isa/gnome-shell
1
0
Fork 0
Code Issues Pull Requests Packages Projects Releases Wiki Activity

js: Add JSDoc to exported functions and fix incorrect JSDoc formatting

Browse Source 
Part-of: <https://gitlab.gnome.org/GNOME/gnome-shell/-/merge_requests/1499>
This commit is contained in:
Evan Welsh 2023-07-30 15:56:59 +03:00 committed by Florian Müllner
parent 4642a8541d
commit 64aa871a8a
56 changed files with 623 additions and 280 deletions
Show Stats Download Patch File Download Diff File Expand all files Collapse all files

3
js/gdm/authPrompt.js
View File

@ -23,11 +23,13 @@ var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
/** @enum {number} */
var AuthPromptMode = {
UNLOCK_ONLY: 0,
UNLOCK_OR_LOG_IN: 1,
};
/** @enum {number} */
var AuthPromptStatus = {
NOT_VERIFYING: 0,
VERIFYING: 1,
@ -37,6 +39,7 @@ var AuthPromptStatus = {
VERIFICATION_IN_PROGRESS: 5,
};
/** @enum {number} */
var BeginRequestType = {
PROVIDE_USERNAME: 0,
DONT_PROVIDE_USERNAME: 1,

3
js/gdm/oVirt.js
View File

@ -43,6 +43,9 @@ var OVirtCredentialsManager = class OVirtCredentialsManager extends Credential.C
}
};
/**
* @returns {OVirtCredentialsManager}
*/
function getOVirtCredentialsManager() {
if (!_oVirtCredentialsManager)
_oVirtCredentialsManager = new OVirtCredentialsManager();

9
js/gdm/util.js
View File

@ -49,8 +49,12 @@ var DISABLE_USER_LIST_KEY = 'disable-user-list';
var USER_READ_TIME = 48;
const FINGERPRINT_ERROR_TIMEOUT_WAIT = 15;
/**
* Keep messages in order by priority
*
* @enum {number}
*/
var MessageType = {
// Keep messages in order by priority
NONE: 0,
HINT: 1,
INFO: 2,
@ -109,6 +113,9 @@ function fadeOutActor(actor) {
return hold;
}
/**
* @param {Clutter.Actor} actor
*/
function cloneAndFadeOutActor(actor) {
// Immediately hide actor so its sibling can have its space
// and position, but leave a non-reactive clone on-screen,

3
js/gdm/vmware.js
View File

@ -46,6 +46,9 @@ var VmwareCredentialsManager = class VmwareCredentialsManager extends Credential
}
};
/**
* @returns {VmwareCredentialsManager}
*/
function getVmwareCredentialsManager() {
if (!_vmwareCredentialsManager)
_vmwareCredentialsManager = new VmwareCredentialsManager();

2
js/misc/config.js.in
View File

@ -15,7 +15,7 @@ var LOCALEDIR = '@datadir@/locale';
var LIBEXECDIR = '@libexecdir@';
var PKGDATADIR = '@datadir@/@PACKAGE_NAME@';
/* g-i package versions */
var LIBMUTTER_API_VERSION = '@LIBMUTTER_API_VERSION@'
var LIBMUTTER_API_VERSION = '@LIBMUTTER_API_VERSION@';
var HAVE_BLUETOOTH = pkg.checkSymbol('GnomeBluetooth', '3.0',
'Client.default_adapter_state')

3
js/misc/extensionUtils.js
View File

@ -12,6 +12,9 @@ var ExtensionType = {
PER_USER: 2,
};
/**
* @enum {number}
*/
var ExtensionState = {
ENABLED: 1,
DISABLED: 2,

8
js/misc/fileUtils.js
View File

@ -44,6 +44,10 @@ function* collectFromDatadirs(subdir, includeUserDir) {
}
}
/**
* @param {Gio.File} dir
* @param {boolean} deleteParent
*/
function recursivelyDeleteDir(dir, deleteParent) {
let children = dir.enumerate_children('standard::name,standard::type',
Gio.FileQueryInfoFlags.NOFOLLOW_SYMLINKS, null);
@ -62,6 +66,10 @@ function recursivelyDeleteDir(dir, deleteParent) {
dir.delete(null);
}
/**
* @param {Gio.File} srcDir
* @param {Gio.File} destDir
*/
function recursivelyMoveDir(srcDir, destDir) {
let children = srcDir.enumerate_children('standard::name,standard::type',
Gio.FileQueryInfoFlags.NOFOLLOW_SYMLINKS, null);

20
js/misc/gnomeSession.js
View File

@ -7,6 +7,7 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
const PresenceIface = loadInterfaceXML('org.gnome.SessionManager.Presence');
/** @enum {number} */
var PresenceStatus = {
AVAILABLE: 0,
INVISIBLE: 1,
@ -15,6 +16,12 @@ var PresenceStatus = {
};
var PresenceProxy = Gio.DBusProxy.makeProxyWrapper(PresenceIface);
/**
* @param {Function} initCallback
* @param {Gio.Cancellable} cancellable
* @returns {Gio.DBusProxy}
*/
function Presence(initCallback, cancellable) {
return new PresenceProxy(Gio.DBus.session, 'org.gnome.SessionManager',
'/org/gnome/SessionManager/Presence', initCallback, cancellable);
@ -25,6 +32,13 @@ function Presence(initCallback, cancellable) {
// of new inhibitors)
const InhibitorIface = loadInterfaceXML('org.gnome.SessionManager.Inhibitor');
var InhibitorProxy = Gio.DBusProxy.makeProxyWrapper(InhibitorIface);
/**
* @param {string} objectPath
* @param {Function} initCallback
* @param {Gio.Cancellable} cancellable
* @returns {Gio.DBusProxy}
*/
function Inhibitor(objectPath, initCallback, cancellable) {
return new InhibitorProxy(Gio.DBus.session, 'org.gnome.SessionManager', objectPath, initCallback, cancellable);
}
@ -32,6 +46,12 @@ function Inhibitor(objectPath, initCallback, cancellable) {
// Not the full interface, only the methods we use
const SessionManagerIface = loadInterfaceXML('org.gnome.SessionManager');
var SessionManagerProxy = Gio.DBusProxy.makeProxyWrapper(SessionManagerIface);
/**
* @param {Function} initCallback
* @param {Gio.Cancellable} cancellable
* @returns {Gio.DBusProxy}
*/
function SessionManager(initCallback, cancellable) {
return new SessionManagerProxy(Gio.DBus.session, 'org.gnome.SessionManager', '/org/gnome/SessionManager', initCallback, cancellable);
}

3
js/misc/ibusManager.js
View File

@ -46,6 +46,9 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) {
`but required is ${requiredMajor}.${requiredMinor}.${requiredMicro}`);
}
/**
* @returns {IBusManager}
*/
function getIBusManager() {
if (_ibusManager == null)
_ibusManager = new IBusManager();

6
js/misc/keyboardManager.js
View File

@ -12,6 +12,9 @@ var DEFAULT_VARIANT = '';
let _xkbInfo = null;
/**
* @returns {GnomeDesktop.XkbInfo}
*/
function getXkbInfo() {
if (_xkbInfo == null)
_xkbInfo = new GnomeDesktop.XkbInfo();
@ -20,6 +23,9 @@ function getXkbInfo() {
let _keyboardManager = null;
/**
* @returns {KeyboardManager}
*/
function getKeyboardManager() {
if (_keyboardManager == null)
_keyboardManager = new KeyboardManager();

6
js/misc/loginManager.js
View File

@ -33,6 +33,9 @@ function versionCompare(required, reference) {
return true;
}
/**
* @returns {boolean}
*/
function canLock() {
try {
let params = GLib.Variant.new('(ss)', ['org.gnome.DisplayManager.Manager', 'Version']);
@ -74,8 +77,7 @@ let _loginManager = null;
/**
* getLoginManager:
* An abstraction over systemd/logind and ConsoleKit.
* @returns {object} - the LoginManager singleton
*
* @returns {LoginManagerSystemd | LoginManagerDummy} - the LoginManager singleton
*/
function getLoginManager() {
if (_loginManager == null) {

31
js/misc/params.js
View File

@ -1,20 +1,23 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported parse */
// parse:
// @params: caller-provided parameter object, or %null
// @defaults-provided defaults object
// @allowExtras: whether or not to allow properties not in @default
//
// Examines @params and fills in default values from @defaults for
// any properties in @defaults that don't appear in @params. If
// @allowExtras is not %true, it will throw an error if @params
// contains any properties that aren't in @defaults.
//
// If @params is %null, this returns the values from @defaults.
//
// Return value: a new object, containing the merged parameters from
// @params and @defaults
/**
* parse:
*
* @param {*} params caller-provided parameter object, or %null
* @param {*} defaults provided defaults object
* @param {boolean} [allowExtras] whether or not to allow properties not in `default`
*
* @summary Examines `params` and fills in default values from `defaults` for
* any properties in `default` that don't appear in `params`. If
* `allowExtras` is not %true, it will throw an error if `params`
* contains any properties that aren't in `defaults`.
*
* If `params` is %null, this returns the values from `defaults`.
*
* @returns a new object, containing the merged parameters from
* `params` and `defaults`
*/
function parse(params = {}, defaults, allowExtras) {
if (!allowExtras) {
for (let prop in params) {

3
js/misc/parentalControlsManager.js
View File

@ -39,6 +39,9 @@ if (HAVE_MALCONTENT) {
let _singleton = null;
/**
* @returns {ParentalControlsManager}
*/
function getDefault() {
if (_singleton === null)
_singleton = new ParentalControlsManager();

5
js/misc/permissionStore.js
View File

@ -8,6 +8,11 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
const PermissionStoreIface = loadInterfaceXML('org.freedesktop.impl.portal.PermissionStore');
const PermissionStoreProxy = Gio.DBusProxy.makeProxyWrapper(PermissionStoreIface);
/**
* @param {Function} initCallback
* @param {Gio.Cancellable} cancellable
* @returns {Gio.DBusProxy}
*/
function PermissionStore(initCallback, cancellable) {
return new PermissionStoreProxy(Gio.DBus.session,
'org.freedesktop.impl.portal.PermissionStore',

3
js/misc/smartcardManager.js
View File

@ -18,6 +18,9 @@ const SmartcardTokenIface = `
let _smartcardManager = null;
/**
* @returns {SmartcardManager}
*/
function getSmartcardManager() {
if (_smartcardManager == null)
_smartcardManager = new SmartcardManager();

3
js/misc/systemActions.js
View File

@ -30,6 +30,9 @@ const SCREENSHOT_UI_ACTION_ID = 'open-screenshot-ui';
let _singleton = null;
/**
* @returns {SystemActions}
*/
function getDefault() {
if (_singleton == null)
_singleton = new SystemActions();

182
js/misc/util.js
View File

@ -41,14 +41,17 @@ const _urlRegexp = new RegExp(
let _desktopSettings = null;
// findUrls:
// @str: string to find URLs in
//
// Searches @str for URLs and returns an array of objects with %url
// properties showing the matched URL string, and %pos properties indicating
// the position within @str where the URL was found.
//
// Return value: the list of match objects, as described above
/**
* findUrls:
*
* @param {string} str string to find URLs in
*
* Searches `str` for URLs and returns an array of objects with %url
* properties showing the matched URL string, and %pos properties indicating
* the position within `str` where the URL was found.
*
* @returns {{url: string, pos: number}[]} the list of match objects, as described above
*/
function findUrls(str) {
let res = [], match;
while ((match = _urlRegexp.exec(str)))
@ -56,11 +59,14 @@ function findUrls(str) {
return res;
}
// spawn:
// @argv: an argv array
//
// Runs @argv in the background, handling any errors that occur
// when trying to start the program.
/**
* spawn:
*
* Runs `argv` in the background, handling any errors that occur
* when trying to start the program.
*
* @param {readonly string[]} argv an argv array
*/
function spawn(argv) {
try {
trySpawn(argv);
@ -69,11 +75,14 @@ function spawn(argv) {
}
}
// spawnCommandLine:
// @commandLine: a command line
//
// Runs @commandLine in the background, handling any errors that
// occur when trying to parse or start the program.
/**
* spawnCommandLine:
*
* @param {readonly string[]} commandLine a command line
*
* Runs commandLine in the background, handling any errors that
* occur when trying to parse or start the program.
*/
function spawnCommandLine(commandLine) {
try {
let [success_, argv] = GLib.shell_parse_argv(commandLine);
@ -83,10 +92,13 @@ function spawnCommandLine(commandLine) {
}
}
// spawnApp:
// @argv: an argv array
//
// Runs @argv as if it was an application, handling startup notification
/**
* spawnApp:
*
* @param {readonly string[]} argv an argv array
*
* Runs argv as if it was an application, handling startup notification
*/
function spawnApp(argv) {
try {
let app = Gio.AppInfo.create_from_commandline(argv.join(' '), null,
@ -99,13 +111,16 @@ function spawnApp(argv) {
}
}
// trySpawn:
// @argv: an argv array
//
// Runs @argv in the background. If launching @argv fails,
// this will throw an error.
/**
* trySpawn:
*
* @param {readonly string[]} argv an argv array
*
* Runs argv in the background. If launching argv fails,
* this will throw an error.
*/
function trySpawn(argv) {
var success_, pid;
let success_, pid;
try {
[success_, pid] = GLib.spawn_async(
null, argv, null,
@ -146,11 +161,14 @@ function trySpawn(argv) {
GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, () => {});
}
// trySpawnCommandLine:
// @commandLine: a command line
//
// Runs @commandLine in the background. If launching @commandLine
// fails, this will throw an error.
/**
* trySpawnCommandLine:
*
* @param {readonly string[]} commandLine a command line
*
* Runs commandLine in the background. If launching commandLine
* fails, this will throw an error.
*/
function trySpawnCommandLine(commandLine) {
let success_, argv;
@ -171,6 +189,14 @@ function _handleSpawnError(command, err) {
Main.notifyError(title, err.message);
}
/**
* Returns an {@link St.Label} with the date passed formatted
* using {@link formatTime}
*
* @param {Date} date the date to format for the label
* @param {object} params params for {@link formatTime}
* @returns {St.Label}
*/
function createTimeLabel(date, params) {
if (_desktopSettings == null)
_desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
@ -182,20 +208,26 @@ function createTimeLabel(date, params) {
return label;
}
// lowerBound:
// @array: an array or array-like object, already sorted
// according to @cmp
// @val: the value to add
// @cmp: a comparator (or undefined to compare as numbers)
//
// Returns the position of the first element that is not
// lower than @val, according to @cmp.
// That is, returns the first position at which it
// is possible to insert @val without violating the
// order.
// This is quite like an ordinary binary search, except
// that it doesn't stop at first element comparing equal.
/**
* lowerBound:
*
* @template T, [K=T]
* @param {readonly T[]} array an array or array-like object, already sorted
* according to `cmp`
* @param {K} val the value to add
* @param {(a: T, val: K) => number} cmp a comparator (or undefined to compare as numbers)
* @returns {number}
*
* Returns the position of the first element that is not
* lower than `val`, according to `cmp`.
* That is, returns the first position at which it
* is possible to insert val without violating the
* order.
*
* This is quite like an ordinary binary search, except
* that it doesn't stop at first element comparing equal.
*/
function lowerBound(array, val, cmp) {
let min, max, mid, v;
cmp ||= (a, b) => a - b;
@ -218,14 +250,20 @@ function lowerBound(array, val, cmp) {
return min == max || cmp(array[min], val) < 0 ? max : min;
}
// insertSorted:
// @array: an array sorted according to @cmp
// @val: a value to insert
// @cmp: the sorting function
//
// Inserts @val into @array, preserving the
// sorting invariants.
// Returns the position at which it was inserted
/**
* insertSorted:
*
* @template T, [K=T]
* @param {T[]} array an array sorted according to `cmp`
* @param {K} val a value to insert
* @param {(a: T, val: K) => number} cmp the sorting function
* @returns {number}
*
* Inserts `val` into `array`, preserving the
* sorting invariants.
*
* Returns the position at which it was inserted
*/
function insertSorted(array, val, cmp) {
let pos = lowerBound(array, val, cmp);
array.splice(pos, 0, val);
@ -233,15 +271,25 @@ function insertSorted(array, val, cmp) {
return pos;
}
/**
* @param {number} start
* @param {number} end
* @param {number} progress
* @returns {number}
*/
function lerp(start, end, progress) {
return start + progress * (end - start);
}
// _GNOMEversionToNumber:
// @version: a GNOME version element
//
// Like Number() but returns sortable values for special-cases
// 'alpha' and 'beta'. Returns NaN for unhandled 'versions'.
/**
* _GNOMEversionToNumber:
*
* @param {string} version a GNOME version element
* @returns {number}
*
* Like Number() but returns sortable values for special-cases
* 'alpha' and 'beta'. Returns NaN for unhandled 'versions'.
*/
function _GNOMEversionToNumber(version) {
let ret = Number(version);
if (!isNaN(ret))
@ -253,12 +301,16 @@ function _GNOMEversionToNumber(version) {
return ret;
}
// GNOMEversionCompare:
// @version1: a string containing a GNOME version
// @version2: a string containing another GNOME version
//
// Returns an integer less than, equal to, or greater than
// zero, if version1 is older, equal or newer than version2
/**
* GNOMEversionCompare:
*
* @param {string} version1 a string containing a GNOME version
* @param {string} version2 a string containing another GNOME version
* @returns {number}
*
* Returns an integer less than, equal to, or greater than
* zero, if `version1` is older, equal or newer than `version2`
*/
function GNOMEversionCompare(version1, version2) {
const v1Array = version1.split('.');
const v2Array = version2.split('.');

1
js/ui/accessDialog.js
View File

@ -16,6 +16,7 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
const RequestIface = loadInterfaceXML('org.freedesktop.impl.portal.Request');
const AccessIface = loadInterfaceXML('org.freedesktop.impl.portal.Access');
/** @enum {number} */
var DialogResponse = {
OK: 0,
CANCEL: 1,

26
js/ui/altTab.js
View File

@ -26,6 +26,7 @@ var APP_ICON_SIZE_SMALL = 48;
const baseIconSizes = [96, 64, 48, 32, 22];
/** @enum {number} */
var AppIconMode = {
THUMBNAIL_ONLY: 1,
APP_ICON_ONLY: 2,
@ -294,27 +295,28 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
/**
* _select:
* @param {number} app: index of the app to select
* @param {number=} window: index of which of @app's windows to select
* @param {bool} forceAppFocus: optional flag, see below
*
* Selects the indicated @app, and optional @window, and sets
* @param {number} app index of the app to select
* @param {number} [window] index of which of `app`'s windows to select
* @param {boolean} [forceAppFocus] optional flag, see below
*
* Selects the indicated `app`, and optional `window`, and sets
* this._thumbnailsFocused appropriately to indicate whether the
* arrow keys should act on the app list or the thumbnail list.
*
* If @app is specified and @window is unspecified or %null, then
* If `app` is specified and `window` is unspecified or %null, then
* the app is highlighted (ie, given a light background), and the
* current thumbnail list, if any, is destroyed. If @app has
* multiple windows, and @forceAppFocus is not %true, then a
* current thumbnail list, if any, is destroyed. If `app` has
* multiple windows, and `forceAppFocus` is not %true, then a
* timeout is started to open a thumbnail list.
*
* If @app and @window are specified (and @forceAppFocus is not),
* then @app will be outlined, a thumbnail list will be created
* and focused (if it hasn't been already), and the @window'th
* If `app` and `window` are specified (and `forceAppFocus` is not),
* then `app` will be outlined, a thumbnail list will be created
* and focused (if it hasn't been already), and the `window`'th
* window in it will be highlighted.
*
* If @app and @window are specified and @forceAppFocus is %true,
* then @app will be highlighted, and @window outlined, and the
* If `app` and `window` are specified and `forceAppFocus` is %true,
* then `app` will be highlighted, and `window` outlined, and the
* app list will have the keyboard focus.
*/
_select(app, window, forceAppFocus) {

4
js/ui/appFavorites.js
View File

@ -206,6 +206,10 @@ class AppFavorites extends Signals.EventEmitter {
}
var appFavoritesInstance = null;
/**
* @returns {AppFavorites}
*/
function getAppFavorites() {
if (appFavoritesInstance == null)
appFavoritesInstance = new AppFavorites();

3
js/ui/background.js
View File

@ -229,6 +229,9 @@ var BackgroundCache = class BackgroundCache extends Signals.EventEmitter {
}
};
/**
* @returns {BackgroundCache}
*/
function getBackgroundCache() {
if (!_backgroundCache)
_backgroundCache = new BackgroundCache();

4
js/ui/backgroundMenu.js
View File

@ -24,6 +24,10 @@ var BackgroundMenu = class BackgroundMenu extends PopupMenu.PopupMenu {
}
};
/**
* @param {Meta.BackgroundActor} actor
* @param {import('./layout.js').LayoutManager} layoutManager
*/
function addBackgroundMenu(actor, layoutManager) {
actor.reactive = true;
actor._backgroundMenu = new BackgroundMenu(layoutManager);

4
js/ui/boxpointer.js
View File

@ -33,6 +33,10 @@ var POPUP_ANIMATION_TIME = 150;
var BoxPointer = GObject.registerClass({
Signals: { 'arrow-side-changed': {} },
}, class BoxPointer extends St.Widget {
/**
* @param {*} arrowSide side to draw the arrow on
* @param {*} binProperties Properties to set on contained bin
*/
_init(arrowSide, binProperties) {
super._init();

10
js/ui/calendar.js
View File

@ -109,10 +109,16 @@ var EventSourceBase = GObject.registerClass({
},
Signals: { 'changed': {} },
}, class EventSourceBase extends GObject.Object {
/**
* @returns {boolean}
*/
get isLoading() {
throw new GObject.NotImplementedError(`isLoading in ${this.constructor.name}`);
}
/**
* @returns {boolean}
*/
get hasCalendars() {
throw new GObject.NotImplementedError(`hasCalendars in ${this.constructor.name}`);
}
@ -128,6 +134,10 @@ var EventSourceBase = GObject.registerClass({
throw new GObject.NotImplementedError(`getEvents in ${this.constructor.name}`);
}
/**
* @param {Date} _day
* @returns {boolean}
*/
hasEvents(_day) {
throw new GObject.NotImplementedError(`hasEvents in ${this.constructor.name}`);
}

1
js/ui/components/autorunManager.js
View File

@ -21,6 +21,7 @@ const SETTING_START_APP = 'autorun-x-content-start-app';
const SETTING_IGNORE = 'autorun-x-content-ignore';
const SETTING_OPEN_FOLDER = 'autorun-x-content-open-folder';
/** @enum {number} */
var AutorunSetting = {
RUN: 0,
IGNORE: 1,

1
js/ui/components/polkitAgent.js
View File

@ -18,6 +18,7 @@ const ShellEntry = imports.ui.shellEntry;
const UserWidget = imports.ui.userWidget;
const {wiggle} = imports.misc.animationUtils;
/** @enum {number} */
const DialogMode = {
AUTH: 0,
CONFIRM: 1,

3
js/ui/dash.js
View File

@ -21,6 +21,9 @@ var DASH_ITEM_LABEL_SHOW_TIME = 150;
var DASH_ITEM_LABEL_HIDE_TIME = 100;
var DASH_ITEM_HOVER_TIMEOUT = 300;
/**
* @param {AppDisplay.AppIcon} source
*/
function getAppFromSource(source) {
if (source instanceof AppDisplay.AppIcon)
return source.app;

23
js/ui/dnd.js
View File

@ -18,14 +18,16 @@ var SNAP_BACK_ANIMATION_TIME = 250;
// Time to animate to original position on success
var REVERT_ANIMATION_TIME = 750;
var DragMotionResult = {
/** @enum {number} */
varragMotionResult = {
NO_DROP: 0,
COPY_DROP: 1,
MOVE_DROP: 2,
CONTINUE: 3,
};
var DragState = {
/** @enum {number} */
varragState = {
INIT: 0,
DRAGGING: 1,
CANCELLED: 2,
@ -69,10 +71,21 @@ function _getRealActorScale(actor) {
return scale;
}
/**
* @typedef {object} DragMonitor
* @property {Function} dragMotion
*/
/**
* @param {DragMonitor} monitor
*/
function addDragMonitor(monitor) {
dragMonitors.push(monitor);
}
/**
* @param {DragMonitor} monitor
*/
function removeDragMonitor(monitor) {
for (let i = 0; i < dragMonitors.length; i++) {
if (dragMonitors[i] == monitor) {
@ -857,9 +870,9 @@ var _Draggable = class _Draggable extends Signals.EventEmitter {
/**
* makeDraggable:
* @param {Clutter.Actor} actor: Source actor
* @param {Object=} params: Additional parameters
* @returns {Object} a new Draggable
* @param {Clutter.Actor} actor Source actor
* @param {object} [params] Additional parameters
* @returns {_Draggable} a new Draggable
*
* Create an object which controls drag and drop for the given actor.
*

3
js/ui/extensionDownloader.js
View File

@ -60,6 +60,9 @@ async function installExtension(uuid, invocation) {
dialog.open(global.get_current_time());
}
/**
* @param {string} uuid
*/
function uninstallExtension(uuid) {
let extension = Main.extensionManager.lookup(uuid);
if (!extension)

28
js/ui/grabHelper.js
View File

@ -7,18 +7,22 @@ const St = imports.gi.St;
const Main = imports.ui.main;
const Params = imports.misc.params;
// GrabHelper:
// @owner: the actor that owns the GrabHelper
// @params: optional parameters to pass to Main.pushModal()
//
// Creates a new GrabHelper object, for dealing with keyboard and pointer grabs
// associated with a set of actors.
//
// Note that the grab can be automatically dropped at any time by the user, and
// your code just needs to deal with it; you shouldn't adjust behavior directly
// after you call ungrab(), but instead pass an 'onUngrab' callback when you
// call grab().
var GrabHelper = class GrabHelper {
/**
* GrabHelper:
*
* Creates a new GrabHelper object, for dealing with keyboard and pointer grabs
* associated with a set of actors.
*
* Note that the grab can be automatically dropped at any time by the user, and
* your code just needs to deal with it; you shouldn't adjust behavior directly
* after you call ungrab(), but instead pass an 'onUngrab' callback when you
* call grab().
*/
class GrabHelper {
/**
* @param {Clutter.Actor} owner the actor that owns the GrabHelper
* @param {*} params optional parameters to pass to Main.pushModal()
*/
constructor(owner, params) {
if (!(owner instanceof Clutter.Actor))
throw new Error('GrabHelper owner must be a Clutter.Actor');

136
js/ui/iconGrid.js
View File

@ -15,6 +15,7 @@ var ICON_SIZE = 96;
var PAGE_SWITCH_TIME = 300;
/** @enum {number} */
var IconSize = {
LARGE: 96,
MEDIUM: 64,
@ -51,6 +52,7 @@ const defaultGridModes = [
var LEFT_DIVIDER_LEEWAY = 20;
var RIGHT_DIVIDER_LEEWAY = 20;
/** @enum {number} */
var DragLocation = {
INVALID: 0,
START_EDGE: 1,
@ -174,6 +176,9 @@ class BaseIcon extends Shell.SquareBin {
}
});
/**
* @param {Clutter.Actor} actor
*/
function zoomOutActor(actor) {
let [x, y] = actor.get_transformed_position();
zoomOutActorAtPos(actor, x, y);
@ -818,16 +823,17 @@ var IconGridLayout = GObject.registerClass({
/**
* addItem:
* @param {Clutter.Actor} item: item to append to the grid
* @param {int} page: page number
* @param {int} index: position in the page
*
* Adds @item to the grid. @item must not be part of the grid.
* @param {Clutter.Actor} item item to append to the grid
* @param {number} page page number
* @param {number} index position in the page
*
* If @index exceeds the number of items per page, @item will
* Adds `item` to the grid. `item` must not be part of the grid.
*
* If `index` exceeds the number of items per page, `item` will
* be added to the next page.
*
* @page must be a number between 0 and the number of pages.
* `page` must be a number between 0 and the number of pages.
* Adding to the page after next will create a new page.
*/
addItem(item, page = -1, index = -1) {
@ -851,7 +857,8 @@ var IconGridLayout = GObject.registerClass({
/**
* appendItem:
* @param {Clutter.Actor} item: item to append to the grid
*
* @param {Clutter.Actor} item item to append to the grid
*
* Appends @item to the grid. @item must not be part of the grid.
*/
@ -861,11 +868,12 @@ var IconGridLayout = GObject.registerClass({
/**
* moveItem:
* @param {Clutter.Actor} item: item to move
* @param {int} newPage: new page of the item
* @param {int} newPosition: new page of the item
*
* Moves @item to the grid. @item must be part of the grid.
* @param {Clutter.Actor} item item to move
* @param {number} newPage new page of the item
* @param {number} newPosition new page of the item
*
* Moves `item` to the grid. `item` must be part of the grid.
*/
moveItem(item, newPage, newPosition) {
if (!this._items.has(item))
@ -883,9 +891,10 @@ var IconGridLayout = GObject.registerClass({
/**
* removeItem:
* @param {Clutter.Actor} item: item to remove from the grid
*
* Removes @item to the grid. @item must be part of the grid.
* @param {Clutter.Actor} item item to remove from the grid
*
* Removes `item` to the grid. `item` must be part of the grid.
*/
removeItem(item) {
if (!this._items.has(item))
@ -902,7 +911,8 @@ var IconGridLayout = GObject.registerClass({
/**
* getItemsAtPage:
* @param {int} pageIndex: page index
*
* @param {number} pageIndex page index
*
* Retrieves the children at page @pageIndex. Children may be invisible.
*
@ -917,12 +927,12 @@ var IconGridLayout = GObject.registerClass({
/**
* getItemPosition:
* @param {BaseIcon} item: the item
*
* Retrieves the position of @item is its page, or -1 if @item is not
* Retrieves the position of `item` is its page, or -1 if `item` is not
* part of the grid.
*
* @returns {[int, int]} the page and position of @item
* @param {BaseIcon} item the item
* @returns {[number, number]} the page and position of `item`
*/
getItemPosition(item) {
if (!this._items.has(item))
@ -936,11 +946,12 @@ var IconGridLayout = GObject.registerClass({
/**
* getItemAt:
* @param {int} page: the page
* @param {int} position: the position in page
*
* Retrieves the item at @page and @position.
*
* @param {number} page the page
* @param {number} position the position in page
*
* @returns {BaseItem} the item at @page and @position, or null
*/
getItemAt(page, position) {
@ -957,11 +968,12 @@ var IconGridLayout = GObject.registerClass({
/**
* getItemPage:
* @param {BaseIcon} item: the item
*
* Retrieves the page @item is in, or -1 if @item is not part of the grid.
* Retrieves the page `item` is in, or -1 if `item` is not part of the grid.
*
* @returns {int} the page where @item is in
* @param {BaseIcon} item the item
*
* @returns {number} the page where `item` is in
*/
getItemPage(item) {
if (!this._items.has(item))
@ -1010,14 +1022,15 @@ var IconGridLayout = GObject.registerClass({
/**
* getDropTarget:
* @param {int} x: position of the horizontal axis
* @param {int} y: position of the vertical axis
*
* Retrieves the item located at (@x, @y), as well as the drag location.
* Both @x and @y are relative to the grid.
* Retrieves the item located at (`x`, `y`), as well as the drag location.
* Both `x` and `y` are relative to the grid.
*
* @returns {[Clutter.Actor, DragLocation]} the item and drag location
* under (@x, @y)
* @param {number} x position of the horizontal axis
* @param {number} y position of the vertical axis
*
* @returns {[BaseIcon | null, DragLocation]} the item and drag location
* under (`x`, `y`)
*/
getDropTarget(x, y) {
const childSize = this._getChildrenMaxSize();
@ -1269,16 +1282,17 @@ var IconGrid = GObject.registerClass({
/**
* addItem:
* @param {Clutter.Actor} item: item to append to the grid
* @param {int} page: page number
* @param {int} index: position in the page
*
* Adds @item to the grid. @item must not be part of the grid.
* @param {BaseItem} item item to append to the grid
* @param {number} page page number
* @param {number} index position in the page
*
* If @index exceeds the number of items per page, @item will
* Adds `item` to the grid. `item` must not be part of the grid.
*
* If `index` exceeds the number of items per page, `item` will
* be added to the next page.
*
* @page must be a number between 0 and the number of pages.
* `page` must be a number between 0 and the number of pages.
* Adding to the page after next will create a new page.
*/
addItem(item, page = -1, index = -1) {
@ -1290,9 +1304,10 @@ var IconGrid = GObject.registerClass({
/**
* appendItem:
* @param {Clutter.Actor} item: item to append to the grid
*
* Appends @item to the grid. @item must not be part of the grid.
* @param {Clutter.Actor} item item to append to the grid
*
* Appends `item` to the grid. `item` must not be part of the grid.
*/
appendItem(item) {
this.layout_manager.appendItem(item);
@ -1300,11 +1315,12 @@ var IconGrid = GObject.registerClass({
/**
* moveItem:
* @param {Clutter.Actor} item: item to move
* @param {int} newPage: new page of the item
* @param {int} newPosition: new page of the item
*
* Moves @item to the grid. @item must be part of the grid.
* Moves `item` to the grid. `item` must be part of the grid.
*
* @param {Clutter.Actor} item item to move
* @param {number} newPage new page of the item
* @param {number} newPosition new page of the item
*/
moveItem(item, newPage, newPosition) {
this.layout_manager.moveItem(item, newPage, newPosition);
@ -1313,9 +1329,10 @@ var IconGrid = GObject.registerClass({
/**
* removeItem:
* @param {Clutter.Actor} item: item to remove from the grid
*
* Removes @item to the grid. @item must be part of the grid.
* Removes `item` to the grid. `item` must be part of the grid.
*
* @param {Clutter.Actor} item item to remove from the grid
*/
removeItem(item) {
if (!this.contains(item))
@ -1326,11 +1343,12 @@ var IconGrid = GObject.registerClass({
/**
* goToPage:
* @param {int} pageIndex: page index
* @param {boolean} animate: animate the page transition
*
* Moves the current page to @pageIndex. @pageIndex must be a valid page
* Moves the current page to `pageIndex`. `pageIndex` must be a valid page
* number.
*
* @param {number} pageIndex page index
* @param {boolean} animate animate the page transition
*/
goToPage(pageIndex, animate = true) {
if (pageIndex >= this.nPages)
@ -1366,11 +1384,12 @@ var IconGrid = GObject.registerClass({
/**
* getItemPage:
* @param {BaseIcon} item: the item
*
* Retrieves the page @item is in, or -1 if @item is not part of the grid.
* Retrieves the page `item` is in, or -1 if `item` is not part of the grid.
*
* @returns {int} the page where @item is in
* @param {BaseIcon} item the item
*
* @returns {number} the page where `item` is in
*/
getItemPage(item) {
return this.layout_manager.getItemPage(item);
@ -1378,12 +1397,13 @@ var IconGrid = GObject.registerClass({
/**
* getItemPosition:
* @param {BaseIcon} item: the item
*
* Retrieves the position of @item is its page, or -1 if @item is not
* Retrieves the position of `item` is its page, or -1 if `item` is not
* part of the grid.
*
* @returns {[int, int]} the page and position of @item
* @param {BaseIcon} item the item
*
* @returns {[number, number]} the page and position of `item`
*/
getItemPosition(item) {
if (!this.contains(item))
@ -1395,12 +1415,13 @@ var IconGrid = GObject.registerClass({
/**
* getItemAt:
* @param {int} page: the page
* @param {int} position: the position in page
*
* Retrieves the item at @page and @position.
* Retrieves the item at `page` and `position`.
*
* @returns {BaseItem} the item at @page and @position, or null
* @param {number} page the page
* @param {number} position the position in page
*
* @returns {BaseItem} the item at `page` and `position`, or null
*/
getItemAt(page, position) {
const layoutManager = this.layout_manager;
@ -1409,9 +1430,10 @@ var IconGrid = GObject.registerClass({
/**
* getItemsAtPage:
* @param {int} page: the page index
*
* Retrieves the children at page @page, including invisible children.
* Retrieves the children at page `page`, including invisible children.
*
* @param {number} page the page index
*
* @returns {Array} an array of {Clutter.Actor}s
*/

47
js/ui/lightbox.js
View File

@ -88,27 +88,6 @@ var RadialShaderEffect = GObject.registerClass({
/**
* Lightbox:
* @container: parent Clutter.Container
* @params: (optional) additional parameters:
* - inhibitEvents: whether to inhibit events for @container
* - width: shade actor width
* - height: shade actor height
* - fadeFactor: fading opacity factor
* - radialEffect: whether to enable the GLSL radial effect
*
* Lightbox creates a dark translucent "shade" actor to hide the
* contents of @container, and allows you to specify particular actors
* in @container to highlight by bringing them above the shade. It
* tracks added and removed actors in @container while the lightboxing
* is active, and ensures that all actors are returned to their
* original stacking order when the lightboxing is removed. (However,
* if actors are restacked by outside code while the lightboxing is
* active, the lightbox may later revert them back to their original
* order.)
*
* By default, the shade window will have the height and width of
* @container and will track any changes in its size. You can override
* this by passing an explicit width and height in @params.
*/
var Lightbox = GObject.registerClass({
Properties: {
@ -116,6 +95,29 @@ var Lightbox = GObject.registerClass({
'active', 'active', 'active', GObject.ParamFlags.READABLE, false),
},
}, class Lightbox extends St.Bin {
/**
* Lightbox creates a dark translucent "shade" actor to hide the
* contents of `container`, and allows you to specify particular actors
* in `container` to highlight by bringing them above the shade. It
* tracks added and removed actors in `container` while the lightboxing
* is active, and ensures that all actors are returned to their
* original stacking order when the lightboxing is removed. (However,
* if actors are restacked by outside code while the lightboxing is
* active, the lightbox may later revert them back to their original
* order.)
*
* By default, the shade window will have the height and width of
* `container` and will track any changes in its size. You can override
* this by passing an explicit width and height in `params`.
*
* @param {Clutter.Container} container parent Clutter.Container
* @param {object} [params] additional parameters:
* @param {boolean=} params.inhibitEvents: whether to inhibit events for `container`
* @param {number=} params.width: shade actor width
* @param {number=} params.height: shade actor height
* @param {number=} params.fadeFactor: fading opacity factor
* @param {boolean=} params.radialEffect: whether to enable the GLSL radial effect
*/
_init(container, params) {
params = Params.parse(params, {
inhibitEvents: false,
@ -251,11 +253,12 @@ var Lightbox = GObject.registerClass({
/**
* highlight:
* @param {Clutter.Actor=} window: actor to highlight
*
* Highlights the indicated actor and unhighlights any other
* currently-highlighted actor. With no arguments or a false/null
* argument, all actors will be unhighlighted.
*
* @param {Clutter.Actor=} window actor to highlight
*/
highlight(window) {
if (this._highlighted == window)

188
js/ui/magnifier.js
View File

@ -169,7 +169,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* setActive:
* Show/hide all the zoom regions.
* @param {bool} activate: Boolean to activate or de-activate the magnifier.
*
* @param {boolean} activate Boolean to activate or de-activate the magnifier.
*/
setActive(activate) {
let isActive = this.isActive();
@ -208,7 +209,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* isActive:
* @returns {bool} Whether the magnifier is active.
*
* @returns {boolean} Whether the magnifier is active.
*/
isActive() {
// Sufficient to check one ZoomRegion since Magnifier's active
@ -245,7 +247,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* isTrackingMouse:
* @returns {bool} whether the magnifier is currently tracking the mouse
*
* @returns {boolean} whether the magnifier is currently tracking the mouse
*/
isTrackingMouse() {
return !!this._mouseTrackingId;
@ -255,6 +258,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
* scrollToMousePos:
* Position all zoom regions' ROI relative to the current location of the
* system pointer.
*
* @param {[xMouse: number, yMouse: number] | []} args
*/
scrollToMousePos(...args) {
const [xMouse, yMouse] = args.length ? args : global.get_pointer();
@ -279,15 +284,16 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* createZoomRegion:
* Create a ZoomRegion instance with the given properties.
* @param {number} xMagFactor:
*
* @param {number} xMagFactor
* The power to set horizontal magnification of the ZoomRegion. A value
* of 1.0 means no magnification, a value of 2.0 doubles the size.
* @param {number} yMagFactor:
* @param {number} yMagFactor
* The power to set the vertical magnification of the ZoomRegion.
* @param {{x: number, y: number, width: number, height: number}} roi:
* @param {{x: number, y: number, width: number, height: number}} roi
* The reg Object that defines the region to magnify, given in
* unmagnified coordinates.
* @param {{x: number, y: number, width: number, height: number}} viewPort:
* @param {{x: number, y: number, width: number, height: number}} viewPort
* Object that defines the position of the ZoomRegion on screen.
* @returns {ZoomRegion} the newly created ZoomRegion.
*/
@ -309,7 +315,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
* addZoomRegion:
* Append the given ZoomRegion to the list of currently defined ZoomRegions
* for this Magnifier instance.
* @param {ZoomRegion} zoomRegion: The zoomRegion to add.
*
* @param {ZoomRegion} zoomRegion The zoomRegion to add.
*/
addZoomRegion(zoomRegion) {
if (zoomRegion) {
@ -322,7 +329,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* getZoomRegions:
* Return a list of ZoomRegion's for this Magnifier.
* @returns {number[]} The Magnifier's zoom region list.
*
* @returns {ZoomRegion[]} The Magnifier's zoom region list.
*/
getZoomRegions() {
return this._zoomRegions;
@ -369,8 +377,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* setCrosshairsVisible:
* Show or hide the cross hair.
* @param {bool} visible: Flag that indicates show (true) or hide (false).
*
* Show or hide the cross hair
*
* @param {boolean} visible Flag that indicates show (true) or hide (false).
*/
setCrosshairsVisible(visible) {
if (visible) {
@ -386,8 +396,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* setCrosshairsColor:
*
* Set the color of the crosshairs for all ZoomRegions.
* @param {string} color: The color as a string, e.g. '#ff0000ff' or 'red'.
*
* @param {string} color The color as a string, e.g. '#ff0000ff' or 'red'.
*/
setCrosshairsColor(color) {
if (this._crossHairs) {
@ -399,6 +411,7 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* getCrosshairsColor:
* Get the color of the crosshairs.
*
* @returns {string} The color as a string, e.g. '#0000ffff' or 'blue'.
*/
getCrosshairsColor() {
@ -412,8 +425,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* setCrosshairsThickness:
*
* Set the crosshairs thickness for all ZoomRegions.
* @param {number} thickness: The width of the vertical and
*
* @param {number} thickness The width of the vertical and
* horizontal lines of the crosshairs.
*/
setCrosshairsThickness(thickness) {
@ -424,6 +439,7 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* getCrosshairsThickness:
* Get the crosshairs thickness.
*
* @returns {number} The width of the vertical and horizontal
* lines of the crosshairs.
*/
@ -436,7 +452,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* setCrosshairsOpacity:
* @param {number} opacity: Value between 0.0 (transparent)
*
* @param {number} opacity Value between 0.0 (transparent)
* and 1.0 (fully opaque).
*/
setCrosshairsOpacity(opacity) {
@ -457,8 +474,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* setCrosshairsLength:
*
* Set the crosshairs length for all ZoomRegions.
* @param {number} length: The length of the vertical and horizontal
*
* @param {number} length The length of the vertical and horizontal
* lines making up the crosshairs.
*/
setCrosshairsLength(length) {
@ -471,6 +490,7 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* getCrosshairsLength:
* Get the crosshairs length.
*
* @returns {number} The length of the vertical and horizontal
* lines making up the crosshairs.
*/
@ -483,8 +503,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* setCrosshairsClip:
*
* Set whether the crosshairs are clipped at their intersection.
* @param {bool} clip: Flag to indicate whether to clip the crosshairs.
*
* @param {boolean} clip Flag to indicate whether to clip the crosshairs.
*/
setCrosshairsClip(clip) {
if (!this._crossHairs)
@ -497,7 +519,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
/**
* getCrosshairsClip:
* Get whether the crosshairs are clipped by the mouse image.
* @returns {bool} Whether the crosshairs are clipped.
*
* @returns {boolean} Whether the crosshairs are clipped.
*/
getCrosshairsClip() {
if (this._crossHairs) {
@ -933,7 +956,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setActive:
* @param {bool} activate: Boolean to show/hide the ZoomRegion.
*
* @param {boolean} activate Boolean to show/hide the ZoomRegion.
*/
setActive(activate) {
if (activate == this.isActive())
@ -960,7 +984,8 @@ var ZoomRegion = class ZoomRegion {
/**
* isActive:
* @returns {bool} Whether this ZoomRegion is active
*
* @returns {boolean} Whether this ZoomRegion is active
*/
isActive() {
return this._magView != null;
@ -968,10 +993,11 @@ var ZoomRegion = class ZoomRegion {
/**
* setMagFactor:
* @param {number} xMagFactor: The power to set the horizontal
*
* @param {number} xMagFactor The power to set the horizontal
* magnification factor to of the magnified view. A value of 1.0
* means no magnification. A value of 2.0 doubles the size.
* @param {number} yMagFactor: The power to set the vertical
* @param {number} yMagFactor The power to set the vertical
* magnification factor to of the magnified view.
*/
setMagFactor(xMagFactor, yMagFactor) {
@ -985,6 +1011,7 @@ var ZoomRegion = class ZoomRegion {
/**
* getMagFactor:
*
* @returns {number[]} an array, [xMagFactor, yMagFactor], containing
* the horizontal and vertical magnification powers. A value of
* 1.0 means no magnification. A value of 2.0 means the contents
@ -996,7 +1023,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setMouseTrackingMode
* @param {GDesktopEnums.MagnifierMouseTrackingMode} mode: the new mode
*
* @param {GDesktopEnums.MagnifierMouseTrackingMode} mode the new mode
*/
setMouseTrackingMode(mode) {
if (mode >= GDesktopEnums.MagnifierMouseTrackingMode.NONE &&
@ -1005,7 +1033,8 @@ var ZoomRegion = class ZoomRegion {
}
/**
* getMouseTrackingMode
* getMouseTrackingMode:
*
* @returns {GDesktopEnums.MagnifierMouseTrackingMode} the current mode
*/
getMouseTrackingMode() {
@ -1014,7 +1043,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setFocusTrackingMode
* @param {GDesktopEnums.MagnifierFocusTrackingMode} mode: the new mode
*
* @param {GDesktopEnums.MagnifierFocusTrackingMode} mode the new mode
*/
setFocusTrackingMode(mode) {
this._focusTrackingMode = mode;
@ -1023,7 +1053,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setCaretTrackingMode
* @param {GDesktopEnums.MagnifierCaretTrackingMode} mode: the new mode
*
* @param {GDesktopEnums.MagnifierCaretTrackingMode} mode the new mode
*/
setCaretTrackingMode(mode) {
this._caretTrackingMode = mode;
@ -1053,7 +1084,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setViewPort
* Sets the position and size of the ZoomRegion on screen.
* @param {{x: number, y: number, width: number, height: number}} viewPort:
*
* @param {{x: number, y: number, width: number, height: number}} viewPort
* Object defining the position and size of the view port.
* The values are in stage coordinate space.
*/
@ -1065,7 +1097,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setROI
* Sets the "region of interest" that the ZoomRegion is magnifying.
* @param {{x: number, y: number, width: number, height: number}} roi:
*
* @param {{x: number, y: number, width: number, height: number}} roi
* Object that defines the region of the screen to magnify.
* The values are in screen (unmagnified) coordinate space.
*/
@ -1087,6 +1120,7 @@ var ZoomRegion = class ZoomRegion {
* Retrieves the "region of interest" -- the rectangular bounds of that part
* of the desktop that the magnified view is showing (x, y, width, height).
* The bounds are given in non-magnified coordinates.
*
* @returns {number[]} an array, [x, y, width, height], representing
* the bounding rectangle of what is shown in the magnified view.
*/
@ -1103,9 +1137,11 @@ var ZoomRegion = class ZoomRegion {
/**
* setLensMode:
* Turn lens mode on/off. In full screen mode, lens mode does nothing since
*
* Turn lens mode on/off. In full screen mode, lens mode does nothing since
* a lens the size of the screen is pointless.
* @param {bool} lensMode: Whether lensMode should be active
*
* @param {boolean} lensMode Whether lensMode should be active
*/
setLensMode(lensMode) {
this._lensMode = lensMode;
@ -1116,7 +1152,8 @@ var ZoomRegion = class ZoomRegion {
/**
* isLensMode:
* Is lens mode on or off?
* @returns {bool} The lens mode state.
*
* @returns {boolean} The lens mode state.
*/
isLensMode() {
return this._lensMode;
@ -1126,7 +1163,8 @@ var ZoomRegion = class ZoomRegion {
* setClampScrollingAtEdges:
* Stop vs. allow scrolling of the magnified contents when it scroll beyond
* the edges of the screen.
* @param {bool} clamp: Boolean to turn on/off clamping.
*
* @param {boolean} clamp Boolean to turn on/off clamping.
*/
setClampScrollingAtEdges(clamp) {
this._clampScrollingAtEdges = clamp;
@ -1210,7 +1248,8 @@ var ZoomRegion = class ZoomRegion {
* setScreenPosition:
* Positions the zoom region to one of the enumerated positions on the
* screen.
* @param {GDesktopEnums.MagnifierScreenPosition} inPosition: the position
*
* @param {GDesktopEnums.MagnifierScreenPosition} inPosition the position
*/
setScreenPosition(inPosition) {
switch (inPosition) {
@ -1236,7 +1275,8 @@ var ZoomRegion = class ZoomRegion {
* getScreenPosition:
* Tell the outside world what the current mode is -- magnifiying the
* top half, bottom half, etc.
* @returns {GDesktopEnums.MagnifierScreenPosition}: the current position.
*
* @returns {GDesktopEnums.MagnifierScreenPosition}: the current position.
*/
getScreenPosition() {
return this._screenPosition;
@ -1252,7 +1292,8 @@ var ZoomRegion = class ZoomRegion {
/**
* scrollToMousePos:
* Set the region of interest based on the position of the system pointer.
* @returns {bool}: Whether the system mouse pointer is over the
*
* @returns {boolean}: Whether the system mouse pointer is over the
* magnified view.
*/
scrollToMousePos() {
@ -1293,8 +1334,9 @@ var ZoomRegion = class ZoomRegion {
* scrollContentsTo:
* Shift the contents of the magnified view such it is centered on the given
* coordinate.
* @param {number} x: The x-coord of the point to center on.
* @param {number} y: The y-coord of the point to center on.
*
* @param {number} x The x-coord of the point to center on.
* @param {number} y The y-coord of the point to center on.
*/
scrollContentsTo(x, y) {
if (x < 0 || x > global.screen_width ||
@ -1314,7 +1356,8 @@ var ZoomRegion = class ZoomRegion {
/**
* addCrosshairs:
* Add crosshairs centered on the magnified mouse.
* @param {Crosshairs} crossHairs: Crosshairs instance
*
* @param {Crosshairs} crossHairs Crosshairs instance
*/
addCrosshairs(crossHairs) {
this._crossHairs = crossHairs;
@ -1328,7 +1371,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setInvertLightness:
* Set whether to invert the lightness of the magnified view.
* @param {bool} flag: whether brightness should be inverted
*
* @param {boolean} flag whether brightness should be inverted
*/
setInvertLightness(flag) {
this._invertLightness = flag;
@ -1338,8 +1382,10 @@ var ZoomRegion = class ZoomRegion {
/**
* getInvertLightness:
*
* Retrieve whether the lightness is inverted.
* @returns {bool} whether brightness should be inverted
*
* @returns {boolean} whether brightness should be inverted
*/
getInvertLightness() {
return this._invertLightness;
@ -1347,8 +1393,10 @@ var ZoomRegion = class ZoomRegion {
/**
* setColorSaturation:
*
* Set the color saturation of the magnified view.
* @param {number} saturation: A value from 0.0 to 1.0 that defines
*
* @param {number} saturation A value from 0.0 to 1.0 that defines
* the color saturation, with 0.0 defining no color (grayscale),
* and 1.0 defining full color.
*/
@ -1361,7 +1409,8 @@ var ZoomRegion = class ZoomRegion {
/**
* getColorSaturation:
* Retrieve the color saturation of the magnified view.
* @returns {number} the color saturation
*
* @returns {number} the color saturation
*/
getColorSaturation() {
return this._colorSaturation;
@ -1370,7 +1419,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setBrightness:
* Alter the brightness of the magnified view.
* @param {Object} brightness: Object containing the contrast for the
*
* @param {object} brightness Object containing the contrast for the
* red, green, and blue channels. Values of 0.0 represent "standard"
* brightness (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed brightness, respectively.
@ -1390,7 +1440,8 @@ var ZoomRegion = class ZoomRegion {
/**
* setContrast:
* Alter the contrast of the magnified view.
* @param {Object} contrast: Object containing the contrast for the
*
* @param {object} contrast Object containing the contrast for the
* red, green, and blue channels. Values of 0.0 represent "standard"
* contrast (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed contrast, respectively.
@ -1410,7 +1461,8 @@ var ZoomRegion = class ZoomRegion {
/**
* getContrast:
* Retrieve the contrast of the magnified view.
* @returns {{r: number, g: number, b: number}}: Object containing
*
* @returns {{r: number, g: number, b: number}}: Object containing
* the contrast for the red, green, and blue channels.
*/
getContrast() {
@ -1768,7 +1820,7 @@ var ZoomRegion = class ZoomRegion {
this._background.set_size(global.screen_width, global.screen_height);
this._updateScreenPosition();
}
};
}
var Crosshairs = GObject.registerClass(
class Crosshairs extends Clutter.Actor {
@ -1819,9 +1871,10 @@ class Crosshairs extends Clutter.Actor {
* already part of some other ZoomRegion, create a clone of the crosshairs
* actor, and add the clone instead. Returns either the original or the
* clone.
* @param {ZoomRegion} zoomRegion: The container to add the crosshairs
*
* @param {ZoomRegion} zoomRegion The container to add the crosshairs
* group to.
* @param {Clutter.Actor} magnifiedMouse: The mouse actor for the
* @param {Clutter.Actor} magnifiedMouse The mouse actor for the
* zoom region -- used to position the crosshairs and properly
* layer them below the mouse.
* @returns {Clutter.Actor} The crosshairs actor, or its clone.
@ -1853,10 +1906,12 @@ class Crosshairs extends Clutter.Actor {
/**
* removeFromParent:
* @param {Clutter.Actor} childActor: the actor returned from
* addToZoomRegion
*
* Remove the crosshairs actor from its parent container, or destroy the
* child actor if it was just a clone of the crosshairs actor.
*
* @param {Clutter.Actor} childActor the actor returned from
* addToZoomRegion
*/
removeFromParent(childActor) {
if (childActor == this)
@ -1868,7 +1923,8 @@ class Crosshairs extends Clutter.Actor {
/**
* setColor:
* Set the color of the crosshairs.
* @param {Clutter.Color} clutterColor: The color
*
* @param {Clutter.Color} clutterColor The color
*/
setColor(clutterColor) {
this._horizLeftHair.background_color = clutterColor;
@ -1880,6 +1936,7 @@ class Crosshairs extends Clutter.Actor {
/**
* getColor:
* Get the color of the crosshairs.
*
* @returns {ClutterColor} the crosshairs color
*/
getColor() {
@ -1888,8 +1945,10 @@ class Crosshairs extends Clutter.Actor {
/**
* setThickness:
*
* Set the width of the vertical and horizontal lines of the crosshairs.
* @param {number} thickness: the new thickness value
*
* @param {number} thickness the new thickness value
*/
setThickness(thickness) {
this._horizLeftHair.set_height(thickness);
@ -1902,6 +1961,7 @@ class Crosshairs extends Clutter.Actor {
/**
* getThickness:
* Get the width of the vertical and horizontal lines of the crosshairs.
*
* @returns {number} The thickness of the crosshairs.
*/
getThickness() {
@ -1911,7 +1971,8 @@ class Crosshairs extends Clutter.Actor {
/**
* setOpacity:
* Set how opaque the crosshairs are.
* @param {number} opacity: Value between 0 (fully transparent)
*
* @param {number} opacity Value between 0 (fully transparent)
* and 255 (full opaque).
*/
setOpacity(opacity) {
@ -1931,7 +1992,8 @@ class Crosshairs extends Clutter.Actor {
/**
* setLength:
* Set the length of the vertical and horizontal lines in the crosshairs.
* @param {number} length: The length of the crosshairs.
*
* @param {number} length The length of the crosshairs.
*/
setLength(length) {
this._horizLeftHair.set_width(length);
@ -1944,6 +2006,7 @@ class Crosshairs extends Clutter.Actor {
/**
* getLength:
* Get the length of the vertical and horizontal lines in the crosshairs.
*
* @returns {number} The length of the crosshairs.
*/
getLength() {
@ -1954,7 +2017,8 @@ class Crosshairs extends Clutter.Actor {
* setClip:
* Set the width and height of the rectangle that clips the crosshairs at
* their intersection
* @param {number[]} size: Array of [width, height] defining the size
*
* @param {[number, number]} size Array of [width, height] defining the size
* of the clip rectangle.
*/
setClip(size) {
@ -1975,7 +2039,8 @@ class Crosshairs extends Clutter.Actor {
* Reposition the horizontal and vertical hairs such that they cross at
* the center of crosshairs group. If called with the dimensions of
* the clip rectangle, these are used to update the size of the clip.
* @param {number[]=} clipSize: If present, the clip's [width, height].
*
* @param {[number, number]} [clipSize] If present, the clip's [width, height].
*/
reCenter(clipSize) {
let [groupWidth, groupHeight] = this.get_size();
@ -2000,7 +2065,7 @@ class Crosshairs extends Clutter.Actor {
}
});
var MagShaderEffects = class MagShaderEffects {
class MagShaderEffects {
constructor(uiGroupClone) {
this._inverse = new Shell.InvertLightnessEffect();
this._brightnessContrast = new Clutter.BrightnessContrastEffect();
@ -2032,7 +2097,8 @@ var MagShaderEffects = class MagShaderEffects {
/**
* setInvertLightness:
* Enable/disable invert lightness effect.
* @param {bool} invertFlag: Enabled flag.
*
* @param {boolean} invertFlag Enabled flag.
*/
setInvertLightness(invertFlag) {
this._inverse.set_enabled(invertFlag);
@ -2046,7 +2112,8 @@ var MagShaderEffects = class MagShaderEffects {
/**
* setBrightness:
* Set the brightness of the magnified view.
* @param {Object} brightness: Object containing the contrast for the
*
* @param {object} brightness Object containing the contrast for the
* red, green, and blue channels. Values of 0.0 represent "standard"
* brightness (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed brightness, respectively.
@ -2071,7 +2138,8 @@ var MagShaderEffects = class MagShaderEffects {
/**
* Set the contrast of the magnified view.
* @param {Object} contrast: Object containing the contrast for the
*
* @param {object} contrast Object containing the contrast for the
* red, green, and blue channels. Values of 0.0 represent "standard"
* contrast (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed contrast, respectively.
@ -2096,4 +2164,4 @@ var MagShaderEffects = class MagShaderEffects {
cRed !== NO_CHANGE || cGreen !== NO_CHANGE || cBlue !== NO_CHANGE ||
bRed !== NO_CHANGE || bGreen !== NO_CHANGE || bBlue !== NO_CHANGE);
}
};
}

23
js/ui/main.js
View File

@ -524,8 +524,9 @@ function loadTheme() {
/**
* notify:
* @param {string} msg: A message
* @param {string} details: Additional information
*
* @param {string} msg A message
* @param {string} details Additional information
*/
function notify(msg, details) {
let source = new MessageTray.SystemNotificationSource();
@ -713,6 +714,11 @@ function popModal(grab, timestamp) {
actionMode = Shell.ActionMode.NORMAL;
}
/**
* Creates the looking glass panel
*
* @returns {LookingGlass.LookingGlass}
*/
function createLookingGlass() {
if (lookingGlass == null)
lookingGlass = new LookingGlass.LookingGlass();
@ -720,6 +726,9 @@ function createLookingGlass() {
return lookingGlass;
}
/**
* Opens the run dialog
*/
function openRunDialog() {
if (runDialog == null)
runDialog = new RunDialog.RunDialog();
@ -736,9 +745,10 @@ function openWelcomeDialog() {
/**
* activateWindow:
* @param {Meta.Window} window: the window to activate
* @param {number=} time: current event time
* @param {number=} workspaceNum: window's workspace number
*
* @param {Meta.Window} window the window to activate
* @param {number=} time current event time
* @param {number=} workspaceNum window's workspace number
*
* Activates @window, switching to its workspace first if necessary,
* and switching out of the overview if it's currently active
@ -882,7 +892,8 @@ function initializeDeferredWork(actor, callback) {
/**
* queueDeferredWork:
* @param {string} workId: work identifier
*
* @param {string} workId work identifier
*
* Ensure that the work identified by @workId will be
* run on map or timeout. You should call this function

5
js/ui/messageList.js
View File

@ -17,6 +17,11 @@ var MESSAGE_ANIMATION_TIME = 100;
var DEFAULT_EXPAND_LINES = 6;
/**
* @param {string} text
* @param {boolean} allowMarkup
* @returns {string}
*/
function _fixMarkup(text, allowMarkup) {
if (allowMarkup) {
// Support &amp;, &quot;, &apos;, &lt; and &gt;, escape all other

3
js/ui/messageTray.js
View File

@ -50,6 +50,7 @@ var State = {
// notifications that were requested to be destroyed by the associated source,
// and REPLACED for notifications that were destroyed as a consequence of a
// newer version having replaced them.
/** @enum {number} */
var NotificationDestroyedReason = {
EXPIRED: 1,
DISMISSED: 2,
@ -61,6 +62,7 @@ var NotificationDestroyedReason = {
// urgency values map to the corresponding values for the notifications received
// through the notification daemon. HIGH urgency value is used for chats received
// through the Telepathy client.
/** @enum {number} */
var Urgency = {
LOW: 0,
NORMAL: 1,
@ -74,6 +76,7 @@ var Urgency = {
// contain information private to the physical system (for example, battery
// status) and hence the same for every user. This affects whether the content
// of a notification is shown on the lock screen.
/** @enum {number} */
var PrivacyScope = {
USER: 0,
SYSTEM: 1,

1
js/ui/modalDialog.js
View File

@ -16,6 +16,7 @@ const Params = imports.misc.params;
var OPEN_AND_CLOSE_TIME = 100;
var FADE_OUT_DIALOG_TIME = 1000;
/** @enum {number} */
var State = {
OPENED: 0,
CLOSED: 1,

7
js/ui/notificationDaemon.js
View File

@ -17,6 +17,7 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
const FdoNotificationsIface = loadInterfaceXML('org.freedesktop.Notifications');
/** @enum {number} */
var NotificationClosedReason = {
EXPIRED: 1,
DISMISSED: 2,
@ -24,6 +25,7 @@ var NotificationClosedReason = {
UNDEFINED: 4,
};
/** @enum {number} */
var Urgency = {
LOW: 0,
NORMAL: 1,
@ -544,9 +546,12 @@ function objectPathFromAppId(appId) {
return `/${appId.replace(/\./g, '/').replace(/-/g, '_')}`;
}
/**
* @returns {{ 'desktop-startup-id': string }}
*/
function getPlatformData() {
let startupId = GLib.Variant.new('s', `_TIME${global.get_current_time()}`);
return { "desktop-startup-id": startupId };
return {'desktop-startup-id': startupId};
}
function InvalidAppError() {}

1
js/ui/overviewControls.js
View File

@ -27,6 +27,7 @@ const A11Y_SCHEMA = 'org.gnome.desktop.a11y.keyboard';
var SIDE_CONTROLS_ANIMATION_TIME = Overview.ANIMATION_TIME;
/** @enum {number} */
var ControlsState = {
HIDDEN: 0,
WINDOW_PICKER: 1,

4
js/ui/pointerWatcher.js
View File

@ -11,6 +11,10 @@ var IDLE_TIME = 1000;
// but we turn off the polling when the user is idle.
let _pointerWatcher = null;
/**
* @returns {PointerWatcher}
*/
function getPointerWatcher() {
if (_pointerWatcher == null)
_pointerWatcher = new PointerWatcher();

1
js/ui/popupMenu.js
View File

@ -16,6 +16,7 @@ const BoxPointer = imports.ui.boxpointer;
const Main = imports.ui.main;
const Params = imports.misc.params;
/** @enum {number} */
var Ornament = {
NONE: 0,
DOT: 1,

36
js/ui/scripting.js
View File

@ -67,7 +67,9 @@ export const PerfHelperProxy = Gio.DBusProxy.makeProxyWrapper(PerfHelperIface);
let _perfHelper = null;
/** @private */
/**
* @returns {PerfHelper}
*/
export async function _getPerfHelper() {
if (_perfHelper == null) {
_perfHelper = await PerfHelperProxy.newAsync(
@ -87,12 +89,13 @@ export function _spawnPerfHelper() {
/**
* createTestWindow:
* @param {Object} params: options for window creation.
* {number} [params.width=640] - width of window, in pixels
* {number} [params.height=480] - height of window, in pixels
* {bool} [params.alpha=false] - whether the window should have an alpha channel
* {bool} [params.maximized=false] - whether the window should be created maximized
* {bool} [params.redraws=false] - whether the window should continually redraw itself
*
* @param {object} params options for window creation.
* @param {number} [params.width=640] - width of window, in pixels
* @param {number} [params.height=480] - height of window, in pixels
* @param {boolean} [params.alpha=false] - whether the window should have an alpha channel
* @param {boolean} [params.maximized=false] - whether the window should be created maximized
* @param {boolean} [params.redraws=false] - whether the window should continually redraw itself
* @returns {Promise}
*
* Creates a window using gnome-shell-perf-helper for testing purposes.
@ -133,6 +136,7 @@ export async function waitTestWindows() {
/**
* destroyTestWindows:
*
* @returns {Promise}
*
* Destroys all windows previously created with createTestWindow().
@ -158,9 +162,10 @@ export async function disableHelperAutoExit() {
}
/**
* defineScriptEvent
* @param {string} name: The event will be called script.<name>
* @param {string} description: Short human-readable description of the event
* defineScriptEvent:
*
* @param {string} name The event will be called script.<name>
* @param {string} description Short human-readable description of the event
*
* Convenience function to define a zero-argument performance event
* within the 'script' namespace that is reserved for events defined locally
@ -317,9 +322,6 @@ async function _runPerfScript(scriptModule, outputFile) {
/**
* runPerfScript
* @param {Object} scriptModule: module object with run and finish
* functions and event handlers
* @param {string} outputFile: path to write output to
*
* Runs a script for automated collection of performance data. The
* script is defined as a Javascript module with specified contents.
@ -350,11 +352,15 @@ async function _runPerfScript(scriptModule, outputFile) {
* '/ s', 'frames', 'frames / s', 'MiB / s / frame'
* value: computed value of the metric
*
* The resulting metrics will be written to @outputFile as JSON, or,
* if @outputFile is not provided, logged.
* The resulting metrics will be written to `outputFile` as JSON, or,
* if `outputFile` is not provided, logged.
*
* After running the script and collecting statistics from the
* event log, GNOME Shell will exit.
*
* @param {object} scriptModule module object with run and finish
* functions and event handlers
* @param {string} outputFile path to write output to
*/
export function runPerfScript(scriptModule, outputFile) {
Shell.PerfLog.get_default().set_enabled(true);

2
js/ui/shellDBus.js
View File

@ -49,7 +49,7 @@ var GnomeShell = class {
/**
* Eval:
* @param {string} code: A string containing JavaScript code
* @param {string} code A string containing JavaScript code
* @returns {Array}
*
* This function executes arbitrary code in the main

4
js/ui/shellEntry.js
View File

@ -131,6 +131,10 @@ function _onPopup(actor, entry) {
entry.menu.open(BoxPointer.PopupAnimation.FULL);
}
/**
* @param {St.Entry} entry
* @param {*} params
*/
function addContextMenu(entry, params) {
if (entry.menu)
return;

1
js/ui/shellMountOperation.js
View File

@ -532,6 +532,7 @@ var ShellProcessesDialog = GObject.registerClass({
const GnomeShellMountOpIface = loadInterfaceXML('org.Gtk.MountOperationHandler');
/** @enum {number} */
var ShellMountOperationType = {
NONE: 0,
ASK_PASSWORD: 1,

3
js/ui/status/keyboard.js
View File

@ -799,6 +799,9 @@ var InputSourceManager = class extends Signals.EventEmitter {
let _inputSourceManager = null;
/**
* @returns {InputSourceManager}
*/
function getInputSourceManager() {
if (_inputSourceManager == null)
_inputSourceManager = new InputSourceManager();

1
js/ui/status/location.js
View File

@ -22,6 +22,7 @@ const ENABLED = 'enabled';
const APP_PERMISSIONS_TABLE = 'location';
const APP_PERMISSIONS_ID = 'location';
/** @enum {number} */
var GeoclueAccuracyLevel = {
NONE: 0,
COUNTRY: 1,

1
js/ui/status/network.js
View File

@ -32,6 +32,7 @@ const MAX_VISIBLE_NETWORKS = 8;
// small optimization, to avoid using [] all the time
const NM80211Mode = NM['80211Mode'];
/** @enum {number} */
var PortalHelperResult = {
CANCELLED: 0,
COMPLETED: 1,

6
js/ui/status/rfkill.js
View File

@ -82,7 +82,11 @@ const RfkillManager = GObject.registerClass({
}
});
var _manager;
let _manager;
/**
* @returns {RfkillManager}
*/
function getRfkillManager() {
if (_manager != null)
return _manager;

6
js/ui/status/thunderbolt.js
View File

@ -23,8 +23,7 @@ const BoltDeviceInterface = loadInterfaceXML('org.freedesktop.bolt1.Device');
const BoltDeviceProxy = Gio.DBusProxy.makeProxyWrapper(BoltDeviceInterface);
/* */
/** @enum {string} */
var Status = {
DISCONNECTED: 'disconnected',
CONNECTING: 'connecting',
@ -34,16 +33,19 @@ var Status = {
AUTHORIZED: 'authorized',
};
/** @enum {string} */
var Policy = {
DEFAULT: 'default',
MANUAL: 'manual',
AUTO: 'auto',
};
/** @enum {string} */
var AuthCtrl = {
NONE: 'none',
};
/** @enum {string} */
var AuthMode = {
DISABLED: 'disabled',
ENABLED: 'enabled',

7
js/ui/swipeTracker.js
View File

@ -37,6 +37,7 @@ const EPSILON = 0.005;
const GESTURE_FINGER_COUNT = 3;
/** @enum {number} */
const State = {
NONE: 0,
SCROLLING: 1,
@ -523,11 +524,11 @@ var SwipeTracker = GObject.registerClass({
/**
* canHandleScrollEvent:
* @param {Clutter.Event} scrollEvent: an event to check
* @returns {bool} whether the event can be handled by the tracker
*
* This function can be used to combine swipe gesture and mouse
* scrolling.
*
* @param {Clutter.Event} scrollEvent an event to check
* @returns {boolean} whether the event can be handled by the tracker
*/
canHandleScrollEvent(scrollEvent) {
if (!this.enabled || this._scrollGesture === null)

9
js/ui/switcherPopup.js
View File

@ -16,6 +16,11 @@ var POPUP_FADE_OUT_TIME = 100; // milliseconds
var DISABLE_HOVER_TIMEOUT = 500; // milliseconds
var NO_MODS_TIMEOUT = 1500; // milliseconds
/**
* @param {number} a
* @param {number} b
* @returns {number}
*/
function mod(a, b) {
return (a + b) % b;
}
@ -645,6 +650,10 @@ var SwitcherList = GObject.registerClass({
}
});
/**
* @param {St.DrawingArrow} area
* @param {St.Side} side
*/
function drawArrow(area, side) {
let themeNode = area.get_theme_node();
let borderColor = themeNode.get_border_color(side);

1
js/ui/welcomeDialog.js
View File

@ -11,6 +11,7 @@ const Dialog = imports.ui.dialog;
const Main = imports.ui.main;
const ModalDialog = imports.ui.modalDialog;
/** @enum {number} */
var DialogResponse = {
NO_THANKS: 0,
TAKE_TOUR: 1,

3
js/ui/windowManager.js
View File

@ -161,6 +161,9 @@ class WindowDimmer extends Clutter.BrightnessContrastEffect {
}
});
/**
* @param {Meta.WindowActor} actor
*/
function getWindowDimmer(actor) {
let effect = actor.get_effect(WINDOW_DIMMER_EFFECT_NAME);

1
js/ui/workspacesView.js
View File

@ -82,6 +82,7 @@ var WorkspacesViewBase = GObject.registerClass({
}
});
/** @enum {number} */
var FitMode = {
SINGLE: 0,
ALL: 1,

2
subprojects/extensions-app/js/main.js
View File

@ -547,6 +547,8 @@ function initEnvironment() {
}
/**
* Main entrypoint for the app
*
* @param {string[]} argv - command line arguments
* @returns {void}
*/