js: Add JSDoc to exported functions and fix incorrect JSDoc formatting
Part-of: <https://gitlab.gnome.org/GNOME/gnome-shell/-/merge_requests/1499>
This commit is contained in:
parent
4642a8541d
commit
64aa871a8a
@ -23,11 +23,13 @@ var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
|
||||
|
||||
var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
|
||||
|
||||
/** @enum {number} */
|
||||
var AuthPromptMode = {
|
||||
UNLOCK_ONLY: 0,
|
||||
UNLOCK_OR_LOG_IN: 1,
|
||||
};
|
||||
|
||||
/** @enum {number} */
|
||||
var AuthPromptStatus = {
|
||||
NOT_VERIFYING: 0,
|
||||
VERIFYING: 1,
|
||||
@ -37,6 +39,7 @@ var AuthPromptStatus = {
|
||||
VERIFICATION_IN_PROGRESS: 5,
|
||||
};
|
||||
|
||||
/** @enum {number} */
|
||||
var BeginRequestType = {
|
||||
PROVIDE_USERNAME: 0,
|
||||
DONT_PROVIDE_USERNAME: 1,
|
||||
|
@ -43,6 +43,9 @@ var OVirtCredentialsManager = class OVirtCredentialsManager extends Credential.C
|
||||
}
|
||||
};
|
||||
|
||||
/**
|
||||
* @returns {OVirtCredentialsManager}
|
||||
*/
|
||||
function getOVirtCredentialsManager() {
|
||||
if (!_oVirtCredentialsManager)
|
||||
_oVirtCredentialsManager = new OVirtCredentialsManager();
|
||||
|
@ -49,8 +49,12 @@ var DISABLE_USER_LIST_KEY = 'disable-user-list';
|
||||
var USER_READ_TIME = 48;
|
||||
const FINGERPRINT_ERROR_TIMEOUT_WAIT = 15;
|
||||
|
||||
/**
|
||||
* Keep messages in order by priority
|
||||
*
|
||||
* @enum {number}
|
||||
*/
|
||||
var MessageType = {
|
||||
// Keep messages in order by priority
|
||||
NONE: 0,
|
||||
HINT: 1,
|
||||
INFO: 2,
|
||||
@ -109,6 +113,9 @@ function fadeOutActor(actor) {
|
||||
return hold;
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {Clutter.Actor} actor
|
||||
*/
|
||||
function cloneAndFadeOutActor(actor) {
|
||||
// Immediately hide actor so its sibling can have its space
|
||||
// and position, but leave a non-reactive clone on-screen,
|
||||
|
@ -46,6 +46,9 @@ var VmwareCredentialsManager = class VmwareCredentialsManager extends Credential
|
||||
}
|
||||
};
|
||||
|
||||
/**
|
||||
* @returns {VmwareCredentialsManager}
|
||||
*/
|
||||
function getVmwareCredentialsManager() {
|
||||
if (!_vmwareCredentialsManager)
|
||||
_vmwareCredentialsManager = new VmwareCredentialsManager();
|
||||
|
@ -15,7 +15,7 @@ var LOCALEDIR = '@datadir@/locale';
|
||||
var LIBEXECDIR = '@libexecdir@';
|
||||
var PKGDATADIR = '@datadir@/@PACKAGE_NAME@';
|
||||
/* g-i package versions */
|
||||
var LIBMUTTER_API_VERSION = '@LIBMUTTER_API_VERSION@'
|
||||
var LIBMUTTER_API_VERSION = '@LIBMUTTER_API_VERSION@';
|
||||
|
||||
var HAVE_BLUETOOTH = pkg.checkSymbol('GnomeBluetooth', '3.0',
|
||||
'Client.default_adapter_state')
|
||||
|
@ -12,6 +12,9 @@ var ExtensionType = {
|
||||
PER_USER: 2,
|
||||
};
|
||||
|
||||
/**
|
||||
* @enum {number}
|
||||
*/
|
||||
var ExtensionState = {
|
||||
ENABLED: 1,
|
||||
DISABLED: 2,
|
||||
|
@ -44,6 +44,10 @@ function* collectFromDatadirs(subdir, includeUserDir) {
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {Gio.File} dir
|
||||
* @param {boolean} deleteParent
|
||||
*/
|
||||
function recursivelyDeleteDir(dir, deleteParent) {
|
||||
let children = dir.enumerate_children('standard::name,standard::type',
|
||||
Gio.FileQueryInfoFlags.NOFOLLOW_SYMLINKS, null);
|
||||
@ -62,6 +66,10 @@ function recursivelyDeleteDir(dir, deleteParent) {
|
||||
dir.delete(null);
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {Gio.File} srcDir
|
||||
* @param {Gio.File} destDir
|
||||
*/
|
||||
function recursivelyMoveDir(srcDir, destDir) {
|
||||
let children = srcDir.enumerate_children('standard::name,standard::type',
|
||||
Gio.FileQueryInfoFlags.NOFOLLOW_SYMLINKS, null);
|
||||
|
@ -7,6 +7,7 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const PresenceIface = loadInterfaceXML('org.gnome.SessionManager.Presence');
|
||||
|
||||
/** @enum {number} */
|
||||
var PresenceStatus = {
|
||||
AVAILABLE: 0,
|
||||
INVISIBLE: 1,
|
||||
@ -15,6 +16,12 @@ var PresenceStatus = {
|
||||
};
|
||||
|
||||
var PresenceProxy = Gio.DBusProxy.makeProxyWrapper(PresenceIface);
|
||||
|
||||
/**
|
||||
* @param {Function} initCallback
|
||||
* @param {Gio.Cancellable} cancellable
|
||||
* @returns {Gio.DBusProxy}
|
||||
*/
|
||||
function Presence(initCallback, cancellable) {
|
||||
return new PresenceProxy(Gio.DBus.session, 'org.gnome.SessionManager',
|
||||
'/org/gnome/SessionManager/Presence', initCallback, cancellable);
|
||||
@ -25,6 +32,13 @@ function Presence(initCallback, cancellable) {
|
||||
// of new inhibitors)
|
||||
const InhibitorIface = loadInterfaceXML('org.gnome.SessionManager.Inhibitor');
|
||||
var InhibitorProxy = Gio.DBusProxy.makeProxyWrapper(InhibitorIface);
|
||||
|
||||
/**
|
||||
* @param {string} objectPath
|
||||
* @param {Function} initCallback
|
||||
* @param {Gio.Cancellable} cancellable
|
||||
* @returns {Gio.DBusProxy}
|
||||
*/
|
||||
function Inhibitor(objectPath, initCallback, cancellable) {
|
||||
return new InhibitorProxy(Gio.DBus.session, 'org.gnome.SessionManager', objectPath, initCallback, cancellable);
|
||||
}
|
||||
@ -32,6 +46,12 @@ function Inhibitor(objectPath, initCallback, cancellable) {
|
||||
// Not the full interface, only the methods we use
|
||||
const SessionManagerIface = loadInterfaceXML('org.gnome.SessionManager');
|
||||
var SessionManagerProxy = Gio.DBusProxy.makeProxyWrapper(SessionManagerIface);
|
||||
|
||||
/**
|
||||
* @param {Function} initCallback
|
||||
* @param {Gio.Cancellable} cancellable
|
||||
* @returns {Gio.DBusProxy}
|
||||
*/
|
||||
function SessionManager(initCallback, cancellable) {
|
||||
return new SessionManagerProxy(Gio.DBus.session, 'org.gnome.SessionManager', '/org/gnome/SessionManager', initCallback, cancellable);
|
||||
}
|
||||
|
@ -46,6 +46,9 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) {
|
||||
`but required is ${requiredMajor}.${requiredMinor}.${requiredMicro}`);
|
||||
}
|
||||
|
||||
/**
|
||||
* @returns {IBusManager}
|
||||
*/
|
||||
function getIBusManager() {
|
||||
if (_ibusManager == null)
|
||||
_ibusManager = new IBusManager();
|
||||
|
@ -12,6 +12,9 @@ var DEFAULT_VARIANT = '';
|
||||
|
||||
let _xkbInfo = null;
|
||||
|
||||
/**
|
||||
* @returns {GnomeDesktop.XkbInfo}
|
||||
*/
|
||||
function getXkbInfo() {
|
||||
if (_xkbInfo == null)
|
||||
_xkbInfo = new GnomeDesktop.XkbInfo();
|
||||
@ -20,6 +23,9 @@ function getXkbInfo() {
|
||||
|
||||
let _keyboardManager = null;
|
||||
|
||||
/**
|
||||
* @returns {KeyboardManager}
|
||||
*/
|
||||
function getKeyboardManager() {
|
||||
if (_keyboardManager == null)
|
||||
_keyboardManager = new KeyboardManager();
|
||||
|
@ -33,6 +33,9 @@ function versionCompare(required, reference) {
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* @returns {boolean}
|
||||
*/
|
||||
function canLock() {
|
||||
try {
|
||||
let params = GLib.Variant.new('(ss)', ['org.gnome.DisplayManager.Manager', 'Version']);
|
||||
@ -74,8 +77,7 @@ let _loginManager = null;
|
||||
/**
|
||||
* getLoginManager:
|
||||
* An abstraction over systemd/logind and ConsoleKit.
|
||||
* @returns {object} - the LoginManager singleton
|
||||
*
|
||||
* @returns {LoginManagerSystemd | LoginManagerDummy} - the LoginManager singleton
|
||||
*/
|
||||
function getLoginManager() {
|
||||
if (_loginManager == null) {
|
||||
|
@ -1,20 +1,23 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported parse */
|
||||
|
||||
// parse:
|
||||
// @params: caller-provided parameter object, or %null
|
||||
// @defaults-provided defaults object
|
||||
// @allowExtras: whether or not to allow properties not in @default
|
||||
//
|
||||
// Examines @params and fills in default values from @defaults for
|
||||
// any properties in @defaults that don't appear in @params. If
|
||||
// @allowExtras is not %true, it will throw an error if @params
|
||||
// contains any properties that aren't in @defaults.
|
||||
//
|
||||
// If @params is %null, this returns the values from @defaults.
|
||||
//
|
||||
// Return value: a new object, containing the merged parameters from
|
||||
// @params and @defaults
|
||||
/**
|
||||
* parse:
|
||||
*
|
||||
* @param {*} params caller-provided parameter object, or %null
|
||||
* @param {*} defaults provided defaults object
|
||||
* @param {boolean} [allowExtras] whether or not to allow properties not in `default`
|
||||
*
|
||||
* @summary Examines `params` and fills in default values from `defaults` for
|
||||
* any properties in `default` that don't appear in `params`. If
|
||||
* `allowExtras` is not %true, it will throw an error if `params`
|
||||
* contains any properties that aren't in `defaults`.
|
||||
*
|
||||
* If `params` is %null, this returns the values from `defaults`.
|
||||
*
|
||||
* @returns a new object, containing the merged parameters from
|
||||
* `params` and `defaults`
|
||||
*/
|
||||
function parse(params = {}, defaults, allowExtras) {
|
||||
if (!allowExtras) {
|
||||
for (let prop in params) {
|
||||
|
@ -39,6 +39,9 @@ if (HAVE_MALCONTENT) {
|
||||
|
||||
let _singleton = null;
|
||||
|
||||
/**
|
||||
* @returns {ParentalControlsManager}
|
||||
*/
|
||||
function getDefault() {
|
||||
if (_singleton === null)
|
||||
_singleton = new ParentalControlsManager();
|
||||
|
@ -8,6 +8,11 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
const PermissionStoreIface = loadInterfaceXML('org.freedesktop.impl.portal.PermissionStore');
|
||||
const PermissionStoreProxy = Gio.DBusProxy.makeProxyWrapper(PermissionStoreIface);
|
||||
|
||||
/**
|
||||
* @param {Function} initCallback
|
||||
* @param {Gio.Cancellable} cancellable
|
||||
* @returns {Gio.DBusProxy}
|
||||
*/
|
||||
function PermissionStore(initCallback, cancellable) {
|
||||
return new PermissionStoreProxy(Gio.DBus.session,
|
||||
'org.freedesktop.impl.portal.PermissionStore',
|
||||
|
@ -18,6 +18,9 @@ const SmartcardTokenIface = `
|
||||
|
||||
let _smartcardManager = null;
|
||||
|
||||
/**
|
||||
* @returns {SmartcardManager}
|
||||
*/
|
||||
function getSmartcardManager() {
|
||||
if (_smartcardManager == null)
|
||||
_smartcardManager = new SmartcardManager();
|
||||
|
@ -30,6 +30,9 @@ const SCREENSHOT_UI_ACTION_ID = 'open-screenshot-ui';
|
||||
|
||||
let _singleton = null;
|
||||
|
||||
/**
|
||||
* @returns {SystemActions}
|
||||
*/
|
||||
function getDefault() {
|
||||
if (_singleton == null)
|
||||
_singleton = new SystemActions();
|
||||
|
182
js/misc/util.js
182
js/misc/util.js
@ -41,14 +41,17 @@ const _urlRegexp = new RegExp(
|
||||
|
||||
let _desktopSettings = null;
|
||||
|
||||
// findUrls:
|
||||
// @str: string to find URLs in
|
||||
//
|
||||
// Searches @str for URLs and returns an array of objects with %url
|
||||
// properties showing the matched URL string, and %pos properties indicating
|
||||
// the position within @str where the URL was found.
|
||||
//
|
||||
// Return value: the list of match objects, as described above
|
||||
/**
|
||||
* findUrls:
|
||||
*
|
||||
* @param {string} str string to find URLs in
|
||||
*
|
||||
* Searches `str` for URLs and returns an array of objects with %url
|
||||
* properties showing the matched URL string, and %pos properties indicating
|
||||
* the position within `str` where the URL was found.
|
||||
*
|
||||
* @returns {{url: string, pos: number}[]} the list of match objects, as described above
|
||||
*/
|
||||
function findUrls(str) {
|
||||
let res = [], match;
|
||||
while ((match = _urlRegexp.exec(str)))
|
||||
@ -56,11 +59,14 @@ function findUrls(str) {
|
||||
return res;
|
||||
}
|
||||
|
||||
// spawn:
|
||||
// @argv: an argv array
|
||||
//
|
||||
// Runs @argv in the background, handling any errors that occur
|
||||
// when trying to start the program.
|
||||
/**
|
||||
* spawn:
|
||||
*
|
||||
* Runs `argv` in the background, handling any errors that occur
|
||||
* when trying to start the program.
|
||||
*
|
||||
* @param {readonly string[]} argv an argv array
|
||||
*/
|
||||
function spawn(argv) {
|
||||
try {
|
||||
trySpawn(argv);
|
||||
@ -69,11 +75,14 @@ function spawn(argv) {
|
||||
}
|
||||
}
|
||||
|
||||
// spawnCommandLine:
|
||||
// @commandLine: a command line
|
||||
//
|
||||
// Runs @commandLine in the background, handling any errors that
|
||||
// occur when trying to parse or start the program.
|
||||
/**
|
||||
* spawnCommandLine:
|
||||
*
|
||||
* @param {readonly string[]} commandLine a command line
|
||||
*
|
||||
* Runs commandLine in the background, handling any errors that
|
||||
* occur when trying to parse or start the program.
|
||||
*/
|
||||
function spawnCommandLine(commandLine) {
|
||||
try {
|
||||
let [success_, argv] = GLib.shell_parse_argv(commandLine);
|
||||
@ -83,10 +92,13 @@ function spawnCommandLine(commandLine) {
|
||||
}
|
||||
}
|
||||
|
||||
// spawnApp:
|
||||
// @argv: an argv array
|
||||
//
|
||||
// Runs @argv as if it was an application, handling startup notification
|
||||
/**
|
||||
* spawnApp:
|
||||
*
|
||||
* @param {readonly string[]} argv an argv array
|
||||
*
|
||||
* Runs argv as if it was an application, handling startup notification
|
||||
*/
|
||||
function spawnApp(argv) {
|
||||
try {
|
||||
let app = Gio.AppInfo.create_from_commandline(argv.join(' '), null,
|
||||
@ -99,13 +111,16 @@ function spawnApp(argv) {
|
||||
}
|
||||
}
|
||||
|
||||
// trySpawn:
|
||||
// @argv: an argv array
|
||||
//
|
||||
// Runs @argv in the background. If launching @argv fails,
|
||||
// this will throw an error.
|
||||
/**
|
||||
* trySpawn:
|
||||
*
|
||||
* @param {readonly string[]} argv an argv array
|
||||
*
|
||||
* Runs argv in the background. If launching argv fails,
|
||||
* this will throw an error.
|
||||
*/
|
||||
function trySpawn(argv) {
|
||||
var success_, pid;
|
||||
let success_, pid;
|
||||
try {
|
||||
[success_, pid] = GLib.spawn_async(
|
||||
null, argv, null,
|
||||
@ -146,11 +161,14 @@ function trySpawn(argv) {
|
||||
GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, () => {});
|
||||
}
|
||||
|
||||
// trySpawnCommandLine:
|
||||
// @commandLine: a command line
|
||||
//
|
||||
// Runs @commandLine in the background. If launching @commandLine
|
||||
// fails, this will throw an error.
|
||||
/**
|
||||
* trySpawnCommandLine:
|
||||
*
|
||||
* @param {readonly string[]} commandLine a command line
|
||||
*
|
||||
* Runs commandLine in the background. If launching commandLine
|
||||
* fails, this will throw an error.
|
||||
*/
|
||||
function trySpawnCommandLine(commandLine) {
|
||||
let success_, argv;
|
||||
|
||||
@ -171,6 +189,14 @@ function _handleSpawnError(command, err) {
|
||||
Main.notifyError(title, err.message);
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns an {@link St.Label} with the date passed formatted
|
||||
* using {@link formatTime}
|
||||
*
|
||||
* @param {Date} date the date to format for the label
|
||||
* @param {object} params params for {@link formatTime}
|
||||
* @returns {St.Label}
|
||||
*/
|
||||
function createTimeLabel(date, params) {
|
||||
if (_desktopSettings == null)
|
||||
_desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
|
||||
@ -182,20 +208,26 @@ function createTimeLabel(date, params) {
|
||||
return label;
|
||||
}
|
||||
|
||||
// lowerBound:
|
||||
// @array: an array or array-like object, already sorted
|
||||
// according to @cmp
|
||||
// @val: the value to add
|
||||
// @cmp: a comparator (or undefined to compare as numbers)
|
||||
//
|
||||
// Returns the position of the first element that is not
|
||||
// lower than @val, according to @cmp.
|
||||
// That is, returns the first position at which it
|
||||
// is possible to insert @val without violating the
|
||||
// order.
|
||||
// This is quite like an ordinary binary search, except
|
||||
// that it doesn't stop at first element comparing equal.
|
||||
|
||||
/**
|
||||
* lowerBound:
|
||||
*
|
||||
* @template T, [K=T]
|
||||
* @param {readonly T[]} array an array or array-like object, already sorted
|
||||
* according to `cmp`
|
||||
* @param {K} val the value to add
|
||||
* @param {(a: T, val: K) => number} cmp a comparator (or undefined to compare as numbers)
|
||||
* @returns {number}
|
||||
*
|
||||
* Returns the position of the first element that is not
|
||||
* lower than `val`, according to `cmp`.
|
||||
* That is, returns the first position at which it
|
||||
* is possible to insert val without violating the
|
||||
* order.
|
||||
*
|
||||
* This is quite like an ordinary binary search, except
|
||||
* that it doesn't stop at first element comparing equal.
|
||||
*/
|
||||
function lowerBound(array, val, cmp) {
|
||||
let min, max, mid, v;
|
||||
cmp ||= (a, b) => a - b;
|
||||
@ -218,14 +250,20 @@ function lowerBound(array, val, cmp) {
|
||||
return min == max || cmp(array[min], val) < 0 ? max : min;
|
||||
}
|
||||
|
||||
// insertSorted:
|
||||
// @array: an array sorted according to @cmp
|
||||
// @val: a value to insert
|
||||
// @cmp: the sorting function
|
||||
//
|
||||
// Inserts @val into @array, preserving the
|
||||
// sorting invariants.
|
||||
// Returns the position at which it was inserted
|
||||
/**
|
||||
* insertSorted:
|
||||
*
|
||||
* @template T, [K=T]
|
||||
* @param {T[]} array an array sorted according to `cmp`
|
||||
* @param {K} val a value to insert
|
||||
* @param {(a: T, val: K) => number} cmp the sorting function
|
||||
* @returns {number}
|
||||
*
|
||||
* Inserts `val` into `array`, preserving the
|
||||
* sorting invariants.
|
||||
*
|
||||
* Returns the position at which it was inserted
|
||||
*/
|
||||
function insertSorted(array, val, cmp) {
|
||||
let pos = lowerBound(array, val, cmp);
|
||||
array.splice(pos, 0, val);
|
||||
@ -233,15 +271,25 @@ function insertSorted(array, val, cmp) {
|
||||
return pos;
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {number} start
|
||||
* @param {number} end
|
||||
* @param {number} progress
|
||||
* @returns {number}
|
||||
*/
|
||||
function lerp(start, end, progress) {
|
||||
return start + progress * (end - start);
|
||||
}
|
||||
|
||||
// _GNOMEversionToNumber:
|
||||
// @version: a GNOME version element
|
||||
//
|
||||
// Like Number() but returns sortable values for special-cases
|
||||
// 'alpha' and 'beta'. Returns NaN for unhandled 'versions'.
|
||||
/**
|
||||
* _GNOMEversionToNumber:
|
||||
*
|
||||
* @param {string} version a GNOME version element
|
||||
* @returns {number}
|
||||
*
|
||||
* Like Number() but returns sortable values for special-cases
|
||||
* 'alpha' and 'beta'. Returns NaN for unhandled 'versions'.
|
||||
*/
|
||||
function _GNOMEversionToNumber(version) {
|
||||
let ret = Number(version);
|
||||
if (!isNaN(ret))
|
||||
@ -253,12 +301,16 @@ function _GNOMEversionToNumber(version) {
|
||||
return ret;
|
||||
}
|
||||
|
||||
// GNOMEversionCompare:
|
||||
// @version1: a string containing a GNOME version
|
||||
// @version2: a string containing another GNOME version
|
||||
//
|
||||
// Returns an integer less than, equal to, or greater than
|
||||
// zero, if version1 is older, equal or newer than version2
|
||||
/**
|
||||
* GNOMEversionCompare:
|
||||
*
|
||||
* @param {string} version1 a string containing a GNOME version
|
||||
* @param {string} version2 a string containing another GNOME version
|
||||
* @returns {number}
|
||||
*
|
||||
* Returns an integer less than, equal to, or greater than
|
||||
* zero, if `version1` is older, equal or newer than `version2`
|
||||
*/
|
||||
function GNOMEversionCompare(version1, version2) {
|
||||
const v1Array = version1.split('.');
|
||||
const v2Array = version2.split('.');
|
||||
|
@ -16,6 +16,7 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
const RequestIface = loadInterfaceXML('org.freedesktop.impl.portal.Request');
|
||||
const AccessIface = loadInterfaceXML('org.freedesktop.impl.portal.Access');
|
||||
|
||||
/** @enum {number} */
|
||||
var DialogResponse = {
|
||||
OK: 0,
|
||||
CANCEL: 1,
|
||||
|
@ -26,6 +26,7 @@ var APP_ICON_SIZE_SMALL = 48;
|
||||
|
||||
const baseIconSizes = [96, 64, 48, 32, 22];
|
||||
|
||||
/** @enum {number} */
|
||||
var AppIconMode = {
|
||||
THUMBNAIL_ONLY: 1,
|
||||
APP_ICON_ONLY: 2,
|
||||
@ -294,27 +295,28 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
|
||||
/**
|
||||
* _select:
|
||||
* @param {number} app: index of the app to select
|
||||
* @param {number=} window: index of which of @app's windows to select
|
||||
* @param {bool} forceAppFocus: optional flag, see below
|
||||
*
|
||||
* Selects the indicated @app, and optional @window, and sets
|
||||
* @param {number} app index of the app to select
|
||||
* @param {number} [window] index of which of `app`'s windows to select
|
||||
* @param {boolean} [forceAppFocus] optional flag, see below
|
||||
*
|
||||
* Selects the indicated `app`, and optional `window`, and sets
|
||||
* this._thumbnailsFocused appropriately to indicate whether the
|
||||
* arrow keys should act on the app list or the thumbnail list.
|
||||
*
|
||||
* If @app is specified and @window is unspecified or %null, then
|
||||
* If `app` is specified and `window` is unspecified or %null, then
|
||||
* the app is highlighted (ie, given a light background), and the
|
||||
* current thumbnail list, if any, is destroyed. If @app has
|
||||
* multiple windows, and @forceAppFocus is not %true, then a
|
||||
* current thumbnail list, if any, is destroyed. If `app` has
|
||||
* multiple windows, and `forceAppFocus` is not %true, then a
|
||||
* timeout is started to open a thumbnail list.
|
||||
*
|
||||
* If @app and @window are specified (and @forceAppFocus is not),
|
||||
* then @app will be outlined, a thumbnail list will be created
|
||||
* and focused (if it hasn't been already), and the @window'th
|
||||
* If `app` and `window` are specified (and `forceAppFocus` is not),
|
||||
* then `app` will be outlined, a thumbnail list will be created
|
||||
* and focused (if it hasn't been already), and the `window`'th
|
||||
* window in it will be highlighted.
|
||||
*
|
||||
* If @app and @window are specified and @forceAppFocus is %true,
|
||||
* then @app will be highlighted, and @window outlined, and the
|
||||
* If `app` and `window` are specified and `forceAppFocus` is %true,
|
||||
* then `app` will be highlighted, and `window` outlined, and the
|
||||
* app list will have the keyboard focus.
|
||||
*/
|
||||
_select(app, window, forceAppFocus) {
|
||||
|
@ -206,6 +206,10 @@ class AppFavorites extends Signals.EventEmitter {
|
||||
}
|
||||
|
||||
var appFavoritesInstance = null;
|
||||
|
||||
/**
|
||||
* @returns {AppFavorites}
|
||||
*/
|
||||
function getAppFavorites() {
|
||||
if (appFavoritesInstance == null)
|
||||
appFavoritesInstance = new AppFavorites();
|
||||
|
@ -229,6 +229,9 @@ var BackgroundCache = class BackgroundCache extends Signals.EventEmitter {
|
||||
}
|
||||
};
|
||||
|
||||
/**
|
||||
* @returns {BackgroundCache}
|
||||
*/
|
||||
function getBackgroundCache() {
|
||||
if (!_backgroundCache)
|
||||
_backgroundCache = new BackgroundCache();
|
||||
|
@ -24,6 +24,10 @@ var BackgroundMenu = class BackgroundMenu extends PopupMenu.PopupMenu {
|
||||
}
|
||||
};
|
||||
|
||||
/**
|
||||
* @param {Meta.BackgroundActor} actor
|
||||
* @param {import('./layout.js').LayoutManager} layoutManager
|
||||
*/
|
||||
function addBackgroundMenu(actor, layoutManager) {
|
||||
actor.reactive = true;
|
||||
actor._backgroundMenu = new BackgroundMenu(layoutManager);
|
||||
|
@ -33,6 +33,10 @@ var POPUP_ANIMATION_TIME = 150;
|
||||
var BoxPointer = GObject.registerClass({
|
||||
Signals: { 'arrow-side-changed': {} },
|
||||
}, class BoxPointer extends St.Widget {
|
||||
/**
|
||||
* @param {*} arrowSide side to draw the arrow on
|
||||
* @param {*} binProperties Properties to set on contained bin
|
||||
*/
|
||||
_init(arrowSide, binProperties) {
|
||||
super._init();
|
||||
|
||||
|
@ -109,10 +109,16 @@ var EventSourceBase = GObject.registerClass({
|
||||
},
|
||||
Signals: { 'changed': {} },
|
||||
}, class EventSourceBase extends GObject.Object {
|
||||
/**
|
||||
* @returns {boolean}
|
||||
*/
|
||||
get isLoading() {
|
||||
throw new GObject.NotImplementedError(`isLoading in ${this.constructor.name}`);
|
||||
}
|
||||
|
||||
/**
|
||||
* @returns {boolean}
|
||||
*/
|
||||
get hasCalendars() {
|
||||
throw new GObject.NotImplementedError(`hasCalendars in ${this.constructor.name}`);
|
||||
}
|
||||
@ -128,6 +134,10 @@ var EventSourceBase = GObject.registerClass({
|
||||
throw new GObject.NotImplementedError(`getEvents in ${this.constructor.name}`);
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {Date} _day
|
||||
* @returns {boolean}
|
||||
*/
|
||||
hasEvents(_day) {
|
||||
throw new GObject.NotImplementedError(`hasEvents in ${this.constructor.name}`);
|
||||
}
|
||||
|
@ -21,6 +21,7 @@ const SETTING_START_APP = 'autorun-x-content-start-app';
|
||||
const SETTING_IGNORE = 'autorun-x-content-ignore';
|
||||
const SETTING_OPEN_FOLDER = 'autorun-x-content-open-folder';
|
||||
|
||||
/** @enum {number} */
|
||||
var AutorunSetting = {
|
||||
RUN: 0,
|
||||
IGNORE: 1,
|
||||
|
@ -18,6 +18,7 @@ const ShellEntry = imports.ui.shellEntry;
|
||||
const UserWidget = imports.ui.userWidget;
|
||||
const {wiggle} = imports.misc.animationUtils;
|
||||
|
||||
/** @enum {number} */
|
||||
const DialogMode = {
|
||||
AUTH: 0,
|
||||
CONFIRM: 1,
|
||||
|
@ -21,6 +21,9 @@ var DASH_ITEM_LABEL_SHOW_TIME = 150;
|
||||
var DASH_ITEM_LABEL_HIDE_TIME = 100;
|
||||
var DASH_ITEM_HOVER_TIMEOUT = 300;
|
||||
|
||||
/**
|
||||
* @param {AppDisplay.AppIcon} source
|
||||
*/
|
||||
function getAppFromSource(source) {
|
||||
if (source instanceof AppDisplay.AppIcon)
|
||||
return source.app;
|
||||
|
23
js/ui/dnd.js
23
js/ui/dnd.js
@ -18,14 +18,16 @@ var SNAP_BACK_ANIMATION_TIME = 250;
|
||||
// Time to animate to original position on success
|
||||
var REVERT_ANIMATION_TIME = 750;
|
||||
|
||||
var DragMotionResult = {
|
||||
/** @enum {number} */
|
||||
varragMotionResult = {
|
||||
NO_DROP: 0,
|
||||
COPY_DROP: 1,
|
||||
MOVE_DROP: 2,
|
||||
CONTINUE: 3,
|
||||
};
|
||||
|
||||
var DragState = {
|
||||
/** @enum {number} */
|
||||
varragState = {
|
||||
INIT: 0,
|
||||
DRAGGING: 1,
|
||||
CANCELLED: 2,
|
||||
@ -69,10 +71,21 @@ function _getRealActorScale(actor) {
|
||||
return scale;
|
||||
}
|
||||
|
||||
/**
|
||||
* @typedef {object} DragMonitor
|
||||
* @property {Function} dragMotion
|
||||
*/
|
||||
|
||||
/**
|
||||
* @param {DragMonitor} monitor
|
||||
*/
|
||||
function addDragMonitor(monitor) {
|
||||
dragMonitors.push(monitor);
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {DragMonitor} monitor
|
||||
*/
|
||||
function removeDragMonitor(monitor) {
|
||||
for (let i = 0; i < dragMonitors.length; i++) {
|
||||
if (dragMonitors[i] == monitor) {
|
||||
@ -857,9 +870,9 @@ var _Draggable = class _Draggable extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* makeDraggable:
|
||||
* @param {Clutter.Actor} actor: Source actor
|
||||
* @param {Object=} params: Additional parameters
|
||||
* @returns {Object} a new Draggable
|
||||
* @param {Clutter.Actor} actor Source actor
|
||||
* @param {object} [params] Additional parameters
|
||||
* @returns {_Draggable} a new Draggable
|
||||
*
|
||||
* Create an object which controls drag and drop for the given actor.
|
||||
*
|
||||
|
@ -60,6 +60,9 @@ async function installExtension(uuid, invocation) {
|
||||
dialog.open(global.get_current_time());
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {string} uuid
|
||||
*/
|
||||
function uninstallExtension(uuid) {
|
||||
let extension = Main.extensionManager.lookup(uuid);
|
||||
if (!extension)
|
||||
|
@ -7,18 +7,22 @@ const St = imports.gi.St;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
|
||||
// GrabHelper:
|
||||
// @owner: the actor that owns the GrabHelper
|
||||
// @params: optional parameters to pass to Main.pushModal()
|
||||
//
|
||||
// Creates a new GrabHelper object, for dealing with keyboard and pointer grabs
|
||||
// associated with a set of actors.
|
||||
//
|
||||
// Note that the grab can be automatically dropped at any time by the user, and
|
||||
// your code just needs to deal with it; you shouldn't adjust behavior directly
|
||||
// after you call ungrab(), but instead pass an 'onUngrab' callback when you
|
||||
// call grab().
|
||||
var GrabHelper = class GrabHelper {
|
||||
/**
|
||||
* GrabHelper:
|
||||
*
|
||||
* Creates a new GrabHelper object, for dealing with keyboard and pointer grabs
|
||||
* associated with a set of actors.
|
||||
*
|
||||
* Note that the grab can be automatically dropped at any time by the user, and
|
||||
* your code just needs to deal with it; you shouldn't adjust behavior directly
|
||||
* after you call ungrab(), but instead pass an 'onUngrab' callback when you
|
||||
* call grab().
|
||||
*/
|
||||
class GrabHelper {
|
||||
/**
|
||||
* @param {Clutter.Actor} owner the actor that owns the GrabHelper
|
||||
* @param {*} params optional parameters to pass to Main.pushModal()
|
||||
*/
|
||||
constructor(owner, params) {
|
||||
if (!(owner instanceof Clutter.Actor))
|
||||
throw new Error('GrabHelper owner must be a Clutter.Actor');
|
||||
|
@ -15,6 +15,7 @@ var ICON_SIZE = 96;
|
||||
|
||||
var PAGE_SWITCH_TIME = 300;
|
||||
|
||||
/** @enum {number} */
|
||||
var IconSize = {
|
||||
LARGE: 96,
|
||||
MEDIUM: 64,
|
||||
@ -51,6 +52,7 @@ const defaultGridModes = [
|
||||
var LEFT_DIVIDER_LEEWAY = 20;
|
||||
var RIGHT_DIVIDER_LEEWAY = 20;
|
||||
|
||||
/** @enum {number} */
|
||||
var DragLocation = {
|
||||
INVALID: 0,
|
||||
START_EDGE: 1,
|
||||
@ -174,6 +176,9 @@ class BaseIcon extends Shell.SquareBin {
|
||||
}
|
||||
});
|
||||
|
||||
/**
|
||||
* @param {Clutter.Actor} actor
|
||||
*/
|
||||
function zoomOutActor(actor) {
|
||||
let [x, y] = actor.get_transformed_position();
|
||||
zoomOutActorAtPos(actor, x, y);
|
||||
@ -818,16 +823,17 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* addItem:
|
||||
* @param {Clutter.Actor} item: item to append to the grid
|
||||
* @param {int} page: page number
|
||||
* @param {int} index: position in the page
|
||||
*
|
||||
* Adds @item to the grid. @item must not be part of the grid.
|
||||
* @param {Clutter.Actor} item item to append to the grid
|
||||
* @param {number} page page number
|
||||
* @param {number} index position in the page
|
||||
*
|
||||
* If @index exceeds the number of items per page, @item will
|
||||
* Adds `item` to the grid. `item` must not be part of the grid.
|
||||
*
|
||||
* If `index` exceeds the number of items per page, `item` will
|
||||
* be added to the next page.
|
||||
*
|
||||
* @page must be a number between 0 and the number of pages.
|
||||
* `page` must be a number between 0 and the number of pages.
|
||||
* Adding to the page after next will create a new page.
|
||||
*/
|
||||
addItem(item, page = -1, index = -1) {
|
||||
@ -851,7 +857,8 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* appendItem:
|
||||
* @param {Clutter.Actor} item: item to append to the grid
|
||||
*
|
||||
* @param {Clutter.Actor} item item to append to the grid
|
||||
*
|
||||
* Appends @item to the grid. @item must not be part of the grid.
|
||||
*/
|
||||
@ -861,11 +868,12 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* moveItem:
|
||||
* @param {Clutter.Actor} item: item to move
|
||||
* @param {int} newPage: new page of the item
|
||||
* @param {int} newPosition: new page of the item
|
||||
*
|
||||
* Moves @item to the grid. @item must be part of the grid.
|
||||
* @param {Clutter.Actor} item item to move
|
||||
* @param {number} newPage new page of the item
|
||||
* @param {number} newPosition new page of the item
|
||||
*
|
||||
* Moves `item` to the grid. `item` must be part of the grid.
|
||||
*/
|
||||
moveItem(item, newPage, newPosition) {
|
||||
if (!this._items.has(item))
|
||||
@ -883,9 +891,10 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* removeItem:
|
||||
* @param {Clutter.Actor} item: item to remove from the grid
|
||||
*
|
||||
* Removes @item to the grid. @item must be part of the grid.
|
||||
* @param {Clutter.Actor} item item to remove from the grid
|
||||
*
|
||||
* Removes `item` to the grid. `item` must be part of the grid.
|
||||
*/
|
||||
removeItem(item) {
|
||||
if (!this._items.has(item))
|
||||
@ -902,7 +911,8 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemsAtPage:
|
||||
* @param {int} pageIndex: page index
|
||||
*
|
||||
* @param {number} pageIndex page index
|
||||
*
|
||||
* Retrieves the children at page @pageIndex. Children may be invisible.
|
||||
*
|
||||
@ -917,12 +927,12 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemPosition:
|
||||
* @param {BaseIcon} item: the item
|
||||
*
|
||||
* Retrieves the position of @item is its page, or -1 if @item is not
|
||||
* Retrieves the position of `item` is its page, or -1 if `item` is not
|
||||
* part of the grid.
|
||||
*
|
||||
* @returns {[int, int]} the page and position of @item
|
||||
* @param {BaseIcon} item the item
|
||||
* @returns {[number, number]} the page and position of `item`
|
||||
*/
|
||||
getItemPosition(item) {
|
||||
if (!this._items.has(item))
|
||||
@ -936,11 +946,12 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemAt:
|
||||
* @param {int} page: the page
|
||||
* @param {int} position: the position in page
|
||||
*
|
||||
* Retrieves the item at @page and @position.
|
||||
*
|
||||
* @param {number} page the page
|
||||
* @param {number} position the position in page
|
||||
*
|
||||
* @returns {BaseItem} the item at @page and @position, or null
|
||||
*/
|
||||
getItemAt(page, position) {
|
||||
@ -957,11 +968,12 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemPage:
|
||||
* @param {BaseIcon} item: the item
|
||||
*
|
||||
* Retrieves the page @item is in, or -1 if @item is not part of the grid.
|
||||
* Retrieves the page `item` is in, or -1 if `item` is not part of the grid.
|
||||
*
|
||||
* @returns {int} the page where @item is in
|
||||
* @param {BaseIcon} item the item
|
||||
*
|
||||
* @returns {number} the page where `item` is in
|
||||
*/
|
||||
getItemPage(item) {
|
||||
if (!this._items.has(item))
|
||||
@ -1010,14 +1022,15 @@ var IconGridLayout = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getDropTarget:
|
||||
* @param {int} x: position of the horizontal axis
|
||||
* @param {int} y: position of the vertical axis
|
||||
*
|
||||
* Retrieves the item located at (@x, @y), as well as the drag location.
|
||||
* Both @x and @y are relative to the grid.
|
||||
* Retrieves the item located at (`x`, `y`), as well as the drag location.
|
||||
* Both `x` and `y` are relative to the grid.
|
||||
*
|
||||
* @returns {[Clutter.Actor, DragLocation]} the item and drag location
|
||||
* under (@x, @y)
|
||||
* @param {number} x position of the horizontal axis
|
||||
* @param {number} y position of the vertical axis
|
||||
*
|
||||
* @returns {[BaseIcon | null, DragLocation]} the item and drag location
|
||||
* under (`x`, `y`)
|
||||
*/
|
||||
getDropTarget(x, y) {
|
||||
const childSize = this._getChildrenMaxSize();
|
||||
@ -1269,16 +1282,17 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* addItem:
|
||||
* @param {Clutter.Actor} item: item to append to the grid
|
||||
* @param {int} page: page number
|
||||
* @param {int} index: position in the page
|
||||
*
|
||||
* Adds @item to the grid. @item must not be part of the grid.
|
||||
* @param {BaseItem} item item to append to the grid
|
||||
* @param {number} page page number
|
||||
* @param {number} index position in the page
|
||||
*
|
||||
* If @index exceeds the number of items per page, @item will
|
||||
* Adds `item` to the grid. `item` must not be part of the grid.
|
||||
*
|
||||
* If `index` exceeds the number of items per page, `item` will
|
||||
* be added to the next page.
|
||||
*
|
||||
* @page must be a number between 0 and the number of pages.
|
||||
* `page` must be a number between 0 and the number of pages.
|
||||
* Adding to the page after next will create a new page.
|
||||
*/
|
||||
addItem(item, page = -1, index = -1) {
|
||||
@ -1290,9 +1304,10 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* appendItem:
|
||||
* @param {Clutter.Actor} item: item to append to the grid
|
||||
*
|
||||
* Appends @item to the grid. @item must not be part of the grid.
|
||||
* @param {Clutter.Actor} item item to append to the grid
|
||||
*
|
||||
* Appends `item` to the grid. `item` must not be part of the grid.
|
||||
*/
|
||||
appendItem(item) {
|
||||
this.layout_manager.appendItem(item);
|
||||
@ -1300,11 +1315,12 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* moveItem:
|
||||
* @param {Clutter.Actor} item: item to move
|
||||
* @param {int} newPage: new page of the item
|
||||
* @param {int} newPosition: new page of the item
|
||||
*
|
||||
* Moves @item to the grid. @item must be part of the grid.
|
||||
* Moves `item` to the grid. `item` must be part of the grid.
|
||||
*
|
||||
* @param {Clutter.Actor} item item to move
|
||||
* @param {number} newPage new page of the item
|
||||
* @param {number} newPosition new page of the item
|
||||
*/
|
||||
moveItem(item, newPage, newPosition) {
|
||||
this.layout_manager.moveItem(item, newPage, newPosition);
|
||||
@ -1313,9 +1329,10 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* removeItem:
|
||||
* @param {Clutter.Actor} item: item to remove from the grid
|
||||
*
|
||||
* Removes @item to the grid. @item must be part of the grid.
|
||||
* Removes `item` to the grid. `item` must be part of the grid.
|
||||
*
|
||||
* @param {Clutter.Actor} item item to remove from the grid
|
||||
*/
|
||||
removeItem(item) {
|
||||
if (!this.contains(item))
|
||||
@ -1326,11 +1343,12 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* goToPage:
|
||||
* @param {int} pageIndex: page index
|
||||
* @param {boolean} animate: animate the page transition
|
||||
*
|
||||
* Moves the current page to @pageIndex. @pageIndex must be a valid page
|
||||
* Moves the current page to `pageIndex`. `pageIndex` must be a valid page
|
||||
* number.
|
||||
*
|
||||
* @param {number} pageIndex page index
|
||||
* @param {boolean} animate animate the page transition
|
||||
*/
|
||||
goToPage(pageIndex, animate = true) {
|
||||
if (pageIndex >= this.nPages)
|
||||
@ -1366,11 +1384,12 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemPage:
|
||||
* @param {BaseIcon} item: the item
|
||||
*
|
||||
* Retrieves the page @item is in, or -1 if @item is not part of the grid.
|
||||
* Retrieves the page `item` is in, or -1 if `item` is not part of the grid.
|
||||
*
|
||||
* @returns {int} the page where @item is in
|
||||
* @param {BaseIcon} item the item
|
||||
*
|
||||
* @returns {number} the page where `item` is in
|
||||
*/
|
||||
getItemPage(item) {
|
||||
return this.layout_manager.getItemPage(item);
|
||||
@ -1378,12 +1397,13 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemPosition:
|
||||
* @param {BaseIcon} item: the item
|
||||
*
|
||||
* Retrieves the position of @item is its page, or -1 if @item is not
|
||||
* Retrieves the position of `item` is its page, or -1 if `item` is not
|
||||
* part of the grid.
|
||||
*
|
||||
* @returns {[int, int]} the page and position of @item
|
||||
* @param {BaseIcon} item the item
|
||||
*
|
||||
* @returns {[number, number]} the page and position of `item`
|
||||
*/
|
||||
getItemPosition(item) {
|
||||
if (!this.contains(item))
|
||||
@ -1395,12 +1415,13 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemAt:
|
||||
* @param {int} page: the page
|
||||
* @param {int} position: the position in page
|
||||
*
|
||||
* Retrieves the item at @page and @position.
|
||||
* Retrieves the item at `page` and `position`.
|
||||
*
|
||||
* @returns {BaseItem} the item at @page and @position, or null
|
||||
* @param {number} page the page
|
||||
* @param {number} position the position in page
|
||||
*
|
||||
* @returns {BaseItem} the item at `page` and `position`, or null
|
||||
*/
|
||||
getItemAt(page, position) {
|
||||
const layoutManager = this.layout_manager;
|
||||
@ -1409,9 +1430,10 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* getItemsAtPage:
|
||||
* @param {int} page: the page index
|
||||
*
|
||||
* Retrieves the children at page @page, including invisible children.
|
||||
* Retrieves the children at page `page`, including invisible children.
|
||||
*
|
||||
* @param {number} page the page index
|
||||
*
|
||||
* @returns {Array} an array of {Clutter.Actor}s
|
||||
*/
|
||||
|
@ -88,27 +88,6 @@ var RadialShaderEffect = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* Lightbox:
|
||||
* @container: parent Clutter.Container
|
||||
* @params: (optional) additional parameters:
|
||||
* - inhibitEvents: whether to inhibit events for @container
|
||||
* - width: shade actor width
|
||||
* - height: shade actor height
|
||||
* - fadeFactor: fading opacity factor
|
||||
* - radialEffect: whether to enable the GLSL radial effect
|
||||
*
|
||||
* Lightbox creates a dark translucent "shade" actor to hide the
|
||||
* contents of @container, and allows you to specify particular actors
|
||||
* in @container to highlight by bringing them above the shade. It
|
||||
* tracks added and removed actors in @container while the lightboxing
|
||||
* is active, and ensures that all actors are returned to their
|
||||
* original stacking order when the lightboxing is removed. (However,
|
||||
* if actors are restacked by outside code while the lightboxing is
|
||||
* active, the lightbox may later revert them back to their original
|
||||
* order.)
|
||||
*
|
||||
* By default, the shade window will have the height and width of
|
||||
* @container and will track any changes in its size. You can override
|
||||
* this by passing an explicit width and height in @params.
|
||||
*/
|
||||
var Lightbox = GObject.registerClass({
|
||||
Properties: {
|
||||
@ -116,6 +95,29 @@ var Lightbox = GObject.registerClass({
|
||||
'active', 'active', 'active', GObject.ParamFlags.READABLE, false),
|
||||
},
|
||||
}, class Lightbox extends St.Bin {
|
||||
/**
|
||||
* Lightbox creates a dark translucent "shade" actor to hide the
|
||||
* contents of `container`, and allows you to specify particular actors
|
||||
* in `container` to highlight by bringing them above the shade. It
|
||||
* tracks added and removed actors in `container` while the lightboxing
|
||||
* is active, and ensures that all actors are returned to their
|
||||
* original stacking order when the lightboxing is removed. (However,
|
||||
* if actors are restacked by outside code while the lightboxing is
|
||||
* active, the lightbox may later revert them back to their original
|
||||
* order.)
|
||||
*
|
||||
* By default, the shade window will have the height and width of
|
||||
* `container` and will track any changes in its size. You can override
|
||||
* this by passing an explicit width and height in `params`.
|
||||
*
|
||||
* @param {Clutter.Container} container parent Clutter.Container
|
||||
* @param {object} [params] additional parameters:
|
||||
* @param {boolean=} params.inhibitEvents: whether to inhibit events for `container`
|
||||
* @param {number=} params.width: shade actor width
|
||||
* @param {number=} params.height: shade actor height
|
||||
* @param {number=} params.fadeFactor: fading opacity factor
|
||||
* @param {boolean=} params.radialEffect: whether to enable the GLSL radial effect
|
||||
*/
|
||||
_init(container, params) {
|
||||
params = Params.parse(params, {
|
||||
inhibitEvents: false,
|
||||
@ -251,11 +253,12 @@ var Lightbox = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* highlight:
|
||||
* @param {Clutter.Actor=} window: actor to highlight
|
||||
*
|
||||
* Highlights the indicated actor and unhighlights any other
|
||||
* currently-highlighted actor. With no arguments or a false/null
|
||||
* argument, all actors will be unhighlighted.
|
||||
*
|
||||
* @param {Clutter.Actor=} window actor to highlight
|
||||
*/
|
||||
highlight(window) {
|
||||
if (this._highlighted == window)
|
||||
|
@ -169,7 +169,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
/**
|
||||
* setActive:
|
||||
* Show/hide all the zoom regions.
|
||||
* @param {bool} activate: Boolean to activate or de-activate the magnifier.
|
||||
*
|
||||
* @param {boolean} activate Boolean to activate or de-activate the magnifier.
|
||||
*/
|
||||
setActive(activate) {
|
||||
let isActive = this.isActive();
|
||||
@ -208,7 +209,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* isActive:
|
||||
* @returns {bool} Whether the magnifier is active.
|
||||
*
|
||||
* @returns {boolean} Whether the magnifier is active.
|
||||
*/
|
||||
isActive() {
|
||||
// Sufficient to check one ZoomRegion since Magnifier's active
|
||||
@ -245,7 +247,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* isTrackingMouse:
|
||||
* @returns {bool} whether the magnifier is currently tracking the mouse
|
||||
*
|
||||
* @returns {boolean} whether the magnifier is currently tracking the mouse
|
||||
*/
|
||||
isTrackingMouse() {
|
||||
return !!this._mouseTrackingId;
|
||||
@ -255,6 +258,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
* scrollToMousePos:
|
||||
* Position all zoom regions' ROI relative to the current location of the
|
||||
* system pointer.
|
||||
*
|
||||
* @param {[xMouse: number, yMouse: number] | []} args
|
||||
*/
|
||||
scrollToMousePos(...args) {
|
||||
const [xMouse, yMouse] = args.length ? args : global.get_pointer();
|
||||
@ -279,15 +284,16 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
/**
|
||||
* createZoomRegion:
|
||||
* Create a ZoomRegion instance with the given properties.
|
||||
* @param {number} xMagFactor:
|
||||
*
|
||||
* @param {number} xMagFactor
|
||||
* The power to set horizontal magnification of the ZoomRegion. A value
|
||||
* of 1.0 means no magnification, a value of 2.0 doubles the size.
|
||||
* @param {number} yMagFactor:
|
||||
* @param {number} yMagFactor
|
||||
* The power to set the vertical magnification of the ZoomRegion.
|
||||
* @param {{x: number, y: number, width: number, height: number}} roi:
|
||||
* @param {{x: number, y: number, width: number, height: number}} roi
|
||||
* The reg Object that defines the region to magnify, given in
|
||||
* unmagnified coordinates.
|
||||
* @param {{x: number, y: number, width: number, height: number}} viewPort:
|
||||
* @param {{x: number, y: number, width: number, height: number}} viewPort
|
||||
* Object that defines the position of the ZoomRegion on screen.
|
||||
* @returns {ZoomRegion} the newly created ZoomRegion.
|
||||
*/
|
||||
@ -309,7 +315,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
* addZoomRegion:
|
||||
* Append the given ZoomRegion to the list of currently defined ZoomRegions
|
||||
* for this Magnifier instance.
|
||||
* @param {ZoomRegion} zoomRegion: The zoomRegion to add.
|
||||
*
|
||||
* @param {ZoomRegion} zoomRegion The zoomRegion to add.
|
||||
*/
|
||||
addZoomRegion(zoomRegion) {
|
||||
if (zoomRegion) {
|
||||
@ -322,7 +329,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
/**
|
||||
* getZoomRegions:
|
||||
* Return a list of ZoomRegion's for this Magnifier.
|
||||
* @returns {number[]} The Magnifier's zoom region list.
|
||||
*
|
||||
* @returns {ZoomRegion[]} The Magnifier's zoom region list.
|
||||
*/
|
||||
getZoomRegions() {
|
||||
return this._zoomRegions;
|
||||
@ -369,8 +377,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* setCrosshairsVisible:
|
||||
* Show or hide the cross hair.
|
||||
* @param {bool} visible: Flag that indicates show (true) or hide (false).
|
||||
*
|
||||
* Show or hide the cross hair
|
||||
*
|
||||
* @param {boolean} visible Flag that indicates show (true) or hide (false).
|
||||
*/
|
||||
setCrosshairsVisible(visible) {
|
||||
if (visible) {
|
||||
@ -386,8 +396,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* setCrosshairsColor:
|
||||
*
|
||||
* Set the color of the crosshairs for all ZoomRegions.
|
||||
* @param {string} color: The color as a string, e.g. '#ff0000ff' or 'red'.
|
||||
*
|
||||
* @param {string} color The color as a string, e.g. '#ff0000ff' or 'red'.
|
||||
*/
|
||||
setCrosshairsColor(color) {
|
||||
if (this._crossHairs) {
|
||||
@ -399,6 +411,7 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
/**
|
||||
* getCrosshairsColor:
|
||||
* Get the color of the crosshairs.
|
||||
*
|
||||
* @returns {string} The color as a string, e.g. '#0000ffff' or 'blue'.
|
||||
*/
|
||||
getCrosshairsColor() {
|
||||
@ -412,8 +425,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* setCrosshairsThickness:
|
||||
*
|
||||
* Set the crosshairs thickness for all ZoomRegions.
|
||||
* @param {number} thickness: The width of the vertical and
|
||||
*
|
||||
* @param {number} thickness The width of the vertical and
|
||||
* horizontal lines of the crosshairs.
|
||||
*/
|
||||
setCrosshairsThickness(thickness) {
|
||||
@ -424,6 +439,7 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
/**
|
||||
* getCrosshairsThickness:
|
||||
* Get the crosshairs thickness.
|
||||
*
|
||||
* @returns {number} The width of the vertical and horizontal
|
||||
* lines of the crosshairs.
|
||||
*/
|
||||
@ -436,7 +452,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* setCrosshairsOpacity:
|
||||
* @param {number} opacity: Value between 0.0 (transparent)
|
||||
*
|
||||
* @param {number} opacity Value between 0.0 (transparent)
|
||||
* and 1.0 (fully opaque).
|
||||
*/
|
||||
setCrosshairsOpacity(opacity) {
|
||||
@ -457,8 +474,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* setCrosshairsLength:
|
||||
*
|
||||
* Set the crosshairs length for all ZoomRegions.
|
||||
* @param {number} length: The length of the vertical and horizontal
|
||||
*
|
||||
* @param {number} length The length of the vertical and horizontal
|
||||
* lines making up the crosshairs.
|
||||
*/
|
||||
setCrosshairsLength(length) {
|
||||
@ -471,6 +490,7 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
/**
|
||||
* getCrosshairsLength:
|
||||
* Get the crosshairs length.
|
||||
*
|
||||
* @returns {number} The length of the vertical and horizontal
|
||||
* lines making up the crosshairs.
|
||||
*/
|
||||
@ -483,8 +503,10 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
|
||||
/**
|
||||
* setCrosshairsClip:
|
||||
*
|
||||
* Set whether the crosshairs are clipped at their intersection.
|
||||
* @param {bool} clip: Flag to indicate whether to clip the crosshairs.
|
||||
*
|
||||
* @param {boolean} clip Flag to indicate whether to clip the crosshairs.
|
||||
*/
|
||||
setCrosshairsClip(clip) {
|
||||
if (!this._crossHairs)
|
||||
@ -497,7 +519,8 @@ var Magnifier = class Magnifier extends Signals.EventEmitter {
|
||||
/**
|
||||
* getCrosshairsClip:
|
||||
* Get whether the crosshairs are clipped by the mouse image.
|
||||
* @returns {bool} Whether the crosshairs are clipped.
|
||||
*
|
||||
* @returns {boolean} Whether the crosshairs are clipped.
|
||||
*/
|
||||
getCrosshairsClip() {
|
||||
if (this._crossHairs) {
|
||||
@ -933,7 +956,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* setActive:
|
||||
* @param {bool} activate: Boolean to show/hide the ZoomRegion.
|
||||
*
|
||||
* @param {boolean} activate Boolean to show/hide the ZoomRegion.
|
||||
*/
|
||||
setActive(activate) {
|
||||
if (activate == this.isActive())
|
||||
@ -960,7 +984,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* isActive:
|
||||
* @returns {bool} Whether this ZoomRegion is active
|
||||
*
|
||||
* @returns {boolean} Whether this ZoomRegion is active
|
||||
*/
|
||||
isActive() {
|
||||
return this._magView != null;
|
||||
@ -968,10 +993,11 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* setMagFactor:
|
||||
* @param {number} xMagFactor: The power to set the horizontal
|
||||
*
|
||||
* @param {number} xMagFactor The power to set the horizontal
|
||||
* magnification factor to of the magnified view. A value of 1.0
|
||||
* means no magnification. A value of 2.0 doubles the size.
|
||||
* @param {number} yMagFactor: The power to set the vertical
|
||||
* @param {number} yMagFactor The power to set the vertical
|
||||
* magnification factor to of the magnified view.
|
||||
*/
|
||||
setMagFactor(xMagFactor, yMagFactor) {
|
||||
@ -985,6 +1011,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* getMagFactor:
|
||||
*
|
||||
* @returns {number[]} an array, [xMagFactor, yMagFactor], containing
|
||||
* the horizontal and vertical magnification powers. A value of
|
||||
* 1.0 means no magnification. A value of 2.0 means the contents
|
||||
@ -996,7 +1023,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* setMouseTrackingMode
|
||||
* @param {GDesktopEnums.MagnifierMouseTrackingMode} mode: the new mode
|
||||
*
|
||||
* @param {GDesktopEnums.MagnifierMouseTrackingMode} mode the new mode
|
||||
*/
|
||||
setMouseTrackingMode(mode) {
|
||||
if (mode >= GDesktopEnums.MagnifierMouseTrackingMode.NONE &&
|
||||
@ -1005,7 +1033,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
}
|
||||
|
||||
/**
|
||||
* getMouseTrackingMode
|
||||
* getMouseTrackingMode:
|
||||
*
|
||||
* @returns {GDesktopEnums.MagnifierMouseTrackingMode} the current mode
|
||||
*/
|
||||
getMouseTrackingMode() {
|
||||
@ -1014,7 +1043,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* setFocusTrackingMode
|
||||
* @param {GDesktopEnums.MagnifierFocusTrackingMode} mode: the new mode
|
||||
*
|
||||
* @param {GDesktopEnums.MagnifierFocusTrackingMode} mode the new mode
|
||||
*/
|
||||
setFocusTrackingMode(mode) {
|
||||
this._focusTrackingMode = mode;
|
||||
@ -1023,7 +1053,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* setCaretTrackingMode
|
||||
* @param {GDesktopEnums.MagnifierCaretTrackingMode} mode: the new mode
|
||||
*
|
||||
* @param {GDesktopEnums.MagnifierCaretTrackingMode} mode the new mode
|
||||
*/
|
||||
setCaretTrackingMode(mode) {
|
||||
this._caretTrackingMode = mode;
|
||||
@ -1053,7 +1084,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* setViewPort
|
||||
* Sets the position and size of the ZoomRegion on screen.
|
||||
* @param {{x: number, y: number, width: number, height: number}} viewPort:
|
||||
*
|
||||
* @param {{x: number, y: number, width: number, height: number}} viewPort
|
||||
* Object defining the position and size of the view port.
|
||||
* The values are in stage coordinate space.
|
||||
*/
|
||||
@ -1065,7 +1097,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* setROI
|
||||
* Sets the "region of interest" that the ZoomRegion is magnifying.
|
||||
* @param {{x: number, y: number, width: number, height: number}} roi:
|
||||
*
|
||||
* @param {{x: number, y: number, width: number, height: number}} roi
|
||||
* Object that defines the region of the screen to magnify.
|
||||
* The values are in screen (unmagnified) coordinate space.
|
||||
*/
|
||||
@ -1087,6 +1120,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
* Retrieves the "region of interest" -- the rectangular bounds of that part
|
||||
* of the desktop that the magnified view is showing (x, y, width, height).
|
||||
* The bounds are given in non-magnified coordinates.
|
||||
*
|
||||
* @returns {number[]} an array, [x, y, width, height], representing
|
||||
* the bounding rectangle of what is shown in the magnified view.
|
||||
*/
|
||||
@ -1103,9 +1137,11 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* setLensMode:
|
||||
* Turn lens mode on/off. In full screen mode, lens mode does nothing since
|
||||
*
|
||||
* Turn lens mode on/off. In full screen mode, lens mode does nothing since
|
||||
* a lens the size of the screen is pointless.
|
||||
* @param {bool} lensMode: Whether lensMode should be active
|
||||
*
|
||||
* @param {boolean} lensMode Whether lensMode should be active
|
||||
*/
|
||||
setLensMode(lensMode) {
|
||||
this._lensMode = lensMode;
|
||||
@ -1116,7 +1152,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* isLensMode:
|
||||
* Is lens mode on or off?
|
||||
* @returns {bool} The lens mode state.
|
||||
*
|
||||
* @returns {boolean} The lens mode state.
|
||||
*/
|
||||
isLensMode() {
|
||||
return this._lensMode;
|
||||
@ -1126,7 +1163,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
* setClampScrollingAtEdges:
|
||||
* Stop vs. allow scrolling of the magnified contents when it scroll beyond
|
||||
* the edges of the screen.
|
||||
* @param {bool} clamp: Boolean to turn on/off clamping.
|
||||
*
|
||||
* @param {boolean} clamp Boolean to turn on/off clamping.
|
||||
*/
|
||||
setClampScrollingAtEdges(clamp) {
|
||||
this._clampScrollingAtEdges = clamp;
|
||||
@ -1210,7 +1248,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
* setScreenPosition:
|
||||
* Positions the zoom region to one of the enumerated positions on the
|
||||
* screen.
|
||||
* @param {GDesktopEnums.MagnifierScreenPosition} inPosition: the position
|
||||
*
|
||||
* @param {GDesktopEnums.MagnifierScreenPosition} inPosition the position
|
||||
*/
|
||||
setScreenPosition(inPosition) {
|
||||
switch (inPosition) {
|
||||
@ -1236,7 +1275,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
* getScreenPosition:
|
||||
* Tell the outside world what the current mode is -- magnifiying the
|
||||
* top half, bottom half, etc.
|
||||
* @returns {GDesktopEnums.MagnifierScreenPosition}: the current position.
|
||||
*
|
||||
* @returns {GDesktopEnums.MagnifierScreenPosition}: the current position.
|
||||
*/
|
||||
getScreenPosition() {
|
||||
return this._screenPosition;
|
||||
@ -1252,7 +1292,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* scrollToMousePos:
|
||||
* Set the region of interest based on the position of the system pointer.
|
||||
* @returns {bool}: Whether the system mouse pointer is over the
|
||||
*
|
||||
* @returns {boolean}: Whether the system mouse pointer is over the
|
||||
* magnified view.
|
||||
*/
|
||||
scrollToMousePos() {
|
||||
@ -1293,8 +1334,9 @@ var ZoomRegion = class ZoomRegion {
|
||||
* scrollContentsTo:
|
||||
* Shift the contents of the magnified view such it is centered on the given
|
||||
* coordinate.
|
||||
* @param {number} x: The x-coord of the point to center on.
|
||||
* @param {number} y: The y-coord of the point to center on.
|
||||
*
|
||||
* @param {number} x The x-coord of the point to center on.
|
||||
* @param {number} y The y-coord of the point to center on.
|
||||
*/
|
||||
scrollContentsTo(x, y) {
|
||||
if (x < 0 || x > global.screen_width ||
|
||||
@ -1314,7 +1356,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* addCrosshairs:
|
||||
* Add crosshairs centered on the magnified mouse.
|
||||
* @param {Crosshairs} crossHairs: Crosshairs instance
|
||||
*
|
||||
* @param {Crosshairs} crossHairs Crosshairs instance
|
||||
*/
|
||||
addCrosshairs(crossHairs) {
|
||||
this._crossHairs = crossHairs;
|
||||
@ -1328,7 +1371,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* setInvertLightness:
|
||||
* Set whether to invert the lightness of the magnified view.
|
||||
* @param {bool} flag: whether brightness should be inverted
|
||||
*
|
||||
* @param {boolean} flag whether brightness should be inverted
|
||||
*/
|
||||
setInvertLightness(flag) {
|
||||
this._invertLightness = flag;
|
||||
@ -1338,8 +1382,10 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* getInvertLightness:
|
||||
*
|
||||
* Retrieve whether the lightness is inverted.
|
||||
* @returns {bool} whether brightness should be inverted
|
||||
*
|
||||
* @returns {boolean} whether brightness should be inverted
|
||||
*/
|
||||
getInvertLightness() {
|
||||
return this._invertLightness;
|
||||
@ -1347,8 +1393,10 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
/**
|
||||
* setColorSaturation:
|
||||
*
|
||||
* Set the color saturation of the magnified view.
|
||||
* @param {number} saturation: A value from 0.0 to 1.0 that defines
|
||||
*
|
||||
* @param {number} saturation A value from 0.0 to 1.0 that defines
|
||||
* the color saturation, with 0.0 defining no color (grayscale),
|
||||
* and 1.0 defining full color.
|
||||
*/
|
||||
@ -1361,7 +1409,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* getColorSaturation:
|
||||
* Retrieve the color saturation of the magnified view.
|
||||
* @returns {number} the color saturation
|
||||
*
|
||||
* @returns {number} the color saturation
|
||||
*/
|
||||
getColorSaturation() {
|
||||
return this._colorSaturation;
|
||||
@ -1370,7 +1419,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* setBrightness:
|
||||
* Alter the brightness of the magnified view.
|
||||
* @param {Object} brightness: Object containing the contrast for the
|
||||
*
|
||||
* @param {object} brightness Object containing the contrast for the
|
||||
* red, green, and blue channels. Values of 0.0 represent "standard"
|
||||
* brightness (no change), whereas values less or greater than
|
||||
* 0.0 indicate decreased or incresaed brightness, respectively.
|
||||
@ -1390,7 +1440,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* setContrast:
|
||||
* Alter the contrast of the magnified view.
|
||||
* @param {Object} contrast: Object containing the contrast for the
|
||||
*
|
||||
* @param {object} contrast Object containing the contrast for the
|
||||
* red, green, and blue channels. Values of 0.0 represent "standard"
|
||||
* contrast (no change), whereas values less or greater than
|
||||
* 0.0 indicate decreased or incresaed contrast, respectively.
|
||||
@ -1410,7 +1461,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
/**
|
||||
* getContrast:
|
||||
* Retrieve the contrast of the magnified view.
|
||||
* @returns {{r: number, g: number, b: number}}: Object containing
|
||||
*
|
||||
* @returns {{r: number, g: number, b: number}}: Object containing
|
||||
* the contrast for the red, green, and blue channels.
|
||||
*/
|
||||
getContrast() {
|
||||
@ -1768,7 +1820,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
this._background.set_size(global.screen_width, global.screen_height);
|
||||
this._updateScreenPosition();
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
var Crosshairs = GObject.registerClass(
|
||||
class Crosshairs extends Clutter.Actor {
|
||||
@ -1819,9 +1871,10 @@ class Crosshairs extends Clutter.Actor {
|
||||
* already part of some other ZoomRegion, create a clone of the crosshairs
|
||||
* actor, and add the clone instead. Returns either the original or the
|
||||
* clone.
|
||||
* @param {ZoomRegion} zoomRegion: The container to add the crosshairs
|
||||
*
|
||||
* @param {ZoomRegion} zoomRegion The container to add the crosshairs
|
||||
* group to.
|
||||
* @param {Clutter.Actor} magnifiedMouse: The mouse actor for the
|
||||
* @param {Clutter.Actor} magnifiedMouse The mouse actor for the
|
||||
* zoom region -- used to position the crosshairs and properly
|
||||
* layer them below the mouse.
|
||||
* @returns {Clutter.Actor} The crosshairs actor, or its clone.
|
||||
@ -1853,10 +1906,12 @@ class Crosshairs extends Clutter.Actor {
|
||||
|
||||
/**
|
||||
* removeFromParent:
|
||||
* @param {Clutter.Actor} childActor: the actor returned from
|
||||
* addToZoomRegion
|
||||
*
|
||||
* Remove the crosshairs actor from its parent container, or destroy the
|
||||
* child actor if it was just a clone of the crosshairs actor.
|
||||
*
|
||||
* @param {Clutter.Actor} childActor the actor returned from
|
||||
* addToZoomRegion
|
||||
*/
|
||||
removeFromParent(childActor) {
|
||||
if (childActor == this)
|
||||
@ -1868,7 +1923,8 @@ class Crosshairs extends Clutter.Actor {
|
||||
/**
|
||||
* setColor:
|
||||
* Set the color of the crosshairs.
|
||||
* @param {Clutter.Color} clutterColor: The color
|
||||
*
|
||||
* @param {Clutter.Color} clutterColor The color
|
||||
*/
|
||||
setColor(clutterColor) {
|
||||
this._horizLeftHair.background_color = clutterColor;
|
||||
@ -1880,6 +1936,7 @@ class Crosshairs extends Clutter.Actor {
|
||||
/**
|
||||
* getColor:
|
||||
* Get the color of the crosshairs.
|
||||
*
|
||||
* @returns {ClutterColor} the crosshairs color
|
||||
*/
|
||||
getColor() {
|
||||
@ -1888,8 +1945,10 @@ class Crosshairs extends Clutter.Actor {
|
||||
|
||||
/**
|
||||
* setThickness:
|
||||
*
|
||||
* Set the width of the vertical and horizontal lines of the crosshairs.
|
||||
* @param {number} thickness: the new thickness value
|
||||
*
|
||||
* @param {number} thickness the new thickness value
|
||||
*/
|
||||
setThickness(thickness) {
|
||||
this._horizLeftHair.set_height(thickness);
|
||||
@ -1902,6 +1961,7 @@ class Crosshairs extends Clutter.Actor {
|
||||
/**
|
||||
* getThickness:
|
||||
* Get the width of the vertical and horizontal lines of the crosshairs.
|
||||
*
|
||||
* @returns {number} The thickness of the crosshairs.
|
||||
*/
|
||||
getThickness() {
|
||||
@ -1911,7 +1971,8 @@ class Crosshairs extends Clutter.Actor {
|
||||
/**
|
||||
* setOpacity:
|
||||
* Set how opaque the crosshairs are.
|
||||
* @param {number} opacity: Value between 0 (fully transparent)
|
||||
*
|
||||
* @param {number} opacity Value between 0 (fully transparent)
|
||||
* and 255 (full opaque).
|
||||
*/
|
||||
setOpacity(opacity) {
|
||||
@ -1931,7 +1992,8 @@ class Crosshairs extends Clutter.Actor {
|
||||
/**
|
||||
* setLength:
|
||||
* Set the length of the vertical and horizontal lines in the crosshairs.
|
||||
* @param {number} length: The length of the crosshairs.
|
||||
*
|
||||
* @param {number} length The length of the crosshairs.
|
||||
*/
|
||||
setLength(length) {
|
||||
this._horizLeftHair.set_width(length);
|
||||
@ -1944,6 +2006,7 @@ class Crosshairs extends Clutter.Actor {
|
||||
/**
|
||||
* getLength:
|
||||
* Get the length of the vertical and horizontal lines in the crosshairs.
|
||||
*
|
||||
* @returns {number} The length of the crosshairs.
|
||||
*/
|
||||
getLength() {
|
||||
@ -1954,7 +2017,8 @@ class Crosshairs extends Clutter.Actor {
|
||||
* setClip:
|
||||
* Set the width and height of the rectangle that clips the crosshairs at
|
||||
* their intersection
|
||||
* @param {number[]} size: Array of [width, height] defining the size
|
||||
*
|
||||
* @param {[number, number]} size Array of [width, height] defining the size
|
||||
* of the clip rectangle.
|
||||
*/
|
||||
setClip(size) {
|
||||
@ -1975,7 +2039,8 @@ class Crosshairs extends Clutter.Actor {
|
||||
* Reposition the horizontal and vertical hairs such that they cross at
|
||||
* the center of crosshairs group. If called with the dimensions of
|
||||
* the clip rectangle, these are used to update the size of the clip.
|
||||
* @param {number[]=} clipSize: If present, the clip's [width, height].
|
||||
*
|
||||
* @param {[number, number]} [clipSize] If present, the clip's [width, height].
|
||||
*/
|
||||
reCenter(clipSize) {
|
||||
let [groupWidth, groupHeight] = this.get_size();
|
||||
@ -2000,7 +2065,7 @@ class Crosshairs extends Clutter.Actor {
|
||||
}
|
||||
});
|
||||
|
||||
var MagShaderEffects = class MagShaderEffects {
|
||||
class MagShaderEffects {
|
||||
constructor(uiGroupClone) {
|
||||
this._inverse = new Shell.InvertLightnessEffect();
|
||||
this._brightnessContrast = new Clutter.BrightnessContrastEffect();
|
||||
@ -2032,7 +2097,8 @@ var MagShaderEffects = class MagShaderEffects {
|
||||
/**
|
||||
* setInvertLightness:
|
||||
* Enable/disable invert lightness effect.
|
||||
* @param {bool} invertFlag: Enabled flag.
|
||||
*
|
||||
* @param {boolean} invertFlag Enabled flag.
|
||||
*/
|
||||
setInvertLightness(invertFlag) {
|
||||
this._inverse.set_enabled(invertFlag);
|
||||
@ -2046,7 +2112,8 @@ var MagShaderEffects = class MagShaderEffects {
|
||||
/**
|
||||
* setBrightness:
|
||||
* Set the brightness of the magnified view.
|
||||
* @param {Object} brightness: Object containing the contrast for the
|
||||
*
|
||||
* @param {object} brightness Object containing the contrast for the
|
||||
* red, green, and blue channels. Values of 0.0 represent "standard"
|
||||
* brightness (no change), whereas values less or greater than
|
||||
* 0.0 indicate decreased or incresaed brightness, respectively.
|
||||
@ -2071,7 +2138,8 @@ var MagShaderEffects = class MagShaderEffects {
|
||||
|
||||
/**
|
||||
* Set the contrast of the magnified view.
|
||||
* @param {Object} contrast: Object containing the contrast for the
|
||||
*
|
||||
* @param {object} contrast Object containing the contrast for the
|
||||
* red, green, and blue channels. Values of 0.0 represent "standard"
|
||||
* contrast (no change), whereas values less or greater than
|
||||
* 0.0 indicate decreased or incresaed contrast, respectively.
|
||||
@ -2096,4 +2164,4 @@ var MagShaderEffects = class MagShaderEffects {
|
||||
cRed !== NO_CHANGE || cGreen !== NO_CHANGE || cBlue !== NO_CHANGE ||
|
||||
bRed !== NO_CHANGE || bGreen !== NO_CHANGE || bBlue !== NO_CHANGE);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
@ -524,8 +524,9 @@ function loadTheme() {
|
||||
|
||||
/**
|
||||
* notify:
|
||||
* @param {string} msg: A message
|
||||
* @param {string} details: Additional information
|
||||
*
|
||||
* @param {string} msg A message
|
||||
* @param {string} details Additional information
|
||||
*/
|
||||
function notify(msg, details) {
|
||||
let source = new MessageTray.SystemNotificationSource();
|
||||
@ -713,6 +714,11 @@ function popModal(grab, timestamp) {
|
||||
actionMode = Shell.ActionMode.NORMAL;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates the looking glass panel
|
||||
*
|
||||
* @returns {LookingGlass.LookingGlass}
|
||||
*/
|
||||
function createLookingGlass() {
|
||||
if (lookingGlass == null)
|
||||
lookingGlass = new LookingGlass.LookingGlass();
|
||||
@ -720,6 +726,9 @@ function createLookingGlass() {
|
||||
return lookingGlass;
|
||||
}
|
||||
|
||||
/**
|
||||
* Opens the run dialog
|
||||
*/
|
||||
function openRunDialog() {
|
||||
if (runDialog == null)
|
||||
runDialog = new RunDialog.RunDialog();
|
||||
@ -736,9 +745,10 @@ function openWelcomeDialog() {
|
||||
|
||||
/**
|
||||
* activateWindow:
|
||||
* @param {Meta.Window} window: the window to activate
|
||||
* @param {number=} time: current event time
|
||||
* @param {number=} workspaceNum: window's workspace number
|
||||
*
|
||||
* @param {Meta.Window} window the window to activate
|
||||
* @param {number=} time current event time
|
||||
* @param {number=} workspaceNum window's workspace number
|
||||
*
|
||||
* Activates @window, switching to its workspace first if necessary,
|
||||
* and switching out of the overview if it's currently active
|
||||
@ -882,7 +892,8 @@ function initializeDeferredWork(actor, callback) {
|
||||
|
||||
/**
|
||||
* queueDeferredWork:
|
||||
* @param {string} workId: work identifier
|
||||
*
|
||||
* @param {string} workId work identifier
|
||||
*
|
||||
* Ensure that the work identified by @workId will be
|
||||
* run on map or timeout. You should call this function
|
||||
|
@ -17,6 +17,11 @@ var MESSAGE_ANIMATION_TIME = 100;
|
||||
|
||||
var DEFAULT_EXPAND_LINES = 6;
|
||||
|
||||
/**
|
||||
* @param {string} text
|
||||
* @param {boolean} allowMarkup
|
||||
* @returns {string}
|
||||
*/
|
||||
function _fixMarkup(text, allowMarkup) {
|
||||
if (allowMarkup) {
|
||||
// Support &, ", ', < and >, escape all other
|
||||
|
@ -50,6 +50,7 @@ var State = {
|
||||
// notifications that were requested to be destroyed by the associated source,
|
||||
// and REPLACED for notifications that were destroyed as a consequence of a
|
||||
// newer version having replaced them.
|
||||
/** @enum {number} */
|
||||
var NotificationDestroyedReason = {
|
||||
EXPIRED: 1,
|
||||
DISMISSED: 2,
|
||||
@ -61,6 +62,7 @@ var NotificationDestroyedReason = {
|
||||
// urgency values map to the corresponding values for the notifications received
|
||||
// through the notification daemon. HIGH urgency value is used for chats received
|
||||
// through the Telepathy client.
|
||||
/** @enum {number} */
|
||||
var Urgency = {
|
||||
LOW: 0,
|
||||
NORMAL: 1,
|
||||
@ -74,6 +76,7 @@ var Urgency = {
|
||||
// contain information private to the physical system (for example, battery
|
||||
// status) and hence the same for every user. This affects whether the content
|
||||
// of a notification is shown on the lock screen.
|
||||
/** @enum {number} */
|
||||
var PrivacyScope = {
|
||||
USER: 0,
|
||||
SYSTEM: 1,
|
||||
|
@ -16,6 +16,7 @@ const Params = imports.misc.params;
|
||||
var OPEN_AND_CLOSE_TIME = 100;
|
||||
var FADE_OUT_DIALOG_TIME = 1000;
|
||||
|
||||
/** @enum {number} */
|
||||
var State = {
|
||||
OPENED: 0,
|
||||
CLOSED: 1,
|
||||
|
@ -17,6 +17,7 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const FdoNotificationsIface = loadInterfaceXML('org.freedesktop.Notifications');
|
||||
|
||||
/** @enum {number} */
|
||||
var NotificationClosedReason = {
|
||||
EXPIRED: 1,
|
||||
DISMISSED: 2,
|
||||
@ -24,6 +25,7 @@ var NotificationClosedReason = {
|
||||
UNDEFINED: 4,
|
||||
};
|
||||
|
||||
/** @enum {number} */
|
||||
var Urgency = {
|
||||
LOW: 0,
|
||||
NORMAL: 1,
|
||||
@ -544,9 +546,12 @@ function objectPathFromAppId(appId) {
|
||||
return `/${appId.replace(/\./g, '/').replace(/-/g, '_')}`;
|
||||
}
|
||||
|
||||
/**
|
||||
* @returns {{ 'desktop-startup-id': string }}
|
||||
*/
|
||||
function getPlatformData() {
|
||||
let startupId = GLib.Variant.new('s', `_TIME${global.get_current_time()}`);
|
||||
return { "desktop-startup-id": startupId };
|
||||
return {'desktop-startup-id': startupId};
|
||||
}
|
||||
|
||||
function InvalidAppError() {}
|
||||
|
@ -27,6 +27,7 @@ const A11Y_SCHEMA = 'org.gnome.desktop.a11y.keyboard';
|
||||
|
||||
var SIDE_CONTROLS_ANIMATION_TIME = Overview.ANIMATION_TIME;
|
||||
|
||||
/** @enum {number} */
|
||||
var ControlsState = {
|
||||
HIDDEN: 0,
|
||||
WINDOW_PICKER: 1,
|
||||
|
@ -11,6 +11,10 @@ var IDLE_TIME = 1000;
|
||||
// but we turn off the polling when the user is idle.
|
||||
|
||||
let _pointerWatcher = null;
|
||||
|
||||
/**
|
||||
* @returns {PointerWatcher}
|
||||
*/
|
||||
function getPointerWatcher() {
|
||||
if (_pointerWatcher == null)
|
||||
_pointerWatcher = new PointerWatcher();
|
||||
|
@ -16,6 +16,7 @@ const BoxPointer = imports.ui.boxpointer;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
|
||||
/** @enum {number} */
|
||||
var Ornament = {
|
||||
NONE: 0,
|
||||
DOT: 1,
|
||||
|
@ -67,7 +67,9 @@ export const PerfHelperProxy = Gio.DBusProxy.makeProxyWrapper(PerfHelperIface);
|
||||
|
||||
let _perfHelper = null;
|
||||
|
||||
/** @private */
|
||||
/**
|
||||
* @returns {PerfHelper}
|
||||
*/
|
||||
export async function _getPerfHelper() {
|
||||
if (_perfHelper == null) {
|
||||
_perfHelper = await PerfHelperProxy.newAsync(
|
||||
@ -87,12 +89,13 @@ export function _spawnPerfHelper() {
|
||||
|
||||
/**
|
||||
* createTestWindow:
|
||||
* @param {Object} params: options for window creation.
|
||||
* {number} [params.width=640] - width of window, in pixels
|
||||
* {number} [params.height=480] - height of window, in pixels
|
||||
* {bool} [params.alpha=false] - whether the window should have an alpha channel
|
||||
* {bool} [params.maximized=false] - whether the window should be created maximized
|
||||
* {bool} [params.redraws=false] - whether the window should continually redraw itself
|
||||
*
|
||||
* @param {object} params options for window creation.
|
||||
* @param {number} [params.width=640] - width of window, in pixels
|
||||
* @param {number} [params.height=480] - height of window, in pixels
|
||||
* @param {boolean} [params.alpha=false] - whether the window should have an alpha channel
|
||||
* @param {boolean} [params.maximized=false] - whether the window should be created maximized
|
||||
* @param {boolean} [params.redraws=false] - whether the window should continually redraw itself
|
||||
* @returns {Promise}
|
||||
*
|
||||
* Creates a window using gnome-shell-perf-helper for testing purposes.
|
||||
@ -133,6 +136,7 @@ export async function waitTestWindows() {
|
||||
|
||||
/**
|
||||
* destroyTestWindows:
|
||||
*
|
||||
* @returns {Promise}
|
||||
*
|
||||
* Destroys all windows previously created with createTestWindow().
|
||||
@ -158,9 +162,10 @@ export async function disableHelperAutoExit() {
|
||||
}
|
||||
|
||||
/**
|
||||
* defineScriptEvent
|
||||
* @param {string} name: The event will be called script.<name>
|
||||
* @param {string} description: Short human-readable description of the event
|
||||
* defineScriptEvent:
|
||||
*
|
||||
* @param {string} name The event will be called script.<name>
|
||||
* @param {string} description Short human-readable description of the event
|
||||
*
|
||||
* Convenience function to define a zero-argument performance event
|
||||
* within the 'script' namespace that is reserved for events defined locally
|
||||
@ -317,9 +322,6 @@ async function _runPerfScript(scriptModule, outputFile) {
|
||||
|
||||
/**
|
||||
* runPerfScript
|
||||
* @param {Object} scriptModule: module object with run and finish
|
||||
* functions and event handlers
|
||||
* @param {string} outputFile: path to write output to
|
||||
*
|
||||
* Runs a script for automated collection of performance data. The
|
||||
* script is defined as a Javascript module with specified contents.
|
||||
@ -350,11 +352,15 @@ async function _runPerfScript(scriptModule, outputFile) {
|
||||
* '/ s', 'frames', 'frames / s', 'MiB / s / frame'
|
||||
* value: computed value of the metric
|
||||
*
|
||||
* The resulting metrics will be written to @outputFile as JSON, or,
|
||||
* if @outputFile is not provided, logged.
|
||||
* The resulting metrics will be written to `outputFile` as JSON, or,
|
||||
* if `outputFile` is not provided, logged.
|
||||
*
|
||||
* After running the script and collecting statistics from the
|
||||
* event log, GNOME Shell will exit.
|
||||
*
|
||||
* @param {object} scriptModule module object with run and finish
|
||||
* functions and event handlers
|
||||
* @param {string} outputFile path to write output to
|
||||
*/
|
||||
export function runPerfScript(scriptModule, outputFile) {
|
||||
Shell.PerfLog.get_default().set_enabled(true);
|
||||
|
@ -49,7 +49,7 @@ var GnomeShell = class {
|
||||
|
||||
/**
|
||||
* Eval:
|
||||
* @param {string} code: A string containing JavaScript code
|
||||
* @param {string} code A string containing JavaScript code
|
||||
* @returns {Array}
|
||||
*
|
||||
* This function executes arbitrary code in the main
|
||||
|
@ -131,6 +131,10 @@ function _onPopup(actor, entry) {
|
||||
entry.menu.open(BoxPointer.PopupAnimation.FULL);
|
||||
}
|
||||
|
||||
/**
|
||||
* @param {St.Entry} entry
|
||||
* @param {*} params
|
||||
*/
|
||||
function addContextMenu(entry, params) {
|
||||
if (entry.menu)
|
||||
return;
|
||||
|
@ -532,6 +532,7 @@ var ShellProcessesDialog = GObject.registerClass({
|
||||
|
||||
const GnomeShellMountOpIface = loadInterfaceXML('org.Gtk.MountOperationHandler');
|
||||
|
||||
/** @enum {number} */
|
||||
var ShellMountOperationType = {
|
||||
NONE: 0,
|
||||
ASK_PASSWORD: 1,
|
||||
|
@ -799,6 +799,9 @@ var InputSourceManager = class extends Signals.EventEmitter {
|
||||
|
||||
let _inputSourceManager = null;
|
||||
|
||||
/**
|
||||
* @returns {InputSourceManager}
|
||||
*/
|
||||
function getInputSourceManager() {
|
||||
if (_inputSourceManager == null)
|
||||
_inputSourceManager = new InputSourceManager();
|
||||
|
@ -22,6 +22,7 @@ const ENABLED = 'enabled';
|
||||
const APP_PERMISSIONS_TABLE = 'location';
|
||||
const APP_PERMISSIONS_ID = 'location';
|
||||
|
||||
/** @enum {number} */
|
||||
var GeoclueAccuracyLevel = {
|
||||
NONE: 0,
|
||||
COUNTRY: 1,
|
||||
|
@ -32,6 +32,7 @@ const MAX_VISIBLE_NETWORKS = 8;
|
||||
// small optimization, to avoid using [] all the time
|
||||
const NM80211Mode = NM['80211Mode'];
|
||||
|
||||
/** @enum {number} */
|
||||
var PortalHelperResult = {
|
||||
CANCELLED: 0,
|
||||
COMPLETED: 1,
|
||||
|
@ -82,7 +82,11 @@ const RfkillManager = GObject.registerClass({
|
||||
}
|
||||
});
|
||||
|
||||
var _manager;
|
||||
let _manager;
|
||||
|
||||
/**
|
||||
* @returns {RfkillManager}
|
||||
*/
|
||||
function getRfkillManager() {
|
||||
if (_manager != null)
|
||||
return _manager;
|
||||
|
@ -23,8 +23,7 @@ const BoltDeviceInterface = loadInterfaceXML('org.freedesktop.bolt1.Device');
|
||||
|
||||
const BoltDeviceProxy = Gio.DBusProxy.makeProxyWrapper(BoltDeviceInterface);
|
||||
|
||||
/* */
|
||||
|
||||
/** @enum {string} */
|
||||
var Status = {
|
||||
DISCONNECTED: 'disconnected',
|
||||
CONNECTING: 'connecting',
|
||||
@ -34,16 +33,19 @@ var Status = {
|
||||
AUTHORIZED: 'authorized',
|
||||
};
|
||||
|
||||
/** @enum {string} */
|
||||
var Policy = {
|
||||
DEFAULT: 'default',
|
||||
MANUAL: 'manual',
|
||||
AUTO: 'auto',
|
||||
};
|
||||
|
||||
/** @enum {string} */
|
||||
var AuthCtrl = {
|
||||
NONE: 'none',
|
||||
};
|
||||
|
||||
/** @enum {string} */
|
||||
var AuthMode = {
|
||||
DISABLED: 'disabled',
|
||||
ENABLED: 'enabled',
|
||||
|
@ -37,6 +37,7 @@ const EPSILON = 0.005;
|
||||
|
||||
const GESTURE_FINGER_COUNT = 3;
|
||||
|
||||
/** @enum {number} */
|
||||
const State = {
|
||||
NONE: 0,
|
||||
SCROLLING: 1,
|
||||
@ -523,11 +524,11 @@ var SwipeTracker = GObject.registerClass({
|
||||
|
||||
/**
|
||||
* canHandleScrollEvent:
|
||||
* @param {Clutter.Event} scrollEvent: an event to check
|
||||
* @returns {bool} whether the event can be handled by the tracker
|
||||
*
|
||||
* This function can be used to combine swipe gesture and mouse
|
||||
* scrolling.
|
||||
*
|
||||
* @param {Clutter.Event} scrollEvent an event to check
|
||||
* @returns {boolean} whether the event can be handled by the tracker
|
||||
*/
|
||||
canHandleScrollEvent(scrollEvent) {
|
||||
if (!this.enabled || this._scrollGesture === null)
|
||||
|
@ -16,6 +16,11 @@ var POPUP_FADE_OUT_TIME = 100; // milliseconds
|
||||
var DISABLE_HOVER_TIMEOUT = 500; // milliseconds
|
||||
var NO_MODS_TIMEOUT = 1500; // milliseconds
|
||||
|
||||
/**
|
||||
* @param {number} a
|
||||
* @param {number} b
|
||||
* @returns {number}
|
||||
*/
|
||||
function mod(a, b) {
|
||||
return (a + b) % b;
|
||||
}
|
||||
@ -645,6 +650,10 @@ var SwitcherList = GObject.registerClass({
|
||||
}
|
||||
});
|
||||
|
||||
/**
|
||||
* @param {St.DrawingArrow} area
|
||||
* @param {St.Side} side
|
||||
*/
|
||||
function drawArrow(area, side) {
|
||||
let themeNode = area.get_theme_node();
|
||||
let borderColor = themeNode.get_border_color(side);
|
||||
|
@ -11,6 +11,7 @@ const Dialog = imports.ui.dialog;
|
||||
const Main = imports.ui.main;
|
||||
const ModalDialog = imports.ui.modalDialog;
|
||||
|
||||
/** @enum {number} */
|
||||
var DialogResponse = {
|
||||
NO_THANKS: 0,
|
||||
TAKE_TOUR: 1,
|
||||
|
@ -161,6 +161,9 @@ class WindowDimmer extends Clutter.BrightnessContrastEffect {
|
||||
}
|
||||
});
|
||||
|
||||
/**
|
||||
* @param {Meta.WindowActor} actor
|
||||
*/
|
||||
function getWindowDimmer(actor) {
|
||||
let effect = actor.get_effect(WINDOW_DIMMER_EFFECT_NAME);
|
||||
|
||||
|
@ -82,6 +82,7 @@ var WorkspacesViewBase = GObject.registerClass({
|
||||
}
|
||||
});
|
||||
|
||||
/** @enum {number} */
|
||||
var FitMode = {
|
||||
SINGLE: 0,
|
||||
ALL: 1,
|
||||
|
@ -547,6 +547,8 @@ function initEnvironment() {
|
||||
}
|
||||
|
||||
/**
|
||||
* Main entrypoint for the app
|
||||
*
|
||||
* @param {string[]} argv - command line arguments
|
||||
* @returns {void}
|
||||
*/
|
||||
|
Loading…
Reference in New Issue
Block a user