding + rightPadding;
|
||||
|
||||
let icon = this._items[this._selectedIndex];
|
||||
let [posX] = icon.get_transformed_position();
|
||||
let [posX, posY] = icon.get_transformed_position();
|
||||
let thumbnailCenter = posX + icon.width / 2;
|
||||
let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
|
||||
let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
|
||||
childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2));
|
||||
if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) {
|
||||
let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding;
|
||||
@@ -103,7 +103,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
childBox.x2 = primary.x + primary.width - rightPadding;
|
||||
childBox.y1 = this._switcherList.allocation.y2 + spacing;
|
||||
this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1);
|
||||
let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
|
||||
let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
|
||||
childBox.y2 = childBox.y1 + childNaturalHeight;
|
||||
this._thumbnails.allocate(childBox, flags);
|
||||
}
|
||||
@@ -291,7 +291,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
if (this._thumbnails)
|
||||
this._destroyThumbnails();
|
||||
if (this._thumbnailTimeoutId != 0)
|
||||
GLib.source_remove(this._thumbnailTimeoutId);
|
||||
Mainloop.source_remove(this._thumbnailTimeoutId);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -326,7 +326,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
}
|
||||
|
||||
if (this._thumbnailTimeoutId != 0) {
|
||||
GLib.source_remove(this._thumbnailTimeoutId);
|
||||
Mainloop.source_remove(this._thumbnailTimeoutId);
|
||||
this._thumbnailTimeoutId = 0;
|
||||
}
|
||||
|
||||
@@ -343,8 +343,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
this._thumbnails.highlight(window, forceAppFocus);
|
||||
} else if (this._items[this._selectedIndex].cachedWindows.length > 1 &&
|
||||
!forceAppFocus) {
|
||||
this._thumbnailTimeoutId = GLib.timeout_add(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
this._thumbnailTimeoutId = Mainloop.timeout_add (
|
||||
THUMBNAIL_POPUP_TIME,
|
||||
this._timeoutPopupThumbnails.bind(this));
|
||||
GLib.Source.set_name_by_id(this._thumbnailTimeoutId, '[gnome-shell] this._timeoutPopupThumbnails');
|
||||
@@ -361,10 +360,10 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
|
||||
_destroyThumbnails() {
|
||||
let thumbnailsActor = this._thumbnails;
|
||||
this._thumbnails.ease({
|
||||
opacity: 0,
|
||||
duration: THUMBNAIL_FADE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
Tweener.addTween(thumbnailsActor,
|
||||
{ opacity: 0,
|
||||
time: THUMBNAIL_FADE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
thumbnailsActor.destroy();
|
||||
this.thumbnailsVisible = false;
|
||||
@@ -392,13 +391,11 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
this._thumbnails.get_allocation_box();
|
||||
|
||||
this._thumbnails.opacity = 0;
|
||||
this._thumbnails.ease({
|
||||
opacity: 255,
|
||||
duration: THUMBNAIL_FADE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this.thumbnailsVisible = true;
|
||||
}
|
||||
Tweener.addTween(this._thumbnails,
|
||||
{ opacity: 255,
|
||||
time: THUMBNAIL_FADE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => this.thumbnailsVisible = true
|
||||
});
|
||||
|
||||
this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
|
||||
@@ -437,8 +434,8 @@ class CyclerHighlight {
|
||||
if (this._clone.source)
|
||||
this._clone.source.sync_visibility();
|
||||
|
||||
let windowActor = this._window
|
||||
? this._window.get_compositor_private() : null;
|
||||
let windowActor = this._window ? this._window.get_compositor_private()
|
||||
: null;
|
||||
|
||||
if (windowActor)
|
||||
windowActor.hide();
|
||||
@@ -472,7 +469,7 @@ var CyclerList = GObject.registerClass({
|
||||
'item-removed': { param_types: [GObject.TYPE_INT] },
|
||||
'item-highlighted': { param_types: [GObject.TYPE_INT] } },
|
||||
}, class CyclerList extends St.Widget {
|
||||
highlight(index, _justOutline) {
|
||||
highlight(index, justOutline) {
|
||||
this.emit('item-highlighted', index);
|
||||
}
|
||||
});
|
||||
@@ -497,7 +494,7 @@ var CyclerPopup = GObject.registerClass({
|
||||
});
|
||||
}
|
||||
|
||||
_highlightItem(index, _justOutline) {
|
||||
_highlightItem(index, justOutline) {
|
||||
this._highlight.window = this._items[index];
|
||||
global.window_group.set_child_above_sibling(this._highlight.actor, null);
|
||||
}
|
||||
@@ -648,9 +645,8 @@ class WindowCyclerPopup extends CyclerPopup {
|
||||
}
|
||||
});
|
||||
|
||||
var AppIcon = GObject.registerClass({
|
||||
GTypeName: 'AltTab_AppIcon'
|
||||
}, class AppIcon extends St.BoxLayout {
|
||||
var AppIcon = GObject.registerClass(
|
||||
class AppIcon extends St.BoxLayout {
|
||||
_init(app) {
|
||||
super._init({ style_class: 'alt-tab-app',
|
||||
vertical: true });
|
||||
@@ -664,7 +660,6 @@ var AppIcon = GObject.registerClass({
|
||||
this.add(this.label, { x_fill: false });
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set_size(size) {
|
||||
this.icon = this.app.create_icon_texture(size);
|
||||
this._iconBin.child = this.icon;
|
||||
@@ -712,7 +707,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
|
||||
_onDestroy() {
|
||||
if (this._mouseTimeOutId != 0)
|
||||
GLib.source_remove(this._mouseTimeOutId);
|
||||
Mainloop.source_remove(this._mouseTimeOutId);
|
||||
|
||||
this.icons.forEach(icon => {
|
||||
icon.app.disconnect(icon._stateChangedId);
|
||||
@@ -791,11 +786,9 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
// activation when the thumbnail list is open
|
||||
_onItemEnter(index) {
|
||||
if (this._mouseTimeOutId != 0)
|
||||
GLib.source_remove(this._mouseTimeOutId);
|
||||
Mainloop.source_remove(this._mouseTimeOutId);
|
||||
if (this._altTabPopup.thumbnailsVisible) {
|
||||
this._mouseTimeOutId = GLib.timeout_add(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
APP_ICON_HOVER_TIMEOUT,
|
||||
this._mouseTimeOutId = Mainloop.timeout_add(APP_ICON_HOVER_TIMEOUT,
|
||||
() => {
|
||||
this._enterItem(index);
|
||||
this._mouseTimeOutId = 0;
|
||||
@@ -808,7 +801,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
}
|
||||
|
||||
_enterItem(index) {
|
||||
let [x, y] = global.get_pointer();
|
||||
let [x, y, mask] = global.get_pointer();
|
||||
let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y);
|
||||
if (this._items[index].contains(pickedActor))
|
||||
this._itemEntered(index);
|
||||
@@ -877,9 +870,9 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
|
||||
_init(windows) {
|
||||
super._init(false);
|
||||
|
||||
this._labels = [];
|
||||
this._thumbnailBins = [];
|
||||
this._clones = [];
|
||||
this._labels = new Array();
|
||||
this._thumbnailBins = new Array();
|
||||
this._clones = new Array();
|
||||
this._windows = windows;
|
||||
|
||||
for (let i = 0; i < windows.length; i++) {
|
||||
@@ -915,7 +908,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
|
||||
return;
|
||||
let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding();
|
||||
totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding();
|
||||
let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
|
||||
let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
|
||||
let spacing = this._items[0].child.get_theme_node().get_length('spacing');
|
||||
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
|
||||
let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor;
|
||||
@@ -940,7 +933,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
|
||||
}
|
||||
|
||||
// Make sure we only do this once
|
||||
this._thumbnailBins = [];
|
||||
this._thumbnailBins = new Array();
|
||||
}
|
||||
|
||||
_removeThumbnail(source, clone) {
|
||||
@@ -1014,9 +1007,9 @@ class WindowIcon extends St.BoxLayout {
|
||||
}
|
||||
|
||||
_createAppIcon(app, size) {
|
||||
let appIcon = app
|
||||
? app.create_icon_texture(size)
|
||||
: new St.Icon({ icon_name: 'icon-missing', icon_size: size });
|
||||
let appIcon = app ? app.create_icon_texture(size)
|
||||
: new St.Icon({ icon_name: 'icon-missing',
|
||||
icon_size: size });
|
||||
appIcon.x_expand = appIcon.y_expand = true;
|
||||
appIcon.x_align = appIcon.y_align = Clutter.ActorAlign.END;
|
||||
|
||||
@@ -1043,7 +1036,7 @@ class WindowList extends SwitcherPopup.SwitcherList {
|
||||
this.addItem(icon, icon.label);
|
||||
this.icons.push(icon);
|
||||
|
||||
icon._unmanagedSignalId = icon.window.connect('unmanaged', window => {
|
||||
icon._unmanagedSignalId = icon.window.connect('unmanaged', (window) => {
|
||||
this._removeWindow(window);
|
||||
});
|
||||
}
|
||||
|
||||
@@ -1,13 +1,13 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Animation, AnimatedIcon, Spinner */
|
||||
|
||||
const { Clutter, GLib, Gio, St } = imports.gi;
|
||||
const { GLib, Gio, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
|
||||
var SPINNER_ANIMATION_TIME = 300;
|
||||
var SPINNER_ANIMATION_DELAY = 1000;
|
||||
var SPINNER_ANIMATION_TIME = 0.3;
|
||||
var SPINNER_ANIMATION_DELAY = 1.0;
|
||||
|
||||
var Animation = class {
|
||||
constructor(file, width, height, speed) {
|
||||
@@ -46,7 +46,7 @@ var Animation = class {
|
||||
|
||||
stop() {
|
||||
if (this._timeoutId > 0) {
|
||||
GLib.source_remove(this._timeoutId);
|
||||
Mainloop.source_remove(this._timeoutId);
|
||||
this._timeoutId = 0;
|
||||
}
|
||||
|
||||
@@ -55,19 +55,12 @@ var Animation = class {
|
||||
|
||||
_loadFile(file, width, height) {
|
||||
let [validResourceScale, resourceScale] = this.actor.get_resource_scale();
|
||||
let wasPlaying = this._isPlaying;
|
||||
|
||||
if (this._isPlaying)
|
||||
this.stop();
|
||||
|
||||
this._isLoaded = false;
|
||||
this.actor.destroy_all_children();
|
||||
|
||||
if (!validResourceScale) {
|
||||
if (wasPlaying)
|
||||
this.play();
|
||||
if (!validResourceScale)
|
||||
return;
|
||||
}
|
||||
|
||||
let textureCache = St.TextureCache.get_default();
|
||||
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
|
||||
@@ -75,9 +68,6 @@ var Animation = class {
|
||||
scaleFactor, resourceScale,
|
||||
this._animationsLoaded.bind(this));
|
||||
this.actor.set_child(this._animations);
|
||||
|
||||
if (wasPlaying)
|
||||
this.play();
|
||||
}
|
||||
|
||||
_showFrame(frame) {
|
||||
@@ -133,22 +123,12 @@ var AnimatedIcon = class extends Animation {
|
||||
};
|
||||
|
||||
var Spinner = class extends AnimatedIcon {
|
||||
constructor(size, params) {
|
||||
// Compatibility with older callers
|
||||
if (params === true || params === false)
|
||||
params = { animate: params };
|
||||
|
||||
params = Params.parse(params, {
|
||||
animate: false,
|
||||
hideOnStop: false,
|
||||
});
|
||||
constructor(size, animate = false) {
|
||||
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg');
|
||||
super(file, size);
|
||||
|
||||
this.actor.opacity = 0;
|
||||
this._animate = params.animate;
|
||||
this._hideOnStop = params.hideOnStop;
|
||||
this.actor.visible = !this._hideOnStop;
|
||||
this._animate = animate;
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
@@ -157,16 +137,15 @@ var Spinner = class extends AnimatedIcon {
|
||||
}
|
||||
|
||||
play() {
|
||||
this.actor.remove_all_transitions();
|
||||
this.actor.show();
|
||||
Tweener.removeTweens(this.actor);
|
||||
|
||||
if (this._animate) {
|
||||
super.play();
|
||||
this.actor.ease({
|
||||
Tweener.addTween(this.actor, {
|
||||
opacity: 255,
|
||||
delay: SPINNER_ANIMATION_DELAY,
|
||||
duration: SPINNER_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.LINEAR
|
||||
time: SPINNER_ANIMATION_TIME,
|
||||
transition: 'linear'
|
||||
});
|
||||
} else {
|
||||
this.actor.opacity = 255;
|
||||
@@ -175,25 +154,20 @@ var Spinner = class extends AnimatedIcon {
|
||||
}
|
||||
|
||||
stop() {
|
||||
this.actor.remove_all_transitions();
|
||||
Tweener.removeTweens(this.actor);
|
||||
|
||||
if (this._animate) {
|
||||
this.actor.ease({
|
||||
Tweener.addTween(this.actor, {
|
||||
opacity: 0,
|
||||
duration: SPINNER_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
time: SPINNER_ANIMATION_TIME,
|
||||
transition: 'linear',
|
||||
onComplete: () => {
|
||||
super.stop();
|
||||
if (this._hideOnStop)
|
||||
this.actor.hide();
|
||||
},
|
||||
}
|
||||
});
|
||||
} else {
|
||||
this.actor.opacity = 0;
|
||||
super.stop();
|
||||
|
||||
if (this._hideOnStop)
|
||||
this.actor.hide();
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
1083
js/ui/appDisplay.js
1083
js/ui/appDisplay.js
File diff suppressed because it is too large
Load Diff
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getAppFavorites */
|
||||
|
||||
const Shell = imports.gi.Shell;
|
||||
const Signals = imports.signals;
|
||||
@@ -147,10 +146,11 @@ class AppFavorites {
|
||||
|
||||
let app = Shell.AppSystem.get_default().lookup_app(appId);
|
||||
|
||||
let msg = _("%s has been added to your favorites.").format(app.get_name());
|
||||
Main.overview.setMessage(msg, {
|
||||
forFeedback: true,
|
||||
undoCallback: () => this._removeFavorite(appId),
|
||||
Main.overview.setMessage(_("%s has been added to your favorites.").format(app.get_name()),
|
||||
{ forFeedback: true,
|
||||
undoCallback: () => {
|
||||
this._removeFavorite(appId);
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
@@ -180,10 +180,11 @@ class AppFavorites {
|
||||
if (!this._removeFavorite(appId))
|
||||
return;
|
||||
|
||||
let msg = _("%s has been removed from your favorites.").format(app.get_name());
|
||||
Main.overview.setMessage(msg, {
|
||||
forFeedback: true,
|
||||
undoCallback: () => this._addFavorite(appId, pos),
|
||||
Main.overview.setMessage(_("%s has been removed from your favorites.").format(app.get_name()),
|
||||
{ forFeedback: true,
|
||||
undoCallback: () => {
|
||||
this._addFavorite(appId, pos);
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported AudioDeviceSelectionDBus */
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
@@ -35,7 +34,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
|
||||
throw new Error('Too few devices for a selection');
|
||||
}
|
||||
|
||||
_buildLayout() {
|
||||
_buildLayout(devices) {
|
||||
let title = new St.Label({ style_class: 'audio-selection-title',
|
||||
text: _("Select Audio Device"),
|
||||
x_align: Clutter.ActorAlign.CENTER });
|
||||
@@ -86,7 +85,6 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
|
||||
box.connect('notify::height', () => {
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
|
||||
box.width = box.height;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
});
|
||||
|
||||
@@ -161,7 +159,7 @@ var AudioDeviceSelectionDBus = class AudioDeviceSelectionDBus {
|
||||
|
||||
let [deviceNames] = params;
|
||||
let devices = 0;
|
||||
deviceNames.forEach(n => (devices |= AudioDevice[n.toUpperCase()]));
|
||||
deviceNames.forEach(n => devices |= AudioDevice[n.toUpperCase()]);
|
||||
|
||||
let dialog;
|
||||
try {
|
||||
|
||||
@@ -99,6 +99,7 @@ const Signals = imports.signals;
|
||||
const LoginManager = imports.misc.loginManager;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff);
|
||||
|
||||
@@ -109,7 +110,7 @@ const COLOR_SHADING_TYPE_KEY = 'color-shading-type';
|
||||
const BACKGROUND_STYLE_KEY = 'picture-options';
|
||||
const PICTURE_URI_KEY = 'picture-uri';
|
||||
|
||||
var FADE_ANIMATION_TIME = 1000;
|
||||
var FADE_ANIMATION_TIME = 1.0;
|
||||
|
||||
// These parameters affect how often we redraw.
|
||||
// The first is how different (percent crossfaded) the slide show
|
||||
@@ -332,12 +333,12 @@ var Background = class Background {
|
||||
}
|
||||
|
||||
_loadPattern() {
|
||||
let colorString, res_, color, secondColor;
|
||||
let colorString, res, color, secondColor;
|
||||
|
||||
colorString = this._settings.get_string(PRIMARY_COLOR_KEY);
|
||||
[res_, color] = Clutter.Color.from_string(colorString);
|
||||
[res, color] = Clutter.Color.from_string(colorString);
|
||||
colorString = this._settings.get_string(SECONDARY_COLOR_KEY);
|
||||
[res_, secondColor] = Clutter.Color.from_string(colorString);
|
||||
[res, secondColor] = Clutter.Color.from_string(colorString);
|
||||
|
||||
let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);
|
||||
|
||||
@@ -441,8 +442,7 @@ var Background = class Background {
|
||||
}
|
||||
|
||||
_loadAnimation(file) {
|
||||
this._cache.getAnimation({
|
||||
file: file,
|
||||
this._cache.getAnimation({ file: file,
|
||||
settingsSchema: this._settings.schema_id,
|
||||
onLoaded: animation => {
|
||||
this._animation = animation;
|
||||
@@ -633,9 +633,9 @@ var Animation = class Animation {
|
||||
}
|
||||
|
||||
load(callback) {
|
||||
this._show = new GnomeDesktop.BGSlideShow({ file: this.file });
|
||||
this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() });
|
||||
|
||||
this._show.load_async(null, () => {
|
||||
this._show.load_async(null, (object, result) => {
|
||||
this.loaded = true;
|
||||
if (callback)
|
||||
callback();
|
||||
@@ -651,7 +651,7 @@ var Animation = class Animation {
|
||||
if (this._show.get_num_slides() < 1)
|
||||
return;
|
||||
|
||||
let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
|
||||
let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
|
||||
|
||||
this.transitionDuration = duration;
|
||||
this.transitionProgress = progress;
|
||||
@@ -710,11 +710,13 @@ var BackgroundManager = class BackgroundManager {
|
||||
this._newBackgroundActor = null;
|
||||
this.emit('changed');
|
||||
|
||||
oldBackgroundActor.ease({
|
||||
opacity: 0,
|
||||
duration: FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => oldBackgroundActor.destroy()
|
||||
Tweener.addTween(oldBackgroundActor,
|
||||
{ opacity: 0,
|
||||
time: FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
oldBackgroundActor.destroy();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
@@ -749,8 +751,7 @@ var BackgroundManager = class BackgroundManager {
|
||||
|
||||
_createBackgroundActor() {
|
||||
let background = this._backgroundSource.getBackground(this._monitorIndex);
|
||||
let backgroundActor = new Meta.BackgroundActor({
|
||||
meta_display: global.display,
|
||||
let backgroundActor = new Meta.BackgroundActor({ meta_display: global.display,
|
||||
monitor: this._monitorIndex,
|
||||
background: background.background,
|
||||
vignette: this._vignette,
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported addBackgroundMenu */
|
||||
|
||||
const { Clutter, St } = imports.gi;
|
||||
|
||||
@@ -31,7 +30,7 @@ function addBackgroundMenu(actor, layoutManager) {
|
||||
|
||||
function openMenu(x, y) {
|
||||
Main.layoutManager.setDummyCursorGeometry(x, y, 0, 0);
|
||||
actor._backgroundMenu.open(BoxPointer.PopupAnimation.FULL);
|
||||
actor._backgroundMenu.open(BoxPointer.PopupAnimation.NONE);
|
||||
}
|
||||
|
||||
let clickAction = new Clutter.ClickAction();
|
||||
|
||||
@@ -1,106 +1,71 @@
|
||||
/* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
|
||||
/* exported BarLevel */
|
||||
|
||||
const { Atk, Clutter, GObject, St } = imports.gi;
|
||||
const { Atk, Clutter, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
var BarLevel = GObject.registerClass({
|
||||
Properties: {
|
||||
'value': GObject.ParamSpec.double(
|
||||
'value', 'value', 'value',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
0, 2, 0),
|
||||
'maximum-value': GObject.ParamSpec.double(
|
||||
'maximum-value', 'maximum-value', 'maximum-value',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
1, 2, 1),
|
||||
'overdrive-start': GObject.ParamSpec.double(
|
||||
'overdrive-start', 'overdrive-start', 'overdrive-start',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
1, 2, 1)
|
||||
}
|
||||
}, class BarLevel extends St.DrawingArea {
|
||||
_init(params) {
|
||||
var BarLevel = class {
|
||||
constructor(value, params = {}) {
|
||||
if (isNaN(value))
|
||||
// Avoid spreading NaNs around
|
||||
throw TypeError('The bar level value must be a number');
|
||||
this._maxValue = 1;
|
||||
this._value = 0;
|
||||
this._value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
this._overdriveStart = 1;
|
||||
this._barLevelWidth = 0;
|
||||
|
||||
let defaultParams = {
|
||||
style_class: 'barlevel',
|
||||
accessible_role: Atk.Role.LEVEL_BAR
|
||||
};
|
||||
super._init(Object.assign(defaultParams, params));
|
||||
this.connect('allocation-changed', (actor, box) => {
|
||||
this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel',
|
||||
can_focus: params['canFocus'] || false,
|
||||
reactive: params['reactive'] || false,
|
||||
accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR });
|
||||
this.actor.connect('repaint', this._barLevelRepaint.bind(this));
|
||||
this.actor.connect('allocation-changed', (actor, box) => {
|
||||
this._barLevelWidth = box.get_width();
|
||||
});
|
||||
|
||||
this._customAccessible = St.GenericAccessible.new_for_actor(this);
|
||||
this.set_accessible(this._customAccessible);
|
||||
this._customAccessible = St.GenericAccessible.new_for_actor(this.actor);
|
||||
this.actor.set_accessible(this._customAccessible);
|
||||
|
||||
this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this));
|
||||
this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this));
|
||||
this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this));
|
||||
this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this));
|
||||
|
||||
this.connect('notify::value', this._valueChanged.bind(this));
|
||||
this.connect('value-changed', this._valueChanged.bind(this));
|
||||
}
|
||||
|
||||
get value() {
|
||||
return this._value;
|
||||
setValue(value) {
|
||||
if (isNaN(value))
|
||||
throw TypeError('The bar level value must be a number');
|
||||
|
||||
this._value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
this.actor.queue_repaint();
|
||||
}
|
||||
|
||||
set value(value) {
|
||||
value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
setMaximumValue(value) {
|
||||
if (isNaN(value))
|
||||
throw TypeError('The bar level max value must be a number');
|
||||
|
||||
if (this._value == value)
|
||||
return;
|
||||
|
||||
this._value = value;
|
||||
this.notify('value');
|
||||
this.queue_repaint();
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get maximum_value() {
|
||||
return this._maxValue;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set maximum_value(value) {
|
||||
value = Math.max(value, 1);
|
||||
|
||||
if (this._maxValue == value)
|
||||
return;
|
||||
|
||||
this._maxValue = value;
|
||||
this._maxValue = Math.max(value, 1);
|
||||
this._overdriveStart = Math.min(this._overdriveStart, this._maxValue);
|
||||
this.notify('maximum-value');
|
||||
this.queue_repaint();
|
||||
this.actor.queue_repaint();
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get overdrive_start() {
|
||||
return this._overdriveStart;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set overdrive_start(value) {
|
||||
if (this._overdriveStart == value)
|
||||
return;
|
||||
|
||||
setOverdriveStart(value) {
|
||||
if (isNaN(value))
|
||||
throw TypeError('The overdrive limit value must be a number');
|
||||
if (value > this._maxValue)
|
||||
throw new Error(`Tried to set overdrive value to ${value}, ` +
|
||||
`which is a number greater than the maximum allowed value ${this._maxValue}`);
|
||||
|
||||
this._overdriveStart = value;
|
||||
this.notify('overdrive-start');
|
||||
this.queue_repaint();
|
||||
this._value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
this.actor.queue_repaint();
|
||||
}
|
||||
|
||||
vfunc_repaint() {
|
||||
let cr = this.get_context();
|
||||
let themeNode = this.get_theme_node();
|
||||
let [width, height] = this.get_surface_size();
|
||||
_barLevelRepaint(area) {
|
||||
let cr = area.get_context();
|
||||
let themeNode = area.get_theme_node();
|
||||
let [width, height] = area.get_surface_size();
|
||||
|
||||
let barLevelHeight = themeNode.get_length('-barlevel-height');
|
||||
let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2;
|
||||
@@ -207,27 +172,32 @@ var BarLevel = GObject.registerClass({
|
||||
cr.$dispose();
|
||||
}
|
||||
|
||||
_getCurrentValue() {
|
||||
_getCurrentValue(actor) {
|
||||
return this._value;
|
||||
}
|
||||
|
||||
_getOverdriveStart() {
|
||||
_getOverdriveStart(actor) {
|
||||
return this._overdriveStart;
|
||||
}
|
||||
|
||||
_getMinimumValue() {
|
||||
_getMinimumValue(actor) {
|
||||
return 0;
|
||||
}
|
||||
|
||||
_getMaximumValue() {
|
||||
_getMaximumValue(actor) {
|
||||
return this._maxValue;
|
||||
}
|
||||
|
||||
_setCurrentValue(_actor, value) {
|
||||
_setCurrentValue(actor, value) {
|
||||
this._value = value;
|
||||
}
|
||||
|
||||
_valueChanged() {
|
||||
_valueChanged(barLevel, value, property) {
|
||||
this._customAccessible.notify("accessible-value");
|
||||
}
|
||||
});
|
||||
|
||||
get value() {
|
||||
return this._value;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(BarLevel.prototype);
|
||||
|
||||
@@ -1,9 +1,9 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported BoxPointer */
|
||||
|
||||
const { Clutter, GObject, Shell, St } = imports.gi;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var PopupAnimation = {
|
||||
NONE: 0,
|
||||
@@ -12,7 +12,7 @@ var PopupAnimation = {
|
||||
FULL: ~0,
|
||||
};
|
||||
|
||||
var POPUP_ANIMATION_TIME = 150;
|
||||
var POPUP_ANIMATION_TIME = 0.15;
|
||||
|
||||
/**
|
||||
* BoxPointer:
|
||||
@@ -105,18 +105,16 @@ var BoxPointer = GObject.registerClass({
|
||||
}
|
||||
}
|
||||
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
Tweener.addTween(this, { opacity: 255,
|
||||
translation_x: 0,
|
||||
translation_y: 0,
|
||||
duration: animationTime,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
transition: 'linear',
|
||||
onComplete: () => {
|
||||
this._unmuteInput();
|
||||
if (onComplete)
|
||||
onComplete();
|
||||
}
|
||||
});
|
||||
},
|
||||
time: animationTime });
|
||||
}
|
||||
|
||||
close(animate, onComplete) {
|
||||
@@ -149,13 +147,12 @@ var BoxPointer = GObject.registerClass({
|
||||
|
||||
this._muteInput();
|
||||
|
||||
this.remove_all_transitions();
|
||||
this.ease({
|
||||
opacity: fade ? 0 : 255,
|
||||
Tweener.removeTweens(this);
|
||||
Tweener.addTween(this, { opacity: fade ? 0 : 255,
|
||||
translation_x: translationX,
|
||||
translation_y: translationY,
|
||||
duration: animationTime,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
transition: 'linear',
|
||||
time: animationTime,
|
||||
onComplete: () => {
|
||||
this.hide();
|
||||
this.opacity = 0;
|
||||
@@ -172,8 +169,8 @@ var BoxPointer = GObject.registerClass({
|
||||
let borderWidth = themeNode.get_length('-arrow-border-width');
|
||||
minSize += borderWidth * 2;
|
||||
natSize += borderWidth * 2;
|
||||
if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)) ||
|
||||
(isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
|
||||
if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM))
|
||||
|| (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
|
||||
let rise = themeNode.get_length('-arrow-rise');
|
||||
minSize += rise;
|
||||
natSize += rise;
|
||||
@@ -472,7 +469,7 @@ var BoxPointer = GObject.registerClass({
|
||||
let sourceAllocation = this._sourceAllocation;
|
||||
let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment;
|
||||
let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment;
|
||||
let [, , natWidth, natHeight] = this.get_preferred_size();
|
||||
let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size();
|
||||
|
||||
// We also want to keep it onscreen, and separated from the
|
||||
// edge by the same distance as the main part of the box is
|
||||
@@ -597,7 +594,7 @@ var BoxPointer = GObject.registerClass({
|
||||
|
||||
_calculateArrowSide(arrowSide) {
|
||||
let sourceAllocation = this._sourceAllocation;
|
||||
let [, , boxWidth, boxHeight] = this.get_preferred_size();
|
||||
let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size();
|
||||
let workarea = this._workArea;
|
||||
|
||||
switch (arrowSide) {
|
||||
|
||||
@@ -1,7 +1,6 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Calendar, CalendarMessageList */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
|
||||
const { Clutter, Gio, GLib, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
@@ -110,15 +109,15 @@ var EmptyEventSource = class EmptyEventSource {
|
||||
destroy() {
|
||||
}
|
||||
|
||||
requestRange(_begin, _end) {
|
||||
requestRange(begin, end) {
|
||||
}
|
||||
|
||||
getEvents(_begin, _end) {
|
||||
getEvents(begin, end) {
|
||||
let result = [];
|
||||
return result;
|
||||
}
|
||||
|
||||
hasEvents(_day) {
|
||||
hasEvents(day) {
|
||||
return false;
|
||||
}
|
||||
};
|
||||
@@ -221,13 +220,13 @@ var DBusEventSource = class DBusEventSource {
|
||||
this._lastRequestEnd = null;
|
||||
}
|
||||
|
||||
_onNameAppeared() {
|
||||
_onNameAppeared(owner) {
|
||||
this._initialized = true;
|
||||
this._resetCache();
|
||||
this._loadEvents(true);
|
||||
}
|
||||
|
||||
_onNameVanished() {
|
||||
_onNameVanished(oldOwner) {
|
||||
this._resetCache();
|
||||
this.emit('changed');
|
||||
}
|
||||
@@ -236,7 +235,7 @@ var DBusEventSource = class DBusEventSource {
|
||||
this._loadEvents(false);
|
||||
}
|
||||
|
||||
_onEventsReceived(results, _error) {
|
||||
_onEventsReceived(results, error) {
|
||||
let newEvents = [];
|
||||
let appointments = results[0] || [];
|
||||
for (let n = 0; n < appointments.length; n++) {
|
||||
@@ -581,8 +580,7 @@ var Calendar = class Calendar {
|
||||
if (row == 2)
|
||||
styleClass = `calendar-day-top ${styleClass}`;
|
||||
|
||||
let leftMost = rtl
|
||||
? iter.getDay() == (this._weekStart + 6) % 7
|
||||
let leftMost = rtl ? iter.getDay() == (this._weekStart + 6) % 7
|
||||
: iter.getDay() == this._weekStart;
|
||||
if (leftMost)
|
||||
styleClass = `calendar-day-left ${styleClass}`;
|
||||
@@ -681,8 +679,7 @@ var EventMessage = class EventMessage extends MessageList.Message {
|
||||
*/
|
||||
title = C_("event list time", "All Day");
|
||||
} else {
|
||||
let date = this._event.date >= periodBegin
|
||||
? this._event.date
|
||||
let date = this._event.date >= periodBegin ? this._event.date
|
||||
: this._event.end;
|
||||
title = Util.formatTime(date, { timeOnly: true });
|
||||
}
|
||||
@@ -690,15 +687,15 @@ var EventMessage = class EventMessage extends MessageList.Message {
|
||||
let rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL;
|
||||
if (this._event.date < periodBegin && !this._event.allDay) {
|
||||
if (rtl)
|
||||
title = `${title}${ELLIPSIS_CHAR}`;
|
||||
title = title + ELLIPSIS_CHAR;
|
||||
else
|
||||
title = `${ELLIPSIS_CHAR}${title}`;
|
||||
title = ELLIPSIS_CHAR + title;
|
||||
}
|
||||
if (this._event.end > periodEnd && !this._event.allDay) {
|
||||
if (rtl)
|
||||
title = `${ELLIPSIS_CHAR}${title}`;
|
||||
title = ELLIPSIS_CHAR + title;
|
||||
else
|
||||
title = `${title}${ELLIPSIS_CHAR}`;
|
||||
title = title + ELLIPSIS_CHAR;
|
||||
}
|
||||
return title;
|
||||
}
|
||||
@@ -737,7 +734,7 @@ class NotificationMessage extends MessageList.Message {
|
||||
return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
|
||||
}
|
||||
|
||||
_onUpdated(n, _clear) {
|
||||
_onUpdated(n, clear) {
|
||||
this.setIcon(this._getIcon());
|
||||
this.setTitle(n.title);
|
||||
this.setBody(n.bannerBodyText);
|
||||
@@ -1073,14 +1070,10 @@ var CalendarMessageList = class CalendarMessageList {
|
||||
this._clearButton.set_x_align(Clutter.ActorAlign.END);
|
||||
this._clearButton.connect('clicked', () => {
|
||||
let sections = [...this._sections.keys()];
|
||||
sections.forEach(s => s.clear());
|
||||
sections.forEach((s) => s.clear());
|
||||
});
|
||||
box.add_actor(this._clearButton);
|
||||
|
||||
this._placeholder.actor.bind_property('visible',
|
||||
this._clearButton, 'visible',
|
||||
GObject.BindingFlags.INVERT_BOOLEAN);
|
||||
|
||||
this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections',
|
||||
vertical: true,
|
||||
y_expand: true,
|
||||
@@ -1151,6 +1144,7 @@ var CalendarMessageList = class CalendarMessageList {
|
||||
|
||||
let empty = sections.every(s => s.empty || !s.actor.visible);
|
||||
this._placeholder.actor.visible = empty;
|
||||
this._clearButton.visible = !empty;
|
||||
|
||||
let canClear = sections.some(s => s.canClear && s.actor.visible);
|
||||
this._clearButton.reactive = canClear;
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported CheckBox */
|
||||
const { Clutter, Pango, St } = imports.gi;
|
||||
|
||||
var CheckBox = class CheckBox {
|
||||
|
||||
@@ -1,13 +1,13 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported CloseDialog */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;
|
||||
|
||||
const Dialog = imports.ui.dialog;
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var FROZEN_WINDOW_BRIGHTNESS = -0.3;
|
||||
var DIALOG_TRANSITION_TIME = 150;
|
||||
var DIALOG_TRANSITION_TIME = 0.15;
|
||||
var ALIVE_TIMEOUT = 5000;
|
||||
|
||||
var CloseDialog = GObject.registerClass({
|
||||
@@ -46,18 +46,6 @@ var CloseDialog = GObject.registerClass({
|
||||
return new Dialog.MessageDialogContent({ icon, title, subtitle });
|
||||
}
|
||||
|
||||
_updateScale() {
|
||||
// Since this is a child of MetaWindowActor (which, for Wayland clients,
|
||||
// applies the geometry scale factor to its children itself, see
|
||||
// meta_window_actor_set_geometry_scale()), make sure we don't apply
|
||||
// the factor twice in the end.
|
||||
if (this._window.get_client_type() !== Meta.WindowClientType.WAYLAND)
|
||||
return;
|
||||
|
||||
let { scaleFactor } = St.ThemeContext.get_for_stage(global.stage);
|
||||
this._dialog.set_scale(1 / scaleFactor, 1 / scaleFactor);
|
||||
}
|
||||
|
||||
_initDialog() {
|
||||
if (this._dialog)
|
||||
return;
|
||||
@@ -76,11 +64,6 @@ var CloseDialog = GObject.registerClass({
|
||||
key: Clutter.Escape });
|
||||
|
||||
global.focus_manager.add_group(this._dialog);
|
||||
|
||||
let themeContext = St.ThemeContext.get_for_stage(global.stage);
|
||||
themeContext.connect('notify::scale-factor', this._updateScale.bind(this));
|
||||
|
||||
this._updateScale();
|
||||
}
|
||||
|
||||
_addWindowEffect() {
|
||||
@@ -162,13 +145,13 @@ var CloseDialog = GObject.registerClass({
|
||||
this._addWindowEffect();
|
||||
this._initDialog();
|
||||
|
||||
this._dialog._dialog.scale_y = 0;
|
||||
this._dialog._dialog.set_pivot_point(0.5, 0.5);
|
||||
this._dialog.scale_y = 0;
|
||||
this._dialog.set_pivot_point(0.5, 0.5);
|
||||
|
||||
this._dialog._dialog.ease({
|
||||
scale_y: 1,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
duration: DIALOG_TRANSITION_TIME,
|
||||
Tweener.addTween(this._dialog,
|
||||
{ scale_y: 1,
|
||||
transition: 'linear',
|
||||
time: DIALOG_TRANSITION_TIME,
|
||||
onComplete: this._onFocusChanged.bind(this)
|
||||
});
|
||||
}
|
||||
@@ -192,12 +175,13 @@ var CloseDialog = GObject.registerClass({
|
||||
this._dialog = null;
|
||||
this._removeWindowEffect();
|
||||
|
||||
dialog.makeInactive();
|
||||
dialog._dialog.ease({
|
||||
scale_y: 0,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
duration: DIALOG_TRANSITION_TIME,
|
||||
onComplete: () => dialog.destroy()
|
||||
Tweener.addTween(dialog,
|
||||
{ scale_y: 0,
|
||||
transition: 'linear',
|
||||
time: DIALOG_TRANSITION_TIME,
|
||||
onComplete: () => {
|
||||
dialog.destroy();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported ComponentManager */
|
||||
const Main = imports.ui.main;
|
||||
|
||||
var ComponentManager = class {
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Gio, GLib } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Params = imports.misc.params;
|
||||
|
||||
const GnomeSession = imports.misc.gnomeSession;
|
||||
@@ -38,7 +38,7 @@ var AutomountManager = class {
|
||||
this._driveDisconnectedId = this._volumeMonitor.connect('drive-disconnected', this._onDriveDisconnected.bind(this));
|
||||
this._driveEjectButtonId = this._volumeMonitor.connect('drive-eject-button', this._onDriveEjectButton.bind(this));
|
||||
|
||||
this._mountAllId = GLib.idle_add(GLib.PRIORITY_DEFAULT, this._startupMountAll.bind(this));
|
||||
this._mountAllId = Mainloop.idle_add(this._startupMountAll.bind(this));
|
||||
GLib.Source.set_name_by_id(this._mountAllId, '[gnome-shell] this._startupMountAll');
|
||||
}
|
||||
|
||||
@@ -50,12 +50,12 @@ var AutomountManager = class {
|
||||
this._volumeMonitor.disconnect(this._driveEjectButtonId);
|
||||
|
||||
if (this._mountAllId > 0) {
|
||||
GLib.source_remove(this._mountAllId);
|
||||
Mainloop.source_remove(this._mountAllId);
|
||||
this._mountAllId = 0;
|
||||
}
|
||||
}
|
||||
|
||||
_InhibitorsChanged(_object, _senderName, [_inhibitor]) {
|
||||
_InhibitorsChanged(object, senderName, [inhibtor]) {
|
||||
this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
|
||||
(result, error) => {
|
||||
if (!error) {
|
||||
@@ -219,7 +219,7 @@ var AutomountManager = class {
|
||||
|
||||
_onVolumeRemoved(monitor, volume) {
|
||||
if (volume._allowAutorunExpireId && volume._allowAutorunExpireId > 0) {
|
||||
GLib.source_remove(volume._allowAutorunExpireId);
|
||||
Mainloop.source_remove(volume._allowAutorunExpireId);
|
||||
delete volume._allowAutorunExpireId;
|
||||
}
|
||||
this._volumeQueue =
|
||||
@@ -248,7 +248,7 @@ var AutomountManager = class {
|
||||
}
|
||||
|
||||
_allowAutorunExpire(volume) {
|
||||
let id = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
|
||||
let id = Mainloop.timeout_add_seconds(AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
|
||||
volume.allowAutorun = false;
|
||||
delete volume._allowAutorunExpireId;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Gio, St } = imports.gi;
|
||||
|
||||
@@ -72,6 +71,8 @@ function startAppForMount(app, mount) {
|
||||
return retval;
|
||||
}
|
||||
|
||||
/******************************************/
|
||||
|
||||
const HotplugSnifferIface = loadInterfaceXML('org.gnome.Shell.HotplugSniffer');
|
||||
const HotplugSnifferProxy = Gio.DBusProxy.makeProxyWrapper(HotplugSnifferIface);
|
||||
function HotplugSniffer() {
|
||||
@@ -323,9 +324,9 @@ var AutorunNotification = class extends MessageTray.Notification {
|
||||
style_class: 'hotplug-notification-item-icon' });
|
||||
box.add(icon);
|
||||
|
||||
let label = new St.Bin({
|
||||
y_align: St.Align.MIDDLE,
|
||||
child: new St.Label({ text: _("Open with %s").format(app.get_name()) }),
|
||||
let label = new St.Bin({ y_align: St.Align.MIDDLE,
|
||||
child: new St.Label
|
||||
({ text: _("Open with %s").format(app.get_name()) })
|
||||
});
|
||||
box.add(label);
|
||||
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi;
|
||||
|
||||
@@ -74,9 +73,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
|
||||
ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
|
||||
this._passwordEntry.clutter_text.connect('activate', this._onPasswordActivate.bind(this));
|
||||
|
||||
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, {
|
||||
animate: true,
|
||||
});
|
||||
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
|
||||
|
||||
if (rtl) {
|
||||
layout.attach(this._workSpinner.actor, 0, row, 1, 1);
|
||||
@@ -179,21 +176,21 @@ class KeyringDialog extends ModalDialog.ModalDialog {
|
||||
return false;
|
||||
}
|
||||
|
||||
_onShowPassword() {
|
||||
_onShowPassword(prompt) {
|
||||
this._buildControlTable();
|
||||
this._ensureOpen();
|
||||
this._updateSensitivity(true);
|
||||
this._passwordEntry.grab_key_focus();
|
||||
}
|
||||
|
||||
_onShowConfirm() {
|
||||
_onShowConfirm(prompt) {
|
||||
this._buildControlTable();
|
||||
this._ensureOpen();
|
||||
this._updateSensitivity(true);
|
||||
this._continueButton.grab_key_focus();
|
||||
}
|
||||
|
||||
_onHidePrompt() {
|
||||
_onHidePrompt(prompt) {
|
||||
this.close();
|
||||
}
|
||||
|
||||
@@ -234,8 +231,7 @@ var KeyringPrompter = class {
|
||||
constructor() {
|
||||
this._prompter = new Gcr.SystemPrompter();
|
||||
this._prompter.connect('new-prompt', () => {
|
||||
let dialog = this._enabled
|
||||
? new KeyringDialog()
|
||||
let dialog = this._enabled ? new KeyringDialog()
|
||||
: new KeyringDummyDialog();
|
||||
this._currentPrompt = dialog.prompt;
|
||||
return this._currentPrompt;
|
||||
|
||||
@@ -1,18 +1,15 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Config = imports.misc.config;
|
||||
const Dialog = imports.ui.dialog;
|
||||
const Main = imports.ui.main;
|
||||
const MessageTray = imports.ui.messageTray;
|
||||
const ModalDialog = imports.ui.modalDialog;
|
||||
const ShellEntry = imports.ui.shellEntry;
|
||||
|
||||
Gio._promisify(Shell.NetworkAgent.prototype,
|
||||
'search_vpn_plugin', 'search_vpn_plugin_finish');
|
||||
|
||||
const VPN_UI_GROUP = 'VPN Plugin UI';
|
||||
|
||||
var NetworkSecretDialog = GObject.registerClass(
|
||||
@@ -114,17 +111,16 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
expand: true });
|
||||
}
|
||||
|
||||
this._okButton = {
|
||||
label: _("Connect"),
|
||||
this._okButton = { label: _("Connect"),
|
||||
action: this._onOk.bind(this),
|
||||
default: true,
|
||||
default: true
|
||||
};
|
||||
|
||||
this.setButtons([{
|
||||
label: _("Cancel"),
|
||||
this.setButtons([{ label: _("Cancel"),
|
||||
action: this.cancel.bind(this),
|
||||
key: Clutter.KEY_Escape,
|
||||
}, this._okButton]);
|
||||
},
|
||||
this._okButton]);
|
||||
|
||||
this._updateOkButton();
|
||||
}
|
||||
@@ -166,9 +162,9 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
if (value.length == 64) {
|
||||
// must be composed of hexadecimal digits only
|
||||
for (let i = 0; i < 64; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f') ||
|
||||
(value[i] >= 'A' && value[i] <= 'F') ||
|
||||
(value[i] >= '0' && value[i] <= '9')))
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f')
|
||||
|| (value[i] >= 'A' && value[i] <= 'F')
|
||||
|| (value[i] >= '0' && value[i] <= '9')))
|
||||
return false;
|
||||
}
|
||||
return true;
|
||||
@@ -182,15 +178,15 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
if (secret.wep_key_type == NM.WepKeyType.KEY) {
|
||||
if (value.length == 10 || value.length == 26) {
|
||||
for (let i = 0; i < value.length; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f') ||
|
||||
(value[i] >= 'A' && value[i] <= 'F') ||
|
||||
(value[i] >= '0' && value[i] <= '9')))
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f')
|
||||
|| (value[i] >= 'A' && value[i] <= 'F')
|
||||
|| (value[i] >= '0' && value[i] <= '9')))
|
||||
return false;
|
||||
}
|
||||
} else if (value.length == 5 || value.length == 13) {
|
||||
for (let i = 0; i < value.length; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'z') ||
|
||||
(value[i] >= 'A' && value[i] <= 'Z')))
|
||||
if (!((value[i] >= 'a' && value[i] <= 'z')
|
||||
|| (value[i] >= 'A' && value[i] <= 'Z')))
|
||||
return false;
|
||||
}
|
||||
} else {
|
||||
@@ -203,7 +199,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
return true;
|
||||
}
|
||||
|
||||
_getWirelessSecrets(secrets, _wirelessSetting) {
|
||||
_getWirelessSecrets(secrets, wirelessSetting) {
|
||||
let wirelessSecuritySetting = this._connection.get_setting_wireless_security();
|
||||
|
||||
if (this._settingName == '802-1x') {
|
||||
@@ -215,7 +211,6 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
// First the easy ones
|
||||
case 'wpa-none':
|
||||
case 'wpa-psk':
|
||||
case 'sae':
|
||||
secrets.push({ label: _("Password: "), key: 'psk',
|
||||
value: wirelessSecuritySetting.psk || '',
|
||||
validate: this._validateWpaPsk, password: true });
|
||||
@@ -390,7 +385,7 @@ var VPNRequestHandler = class {
|
||||
this._newStylePlugin = authHelper.externalUIMode;
|
||||
|
||||
try {
|
||||
let [success_, pid, stdin, stdout, stderr] =
|
||||
let [success, pid, stdin, stdout, stderr] =
|
||||
GLib.spawn_async_with_pipes(null, /* pwd */
|
||||
argv,
|
||||
null, /* envp */
|
||||
@@ -449,7 +444,7 @@ var VPNRequestHandler = class {
|
||||
this._destroyed = true;
|
||||
}
|
||||
|
||||
_vpnChildFinished(pid, status, _requestObj) {
|
||||
_vpnChildFinished(pid, status, requestObj) {
|
||||
this._childWatch = 0;
|
||||
if (this._newStylePlugin) {
|
||||
// For new style plugin, all work is done in the async reading functions
|
||||
@@ -491,7 +486,7 @@ var VPNRequestHandler = class {
|
||||
|
||||
_readStdoutOldStyle() {
|
||||
this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => {
|
||||
let [line, len_] = this._dataStdout.read_line_finish_utf8(result);
|
||||
let [line, len] = this._dataStdout.read_line_finish_utf8(result);
|
||||
|
||||
if (line == null) {
|
||||
// end of file
|
||||
@@ -546,7 +541,7 @@ var VPNRequestHandler = class {
|
||||
message: keyfile.get_string(VPN_UI_GROUP, 'Description'),
|
||||
secrets: [] };
|
||||
|
||||
let [groups, len_] = keyfile.get_groups();
|
||||
let [groups, len] = keyfile.get_groups();
|
||||
for (let i = 0; i < groups.length; i++) {
|
||||
if (groups[i] == VPN_UI_GROUP)
|
||||
continue;
|
||||
@@ -555,11 +550,10 @@ var VPNRequestHandler = class {
|
||||
let shouldAsk = keyfile.get_boolean(groups[i], 'ShouldAsk');
|
||||
|
||||
if (shouldAsk) {
|
||||
contentOverride.secrets.push({
|
||||
label: keyfile.get_string(groups[i], 'Label'),
|
||||
contentOverride.secrets.push({ label: keyfile.get_string(groups[i], 'Label'),
|
||||
key: groups[i],
|
||||
value: value,
|
||||
password: keyfile.get_boolean(groups[i], 'IsSecret'),
|
||||
password: keyfile.get_boolean(groups[i], 'IsSecret')
|
||||
});
|
||||
} else {
|
||||
if (!value.length) // Ignore empty secrets
|
||||
@@ -614,16 +608,23 @@ Signals.addSignalMethods(VPNRequestHandler.prototype);
|
||||
|
||||
var NetworkAgent = class {
|
||||
constructor() {
|
||||
this._native = new Shell.NetworkAgent({
|
||||
identifier: 'org.gnome.Shell.NetworkAgent',
|
||||
this._native = new Shell.NetworkAgent({ identifier: 'org.gnome.Shell.NetworkAgent',
|
||||
capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
|
||||
auto_register: false,
|
||||
auto_register: false
|
||||
});
|
||||
|
||||
this._dialogs = { };
|
||||
this._vpnRequests = { };
|
||||
this._notifications = { };
|
||||
|
||||
this._pluginDir = Gio.file_new_for_path(Config.VPNDIR);
|
||||
try {
|
||||
let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null);
|
||||
monitor.connect('changed', () => this._vpnCacheBuilt = false);
|
||||
} catch (e) {
|
||||
log(`Failed to create monitor for VPN plugin dir: ${e.message}`);
|
||||
}
|
||||
|
||||
this._native.connect('new-request', this._newRequest.bind(this));
|
||||
this._native.connect('cancel-request', this._cancelRequest.bind(this));
|
||||
|
||||
@@ -763,11 +764,13 @@ var NetworkAgent = class {
|
||||
}
|
||||
}
|
||||
|
||||
async _vpnRequest(requestId, connection, hints, flags) {
|
||||
_vpnRequest(requestId, connection, hints, flags) {
|
||||
let vpnSetting = connection.get_setting_vpn();
|
||||
let serviceType = vpnSetting.service_type;
|
||||
|
||||
let binary = await this._findAuthBinary(serviceType);
|
||||
this._buildVPNServiceCache();
|
||||
|
||||
let binary = this._vpnBinaries[serviceType];
|
||||
if (!binary) {
|
||||
log('Invalid VPN service type (cannot find authentication binary)');
|
||||
|
||||
@@ -783,30 +786,36 @@ var NetworkAgent = class {
|
||||
this._vpnRequests[requestId] = vpnRequest;
|
||||
}
|
||||
|
||||
async _findAuthBinary(serviceType) {
|
||||
let plugin;
|
||||
_buildVPNServiceCache() {
|
||||
if (this._vpnCacheBuilt)
|
||||
return;
|
||||
|
||||
try {
|
||||
plugin = await this._native.search_vpn_plugin(serviceType);
|
||||
} catch (e) {
|
||||
logError(e);
|
||||
return null;
|
||||
this._vpnCacheBuilt = true;
|
||||
this._vpnBinaries = { };
|
||||
|
||||
NM.VpnPluginInfo.list_load().forEach(plugin => {
|
||||
let service = plugin.get_service();
|
||||
let fileName = plugin.get_auth_dialog();
|
||||
let supportsHints = plugin.supports_hints();
|
||||
let externalUIMode = false;
|
||||
|
||||
let prop = plugin.lookup_property('GNOME', 'supports-external-ui-mode');
|
||||
if (prop) {
|
||||
prop = prop.trim().toLowerCase();
|
||||
externalUIMode = ['true', 'yes', 'on', '1'].includes(prop);
|
||||
}
|
||||
|
||||
const fileName = plugin.get_auth_dialog();
|
||||
if (!GLib.file_test(fileName, GLib.FileTest.IS_EXECUTABLE)) {
|
||||
if (GLib.file_test(fileName, GLib.FileTest.IS_EXECUTABLE)) {
|
||||
let binary = { fileName, externalUIMode, supportsHints };
|
||||
this._vpnBinaries[service] = binary;
|
||||
|
||||
plugin.get_aliases().forEach(alias => {
|
||||
this._vpnBinaries[alias] = binary;
|
||||
});
|
||||
} else {
|
||||
log('VPN plugin at %s is not executable'.format(fileName));
|
||||
return null;
|
||||
}
|
||||
|
||||
const prop = plugin.lookup_property('GNOME', 'supports-external-ui-mode');
|
||||
const trimmedProp = prop ? prop.trim().toLowerCase() : '';
|
||||
|
||||
return {
|
||||
fileName,
|
||||
supportsHints: plugin.supports_hints(),
|
||||
externalUIMode: ['true', 'yes', 'on', '1'].includes(trimmedProp),
|
||||
};
|
||||
});
|
||||
}
|
||||
};
|
||||
var Component = NetworkAgent;
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { AccountsService, Clutter, Gio, GLib,
|
||||
GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi;
|
||||
@@ -11,11 +10,6 @@ const ModalDialog = imports.ui.modalDialog;
|
||||
const ShellEntry = imports.ui.shellEntry;
|
||||
const UserWidget = imports.ui.userWidget;
|
||||
|
||||
const DialogMode = {
|
||||
AUTH: 0,
|
||||
CONFIRM: 1,
|
||||
};
|
||||
|
||||
var DIALOG_ICON_SIZE = 48;
|
||||
|
||||
var WORK_SPINNER_ICON_SIZE = 16;
|
||||
@@ -56,32 +50,47 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
userName = userNames[0];
|
||||
|
||||
this._user = AccountsService.UserManager.get_default().get_user(userName);
|
||||
let userRealName = this._user.get_real_name();
|
||||
this._userLoadedId = this._user.connect('notify::is_loaded',
|
||||
this._onUserChanged.bind(this));
|
||||
this._userChangedId = this._user.connect('changed',
|
||||
this._onUserChanged.bind(this));
|
||||
|
||||
let userBox = new St.BoxLayout({
|
||||
style_class: 'polkit-dialog-user-layout',
|
||||
vertical: false,
|
||||
});
|
||||
// Special case 'root'
|
||||
let userIsRoot = false;
|
||||
if (userName == 'root') {
|
||||
userIsRoot = true;
|
||||
userRealName = _("Administrator");
|
||||
}
|
||||
|
||||
if (userIsRoot) {
|
||||
let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-root-label',
|
||||
text: userRealName }));
|
||||
content.messageBox.add(userLabel, { x_fill: false,
|
||||
x_align: St.Align.START });
|
||||
} else {
|
||||
let userBox = new St.BoxLayout({ style_class: 'polkit-dialog-user-layout',
|
||||
vertical: false });
|
||||
content.messageBox.add(userBox);
|
||||
|
||||
this._userAvatar = new UserWidget.Avatar(this._user, {
|
||||
iconSize: DIALOG_ICON_SIZE,
|
||||
styleClass: 'polkit-dialog-user-icon',
|
||||
});
|
||||
this._userAvatar = new UserWidget.Avatar(this._user,
|
||||
{ iconSize: DIALOG_ICON_SIZE,
|
||||
styleClass: 'polkit-dialog-user-icon' });
|
||||
this._userAvatar.actor.hide();
|
||||
userBox.add_child(this._userAvatar.actor);
|
||||
userBox.add(this._userAvatar.actor,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
x_align: St.Align.END,
|
||||
y_align: St.Align.START });
|
||||
let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label',
|
||||
text: userRealName }));
|
||||
userBox.add(userLabel,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
x_align: St.Align.END,
|
||||
y_align: St.Align.MIDDLE });
|
||||
}
|
||||
|
||||
this._userLabel = new St.Label({
|
||||
style_class: userName === 'root'
|
||||
? 'polkit-dialog-user-root-label'
|
||||
: 'polkit-dialog-user-label',
|
||||
x_expand: true,
|
||||
y_align: Clutter.ActorAlign.CENTER,
|
||||
});
|
||||
|
||||
if (userName === 'root')
|
||||
this._userLabel.text = _('Administrator');
|
||||
|
||||
userBox.add_child(this._userLabel);
|
||||
this._onUserChanged();
|
||||
|
||||
this._passwordBox = new St.BoxLayout({ vertical: false, style_class: 'prompt-dialog-password-box' });
|
||||
content.messageBox.add(this._passwordBox);
|
||||
@@ -95,11 +104,10 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
this._passwordBox.add(this._passwordEntry,
|
||||
{ expand: true });
|
||||
|
||||
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, {
|
||||
animate: true,
|
||||
});
|
||||
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
|
||||
this._passwordBox.add(this._workSpinner.actor);
|
||||
|
||||
this.setInitialKeyFocus(this._passwordEntry);
|
||||
this._passwordBox.hide();
|
||||
|
||||
this._errorMessageLabel = new St.Label({ style_class: 'prompt-dialog-error-label' });
|
||||
@@ -135,16 +143,8 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
|
||||
this._doneEmitted = false;
|
||||
|
||||
this._mode = -1;
|
||||
|
||||
this._identityToAuth = Polkit.UnixUser.new_for_name(userName);
|
||||
this._cookie = cookie;
|
||||
|
||||
this._userLoadedId = this._user.connect('notify::is-loaded',
|
||||
this._onUserChanged.bind(this));
|
||||
this._userChangedId = this._user.connect('changed',
|
||||
this._onUserChanged.bind(this));
|
||||
this._onUserChanged();
|
||||
}
|
||||
|
||||
_setWorking(working) {
|
||||
@@ -154,9 +154,8 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
this._workSpinner.stop();
|
||||
}
|
||||
|
||||
_initiateSession() {
|
||||
performAuthentication() {
|
||||
this._destroySession();
|
||||
|
||||
this._session = new PolkitAgent.Session({ identity: this._identityToAuth,
|
||||
cookie: this._cookie });
|
||||
this._sessionCompletedId = this._session.connect('completed', this._onSessionCompleted.bind(this));
|
||||
@@ -216,9 +215,6 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
_onAuthenticateButtonPressed() {
|
||||
if (this._mode === DialogMode.CONFIRM)
|
||||
this._initiateSession();
|
||||
else
|
||||
this._onEntryActivate();
|
||||
}
|
||||
|
||||
@@ -250,7 +246,7 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
/* Try and authenticate again */
|
||||
this._initiateSession();
|
||||
this.performAuthentication();
|
||||
}
|
||||
}
|
||||
|
||||
@@ -268,10 +264,9 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
|
||||
this._passwordBox.show();
|
||||
this._passwordEntry.set_text('');
|
||||
this._updateSensitivity(true);
|
||||
|
||||
this._ensureOpen();
|
||||
this._passwordEntry.grab_key_focus();
|
||||
this._updateSensitivity(true);
|
||||
this._ensureOpen();
|
||||
}
|
||||
|
||||
_onSessionShowError(session, text) {
|
||||
@@ -307,40 +302,10 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
_onUserChanged() {
|
||||
if (!this._user.is_loaded)
|
||||
return;
|
||||
|
||||
let userName = this._user.get_user_name();
|
||||
let realName = this._user.get_real_name();
|
||||
|
||||
if (userName !== 'root') {
|
||||
this._userLabel.set_text(realName);
|
||||
|
||||
if (this._user.is_loaded && this._userAvatar) {
|
||||
this._userAvatar.update();
|
||||
this._userAvatar.actor.show();
|
||||
}
|
||||
|
||||
if (this._user.get_password_mode() === AccountsService.UserPasswordMode.NONE) {
|
||||
if (this._mode === DialogMode.CONFIRM)
|
||||
return;
|
||||
|
||||
this._mode = DialogMode.CONFIRM;
|
||||
this._destroySession();
|
||||
|
||||
this._okButton.reactive = true;
|
||||
|
||||
/* We normally open the dialog when we get a "request" signal, but
|
||||
* since in this case initiating a session would perform the
|
||||
* authentication, only open the dialog and initiate the session
|
||||
* when the user confirmed. */
|
||||
this._ensureOpen();
|
||||
} else {
|
||||
if (this._mode === DialogMode.AUTH)
|
||||
return;
|
||||
|
||||
this._mode = DialogMode.AUTH;
|
||||
this._initiateSession();
|
||||
}
|
||||
}
|
||||
|
||||
cancel() {
|
||||
@@ -403,14 +368,26 @@ var AuthenticationAgent = class {
|
||||
}
|
||||
|
||||
this._currentDialog = new AuthenticationDialog(actionId, message, cookie, userNames);
|
||||
|
||||
// We actually don't want to open the dialog until we know for
|
||||
// sure that we're going to interact with the user. For
|
||||
// example, if the password for the identity to auth is blank
|
||||
// (which it will be on a live CD) then there will be no
|
||||
// conversation at all... of course, we don't *know* that
|
||||
// until we actually try it.
|
||||
//
|
||||
// See https://bugzilla.gnome.org/show_bug.cgi?id=643062 for more
|
||||
// discussion.
|
||||
|
||||
this._currentDialog.connect('done', this._onDialogDone.bind(this));
|
||||
this._currentDialog.performAuthentication();
|
||||
}
|
||||
|
||||
_onCancel(_nativeAgent) {
|
||||
_onCancel(nativeAgent) {
|
||||
this._completeRequest(false);
|
||||
}
|
||||
|
||||
_onDialogDone(_dialog, dismissed) {
|
||||
_onDialogDone(dialog, dismissed) {
|
||||
this._completeRequest(dismissed);
|
||||
}
|
||||
|
||||
|
||||
@@ -1,8 +1,8 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, St } = imports.gi;
|
||||
const Lang = imports.lang;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
var Tpl = null;
|
||||
var Tp = null;
|
||||
@@ -41,7 +41,7 @@ var NotificationDirection = {
|
||||
};
|
||||
|
||||
function makeMessageFromTpMessage(tpMessage, direction) {
|
||||
let [text, flags_] = tpMessage.to_text();
|
||||
let [text, flags] = tpMessage.to_text();
|
||||
|
||||
let timestamp = tpMessage.get_sent_timestamp();
|
||||
if (timestamp == 0)
|
||||
@@ -148,11 +148,11 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
}
|
||||
|
||||
vfunc_observe_channels(...args) {
|
||||
let [account, conn, channels, dispatchOp_, requests_, context] = args;
|
||||
let [account, conn, channels, dispatchOp, requests, context] = args;
|
||||
let len = channels.length;
|
||||
for (let i = 0; i < len; i++) {
|
||||
let channel = channels[i];
|
||||
let [targetHandle_, targetHandleType] = channel.get_handle();
|
||||
let [targetHandle, targetHandleType] = channel.get_handle();
|
||||
|
||||
if (channel.get_invalidated())
|
||||
continue;
|
||||
@@ -181,7 +181,7 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
}
|
||||
|
||||
vfunc_handle_channels(...args) {
|
||||
let [account, conn, channels, requests_, userActionTime_, context] = args;
|
||||
let [account, conn, channels, requests, userActionTime, context] = args;
|
||||
this._handlingChannels(account, conn, channels, true);
|
||||
context.accept();
|
||||
}
|
||||
@@ -239,7 +239,7 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
}
|
||||
|
||||
_approveTextChannel(account, conn, channel, dispatchOp, context) {
|
||||
let [targetHandle_, targetHandleType] = channel.get_handle();
|
||||
let [targetHandle, targetHandleType] = channel.get_handle();
|
||||
|
||||
if (targetHandleType != Tp.HandleType.CONTACT) {
|
||||
context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
|
||||
@@ -260,7 +260,7 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
context.accept();
|
||||
}
|
||||
|
||||
_delegatedChannelsCb(_client, _channels) {
|
||||
_delegatedChannelsCb(client, channels) {
|
||||
// Nothing to do as we don't make a distinction between observed and
|
||||
// handled channels.
|
||||
}
|
||||
@@ -427,7 +427,7 @@ var ChatSource = class extends MessageTray.Source {
|
||||
}
|
||||
|
||||
_displayPendingMessages(logManager, result) {
|
||||
let [success_, events] = logManager.get_filtered_events_finish(result);
|
||||
let [success, events] = logManager.get_filtered_events_finish(result);
|
||||
|
||||
let logMessages = events.map(makeMessageFromTplEvent);
|
||||
this._ensureNotification();
|
||||
@@ -545,8 +545,8 @@ var ChatSource = class extends MessageTray.Source {
|
||||
// Wait a bit before notifying for the received message, a handler
|
||||
// could ack it in the meantime.
|
||||
if (this._notifyTimeoutId != 0)
|
||||
GLib.source_remove(this._notifyTimeoutId);
|
||||
this._notifyTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500,
|
||||
Mainloop.source_remove(this._notifyTimeoutId);
|
||||
this._notifyTimeoutId = Mainloop.timeout_add(500,
|
||||
this._notifyTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notifyTimeoutId, '[gnome-shell] this._notifyTimeout');
|
||||
}
|
||||
@@ -562,7 +562,7 @@ var ChatSource = class extends MessageTray.Source {
|
||||
|
||||
// This is called for both messages we send from
|
||||
// our client and other clients as well.
|
||||
_messageSent(channel, message, _flags, _token) {
|
||||
_messageSent(channel, message, flags, token) {
|
||||
this._ensureNotification();
|
||||
message = makeMessageFromTpMessage(message, NotificationDirection.SENT);
|
||||
this._notification.appendMessage(message);
|
||||
@@ -600,7 +600,7 @@ var ChatSource = class extends MessageTray.Source {
|
||||
}
|
||||
}
|
||||
|
||||
_presenceChanged(_contact, _presence, _status, _message) {
|
||||
_presenceChanged(contact, presence, status, message) {
|
||||
if (this._notification)
|
||||
this._notification.update(this._notification.title,
|
||||
this._notification.bannerBodyText,
|
||||
@@ -640,7 +640,7 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
|
||||
destroy(reason) {
|
||||
if (this._timestampTimeoutId)
|
||||
GLib.source_remove(this._timestampTimeoutId);
|
||||
Mainloop.source_remove(this._timestampTimeoutId);
|
||||
this._timestampTimeoutId = 0;
|
||||
super.destroy(reason);
|
||||
}
|
||||
@@ -673,8 +673,8 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
{ datetime: GLib.DateTime.new_from_unix_local (message.timestamp),
|
||||
bannerMarkup: true });
|
||||
|
||||
let group = (message.direction == NotificationDirection.RECEIVED
|
||||
? 'received' : 'sent');
|
||||
let group = (message.direction == NotificationDirection.RECEIVED ?
|
||||
'received' : 'sent');
|
||||
|
||||
this._append({ body: messageBody,
|
||||
group: group,
|
||||
@@ -696,8 +696,8 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
// SCROLLBACK_RECENT_LENGTH previous messages. Otherwise
|
||||
// we'll keep SCROLLBACK_IDLE_LENGTH messages.
|
||||
|
||||
let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME)
|
||||
? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
|
||||
let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) ?
|
||||
SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
|
||||
|
||||
let filteredHistory = this.messages.filter(item => item.realMessage);
|
||||
if (filteredHistory.length > maxLength) {
|
||||
@@ -728,7 +728,7 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
|
||||
// Reset the old message timeout
|
||||
if (this._timestampTimeoutId)
|
||||
GLib.source_remove(this._timestampTimeoutId);
|
||||
Mainloop.source_remove(this._timestampTimeoutId);
|
||||
this._timestampTimeoutId = 0;
|
||||
|
||||
let message = { realMessage: props.group != 'meta',
|
||||
@@ -746,8 +746,7 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
} else {
|
||||
// Schedule a new timestamp in SCROLLBACK_IMMEDIATE_TIME
|
||||
// from the timestamp of the message.
|
||||
this._timestampTimeoutId = GLib.timeout_add_seconds(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
this._timestampTimeoutId = Mainloop.timeout_add_seconds(
|
||||
SCROLLBACK_IMMEDIATE_TIME - (currentTime - timestamp),
|
||||
this.appendTimestamp.bind(this));
|
||||
GLib.Source.set_name_by_id(this._timestampTimeoutId, '[gnome-shell] this.appendTimestamp');
|
||||
@@ -952,15 +951,14 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
|
||||
|
||||
// Remove composing timeout.
|
||||
if (this._composingTimeoutId > 0) {
|
||||
GLib.source_remove(this._composingTimeoutId);
|
||||
Mainloop.source_remove(this._composingTimeoutId);
|
||||
this._composingTimeoutId = 0;
|
||||
}
|
||||
|
||||
if (text != '') {
|
||||
this.notification.source.setChatState(Tp.ChannelChatState.COMPOSING);
|
||||
|
||||
this._composingTimeoutId = GLib.timeout_add_seconds(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
this._composingTimeoutId = Mainloop.timeout_add_seconds(
|
||||
COMPOSING_STOP_TIMEOUT,
|
||||
this._composingStopTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._composingTimeoutId, '[gnome-shell] this._composingStopTimeout');
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported CtrlAltTabManager */
|
||||
|
||||
const { Clutter, GObject, Meta, Shell, St } = imports.gi;
|
||||
|
||||
@@ -64,8 +63,9 @@ var CtrlAltTabManager = class CtrlAltTabManager {
|
||||
if (a.sortGroup != b.sortGroup)
|
||||
return a.sortGroup - b.sortGroup;
|
||||
|
||||
let [ax] = a.proxy.get_transformed_position();
|
||||
let [bx] = b.proxy.get_transformed_position();
|
||||
let ax, bx, y;
|
||||
[ax, y] = a.proxy.get_transformed_position();
|
||||
[bx, y] = b.proxy.get_transformed_position();
|
||||
|
||||
return ax - bx;
|
||||
}
|
||||
|
||||
161
js/ui/dash.js
161
js/ui/dash.js
@@ -1,7 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Dash */
|
||||
|
||||
const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const AppDisplay = imports.ui.appDisplay;
|
||||
@@ -9,10 +9,11 @@ const AppFavorites = imports.ui.appFavorites;
|
||||
const DND = imports.ui.dnd;
|
||||
const IconGrid = imports.ui.iconGrid;
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var DASH_ANIMATION_TIME = 200;
|
||||
var DASH_ITEM_LABEL_SHOW_TIME = 150;
|
||||
var DASH_ITEM_LABEL_HIDE_TIME = 100;
|
||||
var DASH_ANIMATION_TIME = 0.2;
|
||||
var DASH_ITEM_LABEL_SHOW_TIME = 0.15;
|
||||
var DASH_ITEM_LABEL_HIDE_TIME = 0.1;
|
||||
var DASH_ITEM_HOVER_TIMEOUT = 300;
|
||||
|
||||
function getAppFromSource(source) {
|
||||
@@ -23,30 +24,6 @@ function getAppFromSource(source) {
|
||||
}
|
||||
}
|
||||
|
||||
var DashIcon = class DashIcon extends AppDisplay.AppIcon {
|
||||
constructor(app) {
|
||||
super(app, {
|
||||
setSizeManually: true,
|
||||
showLabel: false
|
||||
});
|
||||
}
|
||||
|
||||
// Disable all DnD methods
|
||||
_onDragBegin() {
|
||||
}
|
||||
|
||||
_onDragEnd() {
|
||||
}
|
||||
|
||||
handleDragOver() {
|
||||
return DND.DragMotionResult.CONTINUE;
|
||||
}
|
||||
|
||||
acceptDrop() {
|
||||
return false;
|
||||
}
|
||||
};
|
||||
|
||||
// A container like StBin, but taking the child's scale into account
|
||||
// when requesting a size
|
||||
var DashItemContainer = GObject.registerClass(
|
||||
@@ -54,9 +31,6 @@ class DashItemContainer extends St.Widget {
|
||||
_init() {
|
||||
super._init({ style_class: 'dash-item-container',
|
||||
pivot_point: new Clutter.Point({ x: .5, y: .5 }),
|
||||
scale_x: 0,
|
||||
scale_y: 0,
|
||||
opacity: 0,
|
||||
x_expand: true,
|
||||
x_align: Clutter.ActorAlign.CENTER });
|
||||
|
||||
@@ -67,11 +41,10 @@ class DashItemContainer extends St.Widget {
|
||||
this.label_actor = this.label;
|
||||
|
||||
this.child = null;
|
||||
this._childScale = 0;
|
||||
this._childOpacity = 0;
|
||||
this.animatingOut = false;
|
||||
|
||||
this.connect('notify::scale-x', () => this.queue_relayout());
|
||||
this.connect('notify::scale-y', () => this.queue_relayout());
|
||||
|
||||
this.connect('destroy', () => {
|
||||
if (this.child != null)
|
||||
this.child.destroy();
|
||||
@@ -122,10 +95,10 @@ class DashItemContainer extends St.Widget {
|
||||
x = stageX + this.get_width() + xOffset;
|
||||
|
||||
this.label.set_position(x, y);
|
||||
this.label.ease({
|
||||
opacity: 255,
|
||||
duration: DASH_ITEM_LABEL_SHOW_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
Tweener.addTween(this.label,
|
||||
{ opacity: 255,
|
||||
time: DASH_ITEM_LABEL_SHOW_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
});
|
||||
}
|
||||
|
||||
@@ -135,11 +108,13 @@ class DashItemContainer extends St.Widget {
|
||||
}
|
||||
|
||||
hideLabel() {
|
||||
this.label.ease({
|
||||
opacity: 0,
|
||||
duration: DASH_ITEM_LABEL_HIDE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this.label.hide()
|
||||
Tweener.addTween(this.label,
|
||||
{ opacity: 0,
|
||||
time: DASH_ITEM_LABEL_HIDE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.label.hide();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
@@ -151,6 +126,9 @@ class DashItemContainer extends St.Widget {
|
||||
|
||||
this.child = actor;
|
||||
this.add_actor(this.child);
|
||||
|
||||
this.set_scale(this._childScale, this._childScale);
|
||||
this.set_opacity(this._childOpacity);
|
||||
}
|
||||
|
||||
show(animate) {
|
||||
@@ -158,12 +136,11 @@ class DashItemContainer extends St.Widget {
|
||||
return;
|
||||
|
||||
let time = animate ? DASH_ANIMATION_TIME : 0;
|
||||
this.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
opacity: 255,
|
||||
duration: time,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
Tweener.addTween(this,
|
||||
{ childScale: 1.0,
|
||||
childOpacity: 255,
|
||||
time: time,
|
||||
transition: 'easeOutQuad'
|
||||
});
|
||||
}
|
||||
|
||||
@@ -176,15 +153,38 @@ class DashItemContainer extends St.Widget {
|
||||
}
|
||||
|
||||
this.animatingOut = true;
|
||||
this.ease({
|
||||
scale_x: 0,
|
||||
scale_y: 0,
|
||||
opacity: 0,
|
||||
duration: DASH_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this.destroy()
|
||||
Tweener.addTween(this,
|
||||
{ childScale: 0.0,
|
||||
childOpacity: 0,
|
||||
time: DASH_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.destroy();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
set childScale(scale) {
|
||||
this._childScale = scale;
|
||||
|
||||
this.set_scale(scale, scale);
|
||||
this.queue_relayout();
|
||||
}
|
||||
|
||||
get childScale() {
|
||||
return this._childScale;
|
||||
}
|
||||
|
||||
set childOpacity(opacity) {
|
||||
this._childOpacity = opacity;
|
||||
|
||||
this.set_opacity(opacity);
|
||||
this.queue_redraw();
|
||||
}
|
||||
|
||||
get childOpacity() {
|
||||
return this._childOpacity;
|
||||
}
|
||||
});
|
||||
|
||||
var ShowAppsIcon = GObject.registerClass(
|
||||
@@ -241,14 +241,14 @@ class ShowAppsIcon extends DashItemContainer {
|
||||
this.setLabelText(_("Show Applications"));
|
||||
}
|
||||
|
||||
handleDragOver(source, _actor, _x, _y, _time) {
|
||||
handleDragOver(source, actor, x, y, time) {
|
||||
if (!this._canRemoveApp(getAppFromSource(source)))
|
||||
return DND.DragMotionResult.NO_DROP;
|
||||
|
||||
return DND.DragMotionResult.MOVE_DROP;
|
||||
}
|
||||
|
||||
acceptDrop(source, _actor, _x, _y, _time) {
|
||||
acceptDrop(source, actor, x, y, time) {
|
||||
let app = getAppFromSource(source);
|
||||
if (!this._canRemoveApp(app))
|
||||
return false;
|
||||
@@ -296,7 +296,7 @@ class DashActor extends St.Widget {
|
||||
this.set_allocation(box, flags);
|
||||
|
||||
let [appIcons, showAppsButton] = this.get_children();
|
||||
let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
|
||||
let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
|
||||
|
||||
let childBox = new Clutter.ActorBox();
|
||||
childBox.x1 = contentBox.x1;
|
||||
@@ -351,7 +351,8 @@ var Dash = class Dash {
|
||||
this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
|
||||
|
||||
this._showAppsIcon = new ShowAppsIcon();
|
||||
this._showAppsIcon.show(false);
|
||||
this._showAppsIcon.childScale = 1;
|
||||
this._showAppsIcon.childOpacity = 255;
|
||||
this._showAppsIcon.icon.setIconSize(this.iconSize);
|
||||
this._hookUpLabel(this._showAppsIcon);
|
||||
|
||||
@@ -473,7 +474,19 @@ var Dash = class Dash {
|
||||
}
|
||||
|
||||
_createAppItem(app) {
|
||||
let appIcon = new DashIcon(app);
|
||||
let appIcon = new AppDisplay.AppIcon(app,
|
||||
{ setSizeManually: true,
|
||||
showLabel: false });
|
||||
if (appIcon._draggable) {
|
||||
appIcon._draggable.connect('drag-begin',
|
||||
() => {
|
||||
appIcon.actor.opacity = 50;
|
||||
});
|
||||
appIcon._draggable.connect('drag-end',
|
||||
() => {
|
||||
appIcon.actor.opacity = 255;
|
||||
});
|
||||
}
|
||||
|
||||
appIcon.connect('menu-state-changed',
|
||||
(appIcon, opened) => {
|
||||
@@ -499,7 +512,7 @@ var Dash = class Dash {
|
||||
// that the notify::hover handler does everything we need to.
|
||||
if (opened) {
|
||||
if (this._showLabelTimeoutId > 0) {
|
||||
GLib.source_remove(this._showLabelTimeoutId);
|
||||
Mainloop.source_remove(this._showLabelTimeoutId);
|
||||
this._showLabelTimeoutId = 0;
|
||||
}
|
||||
|
||||
@@ -513,7 +526,7 @@ var Dash = class Dash {
|
||||
if (shouldShow) {
|
||||
if (this._showLabelTimeoutId == 0) {
|
||||
let timeout = this._labelShowing ? 0 : DASH_ITEM_HOVER_TIMEOUT;
|
||||
this._showLabelTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
|
||||
this._showLabelTimeoutId = Mainloop.timeout_add(timeout,
|
||||
() => {
|
||||
this._labelShowing = true;
|
||||
item.showLabel();
|
||||
@@ -522,17 +535,17 @@ var Dash = class Dash {
|
||||
});
|
||||
GLib.Source.set_name_by_id(this._showLabelTimeoutId, '[gnome-shell] item.showLabel');
|
||||
if (this._resetHoverTimeoutId > 0) {
|
||||
GLib.source_remove(this._resetHoverTimeoutId);
|
||||
Mainloop.source_remove(this._resetHoverTimeoutId);
|
||||
this._resetHoverTimeoutId = 0;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if (this._showLabelTimeoutId > 0)
|
||||
GLib.source_remove(this._showLabelTimeoutId);
|
||||
Mainloop.source_remove(this._showLabelTimeoutId);
|
||||
this._showLabelTimeoutId = 0;
|
||||
item.hideLabel();
|
||||
if (this._labelShowing) {
|
||||
this._resetHoverTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, DASH_ITEM_HOVER_TIMEOUT,
|
||||
this._resetHoverTimeoutId = Mainloop.timeout_add(DASH_ITEM_HOVER_TIMEOUT,
|
||||
() => {
|
||||
this._labelShowing = false;
|
||||
this._resetHoverTimeoutId = 0;
|
||||
@@ -620,11 +633,11 @@ var Dash = class Dash {
|
||||
icon.icon.set_size(icon.icon.width * scale,
|
||||
icon.icon.height * scale);
|
||||
|
||||
icon.icon.ease({
|
||||
width: targetWidth,
|
||||
Tweener.addTween(icon.icon,
|
||||
{ width: targetWidth,
|
||||
height: targetHeight,
|
||||
duration: DASH_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
time: DASH_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
});
|
||||
}
|
||||
}
|
||||
@@ -703,8 +716,8 @@ var Dash = class Dash {
|
||||
}
|
||||
|
||||
// App moved
|
||||
let nextApp = newApps.length > newIndex + 1
|
||||
? newApps[newIndex + 1] : null;
|
||||
let nextApp = newApps.length > newIndex + 1 ? newApps[newIndex + 1]
|
||||
: null;
|
||||
let insertHere = nextApp && nextApp == oldApp;
|
||||
let alreadyRemoved = removedActors.reduce((result, actor) => {
|
||||
let removedApp = actor.child._delegate.app;
|
||||
@@ -777,7 +790,7 @@ var Dash = class Dash {
|
||||
}
|
||||
}
|
||||
|
||||
handleDragOver(source, actor, x, y, _time) {
|
||||
handleDragOver(source, actor, x, y, time) {
|
||||
let app = getAppFromSource(source);
|
||||
|
||||
// Don't allow favoriting of transient apps
|
||||
@@ -855,7 +868,7 @@ var Dash = class Dash {
|
||||
}
|
||||
|
||||
// Draggable target interface
|
||||
acceptDrop(source, _actor, _x, _y, _time) {
|
||||
acceptDrop(source, actor, x, y, time) {
|
||||
let app = getAppFromSource(source);
|
||||
|
||||
// Don't allow favoriting of transient apps
|
||||
|
||||
@@ -1,7 +1,6 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported DateMenuButton */
|
||||
|
||||
const { Clutter, Gio, GLib, GnomeDesktop,
|
||||
const { Clutter, GLib, GnomeDesktop,
|
||||
GObject, GWeather, Shell, St } = imports.gi;
|
||||
|
||||
const Util = imports.misc.util;
|
||||
@@ -11,13 +10,8 @@ const Calendar = imports.ui.calendar;
|
||||
const Weather = imports.misc.weather;
|
||||
const System = imports.system;
|
||||
|
||||
const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const MAX_FORECASTS = 5;
|
||||
|
||||
const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration');
|
||||
const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface);
|
||||
|
||||
function _isToday(date) {
|
||||
let now = new Date();
|
||||
return now.getYear() == date.getYear() &&
|
||||
@@ -30,12 +24,10 @@ var TodayButton = class TodayButton {
|
||||
// Having the ability to go to the current date if the user is already
|
||||
// on the current date can be confusing. So don't make the button reactive
|
||||
// until the selected date changes.
|
||||
this.actor = new St.Button({
|
||||
style_class: 'datemenu-today-button',
|
||||
x_align: St.Align.START,
|
||||
x_expand: true,
|
||||
this.actor = new St.Button({ style_class: 'datemenu-today-button',
|
||||
x_expand: true, x_align: St.Align.START,
|
||||
can_focus: true,
|
||||
reactive: false,
|
||||
reactive: false
|
||||
});
|
||||
this.actor.connect('clicked', () => {
|
||||
this._calendar.setDate(new Date(), false);
|
||||
@@ -90,8 +82,7 @@ var WorldClocksSection = class WorldClocksSection {
|
||||
x_fill: true,
|
||||
can_focus: true });
|
||||
this.actor.connect('clicked', () => {
|
||||
if (this._clocksApp)
|
||||
this._clocksApp.activate();
|
||||
this._clockAppMon.activateApp();
|
||||
|
||||
Main.overview.hide();
|
||||
Main.panel.closeCalendar();
|
||||
@@ -104,40 +95,29 @@ var WorldClocksSection = class WorldClocksSection {
|
||||
|
||||
this.actor.child = this._grid;
|
||||
|
||||
this._clocksApp = null;
|
||||
this._clocksProxy = new ClocksProxy(
|
||||
Gio.DBus.session,
|
||||
'org.gnome.clocks',
|
||||
'/org/gnome/clocks',
|
||||
this._onProxyReady.bind(this),
|
||||
null /* cancellable */,
|
||||
Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
|
||||
|
||||
this._settings = new Gio.Settings({
|
||||
schema_id: 'org.gnome.shell.world-clocks'
|
||||
});
|
||||
this._settings.connect('changed', this._clocksChanged.bind(this));
|
||||
this._clocksChanged();
|
||||
|
||||
this._appSystem = Shell.AppSystem.get_default();
|
||||
this._appSystem.connect('installed-changed',
|
||||
this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop',
|
||||
'org.gnome.clocks');
|
||||
this._clockAppMon.connect('available-changed',
|
||||
this._sync.bind(this));
|
||||
this._clockAppMon.watchSetting('world-clocks',
|
||||
this._clocksChanged.bind(this));
|
||||
this._sync();
|
||||
}
|
||||
|
||||
_sync() {
|
||||
this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop');
|
||||
this.actor.visible = this._clocksApp != null;
|
||||
this.actor.visible = this._clockAppMon.available;
|
||||
}
|
||||
|
||||
_clocksChanged() {
|
||||
_clocksChanged(settings) {
|
||||
this._grid.destroy_all_children();
|
||||
this._locations = [];
|
||||
|
||||
let world = GWeather.Location.get_world();
|
||||
let clocks = this._settings.get_value('locations').deep_unpack();
|
||||
let clocks = settings.get_value('world-clocks').deep_unpack();
|
||||
for (let i = 0; i < clocks.length; i++) {
|
||||
let l = world.deserialize(clocks[i]);
|
||||
if (!clocks[i].location)
|
||||
continue;
|
||||
let l = world.deserialize(clocks[i].location);
|
||||
if (l && l.get_timezone() != null)
|
||||
this._locations.push({ location: l });
|
||||
}
|
||||
@@ -148,8 +128,7 @@ var WorldClocksSection = class WorldClocksSection {
|
||||
});
|
||||
|
||||
let layout = this._grid.layout_manager;
|
||||
let title = (this._locations.length == 0)
|
||||
? _("Add world clocks…")
|
||||
let title = (this._locations.length == 0) ? _("Add world clocks…")
|
||||
: _("World Clocks");
|
||||
let header = new St.Label({ style_class: 'world-clocks-header',
|
||||
x_align: Clutter.ActorAlign.START,
|
||||
@@ -217,25 +196,6 @@ var WorldClocksSection = class WorldClocksSection {
|
||||
l.actor.text = Util.formatTime(now, { timeOnly: true });
|
||||
}
|
||||
}
|
||||
|
||||
_onProxyReady(proxy, error) {
|
||||
if (error) {
|
||||
log(`Failed to create GNOME Clocks proxy: ${error}`);
|
||||
return;
|
||||
}
|
||||
|
||||
this._clocksProxy.connect('g-properties-changed',
|
||||
this._onClocksPropertiesChanged.bind(this));
|
||||
this._onClocksPropertiesChanged();
|
||||
}
|
||||
|
||||
_onClocksPropertiesChanged() {
|
||||
if (this._clocksProxy.g_name_owner == null)
|
||||
return;
|
||||
|
||||
this._settings.set_value('locations',
|
||||
new GLib.Variant('av', this._clocksProxy.Locations));
|
||||
}
|
||||
};
|
||||
|
||||
var WeatherSection = class WeatherSection {
|
||||
@@ -289,12 +249,12 @@ var WeatherSection = class WeatherSection {
|
||||
let current = info;
|
||||
let infos = [info];
|
||||
for (let i = 0; i < forecasts.length; i++) {
|
||||
let [ok_, timestamp] = forecasts[i].get_value_update();
|
||||
let [ok, timestamp] = forecasts[i].get_value_update();
|
||||
let datetime = new Date(timestamp * 1000);
|
||||
if (!_isToday(datetime))
|
||||
continue; // Ignore forecasts from other days
|
||||
|
||||
[ok_, timestamp] = current.get_value_update();
|
||||
[ok, timestamp] = current.get_value_update();
|
||||
let currenttime = new Date(timestamp * 1000);
|
||||
if (currenttime.getHours() == datetime.getHours())
|
||||
continue; // Enforce a minimum interval of 1h
|
||||
@@ -315,7 +275,7 @@ var WeatherSection = class WeatherSection {
|
||||
|
||||
let col = 0;
|
||||
infos.forEach(fc => {
|
||||
let [ok_, timestamp] = fc.get_value_update();
|
||||
let [ok, timestamp] = fc.get_value_update();
|
||||
let timeStr = Util.formatTime(new Date(timestamp * 1000), {
|
||||
timeOnly: true
|
||||
});
|
||||
@@ -413,7 +373,7 @@ var MessagesIndicator = class MessagesIndicator {
|
||||
|
||||
_updateCount() {
|
||||
let count = 0;
|
||||
this._sources.forEach(source => (count += source.unseenCount));
|
||||
this._sources.forEach(source => count += source.unseenCount);
|
||||
count -= Main.messageTray.queueCount;
|
||||
|
||||
this.actor.visible = (count > 0);
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Dialog, MessageDialogContent */
|
||||
|
||||
const { Clutter, Gio, GObject, Pango, St } = imports.gi;
|
||||
|
||||
@@ -51,16 +50,10 @@ class Dialog extends St.Widget {
|
||||
y_align: St.Align.START });
|
||||
}
|
||||
|
||||
makeInactive() {
|
||||
_onDestroy() {
|
||||
if (this._eventId != 0)
|
||||
this._parentActor.disconnect(this._eventId);
|
||||
this._eventId = 0;
|
||||
|
||||
this.buttonLayout.get_children().forEach(c => c.set_reactive(false));
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
this.makeInactive();
|
||||
}
|
||||
|
||||
_modalEventHandler(actor, event) {
|
||||
|
||||
84
js/ui/dnd.js
84
js/ui/dnd.js
@@ -1,18 +1,18 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported addDragMonitor, removeDragMonitor, makeDraggable */
|
||||
|
||||
const { Clutter, GLib, Meta, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
// Time to scale down to maxDragActorSize
|
||||
var SCALE_ANIMATION_TIME = 250;
|
||||
var SCALE_ANIMATION_TIME = 0.25;
|
||||
// Time to animate to original position on cancel
|
||||
var SNAP_BACK_ANIMATION_TIME = 250;
|
||||
var SNAP_BACK_ANIMATION_TIME = 0.25;
|
||||
// Time to animate to original position on success
|
||||
var REVERT_ANIMATION_TIME = 750;
|
||||
var REVERT_ANIMATION_TIME = 0.75;
|
||||
|
||||
var DragMotionResult = {
|
||||
NO_DROP: 0,
|
||||
@@ -111,6 +111,9 @@ var _Draggable = class _Draggable {
|
||||
if (event.get_button() != 1)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
if (Tweener.getTweenCount(actor))
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
this._buttonDown = true;
|
||||
this._grabActor(event.get_device());
|
||||
|
||||
@@ -136,6 +139,9 @@ var _Draggable = class _Draggable {
|
||||
!global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
if (Tweener.getTweenCount(actor))
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
this._buttonDown = true;
|
||||
this._grabActor(event.get_device(), event.get_event_sequence());
|
||||
|
||||
@@ -422,22 +428,19 @@ var _Draggable = class _Draggable {
|
||||
// to the final position because that tween would
|
||||
// fight with updates as the user continues dragging
|
||||
// the mouse; instead we do the position computations in
|
||||
// a ::new-frame handler.
|
||||
this._dragActor.ease({
|
||||
scale_x: scale * origScale,
|
||||
// an onUpdate() function.
|
||||
Tweener.addTween(this._dragActor,
|
||||
{ scale_x: scale * origScale,
|
||||
scale_y: scale * origScale,
|
||||
duration: SCALE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
|
||||
this._dragActor.get_transition('scale-x').connect('new-frame', () => {
|
||||
time: SCALE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onUpdate: () => {
|
||||
let currentScale = this._dragActor.scale_x / origScale;
|
||||
this._dragOffsetX = currentScale * origDragOffsetX;
|
||||
this._dragOffsetY = currentScale * origDragOffsetY;
|
||||
this._dragActor.set_position(
|
||||
this._dragX + this._dragOffsetX,
|
||||
this._dragActor.set_position(this._dragX + this._dragOffsetX,
|
||||
this._dragY + this._dragOffsetY);
|
||||
});
|
||||
} });
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -500,7 +503,7 @@ var _Draggable = class _Draggable {
|
||||
|
||||
while (target) {
|
||||
if (target._delegate && target._delegate.handleDragOver) {
|
||||
let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
|
||||
let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
|
||||
// We currently loop through all parents on drag-over even if one of the children has handled it.
|
||||
// We can check the return value of the function and break the loop if it's true if we don't want
|
||||
// to continue checking the parents.
|
||||
@@ -572,16 +575,12 @@ var _Draggable = class _Draggable {
|
||||
|
||||
while (target) {
|
||||
if (target._delegate && target._delegate.acceptDrop) {
|
||||
let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
|
||||
let accepted = false;
|
||||
try {
|
||||
accepted = target._delegate.acceptDrop(this.actor._delegate,
|
||||
this._dragActor, targX, targY, event.get_time());
|
||||
} catch (e) {
|
||||
// On error, skip this target
|
||||
logError(e, "Skipping drag target");
|
||||
}
|
||||
if (accepted) {
|
||||
let [r, targX, targY] = target.transform_stage_point(dropX, dropY);
|
||||
if (target._delegate.acceptDrop(this.actor._delegate,
|
||||
this._dragActor,
|
||||
targX,
|
||||
targY,
|
||||
event.get_time())) {
|
||||
// If it accepted the drop without taking the actor,
|
||||
// handle it ourselves.
|
||||
if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) {
|
||||
@@ -614,15 +613,15 @@ var _Draggable = class _Draggable {
|
||||
if (this._dragActorSource && this._dragActorSource.visible) {
|
||||
// Snap the clone back to its source
|
||||
[x, y] = this._dragActorSource.get_transformed_position();
|
||||
let [sourceScaledWidth] = this._dragActorSource.get_transformed_size();
|
||||
scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0;
|
||||
let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size();
|
||||
scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0;
|
||||
} else if (this._dragOrigParent) {
|
||||
// Snap the actor back to its original position within
|
||||
// its parent, adjusting for the fact that the parent
|
||||
// may have been moved or scaled
|
||||
let [parentX, parentY] = this._dragOrigParent.get_transformed_position();
|
||||
let [parentWidth] = this._dragOrigParent.get_size();
|
||||
let [parentScaledWidth] = this._dragOrigParent.get_transformed_size();
|
||||
let [parentWidth, parentHeight] = this._dragOrigParent.get_size();
|
||||
let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size();
|
||||
let parentScale = 1.0;
|
||||
if (parentWidth != 0)
|
||||
parentScale = parentScaledWidth / parentWidth;
|
||||
@@ -658,12 +657,12 @@ var _Draggable = class _Draggable {
|
||||
|
||||
let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation();
|
||||
|
||||
this._animateDragEnd(eventTime, {
|
||||
x: snapBackX,
|
||||
this._animateDragEnd(eventTime,
|
||||
{ x: snapBackX,
|
||||
y: snapBackY,
|
||||
scale_x: snapBackScale,
|
||||
scale_y: snapBackScale,
|
||||
duration: SNAP_BACK_ANIMATION_TIME
|
||||
time: SNAP_BACK_ANIMATION_TIME,
|
||||
});
|
||||
}
|
||||
|
||||
@@ -676,22 +675,21 @@ var _Draggable = class _Draggable {
|
||||
this._dragActor.set_scale(restoreScale, restoreScale);
|
||||
this._dragActor.opacity = 0;
|
||||
|
||||
this._animateDragEnd(eventTime, {
|
||||
duration: REVERT_ANIMATION_TIME
|
||||
});
|
||||
this._animateDragEnd(eventTime,
|
||||
{ time: REVERT_ANIMATION_TIME });
|
||||
}
|
||||
|
||||
_animateDragEnd(eventTime, params) {
|
||||
this._animationInProgress = true;
|
||||
|
||||
params['opacity'] = this._dragOrigOpacity;
|
||||
params['transition'] = 'easeOutQuad';
|
||||
params['onComplete'] = this._onAnimationComplete;
|
||||
params['onCompleteScope'] = this;
|
||||
params['onCompleteParams'] = [this._dragActor, eventTime];
|
||||
|
||||
// start the animation
|
||||
this._dragActor.ease(Object.assign(params, {
|
||||
opacity: this._dragOrigOpacity,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._onAnimationComplete(this._dragActor, eventTime);
|
||||
}
|
||||
}));
|
||||
Tweener.addTween(this._dragActor, params);
|
||||
}
|
||||
|
||||
_finishAnimation() {
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported EdgeDragAction */
|
||||
|
||||
const { Clutter, GObject, Meta, St } = imports.gi;
|
||||
|
||||
@@ -27,7 +26,7 @@ var EdgeDragAction = GObject.registerClass({
|
||||
return global.display.get_monitor_geometry(monitorIndex);
|
||||
}
|
||||
|
||||
vfunc_gesture_prepare(_actor) {
|
||||
vfunc_gesture_prepare(actor) {
|
||||
if (this.get_n_current_points() == 0)
|
||||
return false;
|
||||
|
||||
@@ -43,7 +42,7 @@ var EdgeDragAction = GObject.registerClass({
|
||||
(this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
|
||||
}
|
||||
|
||||
vfunc_gesture_progress(_actor) {
|
||||
vfunc_gesture_progress(actor) {
|
||||
let [startX, startY] = this.get_press_coords(0);
|
||||
let [x, y] = this.get_motion_coords(0);
|
||||
let offsetX = Math.abs (x - startX);
|
||||
@@ -63,7 +62,7 @@ var EdgeDragAction = GObject.registerClass({
|
||||
return true;
|
||||
}
|
||||
|
||||
vfunc_gesture_end(_actor) {
|
||||
vfunc_gesture_end(actor) {
|
||||
let [startX, startY] = this.get_press_coords(0);
|
||||
let [x, y] = this.get_motion_coords(0);
|
||||
let monitorRect = this._getMonitorRect(startX, startY);
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init, EndSessionDialog */
|
||||
/*
|
||||
* Copyright 2010-2016 Red Hat, Inc
|
||||
*
|
||||
@@ -17,6 +16,8 @@
|
||||
* along with this program; if not, see <http://www.gnu.org/licenses/>.
|
||||
*/
|
||||
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const { AccountsService, Clutter, Gio,
|
||||
GLib, GObject, Pango, Polkit, Shell, St } = imports.gi;
|
||||
|
||||
@@ -350,15 +351,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
}
|
||||
|
||||
// It only makes sense to check for this permission if PackageKit is available.
|
||||
Polkit.Permission.new(
|
||||
'org.freedesktop.packagekit.trigger-offline-update', null, null,
|
||||
(source, res) => {
|
||||
try {
|
||||
this._updatesPermission = Polkit.Permission.new_finish(res);
|
||||
this._updatesPermission = Polkit.Permission.new_sync(
|
||||
'org.freedesktop.packagekit.trigger-offline-update', null, null);
|
||||
} catch (e) {
|
||||
log(`No permission to trigger offline updates: ${e}`);
|
||||
log('No permission to trigger offline updates: %s'.format(e.toString()));
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
@@ -449,16 +447,14 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
for (let i = 0; i < dialogContent.confirmButtons.length; i++) {
|
||||
let signal = dialogContent.confirmButtons[i].signal;
|
||||
let label = dialogContent.confirmButtons[i].label;
|
||||
buttons.push({
|
||||
action: () => {
|
||||
buttons.push({ action: () => {
|
||||
this.close(true);
|
||||
let signalId = this.connect('closed', () => {
|
||||
this.disconnect(signalId);
|
||||
this._confirm(signal);
|
||||
});
|
||||
},
|
||||
label: label,
|
||||
});
|
||||
label: label });
|
||||
}
|
||||
|
||||
this.setButtons(buttons);
|
||||
@@ -565,7 +561,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
let startTime = GLib.get_monotonic_time();
|
||||
this._secondsLeft = this._totalSecondsToStayOpen;
|
||||
|
||||
this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => {
|
||||
this._timerId = Mainloop.timeout_add_seconds(1, () => {
|
||||
let currentTime = GLib.get_monotonic_time();
|
||||
let secondsElapsed = ((currentTime - startTime) / 1000000);
|
||||
|
||||
@@ -587,7 +583,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
|
||||
_stopTimer() {
|
||||
if (this._timerId > 0) {
|
||||
GLib.source_remove(this._timerId);
|
||||
Mainloop.source_remove(this._timerId);
|
||||
this._timerId = 0;
|
||||
}
|
||||
|
||||
@@ -672,7 +668,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
this._loginManager.listSessions(result => {
|
||||
let n = 0;
|
||||
for (let i = 0; i < result.length; i++) {
|
||||
let [id_, uid_, userName, seat_, sessionPath] = result[i];
|
||||
let [id, uid, userName, seat, sessionPath] = result[i];
|
||||
let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath);
|
||||
|
||||
if (proxy.Class != 'user')
|
||||
@@ -738,7 +734,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
let dialogContent = DialogContent[this._type];
|
||||
|
||||
for (let i = 0; i < inhibitorObjectPaths.length; i++) {
|
||||
let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => {
|
||||
let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => {
|
||||
this._onInhibitorLoaded(proxy);
|
||||
});
|
||||
|
||||
@@ -782,7 +778,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
});
|
||||
}
|
||||
|
||||
Close(_parameters, _invocation) {
|
||||
Close(parameters, invocation) {
|
||||
this.close();
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init */
|
||||
|
||||
const Config = imports.misc.config;
|
||||
|
||||
@@ -10,7 +9,7 @@ imports.gi.versions.Gtk = '3.0';
|
||||
imports.gi.versions.TelepathyGLib = '0.12';
|
||||
imports.gi.versions.TelepathyLogger = '0.2';
|
||||
|
||||
const { Clutter, GLib, Meta, Shell, St } = imports.gi;
|
||||
const { Clutter, GLib, Shell, St } = imports.gi;
|
||||
const Gettext = imports.gettext;
|
||||
|
||||
// We can't import shell JS modules yet, because they may have
|
||||
@@ -58,130 +57,6 @@ function _patchLayoutClass(layoutClass, styleProps) {
|
||||
};
|
||||
}
|
||||
|
||||
function _makeEaseCallback(params, cleanup) {
|
||||
let onComplete = params.onComplete;
|
||||
delete params.onComplete;
|
||||
|
||||
let onStopped = params.onStopped;
|
||||
delete params.onStopped;
|
||||
|
||||
return isFinished => {
|
||||
cleanup();
|
||||
|
||||
if (onStopped)
|
||||
onStopped(isFinished);
|
||||
if (onComplete && isFinished)
|
||||
onComplete();
|
||||
};
|
||||
}
|
||||
|
||||
function _getPropertyTarget(actor, propName) {
|
||||
if (!propName.startsWith('@'))
|
||||
return [actor, propName];
|
||||
|
||||
let [type, name, prop] = propName.split('.');
|
||||
switch (type) {
|
||||
case '@layout':
|
||||
return [actor.layout_manager, name];
|
||||
case '@actions':
|
||||
return [actor.get_action(name), prop];
|
||||
case '@constraints':
|
||||
return [actor.get_constraint(name), prop];
|
||||
case '@effects':
|
||||
return [actor.get_effect(name), prop];
|
||||
}
|
||||
|
||||
throw new Error(`Invalid property name ${propName}`);
|
||||
}
|
||||
|
||||
function _easeActor(actor, params) {
|
||||
actor.save_easing_state();
|
||||
|
||||
if (params.duration != undefined)
|
||||
actor.set_easing_duration(params.duration);
|
||||
delete params.duration;
|
||||
|
||||
if (params.delay != undefined)
|
||||
actor.set_easing_delay(params.delay);
|
||||
delete params.delay;
|
||||
|
||||
if (params.mode != undefined)
|
||||
actor.set_easing_mode(params.mode);
|
||||
delete params.mode;
|
||||
|
||||
let cleanup = () => Meta.enable_unredirect_for_display(global.display);
|
||||
let callback = _makeEaseCallback(params, cleanup);
|
||||
|
||||
// cancel overwritten transitions
|
||||
let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
|
||||
animatedProps.forEach(p => actor.remove_transition(p));
|
||||
|
||||
actor.set(params);
|
||||
actor.restore_easing_state();
|
||||
|
||||
let transition = animatedProps.map(p => actor.get_transition(p))
|
||||
.find(t => t !== null);
|
||||
|
||||
if (transition && transition.delay)
|
||||
transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
|
||||
else
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
|
||||
if (transition)
|
||||
transition.connect('stopped', (t, finished) => callback(finished));
|
||||
else
|
||||
callback(true);
|
||||
}
|
||||
|
||||
function _easeActorProperty(actor, propName, target, params) {
|
||||
// Avoid pointless difference with ease()
|
||||
if (params.mode)
|
||||
params.progress_mode = params.mode;
|
||||
delete params.mode;
|
||||
|
||||
if (params.duration)
|
||||
params.duration = adjustAnimationTime(params.duration);
|
||||
let duration = Math.floor(params.duration || 0);
|
||||
|
||||
// Copy Clutter's behavior for implicit animations, see
|
||||
// should_skip_implicit_transition()
|
||||
if (actor instanceof Clutter.Actor && !actor.mapped)
|
||||
duration = 0;
|
||||
|
||||
let cleanup = () => Meta.enable_unredirect_for_display(global.display);
|
||||
let callback = _makeEaseCallback(params, cleanup);
|
||||
|
||||
// cancel overwritten transition
|
||||
actor.remove_transition(propName);
|
||||
|
||||
if (duration == 0) {
|
||||
let [obj, prop] = _getPropertyTarget(actor, propName);
|
||||
obj[prop] = target;
|
||||
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
callback(true);
|
||||
|
||||
return;
|
||||
}
|
||||
|
||||
let pspec = actor.find_property(propName);
|
||||
let transition = new Clutter.PropertyTransition(Object.assign({
|
||||
property_name: propName,
|
||||
interval: new Clutter.Interval({ value_type: pspec.value_type }),
|
||||
remove_on_complete: true
|
||||
}, params));
|
||||
actor.add_transition(propName, transition);
|
||||
|
||||
transition.set_to(target);
|
||||
|
||||
if (transition.delay)
|
||||
transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
|
||||
else
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
|
||||
transition.connect('stopped', (t, finished) => callback(finished));
|
||||
}
|
||||
|
||||
function _loggingFunc(...args) {
|
||||
let fields = { 'MESSAGE': args.join(', ') };
|
||||
let domain = "GNOME Shell";
|
||||
@@ -218,27 +93,6 @@ function init() {
|
||||
column_spacing: 'spacing-columns' });
|
||||
_patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });
|
||||
|
||||
let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
|
||||
Clutter.Actor.prototype.set_easing_duration = function(msecs) {
|
||||
origSetEasingDuration.call(this, adjustAnimationTime(msecs));
|
||||
};
|
||||
let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
|
||||
Clutter.Actor.prototype.set_easing_delay = function(msecs) {
|
||||
origSetEasingDelay.call(this, adjustAnimationTime(msecs));
|
||||
};
|
||||
|
||||
Clutter.Actor.prototype.ease = function(props, easingParams) {
|
||||
_easeActor(this, props, easingParams);
|
||||
};
|
||||
Clutter.Actor.prototype.ease_property = function(propName, target, params) {
|
||||
_easeActorProperty(this, propName, target, params);
|
||||
};
|
||||
St.Adjustment.prototype.ease = function(target, params) {
|
||||
// we're not an actor of course, but we implement the same
|
||||
// transition API as Clutter.Actor, so this works anyway
|
||||
_easeActorProperty(this, 'value', target, params);
|
||||
};
|
||||
|
||||
Clutter.Actor.prototype.toString = function() {
|
||||
return St.describe_actor(this);
|
||||
};
|
||||
@@ -252,12 +106,6 @@ function init() {
|
||||
}
|
||||
});
|
||||
|
||||
St.set_slow_down_factor = function(factor) {
|
||||
let { stack } = new Error();
|
||||
log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
|
||||
St.Settings.get().slow_down_factor = factor;
|
||||
};
|
||||
|
||||
let origToString = Object.prototype.toString;
|
||||
Object.prototype.toString = function() {
|
||||
let base = origToString.call(this);
|
||||
@@ -280,7 +128,7 @@ function init() {
|
||||
if (slowdownEnv) {
|
||||
let factor = parseFloat(slowdownEnv);
|
||||
if (!isNaN(factor) && factor > 0.0)
|
||||
St.Settings.get().slow_down_factor = factor;
|
||||
St.set_slow_down_factor(factor);
|
||||
}
|
||||
|
||||
// OK, now things are initialized enough that we can import shell JS
|
||||
@@ -290,17 +138,3 @@ function init() {
|
||||
Tweener.init();
|
||||
String.prototype.format = Format.format;
|
||||
}
|
||||
|
||||
// adjustAnimationTime:
|
||||
// @msecs: time in milliseconds
|
||||
//
|
||||
// Adjust @msecs to account for St's enable-animations
|
||||
// and slow-down-factor settings
|
||||
function adjustAnimationTime(msecs) {
|
||||
let settings = St.Settings.get();
|
||||
|
||||
if (!settings.enable_animations)
|
||||
return 1;
|
||||
return settings.slow_down_factor * msecs;
|
||||
}
|
||||
|
||||
|
||||
@@ -1,14 +1,12 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init, installExtension, uninstallExtension,
|
||||
checkForUpdates, updateExtension */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Soup } = imports.gi;
|
||||
|
||||
const Config = imports.misc.config;
|
||||
const Dialog = imports.ui.dialog;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const ExtensionSystem = imports.ui.extensionSystem;
|
||||
const FileUtils = imports.misc.fileUtils;
|
||||
const Main = imports.ui.main;
|
||||
const ModalDialog = imports.ui.modalDialog;
|
||||
|
||||
var REPOSITORY_URL_BASE = 'https://extensions.gnome.org';
|
||||
@@ -26,7 +24,7 @@ function installExtension(uuid, invocation) {
|
||||
|
||||
_httpSession.queue_message(message, (session, message) => {
|
||||
if (message.status_code != Soup.KnownStatusCode.OK) {
|
||||
Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
|
||||
ExtensionSystem.logExtensionError(uuid, `downloading info: ${message.status_code}`);
|
||||
invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
|
||||
return;
|
||||
}
|
||||
@@ -35,7 +33,7 @@ function installExtension(uuid, invocation) {
|
||||
try {
|
||||
info = JSON.parse(message.response_body.data);
|
||||
} catch (e) {
|
||||
Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`);
|
||||
ExtensionSystem.logExtensionError(uuid, `parsing info: ${e}`);
|
||||
invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString());
|
||||
return;
|
||||
}
|
||||
@@ -46,7 +44,7 @@ function installExtension(uuid, invocation) {
|
||||
}
|
||||
|
||||
function uninstallExtension(uuid) {
|
||||
let extension = Main.extensionManager.lookup(uuid);
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
if (!extension)
|
||||
return false;
|
||||
|
||||
@@ -54,7 +52,7 @@ function uninstallExtension(uuid) {
|
||||
if (extension.type != ExtensionUtils.ExtensionType.PER_USER)
|
||||
return false;
|
||||
|
||||
if (!Main.extensionManager.unloadExtension(extension))
|
||||
if (!ExtensionSystem.unloadExtension(extension))
|
||||
return false;
|
||||
|
||||
FileUtils.recursivelyDeleteDir(extension.dir, true);
|
||||
@@ -115,10 +113,10 @@ function updateExtension(uuid) {
|
||||
|
||||
_httpSession.queue_message(message, (session, message) => {
|
||||
gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
|
||||
let oldExtension = Main.extensionManager.lookup(uuid);
|
||||
let oldExtension = ExtensionUtils.extensions[uuid];
|
||||
let extensionDir = oldExtension.dir;
|
||||
|
||||
if (!Main.extensionManager.unloadExtension(oldExtension))
|
||||
if (!ExtensionSystem.unloadExtension(oldExtension))
|
||||
return;
|
||||
|
||||
FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir);
|
||||
@@ -127,11 +125,11 @@ function updateExtension(uuid) {
|
||||
let extension = null;
|
||||
|
||||
try {
|
||||
extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
Main.extensionManager.loadExtension(extension);
|
||||
extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
ExtensionSystem.loadExtension(extension);
|
||||
} catch (e) {
|
||||
if (extension)
|
||||
Main.extensionManager.unloadExtension(extension);
|
||||
ExtensionSystem.unloadExtension(extension);
|
||||
|
||||
logError(e, 'Error loading extension %s'.format(uuid));
|
||||
|
||||
@@ -140,7 +138,7 @@ function updateExtension(uuid) {
|
||||
|
||||
// Restore what was there before. We can't do much if we
|
||||
// fail here.
|
||||
Main.extensionManager.loadExtension(oldExtension);
|
||||
ExtensionSystem.loadExtension(oldExtension);
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -153,9 +151,9 @@ function updateExtension(uuid) {
|
||||
|
||||
function checkForUpdates() {
|
||||
let metadatas = {};
|
||||
Main.extensionManager.getUuids().forEach(uuid => {
|
||||
metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata;
|
||||
});
|
||||
for (let uuid in ExtensionUtils.extensions) {
|
||||
metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata;
|
||||
}
|
||||
|
||||
let params = { shell_version: Config.PACKAGE_VERSION,
|
||||
installed: JSON.stringify(metadatas) };
|
||||
@@ -186,14 +184,13 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
|
||||
this._info = info;
|
||||
this._invocation = invocation;
|
||||
|
||||
this.setButtons([{
|
||||
label: _("Cancel"),
|
||||
this.setButtons([{ label: _("Cancel"),
|
||||
action: this._onCancelButtonPressed.bind(this),
|
||||
key: Clutter.Escape,
|
||||
}, {
|
||||
label: _("Install"),
|
||||
key: Clutter.Escape
|
||||
},
|
||||
{ label: _("Install"),
|
||||
action: this._onInstallButtonPressed.bind(this),
|
||||
default: true,
|
||||
default: true
|
||||
}]);
|
||||
|
||||
let content = new Dialog.MessageDialogContent({
|
||||
@@ -206,12 +203,12 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
|
||||
this.contentLayout.add(content);
|
||||
}
|
||||
|
||||
_onCancelButtonPressed() {
|
||||
_onCancelButtonPressed(button, event) {
|
||||
this.close();
|
||||
this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled']));
|
||||
}
|
||||
|
||||
_onInstallButtonPressed() {
|
||||
_onInstallButtonPressed(button, event) {
|
||||
let params = { shell_version: Config.PACKAGE_VERSION };
|
||||
|
||||
let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid);
|
||||
@@ -227,11 +224,16 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
|
||||
}
|
||||
|
||||
function callback() {
|
||||
// Add extension to 'enabled-extensions' for the user, always...
|
||||
let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY);
|
||||
if (!enabledExtensions.includes(uuid)) {
|
||||
enabledExtensions.push(uuid);
|
||||
global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions);
|
||||
}
|
||||
|
||||
try {
|
||||
let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
Main.extensionManager.loadExtension(extension);
|
||||
if (!Main.extensionManager.enableExtension(uuid))
|
||||
throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`);
|
||||
let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
ExtensionSystem.loadExtension(extension);
|
||||
} catch (e) {
|
||||
uninstallExtension(uuid);
|
||||
errback('LoadExtensionError', e);
|
||||
|
||||
@@ -1,63 +1,47 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init connect disconnect */
|
||||
|
||||
const { GLib, Gio, St } = imports.gi;
|
||||
const { Gio, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const FileUtils = imports.misc.fileUtils;
|
||||
const Main = imports.ui.main;
|
||||
|
||||
const { ExtensionState, ExtensionType } = ExtensionUtils;
|
||||
var ExtensionState = {
|
||||
ENABLED: 1,
|
||||
DISABLED: 2,
|
||||
ERROR: 3,
|
||||
OUT_OF_DATE: 4,
|
||||
DOWNLOADING: 5,
|
||||
INITIALIZED: 6,
|
||||
|
||||
// Used as an error state for operations on unknown extensions,
|
||||
// should never be in a real extensionMeta object.
|
||||
UNINSTALLED: 99
|
||||
};
|
||||
|
||||
// Arrays of uuids
|
||||
var enabledExtensions;
|
||||
// Contains the order that extensions were enabled in.
|
||||
var extensionOrder = [];
|
||||
|
||||
// We don't really have a class to add signals on. So, create
|
||||
// a simple dummy object, add the signal methods, and export those
|
||||
// publically.
|
||||
var _signals = {};
|
||||
Signals.addSignalMethods(_signals);
|
||||
|
||||
var connect = _signals.connect.bind(_signals);
|
||||
var disconnect = _signals.disconnect.bind(_signals);
|
||||
|
||||
const ENABLED_EXTENSIONS_KEY = 'enabled-extensions';
|
||||
const DISABLED_EXTENSIONS_KEY = 'disabled-extensions';
|
||||
const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions';
|
||||
const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation';
|
||||
|
||||
var ExtensionManager = class {
|
||||
constructor() {
|
||||
this._initialized = false;
|
||||
this._enabled = false;
|
||||
var initted = false;
|
||||
var enabled;
|
||||
|
||||
this._extensions = new Map();
|
||||
this._enabledExtensions = [];
|
||||
this._extensionOrder = [];
|
||||
|
||||
Main.sessionMode.connect('updated', this._sessionUpdated.bind(this));
|
||||
}
|
||||
|
||||
init() {
|
||||
// The following file should exist for a period of time when extensions
|
||||
// are enabled after start. If it exists, then the systemd unit will
|
||||
// disable extensions should gnome-shell crash.
|
||||
// Should the file already exist from a previous login, then this is OK.
|
||||
let disableFilename = GLib.build_filenamev([GLib.get_user_runtime_dir(), 'gnome-shell-disable-extensions']);
|
||||
let disableFile = Gio.File.new_for_path(disableFilename);
|
||||
try {
|
||||
disableFile.create(Gio.FileCreateFlags.REPLACE_DESTINATION, null);
|
||||
} catch (e) {
|
||||
log(`Failed to create file ${disableFilename}: ${e.message}`);
|
||||
}
|
||||
|
||||
GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 60, () => {
|
||||
FileUtils.deleteGFile(disableFile);
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
|
||||
this._sessionUpdated();
|
||||
}
|
||||
|
||||
lookup(uuid) {
|
||||
return this._extensions.get(uuid);
|
||||
}
|
||||
|
||||
getUuids() {
|
||||
return [...this._extensions.keys()];
|
||||
}
|
||||
|
||||
_callExtensionDisable(uuid) {
|
||||
let extension = this.lookup(uuid);
|
||||
function disableExtension(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
if (!extension)
|
||||
return;
|
||||
|
||||
@@ -72,16 +56,16 @@ var ExtensionManager = class {
|
||||
// user disables C
|
||||
// this should: disable E, disable D, disable C, enable D, enable E
|
||||
|
||||
let orderIdx = this._extensionOrder.indexOf(uuid);
|
||||
let order = this._extensionOrder.slice(orderIdx + 1);
|
||||
let orderIdx = extensionOrder.indexOf(uuid);
|
||||
let order = extensionOrder.slice(orderIdx + 1);
|
||||
let orderReversed = order.slice().reverse();
|
||||
|
||||
for (let i = 0; i < orderReversed.length; i++) {
|
||||
let uuid = orderReversed[i];
|
||||
try {
|
||||
this.lookup(uuid).stateObj.disable();
|
||||
ExtensionUtils.extensions[uuid].stateObj.disable();
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
logExtensionError(uuid, e);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -94,40 +78,39 @@ var ExtensionManager = class {
|
||||
try {
|
||||
extension.stateObj.disable();
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
logExtensionError(uuid, e);
|
||||
}
|
||||
|
||||
for (let i = 0; i < order.length; i++) {
|
||||
let uuid = order[i];
|
||||
try {
|
||||
this.lookup(uuid).stateObj.enable();
|
||||
ExtensionUtils.extensions[uuid].stateObj.enable();
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
logExtensionError(uuid, e);
|
||||
}
|
||||
}
|
||||
|
||||
this._extensionOrder.splice(orderIdx, 1);
|
||||
extensionOrder.splice(orderIdx, 1);
|
||||
|
||||
if ( extension.state != ExtensionState.ERROR ) {
|
||||
extension.state = ExtensionState.DISABLED;
|
||||
this.emit('extension-state-changed', extension);
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
}
|
||||
}
|
||||
|
||||
_callExtensionEnable(uuid) {
|
||||
if (!Main.sessionMode.allowExtensions)
|
||||
return;
|
||||
|
||||
let extension = this.lookup(uuid);
|
||||
function enableExtension(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
if (!extension)
|
||||
return;
|
||||
|
||||
if (extension.state == ExtensionState.INITIALIZED)
|
||||
this._callExtensionInit(uuid);
|
||||
initExtension(uuid);
|
||||
|
||||
if (extension.state != ExtensionState.DISABLED)
|
||||
return;
|
||||
|
||||
extensionOrder.push(uuid);
|
||||
|
||||
let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
|
||||
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
|
||||
for (let i = 0; i < stylesheetNames.length; i++) {
|
||||
@@ -139,7 +122,7 @@ var ExtensionManager = class {
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
|
||||
continue; // not an error
|
||||
this.logExtensionError(uuid, e);
|
||||
log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
|
||||
return;
|
||||
}
|
||||
}
|
||||
@@ -147,123 +130,37 @@ var ExtensionManager = class {
|
||||
try {
|
||||
extension.stateObj.enable();
|
||||
extension.state = ExtensionState.ENABLED;
|
||||
this._extensionOrder.push(uuid);
|
||||
this.emit('extension-state-changed', extension);
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
return;
|
||||
} catch (e) {
|
||||
if (extension.stylesheet) {
|
||||
theme.unload_stylesheet(extension.stylesheet);
|
||||
delete extension.stylesheet;
|
||||
}
|
||||
this.logExtensionError(uuid, e);
|
||||
logExtensionError(uuid, e);
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
enableExtension(uuid) {
|
||||
if (!this._extensions.has(uuid))
|
||||
return false;
|
||||
|
||||
let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
|
||||
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
|
||||
|
||||
if (disabledExtensions.includes(uuid)) {
|
||||
disabledExtensions = disabledExtensions.filter(item => item !== uuid);
|
||||
global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
|
||||
}
|
||||
|
||||
if (!enabledExtensions.includes(uuid)) {
|
||||
enabledExtensions.push(uuid);
|
||||
global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
disableExtension(uuid) {
|
||||
if (!this._extensions.has(uuid))
|
||||
return false;
|
||||
|
||||
let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
|
||||
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
|
||||
|
||||
if (enabledExtensions.includes(uuid)) {
|
||||
enabledExtensions = enabledExtensions.filter(item => item !== uuid);
|
||||
global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
|
||||
}
|
||||
|
||||
if (!disabledExtensions.includes(uuid)) {
|
||||
disabledExtensions.push(uuid);
|
||||
global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
logExtensionError(uuid, error) {
|
||||
let extension = this.lookup(uuid);
|
||||
function logExtensionError(uuid, error) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
if (!extension)
|
||||
return;
|
||||
|
||||
let message = `${error}`;
|
||||
|
||||
extension.error = message;
|
||||
extension.state = ExtensionState.ERROR;
|
||||
if (!extension.errors)
|
||||
extension.errors = [];
|
||||
extension.errors.push(message);
|
||||
|
||||
logError(error, `Extension ${uuid}`);
|
||||
this.emit('extension-state-changed', extension);
|
||||
log('Extension "%s" had error: %s'.format(uuid, message));
|
||||
_signals.emit('extension-state-changed', { uuid: uuid,
|
||||
error: message,
|
||||
state: extension.state });
|
||||
}
|
||||
|
||||
createExtensionObject(uuid, dir, type) {
|
||||
let metadataFile = dir.get_child('metadata.json');
|
||||
if (!metadataFile.query_exists(null)) {
|
||||
throw new Error('Missing metadata.json');
|
||||
}
|
||||
|
||||
let metadataContents, success_;
|
||||
try {
|
||||
[success_, metadataContents] = metadataFile.load_contents(null);
|
||||
if (metadataContents instanceof Uint8Array)
|
||||
metadataContents = imports.byteArray.toString(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error(`Failed to load metadata.json: ${e}`);
|
||||
}
|
||||
let meta;
|
||||
try {
|
||||
meta = JSON.parse(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error(`Failed to parse metadata.json: ${e}`);
|
||||
}
|
||||
|
||||
let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
|
||||
for (let i = 0; i < requiredProperties.length; i++) {
|
||||
let prop = requiredProperties[i];
|
||||
if (!meta[prop]) {
|
||||
throw new Error(`missing "${prop}" property in metadata.json`);
|
||||
}
|
||||
}
|
||||
|
||||
if (uuid != meta.uuid) {
|
||||
throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
|
||||
}
|
||||
|
||||
let extension = {
|
||||
metadata: meta,
|
||||
uuid: meta.uuid,
|
||||
type,
|
||||
dir,
|
||||
path: dir.get_path(),
|
||||
error: '',
|
||||
hasPrefs: dir.get_child('prefs.js').query_exists(null),
|
||||
canChange: false
|
||||
};
|
||||
this._extensions.set(uuid, extension);
|
||||
|
||||
return extension;
|
||||
}
|
||||
|
||||
loadExtension(extension) {
|
||||
function loadExtension(extension) {
|
||||
// Default to error, we set success as the last step
|
||||
extension.state = ExtensionState.ERROR;
|
||||
|
||||
@@ -272,66 +169,63 @@ var ExtensionManager = class {
|
||||
if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
|
||||
extension.state = ExtensionState.OUT_OF_DATE;
|
||||
} else {
|
||||
let enabled = this._enabledExtensions.includes(extension.uuid);
|
||||
let enabled = enabledExtensions.includes(extension.uuid);
|
||||
if (enabled) {
|
||||
if (!this._callExtensionInit(extension.uuid))
|
||||
if (!initExtension(extension.uuid))
|
||||
return;
|
||||
if (extension.state == ExtensionState.DISABLED)
|
||||
this._callExtensionEnable(extension.uuid);
|
||||
enableExtension(extension.uuid);
|
||||
} else {
|
||||
extension.state = ExtensionState.INITIALIZED;
|
||||
}
|
||||
}
|
||||
|
||||
this._updateCanChange(extension);
|
||||
this.emit('extension-state-changed', extension);
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
}
|
||||
|
||||
unloadExtension(extension) {
|
||||
function unloadExtension(extension) {
|
||||
// Try to disable it -- if it's ERROR'd, we can't guarantee that,
|
||||
// but it will be removed on next reboot, and hopefully nothing
|
||||
// broke too much.
|
||||
this._callExtensionDisable(extension.uuid);
|
||||
disableExtension(extension.uuid);
|
||||
|
||||
extension.state = ExtensionState.UNINSTALLED;
|
||||
this.emit('extension-state-changed', extension);
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
|
||||
this._extensions.delete(extension.uuid);
|
||||
delete ExtensionUtils.extensions[extension.uuid];
|
||||
return true;
|
||||
}
|
||||
|
||||
reloadExtension(oldExtension) {
|
||||
function reloadExtension(oldExtension) {
|
||||
// Grab the things we'll need to pass to createExtensionObject
|
||||
// to reload it.
|
||||
let { uuid, dir, type } = oldExtension;
|
||||
let { uuid: uuid, dir: dir, type: type } = oldExtension;
|
||||
|
||||
// Then unload the old extension.
|
||||
this.unloadExtension(oldExtension);
|
||||
unloadExtension(oldExtension);
|
||||
|
||||
// Now, recreate the extension and load it.
|
||||
let newExtension;
|
||||
try {
|
||||
newExtension = this.createExtensionObject(uuid, dir, type);
|
||||
newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type);
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
logExtensionError(uuid, e);
|
||||
return;
|
||||
}
|
||||
|
||||
this.loadExtension(newExtension);
|
||||
loadExtension(newExtension);
|
||||
}
|
||||
|
||||
_callExtensionInit(uuid) {
|
||||
if (!Main.sessionMode.allowExtensions)
|
||||
return false;
|
||||
|
||||
let extension = this.lookup(uuid);
|
||||
if (!extension)
|
||||
throw new Error("Extension was not properly created. Call createExtensionObject first");
|
||||
|
||||
function initExtension(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
let dir = extension.dir;
|
||||
|
||||
if (!extension)
|
||||
throw new Error("Extension was not properly created. Call loadExtension first");
|
||||
|
||||
let extensionJs = dir.get_child('extension.js');
|
||||
if (!extensionJs.query_exists(null)) {
|
||||
this.logExtensionError(uuid, new Error('Missing extension.js'));
|
||||
logExtensionError(uuid, new Error('Missing extension.js'));
|
||||
return false;
|
||||
}
|
||||
|
||||
@@ -342,7 +236,7 @@ var ExtensionManager = class {
|
||||
try {
|
||||
extensionModule = extension.imports.extension;
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
logExtensionError(uuid, e);
|
||||
return false;
|
||||
}
|
||||
|
||||
@@ -350,7 +244,7 @@ var ExtensionManager = class {
|
||||
try {
|
||||
extensionState = extensionModule.init(extension);
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
logExtensionError(uuid, e);
|
||||
return false;
|
||||
}
|
||||
}
|
||||
@@ -360,177 +254,121 @@ var ExtensionManager = class {
|
||||
extension.stateObj = extensionState;
|
||||
|
||||
extension.state = ExtensionState.DISABLED;
|
||||
this.emit('extension-loaded', uuid);
|
||||
_signals.emit('extension-loaded', uuid);
|
||||
return true;
|
||||
}
|
||||
|
||||
_getModeExtensions() {
|
||||
function getEnabledExtensions() {
|
||||
let extensions;
|
||||
if (Array.isArray(Main.sessionMode.enabledExtensions))
|
||||
return Main.sessionMode.enabledExtensions;
|
||||
return [];
|
||||
extensions = Main.sessionMode.enabledExtensions;
|
||||
else
|
||||
extensions = [];
|
||||
|
||||
if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
|
||||
return extensions;
|
||||
|
||||
return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
|
||||
}
|
||||
|
||||
_updateCanChange(extension) {
|
||||
let hasError =
|
||||
extension.state == ExtensionState.ERROR ||
|
||||
extension.state == ExtensionState.OUT_OF_DATE;
|
||||
function onEnabledExtensionsChanged() {
|
||||
let newEnabledExtensions = getEnabledExtensions();
|
||||
|
||||
let isMode = this._getModeExtensions().includes(extension.uuid);
|
||||
let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY);
|
||||
|
||||
let changeKey = isMode
|
||||
? DISABLE_USER_EXTENSIONS_KEY
|
||||
: ENABLED_EXTENSIONS_KEY;
|
||||
|
||||
extension.canChange =
|
||||
!hasError &&
|
||||
global.settings.is_writable(changeKey) &&
|
||||
(isMode || !modeOnly);
|
||||
}
|
||||
|
||||
_getEnabledExtensions() {
|
||||
let extensions = this._getModeExtensions();
|
||||
|
||||
if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
|
||||
extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
|
||||
|
||||
// filter out 'disabled-extensions' which takes precedence
|
||||
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
|
||||
return extensions.filter(item => !disabledExtensions.includes(item));
|
||||
}
|
||||
|
||||
_onUserExtensionsEnabledChanged() {
|
||||
this._onEnabledExtensionsChanged();
|
||||
this._onSettingsWritableChanged();
|
||||
}
|
||||
|
||||
_onEnabledExtensionsChanged() {
|
||||
let newEnabledExtensions = this._getEnabledExtensions();
|
||||
if (!enabled)
|
||||
return;
|
||||
|
||||
// Find and enable all the newly enabled extensions: UUIDs found in the
|
||||
// new setting, but not in the old one.
|
||||
newEnabledExtensions.filter(
|
||||
uuid => !this._enabledExtensions.includes(uuid)
|
||||
uuid => !enabledExtensions.includes(uuid)
|
||||
).forEach(uuid => {
|
||||
this._callExtensionEnable(uuid);
|
||||
enableExtension(uuid);
|
||||
});
|
||||
|
||||
// Find and disable all the newly disabled extensions: UUIDs found in the
|
||||
// old setting, but not in the new one.
|
||||
this._extensionOrder.filter(
|
||||
uuid => !newEnabledExtensions.includes(uuid)
|
||||
).reverse().forEach(uuid => {
|
||||
this._callExtensionDisable(uuid);
|
||||
enabledExtensions.filter(
|
||||
item => !newEnabledExtensions.includes(item)
|
||||
).forEach(uuid => {
|
||||
disableExtension(uuid);
|
||||
});
|
||||
|
||||
this._enabledExtensions = newEnabledExtensions;
|
||||
enabledExtensions = newEnabledExtensions;
|
||||
}
|
||||
|
||||
_onSettingsWritableChanged() {
|
||||
for (let extension of this._extensions.values()) {
|
||||
this._updateCanChange(extension);
|
||||
this.emit('extension-state-changed', extension);
|
||||
}
|
||||
}
|
||||
function _onVersionValidationChanged() {
|
||||
// we want to reload all extensions, but only enable
|
||||
// extensions when allowed by the sessionMode, so
|
||||
// temporarily disable them all
|
||||
enabledExtensions = [];
|
||||
for (let uuid in ExtensionUtils.extensions)
|
||||
reloadExtension(ExtensionUtils.extensions[uuid]);
|
||||
enabledExtensions = getEnabledExtensions();
|
||||
|
||||
_onVersionValidationChanged() {
|
||||
// Disabling extensions modifies the order array, so use a copy
|
||||
let extensionOrder = this._extensionOrder.slice();
|
||||
|
||||
// Disable enabled extensions in the reverse order first to avoid
|
||||
// the "rebasing" done in _callExtensionDisable...
|
||||
extensionOrder.slice().reverse().forEach(uuid => {
|
||||
this._callExtensionDisable(uuid);
|
||||
});
|
||||
|
||||
// ...and then reload and enable extensions in the correct order again.
|
||||
[...this._extensions.values()].sort((a, b) => {
|
||||
return extensionOrder.indexOf(a.uuid) - extensionOrder.indexOf(b.uuid);
|
||||
}).forEach(extension => this.reloadExtension(extension));
|
||||
}
|
||||
|
||||
_loadExtensions() {
|
||||
global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`,
|
||||
this._onEnabledExtensionsChanged.bind(this));
|
||||
global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`,
|
||||
this._onEnabledExtensionsChanged.bind(this));
|
||||
global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`,
|
||||
this._onUserExtensionsEnabledChanged.bind(this));
|
||||
global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`,
|
||||
this._onVersionValidationChanged.bind(this));
|
||||
global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`,
|
||||
this._onSettingsWritableChanged.bind(this));
|
||||
global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`,
|
||||
this._onSettingsWritableChanged.bind(this));
|
||||
|
||||
this._enabledExtensions = this._getEnabledExtensions();
|
||||
|
||||
let perUserDir = Gio.File.new_for_path(global.userdatadir);
|
||||
FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
|
||||
let fileType = info.get_file_type();
|
||||
if (fileType != Gio.FileType.DIRECTORY)
|
||||
return;
|
||||
let uuid = info.get_name();
|
||||
let existing = this.lookup(uuid);
|
||||
if (existing) {
|
||||
log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`);
|
||||
return;
|
||||
}
|
||||
|
||||
let extension;
|
||||
let type = dir.has_prefix(perUserDir)
|
||||
? ExtensionType.PER_USER
|
||||
: ExtensionType.SYSTEM;
|
||||
try {
|
||||
extension = this.createExtensionObject(uuid, dir, type);
|
||||
} catch (e) {
|
||||
logError(e, `Could not load extension ${uuid}`);
|
||||
return;
|
||||
}
|
||||
this.loadExtension(extension);
|
||||
if (Main.sessionMode.allowExtensions) {
|
||||
enabledExtensions.forEach(uuid => {
|
||||
enableExtension(uuid);
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
_enableAllExtensions() {
|
||||
if (this._enabled)
|
||||
function _loadExtensions() {
|
||||
global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
|
||||
global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`, onEnabledExtensionsChanged);
|
||||
global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`, _onVersionValidationChanged);
|
||||
|
||||
enabledExtensions = getEnabledExtensions();
|
||||
|
||||
let finder = new ExtensionUtils.ExtensionFinder();
|
||||
finder.connect('extension-found', (finder, extension) => {
|
||||
loadExtension(extension);
|
||||
});
|
||||
finder.scanExtensions();
|
||||
}
|
||||
|
||||
function enableAllExtensions() {
|
||||
if (enabled)
|
||||
return;
|
||||
|
||||
if (!this._initialized) {
|
||||
this._loadExtensions();
|
||||
this._initialized = true;
|
||||
if (!initted) {
|
||||
_loadExtensions();
|
||||
initted = true;
|
||||
} else {
|
||||
this._enabledExtensions.forEach(uuid => {
|
||||
this._callExtensionEnable(uuid);
|
||||
enabledExtensions.forEach(uuid => {
|
||||
enableExtension(uuid);
|
||||
});
|
||||
}
|
||||
this._enabled = true;
|
||||
enabled = true;
|
||||
}
|
||||
|
||||
_disableAllExtensions() {
|
||||
if (!this._enabled)
|
||||
function disableAllExtensions() {
|
||||
if (!enabled)
|
||||
return;
|
||||
|
||||
if (this._initialized) {
|
||||
this._extensionOrder.slice().reverse().forEach(uuid => {
|
||||
this._callExtensionDisable(uuid);
|
||||
if (initted) {
|
||||
extensionOrder.slice().reverse().forEach(uuid => {
|
||||
disableExtension(uuid);
|
||||
});
|
||||
}
|
||||
|
||||
this._enabled = false;
|
||||
enabled = false;
|
||||
}
|
||||
|
||||
_sessionUpdated() {
|
||||
function _sessionUpdated() {
|
||||
// For now sessionMode.allowExtensions controls extensions from both the
|
||||
// 'enabled-extensions' preference and the sessionMode.enabledExtensions
|
||||
// property; it might make sense to make enabledExtensions independent
|
||||
// from allowExtensions in the future
|
||||
if (Main.sessionMode.allowExtensions) {
|
||||
// Take care of added or removed sessionMode extensions
|
||||
this._onEnabledExtensionsChanged();
|
||||
this._enableAllExtensions();
|
||||
if (initted)
|
||||
enabledExtensions = getEnabledExtensions();
|
||||
enableAllExtensions();
|
||||
} else {
|
||||
this._disableAllExtensions();
|
||||
disableAllExtensions();
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(ExtensionManager.prototype);
|
||||
|
||||
function init() {
|
||||
Main.sessionMode.connect('updated', _sessionUpdated);
|
||||
_sessionUpdated();
|
||||
}
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported GrabHelper */
|
||||
|
||||
const { Clutter, St } = imports.gi;
|
||||
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported CandidatePopup */
|
||||
|
||||
const { Clutter, IBus, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -126,9 +125,6 @@ Signals.addSignalMethods(CandidateArea.prototype);
|
||||
|
||||
var CandidatePopup = class CandidatePopup {
|
||||
constructor() {
|
||||
this._dummyCursor = new St.Widget({ opacity: 0 });
|
||||
Main.layoutManager.uiGroup.add_actor(this._dummyCursor);
|
||||
|
||||
this._boxPointer = new BoxPointer.BoxPointer(St.Side.TOP);
|
||||
this._boxPointer.visible = false;
|
||||
this._boxPointer.style_class = 'candidate-popup-boxpointer';
|
||||
@@ -202,29 +198,29 @@ var CandidatePopup = class CandidatePopup {
|
||||
this._setTextAttributes(this._preeditText.clutter_text,
|
||||
attrs);
|
||||
});
|
||||
panelService.connect('show-preedit-text', () => {
|
||||
panelService.connect('show-preedit-text', ps => {
|
||||
this._preeditText.show();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('hide-preedit-text', () => {
|
||||
panelService.connect('hide-preedit-text', ps => {
|
||||
this._preeditText.hide();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('update-auxiliary-text', (_ps, text, visible) => {
|
||||
panelService.connect('update-auxiliary-text', (ps, text, visible) => {
|
||||
this._auxText.visible = visible;
|
||||
this._updateVisibility();
|
||||
|
||||
this._auxText.text = text.get_text();
|
||||
});
|
||||
panelService.connect('show-auxiliary-text', () => {
|
||||
panelService.connect('show-auxiliary-text', ps => {
|
||||
this._auxText.show();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('hide-auxiliary-text', () => {
|
||||
panelService.connect('hide-auxiliary-text', ps => {
|
||||
this._auxText.hide();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => {
|
||||
panelService.connect('update-lookup-table', (ps, lookupTable, visible) => {
|
||||
this._candidateArea.actor.visible = visible;
|
||||
this._updateVisibility();
|
||||
|
||||
@@ -260,26 +256,24 @@ var CandidatePopup = class CandidatePopup {
|
||||
this._candidateArea.setOrientation(lookupTable.get_orientation());
|
||||
this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
|
||||
});
|
||||
panelService.connect('show-lookup-table', () => {
|
||||
panelService.connect('show-lookup-table', ps => {
|
||||
this._candidateArea.actor.show();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('hide-lookup-table', () => {
|
||||
panelService.connect('hide-lookup-table', ps => {
|
||||
this._candidateArea.actor.hide();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('focus-out', () => {
|
||||
panelService.connect('focus-out', ps => {
|
||||
this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
|
||||
Main.keyboard.resetSuggestions();
|
||||
});
|
||||
}
|
||||
|
||||
_setDummyCursorGeometry(x, y, w, h) {
|
||||
this._dummyCursor.set_position(Math.round(x), Math.round(y));
|
||||
this._dummyCursor.set_size(Math.round(w), Math.round(h));
|
||||
|
||||
Main.layoutManager.setDummyCursorGeometry(x, y, w, h);
|
||||
if (this._boxPointer.visible)
|
||||
this._boxPointer.setPosition(this._dummyCursor, 0);
|
||||
this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
|
||||
}
|
||||
|
||||
_updateVisibility() {
|
||||
@@ -289,7 +283,7 @@ var CandidatePopup = class CandidatePopup {
|
||||
this._candidateArea.actor.visible));
|
||||
|
||||
if (isVisible) {
|
||||
this._boxPointer.setPosition(this._dummyCursor, 0);
|
||||
this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
|
||||
this._boxPointer.open(BoxPointer.PopupAnimation.NONE);
|
||||
this._boxPointer.raise_top();
|
||||
} else {
|
||||
|
||||
@@ -1,17 +1,17 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported BaseIcon, IconGrid, PaginatedIconGrid */
|
||||
|
||||
const { Clutter, GLib, GObject, Meta, St } = imports.gi;
|
||||
const { Clutter, GObject, Meta, St } = imports.gi;
|
||||
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Main = imports.ui.main;
|
||||
|
||||
var ICON_SIZE = 96;
|
||||
var MIN_ICON_SIZE = 16;
|
||||
|
||||
var EXTRA_SPACE_ANIMATION_TIME = 250;
|
||||
var EXTRA_SPACE_ANIMATION_TIME = 0.25;
|
||||
|
||||
var ANIMATION_TIME_IN = 350;
|
||||
var ANIMATION_TIME_IN = 0.350;
|
||||
var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN;
|
||||
var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN;
|
||||
var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM;
|
||||
@@ -26,7 +26,7 @@ var AnimationDirection = {
|
||||
};
|
||||
|
||||
var APPICON_ANIMATION_OUT_SCALE = 3;
|
||||
var APPICON_ANIMATION_OUT_TIME = 250;
|
||||
var APPICON_ANIMATION_OUT_TIME = 0.25;
|
||||
|
||||
var BaseIcon = GObject.registerClass(
|
||||
class BaseIcon extends St.Bin {
|
||||
@@ -56,10 +56,6 @@ class BaseIcon extends St.Bin {
|
||||
|
||||
if (params.showLabel) {
|
||||
this.label = new St.Label({ text: label });
|
||||
this.label.clutter_text.set({
|
||||
x_align: Clutter.ActorAlign.CENTER,
|
||||
y_align: Clutter.ActorAlign.CENTER
|
||||
});
|
||||
this._box.add_actor(this.label);
|
||||
} else {
|
||||
this.label = null;
|
||||
@@ -75,14 +71,14 @@ class BaseIcon extends St.Bin {
|
||||
this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this));
|
||||
}
|
||||
|
||||
vfunc_get_preferred_width(_forHeight) {
|
||||
vfunc_get_preferred_width(forHeight) {
|
||||
// Return the actual height to keep the squared aspect
|
||||
return this.get_preferred_height(-1);
|
||||
}
|
||||
|
||||
// This can be overridden by a subclass, or by the createIcon
|
||||
// parameter to _init()
|
||||
createIcon(_size) {
|
||||
createIcon(size) {
|
||||
throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`);
|
||||
}
|
||||
|
||||
@@ -141,14 +137,6 @@ class BaseIcon extends St.Bin {
|
||||
// animating.
|
||||
zoomOutActor(this.child);
|
||||
}
|
||||
|
||||
animateZoomOutAtPos(x, y) {
|
||||
zoomOutActorAtPos(this.child, x, y);
|
||||
}
|
||||
|
||||
update() {
|
||||
this._createIconTexture(this.iconSize);
|
||||
}
|
||||
});
|
||||
|
||||
function clamp(value, min, max) {
|
||||
@@ -156,15 +144,10 @@ function clamp(value, min, max) {
|
||||
}
|
||||
|
||||
function zoomOutActor(actor) {
|
||||
let [x, y] = actor.get_transformed_position();
|
||||
zoomOutActorAtPos(actor, x, y);
|
||||
}
|
||||
|
||||
function zoomOutActorAtPos(actor, x, y) {
|
||||
let actorClone = new Clutter.Clone({ source: actor,
|
||||
reactive: false });
|
||||
let [width, height] = actor.get_transformed_size();
|
||||
|
||||
let [x, y] = actor.get_transformed_position();
|
||||
actorClone.set_size(width, height);
|
||||
actorClone.set_position(x, y);
|
||||
actorClone.opacity = 255;
|
||||
@@ -181,15 +164,17 @@ function zoomOutActorAtPos(actor, x, y) {
|
||||
let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth);
|
||||
let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight);
|
||||
|
||||
actorClone.ease({
|
||||
Tweener.addTween(actorClone,
|
||||
{ time: APPICON_ANIMATION_OUT_TIME,
|
||||
scale_x: APPICON_ANIMATION_OUT_SCALE,
|
||||
scale_y: APPICON_ANIMATION_OUT_SCALE,
|
||||
translation_x: containedX - scaledX,
|
||||
translation_y: containedY - scaledY,
|
||||
opacity: 0,
|
||||
duration: APPICON_ANIMATION_OUT_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => actorClone.destroy()
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
actorClone.destroy();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
@@ -221,8 +206,6 @@ var IconGrid = GObject.registerClass({
|
||||
this.rightPadding = 0;
|
||||
this.leftPadding = 0;
|
||||
|
||||
this._updateIconSizesLaterId = 0;
|
||||
|
||||
this._items = [];
|
||||
this._clonesAnimating = [];
|
||||
// Pulled from CSS, but hardcode some defaults here
|
||||
@@ -235,19 +218,11 @@ var IconGrid = GObject.registerClass({
|
||||
// swarming into the void ...
|
||||
this.connect('notify::mapped', () => {
|
||||
if (!this.mapped)
|
||||
this._resetAnimationActors();
|
||||
this._cancelAnimation();
|
||||
});
|
||||
|
||||
this.connect('actor-added', this._childAdded.bind(this));
|
||||
this.connect('actor-removed', this._childRemoved.bind(this));
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
if (this._updateIconSizesLaterId) {
|
||||
Meta.later_remove (this._updateIconSizesLaterId);
|
||||
this._updateIconSizesLaterId = 0;
|
||||
}
|
||||
}
|
||||
|
||||
_keyFocusIn(actor) {
|
||||
@@ -256,34 +231,21 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
_childAdded(grid, child) {
|
||||
child._iconGridKeyFocusInId = child.connect('key-focus-in', this._keyFocusIn.bind(this));
|
||||
|
||||
child._paintVisible = child.opacity > 0;
|
||||
child._opacityChangedId = child.connect('notify::opacity', () => {
|
||||
let paintVisible = child._paintVisible;
|
||||
child._paintVisible = child.opacity > 0;
|
||||
if (paintVisible !== child._paintVisible)
|
||||
this.queue_relayout();
|
||||
});
|
||||
}
|
||||
|
||||
_childRemoved(grid, child) {
|
||||
child.disconnect(child._iconGridKeyFocusInId);
|
||||
delete child._iconGridKeyFocusInId;
|
||||
|
||||
child.disconnect(child._opacityChangedId);
|
||||
delete child._opacityChangedId;
|
||||
delete child._paintVisible;
|
||||
}
|
||||
|
||||
vfunc_get_preferred_width(_forHeight) {
|
||||
vfunc_get_preferred_width(forHeight) {
|
||||
if (this._fillParent)
|
||||
// Ignore all size requests of children and request a size of 0;
|
||||
// later we'll allocate as many children as fit the parent
|
||||
return [0, 0];
|
||||
|
||||
let nChildren = this.get_n_children();
|
||||
let nColumns = this._colLimit
|
||||
? Math.min(this._colLimit, nChildren)
|
||||
let nColumns = this._colLimit ? Math.min(this._colLimit,
|
||||
nChildren)
|
||||
: nChildren;
|
||||
let totalSpacing = Math.max(0, nColumns - 1) * this._getSpacing();
|
||||
// Kind of a lie, but not really an issue right now. If
|
||||
@@ -436,20 +398,21 @@ var IconGrid = GObject.registerClass({
|
||||
* set of items to be animated.
|
||||
*/
|
||||
_getChildrenToAnimate() {
|
||||
return this._getVisibleChildren().filter(child => child.opacity > 0);
|
||||
return this._getVisibleChildren();
|
||||
}
|
||||
|
||||
_resetAnimationActors() {
|
||||
_cancelAnimation() {
|
||||
this._clonesAnimating.forEach(clone => clone.destroy());
|
||||
this._clonesAnimating = [];
|
||||
}
|
||||
|
||||
_animationDone() {
|
||||
this._clonesAnimating.forEach(clone => {
|
||||
clone.source.reactive = true;
|
||||
clone.source.opacity = 255;
|
||||
clone.destroy();
|
||||
});
|
||||
this._clonesAnimating = [];
|
||||
}
|
||||
|
||||
_animationDone() {
|
||||
this._resetAnimationActors();
|
||||
this.emit('animation-done');
|
||||
}
|
||||
|
||||
@@ -458,7 +421,7 @@ var IconGrid = GObject.registerClass({
|
||||
throw new GObject.NotImplementedError("Pulse animation only implements " +
|
||||
"'in' animation direction");
|
||||
|
||||
this._resetAnimationActors();
|
||||
this._cancelAnimation();
|
||||
|
||||
let actors = this._getChildrenToAnimate();
|
||||
if (actors.length == 0) {
|
||||
@@ -481,23 +444,21 @@ var IconGrid = GObject.registerClass({
|
||||
let delay = index / actors.length * maxDelay;
|
||||
let bounceUpTime = ANIMATION_TIME_IN / 4;
|
||||
let isLastItem = index == actors.length - 1;
|
||||
actor.ease({
|
||||
Tweener.addTween(actor,
|
||||
{ time: bounceUpTime,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
scale_x: ANIMATION_BOUNCE_ICON_SCALE,
|
||||
scale_y: ANIMATION_BOUNCE_ICON_SCALE,
|
||||
duration: bounceUpTime,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay: delay,
|
||||
onComplete: () => {
|
||||
let duration = ANIMATION_TIME_IN - bounceUpTime;
|
||||
actor.ease({
|
||||
Tweener.addTween(actor,
|
||||
{ time: ANIMATION_TIME_IN - bounceUpTime,
|
||||
transition: 'easeInOutQuad',
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
if (isLastItem)
|
||||
this._animationDone();
|
||||
actor.reactive = true;
|
||||
}
|
||||
});
|
||||
}
|
||||
@@ -506,7 +467,7 @@ var IconGrid = GObject.registerClass({
|
||||
}
|
||||
|
||||
animateSpring(animationDirection, sourceActor) {
|
||||
this._resetAnimationActors();
|
||||
this._cancelAnimation();
|
||||
|
||||
let actors = this._getChildrenToAnimate();
|
||||
if (actors.length == 0) {
|
||||
@@ -560,25 +521,21 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM;
|
||||
let [finalX, finalY] = actor._transformedPosition;
|
||||
movementParams = {
|
||||
movementParams = { time: ANIMATION_TIME_IN,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
x: finalX,
|
||||
y: finalY,
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration: ANIMATION_TIME_IN,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay
|
||||
};
|
||||
|
||||
onComplete: () => {
|
||||
if (isLastItem)
|
||||
movementParams.onComplete = this._animationDone.bind(this);
|
||||
|
||||
fadeParams = {
|
||||
opacity: 255,
|
||||
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay
|
||||
};
|
||||
this._animationDone();
|
||||
} };
|
||||
fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
opacity: 255 };
|
||||
} else {
|
||||
let isLastItem = actor._distance == maxDist;
|
||||
|
||||
@@ -586,29 +543,26 @@ var IconGrid = GObject.registerClass({
|
||||
actorClone.set_position(startX, startY);
|
||||
|
||||
let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM;
|
||||
movementParams = {
|
||||
movementParams = { time: ANIMATION_TIME_OUT,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
x: adjustedSourcePositionX,
|
||||
y: adjustedSourcePositionY,
|
||||
scale_x: scaleX,
|
||||
scale_y: scaleY,
|
||||
duration: ANIMATION_TIME_OUT,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay
|
||||
};
|
||||
|
||||
onComplete: () => {
|
||||
if (isLastItem)
|
||||
movementParams.onComplete = this._animationDone.bind(this);
|
||||
|
||||
fadeParams = {
|
||||
opacity: 0,
|
||||
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
|
||||
};
|
||||
this._animationDone();
|
||||
} };
|
||||
fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
opacity: 0 };
|
||||
}
|
||||
|
||||
actorClone.ease(movementParams);
|
||||
actorClone.ease(fadeParams);
|
||||
|
||||
Tweener.addTween(actorClone, movementParams);
|
||||
Tweener.addTween(actorClone, fadeParams);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -796,28 +750,24 @@ var IconGrid = GObject.registerClass({
|
||||
let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth;
|
||||
let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight;
|
||||
|
||||
let neededSpacePerItem = (neededWidth > neededHeight)
|
||||
? Math.ceil(neededWidth / this._minColumns)
|
||||
let neededSpacePerItem = (neededWidth > neededHeight) ? Math.ceil(neededWidth / this._minColumns)
|
||||
: Math.ceil(neededHeight / this._minRows);
|
||||
this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE);
|
||||
this._fixedVItemSize = Math.max(this._vItemSize - neededSpacePerItem, MIN_ICON_SIZE);
|
||||
|
||||
this._updateSpacingForSize(availWidth, availHeight);
|
||||
}
|
||||
if (!this._updateIconSizesLaterId)
|
||||
this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
|
||||
this._updateIconSizes.bind(this));
|
||||
}
|
||||
|
||||
// Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
|
||||
_updateIconSizes() {
|
||||
this._updateIconSizesLaterId = 0;
|
||||
let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
|
||||
let newIconSize = Math.floor(ICON_SIZE * scale);
|
||||
for (let i in this._items) {
|
||||
this._items[i].icon.setIconSize(newIconSize);
|
||||
}
|
||||
return GLib.SOURCE_REMOVE;
|
||||
}
|
||||
});
|
||||
|
||||
@@ -834,7 +784,7 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
this._childrenPerPage = 0;
|
||||
}
|
||||
|
||||
vfunc_get_preferred_height(_forWidth) {
|
||||
vfunc_get_preferred_height(forWidth) {
|
||||
let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages;
|
||||
return [height, height];
|
||||
}
|
||||
@@ -894,7 +844,7 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
|
||||
// Overridden from IconGrid
|
||||
_getChildrenToAnimate() {
|
||||
let children = super._getChildrenToAnimate();
|
||||
let children = this._getVisibleChildren();
|
||||
let firstIndex = this._childrenPerPage * this.currentPage;
|
||||
let lastIndex = firstIndex + this._childrenPerPage;
|
||||
|
||||
@@ -902,7 +852,7 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
}
|
||||
|
||||
_computePages(availWidthPerPage, availHeightPerPage) {
|
||||
let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage);
|
||||
let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage);
|
||||
let nRows;
|
||||
let children = this._getVisibleChildren();
|
||||
if (nColumns > 0)
|
||||
@@ -973,7 +923,8 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
let childrenPerRow = this._childrenPerPage / this._rowsPerPage;
|
||||
let sourceRow = Math.floor((index - pageOffset) / childrenPerRow);
|
||||
|
||||
let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1 : sourceRow;
|
||||
let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1
|
||||
: sourceRow;
|
||||
let nRowsBelow = this._rowsPerPage - nRowsAbove;
|
||||
|
||||
let nRowsUp, nRowsDown;
|
||||
@@ -1013,14 +964,13 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
|
||||
for (let i = 0; i < children.length; i++) {
|
||||
children[i].translation_y = 0;
|
||||
let params = {
|
||||
translation_y: translationY,
|
||||
duration: EXTRA_SPACE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD
|
||||
let params = { translation_y: translationY,
|
||||
time: EXTRA_SPACE_ANIMATION_TIME,
|
||||
transition: 'easeInOutQuad'
|
||||
};
|
||||
if (i == (children.length - 1))
|
||||
params.onComplete = () => this.emit('space-opened');
|
||||
children[i].ease(params);
|
||||
Tweener.addTween(children[i], params);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1033,10 +983,10 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
for (let i = 0; i < this._translatedChildren.length; i++) {
|
||||
if (!this._translatedChildren[i].translation_y)
|
||||
continue;
|
||||
this._translatedChildren[i].ease({
|
||||
translation_y: 0,
|
||||
duration: EXTRA_SPACE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
Tweener.addTween(this._translatedChildren[i],
|
||||
{ translation_y: 0,
|
||||
time: EXTRA_SPACE_ANIMATION_TIME,
|
||||
transition: 'easeInOutQuad',
|
||||
onComplete: () => this.emit('space-closed')
|
||||
});
|
||||
}
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported InhibitShortcutsDialog */
|
||||
const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi;
|
||||
|
||||
const Dialog = imports.ui.dialog;
|
||||
@@ -76,8 +75,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
|
||||
let name = this._app ? this._app.get_name() : this._window.title;
|
||||
|
||||
/* Translators: %s is an application name like "Settings" */
|
||||
let title = name
|
||||
? _("%s wants to inhibit shortcuts").format(name)
|
||||
let title = name ? _("%s wants to inhibit shortcuts").format(name)
|
||||
: _("Application wants to inhibit shortcuts");
|
||||
let icon = new Gio.ThemedIcon({ name: 'dialog-warning-symbolic' });
|
||||
|
||||
@@ -141,7 +139,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
|
||||
return;
|
||||
}
|
||||
|
||||
let [permissions] = res;
|
||||
let [permissions, data] = res;
|
||||
if (permissions[appId] === undefined) // Not found
|
||||
this._dialog.open();
|
||||
else if (permissions[appId] == GRANTED)
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported KbdA11yDialog */
|
||||
const { Clutter, Gio, GObject } = imports.gi;
|
||||
|
||||
const Dialog = imports.ui.dialog;
|
||||
@@ -27,23 +26,23 @@ class KbdA11yDialog extends GObject.Object {
|
||||
|
||||
if (whatChanged & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) {
|
||||
key = KEY_SLOW_KEYS_ENABLED;
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) > 0;
|
||||
title = enabled
|
||||
? _("Slow Keys Turned On")
|
||||
: _("Slow Keys Turned Off");
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) ? true : false;
|
||||
title = enabled ?
|
||||
_("Slow Keys Turned On") :
|
||||
_("Slow Keys Turned Off");
|
||||
body = _("You just held down the Shift key for 8 seconds. This is the shortcut " +
|
||||
"for the Slow Keys feature, which affects the way your keyboard works.");
|
||||
|
||||
} else if (whatChanged & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) {
|
||||
key = KEY_STICKY_KEYS_ENABLED;
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) > 0;
|
||||
title = enabled
|
||||
? _("Sticky Keys Turned On")
|
||||
: _("Sticky Keys Turned Off");
|
||||
body = enabled
|
||||
? _("You just pressed the Shift key 5 times in a row. This is the shortcut " +
|
||||
"for the Sticky Keys feature, which affects the way your keyboard works.")
|
||||
: _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) ? true : false;
|
||||
title = enabled ?
|
||||
_("Sticky Keys Turned On") :
|
||||
_("Sticky Keys Turned Off");
|
||||
body = enabled ?
|
||||
_("You just pressed the Shift key 5 times in a row. This is the shortcut " +
|
||||
"for the Sticky Keys feature, which affects the way your keyboard works.") :
|
||||
_("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
|
||||
"This turns off the Sticky Keys feature, which affects the way your keyboard works.");
|
||||
} else {
|
||||
return;
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Keyboard */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -11,10 +10,11 @@ const Layout = imports.ui.layout;
|
||||
const Main = imports.ui.main;
|
||||
const PageIndicators = imports.ui.pageIndicators;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2;
|
||||
var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2 * 1000;
|
||||
var KEY_LONG_PRESS_TIME = 250;
|
||||
var PANEL_SWITCH_ANIMATION_TIME = 500;
|
||||
var PANEL_SWITCH_ANIMATION_TIME = 0.5;
|
||||
var PANEL_SWITCH_RELATIVE_DISTANCE = 1 / 3; /* A third of the actor width */
|
||||
|
||||
const A11Y_APPLICATIONS_SCHEMA = 'org.gnome.desktop.a11y.applications';
|
||||
@@ -100,14 +100,13 @@ class KeyContainer extends St.Widget {
|
||||
this._rows = [];
|
||||
}
|
||||
|
||||
appendRow() {
|
||||
appendRow(length) {
|
||||
this._currentRow++;
|
||||
this._currentCol = 0;
|
||||
|
||||
let row = {
|
||||
keys: [],
|
||||
width: 0,
|
||||
};
|
||||
let row = new Object();
|
||||
row.keys = [];
|
||||
row.width = 0;
|
||||
this._rows.push(row);
|
||||
}
|
||||
|
||||
@@ -194,12 +193,12 @@ var LanguageSelectionPopup = class extends PopupMenu.PopupMenu {
|
||||
item = this.addAction(is.displayName, () => {
|
||||
inputSourceManager.activateInputSource(is, true);
|
||||
});
|
||||
item.can_focus = false;
|
||||
item.actor.can_focus = false;
|
||||
}
|
||||
|
||||
this.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
|
||||
item = this.addSettingsAction(_("Region & Language Settings"), 'gnome-region-panel.desktop');
|
||||
item.can_focus = false;
|
||||
item.actor.can_focus = false;
|
||||
|
||||
this._capturedEventId = 0;
|
||||
|
||||
@@ -466,23 +465,16 @@ Signals.addSignalMethods(Key.prototype);
|
||||
|
||||
var KeyboardModel = class {
|
||||
constructor(groupName) {
|
||||
let names = [groupName];
|
||||
if (groupName.includes('+'))
|
||||
names.push(groupName.replace(/\+.*/, ''));
|
||||
names.push('us');
|
||||
|
||||
for (let i = 0; i < names.length; i++) {
|
||||
try {
|
||||
this._model = this._loadModel(names[i]);
|
||||
break;
|
||||
this._model = this._loadModel(groupName);
|
||||
} catch (e) {
|
||||
}
|
||||
this._model = this._loadModel('us');
|
||||
}
|
||||
}
|
||||
|
||||
_loadModel(groupName) {
|
||||
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/%s.json'.format(groupName));
|
||||
let [success_, contents] = file.load_contents(null);
|
||||
let [success, contents] = file.load_contents(null);
|
||||
if (contents instanceof Uint8Array)
|
||||
contents = imports.byteArray.toString(contents);
|
||||
|
||||
@@ -577,27 +569,11 @@ var FocusTracker = class {
|
||||
};
|
||||
Signals.addSignalMethods(FocusTracker.prototype);
|
||||
|
||||
var EmojiPager = GObject.registerClass({
|
||||
Properties: {
|
||||
'delta': GObject.ParamSpec.int(
|
||||
'delta', 'delta', 'delta',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
GLib.MININT32, GLib.MAXINT32, 0)
|
||||
},
|
||||
Signals: {
|
||||
'emoji': { param_types: [GObject.TYPE_STRING] },
|
||||
'page-changed': {
|
||||
param_types: [GObject.TYPE_INT, GObject.TYPE_INT, GObject.TYPE_INT]
|
||||
}
|
||||
}
|
||||
}, class EmojiPager extends St.Widget {
|
||||
_init(sections, nCols, nRows) {
|
||||
super._init({
|
||||
layout_manager: new Clutter.BinLayout(),
|
||||
var EmojiPager = class EmojiPager {
|
||||
constructor(sections, nCols, nRows) {
|
||||
this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout(),
|
||||
reactive: true,
|
||||
clip_to_allocation: true
|
||||
});
|
||||
|
||||
clip_to_allocation: true });
|
||||
this._sections = sections;
|
||||
this._nCols = nCols;
|
||||
this._nRows = nRows;
|
||||
@@ -619,7 +595,7 @@ var EmojiPager = GObject.registerClass({
|
||||
panAction.connect('gesture-cancel', this._onPanCancel.bind(this));
|
||||
panAction.connect('gesture-end', this._onPanEnd.bind(this));
|
||||
this._panAction = panAction;
|
||||
this.add_action(panAction);
|
||||
this.actor.add_action(panAction);
|
||||
}
|
||||
|
||||
get delta() {
|
||||
@@ -632,11 +608,7 @@ var EmojiPager = GObject.registerClass({
|
||||
else if (value < -this._width)
|
||||
value = -this._width;
|
||||
|
||||
if (this._delta == value)
|
||||
return;
|
||||
|
||||
this._delta = value;
|
||||
this.notify('delta');
|
||||
|
||||
if (value == 0)
|
||||
return;
|
||||
@@ -653,8 +625,8 @@ var EmojiPager = GObject.registerClass({
|
||||
if (followingPage != null) {
|
||||
this._followingPanel = this._generatePanel(followingPage);
|
||||
this._followingPanel.set_pivot_point(0.5, 0.5);
|
||||
this.add_child(this._followingPanel);
|
||||
this.set_child_below_sibling(this._followingPanel, this._panel);
|
||||
this.actor.add_child(this._followingPanel);
|
||||
this.actor.set_child_below_sibling(this._followingPanel, this._panel);
|
||||
}
|
||||
|
||||
this._followingPage = followingPage;
|
||||
@@ -690,7 +662,7 @@ var EmojiPager = GObject.registerClass({
|
||||
}
|
||||
|
||||
_onPan(action) {
|
||||
let [dist_, dx, dy_] = action.get_motion_delta(0);
|
||||
let [dist, dx, dy] = action.get_motion_delta(0);
|
||||
this.delta = this.delta + dx;
|
||||
|
||||
if (this._currentKey != null) {
|
||||
@@ -702,12 +674,12 @@ var EmojiPager = GObject.registerClass({
|
||||
}
|
||||
|
||||
_onPanBegin() {
|
||||
this._width = this.width;
|
||||
this._width = this.actor.width;
|
||||
return true;
|
||||
}
|
||||
|
||||
_onPanEnd() {
|
||||
if (Math.abs(this._delta) < this.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
|
||||
if (Math.abs(this._delta) < this.actor.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
|
||||
this._onPanCancel();
|
||||
} else {
|
||||
let value;
|
||||
@@ -719,10 +691,12 @@ var EmojiPager = GObject.registerClass({
|
||||
let relDelta = Math.abs(this._delta - value) / this._width;
|
||||
let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);
|
||||
|
||||
this.remove_all_transitions();
|
||||
this.ease_property('delta', value, {
|
||||
duration: time,
|
||||
onComplete: () => {
|
||||
Tweener.removeTweens(this);
|
||||
Tweener.addTween(this,
|
||||
{ delta: value,
|
||||
time: time,
|
||||
transition: 'easeInOutQuad',
|
||||
onComplete() {
|
||||
this.setCurrentPage(this.getFollowingPage());
|
||||
}
|
||||
});
|
||||
@@ -730,12 +704,14 @@ var EmojiPager = GObject.registerClass({
|
||||
}
|
||||
|
||||
_onPanCancel() {
|
||||
let relDelta = Math.abs(this._delta) / this.width;
|
||||
let relDelta = Math.abs(this._delta) / this.actor.width;
|
||||
let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);
|
||||
|
||||
this.remove_all_transitions();
|
||||
this.ease_property('delta', 0, {
|
||||
duration: time,
|
||||
Tweener.removeTweens(this);
|
||||
Tweener.addTween(this,
|
||||
{ delta: 0,
|
||||
time: time,
|
||||
transition: 'easeInOutQuad',
|
||||
});
|
||||
}
|
||||
|
||||
@@ -846,7 +822,7 @@ var EmojiPager = GObject.registerClass({
|
||||
|
||||
if (!this._panel) {
|
||||
this._panel = this._generatePanel(nPage);
|
||||
this.add_child(this._panel);
|
||||
this.actor.add_child(this._panel);
|
||||
}
|
||||
|
||||
let page = this._pages[nPage];
|
||||
@@ -863,7 +839,8 @@ var EmojiPager = GObject.registerClass({
|
||||
}
|
||||
}
|
||||
}
|
||||
});
|
||||
};
|
||||
Signals.addSignalMethods(EmojiPager.prototype);
|
||||
|
||||
var EmojiSelection = class EmojiSelection {
|
||||
constructor() {
|
||||
@@ -894,7 +871,7 @@ var EmojiSelection = class EmojiSelection {
|
||||
this._emojiPager.connect('emoji', (pager, str) => {
|
||||
this.emit('emoji-selected', str);
|
||||
});
|
||||
this.actor.add(this._emojiPager, { expand: true });
|
||||
this.actor.add(this._emojiPager.actor, { expand: true });
|
||||
|
||||
this._pageIndicator = new PageIndicators.PageIndicators(false);
|
||||
this.actor.add(this._pageIndicator, { expand: true, x_fill: false, y_fill: false });
|
||||
@@ -927,7 +904,7 @@ var EmojiSelection = class EmojiSelection {
|
||||
|
||||
_populateSections() {
|
||||
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/emoji.json');
|
||||
let [success_, contents] = file.load_contents(null);
|
||||
let [success, contents] = file.load_contents(null);
|
||||
|
||||
if (contents instanceof Uint8Array)
|
||||
contents = imports.byteArray.toString(contents);
|
||||
@@ -1194,7 +1171,7 @@ var Keyboard = class Keyboard {
|
||||
|
||||
this._emojiSelection = new EmojiSelection();
|
||||
this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this));
|
||||
this._emojiSelection.connect('hide', () => this.hide());
|
||||
this._emojiSelection.connect('hide', (selection) => this.hide());
|
||||
this._emojiSelection.connect('emoji-selected', (selection, emoji) => {
|
||||
this._keyboardController.commitString(emoji);
|
||||
});
|
||||
@@ -1305,7 +1282,7 @@ var Keyboard = class Keyboard {
|
||||
}
|
||||
}
|
||||
});
|
||||
button.connect('released', (actor, keyval, _str) => {
|
||||
button.connect('released', (actor, keyval, str) => {
|
||||
if (keyval != 0) {
|
||||
if (button._keyvalPress)
|
||||
this._keyboardController.keyvalRelease(keyval);
|
||||
@@ -1490,7 +1467,7 @@ var Keyboard = class Keyboard {
|
||||
this._setActiveLayer(0);
|
||||
}
|
||||
|
||||
_onKeyboardGroupsChanged() {
|
||||
_onKeyboardGroupsChanged(keyboard) {
|
||||
let nonGroupActors = [this._emojiSelection.actor, this._keypad.actor];
|
||||
this._aspectContainer.get_children().filter(c => !nonGroupActors.includes(c)).forEach(c => {
|
||||
c.destroy();
|
||||
@@ -1676,23 +1653,19 @@ var Keyboard = class Keyboard {
|
||||
return;
|
||||
|
||||
if (show) {
|
||||
windowActor.ease({
|
||||
y: windowActor.y - deltaY,
|
||||
duration: Layout.KEYBOARD_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._windowSlideAnimationComplete(window, -deltaY);
|
||||
}
|
||||
});
|
||||
Tweener.addTween(windowActor,
|
||||
{ y: windowActor.y - deltaY,
|
||||
time: Layout.KEYBOARD_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._windowSlideAnimationComplete,
|
||||
onCompleteParams: [window, -deltaY] });
|
||||
} else {
|
||||
windowActor.ease({
|
||||
y: windowActor.y + deltaY,
|
||||
duration: Layout.KEYBOARD_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_IN_QUAD,
|
||||
onComplete: () => {
|
||||
this._windowSlideAnimationComplete(window, deltaY);
|
||||
}
|
||||
});
|
||||
Tweener.addTween(windowActor,
|
||||
{ y: windowActor.y + deltaY,
|
||||
time: Layout.KEYBOARD_ANIMATION_TIME,
|
||||
transition: 'easeInQuad',
|
||||
onComplete: this._windowSlideAnimationComplete,
|
||||
onCompleteParams: [window, deltaY] });
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1756,7 +1729,7 @@ var KeyboardController = class {
|
||||
this.emit('groups-changed');
|
||||
}
|
||||
|
||||
_onSourceChanged(inputSourceManager, _oldSource) {
|
||||
_onSourceChanged(inputSourceManager, oldSource) {
|
||||
let source = inputSourceManager.currentSource;
|
||||
this._currentSource = source;
|
||||
this.emit('active-group', source.id);
|
||||
|
||||
108
js/ui/layout.js
108
js/ui/layout.js
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported MonitorConstraint, LayoutManager */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -11,11 +10,12 @@ const LoginManager = imports.misc.loginManager;
|
||||
const DND = imports.ui.dnd;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Ripples = imports.ui.ripples;
|
||||
|
||||
var STARTUP_ANIMATION_TIME = 500;
|
||||
var KEYBOARD_ANIMATION_TIME = 150;
|
||||
var BACKGROUND_FADE_ANIMATION_TIME = 1000;
|
||||
var STARTUP_ANIMATION_TIME = 0.5;
|
||||
var KEYBOARD_ANIMATION_TIME = 0.15;
|
||||
var BACKGROUND_FADE_ANIMATION_TIME = 1.0;
|
||||
|
||||
var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels
|
||||
var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms
|
||||
@@ -80,12 +80,10 @@ var MonitorConstraint = GObject.registerClass({
|
||||
this.notify('index');
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get work_area() {
|
||||
return this._workArea;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set work_area(v) {
|
||||
if (v == this._workArea)
|
||||
return;
|
||||
@@ -167,12 +165,12 @@ var Monitor = class Monitor {
|
||||
|
||||
const UiActor = GObject.registerClass(
|
||||
class UiActor extends St.Widget {
|
||||
vfunc_get_preferred_width (_forHeight) {
|
||||
vfunc_get_preferred_width (forHeight) {
|
||||
let width = global.stage.width;
|
||||
return [width, width];
|
||||
}
|
||||
|
||||
vfunc_get_preferred_height (_forWidth) {
|
||||
vfunc_get_preferred_height (forWidth) {
|
||||
let height = global.stage.height;
|
||||
return [height, height];
|
||||
}
|
||||
@@ -189,7 +187,6 @@ var LayoutManager = GObject.registerClass({
|
||||
'startup-complete': {},
|
||||
'startup-prepared': {},
|
||||
'monitors-changed': {},
|
||||
'system-modal-opened': {},
|
||||
'keyboard-visible-changed': { param_types: [GObject.TYPE_BOOLEAN] } },
|
||||
}, class LayoutManager extends GObject.Object {
|
||||
_init() {
|
||||
@@ -239,8 +236,7 @@ var LayoutManager = GObject.registerClass({
|
||||
reactive: true });
|
||||
this.addChrome(this.overviewGroup);
|
||||
|
||||
this.screenShieldGroup = new St.Widget({
|
||||
name: 'screenShieldGroup',
|
||||
this.screenShieldGroup = new St.Widget({ name: 'screenShieldGroup',
|
||||
visible: false,
|
||||
clip_to_allocation: true,
|
||||
layout_manager: new Clutter.BinLayout(),
|
||||
@@ -465,11 +461,10 @@ var LayoutManager = GObject.registerClass({
|
||||
let backgroundActor = this._bgManagers[i].backgroundActor;
|
||||
backgroundActor.show();
|
||||
backgroundActor.opacity = 0;
|
||||
backgroundActor.ease({
|
||||
opacity: 255,
|
||||
duration: BACKGROUND_FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
Tweener.addTween(backgroundActor,
|
||||
{ opacity: 255,
|
||||
time: BACKGROUND_FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -700,23 +695,23 @@ var LayoutManager = GObject.registerClass({
|
||||
}
|
||||
|
||||
_startupAnimationGreeter() {
|
||||
this.panelBox.ease({
|
||||
translation_y: 0,
|
||||
duration: STARTUP_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this._startupAnimationComplete()
|
||||
});
|
||||
Tweener.addTween(this.panelBox,
|
||||
{ translation_y: 0,
|
||||
time: STARTUP_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._startupAnimationComplete,
|
||||
onCompleteScope: this });
|
||||
}
|
||||
|
||||
_startupAnimationSession() {
|
||||
this.uiGroup.ease({
|
||||
scale_x: 1,
|
||||
Tweener.addTween(this.uiGroup,
|
||||
{ scale_x: 1,
|
||||
scale_y: 1,
|
||||
opacity: 255,
|
||||
duration: STARTUP_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this._startupAnimationComplete()
|
||||
});
|
||||
time: STARTUP_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._startupAnimationComplete,
|
||||
onCompleteScope: this });
|
||||
}
|
||||
|
||||
_startupAnimationComplete() {
|
||||
@@ -742,14 +737,13 @@ var LayoutManager = GObject.registerClass({
|
||||
|
||||
showKeyboard() {
|
||||
this.keyboardBox.show();
|
||||
this.keyboardBox.ease({
|
||||
anchor_y: this.keyboardBox.height,
|
||||
Tweener.addTween(this.keyboardBox,
|
||||
{ anchor_y: this.keyboardBox.height,
|
||||
opacity: 255,
|
||||
duration: KEYBOARD_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._showKeyboardComplete();
|
||||
}
|
||||
time: KEYBOARD_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._showKeyboardComplete,
|
||||
onCompleteScope: this
|
||||
});
|
||||
this.emit('keyboard-visible-changed', true);
|
||||
}
|
||||
@@ -769,14 +763,13 @@ var LayoutManager = GObject.registerClass({
|
||||
this.keyboardBox.disconnect(this._keyboardHeightNotifyId);
|
||||
this._keyboardHeightNotifyId = 0;
|
||||
}
|
||||
this.keyboardBox.ease({
|
||||
anchor_y: 0,
|
||||
Tweener.addTween(this.keyboardBox,
|
||||
{ anchor_y: 0,
|
||||
opacity: 0,
|
||||
duration: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_IN_QUAD,
|
||||
onComplete: () => {
|
||||
this._hideKeyboardComplete();
|
||||
}
|
||||
time: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
|
||||
transition: 'easeInQuad',
|
||||
onComplete: this._hideKeyboardComplete,
|
||||
onCompleteScope: this
|
||||
});
|
||||
|
||||
this.emit('keyboard-visible-changed', false);
|
||||
@@ -856,13 +849,12 @@ var LayoutManager = GObject.registerClass({
|
||||
index = this._findActor(ancestor);
|
||||
}
|
||||
|
||||
let ancestorData = ancestor
|
||||
? this._trackedActors[index]
|
||||
let ancestorData = ancestor ? this._trackedActors[index]
|
||||
: defaultParams;
|
||||
// We can't use Params.parse here because we want to drop
|
||||
// the extra values like ancestorData.actor
|
||||
for (let prop in defaultParams) {
|
||||
if (!Object.prototype.hasOwnProperty.call(params, prop))
|
||||
if (!params.hasOwnProperty(prop))
|
||||
params[prop] = ancestorData[prop];
|
||||
}
|
||||
|
||||
@@ -1016,6 +1008,11 @@ var LayoutManager = GObject.registerClass({
|
||||
if (Main.modalCount > 0)
|
||||
return GLib.SOURCE_REMOVE;
|
||||
|
||||
// Bug workaround - get_transformed_position()/get_transformed_size() don't work after
|
||||
// a change in stage size until the first pick or paint.
|
||||
// https://bugzilla.gnome.org/show_bug.cgi?id=761565
|
||||
global.stage.get_actor_at_pos(Clutter.PickMode.ALL, 0, 0);
|
||||
|
||||
let rects = [], struts = [], i;
|
||||
let isPopupMenuVisible = global.top_window_group.get_children().some(isPopupMetaWindow);
|
||||
let wantsInputRegion = !isPopupMenuVisible;
|
||||
@@ -1071,17 +1068,16 @@ var LayoutManager = GObject.registerClass({
|
||||
side = Meta.Side.RIGHT;
|
||||
else
|
||||
continue;
|
||||
} else if (x1 <= monitor.x) {
|
||||
} else if (x1 <= monitor.x)
|
||||
side = Meta.Side.LEFT;
|
||||
} else if (y1 <= monitor.y) {
|
||||
else if (y1 <= monitor.y)
|
||||
side = Meta.Side.TOP;
|
||||
} else if (x2 >= monitor.x + monitor.width) {
|
||||
else if (x2 >= monitor.x + monitor.width)
|
||||
side = Meta.Side.RIGHT;
|
||||
} else if (y2 >= monitor.y + monitor.height) {
|
||||
else if (y2 >= monitor.y + monitor.height)
|
||||
side = Meta.Side.BOTTOM;
|
||||
} else {
|
||||
else
|
||||
continue;
|
||||
}
|
||||
|
||||
let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 });
|
||||
let strut = new Meta.Strut({ rect: strutRect, side: side });
|
||||
@@ -1222,8 +1218,6 @@ var HotCorner = class HotCorner {
|
||||
|
||||
if (this.actor)
|
||||
this.actor.destroy();
|
||||
|
||||
this._ripples.destroy();
|
||||
}
|
||||
|
||||
_toggleOverview() {
|
||||
@@ -1236,7 +1230,7 @@ var HotCorner = class HotCorner {
|
||||
}
|
||||
}
|
||||
|
||||
handleDragOver(source, _actor, _x, _y, _time) {
|
||||
handleDragOver(source, actor, x, y, time) {
|
||||
if (source != Main.xdndHandler)
|
||||
return DND.DragMotionResult.CONTINUE;
|
||||
|
||||
@@ -1337,7 +1331,7 @@ var PressureBarrier = class PressureBarrier {
|
||||
let threshold = this._lastTime - this._timeout;
|
||||
|
||||
while (i < this._barrierEvents.length) {
|
||||
let [time, distance_] = this._barrierEvents[i];
|
||||
let [time, distance] = this._barrierEvents[i];
|
||||
if (time >= threshold)
|
||||
break;
|
||||
i++;
|
||||
@@ -1346,14 +1340,14 @@ var PressureBarrier = class PressureBarrier {
|
||||
let firstNewEvent = i;
|
||||
|
||||
for (i = 0; i < firstNewEvent; i++) {
|
||||
let [time_, distance] = this._barrierEvents[i];
|
||||
let [time, distance] = this._barrierEvents[i];
|
||||
this._currentPressure -= distance;
|
||||
}
|
||||
|
||||
this._barrierEvents = this._barrierEvents.slice(firstNewEvent);
|
||||
}
|
||||
|
||||
_onBarrierLeft(barrier, _event) {
|
||||
_onBarrierLeft(barrier, event) {
|
||||
barrier._isHit = false;
|
||||
if (this._barriers.every(b => !b._isHit)) {
|
||||
this._reset();
|
||||
|
||||
@@ -1,10 +1,10 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Lightbox */
|
||||
|
||||
const { Clutter, GObject, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var DEFAULT_FADE_FACTOR = 0.4;
|
||||
var VIGNETTE_BRIGHTNESS = 0.2;
|
||||
@@ -23,31 +23,16 @@ t = clamp(t, 0.0, 1.0);\n\
|
||||
float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\
|
||||
cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);';
|
||||
|
||||
var RadialShaderEffect = GObject.registerClass({
|
||||
Properties: {
|
||||
'brightness': GObject.ParamSpec.float(
|
||||
'brightness', 'brightness', 'brightness',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
0, 1, 1
|
||||
),
|
||||
'sharpness': GObject.ParamSpec.float(
|
||||
'sharpness', 'sharpness', 'sharpness',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
0, 1, 0
|
||||
)
|
||||
}
|
||||
}, class RadialShaderEffect extends Shell.GLSLEffect {
|
||||
var RadialShaderQuad = GObject.registerClass(
|
||||
class RadialShaderQuad extends Shell.GLSLQuad {
|
||||
_init(params) {
|
||||
this._brightness = undefined;
|
||||
this._sharpness = undefined;
|
||||
|
||||
super._init(params);
|
||||
|
||||
this._brightnessLocation = this.get_uniform_location('brightness');
|
||||
this._sharpnessLocation = this.get_uniform_location('vignette_sharpness');
|
||||
|
||||
this.brightness = 1.0;
|
||||
this.sharpness = 0.0;
|
||||
this.vignetteSharpness = 0.0;
|
||||
}
|
||||
|
||||
vfunc_build_pipeline() {
|
||||
@@ -60,25 +45,19 @@ var RadialShaderEffect = GObject.registerClass({
|
||||
}
|
||||
|
||||
set brightness(v) {
|
||||
if (this._brightness == v)
|
||||
return;
|
||||
this._brightness = v;
|
||||
this.set_uniform_float(this._brightnessLocation,
|
||||
1, [this._brightness]);
|
||||
this.notify('brightness');
|
||||
}
|
||||
|
||||
get sharpness() {
|
||||
get vignetteSharpness() {
|
||||
return this._sharpness;
|
||||
}
|
||||
|
||||
set sharpness(v) {
|
||||
if (this._sharpness == v)
|
||||
return;
|
||||
set vignetteSharpness(v) {
|
||||
this._sharpness = v;
|
||||
this.set_uniform_float(this._sharpnessLocation,
|
||||
1, [this._sharpness]);
|
||||
this.notify('sharpness');
|
||||
}
|
||||
});
|
||||
|
||||
@@ -89,8 +68,8 @@ var RadialShaderEffect = GObject.registerClass({
|
||||
* - inhibitEvents: whether to inhibit events for @container
|
||||
* - width: shade actor width
|
||||
* - height: shade actor height
|
||||
* - fadeInTime: milliseconds used to fade in
|
||||
* - fadeOutTime: milliseconds used to fade out
|
||||
* - fadeInTime: seconds used to fade in
|
||||
* - fadeOutTime: seconds used to fade out
|
||||
*
|
||||
* Lightbox creates a dark translucent "shade" actor to hide the
|
||||
* contents of @container, and allows you to specify particular actors
|
||||
@@ -108,8 +87,7 @@ var RadialShaderEffect = GObject.registerClass({
|
||||
*/
|
||||
var Lightbox = class Lightbox {
|
||||
constructor(container, params) {
|
||||
params = Params.parse(params, {
|
||||
inhibitEvents: false,
|
||||
params = Params.parse(params, { inhibitEvents: false,
|
||||
width: null,
|
||||
height: null,
|
||||
fadeFactor: DEFAULT_FADE_FACTOR,
|
||||
@@ -120,13 +98,16 @@ var Lightbox = class Lightbox {
|
||||
this._children = container.get_children();
|
||||
this._fadeFactor = params.fadeFactor;
|
||||
this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
|
||||
|
||||
this.actor = new St.Bin({ reactive: params.inhibitEvents });
|
||||
|
||||
if (this._radialEffect)
|
||||
this.actor.add_effect(new RadialShaderEffect({ name: 'radial' }));
|
||||
this.actor = new RadialShaderQuad({ x: 0,
|
||||
y: 0,
|
||||
reactive: params.inhibitEvents });
|
||||
else
|
||||
this.actor.set({ opacity: 0, style_class: 'lightbox' });
|
||||
this.actor = new St.Bin({ x: 0,
|
||||
y: 0,
|
||||
opacity: 0,
|
||||
style_class: 'lightbox',
|
||||
reactive: params.inhibitEvents });
|
||||
|
||||
container.add_actor(this.actor);
|
||||
this.actor.raise_top();
|
||||
@@ -173,52 +154,60 @@ var Lightbox = class Lightbox {
|
||||
}
|
||||
|
||||
show(fadeInTime) {
|
||||
this.actor.remove_all_transitions();
|
||||
fadeInTime = fadeInTime || 0;
|
||||
|
||||
let easeProps = {
|
||||
duration: fadeInTime || 0,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
};
|
||||
|
||||
let onComplete = () => {
|
||||
Tweener.removeTweens(this.actor);
|
||||
if (this._radialEffect) {
|
||||
Tweener.addTween(this.actor,
|
||||
{ brightness: VIGNETTE_BRIGHTNESS,
|
||||
vignetteSharpness: VIGNETTE_SHARPNESS,
|
||||
time: fadeInTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.shown = true;
|
||||
this.emit('shown');
|
||||
};
|
||||
}
|
||||
});
|
||||
} else {
|
||||
Tweener.addTween(this.actor,
|
||||
{ opacity: 255 * this._fadeFactor,
|
||||
time: fadeInTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.shown = true;
|
||||
this.emit('shown');
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
this.actor.show();
|
||||
|
||||
if (this._radialEffect) {
|
||||
this.actor.ease_property(
|
||||
'@effects.radial.brightness', VIGNETTE_BRIGHTNESS, easeProps);
|
||||
this.actor.ease_property(
|
||||
'@effects.radial.sharpness', VIGNETTE_SHARPNESS,
|
||||
Object.assign({ onComplete }, easeProps));
|
||||
} else {
|
||||
this.actor.ease(Object.assign(easeProps, {
|
||||
opacity: 255 * this._fadeFactor,
|
||||
onComplete
|
||||
}));
|
||||
}
|
||||
}
|
||||
|
||||
hide(fadeOutTime) {
|
||||
fadeOutTime = fadeOutTime || 0;
|
||||
|
||||
this.shown = false;
|
||||
this.actor.remove_all_transitions();
|
||||
|
||||
let easeProps = {
|
||||
duration: fadeOutTime || 0,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
};
|
||||
|
||||
let onComplete = () => this.actor.hide();
|
||||
|
||||
Tweener.removeTweens(this.actor);
|
||||
if (this._radialEffect) {
|
||||
this.actor.ease_property(
|
||||
'@effects.radial.brightness', 1.0, easeProps);
|
||||
this.actor.ease_property(
|
||||
'@effects.radial.sharpness', 0.0, Object.assign({ onComplete }, easeProps));
|
||||
Tweener.addTween(this.actor,
|
||||
{ brightness: 1.0,
|
||||
vignetteSharpness: 0.0,
|
||||
opacity: 0,
|
||||
time: fadeOutTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.actor.hide();
|
||||
}
|
||||
});
|
||||
} else {
|
||||
this.actor.ease(Object.assign(easeProps, { opacity: 0, onComplete }));
|
||||
Tweener.addTween(this.actor,
|
||||
{ opacity: 0,
|
||||
time: fadeOutTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.actor.hide();
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported LocatePointer */
|
||||
|
||||
const { Gio } = imports.gi;
|
||||
const Ripples = imports.ui.ripples;
|
||||
@@ -11,29 +10,15 @@ const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface";
|
||||
var LocatePointer = class {
|
||||
constructor() {
|
||||
this._settings = new Gio.Settings({ schema_id: LOCATE_POINTER_SCHEMA });
|
||||
this._settings.connect(`changed::${LOCATE_POINTER_KEY}`, () => this._syncEnabled());
|
||||
this._syncEnabled();
|
||||
}
|
||||
|
||||
_syncEnabled() {
|
||||
let enabled = this._settings.get_boolean(LOCATE_POINTER_KEY);
|
||||
if (enabled == !!this._ripples)
|
||||
return;
|
||||
|
||||
if (enabled) {
|
||||
this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
|
||||
this._ripples.addTo(Main.uiGroup);
|
||||
} else {
|
||||
this._ripples.destroy();
|
||||
this._ripples = null;
|
||||
}
|
||||
}
|
||||
|
||||
show() {
|
||||
if (!this._ripples)
|
||||
if (!this._settings.get_boolean(LOCATE_POINTER_KEY))
|
||||
return;
|
||||
|
||||
let [x, y] = global.get_pointer();
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
this._ripples.playAnimation(x, y);
|
||||
}
|
||||
};
|
||||
|
||||
@@ -1,24 +1,26 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported LookingGlass */
|
||||
|
||||
const { Clutter, Cogl, Gio, GLib,
|
||||
GObject, Meta, Pango, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
const System = imports.system;
|
||||
|
||||
const History = imports.misc.history;
|
||||
const ExtensionSystem = imports.ui.extensionSystem;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const ShellEntry = imports.ui.shellEntry;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Main = imports.ui.main;
|
||||
const JsParse = imports.misc.jsParse;
|
||||
|
||||
const { ExtensionState } = ExtensionUtils;
|
||||
|
||||
const CHEVRON = '>>> ';
|
||||
|
||||
/* Imports...feel free to add here as needed */
|
||||
var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
|
||||
'const Main = imports.ui.main; ' +
|
||||
'const Mainloop = imports.mainloop; ' +
|
||||
'const Tweener = imports.ui.tweener; ' +
|
||||
/* Utility functions...we should probably be able to use these
|
||||
* in the shell core code too. */
|
||||
'const stage = global.stage; ' +
|
||||
@@ -30,11 +32,9 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im
|
||||
const HISTORY_KEY = 'looking-glass-history';
|
||||
// Time between tabs for them to count as a double-tab event
|
||||
var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500;
|
||||
var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200;
|
||||
var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2;
|
||||
var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords();
|
||||
|
||||
const LG_ANIMATION_TIME = 500;
|
||||
|
||||
function _getAutoCompleteGlobalKeywords() {
|
||||
const keywords = ['true', 'false', 'null', 'new'];
|
||||
// Don't add the private properties of window (i.e., ones starting with '_')
|
||||
@@ -238,7 +238,7 @@ var Notebook = class Notebook {
|
||||
Signals.addSignalMethods(Notebook.prototype);
|
||||
|
||||
function objectToString(o) {
|
||||
if (typeof o == typeof objectToString) {
|
||||
if (typeof(o) == typeof(objectToString)) {
|
||||
// special case this since the default is way, way too verbose
|
||||
return '<js function>';
|
||||
} else {
|
||||
@@ -266,7 +266,7 @@ var ObjLink = class ObjLink {
|
||||
this._lookingGlass = lookingGlass;
|
||||
}
|
||||
|
||||
_onClicked() {
|
||||
_onClicked(link) {
|
||||
this._lookingGlass.inspectObject(this._obj, this.actor);
|
||||
}
|
||||
};
|
||||
@@ -304,9 +304,6 @@ var WindowList = class WindowList {
|
||||
}
|
||||
|
||||
_updateWindowList() {
|
||||
if (!this._lookingGlass.isOpen)
|
||||
return;
|
||||
|
||||
this.actor.destroy_all_children();
|
||||
let windows = global.get_window_actors();
|
||||
let tracker = Shell.WindowTracker.get_default();
|
||||
@@ -338,10 +335,6 @@ var WindowList = class WindowList {
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
update() {
|
||||
this._updateWindowList();
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(WindowList.prototype);
|
||||
|
||||
@@ -374,7 +367,7 @@ var ObjInspector = class ObjInspector {
|
||||
|
||||
let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' });
|
||||
this._container.add_actor(hbox);
|
||||
let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof obj,
|
||||
let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof(obj),
|
||||
objectToString(obj)) });
|
||||
label.single_line_mode = true;
|
||||
hbox.add(label, { expand: true, y_fill: false });
|
||||
@@ -392,7 +385,7 @@ var ObjInspector = class ObjInspector {
|
||||
button.add_actor(new St.Icon({ icon_name: 'window-close-symbolic' }));
|
||||
button.connect('clicked', this.close.bind(this));
|
||||
hbox.add(button);
|
||||
if (typeof obj == typeof {}) {
|
||||
if (typeof(obj) == typeof({})) {
|
||||
let properties = [];
|
||||
for (let propName in obj) {
|
||||
properties.push(propName);
|
||||
@@ -424,12 +417,9 @@ var ObjInspector = class ObjInspector {
|
||||
this.actor.show();
|
||||
if (sourceActor) {
|
||||
this.actor.set_scale(0, 0);
|
||||
this.actor.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: 200
|
||||
});
|
||||
Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1,
|
||||
transition: 'easeOutQuad',
|
||||
time: 0.2 });
|
||||
} else {
|
||||
this.actor.set_scale(1, 1);
|
||||
}
|
||||
@@ -528,7 +518,7 @@ var Inspector = GObject.registerClass({
|
||||
|
||||
let primary = Main.layoutManager.primaryMonitor;
|
||||
|
||||
let [, , natWidth, natHeight] =
|
||||
let [minWidth, minHeight, natWidth, natHeight] =
|
||||
this._eventHandler.get_preferred_size();
|
||||
|
||||
let childBox = new Clutter.ActorBox();
|
||||
@@ -633,16 +623,15 @@ var Extensions = class Extensions {
|
||||
this._extensionsList.add(this._noExtensions);
|
||||
this.actor.add(this._extensionsList);
|
||||
|
||||
Main.extensionManager.getUuids().forEach(uuid => {
|
||||
for (let uuid in ExtensionUtils.extensions)
|
||||
this._loadExtension(null, uuid);
|
||||
});
|
||||
|
||||
Main.extensionManager.connect('extension-loaded',
|
||||
ExtensionSystem.connect('extension-loaded',
|
||||
this._loadExtension.bind(this));
|
||||
}
|
||||
|
||||
_loadExtension(o, uuid) {
|
||||
let extension = Main.extensionManager.lookup(uuid);
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
// There can be cases where we create dummy extension metadata
|
||||
// that's not really a proper extension. Don't bother with these.
|
||||
if (!extension.metadata.name)
|
||||
@@ -699,16 +688,16 @@ var Extensions = class Extensions {
|
||||
|
||||
_stateToString(extensionState) {
|
||||
switch (extensionState) {
|
||||
case ExtensionState.ENABLED:
|
||||
case ExtensionSystem.ExtensionState.ENABLED:
|
||||
return _("Enabled");
|
||||
case ExtensionState.DISABLED:
|
||||
case ExtensionState.INITIALIZED:
|
||||
case ExtensionSystem.ExtensionState.DISABLED:
|
||||
case ExtensionSystem.ExtensionState.INITIALIZED:
|
||||
return _("Disabled");
|
||||
case ExtensionState.ERROR:
|
||||
case ExtensionSystem.ExtensionState.ERROR:
|
||||
return _("Error");
|
||||
case ExtensionState.OUT_OF_DATE:
|
||||
case ExtensionSystem.ExtensionState.OUT_OF_DATE:
|
||||
return _("Out of date");
|
||||
case ExtensionState.DOWNLOADING:
|
||||
case ExtensionSystem.ExtensionState.DOWNLOADING:
|
||||
return _("Downloading");
|
||||
}
|
||||
return 'Unknown'; // Not translated, shouldn't appear
|
||||
@@ -826,7 +815,7 @@ var LookingGlass = class LookingGlass {
|
||||
gcIcon.connect('button-press-event', () => {
|
||||
gcIcon.icon_name = 'user-trash';
|
||||
System.gc();
|
||||
this._timeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, () => {
|
||||
this._timeoutId = Mainloop.timeout_add(500, () => {
|
||||
gcIcon.icon_name = 'user-trash-full';
|
||||
this._timeoutId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
@@ -865,7 +854,7 @@ var LookingGlass = class LookingGlass {
|
||||
this._extensions = new Extensions(this);
|
||||
notebook.appendPage('Extensions', this._extensions.actor);
|
||||
|
||||
this._entry.clutter_text.connect('activate', (o, _e) => {
|
||||
this._entry.clutter_text.connect('activate', (o, e) => {
|
||||
// Hide any completions we are currently showing
|
||||
this._hideCompletions();
|
||||
|
||||
@@ -949,37 +938,31 @@ var LookingGlass = class LookingGlass {
|
||||
this._completionActor.set_text(completions.join(', '));
|
||||
|
||||
// Setting the height to -1 allows us to get its actual preferred height rather than
|
||||
// whatever was last set when animating
|
||||
// whatever was last given in set_height by Tweener.
|
||||
this._completionActor.set_height(-1);
|
||||
let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
|
||||
let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
|
||||
|
||||
// Don't reanimate if we are already visible
|
||||
if (this._completionActor.visible) {
|
||||
this._completionActor.height = naturalHeight;
|
||||
} else {
|
||||
let settings = St.Settings.get();
|
||||
let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
|
||||
this._completionActor.show();
|
||||
this._completionActor.remove_all_transitions();
|
||||
this._completionActor.ease({
|
||||
Tweener.removeTweens(this._completionActor);
|
||||
Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
|
||||
transition: 'easeOutQuad',
|
||||
height: naturalHeight,
|
||||
opacity: 255,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
opacity: 255
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
_hideCompletions() {
|
||||
if (this._completionActor) {
|
||||
let settings = St.Settings.get();
|
||||
let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
|
||||
this._completionActor.remove_all_transitions();
|
||||
this._completionActor.ease({
|
||||
Tweener.removeTweens(this._completionActor);
|
||||
Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
|
||||
transition: 'easeOutQuad',
|
||||
height: 0,
|
||||
opacity: 0,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._completionActor.hide();
|
||||
}
|
||||
@@ -1015,11 +998,7 @@ var LookingGlass = class LookingGlass {
|
||||
}
|
||||
|
||||
getResult(idx) {
|
||||
try {
|
||||
return this._results[idx - this._offset].o;
|
||||
} catch (e) {
|
||||
throw new Error(`Unknown result at index ${idx}`);
|
||||
}
|
||||
}
|
||||
|
||||
toggle() {
|
||||
@@ -1030,10 +1009,7 @@ var LookingGlass = class LookingGlass {
|
||||
}
|
||||
|
||||
_queueResize() {
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
|
||||
this._resize();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => this._resize());
|
||||
}
|
||||
|
||||
_resize() {
|
||||
@@ -1096,18 +1072,14 @@ var LookingGlass = class LookingGlass {
|
||||
this._open = true;
|
||||
this._history.lastItem();
|
||||
|
||||
this.actor.remove_all_transitions();
|
||||
Tweener.removeTweens(this.actor);
|
||||
|
||||
// We inverse compensate for the slow-down so you can change the factor
|
||||
// through LookingGlass without long waits.
|
||||
let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor;
|
||||
this.actor.ease({
|
||||
y: this._targetY,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(),
|
||||
transition: 'easeOutQuad',
|
||||
y: this._targetY
|
||||
});
|
||||
|
||||
this._windowList.update();
|
||||
}
|
||||
|
||||
close() {
|
||||
@@ -1117,25 +1089,19 @@ var LookingGlass = class LookingGlass {
|
||||
this._objInspector.actor.hide();
|
||||
|
||||
this._open = false;
|
||||
this.actor.remove_all_transitions();
|
||||
Tweener.removeTweens(this.actor);
|
||||
|
||||
this.setBorderPaintTarget(null);
|
||||
|
||||
Main.popModal(this._entry);
|
||||
|
||||
let settings = St.Settings.get();
|
||||
let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor,
|
||||
LG_ANIMATION_TIME);
|
||||
this.actor.ease({
|
||||
Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5),
|
||||
transition: 'easeOutQuad',
|
||||
y: this._hiddenY,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this.actor.hide()
|
||||
});
|
||||
onComplete: () => {
|
||||
this.actor.hide();
|
||||
}
|
||||
|
||||
get isOpen() {
|
||||
return this._open;
|
||||
});
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(LookingGlass.prototype);
|
||||
|
||||
@@ -2,6 +2,7 @@
|
||||
|
||||
const { Atspi, Clutter, GDesktopEnums,
|
||||
Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Background = imports.ui.background;
|
||||
@@ -106,7 +107,8 @@ var Magnifier = class Magnifier {
|
||||
// Create the first ZoomRegion and initialize it according to the
|
||||
// magnification settings.
|
||||
|
||||
[this.xMouse, this.yMouse] = global.get_pointer();
|
||||
let mask;
|
||||
[this.xMouse, this.yMouse, mask] = global.get_pointer();
|
||||
|
||||
let aZoomRegion = new ZoomRegion(this, this._cursorRoot);
|
||||
this._zoomRegions.push(aZoomRegion);
|
||||
@@ -127,8 +129,6 @@ var Magnifier = class Magnifier {
|
||||
* Show the system mouse pointer.
|
||||
*/
|
||||
showSystemCursor() {
|
||||
if (this._cursorTracker.set_keep_focus_while_hidden)
|
||||
this._cursorTracker.set_keep_focus_while_hidden(false);
|
||||
this._cursorTracker.set_pointer_visible(true);
|
||||
}
|
||||
|
||||
@@ -137,8 +137,6 @@ var Magnifier = class Magnifier {
|
||||
* Hide the system mouse pointer.
|
||||
*/
|
||||
hideSystemCursor() {
|
||||
if (this._cursorTracker.set_keep_focus_while_hidden)
|
||||
this._cursorTracker.set_keep_focus_while_hidden(true);
|
||||
this._cursorTracker.set_pointer_visible(false);
|
||||
}
|
||||
|
||||
@@ -150,7 +148,7 @@ var Magnifier = class Magnifier {
|
||||
setActive(activate) {
|
||||
let isActive = this.isActive();
|
||||
|
||||
this._zoomRegions.forEach(zoomRegion => {
|
||||
this._zoomRegions.forEach((zoomRegion, index, array) => {
|
||||
zoomRegion.setActive(activate);
|
||||
});
|
||||
|
||||
@@ -173,7 +171,7 @@ var Magnifier = class Magnifier {
|
||||
// Make sure system mouse pointer is shown when all zoom regions are
|
||||
// invisible.
|
||||
if (!activate)
|
||||
this.showSystemCursor();
|
||||
this._cursorTracker.set_pointer_visible(true);
|
||||
|
||||
// Notify interested parties of this change
|
||||
this.emit('active-changed', activate);
|
||||
@@ -229,14 +227,14 @@ var Magnifier = class Magnifier {
|
||||
* @return true.
|
||||
*/
|
||||
scrollToMousePos() {
|
||||
let [xMouse, yMouse] = global.get_pointer();
|
||||
let [xMouse, yMouse, mask] = global.get_pointer();
|
||||
|
||||
if (xMouse != this.xMouse || yMouse != this.yMouse) {
|
||||
this.xMouse = xMouse;
|
||||
this.yMouse = yMouse;
|
||||
|
||||
let sysMouseOverAny = false;
|
||||
this._zoomRegions.forEach(zoomRegion => {
|
||||
this._zoomRegions.forEach((zoomRegion, index, array) => {
|
||||
if (zoomRegion.scrollToMousePos())
|
||||
sysMouseOverAny = true;
|
||||
});
|
||||
@@ -268,7 +266,7 @@ var Magnifier = class Magnifier {
|
||||
zoomRegion.setViewPort(viewPort);
|
||||
|
||||
// We ignore the redundant width/height on the ROI
|
||||
let fixedROI = Object.create(roi);
|
||||
let fixedROI = new Object(roi);
|
||||
fixedROI.width = viewPort.width / xMagFactor;
|
||||
fixedROI.height = viewPort.height / yMagFactor;
|
||||
zoomRegion.setROI(fixedROI);
|
||||
@@ -334,7 +332,7 @@ var Magnifier = class Magnifier {
|
||||
this.setCrosshairsClip(clip);
|
||||
|
||||
let theCrossHairs = this._crossHairs;
|
||||
this._zoomRegions.forEach (zoomRegion => {
|
||||
this._zoomRegions.forEach ((zoomRegion, index, array) => {
|
||||
zoomRegion.addCrosshairs(theCrossHairs);
|
||||
});
|
||||
}
|
||||
@@ -362,7 +360,7 @@ var Magnifier = class Magnifier {
|
||||
*/
|
||||
setCrosshairsColor(color) {
|
||||
if (this._crossHairs) {
|
||||
let [res_, clutterColor] = Clutter.Color.from_string(color);
|
||||
let [res, clutterColor] = Clutter.Color.from_string(color);
|
||||
this._crossHairs.setColor(clutterColor);
|
||||
}
|
||||
}
|
||||
@@ -455,11 +453,15 @@ var Magnifier = class Magnifier {
|
||||
* @clip: Flag to indicate whether to clip the crosshairs.
|
||||
*/
|
||||
setCrosshairsClip(clip) {
|
||||
if (!this._crossHairs)
|
||||
return;
|
||||
|
||||
// Setting no clipping on crosshairs means a zero sized clip rectangle.
|
||||
this._crossHairs.setClip(clip ? CROSSHAIRS_CLIP_SIZE : [0, 0]);
|
||||
if (clip) {
|
||||
if (this._crossHairs)
|
||||
this._crossHairs.setClip(CROSSHAIRS_CLIP_SIZE);
|
||||
} else {
|
||||
// Setting no clipping on crosshairs means a zero sized clip
|
||||
// rectangle.
|
||||
if (this._crossHairs)
|
||||
this._crossHairs.setClip([0, 0]);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1143,7 +1145,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
_clearScrollContentsTimer() {
|
||||
if (this._scrollContentsTimerId != 0) {
|
||||
GLib.source_remove(this._scrollContentsTimerId);
|
||||
Mainloop.source_remove(this._scrollContentsTimerId);
|
||||
this._scrollContentsTimerId = 0;
|
||||
}
|
||||
}
|
||||
@@ -1155,7 +1157,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
}
|
||||
|
||||
this._clearScrollContentsTimer();
|
||||
this._scrollContentsTimerId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, POINTER_REST_TIME, () => {
|
||||
this._scrollContentsTimerId = Mainloop.timeout_add(POINTER_REST_TIME, () => {
|
||||
this._scrollContentsToDelayed(x, y);
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
@@ -1513,7 +1515,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
}
|
||||
|
||||
_centerFromPointProportional(xPoint, yPoint) {
|
||||
let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI();
|
||||
let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI();
|
||||
let halfScreenWidth = global.screen_width / 2;
|
||||
let halfScreenHeight = global.screen_height / 2;
|
||||
// We want to pad with a constant distance after zooming, so divide
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported ShellMagnifier */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
const Main = imports.ui.main;
|
||||
@@ -125,7 +124,7 @@ var ShellMagnifier = class ShellMagnifier {
|
||||
let zoomRegions = Main.magnifier.getZoomRegions();
|
||||
let objectPaths = [];
|
||||
let thoseZoomers = this._zoomers;
|
||||
zoomRegions.forEach (aZoomRegion => {
|
||||
zoomRegions.forEach ((aZoomRegion, index, array) => {
|
||||
let found = false;
|
||||
for (let objectPath in thoseZoomers) {
|
||||
let proxyAndZoomRegion = thoseZoomers[objectPath];
|
||||
|
||||
@@ -1,14 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported componentManager, notificationDaemon, windowAttentionHandler,
|
||||
ctrlAltTabManager, padOsdService, osdWindowManager,
|
||||
osdMonitorLabeler, shellMountOpDBusService, shellDBusService,
|
||||
shellAccessDialogDBusService, shellAudioSelectionDBusService,
|
||||
screenSaverDBus, screencastService, uiGroup, magnifier,
|
||||
xdndHandler, keyboard, kbdA11yDialog, introspectService,
|
||||
start, pushModal, popModal, activateWindow, createLookingGlass,
|
||||
initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const AccessDialog = imports.ui.accessDialog;
|
||||
const AudioDeviceSelection = imports.ui.audioDeviceSelection;
|
||||
@@ -53,7 +46,6 @@ const LOG_DOMAIN = 'GNOME Shell';
|
||||
const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a';
|
||||
|
||||
var componentManager = null;
|
||||
var extensionManager = null;
|
||||
var panel = null;
|
||||
var overview = null;
|
||||
var runDialog = null;
|
||||
@@ -229,17 +221,12 @@ function _initializeUI() {
|
||||
EndSessionDialog.init();
|
||||
|
||||
// We're ready for the session manager to move to the next phase
|
||||
GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
|
||||
Shell.util_sd_notify();
|
||||
Meta.register_with_session();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
|
||||
_startDate = new Date();
|
||||
|
||||
ExtensionDownloader.init();
|
||||
extensionManager = new ExtensionSystem.ExtensionManager();
|
||||
extensionManager.init();
|
||||
ExtensionSystem.init();
|
||||
|
||||
if (sessionMode.isGreeter && screenShield) {
|
||||
layoutManager.connect('startup-prepared', () => {
|
||||
@@ -623,7 +610,7 @@ function _runDeferredWork(workId) {
|
||||
_deferredWorkQueue.splice(index, 1);
|
||||
_deferredWorkData[workId].callback();
|
||||
if (_deferredWorkQueue.length == 0 && _deferredTimeoutId > 0) {
|
||||
GLib.source_remove(_deferredTimeoutId);
|
||||
Mainloop.source_remove(_deferredTimeoutId);
|
||||
_deferredTimeoutId = 0;
|
||||
}
|
||||
}
|
||||
@@ -669,7 +656,7 @@ function _queueBeforeRedraw(workId) {
|
||||
*
|
||||
* Returns: A string work identifier
|
||||
*/
|
||||
function initializeDeferredWork(actor, callback) {
|
||||
function initializeDeferredWork(actor, callback, props) {
|
||||
// Turn into a string so we can use as an object property
|
||||
let workId = `${(++_deferredWorkSequence)}`;
|
||||
_deferredWorkData[workId] = { 'actor': actor,
|
||||
@@ -709,8 +696,9 @@ function queueDeferredWork(workId) {
|
||||
_deferredWorkQueue.push(workId);
|
||||
if (data.actor.mapped) {
|
||||
_queueBeforeRedraw(workId);
|
||||
return;
|
||||
} else if (_deferredTimeoutId == 0) {
|
||||
_deferredTimeoutId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, DEFERRED_TIMEOUT_SECONDS, () => {
|
||||
_deferredTimeoutId = Mainloop.timeout_add_seconds(DEFERRED_TIMEOUT_SECONDS, () => {
|
||||
_runAllDeferredWork();
|
||||
_deferredTimeoutId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
|
||||
@@ -4,9 +4,10 @@ const MessageTray = imports.ui.messageTray;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Calendar = imports.ui.calendar;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Util = imports.misc.util;
|
||||
|
||||
var MESSAGE_ANIMATION_TIME = 100;
|
||||
var MESSAGE_ANIMATION_TIME = 0.1;
|
||||
|
||||
var DEFAULT_EXPAND_LINES = 6;
|
||||
|
||||
@@ -129,12 +130,12 @@ var URLHighlighter = class URLHighlighter {
|
||||
}
|
||||
|
||||
_findUrlAtPos(event) {
|
||||
let success_;
|
||||
let success;
|
||||
let [x, y] = event.get_coords();
|
||||
[success_, x, y] = this.actor.transform_stage_point(x, y);
|
||||
[success, x, y] = this.actor.transform_stage_point(x, y);
|
||||
let findPos = -1;
|
||||
for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
|
||||
let [success_, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
|
||||
let [success, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
|
||||
if (py > y || py + lineHeight < y || x < px)
|
||||
continue;
|
||||
findPos = i;
|
||||
@@ -333,10 +334,7 @@ var Message = class Message {
|
||||
|
||||
let closeIcon = new St.Icon({ icon_name: 'window-close-symbolic',
|
||||
icon_size: 16 });
|
||||
this._closeButton = new St.Button({
|
||||
style_class: 'message-close-button',
|
||||
child: closeIcon, opacity: 0,
|
||||
});
|
||||
this._closeButton = new St.Button({ child: closeIcon, opacity: 0 });
|
||||
titleBox.add_actor(this._closeButton);
|
||||
|
||||
this._bodyStack = new St.Widget({ x_expand: true });
|
||||
@@ -442,17 +440,15 @@ var Message = class Message {
|
||||
}
|
||||
|
||||
if (animate) {
|
||||
this._bodyStack.ease_property('@layout.expansion', 1, {
|
||||
progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
});
|
||||
|
||||
Tweener.addTween(this._bodyStack.layout_manager,
|
||||
{ expansion: 1,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
this._actionBin.scale_y = 0;
|
||||
this._actionBin.ease({
|
||||
scale_y: 1,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
Tweener.addTween(this._actionBin,
|
||||
{ scale_y: 1,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
} else {
|
||||
this._bodyStack.layout_manager.expansion = 1;
|
||||
this._actionBin.scale_y = 1;
|
||||
@@ -463,20 +459,18 @@ var Message = class Message {
|
||||
|
||||
unexpand(animate) {
|
||||
if (animate) {
|
||||
this._bodyStack.ease_property('@layout.expansion', 0, {
|
||||
progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
});
|
||||
|
||||
this._actionBin.ease({
|
||||
scale_y: 0,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
Tweener.addTween(this._bodyStack.layout_manager,
|
||||
{ expansion: 0,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
Tweener.addTween(this._actionBin,
|
||||
{ scale_y: 0,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this._actionBin.hide();
|
||||
this.expanded = false;
|
||||
}
|
||||
});
|
||||
} });
|
||||
} else {
|
||||
this._bodyStack.layout_manager.expansion = 0;
|
||||
this._actionBin.scale_y = 0;
|
||||
@@ -587,12 +581,10 @@ var MessageListSection = class MessageListSection {
|
||||
this._list.insert_child_at_index(obj.container, index);
|
||||
|
||||
if (animate)
|
||||
obj.container.ease({
|
||||
scale_x: 1,
|
||||
Tweener.addTween(obj.container, { scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
}
|
||||
|
||||
moveMessage(message, index, animate) {
|
||||
@@ -605,20 +597,16 @@ var MessageListSection = class MessageListSection {
|
||||
|
||||
let onComplete = () => {
|
||||
this._list.set_child_at_index(obj.container, index);
|
||||
obj.container.ease({
|
||||
scale_x: 1,
|
||||
Tweener.addTween(obj.container, { scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
};
|
||||
obj.container.ease({
|
||||
scale_x: 0,
|
||||
Tweener.addTween(obj.container, { scale_x: 0,
|
||||
scale_y: 0,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete
|
||||
});
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: onComplete });
|
||||
}
|
||||
|
||||
removeMessage(message, animate) {
|
||||
@@ -631,16 +619,13 @@ var MessageListSection = class MessageListSection {
|
||||
this._messages.delete(message);
|
||||
|
||||
if (animate) {
|
||||
obj.container.ease({
|
||||
scale_x: 0,
|
||||
scale_y: 0,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0,
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
obj.container.destroy();
|
||||
global.sync_pointer();
|
||||
}
|
||||
});
|
||||
} });
|
||||
} else {
|
||||
obj.container.destroy();
|
||||
global.sync_pointer();
|
||||
@@ -662,14 +647,15 @@ var MessageListSection = class MessageListSection {
|
||||
for (let i = 0; i < messages.length; i++) {
|
||||
let message = messages[i];
|
||||
let obj = this._messages.get(message);
|
||||
obj.container.ease({
|
||||
anchor_x: this._list.width,
|
||||
Tweener.addTween(obj.container,
|
||||
{ anchor_x: this._list.width,
|
||||
opacity: 0,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
delay: i * delay,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => message.close()
|
||||
});
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
message.close();
|
||||
} });
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,9 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported NotificationPolicy, NotificationGenericPolicy,
|
||||
NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel,
|
||||
SystemNotificationSource, MessageTray */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Calendar = imports.ui.calendar;
|
||||
@@ -11,14 +9,15 @@ const GnomeSession = imports.misc.gnomeSession;
|
||||
const Layout = imports.ui.layout;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings';
|
||||
|
||||
var ANIMATION_TIME = 200;
|
||||
var NOTIFICATION_TIMEOUT = 4000;
|
||||
var ANIMATION_TIME = 0.2;
|
||||
var NOTIFICATION_TIMEOUT = 4;
|
||||
|
||||
var HIDE_TIMEOUT = 200;
|
||||
var LONGER_HIDE_TIMEOUT = 600;
|
||||
var HIDE_TIMEOUT = 0.2;
|
||||
var LONGER_HIDE_TIMEOUT = 0.6;
|
||||
|
||||
var MAX_NOTIFICATIONS_IN_QUEUE = 3;
|
||||
var MAX_NOTIFICATIONS_PER_SOURCE = 3;
|
||||
@@ -136,13 +135,12 @@ var FocusGrabber = class FocusGrabber {
|
||||
// A notification without a policy object will inherit the default one.
|
||||
var NotificationPolicy = class NotificationPolicy {
|
||||
constructor(params) {
|
||||
params = Params.parse(params, {
|
||||
enable: true,
|
||||
params = Params.parse(params, { enable: true,
|
||||
enableSound: true,
|
||||
showBanners: true,
|
||||
forceExpanded: false,
|
||||
showInLockScreen: true,
|
||||
detailsInLockScreen: false,
|
||||
detailsInLockScreen: false
|
||||
});
|
||||
Object.getOwnPropertyNames(params).forEach(key => {
|
||||
let desc = Object.getOwnPropertyDescriptor(params, key);
|
||||
@@ -153,7 +151,6 @@ var NotificationPolicy = class NotificationPolicy {
|
||||
// Do nothing for the default policy. These methods are only useful for the
|
||||
// GSettings policy.
|
||||
store() { }
|
||||
|
||||
destroy() { }
|
||||
|
||||
get enable() {
|
||||
@@ -653,7 +650,7 @@ class SourceActorWithLabel extends SourceActor {
|
||||
|
||||
let childBox = new Clutter.ActorBox();
|
||||
|
||||
let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
|
||||
let [minWidth, minHeight, naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
|
||||
let direction = this.get_text_direction();
|
||||
|
||||
if (direction == Clutter.TextDirection.LTR) {
|
||||
@@ -735,8 +732,7 @@ var Source = class Source {
|
||||
}
|
||||
|
||||
get narrowestPrivacyScope() {
|
||||
return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM)
|
||||
? PrivacyScope.SYSTEM
|
||||
return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) ? PrivacyScope.SYSTEM
|
||||
: PrivacyScope.USER;
|
||||
}
|
||||
|
||||
@@ -831,7 +827,7 @@ Signals.addSignalMethods(Source.prototype);
|
||||
|
||||
var MessageTray = class MessageTray {
|
||||
constructor() {
|
||||
this._presence = new GnomeSession.Presence((proxy, _error) => {
|
||||
this._presence = new GnomeSession.Presence((proxy, error) => {
|
||||
this._onStatusChanged(proxy.status);
|
||||
});
|
||||
this._busy = false;
|
||||
@@ -1006,6 +1002,7 @@ var MessageTray = class MessageTray {
|
||||
|
||||
_addSource(source) {
|
||||
let obj = {
|
||||
source: source,
|
||||
notifyId: 0,
|
||||
destroyId: 0,
|
||||
};
|
||||
@@ -1092,7 +1089,7 @@ var MessageTray = class MessageTray {
|
||||
_resetNotificationLeftTimeout() {
|
||||
this._useLongerNotificationLeftTimeout = false;
|
||||
if (this._notificationLeftTimeoutId) {
|
||||
GLib.source_remove(this._notificationLeftTimeoutId);
|
||||
Mainloop.source_remove(this._notificationLeftTimeoutId);
|
||||
this._notificationLeftTimeoutId = 0;
|
||||
this._notificationLeftMouseX = -1;
|
||||
this._notificationLeftMouseY = -1;
|
||||
@@ -1130,15 +1127,15 @@ var MessageTray = class MessageTray {
|
||||
// this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us
|
||||
// to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still
|
||||
// close to its previous position, we extend the timeout once.
|
||||
let [x, y] = global.get_pointer();
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
this._notificationLeftMouseX = x;
|
||||
this._notificationLeftMouseY = y;
|
||||
|
||||
// We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it.
|
||||
// We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
|
||||
// That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
|
||||
let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT;
|
||||
this._notificationLeftTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, this._onNotificationLeftTimeout.bind(this));
|
||||
let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000;
|
||||
this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
|
||||
}
|
||||
}
|
||||
@@ -1159,7 +1156,7 @@ var MessageTray = class MessageTray {
|
||||
}
|
||||
|
||||
_onNotificationLeftTimeout() {
|
||||
let [x, y] = global.get_pointer();
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
// We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side.
|
||||
if (this._notificationLeftMouseX > -1 &&
|
||||
y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD &&
|
||||
@@ -1167,9 +1164,7 @@ var MessageTray = class MessageTray {
|
||||
x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
|
||||
x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
|
||||
this._notificationLeftMouseX = -1;
|
||||
this._notificationLeftTimeoutId = GLib.timeout_add(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
LONGER_HIDE_TIMEOUT,
|
||||
this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000,
|
||||
this._onNotificationLeftTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
|
||||
} else {
|
||||
@@ -1251,6 +1246,34 @@ var MessageTray = class MessageTray {
|
||||
this._notificationExpired = false;
|
||||
}
|
||||
|
||||
_tween(actor, statevar, value, params) {
|
||||
let onComplete = params.onComplete;
|
||||
let onCompleteScope = params.onCompleteScope;
|
||||
let onCompleteParams = params.onCompleteParams;
|
||||
|
||||
params.onComplete = this._tweenComplete;
|
||||
params.onCompleteScope = this;
|
||||
params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams];
|
||||
|
||||
// Remove other tweens that could mess with the state machine
|
||||
Tweener.removeTweens(actor);
|
||||
Tweener.addTween(actor, params);
|
||||
|
||||
let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING;
|
||||
this[statevar] = valuing;
|
||||
}
|
||||
|
||||
_tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) {
|
||||
this[statevar] = value;
|
||||
if (onComplete)
|
||||
onComplete.apply(onCompleteScope, onCompleteParams);
|
||||
this._updateState();
|
||||
}
|
||||
|
||||
_clampOpacity() {
|
||||
this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255));
|
||||
}
|
||||
|
||||
_onIdleMonitorBecameActive() {
|
||||
this._userActiveWhileNotificationShown = true;
|
||||
this._updateNotificationTimeout(2000);
|
||||
@@ -1277,6 +1300,7 @@ var MessageTray = class MessageTray {
|
||||
|
||||
this._bannerBin.add_actor(this._banner.actor);
|
||||
|
||||
this._bannerBin._opacity = 0;
|
||||
this._bannerBin.opacity = 0;
|
||||
this._bannerBin.y = -this._banner.actor.height;
|
||||
this.actor.show();
|
||||
@@ -1284,7 +1308,7 @@ var MessageTray = class MessageTray {
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
this._updateShowingNotification();
|
||||
|
||||
let [x, y] = global.get_pointer();
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
// We save the position of the mouse at the time when we started showing the notification
|
||||
// in order to determine if the notification popped up under it. We make that check if
|
||||
// the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't
|
||||
@@ -1322,45 +1346,39 @@ var MessageTray = class MessageTray {
|
||||
// We use this._showNotificationCompleted() onComplete callback to extend the time the updated
|
||||
// notification is being shown.
|
||||
|
||||
this._notificationState = State.SHOWING;
|
||||
this._bannerBin.remove_all_transitions();
|
||||
this._bannerBin.ease({
|
||||
opacity: 255,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.LINEAR
|
||||
});
|
||||
this._bannerBin.ease({
|
||||
y: 0,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_BACK,
|
||||
onComplete: () => {
|
||||
this._notificationState = State.SHOWN;
|
||||
this._showNotificationCompleted();
|
||||
this._updateState();
|
||||
}
|
||||
});
|
||||
let tweenParams = { y: 0,
|
||||
_opacity: 255,
|
||||
time: ANIMATION_TIME,
|
||||
transition: 'easeOutBack',
|
||||
onUpdate: this._clampOpacity,
|
||||
onUpdateScope: this,
|
||||
onComplete: this._showNotificationCompleted,
|
||||
onCompleteScope: this
|
||||
};
|
||||
|
||||
this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams);
|
||||
}
|
||||
|
||||
_showNotificationCompleted() {
|
||||
if (this._notification.urgency != Urgency.CRITICAL)
|
||||
this._updateNotificationTimeout(NOTIFICATION_TIMEOUT);
|
||||
this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000);
|
||||
}
|
||||
|
||||
_updateNotificationTimeout(timeout) {
|
||||
if (this._notificationTimeoutId) {
|
||||
GLib.source_remove(this._notificationTimeoutId);
|
||||
Mainloop.source_remove(this._notificationTimeoutId);
|
||||
this._notificationTimeoutId = 0;
|
||||
}
|
||||
if (timeout > 0) {
|
||||
this._notificationTimeoutId =
|
||||
GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
|
||||
Mainloop.timeout_add(timeout,
|
||||
this._notificationTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notificationTimeoutId, '[gnome-shell] this._notificationTimeout');
|
||||
}
|
||||
}
|
||||
|
||||
_notificationTimeout() {
|
||||
let [x, y] = global.get_pointer();
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) {
|
||||
// The mouse is moving towards the notification, so don't
|
||||
// hide it yet. (We just create a new timeout (and destroy
|
||||
@@ -1396,26 +1414,20 @@ var MessageTray = class MessageTray {
|
||||
}
|
||||
|
||||
this._resetNotificationLeftTimeout();
|
||||
this._bannerBin.remove_all_transitions();
|
||||
|
||||
if (animate) {
|
||||
this._notificationState = State.HIDING;
|
||||
this._bannerBin.ease({
|
||||
opacity: 0,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_BACK
|
||||
});
|
||||
this._bannerBin.ease({
|
||||
y: -this._bannerBin.height,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_BACK,
|
||||
onComplete: () => {
|
||||
this._notificationState = State.HIDDEN;
|
||||
this._hideNotificationCompleted();
|
||||
this._updateState();
|
||||
}
|
||||
this._tween(this._bannerBin, '_notificationState', State.HIDDEN,
|
||||
{ y: -this._bannerBin.height,
|
||||
_opacity: 0,
|
||||
time: ANIMATION_TIME,
|
||||
transition: 'easeOutBack',
|
||||
onUpdate: this._clampOpacity,
|
||||
onUpdateScope: this,
|
||||
onComplete: this._hideNotificationCompleted,
|
||||
onCompleteScope: this
|
||||
});
|
||||
} else {
|
||||
Tweener.removeTweens(this._bannerBin);
|
||||
this._bannerBin.y = -this._bannerBin.height;
|
||||
this._bannerBin.opacity = 0;
|
||||
this._notificationState = State.HIDDEN;
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported ModalDialog */
|
||||
|
||||
const { Atk, Clutter, GObject, Shell, St } = imports.gi;
|
||||
|
||||
@@ -8,9 +7,10 @@ const Layout = imports.ui.layout;
|
||||
const Lightbox = imports.ui.lightbox;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var OPEN_AND_CLOSE_TIME = 100;
|
||||
var FADE_OUT_DIALOG_TIME = 1000;
|
||||
var OPEN_AND_CLOSE_TIME = 0.1;
|
||||
var FADE_OUT_DIALOG_TIME = 1.0;
|
||||
|
||||
var State = {
|
||||
OPENED: 0,
|
||||
@@ -124,10 +124,10 @@ var ModalDialog = GObject.registerClass({
|
||||
this._lightbox.show();
|
||||
this.opacity = 0;
|
||||
this.show();
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 255,
|
||||
time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this._setState(State.OPENED);
|
||||
this.emit('opened');
|
||||
@@ -175,17 +175,16 @@ var ModalDialog = GObject.registerClass({
|
||||
this.popModal(timestamp);
|
||||
this._savedKeyFocus = null;
|
||||
|
||||
if (this._shouldFadeOut) {
|
||||
this.ease({
|
||||
opacity: 0,
|
||||
duration: OPEN_AND_CLOSE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this._closeComplete()
|
||||
if (this._shouldFadeOut)
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 0,
|
||||
time: OPEN_AND_CLOSE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._closeComplete.bind(this)
|
||||
});
|
||||
} else {
|
||||
else
|
||||
this._closeComplete();
|
||||
}
|
||||
}
|
||||
|
||||
// Drop modal status without closing the dialog; this makes the
|
||||
// dialog insensitive as well, so it needs to be followed shortly
|
||||
@@ -216,8 +215,6 @@ var ModalDialog = GObject.registerClass({
|
||||
if (!Main.pushModal(this, params))
|
||||
return false;
|
||||
|
||||
Main.layoutManager.emit('system-modal-opened');
|
||||
|
||||
this._hasModal = true;
|
||||
if (this._savedKeyFocus) {
|
||||
this._savedKeyFocus.grab_key_focus();
|
||||
@@ -251,11 +248,13 @@ var ModalDialog = GObject.registerClass({
|
||||
return;
|
||||
|
||||
this.popModal(timestamp);
|
||||
this.dialogLayout.ease({
|
||||
opacity: 0,
|
||||
duration: FADE_OUT_DIALOG_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => (this.state = State.FADED_OUT)
|
||||
Tweener.addTween(this.dialogLayout,
|
||||
{ opacity: 0,
|
||||
time: FADE_OUT_DIALOG_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this._setState(State.FADED_OUT);
|
||||
}
|
||||
});
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
/* exported MediaSection */
|
||||
const { Gio, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
@@ -71,8 +70,7 @@ var MediaMessage = class MediaMessage extends MessageList.Message {
|
||||
}
|
||||
|
||||
let isPlaying = this._player.status == 'Playing';
|
||||
let iconName = isPlaying
|
||||
? 'media-playback-pause-symbolic'
|
||||
let iconName = isPlaying ? 'media-playback-pause-symbolic'
|
||||
: 'media-playback-start-symbolic';
|
||||
this._playPauseButton.child.icon_name = iconName;
|
||||
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported NotificationDaemon */
|
||||
|
||||
const { GdkPixbuf, Gio, GLib, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const Config = imports.misc.config;
|
||||
const Main = imports.ui.main;
|
||||
@@ -64,7 +64,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
|
||||
_imageForNotificationData(hints) {
|
||||
if (hints['image-data']) {
|
||||
let [width, height, rowStride, hasAlpha,
|
||||
bitsPerSample, nChannels_, data] = hints['image-data'];
|
||||
bitsPerSample, nChannels, data] = hints['image-data'];
|
||||
return Shell.util_create_pixbuf_from_data(data, GdkPixbuf.Colorspace.RGB, hasAlpha,
|
||||
bitsPerSample, width, height, rowStride);
|
||||
} else if (hints['image-path']) {
|
||||
@@ -170,7 +170,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
|
||||
// Ignore replacesId since we already sent back a
|
||||
// NotificationClosed for that id.
|
||||
id = this._nextNotificationId++;
|
||||
let idleId = GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
|
||||
let idleId = Mainloop.idle_add(() => {
|
||||
this._emitNotificationClosed(id, NotificationClosedReason.DISMISSED);
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
@@ -259,7 +259,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
|
||||
}
|
||||
|
||||
_notifyForSource(source, ndata) {
|
||||
let [id_, icon, summary, body, actions, hints, notification] =
|
||||
let [id, icon, summary, body, actions, hints, notification] =
|
||||
[ndata.id, ndata.icon, ndata.summary, ndata.body,
|
||||
ndata.actions, ndata.hints, ndata.notification];
|
||||
|
||||
@@ -346,8 +346,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
|
||||
notification.setTransient(!!hints['transient']);
|
||||
|
||||
let privacyScope = (hints['x-gnome-privacy-scope'] || 'user');
|
||||
notification.setPrivacyScope(privacyScope == 'system'
|
||||
? MessageTray.PrivacyScope.SYSTEM
|
||||
notification.setPrivacyScope(privacyScope == 'system' ? MessageTray.PrivacyScope.SYSTEM
|
||||
: MessageTray.PrivacyScope.USER);
|
||||
|
||||
let sourceGIcon = source.useNotificationIcon ? gicon : null;
|
||||
@@ -541,22 +540,21 @@ class GtkNotificationDaemonNotification extends MessageTray.Notification {
|
||||
super(source);
|
||||
this._serialized = GLib.Variant.new('a{sv}', notification);
|
||||
|
||||
let { title,
|
||||
body,
|
||||
icon: gicon,
|
||||
urgent,
|
||||
priority,
|
||||
buttons,
|
||||
let { "title": title,
|
||||
"body": body,
|
||||
"icon": gicon,
|
||||
"urgent": urgent,
|
||||
"priority": priority,
|
||||
"buttons": buttons,
|
||||
"default-action": defaultAction,
|
||||
"default-action-target": defaultActionTarget,
|
||||
timestamp: time } = notification;
|
||||
"timestamp": time } = notification;
|
||||
|
||||
if (priority) {
|
||||
let urgency = PRIORITY_URGENCY_MAP[priority.unpack()];
|
||||
this.setUrgency(urgency != undefined ? urgency : MessageTray.Urgency.NORMAL);
|
||||
} else if (urgent) {
|
||||
this.setUrgency(urgent.unpack()
|
||||
? MessageTray.Urgency.CRITICAL
|
||||
this.setUrgency(urgent.unpack() ? MessageTray.Urgency.CRITICAL
|
||||
: MessageTray.Urgency.NORMAL);
|
||||
} else {
|
||||
this.setUrgency(MessageTray.Urgency.NORMAL);
|
||||
@@ -590,8 +588,8 @@ class GtkNotificationDaemonNotification extends MessageTray.Notification {
|
||||
}
|
||||
|
||||
_onButtonClicked(button) {
|
||||
let { action, target } = button;
|
||||
this._activateAction(action.unpack(), target);
|
||||
let { 'action': action, 'target': actionTarget } = button;
|
||||
this._activateAction(action.unpack(), actionTarget);
|
||||
}
|
||||
|
||||
activate() {
|
||||
@@ -751,7 +749,6 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
|
||||
_loadNotifications() {
|
||||
this._isLoading = true;
|
||||
|
||||
try {
|
||||
let value = global.get_persistent_state('a(sa(sv))', 'notifications');
|
||||
if (value) {
|
||||
let sources = value.deep_unpack();
|
||||
@@ -773,12 +770,9 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
|
||||
});
|
||||
});
|
||||
}
|
||||
} catch (e) {
|
||||
logError(e, 'Failed to load saved notifications');
|
||||
} finally {
|
||||
|
||||
this._isLoading = false;
|
||||
}
|
||||
}
|
||||
|
||||
_saveNotifications() {
|
||||
if (this._isLoading)
|
||||
|
||||
@@ -1,5 +1,4 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported OsdMonitorLabeler */
|
||||
|
||||
const { Clutter, Gio, Meta, St } = imports.gi;
|
||||
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user