Compare commits

..

3 Commits

Author SHA1 Message Date
Georges Basile Stavracas Neto
d6345a5c8b altTab: Switch to MetaWindowContent 2019-10-17 08:42:37 +02:00
Georges Basile Stavracas Neto
628b34e96f overview: Switch to MetaWindowContent 2019-10-16 18:17:47 +02:00
Georges Basile Stavracas Neto
5743b52ec8 workspace: Replace ClutterClone by MetaWindowContent 2019-10-16 18:16:12 +02:00
251 changed files with 6572 additions and 31819 deletions

6
.eslintrc.json Normal file
View File

@@ -0,0 +1,6 @@
{
"extends": [
"./lint/eslintrc-gjs.json",
"./lint/eslintrc-shell.json"
]
}

View File

@@ -1,3 +0,0 @@
extends:
- ./lint/eslintrc-gjs.yml
- ./lint/eslintrc-shell.yml

View File

@@ -14,7 +14,7 @@ variables:
- merge_requests - merge_requests
check_commit_log: check_commit_log:
image: registry.gitlab.gnome.org/gnome/mutter/master:v3 image: registry.gitlab.gnome.org/gnome/mutter/master:v2
stage: review stage: review
variables: variables:
GIT_DEPTH: "100" GIT_DEPTH: "100"
@@ -47,7 +47,7 @@ eslint:
when: always when: always
build: build:
image: registry.gitlab.gnome.org/gnome/mutter/master:v3 image: registry.gitlab.gnome.org/gnome/mutter/master:v2
stage: build stage: build
before_script: before_script:
- .gitlab-ci/checkout-mutter.sh - .gitlab-ci/checkout-mutter.sh
@@ -65,15 +65,14 @@ build:
- build - build
test: test:
image: registry.gitlab.gnome.org/gnome/mutter/master:v3 image: registry.gitlab.gnome.org/gnome/mutter/master:v2
stage: test stage: test
variables: variables:
XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir" XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
NO_AT_BRIDGE: "1"
before_script: before_script:
- ninja -C mutter/build install - ninja -C mutter/build install
script: script:
- dbus-run-session -- xvfb-run meson test -C build --no-rebuild - xvfb-run meson test -C build --no-rebuild
<<: *only_default <<: *only_default
artifacts: artifacts:
expire_in: 1 day expire_in: 1 day
@@ -82,7 +81,7 @@ test:
when: on_failure when: on_failure
test-pot: test-pot:
image: registry.gitlab.gnome.org/gnome/mutter/master:v3 image: registry.gitlab.gnome.org/gnome/mutter/master:v2
stage: test stage: test
before_script: before_script:
- ninja -C mutter/build install - ninja -C mutter/build install

View File

@@ -1,5 +1,6 @@
#!/usr/bin/bash #!/usr/bin/bash
shell_branch=$(git describe --contains --all HEAD)
mutter_target= mutter_target=
git clone https://gitlab.gnome.org/GNOME/mutter.git git clone https://gitlab.gnome.org/GNOME/mutter.git
@@ -25,7 +26,8 @@ if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
fi fi
if [ -z "$mutter_target" ]; then if [ -z "$mutter_target" ]; then
mutter_target=$(git branch -r -l origin/$CI_COMMIT_REF_NAME) mutter_target=$(git branch -r -l origin/$shell_branch)
mutter_target=${mutter_target:-$(git branch -r -l ${shell_branch#remotes/})}
mutter_target=${mutter_target:-origin/master} mutter_target=${mutter_target:-origin/master}
echo Using $mutter_target instead echo Using $mutter_target instead
fi fi

View File

@@ -13,17 +13,11 @@ is_empty() {
} }
run_eslint() { run_eslint() {
ARGS_LEGACY='--config lint/eslintrc-legacy.yml' ARGS_LEGACY='--config lint/eslintrc-legacy.json'
local extra_args=ARGS_$1 local extra_args=ARGS_$1
local output_var=OUTPUT_$1 local output=OUTPUT_$1
local output=${!output_var} eslint -f unix ${!extra_args} -o ${!output} js
# ensure output exists even if eslint doesn't report any errors
mkdir -p $(dirname $output)
touch $output
eslint -f unix ${!extra_args} -o $output js
} }
list_commit_range_additions() { list_commit_range_additions() {
@@ -76,13 +70,10 @@ create_common() {
# non-legacy style just yet ... # non-legacy style just yet ...
unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME
REMOTE=${1:-$CI_MERGE_REQUEST_PROJECT_URL.git} if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
BRANCH_NAME=${2:-$CI_MERGE_REQUEST_TARGET_BRANCH_NAME} git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME
if [ "$BRANCH_NAME" ]; then
git fetch $REMOTE $BRANCH_NAME
branch_point=$(git merge-base HEAD FETCH_HEAD) branch_point=$(git merge-base HEAD FETCH_HEAD)
commit_range=$branch_point...HEAD commit_range=$branch_point...$CI_COMMIT_SHA
list_commit_range_additions $commit_range > $LINE_CHANGES list_commit_range_additions $commit_range > $LINE_CHANGES
@@ -105,7 +96,7 @@ if ! is_empty $OUTPUT_FINAL; then
fi fi
# Just show the report and succeed when not testing a MR # Just show the report and succeed when not testing a MR
if [ -z "$BRANCH_NAME" ]; then if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
exit 0 exit 0
fi fi

View File

@@ -163,17 +163,11 @@ you to inherit from a type to use it, you can do so:
return [100, 100]; return [100, 100];
} }
vfunc_paint(paintContext) { vfunc_paint() {
let framebuffer = paintContext.get_framebuffer();
let coglContext = framebuffer.get_context();
let alloc = this.get_allocation_box(); let alloc = this.get_allocation_box();
Cogl.set_source_color4ub(255, 0, 0, 255);
let pipeline = new Cogl.Pipeline(coglContext); Cogl.rectangle(alloc.x1, alloc.y1,
pipeline.set_color4ub(255, 0, 0, 255); alloc.x2, alloc.y2);
framebuffer.draw_rectangle(pipeline,
alloc.x1, alloc.y1,
alloc.x2, alloc.y2);
} }
}); });
``` ```

65
NEWS
View File

@@ -1,68 +1,3 @@
3.35.2
======
* Fix unredirection after cancelled animations [Florian; #1788]
* Include shadow in window screenshots [Robert; !762]
* Show indicator when microphone is active [Florian; !729]
* Use inheritance instead of delegate pattern [Marco; !559]
* Use cached coordinates for window sorting in overview [Andrew; !763]
* Wiggle login/unlock password entries on failure [Georges; !769]
* Update window titles in app menu [Florian; #1830]
* Fix window animations getting stuck by workspace switches [Jonas D.; !784]
* Fix not-responding dialog size when using geometry scaling [Jonas D.; !783]
* Handle buggy MPRIS clients more gracefully [Philip; #1362]
* Deprecate StBoxLayout's child properties [Florian; !780]
* Remove StBin's align properties [Florian; !803]
* Use correct timezones for events [Milan, Florian; !806, #1895]
* Reduce overhead of tracking stylesheet changes [Carlos; !779]
* Replace action icons in system menu with regular menu items [Florian; #270]
* Refine polkit dialogs [Jonas D.; !788]
* Fix battery icon glitch in "100% but charging" case [Philip; !814]
* Fix windows getting stuck on screen if closed while animating [Florian; !815]
* Use font from interface settings [Florian; #688288]
* Show polkit confirmation dialog for users with no password
[Joaquim, Jonas D.; !829]
* Use better OSK layout fallback for unsupported variants [Florian; #1907]
* Hide stopped spinner in top bar [Joonas; !832]
* Reuse existing icons when updating the app picker grid [Georges; !841]
* Show switcher popups immediately on second key press [Florian; #1928]
* Add position-based animation to page indicators [Alexander; !843]
* Improve modifier-less keyboard navigation of switcher popups [Florian; #1883]
* Improve weather integration [Florian; #1927, #1926]
* Add back sound feedback when scrolling volume indicator [Florian; #53]
* Fix creating app folders with no pre-existing folders [Jonas D.; #1652]
* Improve DND page switching in app picker [Florian, Jonas D.; #1693]
* Fix disable command of gnome-extensions tool [Florian; #1946]
* Tweak styling of notifications/media constrols [Joonas; !855, !865]
* Enable clean session shutdown after gnome-shell failure [Benjamin; !858]
* Also remove scaled keys when texture cache is cleared [Daniel M.; !567]
* Don't show overflow indicator in switchers that fit screen [Florian; #1834]
* Move libcroco dependency in-tree [Federico; !861]
* Move to app folder location when it is created/renamed [Georges; !883]
* Dismiss switcher popups when a system modal dialogs opens [Florian; #1536]
* Fix weather forecasts for automatic location when Weather is not sandboxed
[Florian; #1823]
* Place launched applications into a systemd scope [Benjamin; !863]
* Fixed crashes [Jonas D., Carlos; !787, !813]
* Misc. bug fixes and cleanups [Marco, Georges, Daniel V., Florian, Robert,
Kalev, Philip, Jonas D., Will, Carlos, Jonas Å., cunidev, Joonas, Federico;
!747, !765, !421, !759, !749, !730, !770, #1799, !774, !773, !776, !777,
!782, !794, !778, !792, !790, !190, !796, !795, !797, !798, !800, !804, !808,
!807, !810, !811, !563, !809, !805, !817, !818, !822, !830, !828, !823, !835,
!840, !842, !833, !845, !846, !847, !851, #1916, !862, !866, #1979, !827,
#1976, !884, !873, !885, !799, !887, !891, !816]
Contributors:
Marco Trevisan (Treviño), Benjamin Berg, Philip Chimento, Milan Crha,
Jonas Dreßler, Carlos Garnacho, Joonas Henriksson, Kalev Lember, Robert Mader,
Alexander Mikhaylenko, Daniel García Moreno, Florian Müllner,
Georges Basile Stavracas Neto, Federico Mena Quintero, Joaquim Rocha,
Will Thompson, Daniel van Vugt, Andrew Watson, cunidev, Jonas Ådahl
Translators:
Daniel Mustieles [es], Goran Vidović [hr], Fabio Tomat [fur],
Danial Behzadi [fa], Andika Triwidada [id], Efstathios Iosifidis [el],
Ricardo Silva Veloso [pt_BR]
3.35.1 3.35.1
====== ======
* Misc. bug fixes and cleanups [Marco; Matthias; !758, #701212] * Misc. bug fixes and cleanups [Marco; Matthias; !758, #701212]

View File

@@ -1,46 +1,5 @@
<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN"
"http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
<node> <node>
<!--
net.hadess.SwitcherooControl:
@short_description: D-Bus proxy to access dual-GPU controls.
After checking the availability of two switchable GPUs in the machine,
check the value of net.hadess.SwitcherooControl.HasDualGpu to see
if running applications on the discrete GPU should be offered.
The object path will be "/net/hadess/SwitcherooControl".
-->
<interface name="net.hadess.SwitcherooControl"> <interface name="net.hadess.SwitcherooControl">
<!--
HasDualGpu:
Whether two switchable GPUs are present on the system. This property
has been obsoleted in favour of the "NumGPUs" property.
-->
<property name="HasDualGpu" type="b" access="read"/> <property name="HasDualGpu" type="b" access="read"/>
<!--
NumGPUs:
The number of GPUs available on the system. Note that while having no
GPUs is unlikely, consumers of this API should probably not throw errors
if that were the case.
-->
<property name="NumGPUs" type="u" access="read"/>
<!--
GPUs:
An array of key-pair values representing each GPU. The key named "Name" (s)
will contain a user-facing name for the GPU, the "Environment" (as) key will
contain an array of even number of strings, each being an environment
variable to set to use the GPU, followed by its value, the "Default" (b) key
will tag the default (usually integrated) GPU.
-->
<property name="GPUs" type="aa{sv}" access="read"/>
</interface> </interface>
</node> </node>

View File

@@ -1,12 +1,11 @@
[Unit] [Unit]
Description=Disable GNOME Shell extensions after failure Description=Disable GNOME Shell extensions after failure
# Note that this unit must not conflict with anything, and must
# be able to run in parallel with the gnome-session-shutdown.target.
DefaultDependencies=no DefaultDependencies=no
# We want to disable extensions only if gnome-shell has flagged the extensions # Only disable extensions for a short period of time after login.
# to be a likely cause of trouble. # This means we err on the side of failing the first login after a broken
ConditionPathExists=%t/gnome-shell-disable-extensions # extension was installed.
Requisite=gnome-session-stable.timer
[Service] [Service]
Type=simple Type=simple

View File

@@ -50,7 +50,7 @@
</description> </description>
</key> </key>
<key name="favorite-apps" type="as"> <key name="favorite-apps" type="as">
<default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'org.gnome.Shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default> <default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default>
<summary>List of desktop file IDs for favorite applications</summary> <summary>List of desktop file IDs for favorite applications</summary>
<description> <description>
The applications corresponding to these identifiers The applications corresponding to these identifiers

View File

@@ -36,8 +36,10 @@ $_hover_bg_color: lighten($bg_color,if($variant=='light', 5%, 3%));
$_active_bg_color: if($variant == 'light', darken($bg_color, 14%), darken($bg_color, 9%)); $_active_bg_color: if($variant == 'light', darken($bg_color, 14%), darken($bg_color, 9%));
$font-size: 11; $font-size: 11;
$font-family: Cantarell, Sans-Serif;
stage { stage {
font-family: $font-family;
@include fontsize($font-size); @include fontsize($font-size);
color: $fg_color; color: $fg_color;
} }
@@ -977,7 +979,6 @@ StScrollBar {
spacing-columns: 0.8em; spacing-columns: 0.8em;
} }
.weather-header-box,
.weather-box { .weather-box {
spacing: 0.4em; spacing: 0.4em;
} }
@@ -1060,9 +1061,9 @@ StScrollBar {
} }
.calendar-today { .calendar-today {
font-weight: bold; font-weight: bold;
color: lighten($fg_color,5%); //color: lighten($fg_color,10%);
background-color: darken($bg_color,5%); //background-color: darken($bg_color,5%);
// border: 1px solid lighten($_bubble_borders_color,20%); border: 1px solid $_bubble_borders_color;
} }
.calendar-day-with-events { .calendar-day-with-events {
color: lighten($fg_color,10%); color: lighten($fg_color,10%);
@@ -1152,21 +1153,14 @@ StScrollBar {
padding: 10px; padding: 10px;
} }
.message-close-button {
color: lighten($fg_color, 15%);
&:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
&:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
}
.message-media-control { .message-media-control {
padding: 12px; padding: 12px;
color: lighten($fg_color, 15%); color: lighten($fg_color, 15%);
&:last-child:ltr { padding-right: 18px; } &:last-child:ltr { padding-right: 18px; }
&:last-child:rtl { padding-left: 18px; } &:last-child:rtl { padding-left: 18px; }
&:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); } &:hover { color: $fg_color; }
&:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); } &:insensitive { color: darken($fg_color,40%); }
&:insensitive { color: if($variant=='light', lighten($fg_color, 50%), darken($fg_color, 40%)); }
} }
.media-message-cover-icon { .media-message-cover-icon {
@@ -1196,8 +1190,7 @@ StScrollBar {
.aggregate-menu { .aggregate-menu {
min-width: 21em; min-width: 21em;
.popup-menu-icon { padding: 0 4px; .popup-menu-icon { padding: 0 4px; }
-st-icon-style: symbolic; }
.popup-sub-menu .popup-menu-item > :first-child { .popup-sub-menu .popup-menu-item > :first-child {
&:ltr { /* 12px spacing + 2*4px padding */ &:ltr { /* 12px spacing + 2*4px padding */
padding-left: 20px; margin-left: 1.09em; } padding-left: 20px; margin-left: 1.09em; }
@@ -1206,6 +1199,27 @@ StScrollBar {
} }
} }
.system-menu-action {
-st-icon-style: symbolic;
color: $fg_color;
border-radius: 32px; /* wish we could do 50% */
padding: 13px;
border: 1px solid $_bubble_borders_color;
&:hover, &:focus {
background-color: $_hover_bg_color;
color: $fg_color;
border: none;
padding: 14px;
}
&:active {
background-color: $selected_bg_color;
color: $selected_fg_color;
}
& > StIcon { icon-size: 16px; }
}
// Activities Ripples // Activities Ripples
.ripple-box { .ripple-box {
width: 52px; width: 52px;
@@ -1557,14 +1571,20 @@ StScrollBar {
} }
.page-indicator { .page-indicator {
padding: 7px 16px; padding: 15px 20px;
.page-indicator-icon { .page-indicator-icon {
width: 12px; width: 12px;
height: 12px; height: 12px;
background-color: white; background-color: transparent;
border-radius: 6px; border: 2px solid rgba(255, 255, 255, 0.4);
border-radius: 12px;
} }
&:hover .page-indicator-icon { border-color: white; }
&:active .page-indicator-icon { border: none; margin: 2px; background-color: white; }
&:checked .page-indicator-icon,
&:checked:active .page-indicator-icon { background-color: white;}
} }
.no-frequent-applications-label { @extend %status_text; } .no-frequent-applications-label { @extend %status_text; }
@@ -1764,8 +1784,8 @@ StScrollBar {
padding: 4px 4px; padding: 4px 4px;
.page-indicator-icon { .page-indicator-icon {
width: 8px; width: 6px;
height: 8px; height: 6px
} }
} }
} }

View File

@@ -23,13 +23,14 @@ function stripPrefix(string, prefix) {
return string; return string;
} }
var Application = GObject.registerClass( var Application = GObject.registerClass({
class Application extends Gtk.Application { GTypeName: 'ExtensionPrefs_Application'
}, class Application extends Gtk.Application {
_init() { _init() {
GLib.set_prgname('gnome-shell-extension-prefs'); GLib.set_prgname('gnome-shell-extension-prefs');
super._init({ super._init({
application_id: 'org.gnome.shell.ExtensionPrefs', application_id: 'org.gnome.shell.ExtensionPrefs',
flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE, flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
}); });
this._startupUuid = null; this._startupUuid = null;
@@ -60,12 +61,12 @@ class Application extends Gtk.Application {
let dialog = new Gtk.Window({ let dialog = new Gtk.Window({
modal: !this._skipMainWindow, modal: !this._skipMainWindow,
type_hint: Gdk.WindowTypeHint.DIALOG, type_hint: Gdk.WindowTypeHint.DIALOG
}); });
dialog.set_titlebar(new Gtk.HeaderBar({ dialog.set_titlebar(new Gtk.HeaderBar({
show_close_button: true, show_close_button: true,
title: row.name, title: row.name,
visible: true, visible: true
})); }));
if (this._skipMainWindow) { if (this._skipMainWindow) {
@@ -88,20 +89,20 @@ class Application extends Gtk.Application {
_buildErrorUI(row, exc) { _buildErrorUI(row, exc) {
let scroll = new Gtk.ScrolledWindow({ let scroll = new Gtk.ScrolledWindow({
hscrollbar_policy: Gtk.PolicyType.NEVER, hscrollbar_policy: Gtk.PolicyType.NEVER,
propagate_natural_height: true, propagate_natural_height: true
}); });
let box = new Gtk.Box({ let box = new Gtk.Box({
orientation: Gtk.Orientation.VERTICAL, orientation: Gtk.Orientation.VERTICAL,
spacing: 12, spacing: 12,
margin: 100, margin: 100,
margin_bottom: 60, margin_bottom: 60
}); });
scroll.add(box); scroll.add(box);
let label = new Gtk.Label({ let label = new Gtk.Label({
label: '<span size="x-large">%s</span>'.format(_("Somethings gone wrong")), label: '<span size="x-large">%s</span>'.format(_("Somethings gone wrong")),
use_markup: true, use_markup: true
}); });
label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL); label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
box.add(label); box.add(label);
@@ -109,13 +110,13 @@ class Application extends Gtk.Application {
label = new Gtk.Label({ label = new Gtk.Label({
label: _("Were very sorry, but theres been a problem: the settings for this extension cant be displayed. We recommend that you report the issue to the extension authors."), label: _("Were very sorry, but theres been a problem: the settings for this extension cant be displayed. We recommend that you report the issue to the extension authors."),
justify: Gtk.Justification.CENTER, justify: Gtk.Justification.CENTER,
wrap: true, wrap: true
}); });
box.add(label); box.add(label);
let expander = new Expander({ let expander = new Expander({
label: _("Technical Details"), label: _("Technical Details"),
margin_top: 12, margin_top: 12
}); });
box.add(expander); box.add(expander);
@@ -126,14 +127,14 @@ class Application extends Gtk.Application {
let buffer = new Gtk.TextBuffer({ text: errortext }); let buffer = new Gtk.TextBuffer({ text: errortext });
let textview = new Gtk.TextView({ let textview = new Gtk.TextView({
buffer, buffer: buffer,
wrap_mode: Gtk.WrapMode.WORD, wrap_mode: Gtk.WrapMode.WORD,
monospace: true, monospace: true,
editable: false, editable: false,
top_margin: 12, top_margin: 12,
bottom_margin: 12, bottom_margin: 12,
left_margin: 12, left_margin: 12,
right_margin: 12, right_margin: 12
}); });
let toolbar = new Gtk.Toolbar(); let toolbar = new Gtk.Toolbar();
@@ -149,7 +150,7 @@ class Application extends Gtk.Application {
let copyButton = new Gtk.ToolButton({ let copyButton = new Gtk.ToolButton({
icon_name: 'edit-copy-symbolic', icon_name: 'edit-copy-symbolic',
tooltip_text: _("Copy Error"), tooltip_text: _("Copy Error")
}); });
toolbar.add(copyButton); toolbar.add(copyButton);
@@ -158,15 +159,15 @@ class Application extends Gtk.Application {
// markdown for pasting in gitlab issues // markdown for pasting in gitlab issues
let lines = [ let lines = [
`The settings of extension ${row.uuid} had an error:`, `The settings of extension ${row.uuid} had an error:`,
'```', // '`' (xgettext throws up on odd number of backticks) '```',
`${exc}`, `${exc}`,
'```', // '`' '```',
'', '',
'Stack trace:', 'Stack trace:',
'```', // '`' '```',
exc.stack.replace(/\n$/, ''), // stack without trailing newline exc.stack.replace(/\n$/, ''), // stack without trailing newline
'```', // '`' '```',
'', ''
]; ];
clipboard.set_text(lines.join('\n'), -1); clipboard.set_text(lines.join('\n'), -1);
}); });
@@ -179,7 +180,7 @@ class Application extends Gtk.Application {
label: _("Homepage"), label: _("Homepage"),
tooltip_text: _("Visit extension homepage"), tooltip_text: _("Visit extension homepage"),
no_show_all: true, no_show_all: true,
visible: row.url != null, visible: row.url != null
}); });
toolbar.add(urlButton); toolbar.add(urlButton);
@@ -189,7 +190,7 @@ class Application extends Gtk.Application {
}); });
let expandedBox = new Gtk.Box({ let expandedBox = new Gtk.Box({
orientation: Gtk.Orientation.VERTICAL, orientation: Gtk.Orientation.VERTICAL
}); });
expandedBox.add(textview); expandedBox.add(textview);
expandedBox.add(toolbar); expandedBox.add(toolbar);
@@ -219,7 +220,7 @@ class Application extends Gtk.Application {
Gio.SettingsBindFlags.INVERT_BOOLEAN); Gio.SettingsBindFlags.INVERT_BOOLEAN);
this._mainStack = new Gtk.Stack({ this._mainStack = new Gtk.Stack({
transition_type: Gtk.StackTransitionType.CROSSFADE, transition_type: Gtk.StackTransitionType.CROSSFADE
}); });
this._window.add(this._mainStack); this._window.add(this._mainStack);
@@ -258,15 +259,23 @@ class Application extends Gtk.Application {
} }
_onExtensionStateChanged(proxy, senderName, [uuid, newState]) { _onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
let extension = ExtensionUtils.deserializeExtension(newState);
let row = this._findExtensionRow(uuid); let row = this._findExtensionRow(uuid);
if (row) { if (row) {
if (extension.state === ExtensionState.UNINSTALLED) let { state } = ExtensionUtils.deserializeExtension(newState);
if (state == ExtensionState.UNINSTALLED)
row.destroy(); row.destroy();
return; // we only deal with new and deleted extensions here return; // we only deal with new and deleted extensions here
} }
this._addExtensionRow(extension);
this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
let extension = ExtensionUtils.deserializeExtension(serialized);
if (!extension)
return;
// check the extension wasn't added in between
if (this._findExtensionRow(uuid) != null)
return;
this._addExtensionRow(extension);
});
} }
_scanExtensions() { _scanExtensions() {
@@ -352,20 +361,20 @@ var Expander = GObject.registerClass({
'label', 'label', 'label', 'label', 'label', 'label',
GObject.ParamFlags.READWRITE, GObject.ParamFlags.READWRITE,
null null
), )
}, }
}, class Expander extends Gtk.Box { }, class Expander extends Gtk.Box {
_init(params = {}) { _init(params = {}) {
this._labelText = null; this._labelText = null;
super._init(Object.assign(params, { super._init(Object.assign(params, {
orientation: Gtk.Orientation.VERTICAL, orientation: Gtk.Orientation.VERTICAL,
spacing: 0, spacing: 0
})); }));
this._frame = new Gtk.Frame({ this._frame = new Gtk.Frame({
shadow_type: Gtk.ShadowType.IN, shadow_type: Gtk.ShadowType.IN,
hexpand: true, hexpand: true
}); });
let eventBox = new Gtk.EventBox(); let eventBox = new Gtk.EventBox();
@@ -373,12 +382,12 @@ var Expander = GObject.registerClass({
let hbox = new Gtk.Box({ let hbox = new Gtk.Box({
spacing: 6, spacing: 6,
margin: 12, margin: 12
}); });
eventBox.add(hbox); eventBox.add(hbox);
this._arrow = new Gtk.Image({ this._arrow = new Gtk.Image({
icon_name: 'pan-end-symbolic', icon_name: 'pan-end-symbolic'
}); });
hbox.add(this._arrow); hbox.add(this._arrow);
@@ -388,7 +397,7 @@ var Expander = GObject.registerClass({
this._revealer = new Gtk.Revealer(); this._revealer = new Gtk.Revealer();
this._childBin = new Gtk.Frame({ this._childBin = new Gtk.Frame({
shadow_type: Gtk.ShadowType.IN, shadow_type: Gtk.ShadowType.IN
}); });
this._revealer.add(this._childBin); this._revealer.add(this._childBin);
@@ -406,7 +415,7 @@ var Expander = GObject.registerClass({
this._gesture = new Gtk.GestureMultiPress({ this._gesture = new Gtk.GestureMultiPress({
widget: this._frame, widget: this._frame,
button: 0, button: 0,
exclusive: true, exclusive: true
}); });
this._gesture.connect('released', (gesture, nPress) => { this._gesture.connect('released', (gesture, nPress) => {
if (nPress == 1) if (nPress == 1)
@@ -451,7 +460,7 @@ class EmptyPlaceholder extends Gtk.Box {
super._init({ super._init({
orientation: Gtk.Orientation.VERTICAL, orientation: Gtk.Orientation.VERTICAL,
spacing: 6, spacing: 6,
margin: 32, margin: 32
}); });
let image = new Gtk.Image({ let image = new Gtk.Image({
@@ -459,15 +468,15 @@ class EmptyPlaceholder extends Gtk.Box {
pixel_size: 96, pixel_size: 96,
visible: true, visible: true,
vexpand: true, vexpand: true,
valign: Gtk.Align.END, valign: Gtk.Align.END
}); });
image.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL); image.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
this.add(image); this.add(image);
let label = new Gtk.Label({ let label = new Gtk.Label({
label: `<b><span size="x-large">${_("No Extensions Installed")}</span></b>`, label: `<b><span size="x-large">${_("No Extensions Installed" )}</span></b>`,
use_markup: true, use_markup: true,
visible: true, visible: true
}); });
label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL); label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
this.add(label); this.add(label);
@@ -482,9 +491,9 @@ class EmptyPlaceholder extends Gtk.Box {
visible: true, visible: true,
max_width_chars: 50, max_width_chars: 50,
hexpand: true, hexpand: true,
vexpand: appInfo == null, vexpand: (appInfo == null),
halign: Gtk.Align.CENTER, halign: Gtk.Align.CENTER,
valign: Gtk.Align.START, valign: Gtk.Align.START
}); });
this.add(desc); this.add(desc);
@@ -492,14 +501,14 @@ class EmptyPlaceholder extends Gtk.Box {
let button = new Gtk.Button({ let button = new Gtk.Button({
label: _("Browse in Software"), label: _("Browse in Software"),
image: new Gtk.Image({ image: new Gtk.Image({
icon_name: "org.gnome.Software-symbolic", icon_name: "org.gnome.Software-symbolic"
}), }),
always_show_image: true, always_show_image: true,
margin_top: 12, margin_top: 12,
visible: true, visible: true,
halign: Gtk.Align.CENTER, halign: Gtk.Align.CENTER,
valign: Gtk.Align.START, valign: Gtk.Align.START,
vexpand: true, vexpand: true
}); });
this.add(button); this.add(button);
@@ -518,13 +527,13 @@ class NoShellPlaceholder extends Gtk.Box {
orientation: Gtk.Orientation.VERTICAL, orientation: Gtk.Orientation.VERTICAL,
spacing: 12, spacing: 12,
margin: 100, margin: 100,
margin_bottom: 60, margin_bottom: 60
}); });
let label = new Gtk.Label({ let label = new Gtk.Label({
label: '<span size="x-large">%s</span>'.format( label: '<span size="x-large">%s</span>'.format(
_("Somethings gone wrong")), _("Somethings gone wrong")),
use_markup: true, use_markup: true
}); });
label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL); label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
this.add(label); this.add(label);
@@ -532,7 +541,7 @@ class NoShellPlaceholder extends Gtk.Box {
label = new Gtk.Label({ label = new Gtk.Label({
label: _("Were very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."), label: _("Were very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
justify: Gtk.Justification.CENTER, justify: Gtk.Justification.CENTER,
wrap: true, wrap: true
}); });
this.add(label); this.add(label);
@@ -569,11 +578,11 @@ class ExtensionRow extends Gtk.ListBoxRow {
return; return;
this._extension = ExtensionUtils.deserializeExtension(newState); this._extension = ExtensionUtils.deserializeExtension(newState);
let state = this._extension.state == ExtensionState.ENABLED; let state = (this._extension.state == ExtensionState.ENABLED);
this._switch.block_signal_handler(this._notifyActiveId); GObject.signal_handler_block(this._switch, this._notifyActiveId);
this._switch.state = state; this._switch.state = state;
this._switch.unblock_signal_handler(this._notifyActiveId); GObject.signal_handler_unblock(this._switch, this._notifyActiveId);
this._switch.sensitive = this._canToggle(); this._switch.sensitive = this._canToggle();
}); });
@@ -640,7 +649,7 @@ class ExtensionRow extends Gtk.ListBoxRow {
this._switch = new Gtk.Switch({ this._switch = new Gtk.Switch({
valign: Gtk.Align.CENTER, valign: Gtk.Align.CENTER,
sensitive: this._canToggle(), sensitive: this._canToggle(),
state: this._extension.state === ExtensionState.ENABLED, state: this._extension.state === ExtensionState.ENABLED
}); });
this._notifyActiveId = this._switch.connect('notify::active', () => { this._notifyActiveId = this._switch.connect('notify::active', () => {
if (this._switch.active) if (this._switch.active)
@@ -657,12 +666,12 @@ class ExtensionRow extends Gtk.ListBoxRow {
} }
get prefsModule() { get prefsModule() {
// give extension prefs access to their own extension object
ExtensionUtils.getCurrentExtension = () => this._extension;
if (!this._prefsModule) { if (!this._prefsModule) {
ExtensionUtils.installImporter(this._extension); ExtensionUtils.installImporter(this._extension);
// give extension prefs access to their own extension object
ExtensionUtils.getCurrentExtension = () => this._extension;
this._prefsModule = this._extension.imports.prefs; this._prefsModule = this._extension.imports.prefs;
this._prefsModule.init(this._extension.metadata); this._prefsModule.init(this._extension.metadata);
} }
@@ -683,7 +692,7 @@ function initEnvironment() {
log(`ERROR: ${s}`); log(`ERROR: ${s}`);
}, },
userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell']), userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell'])
}; };
String.prototype.format = Format.format; String.prototype.format = Format.format;

View File

@@ -6,7 +6,6 @@ const { Clutter, GObject, Pango, Shell, St } = imports.gi;
const Animation = imports.ui.animation; const Animation = imports.ui.animation;
const Batch = imports.gdm.batch; const Batch = imports.gdm.batch;
const GdmUtil = imports.gdm.util; const GdmUtil = imports.gdm.util;
const Util = imports.misc.util;
const Params = imports.misc.params; const Params = imports.misc.params;
const ShellEntry = imports.ui.shellEntry; const ShellEntry = imports.ui.shellEntry;
const UserWidget = imports.ui.userWidget; const UserWidget = imports.ui.userWidget;
@@ -17,25 +16,21 @@ var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
var MESSAGE_FADE_OUT_ANIMATION_TIME = 500; var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
const WIGGLE_OFFSET = 6;
const WIGGLE_DURATION = 65;
const N_WIGGLES = 3;
var AuthPromptMode = { var AuthPromptMode = {
UNLOCK_ONLY: 0, UNLOCK_ONLY: 0,
UNLOCK_OR_LOG_IN: 1, UNLOCK_OR_LOG_IN: 1
}; };
var AuthPromptStatus = { var AuthPromptStatus = {
NOT_VERIFYING: 0, NOT_VERIFYING: 0,
VERIFYING: 1, VERIFYING: 1,
VERIFICATION_FAILED: 2, VERIFICATION_FAILED: 2,
VERIFICATION_SUCCEEDED: 3, VERIFICATION_SUCCEEDED: 3
}; };
var BeginRequestType = { var BeginRequestType = {
PROVIDE_USERNAME: 0, PROVIDE_USERNAME: 0,
DONT_PROVIDE_USERNAME: 1, DONT_PROVIDE_USERNAME: 1
}; };
var AuthPrompt = GObject.registerClass({ var AuthPrompt = GObject.registerClass({
@@ -45,12 +40,12 @@ var AuthPrompt = GObject.registerClass({
'next': {}, 'next': {},
'prompted': {}, 'prompted': {},
'reset': { param_types: [GObject.TYPE_UINT] }, 'reset': { param_types: [GObject.TYPE_UINT] },
}, }
}, class AuthPrompt extends St.BoxLayout { }, class AuthPrompt extends St.BoxLayout {
_init(gdmClient, mode) { _init(gdmClient, mode) {
super._init({ super._init({
style_class: 'login-dialog-prompt-layout', style_class: 'login-dialog-prompt-layout',
vertical: true, vertical: true
}); });
this.verificationStatus = AuthPromptStatus.NOT_VERIFYING; this.verificationStatus = AuthPromptStatus.NOT_VERIFYING;
@@ -64,7 +59,7 @@ var AuthPrompt = GObject.registerClass({
else if (this._mode == AuthPromptMode.UNLOCK_OR_LOG_IN) else if (this._mode == AuthPromptMode.UNLOCK_OR_LOG_IN)
reauthenticationOnly = false; reauthenticationOnly = false;
this._userVerifier = new GdmUtil.ShellUserVerifier(this._gdmClient, { reauthenticationOnly }); this._userVerifier = new GdmUtil.ShellUserVerifier(this._gdmClient, { reauthenticationOnly: reauthenticationOnly });
this._userVerifier.connect('ask-question', this._onAskQuestion.bind(this)); this._userVerifier.connect('ask-question', this._onAskQuestion.bind(this));
this._userVerifier.connect('show-message', this._onShowMessage.bind(this)); this._userVerifier.connect('show-message', this._onShowMessage.bind(this));
@@ -78,61 +73,59 @@ var AuthPrompt = GObject.registerClass({
this.connect('next', () => { this.connect('next', () => {
this.updateSensitivity(false); this.updateSensitivity(false);
this.startSpinning(); this.startSpinning();
if (this._queryingService) if (this._queryingService) {
this._userVerifier.answerQuery(this._queryingService, this._entry.text); this._userVerifier.answerQuery(this._queryingService, this._entry.text);
else } else {
this._preemptiveAnswer = this._entry.text; this._preemptiveAnswer = this._entry.text;
}
}); });
this.connect('destroy', this._onDestroy.bind(this)); this.connect('destroy', this._onDestroy.bind(this));
this._userWell = new St.Bin({ this._userWell = new St.Bin({ x_fill: true, x_align: St.Align.START });
x_expand: true, this.add(this._userWell, {
y_expand: true, x_align: St.Align.START,
}); x_fill: true,
this.add_child(this._userWell); y_fill: true,
this._label = new St.Label({ expand: true
style_class: 'login-dialog-prompt-label',
x_expand: false,
y_expand: true,
}); });
this._label = new St.Label({ style_class: 'login-dialog-prompt-label' });
this.add_child(this._label); this.add(this._label, {
this._entry = new St.Entry({ expand: true,
style_class: 'login-dialog-prompt-entry', x_fill: false,
can_focus: true, y_fill: true,
x_expand: false, x_align: St.Align.START
y_expand: true,
}); });
this._entry = new St.Entry({ style_class: 'login-dialog-prompt-entry',
can_focus: true });
ShellEntry.addContextMenu(this._entry, { isPassword: true, actionMode: Shell.ActionMode.NONE }); ShellEntry.addContextMenu(this._entry, { isPassword: true, actionMode: Shell.ActionMode.NONE });
this.add_child(this._entry); this.add(this._entry, {
expand: true,
x_fill: true,
y_fill: false,
x_align: St.Align.START
});
this._entry.grab_key_focus(); this._entry.grab_key_focus();
this._message = new St.Label({ this._message = new St.Label({ opacity: 0,
opacity: 0, styleClass: 'login-dialog-message' });
styleClass: 'login-dialog-message',
x_expand: false,
y_expand: true,
y_align: Clutter.ActorAlign.START,
});
this._message.clutter_text.line_wrap = true; this._message.clutter_text.line_wrap = true;
this._message.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; this._message.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
this.add_child(this._message); this.add(this._message, { x_fill: false, x_align: St.Align.START, y_align: St.Align.START });
this._buttonBox = new St.BoxLayout({ this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box',
style_class: 'login-dialog-button-box', vertical: false });
vertical: false, this.add(this._buttonBox, {
y_align: Clutter.ActorAlign.END, expand: true,
x_align: St.Align.MIDDLE,
y_align: St.Align.END
}); });
this.add_child(this._buttonBox);
this._defaultButtonWell = new St.Widget({ this._defaultButtonWell = new St.Widget({ layout_manager: new Clutter.BinLayout() });
layout_manager: new Clutter.BinLayout(), this._defaultButtonWellActor = null;
x_align: Clutter.ActorAlign.END,
y_align: Clutter.ActorAlign.CENTER,
});
this._initButtons(); this._initButtons();
@@ -154,32 +147,38 @@ var AuthPrompt = GObject.registerClass({
} }
_initButtons() { _initButtons() {
this.cancelButton = new St.Button({ this.cancelButton = new St.Button({ style_class: 'modal-dialog-button button',
style_class: 'modal-dialog-button button', button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, reactive: true,
reactive: true, can_focus: true,
can_focus: true, label: _("Cancel") });
label: _("Cancel"),
x_expand: true,
x_align: Clutter.ActorAlign.START,
y_align: Clutter.ActorAlign.END,
});
this.cancelButton.connect('clicked', () => this.cancel()); this.cancelButton.connect('clicked', () => this.cancel());
this._buttonBox.add_child(this.cancelButton); this._buttonBox.add(this.cancelButton,
{ expand: false,
x_fill: false,
y_fill: false,
x_align: St.Align.START,
y_align: St.Align.END });
this._buttonBox.add_child(this._defaultButtonWell); this._buttonBox.add(this._defaultButtonWell,
this.nextButton = new St.Button({ { expand: true,
style_class: 'modal-dialog-button button', x_fill: false,
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, y_fill: false,
reactive: true, x_align: St.Align.END,
can_focus: true, y_align: St.Align.MIDDLE });
label: _("Next"), this.nextButton = new St.Button({ style_class: 'modal-dialog-button button',
x_align: Clutter.ActorAlign.END, button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
y_align: Clutter.ActorAlign.END, reactive: true,
}); can_focus: true,
label: _("Next") });
this.nextButton.connect('clicked', () => this.emit('next')); this.nextButton.connect('clicked', () => this.emit('next'));
this.nextButton.add_style_pseudo_class('default'); this.nextButton.add_style_pseudo_class('default');
this._buttonBox.add_child(this.nextButton); this._buttonBox.add(this.nextButton,
{ expand: false,
x_fill: false,
y_fill: false,
x_align: St.Align.END,
y_align: St.Align.END });
this._updateNextButtonSensitivity(this._entry.text.length > 0); this._updateNextButtonSensitivity(this._entry.text.length > 0);
@@ -257,12 +256,6 @@ var AuthPrompt = GObject.registerClass({
this.updateSensitivity(canRetry); this.updateSensitivity(canRetry);
this.setActorInDefaultButtonWell(null); this.setActorInDefaultButtonWell(null);
this.verificationStatus = AuthPromptStatus.VERIFICATION_FAILED; this.verificationStatus = AuthPromptStatus.VERIFICATION_FAILED;
Util.wiggle(this._entry, {
offset: WIGGLE_OFFSET,
duration: WIGGLE_DURATION,
wiggleCount: N_WIGGLES,
});
} }
_onVerificationComplete() { _onVerificationComplete() {
@@ -321,7 +314,7 @@ var AuthPrompt = GObject.registerClass({
if (this._spinner) if (this._spinner)
this._spinner.stop(); this._spinner.stop();
} }
}, }
}); });
} }
} }
@@ -330,16 +323,15 @@ var AuthPrompt = GObject.registerClass({
if (isSpinner) if (isSpinner)
this._spinner.play(); this._spinner.play();
if (!animate) { if (!animate)
actor.opacity = 255; actor.opacity = 255;
} else { else
actor.ease({ actor.ease({
opacity: 255, opacity: 255,
duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME, duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY, delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR
}); });
}
} }
this._defaultButtonWellActor = actor; this._defaultButtonWellActor = actor;
@@ -392,7 +384,7 @@ var AuthPrompt = GObject.registerClass({
this._message.ease({ this._message.ease({
opacity: 0, opacity: 0,
duration: MESSAGE_FADE_OUT_ANIMATION_TIME, duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
@@ -445,7 +437,6 @@ var AuthPrompt = GObject.registerClass({
if (user) { if (user) {
let userWidget = new UserWidget.UserWidget(user); let userWidget = new UserWidget.UserWidget(user);
userWidget.x_align = Clutter.ActorAlign.START;
this._userWell.set_child(userWidget); this._userWell.set_child(userWidget);
} }
} }
@@ -525,9 +516,9 @@ var AuthPrompt = GObject.registerClass({
} }
cancel() { cancel() {
if (this.verificationStatus == AuthPromptStatus.VERIFICATION_SUCCEEDED) if (this.verificationStatus == AuthPromptStatus.VERIFICATION_SUCCEEDED) {
return; return;
}
this.reset(); this.reset();
this.emit('cancelled'); this.emit('cancelled');
} }

View File

@@ -112,12 +112,13 @@ var Batch = class extends Task {
for (let i = 0; i < tasks.length; i++) { for (let i = 0; i < tasks.length; i++) {
let task; let task;
if (tasks[i] instanceof Task) if (tasks[i] instanceof Task) {
task = tasks[i]; task = tasks[i];
else if (typeof tasks[i] == 'function') } else if (typeof tasks[i] == 'function') {
task = new Task(scope, tasks[i]); task = new Task(scope, tasks[i]);
else } else {
throw new Error('Batch tasks must be functions or Task, Hold or Batch objects'); throw new Error('Batch tasks must be functions or Task, Hold or Batch objects');
}
this.tasks.push(task); this.tasks.push(task);
} }
@@ -128,8 +129,9 @@ var Batch = class extends Task {
} }
runTask() { runTask() {
if (!(this._currentTaskIndex in this.tasks)) if (!(this._currentTaskIndex in this.tasks)) {
return null; return null;
}
return this.tasks[this._currentTaskIndex].run(); return this.tasks[this._currentTaskIndex].run();
} }
@@ -177,8 +179,9 @@ var ConcurrentBatch = class extends Batch {
process() { process() {
let hold = this.runTask(); let hold = this.runTask();
if (hold) if (hold) {
this.hold.acquireUntilAfter(hold); this.hold.acquireUntilAfter(hold);
}
// Regardless of the state of the just run task, // Regardless of the state of the just run task,
// fire off the next one, so all the tasks can run // fire off the next one, so all the tasks can run

View File

@@ -20,7 +20,7 @@ function FprintManager() {
g_interface_info: FprintManagerInfo, g_interface_info: FprintManagerInfo,
g_name: 'net.reactivated.Fprint', g_name: 'net.reactivated.Fprint',
g_object_path: '/net/reactivated/Fprint/Manager', g_object_path: '/net/reactivated/Fprint/Manager',
g_flags: Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES }); g_flags: (Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES) });
try { try {
self.init(null); self.init(null);

View File

@@ -39,20 +39,19 @@ const _LOGO_ICON_HEIGHT = 48;
const _MAX_BOTTOM_MENU_ITEMS = 5; const _MAX_BOTTOM_MENU_ITEMS = 5;
var UserListItem = GObject.registerClass({ var UserListItem = GObject.registerClass({
Signals: { 'activate': {} }, GTypeName: 'LoginDialog_UserListItem',
Signals: { 'activate': {} }
}, class UserListItem extends St.Button { }, class UserListItem extends St.Button {
_init(user) { _init(user) {
let layout = new St.BoxLayout({ let layout = new St.BoxLayout({ vertical: true });
vertical: true,
x_align: Clutter.ActorAlign.START,
});
super._init({ super._init({
style_class: 'login-dialog-user-list-item', style_class: 'login-dialog-user-list-item',
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
can_focus: true, can_focus: true,
x_expand: true,
child: layout, child: layout,
reactive: true, reactive: true,
x_align: St.Align.START,
x_fill: true
}); });
this.user = user; this.user = user;
@@ -125,7 +124,7 @@ var UserListItem = GObject.registerClass({
let startTime = GLib.get_monotonic_time(); let startTime = GLib.get_monotonic_time();
this._timedLoginTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 33, this._timedLoginTimeoutId = GLib.timeout_add (GLib.PRIORITY_DEFAULT, 33,
() => { () => {
let currentTime = GLib.get_monotonic_time(); let currentTime = GLib.get_monotonic_time();
let elapsedTime = (currentTime - startTime) / GLib.USEC_PER_SEC; let elapsedTime = (currentTime - startTime) / GLib.USEC_PER_SEC;
@@ -156,17 +155,14 @@ var UserListItem = GObject.registerClass({
}); });
var UserList = GObject.registerClass({ var UserList = GObject.registerClass({
GTypeName: 'LoginDialog_UserList',
Signals: { Signals: {
'activate': { param_types: [UserListItem.$gtype] }, 'activate': { param_types: [UserListItem.$gtype] },
'item-added': { param_types: [UserListItem.$gtype] }, 'item-added': { param_types: [UserListItem.$gtype] },
}, }
}, class UserList extends St.ScrollView { }, class UserList extends St.ScrollView {
_init() { _init() {
super._init({ super._init({ style_class: 'login-dialog-user-list-view' });
style_class: 'login-dialog-user-list-view',
x_expand: true,
y_expand: true,
});
this.set_policy(St.PolicyType.NEVER, this.set_policy(St.PolicyType.NEVER,
St.PolicyType.AUTOMATIC); St.PolicyType.AUTOMATIC);
@@ -224,7 +220,7 @@ var UserList = GObject.registerClass({
let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0); let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
adjustment.ease(value, { adjustment.ease(value, {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: _SCROLL_ANIMATION_TIME, duration: _SCROLL_ANIMATION_TIME
}); });
} }
@@ -269,7 +265,7 @@ var UserList = GObject.registerClass({
this.removeUser(user); this.removeUser(user);
let item = new UserListItem(user); let item = new UserListItem(user);
this._box.add_child(item); this._box.add(item, { x_fill: true });
this._items[userName] = item; this._items[userName] = item;
@@ -307,7 +303,8 @@ var UserList = GObject.registerClass({
}); });
var SessionMenuButton = GObject.registerClass({ var SessionMenuButton = GObject.registerClass({
Signals: { 'session-activated': { param_types: [GObject.TYPE_STRING] } }, GTypeName: 'LoginDialog_SessionMenuButton',
Signals: { 'session-activated': { param_types: [GObject.TYPE_STRING] } }
}, class SessionMenuButton extends St.Bin { }, class SessionMenuButton extends St.Bin {
_init() { _init() {
let gearIcon = new St.Icon({ icon_name: 'emblem-system-symbolic' }); let gearIcon = new St.Icon({ icon_name: 'emblem-system-symbolic' });
@@ -318,7 +315,7 @@ var SessionMenuButton = GObject.registerClass({
can_focus: true, can_focus: true,
accessible_name: _("Choose Session"), accessible_name: _("Choose Session"),
accessible_role: Atk.Role.MENU, accessible_role: Atk.Role.MENU,
child: gearIcon, child: gearIcon
}); });
super._init({ child: button }); super._init({ child: button });
@@ -446,7 +443,10 @@ var LoginDialog = GObject.registerClass({
this.add_child(this._userSelectionBox); this.add_child(this._userSelectionBox);
this._userList = new UserList(); this._userList = new UserList();
this._userSelectionBox.add_child(this._userList); this._userSelectionBox.add(this._userList,
{ expand: true,
x_fill: true,
y_fill: true });
this._authPrompt = new AuthPrompt.AuthPrompt(this._gdmClient, AuthPrompt.AuthPromptMode.UNLOCK_OR_LOG_IN); this._authPrompt = new AuthPrompt.AuthPrompt(this._gdmClient, AuthPrompt.AuthPromptMode.UNLOCK_OR_LOG_IN);
this._authPrompt.connect('prompted', this._onPrompted.bind(this)); this._authPrompt.connect('prompted', this._onPrompted.bind(this));
@@ -457,24 +457,24 @@ var LoginDialog = GObject.registerClass({
// translators: this message is shown below the user list on the // translators: this message is shown below the user list on the
// login screen. It can be activated to reveal an entry for // login screen. It can be activated to reveal an entry for
// manually entering the username. // manually entering the username.
let notListedLabel = new St.Label({ let notListedLabel = new St.Label({ text: _("Not listed?"),
text: _("Not listed?"), style_class: 'login-dialog-not-listed-label' });
style_class: 'login-dialog-not-listed-label', this._notListedButton = new St.Button({ style_class: 'login-dialog-not-listed-button',
x_align: Clutter.ActorAlign.START, button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
}); can_focus: true,
this._notListedButton = new St.Button({ child: notListedLabel,
style_class: 'login-dialog-not-listed-button', reactive: true,
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, x_align: St.Align.START,
can_focus: true, x_fill: true });
child: notListedLabel,
reactive: true,
});
this._notListedButton.connect('clicked', this._hideUserListAskForUsernameAndBeginVerification.bind(this)); this._notListedButton.connect('clicked', this._hideUserListAskForUsernameAndBeginVerification.bind(this));
this._notListedButton.hide(); this._notListedButton.hide();
this._userSelectionBox.add_child(this._notListedButton); this._userSelectionBox.add(this._notListedButton,
{ expand: false,
x_align: St.Align.START,
x_fill: true });
this._bannerView = new St.ScrollView({ style_class: 'login-dialog-banner-view', this._bannerView = new St.ScrollView({ style_class: 'login-dialog-banner-view',
opacity: 0, opacity: 0,
@@ -509,7 +509,7 @@ var LoginDialog = GObject.registerClass({
this._sessionMenuButton = new SessionMenuButton(); this._sessionMenuButton = new SessionMenuButton();
this._sessionMenuButton.connect('session-activated', this._sessionMenuButton.connect('session-activated',
(list, sessionId) => { (list, sessionId) => {
this._greeter.call_select_session_sync(sessionId, null); this._greeter.call_select_session_sync (sessionId, null);
}); });
this._sessionMenuButton.opacity = 0; this._sessionMenuButton.opacity = 0;
this._sessionMenuButton.show(); this._sessionMenuButton.show();
@@ -702,8 +702,9 @@ var LoginDialog = GObject.registerClass({
} }
// Finally hand out the allocations // Finally hand out the allocations
if (bannerAllocation) if (bannerAllocation) {
this._bannerView.allocate(bannerAllocation, flags); this._bannerView.allocate(bannerAllocation, flags);
}
if (authPromptAllocation) if (authPromptAllocation)
this._authPrompt.allocate(authPromptAllocation, flags); this._authPrompt.allocate(authPromptAllocation, flags);
@@ -776,7 +777,7 @@ var LoginDialog = GObject.registerClass({
this._bannerView.ease({ this._bannerView.ease({
opacity: 255, opacity: 255,
duration: _FADE_ANIMATION_TIME, duration: _FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
@@ -819,9 +820,9 @@ var LoginDialog = GObject.registerClass({
_resetGreeterProxy() { _resetGreeterProxy() {
if (GLib.getenv('GDM_GREETER_TEST') != '1') { if (GLib.getenv('GDM_GREETER_TEST') != '1') {
if (this._greeter) if (this._greeter) {
this._greeter.run_dispose(); this._greeter.run_dispose();
}
this._greeter = this._gdmClient.get_greeter_sync(null); this._greeter = this._gdmClient.get_greeter_sync(null);
this._defaultSessionChangedId = this._greeter.connect('default-session-name-changed', this._defaultSessionChangedId = this._greeter.connect('default-session-name-changed',
@@ -877,7 +878,7 @@ var LoginDialog = GObject.registerClass({
this._authPrompt.ease({ this._authPrompt.ease({
opacity: 255, opacity: 255,
duration: _FADE_ANIMATION_TIME, duration: _FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
this._fadeInBannerView(); this._fadeInBannerView();
} }
@@ -945,7 +946,7 @@ var LoginDialog = GObject.registerClass({
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING) if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
this._authPrompt.reset(); this._authPrompt.reset();
this._unbindOpacity(); this._unbindOpacity();
}, }
}); });
} }
@@ -967,7 +968,7 @@ var LoginDialog = GObject.registerClass({
onComplete: () => { onComplete: () => {
this._greeter.call_start_session_when_ready_sync(serviceName, true, null); this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
this._unbindOpacity(); this._unbindOpacity();
}, }
}); });
} }
@@ -984,7 +985,7 @@ var LoginDialog = GObject.registerClass({
let hold = new Batch.Hold(); let hold = new Batch.Hold();
let signalId = this._userList.connect('item-added', let signalId = this._userList.connect('item-added',
() => { () => {
item = this._userList.getItemFromUserName(userName); let item = this._userList.getItemFromUserName(userName);
if (item) if (item)
hold.release(); hold.release();
@@ -1038,8 +1039,9 @@ var LoginDialog = GObject.registerClass({
() => { () => {
// If we're just starting out, start on the right item. // If we're just starting out, start on the right item.
if (!this._userManager.is_loaded) if (!this._userManager.is_loaded) {
this._userList.jumpToItem(loginItem); this._userList.jumpToItem(loginItem);
}
}, },
() => { () => {
@@ -1090,8 +1092,9 @@ var LoginDialog = GObject.registerClass({
// Restart timed login on user interaction // Restart timed login on user interaction
global.stage.connect('captured-event', (actor, event) => { global.stage.connect('captured-event', (actor, event) => {
if (event.type() == Clutter.EventType.KEY_PRESS || if (event.type() == Clutter.EventType.KEY_PRESS ||
event.type() == Clutter.EventType.BUTTON_PRESS) event.type() == Clutter.EventType.BUTTON_PRESS) {
this._startTimedLogin(userName, seconds); this._startTimedLogin(userName, seconds);
}
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
}); });
@@ -1134,7 +1137,8 @@ var LoginDialog = GObject.registerClass({
let userName = item.user.get_user_name(); let userName = item.user.get_user_name();
let hold = new Batch.Hold(); let hold = new Batch.Hold();
this._authPrompt.begin({ userName, hold }); this._authPrompt.begin({ userName: userName,
hold: hold });
return hold; return hold;
} }
@@ -1197,8 +1201,9 @@ var LoginDialog = GObject.registerClass({
let users = this._userManager.list_users(); let users = this._userManager.list_users();
for (let i = 0; i < users.length; i++) for (let i = 0; i < users.length; i++) {
this._userList.addUser(users[i]); this._userList.addUser(users[i]);
}
this._updateDisableUserList(); this._updateDisableUserList();
@@ -1240,7 +1245,7 @@ var LoginDialog = GObject.registerClass({
this.ease({ this.ease({
opacity: 255, opacity: 255,
duration: 1000, duration: 1000,
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD
}); });
return true; return true;

View File

@@ -23,7 +23,7 @@ function OVirtCredentials() {
g_interface_info: OVirtCredentialsInfo, g_interface_info: OVirtCredentialsInfo,
g_name: 'org.ovirt.vdsm.Credentials', g_name: 'org.ovirt.vdsm.Credentials',
g_object_path: '/org/ovirt/vdsm/Credentials', g_object_path: '/org/ovirt/vdsm/Credentials',
g_flags: Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES }); g_flags: (Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES) });
self.init(null); self.init(null);
return self; return self;
} }

View File

@@ -37,7 +37,7 @@ var MessageType = {
NONE: 0, NONE: 0,
ERROR: 1, ERROR: 1,
INFO: 2, INFO: 2,
HINT: 3, HINT: 3
}; };
function fadeInActor(actor) { function fadeInActor(actor) {
@@ -58,7 +58,7 @@ function fadeInActor(actor) {
onComplete: () => { onComplete: () => {
this.set_height(-1); this.set_height(-1);
hold.release(); hold.release();
}, }
}); });
return hold; return hold;
@@ -81,7 +81,7 @@ function fadeOutActor(actor) {
this.hide(); this.hide();
this.set_height(-1); this.set_height(-1);
hold.release(); hold.release();
}, }
}); });
return hold; return hold;
} }
@@ -109,7 +109,7 @@ function cloneAndFadeOutActor(actor) {
onComplete: () => { onComplete: () => {
clone.destroy(); clone.destroy();
hold.release(); hold.release();
}, }
}); });
return hold; return hold;
} }
@@ -272,7 +272,7 @@ var ShellUserVerifier = class {
let interval = this._getIntervalForMessage(message); let interval = this._getIntervalForMessage(message);
this.hasPendingMessages = true; this.hasPendingMessages = true;
this._messageQueue.push({ text: message, type: messageType, interval }); this._messageQueue.push({ text: message, type: messageType, interval: interval });
this._queueMessageTimeout(); this._queueMessageTimeout();
} }
@@ -544,7 +544,6 @@ var ShellUserVerifier = class {
}); });
} }
} else { } else {
// eslint-disable-next-line no-lonely-if
if (!this.hasPendingMessages) { if (!this.hasPendingMessages) {
this._cancelAndReset(); this._cancelAndReset();
} else { } else {
@@ -572,8 +571,9 @@ var ShellUserVerifier = class {
// if the password service fails, then cancel everything. // if the password service fails, then cancel everything.
// But if, e.g., fingerprint fails, still give // But if, e.g., fingerprint fails, still give
// password authentication a chance to succeed // password authentication a chance to succeed
if (this.serviceIsForeground(serviceName)) if (this.serviceIsForeground(serviceName)) {
this._verificationFailed(true); this._verificationFailed(true);
}
} }
}; };
Signals.addSignalMethods(ShellUserVerifier.prototype); Signals.addSignalMethods(ShellUserVerifier.prototype);

View File

@@ -15,7 +15,7 @@ const Config = imports.misc.config;
var ExtensionType = { var ExtensionType = {
SYSTEM: 1, SYSTEM: 1,
PER_USER: 2, PER_USER: 2
}; };
var ExtensionState = { var ExtensionState = {
@@ -28,7 +28,7 @@ var ExtensionState = {
// Used as an error state for operations on unknown extensions, // Used as an error state for operations on unknown extensions,
// should never be in a real extensionMeta object. // should never be in a real extensionMeta object.
UNINSTALLED: 99, UNINSTALLED: 99
}; };
const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange']; const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
@@ -36,11 +36,10 @@ const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'ca
/** /**
* getCurrentExtension: * getCurrentExtension:
* *
* @returns {?object} - The current extension, or null if not called from * Returns the current extension, or null if not called from an extension.
* an extension.
*/ */
function getCurrentExtension() { function getCurrentExtension() {
let stack = new Error().stack.split('\n'); let stack = (new Error()).stack.split('\n');
let extensionStackLine; let extensionStackLine;
// Search for an occurrence of an extension stack frame // Search for an occurrence of an extension stack frame
@@ -85,7 +84,7 @@ function getCurrentExtension() {
/** /**
* initTranslations: * initTranslations:
* @param {string=} domain - the gettext domain to use * @domain: (optional): the gettext domain to use
* *
* Initialize Gettext to load translations from extensionsdir/locale. * Initialize Gettext to load translations from extensionsdir/locale.
* If @domain is not provided, it will be taken from metadata['gettext-domain'] * If @domain is not provided, it will be taken from metadata['gettext-domain']
@@ -109,8 +108,7 @@ function initTranslations(domain) {
/** /**
* getSettings: * getSettings:
* @param {string=} schema - the GSettings schema id * @schema: (optional): the GSettings schema id
* @returns {Gio.Settings} - a new settings object for @schema
* *
* Builds and returns a GSettings schema for @schema, using schema files * Builds and returns a GSettings schema for @schema, using schema files
* in extensionsdir/schemas. If @schema is omitted, it is taken from * in extensionsdir/schemas. If @schema is omitted, it is taken from
@@ -130,13 +128,12 @@ function getSettings(schema) {
// SYSTEM extension that has been installed in the same prefix as the shell // SYSTEM extension that has been installed in the same prefix as the shell
let schemaDir = extension.dir.get_child('schemas'); let schemaDir = extension.dir.get_child('schemas');
let schemaSource; let schemaSource;
if (schemaDir.query_exists(null)) { if (schemaDir.query_exists(null))
schemaSource = GioSSS.new_from_directory(schemaDir.get_path(), schemaSource = GioSSS.new_from_directory(schemaDir.get_path(),
GioSSS.get_default(), GioSSS.get_default(),
false); false);
} else { else
schemaSource = GioSSS.get_default(); schemaSource = GioSSS.get_default();
}
let schemaObj = schemaSource.lookup(schema, true); let schemaObj = schemaSource.lookup(schema, true);
if (!schemaObj) if (!schemaObj)
@@ -147,9 +144,8 @@ function getSettings(schema) {
/** /**
* versionCheck: * versionCheck:
* @param {string[]} required - an array of versions we're compatible with * @required: an array of versions we're compatible with
* @param {string} current - the version we have * @current: the version we have
* @returns {bool} - true if @current is compatible with @required
* *
* Check if a component is compatible for an extension. * Check if a component is compatible for an extension.
* @required is an array, and at least one version must match. * @required is an array, and at least one version must match.

View File

@@ -1,5 +1,5 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported collectFromDatadirs, recursivelyDeleteDir, /* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
recursivelyMoveDir, loadInterfaceXML */ recursivelyMoveDir, loadInterfaceXML */
const { Gio, GLib } = imports.gi; const { Gio, GLib } = imports.gi;
@@ -29,6 +29,11 @@ function collectFromDatadirs(subdir, includeUserDir, processFile) {
} }
} }
function deleteGFile(file) {
// Work around 'delete' being a keyword in JS.
return file['delete'](null);
}
function recursivelyDeleteDir(dir, deleteParent) { function recursivelyDeleteDir(dir, deleteParent) {
let children = dir.enumerate_children('standard::name,standard::type', let children = dir.enumerate_children('standard::name,standard::type',
Gio.FileQueryInfoFlags.NONE, null); Gio.FileQueryInfoFlags.NONE, null);
@@ -38,13 +43,13 @@ function recursivelyDeleteDir(dir, deleteParent) {
let type = info.get_file_type(); let type = info.get_file_type();
let child = dir.get_child(info.get_name()); let child = dir.get_child(info.get_name());
if (type == Gio.FileType.REGULAR) if (type == Gio.FileType.REGULAR)
child.delete(null); deleteGFile(child);
else if (type == Gio.FileType.DIRECTORY) else if (type == Gio.FileType.DIRECTORY)
recursivelyDeleteDir(child, true); recursivelyDeleteDir(child, true);
} }
if (deleteParent) if (deleteParent)
dir.delete(null); deleteGFile(dir);
} }
function recursivelyMoveDir(srcDir, destDir) { function recursivelyMoveDir(srcDir, destDir) {
@@ -70,14 +75,14 @@ let _ifaceResource = null;
function loadInterfaceXML(iface) { function loadInterfaceXML(iface) {
if (!_ifaceResource) { if (!_ifaceResource) {
// don't use global.datadir so the method is usable from tests/tools // don't use global.datadir so the method is usable from tests/tools
let dir = GLib.getenv('GNOME_SHELL_DATADIR') || Config.PKGDATADIR; let dir = GLib.getenv ('GNOME_SHELL_DATADIR') || Config.PKGDATADIR;
let path = `${dir}/gnome-shell-dbus-interfaces.gresource`; let path = dir + '/gnome-shell-dbus-interfaces.gresource';
_ifaceResource = Gio.Resource.load(path); _ifaceResource = Gio.Resource.load(path);
_ifaceResource._register(); _ifaceResource._register();
} }
let xml = null; let xml = null;
let uri = `resource:///org/gnome/shell/dbus-interfaces/${iface}.xml`; let uri = 'resource:///org/gnome/shell/dbus-interfaces/' + iface + '.xml';
let f = Gio.File.new_for_uri(uri); let f = Gio.File.new_for_uri(uri);
try { try {

View File

@@ -11,7 +11,7 @@ var PresenceStatus = {
AVAILABLE: 0, AVAILABLE: 0,
INVISIBLE: 1, INVISIBLE: 1,
BUSY: 2, BUSY: 2,
IDLE: 3, IDLE: 3
}; };
var PresenceProxy = Gio.DBusProxy.makeProxyWrapper(PresenceIface); var PresenceProxy = Gio.DBusProxy.makeProxyWrapper(PresenceIface);

View File

@@ -82,11 +82,11 @@ var HistoryManager = class {
_onEntryKeyPress(entry, event) { _onEntryKeyPress(entry, event) {
let symbol = event.get_key_symbol(); let symbol = event.get_key_symbol();
if (symbol == Clutter.KEY_Up) if (symbol == Clutter.KEY_Up) {
return this._setPrevItem(entry.get_text()); return this._setPrevItem(entry.get_text());
else if (symbol == Clutter.KEY_Down) } else if (symbol == Clutter.KEY_Down) {
return this._setNextItem(entry.get_text()); return this._setNextItem(entry.get_text());
}
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
} }

View File

@@ -142,7 +142,7 @@ var IBusManager = class {
}); });
this._panelService.connect('focus-in', (panel, path) => { this._panelService.connect('focus-in', (panel, path) => {
if (!GLib.str_has_suffix(path, '/InputContext_1')) if (!GLib.str_has_suffix(path, '/InputContext_1'))
this.emit('focus-in'); this.emit ('focus-in');
}); });
this._panelService.connect('focus-out', () => this.emit('focus-out')); this._panelService.connect('focus-out', () => this.emit('focus-out'));
@@ -157,10 +157,10 @@ var IBusManager = class {
} catch (e) { } catch (e) {
} }
// If an engine is already active we need to get its properties // If an engine is already active we need to get its properties
this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, res) => { this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, result) => {
let engine; let engine;
try { try {
engine = this._ibus.get_global_engine_async_finish(res); engine = this._ibus.get_global_engine_async_finish(result);
if (!engine) if (!engine)
return; return;
} catch (e) { } catch (e) {

View File

@@ -48,7 +48,7 @@ class InputMethod extends Clutter.InputMethod {
_onConnected() { _onConnected() {
this._cancellable = new Gio.Cancellable(); this._cancellable = new Gio.Cancellable();
this._ibus.create_input_context_async('gnome-shell', -1, this._ibus.create_input_context_async ('gnome-shell', -1,
this._cancellable, this._setContext.bind(this)); this._cancellable, this._setContext.bind(this));
} }
@@ -69,7 +69,6 @@ class InputMethod extends Clutter.InputMethod {
this._context.connect('show-preedit-text', this._onShowPreeditText.bind(this)); this._context.connect('show-preedit-text', this._onShowPreeditText.bind(this));
this._context.connect('hide-preedit-text', this._onHidePreeditText.bind(this)); this._context.connect('hide-preedit-text', this._onHidePreeditText.bind(this));
this._context.connect('forward-key-event', this._onForwardKeyEvent.bind(this)); this._context.connect('forward-key-event', this._onForwardKeyEvent.bind(this));
this._context.connect('destroy', this._clear.bind(this));
this._updateCapabilities(); this._updateCapabilities();
} }
@@ -129,7 +128,7 @@ class InputMethod extends Clutter.InputMethod {
_onForwardKeyEvent(_context, keyval, keycode, state) { _onForwardKeyEvent(_context, keyval, keycode, state) {
let press = (state & IBus.ModifierType.RELEASE_MASK) == 0; let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
state &= ~IBus.ModifierType.RELEASE_MASK; state &= ~(IBus.ModifierType.RELEASE_MASK);
let curEvent = Clutter.get_current_event(); let curEvent = Clutter.get_current_event();
let time; let time;
@@ -265,9 +264,6 @@ class InputMethod extends Clutter.InputMethod {
event.get_key_code() - 8, // Convert XKB keycodes to evcodes event.get_key_code() - 8, // Convert XKB keycodes to evcodes
state, -1, this._cancellable, state, -1, this._cancellable,
(context, res) => { (context, res) => {
if (context != this._context)
return;
try { try {
let retval = context.process_key_event_async_finish(res); let retval = context.process_key_event_async_finish(res);
this.notify_key_event(event, retval); this.notify_key_event(event, retval);

View File

@@ -40,15 +40,6 @@ var IntrospectService = class {
}); });
this._syncRunningApplications(); this._syncRunningApplications();
this._whitelistMap = new Map();
APP_WHITELIST.forEach(appName => {
Gio.DBus.watch_name(Gio.BusType.SESSION,
appName,
Gio.BusNameWatcherFlags.NONE,
(conn, name, owner) => this._whitelistMap.set(name, owner),
(conn, name) => this._whitelistMap.delete(name));
});
} }
_isStandaloneApp(app) { _isStandaloneApp(app) {
@@ -60,7 +51,7 @@ var IntrospectService = class {
} }
_isSenderWhitelisted(sender) { _isSenderWhitelisted(sender) {
return [...this._whitelistMap.values()].includes(sender); return APP_WHITELIST.includes(sender);
} }
_getSandboxedAppId(app) { _getSandboxedAppId(app) {
@@ -79,7 +70,7 @@ var IntrospectService = class {
for (let app of apps) { for (let app of apps) {
let appInfo = {}; let appInfo = {};
let isAppActive = focusedApp == app; let isAppActive = (focusedApp == app);
if (!this._isStandaloneApp(app)) if (!this._isStandaloneApp(app))
continue; continue;
@@ -113,10 +104,10 @@ var IntrospectService = class {
return false; return false;
let type = window.get_window_type(); let type = window.get_window_type();
return type == Meta.WindowType.NORMAL || return (type == Meta.WindowType.NORMAL ||
type == Meta.WindowType.DIALOG || type == Meta.WindowType.DIALOG ||
type == Meta.WindowType.MODAL_DIALOG || type == Meta.WindowType.MODAL_DIALOG ||
type == Meta.WindowType.UTILITY; type == Meta.WindowType.UTILITY);
} }
GetRunningApplicationsAsync(params, invocation) { GetRunningApplicationsAsync(params, invocation) {
@@ -161,9 +152,9 @@ var IntrospectService = class {
'app-id': GLib.Variant.new('s', app.get_id()), 'app-id': GLib.Variant.new('s', app.get_id()),
'client-type': GLib.Variant.new('u', window.get_client_type()), 'client-type': GLib.Variant.new('u', window.get_client_type()),
'is-hidden': GLib.Variant.new('b', window.is_hidden()), 'is-hidden': GLib.Variant.new('b', window.is_hidden()),
'has-focus': GLib.Variant.new('b', window == focusWindow), 'has-focus': GLib.Variant.new('b', (window == focusWindow)),
'width': GLib.Variant.new('u', frameRect.width), 'width': GLib.Variant.new('u', frameRect.width),
'height': GLib.Variant.new('u', frameRect.height), 'height': GLib.Variant.new('u', frameRect.height)
}; };
// These properties may not be available for all windows: // These properties may not be available for all windows:
@@ -173,10 +164,9 @@ var IntrospectService = class {
if (wmClass != null) if (wmClass != null)
windowsList[windowId]['wm-class'] = GLib.Variant.new('s', wmClass); windowsList[windowId]['wm-class'] = GLib.Variant.new('s', wmClass);
if (sandboxedAppId != null) { if (sandboxedAppId != null)
windowsList[windowId]['sandboxed-app-id'] = windowsList[windowId]['sandboxed-app-id'] =
GLib.Variant.new('s', sandboxedAppId); GLib.Variant.new('s', sandboxedAppId);
}
} }
} }
invocation.return_value(new GLib.Variant('(a{ta{sv}})', [windowsList])); invocation.return_value(new GLib.Variant('(a{ta{sv}})', [windowsList]));

View File

@@ -11,8 +11,9 @@ function getCompletions(text, commandHeader, globalCompletionList) {
let methods = []; let methods = [];
let expr_, base; let expr_, base;
let attrHead = ''; let attrHead = '';
if (globalCompletionList == null) if (globalCompletionList == null) {
globalCompletionList = []; globalCompletionList = [];
}
let offset = getExpressionOffset(text, text.length - 1); let offset = getExpressionOffset(text, text.length - 1);
if (offset >= 0) { if (offset >= 0) {
@@ -58,8 +59,9 @@ function isStopChar(c) {
function findMatchingQuote(expr, offset) { function findMatchingQuote(expr, offset) {
let quoteChar = expr.charAt(offset); let quoteChar = expr.charAt(offset);
for (let i = offset - 1; i >= 0; --i) { for (let i = offset - 1; i >= 0; --i) {
if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') {
return i; return i;
}
} }
return -1; return -1;
} }
@@ -67,8 +69,9 @@ function findMatchingQuote(expr, offset) {
// Given the ending position of a regex, find where it starts // Given the ending position of a regex, find where it starts
function findMatchingSlash(expr, offset) { function findMatchingSlash(expr, offset) {
for (let i = offset - 1; i >= 0; --i) { for (let i = offset - 1; i >= 0; --i) {
if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') {
return i; return i;
}
} }
return -1; return -1;
} }
@@ -79,30 +82,31 @@ function findMatchingSlash(expr, offset) {
// findMatchingBrace("[(])", 3) returns 1. // findMatchingBrace("[(])", 3) returns 1.
function findMatchingBrace(expr, offset) { function findMatchingBrace(expr, offset) {
let closeBrace = expr.charAt(offset); let closeBrace = expr.charAt(offset);
let openBrace = { ')': '(', ']': '[' }[closeBrace]; let openBrace = ({ ')': '(', ']': '[' })[closeBrace];
return findTheBrace(expr, offset - 1, openBrace, closeBrace); function findTheBrace(expr, offset) {
} if (offset < 0) {
return -1;
}
function findTheBrace(expr, offset, ...braces) { if (expr.charAt(offset) == openBrace) {
let [openBrace, closeBrace] = braces; return offset;
}
if (expr.charAt(offset).match(/['"]/)) {
return findTheBrace(expr, findMatchingQuote(expr, offset) - 1);
}
if (expr.charAt(offset) == '/') {
return findTheBrace(expr, findMatchingSlash(expr, offset) - 1);
}
if (expr.charAt(offset) == closeBrace) {
return findTheBrace(expr, findTheBrace(expr, offset - 1) - 1);
}
if (offset < 0) return findTheBrace(expr, offset - 1);
return -1;
if (expr.charAt(offset) == openBrace) }
return offset;
if (expr.charAt(offset).match(/['"]/)) return findTheBrace(expr, offset - 1);
return findTheBrace(expr, findMatchingQuote(expr, offset) - 1, ...braces);
if (expr.charAt(offset) == '/')
return findTheBrace(expr, findMatchingSlash(expr, offset) - 1, ...braces);
if (expr.charAt(offset) == closeBrace)
return findTheBrace(expr, findTheBrace(expr, offset - 1, ...braces) - 1, ...braces);
return findTheBrace(expr, offset - 1, ...braces);
} }
// Walk expr backwards from offset looking for the beginning of an // Walk expr backwards from offset looking for the beginning of an
@@ -114,11 +118,13 @@ function getExpressionOffset(expr, offset) {
while (offset >= 0) { while (offset >= 0) {
let currChar = expr.charAt(offset); let currChar = expr.charAt(offset);
if (isStopChar(currChar)) if (isStopChar(currChar)) {
return offset + 1; return offset + 1;
}
if (currChar.match(/[)\]]/)) if (currChar.match(/[)\]]/)) {
offset = findMatchingBrace(expr, offset); offset = findMatchingBrace(expr, offset);
}
--offset; --offset;
} }
@@ -135,10 +141,10 @@ function isValidPropertyName(w) {
// To get all properties (enumerable and not), we need to walk // To get all properties (enumerable and not), we need to walk
// the prototype chain ourselves // the prototype chain ourselves
function getAllProps(obj) { function getAllProps(obj) {
if (obj === null || obj === undefined) if (obj === null || obj === undefined) {
return []; return [];
}
return Object.getOwnPropertyNames(obj).concat(getAllProps(Object.getPrototypeOf(obj))); return Object.getOwnPropertyNames(obj).concat( getAllProps(Object.getPrototypeOf(obj)) );
} }
// Given a string _expr_, returns all methods // Given a string _expr_, returns all methods
@@ -162,7 +168,7 @@ function getPropertyNamesFromExpression(expr, commandHeader = '') {
if (typeof obj === 'object') { if (typeof obj === 'object') {
let allProps = getAllProps(obj); let allProps = getAllProps(obj);
// Get only things we are allowed to complete following a '.' // Get only things we are allowed to complete following a '.'
allProps = allProps.filter(isValidPropertyName); allProps = allProps.filter( isValidPropertyName );
// Make sure propsUnique contains one key for every // Make sure propsUnique contains one key for every
// property so we end up with a unique list of properties // property so we end up with a unique list of properties
@@ -183,26 +189,24 @@ function getCommonPrefix(words) {
return word; return word;
} }
// Remove any blocks that are quoted or are in a regex
function removeLiterals(str) {
if (str.length == 0)
return '';
let currChar = str.charAt(str.length - 1);
if (currChar == '"' || currChar == '\'') {
return removeLiterals(
str.slice(0, findMatchingQuote(str, str.length - 1)));
} else if (currChar == '/') {
return removeLiterals(
str.slice(0, findMatchingSlash(str, str.length - 1)));
}
return removeLiterals(str.slice(0, str.length - 1)) + currChar;
}
// Returns true if there is reason to think that eval(str) // Returns true if there is reason to think that eval(str)
// will modify the global scope // will modify the global scope
function isUnsafeExpression(str) { function isUnsafeExpression(str) {
// Remove any blocks that are quoted or are in a regex
function removeLiterals(str) {
if (str.length == 0) {
return '';
}
let currChar = str.charAt(str.length - 1);
if (currChar == '"' || currChar == '\'') {
return removeLiterals(str.slice(0, findMatchingQuote(str, str.length - 1)));
} else if (currChar == '/') {
return removeLiterals(str.slice(0, findMatchingSlash(str, str.length - 1)));
}
return removeLiterals(str.slice(0, str.length - 1)) + currChar;
}
// Check for any sort of assignment // Check for any sort of assignment
// The strategy used is dumb: remove any quotes // The strategy used is dumb: remove any quotes
@@ -210,8 +214,8 @@ function isUnsafeExpression(str) {
// If there is, it might be an unsafe assignment. // If there is, it might be an unsafe assignment.
let prunedStr = removeLiterals(str); let prunedStr = removeLiterals(str);
prunedStr = prunedStr.replace(/[=!]==/g, ''); // replace === and !== with nothing prunedStr = prunedStr.replace(/[=!]==/g, ''); //replace === and !== with nothing
prunedStr = prunedStr.replace(/[=<>!]=/g, ''); // replace ==, <=, >=, != with nothing prunedStr = prunedStr.replace(/[=<>!]=/g, ''); //replace ==, <=, >=, != with nothing
if (prunedStr.match(/[=]/)) { if (prunedStr.match(/[=]/)) {
return true; return true;

View File

@@ -74,9 +74,8 @@ function registerSessionWithGDM() {
let _loginManager = null; let _loginManager = null;
/** /**
* getLoginManager: * LoginManager:
* An abstraction over systemd/logind and ConsoleKit. * An abstraction over systemd/logind and ConsoleKit.
* @returns {object} - the LoginManager singleton
* *
*/ */
function getLoginManager() { function getLoginManager() {
@@ -104,21 +103,21 @@ var LoginManagerSystemd = class {
getCurrentSessionProxy(callback) { getCurrentSessionProxy(callback) {
if (this._currentSession) { if (this._currentSession) {
callback(this._currentSession); callback (this._currentSession);
return; return;
} }
let sessionId = GLib.getenv('XDG_SESSION_ID'); let sessionId = GLib.getenv('XDG_SESSION_ID');
if (!sessionId) { if (!sessionId) {
log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.'); log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
let [session, objectPath] = this._userProxy.Display; let [session, objectPath_] = this._userProxy.Display;
if (session) { if (session) {
log(`Will monitor session ${session}`); log(`Will monitor session ${session}`);
sessionId = session; sessionId = session;
} else { } else {
log('Failed to find "Display" session; are we the greeter?'); log('Failed to find "Display" session; are we the greeter?');
for ([session, objectPath] of this._userProxy.Sessions) { for (let [session, objectPath] of this._userProxy.Sessions) {
let sessionProxy = new SystemdLoginSession(Gio.DBus.system, let sessionProxy = new SystemdLoginSession(Gio.DBus.system,
'org.freedesktop.login1', 'org.freedesktop.login1',
objectPath); objectPath);
@@ -186,7 +185,7 @@ var LoginManagerSystemd = class {
try { try {
let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result); let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
fd = fdList.steal_fds()[0]; fd = fdList.steal_fds()[0];
callback(new Gio.UnixInputStream({ fd })); callback(new Gio.UnixInputStream({ fd: fd }));
} catch (e) { } catch (e) {
logError(e, "Error getting systemd inhibitor"); logError(e, "Error getting systemd inhibitor");
callback(null); callback(null);

View File

@@ -1,7 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported ModemBase, ModemGsm, ModemCdma, BroadbandModem */
const { Gio, GObject, NM, NMA } = imports.gi; const { Gio, NMA } = imports.gi;
const Signals = imports.signals;
const { loadInterfaceXML } = imports.misc.fileUtils; const { loadInterfaceXML } = imports.misc.fileUtils;
@@ -98,46 +98,21 @@ const ModemGsmNetworkProxy = Gio.DBusProxy.makeProxyWrapper(ModemGsmNetworkInter
const ModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager.Modem.Cdma'); const ModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager.Modem.Cdma');
const ModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(ModemCdmaInterface); const ModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(ModemCdmaInterface);
var ModemBase = GObject.registerClass({ var ModemGsm = class {
GTypeFlags: GObject.TypeFlags.ABSTRACT, constructor(path) {
Properties: {
'operator-name': GObject.ParamSpec.string(
'operator-name', 'operator-name', 'operator-name',
GObject.ParamFlags.READABLE,
null),
'signal-quality': GObject.ParamSpec.int(
'signal-quality', 'signal-quality', 'signal-quality',
GObject.ParamFlags.READABLE,
0, 100, 0),
},
}, class ModemBase extends GObject.Object {
_setOperatorName(operatorName) {
if (this.operator_name == operatorName)
return;
this.operator_name = operatorName;
this.notify('operator-name');
}
_setSignalQuality(signalQuality) {
if (this.signal_quality == signalQuality)
return;
this.signal_quality = signalQuality;
this.notify('signal-quality');
}
});
var ModemGsm = GObject.registerClass(
class ModemGsm extends ModemBase {
_init(path) {
super._init();
this._proxy = new ModemGsmNetworkProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path); this._proxy = new ModemGsmNetworkProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
this.signal_quality = 0;
this.operator_name = null;
// Code is duplicated because the function have different signatures // Code is duplicated because the function have different signatures
this._proxy.connectSignal('SignalQuality', (proxy, sender, [quality]) => { this._proxy.connectSignal('SignalQuality', (proxy, sender, [quality]) => {
this._setSignalQuality(quality); this.signal_quality = quality;
this.emit('notify::signal-quality');
}); });
this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => { this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
this._setOperatorName(_findProviderForMccMnc(name, code)); this.operator_name = _findProviderForMccMnc(name, code);
this.emit('notify::operator-name');
}); });
this._proxy.GetRegistrationInfoRemote(([result], err) => { this._proxy.GetRegistrationInfoRemote(([result], err) => {
if (err) { if (err) {
@@ -146,28 +121,32 @@ class ModemGsm extends ModemBase {
} }
let [status_, code, name] = result; let [status_, code, name] = result;
this._setOperatorName(_findProviderForMccMnc(name, code)); this.operator_name = _findProviderForMccMnc(name, code);
this.emit('notify::operator-name');
}); });
this._proxy.GetSignalQualityRemote((result, err) => { this._proxy.GetSignalQualityRemote((result, err) => {
if (err) { if (err) {
// it will return an error if the device is not connected // it will return an error if the device is not connected
this._setSignalQuality(0); this.signal_quality = 0;
} else { } else {
let [quality] = result; let [quality] = result;
this._setSignalQuality(quality); this.signal_quality = quality;
} }
this.emit('notify::signal-quality');
}); });
} }
}); };
Signals.addSignalMethods(ModemGsm.prototype);
var ModemCdma = GObject.registerClass( var ModemCdma = class {
class ModemCdma extends ModemBase { constructor(path) {
_init(path) {
super._init();
this._proxy = new ModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path); this._proxy = new ModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
this.signal_quality = 0;
this.operator_name = null;
this._proxy.connectSignal('SignalQuality', (proxy, sender, params) => { this._proxy.connectSignal('SignalQuality', (proxy, sender, params) => {
this._setSignalQuality(params[0]); this.signal_quality = params[0];
this.emit('notify::signal-quality');
// receiving this signal means the device got activated // receiving this signal means the device got activated
// and we can finally call GetServingSystem // and we can finally call GetServingSystem
@@ -177,11 +156,12 @@ class ModemCdma extends ModemBase {
this._proxy.GetSignalQualityRemote((result, err) => { this._proxy.GetSignalQualityRemote((result, err) => {
if (err) { if (err) {
// it will return an error if the device is not connected // it will return an error if the device is not connected
this._setSignalQuality(0); this.signal_quality = 0;
} else { } else {
let [quality] = result; let [quality] = result;
this._setSignalQuality(quality); this.signal_quality = quality;
} }
this.emit('notify::signal-quality');
}); });
} }
@@ -189,14 +169,17 @@ class ModemCdma extends ModemBase {
this._proxy.GetServingSystemRemote(([result], err) => { this._proxy.GetServingSystemRemote(([result], err) => {
if (err) { if (err) {
// it will return an error if the device is not connected // it will return an error if the device is not connected
this._setOperatorName(null); this.operator_name = null;
} else { } else {
let [bandClass_, band_, sid] = result; let [bandClass_, band_, sid] = result;
this._setOperatorName(_findProviderForSid(sid));
this.operator_name = _findProviderForSid(sid);
} }
this.emit('notify::operator-name');
}); });
} }
}); };
Signals.addSignalMethods(ModemCdma.prototype);
// ------------------------------------------------------- // // ------------------------------------------------------- //
@@ -212,20 +195,12 @@ const BroadbandModem3gppProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModem3gp
const BroadbandModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem.ModemCdma'); const BroadbandModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem.ModemCdma');
const BroadbandModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemCdmaInterface); const BroadbandModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemCdmaInterface);
var BroadbandModem = GObject.registerClass({ var BroadbandModem = class {
Properties: { constructor(path, capabilities) {
'capabilities': GObject.ParamSpec.flags( this._proxy = new BroadbandModemProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
'capabilities', 'capabilities', 'capabilities',
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
NM.DeviceModemCapabilities.$gtype,
NM.DeviceModemCapabilities.NONE),
},
}, class BroadbandModem extends ModemBase {
_init(path, capabilities) {
super._init({ capabilities });
this._proxy = new BroadbandModemProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
this._proxy_3gpp = new BroadbandModem3gppProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path); this._proxy_3gpp = new BroadbandModem3gppProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
this._proxy_cdma = new BroadbandModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path); this._proxy_cdma = new BroadbandModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
this._capabilities = capabilities;
this._proxy.connect('g-properties-changed', (proxy, properties) => { this._proxy.connect('g-properties-changed', (proxy, properties) => {
if ('SignalQuality' in properties.deep_unpack()) if ('SignalQuality' in properties.deep_unpack())
@@ -249,8 +224,9 @@ var BroadbandModem = GObject.registerClass({
} }
_reloadSignalQuality() { _reloadSignalQuality() {
let [quality, recent_] = this.SignalQuality; let [quality, recent_] = this._proxy.SignalQuality;
this._setSignalQuality(quality); this.signal_quality = quality;
this.emit('notify::signal-quality');
} }
_reloadOperatorName() { _reloadOperatorName() {
@@ -264,7 +240,8 @@ var BroadbandModem = GObject.registerClass({
newName += this.operator_name_cdma; newName += this.operator_name_cdma;
} }
this._setOperatorName(newName); this.operator_name = newName;
this.emit('notify::operator-name');
} }
_reload3gppOperatorName() { _reload3gppOperatorName() {
@@ -279,4 +256,5 @@ var BroadbandModem = GObject.registerClass({
this.operator_name_cdma = _findProviderForSid(sid); this.operator_name_cdma = _findProviderForSid(sid);
this._reloadOperatorName(); this._reloadOperatorName();
} }
}); };
Signals.addSignalMethods(BroadbandModem.prototype);

View File

@@ -192,8 +192,9 @@ var ObjectManager = class {
_onNameAppeared() { _onNameAppeared() {
this._managerProxy.GetManagedObjectsRemote((result, error) => { this._managerProxy.GetManagedObjectsRemote((result, error) => {
if (!result) { if (!result) {
if (error) if (error) {
logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`); logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`);
}
this._tryToCompleteLoad(); this._tryToCompleteLoad();
return; return;

View File

@@ -17,10 +17,9 @@
// @params and @defaults // @params and @defaults
function parse(params = {}, defaults, allowExtras) { function parse(params = {}, defaults, allowExtras) {
if (!allowExtras) { if (!allowExtras) {
for (let prop in params) { for (let prop in params)
if (!(prop in defaults)) if (!(prop in defaults))
throw new Error(`Unrecognized parameter "${prop}"`); throw new Error(`Unrecognized parameter "${prop}"`);
}
} }
let defaultsCopy = Object.assign({}, defaults); let defaultsCopy = Object.assign({}, defaults);

View File

@@ -72,10 +72,11 @@ var SmartcardManager = class {
if ('IsInserted' in properties.deep_unpack()) { if ('IsInserted' in properties.deep_unpack()) {
this._updateToken(token); this._updateToken(token);
if (token.IsInserted) if (token.IsInserted) {
this.emit('smartcard-inserted', token); this.emit('smartcard-inserted', token);
else } else {
this.emit('smartcard-removed', token); this.emit('smartcard-removed', token);
}
} }
}); });

View File

@@ -74,8 +74,8 @@ const SystemActions = GObject.registerClass({
'orientation-lock-icon', 'orientation-lock-icon',
'orientation-lock-icon', 'orientation-lock-icon',
GObject.ParamFlags.READWRITE, GObject.ParamFlags.READWRITE,
null), null)
}, }
}, class SystemActions extends GObject.Object { }, class SystemActions extends GObject.Object {
_init() { _init() {
super._init(); super._init();
@@ -90,7 +90,7 @@ const SystemActions = GObject.registerClass({
iconName: 'system-shutdown-symbolic', iconName: 'system-shutdown-symbolic',
// Translators: A list of keywords that match the power-off action, separated by semicolons // Translators: A list of keywords that match the power-off action, separated by semicolons
keywords: _("power off;shutdown;reboot;restart").split(/[; ]/), keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
available: false, available: false
}); });
this._actions.set(LOCK_SCREEN_ACTION_ID, { this._actions.set(LOCK_SCREEN_ACTION_ID, {
// Translators: The name of the lock screen action in search // Translators: The name of the lock screen action in search
@@ -98,7 +98,7 @@ const SystemActions = GObject.registerClass({
iconName: 'system-lock-screen-symbolic', iconName: 'system-lock-screen-symbolic',
// Translators: A list of keywords that match the lock screen action, separated by semicolons // Translators: A list of keywords that match the lock screen action, separated by semicolons
keywords: _("lock screen").split(/[; ]/), keywords: _("lock screen").split(/[; ]/),
available: false, available: false
}); });
this._actions.set(LOGOUT_ACTION_ID, { this._actions.set(LOGOUT_ACTION_ID, {
// Translators: The name of the logout action in search // Translators: The name of the logout action in search
@@ -106,7 +106,7 @@ const SystemActions = GObject.registerClass({
iconName: 'application-exit-symbolic', iconName: 'application-exit-symbolic',
// Translators: A list of keywords that match the logout action, separated by semicolons // Translators: A list of keywords that match the logout action, separated by semicolons
keywords: _("logout;log out;sign off").split(/[; ]/), keywords: _("logout;log out;sign off").split(/[; ]/),
available: false, available: false
}); });
this._actions.set(SUSPEND_ACTION_ID, { this._actions.set(SUSPEND_ACTION_ID, {
// Translators: The name of the suspend action in search // Translators: The name of the suspend action in search
@@ -114,7 +114,7 @@ const SystemActions = GObject.registerClass({
iconName: 'media-playback-pause-symbolic', iconName: 'media-playback-pause-symbolic',
// Translators: A list of keywords that match the suspend action, separated by semicolons // Translators: A list of keywords that match the suspend action, separated by semicolons
keywords: _("suspend;sleep").split(/[; ]/), keywords: _("suspend;sleep").split(/[; ]/),
available: false, available: false
}); });
this._actions.set(SWITCH_USER_ACTION_ID, { this._actions.set(SWITCH_USER_ACTION_ID, {
// Translators: The name of the switch user action in search // Translators: The name of the switch user action in search
@@ -122,7 +122,7 @@ const SystemActions = GObject.registerClass({
iconName: 'system-switch-user-symbolic', iconName: 'system-switch-user-symbolic',
// Translators: A list of keywords that match the switch user action, separated by semicolons // Translators: A list of keywords that match the switch user action, separated by semicolons
keywords: _("switch user").split(/[; ]/), keywords: _("switch user").split(/[; ]/),
available: false, available: false
}); });
this._actions.set(LOCK_ORIENTATION_ACTION_ID, { this._actions.set(LOCK_ORIENTATION_ACTION_ID, {
// Translators: The name of the lock orientation action in search // Translators: The name of the lock orientation action in search
@@ -130,7 +130,7 @@ const SystemActions = GObject.registerClass({
iconName: '', iconName: '',
// Translators: A list of keywords that match the lock orientation action, separated by semicolons // Translators: A list of keywords that match the lock orientation action, separated by semicolons
keywords: _("lock orientation;screen;rotation").split(/[; ]/), keywords: _("lock orientation;screen;rotation").split(/[; ]/),
available: false, available: false
}); });
this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA }); this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA });
@@ -233,10 +233,9 @@ const SystemActions = GObject.registerClass({
_updateOrientationLock() { _updateOrientationLock() {
let available = false; let available = false;
if (this._sensorProxy.g_name_owner) { if (this._sensorProxy.g_name_owner)
available = this._sensorProxy.HasAccelerometer && available = this._sensorProxy.HasAccelerometer &&
this._monitorManager.get_is_builtin_display_on(); this._monitorManager.get_is_builtin_display_on();
}
this._actions.get(LOCK_ORIENTATION_ACTION_ID).available = available; this._actions.get(LOCK_ORIENTATION_ACTION_ID).available = available;
@@ -274,10 +273,9 @@ const SystemActions = GObject.registerClass({
let results = []; let results = [];
for (let [key, { available, keywords }] of this._actions) { for (let [key, { available, keywords }] of this._actions)
if (available && terms.every(t => keywords.some(k => k.startsWith(t)))) if (available && terms.every(t => keywords.some(k => k.startsWith(t))))
results.push(key); results.push(key);
}
return results; return results;
} }

View File

@@ -1,9 +1,9 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine, /* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
formatTime, formatTimeSpan, createTimeLabel, insertSorted, formatTime, formatTimeSpan, createTimeLabel, insertSorted,
makeCloseButton, ensureActorVisibleInScrollView, wiggle */ makeCloseButton, ensureActorVisibleInScrollView */
const { Clutter, Gio, GLib, GObject, Shell, St, GnomeDesktop } = imports.gi; const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
const Gettext = imports.gettext; const Gettext = imports.gettext;
const Main = imports.ui.main; const Main = imports.ui.main;
@@ -121,15 +121,12 @@ function trySpawn(argv) {
// We are only interested in the part in the parentheses. (And // We are only interested in the part in the parentheses. (And
// we can't pattern match the text, since it gets localized.) // we can't pattern match the text, since it gets localized.)
let message = err.message.replace(/.*\((.+)\)/, '$1'); let message = err.message.replace(/.*\((.+)\)/, '$1');
throw new err.constructor({ code: err.code, message }); throw new (err.constructor)({ code: err.code,
message: message });
} else { } else {
throw err; throw err;
} }
} }
// Async call, we don't need the reply though
GnomeDesktop.start_systemd_scope(argv[0], pid, null, null, null, () => {});
// Dummy child watch; we don't want to double-fork internally // Dummy child watch; we don't want to double-fork internally
// because then we lose the parent-child relationship, which // because then we lose the parent-child relationship, which
// can break polkit. See https://bugzilla.redhat.com//show_bug.cgi?id=819275 // can break polkit. See https://bugzilla.redhat.com//show_bug.cgi?id=819275
@@ -175,28 +172,23 @@ function formatTimeSpan(date) {
if (minutesAgo < 5) if (minutesAgo < 5)
return _("Just now"); return _("Just now");
if (hoursAgo < 1) { if (hoursAgo < 1)
return Gettext.ngettext("%d minute ago", return Gettext.ngettext("%d minute ago",
"%d minutes ago", minutesAgo).format(minutesAgo); "%d minutes ago", minutesAgo).format(minutesAgo);
} if (daysAgo < 1)
if (daysAgo < 1) {
return Gettext.ngettext("%d hour ago", return Gettext.ngettext("%d hour ago",
"%d hours ago", hoursAgo).format(hoursAgo); "%d hours ago", hoursAgo).format(hoursAgo);
}
if (daysAgo < 2) if (daysAgo < 2)
return _("Yesterday"); return _("Yesterday");
if (daysAgo < 15) { if (daysAgo < 15)
return Gettext.ngettext("%d day ago", return Gettext.ngettext("%d day ago",
"%d days ago", daysAgo).format(daysAgo); "%d days ago", daysAgo).format(daysAgo);
} if (weeksAgo < 8)
if (weeksAgo < 8) {
return Gettext.ngettext("%d week ago", return Gettext.ngettext("%d week ago",
"%d weeks ago", weeksAgo).format(weeksAgo); "%d weeks ago", weeksAgo).format(weeksAgo);
} if (yearsAgo < 1)
if (yearsAgo < 1) {
return Gettext.ngettext("%d month ago", return Gettext.ngettext("%d month ago",
"%d months ago", monthsAgo).format(monthsAgo); "%d months ago", monthsAgo).format(monthsAgo);
}
return Gettext.ngettext("%d year ago", return Gettext.ngettext("%d year ago",
"%d years ago", yearsAgo).format(yearsAgo); "%d years ago", yearsAgo).format(yearsAgo);
} }
@@ -221,10 +213,7 @@ function formatTime(time, params) {
_desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' }); _desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
let clockFormat = _desktopSettings.get_string('clock-format'); let clockFormat = _desktopSettings.get_string('clock-format');
params = Params.parse(params, { params = Params.parse(params, { timeOnly: false });
timeOnly: false,
ampm: true,
});
if (clockFormat == '24h') { if (clockFormat == '24h') {
// Show only the time if date is on today // Show only the time if date is on today
@@ -257,7 +246,7 @@ function formatTime(time, params) {
format = N_("%B %-d %Y, %H\u2236%M"); format = N_("%B %-d %Y, %H\u2236%M");
} else { } else {
// Show only the time if date is on today // Show only the time if date is on today
if (daysAgo < 1 || params.timeOnly) // eslint-disable-line no-lonely-if if (daysAgo < 1 || params.timeOnly)
/* Translators: Time in 12h format */ /* Translators: Time in 12h format */
format = N_("%l\u2236%M %p"); format = N_("%l\u2236%M %p");
// Show the word "Yesterday" and time if date is on yesterday // Show the word "Yesterday" and time if date is on yesterday
@@ -286,11 +275,6 @@ function formatTime(time, params) {
format = N_("%B %-d %Y, %l\u2236%M %p"); format = N_("%B %-d %Y, %l\u2236%M %p");
} }
// Time in short 12h format, without the equivalent of "AM" or "PM"; used
// when it is clear from the context
if (!params.ampm)
format = format.replace(/\s*%p/g, '');
let formattedTime = date.format(Shell.util_translate_time_string(format)); let formattedTime = date.format(Shell.util_translate_time_string(format));
// prepend LTR-mark to colon/ratio to force a text direction on times // prepend LTR-mark to colon/ratio to force a text direction on times
return formattedTime.replace(/([:\u2236])/g, '\u200e$1'); return formattedTime.replace(/([:\u2236])/g, '\u200e$1');
@@ -341,7 +325,7 @@ function lowerBound(array, val, cmp) {
max = mid; max = mid;
} }
return min == max || cmp(array[min], val) < 0 ? max : min; return (min == max || cmp(array[min], val) < 0) ? max : min;
} }
// insertSorted: // insertSorted:
@@ -362,13 +346,19 @@ function insertSorted(array, val, cmp) {
var CloseButton = GObject.registerClass( var CloseButton = GObject.registerClass(
class CloseButton extends St.Button { class CloseButton extends St.Button {
_init(boxpointer) { _init(boxpointer) {
super._init({ super._init({ style_class: 'notification-close' });
style_class: 'notification-close',
x_expand: true, // This is a bit tricky. St.Bin has its own x-align/y-align properties
y_expand: true, // that compete with Clutter's properties. This should be fixed for
x_align: Clutter.ActorAlign.END, // Clutter 2.0. Since St.Bin doesn't define its own setters, the
y_align: Clutter.ActorAlign.START, // setters are a workaround to get Clutter's version.
}); this.set_x_align(Clutter.ActorAlign.END);
this.set_y_align(Clutter.ActorAlign.START);
// XXX Clutter 2.0 workaround: ClutterBinLayout needs expand
// to respect the alignments.
this.set_x_expand(true);
this.set_y_expand(true);
this._boxPointer = boxpointer; this._boxPointer = boxpointer;
if (boxpointer) if (boxpointer)
@@ -421,7 +411,7 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
if (!parent) if (!parent)
throw new Error("actor not in scroll view"); throw new Error("actor not in scroll view");
box = parent.get_allocation_box(); let box = parent.get_allocation_box();
y1 += box.y1; y1 += box.y1;
y2 += box.y1; y2 += box.y1;
parent = parent.get_parent(); parent = parent.get_parent();
@@ -436,40 +426,6 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
adjustment.ease(value, { adjustment.ease(value, {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: SCROLL_TIME, duration: SCROLL_TIME
});
}
function wiggle(actor, params) {
params = Params.parse(params, {
offset: 0,
duration: 0,
wiggleCount: 0,
});
actor.translation_x = 0;
// Accelerate before wiggling
actor.ease({
translation_x: -params.offset,
duration: params.duration,
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => {
// Wiggle
actor.ease({
translation_x: params.offset,
duration: params.duration,
mode: Clutter.AnimationMode.LINEAR,
repeatCount: params.wiggleCount,
autoReverse: true,
onComplete: () => {
// Decelerate and return to the original position
actor.ease({
translation_x: 0,
duration: params.duration,
mode: Clutter.AnimationMode.EASE_IN_QUAD,
});
},
});
},
}); });
} }

View File

@@ -32,7 +32,6 @@ var WeatherClient = class {
this._gclueStarting = false; this._gclueStarting = false;
this._gclueLocationChangedId = 0; this._gclueLocationChangedId = 0;
this._needsAuth = true;
this._weatherAuthorized = false; this._weatherAuthorized = false;
this._permStore = new PermissionStore.PermissionStore((proxy, error) => { this._permStore = new PermissionStore.PermissionStore((proxy, error) => {
if (error) { if (error) {
@@ -48,11 +47,11 @@ var WeatherClient = class {
return; return;
} }
this._permStore.LookupRemote('gnome', 'geolocation', (res, err) => { this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => {
if (err) if (error)
log(`Error looking up permission: ${err.message}`); log(`Error looking up permission: ${error.message}`);
let [perms, data] = err ? [{}, null] : res; let [perms, data] = error ? [{}, null] : res;
let params = ['gnome', 'geolocation', false, data, perms]; let params = ['gnome', 'geolocation', false, data, perms];
this._onPermStoreChanged(this._permStore, '', params); this._onPermStoreChanged(this._permStore, '', params);
}); });
@@ -91,7 +90,7 @@ var WeatherClient = class {
this._onWeatherProxyReady.bind(this)); this._onWeatherProxyReady.bind(this));
this._settings = new Gio.Settings({ this._settings = new Gio.Settings({
schema_id: 'org.gnome.shell.weather', schema_id: 'org.gnome.shell.weather'
}); });
this._settings.connect('changed::automatic-location', this._settings.connect('changed::automatic-location',
this._onAutomaticLocationChanged.bind(this)); this._onAutomaticLocationChanged.bind(this));
@@ -143,7 +142,7 @@ var WeatherClient = class {
get _useAutoLocation() { get _useAutoLocation() {
return this._autoLocationRequested && return this._autoLocationRequested &&
this._locationSettings.get_boolean('enabled') && this._locationSettings.get_boolean('enabled') &&
(!this._needsAuth || this._weatherAuthorized); this._weatherAuthorized;
} }
_onWeatherProxyReady(o, res) { _onWeatherProxyReady(o, res) {
@@ -170,19 +169,12 @@ var WeatherClient = class {
} }
_onInstalledChanged() { _onInstalledChanged() {
let hadApp = this._weatherApp != null; let hadApp = (this._weatherApp != null);
this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID); this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
let haveApp = this._weatherApp != null; let haveApp = (this._weatherApp != null);
if (hadApp !== haveApp) if (hadApp !== haveApp)
this.emit('changed'); this.emit('changed');
let neededAuth = this._needsAuth;
this._needsAuth = this._weatherApp === null ||
this._weatherApp.app_info.has_key('X-Flatpak');
if (neededAuth !== this._needsAuth)
this._updateAutoLocation();
} }
_loadInfo() { _loadInfo() {
@@ -213,7 +205,7 @@ var WeatherClient = class {
this._weatherInfo.abort(); this._weatherInfo.abort();
this._weatherInfo.set_location(location); this._weatherInfo.set_location(location);
this._locationValid = location != null; this._locationValid = (location != null);
this._weatherInfo.set_enabled_providers(location ? this._providers : 0); this._weatherInfo.set_enabled_providers(location ? this._providers : 0);

View File

@@ -57,7 +57,7 @@ var METRICS = {
units: "us" }, units: "us" },
applicationsShowTimeSubsequent: applicationsShowTimeSubsequent:
{ description: "Time to switch to applications view, second time", { description: "Time to switch to applications view, second time",
units: "us" }, units: "us" }
}; };
let WINDOW_CONFIGS = [ let WINDOW_CONFIGS = [
@@ -67,7 +67,7 @@ let WINDOW_CONFIGS = [
{ width: 640, height: 480, alpha: false, maximized: true, count: 5, metric: 'overviewFps5Maximized' }, { width: 640, height: 480, alpha: false, maximized: true, count: 5, metric: 'overviewFps5Maximized' },
{ width: 640, height: 480, alpha: false, maximized: true, count: 10, metric: 'overviewFps10Maximized' }, { width: 640, height: 480, alpha: false, maximized: true, count: 10, metric: 'overviewFps10Maximized' },
{ width: 640, height: 480, alpha: true, maximized: false, count: 5, metric: 'overviewFps5Alpha' }, { width: 640, height: 480, alpha: true, maximized: false, count: 5, metric: 'overviewFps5Alpha' },
{ width: 640, height: 480, alpha: true, maximized: false, count: 10, metric: 'overviewFps10Alpha' }, { width: 640, height: 480, alpha: true, maximized: false, count: 10, metric: 'overviewFps10Alpha' }
]; ];
function *run() { function *run() {
@@ -94,12 +94,11 @@ function *run() {
let config = WINDOW_CONFIGS[i / 2]; let config = WINDOW_CONFIGS[i / 2];
yield Scripting.destroyTestWindows(); yield Scripting.destroyTestWindows();
for (let k = 0; k < config.count; k++) { for (let k = 0; k < config.count; k++)
yield Scripting.createTestWindow({ width: config.width, yield Scripting.createTestWindow({ width: config.width,
height: config.height, height: config.height,
alpha: config.alpha, alpha: config.alpha,
maximized: config.maximized }); maximized: config.maximized });
}
yield Scripting.waitTestWindows(); yield Scripting.waitTestWindows();
yield Scripting.sleep(1000); yield Scripting.sleep(1000);
@@ -175,10 +174,11 @@ function script_applicationsShowDone(time) {
} }
function script_afterShowHide(_time) { function script_afterShowHide(_time) {
if (overviewShowCount == 1) if (overviewShowCount == 1) {
METRICS.usedAfterOverview.value = mallocUsedSize; METRICS.usedAfterOverview.value = mallocUsedSize;
else } else {
METRICS.leakedAfterOverview.value = mallocUsedSize - METRICS.usedAfterOverview.value; METRICS.leakedAfterOverview.value = mallocUsedSize - METRICS.usedAfterOverview.value;
}
} }
function malloc_usedSize(time, bytes) { function malloc_usedSize(time, bytes) {

View File

@@ -114,7 +114,7 @@ function *run() {
Scripting.scriptEvent('desktopShown'); Scripting.scriptEvent('desktopShown');
let interfaceSettings = new Gio.Settings({ let interfaceSettings = new Gio.Settings({
schema_id: 'org.gnome.desktop.interface', schema_id: 'org.gnome.desktop.interface'
}); });
interfaceSettings.set_boolean('enable-animations', false); interfaceSettings.set_boolean('enable-animations', false);

View File

@@ -11,17 +11,17 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
const PortalHelperResult = { const PortalHelperResult = {
CANCELLED: 0, CANCELLED: 0,
COMPLETED: 1, COMPLETED: 1,
RECHECK: 2, RECHECK: 2
}; };
const PortalHelperSecurityLevel = { const PortalHelperSecurityLevel = {
NOT_YET_DETERMINED: 0, NOT_YET_DETERMINED: 0,
SECURE: 1, SECURE: 1,
INSECURE: 2, INSECURE: 2
}; };
const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org'; const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org';
const CONNECTIVITY_CHECK_URI = `http://${CONNECTIVITY_CHECK_HOST}`; const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST;
const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC; const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC;
const HelperDBusInterface = loadInterfaceXML('org.gnome.Shell.PortalHelper'); const HelperDBusInterface = loadInterfaceXML('org.gnome.Shell.PortalHelper');
@@ -92,7 +92,7 @@ class PortalHeaderBar extends Gtk.HeaderBar {
var PortalWindow = GObject.registerClass( var PortalWindow = GObject.registerClass(
class PortalWindow extends Gtk.ApplicationWindow { class PortalWindow extends Gtk.ApplicationWindow {
_init(application, url, timestamp, doneCallback) { _init(application, url, timestamp, doneCallback) {
super._init({ application }); super._init({ application: application });
this.connect('delete-event', this.destroyWindow.bind(this)); this.connect('delete-event', this.destroyWindow.bind(this));
this._headerBar = new PortalHeaderBar(); this._headerBar = new PortalHeaderBar();
@@ -287,7 +287,7 @@ class WebPortalHelper extends Gtk.Application {
} }
Authenticate(connection, url, timestamp) { Authenticate(connection, url, timestamp) {
this._queue.push({ connection, url, timestamp }); this._queue.push({ connection: connection, url: url, timestamp: timestamp });
this._processQueue(); this._processQueue();
} }

View File

@@ -13,7 +13,7 @@ const AccessIface = loadInterfaceXML('org.freedesktop.impl.portal.Access');
var DialogResponse = { var DialogResponse = {
OK: 0, OK: 0,
CANCEL: 1, CANCEL: 1,
CLOSED: 2, CLOSED: 2
}; };
var AccessDialog = GObject.registerClass( var AccessDialog = GObject.registerClass(
@@ -35,7 +35,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
_buildLayout(title, subtitle, body, options) { _buildLayout(title, subtitle, body, options) {
// No support for non-modal system dialogs, so ignore the option // No support for non-modal system dialogs, so ignore the option
// let modal = options['modal'] || true; //let modal = options['modal'] || true;
let denyLabel = options['deny_label'] || _("Deny Access"); let denyLabel = options['deny_label'] || _("Deny Access");
let grantLabel = options['grant_label'] || _("Grant Access"); let grantLabel = options['grant_label'] || _("Grant Access");
let iconName = options['icon'] || null; let iconName = options['icon'] || null;

View File

@@ -28,14 +28,20 @@ var AppIconMode = {
function _createWindowClone(window, size) { function _createWindowClone(window, size) {
let [width, height] = window.get_size(); let [width, height] = window.get_size();
let scale = Math.min(1.0, size / width, size / height); let scale = Math.min(1.0, size / width, size / height);
return new Clutter.Clone({ source: window,
width: width * scale, let cloneWidth = size;
height: height * scale, let cloneHeight = size;
x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER, if (width > height)
// usual hack for the usual bug in ClutterBinLayout... cloneHeight = size * (height / width);
x_expand: true, else
y_expand: true }); cloneWidth = size * (width / height);
return new Clutter.Actor({
content: window.content,
width: cloneWidth,
height: cloneHeight,
});
} }
function getWindows(workspace) { function getWindows(workspace) {
@@ -62,7 +68,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
this.thumbnailsVisible = false; this.thumbnailsVisible = false;
let apps = Shell.AppSystem.get_default().get_running(); let apps = Shell.AppSystem.get_default().get_running ();
if (apps.length == 0) if (apps.length == 0)
return; return;
@@ -111,12 +117,14 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
_initialSelection(backward, binding) { _initialSelection(backward, binding) {
if (binding == 'switch-group') { if (binding == 'switch-group') {
if (backward) if (backward) {
this._select(0, this._items[0].cachedWindows.length - 1); this._select(0, this._items[0].cachedWindows.length - 1);
else if (this._items[0].cachedWindows.length > 1) } else {
this._select(0, 1); if (this._items[0].cachedWindows.length > 1)
else this._select(0, 1);
this._select(0, 0); else
this._select(0, 0);
}
} else if (binding == 'switch-group-backward') { } else if (binding == 'switch-group-backward') {
this._select(0, this._items[0].cachedWindows.length - 1); this._select(0, this._items[0].cachedWindows.length - 1);
} else if (binding == 'switch-applications-backward') { } else if (binding == 'switch-applications-backward') {
@@ -178,27 +186,28 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
this._select(this._next()); this._select(this._next());
} else if (action == Meta.KeyBindingAction.SWITCH_APPLICATIONS_BACKWARD) { } else if (action == Meta.KeyBindingAction.SWITCH_APPLICATIONS_BACKWARD) {
this._select(this._previous()); this._select(this._previous());
} else if (keysym === Clutter.KEY_q) { } else if (keysym == Clutter.q) {
this._quitApplication(this._selectedIndex); this._quitApplication(this._selectedIndex);
} else if (this._thumbnailsFocused) { } else if (this._thumbnailsFocused) {
if (keysym === Clutter.KEY_Left) if (keysym == Clutter.Left)
this._select(this._selectedIndex, this._previousWindow()); this._select(this._selectedIndex, this._previousWindow());
else if (keysym === Clutter.KEY_Right) else if (keysym == Clutter.Right)
this._select(this._selectedIndex, this._nextWindow()); this._select(this._selectedIndex, this._nextWindow());
else if (keysym === Clutter.KEY_Up) else if (keysym == Clutter.Up)
this._select(this._selectedIndex, null, true); this._select(this._selectedIndex, null, true);
else if (keysym === Clutter.KEY_w || keysym === Clutter.KEY_F4) else if (keysym == Clutter.w || keysym == Clutter.F4)
this._closeAppWindow(this._selectedIndex, this._currentWindow); this._closeAppWindow(this._selectedIndex, this._currentWindow);
else else
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
} else if (keysym == Clutter.KEY_Left) {
this._select(this._previous());
} else if (keysym == Clutter.KEY_Right) {
this._select(this._next());
} else if (keysym == Clutter.KEY_Down) {
this._select(this._selectedIndex, 0);
} else { } else {
return Clutter.EVENT_PROPAGATE; if (keysym == Clutter.Left)
this._select(this._previous());
else if (keysym == Clutter.Right)
this._select(this._next());
else if (keysym == Clutter.Down)
this._select(this._selectedIndex, 0);
else
return Clutter.EVENT_PROPAGATE;
} }
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
@@ -293,9 +302,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
/** /**
* _select: * _select:
* @param {number} app: index of the app to select * @app: index of the app to select
* @param {number=} window: index of which of @app's windows to select * @window: (optional) index of which of @app's windows to select
* @param {bool} forceAppFocus: optional flag, see below * @forceAppFocus: optional flag, see below
* *
* Selects the indicated @app, and optional @window, and sets * Selects the indicated @app, and optional @window, and sets
* this._thumbnailsFocused appropriately to indicate whether the * this._thumbnailsFocused appropriately to indicate whether the
@@ -365,15 +374,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
onComplete: () => { onComplete: () => {
thumbnailsActor.destroy(); thumbnailsActor.destroy();
this.thumbnailsVisible = false; this.thumbnailsVisible = false;
}, }
}); });
this._thumbnails = null; this._thumbnails = null;
if (this._switcherList._items[this._selectedIndex]) if (this._switcherList._items[this._selectedIndex])
this._switcherList._items[this._selectedIndex].remove_accessible_state(Atk.StateType.EXPANDED); this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
} }
_createThumbnails() { _createThumbnails() {
this._thumbnails = new ThumbnailList(this._items[this._selectedIndex].cachedWindows); this._thumbnails = new ThumbnailList (this._items[this._selectedIndex].cachedWindows);
this._thumbnails.connect('item-activated', this._windowActivated.bind(this)); this._thumbnails.connect('item-activated', this._windowActivated.bind(this));
this._thumbnails.connect('item-entered', this._windowEntered.bind(this)); this._thumbnails.connect('item-entered', this._windowEntered.bind(this));
this._thumbnails.connect('item-removed', this._windowRemoved.bind(this)); this._thumbnails.connect('item-removed', this._windowRemoved.bind(this));
@@ -395,10 +404,10 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => { onComplete: () => {
this.thumbnailsVisible = true; this.thumbnailsVisible = true;
}, }
}); });
this._switcherList._items[this._selectedIndex].add_accessible_state(Atk.StateType.EXPANDED); this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
} }
}); });
@@ -408,14 +417,14 @@ class CyclerHighlight extends St.Widget {
super._init({ layout_manager: new Clutter.BinLayout() }); super._init({ layout_manager: new Clutter.BinLayout() });
this._window = null; this._window = null;
this._clone = new Clutter.Clone(); this._clone = new Clutter.Actor();
this.add_actor(this._clone); this.add_actor(this._clone);
this._highlight = new St.Widget({ style_class: 'cycler-highlight' }); this._highlight = new St.Widget({ style_class: 'cycler-highlight' });
this.add_actor(this._highlight); this.add_actor(this._highlight);
let coordinate = Clutter.BindCoordinate.ALL; let coordinate = Clutter.BindCoordinate.ALL;
let constraint = new Clutter.BindConstraint({ coordinate }); let constraint = new Clutter.BindConstraint({ coordinate: coordinate });
this._clone.bind_property('source', constraint, 'source', 0); this._clone.bind_property('source', constraint, 'source', 0);
this.add_constraint(constraint); this.add_constraint(constraint);
@@ -430,8 +439,8 @@ class CyclerHighlight extends St.Widget {
this._window = w; this._window = w;
if (this._clone.source) if (this._clone.content)
this._clone.source.sync_visibility(); this._clone.content.window_actor.sync_visibility();
let windowActor = this._window let windowActor = this._window
? this._window.get_compositor_private() : null; ? this._window.get_compositor_private() : null;
@@ -439,7 +448,7 @@ class CyclerHighlight extends St.Widget {
if (windowActor) if (windowActor)
windowActor.hide(); windowActor.hide();
this._clone.source = windowActor; this._clone.content = windowActor.content;
} }
_onAllocationChanged() { _onAllocationChanged() {
@@ -474,7 +483,7 @@ var CyclerList = GObject.registerClass({
}); });
var CyclerPopup = GObject.registerClass({ var CyclerPopup = GObject.registerClass({
GTypeFlags: GObject.TypeFlags.ABSTRACT, GTypeFlags: GObject.TypeFlags.ABSTRACT
}, class CyclerPopup extends SwitcherPopup.SwitcherPopup { }, class CyclerPopup extends SwitcherPopup.SwitcherPopup {
_init() { _init() {
super._init(); super._init();
@@ -588,18 +597,20 @@ class WindowSwitcherPopup extends SwitcherPopup.SwitcherPopup {
} }
_keyPressHandler(keysym, action) { _keyPressHandler(keysym, action) {
if (action == Meta.KeyBindingAction.SWITCH_WINDOWS) if (action == Meta.KeyBindingAction.SWITCH_WINDOWS) {
this._select(this._next()); this._select(this._next());
else if (action == Meta.KeyBindingAction.SWITCH_WINDOWS_BACKWARD) } else if (action == Meta.KeyBindingAction.SWITCH_WINDOWS_BACKWARD) {
this._select(this._previous()); this._select(this._previous());
else if (keysym == Clutter.KEY_Left) } else {
this._select(this._previous()); if (keysym == Clutter.Left)
else if (keysym == Clutter.KEY_Right) this._select(this._previous());
this._select(this._next()); else if (keysym == Clutter.Right)
else if (keysym == Clutter.KEY_w || keysym == Clutter.KEY_F4) this._select(this._next());
this._closeWindow(this._selectedIndex); else if (keysym == Clutter.w || keysym == Clutter.F4)
else this._closeWindow(this._selectedIndex);
return Clutter.EVENT_PROPAGATE; else
return Clutter.EVENT_PROPAGATE;
}
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
} }
@@ -642,22 +653,20 @@ class WindowCyclerPopup extends CyclerPopup {
} }
}); });
var AppIcon = GObject.registerClass( var AppIcon = GObject.registerClass({
class AppIcon extends St.BoxLayout { GTypeName: 'AltTab_AppIcon'
}, class AppIcon extends St.BoxLayout {
_init(app) { _init(app) {
super._init({ style_class: 'alt-tab-app', super._init({ style_class: 'alt-tab-app',
vertical: true }); vertical: true });
this.app = app; this.app = app;
this.icon = null; this.icon = null;
this._iconBin = new St.Bin(); this._iconBin = new St.Bin({ x_fill: true, y_fill: true });
this.add_child(this._iconBin); this.add(this._iconBin, { x_fill: false, y_fill: false } );
this.label = new St.Label({ this.label = new St.Label({ text: this.app.get_name() });
text: this.app.get_name(), this.add(this.label, { x_fill: false });
x_align: Clutter.ActorAlign.CENTER,
});
this.add_child(this.label);
} }
// eslint-disable-next-line camelcase // eslint-disable-next-line camelcase
@@ -693,7 +702,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
// Cache the window list now; we don't handle dynamic changes here, // Cache the window list now; we don't handle dynamic changes here,
// and we don't want to be continually retrieving it // and we don't want to be continually retrieving it
appIcon.cachedWindows = allWindows.filter( appIcon.cachedWindows = allWindows.filter(
w => windowTracker.get_window_app(w) == appIcon.app w => windowTracker.get_window_app (w) == appIcon.app
); );
if (appIcon.cachedWindows.length > 0) if (appIcon.cachedWindows.length > 0)
this._addIcon(appIcon); this._addIcon(appIcon);
@@ -717,9 +726,9 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
_setIconSize() { _setIconSize() {
let j = 0; let j = 0;
while (this._items.length > 1 && this._items[j].style_class != 'item-box') while (this._items.length > 1 && this._items[j].style_class != 'item-box') {
j++; j++;
}
let themeNode = this._items[j].get_theme_node(); let themeNode = this._items[j].get_theme_node();
this._list.ensure_style(); this._list.ensure_style();
@@ -853,7 +862,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
if (appIcon.cachedWindows.length == 1) if (appIcon.cachedWindows.length == 1)
arrow.hide(); arrow.hide();
else else
item.add_accessible_state(Atk.StateType.EXPANDABLE); item.add_accessible_state (Atk.StateType.EXPANDABLE);
} }
_removeIcon(app) { _removeIcon(app) {
@@ -889,13 +898,12 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
let title = windows[i].get_title(); let title = windows[i].get_title();
if (title) { if (title) {
let name = new St.Label({ let name = new St.Label({ text: title });
text: title, // St.Label doesn't support text-align so use a Bin
// St.Label doesn't support text-align let bin = new St.Bin({ x_align: St.Align.MIDDLE });
x_align: Clutter.ActorAlign.CENTER, this._labels.push(bin);
}); bin.add_actor(name);
this._labels.push(name); box.add_actor(bin);
box.add_actor(name);
this.addItem(box, name); this.addItem(box, name);
} else { } else {
@@ -974,7 +982,7 @@ class WindowIcon extends St.BoxLayout {
this._icon = new St.Widget({ layout_manager: new Clutter.BinLayout() }); this._icon = new St.Widget({ layout_manager: new Clutter.BinLayout() });
this.add_child(this._icon); this.add(this._icon, { x_fill: false, y_fill: false } );
this.label = new St.Label({ text: window.get_title() }); this.label = new St.Label({ text: window.get_title() });
let tracker = Shell.WindowTracker.get_default(); let tracker = Shell.WindowTracker.get_default();
@@ -997,10 +1005,9 @@ class WindowIcon extends St.BoxLayout {
size = WINDOW_PREVIEW_SIZE; size = WINDOW_PREVIEW_SIZE;
this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor)); this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
if (this.app) { if (this.app)
this._icon.add_actor(this._createAppIcon(this.app, this._icon.add_actor(this._createAppIcon(this.app,
APP_ICON_SIZE_SMALL)); APP_ICON_SIZE_SMALL));
}
break; break;
case AppIconMode.APP_ICON_ONLY: case AppIconMode.APP_ICON_ONLY:

View File

@@ -3,8 +3,6 @@
const { Clutter, GLib, GObject, Gio, St } = imports.gi; const { Clutter, GLib, GObject, Gio, St } = imports.gi;
const Params = imports.misc.params;
var ANIMATED_ICON_UPDATE_TIMEOUT = 16; var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
var SPINNER_ANIMATION_TIME = 300; var SPINNER_ANIMATION_TIME = 300;
var SPINNER_ANIMATION_DELAY = 1000; var SPINNER_ANIMATION_DELAY = 1000;
@@ -12,7 +10,7 @@ var SPINNER_ANIMATION_DELAY = 1000;
var Animation = GObject.registerClass( var Animation = GObject.registerClass(
class Animation extends St.Bin { class Animation extends St.Bin {
_init(file, width, height, speed) { _init(file, width, height, speed) {
super._init({ width, height }); super._init({ width: width, height: height });
this.connect('destroy', this._onDestroy.bind(this)); this.connect('destroy', this._onDestroy.bind(this));
this.connect('resource-scale-changed', this.connect('resource-scale-changed',
this._loadFile.bind(this, file, width, height)); this._loadFile.bind(this, file, width, height));
@@ -73,10 +71,6 @@ class Animation extends St.Bin {
this._animations = textureCache.load_sliced_image(file, width, height, this._animations = textureCache.load_sliced_image(file, width, height,
scaleFactor, resourceScale, scaleFactor, resourceScale,
this._animationsLoaded.bind(this)); this._animationsLoaded.bind(this));
this._animations.set({
x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER,
});
this.set_child(this._animations); this.set_child(this._animations);
if (wasPlaying) if (wasPlaying)
@@ -88,7 +82,7 @@ class Animation extends St.Bin {
if (oldFrameActor) if (oldFrameActor)
oldFrameActor.hide(); oldFrameActor.hide();
this._frame = frame % this._animations.get_n_children(); this._frame = (frame % this._animations.get_n_children());
let newFrameActor = this._animations.get_child_at_index(this._frame); let newFrameActor = this._animations.get_child_at_index(this._frame);
if (newFrameActor) if (newFrameActor)
@@ -138,18 +132,12 @@ class AnimatedIcon extends Animation {
var Spinner = GObject.registerClass( var Spinner = GObject.registerClass(
class Spinner extends AnimatedIcon { class Spinner extends AnimatedIcon {
_init(size, params) { _init(size, animate = false) {
params = Params.parse(params, {
animate: false,
hideOnStop: false,
});
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg'); let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg');
super._init(file, size); super._init(file, size);
this.opacity = 0; this.opacity = 0;
this._animate = params.animate; this._animate = animate;
this._hideOnStop = params.hideOnStop;
this.visible = !this._hideOnStop;
} }
_onDestroy() { _onDestroy() {
@@ -159,7 +147,6 @@ class Spinner extends AnimatedIcon {
play() { play() {
this.remove_all_transitions(); this.remove_all_transitions();
this.show();
if (this._animate) { if (this._animate) {
super.play(); super.play();
@@ -167,7 +154,7 @@ class Spinner extends AnimatedIcon {
opacity: 255, opacity: 255,
delay: SPINNER_ANIMATION_DELAY, delay: SPINNER_ANIMATION_DELAY,
duration: SPINNER_ANIMATION_TIME, duration: SPINNER_ANIMATION_TIME,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR
}); });
} else { } else {
this.opacity = 255; this.opacity = 255;
@@ -183,18 +170,11 @@ class Spinner extends AnimatedIcon {
opacity: 0, opacity: 0,
duration: SPINNER_ANIMATION_TIME, duration: SPINNER_ANIMATION_TIME,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR,
onComplete: () => { onComplete: () => super.stop()
super.stop();
if (this._hideOnStop)
this.hide();
},
}); });
} else { } else {
this.opacity = 0; this.opacity = 0;
super.stop(); super.stop();
if (this._hideOnStop)
this.hide();
} }
} }
}); });

File diff suppressed because it is too large Load Diff

View File

@@ -55,7 +55,6 @@ const RENAMED_DESKTOP_IDS = {
'org.gnome.taquin.desktop': 'org.gnome.Taquin.desktop', 'org.gnome.taquin.desktop': 'org.gnome.Taquin.desktop',
'org.gnome.Weather.Application.desktop': 'org.gnome.Weather.desktop', 'org.gnome.Weather.Application.desktop': 'org.gnome.Weather.desktop',
'polari.desktop': 'org.gnome.Polari.desktop', 'polari.desktop': 'org.gnome.Polari.desktop',
'shotwell.desktop': 'org.gnome.Shotwell.desktop',
'tali.desktop': 'org.gnome.Tali.desktop', 'tali.desktop': 'org.gnome.Tali.desktop',
'totem.desktop': 'org.gnome.Totem.desktop', 'totem.desktop': 'org.gnome.Totem.desktop',
'evince.desktop': 'org.gnome.Evince.desktop', 'evince.desktop': 'org.gnome.Evince.desktop',

View File

@@ -9,13 +9,13 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
var AudioDevice = { var AudioDevice = {
HEADPHONES: 1 << 0, HEADPHONES: 1 << 0,
HEADSET: 1 << 1, HEADSET: 1 << 1,
MICROPHONE: 1 << 2, MICROPHONE: 1 << 2
}; };
const AudioDeviceSelectionIface = loadInterfaceXML('org.gnome.Shell.AudioDeviceSelection'); const AudioDeviceSelectionIface = loadInterfaceXML('org.gnome.Shell.AudioDeviceSelection');
var AudioDeviceSelectionDialog = GObject.registerClass({ var AudioDeviceSelectionDialog = GObject.registerClass({
Signals: { 'device-selected': { param_types: [GObject.TYPE_UINT] } }, Signals: { 'device-selected': { param_types: [GObject.TYPE_UINT] } }
}, class AudioDeviceSelectionDialog extends ModalDialog.ModalDialog { }, class AudioDeviceSelectionDialog extends ModalDialog.ModalDialog {
_init(devices) { _init(devices) {
super._init({ styleClass: 'audio-device-selection-dialog' }); super._init({ styleClass: 'audio-device-selection-dialog' });
@@ -43,19 +43,15 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
this.contentLayout.style_class = 'audio-selection-content'; this.contentLayout.style_class = 'audio-selection-content';
this.contentLayout.add(title); this.contentLayout.add(title);
this._selectionBox = new St.BoxLayout({ this._selectionBox = new St.BoxLayout({ style_class: 'audio-selection-box' });
style_class: 'audio-selection-box', this.contentLayout.add(this._selectionBox, { expand: true });
x_expand: true,
});
this.contentLayout.add_child(this._selectionBox);
if (Main.sessionMode.allowSettings) { if (Main.sessionMode.allowSettings)
this.addButton({ action: this._openSettings.bind(this), this.addButton({ action: this._openSettings.bind(this),
label: _("Sound Settings") }); label: _("Sound Settings") });
}
this.addButton({ action: this.close.bind(this), this.addButton({ action: this.close.bind(this),
label: _("Cancel"), label: _("Cancel"),
key: Clutter.KEY_Escape }); key: Clutter.Escape });
} }
_getDeviceLabel(device) { _getDeviceLabel(device) {

View File

@@ -145,7 +145,7 @@ var BackgroundCache = class BackgroundCache {
let monitor = file.monitor(Gio.FileMonitorFlags.NONE, null); let monitor = file.monitor(Gio.FileMonitorFlags.NONE, null);
monitor.connect('changed', monitor.connect('changed',
(obj, theFile, otherFile, eventType) => { (obj, file, otherFile, eventType) => {
// Ignore CHANGED and CREATED events, since in both cases // Ignore CHANGED and CREATED events, since in both cases
// we'll get a CHANGES_DONE_HINT event when done. // we'll get a CHANGES_DONE_HINT event when done.
if (eventType != Gio.FileMonitorEvent.CHANGED && if (eventType != Gio.FileMonitorEvent.CHANGED &&
@@ -222,7 +222,7 @@ function getBackgroundCache() {
} }
var Background = GObject.registerClass({ var Background = GObject.registerClass({
Signals: { 'loaded': {}, 'bg-changed': {} }, Signals: { 'loaded': {}, 'bg-changed': {} }
}, class Background extends Meta.Background { }, class Background extends Meta.Background {
_init(params) { _init(params) {
params = Params.parse(params, { monitorIndex: 0, params = Params.parse(params, { monitorIndex: 0,
@@ -269,9 +269,9 @@ var Background = GObject.registerClass({
let i; let i;
let keys = Object.keys(this._fileWatches); let keys = Object.keys(this._fileWatches);
for (i = 0; i < keys.length; i++) for (i = 0; i < keys.length; i++) {
this._cache.disconnect(this._fileWatches[keys[i]]); this._cache.disconnect(this._fileWatches[keys[i]]);
}
this._fileWatches = null; this._fileWatches = null;
if (this._timezoneChangedId != 0) if (this._timezoneChangedId != 0)
@@ -403,7 +403,6 @@ var Background = GObject.registerClass({
if (numPendingImages == 0) if (numPendingImages == 0)
finish(); finish();
} else { } else {
// eslint-disable-next-line no-loop-func
let id = image.connect('loaded', () => { let id = image.connect('loaded', () => {
image.disconnect(id); image.disconnect(id);
numPendingImages--; numPendingImages--;
@@ -445,7 +444,7 @@ var Background = GObject.registerClass({
_loadAnimation(file) { _loadAnimation(file) {
this._cache.getAnimation({ this._cache.getAnimation({
file, file: file,
settingsSchema: this._settings.schema_id, settingsSchema: this._settings.schema_id,
onLoaded: animation => { onLoaded: animation => {
this._animation = animation; this._animation = animation;
@@ -457,7 +456,7 @@ var Background = GObject.registerClass({
this._updateAnimation(); this._updateAnimation();
this._watchFile(file); this._watchFile(file);
}, }
}); });
} }
@@ -501,7 +500,7 @@ var Background = GObject.registerClass({
let _systemBackground; let _systemBackground;
var SystemBackground = GObject.registerClass({ var SystemBackground = GObject.registerClass({
Signals: { 'loaded': {} }, Signals: { 'loaded': {} }
}, class SystemBackground extends Meta.BackgroundActor { }, class SystemBackground extends Meta.BackgroundActor {
_init() { _init() {
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/noise-texture.png'); let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/noise-texture.png');
@@ -515,7 +514,7 @@ var SystemBackground = GObject.registerClass({
super._init({ super._init({
meta_display: global.display, meta_display: global.display,
monitor: 0, monitor: 0,
background: _systemBackground, background: _systemBackground
}); });
let cache = Meta.BackgroundImageCache.get_default(); let cache = Meta.BackgroundImageCache.get_default();
@@ -593,11 +592,11 @@ var BackgroundSource = class BackgroundSource {
if (!(monitorIndex in this._backgrounds)) { if (!(monitorIndex in this._backgrounds)) {
let background = new Background({ let background = new Background({
monitorIndex, monitorIndex: monitorIndex,
layoutManager: this._layoutManager, layoutManager: this._layoutManager,
settings: this._settings, settings: this._settings,
file, file: file,
style, style: style
}); });
background._changedId = background.connect('bg-changed', () => { background._changedId = background.connect('bg-changed', () => {
@@ -626,11 +625,11 @@ var BackgroundSource = class BackgroundSource {
} }
}; };
var Animation = GObject.registerClass( var Animation = class Animation {
class Animation extends GnomeDesktop.BGSlideShow { constructor(params) {
_init(params) { params = Params.parse(params, { file: null });
super._init(params);
this.file = params.file;
this.keyFrameFiles = []; this.keyFrameFiles = [];
this.transitionProgress = 0.0; this.transitionProgress = 0.0;
this.transitionDuration = 0.0; this.transitionDuration = 0.0;
@@ -638,7 +637,9 @@ class Animation extends GnomeDesktop.BGSlideShow {
} }
load(callback) { load(callback) {
this.load_async(null, () => { this._show = new GnomeDesktop.BGSlideShow({ file: this.file });
this._show.load_async(null, () => {
this.loaded = true; this.loaded = true;
if (callback) if (callback)
callback(); callback();
@@ -648,11 +649,13 @@ class Animation extends GnomeDesktop.BGSlideShow {
update(monitor) { update(monitor) {
this.keyFrameFiles = []; this.keyFrameFiles = [];
if (this.get_num_slides() < 1) if (!this._show)
return; return;
let [progress, duration, isFixed_, filename1, filename2] = if (this._show.get_num_slides() < 1)
this.get_current_slide(monitor.width, monitor.height); return;
let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
this.transitionDuration = duration; this.transitionDuration = duration;
this.transitionProgress = progress; this.transitionProgress = progress;
@@ -663,7 +666,8 @@ class Animation extends GnomeDesktop.BGSlideShow {
if (filename2) if (filename2)
this.keyFrameFiles.push(Gio.File.new_for_path(filename2)); this.keyFrameFiles.push(Gio.File.new_for_path(filename2));
} }
}); };
Signals.addSignalMethods(Animation.prototype);
var BackgroundManager = class BackgroundManager { var BackgroundManager = class BackgroundManager {
constructor(params) { constructor(params) {
@@ -714,7 +718,7 @@ var BackgroundManager = class BackgroundManager {
opacity: 0, opacity: 0,
duration: FADE_ANIMATION_TIME, duration: FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => oldBackgroundActor.destroy(), onComplete: () => oldBackgroundActor.destroy()
}); });
} }
@@ -763,7 +767,7 @@ var BackgroundManager = class BackgroundManager {
if (this._controlPosition) { if (this._controlPosition) {
let monitor = this._layoutManager.monitors[this._monitorIndex]; let monitor = this._layoutManager.monitors[this._monitorIndex];
backgroundActor.set_position(monitor.x, monitor.y); backgroundActor.set_position(monitor.x, monitor.y);
this._container.set_child_below_sibling(backgroundActor, null); backgroundActor.lower_bottom();
} }
let changeSignalId = background.connect('bg-changed', () => { let changeSignalId = background.connect('bg-changed', () => {

View File

@@ -35,12 +35,11 @@ function addBackgroundMenu(actor, layoutManager) {
} }
let clickAction = new Clutter.ClickAction(); let clickAction = new Clutter.ClickAction();
clickAction.connect('long-press', (action, theActor, state) => { clickAction.connect('long-press', (action, actor, state) => {
if (state == Clutter.LongPressState.QUERY) { if (state == Clutter.LongPressState.QUERY)
return (action.get_button() == 0 || return ((action.get_button() == 0 ||
action.get_button() == 1) && action.get_button() == 1) &&
!actor._backgroundMenu.isOpen; !actor._backgroundMenu.isOpen);
}
if (state == Clutter.LongPressState.ACTIVATE) { if (state == Clutter.LongPressState.ACTIVATE) {
let [x, y] = action.get_coords(); let [x, y] = action.get_coords();
openMenu(x, y); openMenu(x, y);

View File

@@ -16,8 +16,8 @@ var BarLevel = GObject.registerClass({
'overdrive-start': GObject.ParamSpec.double( 'overdrive-start': GObject.ParamSpec.double(
'overdrive-start', 'overdrive-start', 'overdrive-start', 'overdrive-start', 'overdrive-start', 'overdrive-start',
GObject.ParamFlags.READWRITE, GObject.ParamFlags.READWRITE,
1, 2, 1), 1, 2, 1)
}, }
}, class BarLevel extends St.DrawingArea { }, class BarLevel extends St.DrawingArea {
_init(params) { _init(params) {
this._maxValue = 1; this._maxValue = 1;
@@ -27,7 +27,7 @@ var BarLevel = GObject.registerClass({
let defaultParams = { let defaultParams = {
style_class: 'barlevel', style_class: 'barlevel',
accessible_role: Atk.Role.LEVEL_BAR, accessible_role: Atk.Role.LEVEL_BAR
}; };
super._init(Object.assign(defaultParams, params)); super._init(Object.assign(defaultParams, params));
this.connect('allocation-changed', (actor, box) => { this.connect('allocation-changed', (actor, box) => {
@@ -88,10 +88,9 @@ var BarLevel = GObject.registerClass({
if (this._overdriveStart == value) if (this._overdriveStart == value)
return; return;
if (value > this._maxValue) { if (value > this._maxValue)
throw new Error(`Tried to set overdrive value to ${value}, ` + throw new Error(`Tried to set overdrive value to ${value}, ` +
`which is a number greater than the maximum allowed value ${this._maxValue}`); `which is a number greater than the maximum allowed value ${this._maxValue}`);
}
this._overdriveStart = value; this._overdriveStart = value;
this.notify('overdrive-start'); this.notify('overdrive-start');

View File

@@ -44,7 +44,7 @@ var BoxPointer = GObject.registerClass({
this._border = new St.DrawingArea(); this._border = new St.DrawingArea();
this._border.connect('repaint', this._drawBorder.bind(this)); this._border.connect('repaint', this._drawBorder.bind(this));
this.add_actor(this._border); this.add_actor(this._border);
this.set_child_above_sibling(this.bin, this._border); this.bin.raise(this._border);
this._sourceAlignment = 0.5; this._sourceAlignment = 0.5;
this._muteInput = true; this._muteInput = true;
@@ -72,7 +72,7 @@ var BoxPointer = GObject.registerClass({
open(animate, onComplete) { open(animate, onComplete) {
let themeNode = this.get_theme_node(); let themeNode = this.get_theme_node();
let rise = themeNode.get_length('-arrow-rise'); let rise = themeNode.get_length('-arrow-rise');
let animationTime = animate & PopupAnimation.FULL ? POPUP_ANIMATION_TIME : 0; let animationTime = (animate & PopupAnimation.FULL) ? POPUP_ANIMATION_TIME : 0;
if (animate & PopupAnimation.FADE) if (animate & PopupAnimation.FADE)
this.opacity = 0; this.opacity = 0;
@@ -108,7 +108,7 @@ var BoxPointer = GObject.registerClass({
this._muteInput = false; this._muteInput = false;
if (onComplete) if (onComplete)
onComplete(); onComplete();
}, }
}); });
} }
@@ -120,8 +120,8 @@ var BoxPointer = GObject.registerClass({
let translationY = 0; let translationY = 0;
let themeNode = this.get_theme_node(); let themeNode = this.get_theme_node();
let rise = themeNode.get_length('-arrow-rise'); let rise = themeNode.get_length('-arrow-rise');
let fade = animate & PopupAnimation.FADE; let fade = (animate & PopupAnimation.FADE);
let animationTime = animate & PopupAnimation.FULL ? POPUP_ANIMATION_TIME : 0; let animationTime = (animate & PopupAnimation.FULL) ? POPUP_ANIMATION_TIME : 0;
if (animate & PopupAnimation.SLIDE) { if (animate & PopupAnimation.SLIDE) {
switch (this._arrowSide) { switch (this._arrowSide) {
@@ -156,7 +156,7 @@ var BoxPointer = GObject.registerClass({
this.translation_y = 0; this.translation_y = 0;
if (onComplete) if (onComplete)
onComplete(); onComplete();
}, }
}); });
} }
@@ -247,10 +247,11 @@ var BoxPointer = GObject.registerClass({
let [absX, absY] = this.get_transformed_position(); let [absX, absY] = this.get_transformed_position();
if (this._arrowSide == St.Side.TOP || if (this._arrowSide == St.Side.TOP ||
this._arrowSide == St.Side.BOTTOM) this._arrowSide == St.Side.BOTTOM) {
this._arrowOrigin = sourceX - absX + sourceWidth / 2; this._arrowOrigin = sourceX - absX + sourceWidth / 2;
else } else {
this._arrowOrigin = sourceY - absY + sourceHeight / 2; this._arrowOrigin = sourceY - absY + sourceHeight / 2;
}
} }
let borderWidth = themeNode.get_length('-arrow-border-width'); let borderWidth = themeNode.get_length('-arrow-border-width');
@@ -265,19 +266,20 @@ var BoxPointer = GObject.registerClass({
let [width, height] = area.get_surface_size(); let [width, height] = area.get_surface_size();
let [boxWidth, boxHeight] = [width, height]; let [boxWidth, boxHeight] = [width, height];
if (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM) if (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM) {
boxHeight -= rise; boxHeight -= rise;
else } else {
boxWidth -= rise; boxWidth -= rise;
}
let cr = area.get_context(); let cr = area.get_context();
// Translate so that box goes from 0,0 to boxWidth,boxHeight, // Translate so that box goes from 0,0 to boxWidth,boxHeight,
// with the arrow poking out of that // with the arrow poking out of that
if (this._arrowSide == St.Side.TOP) if (this._arrowSide == St.Side.TOP) {
cr.translate(0, rise); cr.translate(0, rise);
else if (this._arrowSide == St.Side.LEFT) } else if (this._arrowSide == St.Side.LEFT) {
cr.translate(rise, 0); cr.translate(rise, 0);
}
let [x1, y1] = [halfBorder, halfBorder]; let [x1, y1] = [halfBorder, halfBorder];
let [x2, y2] = [boxWidth - halfBorder, boxHeight - halfBorder]; let [x2, y2] = [boxWidth - halfBorder, boxHeight - halfBorder];
@@ -473,7 +475,7 @@ var BoxPointer = GObject.registerClass({
let borderWidth = themeNode.get_length('-arrow-border-width'); let borderWidth = themeNode.get_length('-arrow-border-width');
let arrowBase = themeNode.get_length('-arrow-base'); let arrowBase = themeNode.get_length('-arrow-base');
let borderRadius = themeNode.get_length('-arrow-border-radius'); let borderRadius = themeNode.get_length('-arrow-border-radius');
let margin = 4 * borderRadius + borderWidth + arrowBase; let margin = (4 * borderRadius + borderWidth + arrowBase);
let gap = themeNode.get_length('-boxpointer-gap'); let gap = themeNode.get_length('-boxpointer-gap');
let padding = themeNode.get_length('-arrow-rise'); let padding = themeNode.get_length('-arrow-rise');
@@ -524,11 +526,11 @@ var BoxPointer = GObject.registerClass({
arrowOrigin = sourceCenterX - resX; arrowOrigin = sourceCenterX - resX;
if (arrowOrigin <= (x1 + (borderRadius + halfBase))) { if (arrowOrigin <= (x1 + (borderRadius + halfBase))) {
if (arrowOrigin > x1) if (arrowOrigin > x1)
resX += arrowOrigin - x1; resX += (arrowOrigin - x1);
arrowOrigin = x1; arrowOrigin = x1;
} else if (arrowOrigin >= (x2 - (borderRadius + halfBase))) { } else if (arrowOrigin >= (x2 - (borderRadius + halfBase))) {
if (arrowOrigin < x2) if (arrowOrigin < x2)
resX -= x2 - arrowOrigin; resX -= (x2 - arrowOrigin);
arrowOrigin = x2; arrowOrigin = x2;
} }
break; break;
@@ -543,11 +545,11 @@ var BoxPointer = GObject.registerClass({
arrowOrigin = sourceCenterY - resY; arrowOrigin = sourceCenterY - resY;
if (arrowOrigin <= (y1 + (borderRadius + halfBase))) { if (arrowOrigin <= (y1 + (borderRadius + halfBase))) {
if (arrowOrigin > y1) if (arrowOrigin > y1)
resY += arrowOrigin - y1; resY += (arrowOrigin - y1);
arrowOrigin = y1; arrowOrigin = y1;
} else if (arrowOrigin >= (y2 - (borderRadius + halfBase))) { } else if (arrowOrigin >= (y2 - (borderRadius + halfBase))) {
if (arrowOrigin < y2) if (arrowOrigin < y2)
resX -= y2 - arrowOrigin; resX -= (y2 - arrowOrigin);
arrowOrigin = y2; arrowOrigin = y2;
} }
break; break;

View File

@@ -1,7 +1,8 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Calendar, CalendarMessageList, DBusEventSource */ /* exported Calendar, CalendarMessageList */
const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
const Signals = imports.signals;
const Main = imports.ui.main; const Main = imports.ui.main;
const MessageList = imports.ui.messageList; const MessageList = imports.ui.messageList;
@@ -20,7 +21,7 @@ var MESSAGE_ICON_SIZE = -1; // pick up from CSS
var NC_ = (context, str) => `${context}\u0004${str}`; var NC_ = (context, str) => `${context}\u0004${str}`;
function sameYear(dateA, dateB) { function sameYear(dateA, dateB) {
return dateA.getYear() == dateB.getYear(); return (dateA.getYear() == dateB.getYear());
} }
function sameMonth(dateA, dateB) { function sameMonth(dateA, dateB) {
@@ -78,7 +79,7 @@ function _getCalendarDayAbbreviation(dayNumber) {
/* Translators: Calendar grid abbreviation for Friday */ /* Translators: Calendar grid abbreviation for Friday */
NC_("grid friday", "F"), NC_("grid friday", "F"),
/* Translators: Calendar grid abbreviation for Saturday */ /* Translators: Calendar grid abbreviation for Saturday */
NC_("grid saturday", "S"), NC_("grid saturday", "S")
]; ];
return Shell.util_translate_time_string(abbreviations[dayNumber]); return Shell.util_translate_time_string(abbreviations[dayNumber]);
} }
@@ -98,54 +99,17 @@ var CalendarEvent = class CalendarEvent {
// Interface for appointments/events - e.g. the contents of a calendar // Interface for appointments/events - e.g. the contents of a calendar
// //
var EventSourceBase = GObject.registerClass({ // First, an implementation with no events
GTypeFlags: GObject.TypeFlags.ABSTRACT, var EmptyEventSource = class EmptyEventSource {
Properties: { constructor() {
'has-calendars': GObject.ParamSpec.boolean( this.isLoading = false;
'has-calendars', 'has-calendars', 'has-calendars', this.isDummy = true;
GObject.ParamFlags.READABLE, this.hasCalendars = false;
false),
'is-loading': GObject.ParamSpec.boolean(
'is-loading', 'is-loading', 'is-loading',
GObject.ParamFlags.READABLE,
false),
},
Signals: { 'changed': {} },
}, class EventSourceBase extends GObject.Object {
get isLoading() {
throw new GObject.NotImplementedError(`isLoading in ${this.constructor.name}`);
}
get hasCalendars() {
throw new GObject.NotImplementedError(`hasCalendars in ${this.constructor.name}`);
} }
destroy() { destroy() {
} }
requestRange(_begin, _end) {
throw new GObject.NotImplementedError(`requestRange in ${this.constructor.name}`);
}
getEvents(_begin, _end) {
throw new GObject.NotImplementedError(`getEvents in ${this.constructor.name}`);
}
hasEvents(_day) {
throw new GObject.NotImplementedError(`hasEvents in ${this.constructor.name}`);
}
});
var EmptyEventSource = GObject.registerClass(
class EmptyEventSource extends EventSourceBase {
get isLoading() {
return false;
}
get hasCalendars() {
return false;
}
requestRange(_begin, _end) { requestRange(_begin, _end) {
} }
@@ -157,7 +121,8 @@ class EmptyEventSource extends EventSourceBase {
hasEvents(_day) { hasEvents(_day) {
return false; return false;
} }
}); };
Signals.addSignalMethods(EmptyEventSource.prototype);
const CalendarServerIface = loadInterfaceXML('org.gnome.Shell.CalendarServer'); const CalendarServerIface = loadInterfaceXML('org.gnome.Shell.CalendarServer');
@@ -189,12 +154,11 @@ function _dateIntervalsOverlap(a0, a1, b0, b1) {
} }
// an implementation that reads data from a session bus service // an implementation that reads data from a session bus service
var DBusEventSource = GObject.registerClass( var DBusEventSource = class DBusEventSource {
class DBusEventSource extends EventSourceBase { constructor() {
_init() {
super._init();
this._resetCache(); this._resetCache();
this._isLoading = false; this.isLoading = false;
this.isDummy = false;
this._initialized = false; this._initialized = false;
this._dbusProxy = new CalendarServer(); this._dbusProxy = new CalendarServer();
@@ -229,12 +193,12 @@ class DBusEventSource extends EventSourceBase {
}); });
this._dbusProxy.connect('g-properties-changed', () => { this._dbusProxy.connect('g-properties-changed', () => {
this.notify('has-calendars'); this.emit('notify::has-calendars');
}); });
this._initialized = loaded; this._initialized = loaded;
if (loaded) { if (loaded) {
this.notify('has-calendars'); this.emit('notify::has-calendars');
this._onNameAppeared(); this._onNameAppeared();
} }
}); });
@@ -251,10 +215,6 @@ class DBusEventSource extends EventSourceBase {
return false; return false;
} }
get isLoading() {
return this._isLoading;
}
_resetCache() { _resetCache() {
this._events = []; this._events = [];
this._lastRequestBegin = null; this._lastRequestBegin = null;
@@ -292,7 +252,7 @@ class DBusEventSource extends EventSourceBase {
newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime()); newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
this._events = newEvents; this._events = newEvents;
this._isLoading = false; this.isLoading = false;
this.emit('changed'); this.emit('changed');
} }
@@ -312,7 +272,7 @@ class DBusEventSource extends EventSourceBase {
requestRange(begin, end) { requestRange(begin, end) {
if (!(_datesEqual(begin, this._lastRequestBegin) && _datesEqual(end, this._lastRequestEnd))) { if (!(_datesEqual(begin, this._lastRequestBegin) && _datesEqual(end, this._lastRequestEnd))) {
this._isLoading = true; this.isLoading = true;
this._lastRequestBegin = begin; this._lastRequestBegin = begin;
this._lastRequestEnd = end; this._lastRequestEnd = end;
this._curRequestBegin = begin; this._curRequestBegin = begin;
@@ -326,8 +286,9 @@ class DBusEventSource extends EventSourceBase {
for (let n = 0; n < this._events.length; n++) { for (let n = 0; n < this._events.length; n++) {
let event = this._events[n]; let event = this._events[n];
if (_dateIntervalsOverlap(event.date, event.end, begin, end)) if (_dateIntervalsOverlap (event.date, event.end, begin, end)) {
result.push(event); result.push(event);
}
} }
result.sort((event1, event2) => { result.sort((event1, event2) => {
// sort events by end time on ending day // sort events by end time on ending day
@@ -349,10 +310,11 @@ class DBusEventSource extends EventSourceBase {
return true; return true;
} }
}); };
Signals.addSignalMethods(DBusEventSource.prototype);
var Calendar = GObject.registerClass({ var Calendar = GObject.registerClass({
Signals: { 'selected-date-changed': { param_types: [GLib.DateTime.$gtype] } }, Signals: { 'selected-date-changed': { param_types: [GLib.DateTime.$gtype] } }
}, class Calendar extends St.Widget { }, class Calendar extends St.Widget {
_init() { _init() {
this._weekStart = Shell.util_get_week_start(); this._weekStart = Shell.util_get_week_start();
@@ -386,17 +348,16 @@ var Calendar = GObject.registerClass({
super._init({ super._init({
style_class: 'calendar', style_class: 'calendar',
layout_manager: new Clutter.GridLayout(), layout_manager: new Clutter.TableLayout(),
reactive: true, reactive: true
}); });
this._buildHeader(); this._buildHeader ();
} }
// @eventSource: is an object implementing the EventSource API, e.g. the
// requestRange(), getEvents(), hasEvents() methods and the ::changed signal.
setEventSource(eventSource) { setEventSource(eventSource) {
if (!(eventSource instanceof EventSourceBase))
throw new Error('Event source is not valid type');
this._eventSource = eventSource; this._eventSource = eventSource;
this._eventSource.connect('changed', () => { this._eventSource.connect('changed', () => {
this._rebuildCalendar(); this._rebuildCalendar();
@@ -433,7 +394,8 @@ var Calendar = GObject.registerClass({
// Top line of the calendar '<| September 2009 |>' // Top line of the calendar '<| September 2009 |>'
this._topBox = new St.BoxLayout(); this._topBox = new St.BoxLayout();
layout.attach(this._topBox, 0, 0, offsetCols + 7, 1); layout.pack(this._topBox, 0, 0);
layout.set_span(this._topBox, offsetCols + 7, 1);
this._backButton = new St.Button({ style_class: 'calendar-change-month-back pager-button', this._backButton = new St.Button({ style_class: 'calendar-change-month-back pager-button',
accessible_name: _("Previous month"), accessible_name: _("Previous month"),
@@ -442,13 +404,9 @@ var Calendar = GObject.registerClass({
this._topBox.add(this._backButton); this._topBox.add(this._backButton);
this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this)); this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this));
this._monthLabel = new St.Label({ this._monthLabel = new St.Label({ style_class: 'calendar-month-label',
style_class: 'calendar-month-label', can_focus: true });
can_focus: true, this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE });
x_align: Clutter.ActorAlign.CENTER,
x_expand: true,
});
this._topBox.add_child(this._monthLabel);
this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button', this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button',
accessible_name: _("Next month"), accessible_name: _("Next month"),
@@ -478,7 +436,7 @@ var Calendar = GObject.registerClass({
col = 6 - (7 + iter.getDay() - this._weekStart) % 7; col = 6 - (7 + iter.getDay() - this._weekStart) % 7;
else else
col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7; col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7;
layout.attach(label, col, 1, 1, 1); layout.pack(label, col, 1);
iter.setTime(iter.getTime() + MSECS_IN_DAY); iter.setTime(iter.getTime() + MSECS_IN_DAY);
} }
@@ -605,7 +563,7 @@ var Calendar = GObject.registerClass({
can_focus: true }); can_focus: true });
let rtl = button.get_text_direction() == Clutter.TextDirection.RTL; let rtl = button.get_text_direction() == Clutter.TextDirection.RTL;
if (this._eventSource instanceof EmptyEventSource) if (this._eventSource.isDummy)
button.reactive = false; button.reactive = false;
button._date = new Date(iter); button._date = new Date(iter);
@@ -649,7 +607,7 @@ var Calendar = GObject.registerClass({
col = 6 - (7 + iter.getDay() - this._weekStart) % 7; col = 6 - (7 + iter.getDay() - this._weekStart) % 7;
else else
col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7; col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7;
layout.attach(button, col, row, 1, 1); layout.pack(button, col, row);
this._buttons.push(button); this._buttons.push(button);
@@ -659,7 +617,7 @@ var Calendar = GObject.registerClass({
can_focus: true }); can_focus: true });
let weekFormat = Shell.util_translate_time_string(N_("Week %V")); let weekFormat = Shell.util_translate_time_string(N_("Week %V"));
label.accessible_name = iter.toLocaleFormat(weekFormat); label.accessible_name = iter.toLocaleFormat(weekFormat);
layout.attach(label, rtl ? 7 : 0, row, 1, 1); layout.pack(label, rtl ? 7 : 0, row);
} }
iter.setTime(iter.getTime() + MSECS_IN_DAY); iter.setTime(iter.getTime() + MSECS_IN_DAY);
@@ -712,15 +670,15 @@ class EventMessage extends MessageList.Message {
vfunc_style_changed() { vfunc_style_changed() {
let iconVisible = this.get_parent().has_style_pseudo_class('first-child'); let iconVisible = this.get_parent().has_style_pseudo_class('first-child');
this._icon.opacity = iconVisible ? 255 : 0; this._icon.opacity = (iconVisible ? 255 : 0);
super.vfunc_style_changed(); super.vfunc_style_changed();
} }
_formatEventTime() { _formatEventTime() {
let periodBegin = _getBeginningOfDay(this._date); let periodBegin = _getBeginningOfDay(this._date);
let periodEnd = _getEndOfDay(this._date); let periodEnd = _getEndOfDay(this._date);
let allDay = this._event.allDay || (this._event.date <= periodBegin && let allDay = (this._event.allDay || (this._event.date <= periodBegin &&
this._event.end >= periodEnd); this._event.end >= periodEnd));
let title; let title;
if (allDay) { if (allDay) {
/* Translators: Shown in calendar event list for all day events /* Translators: Shown in calendar event list for all day events
@@ -777,12 +735,11 @@ class NotificationMessage extends MessageList.Message {
} }
_getIcon() { _getIcon() {
if (this.notification.gicon) { if (this.notification.gicon)
return new St.Icon({ gicon: this.notification.gicon, return new St.Icon({ gicon: this.notification.gicon,
icon_size: MESSAGE_ICON_SIZE }); icon_size: MESSAGE_ICON_SIZE });
} else { else
return this.notification.source.createIcon(MESSAGE_ICON_SIZE); return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
}
} }
_onUpdated(n, _clear) { _onUpdated(n, _clear) {
@@ -829,8 +786,8 @@ class EventsSection extends MessageList.MessageListSection {
this._title = new St.Button({ style_class: 'events-section-title', this._title = new St.Button({ style_class: 'events-section-title',
label: '', label: '',
x_align: St.Align.START,
can_focus: true }); can_focus: true });
this._title.child.x_align = Clutter.ActorAlign.START;
this.insert_child_below(this._title, null); this.insert_child_below(this._title, null);
this._title.connect('clicked', this._onTitleClicked.bind(this)); this._title.connect('clicked', this._onTitleClicked.bind(this));
@@ -842,9 +799,6 @@ class EventsSection extends MessageList.MessageListSection {
} }
setEventSource(eventSource) { setEventSource(eventSource) {
if (!(eventSource instanceof EventSourceBase))
throw new Error('Event source is not valid type');
this._eventSource = eventSource; this._eventSource = eventSource;
this._eventSource.connect('changed', this._reloadEvents.bind(this)); this._eventSource.connect('changed', this._reloadEvents.bind(this));
} }
@@ -861,15 +815,14 @@ class EventsSection extends MessageList.MessageListSection {
let dayFormat; let dayFormat;
let now = new Date(); let now = new Date();
if (sameYear(this._date, now)) { if (sameYear(this._date, now))
/* Translators: Shown on calendar heading when selected day occurs on current year */ /* Translators: Shown on calendar heading when selected day occurs on current year */
dayFormat = Shell.util_translate_time_string(NC_("calendar heading", dayFormat = Shell.util_translate_time_string(NC_("calendar heading",
"%A, %B %-d")); "%A, %B %-d"));
} else { else
/* Translators: Shown on calendar heading when selected day occurs on different year */ /* Translators: Shown on calendar heading when selected day occurs on different year */
dayFormat = Shell.util_translate_time_string(NC_("calendar heading", dayFormat = Shell.util_translate_time_string(NC_("calendar heading",
"%A, %B %-d, %Y")); "%A, %B %-d, %Y"));
}
this._title.label = this._date.toLocaleFormat(dayFormat); this._title.label = this._date.toLocaleFormat(dayFormat);
} }
@@ -910,7 +863,7 @@ class EventsSection extends MessageList.MessageListSection {
_appInstalledChanged() { _appInstalledChanged() {
this._calendarApp = undefined; this._calendarApp = undefined;
this._title.reactive = this._getCalendarApp() != null; this._title.reactive = (this._getCalendarApp() != null);
} }
_getCalendarApp() { _getCalendarApp() {
@@ -962,7 +915,7 @@ class NotificationTimeLabel extends St.Label {
super._init({ super._init({
style_class: 'event-time', style_class: 'event-time',
x_align: Clutter.ActorAlign.START, x_align: Clutter.ActorAlign.START,
y_align: Clutter.ActorAlign.END, y_align: Clutter.ActorAlign.END
}); });
this._datetime = datetime; this._datetime = datetime;
} }
@@ -998,7 +951,7 @@ class NotificationSection extends MessageList.MessageListSection {
notificationAddedId: 0, notificationAddedId: 0,
}; };
obj.destroyId = source.connect('destroy', () => { obj.destroyId = source.connect('destroy', source => {
this._onSourceDestroy(source, obj); this._onSourceDestroy(source, obj);
}); });
obj.notificationAddedId = source.connect('notification-added', obj.notificationAddedId = source.connect('notification-added',
@@ -1109,7 +1062,7 @@ class CalendarMessageList extends St.Widget {
style_class: 'message-list', style_class: 'message-list',
layout_manager: new Clutter.BinLayout(), layout_manager: new Clutter.BinLayout(),
x_expand: true, x_expand: true,
y_expand: true, y_expand: true
}); });
this._placeholder = new Placeholder(); this._placeholder = new Placeholder();
@@ -1119,20 +1072,17 @@ class CalendarMessageList extends St.Widget {
x_expand: true, y_expand: true }); x_expand: true, y_expand: true });
this.add_actor(box); this.add_actor(box);
this._scrollView = new St.ScrollView({ this._scrollView = new St.ScrollView({ style_class: 'vfade',
style_class: 'vfade', overlay_scrollbars: true,
overlay_scrollbars: true, x_expand: true, y_expand: true,
x_expand: true, y_expand: true, x_fill: true, y_fill: true });
});
this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC); this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
box.add_actor(this._scrollView); box.add_actor(this._scrollView);
this._clearButton = new St.Button({ this._clearButton = new St.Button({ style_class: 'message-list-clear-button button',
style_class: 'message-list-clear-button button', label: _("Clear"),
label: _('Clear'), can_focus: true });
can_focus: true, this._clearButton.set_x_align(Clutter.ActorAlign.END);
x_align: Clutter.ActorAlign.END,
});
this._clearButton.connect('clicked', () => { this._clearButton.connect('clicked', () => {
this._sectionList.get_children().forEach(s => s.clear()); this._sectionList.get_children().forEach(s => s.clear());
}); });
@@ -1144,7 +1094,6 @@ class CalendarMessageList extends St.Widget {
this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections', this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections',
vertical: true, vertical: true,
x_expand: true,
y_expand: true, y_expand: true,
y_align: Clutter.ActorAlign.START }); y_align: Clutter.ActorAlign.START });
this._sectionList.connect('actor-added', this._sync.bind(this)); this._sectionList.connect('actor-added', this._sync.bind(this));
@@ -1174,7 +1123,7 @@ class CalendarMessageList extends St.Widget {
Util.ensureActorVisibleInScrollView(this._scrollView, messageActor); Util.ensureActorVisibleInScrollView(this._scrollView, messageActor);
})); }));
connectionsIds.push(section.connect('destroy', () => { connectionsIds.push(section.connect('destroy', (section) => {
connectionsIds.forEach(id => section.disconnect(id)); connectionsIds.forEach(id => section.disconnect(id));
this._sectionList.remove_actor(section); this._sectionList.remove_actor(section);
})); }));

View File

@@ -4,19 +4,19 @@ const { Clutter, GObject, Pango, St } = imports.gi;
var CheckBox = GObject.registerClass( var CheckBox = GObject.registerClass(
class CheckBox extends St.Button { class CheckBox extends St.Button {
_init(label) { _init(label) {
let container = new St.BoxLayout({ let container = new St.BoxLayout();
x_expand: true,
y_expand: true,
});
super._init({ super._init({
style_class: 'check-box', style_class: 'check-box',
child: container, child: container,
button_mask: St.ButtonMask.ONE, button_mask: St.ButtonMask.ONE,
toggle_mode: true, toggle_mode: true,
can_focus: true, can_focus: true,
x_fill: true,
y_fill: true
}); });
this._box = new St.Bin({ y_align: Clutter.ActorAlign.START }); this._box = new St.Bin();
this._box.set_y_align(Clutter.ActorAlign.START);
container.add_actor(this._box); container.add_actor(this._box);
this._label = new St.Label(); this._label = new St.Label();

View File

@@ -1,7 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported CloseDialog */ /* exported CloseDialog */
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;
const Dialog = imports.ui.dialog; const Dialog = imports.ui.dialog;
const Main = imports.ui.main; const Main = imports.ui.main;
@@ -13,7 +13,7 @@ var ALIVE_TIMEOUT = 5000;
var CloseDialog = GObject.registerClass({ var CloseDialog = GObject.registerClass({
Implements: [Meta.CloseDialog], Implements: [Meta.CloseDialog],
Properties: { Properties: {
'window': GObject.ParamSpec.override('window', Meta.CloseDialog), 'window': GObject.ParamSpec.override('window', Meta.CloseDialog)
}, },
}, class CloseDialog extends GObject.Object { }, class CloseDialog extends GObject.Object {
_init(window) { _init(window) {
@@ -46,18 +46,6 @@ var CloseDialog = GObject.registerClass({
return new Dialog.MessageDialogContent({ icon, title, subtitle }); return new Dialog.MessageDialogContent({ icon, title, subtitle });
} }
_updateScale() {
// Since this is a child of MetaWindowActor (which, for Wayland clients,
// applies the geometry scale factor to its children itself, see
// meta_window_actor_set_geometry_scale()), make sure we don't apply
// the factor twice in the end.
if (this._window.get_client_type() !== Meta.WindowClientType.WAYLAND)
return;
let { scaleFactor } = St.ThemeContext.get_for_stage(global.stage);
this._dialog.set_scale(1 / scaleFactor, 1 / scaleFactor);
}
_initDialog() { _initDialog() {
if (this._dialog) if (this._dialog)
return; return;
@@ -73,14 +61,9 @@ var CloseDialog = GObject.registerClass({
default: true }); default: true });
this._dialog.addButton({ label: _('Wait'), this._dialog.addButton({ label: _('Wait'),
action: this._onWait.bind(this), action: this._onWait.bind(this),
key: Clutter.KEY_Escape }); key: Clutter.Escape });
global.focus_manager.add_group(this._dialog); global.focus_manager.add_group(this._dialog);
let themeContext = St.ThemeContext.get_for_stage(global.stage);
themeContext.connect('notify::scale-factor', this._updateScale.bind(this));
this._updateScale();
} }
_addWindowEffect() { _addWindowEffect() {
@@ -124,12 +107,11 @@ var CloseDialog = GObject.registerClass({
if (this._tracked === shouldTrack) if (this._tracked === shouldTrack)
return; return;
if (shouldTrack) { if (shouldTrack)
Main.layoutManager.trackChrome(this._dialog, Main.layoutManager.trackChrome(this._dialog,
{ affectsInputRegion: true }); { affectsInputRegion: true });
} else { else
Main.layoutManager.untrackChrome(this._dialog); Main.layoutManager.untrackChrome(this._dialog);
}
// The buttons are broken when they aren't added to the input region, // The buttons are broken when they aren't added to the input region,
// so disable them properly in that case // so disable them properly in that case
@@ -163,14 +145,14 @@ var CloseDialog = GObject.registerClass({
this._addWindowEffect(); this._addWindowEffect();
this._initDialog(); this._initDialog();
this._dialog._dialog.scale_y = 0; this._dialog.scale_y = 0;
this._dialog._dialog.set_pivot_point(0.5, 0.5); this._dialog.set_pivot_point(0.5, 0.5);
this._dialog._dialog.ease({ this._dialog.ease({
scale_y: 1, scale_y: 1,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR,
duration: DIALOG_TRANSITION_TIME, duration: DIALOG_TRANSITION_TIME,
onComplete: this._onFocusChanged.bind(this), onComplete: this._onFocusChanged.bind(this)
}); });
} }
@@ -193,11 +175,11 @@ var CloseDialog = GObject.registerClass({
this._dialog = null; this._dialog = null;
this._removeWindowEffect(); this._removeWindowEffect();
dialog._dialog.ease({ dialog.ease({
scale_y: 0, scale_y: 0,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR,
duration: DIALOG_TRANSITION_TIME, duration: DIALOG_TRANSITION_TIME,
onComplete: () => dialog.destroy(), onComplete: () => dialog.destroy()
}); });
} }

View File

@@ -58,8 +58,9 @@ var AutomountManager = class {
_InhibitorsChanged(_object, _senderName, [_inhibitor]) { _InhibitorsChanged(_object, _senderName, [_inhibitor]) {
this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT, this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
(result, error) => { (result, error) => {
if (!error) if (!error) {
this._inhibited = result[0]; this._inhibited = result[0];
}
}); });
} }
@@ -109,7 +110,7 @@ var AutomountManager = class {
// mount operation object // mount operation object
if (drive.can_stop()) { if (drive.can_stop()) {
drive.stop(Gio.MountUnmountFlags.FORCE, null, null, drive.stop(Gio.MountUnmountFlags.FORCE, null, null,
(o, res) => { (drive, res) => {
try { try {
drive.stop_finish(res); drive.stop_finish(res);
} catch (e) { } catch (e) {
@@ -118,7 +119,7 @@ var AutomountManager = class {
}); });
} else if (drive.can_eject()) { } else if (drive.can_eject()) {
drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null, drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null,
(o, res) => { (drive, res) => {
try { try {
drive.eject_with_operation_finish(res); drive.eject_with_operation_finish(res);
} catch (e) { } catch (e) {
@@ -222,7 +223,7 @@ var AutomountManager = class {
delete volume._allowAutorunExpireId; delete volume._allowAutorunExpireId;
} }
this._volumeQueue = this._volumeQueue =
this._volumeQueue.filter(element => element != volume); this._volumeQueue.filter(element => (element != volume));
} }
_reaskPassword(volume) { _reaskPassword(volume) {
@@ -230,7 +231,7 @@ var AutomountManager = class {
let existingDialog = prevOperation ? prevOperation.borrowDialog() : null; let existingDialog = prevOperation ? prevOperation.borrowDialog() : null;
let operation = let operation =
new ShellMountOperation.ShellMountOperation(volume, new ShellMountOperation.ShellMountOperation(volume,
{ existingDialog }); { existingDialog: existingDialog });
this._mountVolume(volume, operation); this._mountVolume(volume, operation);
} }

View File

@@ -1,7 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Component */ /* exported Component */
const { Clutter, Gio, GObject, St } = imports.gi; const { Gio, GObject, St } = imports.gi;
const GnomeSession = imports.misc.gnomeSession; const GnomeSession = imports.misc.gnomeSession;
const Main = imports.ui.main; const Main = imports.ui.main;
@@ -20,7 +20,7 @@ var AutorunSetting = {
RUN: 0, RUN: 0,
IGNORE: 1, IGNORE: 1,
FILES: 2, FILES: 2,
ASK: 3, ASK: 3
}; };
// misc utils // misc utils
@@ -41,7 +41,7 @@ function isMountRootHidden(root) {
let path = root.get_path(); let path = root.get_path();
// skip any mounts in hidden directory hierarchies // skip any mounts in hidden directory hierarchies
return path.includes('/.'); return (path.includes('/.'));
} }
function isMountNonLocal(mount) { function isMountNonLocal(mount) {
@@ -52,7 +52,7 @@ function isMountNonLocal(mount) {
if (volume == null) if (volume == null)
return true; return true;
return volume.get_identifier("class") == "network"; return (volume.get_identifier("class") == "network");
} }
function startAppForMount(app, mount) { function startAppForMount(app, mount) {
@@ -115,8 +115,7 @@ var ContentTypeDiscoverer = class {
let hotplugSniffer = new HotplugSniffer(); let hotplugSniffer = new HotplugSniffer();
hotplugSniffer.SniffURIRemote(root.get_uri(), hotplugSniffer.SniffURIRemote(root.get_uri(),
result => { ([contentTypes]) => {
[contentTypes] = result;
this._emitCallback(mount, contentTypes); this._emitCallback(mount, contentTypes);
}); });
} }
@@ -125,7 +124,7 @@ var ContentTypeDiscoverer = class {
_emitCallback(mount, contentTypes = []) { _emitCallback(mount, contentTypes = []) {
// we're not interested in win32 software content types here // we're not interested in win32 software content types here
contentTypes = contentTypes.filter( contentTypes = contentTypes.filter(
type => type != 'x-content/win32-software' type => (type != 'x-content/win32-software')
); );
let apps = []; let apps = [];
@@ -167,7 +166,7 @@ var AutorunManager = class {
if (!this._session.SessionIsActive) if (!this._session.SessionIsActive)
return; return;
let discoverer = new ContentTypeDiscoverer((m, apps, contentTypes) => { let discoverer = new ContentTypeDiscoverer((mount, apps, contentTypes) => {
this._dispatcher.addMount(mount, apps, contentTypes); this._dispatcher.addMount(mount, apps, contentTypes);
}); });
discoverer.guessContentTypes(mount); discoverer.guessContentTypes(mount);
@@ -202,7 +201,7 @@ var AutorunDispatcher = class {
} }
_getSourceForMount(mount) { _getSourceForMount(mount) {
let filtered = this._sources.filter(source => source.mount == mount); let filtered = this._sources.filter(source => (source.mount == mount));
// we always make sure not to add two sources for the same // we always make sure not to add two sources for the same
// mount in addMount(), so it's safe to assume filtered.length // mount in addMount(), so it's safe to assume filtered.length
@@ -246,10 +245,11 @@ var AutorunDispatcher = class {
let success = false; let success = false;
let app = null; let app = null;
if (setting == AutorunSetting.RUN) if (setting == AutorunSetting.RUN) {
app = Gio.app_info_get_default_for_type(contentTypes[0], false); app = Gio.app_info_get_default_for_type(contentTypes[0], false);
else if (setting == AutorunSetting.FILES) } else if (setting == AutorunSetting.FILES) {
app = Gio.app_info_get_default_for_type('inode/directory', false); app = Gio.app_info_get_default_for_type('inode/directory', false);
}
if (app) if (app)
success = startAppForMount(app, mount); success = startAppForMount(app, mount);
@@ -320,23 +320,20 @@ class AutorunNotification extends MessageTray.Notification {
} }
_buttonForApp(app) { _buttonForApp(app) {
let box = new St.BoxLayout({ let box = new St.BoxLayout();
x_expand: true,
x_align: Clutter.ActorAlign.START,
});
let icon = new St.Icon({ gicon: app.get_icon(), let icon = new St.Icon({ gicon: app.get_icon(),
style_class: 'hotplug-notification-item-icon' }); style_class: 'hotplug-notification-item-icon' });
box.add(icon); box.add(icon);
let label = new St.Bin({ let label = new St.Bin({
child: new St.Label({ y_align: St.Align.MIDDLE,
text: _("Open with %s").format(app.get_name()), child: new St.Label({ text: _("Open with %s").format(app.get_name()) }),
y_align: Clutter.ActorAlign.CENTER,
}),
}); });
box.add(label); box.add(label);
let button = new St.Button({ child: box, let button = new St.Button({ child: box,
x_fill: true,
x_align: St.Align.START,
x_expand: true, x_expand: true,
button_mask: St.ButtonMask.ONE, button_mask: St.ButtonMask.ONE,
style_class: 'hotplug-notification-item button' }); style_class: 'hotplug-notification-item button' });

View File

@@ -33,7 +33,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
this._cancelButton = this.addButton({ label: '', this._cancelButton = this.addButton({ label: '',
action: this._onCancelButton.bind(this), action: this._onCancelButton.bind(this),
key: Clutter.KEY_Escape }); key: Clutter.Escape });
this._continueButton = this.addButton({ label: '', this._continueButton = this.addButton({ label: '',
action: this._onContinueButton.bind(this), action: this._onContinueButton.bind(this),
default: true }); default: true });
@@ -54,12 +54,8 @@ class KeyringDialog extends ModalDialog.ModalDialog {
_buildControlTable() { _buildControlTable() {
let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL }); let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
let table = new St.Widget({ let table = new St.Widget({ style_class: 'keyring-dialog-control-table',
style_class: 'keyring-dialog-control-table', layout_manager: layout });
layout_manager: layout,
x_expand: true,
y_expand: true,
});
layout.hookup_style(table); layout.hookup_style(table);
let rtl = table.get_text_direction() == Clutter.TextDirection.RTL; let rtl = table.get_text_direction() == Clutter.TextDirection.RTL;
let row = 0; let row = 0;
@@ -78,9 +74,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true }); ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
this._passwordEntry.clutter_text.connect('activate', this._onPasswordActivate.bind(this)); this._passwordEntry.clutter_text.connect('activate', this._onPasswordActivate.bind(this));
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, { this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
animate: true,
});
if (rtl) { if (rtl) {
layout.attach(this._workSpinner, 0, row, 1, 1); layout.attach(this._workSpinner, 0, row, 1, 1);
@@ -98,9 +92,9 @@ class KeyringDialog extends ModalDialog.ModalDialog {
} }
if (this.prompt.confirm_visible) { if (this.prompt.confirm_visible) {
var label = new St.Label({ style_class: 'prompt-dialog-password-label', var label = new St.Label(({ style_class: 'prompt-dialog-password-label',
x_align: Clutter.ActorAlign.START, x_align: Clutter.ActorAlign.START,
y_align: Clutter.ActorAlign.CENTER }); y_align: Clutter.ActorAlign.CENTER }));
label.set_text(_("Type again:")); label.set_text(_("Type again:"));
this._confirmEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry', this._confirmEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
text: '', text: '',
@@ -146,7 +140,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
} }
this._controlTable = table; this._controlTable = table;
this._content.messageBox.add_child(table); this._content.messageBox.add(table, { x_fill: true, y_fill: true });
} }
_updateSensitivity(sensitive) { _updateSensitivity(sensitive) {
@@ -234,11 +228,10 @@ var KeyringDummyDialog = class {
} }
}; };
var KeyringPrompter = GObject.registerClass( var KeyringPrompter = class {
class KeyringPrompter extends Gcr.SystemPrompter { constructor() {
_init() { this._prompter = new Gcr.SystemPrompter();
super._init(); this._prompter.connect('new-prompt', () => {
this.connect('new-prompt', () => {
let dialog = this._enabled let dialog = this._enabled
? new KeyringDialog() ? new KeyringDialog()
: new KeyringDummyDialog(); : new KeyringDummyDialog();
@@ -253,7 +246,7 @@ class KeyringPrompter extends Gcr.SystemPrompter {
enable() { enable() {
if (!this._registered) { if (!this._registered) {
this.register(Gio.DBus.session); this._prompter.register(Gio.DBus.session);
this._dbusId = Gio.DBus.session.own_name('org.gnome.keyring.SystemPrompter', this._dbusId = Gio.DBus.session.own_name('org.gnome.keyring.SystemPrompter',
Gio.BusNameOwnerFlags.ALLOW_REPLACEMENT, null, null); Gio.BusNameOwnerFlags.ALLOW_REPLACEMENT, null, null);
this._registered = true; this._registered = true;
@@ -264,10 +257,10 @@ class KeyringPrompter extends Gcr.SystemPrompter {
disable() { disable() {
this._enabled = false; this._enabled = false;
if (this.prompting) if (this._prompter.prompting)
this._currentPrompt.cancel(); this._currentPrompt.cancel();
this._currentPrompt = null; this._currentPrompt = null;
} }
}); };
var Component = KeyringPrompter; var Component = KeyringPrompter;

View File

@@ -56,7 +56,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
secret.entry = new St.Entry({ style_class: 'prompt-dialog-password-entry', secret.entry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
text: secret.value, can_focus: reactive, text: secret.value, can_focus: reactive,
reactive, reactive: reactive,
x_expand: true }); x_expand: true });
ShellEntry.addContextMenu(secret.entry, ShellEntry.addContextMenu(secret.entry,
{ isPassword: secret.password }); { isPassword: secret.password });
@@ -106,7 +106,10 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
descriptionLabel.clutter_text.line_wrap = true; descriptionLabel.clutter_text.line_wrap = true;
descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
contentBox.messageBox.add_child(descriptionLabel); contentBox.messageBox.add(descriptionLabel,
{ y_fill: true,
y_align: St.Align.START,
expand: true });
} }
this._okButton = { this._okButton = {
@@ -169,7 +172,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
return true; return true;
} }
return value.length >= 8 && value.length <= 63; return (value.length >= 8 && value.length <= 63);
} }
_validateStaticWep(secret) { _validateStaticWep(secret) {
@@ -222,12 +225,11 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
validate: this._validateStaticWep, password: true }); validate: this._validateStaticWep, password: true });
break; break;
case 'ieee8021x': case 'ieee8021x':
if (wirelessSecuritySetting.auth_alg == 'leap') { // Cisco LEAP if (wirelessSecuritySetting.auth_alg == 'leap') // Cisco LEAP
secrets.push({ label: _("Password: "), key: 'leap-password', secrets.push({ label: _("Password: "), key: 'leap-password',
value: wirelessSecuritySetting.leap_password || '', password: true }); value: wirelessSecuritySetting.leap_password || '', password: true });
} else { // Dynamic (IEEE 802.1x) WEP else // Dynamic (IEEE 802.1x) WEP
this._get8021xSecrets(secrets); this._get8021xSecrets(secrets);
}
break; break;
case 'wpa-eap': case 'wpa-eap':
this._get8021xSecrets(secrets); this._get8021xSecrets(secrets);
@@ -242,18 +244,15 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
/* If hints were given we know exactly what we need to ask */ /* If hints were given we know exactly what we need to ask */
if (this._settingName == "802-1x" && this._hints.length) { if (this._settingName == "802-1x" && this._hints.length) {
if (this._hints.includes('identity')) { if (this._hints.includes('identity'))
secrets.push({ label: _("Username: "), key: 'identity', secrets.push({ label: _("Username: "), key: 'identity',
value: ieee8021xSetting.identity || '', password: false }); value: ieee8021xSetting.identity || '', password: false });
} if (this._hints.includes('password'))
if (this._hints.includes('password')) {
secrets.push({ label: _("Password: "), key: 'password', secrets.push({ label: _("Password: "), key: 'password',
value: ieee8021xSetting.password || '', password: true }); value: ieee8021xSetting.password || '', password: true });
} if (this._hints.includes('private-key-password'))
if (this._hints.includes('private-key-password')) {
secrets.push({ label: _("Private key password: "), key: 'private-key-password', secrets.push({ label: _("Private key password: "), key: 'private-key-password',
value: ieee8021xSetting.private_key_password || '', password: true }); value: ieee8021xSetting.private_key_password || '', password: true });
}
return; return;
} }
@@ -557,7 +556,7 @@ var VPNRequestHandler = class {
contentOverride.secrets.push({ contentOverride.secrets.push({
label: keyfile.get_string(groups[i], 'Label'), label: keyfile.get_string(groups[i], 'Label'),
key: groups[i], key: groups[i],
value, value: value,
password: keyfile.get_boolean(groups[i], 'IsSecret'), password: keyfile.get_boolean(groups[i], 'IsSecret'),
}); });
} else { } else {

View File

@@ -11,19 +11,12 @@ const ModalDialog = imports.ui.modalDialog;
const ShellEntry = imports.ui.shellEntry; const ShellEntry = imports.ui.shellEntry;
const UserWidget = imports.ui.userWidget; const UserWidget = imports.ui.userWidget;
const DialogMode = {
AUTH: 0,
CONFIRM: 1,
};
var DIALOG_ICON_SIZE = 48; var DIALOG_ICON_SIZE = 48;
var WORK_SPINNER_ICON_SIZE = 16; var WORK_SPINNER_ICON_SIZE = 16;
const DELAYED_RESET_TIMEOUT = 200;
var AuthenticationDialog = GObject.registerClass({ var AuthenticationDialog = GObject.registerClass({
Signals: { 'done': { param_types: [GObject.TYPE_BOOLEAN] } }, Signals: { 'done': { param_types: [GObject.TYPE_BOOLEAN] } }
}, class AuthenticationDialog extends ModalDialog.ModalDialog { }, class AuthenticationDialog extends ModalDialog.ModalDialog {
_init(actionId, body, cookie, userNames) { _init(actionId, body, cookie, userNames) {
super._init({ styleClass: 'prompt-dialog' }); super._init({ styleClass: 'prompt-dialog' });
@@ -31,6 +24,7 @@ var AuthenticationDialog = GObject.registerClass({
this.actionId = actionId; this.actionId = actionId;
this.message = body; this.message = body;
this.userNames = userNames; this.userNames = userNames;
this._wasDismissed = false;
this._sessionUpdatedId = Main.sessionMode.connect('updated', () => { this._sessionUpdatedId = Main.sessionMode.connect('updated', () => {
this.visible = !Main.sessionMode.isLocked; this.visible = !Main.sessionMode.isLocked;
@@ -57,63 +51,70 @@ var AuthenticationDialog = GObject.registerClass({
userName = userNames[0]; userName = userNames[0];
this._user = AccountsService.UserManager.get_default().get_user(userName); this._user = AccountsService.UserManager.get_default().get_user(userName);
let userRealName = this._user.get_real_name();
this._userLoadedId = this._user.connect('notify::is_loaded',
this._onUserChanged.bind(this));
this._userChangedId = this._user.connect('changed',
this._onUserChanged.bind(this));
let userBox = new St.BoxLayout({ // Special case 'root'
style_class: 'polkit-dialog-user-layout', let userIsRoot = false;
vertical: false, if (userName == 'root') {
}); userIsRoot = true;
content.messageBox.add(userBox); userRealName = _("Administrator");
}
this._userAvatar = new UserWidget.Avatar(this._user, { if (userIsRoot) {
iconSize: DIALOG_ICON_SIZE, let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-root-label',
styleClass: 'polkit-dialog-user-icon', text: userRealName }));
}); content.messageBox.add(userLabel, { x_fill: false,
userBox.add_child(this._userAvatar); x_align: St.Align.START });
} else {
let userBox = new St.BoxLayout({ style_class: 'polkit-dialog-user-layout',
vertical: false });
content.messageBox.add(userBox);
this._userAvatar = new UserWidget.Avatar(this._user,
{ iconSize: DIALOG_ICON_SIZE,
styleClass: 'polkit-dialog-user-icon' });
this._userAvatar.hide();
userBox.add(this._userAvatar,
{ x_fill: true,
y_fill: false,
x_align: St.Align.END,
y_align: St.Align.START });
let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label',
text: userRealName }));
userBox.add(userLabel,
{ x_fill: true,
y_fill: false,
x_align: St.Align.END,
y_align: St.Align.MIDDLE });
}
this._userLabel = new St.Label({ this._onUserChanged();
style_class: userName === 'root'
? 'polkit-dialog-user-root-label'
: 'polkit-dialog-user-label',
x_expand: true,
y_align: Clutter.ActorAlign.CENTER,
});
if (userName === 'root')
this._userLabel.text = _('Administrator');
userBox.add_child(this._userLabel);
this._passwordBox = new St.BoxLayout({ vertical: false, style_class: 'prompt-dialog-password-box' }); this._passwordBox = new St.BoxLayout({ vertical: false, style_class: 'prompt-dialog-password-box' });
content.messageBox.add(this._passwordBox); content.messageBox.add(this._passwordBox);
this._passwordLabel = new St.Label({ this._passwordLabel = new St.Label(({ style_class: 'prompt-dialog-password-label' }));
style_class: 'prompt-dialog-password-label', this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE });
y_align: Clutter.ActorAlign.CENTER, this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
}); text: "",
this._passwordBox.add_child(this._passwordLabel); can_focus: true });
this._passwordEntry = new St.Entry({
style_class: 'prompt-dialog-password-entry',
text: "",
can_focus: true,
x_expand: true,
});
ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true }); ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this)); this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this));
this._passwordEntry.bind_property('reactive', this._passwordBox.add(this._passwordEntry,
this._passwordEntry.clutter_text, 'editable', { expand: true });
GObject.BindingFlags.SYNC_CREATE);
this._passwordBox.add_child(this._passwordEntry);
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, { this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
animate: true,
});
this._passwordBox.add(this._workSpinner); this._passwordBox.add(this._workSpinner);
this.setInitialKeyFocus(this._passwordEntry);
this._passwordBox.hide(); this._passwordBox.hide();
this._errorMessageLabel = new St.Label({ style_class: 'prompt-dialog-error-label' }); this._errorMessageLabel = new St.Label({ style_class: 'prompt-dialog-error-label' });
this._errorMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; this._errorMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
this._errorMessageLabel.clutter_text.line_wrap = true; this._errorMessageLabel.clutter_text.line_wrap = true;
content.messageBox.add_child(this._errorMessageLabel); content.messageBox.add(this._errorMessageLabel, { x_fill: false, x_align: St.Align.START });
this._errorMessageLabel.hide(); this._errorMessageLabel.hide();
this._infoMessageLabel = new St.Label({ style_class: 'prompt-dialog-info-label' }); this._infoMessageLabel = new St.Label({ style_class: 'prompt-dialog-info-label' });
@@ -136,30 +137,15 @@ var AuthenticationDialog = GObject.registerClass({
this._cancelButton = this.addButton({ label: _("Cancel"), this._cancelButton = this.addButton({ label: _("Cancel"),
action: this.cancel.bind(this), action: this.cancel.bind(this),
key: Clutter.KEY_Escape }); key: Clutter.Escape });
this._okButton = this.addButton({ label: _("Authenticate"), this._okButton = this.addButton({ label: _("Authenticate"),
action: this._onAuthenticateButtonPressed.bind(this), action: this._onAuthenticateButtonPressed.bind(this),
reactive: false }); default: true });
this._okButton.bind_property('reactive',
this._okButton, 'can-focus',
GObject.BindingFlags.SYNC_CREATE);
this._passwordEntry.clutter_text.connect('text-changed', text => {
this._okButton.reactive = text.get_text().length > 0;
});
this._doneEmitted = false; this._doneEmitted = false;
this._mode = -1;
this._identityToAuth = Polkit.UnixUser.new_for_name(userName); this._identityToAuth = Polkit.UnixUser.new_for_name(userName);
this._cookie = cookie; this._cookie = cookie;
this._userLoadedId = this._user.connect('notify::is-loaded',
this._onUserChanged.bind(this));
this._userChangedId = this._user.connect('changed',
this._onUserChanged.bind(this));
this._onUserChanged();
} }
_setWorking(working) { _setWorking(working) {
@@ -169,9 +155,8 @@ var AuthenticationDialog = GObject.registerClass({
this._workSpinner.stop(); this._workSpinner.stop();
} }
_initiateSession() { performAuthentication() {
this._destroySession(DELAYED_RESET_TIMEOUT); this._destroySession();
this._session = new PolkitAgent.Session({ identity: this._identityToAuth, this._session = new PolkitAgent.Session({ identity: this._identityToAuth,
cookie: this._cookie }); cookie: this._cookie });
this._sessionCompletedId = this._session.connect('completed', this._onSessionCompleted.bind(this)); this._sessionCompletedId = this._session.connect('completed', this._onSessionCompleted.bind(this));
@@ -210,15 +195,18 @@ var AuthenticationDialog = GObject.registerClass({
} }
} }
_updateSensitivity(sensitive) {
this._passwordEntry.reactive = sensitive;
this._passwordEntry.clutter_text.editable = sensitive;
this._okButton.can_focus = sensitive;
this._okButton.reactive = sensitive;
this._setWorking(!sensitive);
}
_onEntryActivate() { _onEntryActivate() {
let response = this._passwordEntry.get_text(); let response = this._passwordEntry.get_text();
if (response.length === 0) this._updateSensitivity(false);
return;
this._passwordEntry.reactive = false;
this._okButton.reactive = false;
this._setWorking(true);
this._session.response(response); this._session.response(response);
// When the user responds, dismiss already shown info and // When the user responds, dismiss already shown info and
// error texts (if any) // error texts (if any)
@@ -228,10 +216,7 @@ var AuthenticationDialog = GObject.registerClass({
} }
_onAuthenticateButtonPressed() { _onAuthenticateButtonPressed() {
if (this._mode === DialogMode.CONFIRM) this._onEntryActivate();
this._initiateSession();
else
this._onEntryActivate();
} }
_onSessionCompleted(session, gainedAuthorization) { _onSessionCompleted(session, gainedAuthorization) {
@@ -250,7 +235,7 @@ var AuthenticationDialog = GObject.registerClass({
* error providing authentication-method specific information), * error providing authentication-method specific information),
* show "Sorry, that didn't work. Please try again." * show "Sorry, that didn't work. Please try again."
*/ */
if (!this._errorMessageLabel.visible) { if (!this._errorMessageLabel.visible && !this._wasDismissed) {
/* Translators: "that didn't work" refers to the fact that the /* Translators: "that didn't work" refers to the fact that the
* requested authentication was not gained; this can happen * requested authentication was not gained; this can happen
* because of an authentication error (like invalid password), * because of an authentication error (like invalid password),
@@ -262,16 +247,11 @@ var AuthenticationDialog = GObject.registerClass({
} }
/* Try and authenticate again */ /* Try and authenticate again */
this._initiateSession(); this.performAuthentication();
} }
} }
_onSessionRequest(session, request, echoOn) { _onSessionRequest(session, request, echoOn) {
if (this._sessionRequestTimeoutId) {
GLib.source_remove(this._sessionRequestTimeoutId);
this._sessionRequestTimeoutId = 0;
}
// Cheap localization trick // Cheap localization trick
if (request == 'Password:' || request == 'Password: ') if (request == 'Password:' || request == 'Password: ')
this._passwordLabel.set_text(_("Password:")); this._passwordLabel.set_text(_("Password:"));
@@ -285,12 +265,9 @@ var AuthenticationDialog = GObject.registerClass({
this._passwordBox.show(); this._passwordBox.show();
this._passwordEntry.set_text(''); this._passwordEntry.set_text('');
this._passwordEntry.reactive = true;
this._okButton.reactive = false;
this._setWorking(false);
this._ensureOpen();
this._passwordEntry.grab_key_focus(); this._passwordEntry.grab_key_focus();
this._updateSensitivity(true);
this._ensureOpen();
} }
_onSessionShowError(session, text) { _onSessionShowError(session, text) {
@@ -311,78 +288,29 @@ var AuthenticationDialog = GObject.registerClass({
this._ensureOpen(); this._ensureOpen();
} }
_destroySession(delay = 0) { _destroySession() {
if (this._session) { if (this._session) {
if (!this._completed)
this._session.cancel();
this._completed = false;
this._session.disconnect(this._sessionCompletedId); this._session.disconnect(this._sessionCompletedId);
this._session.disconnect(this._sessionRequestId); this._session.disconnect(this._sessionRequestId);
this._session.disconnect(this._sessionShowErrorId); this._session.disconnect(this._sessionShowErrorId);
this._session.disconnect(this._sessionShowInfoId); this._session.disconnect(this._sessionShowInfoId);
if (!this._completed)
this._session.cancel();
this._completed = false;
this._session = null; this._session = null;
} }
if (this._sessionRequestTimeoutId) {
GLib.source_remove(this._sessionRequestTimeoutId);
this._sessionRequestTimeoutId = 0;
}
let resetDialog = () => {
if (this.state != ModalDialog.State.OPENED)
return;
this._passwordBox.hide();
this._cancelButton.grab_key_focus();
this._okButton.reactive = false;
};
if (delay) {
this._sessionRequestTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, delay, resetDialog);
GLib.Source.set_name_by_id(this._sessionRequestTimeoutId, '[gnome-shell] this._sessionRequestTimeoutId');
} else {
resetDialog();
}
} }
_onUserChanged() { _onUserChanged() {
if (!this._user.is_loaded) if (this._user.is_loaded && this._userAvatar) {
return; this._userAvatar.update();
this._userAvatar.show();
let userName = this._user.get_user_name();
let realName = this._user.get_real_name();
if (userName !== 'root')
this._userLabel.set_text(realName);
this._userAvatar.update();
if (this._user.get_password_mode() === AccountsService.UserPasswordMode.NONE) {
if (this._mode === DialogMode.CONFIRM)
return;
this._mode = DialogMode.CONFIRM;
this._destroySession();
this._okButton.reactive = true;
/* We normally open the dialog when we get a "request" signal, but
* since in this case initiating a session would perform the
* authentication, only open the dialog and initiate the session
* when the user confirmed. */
this._ensureOpen();
} else {
if (this._mode === DialogMode.AUTH)
return;
this._mode = DialogMode.AUTH;
this._initiateSession();
} }
} }
cancel() { cancel() {
this._wasDismissed = true;
this.close(global.get_current_time()); this.close(global.get_current_time());
this._emitDone(true); this._emitDone(true);
} }
@@ -390,10 +318,7 @@ var AuthenticationDialog = GObject.registerClass({
_onDialogClosed() { _onDialogClosed() {
if (this._sessionUpdatedId) if (this._sessionUpdatedId)
Main.sessionMode.disconnect(this._sessionUpdatedId); Main.sessionMode.disconnect(this._sessionUpdatedId);
this._sessionUpdatedId = 0;
if (this._sessionRequestTimeoutId)
GLib.source_remove(this._sessionRequestTimeoutId);
this._sessionRequestTimeoutId = 0;
if (this._user) { if (this._user) {
this._user.disconnect(this._userLoadedId); this._user.disconnect(this._userLoadedId);
@@ -405,20 +330,19 @@ var AuthenticationDialog = GObject.registerClass({
} }
}); });
var AuthenticationAgent = GObject.registerClass( var AuthenticationAgent = class {
class AuthenticationAgent extends Shell.PolkitAuthenticationAgent { constructor() {
_init() {
super._init();
this._currentDialog = null; this._currentDialog = null;
this.connect('initiate', this._onInitiate.bind(this)); this._handle = null;
this.connect('cancel', this._onCancel.bind(this)); this._native = new Shell.PolkitAuthenticationAgent();
this._native.connect('initiate', this._onInitiate.bind(this));
this._native.connect('cancel', this._onCancel.bind(this));
this._sessionUpdatedId = 0; this._sessionUpdatedId = 0;
} }
enable() { enable() {
try { try {
this.register(); this._native.register();
} catch (e) { } catch (e) {
log('Failed to register AuthenticationAgent'); log('Failed to register AuthenticationAgent');
} }
@@ -426,7 +350,7 @@ class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {
disable() { disable() {
try { try {
this.unregister(); this._native.unregister();
} catch (e) { } catch (e) {
log('Failed to unregister AuthenticationAgent'); log('Failed to unregister AuthenticationAgent');
} }
@@ -445,7 +369,19 @@ class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {
} }
this._currentDialog = new AuthenticationDialog(actionId, message, cookie, userNames); this._currentDialog = new AuthenticationDialog(actionId, message, cookie, userNames);
// We actually don't want to open the dialog until we know for
// sure that we're going to interact with the user. For
// example, if the password for the identity to auth is blank
// (which it will be on a live CD) then there will be no
// conversation at all... of course, we don't *know* that
// until we actually try it.
//
// See https://bugzilla.gnome.org/show_bug.cgi?id=643062 for more
// discussion.
this._currentDialog.connect('done', this._onDialogDone.bind(this)); this._currentDialog.connect('done', this._onDialogDone.bind(this));
this._currentDialog.performAuthentication();
} }
_onCancel(_nativeAgent) { _onCancel(_nativeAgent) {
@@ -464,8 +400,8 @@ class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {
Main.sessionMode.disconnect(this._sessionUpdatedId); Main.sessionMode.disconnect(this._sessionUpdatedId);
this._sessionUpdatedId = 0; this._sessionUpdatedId = 0;
this.complete(dismissed); this._native.complete(dismissed);
} }
}); };
var Component = AuthenticationAgent; var Component = AuthenticationAgent;

View File

@@ -19,7 +19,7 @@ const MessageTray = imports.ui.messageTray;
const Params = imports.misc.params; const Params = imports.misc.params;
const Util = imports.misc.util; const Util = imports.misc.util;
const HAVE_TP = Tp != null && Tpl != null; const HAVE_TP = (Tp != null && Tpl != null);
// See Notification.appendMessage // See Notification.appendMessage
var SCROLLBACK_IMMEDIATE_TIME = 3 * 60; // 3 minutes var SCROLLBACK_IMMEDIATE_TIME = 3 * 60; // 3 minutes
@@ -37,7 +37,7 @@ var CHAT_EXPAND_LINES = 12;
var NotificationDirection = { var NotificationDirection = {
SENT: 'chat-sent', SENT: 'chat-sent',
RECEIVED: 'chat-received', RECEIVED: 'chat-received'
}; };
function makeMessageFromTpMessage(tpMessage, direction) { function makeMessageFromTpMessage(tpMessage, direction) {
@@ -49,10 +49,10 @@ function makeMessageFromTpMessage(tpMessage, direction) {
return { return {
messageType: tpMessage.get_message_type(), messageType: tpMessage.get_message_type(),
text, text: text,
sender: tpMessage.sender.alias, sender: tpMessage.sender.alias,
timestamp, timestamp: timestamp,
direction, direction: direction
}; };
} }
@@ -66,7 +66,7 @@ function makeMessageFromTplEvent(event) {
text: event.get_message(), text: event.get_message(),
sender: event.get_sender().get_alias(), sender: event.get_sender().get_alias(),
timestamp: event.get_timestamp(), timestamp: event.get_timestamp(),
direction, direction: direction
}; };
} }
@@ -158,7 +158,7 @@ class TelepathyClient extends Tp.BaseClient {
continue; continue;
/* Only observe contact text channels */ /* Only observe contact text channels */
if (!(channel instanceof Tp.TextChannel) || if ((!(channel instanceof Tp.TextChannel)) ||
targetHandleType != Tp.HandleType.CONTACT) targetHandleType != Tp.HandleType.CONTACT)
continue; continue;
@@ -231,12 +231,11 @@ class TelepathyClient extends Tp.BaseClient {
return; return;
} }
if (chanType == Tp.IFACE_CHANNEL_TYPE_TEXT) { if (chanType == Tp.IFACE_CHANNEL_TYPE_TEXT)
this._approveTextChannel(account, conn, channel, dispatchOp, context); this._approveTextChannel(account, conn, channel, dispatchOp, context);
} else { else
context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT, context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
message: 'Unsupported channel type' })); message: 'Unsupported channel type' }));
}
} }
_approveTextChannel(account, conn, channel, dispatchOp, context) { _approveTextChannel(account, conn, channel, dispatchOp, context) {
@@ -249,7 +248,7 @@ class TelepathyClient extends Tp.BaseClient {
} }
// Approve private text channels right away as we are going to handle it // Approve private text channels right away as we are going to handle it
dispatchOp.claim_with_async(this, (o, result) => { dispatchOp.claim_with_async(this, (dispatchOp, result) => {
try { try {
dispatchOp.claim_with_finish(result); dispatchOp.claim_with_finish(result);
this._handlingChannels(account, conn, [channel], false); this._handlingChannels(account, conn, [channel], false);
@@ -350,10 +349,11 @@ class ChatSource extends MessageTray.Source {
getIcon() { getIcon() {
let file = this._contact.get_avatar_file(); let file = this._contact.get_avatar_file();
if (file) if (file) {
return new Gio.FileIcon({ file }); return new Gio.FileIcon({ file: file });
else } else {
return new Gio.ThemedIcon({ name: 'avatar-default' }); return new Gio.ThemedIcon({ name: 'avatar-default' });
}
} }
getSecondaryIcon() { getSecondaryIcon() {
@@ -387,11 +387,10 @@ class ChatSource extends MessageTray.Source {
_updateAvatarIcon() { _updateAvatarIcon() {
this.iconUpdated(); this.iconUpdated();
if (this._notifiction) { if (this._notifiction)
this._notification.update(this._notification.title, this._notification.update(this._notification.title,
this._notification.bannerBodyText, this._notification.bannerBodyText,
{ gicon: this.getIcon() }); { gicon: this.getIcon() });
}
} }
open() { open() {
@@ -603,11 +602,10 @@ class ChatSource extends MessageTray.Source {
} }
_presenceChanged(_contact, _presence, _status, _message) { _presenceChanged(_contact, _presence, _status, _message) {
if (this._notification) { if (this._notification)
this._notification.update(this._notification.title, this._notification.update(this._notification.title,
this._notification.bannerBodyText, this._notification.bannerBodyText,
{ secondaryGIcon: this.getSecondaryIcon() }); { secondaryGIcon: this.getSecondaryIcon() });
}
} }
_pendingRemoved(channel, message) { _pendingRemoved(channel, message) {
@@ -635,7 +633,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
'message-removed': { param_types: [Tp.Message.$gtype] }, 'message-removed': { param_types: [Tp.Message.$gtype] },
'message-added': { param_types: [Tp.Message.$gtype] }, 'message-added': { param_types: [Tp.Message.$gtype] },
'timestamp-changed': { param_types: [Tp.Message.$gtype] }, 'timestamp-changed': { param_types: [Tp.Message.$gtype] },
}, }
}, class ChatNotification extends MessageTray.Notification { }, class ChatNotification extends MessageTray.Notification {
_init(source) { _init(source) {
super._init(source, source.title, null, super._init(source, source.title, null,
@@ -656,16 +654,16 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
/** /**
* appendMessage: * appendMessage:
* @param {Object} message: An object with the properties * @message: An object with the properties:
* {string} message.text: the body of the message, * text: the body of the message,
* {Tp.ChannelTextMessageType} message.messageType: the type * messageType: a #Tp.ChannelTextMessageType,
* {string} message.sender: the name of the sender, * sender: the name of the sender,
* {number} message.timestamp: the time the message was sent * timestamp: the time the message was sent
* {NotificationDirection} message.direction: a #NotificationDirection * direction: a #NotificationDirection
* *
* @param {bool} noTimestamp: Whether to add a timestamp. If %true, * @noTimestamp: Whether to add a timestamp. If %true, no timestamp
* no timestamp will be added, regardless of the difference since * will be added, regardless of the difference since the
* the last timestamp * last timestamp
*/ */
appendMessage(message, noTimestamp) { appendMessage(message, noTimestamp) {
let messageBody = GLib.markup_escape_text(message.text, -1); let messageBody = GLib.markup_escape_text(message.text, -1);
@@ -677,20 +675,19 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
styles.push('chat-action'); styles.push('chat-action');
} }
if (message.direction == NotificationDirection.RECEIVED) { if (message.direction == NotificationDirection.RECEIVED)
this.update(this.source.title, messageBody, this.update(this.source.title, messageBody,
{ datetime: GLib.DateTime.new_from_unix_local(message.timestamp), { datetime: GLib.DateTime.new_from_unix_local (message.timestamp),
bannerMarkup: true }); bannerMarkup: true });
}
let group = message.direction == NotificationDirection.RECEIVED let group = (message.direction == NotificationDirection.RECEIVED
? 'received' : 'sent'; ? 'received' : 'sent');
this._append({ body: messageBody, this._append({ body: messageBody,
group, group: group,
styles, styles: styles,
timestamp: message.timestamp, timestamp: message.timestamp,
noTimestamp }); noTimestamp: noTimestamp });
} }
_filterMessages() { _filterMessages() {
@@ -698,7 +695,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
return; return;
let lastMessageTime = this.messages[0].timestamp; let lastMessageTime = this.messages[0].timestamp;
let currentTime = Date.now() / 1000; let currentTime = (Date.now() / 1000);
// Keep the scrollback from growing too long. If the most // Keep the scrollback from growing too long. If the most
// recent message (before the one we just added) is within // recent message (before the one we just added) is within
@@ -706,7 +703,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
// SCROLLBACK_RECENT_LENGTH previous messages. Otherwise // SCROLLBACK_RECENT_LENGTH previous messages. Otherwise
// we'll keep SCROLLBACK_IDLE_LENGTH messages. // we'll keep SCROLLBACK_IDLE_LENGTH messages.
let maxLength = lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME)
? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH; ? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
let filteredHistory = this.messages.filter(item => item.realMessage); let filteredHistory = this.messages.filter(item => item.realMessage);
@@ -720,16 +717,16 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({
/** /**
* _append: * _append:
* @param {Object} props: An object with the properties: * @props: An object with the properties:
* {string} props.body: The text of the message. * body: The text of the message.
* {string} props.group: The group of the message, one of: * group: The group of the message, one of:
* 'received', 'sent', 'meta'. * 'received', 'sent', 'meta'.
* {string[]} props.styles: Style class names for the message to have. * styles: Style class names for the message to have.
* {number} props.timestamp: The timestamp of the message. * timestamp: The timestamp of the message.
* {bool} props.noTimestamp: suppress timestamp signal? * noTimestamp: suppress timestamp signal?
*/ */
_append(props) { _append(props) {
let currentTime = Date.now() / 1000; let currentTime = (Date.now() / 1000);
props = Params.parse(props, { body: null, props = Params.parse(props, { body: null,
group: null, group: null,
styles: [], styles: [],

View File

@@ -12,7 +12,7 @@ var POPUP_APPICON_SIZE = 96;
var SortGroup = { var SortGroup = {
TOP: 0, TOP: 0,
MIDDLE: 1, MIDDLE: 1,
BOTTOM: 2, BOTTOM: 2
}; };
var CtrlAltTabManager = class CtrlAltTabManager { var CtrlAltTabManager = class CtrlAltTabManager {
@@ -86,26 +86,25 @@ var CtrlAltTabManager = class CtrlAltTabManager {
for (let i = 0; i < windows.length; i++) { for (let i = 0; i < windows.length; i++) {
let icon = null; let icon = null;
let iconName = null; let iconName = null;
if (windows[i].get_window_type() == Meta.WindowType.DESKTOP) { if (windows[i].get_window_type () == Meta.WindowType.DESKTOP) {
iconName = 'video-display-symbolic'; iconName = 'video-display-symbolic';
} else { } else {
let app = windowTracker.get_window_app(windows[i]); let app = windowTracker.get_window_app(windows[i]);
if (app) { if (app)
icon = app.create_icon_texture(POPUP_APPICON_SIZE); icon = app.create_icon_texture(POPUP_APPICON_SIZE);
} else { else
icon = textureCache.bind_cairo_surface_property(windows[i], icon = textureCache.bind_cairo_surface_property(windows[i],
'icon', 'icon',
POPUP_APPICON_SIZE); POPUP_APPICON_SIZE);
}
} }
items.push({ name: windows[i].title, items.push({ name: windows[i].title,
proxy: windows[i].get_compositor_private(), proxy: windows[i].get_compositor_private(),
focusCallback: timestamp => { focusCallback: function(timestamp) {
Main.activateWindow(windows[i], timestamp); Main.activateWindow(this, timestamp);
}, }.bind(windows[i]),
iconActor: icon, iconActor: icon,
iconName, iconName: iconName,
sortGroup: SortGroup.MIDDLE }); sortGroup: SortGroup.MIDDLE });
} }
} }
@@ -144,9 +143,9 @@ class CtrlAltTabPopup extends SwitcherPopup.SwitcherPopup {
this._select(this._next()); this._select(this._next());
else if (action == Meta.KeyBindingAction.SWITCH_PANELS_BACKWARD) else if (action == Meta.KeyBindingAction.SWITCH_PANELS_BACKWARD)
this._select(this._previous()); this._select(this._previous());
else if (keysym == Clutter.KEY_Left) else if (keysym == Clutter.Left)
this._select(this._previous()); this._select(this._previous());
else if (keysym == Clutter.KEY_Right) else if (keysym == Clutter.Right)
this._select(this._next()); this._select(this._next());
else else
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
@@ -178,13 +177,10 @@ class CtrlAltTabSwitcher extends SwitcherPopup.SwitcherList {
icon = new St.Icon({ icon_name: item.iconName, icon = new St.Icon({ icon_name: item.iconName,
icon_size: POPUP_APPICON_SIZE }); icon_size: POPUP_APPICON_SIZE });
} }
box.add_child(icon); box.add(icon, { x_fill: false, y_fill: false } );
let text = new St.Label({ let text = new St.Label({ text: item.name });
text: item.name, box.add(text, { x_fill: false });
x_align: Clutter.ActorAlign.CENTER,
});
box.add_child(text);
this.addItem(box, text); this.addItem(box, text);
} }

View File

@@ -16,10 +16,11 @@ var DASH_ITEM_LABEL_HIDE_TIME = 100;
var DASH_ITEM_HOVER_TIMEOUT = 300; var DASH_ITEM_HOVER_TIMEOUT = 300;
function getAppFromSource(source) { function getAppFromSource(source) {
if (source instanceof AppDisplay.AppIcon) if (source instanceof AppDisplay.AppIcon) {
return source.app; return source.app;
else } else {
return null; return null;
}
} }
var DashIcon = GObject.registerClass( var DashIcon = GObject.registerClass(
@@ -27,7 +28,7 @@ class DashIcon extends AppDisplay.AppIcon {
_init(app) { _init(app) {
super._init(app, { super._init(app, {
setSizeManually: true, setSizeManually: true,
showLabel: false, showLabel: false
}); });
} }
@@ -125,7 +126,7 @@ class DashItemContainer extends St.Widget {
this.label.ease({ this.label.ease({
opacity: 255, opacity: 255,
duration: DASH_ITEM_LABEL_SHOW_TIME, duration: DASH_ITEM_LABEL_SHOW_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
@@ -139,7 +140,7 @@ class DashItemContainer extends St.Widget {
opacity: 0, opacity: 0,
duration: DASH_ITEM_LABEL_HIDE_TIME, duration: DASH_ITEM_LABEL_HIDE_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this.label.hide(), onComplete: () => this.label.hide()
}); });
} }
@@ -163,7 +164,7 @@ class DashItemContainer extends St.Widget {
scale_y: 1, scale_y: 1,
opacity: 255, opacity: 255,
duration: time, duration: time,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
@@ -182,7 +183,7 @@ class DashItemContainer extends St.Widget {
opacity: 0, opacity: 0,
duration: DASH_ANIMATION_TIME, duration: DASH_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this.destroy(), onComplete: () => this.destroy()
}); });
} }
}); });
@@ -284,12 +285,9 @@ var DashActor = GObject.registerClass(
class DashActor extends St.Widget { class DashActor extends St.Widget {
_init() { _init() {
let layout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.VERTICAL }); let layout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.VERTICAL });
super._init({ super._init({ name: 'dash',
name: 'dash', layout_manager: layout,
layout_manager: layout, clip_to_allocation: true });
clip_to_allocation: true,
y_align: Clutter.ActorAlign.CENTER,
});
} }
vfunc_allocate(box, flags) { vfunc_allocate(box, flags) {
@@ -334,7 +332,7 @@ class DashActor extends St.Widget {
const baseIconSizes = [16, 22, 24, 32, 48, 64]; const baseIconSizes = [16, 22, 24, 32, 48, 64];
var Dash = GObject.registerClass({ var Dash = GObject.registerClass({
Signals: { 'icon-size-changed': {} }, Signals: { 'icon-size-changed': {} }
}, class Dash extends St.Bin { }, class Dash extends St.Bin {
_init() { _init() {
this._maxHeight = -1; this._maxHeight = -1;
@@ -397,7 +395,7 @@ var Dash = GObject.registerClass({
_onDragBegin() { _onDragBegin() {
this._dragCancelled = false; this._dragCancelled = false;
this._dragMonitor = { this._dragMonitor = {
dragMotion: this._onDragMotion.bind(this), dragMotion: this._onDragMotion.bind(this)
}; };
DND.addDragMonitor(this._dragMonitor); DND.addDragMonitor(this._dragMonitor);
@@ -481,7 +479,7 @@ var Dash = GObject.registerClass({
let appIcon = new DashIcon(app); let appIcon = new DashIcon(app);
appIcon.connect('menu-state-changed', appIcon.connect('menu-state-changed',
(o, opened) => { (appIcon, opened) => {
this._itemMenuStateChanged(item, opened); this._itemMenuStateChanged(item, opened);
}); });
@@ -629,7 +627,7 @@ var Dash = GObject.registerClass({
width: targetWidth, width: targetWidth,
height: targetHeight, height: targetHeight,
duration: DASH_ANIMATION_TIME, duration: DASH_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
} }
@@ -728,10 +726,9 @@ var Dash = GObject.registerClass({
} }
} }
for (let i = 0; i < addedItems.length; i++) { for (let i = 0; i < addedItems.length; i++)
this._box.insert_child_at_index(addedItems[i].item, this._box.insert_child_at_index(addedItems[i].item,
addedItems[i].pos); addedItems[i].pos);
}
for (let i = 0; i < removedActors.length; i++) { for (let i = 0; i < removedActors.length; i++) {
let item = removedActors[i]; let item = removedActors[i];
@@ -755,8 +752,9 @@ var Dash = GObject.registerClass({
if (!this._shownInitially) if (!this._shownInitially)
this._shownInitially = true; this._shownInitially = true;
for (let i = 0; i < addedItems.length; i++) for (let i = 0; i < addedItems.length; i++) {
addedItems[i].item.show(animate); addedItems[i].item.show(animate);
}
// Workaround for https://bugzilla.gnome.org/show_bug.cgi?id=692744 // Workaround for https://bugzilla.gnome.org/show_bug.cgi?id=692744
// Without it, StBoxLayout may use a stale size cache // Without it, StBoxLayout may use a stale size cache
@@ -836,8 +834,8 @@ var Dash = GObject.registerClass({
} }
this._dragPlaceholder = new DragPlaceholderItem(); this._dragPlaceholder = new DragPlaceholderItem();
this._dragPlaceholder.child.set_width(this.iconSize); this._dragPlaceholder.child.set_width (this.iconSize);
this._dragPlaceholder.child.set_height(this.iconSize / 2); this._dragPlaceholder.child.set_height (this.iconSize / 2);
this._box.insert_child_at_index(this._dragPlaceholder, this._box.insert_child_at_index(this._dragPlaceholder,
this._dragPlaceholderPos); this._dragPlaceholderPos);
this._dragPlaceholder.show(fadeIn); this._dragPlaceholder.show(fadeIn);
@@ -851,7 +849,7 @@ var Dash = GObject.registerClass({
if (!this._dragPlaceholder) if (!this._dragPlaceholder)
return DND.DragMotionResult.NO_DROP; return DND.DragMotionResult.NO_DROP;
let srcIsFavorite = favPos != -1; let srcIsFavorite = (favPos != -1);
if (srcIsFavorite) if (srcIsFavorite)
return DND.DragMotionResult.MOVE_DROP; return DND.DragMotionResult.MOVE_DROP;
@@ -864,8 +862,9 @@ var Dash = GObject.registerClass({
let app = getAppFromSource(source); let app = getAppFromSource(source);
// Don't allow favoriting of transient apps // Don't allow favoriting of transient apps
if (app == null || app.is_window_backed()) if (app == null || app.is_window_backed()) {
return false; return false;
}
if (!global.settings.is_writable('favorite-apps')) if (!global.settings.is_writable('favorite-apps'))
return false; return false;
@@ -874,7 +873,7 @@ var Dash = GObject.registerClass({
let favorites = AppFavorites.getAppFavorites().getFavoriteMap(); let favorites = AppFavorites.getAppFavorites().getFavoriteMap();
let srcIsFavorite = id in favorites; let srcIsFavorite = (id in favorites);
let favPos = 0; let favPos = 0;
let children = this._box.get_children(); let children = this._box.get_children();

View File

@@ -2,7 +2,7 @@
/* exported DateMenuButton */ /* exported DateMenuButton */
const { Clutter, Gio, GLib, GnomeDesktop, const { Clutter, Gio, GLib, GnomeDesktop,
GObject, GWeather, Pango, Shell, St } = imports.gi; GObject, GWeather, Shell, St } = imports.gi;
const Util = imports.misc.util; const Util = imports.misc.util;
const Main = imports.ui.main; const Main = imports.ui.main;
@@ -37,9 +37,10 @@ class TodayButton extends St.Button {
// until the selected date changes. // until the selected date changes.
super._init({ super._init({
style_class: 'datemenu-today-button', style_class: 'datemenu-today-button',
x_align: St.Align.START,
x_expand: true, x_expand: true,
can_focus: true, can_focus: true,
reactive: false, reactive: false
}); });
let hbox = new St.BoxLayout({ vertical: true }); let hbox = new St.BoxLayout({ vertical: true });
@@ -72,14 +73,14 @@ class TodayButton extends St.Button {
* "Tue 9:29 AM"). The string itself should become a full date, e.g., * "Tue 9:29 AM"). The string itself should become a full date, e.g.,
* "February 17 2015". * "February 17 2015".
*/ */
let dateFormat = Shell.util_translate_time_string(N_("%B %-d %Y")); let dateFormat = Shell.util_translate_time_string (N_("%B %-d %Y"));
this._dateLabel.set_text(date.toLocaleFormat(dateFormat)); this._dateLabel.set_text(date.toLocaleFormat(dateFormat));
/* Translators: This is the accessible name of the date button shown /* Translators: This is the accessible name of the date button shown
* below the time in the shell; it should combine the weekday and the * below the time in the shell; it should combine the weekday and the
* date, e.g. "Tuesday February 17 2015". * date, e.g. "Tuesday February 17 2015".
*/ */
dateFormat = Shell.util_translate_time_string(N_("%A %B %e %Y")); dateFormat = Shell.util_translate_time_string (N_("%A %B %e %Y"));
this.accessible_name = date.toLocaleFormat(dateFormat); this.accessible_name = date.toLocaleFormat(dateFormat);
} }
}); });
@@ -89,8 +90,8 @@ class WorldClocksSection extends St.Button {
_init() { _init() {
super._init({ super._init({
style_class: 'world-clocks-button', style_class: 'world-clocks-button',
can_focus: true, x_fill: true,
x_expand: true, can_focus: true
}); });
this._clock = new GnomeDesktop.WallClock(); this._clock = new GnomeDesktop.WallClock();
this._clockNotifyId = 0; this._clockNotifyId = 0;
@@ -99,7 +100,6 @@ class WorldClocksSection extends St.Button {
let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL }); let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
this._grid = new St.Widget({ style_class: 'world-clocks-grid', this._grid = new St.Widget({ style_class: 'world-clocks-grid',
x_expand: true,
layout_manager: layout }); layout_manager: layout });
layout.hookup_style(this._grid); layout.hookup_style(this._grid);
@@ -115,7 +115,7 @@ class WorldClocksSection extends St.Button {
Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES); Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
this._settings = new Gio.Settings({ this._settings = new Gio.Settings({
schema_id: 'org.gnome.shell.world-clocks', schema_id: 'org.gnome.shell.world-clocks'
}); });
this._settings.connect('changed', this._clocksChanged.bind(this)); this._settings.connect('changed', this._clocksChanged.bind(this));
this._clocksChanged(); this._clocksChanged();
@@ -157,7 +157,7 @@ class WorldClocksSection extends St.Button {
}); });
let layout = this._grid.layout_manager; let layout = this._grid.layout_manager;
let title = this._locations.length == 0 let title = (this._locations.length == 0)
? _("Add world clocks…") ? _("Add world clocks…")
: _("World Clocks"); : _("World Clocks");
let header = new St.Label({ style_class: 'world-clocks-header', let header = new St.Label({ style_class: 'world-clocks-header',
@@ -182,8 +182,8 @@ class WorldClocksSection extends St.Button {
let otherOffset = this._getTimeAtLocation(l).get_utc_offset(); let otherOffset = this._getTimeAtLocation(l).get_utc_offset();
let offset = (otherOffset - localOffset) / GLib.TIME_SPAN_HOUR; let offset = (otherOffset - localOffset) / GLib.TIME_SPAN_HOUR;
let fmt = Math.trunc(offset) == offset ? '%s%.0f' : '%s%.1f'; let fmt = (Math.trunc(offset) == offset) ? '%s%.0f' : '%s%.1f';
let prefix = offset >= 0 ? '+' : '-'; let prefix = (offset >= 0) ? '+' : '-';
let tz = new St.Label({ style_class: 'world-clocks-timezone', let tz = new St.Label({ style_class: 'world-clocks-timezone',
text: fmt.format(prefix, Math.abs(offset)), text: fmt.format(prefix, Math.abs(offset)),
x_align: Clutter.ActorAlign.END, x_align: Clutter.ActorAlign.END,
@@ -203,10 +203,9 @@ class WorldClocksSection extends St.Button {
} }
if (this._grid.get_n_children() > 1) { if (this._grid.get_n_children() > 1) {
if (!this._clockNotifyId) { if (!this._clockNotifyId)
this._clockNotifyId = this._clockNotifyId =
this._clock.connect('notify::clock', this._updateLabels.bind(this)); this._clock.connect('notify::clock', this._updateLabels.bind(this));
}
this._updateLabels(); this._updateLabels();
} else { } else {
if (this._clockNotifyId) if (this._clockNotifyId)
@@ -253,42 +252,31 @@ class WeatherSection extends St.Button {
_init() { _init() {
super._init({ super._init({
style_class: 'weather-button', style_class: 'weather-button',
can_focus: true, x_fill: true,
x_expand: true, can_focus: true
}); });
this._weatherClient = new Weather.WeatherClient(); this._weatherClient = new Weather.WeatherClient();
let box = new St.BoxLayout({ let box = new St.BoxLayout({ style_class: 'weather-box',
style_class: 'weather-box', vertical: true });
vertical: true,
x_expand: true,
});
this.child = box; this.child = box;
let titleBox = new St.BoxLayout({ style_class: 'weather-header-box' }); let titleBox = new St.BoxLayout();
titleBox.add_child(new St.Label({ titleBox.add_child(new St.Label({ style_class: 'weather-header',
style_class: 'weather-header', x_align: Clutter.ActorAlign.START,
x_align: Clutter.ActorAlign.START, x_expand: true,
x_expand: true, text: _("Weather") }));
y_align: Clutter.ActorAlign.END,
text: _('Weather'),
}));
box.add_child(titleBox); box.add_child(titleBox);
this._titleLocation = new St.Label({ this._titleLocation = new St.Label({ style_class: 'weather-header location',
style_class: 'weather-header location', x_align: Clutter.ActorAlign.END });
x_align: Clutter.ActorAlign.END,
y_align: Clutter.ActorAlign.END,
});
titleBox.add_child(this._titleLocation); titleBox.add_child(this._titleLocation);
let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL }); let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
this._forecastGrid = new St.Widget({ this._forecastGrid = new St.Widget({ style_class: 'weather-grid',
style_class: 'weather-grid', layout_manager: layout });
layout_manager: layout,
});
layout.hookup_style(this._forecastGrid); layout.hookup_style(this._forecastGrid);
box.add_child(this._forecastGrid); box.add_child(this._forecastGrid);
@@ -309,27 +297,25 @@ class WeatherSection extends St.Button {
} }
_getInfos() { _getInfos() {
let forecasts = this._weatherClient.info.get_forecast_list(); let info = this._weatherClient.info;
let forecasts = info.get_forecast_list();
let now = GLib.DateTime.new_now_local(); let current = info;
let current = GLib.DateTime.new_from_unix_local(0); let infos = [info];
let infos = [];
for (let i = 0; i < forecasts.length; i++) { for (let i = 0; i < forecasts.length; i++) {
const [valid, timestamp] = forecasts[i].get_value_update(); let [ok_, timestamp] = forecasts[i].get_value_update();
if (!valid || timestamp === 0) let datetime = new Date(timestamp * 1000);
continue; // 0 means 'never updated' if (!_isToday(datetime))
continue; // Ignore forecasts from other days
const datetime = GLib.DateTime.new_from_unix_local(timestamp); [ok_, timestamp] = current.get_value_update();
if (now.difference(datetime) > 0) let currenttime = new Date(timestamp * 1000);
continue; // Ignore earlier forecasts if (currenttime.getHours() == datetime.getHours())
if (datetime.difference(current) < GLib.TIME_SPAN_HOUR)
continue; // Enforce a minimum interval of 1h continue; // Enforce a minimum interval of 1h
if (infos.push(forecasts[i]) == MAX_FORECASTS) current = forecasts[i];
if (infos.push(current) == MAX_FORECASTS)
break; // Use a maximum of five forecasts break; // Use a maximum of five forecasts
current = datetime;
} }
return infos; return infos;
} }
@@ -343,31 +329,21 @@ class WeatherSection extends St.Button {
let col = 0; let col = 0;
infos.forEach(fc => { infos.forEach(fc => {
const [valid_, timestamp] = fc.get_value_update(); let [ok_, timestamp] = fc.get_value_update();
let timeStr = Util.formatTime(new Date(timestamp * 1000), { let timeStr = Util.formatTime(new Date(timestamp * 1000), {
timeOnly: true, timeOnly: true
ampm: false,
}); });
let icon = new St.Icon({ let icon = new St.Icon({ style_class: 'weather-forecast-icon',
style_class: 'weather-forecast-icon', icon_name: fc.get_symbolic_icon_name(),
icon_name: fc.get_symbolic_icon_name(), x_align: Clutter.ActorAlign.CENTER,
x_align: Clutter.ActorAlign.CENTER, x_expand: true });
x_expand: true, let temp = new St.Label({ style_class: 'weather-forecast-temp',
}); text: fc.get_temp_summary(),
let temp = new St.Label({ x_align: Clutter.ActorAlign.CENTER });
style_class: 'weather-forecast-temp', let time = new St.Label({ style_class: 'weather-forecast-time',
text: fc.get_temp_summary(), text: timeStr,
x_align: Clutter.ActorAlign.CENTER, x_align: Clutter.ActorAlign.CENTER });
});
let time = new St.Label({
style_class: 'weather-forecast-time',
text: timeStr,
x_align: Clutter.ActorAlign.CENTER,
});
temp.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
time.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
layout.attach(icon, col, 0, 1, 1); layout.attach(icon, col, 0, 1, 1);
layout.attach(temp, col, 1, 1, 1); layout.attach(temp, col, 1, 1, 1);
@@ -391,12 +367,7 @@ class WeatherSection extends St.Button {
} }
let info = this._weatherClient.info; let info = this._weatherClient.info;
let loc = info.get_location(); this._titleLocation.text = info.get_location().get_name();
if (loc.get_level() !== GWeather.LocationLevel.CITY && loc.has_coords()) {
let world = GWeather.Location.get_world();
loc = world.find_nearest_city(...loc.get_coords());
}
this._titleLocation.text = loc.get_name();
if (this._weatherClient.loading) { if (this._weatherClient.loading) {
this._setStatusLabel(_("Loading…")); this._setStatusLabel(_("Loading…"));
@@ -434,7 +405,7 @@ class MessagesIndicator extends St.Icon {
icon_size: 16, icon_size: 16,
visible: false, visible: false,
y_expand: true, y_expand: true,
y_align: Clutter.ActorAlign.CENTER, y_align: Clutter.ActorAlign.CENTER
}); });
this._sources = []; this._sources = [];
@@ -463,7 +434,7 @@ class MessagesIndicator extends St.Icon {
this._sources.forEach(source => (count += source.unseenCount)); this._sources.forEach(source => (count += source.unseenCount));
count -= Main.messageTray.queueCount; count -= Main.messageTray.queueCount;
this.visible = count > 0; this.visible = (count > 0);
} }
}); });
@@ -564,7 +535,7 @@ class DateMenuButton extends PanelMenu.Button {
this.label_actor = this._clockDisplay; this.label_actor = this._clockDisplay;
this.add_actor(box); this.add_actor(box);
this.add_style_class_name('clock-display'); this.add_style_class_name ('clock-display');
let layout = new FreezableBinLayout(); let layout = new FreezableBinLayout();
let bin = new St.Widget({ layout_manager: layout }); let bin = new St.Widget({ layout_manager: layout });
@@ -594,7 +565,7 @@ class DateMenuButton extends PanelMenu.Button {
// Fill up the first column // Fill up the first column
this._messageList = new Calendar.CalendarMessageList(); this._messageList = new Calendar.CalendarMessageList();
hbox.add_child(this._messageList); hbox.add(this._messageList, { expand: true, y_fill: false, y_align: St.Align.START });
// Fill up the second column // Fill up the second column
let boxLayout = new CalendarColumnLayout(this._calendar); let boxLayout = new CalendarColumnLayout(this._calendar);
@@ -609,21 +580,20 @@ class DateMenuButton extends PanelMenu.Button {
vbox.add_actor(this._calendar); vbox.add_actor(this._calendar);
this._displaysSection = new St.ScrollView({ style_class: 'datemenu-displays-section vfade', this._displaysSection = new St.ScrollView({ style_class: 'datemenu-displays-section vfade',
x_expand: true, x_expand: true, x_fill: true,
overlay_scrollbars: true }); overlay_scrollbars: true });
this._displaysSection.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC); this._displaysSection.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
vbox.add_actor(this._displaysSection); vbox.add_actor(this._displaysSection);
let displaysBox = new St.BoxLayout({ vertical: true, let displaysBox = new St.BoxLayout({ vertical: true,
x_expand: true,
style_class: 'datemenu-displays-box' }); style_class: 'datemenu-displays-box' });
this._displaysSection.add_actor(displaysBox); this._displaysSection.add_actor(displaysBox);
this._clocksItem = new WorldClocksSection(); this._clocksItem = new WorldClocksSection();
displaysBox.add_child(this._clocksItem); displaysBox.add(this._clocksItem, { x_fill: true });
this._weatherItem = new WeatherSection(); this._weatherItem = new WeatherSection();
displaysBox.add_child(this._weatherItem); displaysBox.add(this._weatherItem, { x_fill: true });
// Done with hbox for calendar and event list // Done with hbox for calendar and event list
@@ -661,11 +631,11 @@ class DateMenuButton extends PanelMenu.Button {
_sessionUpdated() { _sessionUpdated() {
let eventSource; let eventSource;
let showEvents = Main.sessionMode.showCalendarEvents; let showEvents = Main.sessionMode.showCalendarEvents;
if (showEvents) if (showEvents) {
eventSource = this._getEventSource(); eventSource = this._getEventSource();
else } else {
eventSource = new Calendar.EmptyEventSource(); eventSource = new Calendar.EmptyEventSource();
}
this._setEventSource(eventSource); this._setEventSource(eventSource);
// Displays are not actually expected to launch Settings when activated // Displays are not actually expected to launch Settings when activated

View File

@@ -36,15 +36,19 @@ class Dialog extends St.Widget {
this._dialog.request_mode = Clutter.RequestMode.HEIGHT_FOR_WIDTH; this._dialog.request_mode = Clutter.RequestMode.HEIGHT_FOR_WIDTH;
this._dialog.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS); this._dialog.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
this.contentLayout = new St.BoxLayout({ this.contentLayout = new St.BoxLayout({ vertical: true,
vertical: true, style_class: "modal-dialog-content-box" });
style_class: 'modal-dialog-content-box', this._dialog.add(this.contentLayout,
y_expand: true, { expand: true,
}); x_fill: true,
this._dialog.add_child(this.contentLayout); y_fill: true,
x_align: St.Align.MIDDLE,
y_align: St.Align.START });
this.buttonLayout = new St.Widget({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) }); this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) });
this._dialog.add_child(this.buttonLayout); this._dialog.add(this.buttonLayout,
{ x_align: St.Align.MIDDLE,
y_align: St.Align.START });
} }
_onDestroy() { _onDestroy() {
@@ -96,7 +100,7 @@ class Dialog extends St.Widget {
} }
addContent(actor) { addContent(actor) {
this.contentLayout.add(actor, { expand: true }); this.contentLayout.add (actor, { expand: true });
} }
addButton(buttonInfo) { addButton(buttonInfo) {
@@ -117,7 +121,7 @@ class Dialog extends St.Widget {
can_focus: true, can_focus: true,
x_expand: true, x_expand: true,
y_expand: true, y_expand: true,
label }); label: label });
button.connect('clicked', action); button.connect('clicked', action);
buttonInfo['button'] = button; buttonInfo['button'] = button;
@@ -159,8 +163,8 @@ var MessageDialogContent = GObject.registerClass({
'body': GObject.ParamSpec.string('body', 'body', 'body', 'body': GObject.ParamSpec.string('body', 'body', 'body',
GObject.ParamFlags.READWRITE | GObject.ParamFlags.READWRITE |
GObject.ParamFlags.CONSTRUCT, GObject.ParamFlags.CONSTRUCT,
null), null)
}, }
}, class MessageDialogContent extends St.BoxLayout { }, class MessageDialogContent extends St.BoxLayout {
_init(params) { _init(params) {
this._icon = new St.Icon({ y_align: Clutter.ActorAlign.START }); this._icon = new St.Icon({ y_align: Clutter.ActorAlign.START });
@@ -211,7 +215,7 @@ var MessageDialogContent = GObject.registerClass({
set icon(icon) { set icon(icon) {
this._icon.set({ this._icon.set({
gicon: icon, gicon: icon,
visible: icon != null, visible: icon != null
}); });
this.notify('icon'); this.notify('icon');
} }
@@ -231,7 +235,7 @@ var MessageDialogContent = GObject.registerClass({
_setLabel(label, prop, value) { _setLabel(label, prop, value) {
label.set({ label.set({
text: value || '', text: value || '',
visible: value != null, visible: value != null
}); });
this.notify(prop); this.notify(prop);
} }

View File

@@ -18,7 +18,7 @@ var DragMotionResult = {
NO_DROP: 0, NO_DROP: 0,
COPY_DROP: 1, COPY_DROP: 1,
MOVE_DROP: 2, MOVE_DROP: 2,
CONTINUE: 3, CONTINUE: 3
}; };
var DragState = { var DragState = {
@@ -30,13 +30,13 @@ var DragState = {
var DRAG_CURSOR_MAP = { var DRAG_CURSOR_MAP = {
0: Meta.Cursor.DND_UNSUPPORTED_TARGET, 0: Meta.Cursor.DND_UNSUPPORTED_TARGET,
1: Meta.Cursor.DND_COPY, 1: Meta.Cursor.DND_COPY,
2: Meta.Cursor.DND_MOVE, 2: Meta.Cursor.DND_MOVE
}; };
var DragDropResult = { var DragDropResult = {
FAILURE: 0, FAILURE: 0,
SUCCESS: 1, SUCCESS: 1,
CONTINUE: 2, CONTINUE: 2
}; };
var dragMonitors = []; var dragMonitors = [];
@@ -61,12 +61,11 @@ function addDragMonitor(monitor) {
} }
function removeDragMonitor(monitor) { function removeDragMonitor(monitor) {
for (let i = 0; i < dragMonitors.length; i++) { for (let i = 0; i < dragMonitors.length; i++)
if (dragMonitors[i] == monitor) { if (dragMonitors[i] == monitor) {
dragMonitors.splice(i, 1); dragMonitors.splice(i, 1);
return; return;
} }
}
} }
var _Draggable = class _Draggable { var _Draggable = class _Draggable {
@@ -151,12 +150,12 @@ var _Draggable = class _Draggable {
if (touchSequence) if (touchSequence)
pointer.sequence_grab(touchSequence, actor); pointer.sequence_grab(touchSequence, actor);
else if (pointer) else if (pointer)
pointer.grab(actor); pointer.grab (actor);
this._grabbedDevice = pointer; this._grabbedDevice = pointer;
this._touchSequence = touchSequence; this._touchSequence = touchSequence;
this._capturedEventId = global.stage.connect('captured-event', (o, event) => { this._capturedEventId = global.stage.connect('captured-event', (actor, event) => {
let device = event.get_device(); let device = event.get_device();
if (device != this._grabbedDevice && if (device != this._grabbedDevice &&
device.get_device_type() != Clutter.InputDeviceType.KEYBOARD_DEVICE) device.get_device_type() != Clutter.InputDeviceType.KEYBOARD_DEVICE)
@@ -172,7 +171,7 @@ var _Draggable = class _Draggable {
} }
if (this._touchSequence) if (this._touchSequence)
this._grabbedDevice.sequence_ungrab(this._touchSequence); this._grabbedDevice.sequence_ungrab (this._touchSequence);
else else
this._grabbedDevice.ungrab(); this._grabbedDevice.ungrab();
@@ -213,9 +212,9 @@ var _Draggable = class _Draggable {
_eventIsRelease(event) { _eventIsRelease(event) {
if (event.type() == Clutter.EventType.BUTTON_RELEASE) { if (event.type() == Clutter.EventType.BUTTON_RELEASE) {
let buttonMask = Clutter.ModifierType.BUTTON1_MASK | let buttonMask = (Clutter.ModifierType.BUTTON1_MASK |
Clutter.ModifierType.BUTTON2_MASK | Clutter.ModifierType.BUTTON2_MASK |
Clutter.ModifierType.BUTTON3_MASK; Clutter.ModifierType.BUTTON3_MASK);
/* We only obey the last button release from the device, /* We only obey the last button release from the device,
* other buttons may get pressed/released during the DnD op. * other buttons may get pressed/released during the DnD op.
*/ */
@@ -259,16 +258,16 @@ var _Draggable = class _Draggable {
} else if (event.type() == Clutter.EventType.MOTION || } else if (event.type() == Clutter.EventType.MOTION ||
(event.type() == Clutter.EventType.TOUCH_UPDATE && (event.type() == Clutter.EventType.TOUCH_UPDATE &&
global.display.is_pointer_emulating_sequence(event.get_event_sequence()))) { global.display.is_pointer_emulating_sequence(event.get_event_sequence()))) {
if (this._dragActor && this._dragState == DragState.DRAGGING) if (this._dragActor && this._dragState == DragState.DRAGGING) {
return this._updateDragPosition(event); return this._updateDragPosition(event);
else if (this._dragActor == null && this._dragState != DragState.CANCELLED) } else if (this._dragActor == null && this._dragState != DragState.CANCELLED) {
return this._maybeStartDrag(event); return this._maybeStartDrag(event);
}
// We intercept KEY_PRESS event so that we can process Esc key press to cancel // We intercept KEY_PRESS event so that we can process Esc key press to cancel
// dragging and ignore all other key presses. // dragging and ignore all other key presses.
} else if (event.type() == Clutter.EventType.KEY_PRESS && this._dragState == DragState.DRAGGING) { } else if (event.type() == Clutter.EventType.KEY_PRESS && this._dragState == DragState.DRAGGING) {
let symbol = event.get_key_symbol(); let symbol = event.get_key_symbol();
if (symbol == Clutter.KEY_Escape) { if (symbol == Clutter.Escape) {
this._cancelDrag(event.get_time()); this._cancelDrag(event.get_time());
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
} }
@@ -292,11 +291,9 @@ var _Draggable = class _Draggable {
/** /**
* startDrag: * startDrag:
* @param {number} stageX: X coordinate of event * @stageX: X coordinate of event
* @param {number} stageY: Y coordinate of event * @stageY: Y coordinate of event
* @param {number} time: Event timestamp * @time: Event timestamp
* @param {Clutter.EventSequence=} sequence: Event sequence
* @param {Clutter.InputDevice=} device: device that originated the event
* *
* Directly initiate a drag and drop operation from the given actor. * Directly initiate a drag and drop operation from the given actor.
* This function is useful to call if you've specified manualMode * This function is useful to call if you've specified manualMode
@@ -341,7 +338,7 @@ var _Draggable = class _Draggable {
if (this.actor._delegate && this.actor._delegate.getDragActor) { if (this.actor._delegate && this.actor._delegate.getDragActor) {
this._dragActor = this.actor._delegate.getDragActor(); this._dragActor = this.actor._delegate.getDragActor();
Main.uiGroup.add_child(this._dragActor); Main.uiGroup.add_child(this._dragActor);
Main.uiGroup.set_child_above_sibling(this._dragActor, null); this._dragActor.raise_top();
Shell.util_set_hidden_from_pick(this._dragActor, true); Shell.util_set_hidden_from_pick(this._dragActor, true);
// Drag actor does not always have to be the same as actor. For example drag actor // Drag actor does not always have to be the same as actor. For example drag actor
@@ -391,7 +388,7 @@ var _Draggable = class _Draggable {
this._dragOrigParent.remove_actor(this._dragActor); this._dragOrigParent.remove_actor(this._dragActor);
Main.uiGroup.add_child(this._dragActor); Main.uiGroup.add_child(this._dragActor);
Main.uiGroup.set_child_above_sibling(this._dragActor, null); this._dragActor.raise_top();
Shell.util_set_hidden_from_pick(this._dragActor, true); Shell.util_set_hidden_from_pick(this._dragActor, true);
} }
@@ -430,7 +427,7 @@ var _Draggable = class _Draggable {
scale_x: scale * origScale, scale_x: scale * origScale,
scale_y: scale * origScale, scale_y: scale * origScale,
duration: SCALE_ANIMATION_TIME, duration: SCALE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
this._dragActor.get_transition('scale-x').connect('new-frame', () => { this._dragActor.get_transition('scale-x').connect('new-frame', () => {
@@ -475,7 +472,7 @@ var _Draggable = class _Draggable {
y: this._dragY, y: this._dragY,
dragActor: this._dragActor, dragActor: this._dragActor,
source: this.actor._delegate, source: this.actor._delegate,
targetActor: target, targetActor: target
}; };
let targetActorDestroyHandlerId; let targetActorDestroyHandlerId;
@@ -554,11 +551,11 @@ var _Draggable = class _Draggable {
let dropEvent = { let dropEvent = {
dropActor: this._dragActor, dropActor: this._dragActor,
targetActor: target, targetActor: target,
clutterEvent: event, clutterEvent: event
}; };
for (let i = 0; i < dragMonitors.length; i++) { for (let i = 0; i < dragMonitors.length; i++) {
let dropFunc = dragMonitors[i].dragDrop; let dropFunc = dragMonitors[i].dragDrop;
if (dropFunc) { if (dropFunc)
switch (dropFunc(dropEvent)) { switch (dropFunc(dropEvent)) {
case DragDropResult.FAILURE: case DragDropResult.FAILURE:
case DragDropResult.SUCCESS: case DragDropResult.SUCCESS:
@@ -566,7 +563,6 @@ var _Draggable = class _Draggable {
case DragDropResult.CONTINUE: case DragDropResult.CONTINUE:
continue; continue;
} }
}
} }
// At this point it is too late to cancel a drag by destroying // At this point it is too late to cancel a drag by destroying
@@ -577,15 +573,11 @@ var _Draggable = class _Draggable {
while (target) { while (target) {
if (target._delegate && target._delegate.acceptDrop) { if (target._delegate && target._delegate.acceptDrop) {
let [r_, targX, targY] = target.transform_stage_point(dropX, dropY); let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
let accepted = false; if (target._delegate.acceptDrop(this.actor._delegate,
try { this._dragActor,
accepted = target._delegate.acceptDrop(this.actor._delegate, targX,
this._dragActor, targX, targY, event.get_time()); targY,
} catch (e) { event.get_time())) {
// On error, skip this target
logError(e, "Skipping drag target");
}
if (accepted) {
// If it accepted the drop without taking the actor, // If it accepted the drop without taking the actor,
// handle it ourselves. // handle it ourselves.
if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) { if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) {
@@ -646,7 +638,7 @@ var _Draggable = class _Draggable {
_cancelDrag(eventTime) { _cancelDrag(eventTime) {
this.emit('drag-cancelled', eventTime); this.emit('drag-cancelled', eventTime);
let wasCancelled = this._dragState == DragState.CANCELLED; let wasCancelled = (this._dragState == DragState.CANCELLED);
this._dragState = DragState.CANCELLED; this._dragState = DragState.CANCELLED;
if (this._actorDestroyed || wasCancelled) { if (this._actorDestroyed || wasCancelled) {
@@ -667,7 +659,7 @@ var _Draggable = class _Draggable {
y: snapBackY, y: snapBackY,
scale_x: snapBackScale, scale_x: snapBackScale,
scale_y: snapBackScale, scale_y: snapBackScale,
duration: SNAP_BACK_ANIMATION_TIME, duration: SNAP_BACK_ANIMATION_TIME
}); });
} }
@@ -681,7 +673,7 @@ var _Draggable = class _Draggable {
this._dragActor.opacity = 0; this._dragActor.opacity = 0;
this._animateDragEnd(eventTime, { this._animateDragEnd(eventTime, {
duration: REVERT_ANIMATION_TIME, duration: REVERT_ANIMATION_TIME
}); });
} }
@@ -694,7 +686,7 @@ var _Draggable = class _Draggable {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => { onComplete: () => {
this._onAnimationComplete(this._dragActor, eventTime); this._onAnimationComplete(this._dragActor, eventTime);
}, }
})); }));
} }
@@ -748,9 +740,8 @@ Signals.addSignalMethods(_Draggable.prototype);
/** /**
* makeDraggable: * makeDraggable:
* @param {Clutter.Actor} actor: Source actor * @actor: Source actor
* @param {Object=} params: Additional parameters * @params: (optional) Additional parameters
* @returns {Object} a new Draggable
* *
* Create an object which controls drag and drop for the given actor. * Create an object which controls drag and drop for the given actor.
* *

View File

@@ -37,17 +37,17 @@ var EdgeDragAction = GObject.registerClass({
let [x, y] = this.get_press_coords(0); let [x, y] = this.get_press_coords(0);
let monitorRect = this._getMonitorRect(x, y); let monitorRect = this._getMonitorRect(x, y);
return (this._side == St.Side.LEFT && x < monitorRect.x + EDGE_THRESHOLD) || return ((this._side == St.Side.LEFT && x < monitorRect.x + EDGE_THRESHOLD) ||
(this._side == St.Side.RIGHT && x > monitorRect.x + monitorRect.width - EDGE_THRESHOLD) || (this._side == St.Side.RIGHT && x > monitorRect.x + monitorRect.width - EDGE_THRESHOLD) ||
(this._side == St.Side.TOP && y < monitorRect.y + EDGE_THRESHOLD) || (this._side == St.Side.TOP && y < monitorRect.y + EDGE_THRESHOLD) ||
(this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD); (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
} }
vfunc_gesture_progress(_actor) { vfunc_gesture_progress(_actor) {
let [startX, startY] = this.get_press_coords(0); let [startX, startY] = this.get_press_coords(0);
let [x, y] = this.get_motion_coords(0); let [x, y] = this.get_motion_coords(0);
let offsetX = Math.abs(x - startX); let offsetX = Math.abs (x - startX);
let offsetY = Math.abs(y - startY); let offsetY = Math.abs (y - startY);
if (offsetX < EDGE_THRESHOLD && offsetY < EDGE_THRESHOLD) if (offsetX < EDGE_THRESHOLD && offsetY < EDGE_THRESHOLD)
return true; return true;

View File

@@ -128,7 +128,7 @@ const DialogType = {
SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */, SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */, RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
UPDATE_RESTART: 3, UPDATE_RESTART: 3,
UPGRADE_RESTART: 4, UPGRADE_RESTART: 4
}; };
const DialogContent = { const DialogContent = {
@@ -136,7 +136,7 @@ const DialogContent = {
1 /* DialogType.SHUTDOWN */: shutdownDialogContent, 1 /* DialogType.SHUTDOWN */: shutdownDialogContent,
2 /* DialogType.RESTART */: restartDialogContent, 2 /* DialogType.RESTART */: restartDialogContent,
3 /* DialogType.UPDATE_RESTART */: restartUpdateDialogContent, 3 /* DialogType.UPDATE_RESTART */: restartUpdateDialogContent,
4 /* DialogType.UPGRADE_RESTART */: restartUpgradeDialogContent, 4 /* DialogType.UPGRADE_RESTART */: restartUpgradeDialogContent
}; };
var MAX_USERS_IN_SESSION_DIALOG = 5; var MAX_USERS_IN_SESSION_DIALOG = 5;
@@ -218,7 +218,7 @@ function init() {
// This always returns the same singleton object // This always returns the same singleton object
// By instantiating it initially, we register the // By instantiating it initially, we register the
// bus object, etc. // bus object, etc.
new EndSessionDialog(); (new EndSessionDialog());
} }
var EndSessionDialog = GObject.registerClass( var EndSessionDialog = GObject.registerClass(
@@ -263,35 +263,38 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._userLoadedId = this._user.connect('notify::is_loaded', this._sync.bind(this)); this._userLoadedId = this._user.connect('notify::is_loaded', this._sync.bind(this));
this._userChangedId = this._user.connect('changed', this._sync.bind(this)); this._userChangedId = this._user.connect('changed', this._sync.bind(this));
let mainContentLayout = new St.BoxLayout({ let mainContentLayout = new St.BoxLayout({ vertical: false });
vertical: false, this.contentLayout.add(mainContentLayout,
x_expand: true, { x_fill: true,
y_expand: false, y_fill: false });
});
this.contentLayout.add_child(mainContentLayout);
this._iconBin = new St.Bin({ this._iconBin = new St.Bin();
x_expand: true, mainContentLayout.add(this._iconBin,
x_align: Clutter.ActorAlign.END, { x_fill: true,
}); y_fill: false,
mainContentLayout.add_child(this._iconBin); x_align: St.Align.END,
y_align: St.Align.START });
let messageLayout = new St.BoxLayout({ vertical: true, let messageLayout = new St.BoxLayout({ vertical: true,
style_class: 'end-session-dialog-layout' }); style_class: 'end-session-dialog-layout' });
mainContentLayout.add_child(messageLayout); mainContentLayout.add(messageLayout,
{ y_align: St.Align.START });
this._subjectLabel = new St.Label({ style_class: 'end-session-dialog-subject' }); this._subjectLabel = new St.Label({ style_class: 'end-session-dialog-subject' });
messageLayout.add_child(this._subjectLabel); messageLayout.add(this._subjectLabel,
{ x_fill: false,
y_fill: false,
x_align: St.Align.START,
y_align: St.Align.START });
this._descriptionLabel = new St.Label({ this._descriptionLabel = new St.Label({ style_class: 'end-session-dialog-description' });
style_class: 'end-session-dialog-description',
y_expand: true,
});
this._descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; this._descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
this._descriptionLabel.clutter_text.line_wrap = true; this._descriptionLabel.clutter_text.line_wrap = true;
messageLayout.add_child(this._descriptionLabel); messageLayout.add(this._descriptionLabel,
{ y_fill: true,
y_align: St.Align.START });
this._checkBox = new CheckBox.CheckBox(); this._checkBox = new CheckBox.CheckBox();
this._checkBox.connect('clicked', this._sync.bind(this)); this._checkBox.connect('clicked', this._sync.bind(this));
@@ -303,13 +306,11 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._batteryWarning.clutter_text.line_wrap = true; this._batteryWarning.clutter_text.line_wrap = true;
messageLayout.add(this._batteryWarning); messageLayout.add(this._batteryWarning);
this._scrollView = new St.ScrollView({ this._scrollView = new St.ScrollView({ style_class: 'end-session-dialog-list' });
style_class: 'end-session-dialog-list',
x_expand: true,
y_expand: true,
});
this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC); this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
this.contentLayout.add_child(this._scrollView); this.contentLayout.add(this._scrollView,
{ x_fill: true,
y_fill: true });
this._scrollView.hide(); this._scrollView.hide();
this._inhibitorSection = new St.BoxLayout({ vertical: true, this._inhibitorSection = new St.BoxLayout({ vertical: true,
@@ -366,7 +367,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
} }
_sync() { _sync() {
let open = this.state == ModalDialog.State.OPENING || this.state == ModalDialog.State.OPENED; let open = (this.state == ModalDialog.State.OPENING || this.state == ModalDialog.State.OPENED);
if (!open) if (!open)
return; return;
@@ -443,7 +444,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
let dialogContent = DialogContent[this._type]; let dialogContent = DialogContent[this._type];
let buttons = [{ action: this.cancel.bind(this), let buttons = [{ action: this.cancel.bind(this),
label: _("Cancel"), label: _("Cancel"),
key: Clutter.KEY_Escape }]; key: Clutter.Escape }];
for (let i = 0; i < dialogContent.confirmButtons.length; i++) { for (let i = 0; i < dialogContent.confirmButtons.length; i++) {
let signal = dialogContent.confirmButtons[i].signal; let signal = dialogContent.confirmButtons[i].signal;
@@ -456,7 +457,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._confirm(signal); this._confirm(signal);
}); });
}, },
label, label: label,
}); });
} }
@@ -566,7 +567,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => { this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => {
let currentTime = GLib.get_monotonic_time(); let currentTime = GLib.get_monotonic_time();
let secondsElapsed = (currentTime - startTime) / 1000000; let secondsElapsed = ((currentTime - startTime) / 1000000);
this._secondsLeft = this._totalSecondsToStayOpen - secondsElapsed; this._secondsLeft = this._totalSecondsToStayOpen - secondsElapsed;
if (this._secondsLeft > 0) { if (this._secondsLeft > 0) {
@@ -681,12 +682,11 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
continue; continue;
let sessionId = GLib.getenv('XDG_SESSION_ID'); let sessionId = GLib.getenv('XDG_SESSION_ID');
if (!sessionId) { if (!sessionId)
this._loginManager.getCurrentSessionProxy(currentSessionProxy => { this._loginManager.getCurrentSessionProxy(currentSessionProxy => {
sessionId = currentSessionProxy.Id; sessionId = currentSessionProxy.Id;
log(`endSessionDialog: No XDG_SESSION_ID, fetched from logind: ${sessionId}`); log(`endSessionDialog: No XDG_SESSION_ID, fetched from logind: ${sessionId}`);
}); });
}
if (proxy.Id == sessionId) if (proxy.Id == sessionId)
continue; continue;
@@ -754,14 +754,14 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed; let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed;
_setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || ''); _setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || '');
this._checkBox.visible = dialogContent.checkBoxText && updatePrepared && updatesAllowed; this._checkBox.visible = (dialogContent.checkBoxText && updatePrepared && updatesAllowed);
this._checkBox.checked = updatePrepared && updateTriggered; this._checkBox.checked = (updatePrepared && updateTriggered);
// We show the warning either together with the checkbox, or when // We show the warning either together with the checkbox, or when
// updates have already been triggered, but the user doesn't have // updates have already been triggered, but the user doesn't have
// enough permissions to cancel them. // enough permissions to cancel them.
this._batteryWarning.visible = dialogContent.showBatteryWarning && this._batteryWarning.visible = (dialogContent.showBatteryWarning &&
(this._checkBox.visible || updatePrepared && updateTriggered && !updatesAllowed); (this._checkBox.visible || updatePrepared && updateTriggered && !updatesAllowed));
this._updateButtons(); this._updateButtons();

View File

@@ -10,7 +10,7 @@ imports.gi.versions.Gtk = '3.0';
imports.gi.versions.TelepathyGLib = '0.12'; imports.gi.versions.TelepathyGLib = '0.12';
imports.gi.versions.TelepathyLogger = '0.2'; imports.gi.versions.TelepathyLogger = '0.2';
const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, GLib, Meta, Shell, St } = imports.gi;
const Gettext = imports.gettext; const Gettext = imports.gettext;
// We can't import shell JS modules yet, because they may have // We can't import shell JS modules yet, because they may have
@@ -23,7 +23,7 @@ const Gettext = imports.gettext;
// of interfaces in Javascript // of interfaces in Javascript
function _patchContainerClass(containerClass) { function _patchContainerClass(containerClass) {
// This one is a straightforward mapping of the C method // This one is a straightforward mapping of the C method
containerClass.prototype.child_set = function (actor, props) { containerClass.prototype.child_set = function(actor, props) {
let meta = this.get_child_meta(actor); let meta = this.get_child_meta(actor);
for (let prop in props) for (let prop in props)
meta[prop] = props[prop]; meta[prop] = props[prop];
@@ -32,7 +32,7 @@ function _patchContainerClass(containerClass) {
// clutter_container_add() actually is a an add-many-actors // clutter_container_add() actually is a an add-many-actors
// method. We conveniently, but somewhat dubiously, take the // method. We conveniently, but somewhat dubiously, take the
// this opportunity to make it do something more useful. // this opportunity to make it do something more useful.
containerClass.prototype.add = function (actor, props) { containerClass.prototype.add = function(actor, props) {
this.add_actor(actor); this.add_actor(actor);
if (props) if (props)
this.child_set(actor, props); this.child_set(actor, props);
@@ -40,8 +40,8 @@ function _patchContainerClass(containerClass) {
} }
function _patchLayoutClass(layoutClass, styleProps) { function _patchLayoutClass(layoutClass, styleProps) {
if (styleProps) { if (styleProps)
layoutClass.prototype.hookup_style = function (container) { layoutClass.prototype.hookup_style = function(container) {
container.connect('style-changed', () => { container.connect('style-changed', () => {
let node = container.get_theme_node(); let node = container.get_theme_node();
for (let prop in styleProps) { for (let prop in styleProps) {
@@ -51,7 +51,11 @@ function _patchLayoutClass(layoutClass, styleProps) {
} }
}); });
}; };
} layoutClass.prototype.child_set = function(actor, props) {
let meta = this.get_child_meta(actor.get_parent(), actor);
for (let prop in props)
meta[prop] = props[prop];
};
} }
function _makeEaseCallback(params, cleanup) { function _makeEaseCallback(params, cleanup) {
@@ -101,16 +105,6 @@ function _easeActor(actor, params) {
actor.set_easing_delay(params.delay); actor.set_easing_delay(params.delay);
delete params.delay; delete params.delay;
let repeatCount = 0;
if (params.repeatCount != undefined)
repeatCount = params.repeatCount;
delete params.repeatCount;
let autoReverse = false;
if (params.autoReverse != undefined)
autoReverse = params.autoReverse;
delete params.autoReverse;
if (params.mode != undefined) if (params.mode != undefined)
actor.set_easing_mode(params.mode); actor.set_easing_mode(params.mode);
delete params.mode; delete params.mode;
@@ -133,12 +127,10 @@ function _easeActor(actor, params) {
else else
Meta.disable_unredirect_for_display(global.display); Meta.disable_unredirect_for_display(global.display);
if (transition) { if (transition)
transition.set({ repeatCount, autoReverse });
transition.connect('stopped', (t, finished) => callback(finished)); transition.connect('stopped', (t, finished) => callback(finished));
} else { else
callback(true); callback(true);
}
} }
function _easeActorProperty(actor, propName, target, params) { function _easeActorProperty(actor, propName, target, params) {
@@ -151,16 +143,6 @@ function _easeActorProperty(actor, propName, target, params) {
params.duration = adjustAnimationTime(params.duration); params.duration = adjustAnimationTime(params.duration);
let duration = Math.floor(params.duration || 0); let duration = Math.floor(params.duration || 0);
let repeatCount = 0;
if (params.repeatCount != undefined)
repeatCount = params.repeatCount;
delete params.repeatCount;
let autoReverse = false;
if (params.autoReverse != undefined)
autoReverse = params.autoReverse;
delete params.autoReverse;
// Copy Clutter's behavior for implicit animations, see // Copy Clutter's behavior for implicit animations, see
// should_skip_implicit_transition() // should_skip_implicit_transition()
if (actor instanceof Clutter.Actor && !actor.mapped) if (actor instanceof Clutter.Actor && !actor.mapped)
@@ -186,9 +168,7 @@ function _easeActorProperty(actor, propName, target, params) {
let transition = new Clutter.PropertyTransition(Object.assign({ let transition = new Clutter.PropertyTransition(Object.assign({
property_name: propName, property_name: propName,
interval: new Clutter.Interval({ value_type: pspec.value_type }), interval: new Clutter.Interval({ value_type: pspec.value_type }),
remove_on_complete: true, remove_on_complete: true
repeat_count: repeatCount,
auto_reverse: autoReverse,
}, params)); }, params));
actor.add_transition(propName, transition); actor.add_transition(propName, transition);
@@ -229,37 +209,37 @@ function init() {
window.ngettext = Gettext.ngettext; window.ngettext = Gettext.ngettext;
window.N_ = s => s; window.N_ = s => s;
GObject.gtypeNameBasedOnJSPath = true;
// Miscellaneous monkeypatching // Miscellaneous monkeypatching
_patchContainerClass(St.BoxLayout); _patchContainerClass(St.BoxLayout);
_patchLayoutClass(Clutter.TableLayout, { row_spacing: 'spacing-rows',
column_spacing: 'spacing-columns' });
_patchLayoutClass(Clutter.GridLayout, { row_spacing: 'spacing-rows', _patchLayoutClass(Clutter.GridLayout, { row_spacing: 'spacing-rows',
column_spacing: 'spacing-columns' }); column_spacing: 'spacing-columns' });
_patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' }); _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });
let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration; let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
Clutter.Actor.prototype.set_easing_duration = function (msecs) { Clutter.Actor.prototype.set_easing_duration = function(msecs) {
origSetEasingDuration.call(this, adjustAnimationTime(msecs)); origSetEasingDuration.call(this, adjustAnimationTime(msecs));
}; };
let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay; let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
Clutter.Actor.prototype.set_easing_delay = function (msecs) { Clutter.Actor.prototype.set_easing_delay = function(msecs) {
origSetEasingDelay.call(this, adjustAnimationTime(msecs)); origSetEasingDelay.call(this, adjustAnimationTime(msecs));
}; };
Clutter.Actor.prototype.ease = function (props, easingParams) { Clutter.Actor.prototype.ease = function(props, easingParams) {
_easeActor(this, props, easingParams); _easeActor(this, props, easingParams);
}; };
Clutter.Actor.prototype.ease_property = function (propName, target, params) { Clutter.Actor.prototype.ease_property = function(propName, target, params) {
_easeActorProperty(this, propName, target, params); _easeActorProperty(this, propName, target, params);
}; };
St.Adjustment.prototype.ease = function (target, params) { St.Adjustment.prototype.ease = function(target, params) {
// we're not an actor of course, but we implement the same // we're not an actor of course, but we implement the same
// transition API as Clutter.Actor, so this works anyway // transition API as Clutter.Actor, so this works anyway
_easeActorProperty(this, 'value', target, params); _easeActorProperty(this, 'value', target, params);
}; };
Clutter.Actor.prototype.toString = function () { Clutter.Actor.prototype.toString = function() {
return St.describe_actor(this); return St.describe_actor(this);
}; };
// Deprecation warning for former JS classes turned into an actor subclass // Deprecation warning for former JS classes turned into an actor subclass
@@ -269,17 +249,17 @@ function init() {
let { stack } = new Error(); let { stack } = new Error();
log(`Usage of object.actor is deprecated for ${klass}\n${stack}`); log(`Usage of object.actor is deprecated for ${klass}\n${stack}`);
return this; return this;
}, }
}); });
St.set_slow_down_factor = function (factor) { St.set_slow_down_factor = function(factor) {
let { stack } = new Error(); let { stack } = new Error();
log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`); log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
St.Settings.get().slow_down_factor = factor; St.Settings.get().slow_down_factor = factor;
}; };
let origToString = Object.prototype.toString; let origToString = Object.prototype.toString;
Object.prototype.toString = function () { Object.prototype.toString = function() {
let base = origToString.call(this); let base = origToString.call(this);
try { try {
if ('actor' in this && this.actor instanceof Clutter.Actor) if ('actor' in this && this.actor instanceof Clutter.Actor)
@@ -292,9 +272,8 @@ function init() {
}; };
// Work around https://bugzilla.mozilla.org/show_bug.cgi?id=508783 // Work around https://bugzilla.mozilla.org/show_bug.cgi?id=508783
Date.prototype.toLocaleFormat = function (format) { Date.prototype.toLocaleFormat = function(format) {
let dt = GLib.DateTime.new_from_unix_local(this.getTime() / 1000); return Shell.util_format_date(format, this.getTime());
return dt ? dt.format(format) : '';
}; };
let slowdownEnv = GLib.getenv('GNOME_SHELL_SLOWDOWN_FACTOR'); let slowdownEnv = GLib.getenv('GNOME_SHELL_SLOWDOWN_FACTOR');

View File

@@ -19,12 +19,12 @@ var REPOSITORY_URL_UPDATE = `${REPOSITORY_URL_BASE}/update-info/`;
let _httpSession; let _httpSession;
function installExtension(uuid, invocation) { function installExtension(uuid, invocation) {
let params = { uuid, let params = { uuid: uuid,
shell_version: Config.PACKAGE_VERSION }; shell_version: Config.PACKAGE_VERSION };
let message = Soup.form_request_new_from_hash('GET', REPOSITORY_URL_INFO, params); let message = Soup.form_request_new_from_hash('GET', REPOSITORY_URL_INFO, params);
_httpSession.queue_message(message, () => { _httpSession.queue_message(message, (session, message) => {
if (message.status_code != Soup.KnownStatusCode.OK) { if (message.status_code != Soup.KnownStatusCode.OK) {
Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`); Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString()); invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
@@ -90,7 +90,7 @@ function gotExtensionZipFile(session, message, uuid, dir, callback, errback) {
return; return;
} }
GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, (o, status) => { GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, (pid, status) => {
GLib.spawn_close_pid(pid); GLib.spawn_close_pid(pid);
if (status != 0) if (status != 0)
@@ -113,7 +113,7 @@ function updateExtension(uuid) {
let url = REPOSITORY_URL_DOWNLOAD.format(uuid); let url = REPOSITORY_URL_DOWNLOAD.format(uuid);
let message = Soup.form_request_new_from_hash('GET', url, params); let message = Soup.form_request_new_from_hash('GET', url, params);
_httpSession.queue_message(message, session => { _httpSession.queue_message(message, (session, message) => {
gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => { gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
let oldExtension = Main.extensionManager.lookup(uuid); let oldExtension = Main.extensionManager.lookup(uuid);
let extensionDir = oldExtension.dir; let extensionDir = oldExtension.dir;
@@ -145,8 +145,8 @@ function updateExtension(uuid) {
} }
FileUtils.recursivelyDeleteDir(oldExtensionTmpDir, true); FileUtils.recursivelyDeleteDir(oldExtensionTmpDir, true);
}, (code, msg) => { }, (code, message) => {
log(`Error while updating extension ${uuid}: ${code} (${msg})`); log('Error while updating extension %s: %s (%s)'.format(uuid, code, message ? message : ''));
}); });
}); });
} }
@@ -162,7 +162,7 @@ function checkForUpdates() {
let url = REPOSITORY_URL_UPDATE; let url = REPOSITORY_URL_UPDATE;
let message = Soup.form_request_new_from_hash('GET', url, params); let message = Soup.form_request_new_from_hash('GET', url, params);
_httpSession.queue_message(message, () => { _httpSession.queue_message(message, (session, message) => {
if (message.status_code != Soup.KnownStatusCode.OK) if (message.status_code != Soup.KnownStatusCode.OK)
return; return;
@@ -189,7 +189,7 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
this.setButtons([{ this.setButtons([{
label: _("Cancel"), label: _("Cancel"),
action: this._onCancelButtonPressed.bind(this), action: this._onCancelButtonPressed.bind(this),
key: Clutter.KEY_Escape, key: Clutter.Escape,
}, { }, {
label: _("Install"), label: _("Install"),
action: this._onInstallButtonPressed.bind(this), action: this._onInstallButtonPressed.bind(this),
@@ -199,8 +199,8 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
let content = new Dialog.MessageDialogContent({ let content = new Dialog.MessageDialogContent({
title: _("Download and install “%s” from extensions.gnome.org?").format(info.name), title: _("Download and install “%s” from extensions.gnome.org?").format(info.name),
icon: new Gio.FileIcon({ icon: new Gio.FileIcon({
file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`), file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`)
}), })
}); });
this.contentLayout.add(content); this.contentLayout.add(content);
@@ -220,9 +220,10 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
let uuid = this._uuid; let uuid = this._uuid;
let dir = Gio.File.new_for_path(GLib.build_filenamev([global.userdatadir, 'extensions', uuid])); let dir = Gio.File.new_for_path(GLib.build_filenamev([global.userdatadir, 'extensions', uuid]));
let invocation = this._invocation; let invocation = this._invocation;
function errback(code, msg) { function errback(code, message) {
log(`Error while installing ${uuid}: ${code} (${msg})`); let msg = message ? message.toString() : '';
invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg || ''); log('Error while installing %s: %s (%s)'.format(uuid, code, msg));
invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg);
} }
function callback() { function callback() {
@@ -240,7 +241,7 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
invocation.return_value(GLib.Variant.new('(s)', ['successful'])); invocation.return_value(GLib.Variant.new('(s)', ['successful']));
} }
_httpSession.queue_message(message, session => { _httpSession.queue_message(message, (session, message) => {
gotExtensionZipFile(session, message, uuid, dir, callback, errback); gotExtensionZipFile(session, message, uuid, dir, callback, errback);
}); });

View File

@@ -1,7 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported init connect disconnect */ /* exported init connect disconnect */
const { GLib, Gio, St } = imports.gi; const { Gio, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
const ExtensionUtils = imports.misc.extensionUtils; const ExtensionUtils = imports.misc.extensionUtils;
@@ -28,23 +28,6 @@ var ExtensionManager = class {
} }
init() { init() {
// The following file should exist for a period of time when extensions
// are enabled after start. If it exists, then the systemd unit will
// disable extensions should gnome-shell crash.
// Should the file already exist from a previous login, then this is OK.
let disableFilename = GLib.build_filenamev([GLib.get_user_runtime_dir(), 'gnome-shell-disable-extensions']);
let disableFile = Gio.File.new_for_path(disableFilename);
try {
disableFile.create(Gio.FileCreateFlags.REPLACE_DESTINATION, null);
} catch (e) {
log(`Failed to create file ${disableFilename}: ${e.message}`);
}
GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 60, () => {
disableFile.delete(null);
return GLib.SOURCE_REMOVE;
});
this._sessionUpdated(); this._sessionUpdated();
} }
@@ -77,11 +60,11 @@ var ExtensionManager = class {
let orderReversed = order.slice().reverse(); let orderReversed = order.slice().reverse();
for (let i = 0; i < orderReversed.length; i++) { for (let i = 0; i < orderReversed.length; i++) {
let otherUuid = orderReversed[i]; let uuid = orderReversed[i];
try { try {
this.lookup(otherUuid).stateObj.disable(); this.lookup(uuid).stateObj.disable();
} catch (e) { } catch (e) {
this.logExtensionError(otherUuid, e); this.logExtensionError(uuid, e);
} }
} }
@@ -98,11 +81,11 @@ var ExtensionManager = class {
} }
for (let i = 0; i < order.length; i++) { for (let i = 0; i < order.length; i++) {
let otherUuid = order[i]; let uuid = order[i];
try { try {
this.lookup(otherUuid).stateObj.enable(); this.lookup(uuid).stateObj.enable();
} catch (e) { } catch (e) {
this.logExtensionError(otherUuid, e); this.logExtensionError(uuid, e);
} }
} }
@@ -217,8 +200,9 @@ var ExtensionManager = class {
createExtensionObject(uuid, dir, type) { createExtensionObject(uuid, dir, type) {
let metadataFile = dir.get_child('metadata.json'); let metadataFile = dir.get_child('metadata.json');
if (!metadataFile.query_exists(null)) if (!metadataFile.query_exists(null)) {
throw new Error('Missing metadata.json'); throw new Error('Missing metadata.json');
}
let metadataContents, success_; let metadataContents, success_;
try { try {
@@ -238,12 +222,14 @@ var ExtensionManager = class {
let requiredProperties = ['uuid', 'name', 'description', 'shell-version']; let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
for (let i = 0; i < requiredProperties.length; i++) { for (let i = 0; i < requiredProperties.length; i++) {
let prop = requiredProperties[i]; let prop = requiredProperties[i];
if (!meta[prop]) if (!meta[prop]) {
throw new Error(`missing "${prop}" property in metadata.json`); throw new Error(`missing "${prop}" property in metadata.json`);
}
} }
if (uuid != meta.uuid) if (uuid != meta.uuid) {
throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`); throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
}
let extension = { let extension = {
metadata: meta, metadata: meta,
@@ -253,7 +239,7 @@ var ExtensionManager = class {
path: dir.get_path(), path: dir.get_path(),
error: '', error: '',
hasPrefs: dir.get_child('prefs.js').query_exists(null), hasPrefs: dir.get_child('prefs.js').query_exists(null),
canChange: false, canChange: false
}; };
this._extensions.set(uuid, extension); this._extensions.set(uuid, extension);

View File

@@ -195,7 +195,7 @@ var GrabHelper = class GrabHelper {
} }
_takeModalGrab() { _takeModalGrab() {
let firstGrab = this._modalCount == 0; let firstGrab = (this._modalCount == 0);
if (firstGrab) { if (firstGrab) {
if (!Main.pushModal(this._owner, this._modalParams)) if (!Main.pushModal(this._owner, this._modalParams))
return false; return false;
@@ -292,7 +292,7 @@ var GrabHelper = class GrabHelper {
let touchEnd = type == Clutter.EventType.TOUCH_END; let touchEnd = type == Clutter.EventType.TOUCH_END;
let touch = touchUpdate || touchBegin || touchEnd; let touch = touchUpdate || touchBegin || touchEnd;
if (touch && !global.display.is_pointer_emulating_sequence(event.get_event_sequence())) if (touch && !global.display.is_pointer_emulating_sequence (event.get_event_sequence()))
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
if (this._ignoreUntilRelease && (motion || release || touch)) { if (this._ignoreUntilRelease && (motion || release || touch)) {

View File

@@ -20,13 +20,13 @@ var CandidateArea = GObject.registerClass({
'cursor-up': {}, 'cursor-up': {},
'next-page': {}, 'next-page': {},
'previous-page': {}, 'previous-page': {},
}, }
}, class CandidateArea extends St.BoxLayout { }, class CandidateArea extends St.BoxLayout {
_init() { _init() {
super._init({ super._init({
vertical: true, vertical: true,
reactive: true, reactive: true,
visible: false, visible: false
}); });
this._candidateBoxes = []; this._candidateBoxes = [];
for (let i = 0; i < MAX_CANDIDATES_PER_PAGE; ++i) { for (let i = 0; i < MAX_CANDIDATES_PER_PAGE; ++i) {
@@ -35,8 +35,8 @@ var CandidateArea = GObject.registerClass({
track_hover: true }); track_hover: true });
box._indexLabel = new St.Label({ style_class: 'candidate-index' }); box._indexLabel = new St.Label({ style_class: 'candidate-index' });
box._candidateLabel = new St.Label({ style_class: 'candidate-label' }); box._candidateLabel = new St.Label({ style_class: 'candidate-label' });
box.add_child(box._indexLabel); box.add(box._indexLabel, { y_fill: false });
box.add_child(box._candidateLabel); box.add(box._candidateLabel, { y_fill: false });
this._candidateBoxes.push(box); this._candidateBoxes.push(box);
this.add(box); this.add(box);
@@ -49,19 +49,13 @@ var CandidateArea = GObject.registerClass({
this._buttonBox = new St.BoxLayout({ style_class: 'candidate-page-button-box' }); this._buttonBox = new St.BoxLayout({ style_class: 'candidate-page-button-box' });
this._previousButton = new St.Button({ this._previousButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-previous button' });
style_class: 'candidate-page-button candidate-page-button-previous button',
x_expand: true,
});
this._previousButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' }); this._previousButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' });
this._buttonBox.add_child(this._previousButton); this._buttonBox.add(this._previousButton, { expand: true });
this._nextButton = new St.Button({ this._nextButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-next button' });
style_class: 'candidate-page-button candidate-page-button-next button',
x_expand: true,
});
this._nextButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' }); this._nextButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' });
this._buttonBox.add_child(this._nextButton); this._buttonBox.add(this._nextButton, { expand: true });
this.add(this._buttonBox); this.add(this._buttonBox);
@@ -118,7 +112,7 @@ var CandidateArea = GObject.registerClass({
if (!visible) if (!visible)
continue; continue;
box._indexLabel.text = indexes && indexes[i] ? indexes[i] : DEFAULT_INDEX_LABELS[i]; box._indexLabel.text = ((indexes && indexes[i]) ? indexes[i] : DEFAULT_INDEX_LABELS[i]);
box._candidateLabel.text = candidates[i]; box._candidateLabel.text = candidates[i];
} }
@@ -215,10 +209,9 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer {
this._preeditText.text = text.get_text(); this._preeditText.text = text.get_text();
let attrs = text.get_attributes(); let attrs = text.get_attributes();
if (attrs) { if (attrs)
this._setTextAttributes(this._preeditText.clutter_text, this._setTextAttributes(this._preeditText.clutter_text,
attrs); attrs);
}
}); });
panelService.connect('show-preedit-text', () => { panelService.connect('show-preedit-text', () => {
this._preeditText.show(); this._preeditText.show();
@@ -250,7 +243,7 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer {
let cursorPos = lookupTable.get_cursor_pos(); let cursorPos = lookupTable.get_cursor_pos();
let pageSize = lookupTable.get_page_size(); let pageSize = lookupTable.get_page_size();
let nPages = Math.ceil(nCandidates / pageSize); let nPages = Math.ceil(nCandidates / pageSize);
let page = cursorPos == 0 ? 0 : Math.floor(cursorPos / pageSize); let page = ((cursorPos == 0) ? 0 : Math.floor(cursorPos / pageSize));
let startIndex = page * pageSize; let startIndex = page * pageSize;
let endIndex = Math.min((page + 1) * pageSize, nCandidates); let endIndex = Math.min((page + 1) * pageSize, nCandidates);
@@ -301,15 +294,15 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer {
} }
_updateVisibility() { _updateVisibility() {
let isVisible = !Main.keyboard.visible && let isVisible = (!Main.keyboard.visible &&
(this._preeditText.visible || (this._preeditText.visible ||
this._auxText.visible || this._auxText.visible ||
this._candidateArea.visible); this._candidateArea.visible));
if (isVisible) { if (isVisible) {
this.setPosition(this._dummyCursor, 0); this.setPosition(this._dummyCursor, 0);
this.open(BoxPointer.PopupAnimation.NONE); this.open(BoxPointer.PopupAnimation.NONE);
this.get_parent().set_child_above_sibling(this, null); this.raise_top();
} else { } else {
this.close(BoxPointer.PopupAnimation.NONE); this.close(BoxPointer.PopupAnimation.NONE);
} }
@@ -317,9 +310,8 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer {
_setTextAttributes(clutterText, ibusAttrList) { _setTextAttributes(clutterText, ibusAttrList) {
let attr; let attr;
for (let i = 0; (attr = ibusAttrList.get(i)); ++i) { for (let i = 0; (attr = ibusAttrList.get(i)); ++i)
if (attr.get_attr_type() == IBus.AttrType.BACKGROUND) if (attr.get_attr_type() == IBus.AttrType.BACKGROUND)
clutterText.set_selection(attr.get_start_index(), attr.get_end_index()); clutterText.set_selection(attr.get_start_index(), attr.get_end_index());
}
} }
}); });

View File

@@ -22,7 +22,7 @@ var ANIMATION_BOUNCE_ICON_SCALE = 1.1;
var AnimationDirection = { var AnimationDirection = {
IN: 0, IN: 0,
OUT: 1, OUT: 1
}; };
var APPICON_ANIMATION_OUT_SCALE = 3; var APPICON_ANIMATION_OUT_SCALE = 3;
@@ -39,19 +39,18 @@ class BaseIcon extends St.Bin {
if (params.showLabel) if (params.showLabel)
styleClass += ' overview-icon-with-label'; styleClass += ' overview-icon-with-label';
super._init({ style_class: styleClass }); super._init({ style_class: styleClass,
x_fill: true,
y_fill: true });
this.connect('destroy', this._onDestroy.bind(this)); this.connect('destroy', this._onDestroy.bind(this));
this._box = new St.BoxLayout({ this._box = new St.BoxLayout({ vertical: true });
vertical: true,
x_expand: true,
y_expand: true,
});
this.set_child(this._box); this.set_child(this._box);
this.iconSize = ICON_SIZE; this.iconSize = ICON_SIZE;
this._iconBin = new St.Bin(); this._iconBin = new St.Bin({ x_align: St.Align.MIDDLE,
y_align: St.Align.MIDDLE });
this._box.add_actor(this._iconBin); this._box.add_actor(this._iconBin);
@@ -59,7 +58,7 @@ class BaseIcon extends St.Bin {
this.label = new St.Label({ text: label }); this.label = new St.Label({ text: label });
this.label.clutter_text.set({ this.label.clutter_text.set({
x_align: Clutter.ActorAlign.CENTER, x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER, y_align: Clutter.ActorAlign.CENTER
}); });
this._box.add_actor(this.label); this._box.add_actor(this.label);
} else { } else {
@@ -190,7 +189,7 @@ function zoomOutActorAtPos(actor, x, y) {
opacity: 0, opacity: 0,
duration: APPICON_ANIMATION_OUT_TIME, duration: APPICON_ANIMATION_OUT_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => actorClone.destroy(), onComplete: () => actorClone.destroy()
}); });
} }
@@ -246,7 +245,7 @@ var IconGrid = GObject.registerClass({
_onDestroy() { _onDestroy() {
if (this._updateIconSizesLaterId) { if (this._updateIconSizesLaterId) {
Meta.later_remove(this._updateIconSizesLaterId); Meta.later_remove (this._updateIconSizesLaterId);
this._updateIconSizesLaterId = 0; this._updateIconSizesLaterId = 0;
} }
} }
@@ -432,7 +431,7 @@ var IconGrid = GObject.registerClass({
return true; return true;
} }
/* /**
* Intended to be override by subclasses if they need a different * Intended to be override by subclasses if they need a different
* set of items to be animated. * set of items to be animated.
*/ */
@@ -455,10 +454,9 @@ var IconGrid = GObject.registerClass({
} }
animatePulse(animationDirection) { animatePulse(animationDirection) {
if (animationDirection != AnimationDirection.IN) { if (animationDirection != AnimationDirection.IN)
throw new GObject.NotImplementedError("Pulse animation only implements " + throw new GObject.NotImplementedError("Pulse animation only implements " +
"'in' animation direction"); "'in' animation direction");
}
this._resetAnimationActors(); this._resetAnimationActors();
@@ -488,7 +486,7 @@ var IconGrid = GObject.registerClass({
scale_y: ANIMATION_BOUNCE_ICON_SCALE, scale_y: ANIMATION_BOUNCE_ICON_SCALE,
duration: bounceUpTime, duration: bounceUpTime,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay, delay: delay,
onComplete: () => { onComplete: () => {
let duration = ANIMATION_TIME_IN - bounceUpTime; let duration = ANIMATION_TIME_IN - bounceUpTime;
actor.ease({ actor.ease({
@@ -500,9 +498,9 @@ var IconGrid = GObject.registerClass({
if (isLastItem) if (isLastItem)
this._animationDone(); this._animationDone();
actor.reactive = true; actor.reactive = true;
}, }
}); });
}, }
}); });
} }
} }
@@ -569,7 +567,7 @@ var IconGrid = GObject.registerClass({
scale_y: 1, scale_y: 1,
duration: ANIMATION_TIME_IN, duration: ANIMATION_TIME_IN,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay, delay
}; };
if (isLastItem) if (isLastItem)
@@ -579,7 +577,7 @@ var IconGrid = GObject.registerClass({
opacity: 255, opacity: 255,
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM, duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay, delay
}; };
} else { } else {
let isLastItem = actor._distance == maxDist; let isLastItem = actor._distance == maxDist;
@@ -595,7 +593,7 @@ var IconGrid = GObject.registerClass({
scale_y: scaleY, scale_y: scaleY,
duration: ANIMATION_TIME_OUT, duration: ANIMATION_TIME_OUT,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay, delay
}; };
if (isLastItem) if (isLastItem)
@@ -605,7 +603,7 @@ var IconGrid = GObject.registerClass({
opacity: 0, opacity: 0,
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM, duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM, delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
}; };
} }
@@ -678,8 +676,8 @@ var IconGrid = GObject.registerClass({
nRows(forWidth) { nRows(forWidth) {
let children = this._getVisibleChildren(); let children = this._getVisibleChildren();
let nColumns = forWidth < 0 ? children.length : this._computeLayout(forWidth)[0]; let nColumns = (forWidth < 0) ? children.length : this._computeLayout(forWidth)[0];
let nRows = nColumns > 0 ? Math.ceil(children.length / nColumns) : 0; let nRows = (nColumns > 0) ? Math.ceil(children.length / nColumns) : 0;
if (this._rowLimit) if (this._rowLimit)
nRows = Math.min(nRows, this._rowLimit); nRows = Math.min(nRows, this._rowLimit);
return nRows; return nRows;
@@ -785,7 +783,7 @@ var IconGrid = GObject.registerClass({
this.topPadding = this.rightPadding = this.bottomPadding = this.leftPadding = spacing; this.topPadding = this.rightPadding = this.bottomPadding = this.leftPadding = spacing;
} }
/* /**
* This function must to be called before iconGrid allocation, * This function must to be called before iconGrid allocation,
* to know how much spacing can the grid has * to know how much spacing can the grid has
*/ */
@@ -798,7 +796,7 @@ var IconGrid = GObject.registerClass({
let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth; let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth;
let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight; let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight;
let neededSpacePerItem = neededWidth > neededHeight let neededSpacePerItem = (neededWidth > neededHeight)
? Math.ceil(neededWidth / this._minColumns) ? Math.ceil(neededWidth / this._minColumns)
: Math.ceil(neededHeight / this._minRows); : Math.ceil(neededHeight / this._minRows);
this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE); this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE);
@@ -806,10 +804,9 @@ var IconGrid = GObject.registerClass({
this._updateSpacingForSize(availWidth, availHeight); this._updateSpacingForSize(availWidth, availHeight);
} }
if (!this._updateIconSizesLaterId) { if (!this._updateIconSizesLaterId)
this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW, this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
this._updateIconSizes.bind(this)); this._updateIconSizes.bind(this));
}
} }
// Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
@@ -817,9 +814,9 @@ var IconGrid = GObject.registerClass({
this._updateIconSizesLaterId = 0; this._updateIconSizesLaterId = 0;
let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize); let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
let newIconSize = Math.floor(ICON_SIZE * scale); let newIconSize = Math.floor(ICON_SIZE * scale);
for (let i in this._items) for (let i in this._items) {
this._items[i].icon.setIconSize(newIconSize); this._items[i].icon.setIconSize(newIconSize);
}
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
} }
}); });
@@ -881,9 +878,9 @@ var PaginatedIconGrid = GObject.registerClass({
children[i].show(); children[i].show();
columnIndex++; columnIndex++;
if (columnIndex == nColumns) if (columnIndex == nColumns) {
columnIndex = 0; columnIndex = 0;
}
if (columnIndex == 0) { if (columnIndex == 0) {
y += this._getVItemSize() + spacing; y += this._getVItemSize() + spacing;
if ((i + 1) % this._childrenPerPage == 0) if ((i + 1) % this._childrenPerPage == 0)
@@ -958,10 +955,9 @@ var PaginatedIconGrid = GObject.registerClass({
/** /**
* openExtraSpace: * openExtraSpace:
* @param {Clutter.Actor} sourceItem: item for which to create extra space * @sourceItem: the item for which to create extra space
* @param {St.Side} side: where @sourceItem should be located relative to * @side: where @sourceItem should be located relative to the created space
* the created space * @nRows: the amount of space to create
* @param {number} nRows: the amount of space to create
* *
* Pan view to create extra space for @nRows above or below @sourceItem. * Pan view to create extra space for @nRows above or below @sourceItem.
*/ */
@@ -977,7 +973,7 @@ var PaginatedIconGrid = GObject.registerClass({
let childrenPerRow = this._childrenPerPage / this._rowsPerPage; let childrenPerRow = this._childrenPerPage / this._rowsPerPage;
let sourceRow = Math.floor((index - pageOffset) / childrenPerRow); let sourceRow = Math.floor((index - pageOffset) / childrenPerRow);
let nRowsAbove = side == St.Side.TOP ? sourceRow + 1 : sourceRow; let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1 : sourceRow;
let nRowsBelow = this._rowsPerPage - nRowsAbove; let nRowsBelow = this._rowsPerPage - nRowsAbove;
let nRowsUp, nRowsDown; let nRowsUp, nRowsDown;
@@ -1020,7 +1016,7 @@ var PaginatedIconGrid = GObject.registerClass({
let params = { let params = {
translation_y: translationY, translation_y: translationY,
duration: EXTRA_SPACE_ANIMATION_TIME, duration: EXTRA_SPACE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD
}; };
if (i == (children.length - 1)) if (i == (children.length - 1))
params.onComplete = () => this.emit('space-opened'); params.onComplete = () => this.emit('space-opened');
@@ -1041,7 +1037,7 @@ var PaginatedIconGrid = GObject.registerClass({
translation_y: 0, translation_y: 0,
duration: EXTRA_SPACE_ANIMATION_TIME, duration: EXTRA_SPACE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
onComplete: () => this.emit('space-closed'), onComplete: () => this.emit('space-closed')
}); });
} }
} }

View File

@@ -18,8 +18,8 @@ var DialogResponse = Meta.InhibitShortcutsDialogResponse;
var InhibitShortcutsDialog = GObject.registerClass({ var InhibitShortcutsDialog = GObject.registerClass({
Implements: [Meta.InhibitShortcutsDialog], Implements: [Meta.InhibitShortcutsDialog],
Properties: { Properties: {
'window': GObject.ParamSpec.override('window', Meta.InhibitShortcutsDialog), 'window': GObject.ParamSpec.override('window', Meta.InhibitShortcutsDialog)
}, }
}, class InhibitShortcutsDialog extends GObject.Object { }, class InhibitShortcutsDialog extends GObject.Object {
_init(window) { _init(window) {
super._init(); super._init();
@@ -84,11 +84,10 @@ var InhibitShortcutsDialog = GObject.registerClass({
let contentParams = { icon, title }; let contentParams = { icon, title };
let restoreAccel = this._getRestoreAccel(); let restoreAccel = this._getRestoreAccel();
if (restoreAccel) { if (restoreAccel)
contentParams.subtitle = contentParams.subtitle =
/* Translators: %s is a keyboard shortcut like "Super+x" */ /* Translators: %s is a keyboard shortcut like "Super+x" */
_("You can restore shortcuts by pressing %s.").format(restoreAccel); _("You can restore shortcuts by pressing %s.").format(restoreAccel);
}
let content = new Dialog.MessageDialogContent(contentParams); let content = new Dialog.MessageDialogContent(contentParams);
this._dialog.contentLayout.add_actor(content); this._dialog.contentLayout.add_actor(content);
@@ -135,10 +134,10 @@ var InhibitShortcutsDialog = GObject.registerClass({
this._permStore.LookupRemote(APP_PERMISSIONS_TABLE, this._permStore.LookupRemote(APP_PERMISSIONS_TABLE,
APP_PERMISSIONS_ID, APP_PERMISSIONS_ID,
(res, err) => { (res, error) => {
if (err) { if (error) {
this._dialog.open(); this._dialog.open();
log(err.message); log(error.message);
return; return;
} }

View File

@@ -61,7 +61,7 @@ class KbdA11yDialog extends GObject.Object {
dialog.close(); dialog.close();
}, },
default: enabled, default: enabled,
key: !enabled ? Clutter.KEY_Escape : null }); key: !enabled ? Clutter.Escape : null });
dialog.addButton({ label: enabled ? _("Turn Off") : _("Leave Off"), dialog.addButton({ label: enabled ? _("Turn Off") : _("Leave Off"),
action: () => { action: () => {
@@ -69,7 +69,7 @@ class KbdA11yDialog extends GObject.Object {
dialog.close(); dialog.close();
}, },
default: !enabled, default: !enabled,
key: enabled ? Clutter.KEY_Escape : null }); key: enabled ? Clutter.Escape : null });
dialog.open(); dialog.open();
} }

View File

@@ -92,7 +92,7 @@ class KeyContainer extends St.Widget {
super._init({ super._init({
layout_manager: gridLayout, layout_manager: gridLayout,
x_expand: true, x_expand: true,
y_expand: true, y_expand: true
}); });
this._gridLayout = gridLayout; this._gridLayout = gridLayout;
this._currentRow = 0; this._currentRow = 0;
@@ -120,7 +120,7 @@ class KeyContainer extends St.Widget {
left: this._currentCol, left: this._currentCol,
top: this._currentRow, top: this._currentRow,
width, width,
height, height
}; };
let row = this._rows[this._rows.length - 1]; let row = this._rows[this._rows.length - 1];
@@ -167,11 +167,7 @@ class KeyContainer extends St.Widget {
var Suggestions = GObject.registerClass( var Suggestions = GObject.registerClass(
class Suggestions extends St.BoxLayout { class Suggestions extends St.BoxLayout {
_init() { _init() {
super._init({ super._init({ style_class: 'word-suggestions', vertical: false });
style_class: 'word-suggestions',
vertical: false,
x_align: Clutter.ActorAlign.CENTER,
});
this.show(); this.show();
} }
@@ -255,7 +251,7 @@ var Key = GObject.registerClass({
'long-press': {}, 'long-press': {},
'pressed': { param_types: [GObject.TYPE_UINT, GObject.TYPE_STRING] }, 'pressed': { param_types: [GObject.TYPE_UINT, GObject.TYPE_STRING] },
'released': { param_types: [GObject.TYPE_UINT, GObject.TYPE_STRING] }, 'released': { param_types: [GObject.TYPE_UINT, GObject.TYPE_STRING] },
}, }
}, class Key extends St.BoxLayout { }, class Key extends St.BoxLayout {
_init(key, extendedKeys) { _init(key, extendedKeys) {
super._init({ style_class: 'key-container' }); super._init({ style_class: 'key-container' });
@@ -266,11 +262,11 @@ var Key = GObject.registerClass({
/* Add the key in a container, so keys can be padded without losing /* Add the key in a container, so keys can be padded without losing
* logical proportions between those. * logical proportions between those.
*/ */
this.add_child(this.keyButton); this.add(this.keyButton, { expand: true, x_fill: true });
this.connect('destroy', this._onDestroy.bind(this)); this.connect('destroy', this._onDestroy.bind(this));
this._extendedKeys = extendedKeys; this._extended_keys = extendedKeys;
this._extendedKeyboard = null; this._extended_keyboard = null;
this._pressTimeoutId = 0; this._pressTimeoutId = 0;
this._capturedPress = false; this._capturedPress = false;
@@ -289,13 +285,13 @@ var Key = GObject.registerClass({
} }
_ensureExtendedKeysPopup() { _ensureExtendedKeysPopup() {
if (this._extendedKeys.length === 0) if (this._extended_keys.length == 0)
return; return;
if (this._boxPointer) this._boxPointer = new BoxPointer.BoxPointer(St.Side.BOTTOM,
return; { x_fill: true,
y_fill: true,
this._boxPointer = new BoxPointer.BoxPointer(St.Side.BOTTOM); x_align: St.Align.START });
this._boxPointer.hide(); this._boxPointer.hide();
Main.layoutManager.addTopChrome(this._boxPointer); Main.layoutManager.addTopChrome(this._boxPointer);
this._boxPointer.setPosition(this.keyButton, 0.5); this._boxPointer.setPosition(this.keyButton, 0.5);
@@ -303,7 +299,7 @@ var Key = GObject.registerClass({
// Adds style to existing keyboard style to avoid repetition // Adds style to existing keyboard style to avoid repetition
this._boxPointer.add_style_class_name('keyboard-subkeys'); this._boxPointer.add_style_class_name('keyboard-subkeys');
this._getExtendedKeys(); this._getExtendedKeys();
this.keyButton._extendedKeys = this._extendedKeyboard; this.keyButton._extended_keys = this._extended_keyboard;
} }
_getKeyval(key) { _getKeyval(key) {
@@ -314,28 +310,29 @@ var Key = GObject.registerClass({
_press(key) { _press(key) {
this.emit('activated'); this.emit('activated');
if (key !== this.key || this._extendedKeys.length === 0) if (key != this.key || this._extended_keys.length == 0) {
this.emit('pressed', this._getKeyval(key), key); this.emit('pressed', this._getKeyval(key), key);
}
if (key == this.key) { if (key == this.key) {
this._pressTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, this._pressTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT,
KEY_LONG_PRESS_TIME, KEY_LONG_PRESS_TIME,
() => { () => {
this._longPress = true; this._longPress = true;
this._pressTimeoutId = 0; this._pressTimeoutId = 0;
this.emit('long-press'); this.emit('long-press');
if (this._extendedKeys.length > 0) { if (this._extended_keys.length > 0) {
this._touchPressed = false; this._touchPressed = false;
this._ensureExtendedKeysPopup(); this.keyButton.set_hover(false);
this.keyButton.set_hover(false); this.keyButton.fake_release();
this.keyButton.fake_release(); this._ensureExtendedKeysPopup();
this._showSubkeys(); this._showSubkeys();
} }
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
}); });
} }
} }
@@ -345,7 +342,7 @@ var Key = GObject.registerClass({
this._pressTimeoutId = 0; this._pressTimeoutId = 0;
} }
if (!this._longPress && key === this.key && this._extendedKeys.length > 0) if (!this._longPress && key == this.key && this._extended_keys.length > 0)
this.emit('pressed', this._getKeyval(key), key); this.emit('pressed', this._getKeyval(key), key);
this.emit('released', this._getKeyval(key), key); this.emit('released', this._getKeyval(key), key);
@@ -365,8 +362,8 @@ var Key = GObject.registerClass({
_onCapturedEvent(actor, event) { _onCapturedEvent(actor, event) {
let type = event.type(); let type = event.type();
let press = type == Clutter.EventType.BUTTON_PRESS || type == Clutter.EventType.TOUCH_BEGIN; let press = (type == Clutter.EventType.BUTTON_PRESS || type == Clutter.EventType.TOUCH_BEGIN);
let release = type == Clutter.EventType.BUTTON_RELEASE || type == Clutter.EventType.TOUCH_END; let release = (type == Clutter.EventType.BUTTON_RELEASE || type == Clutter.EventType.TOUCH_END);
if (event.get_source() == this._boxPointer.bin || if (event.get_source() == this._boxPointer.bin ||
this._boxPointer.bin.contains(event.get_source())) this._boxPointer.bin.contains(event.get_source()))
@@ -406,11 +403,8 @@ var Key = GObject.registerClass({
_makeKey(key) { _makeKey(key) {
let label = GLib.markup_escape_text(key, -1); let label = GLib.markup_escape_text(key, -1);
let button = new St.Button({ let button = new St.Button ({ label: label,
label, style_class: 'keyboard-key' });
style_class: 'keyboard-key',
x_expand: true,
});
button.keyWidth = 1; button.keyWidth = 1;
button.connect('button-press-event', () => { button.connect('button-press-event', () => {
@@ -448,22 +442,19 @@ var Key = GObject.registerClass({
} }
_getExtendedKeys() { _getExtendedKeys() {
this._extendedKeyboard = new St.BoxLayout({ this._extended_keyboard = new St.BoxLayout({ style_class: 'key-container',
style_class: 'key-container', vertical: false });
vertical: false, for (let i = 0; i < this._extended_keys.length; ++i) {
}); let extendedKey = this._extended_keys[i];
for (let i = 0; i < this._extendedKeys.length; ++i) {
let extendedKey = this._extendedKeys[i];
let key = this._makeKey(extendedKey); let key = this._makeKey(extendedKey);
key.extendedKey = extendedKey; key.extended_key = extendedKey;
this._extendedKeyboard.add(key); this._extended_keyboard.add(key);
key.set_size(...this.keyButton.allocation.get_size()); key.width = this.keyButton.width;
this.keyButton.connect('notify::allocation', key.height = this.keyButton.height;
() => key.set_size(...this.keyButton.allocation.get_size()));
} }
this._boxPointer.bin.add_actor(this._extendedKeyboard); this._boxPointer.bin.add_actor(this._extended_keyboard);
} }
get subkeys() { get subkeys() {
@@ -484,17 +475,10 @@ var Key = GObject.registerClass({
var KeyboardModel = class { var KeyboardModel = class {
constructor(groupName) { constructor(groupName) {
let names = [groupName]; try {
if (names.includes('+')) this._model = this._loadModel(groupName);
names.push(groupName.replace(/\+.*/, '')); } catch (e) {
names.push('us'); this._model = this._loadModel('us');
for (let i = 0; i < names.length; i++) {
try {
this._model = this._loadModel(names[i]);
break;
} catch (e) {
}
} }
} }
@@ -600,20 +584,20 @@ var EmojiPager = GObject.registerClass({
'delta': GObject.ParamSpec.int( 'delta': GObject.ParamSpec.int(
'delta', 'delta', 'delta', 'delta', 'delta', 'delta',
GObject.ParamFlags.READWRITE, GObject.ParamFlags.READWRITE,
GLib.MININT32, GLib.MAXINT32, 0), GLib.MININT32, GLib.MAXINT32, 0)
}, },
Signals: { Signals: {
'emoji': { param_types: [GObject.TYPE_STRING] }, 'emoji': { param_types: [GObject.TYPE_STRING] },
'page-changed': { 'page-changed': {
param_types: [GObject.TYPE_INT, GObject.TYPE_INT, GObject.TYPE_INT], param_types: [GObject.TYPE_INT, GObject.TYPE_INT, GObject.TYPE_INT]
}, }
}, }
}, class EmojiPager extends St.Widget { }, class EmojiPager extends St.Widget {
_init(sections, nCols, nRows) { _init(sections, nCols, nRows) {
super._init({ super._init({
layout_manager: new Clutter.BinLayout(), layout_manager: new Clutter.BinLayout(),
reactive: true, reactive: true,
clip_to_allocation: true, clip_to_allocation: true
}); });
this._sections = sections; this._sections = sections;
this._nCols = nCols; this._nCols = nCols;
@@ -741,7 +725,7 @@ var EmojiPager = GObject.registerClass({
duration: time, duration: time,
onComplete: () => { onComplete: () => {
this.setCurrentPage(this.getFollowingPage()); this.setCurrentPage(this.getFollowingPage());
}, }
}); });
} }
} }
@@ -887,14 +871,14 @@ var EmojiSelection = GObject.registerClass({
'emoji-selected': { param_types: [GObject.TYPE_STRING] }, 'emoji-selected': { param_types: [GObject.TYPE_STRING] },
'close-request': {}, 'close-request': {},
'toggle': {}, 'toggle': {},
}, }
}, class EmojiSelection extends St.BoxLayout { }, class EmojiSelection extends St.BoxLayout {
_init() { _init() {
super._init({ super._init({
style_class: 'emoji-panel', style_class: 'emoji-panel',
x_expand: true, x_expand: true,
y_expand: true, y_expand: true,
vertical: true, vertical: true
}); });
this._sections = [ this._sections = [
@@ -918,22 +902,17 @@ var EmojiSelection = GObject.registerClass({
this._emojiPager.connect('emoji', (pager, str) => { this._emojiPager.connect('emoji', (pager, str) => {
this.emit('emoji-selected', str); this.emit('emoji-selected', str);
}); });
this.add_child(this._emojiPager); this.add(this._emojiPager, { expand: true });
this._pageIndicator = new PageIndicators.PageIndicators( this._pageIndicator = new PageIndicators.PageIndicators(
Clutter.Orientation.HORIZONTAL Clutter.Orientation.HORIZONTAL
); );
this.add_child(this._pageIndicator); this.add(this._pageIndicator, { expand: true, x_fill: false, y_fill: false });
this._pageIndicator.setReactive(false); this._pageIndicator.setReactive(false);
this._emojiPager.connect('notify::delta', () => {
this._updateIndicatorPosition();
});
let bottomRow = this._createBottomRow(); let bottomRow = this._createBottomRow();
this.add_child(bottomRow); this.add(bottomRow, { expand: true, x_fill: false, y_fill: false });
this._curPage = 0;
this._emojiPager.setCurrentPage(0); this._emojiPager.setCurrentPage(0);
} }
@@ -948,9 +927,8 @@ var EmojiSelection = GObject.registerClass({
} }
_onPageChanged(sectionLabel, page, nPages) { _onPageChanged(sectionLabel, page, nPages) {
this._curPage = page;
this._pageIndicator.setNPages(nPages); this._pageIndicator.setNPages(nPages);
this._updateIndicatorPosition(); this._pageIndicator.setCurrentPage(page);
for (let i = 0; i < this._sections.length; i++) { for (let i = 0; i < this._sections.length; i++) {
let sect = this._sections[i]; let sect = this._sections[i];
@@ -958,11 +936,6 @@ var EmojiSelection = GObject.registerClass({
} }
} }
_updateIndicatorPosition() {
this._pageIndicator.setCurrentPosition(this._curPage -
this._emojiPager.delta / this._emojiPager.width);
}
_findSection(emoji) { _findSection(emoji) {
for (let i = 0; i < this._sections.length; i++) { for (let i = 0; i < this._sections.length; i++) {
if (this._sections[i].first == emoji) if (this._sections[i].first == emoji)
@@ -1052,7 +1025,7 @@ var EmojiSelection = GObject.registerClass({
var Keypad = GObject.registerClass({ var Keypad = GObject.registerClass({
Signals: { Signals: {
'keyval': { param_types: [GObject.TYPE_UINT] }, 'keyval': { param_types: [GObject.TYPE_UINT] },
}, }
}, class Keypad extends AspectContainer { }, class Keypad extends AspectContainer {
_init() { _init() {
let keys = [ let keys = [
@@ -1073,7 +1046,7 @@ var Keypad = GObject.registerClass({
super._init({ super._init({
layout_manager: new Clutter.BinLayout(), layout_manager: new Clutter.BinLayout(),
x_expand: true, x_expand: true,
y_expand: true, y_expand: true
}); });
let gridLayout = new Clutter.GridLayout({ orientation: Clutter.Orientation.HORIZONTAL, let gridLayout = new Clutter.GridLayout({ orientation: Clutter.Orientation.HORIZONTAL,
@@ -1183,7 +1156,7 @@ var KeyboardManager = class KeyBoardManager {
let actor = event.get_source(); let actor = event.get_source();
return Main.layoutManager.keyboardBox.contains(actor) || return Main.layoutManager.keyboardBox.contains(actor) ||
!!actor._extendedKeys || !!actor.extendedKey; !!actor._extended_keys || !!actor.extended_key;
} }
}; };
@@ -1288,10 +1261,10 @@ class Keyboard extends St.BoxLayout {
this._currentPage = null; this._currentPage = null;
this._suggestions = new Suggestions(); this._suggestions = new Suggestions();
this.add_child(this._suggestions); this.add(this._suggestions, { x_align: St.Align.MIDDLE, x_fill: false });
this._aspectContainer = new AspectContainer({ layout_manager: new Clutter.BinLayout() }); this._aspectContainer = new AspectContainer({ layout_manager: new Clutter.BinLayout() });
this.add_child(this._aspectContainer); this.add(this._aspectContainer, { expand: true });
this._emojiSelection = new EmojiSelection(); this._emojiSelection = new EmojiSelection();
this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this)); this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this));
@@ -1331,10 +1304,9 @@ class Keyboard extends St.BoxLayout {
this._connectSignal(global.stage, 'notify::key-focus', this._connectSignal(global.stage, 'notify::key-focus',
this._onKeyFocusChanged.bind(this)); this._onKeyFocusChanged.bind(this));
if (Meta.is_wayland_compositor()) { if (Meta.is_wayland_compositor())
this._connectSignal(this._keyboardController, 'emoji-visible', this._connectSignal(this._keyboardController, 'emoji-visible',
this._onEmojiKeyVisible.bind(this)); this._onEmojiKeyVisible.bind(this));
}
this._relayout(); this._relayout();
} }
@@ -1345,7 +1317,7 @@ class Keyboard extends St.BoxLayout {
// Showing an extended key popup and clicking a key from the extended keys // Showing an extended key popup and clicking a key from the extended keys
// will grab focus, but ignore that // will grab focus, but ignore that
let extendedKeysWereFocused = this._focusInExtendedKeys; let extendedKeysWereFocused = this._focusInExtendedKeys;
this._focusInExtendedKeys = focus && (focus._extendedKeys || focus.extendedKey); this._focusInExtendedKeys = focus && (focus._extended_keys || focus.extended_key);
if (this._focusInExtendedKeys || extendedKeysWereFocused) if (this._focusInExtendedKeys || extendedKeysWereFocused)
return; return;
@@ -1374,7 +1346,7 @@ class Keyboard extends St.BoxLayout {
* basically). We however make things consistent by skipping that * basically). We however make things consistent by skipping that
* second level. * second level.
*/ */
let level = i >= 1 && levels.length == 3 ? i + 1 : i; let level = (i >= 1 && levels.length == 3) ? i + 1 : i;
let layout = new KeyContainer(); let layout = new KeyContainer();
layout.shiftKeys = []; layout.shiftKeys = [];
@@ -1463,7 +1435,7 @@ class Keyboard extends St.BoxLayout {
if (switchToLevel != null) { if (switchToLevel != null) {
this._setActiveLayer(switchToLevel); this._setActiveLayer(switchToLevel);
// Shift only gets latched on long press // Shift only gets latched on long press
this._latched = switchToLevel != 1; this._latched = (switchToLevel != 1);
} else if (keyval != null) { } else if (keyval != null) {
this._keyboardController.keyvalPress(keyval); this._keyboardController.keyvalPress(keyval);
} }
@@ -1563,7 +1535,7 @@ class Keyboard extends St.BoxLayout {
for (let i = 0; i < rows.length; ++i) { for (let i = 0; i < rows.length; ++i) {
layout.appendRow(); layout.appendRow();
let [pre, post] = this._getDefaultKeysForRow(i, rows.length, level); let [pre, post] = this._getDefaultKeysForRow(i, rows.length, level);
this._mergeRowKeys(layout, pre, rows[i], post, numLevels); this._mergeRowKeys (layout, pre, rows[i], post, numLevels);
} }
} }
@@ -1633,7 +1605,7 @@ class Keyboard extends St.BoxLayout {
else if (state == Clutter.InputPanelState.ON) else if (state == Clutter.InputPanelState.ON)
enabled = true; enabled = true;
else if (state == Clutter.InputPanelState.TOGGLE) else if (state == Clutter.InputPanelState.TOGGLE)
enabled = this._keyboardVisible == false; enabled = (this._keyboardVisible == false);
else else
return; return;
@@ -1688,12 +1660,12 @@ class Keyboard extends St.BoxLayout {
this._clearKeyboardRestTimer(); this._clearKeyboardRestTimer();
this._keyboardRestingId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, this._keyboardRestingId = GLib.timeout_add(GLib.PRIORITY_DEFAULT,
KEYBOARD_REST_TIME, KEYBOARD_REST_TIME,
() => { () => {
this._clearKeyboardRestTimer(); this._clearKeyboardRestTimer();
this._open(monitor); this._open(monitor);
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
}); });
GLib.Source.set_name_by_id(this._keyboardRestingId, '[gnome-shell] this._clearKeyboardRestTimer'); GLib.Source.set_name_by_id(this._keyboardRestingId, '[gnome-shell] this._clearKeyboardRestTimer');
} }
@@ -1722,12 +1694,12 @@ class Keyboard extends St.BoxLayout {
this._clearKeyboardRestTimer(); this._clearKeyboardRestTimer();
this._keyboardRestingId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, this._keyboardRestingId = GLib.timeout_add(GLib.PRIORITY_DEFAULT,
KEYBOARD_REST_TIME, KEYBOARD_REST_TIME,
() => { () => {
this._clearKeyboardRestTimer(); this._clearKeyboardRestTimer();
this._close(); this._close();
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
}); });
GLib.Source.set_name_by_id(this._keyboardRestingId, '[gnome-shell] this._clearKeyboardRestTimer'); GLib.Source.set_name_by_id(this._keyboardRestingId, '[gnome-shell] this._clearKeyboardRestTimer');
} }
@@ -1778,7 +1750,7 @@ class Keyboard extends St.BoxLayout {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => { onComplete: () => {
this._windowSlideAnimationComplete(window, -deltaY); this._windowSlideAnimationComplete(window, -deltaY);
}, }
}); });
} else { } else {
windowActor.ease({ windowActor.ease({
@@ -1787,7 +1759,7 @@ class Keyboard extends St.BoxLayout {
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD,
onComplete: () => { onComplete: () => {
this._windowSlideAnimationComplete(window, deltaY); this._windowSlideAnimationComplete(window, deltaY);
}, }
}); });
} }
} }
@@ -1835,8 +1807,8 @@ var KeyboardController = class {
this._inputSourceManager = InputSourceManager.getInputSourceManager(); this._inputSourceManager = InputSourceManager.getInputSourceManager();
this._sourceChangedId = this._inputSourceManager.connect('current-source-changed', this._sourceChangedId = this._inputSourceManager.connect('current-source-changed',
this._onSourceChanged.bind(this)); this._onSourceChanged.bind(this));
this._sourcesModifiedId = this._inputSourceManager.connect('sources-changed', this._sourcesModifiedId = this._inputSourceManager.connect ('sources-changed',
this._onSourcesModified.bind(this)); this._onSourcesModified.bind(this));
this._currentSource = this._inputSourceManager.currentSource; this._currentSource = this._inputSourceManager.currentSource;
Main.inputMethod.connect('notify::content-purpose', Main.inputMethod.connect('notify::content-purpose',

View File

@@ -44,7 +44,7 @@ var MonitorConstraint = GObject.registerClass({
'work-area': GObject.ParamSpec.boolean('work-area', 'work-area': GObject.ParamSpec.boolean('work-area',
'Work-area', 'Track monitor\'s work-area', 'Work-area', 'Track monitor\'s work-area',
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
false), false)
}, },
}, class MonitorConstraint extends Clutter.Constraint { }, class MonitorConstraint extends Clutter.Constraint {
_init(props) { _init(props) {
@@ -167,12 +167,12 @@ var Monitor = class Monitor {
const UiActor = GObject.registerClass( const UiActor = GObject.registerClass(
class UiActor extends St.Widget { class UiActor extends St.Widget {
vfunc_get_preferred_width(_forHeight) { vfunc_get_preferred_width (_forHeight) {
let width = global.stage.width; let width = global.stage.width;
return [width, width]; return [width, width];
} }
vfunc_get_preferred_height(_forWidth) { vfunc_get_preferred_height (_forWidth) {
let height = global.stage.height; let height = global.stage.height;
return [height, height]; return [height, height];
} }
@@ -181,7 +181,7 @@ class UiActor extends St.Widget {
const defaultParams = { const defaultParams = {
trackFullscreen: false, trackFullscreen: false,
affectsStruts: false, affectsStruts: false,
affectsInputRegion: true, affectsInputRegion: true
}; };
var LayoutManager = GObject.registerClass({ var LayoutManager = GObject.registerClass({
@@ -189,13 +189,12 @@ var LayoutManager = GObject.registerClass({
'startup-complete': {}, 'startup-complete': {},
'startup-prepared': {}, 'startup-prepared': {},
'monitors-changed': {}, 'monitors-changed': {},
'system-modal-opened': {},
'keyboard-visible-changed': { param_types: [GObject.TYPE_BOOLEAN] } }, 'keyboard-visible-changed': { param_types: [GObject.TYPE_BOOLEAN] } },
}, class LayoutManager extends GObject.Object { }, class LayoutManager extends GObject.Object {
_init() { _init() {
super._init(); super._init();
this._rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL; this._rtl = (Clutter.get_default_text_direction() == Clutter.TextDirection.RTL);
this.monitors = []; this.monitors = [];
this.primaryMonitor = null; this.primaryMonitor = null;
this.primaryIndex = -1; this.primaryIndex = -1;
@@ -213,6 +212,11 @@ var LayoutManager = GObject.registerClass({
this._startingUp = true; this._startingUp = true;
this._pendingLoadBackground = false; this._pendingLoadBackground = false;
// We don't want to paint the stage background color because either
// the SystemBackground we create or the MetaBackgroundActor inside
// global.window_group covers the entirety of the screen.
global.stage.no_clear_hint = true;
// Set up stage hierarchy to group all UI actors under one container. // Set up stage hierarchy to group all UI actors under one container.
this.uiGroup = new UiActor({ name: 'uiGroup' }); this.uiGroup = new UiActor({ name: 'uiGroup' });
this.uiGroup.set_flags(Clutter.ActorFlags.NO_LAYOUT); this.uiGroup.set_flags(Clutter.ActorFlags.NO_LAYOUT);
@@ -270,11 +274,11 @@ var LayoutManager = GObject.registerClass({
this._backgroundGroup = new Meta.BackgroundGroup(); this._backgroundGroup = new Meta.BackgroundGroup();
global.window_group.add_child(this._backgroundGroup); global.window_group.add_child(this._backgroundGroup);
global.window_group.set_child_below_sibling(this._backgroundGroup, null); this._backgroundGroup.lower_bottom();
this._bgManagers = []; this._bgManagers = [];
this._interfaceSettings = new Gio.Settings({ this._interfaceSettings = new Gio.Settings({
schema_id: 'org.gnome.desktop.interface', schema_id: 'org.gnome.desktop.interface'
}); });
this._interfaceSettings.connect('changed::enable-hot-corners', this._interfaceSettings.connect('changed::enable-hot-corners',
@@ -340,11 +344,10 @@ var LayoutManager = GObject.registerClass({
this.monitors = []; this.monitors = [];
let nMonitors = display.get_n_monitors(); let nMonitors = display.get_n_monitors();
for (let i = 0; i < nMonitors; i++) { for (let i = 0; i < nMonitors; i++)
this.monitors.push(new Monitor(i, this.monitors.push(new Monitor(i,
display.get_monitor_geometry(i), display.get_monitor_geometry(i),
display.get_monitor_scale(i))); display.get_monitor_scale(i)));
}
if (nMonitors == 0) { if (nMonitors == 0) {
this.primaryIndex = this.bottomIndex = -1; this.primaryIndex = this.bottomIndex = -1;
@@ -447,7 +450,7 @@ var LayoutManager = GObject.registerClass({
_createBackgroundManager(monitorIndex) { _createBackgroundManager(monitorIndex) {
let bgManager = new Background.BackgroundManager({ container: this._backgroundGroup, let bgManager = new Background.BackgroundManager({ container: this._backgroundGroup,
layoutManager: this, layoutManager: this,
monitorIndex }); monitorIndex: monitorIndex });
bgManager.connect('changed', this._addBackgroundMenu.bind(this)); bgManager.connect('changed', this._addBackgroundMenu.bind(this));
this._addBackgroundMenu(bgManager); this._addBackgroundMenu(bgManager);
@@ -464,14 +467,15 @@ var LayoutManager = GObject.registerClass({
backgroundActor.ease({ backgroundActor.ease({
opacity: 255, opacity: 255,
duration: BACKGROUND_FADE_ANIMATION_TIME, duration: BACKGROUND_FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
} }
} }
_updateBackgrounds() { _updateBackgrounds() {
for (let i = 0; i < this._bgManagers.length; i++) let i;
for (i = 0; i < this._bgManagers.length; i++)
this._bgManagers[i].destroy(); this._bgManagers[i].destroy();
this._bgManagers = []; this._bgManagers = [];
@@ -699,7 +703,7 @@ var LayoutManager = GObject.registerClass({
translation_y: 0, translation_y: 0,
duration: STARTUP_ANIMATION_TIME, duration: STARTUP_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this._startupAnimationComplete(), onComplete: () => this._startupAnimationComplete()
}); });
} }
@@ -710,7 +714,7 @@ var LayoutManager = GObject.registerClass({
opacity: 255, opacity: 255,
duration: STARTUP_ANIMATION_TIME, duration: STARTUP_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this._startupAnimationComplete(), onComplete: () => this._startupAnimationComplete()
}); });
} }
@@ -744,7 +748,7 @@ var LayoutManager = GObject.registerClass({
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => { onComplete: () => {
this._showKeyboardComplete(); this._showKeyboardComplete();
}, }
}); });
this.emit('keyboard-visible-changed', true); this.emit('keyboard-visible-changed', true);
} }
@@ -771,7 +775,7 @@ var LayoutManager = GObject.registerClass({
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD,
onComplete: () => { onComplete: () => {
this._hideKeyboardComplete(); this._hideKeyboardComplete();
}, }
}); });
this.emit('keyboard-visible-changed', false); this.emit('keyboard-visible-changed', false);
@@ -957,7 +961,7 @@ var LayoutManager = GObject.registerClass({
findIndexForActor(actor) { findIndexForActor(actor) {
let [x, y] = actor.get_transformed_position(); let [x, y] = actor.get_transformed_position();
let [w, h] = actor.get_transformed_size(); let [w, h] = actor.get_transformed_size();
let rect = new Meta.Rectangle({ x, y, width: w, height: h }); let rect = new Meta.Rectangle({ x: x, y: y, width: w, height: h });
return global.display.get_monitor_index_for_rect(rect); return global.display.get_monitor_index_for_rect(rect);
} }
@@ -972,10 +976,9 @@ var LayoutManager = GObject.registerClass({
if (this._startingUp) if (this._startingUp)
return; return;
if (!this._updateRegionIdle) { if (!this._updateRegionIdle)
this._updateRegionIdle = Meta.later_add(Meta.LaterType.BEFORE_REDRAW, this._updateRegionIdle = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
this._updateRegions.bind(this)); this._updateRegions.bind(this));
}
} }
_getWindowActorsForWorkspace(workspace) { _getWindowActorsForWorkspace(workspace) {
@@ -1029,7 +1032,7 @@ var LayoutManager = GObject.registerClass({
h = Math.round(h); h = Math.round(h);
if (actorData.affectsInputRegion && wantsInputRegion && actorData.actor.get_paint_visibility()) if (actorData.affectsInputRegion && wantsInputRegion && actorData.actor.get_paint_visibility())
rects.push(new Meta.Rectangle({ x, y, width: w, height: h })); rects.push(new Meta.Rectangle({ x: x, y: y, width: w, height: h }));
let monitor = null; let monitor = null;
if (actorData.affectsStruts) if (actorData.affectsStruts)
@@ -1080,7 +1083,7 @@ var LayoutManager = GObject.registerClass({
} }
let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 }); let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 });
let strut = new Meta.Strut({ rect: strutRect, side }); let strut = new Meta.Strut({ rect: strutRect, side: side });
struts.push(strut); struts.push(strut);
} }
} }
@@ -1189,7 +1192,7 @@ class HotCorner extends Clutter.Actor {
y: this._y, y: this._y,
width: 3, width: 3,
height: 3, height: 3,
reactive: true, reactive: true
}); });
this._corner = new Clutter.Actor({ name: 'hot-corner', this._corner = new Clutter.Actor({ name: 'hot-corner',

View File

@@ -33,8 +33,8 @@ var RadialShaderEffect = GObject.registerClass({
'sharpness', 'sharpness', 'sharpness', 'sharpness', 'sharpness', 'sharpness',
GObject.ParamFlags.READWRITE, GObject.ParamFlags.READWRITE,
0, 1, 0 0, 1, 0
), )
}, }
}, class RadialShaderEffect extends Shell.GLSLEffect { }, class RadialShaderEffect extends Shell.GLSLEffect {
_init(params) { _init(params) {
this._brightness = undefined; this._brightness = undefined;
@@ -109,7 +109,7 @@ var Lightbox = GObject.registerClass({
Properties: { Properties: {
'active': GObject.ParamSpec.boolean( 'active': GObject.ParamSpec.boolean(
'active', 'active', 'active', GObject.ParamFlags.READABLE, false), 'active', 'active', 'active', GObject.ParamFlags.READABLE, false),
}, }
}, class Lightbox extends St.Bin { }, class Lightbox extends St.Bin {
_init(container, params) { _init(container, params) {
params = Params.parse(params, { params = Params.parse(params, {
@@ -124,7 +124,7 @@ var Lightbox = GObject.registerClass({
reactive: params.inhibitEvents, reactive: params.inhibitEvents,
width: params.width, width: params.width,
height: params.height, height: params.height,
visible: false, visible: false
}); });
this._active = false; this._active = false;
@@ -139,14 +139,14 @@ var Lightbox = GObject.registerClass({
this.set({ opacity: 0, style_class: 'lightbox' }); this.set({ opacity: 0, style_class: 'lightbox' });
container.add_actor(this); container.add_actor(this);
container.set_child_above_sibling(this, null); this.raise_top();
this.connect('destroy', this._onDestroy.bind(this)); this.connect('destroy', this._onDestroy.bind(this));
if (!params.width || !params.height) { if (!params.width || !params.height) {
this.add_constraint(new Clutter.BindConstraint({ this.add_constraint(new Clutter.BindConstraint({
source: container, source: container,
coordinate: Clutter.BindCoordinate.ALL, coordinate: Clutter.BindCoordinate.ALL
})); }));
} }
@@ -187,7 +187,7 @@ var Lightbox = GObject.registerClass({
let easeProps = { let easeProps = {
duration: fadeInTime || 0, duration: fadeInTime || 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}; };
let onComplete = () => { let onComplete = () => {
@@ -206,7 +206,7 @@ var Lightbox = GObject.registerClass({
} else { } else {
this.ease(Object.assign(easeProps, { this.ease(Object.assign(easeProps, {
opacity: 255 * this._fadeFactor, opacity: 255 * this._fadeFactor,
onComplete, onComplete
})); }));
} }
} }
@@ -219,7 +219,7 @@ var Lightbox = GObject.registerClass({
let easeProps = { let easeProps = {
duration: fadeOutTime || 0, duration: fadeOutTime || 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}; };
let onComplete = () => this.hide(); let onComplete = () => this.hide();
@@ -245,7 +245,7 @@ var Lightbox = GObject.registerClass({
/** /**
* highlight: * highlight:
* @param {Clutter.Actor=} window: actor to highlight * @window: actor to highlight
* *
* Highlights the indicated actor and unhighlights any other * Highlights the indicated actor and unhighlights any other
* currently-highlighted actor. With no arguments or a false/null * currently-highlighted actor. With no arguments or a false/null
@@ -264,9 +264,9 @@ var Lightbox = GObject.registerClass({
let below = this; let below = this;
for (let i = this._children.length - 1; i >= 0; i--) { for (let i = this._children.length - 1; i >= 0; i--) {
if (this._children[i] == window) if (this._children[i] == window)
this._container.set_child_above_sibling(this._children[i], null); this._children[i].raise_top();
else if (this._children[i] == this._highlighted) else if (this._children[i] == this._highlighted)
this._container.set_child_below_sibling(this._children[i], below); this._children[i].lower(below);
else else
below = this._children[i]; below = this._children[i];
} }

View File

@@ -54,9 +54,9 @@ var AutoComplete = class AutoComplete {
} }
_processCompletionRequest(event) { _processCompletionRequest(event) {
if (event.completions.length == 0) if (event.completions.length == 0) {
return; return;
}
// Unique match = go ahead and complete; multiple matches + single tab = complete the common starting string; // Unique match = go ahead and complete; multiple matches + single tab = complete the common starting string;
// multiple matches + double tab = emit a suggest event with all possible options // multiple matches + double tab = emit a suggest event with all possible options
if (event.completions.length == 1) { if (event.completions.length == 1) {
@@ -78,20 +78,20 @@ var AutoComplete = class AutoComplete {
_entryKeyPressEvent(actor, event) { _entryKeyPressEvent(actor, event) {
let cursorPos = this._entry.clutter_text.get_cursor_position(); let cursorPos = this._entry.clutter_text.get_cursor_position();
let text = this._entry.get_text(); let text = this._entry.get_text();
if (cursorPos != -1) if (cursorPos != -1) {
text = text.slice(0, cursorPos); text = text.slice(0, cursorPos);
}
if (event.get_key_symbol() == Clutter.KEY_Tab) { if (event.get_key_symbol() == Clutter.Tab) {
let [completions, attrHead] = JsParse.getCompletions(text, commandHeader, AUTO_COMPLETE_GLOBAL_KEYWORDS); let [completions, attrHead] = JsParse.getCompletions(text, commandHeader, AUTO_COMPLETE_GLOBAL_KEYWORDS);
let currTime = global.get_current_time(); let currTime = global.get_current_time();
if ((currTime - this._lastTabTime) < AUTO_COMPLETE_DOUBLE_TAB_DELAY) { if ((currTime - this._lastTabTime) < AUTO_COMPLETE_DOUBLE_TAB_DELAY) {
this._processCompletionRequest({ tabType: 'double', this._processCompletionRequest({ tabType: 'double',
completions, completions: completions,
attrHead }); attrHead: attrHead });
} else { } else {
this._processCompletionRequest({ tabType: 'single', this._processCompletionRequest({ tabType: 'single',
completions, completions: completions,
attrHead }); attrHead: attrHead });
} }
this._lastTabTime = currTime; this._lastTabTime = currTime;
} }
@@ -114,10 +114,7 @@ var Notebook = GObject.registerClass({
Signals: { 'selection': { param_types: [Clutter.Actor.$gtype] } }, Signals: { 'selection': { param_types: [Clutter.Actor.$gtype] } },
}, class Notebook extends St.BoxLayout { }, class Notebook extends St.BoxLayout {
_init() { _init() {
super._init({ super._init({ vertical: true });
vertical: true,
y_expand: true,
});
this.tabControls = new St.BoxLayout({ style_class: 'labels' }); this.tabControls = new St.BoxLayout({ style_class: 'labels' });
@@ -134,21 +131,21 @@ var Notebook = GObject.registerClass({
this.selectChild(child); this.selectChild(child);
return true; return true;
}); });
labelBox.add_child(label); labelBox.add(label, { expand: true });
this.tabControls.add(labelBox); this.tabControls.add(labelBox);
let scrollview = new St.ScrollView({ y_expand: true }); let scrollview = new St.ScrollView({ x_fill: true, y_fill: true });
scrollview.get_hscroll_bar().hide(); scrollview.get_hscroll_bar().hide();
scrollview.add_actor(child); scrollview.add_actor(child);
let tabData = { child, let tabData = { child: child,
labelBox, labelBox: labelBox,
label, label: label,
scrollView: scrollview, scrollView: scrollview,
_scrollToBottom: false }; _scrollToBottom: false };
this._tabs.push(tabData); this._tabs.push(tabData);
scrollview.hide(); scrollview.hide();
this.add_child(scrollview); this.add(scrollview, { expand: true });
let vAdjust = scrollview.vscroll.adjustment; let vAdjust = scrollview.vscroll.adjustment;
vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData)); vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData));
@@ -224,16 +221,18 @@ var Notebook = GObject.registerClass({
nextTab() { nextTab() {
let nextIndex = this._selectedIndex; let nextIndex = this._selectedIndex;
if (nextIndex < this._tabs.length - 1) if (nextIndex < this._tabs.length - 1) {
++nextIndex; ++nextIndex;
}
this.selectIndex(nextIndex); this.selectIndex(nextIndex);
} }
prevTab() { prevTab() {
let prevIndex = this._selectedIndex; let prevIndex = this._selectedIndex;
if (prevIndex > 0) if (prevIndex > 0) {
--prevIndex; --prevIndex;
}
this.selectIndex(prevIndex); this.selectIndex(prevIndex);
} }
@@ -262,8 +261,7 @@ class ObjLink extends St.Button {
reactive: true, reactive: true,
track_hover: true, track_hover: true,
style_class: 'shell-link', style_class: 'shell-link',
label: text, label: text
x_align: Clutter.ActorAlign.START,
}); });
this.get_child().single_line_mode = true; this.get_child().single_line_mode = true;
@@ -276,8 +274,9 @@ class ObjLink extends St.Button {
} }
}); });
var Result = GObject.registerClass( var Result = GObject.registerClass({
class Result extends St.BoxLayout { GTypeName: 'LookingClass_Result'
}, class Result extends St.BoxLayout {
_init(lookingGlass, command, o, index) { _init(lookingGlass, command, o, index) {
super._init({ vertical: true }); super._init({ vertical: true });
@@ -300,6 +299,7 @@ class Result extends St.BoxLayout {
}); });
var WindowList = GObject.registerClass({ var WindowList = GObject.registerClass({
GTypeName: 'LookingClass_WindowList'
}, class WindowList extends St.BoxLayout { }, class WindowList extends St.BoxLayout {
_init(lookingGlass) { _init(lookingGlass) {
super._init({ name: 'Windows', vertical: true, style: 'spacing: 8px' }); super._init({ name: 'Windows', vertical: true, style: 'spacing: 8px' });
@@ -328,7 +328,7 @@ var WindowList = GObject.registerClass({
let box = new St.BoxLayout({ vertical: true }); let box = new St.BoxLayout({ vertical: true });
this.add(box); this.add(box);
let windowLink = new ObjLink(this._lookingGlass, metaWindow, metaWindow.title); let windowLink = new ObjLink(this._lookingGlass, metaWindow, metaWindow.title);
box.add_child(windowLink); box.add(windowLink, { x_align: St.Align.START, x_fill: false });
let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' }); let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' });
box.add(propsBox); box.add(propsBox);
propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` })); propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` }));
@@ -337,10 +337,10 @@ var WindowList = GObject.registerClass({
let icon = app.create_icon_texture(22); let icon = app.create_icon_texture(22);
let propBox = new St.BoxLayout({ style: 'spacing: 6px; ' }); let propBox = new St.BoxLayout({ style: 'spacing: 6px; ' });
propsBox.add(propBox); propsBox.add(propBox);
propBox.add_child(new St.Label({ text: 'app: ' })); propBox.add(new St.Label({ text: 'app: ' }), { y_fill: false });
let appLink = new ObjLink(this._lookingGlass, app, app.get_id()); let appLink = new ObjLink(this._lookingGlass, app, app.get_id());
propBox.add_child(appLink); propBox.add(appLink, { y_fill: false });
propBox.add_child(icon); propBox.add(icon, { y_fill: false });
} else { } else {
propsBox.add(new St.Label({ text: '<untracked>' })); propsBox.add(new St.Label({ text: '<untracked>' }));
} }
@@ -357,6 +357,8 @@ class ObjInspector extends St.ScrollView {
_init(lookingGlass) { _init(lookingGlass) {
super._init({ super._init({
pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }), pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }),
x_fill: true,
y_fill: true
}); });
this._obj = null; this._obj = null;
@@ -365,13 +367,9 @@ class ObjInspector extends St.ScrollView {
this._parentList = []; this._parentList = [];
this.get_hscroll_bar().hide(); this.get_hscroll_bar().hide();
this._container = new St.BoxLayout({ this._container = new St.BoxLayout({ name: 'LookingGlassPropertyInspector',
name: 'LookingGlassPropertyInspector', style_class: 'lg-dialog',
style_class: 'lg-dialog', vertical: true });
vertical: true,
x_expand: true,
y_expand: true,
});
this.add_actor(this._container); this.add_actor(this._container);
this._lookingGlass = lookingGlass; this._lookingGlass = lookingGlass;
@@ -388,12 +386,10 @@ class ObjInspector extends St.ScrollView {
let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' }); let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' });
this._container.add_actor(hbox); this._container.add_actor(hbox);
let label = new St.Label({ let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof obj,
text: 'Inspecting: %s: %s'.format(typeof obj, objectToString(obj)), objectToString(obj)) });
x_expand: true,
});
label.single_line_mode = true; label.single_line_mode = true;
hbox.add_child(label); hbox.add(label, { expand: true, y_fill: false });
let button = new St.Button({ label: 'Insert', style_class: 'lg-obj-inspector-button' }); let button = new St.Button({ label: 'Insert', style_class: 'lg-obj-inspector-button' });
button.connect('clicked', this._onInsert.bind(this)); button.connect('clicked', this._onInsert.bind(this));
hbox.add(button); hbox.add(button);
@@ -410,8 +406,9 @@ class ObjInspector extends St.ScrollView {
hbox.add(button); hbox.add(button);
if (typeof obj == typeof {}) { if (typeof obj == typeof {}) {
let properties = []; let properties = [];
for (let propName in obj) for (let propName in obj) {
properties.push(propName); properties.push(propName);
}
properties.sort(); properties.sort();
for (let i = 0; i < properties.length; i++) { for (let i = 0; i < properties.length; i++) {
@@ -423,10 +420,10 @@ class ObjInspector extends St.ScrollView {
} catch (e) { } catch (e) {
link = new St.Label({ text: '<error>' }); link = new St.Label({ text: '<error>' });
} }
let box = new St.BoxLayout(); let hbox = new St.BoxLayout();
box.add(new St.Label({ text: `${propName}: ` })); hbox.add(new St.Label({ text: `${propName}: ` }));
box.add(link); hbox.add(link);
this._container.add_actor(box); this._container.add_actor(hbox);
} }
} }
} }
@@ -443,7 +440,7 @@ class ObjInspector extends St.ScrollView {
scale_x: 1, scale_x: 1,
scale_y: 1, scale_y: 1,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: 200, duration: 200
}); });
} else { } else {
this.set_scale(1, 1); this.set_scale(1, 1);
@@ -472,40 +469,25 @@ class ObjInspector extends St.ScrollView {
var RedBorderEffect = GObject.registerClass( var RedBorderEffect = GObject.registerClass(
class RedBorderEffect extends Clutter.Effect { class RedBorderEffect extends Clutter.Effect {
_init() { vfunc_paint() {
super._init();
this._pipeline = null;
}
vfunc_paint(paintContext) {
let framebuffer = paintContext.get_framebuffer();
let coglContext = framebuffer.get_context();
let actor = this.get_actor(); let actor = this.get_actor();
actor.continue_paint(paintContext); actor.continue_paint();
if (!this._pipeline) { let color = new Cogl.Color();
let color = new Cogl.Color(); color.init_from_4ub(0xff, 0, 0, 0xc4);
color.init_from_4ub(0xff, 0, 0, 0xc4); Cogl.set_source_color(color);
this._pipeline = new Cogl.Pipeline(coglContext); let geom = actor.get_allocation_geometry();
this._pipeline.set_color(color);
}
let alloc = actor.get_allocation_box();
let width = 2; let width = 2;
// clockwise order // clockwise order
framebuffer.draw_rectangle(this._pipeline, Cogl.rectangle(0, 0, geom.width, width);
0, 0, alloc.get_width(), width); Cogl.rectangle(geom.width - width, width,
framebuffer.draw_rectangle(this._pipeline, geom.width, geom.height);
alloc.get_width() - width, width, Cogl.rectangle(0, geom.height,
alloc.get_width(), alloc.get_height()); geom.width - width, geom.height - width);
framebuffer.draw_rectangle(this._pipeline, Cogl.rectangle(0, geom.height - width,
0, alloc.get_height(), width, width);
alloc.get_width() - width, alloc.get_height() - width);
framebuffer.draw_rectangle(this._pipeline,
0, alloc.get_height() - width,
width, width);
} }
}); });
@@ -523,8 +505,8 @@ var Inspector = GObject.registerClass({
reactive: true }); reactive: true });
this._eventHandler = eventHandler; this._eventHandler = eventHandler;
this.add_actor(eventHandler); this.add_actor(eventHandler);
this._displayText = new St.Label({ x_expand: true }); this._displayText = new St.Label();
eventHandler.add_child(this._displayText); eventHandler.add(this._displayText, { expand: true });
eventHandler.connect('key-press-event', this._onKeyPressEvent.bind(this)); eventHandler.connect('key-press-event', this._onKeyPressEvent.bind(this));
eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this)); eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this));
@@ -577,7 +559,7 @@ var Inspector = GObject.registerClass({
} }
_onKeyPressEvent(actor, event) { _onKeyPressEvent(actor, event) {
if (event.get_key_symbol() === Clutter.KEY_Escape) if (event.get_key_symbol() == Clutter.Escape)
this._close(); this._close();
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
} }
@@ -650,6 +632,7 @@ var Inspector = GObject.registerClass({
}); });
var Extensions = GObject.registerClass({ var Extensions = GObject.registerClass({
GTypeName: 'LookingClass_Extensions'
}, class Extensions extends St.BoxLayout { }, class Extensions extends St.BoxLayout {
_init(lookingGlass) { _init(lookingGlass) {
super._init({ vertical: true, name: 'lookingGlassExtensions' }); super._init({ vertical: true, name: 'lookingGlassExtensions' });
@@ -682,7 +665,7 @@ var Extensions = GObject.registerClass({
if (this._numExtensions == 0) if (this._numExtensions == 0)
this._extensionsList.remove_actor(this._noExtensions); this._extensionsList.remove_actor(this._noExtensions);
this._numExtensions++; this._numExtensions ++;
this._extensionsList.add(extensionDisplay); this._extensionsList.add(extensionDisplay);
} }
@@ -707,7 +690,7 @@ var Extensions = GObject.registerClass({
let errors = extension.errors; let errors = extension.errors;
let errorDisplay = new St.BoxLayout({ vertical: true }); let errorDisplay = new St.BoxLayout({ vertical: true });
if (errors && errors.length) { if (errors && errors.length) {
for (let i = 0; i < errors.length; i++) for (let i = 0; i < errors.length; i ++)
errorDisplay.add(new St.Label({ text: errors[i] })); errorDisplay.add(new St.Label({ text: errors[i] }));
} else { } else {
/* Translators: argument is an extension UUID. */ /* Translators: argument is an extension UUID. */
@@ -746,18 +729,12 @@ var Extensions = GObject.registerClass({
_createExtensionDisplay(extension) { _createExtensionDisplay(extension) {
let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true }); let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true });
let name = new St.Label({ let name = new St.Label({ style_class: 'lg-extension-name',
style_class: 'lg-extension-name', text: extension.metadata.name });
text: extension.metadata.name, box.add(name, { expand: true });
x_expand: true, let description = new St.Label({ style_class: 'lg-extension-description',
}); text: extension.metadata.description || 'No description' });
box.add_child(name); box.add(description, { expand: true });
let description = new St.Label({
style_class: 'lg-extension-description',
text: extension.metadata.description || 'No description',
x_expand: true,
});
box.add_child(description);
let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' }); let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' });
box.add(metaBox); box.add(metaBox);
@@ -805,7 +782,7 @@ class LookingGlass extends St.BoxLayout {
style_class: 'lg-dialog', style_class: 'lg-dialog',
vertical: true, vertical: true,
visible: false, visible: false,
reactive: true, reactive: true
}); });
this._borderPaintTarget = null; this._borderPaintTarget = null;
@@ -874,37 +851,27 @@ class LookingGlass extends St.BoxLayout {
let notebook = new Notebook(); let notebook = new Notebook();
this._notebook = notebook; this._notebook = notebook;
this.add_child(notebook); this.add(notebook, { expand: true });
let emptyBox = new St.Bin({ x_expand: true }); let emptyBox = new St.Bin();
toolbar.add_child(emptyBox); toolbar.add(emptyBox, { expand: true });
toolbar.add_actor(notebook.tabControls); toolbar.add_actor(notebook.tabControls);
this._evalBox = new St.BoxLayout({ name: 'EvalBox', vertical: true }); this._evalBox = new St.BoxLayout({ name: 'EvalBox', vertical: true });
notebook.appendPage('Evaluator', this._evalBox); notebook.appendPage('Evaluator', this._evalBox);
this._resultsArea = new St.BoxLayout({ this._resultsArea = new St.BoxLayout({ name: 'ResultsArea', vertical: true });
name: 'ResultsArea', this._evalBox.add(this._resultsArea, { expand: true });
vertical: true,
y_expand: true,
});
this._evalBox.add_child(this._resultsArea);
this._entryArea = new St.BoxLayout({ this._entryArea = new St.BoxLayout({ name: 'EntryArea' });
name: 'EntryArea',
y_align: Clutter.ActorAlign.END,
});
this._evalBox.add_actor(this._entryArea); this._evalBox.add_actor(this._entryArea);
let label = new St.Label({ text: CHEVRON }); let label = new St.Label({ text: CHEVRON });
this._entryArea.add(label); this._entryArea.add(label);
this._entry = new St.Entry({ this._entry = new St.Entry({ can_focus: true });
can_focus: true,
x_expand: true,
});
ShellEntry.addContextMenu(this._entry); ShellEntry.addContextMenu(this._entry);
this._entryArea.add_child(this._entry); this._entryArea.add(this._entry, { expand: true });
this._windowList = new WindowList(this); this._windowList = new WindowList(this);
notebook.appendPage('Windows', this._windowList); notebook.appendPage('Windows', this._windowList);
@@ -1009,7 +976,7 @@ class LookingGlass extends St.BoxLayout {
height: naturalHeight, height: naturalHeight,
opacity: 255, opacity: 255,
duration, duration,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
} }
@@ -1026,7 +993,7 @@ class LookingGlass extends St.BoxLayout {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => { onComplete: () => {
this._completionActor.hide(); this._completionActor.hide();
}, }
}); });
} }
} }
@@ -1108,19 +1075,21 @@ class LookingGlass extends St.BoxLayout {
// Handle key events which are relevant for all tabs of the LookingGlass // Handle key events which are relevant for all tabs of the LookingGlass
vfunc_key_press_event(keyPressEvent) { vfunc_key_press_event(keyPressEvent) {
let symbol = keyPressEvent.keyval; let symbol = keyPressEvent.keyval;
if (symbol == Clutter.KEY_Escape) { if (symbol == Clutter.Escape) {
if (this._objInspector.visible) if (this._objInspector.visible) {
this._objInspector.close(); this._objInspector.close();
else } else {
this.close(); this.close();
}
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
} }
// Ctrl+PgUp and Ctrl+PgDown switches tabs in the notebook view // Ctrl+PgUp and Ctrl+PgDown switches tabs in the notebook view
if (keyPressEvent.modifier_state & Clutter.ModifierType.CONTROL_MASK) { if (keyPressEvent.modifier_state & Clutter.ModifierType.CONTROL_MASK) {
if (symbol == Clutter.KEY_Page_Up) if (symbol == Clutter.KEY_Page_Up) {
this._notebook.prevTab(); this._notebook.prevTab();
else if (symbol == Clutter.KEY_Page_Down) } else if (symbol == Clutter.KEY_Page_Down) {
this._notebook.nextTab(); this._notebook.nextTab();
}
} }
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
} }
@@ -1145,7 +1114,7 @@ class LookingGlass extends St.BoxLayout {
this.ease({ this.ease({
y: this._targetY, y: this._targetY,
duration, duration,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
this._windowList.update(); this._windowList.update();
@@ -1171,7 +1140,7 @@ class LookingGlass extends St.BoxLayout {
y: this._hiddenY, y: this._hiddenY,
duration, duration,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this.hide(), onComplete: () => this.hide()
}); });
} }

View File

@@ -55,7 +55,7 @@ var MouseSpriteContent = GObject.registerClass({
return [true, this._texture.get_width(), this._texture.get_height()]; return [true, this._texture.get_width(), this._texture.get_height()];
} }
vfunc_paint_content(actor, node, _paintContext) { vfunc_paint_content(actor, node) {
if (!this._texture) if (!this._texture)
return; return;
@@ -118,7 +118,7 @@ var Magnifier = class Magnifier {
}); });
// Export to dbus. // Export to dbus.
new MagnifierDBus.ShellMagnifier(); (new MagnifierDBus.ShellMagnifier());
this.setActive(St.Settings.get().magnifier_active); this.setActive(St.Settings.get().magnifier_active);
} }
@@ -141,7 +141,7 @@ var Magnifier = class Magnifier {
/** /**
* setActive: * setActive:
* Show/hide all the zoom regions. * Show/hide all the zoom regions.
* @param {bool} activate: Boolean to activate or de-activate the magnifier. * @activate: Boolean to activate or de-activate the magnifier.
*/ */
setActive(activate) { setActive(activate) {
let isActive = this.isActive(); let isActive = this.isActive();
@@ -177,7 +177,7 @@ var Magnifier = class Magnifier {
/** /**
* isActive: * isActive:
* @returns {bool} Whether the magnifier is active. * @return Whether the magnifier is active (boolean).
*/ */
isActive() { isActive() {
// Sufficient to check one ZoomRegion since Magnifier's active // Sufficient to check one ZoomRegion since Magnifier's active
@@ -212,7 +212,7 @@ var Magnifier = class Magnifier {
/** /**
* isTrackingMouse: * isTrackingMouse:
* @returns {bool} whether the magnifier is currently tracking the mouse * Is the magnifier tracking the mouse currently?
*/ */
isTrackingMouse() { isTrackingMouse() {
return !!this._mouseTrackingId; return !!this._mouseTrackingId;
@@ -222,7 +222,7 @@ var Magnifier = class Magnifier {
* scrollToMousePos: * scrollToMousePos:
* Position all zoom regions' ROI relative to the current location of the * Position all zoom regions' ROI relative to the current location of the
* system pointer. * system pointer.
* @returns {bool} true. * @return true.
*/ */
scrollToMousePos() { scrollToMousePos() {
let [xMouse, yMouse] = global.get_pointer(); let [xMouse, yMouse] = global.get_pointer();
@@ -247,17 +247,17 @@ var Magnifier = class Magnifier {
/** /**
* createZoomRegion: * createZoomRegion:
* Create a ZoomRegion instance with the given properties. * Create a ZoomRegion instance with the given properties.
* @param {number} xMagFactor: * @xMagFactor: The power to set horizontal magnification of the
* The power to set horizontal magnification of the ZoomRegion. A value * ZoomRegion. A value of 1.0 means no magnification. A
* of 1.0 means no magnification, a value of 2.0 doubles the size. * value of 2.0 doubles the size.
* @param {number} yMagFactor: * @yMagFactor: The power to set the vertical magnification of the
* The power to set the vertical magnification of the ZoomRegion. * ZoomRegion.
* @param {{x: number, y: number, width: number, height: number}} roi: * @roi Object in the form { x, y, width, height } that
* The reg Object that defines the region to magnify, given in * defines the region to magnify. Given in unmagnified
* unmagnified coordinates. * coordinates.
* @param {{x: number, y: number, width: number, height: number}} viewPort: * @viewPort Object in the form { x, y, width, height } that defines
* Object that defines the position of the ZoomRegion on screen. * the position of the ZoomRegion on screen.
* @returns {ZoomRegion} the newly created ZoomRegion. * @return The newly created ZoomRegion.
*/ */
createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) { createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) {
let zoomRegion = new ZoomRegion(this, this._cursorRoot); let zoomRegion = new ZoomRegion(this, this._cursorRoot);
@@ -277,7 +277,7 @@ var Magnifier = class Magnifier {
* addZoomRegion: * addZoomRegion:
* Append the given ZoomRegion to the list of currently defined ZoomRegions * Append the given ZoomRegion to the list of currently defined ZoomRegions
* for this Magnifier instance. * for this Magnifier instance.
* @param {ZoomRegion} zoomRegion: The zoomRegion to add. * @zoomRegion: The zoomRegion to add.
*/ */
addZoomRegion(zoomRegion) { addZoomRegion(zoomRegion) {
if (zoomRegion) { if (zoomRegion) {
@@ -290,7 +290,7 @@ var Magnifier = class Magnifier {
/** /**
* getZoomRegions: * getZoomRegions:
* Return a list of ZoomRegion's for this Magnifier. * Return a list of ZoomRegion's for this Magnifier.
* @returns {number[]} The Magnifier's zoom region list. * @return: The Magnifier's zoom region list (array).
*/ */
getZoomRegions() { getZoomRegions() {
return this._zoomRegions; return this._zoomRegions;
@@ -330,7 +330,7 @@ var Magnifier = class Magnifier {
this.setCrosshairsClip(clip); this.setCrosshairsClip(clip);
let theCrossHairs = this._crossHairs; let theCrossHairs = this._crossHairs;
this._zoomRegions.forEach(zoomRegion => { this._zoomRegions.forEach (zoomRegion => {
zoomRegion.addCrosshairs(theCrossHairs); zoomRegion.addCrosshairs(theCrossHairs);
}); });
} }
@@ -338,7 +338,7 @@ var Magnifier = class Magnifier {
/** /**
* setCrosshairsVisible: * setCrosshairsVisible:
* Show or hide the cross hair. * Show or hide the cross hair.
* @param {bool} visible: Flag that indicates show (true) or hide (false). * @visible Flag that indicates show (true) or hide (false).
*/ */
setCrosshairsVisible(visible) { setCrosshairsVisible(visible) {
if (visible) { if (visible) {
@@ -346,7 +346,6 @@ var Magnifier = class Magnifier {
this.addCrosshairs(); this.addCrosshairs();
this._crossHairs.show(); this._crossHairs.show();
} else { } else {
// eslint-disable-next-line no-lonely-if
if (this._crossHairs) if (this._crossHairs)
this._crossHairs.hide(); this._crossHairs.hide();
} }
@@ -355,7 +354,7 @@ var Magnifier = class Magnifier {
/** /**
* setCrosshairsColor: * setCrosshairsColor:
* Set the color of the crosshairs for all ZoomRegions. * Set the color of the crosshairs for all ZoomRegions.
* @param {string} color: The color as a string, e.g. '#ff0000ff' or 'red'. * @color: The color as a string, e.g. '#ff0000ff' or 'red'.
*/ */
setCrosshairsColor(color) { setCrosshairsColor(color) {
if (this._crossHairs) { if (this._crossHairs) {
@@ -367,7 +366,7 @@ var Magnifier = class Magnifier {
/** /**
* getCrosshairsColor: * getCrosshairsColor:
* Get the color of the crosshairs. * Get the color of the crosshairs.
* @returns {string} The color as a string, e.g. '#0000ffff' or 'blue'. * @return: The color as a string, e.g. '#0000ffff' or 'blue'.
*/ */
getCrosshairsColor() { getCrosshairsColor() {
if (this._crossHairs) { if (this._crossHairs) {
@@ -381,8 +380,8 @@ var Magnifier = class Magnifier {
/** /**
* setCrosshairsThickness: * setCrosshairsThickness:
* Set the crosshairs thickness for all ZoomRegions. * Set the crosshairs thickness for all ZoomRegions.
* @param {number} thickness: The width of the vertical and * @thickness: The width of the vertical and horizontal lines of the
* horizontal lines of the crosshairs. * crosshairs.
*/ */
setCrosshairsThickness(thickness) { setCrosshairsThickness(thickness) {
if (this._crossHairs) if (this._crossHairs)
@@ -392,8 +391,8 @@ var Magnifier = class Magnifier {
/** /**
* getCrosshairsThickness: * getCrosshairsThickness:
* Get the crosshairs thickness. * Get the crosshairs thickness.
* @returns {number} The width of the vertical and horizontal * @return: The width of the vertical and horizontal lines of the
* lines of the crosshairs. * crosshairs.
*/ */
getCrosshairsThickness() { getCrosshairsThickness() {
if (this._crossHairs) if (this._crossHairs)
@@ -404,8 +403,7 @@ var Magnifier = class Magnifier {
/** /**
* setCrosshairsOpacity: * setCrosshairsOpacity:
* @param {number} opacity: Value between 0.0 (transparent) * @opacity: Value between 0.0 (transparent) and 1.0 (fully opaque).
* and 1.0 (fully opaque).
*/ */
setCrosshairsOpacity(opacity) { setCrosshairsOpacity(opacity) {
if (this._crossHairs) if (this._crossHairs)
@@ -414,7 +412,7 @@ var Magnifier = class Magnifier {
/** /**
* getCrosshairsOpacity: * getCrosshairsOpacity:
* @returns {number} Value between 0.0 (transparent) and 1.0 (fully opaque). * @return: Value between 0.0 (transparent) and 1.0 (fully opaque).
*/ */
getCrosshairsOpacity() { getCrosshairsOpacity() {
if (this._crossHairs) if (this._crossHairs)
@@ -426,8 +424,8 @@ var Magnifier = class Magnifier {
/** /**
* setCrosshairsLength: * setCrosshairsLength:
* Set the crosshairs length for all ZoomRegions. * Set the crosshairs length for all ZoomRegions.
* @param {number} length: The length of the vertical and horizontal * @length: The length of the vertical and horizontal lines making up the
* lines making up the crosshairs. * crosshairs.
*/ */
setCrosshairsLength(length) { setCrosshairsLength(length) {
if (this._crossHairs) if (this._crossHairs)
@@ -437,8 +435,8 @@ var Magnifier = class Magnifier {
/** /**
* getCrosshairsLength: * getCrosshairsLength:
* Get the crosshairs length. * Get the crosshairs length.
* @returns {number} The length of the vertical and horizontal * @return: The length of the vertical and horizontal lines making up the
* lines making up the crosshairs. * crosshairs.
*/ */
getCrosshairsLength() { getCrosshairsLength() {
if (this._crossHairs) if (this._crossHairs)
@@ -450,7 +448,7 @@ var Magnifier = class Magnifier {
/** /**
* setCrosshairsClip: * setCrosshairsClip:
* Set whether the crosshairs are clipped at their intersection. * Set whether the crosshairs are clipped at their intersection.
* @param {bool} clip: Flag to indicate whether to clip the crosshairs. * @clip: Flag to indicate whether to clip the crosshairs.
*/ */
setCrosshairsClip(clip) { setCrosshairsClip(clip) {
if (!this._crossHairs) if (!this._crossHairs)
@@ -463,18 +461,18 @@ var Magnifier = class Magnifier {
/** /**
* getCrosshairsClip: * getCrosshairsClip:
* Get whether the crosshairs are clipped by the mouse image. * Get whether the crosshairs are clipped by the mouse image.
* @returns {bool} Whether the crosshairs are clipped. * @return: Whether the crosshairs are clipped.
*/ */
getCrosshairsClip() { getCrosshairsClip() {
if (this._crossHairs) { if (this._crossHairs) {
let [clipWidth, clipHeight] = this._crossHairs.getClip(); let [clipWidth, clipHeight] = this._crossHairs.getClip();
return clipWidth > 0 && clipHeight > 0; return (clipWidth > 0 && clipHeight > 0);
} else { } else {
return false; return false;
} }
} }
// Private methods // //// Private methods ////
_updateMouseSprite() { _updateMouseSprite() {
this._updateSpriteTexture(); this._updateSpriteTexture();
@@ -625,8 +623,9 @@ var Magnifier = class Magnifier {
_updateLensMode() { _updateLensMode() {
// Applies only to the first zoom region. // Applies only to the first zoom region.
if (this._zoomRegions.length) if (this._zoomRegions.length) {
this._zoomRegions[0].setLensMode(this._settings.get_boolean(LENS_MODE_KEY)); this._zoomRegions[0].setLensMode(this._settings.get_boolean(LENS_MODE_KEY));
}
} }
_updateClampMode() { _updateClampMode() {
@@ -773,16 +772,15 @@ var ZoomRegion = class ZoomRegion {
} }
_updateScreenPosition() { _updateScreenPosition() {
if (this._screenPosition == GDesktopEnums.MagnifierScreenPosition.NONE) { if (this._screenPosition == GDesktopEnums.MagnifierScreenPosition.NONE)
this._setViewPort({ this._setViewPort({
x: this._viewPortX, x: this._viewPortX,
y: this._viewPortY, y: this._viewPortY,
width: this._viewPortWidth, width: this._viewPortWidth,
height: this._viewPortHeight, height: this._viewPortHeight
}); });
} else { else
this.setScreenPosition(this._screenPosition); this.setScreenPosition(this._screenPosition);
}
} }
_updateFocus(caller, event) { _updateFocus(caller, event) {
@@ -820,7 +818,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setActive: * setActive:
* @param {bool} activate: Boolean to show/hide the ZoomRegion. * @activate: Boolean to show/hide the ZoomRegion.
*/ */
setActive(activate) { setActive(activate) {
if (activate == this.isActive()) if (activate == this.isActive())
@@ -846,7 +844,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* isActive: * isActive:
* @returns {bool} Whether this ZoomRegion is active * @return Whether this ZoomRegion is active (boolean).
*/ */
isActive() { isActive() {
return this._magView != null; return this._magView != null;
@@ -854,24 +852,24 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setMagFactor: * setMagFactor:
* @param {number} xMagFactor: The power to set the horizontal * @xMagFactor: The power to set the horizontal magnification factor to
* magnification factor to of the magnified view. A value of 1.0 * of the magnified view. A value of 1.0 means no
* means no magnification. A value of 2.0 doubles the size. * magnification. A value of 2.0 doubles the size.
* @param {number} yMagFactor: The power to set the vertical * @yMagFactor: The power to set the vertical magnification factor to
* magnification factor to of the magnified view. * of the magnified view.
*/ */
setMagFactor(xMagFactor, yMagFactor) { setMagFactor(xMagFactor, yMagFactor) {
this._changeROI({ xMagFactor, this._changeROI({ xMagFactor: xMagFactor,
yMagFactor, yMagFactor: yMagFactor,
redoCursorTracking: this._followingCursor }); redoCursorTracking: this._followingCursor });
} }
/** /**
* getMagFactor: * getMagFactor:
* @returns {number[]} an array, [xMagFactor, yMagFactor], containing * @return an array, [xMagFactor, yMagFactor], containing the horizontal
* the horizontal and vertical magnification powers. A value of * and vertical magnification powers. A value of 1.0 means no
* 1.0 means no magnification. A value of 2.0 means the contents * magnification. A value of 2.0 means the contents are doubled
* are doubled in size, and so on. * in size, and so on.
*/ */
getMagFactor() { getMagFactor() {
return [this._xMagFactor, this._yMagFactor]; return [this._xMagFactor, this._yMagFactor];
@@ -879,7 +877,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setMouseTrackingMode * setMouseTrackingMode
* @param {GDesktopEnums.MagnifierMouseTrackingMode} mode: the new mode * @mode: One of the enum MouseTrackingMode values.
*/ */
setMouseTrackingMode(mode) { setMouseTrackingMode(mode) {
if (mode >= GDesktopEnums.MagnifierMouseTrackingMode.NONE && if (mode >= GDesktopEnums.MagnifierMouseTrackingMode.NONE &&
@@ -889,7 +887,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* getMouseTrackingMode * getMouseTrackingMode
* @returns {GDesktopEnums.MagnifierMouseTrackingMode} the current mode * @return: One of the enum MouseTrackingMode values.
*/ */
getMouseTrackingMode() { getMouseTrackingMode() {
return this._mouseTrackingMode; return this._mouseTrackingMode;
@@ -897,7 +895,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setFocusTrackingMode * setFocusTrackingMode
* @param {GDesktopEnums.MagnifierFocusTrackingMode} mode: the new mode * @mode: One of the enum FocusTrackingMode values.
*/ */
setFocusTrackingMode(mode) { setFocusTrackingMode(mode) {
this._focusTrackingMode = mode; this._focusTrackingMode = mode;
@@ -906,7 +904,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setCaretTrackingMode * setCaretTrackingMode
* @param {GDesktopEnums.MagnifierCaretTrackingMode} mode: the new mode * @mode: One of the enum CaretTrackingMode values.
*/ */
setCaretTrackingMode(mode) { setCaretTrackingMode(mode) {
this._caretTrackingMode = mode; this._caretTrackingMode = mode;
@@ -936,9 +934,9 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setViewPort * setViewPort
* Sets the position and size of the ZoomRegion on screen. * Sets the position and size of the ZoomRegion on screen.
* @param {{x: number, y: number, width: number, height: number}} viewPort: * @viewPort: Object defining the position and size of the view port.
* Object defining the position and size of the view port. * It has members x, y, width, height. The values are in
* The values are in stage coordinate space. * stage coordinate space.
*/ */
setViewPort(viewPort) { setViewPort(viewPort) {
this._setViewPort(viewPort); this._setViewPort(viewPort);
@@ -948,9 +946,9 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setROI * setROI
* Sets the "region of interest" that the ZoomRegion is magnifying. * Sets the "region of interest" that the ZoomRegion is magnifying.
* @param {{x: number, y: number, width: number, height: number}} roi: * @roi: Object that defines the region of the screen to magnify. It
* Object that defines the region of the screen to magnify. * has members x, y, width, height. The values are in
* The values are in screen (unmagnified) coordinate space. * screen (unmagnified) coordinate space.
*/ */
setROI(roi) { setROI(roi) {
if (roi.width <= 0 || roi.height <= 0) if (roi.width <= 0 || roi.height <= 0)
@@ -968,8 +966,8 @@ var ZoomRegion = class ZoomRegion {
* Retrieves the "region of interest" -- the rectangular bounds of that part * Retrieves the "region of interest" -- the rectangular bounds of that part
* of the desktop that the magnified view is showing (x, y, width, height). * of the desktop that the magnified view is showing (x, y, width, height).
* The bounds are given in non-magnified coordinates. * The bounds are given in non-magnified coordinates.
* @returns {number[]} an array, [x, y, width, height], representing * @return an array, [x, y, width, height], representing the bounding
* the bounding rectangle of what is shown in the magnified view. * rectangle of what is shown in the magnified view.
*/ */
getROI() { getROI() {
let roiWidth = this._viewPortWidth / this._xMagFactor; let roiWidth = this._viewPortWidth / this._xMagFactor;
@@ -984,18 +982,18 @@ var ZoomRegion = class ZoomRegion {
* setLensMode: * setLensMode:
* Turn lens mode on/off. In full screen mode, lens mode does nothing since * Turn lens mode on/off. In full screen mode, lens mode does nothing since
* a lens the size of the screen is pointless. * a lens the size of the screen is pointless.
* @param {bool} lensMode: Whether lensMode should be active * @lensMode: A boolean to set the sense of lens mode.
*/ */
setLensMode(lensMode) { setLensMode(lensMode) {
this._lensMode = lensMode; this._lensMode = lensMode;
if (!this._lensMode) if (!this._lensMode)
this.setScreenPosition(this._screenPosition); this.setScreenPosition (this._screenPosition);
} }
/** /**
* isLensMode: * isLensMode:
* Is lens mode on or off? * Is lens mode on or off?
* @returns {bool} The lens mode state. * @return The lens mode state as a boolean.
*/ */
isLensMode() { isLensMode() {
return this._lensMode; return this._lensMode;
@@ -1005,7 +1003,7 @@ var ZoomRegion = class ZoomRegion {
* setClampScrollingAtEdges: * setClampScrollingAtEdges:
* Stop vs. allow scrolling of the magnified contents when it scroll beyond * Stop vs. allow scrolling of the magnified contents when it scroll beyond
* the edges of the screen. * the edges of the screen.
* @param {bool} clamp: Boolean to turn on/off clamping. * @clamp: Boolean to turn on/off clamping.
*/ */
setClampScrollingAtEdges(clamp) { setClampScrollingAtEdges(clamp) {
this._clampScrollingAtEdges = clamp; this._clampScrollingAtEdges = clamp;
@@ -1089,7 +1087,9 @@ var ZoomRegion = class ZoomRegion {
* setScreenPosition: * setScreenPosition:
* Positions the zoom region to one of the enumerated positions on the * Positions the zoom region to one of the enumerated positions on the
* screen. * screen.
* @param {GDesktopEnums.MagnifierScreenPosition} inPosition: the position * @position: one of Magnifier.FULL_SCREEN, Magnifier.TOP_HALF,
* Magnifier.BOTTOM_HALF,Magnifier.LEFT_HALF, or
* Magnifier.RIGHT_HALF.
*/ */
setScreenPosition(inPosition) { setScreenPosition(inPosition) {
switch (inPosition) { switch (inPosition) {
@@ -1115,7 +1115,7 @@ var ZoomRegion = class ZoomRegion {
* getScreenPosition: * getScreenPosition:
* Tell the outside world what the current mode is -- magnifiying the * Tell the outside world what the current mode is -- magnifiying the
* top half, bottom half, etc. * top half, bottom half, etc.
* @returns {GDesktopEnums.MagnifierScreenPosition}: the current position. * @return: the current mode.
*/ */
getScreenPosition() { getScreenPosition() {
return this._screenPosition; return this._screenPosition;
@@ -1124,8 +1124,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* scrollToMousePos: * scrollToMousePos:
* Set the region of interest based on the position of the system pointer. * Set the region of interest based on the position of the system pointer.
* @returns {bool}: Whether the system mouse pointer is over the * @return: Whether the system mouse pointer is over the magnified view.
* magnified view.
*/ */
scrollToMousePos() { scrollToMousePos() {
this._followingCursor = true; this._followingCursor = true;
@@ -1162,8 +1161,8 @@ var ZoomRegion = class ZoomRegion {
* scrollContentsTo: * scrollContentsTo:
* Shift the contents of the magnified view such it is centered on the given * Shift the contents of the magnified view such it is centered on the given
* coordinate. * coordinate.
* @param {number} x: The x-coord of the point to center on. * @x: The x-coord of the point to center on.
* @param {number} y: The y-coord of the point to center on. * @y: The y-coord of the point to center on.
*/ */
scrollContentsTo(x, y) { scrollContentsTo(x, y) {
this._clearScrollContentsTimer(); this._clearScrollContentsTimer();
@@ -1176,21 +1175,22 @@ var ZoomRegion = class ZoomRegion {
/** /**
* addCrosshairs: * addCrosshairs:
* Add crosshairs centered on the magnified mouse. * Add crosshairs centered on the magnified mouse.
* @param {Crosshairs} crossHairs: Crosshairs instance * @crossHairs: Crosshairs instance
*/ */
addCrosshairs(crossHairs) { addCrosshairs(crossHairs) {
this._crossHairs = crossHairs; this._crossHairs = crossHairs;
// If the crossHairs is not already within a larger container, add it // If the crossHairs is not already within a larger container, add it
// to this zoom region. Otherwise, add a clone. // to this zoom region. Otherwise, add a clone.
if (crossHairs && this.isActive()) if (crossHairs && this.isActive()) {
this._crossHairsActor = crossHairs.addToZoomRegion(this, this._mouseActor); this._crossHairsActor = crossHairs.addToZoomRegion(this, this._mouseActor);
}
} }
/** /**
* setInvertLightness: * setInvertLightness:
* Set whether to invert the lightness of the magnified view. * Set whether to invert the lightness of the magnified view.
* @param {bool} flag: whether brightness should be inverted * @flag Boolean to either invert brightness (true), or not (false).
*/ */
setInvertLightness(flag) { setInvertLightness(flag) {
this._invertLightness = flag; this._invertLightness = flag;
@@ -1201,7 +1201,7 @@ var ZoomRegion = class ZoomRegion {
/** /**
* getInvertLightness: * getInvertLightness:
* Retrieve whether the lightness is inverted. * Retrieve whether the lightness is inverted.
* @returns {bool} whether brightness should be inverted * @return Boolean indicating inversion (true), or not (false).
*/ */
getInvertLightness() { getInvertLightness() {
return this._invertLightness; return this._invertLightness;
@@ -1210,9 +1210,9 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setColorSaturation: * setColorSaturation:
* Set the color saturation of the magnified view. * Set the color saturation of the magnified view.
* @param {number} saturation: A value from 0.0 to 1.0 that defines * @sauration A value from 0.0 to 1.0 that defines the color
* the color saturation, with 0.0 defining no color (grayscale), * saturation, with 0.0 defining no color (grayscale),
* and 1.0 defining full color. * and 1.0 defining full color.
*/ */
setColorSaturation(saturation) { setColorSaturation(saturation) {
this._colorSaturation = saturation; this._colorSaturation = saturation;
@@ -1223,7 +1223,6 @@ var ZoomRegion = class ZoomRegion {
/** /**
* getColorSaturation: * getColorSaturation:
* Retrieve the color saturation of the magnified view. * Retrieve the color saturation of the magnified view.
* @returns {number} the color saturation
*/ */
getColorSaturation() { getColorSaturation() {
return this._colorSaturation; return this._colorSaturation;
@@ -1232,14 +1231,10 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setBrightness: * setBrightness:
* Alter the brightness of the magnified view. * Alter the brightness of the magnified view.
* @param {Object} brightness: Object containing the contrast for the * @brightness Object containing the contrast for the red, green,
* red, green, and blue channels. Values of 0.0 represent "standard" * and blue channels. Values of 0.0 represent "standard"
* brightness (no change), whereas values less or greater than * brightness (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed brightness, respectively. * 0.0 indicate decreased or incresaed brightness, respectively.
*
* {number} brightness.r - the red component
* {number} brightness.g - the green component
* {number} brightness.b - the blue component
*/ */
setBrightness(brightness) { setBrightness(brightness) {
this._brightness.r = brightness.r; this._brightness.r = brightness.r;
@@ -1252,14 +1247,10 @@ var ZoomRegion = class ZoomRegion {
/** /**
* setContrast: * setContrast:
* Alter the contrast of the magnified view. * Alter the contrast of the magnified view.
* @param {Object} contrast: Object containing the contrast for the * @contrast Object containing the contrast for the red, green,
* red, green, and blue channels. Values of 0.0 represent "standard" * and blue channels. Values of 0.0 represent "standard"
* contrast (no change), whereas values less or greater than * contrast (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed contrast, respectively. * 0.0 indicate decreased or incresaed contrast, respectively.
*
* {number} contrast.r - the red component
* {number} contrast.g - the green component
* {number} contrast.b - the blue component
*/ */
setContrast(contrast) { setContrast(contrast) {
this._contrast.r = contrast.r; this._contrast.r = contrast.r;
@@ -1272,8 +1263,8 @@ var ZoomRegion = class ZoomRegion {
/** /**
* getContrast: * getContrast:
* Retrieve the contrast of the magnified view. * Retrieve the contrast of the magnified view.
* @returns {{r: number, g: number, b: number}}: Object containing * @return Object containing the contrast for the red, green,
* the contrast for the red, green, and blue channels. * and blue channels.
*/ */
getContrast() { getContrast() {
let contrast = {}; let contrast = {};
@@ -1283,15 +1274,15 @@ var ZoomRegion = class ZoomRegion {
return contrast; return contrast;
} }
// Private methods // //// Private methods ////
_createActors() { _createActors() {
// The root actor for the zoom region // The root actor for the zoom region
this._magView = new St.Bin({ style_class: 'magnifier-zoom-region' }); this._magView = new St.Bin({ style_class: 'magnifier-zoom-region', x_fill: true, y_fill: true });
global.stage.add_actor(this._magView); global.stage.add_actor(this._magView);
// hide the magnified region from CLUTTER_PICK_ALL // hide the magnified region from CLUTTER_PICK_ALL
Shell.util_set_hidden_from_pick(this._magView, true); Shell.util_set_hidden_from_pick (this._magView, true);
// Add a group to clip the contents of the magnified view. // Add a group to clip the contents of the magnified view.
let mainGroup = new Clutter.Actor({ clip_to_allocation: true }); let mainGroup = new Clutter.Actor({ clip_to_allocation: true });
@@ -1331,7 +1322,7 @@ var ZoomRegion = class ZoomRegion {
_destroyActors() { _destroyActors() {
if (this._mouseActor == this._mouseSourceActor) if (this._mouseActor == this._mouseSourceActor)
this._mouseActor.get_parent().remove_actor(this._mouseActor); this._mouseActor.get_parent().remove_actor (this._mouseActor);
if (this._crossHairs) if (this._crossHairs)
this._crossHairs.removeFromParent(this._crossHairsActor); this._crossHairs.removeFromParent(this._crossHairsActor);
@@ -1411,12 +1402,11 @@ var ZoomRegion = class ZoomRegion {
// If in lens mode, move the magnified view such that it is centered // If in lens mode, move the magnified view such that it is centered
// over the actual mouse. However, in full screen mode, the "lens" is // over the actual mouse. However, in full screen mode, the "lens" is
// the size of the screen -- pointless to move such a large lens around. // the size of the screen -- pointless to move such a large lens around.
if (this._lensMode && !this._isFullScreen()) { if (this._lensMode && !this._isFullScreen())
this._setViewPort({ x: this._xCenter - this._viewPortWidth / 2, this._setViewPort({ x: this._xCenter - this._viewPortWidth / 2,
y: this._yCenter - this._viewPortHeight / 2, y: this._yCenter - this._viewPortHeight / 2,
width: this._viewPortWidth, width: this._viewPortWidth,
height: this._viewPortHeight }, true); height: this._viewPortHeight }, true);
}
this._updateCloneGeometry(); this._updateCloneGeometry();
this._updateMousePosition(); this._updateMousePosition();
@@ -1430,9 +1420,10 @@ var ZoomRegion = class ZoomRegion {
let xMouse = this._magnifier.xMouse; let xMouse = this._magnifier.xMouse;
let yMouse = this._magnifier.yMouse; let yMouse = this._magnifier.yMouse;
mouseIsOver = mouseIsOver = (
xMouse >= this._viewPortX && xMouse < (this._viewPortX + this._viewPortWidth) && xMouse >= this._viewPortX && xMouse < (this._viewPortX + this._viewPortWidth) &&
yMouse >= this._viewPortY && yMouse < (this._viewPortY + this._viewPortHeight); yMouse >= this._viewPortY && yMouse < (this._viewPortY + this._viewPortHeight)
);
} }
return mouseIsOver; return mouseIsOver;
} }
@@ -1457,12 +1448,13 @@ var ZoomRegion = class ZoomRegion {
let xMouse = this._magnifier.xMouse; let xMouse = this._magnifier.xMouse;
let yMouse = this._magnifier.yMouse; let yMouse = this._magnifier.yMouse;
if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) {
return this._centerFromPointProportional(xMouse, yMouse); return this._centerFromPointProportional(xMouse, yMouse);
else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
return this._centerFromPointPush(xMouse, yMouse); return this._centerFromPointPush(xMouse, yMouse);
else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
return this._centerFromPointCentered(xMouse, yMouse); return this._centerFromPointCentered(xMouse, yMouse);
}
return null; // Should never be hit return null; // Should never be hit
} }
@@ -1504,14 +1496,14 @@ var ZoomRegion = class ZoomRegion {
let yRoiBottom = yRoi + heightRoi - cursorHeight; let yRoiBottom = yRoi + heightRoi - cursorHeight;
if (xPoint < xRoi) if (xPoint < xRoi)
xPos -= xRoi - xPoint; xPos -= (xRoi - xPoint);
else if (xPoint > xRoiRight) else if (xPoint > xRoiRight)
xPos += xPoint - xRoiRight; xPos += (xPoint - xRoiRight);
if (yPoint < yRoi) if (yPoint < yRoi)
yPos -= yRoi - yPoint; yPos -= (yRoi - yPoint);
else if (yPoint > yRoiBottom) else if (yPoint > yRoiBottom)
yPos += yPoint - yRoiBottom; yPos += (yPoint - yRoiBottom);
return [xPos, yPos]; return [xPos, yPos];
} }
@@ -1608,7 +1600,7 @@ class Crosshairs extends Clutter.Actor {
super._init({ super._init({
clip_to_allocation: false, clip_to_allocation: false,
width: groupWidth, width: groupWidth,
height: groupHeight, height: groupHeight
}); });
this._horizLeftHair = new Clutter.Actor(); this._horizLeftHair = new Clutter.Actor();
this._horizRightHair = new Clutter.Actor(); this._horizRightHair = new Clutter.Actor();
@@ -1637,12 +1629,11 @@ class Crosshairs extends Clutter.Actor {
* already part of some other ZoomRegion, create a clone of the crosshairs * already part of some other ZoomRegion, create a clone of the crosshairs
* actor, and add the clone instead. Returns either the original or the * actor, and add the clone instead. Returns either the original or the
* clone. * clone.
* @param {ZoomRegion} zoomRegion: The container to add the crosshairs * @zoomRegion: The container to add the crosshairs group to.
* group to. * @magnifiedMouse: The mouse actor for the zoom region -- used to
* @param {Clutter.Actor} magnifiedMouse: The mouse actor for the * position the crosshairs and properly layer them below
* zoom region -- used to position the crosshairs and properly * the mouse.
* layer them below the mouse. * @return The crosshairs actor, or its clone.
* @returns {Clutter.Actor} The crosshairs actor, or its clone.
*/ */
addToZoomRegion(zoomRegion, magnifiedMouse) { addToZoomRegion(zoomRegion, magnifiedMouse) {
let crosshairsActor = null; let crosshairsActor = null;
@@ -1660,7 +1651,7 @@ class Crosshairs extends Clutter.Actor {
} }
container.add_actor(crosshairsActor); container.add_actor(crosshairsActor);
container.set_child_above_sibling(magnifiedMouse, crosshairsActor); container.raise_child(magnifiedMouse, crosshairsActor);
let [xMouse, yMouse] = magnifiedMouse.get_position(); let [xMouse, yMouse] = magnifiedMouse.get_position();
let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size(); let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size();
crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2); crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2);
@@ -1671,8 +1662,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* removeFromParent: * removeFromParent:
* @param {Clutter.Actor} childActor: the actor returned from * @childActor: the actor returned from addToZoomRegion
* addToZoomRegion
* Remove the crosshairs actor from its parent container, or destroy the * Remove the crosshairs actor from its parent container, or destroy the
* child actor if it was just a clone of the crosshairs actor. * child actor if it was just a clone of the crosshairs actor.
*/ */
@@ -1686,7 +1676,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* setColor: * setColor:
* Set the color of the crosshairs. * Set the color of the crosshairs.
* @param {Clutter.Color} clutterColor: The color * @clutterColor: The color as a Clutter.Color.
*/ */
setColor(clutterColor) { setColor(clutterColor) {
this._horizLeftHair.background_color = clutterColor; this._horizLeftHair.background_color = clutterColor;
@@ -1698,7 +1688,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* getColor: * getColor:
* Get the color of the crosshairs. * Get the color of the crosshairs.
* @returns {ClutterColor} the crosshairs color * @color: The color as a Clutter.Color.
*/ */
getColor() { getColor() {
return this._horizLeftHair.get_color(); return this._horizLeftHair.get_color();
@@ -1707,7 +1697,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* setThickness: * setThickness:
* Set the width of the vertical and horizontal lines of the crosshairs. * Set the width of the vertical and horizontal lines of the crosshairs.
* @param {number} thickness: the new thickness value * @thickness
*/ */
setThickness(thickness) { setThickness(thickness) {
this._horizLeftHair.set_height(thickness); this._horizLeftHair.set_height(thickness);
@@ -1720,7 +1710,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* getThickness: * getThickness:
* Get the width of the vertical and horizontal lines of the crosshairs. * Get the width of the vertical and horizontal lines of the crosshairs.
* @returns {number} The thickness of the crosshairs. * @return: The thickness of the crosshairs.
*/ */
getThickness() { getThickness() {
return this._horizLeftHair.get_height(); return this._horizLeftHair.get_height();
@@ -1729,8 +1719,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* setOpacity: * setOpacity:
* Set how opaque the crosshairs are. * Set how opaque the crosshairs are.
* @param {number} opacity: Value between 0 (fully transparent) * @opacity: Value between 0 (fully transparent) and 255 (full opaque).
* and 255 (full opaque).
*/ */
setOpacity(opacity) { setOpacity(opacity) {
// set_opacity() throws an exception for values outside the range // set_opacity() throws an exception for values outside the range
@@ -1749,7 +1738,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* setLength: * setLength:
* Set the length of the vertical and horizontal lines in the crosshairs. * Set the length of the vertical and horizontal lines in the crosshairs.
* @param {number} length: The length of the crosshairs. * @length: The length of the crosshairs.
*/ */
setLength(length) { setLength(length) {
this._horizLeftHair.set_width(length); this._horizLeftHair.set_width(length);
@@ -1762,7 +1751,7 @@ class Crosshairs extends Clutter.Actor {
/** /**
* getLength: * getLength:
* Get the length of the vertical and horizontal lines in the crosshairs. * Get the length of the vertical and horizontal lines in the crosshairs.
* @returns {number} The length of the crosshairs. * @return: The length of the crosshairs.
*/ */
getLength() { getLength() {
return this._horizLeftHair.get_width(); return this._horizLeftHair.get_width();
@@ -1772,8 +1761,8 @@ class Crosshairs extends Clutter.Actor {
* setClip: * setClip:
* Set the width and height of the rectangle that clips the crosshairs at * Set the width and height of the rectangle that clips the crosshairs at
* their intersection * their intersection
* @param {number[]} size: Array of [width, height] defining the size * @size: Array of [width, height] defining the size of the clip
* of the clip rectangle. * rectangle.
*/ */
setClip(size) { setClip(size) {
if (size) { if (size) {
@@ -1793,7 +1782,7 @@ class Crosshairs extends Clutter.Actor {
* Reposition the horizontal and vertical hairs such that they cross at * Reposition the horizontal and vertical hairs such that they cross at
* the center of crosshairs group. If called with the dimensions of * the center of crosshairs group. If called with the dimensions of
* the clip rectangle, these are used to update the size of the clip. * the clip rectangle, these are used to update the size of the clip.
* @param {number[]=} clipSize: If present, the clip's [width, height]. * @clipSize: Optional. If present, an array of the form [width, height].
*/ */
reCenter(clipSize) { reCenter(clipSize) {
let [groupWidth, groupHeight] = this.get_size(); let [groupWidth, groupHeight] = this.get_size();
@@ -1851,7 +1840,7 @@ var MagShaderEffects = class MagShaderEffects {
/** /**
* setInvertLightness: * setInvertLightness:
* Enable/disable invert lightness effect. * Enable/disable invert lightness effect.
* @param {bool} invertFlag: Enabled flag. * @invertFlag: Enabled flag.
*/ */
setInvertLightness(invertFlag) { setInvertLightness(invertFlag) {
this._inverse.set_enabled(invertFlag); this._inverse.set_enabled(invertFlag);
@@ -1864,14 +1853,11 @@ var MagShaderEffects = class MagShaderEffects {
/** /**
* setBrightness: * setBrightness:
* Set the brightness of the magnified view. * Set the brightness of the magnified view.
* @param {Object} brightness: Object containing the contrast for the * @brightness: Object containing the brightness for the red, green,
* red, green, and blue channels. Values of 0.0 represent "standard" * and blue channels. Values of 0.0 represent "standard"
* brightness (no change), whereas values less or greater than * brightness (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed brightness, respectively. * 0.0 indicate decreased or incresaed brightness,
* * respectively.
* {number} brightness.r - the red component
* {number} brightness.g - the green component
* {number} brightness.b - the blue component
*/ */
setBrightness(brightness) { setBrightness(brightness) {
let bRed = brightness.r; let bRed = brightness.r;
@@ -1883,21 +1869,17 @@ var MagShaderEffects = class MagShaderEffects {
// it modifies the brightness and/or contrast. // it modifies the brightness and/or contrast.
let [cRed, cGreen, cBlue] = this._brightnessContrast.get_contrast(); let [cRed, cGreen, cBlue] = this._brightnessContrast.get_contrast();
this._brightnessContrast.set_enabled( this._brightnessContrast.set_enabled(
bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE || (bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE ||
cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE)
); );
} }
/** /**
* Set the contrast of the magnified view. * Set the contrast of the magnified view.
* @param {Object} contrast: Object containing the contrast for the * @contrast: Object containing the contrast for the red, green,
* red, green, and blue channels. Values of 0.0 represent "standard" * and blue channels. Values of 0.0 represent "standard"
* contrast (no change), whereas values less or greater than * contrast (no change), whereas values less or greater than
* 0.0 indicate decreased or incresaed contrast, respectively. * 0.0 indicate decreased or incresaed contrast, respectively.
*
* {number} contrast.r - the red component
* {number} contrast.g - the green component
* {number} contrast.b - the blue component
*/ */
setContrast(contrast) { setContrast(contrast) {
let cRed = contrast.r; let cRed = contrast.r;

View File

@@ -32,7 +32,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* setActive: * setActive:
* @param {bool} activate: activate or de-activate the magnifier. * @activate: Boolean to activate or de-activate the magnifier.
*/ */
setActive(activate) { setActive(activate) {
Main.magnifier.setActive(activate); Main.magnifier.setActive(activate);
@@ -40,7 +40,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* isActive: * isActive:
* @returns {bool} Whether the magnifier is active. * @return Whether the magnifier is active (boolean).
*/ */
isActive() { isActive() {
return Main.magnifier.isActive(); return Main.magnifier.isActive();
@@ -65,25 +65,22 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* createZoomRegion: * createZoomRegion:
* Create a new ZoomRegion and return its object path. * Create a new ZoomRegion and return its object path.
* @param {number} xMagFactor: * @xMagFactor: The power to set horizontal magnification of the
* The power to set horizontal magnification of the ZoomRegion. * ZoomRegion. A value of 1.0 means no magnification. A
* A value of 1.0 means no magnification. A value of 2.0 doubles * value of 2.0 doubles the size.
* the size. * @yMagFactor: The power to set the vertical magnification of the
* @param {number} yMagFactor: * ZoomRegion.
* The power to set the vertical magnification of the * @roi Array of integers defining the region of the
* ZoomRegion. * screen/desktop to magnify. The array has the form
* @param {number[]} roi * [left, top, right, bottom].
* Array of integers defining the region of the screen/desktop * @viewPort Array of integers, [left, top, right, bottom] that defines
* to magnify. The array has the form [left, top, right, bottom]. * the position of the ZoomRegion on screen.
* @param {number[]} viewPort
* Array of integers, [left, top, right, bottom] that defines
* the position of the ZoomRegion on screen.
* *
* FIXME: The arguments here are redundant, since the width and height of * FIXME: The arguments here are redundant, since the width and height of
* the ROI are determined by the viewport and magnification factors. * the ROI are determined by the viewport and magnification factors.
* We ignore the passed in width and height. * We ignore the passed in width and height.
* *
* @returns {ZoomRegion} The newly created ZoomRegion. * @return The newly created ZoomRegion.
*/ */
createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) { createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) {
let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] }; let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
@@ -103,9 +100,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* addZoomRegion: * addZoomRegion:
* Append the given ZoomRegion to the magnifier's list of ZoomRegions. * Append the given ZoomRegion to the magnifier's list of ZoomRegions.
* @param {string} zoomerObjectPath: The object path for the zoom * @zoomerObjectPath: The object path for the zoom region proxy.
* region proxy.
* @returns {bool} whether the region was added successfully
*/ */
addZoomRegion(zoomerObjectPath) { addZoomRegion(zoomerObjectPath) {
let proxyAndZoomRegion = this._zoomers[zoomerObjectPath]; let proxyAndZoomRegion = this._zoomers[zoomerObjectPath];
@@ -120,8 +115,8 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* getZoomRegions: * getZoomRegions:
* Return a list of ZoomRegion object paths for this Magnifier. * Return a list of ZoomRegion object paths for this Magnifier.
* @returns {string[]}: The Magnifier's zoom region list as an array * @return: The Magnifier's zoom region list as an array of DBus object
* of DBus object paths. * paths.
*/ */
getZoomRegions() { getZoomRegions() {
// There may be more ZoomRegions in the magnifier itself than have // There may be more ZoomRegions in the magnifier itself than have
@@ -130,7 +125,7 @@ var ShellMagnifier = class ShellMagnifier {
let zoomRegions = Main.magnifier.getZoomRegions(); let zoomRegions = Main.magnifier.getZoomRegions();
let objectPaths = []; let objectPaths = [];
let thoseZoomers = this._zoomers; let thoseZoomers = this._zoomers;
zoomRegions.forEach(aZoomRegion => { zoomRegions.forEach (aZoomRegion => {
let found = false; let found = false;
for (let objectPath in thoseZoomers) { for (let objectPath in thoseZoomers) {
let proxyAndZoomRegion = thoseZoomers[objectPath]; let proxyAndZoomRegion = thoseZoomers[objectPath];
@@ -142,7 +137,7 @@ var ShellMagnifier = class ShellMagnifier {
} }
if (!found) { if (!found) {
// Got a ZoomRegion with no DBus proxy, make one. // Got a ZoomRegion with no DBus proxy, make one.
let newPath = `${ZOOM_SERVICE_PATH}/zoomer${_zoomRegionInstanceCount}`; let newPath = ZOOM_SERVICE_PATH + '/zoomer' + _zoomRegionInstanceCount;
_zoomRegionInstanceCount++; _zoomRegionInstanceCount++;
let zoomRegionProxy = new ShellMagnifierZoomRegion(newPath, aZoomRegion); let zoomRegionProxy = new ShellMagnifierZoomRegion(newPath, aZoomRegion);
let proxyAndZoomer = {}; let proxyAndZoomer = {};
@@ -174,7 +169,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* fullScreenCapable: * fullScreenCapable:
* Consult if the Magnifier can magnify in full-screen mode. * Consult if the Magnifier can magnify in full-screen mode.
* @returns {bool} Always return true. * @return Always return true.
*/ */
fullScreenCapable() { fullScreenCapable() {
return true; return true;
@@ -183,7 +178,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* setCrosswireSize: * setCrosswireSize:
* Set the crosswire size of all ZoomRegions. * Set the crosswire size of all ZoomRegions.
* @param {number} size: The thickness of each line in the cross wire. * @size: The thickness of each line in the cross wire.
*/ */
setCrosswireSize(size) { setCrosswireSize(size) {
Main.magnifier.setCrosshairsThickness(size); Main.magnifier.setCrosshairsThickness(size);
@@ -192,7 +187,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* getCrosswireSize: * getCrosswireSize:
* Get the crosswire size of all ZoomRegions. * Get the crosswire size of all ZoomRegions.
* @returns {number}: The thickness of each line in the cross wire. * @return: The thickness of each line in the cross wire.
*/ */
getCrosswireSize() { getCrosswireSize() {
return Main.magnifier.getCrosshairsThickness(); return Main.magnifier.getCrosshairsThickness();
@@ -201,16 +196,16 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* setCrosswireLength: * setCrosswireLength:
* Set the crosswire length of all zoom-regions.. * Set the crosswire length of all zoom-regions..
* @param {number} length: The length of each line in the cross wire. * @size: The length of each line in the cross wire.
*/ */
setCrosswireLength(length) { setCrosswireLength(length) {
Main.magnifier.setCrosshairsLength(length); Main.magnifier.setCrosshairsLength(length);
} }
/** /**
* getCrosswireSize: * setCrosswireSize:
* Get the crosswire length of all zoom-regions. * Set the crosswire size of all zoom-regions.
* @returns {number} size: The length of each line in the cross wire. * @size: The thickness of each line in the cross wire.
*/ */
getCrosswireLength() { getCrosswireLength() {
return Main.magnifier.getCrosshairsLength(); return Main.magnifier.getCrosshairsLength();
@@ -219,7 +214,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* setCrosswireClip: * setCrosswireClip:
* Set if the crosswire will be clipped by the cursor image.. * Set if the crosswire will be clipped by the cursor image..
* @param {bool} clip: Flag to indicate whether to clip the crosswire. * @clip: Flag to indicate whether to clip the crosswire.
*/ */
setCrosswireClip(clip) { setCrosswireClip(clip) {
Main.magnifier.setCrosshairsClip(clip); Main.magnifier.setCrosshairsClip(clip);
@@ -228,7 +223,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* getCrosswireClip: * getCrosswireClip:
* Get the crosswire clip value. * Get the crosswire clip value.
* @returns {bool}: Whether the crosswire is clipped by the cursor image. * @return: Whether the crosswire is clipped by the cursor image.
*/ */
getCrosswireClip() { getCrosswireClip() {
return Main.magnifier.getCrosshairsClip(); return Main.magnifier.getCrosshairsClip();
@@ -237,7 +232,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* setCrosswireColor: * setCrosswireColor:
* Set the crosswire color of all ZoomRegions. * Set the crosswire color of all ZoomRegions.
* @param {number} color: Unsigned int of the form rrggbbaa. * @color: Unsigned int of the form rrggbbaa.
*/ */
setCrosswireColor(color) { setCrosswireColor(color) {
Main.magnifier.setCrosshairsColor('#%08x'.format(color)); Main.magnifier.setCrosshairsColor('#%08x'.format(color));
@@ -246,8 +241,7 @@ var ShellMagnifier = class ShellMagnifier {
/** /**
* getCrosswireClip: * getCrosswireClip:
* Get the crosswire color of all ZoomRegions. * Get the crosswire color of all ZoomRegions.
* @returns {number}: The crosswire color as an unsigned int in * @return: The crosswire color as an unsigned int in the form rrggbbaa.
* the form rrggbbaa.
*/ */
getCrosswireColor() { getCrosswireColor() {
let colorString = Main.magnifier.getCrosshairsColor(); let colorString = Main.magnifier.getCrosshairsColor();
@@ -272,11 +266,11 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
/** /**
* setMagFactor: * setMagFactor:
* @param {number} xMagFactor: The power to set the horizontal * @xMagFactor: The power to set the horizontal magnification factor to
* magnification factor to of the magnified view. A value of * of the magnified view. A value of 1.0 means no
* 1.0 means no magnification. A value of 2.0 doubles the size. * magnification. A value of 2.0 doubles the size.
* @param {number} yMagFactor: The power to set the vertical * @yMagFactor: The power to set the vertical magnification factor to
* magnification factor to of the magnified view. * of the magnified view.
*/ */
setMagFactor(xMagFactor, yMagFactor) { setMagFactor(xMagFactor, yMagFactor) {
this._zoomRegion.setMagFactor(xMagFactor, yMagFactor); this._zoomRegion.setMagFactor(xMagFactor, yMagFactor);
@@ -284,7 +278,7 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
/** /**
* getMagFactor: * getMagFactor:
* @returns {number[]}: [xMagFactor, yMagFactor], containing the horizontal * @return an array, [xMagFactor, yMagFactor], containing the horizontal
* and vertical magnification powers. A value of 1.0 means no * and vertical magnification powers. A value of 1.0 means no
* magnification. A value of 2.0 means the contents are doubled * magnification. A value of 2.0 means the contents are doubled
* in size, and so on. * in size, and so on.
@@ -296,9 +290,9 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
/** /**
* setRoi: * setRoi:
* Sets the "region of interest" that the ZoomRegion is magnifying. * Sets the "region of interest" that the ZoomRegion is magnifying.
* @param {number[]} roi: [left, top, right, bottom], defining the * @roi Array, [left, top, right, bottom], defining the region of the
* region of the screen to magnify. * screen to magnify. The values are in screen (unmagnified)
* The values are in screen (unmagnified) coordinate space. * coordinate space.
*/ */
setRoi(roi) { setRoi(roi) {
let roiObject = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] }; let roiObject = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
@@ -310,7 +304,7 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
* Retrieves the "region of interest" -- the rectangular bounds of that part * Retrieves the "region of interest" -- the rectangular bounds of that part
* of the desktop that the magnified view is showing (x, y, width, height). * of the desktop that the magnified view is showing (x, y, width, height).
* The bounds are given in non-magnified coordinates. * The bounds are given in non-magnified coordinates.
* @returns {Array}: [left, top, right, bottom], representing the bounding * @return an array, [left, top, right, bottom], representing the bounding
* rectangle of what is shown in the magnified view. * rectangle of what is shown in the magnified view.
*/ */
getRoi() { getRoi() {
@@ -323,11 +317,10 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
/** /**
* Set the "region of interest" by centering the given screen coordinate * Set the "region of interest" by centering the given screen coordinate
* within the zoom region. * within the zoom region.
* @param {number} x: The x-coord of the point to place at the * @x The x-coord of the point to place at the center of the zoom region.
* center of the zoom region. * @y The y-coord.
* @param {number} y: The y-coord. * @return Whether the shift was successful (for GS-mag, this is always
* @returns {bool} Whether the shift was successful (for GS-mag, this * true).
* is always true).
*/ */
shiftContentsTo(x, y) { shiftContentsTo(x, y) {
this._zoomRegion.scrollContentsTo(x, y); this._zoomRegion.scrollContentsTo(x, y);
@@ -337,8 +330,8 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
/** /**
* moveResize * moveResize
* Sets the position and size of the ZoomRegion on screen. * Sets the position and size of the ZoomRegion on screen.
* @param {number[]} viewPort: [left, top, right, bottom], defining * @viewPort Array, [left, top, right, bottom], defining the position and
* the position and size on screen to place the zoom region. * size on screen to place the zoom region.
*/ */
moveResize(viewPort) { moveResize(viewPort) {
let viewRect = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] }; let viewRect = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] };

View File

@@ -199,12 +199,12 @@ function _initializeUI() {
layoutManager.init(); layoutManager.init();
overview.init(); overview.init();
new PointerA11yTimeout.PointerA11yTimeout(); (new PointerA11yTimeout.PointerA11yTimeout());
_a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA }); _a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA });
global.display.connect('overlay-key', () => { global.display.connect('overlay-key', () => {
if (!_a11ySettings.get_boolean(STICKY_KEYS_ENABLE)) if (!_a11ySettings.get_boolean (STICKY_KEYS_ENABLE))
overview.toggle(); overview.toggle();
}); });
@@ -248,17 +248,17 @@ function _initializeUI() {
} }
layoutManager.connect('startup-complete', () => { layoutManager.connect('startup-complete', () => {
if (actionMode == Shell.ActionMode.NONE) if (actionMode == Shell.ActionMode.NONE) {
actionMode = Shell.ActionMode.NORMAL; actionMode = Shell.ActionMode.NORMAL;
}
if (screenShield) if (screenShield) {
screenShield.lockIfWasLocked(); screenShield.lockIfWasLocked();
}
if (sessionMode.currentMode != 'gdm' && if (sessionMode.currentMode != 'gdm' &&
sessionMode.currentMode != 'initial-setup') { sessionMode.currentMode != 'initial-setup') {
GLib.log_structured(LOG_DOMAIN, GLib.LogLevelFlags.LEVEL_MESSAGE, { GLib.log_structured(LOG_DOMAIN, GLib.LogLevelFlags.LEVEL_MESSAGE, {
'MESSAGE': `GNOME Shell started at ${_startDate}`, 'MESSAGE': `GNOME Shell started at ${_startDate}`,
'MESSAGE_ID': GNOMESHELL_STARTED_MESSAGE_ID, 'MESSAGE_ID': GNOMESHELL_STARTED_MESSAGE_ID
}); });
} }
@@ -289,19 +289,19 @@ function _initializeUI() {
function _getStylesheet(name) { function _getStylesheet(name) {
let stylesheet; let stylesheet;
stylesheet = Gio.File.new_for_uri(`resource:///org/gnome/shell/theme/${name}`); stylesheet = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/' + name);
if (stylesheet.query_exists(null)) if (stylesheet.query_exists(null))
return stylesheet; return stylesheet;
let dataDirs = GLib.get_system_data_dirs(); let dataDirs = GLib.get_system_data_dirs();
for (let i = 0; i < dataDirs.length; i++) { for (let i = 0; i < dataDirs.length; i++) {
let path = GLib.build_filenamev([dataDirs[i], 'gnome-shell', 'theme', name]); let path = GLib.build_filenamev([dataDirs[i], 'gnome-shell', 'theme', name]);
stylesheet = Gio.file_new_for_path(path); let stylesheet = Gio.file_new_for_path(path);
if (stylesheet.query_exists(null)) if (stylesheet.query_exists(null))
return stylesheet; return stylesheet;
} }
stylesheet = Gio.File.new_for_path(`${global.datadir}/theme/${name}`); stylesheet = Gio.File.new_for_path(global.datadir + '/theme/' + name);
if (stylesheet.query_exists(null)) if (stylesheet.query_exists(null))
return stylesheet; return stylesheet;
@@ -337,7 +337,7 @@ function _loadDefaultStylesheet() {
* *
* Get the theme CSS file that the shell will load * Get the theme CSS file that the shell will load
* *
* @returns {?Gio.File}: A #GFile that contains the theme CSS, * Returns: A #GFile that contains the theme CSS,
* null if using the default * null if using the default
*/ */
function getThemeStylesheet() { function getThemeStylesheet() {
@@ -346,8 +346,8 @@ function getThemeStylesheet() {
/** /**
* setThemeStylesheet: * setThemeStylesheet:
* @param {string=} cssStylesheet: A file path that contains the theme CSS, * @cssStylesheet: A file path that contains the theme CSS,
* set it to null to use the default * set it to null to use the default
* *
* Set the theme CSS file that the shell will load * Set the theme CSS file that the shell will load
*/ */
@@ -359,12 +359,12 @@ function reloadThemeResource() {
if (_themeResource) if (_themeResource)
_themeResource._unregister(); _themeResource._unregister();
_themeResource = Gio.Resource.load(`${global.datadir}/gnome-shell-theme.gresource`); _themeResource = Gio.Resource.load(global.datadir + '/gnome-shell-theme.gresource');
_themeResource._register(); _themeResource._register();
} }
function _loadOskLayouts() { function _loadOskLayouts() {
_oskResource = Gio.Resource.load(`${global.datadir}/gnome-shell-osk-layouts.gresource`); _oskResource = Gio.Resource.load(global.datadir + '/gnome-shell-osk-layouts.gresource');
_oskResource._register(); _oskResource._register();
} }
@@ -374,13 +374,11 @@ function _loadOskLayouts() {
* Reloads the theme CSS file * Reloads the theme CSS file
*/ */
function loadTheme() { function loadTheme() {
let themeContext = St.ThemeContext.get_for_stage(global.stage); let themeContext = St.ThemeContext.get_for_stage (global.stage);
let previousTheme = themeContext.get_theme(); let previousTheme = themeContext.get_theme();
let theme = new St.Theme({ let theme = new St.Theme ({ application_stylesheet: _cssStylesheet,
application_stylesheet: _cssStylesheet, default_stylesheet: _defaultCssStylesheet });
default_stylesheet: _defaultCssStylesheet,
});
if (theme.default_stylesheet == null) if (theme.default_stylesheet == null)
throw new Error("No valid stylesheet found for '%s'".format(sessionMode.stylesheetName)); throw new Error("No valid stylesheet found for '%s'".format(sessionMode.stylesheetName));
@@ -392,13 +390,13 @@ function loadTheme() {
theme.load_stylesheet(customStylesheets[i]); theme.load_stylesheet(customStylesheets[i]);
} }
themeContext.set_theme(theme); themeContext.set_theme (theme);
} }
/** /**
* notify: * notify:
* @param {string} msg: A message * @msg: A message
* @param {string} details: Additional information * @details: Additional information
*/ */
function notify(msg, details) { function notify(msg, details) {
let source = new MessageTray.SystemNotificationSource(); let source = new MessageTray.SystemNotificationSource();
@@ -410,8 +408,8 @@ function notify(msg, details) {
/** /**
* notifyError: * notifyError:
* @param {string} msg: An error message * @msg: An error message
* @param {string} details: Additional information * @details: Additional information
* *
* See shell_global_notify_problem(). * See shell_global_notify_problem().
*/ */
@@ -435,8 +433,8 @@ function _findModal(actor) {
/** /**
* pushModal: * pushModal:
* @param {Clutter.Actor} actor: actor which will be given keyboard focus * @actor: #ClutterActor which will be given keyboard focus
* @param {Object=} params: optional parameters * @params: optional parameters
* *
* Ensure we are in a mode where all keyboard and mouse input goes to * Ensure we are in a mode where all keyboard and mouse input goes to
* the stage, and focus @actor. Multiple calls to this function act in * the stage, and focus @actor. Multiple calls to this function act in
@@ -459,7 +457,7 @@ function _findModal(actor) {
* global keybindings; the default of NONE will filter * global keybindings; the default of NONE will filter
* out all keybindings * out all keybindings
* *
* @returns {bool}: true iff we successfully acquired a grab or already had one * Returns: true iff we successfully acquired a grab or already had one
*/ */
function pushModal(actor, params) { function pushModal(actor, params) {
params = Params.parse(params, { timestamp: global.get_current_time(), params = Params.parse(params, { timestamp: global.get_current_time(),
@@ -490,11 +488,11 @@ function pushModal(actor, params) {
modalActorFocusStack[index].prevFocus = null; modalActorFocusStack[index].prevFocus = null;
}); });
} }
modalActorFocusStack.push({ actor, modalActorFocusStack.push({ actor: actor,
destroyId: actorDestroyId, destroyId: actorDestroyId,
prevFocus, prevFocus: prevFocus,
prevFocusDestroyId, prevFocusDestroyId: prevFocusDestroyId,
actionMode }); actionMode: actionMode });
actionMode = params.actionMode; actionMode = params.actionMode;
global.stage.set_key_focus(actor); global.stage.set_key_focus(actor);
@@ -503,9 +501,8 @@ function pushModal(actor, params) {
/** /**
* popModal: * popModal:
* @param {Clutter.Actor} actor: the actor passed to original invocation * @actor: #ClutterActor passed to original invocation of pushModal()
* of pushModal() * @timestamp: optional timestamp
* @param {number=} timestamp: optional timestamp
* *
* Reverse the effect of pushModal(). If this invocation is undoing * Reverse the effect of pushModal(). If this invocation is undoing
* the topmost invocation, then the focus will be restored to the * the topmost invocation, then the focus will be restored to the
@@ -576,24 +573,24 @@ function popModal(actor, timestamp) {
} }
function createLookingGlass() { function createLookingGlass() {
if (lookingGlass == null) if (lookingGlass == null) {
lookingGlass = new LookingGlass.LookingGlass(); lookingGlass = new LookingGlass.LookingGlass();
}
return lookingGlass; return lookingGlass;
} }
function openRunDialog() { function openRunDialog() {
if (runDialog == null) if (runDialog == null) {
runDialog = new RunDialog.RunDialog(); runDialog = new RunDialog.RunDialog();
}
runDialog.open(); runDialog.open();
} }
/** /**
* activateWindow: * activateWindow:
* @param {Meta.Window} window: the window to activate * @window: the Meta.Window to activate
* @param {number=} time: current event time * @time: (optional) current event time
* @param {number=} workspaceNum: window's workspace number * @workspaceNum: (optional) window's workspace number
* *
* Activates @window, switching to its workspace first if necessary, * Activates @window, switching to its workspace first if necessary,
* and switching out of the overview if it's currently active * and switching out of the overview if it's currently active
@@ -601,7 +598,7 @@ function openRunDialog() {
function activateWindow(window, time, workspaceNum) { function activateWindow(window, time, workspaceNum) {
let workspaceManager = global.workspace_manager; let workspaceManager = global.workspace_manager;
let activeWorkspaceNum = workspaceManager.get_active_workspace_index(); let activeWorkspaceNum = workspaceManager.get_active_workspace_index();
let windowWorkspaceNum = workspaceNum !== undefined ? workspaceNum : window.get_workspace().index(); let windowWorkspaceNum = (workspaceNum !== undefined) ? workspaceNum : window.get_workspace().index();
if (!time) if (!time)
time = global.get_current_time(); time = global.get_current_time();
@@ -669,8 +666,8 @@ function _queueBeforeRedraw(workId) {
/** /**
* initializeDeferredWork: * initializeDeferredWork:
* @param {Clutter.Actor} actor: an actor * @actor: A #ClutterActor
* @param {callback} callback: Function to invoke to perform work * @callback: Function to invoke to perform work
* *
* This function sets up a callback to be invoked when either the * This function sets up a callback to be invoked when either the
* given actor is mapped, or after some period of time when the machine * given actor is mapped, or after some period of time when the machine
@@ -683,13 +680,13 @@ function _queueBeforeRedraw(workId) {
* initialization as well, under the assumption that new actors * initialization as well, under the assumption that new actors
* will need it. * will need it.
* *
* @returns {string}: A string work identifier * Returns: A string work identifier
*/ */
function initializeDeferredWork(actor, callback) { function initializeDeferredWork(actor, callback) {
// Turn into a string so we can use as an object property // Turn into a string so we can use as an object property
let workId = `${++_deferredWorkSequence}`; let workId = `${(++_deferredWorkSequence)}`;
_deferredWorkData[workId] = { actor, _deferredWorkData[workId] = { 'actor': actor,
callback }; 'callback': callback };
actor.connect('notify::mapped', () => { actor.connect('notify::mapped', () => {
if (!(actor.mapped && _deferredWorkQueue.includes(workId))) if (!(actor.mapped && _deferredWorkQueue.includes(workId)))
return; return;
@@ -707,7 +704,7 @@ function initializeDeferredWork(actor, callback) {
/** /**
* queueDeferredWork: * queueDeferredWork:
* @param {string} workId: work identifier * @workId: work identifier
* *
* Ensure that the work identified by @workId will be * Ensure that the work identified by @workId will be
* run on map or timeout. You should call this function * run on map or timeout. You should call this function
@@ -743,13 +740,12 @@ class RestartMessage extends ModalDialog.ModalDialog {
shouldFadeIn: false, shouldFadeIn: false,
destroyOnClose: true }); destroyOnClose: true });
let label = new St.Label({ let label = new St.Label({ text: message });
text: message,
x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER,
});
this.contentLayout.add_child(label); this.contentLayout.add(label, { x_fill: false,
y_fill: false,
x_align: St.Align.MIDDLE,
y_align: St.Align.MIDDLE });
this.buttonLayout.hide(); this.buttonLayout.hide();
} }
}); });

View File

@@ -39,7 +39,7 @@ class URLHighlighter extends St.Label {
reactive: true, reactive: true,
style_class: 'url-highlighter', style_class: 'url-highlighter',
x_expand: true, x_expand: true,
x_align: Clutter.ActorAlign.START, x_align: Clutter.ActorAlign.START
}); });
this._linkColor = '#ccccff'; this._linkColor = '#ccccff';
this.connect('style-changed', () => { this.connect('style-changed', () => {
@@ -79,7 +79,7 @@ class URLHighlighter extends St.Label {
if (urlId != -1) { if (urlId != -1) {
let url = this._urls[urlId].url; let url = this._urls[urlId].url;
if (!url.includes(':')) if (!url.includes(':'))
url = `http://${url}`; url = 'http://' + url;
Gio.app_info_launch_default_for_uri( Gio.app_info_launch_default_for_uri(
url, global.create_app_launch_context(0, -1)); url, global.create_app_launch_context(0, -1));
@@ -132,7 +132,7 @@ class URLHighlighter extends St.Label {
for (let i = 0; i < urls.length; i++) { for (let i = 0; i < urls.length; i++) {
let url = urls[i]; let url = urls[i];
let str = this._text.substr(pos, url.pos - pos); let str = this._text.substr(pos, url.pos - pos);
markup += `${str}<span foreground="${this._linkColor}"><u>${url.url}</u></span>`; markup += str + '<span foreground="' + this._linkColor + '"><u>' + url.url + '</u></span>';
pos = url.pos + url.url.length; pos = url.pos + url.url.length;
} }
markup += this._text.substr(pos); markup += this._text.substr(pos);
@@ -150,11 +150,10 @@ class URLHighlighter extends St.Label {
findPos = i; findPos = i;
} }
if (findPos != -1) { if (findPos != -1) {
for (let i = 0; i < this._urls.length; i++) { for (let i = 0; i < this._urls.length; i++)
if (findPos >= this._urls[i].pos && if (findPos >= this._urls[i].pos &&
this._urls[i].pos + this._urls[i].url.length > findPos) this._urls[i].pos + this._urls[i].url.length > findPos)
return i; return i;
}
} }
return -1; return -1;
} }
@@ -171,22 +170,20 @@ class ScaleLayout extends Clutter.BinLayout {
if (this._container == container) if (this._container == container)
return; return;
if (this._container) { if (this._container)
for (let id of this._signals) for (let id of this._signals)
this._container.disconnect(id); this._container.disconnect(id);
}
this._container = container; this._container = container;
this._signals = []; this._signals = [];
if (this._container) { if (this._container)
for (let signal of ['notify::scale-x', 'notify::scale-y']) { for (let signal of ['notify::scale-x', 'notify::scale-y']) {
let id = this._container.connect(signal, () => { let id = this._container.connect(signal, () => {
this.layout_changed(); this.layout_changed();
}); });
this._signals.push(id); this._signals.push(id);
} }
}
} }
vfunc_get_preferred_width(container, forHeight) { vfunc_get_preferred_width(container, forHeight) {
@@ -213,7 +210,7 @@ var LabelExpanderLayout = GObject.registerClass({
'Expansion of the layout, between 0 (collapsed) ' + 'Expansion of the layout, between 0 (collapsed) ' +
'and 1 (fully expanded', 'and 1 (fully expanded',
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
0, 1, 0), 0, 1, 0)
}, },
}, class LabelExpanderLayout extends Clutter.LayoutManager { }, class LabelExpanderLayout extends Clutter.LayoutManager {
_init(params) { _init(params) {
@@ -235,7 +232,7 @@ var LabelExpanderLayout = GObject.registerClass({
let visibleIndex = this._expansion > 0 ? 1 : 0; let visibleIndex = this._expansion > 0 ? 1 : 0;
for (let i = 0; this._container && i < this._container.get_n_children(); i++) for (let i = 0; this._container && i < this._container.get_n_children(); i++)
this._container.get_child_at_index(i).visible = i == visibleIndex; this._container.get_child_at_index(i).visible = (i == visibleIndex);
this.layout_changed(); this.layout_changed();
} }
@@ -298,11 +295,12 @@ var LabelExpanderLayout = GObject.registerClass({
var Message = GObject.registerClass({ var Message = GObject.registerClass({
GTypeName: 'MessageList_Message',
Signals: { Signals: {
'close': {}, 'close': {},
'expanded': {}, 'expanded': {},
'unexpanded': {}, 'unexpanded': {},
}, }
}, class Message extends St.Button { }, class Message extends St.Button {
_init(title, body) { _init(title, body) {
super._init({ super._init({
@@ -310,16 +308,13 @@ var Message = GObject.registerClass({
accessible_role: Atk.Role.NOTIFICATION, accessible_role: Atk.Role.NOTIFICATION,
can_focus: true, can_focus: true,
x_expand: true, x_expand: true,
y_expand: true, x_fill: true
}); });
this.expanded = false; this.expanded = false;
this._useBodyMarkup = false; this._useBodyMarkup = false;
let vbox = new St.BoxLayout({ let vbox = new St.BoxLayout({ vertical: true });
vertical: true,
x_expand: true,
});
this.set_child(vbox); this.set_child(vbox);
let hbox = new St.BoxLayout(); let hbox = new St.BoxLayout();
@@ -331,7 +326,7 @@ var Message = GObject.registerClass({
this._iconBin = new St.Bin({ style_class: 'message-icon-bin', this._iconBin = new St.Bin({ style_class: 'message-icon-bin',
y_expand: true, y_expand: true,
y_align: Clutter.ActorAlign.START, y_align: St.Align.START,
visible: false }); visible: false });
hbox.add_actor(this._iconBin); hbox.add_actor(this._iconBin);
@@ -349,18 +344,14 @@ var Message = GObject.registerClass({
this.setTitle(title); this.setTitle(title);
titleBox.add_actor(this.titleLabel); titleBox.add_actor(this.titleLabel);
this._secondaryBin = new St.Bin({ this._secondaryBin = new St.Bin({ style_class: 'message-secondary-bin',
style_class: 'message-secondary-bin', x_expand: true, y_expand: true,
x_expand: true, y_expand: true, x_fill: true, y_fill: true });
});
titleBox.add_actor(this._secondaryBin); titleBox.add_actor(this._secondaryBin);
let closeIcon = new St.Icon({ icon_name: 'window-close-symbolic', let closeIcon = new St.Icon({ icon_name: 'window-close-symbolic',
icon_size: 16 }); icon_size: 16 });
this._closeButton = new St.Button({ this._closeButton = new St.Button({ child: closeIcon, opacity: 0 });
style_class: 'message-close-button',
child: closeIcon, opacity: 0,
});
titleBox.add_actor(this._closeButton); titleBox.add_actor(this._closeButton);
this._bodyStack = new St.Widget({ x_expand: true }); this._bodyStack = new St.Widget({ x_expand: true });
@@ -385,7 +376,7 @@ var Message = GObject.registerClass({
setIcon(actor) { setIcon(actor) {
this._iconBin.child = actor; this._iconBin.child = actor;
this._iconBin.visible = actor != null; this._iconBin.visible = (actor != null);
} }
setSecondaryActor(actor) { setSecondaryActor(actor) {
@@ -456,7 +447,7 @@ var Message = GObject.registerClass({
expand(animate) { expand(animate) {
this.expanded = true; this.expanded = true;
this._actionBin.visible = this._actionBin.get_n_children() > 0; this._actionBin.visible = (this._actionBin.get_n_children() > 0);
if (this._bodyStack.get_n_children() < 2) { if (this._bodyStack.get_n_children() < 2) {
this._expandedLabel = new URLHighlighter(this._bodyText, this._expandedLabel = new URLHighlighter(this._bodyText,
@@ -474,7 +465,7 @@ var Message = GObject.registerClass({
this._actionBin.ease({ this._actionBin.ease({
scale_y: 1, scale_y: 1,
duration: MessageTray.ANIMATION_TIME, duration: MessageTray.ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} else { } else {
this._bodyStack.layout_manager.expansion = 1; this._bodyStack.layout_manager.expansion = 1;
@@ -498,7 +489,7 @@ var Message = GObject.registerClass({
onComplete: () => { onComplete: () => {
this._actionBin.hide(); this._actionBin.hide();
this.expanded = false; this.expanded = false;
}, }
}); });
} else { } else {
this._bodyStack.layout_manager.expansion = 0; this._bodyStack.layout_manager.expansion = 0;
@@ -549,14 +540,14 @@ var MessageListSection = GObject.registerClass({
'can-clear-changed': {}, 'can-clear-changed': {},
'empty-changed': {}, 'empty-changed': {},
'message-focused': { param_types: [Message.$gtype] }, 'message-focused': { param_types: [Message.$gtype] },
}, }
}, class MessageListSection extends St.BoxLayout { }, class MessageListSection extends St.BoxLayout {
_init() { _init() {
super._init({ super._init({
style_class: 'message-list-section', style_class: 'message-list-section',
clip_to_allocation: true, clip_to_allocation: true,
vertical: true, vertical: true,
x_expand: true, x_expand: true
}); });
this._list = new St.BoxLayout({ style_class: 'message-list-section-list', this._list = new St.BoxLayout({ style_class: 'message-list-section-list',
@@ -615,6 +606,8 @@ var MessageListSection = GObject.registerClass({
let listItem = new St.Bin({ let listItem = new St.Bin({
child: message, child: message,
x_fill: true,
y_fill: true,
layout_manager: new ScaleLayout(), layout_manager: new ScaleLayout(),
pivot_point: new Graphene.Point({ x: .5, y: .5 }), pivot_point: new Graphene.Point({ x: .5, y: .5 }),
}); });
@@ -638,14 +631,14 @@ var MessageListSection = GObject.registerClass({
scale_x: 1, scale_x: 1,
scale_y: 1, scale_y: 1,
duration: MESSAGE_ANIMATION_TIME, duration: MESSAGE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
} }
moveMessage(message, index, animate) { moveMessage(message, index, animate) {
if (!this._messages.includes(message)) if (!this._messages.includes(message))
throw new Error(`Impossible to move untracked message`); throw new Error(`Impossible to move the untracked message ${message}`);
let listItem = message.get_parent(); let listItem = message.get_parent();
@@ -660,7 +653,7 @@ var MessageListSection = GObject.registerClass({
scale_x: 1, scale_x: 1,
scale_y: 1, scale_y: 1,
duration: MESSAGE_ANIMATION_TIME, duration: MESSAGE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
}; };
listItem.ease({ listItem.ease({
@@ -668,13 +661,13 @@ var MessageListSection = GObject.registerClass({
scale_y: 0, scale_y: 0,
duration: MESSAGE_ANIMATION_TIME, duration: MESSAGE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete, onComplete
}); });
} }
removeMessage(message, animate) { removeMessage(message, animate) {
if (!this._messages.includes(message)) if (!this._messages.includes(message))
throw new Error(`Impossible to remove untracked message`); throw new Error(`Impossible to remove the untracked message ${message}`);
let listItem = message.get_parent(); let listItem = message.get_parent();
listItem._connectionsIds.forEach(id => message.disconnect(id)); listItem._connectionsIds.forEach(id => message.disconnect(id));
@@ -688,7 +681,7 @@ var MessageListSection = GObject.registerClass({
onComplete: () => { onComplete: () => {
listItem.destroy(); listItem.destroy();
global.sync_pointer(); global.sync_pointer();
}, }
}); });
} else { } else {
listItem.destroy(); listItem.destroy();
@@ -716,7 +709,7 @@ var MessageListSection = GObject.registerClass({
duration: MESSAGE_ANIMATION_TIME, duration: MESSAGE_ANIMATION_TIME,
delay: i * delay, delay: i * delay,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => message.close(), onComplete: () => message.close()
}); });
} }
} }

View File

@@ -33,7 +33,7 @@ var State = {
HIDDEN: 0, HIDDEN: 0,
SHOWING: 1, SHOWING: 1,
SHOWN: 2, SHOWN: 2,
HIDING: 3, HIDING: 3
}; };
// These reasons are useful when we destroy the notifications received through // These reasons are useful when we destroy the notifications received through
@@ -47,7 +47,7 @@ var NotificationDestroyedReason = {
EXPIRED: 1, EXPIRED: 1,
DISMISSED: 2, DISMISSED: 2,
SOURCE_CLOSED: 3, SOURCE_CLOSED: 3,
REPLACED: 4, REPLACED: 4
}; };
// Message tray has its custom Urgency enumeration. LOW, NORMAL and CRITICAL // Message tray has its custom Urgency enumeration. LOW, NORMAL and CRITICAL
@@ -58,7 +58,7 @@ var Urgency = {
LOW: 0, LOW: 0,
NORMAL: 1, NORMAL: 1,
HIGH: 2, HIGH: 2,
CRITICAL: 3, CRITICAL: 3
}; };
// The privacy of the details of a notification. USER is for notifications which // The privacy of the details of a notification. USER is for notifications which
@@ -134,6 +134,7 @@ var FocusGrabber = class FocusGrabber {
// //
// A notification without a policy object will inherit the default one. // A notification without a policy object will inherit the default one.
var NotificationPolicy = GObject.registerClass({ var NotificationPolicy = GObject.registerClass({
GTypeName: 'MessageTray_NotificationPolicy',
Properties: { Properties: {
'enable': GObject.ParamSpec.boolean( 'enable': GObject.ParamSpec.boolean(
'enable', 'enable', 'enable', 'enable', 'enable', 'enable',
@@ -159,7 +160,7 @@ var NotificationPolicy = GObject.registerClass({
'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen',
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY, GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
false), false),
}, }
}, class NotificationPolicy extends GObject.Object { }, class NotificationPolicy extends GObject.Object {
// Do nothing for the default policy. These methods are only useful for the // Do nothing for the default policy. These methods are only useful for the
// GSettings policy. // GSettings policy.
@@ -191,6 +192,7 @@ var NotificationPolicy = GObject.registerClass({
}); });
var NotificationGenericPolicy = GObject.registerClass({ var NotificationGenericPolicy = GObject.registerClass({
GTypeName: 'MessageTray_NotificationGenericPolicy'
}, class NotificationGenericPolicy extends NotificationPolicy { }, class NotificationGenericPolicy extends NotificationPolicy {
_init() { _init() {
super._init(); super._init();
@@ -221,6 +223,7 @@ var NotificationGenericPolicy = GObject.registerClass({
}); });
var NotificationApplicationPolicy = GObject.registerClass({ var NotificationApplicationPolicy = GObject.registerClass({
GTypeName: 'MessageTray_NotificationApplicationPolicy'
}, class NotificationApplicationPolicy extends NotificationPolicy { }, class NotificationApplicationPolicy extends NotificationPolicy {
_init(id) { _init(id) {
super._init(); super._init();
@@ -347,6 +350,7 @@ var NotificationApplicationPolicy = GObject.registerClass({
// //
// [1] https://developer.gnome.org/notification-spec/#markup // [1] https://developer.gnome.org/notification-spec/#markup
var Notification = GObject.registerClass({ var Notification = GObject.registerClass({
GTypeName: 'MessageTray_Notification',
Properties: { Properties: {
'acknowledged': GObject.ParamSpec.boolean( 'acknowledged': GObject.ParamSpec.boolean(
'acknowledged', 'acknowledged', 'acknowledged', 'acknowledged', 'acknowledged', 'acknowledged',
@@ -357,7 +361,7 @@ var Notification = GObject.registerClass({
'activated': {}, 'activated': {},
'destroy': { param_types: [GObject.TYPE_UINT] }, 'destroy': { param_types: [GObject.TYPE_UINT] },
'updated': { param_types: [GObject.TYPE_BOOLEAN] }, 'updated': { param_types: [GObject.TYPE_BOOLEAN] },
}, }
}, class Notification extends GObject.Object { }, class Notification extends GObject.Object {
_init(source, title, banner, params) { _init(source, title, banner, params) {
super._init(); super._init();
@@ -435,7 +439,7 @@ var Notification = GObject.registerClass({
// @label: the label for the action's button // @label: the label for the action's button
// @callback: the callback for the action // @callback: the callback for the action
addAction(label, callback) { addAction(label, callback) {
this.actions.push({ label, callback }); this.actions.push({ label: label, callback: callback });
} }
get acknowledged() { get acknowledged() {
@@ -522,7 +526,7 @@ var NotificationBanner = GObject.registerClass({
Signals: { Signals: {
'done-displaying': {}, 'done-displaying': {},
'unfocused': {}, 'unfocused': {},
}, }
}, class NotificationBanner extends Calendar.NotificationMessage { }, class NotificationBanner extends Calendar.NotificationMessage {
_init(notification) { _init(notification) {
super._init(notification); super._init(notification);
@@ -609,7 +613,7 @@ var NotificationBanner = GObject.registerClass({
addAction(label, callback) { addAction(label, callback) {
let button = new St.Button({ style_class: 'notification-button', let button = new St.Button({ style_class: 'notification-button',
label, label: label,
x_expand: true, x_expand: true,
can_focus: true }); can_focus: true });
@@ -632,7 +636,8 @@ class SourceActor extends St.Widget {
this._actorDestroyed = false; this._actorDestroyed = false;
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
this._iconBin = new St.Bin({ x_expand: true, this._iconBin = new St.Bin({ x_fill: true,
x_expand: true,
height: size * scaleFactor, height: size * scaleFactor,
width: size * scaleFactor }); width: size * scaleFactor });
@@ -728,6 +733,7 @@ class SourceActorWithLabel extends SourceActor {
}); });
var Source = GObject.registerClass({ var Source = GObject.registerClass({
GTypeName: 'MessageTray_Source',
Properties: { Properties: {
'count': GObject.ParamSpec.int( 'count': GObject.ParamSpec.int(
'count', 'count', 'count', 'count', 'count', 'count',
@@ -747,10 +753,10 @@ var Source = GObject.registerClass({
'icon-updated': {}, 'icon-updated': {},
'notification-added': { param_types: [Notification.$gtype] }, 'notification-added': { param_types: [Notification.$gtype] },
'notification-show': { param_types: [Notification.$gtype] }, 'notification-show': { param_types: [Notification.$gtype] },
}, }
}, class Source extends GObject.Object { }, class Source extends GObject.Object {
_init(title, iconName) { _init(title, iconName) {
super._init({ title }); super._init({ title: title });
this.SOURCE_ICON_SIZE = 48; this.SOURCE_ICON_SIZE = 48;
@@ -856,10 +862,11 @@ var Source = GObject.registerClass({
notification.acknowledged = false; notification.acknowledged = false;
this.pushNotification(notification); this.pushNotification(notification);
if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL) if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL) {
this.emit('notification-show', notification); this.emit('notification-show', notification);
else } else {
notification.playSound(); notification.playSound();
}
} }
notify(propName) { notify(propName) {
@@ -900,10 +907,9 @@ var Source = GObject.registerClass({
} }
destroyNonResidentNotifications() { destroyNonResidentNotifications() {
for (let i = this.notifications.length - 1; i >= 0; i--) { for (let i = this.notifications.length - 1; i >= 0; i--)
if (!this.notifications[i].resident) if (!this.notifications[i].resident)
this.notifications[i].destroy(); this.notifications[i].destroy();
}
} }
}); });
@@ -912,13 +918,13 @@ var MessageTray = GObject.registerClass({
'queue-changed': {}, 'queue-changed': {},
'source-added': { param_types: [Source.$gtype] }, 'source-added': { param_types: [Source.$gtype] },
'source-removed': { param_types: [Source.$gtype] }, 'source-removed': { param_types: [Source.$gtype] },
}, }
}, class MessageTray extends St.Widget { }, class MessageTray extends St.Widget {
_init() { _init() {
super._init({ super._init({
visible: false, visible: false,
clip_to_allocation: true, clip_to_allocation: true,
layout_manager: new Clutter.BinLayout(), layout_manager: new Clutter.BinLayout()
}); });
this._presence = new GnomeSession.Presence((proxy, _error) => { this._presence = new GnomeSession.Presence((proxy, _error) => {
@@ -1162,7 +1168,7 @@ var MessageTray = GObject.registerClass({
// indicator in the panel; however do make an exception for CRITICAL // indicator in the panel; however do make an exception for CRITICAL
// notifications, as only banner mode allows expansion. // notifications, as only banner mode allows expansion.
let bannerCount = this._notification ? 1 : 0; let bannerCount = this._notification ? 1 : 0;
let full = this.queueCount + bannerCount >= MAX_NOTIFICATIONS_IN_QUEUE; let full = (this.queueCount + bannerCount >= MAX_NOTIFICATIONS_IN_QUEUE);
if (!full || notification.urgency == Urgency.CRITICAL) { if (!full || notification.urgency == Urgency.CRITICAL) {
notification.connect('destroy', notification.connect('destroy',
this._onNotificationDestroy.bind(this)); this._onNotificationDestroy.bind(this));
@@ -1309,7 +1315,7 @@ var MessageTray = GObject.registerClass({
let nextNotification = this._notificationQueue[0] || null; let nextNotification = this._notificationQueue[0] || null;
if (hasNotifications && nextNotification) { if (hasNotifications && nextNotification) {
let limited = this._busy || Main.layoutManager.primaryMonitor.inFullscreen; let limited = this._busy || Main.layoutManager.primaryMonitor.inFullscreen;
let showNextNotification = !limited || nextNotification.forFeedback || nextNotification.urgency == Urgency.CRITICAL; let showNextNotification = (!limited || nextNotification.forFeedback || nextNotification.urgency == Urgency.CRITICAL);
if (showNextNotification) if (showNextNotification)
this._showNotification(); this._showNotification();
} }
@@ -1319,7 +1325,7 @@ var MessageTray = GObject.registerClass({
this._notification.urgency != Urgency.CRITICAL && this._notification.urgency != Urgency.CRITICAL &&
!this._banner.focused && !this._banner.focused &&
!this._pointerInNotification) || this._notificationExpired; !this._pointerInNotification) || this._notificationExpired;
let mustClose = this._notificationRemoved || !hasNotifications || expired; let mustClose = (this._notificationRemoved || !hasNotifications || expired);
if (mustClose) { if (mustClose) {
let animate = hasNotifications && !this._notificationRemoved; let animate = hasNotifications && !this._notificationRemoved;
@@ -1414,7 +1420,7 @@ var MessageTray = GObject.registerClass({
this._bannerBin.ease({ this._bannerBin.ease({
opacity: 255, opacity: 255,
duration: ANIMATION_TIME, duration: ANIMATION_TIME,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR
}); });
this._bannerBin.ease({ this._bannerBin.ease({
y: 0, y: 0,
@@ -1424,7 +1430,7 @@ var MessageTray = GObject.registerClass({
this._notificationState = State.SHOWN; this._notificationState = State.SHOWN;
this._showNotificationCompleted(); this._showNotificationCompleted();
this._updateState(); this._updateState();
}, }
}); });
} }
@@ -1490,7 +1496,7 @@ var MessageTray = GObject.registerClass({
this._bannerBin.ease({ this._bannerBin.ease({
opacity: 0, opacity: 0,
duration: ANIMATION_TIME, duration: ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_BACK, mode: Clutter.AnimationMode.EASE_OUT_BACK
}); });
this._bannerBin.ease({ this._bannerBin.ease({
y: -this._bannerBin.height, y: -this._bannerBin.height,
@@ -1500,7 +1506,7 @@ var MessageTray = GObject.registerClass({
this._notificationState = State.HIDDEN; this._notificationState = State.HIDDEN;
this._hideNotificationCompleted(); this._hideNotificationCompleted();
this._updateState(); this._updateState();
}, }
}); });
} else { } else {
this._bannerBin.y = -this._bannerBin.height; this._bannerBin.y = -this._bannerBin.height;

View File

@@ -17,7 +17,7 @@ var State = {
CLOSED: 1, CLOSED: 1,
OPENING: 2, OPENING: 2,
CLOSING: 3, CLOSING: 3,
FADED_OUT: 4, FADED_OUT: 4
}; };
var ModalDialog = GObject.registerClass({ var ModalDialog = GObject.registerClass({
@@ -26,9 +26,9 @@ var ModalDialog = GObject.registerClass({
GObject.ParamFlags.READABLE, GObject.ParamFlags.READABLE,
Math.min(...Object.values(State)), Math.min(...Object.values(State)),
Math.max(...Object.values(State)), Math.max(...Object.values(State)),
State.CLOSED), State.CLOSED)
}, },
Signals: { 'opened': {}, 'closed': {} }, Signals: { 'opened': {}, 'closed': {} }
}, class ModalDialog extends St.Widget { }, class ModalDialog extends St.Widget {
_init(params) { _init(params) {
super._init({ visible: false, super._init({ visible: false,
@@ -57,12 +57,9 @@ var ModalDialog = GObject.registerClass({
coordinate: Clutter.BindCoordinate.ALL }); coordinate: Clutter.BindCoordinate.ALL });
this.add_constraint(constraint); this.add_constraint(constraint);
this.backgroundStack = new St.Widget({ this.backgroundStack = new St.Widget({ layout_manager: new Clutter.BinLayout() });
layout_manager: new Clutter.BinLayout(), this._backgroundBin = new St.Bin({ child: this.backgroundStack,
x_expand: true, x_fill: true, y_fill: true });
y_expand: true,
});
this._backgroundBin = new St.Bin({ child: this.backgroundStack });
this._monitorConstraint = new Layout.MonitorConstraint(); this._monitorConstraint = new Layout.MonitorConstraint();
this._backgroundBin.add_constraint(this._monitorConstraint); this._backgroundBin.add_constraint(this._monitorConstraint);
this.add_actor(this._backgroundBin); this.add_actor(this._backgroundBin);
@@ -134,7 +131,7 @@ var ModalDialog = GObject.registerClass({
onComplete: () => { onComplete: () => {
this._setState(State.OPENED); this._setState(State.OPENED);
this.emit('opened'); this.emit('opened');
}, }
}); });
} }
@@ -183,7 +180,7 @@ var ModalDialog = GObject.registerClass({
opacity: 0, opacity: 0,
duration: OPEN_AND_CLOSE_TIME, duration: OPEN_AND_CLOSE_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this._closeComplete(), onComplete: () => this._closeComplete()
}); });
} else { } else {
this._closeComplete(); this._closeComplete();
@@ -206,7 +203,7 @@ var ModalDialog = GObject.registerClass({
this._hasModal = false; this._hasModal = false;
if (!this._shellReactive) if (!this._shellReactive)
this.backgroundStack.set_child_above_sibling(this._eventBlocker, null); this._eventBlocker.raise_top();
} }
pushModal(timestamp) { pushModal(timestamp) {
@@ -219,8 +216,6 @@ var ModalDialog = GObject.registerClass({
if (!Main.pushModal(this, params)) if (!Main.pushModal(this, params))
return false; return false;
Main.layoutManager.emit('system-modal-opened');
this._hasModal = true; this._hasModal = true;
if (this._savedKeyFocus) { if (this._savedKeyFocus) {
this._savedKeyFocus.grab_key_focus(); this._savedKeyFocus.grab_key_focus();
@@ -231,7 +226,7 @@ var ModalDialog = GObject.registerClass({
} }
if (!this._shellReactive) if (!this._shellReactive)
this.backgroundStack.set_child_below_sibling(this._eventBlocker, null); this._eventBlocker.lower_bottom();
return true; return true;
} }
@@ -258,7 +253,7 @@ var ModalDialog = GObject.registerClass({
opacity: 0, opacity: 0,
duration: FADE_OUT_DIALOG_TIME, duration: FADE_OUT_DIALOG_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => (this.state = State.FADED_OUT), onComplete: () => (this.state = State.FADED_OUT)
}); });
} }
}); });

View File

@@ -44,19 +44,11 @@ class MediaMessage extends MessageList.Message {
this._player.next(); this._player.next();
}); });
this._updateHandlerId = this._player.connect('changed', this._update.bind(this));
this._player.connect('changed', this._update.bind(this)); this._player.connect('closed', this.close.bind(this));
this._closedHandlerId =
this._player.connect('closed', this.close.bind(this));
this._update(); this._update();
} }
_onDestroy() {
super._onDestroy();
this._player.disconnect(this._updateHandlerId);
this._player.disconnect(this._closedHandlerId);
}
vfunc_clicked() { vfunc_clicked() {
this._player.raise(); this._player.raise();
Main.panel.closeCalendar(); Main.panel.closeCalendar();
@@ -72,7 +64,7 @@ class MediaMessage extends MessageList.Message {
if (this._player.trackCoverUrl) { if (this._player.trackCoverUrl) {
let file = Gio.File.new_for_uri(this._player.trackCoverUrl); let file = Gio.File.new_for_uri(this._player.trackCoverUrl);
this._icon.gicon = new Gio.FileIcon({ file }); this._icon.gicon = new Gio.FileIcon({ file: file });
this._icon.remove_style_class_name('fallback'); this._icon.remove_style_class_name('fallback');
} else { } else {
this._icon.icon_name = 'audio-x-generic-symbolic'; this._icon.icon_name = 'audio-x-generic-symbolic';
@@ -103,7 +95,6 @@ var MprisPlayer = class MprisPlayer {
this._trackArtists = []; this._trackArtists = [];
this._trackTitle = ''; this._trackTitle = '';
this._trackCoverUrl = ''; this._trackCoverUrl = '';
this._busName = busName;
} }
get status() { get status() {
@@ -186,39 +177,9 @@ var MprisPlayer = class MprisPlayer {
for (let prop in this._playerProxy.Metadata) for (let prop in this._playerProxy.Metadata)
metadata[prop] = this._playerProxy.Metadata[prop].deep_unpack(); metadata[prop] = this._playerProxy.Metadata[prop].deep_unpack();
// Validate according to the spec; some clients send buggy metadata: this._trackArtists = metadata['xesam:artist'] || [_("Unknown artist")];
// https://www.freedesktop.org/wiki/Specifications/mpris-spec/metadata this._trackTitle = metadata['xesam:title'] || _("Unknown title");
this._trackArtists = metadata['xesam:artist']; this._trackCoverUrl = metadata['mpris:artUrl'] || '';
if (!Array.isArray(this._trackArtists) ||
!this._trackArtists.every(artist => typeof artist === 'string')) {
if (typeof this._trackArtists !== 'undefined') {
log(`Received faulty track artist metadata from ${
this._busName}; expected an array of strings, got ${
this._trackArtists} (${typeof this._trackArtists})`);
}
this._trackArtists = [_("Unknown artist")];
}
this._trackTitle = metadata['xesam:title'];
if (typeof this._trackTitle !== 'string') {
if (typeof this._trackTitle !== 'undefined') {
log(`Received faulty track title metadata from ${
this._busName}; expected a string, got ${
this._trackTitle} (${typeof this._trackTitle})`);
}
this._trackTitle = _("Unknown title");
}
this._trackCoverUrl = metadata['mpris:artUrl'];
if (typeof this._trackCoverUrl !== 'string') {
if (typeof this._trackCoverUrl !== 'undefined') {
log(`Received faulty track cover art metadata from ${
this._busName}; expected a string, got ${
this._trackCoverUrl} (${typeof this._trackCoverUrl})`);
}
this._trackCoverUrl = '';
}
this.emit('changed'); this.emit('changed');
let visible = this._playerProxy.CanPlay; let visible = this._playerProxy.CanPlay;
@@ -228,7 +189,7 @@ var MprisPlayer = class MprisPlayer {
if (visible) if (visible)
this.emit('show'); this.emit('show');
else else
this.emit('hide'); this._close();
} }
} }
}; };
@@ -256,20 +217,15 @@ class MediaSection extends MessageList.MessageListSection {
return; return;
let player = new MprisPlayer(busName); let player = new MprisPlayer(busName);
let message = null;
player.connect('closed', player.connect('closed',
() => { () => {
this._players.delete(busName); this._players.delete(busName);
}); });
player.connect('show', () => { player.connect('show',
message = new MediaMessage(player); () => {
this.addMessage(message, true); let message = new MediaMessage(player);
}); this.addMessage(message, true);
player.connect('hide', () => { });
this.removeMessage(message, true);
message = null;
});
this._players.set(busName, player); this._players.set(busName, player);
} }

View File

@@ -23,13 +23,13 @@ var NotificationClosedReason = {
EXPIRED: 1, EXPIRED: 1,
DISMISSED: 2, DISMISSED: 2,
APP_CLOSED: 3, APP_CLOSED: 3,
UNDEFINED: 4, UNDEFINED: 4
}; };
var Urgency = { var Urgency = {
LOW: 0, LOW: 0,
NORMAL: 1, NORMAL: 1,
CRITICAL: 2, CRITICAL: 2
}; };
const rewriteRules = { const rewriteRules = {
@@ -39,8 +39,8 @@ const rewriteRules = {
{ pattern: /^XChat: New public message from: (\S*) \((.*)\)$/, { pattern: /^XChat: New public message from: (\S*) \((.*)\)$/,
replacement: '$2 <$1>' }, replacement: '$2 <$1>' },
{ pattern: /^XChat: Highlighted message from: (\S*) \((.*)\)$/, { pattern: /^XChat: Highlighted message from: (\S*) \((.*)\)$/,
replacement: '$2 <$1>' }, replacement: '$2 <$1>' }
], ]
}; };
var FdoNotificationDaemon = class FdoNotificationDaemon { var FdoNotificationDaemon = class FdoNotificationDaemon {
@@ -201,13 +201,13 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
hints['image-data'] = hints['icon_data']; hints['image-data'] = hints['icon_data'];
} }
let ndata = { appName, let ndata = { appName: appName,
icon, icon: icon,
summary, summary: summary,
body, body: body,
actions, actions: actions,
hints, hints: hints,
timeout }; timeout: timeout };
if (replacesId != 0 && this._notifications[replacesId]) { if (replacesId != 0 && this._notifications[replacesId]) {
ndata.id = id = replacesId; ndata.id = id = replacesId;
ndata.notification = this._notifications[replacesId].notification; ndata.notification = this._notifications[replacesId].notification;
@@ -245,7 +245,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
return; return;
} }
[pid] = result; let [pid] = result;
source = this._getSource(appName, pid, ndata, sender, null); source = this._getSource(appName, pid, ndata, sender, null);
this._senderToPid[sender] = pid; this._senderToPid[sender] = pid;
@@ -299,7 +299,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
else if (!gicon) else if (!gicon)
gicon = this._fallbackIconForNotificationData(hints); gicon = this._fallbackIconForNotificationData(hints);
notification.update(summary, body, { gicon, notification.update(summary, body, { gicon: gicon,
bannerMarkup: true, bannerMarkup: true,
clear: true, clear: true,
soundFile: hints['sound-file'], soundFile: hints['sound-file'],
@@ -310,13 +310,12 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
if (actions.length) { if (actions.length) {
for (let i = 0; i < actions.length - 1; i += 2) { for (let i = 0; i < actions.length - 1; i += 2) {
let [actionId, label] = [actions[i], actions[i + 1]]; let [actionId, label] = [actions[i], actions[i + 1]];
if (actionId == 'default') { if (actionId == 'default')
hasDefaultAction = true; hasDefaultAction = true;
} else { else
notification.addAction(label, () => { notification.addAction(label, () => {
this._emitActionInvoked(ndata.id, actionId); this._emitActionInvoked(ndata.id, actionId);
}); });
}
} }
} }
@@ -346,7 +345,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
// of the 'transient' hint with hints['transient'] rather than hints.transient // of the 'transient' hint with hints['transient'] rather than hints.transient
notification.setTransient(!!hints['transient']); notification.setTransient(!!hints['transient']);
let privacyScope = hints['x-gnome-privacy-scope'] || 'user'; let privacyScope = (hints['x-gnome-privacy-scope'] || 'user');
notification.setPrivacyScope(privacyScope == 'system' notification.setPrivacyScope(privacyScope == 'system'
? MessageTray.PrivacyScope.SYSTEM ? MessageTray.PrivacyScope.SYSTEM
: MessageTray.PrivacyScope.USER); : MessageTray.PrivacyScope.USER);
@@ -384,7 +383,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
Config.PACKAGE_NAME, Config.PACKAGE_NAME,
'GNOME', 'GNOME',
Config.PACKAGE_VERSION, Config.PACKAGE_VERSION,
'1.2', '1.2'
]; ];
} }
@@ -428,14 +427,13 @@ class FdoNotificationDaemonSource extends MessageTray.Source {
else else
this.useNotificationIcon = true; this.useNotificationIcon = true;
if (sender) { if (sender)
this._nameWatcherId = Gio.DBus.session.watch_name(sender, this._nameWatcherId = Gio.DBus.session.watch_name(sender,
Gio.BusNameWatcherFlags.NONE, Gio.BusNameWatcherFlags.NONE,
null, null,
this._onNameVanished.bind(this)); this._onNameVanished.bind(this));
} else { else
this._nameWatcherId = 0; this._nameWatcherId = 0;
}
} }
_createPolicy() { _createPolicy() {
@@ -534,7 +532,7 @@ const PRIORITY_URGENCY_MAP = {
low: MessageTray.Urgency.LOW, low: MessageTray.Urgency.LOW,
normal: MessageTray.Urgency.NORMAL, normal: MessageTray.Urgency.NORMAL,
high: MessageTray.Urgency.HIGH, high: MessageTray.Urgency.HIGH,
urgent: MessageTray.Urgency.CRITICAL, urgent: MessageTray.Urgency.CRITICAL
}; };
var GtkNotificationDaemonNotification = GObject.registerClass( var GtkNotificationDaemonNotification = GObject.registerClass(

View File

@@ -66,7 +66,7 @@ var OsdMonitorLabeler = class {
_trackClient(client) { _trackClient(client) {
if (this._client) if (this._client)
return this._client == client; return (this._client == client);
this._client = client; this._client = client;
this._clientWatchId = Gio.bus_watch_name(Gio.BusType.SESSION, client, 0, null, this._clientWatchId = Gio.bus_watch_name(Gio.BusType.SESSION, client, 0, null,

View File

@@ -48,7 +48,7 @@ class OsdWindow extends St.Widget {
x_expand: true, x_expand: true,
y_expand: true, y_expand: true,
x_align: Clutter.ActorAlign.CENTER, x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER, y_align: Clutter.ActorAlign.CENTER
}); });
this._monitorIndex = monitorIndex; this._monitorIndex = monitorIndex;
@@ -61,15 +61,15 @@ class OsdWindow extends St.Widget {
this._box.add_constraint(this._boxConstraint); this._box.add_constraint(this._boxConstraint);
this.add_actor(this._box); this.add_actor(this._box);
this._icon = new St.Icon({ y_expand: true }); this._icon = new St.Icon();
this._box.add_child(this._icon); this._box.add(this._icon, { expand: true });
this._label = new St.Label(); this._label = new St.Label();
this._box.add(this._label); this._box.add(this._label);
this._level = new BarLevel.BarLevel({ this._level = new BarLevel.BarLevel({
style_class: 'level', style_class: 'level',
value: 0, value: 0
}); });
this._box.add(this._level); this._box.add(this._level);
@@ -105,22 +105,21 @@ class OsdWindow extends St.Widget {
} }
setLabel(label) { setLabel(label) {
this._label.visible = label != undefined; this._label.visible = (label != undefined);
if (label) if (label)
this._label.text = label; this._label.text = label;
} }
setLevel(value) { setLevel(value) {
this._level.visible = value != undefined; this._level.visible = (value != undefined);
if (value != undefined) { if (value != undefined) {
if (this.visible) { if (this.visible)
this._level.ease_property('value', value, { this._level.ease_property('value', value, {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: LEVEL_ANIMATION_TIME, duration: LEVEL_ANIMATION_TIME
}); });
} else { else
this._level.value = value; this._level.value = value;
}
} }
} }
@@ -141,7 +140,7 @@ class OsdWindow extends St.Widget {
this.ease({ this.ease({
opacity: 255, opacity: 255,
duration: FADE_TIME, duration: FADE_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
@@ -169,7 +168,7 @@ class OsdWindow extends St.Widget {
onComplete: () => { onComplete: () => {
this._reset(); this._reset();
Meta.enable_unredirect_for_display(global.display); Meta.enable_unredirect_for_display(global.display);
}, }
}); });
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
} }

View File

@@ -84,7 +84,7 @@ class OverviewActor extends St.BoxLayout {
/* Translators: This is the main view to select /* Translators: This is the main view to select
activities. See also note for "Activities" string. */ activities. See also note for "Activities" string. */
accessible_name: _("Overview"), accessible_name: _("Overview"),
vertical: true, vertical: true
}); });
this.add_constraint(new LayoutManager.MonitorConstraint({ primary: true })); this.add_constraint(new LayoutManager.MonitorConstraint({ primary: true }));
@@ -94,7 +94,7 @@ class OverviewActor extends St.BoxLayout {
let panelGhost = new St.Bin({ let panelGhost = new St.Bin({
child: new Clutter.Clone({ source: Main.panel }), child: new Clutter.Clone({ source: Main.panel }),
reactive: false, reactive: false,
opacity: 0, opacity: 0
}); });
this.add_actor(panelGhost); this.add_actor(panelGhost);
@@ -106,19 +106,18 @@ class OverviewActor extends St.BoxLayout {
characters. */ characters. */
hint_text: _("Type to search…"), hint_text: _("Type to search…"),
track_hover: true, track_hover: true,
can_focus: true, can_focus: true
}); });
this._searchEntry.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
let searchEntryBin = new St.Bin({ let searchEntryBin = new St.Bin({
child: this._searchEntry, child: this._searchEntry,
x_align: Clutter.ActorAlign.CENTER, x_align: St.Align.MIDDLE
}); });
this.add_actor(searchEntryBin); this.add_actor(searchEntryBin);
this._controls = new OverviewControls.ControlsManager(this._searchEntry); this._controls = new OverviewControls.ControlsManager(this._searchEntry);
// Add our same-line elements after the search entry // Add our same-line elements after the search entry
this.add_child(this._controls); this.add(this._controls, { y_fill: true, expand: true });
} }
get dash() { get dash() {
@@ -206,7 +205,7 @@ var Overview = class {
// XDND // XDND
this._dragMonitor = { this._dragMonitor = {
dragMotion: this._onDragMotion.bind(this), dragMotion: this._onDragMotion.bind(this)
}; };
@@ -245,11 +244,11 @@ var Overview = class {
for (let i = 0; i < backgrounds.length; i++) { for (let i = 0; i < backgrounds.length; i++) {
backgrounds[i].ease_property('brightness', 1.0, { backgrounds[i].ease_property('brightness', 1.0, {
duration: SHADE_ANIMATION_TIME, duration: SHADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
backgrounds[i].ease_property('vignette-sharpness', 0.0, { backgrounds[i].ease_property('vignette-sharpness', 0.0, {
duration: SHADE_ANIMATION_TIME, duration: SHADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
} }
@@ -259,11 +258,11 @@ var Overview = class {
for (let i = 0; i < backgrounds.length; i++) { for (let i = 0; i < backgrounds.length; i++) {
backgrounds[i].ease_property('brightness', Lightbox.VIGNETTE_BRIGHTNESS, { backgrounds[i].ease_property('brightness', Lightbox.VIGNETTE_BRIGHTNESS, {
duration: SHADE_ANIMATION_TIME, duration: SHADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
backgrounds[i].ease_property('vignette-sharpness', Lightbox.VIGNETTE_SHARPNESS, { backgrounds[i].ease_property('vignette-sharpness', Lightbox.VIGNETTE_SHARPNESS, {
duration: SHADE_ANIMATION_TIME, duration: SHADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
} }
@@ -401,8 +400,12 @@ var Overview = class {
return null; return null;
let window = windows[0]; let window = windows[0];
let clone = new Clutter.Clone({ source: window, let clone = new Clutter.Actor({
x: window.x, y: window.y }); source: window.content,
request_mode: Clutter.RequestMode.CONTENT_SIZE,
x: window.x,
y: window.y,
});
clone.source.connect('destroy', () => { clone.source.connect('destroy', () => {
clone.destroy(); clone.destroy();
}); });
@@ -476,7 +479,7 @@ var Overview = class {
this._desktopFade.ease({ this._desktopFade.ease({
opacity: 255, opacity: 255,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: ANIMATION_TIME, duration: ANIMATION_TIME
}); });
} }
@@ -494,7 +497,7 @@ var Overview = class {
this._desktopFade.ease({ this._desktopFade.ease({
opacity: 0, opacity: 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: ANIMATION_TIME, duration: ANIMATION_TIME
}); });
} }
@@ -534,7 +537,6 @@ var Overview = class {
} }
} }
} else { } else {
// eslint-disable-next-line no-lonely-if
if (this._modal) { if (this._modal) {
Main.popModal(this._overview); Main.popModal(this._overview);
this._modal = false; this._modal = false;
@@ -578,12 +580,11 @@ var Overview = class {
opacity: 255, opacity: 255,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: ANIMATION_TIME, duration: ANIMATION_TIME,
onComplete: () => this._showDone(), onComplete: () => this._showDone()
}); });
this._shadeBackgrounds(); this._shadeBackgrounds();
Main.layoutManager.overviewGroup.set_child_above_sibling( this._coverPane.raise_top();
this._coverPane, null);
this._coverPane.show(); this._coverPane.show();
this.emit('showing'); this.emit('showing');
} }
@@ -615,8 +616,8 @@ var Overview = class {
let event = Clutter.get_current_event(); let event = Clutter.get_current_event();
if (event) { if (event) {
let type = event.type(); let type = event.type();
let button = type == Clutter.EventType.BUTTON_PRESS || let button = (type == Clutter.EventType.BUTTON_PRESS ||
type == Clutter.EventType.BUTTON_RELEASE; type == Clutter.EventType.BUTTON_RELEASE);
let ctrl = (event.get_state() & Clutter.ModifierType.CONTROL_MASK) != 0; let ctrl = (event.get_state() & Clutter.ModifierType.CONTROL_MASK) != 0;
if (button && ctrl) if (button && ctrl)
return; return;
@@ -642,12 +643,11 @@ var Overview = class {
opacity: 0, opacity: 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: ANIMATION_TIME, duration: ANIMATION_TIME,
onComplete: () => this._hideDone(), onComplete: () => this._hideDone()
}); });
this._unshadeBackgrounds(); this._unshadeBackgrounds();
Main.layoutManager.overviewGroup.set_child_above_sibling( this._coverPane.raise_top();
this._coverPane, null);
this._coverPane.show(); this._coverPane.show();
this.emit('hiding'); this.emit('hiding');
} }

View File

@@ -12,17 +12,17 @@ const WorkspaceThumbnail = imports.ui.workspaceThumbnail;
var SIDE_CONTROLS_ANIMATION_TIME = 160; var SIDE_CONTROLS_ANIMATION_TIME = 160;
function getRtlSlideDirection(direction, actor) { function getRtlSlideDirection(direction, actor) {
let rtl = actor.text_direction == Clutter.TextDirection.RTL; let rtl = (actor.text_direction == Clutter.TextDirection.RTL);
if (rtl) { if (rtl)
direction = direction == SlideDirection.LEFT direction = (direction == SlideDirection.LEFT)
? SlideDirection.RIGHT : SlideDirection.LEFT; ? SlideDirection.RIGHT : SlideDirection.LEFT;
}
return direction; return direction;
} }
var SlideDirection = { var SlideDirection = {
LEFT: 0, LEFT: 0,
RIGHT: 1, RIGHT: 1
}; };
var SlideLayout = GObject.registerClass({ var SlideLayout = GObject.registerClass({
@@ -34,8 +34,8 @@ var SlideLayout = GObject.registerClass({
'translation-x': GObject.ParamSpec.double( 'translation-x': GObject.ParamSpec.double(
'translation-x', 'translation-x', 'translation-x', 'translation-x', 'translation-x', 'translation-x',
GObject.ParamFlags.READWRITE, GObject.ParamFlags.READWRITE,
-Infinity, Infinity, 0), -Infinity, Infinity, 0)
}, }
}, class SlideLayout extends Clutter.FixedLayout { }, class SlideLayout extends Clutter.FixedLayout {
_init(params) { _init(params) {
this._slideX = 1; this._slideX = 1;
@@ -67,7 +67,7 @@ var SlideLayout = GObject.registerClass({
// flags only determine what to do if the allocated box is bigger // flags only determine what to do if the allocated box is bigger
// than the actor's box. // than the actor's box.
let realDirection = getRtlSlideDirection(this._direction, child); let realDirection = getRtlSlideDirection(this._direction, child);
let alignX = realDirection == SlideDirection.LEFT let alignX = (realDirection == SlideDirection.LEFT)
? availWidth - natWidth ? availWidth - natWidth
: availWidth - natWidth * this._slideX; : availWidth - natWidth * this._slideX;
@@ -128,7 +128,7 @@ class SlidingControl extends St.Widget {
super._init({ super._init({
layout_manager: this.layout, layout_manager: this.layout,
style_class: 'overview-controls', style_class: 'overview-controls',
clip_to_allocation: true, clip_to_allocation: true
}); });
this._visible = true; this._visible = true;
@@ -168,7 +168,7 @@ class SlidingControl extends St.Widget {
let visibleWidth = this.getVisibleWidth(); let visibleWidth = this.getVisibleWidth();
if (direction == SlideDirection.LEFT) if (direction == SlideDirection.LEFT)
return -visibleWidth; return - visibleWidth;
else else
return visibleWidth; return visibleWidth;
} }
@@ -178,11 +178,12 @@ class SlidingControl extends St.Widget {
let translationEnd = 0; let translationEnd = 0;
let translation = this._getTranslation(); let translation = this._getTranslation();
let shouldShow = this._getSlide() > 0; let shouldShow = (this._getSlide() > 0);
if (shouldShow) if (shouldShow) {
translationStart = translation; translationStart = translation;
else } else {
translationEnd = translation; translationEnd = translation;
}
if (this.layout.translation_x == translationEnd) if (this.layout.translation_x == translationEnd)
return; return;
@@ -223,7 +224,7 @@ class SlidingControl extends St.Widget {
this.ease({ this.ease({
opacity: 255, opacity: 255,
duration: SIDE_CONTROLS_ANIMATION_TIME / 2, duration: SIDE_CONTROLS_ANIMATION_TIME / 2,
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD
}); });
} }
@@ -231,7 +232,7 @@ class SlidingControl extends St.Widget {
this.ease({ this.ease({
opacity: 128, opacity: 128,
duration: SIDE_CONTROLS_ANIMATION_TIME / 2, duration: SIDE_CONTROLS_ANIMATION_TIME / 2,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
@@ -428,7 +429,7 @@ class ControlsManager extends St.Widget {
layout_manager: layout, layout_manager: layout,
x_expand: true, x_expand: true,
y_expand: true, y_expand: true,
clip_to_allocation: true, clip_to_allocation: true
}); });
this.dash = new Dash.Dash(); this.dash = new Dash.Dash();
@@ -451,7 +452,7 @@ class ControlsManager extends St.Widget {
this.add_actor(this._dashSlider); this.add_actor(this._dashSlider);
this._group.add_actor(this._dashSpacer); this._group.add_actor(this._dashSpacer);
this._group.add_child(this.viewSelector); this._group.add(this.viewSelector, { x_fill: true, expand: true });
this._group.add_actor(this._thumbnailsSlider); this._group.add_actor(this._thumbnailsSlider);
layout.connect('allocation-changed', this._updateWorkspacesGeometry.bind(this)); layout.connect('allocation-changed', this._updateWorkspacesGeometry.bind(this));
@@ -462,7 +463,7 @@ class ControlsManager extends St.Widget {
_updateWorkspacesGeometry() { _updateWorkspacesGeometry() {
let [x, y] = this.get_transformed_position(); let [x, y] = this.get_transformed_position();
let [width, height] = this.get_transformed_size(); let [width, height] = this.get_transformed_size();
let geometry = { x, y, width, height }; let geometry = { x: x, y: y, width: width, height: height };
let spacing = this.get_theme_node().get_length('spacing'); let spacing = this.get_theme_node().get_length('spacing');
let dashWidth = this._dashSlider.getVisibleWidth() + spacing; let dashWidth = this._dashSlider.getVisibleWidth() + spacing;
@@ -489,9 +490,9 @@ class ControlsManager extends St.Widget {
return; return;
let activePage = this.viewSelector.getActivePage(); let activePage = this.viewSelector.getActivePage();
let dashVisible = activePage == ViewSelector.ViewPage.WINDOWS || let dashVisible = (activePage == ViewSelector.ViewPage.WINDOWS ||
activePage == ViewSelector.ViewPage.APPS; activePage == ViewSelector.ViewPage.APPS);
let thumbnailsVisible = activePage == ViewSelector.ViewPage.WINDOWS; let thumbnailsVisible = (activePage == ViewSelector.ViewPage.WINDOWS);
if (dashVisible) if (dashVisible)
this._dashSlider.slideIn(); this._dashSlider.slideIn();
@@ -509,7 +510,7 @@ class ControlsManager extends St.Widget {
return; return;
let activePage = this.viewSelector.getActivePage(); let activePage = this.viewSelector.getActivePage();
this._dashSpacer.visible = activePage == ViewSelector.ViewPage.WINDOWS; this._dashSpacer.visible = (activePage == ViewSelector.ViewPage.WINDOWS);
} }
_onPageEmpty() { _onPageEmpty() {

View File

@@ -23,23 +23,23 @@ const UP = 0;
const DOWN = 1; const DOWN = 1;
var PadChooser = GObject.registerClass({ var PadChooser = GObject.registerClass({
Signals: { 'pad-selected': { param_types: [Clutter.InputDevice.$gtype] } }, Signals: { 'pad-selected': { param_types: [Clutter.InputDevice.$gtype] } }
}, class PadChooser extends St.Button { }, class PadChooser extends St.Button {
_init(device, groupDevices) { _init(device, groupDevices) {
super._init({ super._init({
style_class: 'pad-chooser-button', style_class: 'pad-chooser-button',
toggle_mode: true, toggle_mode: true,
x_fill: false,
y_fill: false,
x_align: St.Align.MIDDLE,
y_align: St.Align.MIDDLE
}); });
this.currentDevice = device; this.currentDevice = device;
this._padChooserMenu = null; this._padChooserMenu = null;
let arrow = new St.Icon({ let arrow = new St.Icon({ style_class: 'popup-menu-arrow',
style_class: 'popup-menu-arrow', icon_name: 'pan-down-symbolic',
icon_name: 'pan-down-symbolic', accessible_role: Atk.Role.ARROW });
accessible_role: Atk.Role.ARROW,
x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER,
});
this.set_child(arrow); this.set_child(arrow);
this._ensureMenu(groupDevices); this._ensureMenu(groupDevices);
@@ -89,7 +89,8 @@ var PadChooser = GObject.registerClass({
}); });
var KeybindingEntry = GObject.registerClass({ var KeybindingEntry = GObject.registerClass({
Signals: { 'keybinding-edited': {} }, GTypeName: 'PadOsd_KeybindingEntry',
Signals: { 'keybinding-edited': {} }
}, class KeybindingEntry extends St.Entry { }, class KeybindingEntry extends St.Entry {
_init() { _init() {
super._init({ hint_text: _("New shortcut…"), style: 'width: 10em' }); super._init({ hint_text: _("New shortcut…"), style: 'width: 10em' });
@@ -110,7 +111,8 @@ var KeybindingEntry = GObject.registerClass({
}); });
var ActionComboBox = GObject.registerClass({ var ActionComboBox = GObject.registerClass({
Signals: { 'action-selected': { param_types: [GObject.TYPE_INT] } }, GTypeName: 'PadOsd_ActionComboBox',
Signals: { 'action-selected': { param_types: [GObject.TYPE_INT] } }
}, class ActionComboBox extends St.Button { }, class ActionComboBox extends St.Button {
_init() { _init() {
super._init({ style_class: 'button' }); super._init({ style_class: 'button' });
@@ -192,7 +194,8 @@ var ActionComboBox = GObject.registerClass({
}); });
var ActionEditor = GObject.registerClass({ var ActionEditor = GObject.registerClass({
Signals: { 'done': {} }, GTypeName: 'PadOsd_ActionEditor',
Signals: { 'done': {} }
}, class ActionEditor extends St.Widget { }, class ActionEditor extends St.Widget {
_init() { _init() {
let boxLayout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.HORIZONTAL, let boxLayout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.HORIZONTAL,
@@ -233,7 +236,7 @@ var ActionEditor = GObject.registerClass({
this._actionComboBox.setAction(this._currentAction); this._actionComboBox.setAction(this._currentAction);
this._updateKeybindingEntryState(); this._updateKeybindingEntryState();
let isButton = action == Meta.PadActionType.BUTTON; let isButton = (action == Meta.PadActionType.BUTTON);
this._actionComboBox.setButtonActionsActive(isButton); this._actionComboBox.setButtonActionsActive(isButton);
} }
@@ -291,7 +294,7 @@ var PadDiagram = GObject.registerClass({
'Editor actor', 'Editor actor',
GObject.ParamFlags.READWRITE | GObject.ParamFlags.READWRITE |
GObject.ParamFlags.CONSTRUCT_ONLY, GObject.ParamFlags.CONSTRUCT_ONLY,
Clutter.Actor.$gtype), Clutter.Actor.$gtype)
}, },
}, class PadDiagram extends St.DrawingArea { }, class PadDiagram extends St.DrawingArea {
_init(params) { _init(params) {
@@ -344,19 +347,17 @@ var PadDiagram = GObject.registerClass({
} }
_wrappingSvgHeader() { _wrappingSvgHeader() {
return '<?xml version="1.0" encoding="UTF-8" standalone="no"?>' + return ('<?xml version="1.0" encoding="UTF-8" standalone="no"?>' +
'<svg version="1.1" xmlns="http://www.w3.org/2000/svg" ' + '<svg version="1.1" xmlns="http://www.w3.org/2000/svg" ' +
'xmlns:xi="http://www.w3.org/2001/XInclude" ' + 'xmlns:xi="http://www.w3.org/2001/XInclude" ' +
`width="${ // " (give xgettext the paired quotes it expects) `width="${this._imageWidth}" height="${this._imageHeight}"> ` +
this._imageWidth '<style type="text/css">');
}" height="${this._imageHeight}"> ` + // "
'<style type="text/css">';
} }
_wrappingSvgFooter() { _wrappingSvgFooter() {
return '</style>' + return ('</style>' +
'<xi:include href="' + this._imagePath + '" />' + '<xi:include href="' + this._imagePath + '" />' +
'</svg>'; '</svg>');
} }
_cssString() { _cssString() {
@@ -618,10 +619,7 @@ var PadDiagram = GObject.registerClass({
}); });
var PadOsd = GObject.registerClass({ var PadOsd = GObject.registerClass({
Signals: { Signals: { 'pad-selected': { param_types: [Clutter.InputDevice.$gtype] } }
'pad-selected': { param_types: [Clutter.InputDevice.$gtype] },
'closed': {},
},
}, class PadOsd extends St.BoxLayout { }, class PadOsd extends St.BoxLayout {
_init(padDevice, settings, imagePath, editionMode, monitorIndex) { _init(padDevice, settings, imagePath, editionMode, monitorIndex) {
super._init({ super._init({
@@ -629,7 +627,7 @@ var PadOsd = GObject.registerClass({
vertical: true, vertical: true,
x_expand: true, x_expand: true,
y_expand: true, y_expand: true,
reactive: true, reactive: true
}); });
this.padDevice = padDevice; this.padDevice = padDevice;
@@ -735,12 +733,10 @@ var PadOsd = GObject.registerClass({
x_align: Clutter.ActorAlign.CENTER, x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER }); y_align: Clutter.ActorAlign.CENTER });
this.add_actor(buttonBox); this.add_actor(buttonBox);
this._editButton = new St.Button({ this._editButton = new St.Button({ label: _("Edit…"),
label: _('Edit…'), style_class: 'button',
style_class: 'button', x_align: Clutter.ActorAlign.CENTER,
can_focus: true, can_focus: true });
x_align: Clutter.ActorAlign.CENTER,
});
this._editButton.connect('clicked', () => { this._editButton.connect('clicked', () => {
this.setEditionMode(true); this.setEditionMode(true);
}); });
@@ -797,7 +793,7 @@ var PadOsd = GObject.registerClass({
this._padDiagram.deactivateButton(event.get_button()); this._padDiagram.deactivateButton(event.get_button());
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
} else if (event.type() == Clutter.EventType.KEY_PRESS && } else if (event.type() == Clutter.EventType.KEY_PRESS &&
(!this._editionMode || event.get_key_symbol() === Clutter.KEY_Escape)) { (!this._editionMode || event.get_key_symbol() == Clutter.Escape)) {
if (this._editedAction != null) if (this._editedAction != null)
this._endActionEdition(); this._endActionEdition();
else else
@@ -844,23 +840,22 @@ var PadOsd = GObject.registerClass({
this._tipLabel.set_text(_("Press any key to exit")); this._tipLabel.set_text(_("Press any key to exit"));
} }
this._titleLabel.clutter_text.set_markup( this._titleLabel.clutter_text.set_markup('<span size="larger"><b>' + title + '</b></span>');
`<span size="larger"><b>${title}</b></span>`);
} }
_isEditedAction(type, number, dir) { _isEditedAction(type, number, dir) {
if (!this._editedAction) if (!this._editedAction)
return false; return false;
return this._editedAction.type == type && return (this._editedAction.type == type &&
this._editedAction.number == number && this._editedAction.number == number &&
this._editedAction.dir == dir; this._editedAction.dir == dir);
} }
_followUpActionEdition(str) { _followUpActionEdition(str) {
let { type, dir, number, mode } = this._editedAction; let { type, dir, number, mode } = this._editedAction;
let hasNextAction = type == Meta.PadActionType.RING && dir == CCW || let hasNextAction = (type == Meta.PadActionType.RING && dir == CCW ||
type == Meta.PadActionType.STRIP && dir == UP; type == Meta.PadActionType.STRIP && dir == UP);
if (!hasNextAction) if (!hasNextAction)
return false; return false;

View File

@@ -1,15 +1,10 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported PageIndicators, AnimatedPageIndicators */ /* exported PageIndicators, AnimatedPageIndicators */
const { Clutter, GLib, Graphene, GObject, Meta, St } = imports.gi; const { Clutter, GLib, GObject, Meta, St } = imports.gi;
const { ANIMATION_TIME_OUT, ANIMATION_MAX_DELAY_OUT_FOR_ITEM, AnimationDirection } = imports.ui.iconGrid; const { ANIMATION_TIME_OUT, ANIMATION_MAX_DELAY_OUT_FOR_ITEM, AnimationDirection } = imports.ui.iconGrid;
const INDICATOR_INACTIVE_OPACITY = 128;
const INDICATOR_INACTIVE_OPACITY_HOVER = 255;
const INDICATOR_INACTIVE_SCALE = 2 / 3;
const INDICATOR_INACTIVE_SCALE_PRESSED = 0.5;
var INDICATORS_BASE_TIME = 250; var INDICATORS_BASE_TIME = 250;
var INDICATORS_BASE_TIME_OUT = 125; var INDICATORS_BASE_TIME_OUT = 125;
var INDICATORS_ANIMATION_DELAY = 125; var INDICATORS_ANIMATION_DELAY = 125;
@@ -17,13 +12,13 @@ var INDICATORS_ANIMATION_DELAY_OUT = 62.5;
var INDICATORS_ANIMATION_MAX_TIME = 750; var INDICATORS_ANIMATION_MAX_TIME = 750;
var SWITCH_TIME = 400; var SWITCH_TIME = 400;
var INDICATORS_ANIMATION_MAX_TIME_OUT = var INDICATORS_ANIMATION_MAX_TIME_OUT =
Math.min(SWITCH_TIME, Math.min (SWITCH_TIME,
ANIMATION_TIME_OUT + ANIMATION_MAX_DELAY_OUT_FOR_ITEM); ANIMATION_TIME_OUT + ANIMATION_MAX_DELAY_OUT_FOR_ITEM);
var ANIMATION_DELAY = 100; var ANIMATION_DELAY = 100;
var PageIndicators = GObject.registerClass({ var PageIndicators = GObject.registerClass({
Signals: { 'page-activated': { param_types: [GObject.TYPE_INT] } }, Signals: { 'page-activated': { param_types: [GObject.TYPE_INT] } }
}, class PageIndicators extends St.BoxLayout { }, class PageIndicators extends St.BoxLayout {
_init(orientation = Clutter.Orientation.VERTICAL) { _init(orientation = Clutter.Orientation.VERTICAL) {
let vertical = orientation == Clutter.Orientation.VERTICAL; let vertical = orientation == Clutter.Orientation.VERTICAL;
@@ -34,10 +29,10 @@ var PageIndicators = GObject.registerClass({
x_align: vertical ? Clutter.ActorAlign.END : Clutter.ActorAlign.CENTER, x_align: vertical ? Clutter.ActorAlign.END : Clutter.ActorAlign.CENTER,
y_align: vertical ? Clutter.ActorAlign.CENTER : Clutter.ActorAlign.END, y_align: vertical ? Clutter.ActorAlign.CENTER : Clutter.ActorAlign.END,
reactive: true, reactive: true,
clip_to_allocation: true, clip_to_allocation: true
}); });
this._nPages = 0; this._nPages = 0;
this._currentPosition = 0; this._currentPage = undefined;
this._reactive = true; this._reactive = true;
this._reactive = true; this._reactive = true;
} }
@@ -71,21 +66,13 @@ var PageIndicators = GObject.registerClass({
button_mask: St.ButtonMask.ONE | button_mask: St.ButtonMask.ONE |
St.ButtonMask.TWO | St.ButtonMask.TWO |
St.ButtonMask.THREE, St.ButtonMask.THREE,
reactive: this._reactive }); toggle_mode: true,
indicator.child = new St.Widget({ reactive: this._reactive,
style_class: 'page-indicator-icon', checked: pageIndex == this._currentPage });
pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }), indicator.child = new St.Widget({ style_class: 'page-indicator-icon' });
});
indicator.connect('clicked', () => { indicator.connect('clicked', () => {
this.emit('page-activated', pageIndex); this.emit('page-activated', pageIndex);
}); });
indicator.connect('notify::hover', () => {
this._updateIndicator(indicator, pageIndex);
});
indicator.connect('notify::pressed', () => {
this._updateIndicator(indicator, pageIndex);
});
this._updateIndicator(indicator, pageIndex);
this.add_actor(indicator); this.add_actor(indicator);
} }
} else { } else {
@@ -94,31 +81,15 @@ var PageIndicators = GObject.registerClass({
children[i].destroy(); children[i].destroy();
} }
this._nPages = nPages; this._nPages = nPages;
this.visible = this._nPages > 1; this.visible = (this._nPages > 1);
} }
_updateIndicator(indicator, pageIndex) { setCurrentPage(currentPage) {
let progress = this._currentPage = currentPage;
Math.max(1 - Math.abs(this._currentPosition - pageIndex), 0);
let inactiveScale = indicator.pressed
? INDICATOR_INACTIVE_SCALE_PRESSED : INDICATOR_INACTIVE_SCALE;
let inactiveOpacity = indicator.hover
? INDICATOR_INACTIVE_OPACITY_HOVER : INDICATOR_INACTIVE_OPACITY;
let scale = inactiveScale + (1 - inactiveScale) * progress;
let opacity = inactiveOpacity + (255 - inactiveOpacity) * progress;
indicator.child.set_scale(scale, scale);
indicator.child.opacity = opacity;
}
setCurrentPosition(currentPosition) {
this._currentPosition = currentPosition;
let children = this.get_children(); let children = this.get_children();
for (let i = 0; i < children.length; i++) for (let i = 0; i < children.length; i++)
this._updateIndicator(children[i], i); children[i].set_checked(i == this._currentPage);
} }
}); });
@@ -183,7 +154,7 @@ class AnimatedPageIndicators extends PageIndicators {
translation_x: isAnimationIn ? 0 : offset, translation_x: isAnimationIn ? 0 : offset,
duration: baseTime + delay * i, duration: baseTime + delay * i,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay: isAnimationIn ? ANIMATION_DELAY : 0, delay: isAnimationIn ? ANIMATION_DELAY : 0
}); });
} }
} }

View File

@@ -57,7 +57,8 @@ function _unpremultiply(color) {
let red = Math.min((color.red * 255 + 127) / color.alpha, 255); let red = Math.min((color.red * 255 + 127) / color.alpha, 255);
let green = Math.min((color.green * 255 + 127) / color.alpha, 255); let green = Math.min((color.green * 255 + 127) / color.alpha, 255);
let blue = Math.min((color.blue * 255 + 127) / color.alpha, 255); let blue = Math.min((color.blue * 255 + 127) / color.alpha, 255);
return new Clutter.Color({ red, green, blue, alpha: color.alpha }); return new Clutter.Color({ red: red, green: green,
blue: blue, alpha: color.alpha });
} }
class AppMenu extends PopupMenu.PopupMenu { class AppMenu extends PopupMenu.PopupMenu {
@@ -118,7 +119,7 @@ class AppMenu extends PopupMenu.PopupMenu {
_updateDetailsVisibility() { _updateDetailsVisibility() {
let sw = this._appSystem.lookup_app('org.gnome.Software.desktop'); let sw = this._appSystem.lookup_app('org.gnome.Software.desktop');
this._detailsItem.visible = sw != null; this._detailsItem.visible = (sw != null);
} }
isEmpty() { isEmpty() {
@@ -169,13 +170,9 @@ class AppMenu extends PopupMenu.PopupMenu {
let windows = this._app.get_windows(); let windows = this._app.get_windows();
windows.forEach(window => { windows.forEach(window => {
let title = window.title || this._app.get_name(); let title = window.title || this._app.get_name();
let item = this._windowSection.addAction(title, event => { this._windowSection.addAction(title, event => {
Main.activateWindow(window, event.get_time()); Main.activateWindow(window, event.get_time());
}); });
let id = window.connect('notify::title', () => {
item.label.text = window.title || this._app.get_name();
});
item.connect('destroy', () => window.disconnect(id));
}); });
} }
} }
@@ -237,10 +234,7 @@ var AppMenuButton = GObject.registerClass({
this._overviewHidingId = Main.overview.connect('hiding', this._sync.bind(this)); this._overviewHidingId = Main.overview.connect('hiding', this._sync.bind(this));
this._overviewShowingId = Main.overview.connect('showing', this._sync.bind(this)); this._overviewShowingId = Main.overview.connect('showing', this._sync.bind(this));
this._spinner = new Animation.Spinner(PANEL_ICON_SIZE, { this._spinner = new Animation.Spinner(PANEL_ICON_SIZE, true);
animate: true,
hideOnStop: true,
});
this._container.add_actor(this._spinner); this._container.add_actor(this._spinner);
let menu = new AppMenu(this); let menu = new AppMenu(this);
@@ -270,7 +264,7 @@ var AppMenuButton = GObject.registerClass({
this.ease({ this.ease({
opacity: 255, opacity: 255,
duration: Overview.ANIMATION_TIME, duration: Overview.ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD
}); });
} }
@@ -285,7 +279,7 @@ var AppMenuButton = GObject.registerClass({
opacity: 0, opacity: 0,
mode: Clutter.Animation.EASE_OUT_QUAD, mode: Clutter.Animation.EASE_OUT_QUAD,
duration: Overview.ANIMATION_TIME, duration: Overview.ANIMATION_TIME,
onComplete: () => this.hide(), onComplete: () => this.hide()
}); });
} }
@@ -346,10 +340,9 @@ var AppMenuButton = GObject.registerClass({
if (focusedApp && focusedApp.is_on_workspace(workspace)) if (focusedApp && focusedApp.is_on_workspace(workspace))
return focusedApp; return focusedApp;
for (let i = 0; i < this._startingApps.length; i++) { for (let i = 0; i < this._startingApps.length; i++)
if (this._startingApps[i].is_on_workspace(workspace)) if (this._startingApps[i].is_on_workspace(workspace))
return this._startingApps[i]; return this._startingApps[i];
}
return null; return null;
} }
@@ -372,21 +365,21 @@ var AppMenuButton = GObject.registerClass({
} }
} }
let visible = this._targetApp != null && !Main.overview.visibleTarget; let visible = (this._targetApp != null && !Main.overview.visibleTarget);
if (visible) if (visible)
this.fadeIn(); this.fadeIn();
else else
this.fadeOut(); this.fadeOut();
let isBusy = this._targetApp != null && let isBusy = (this._targetApp != null &&
(this._targetApp.get_state() == Shell.AppState.STARTING || (this._targetApp.get_state() == Shell.AppState.STARTING ||
this._targetApp.get_busy()); this._targetApp.get_busy()));
if (isBusy) if (isBusy)
this.startAnimation(); this.startAnimation();
else else
this.stopAnimation(); this.stopAnimation();
this.reactive = visible && !isBusy; this.reactive = (visible && !isBusy);
this._syncIcon(); this._syncIcon();
this.menu.setApp(this._targetApp); this.menu.setApp(this._targetApp);
@@ -439,11 +432,11 @@ class ActivitiesButton extends PanelMenu.Button {
Main.overview.connect('showing', () => { Main.overview.connect('showing', () => {
this.add_style_pseudo_class('overview'); this.add_style_pseudo_class('overview');
this.add_accessible_state(Atk.StateType.CHECKED); this.add_accessible_state (Atk.StateType.CHECKED);
}); });
Main.overview.connect('hiding', () => { Main.overview.connect('hiding', () => {
this.remove_style_pseudo_class('overview'); this.remove_style_pseudo_class('overview');
this.remove_accessible_state(Atk.StateType.CHECKED); this.remove_accessible_state (Atk.StateType.CHECKED);
}); });
this._xdndTimeOut = 0; this._xdndTimeOut = 0;
@@ -474,24 +467,23 @@ class ActivitiesButton extends PanelMenu.Button {
vfunc_event(event) { vfunc_event(event) {
if (event.type() == Clutter.EventType.TOUCH_END || if (event.type() == Clutter.EventType.TOUCH_END ||
event.type() == Clutter.EventType.BUTTON_RELEASE) { event.type() == Clutter.EventType.BUTTON_RELEASE)
if (Main.overview.shouldToggleByCornerOrButton()) if (Main.overview.shouldToggleByCornerOrButton())
Main.overview.toggle(); Main.overview.toggle();
}
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
} }
vfunc_key_release_event(keyEvent) { vfunc_key_release_event(keyEvent) {
let symbol = keyEvent.keyval; let ret = super.vfunc_key_release_event(keyEvent);
if (symbol == Clutter.KEY_Return || symbol == Clutter.KEY_space) { if (ret == Clutter.EVENT_PROPAGATE) {
if (Main.overview.shouldToggleByCornerOrButton()) { let symbol = keyEvent.keyval;
Main.overview.toggle(); if (symbol == Clutter.KEY_Return || symbol == Clutter.KEY_space) {
return Clutter.EVENT_STOP; if (Main.overview.shouldToggleByCornerOrButton())
Main.overview.toggle();
} }
} }
return ret;
return Clutter.EVENT_PROPAGATE;
} }
_xdndToggleOverview() { _xdndToggleOverview() {
@@ -533,8 +525,8 @@ class PanelCorner extends St.DrawingArea {
if (index < 0) if (index < 0)
return null; return null;
if (!children[index].has_style_class_name('panel-menu') && if (!(children[index].has_style_class_name('panel-menu')) &&
!children[index].has_style_class_name('panel-button')) !(children[index].has_style_class_name('panel-button')))
return this._findRightmostButton(children[index]); return this._findRightmostButton(children[index]);
return children[index]; return children[index];
@@ -558,8 +550,8 @@ class PanelCorner extends St.DrawingArea {
if (index == children.length) if (index == children.length)
return null; return null;
if (!children[index].has_style_class_name('panel-menu') && if (!(children[index].has_style_class_name('panel-menu')) &&
!children[index].has_style_class_name('panel-button')) !(children[index].has_style_class_name('panel-button')))
return this._findLeftmostButton(children[index]); return this._findLeftmostButton(children[index]);
return children[index]; return children[index];
@@ -627,15 +619,14 @@ class PanelCorner extends St.DrawingArea {
cr.setOperator(Cairo.Operator.SOURCE); cr.setOperator(Cairo.Operator.SOURCE);
cr.moveTo(0, offsetY); cr.moveTo(0, offsetY);
if (this._side == St.Side.LEFT) { if (this._side == St.Side.LEFT)
cr.arc(cornerRadius, cr.arc(cornerRadius,
borderWidth + cornerRadius, borderWidth + cornerRadius,
cornerRadius, Math.PI, 3 * Math.PI / 2); cornerRadius, Math.PI, 3 * Math.PI / 2);
} else { else
cr.arc(0, cr.arc(0,
borderWidth + cornerRadius, borderWidth + cornerRadius,
cornerRadius, 3 * Math.PI / 2, 2 * Math.PI); cornerRadius, 3 * Math.PI / 2, 2 * Math.PI);
}
cr.lineTo(cornerRadius, offsetY); cr.lineTo(cornerRadius, offsetY);
cr.closePath(); cr.closePath();
@@ -651,7 +642,7 @@ class PanelCorner extends St.DrawingArea {
Clutter.cairo_set_source_color(cr, backgroundColor); Clutter.cairo_set_source_color(cr, backgroundColor);
cr.save(); cr.save();
cr.translate(xOffsetDirection * offset, -offset); cr.translate(xOffsetDirection * offset, - offset);
cr.appendPath(savedPath); cr.appendPath(savedPath);
cr.fill(); cr.fill();
cr.restore(); cr.restore();
@@ -713,15 +704,16 @@ class AggregateMenu extends PanelMenu.Button {
this._indicators = new St.BoxLayout({ style_class: 'panel-status-indicators-box' }); this._indicators = new St.BoxLayout({ style_class: 'panel-status-indicators-box' });
this.add_child(this._indicators); this.add_child(this._indicators);
if (Config.HAVE_NETWORKMANAGER) if (Config.HAVE_NETWORKMANAGER) {
this._network = new imports.ui.status.network.NMApplet(); this._network = new imports.ui.status.network.NMApplet();
else } else {
this._network = null; this._network = null;
}
if (Config.HAVE_BLUETOOTH) if (Config.HAVE_BLUETOOTH) {
this._bluetooth = new imports.ui.status.bluetooth.Indicator(); this._bluetooth = new imports.ui.status.bluetooth.Indicator();
else } else {
this._bluetooth = null; this._bluetooth = null;
}
this._remoteAccess = new imports.ui.status.remoteAccess.RemoteAccessApplet(); this._remoteAccess = new imports.ui.status.remoteAccess.RemoteAccessApplet();
this._power = new imports.ui.status.power.Indicator(); this._power = new imports.ui.status.power.Indicator();
@@ -738,10 +730,12 @@ class AggregateMenu extends PanelMenu.Button {
this._indicators.add_child(this._screencast); this._indicators.add_child(this._screencast);
this._indicators.add_child(this._location); this._indicators.add_child(this._location);
this._indicators.add_child(this._nightLight); this._indicators.add_child(this._nightLight);
if (this._network) if (this._network) {
this._indicators.add_child(this._network); this._indicators.add_child(this._network);
if (this._bluetooth) }
if (this._bluetooth) {
this._indicators.add_child(this._bluetooth); this._indicators.add_child(this._bluetooth);
}
this._indicators.add_child(this._remoteAccess); this._indicators.add_child(this._remoteAccess);
this._indicators.add_child(this._rfkill); this._indicators.add_child(this._rfkill);
this._indicators.add_child(this._volume); this._indicators.add_child(this._volume);
@@ -751,24 +745,23 @@ class AggregateMenu extends PanelMenu.Button {
this.menu.addMenuItem(this._volume.menu); this.menu.addMenuItem(this._volume.menu);
this.menu.addMenuItem(this._brightness.menu); this.menu.addMenuItem(this._brightness.menu);
this.menu.addMenuItem(new PopupMenu.PopupSeparatorMenuItem()); this.menu.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
if (this._network) if (this._network) {
this.menu.addMenuItem(this._network.menu); this.menu.addMenuItem(this._network.menu);
}
if (this._bluetooth) if (this._bluetooth) {
this.menu.addMenuItem(this._bluetooth.menu); this.menu.addMenuItem(this._bluetooth.menu);
}
this.menu.addMenuItem(this._remoteAccess.menu); this.menu.addMenuItem(this._remoteAccess.menu);
this.menu.addMenuItem(this._location.menu); this.menu.addMenuItem(this._location.menu);
this.menu.addMenuItem(this._rfkill.menu); this.menu.addMenuItem(this._rfkill.menu);
this.menu.addMenuItem(this._power.menu); this.menu.addMenuItem(this._power.menu);
this.menu.addMenuItem(this._nightLight.menu); this.menu.addMenuItem(this._nightLight.menu);
this.menu.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
this.menu.addMenuItem(this._system.menu); this.menu.addMenuItem(this._system.menu);
menuLayout.addSizeChild(this._location.menu.actor); menuLayout.addSizeChild(this._location.menu.actor);
menuLayout.addSizeChild(this._rfkill.menu.actor); menuLayout.addSizeChild(this._rfkill.menu.actor);
menuLayout.addSizeChild(this._power.menu.actor); menuLayout.addSizeChild(this._power.menu.actor);
menuLayout.addSizeChild(this._system.menu.actor); menuLayout.addSizeChild(this._system.buttonGroup);
} }
}); });
@@ -1108,7 +1101,7 @@ class Panel extends St.Widget {
let boxes = { let boxes = {
left: this._leftBox, left: this._leftBox,
center: this._centerBox, center: this._centerBox,
right: this._rightBox, right: this._rightBox
}; };
let boxContainer = boxes[box] || this._rightBox; let boxContainer = boxes[box] || this._rightBox;
this.statusArea[role] = indicator; this.statusArea[role] = indicator;

View File

@@ -10,17 +10,15 @@ const PopupMenu = imports.ui.popupMenu;
var ButtonBox = GObject.registerClass( var ButtonBox = GObject.registerClass(
class ButtonBox extends St.Widget { class ButtonBox extends St.Widget {
_init(params) { _init(params) {
params = Params.parse(params, { params = Params.parse(params, { style_class: 'panel-button' }, true);
style_class: 'panel-button',
x_expand: true,
y_expand: true,
}, true);
super._init(params); super._init(params);
this._delegate = this; this._delegate = this;
this.container = new St.Bin({ child: this }); this.container = new St.Bin({ y_fill: true,
x_fill: true,
child: this });
this.connect('style-changed', this._onStyleChanged.bind(this)); this.connect('style-changed', this._onStyleChanged.bind(this));
this.connect('destroy', this._onDestroy.bind(this)); this.connect('destroy', this._onDestroy.bind(this));
@@ -154,7 +152,7 @@ var Button = GObject.registerClass({
if (symbol == Clutter.KEY_Left || symbol == Clutter.KEY_Right) { if (symbol == Clutter.KEY_Left || symbol == Clutter.KEY_Right) {
let group = global.focus_manager.get_group(this); let group = global.focus_manager.get_group(this);
if (group) { if (group) {
let direction = symbol == Clutter.KEY_Left ? St.DirectionType.LEFT : St.DirectionType.RIGHT; let direction = (symbol == Clutter.KEY_Left) ? St.DirectionType.LEFT : St.DirectionType.RIGHT;
group.navigate_focus(this, direction, false); group.navigate_focus(this, direction, false);
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
} }
@@ -179,7 +177,7 @@ var Button = GObject.registerClass({
// measures are in logical pixels, so make sure to consider the scale // measures are in logical pixels, so make sure to consider the scale
// factor when computing max-height // factor when computing max-height
let maxHeight = Math.round((workArea.height - verticalMargins) / scaleFactor); let maxHeight = Math.round((workArea.height - verticalMargins) / scaleFactor);
this.menu.actor.style = 'max-height: %spx;'.format(maxHeight); this.menu.actor.style = ('max-height: %spx;').format(maxHeight);
} }
_onDestroy() { _onDestroy() {
@@ -197,13 +195,14 @@ var Button = GObject.registerClass({
* of an icon and a menu section, which will be composed into the * of an icon and a menu section, which will be composed into the
* aggregate menu. * aggregate menu.
*/ */
var SystemIndicator = GObject.registerClass( var SystemIndicator = GObject.registerClass({
class SystemIndicator extends St.BoxLayout { GTypeName: 'PanelMenu_SystemIndicator',
}, class SystemIndicator extends St.BoxLayout {
_init() { _init() {
super._init({ super._init({
style_class: 'panel-status-indicators-box', style_class: 'panel-status-indicators-box',
reactive: true, reactive: true,
visible: false, visible: false
}); });
this.menu = new PopupMenu.PopupMenuSection(); this.menu = new PopupMenu.PopupMenuSection();
} }

View File

@@ -10,8 +10,8 @@ var PieTimer = GObject.registerClass({
'angle': GObject.ParamSpec.double( 'angle': GObject.ParamSpec.double(
'angle', 'angle', 'angle', 'angle', 'angle', 'angle',
GObject.ParamFlags.READWRITE, GObject.ParamFlags.READWRITE,
0, 2 * Math.PI, 0), 0, 2 * Math.PI, 0)
}, }
}, class PieTimer extends St.DrawingArea { }, class PieTimer extends St.DrawingArea {
_init() { _init() {
this._angle = 0; this._angle = 0;
@@ -20,7 +20,7 @@ var PieTimer = GObject.registerClass({
opacity: 0, opacity: 0,
visible: false, visible: false,
can_focus: false, can_focus: false,
reactive: false, reactive: false
}); });
this.set_pivot_point(0.5, 0.5); this.set_pivot_point(0.5, 0.5);
@@ -84,13 +84,13 @@ var PieTimer = GObject.registerClass({
this.ease({ this.ease({
opacity: 255, opacity: 255,
duration: duration / 4, duration: duration / 4,
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD
}); });
this.ease_property('angle', 2 * Math.PI, { this.ease_property('angle', 2 * Math.PI, {
duration, duration,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR,
onComplete: this._onTransitionComplete.bind(this), onComplete: this._onTransitionComplete.bind(this)
}); });
} }
@@ -101,7 +101,7 @@ var PieTimer = GObject.registerClass({
opacity: 0, opacity: 0,
duration: SUCCESS_ZOOM_OUT_DURATION, duration: SUCCESS_ZOOM_OUT_DURATION,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onStopped: () => this.destroy(), onStopped: () => this.destroy()
}); });
} }
}); });
@@ -110,7 +110,7 @@ var PointerA11yTimeout = class PointerA11yTimeout {
constructor() { constructor() {
let manager = Clutter.DeviceManager.get_default(); let manager = Clutter.DeviceManager.get_default();
manager.connect('ptr-a11y-timeout-started', (o, device, type, timeout) => { manager.connect('ptr-a11y-timeout-started', (manager, device, type, timeout) => {
let [x, y] = global.get_pointer(); let [x, y] = global.get_pointer();
this._pieTimer = new PieTimer(); this._pieTimer = new PieTimer();
@@ -123,7 +123,7 @@ var PointerA11yTimeout = class PointerA11yTimeout {
global.display.set_cursor(Meta.Cursor.CROSSHAIR); global.display.set_cursor(Meta.Cursor.CROSSHAIR);
}); });
manager.connect('ptr-a11y-timeout-stopped', (o, device, type, clicked) => { manager.connect('ptr-a11y-timeout-stopped', (manager, device, type, clicked) => {
if (!clicked) if (!clicked)
this._pieTimer.destroy(); this._pieTimer.destroy();

View File

@@ -19,17 +19,14 @@ var Ornament = {
}; };
function isPopupMenuItemVisible(child) { function isPopupMenuItemVisible(child) {
if (child._delegate instanceof PopupMenuSection) { if (child._delegate instanceof PopupMenuSection)
if (child._delegate.isEmpty()) if (child._delegate.isEmpty())
return false; return false;
}
return child.visible; return child.visible;
} }
/** /**
* arrowIcon * @side Side to which the arrow points.
* @param {St.Side} side - Side to which the arrow points.
* @returns {St.Icon} a new arrow icon
*/ */
function arrowIcon(side) { function arrowIcon(side) {
let iconName; let iconName;
@@ -68,10 +65,10 @@ var PopupBaseMenuItem = GObject.registerClass({
}, },
Signals: { Signals: {
'activate': { param_types: [Clutter.Event.$gtype] }, 'activate': { param_types: [Clutter.Event.$gtype] },
}, }
}, class PopupBaseMenuItem extends St.BoxLayout { }, class PopupBaseMenuItem extends St.BoxLayout {
_init(params) { _init(params) {
params = Params.parse(params, { params = Params.parse (params, {
reactive: true, reactive: true,
activate: true, activate: true,
hover: true, hover: true,
@@ -121,18 +118,18 @@ var PopupBaseMenuItem = GObject.registerClass({
this._parent = parent; this._parent = parent;
} }
vfunc_button_press_event() { vfunc_button_press_event(buttonEvent) {
if (!this._activatable) if (!this._activatable)
return Clutter.EVENT_PROPAGATE; return super.vfunc_button_press_event(buttonEvent);
// This is the CSS active state // This is the CSS active state
this.add_style_pseudo_class('active'); this.add_style_pseudo_class('active');
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
} }
vfunc_button_release_event() { vfunc_button_release_event(buttonEvent) {
if (!this._activatable) if (!this._activatable)
return Clutter.EVENT_PROPAGATE; return super.vfunc_button_release_event(buttonEvent);
this.remove_style_pseudo_class('active'); this.remove_style_pseudo_class('active');
this.activate(Clutter.get_current_event()); this.activate(Clutter.get_current_event());
@@ -141,7 +138,7 @@ var PopupBaseMenuItem = GObject.registerClass({
vfunc_touch_event(touchEvent) { vfunc_touch_event(touchEvent) {
if (!this._activatable) if (!this._activatable)
return Clutter.EVENT_PROPAGATE; return super.vfunc_touch_event(touchEvent);
if (touchEvent.type == Clutter.EventType.TOUCH_END) { if (touchEvent.type == Clutter.EventType.TOUCH_END) {
this.remove_style_pseudo_class('active'); this.remove_style_pseudo_class('active');
@@ -272,7 +269,7 @@ class PopupMenuItem extends PopupBaseMenuItem {
_init(text, params) { _init(text, params) {
super._init(params); super._init(params);
this.label = new St.Label({ text }); this.label = new St.Label({ text: text });
this.add_child(this.label); this.add_child(this.label);
this.label_actor = this.label; this.label_actor = this.label;
} }
@@ -294,10 +291,9 @@ class PopupSeparatorMenuItem extends PopupBaseMenuItem {
this._syncVisibility(); this._syncVisibility();
this._separator = new St.Widget({ style_class: 'popup-separator-menu-item', this._separator = new St.Widget({ style_class: 'popup-separator-menu-item',
x_expand: true,
y_expand: true, y_expand: true,
y_align: Clutter.ActorAlign.CENTER }); y_align: Clutter.ActorAlign.CENTER });
this.add_child(this._separator); this.add(this._separator, { expand: true });
} }
_syncVisibility() { _syncVisibility() {
@@ -328,12 +324,12 @@ class Switch extends St.Bin {
}); });
var PopupSwitchMenuItem = GObject.registerClass({ var PopupSwitchMenuItem = GObject.registerClass({
Signals: { 'toggled': { param_types: [GObject.TYPE_BOOLEAN] } }, Signals: { 'toggled': { param_types: [GObject.TYPE_BOOLEAN] }, },
}, class PopupSwitchMenuItem extends PopupBaseMenuItem { }, class PopupSwitchMenuItem extends PopupBaseMenuItem {
_init(text, active, params) { _init(text, active, params) {
super._init(params); super._init(params);
this.label = new St.Label({ text }); this.label = new St.Label({ text: text });
this._switch = new Switch(active); this._switch = new Switch(active);
this.accessible_role = Atk.Role.CHECK_MENU_ITEM; this.accessible_role = Atk.Role.CHECK_MENU_ITEM;
@@ -342,11 +338,8 @@ var PopupSwitchMenuItem = GObject.registerClass({
this.add_child(this.label); this.add_child(this.label);
this._statusBin = new St.Bin({ this._statusBin = new St.Bin({ x_align: St.Align.END });
x_align: Clutter.ActorAlign.END, this.add(this._statusBin, { expand: true, x_align: St.Align.END });
x_expand: true,
});
this.add_child(this._statusBin);
this._statusLabel = new St.Label({ this._statusLabel = new St.Label({
text: '', text: '',
@@ -419,7 +412,7 @@ class PopupImageMenuItem extends PopupBaseMenuItem {
this._icon = new St.Icon({ style_class: 'popup-menu-icon', this._icon = new St.Icon({ style_class: 'popup-menu-icon',
x_align: Clutter.ActorAlign.END }); x_align: Clutter.ActorAlign.END });
this.add_child(this._icon); this.add_child(this._icon);
this.label = new St.Label({ text }); this.label = new St.Label({ text: text });
this.add_child(this.label); this.add_child(this.label);
this.label_actor = this.label; this.label_actor = this.label;
@@ -444,14 +437,12 @@ var PopupMenuBase = class {
this.focusActor = sourceActor; this.focusActor = sourceActor;
this._parent = null; this._parent = null;
this.box = new St.BoxLayout({ if (styleClass !== undefined) {
vertical: true, this.box = new St.BoxLayout({ style_class: styleClass,
x_expand: true, vertical: true });
y_expand: true, } else {
}); this.box = new St.BoxLayout({ vertical: true });
}
if (styleClass !== undefined)
this.box.style_class = styleClass;
this.length = 0; this.length = 0;
this.isOpen = false; this.isOpen = false;
@@ -510,7 +501,7 @@ var PopupMenuBase = class {
menuItem = new PopupMenuItem(title); menuItem = new PopupMenuItem(title);
this.addMenuItem(menuItem); this.addMenuItem(menuItem);
menuItem.connect('activate', (o, event) => { menuItem.connect('activate', (menuItem, event) => {
callback(event); callback(event);
}); });
@@ -568,7 +559,7 @@ var PopupMenuBase = class {
} }
_connectItemSignals(menuItem) { _connectItemSignals(menuItem) {
menuItem._activeChangeId = menuItem.connect('notify::active', () => { menuItem._activeChangeId = menuItem.connect('notify::active', menuItem => {
let active = menuItem.active; let active = menuItem.active;
if (active && this._activeMenuItem != menuItem) { if (active && this._activeMenuItem != menuItem) {
if (this._activeMenuItem) if (this._activeMenuItem)
@@ -592,7 +583,7 @@ var PopupMenuBase = class {
menuItem.actor.grab_key_focus(); menuItem.actor.grab_key_focus();
} }
}); });
menuItem._activateId = menuItem.connect_after('activate', () => { menuItem._activateId = menuItem.connect_after('activate', (menuItem, _event) => {
this.emit('activate', menuItem); this.emit('activate', menuItem);
this.itemActivated(BoxPointer.PopupAnimation.FULL); this.itemActivated(BoxPointer.PopupAnimation.FULL);
}); });
@@ -605,7 +596,7 @@ var PopupMenuBase = class {
// the menuItem may have, called destroyId // the menuItem may have, called destroyId
// (FIXME: in the future it may make sense to have container objects // (FIXME: in the future it may make sense to have container objects
// like PopupMenuManager does) // like PopupMenuManager does)
menuItem._popupMenuDestroyId = menuItem.connect('destroy', () => { menuItem._popupMenuDestroyId = menuItem.connect('destroy', menuItem => {
menuItem.disconnect(menuItem._popupMenuDestroyId); menuItem.disconnect(menuItem._popupMenuDestroyId);
menuItem.disconnect(menuItem._activateId); menuItem.disconnect(menuItem._activateId);
menuItem.disconnect(menuItem._activeChangeId); menuItem.disconnect(menuItem._activeChangeId);
@@ -801,7 +792,10 @@ var PopupMenu = class extends PopupMenuBase {
this._arrowAlignment = arrowAlignment; this._arrowAlignment = arrowAlignment;
this._arrowSide = arrowSide; this._arrowSide = arrowSide;
this._boxPointer = new BoxPointer.BoxPointer(arrowSide); this._boxPointer = new BoxPointer.BoxPointer(arrowSide,
{ x_fill: true,
y_fill: true,
x_align: St.Align.START });
this.actor = this._boxPointer; this.actor = this._boxPointer;
this.actor._delegate = this; this.actor._delegate = this;
this.actor.style_class = 'popup-menu-boxpointer'; this.actor.style_class = 'popup-menu-boxpointer';
@@ -812,12 +806,10 @@ var PopupMenu = class extends PopupMenuBase {
global.focus_manager.add_group(this.actor); global.focus_manager.add_group(this.actor);
this.actor.reactive = true; this.actor.reactive = true;
if (this.sourceActor) { if (this.sourceActor)
this._keyPressId = this.sourceActor.connect('key-press-event', this._keyPressId = this.sourceActor.connect('key-press-event',
this._onKeyPress.bind(this)); this._onKeyPress.bind(this));
}
this._systemModalOpenedId = 0;
this._openedSubMenu = null; this._openedSubMenu = null;
} }
@@ -892,17 +884,12 @@ var PopupMenu = class extends PopupMenuBase {
if (this.isEmpty()) if (this.isEmpty())
return; return;
if (!this._systemModalOpenedId) {
this._systemModalOpenedId =
Main.layoutManager.connect('system-modal-opened', () => this.close());
}
this.isOpen = true; this.isOpen = true;
this._boxPointer.setPosition(this.sourceActor, this._arrowAlignment); this._boxPointer.setPosition(this.sourceActor, this._arrowAlignment);
this._boxPointer.open(animate); this._boxPointer.open(animate);
this.actor.get_parent().set_child_above_sibling(this.actor, null); this.actor.raise_top();
this.emit('open-state-changed', true); this.emit('open-state-changed', true);
} }
@@ -927,11 +914,6 @@ var PopupMenu = class extends PopupMenuBase {
destroy() { destroy() {
if (this._keyPressId) if (this._keyPressId)
this.sourceActor.disconnect(this._keyPressId); this.sourceActor.disconnect(this._keyPressId);
if (this._systemModalOpenedId)
Main.layoutManager.disconnect(this._systemModalOpenedId);
this._systemModalOpenedId = 0;
super.destroy(); super.destroy();
} }
}; };
@@ -1045,12 +1027,12 @@ var PopupSubMenu = class extends PopupMenuBase {
height: naturalHeight, height: naturalHeight,
duration: 250, duration: 250,
mode: Clutter.AnimationMode.EASE_OUT_EXPO, mode: Clutter.AnimationMode.EASE_OUT_EXPO,
onComplete: () => this.actor.set_height(-1), onComplete: () => this.actor.set_height(-1)
}); });
this._arrow.ease({ this._arrow.ease({
rotation_angle_z: targetAngle, rotation_angle_z: targetAngle,
duration: 250, duration: 250,
mode: Clutter.AnimationMode.EASE_OUT_EXPO, mode: Clutter.AnimationMode.EASE_OUT_EXPO
}); });
} else { } else {
this._arrow.rotation_angle_z = targetAngle; this._arrow.rotation_angle_z = targetAngle;
@@ -1078,12 +1060,12 @@ var PopupSubMenu = class extends PopupMenuBase {
onComplete: () => { onComplete: () => {
this.actor.hide(); this.actor.hide();
this.actor.set_height(-1); this.actor.set_height(-1);
}, }
}); });
this._arrow.ease({ this._arrow.ease({
rotation_angle_z: 0, rotation_angle_z: 0,
duration: 250, duration: 250,
mode: Clutter.AnimationMode.EASE_OUT_EXPO, mode: Clutter.AnimationMode.EASE_OUT_EXPO
}); });
} else { } else {
this._arrow.rotation_angle_z = 0; this._arrow.rotation_angle_z = 0;
@@ -1144,17 +1126,14 @@ class PopupSubMenuMenuItem extends PopupBaseMenuItem {
this.add_child(this.icon); this.add_child(this.icon);
} }
this.label = new St.Label({ text, this.label = new St.Label({ text: text,
y_expand: true, y_expand: true,
y_align: Clutter.ActorAlign.CENTER }); y_align: Clutter.ActorAlign.CENTER });
this.add_child(this.label); this.add_child(this.label);
this.label_actor = this.label; this.label_actor = this.label;
let expander = new St.Bin({ let expander = new St.Bin({ style_class: 'popup-menu-item-expander' });
style_class: 'popup-menu-item-expander', this.add(expander, { expand: true });
x_expand: true,
});
this.add_child(expander);
this._triangle = arrowIcon(St.Side.RIGHT); this._triangle = arrowIcon(St.Side.RIGHT);
this._triangle.pivot_point = new Graphene.Point({ x: 0.5, y: 0.6 }); this._triangle.pivot_point = new Graphene.Point({ x: 0.5, y: 0.6 });
@@ -1192,7 +1171,7 @@ class PopupSubMenuMenuItem extends PopupBaseMenuItem {
} else { } else {
this.remove_style_pseudo_class('open'); this.remove_style_pseudo_class('open');
this._getTopMenu()._setOpenedSubMenu(null); this._getTopMenu()._setOpenedSubMenu(null);
this.remove_accessible_state(Atk.StateType.EXPANDED); this.remove_accessible_state (Atk.StateType.EXPANDED);
this.remove_style_pseudo_class('checked'); this.remove_style_pseudo_class('checked');
} }
} }
@@ -1266,11 +1245,11 @@ var PopupMenuManager = class {
return; return;
let menudata = { let menudata = {
menu, menu: menu,
openStateChangeId: menu.connect('open-state-changed', this._onMenuOpenState.bind(this)), openStateChangeId: menu.connect('open-state-changed', this._onMenuOpenState.bind(this)),
destroyId: menu.connect('destroy', this._onMenuDestroy.bind(this)), destroyId: menu.connect('destroy', this._onMenuDestroy.bind(this)),
enterId: 0, enterId: 0,
focusInId: 0, focusInId: 0
}; };
let source = menu.sourceActor; let source = menu.sourceActor;

View File

@@ -181,7 +181,7 @@ function loadRemoteSearchProviders(searchSettings, callback) {
return -1; return -1;
// finally, if both providers are found, return their order in the list // finally, if both providers are found, return their order in the list
return idxA - idxB; return (idxA - idxB);
}); });
callback(loadedProviders); callback(loadedProviders);
@@ -228,7 +228,8 @@ var RemoteSearchProvider = class {
} }
if (gicon) if (gicon)
icon = new St.Icon({ gicon, icon_size: size }); icon = new St.Icon({ gicon: gicon,
icon_size: size });
return icon; return icon;
} }

View File

@@ -53,13 +53,13 @@ var Ripples = class Ripples {
ripple.visible = true; ripple.visible = true;
ripple.opacity = 255 * Math.sqrt(startOpacity); ripple.opacity = 255 * Math.sqrt(startOpacity);
ripple.scale_x = ripple.scale_y = startScale; ripple.scale_x = ripple.scale_y = startScale;
ripple.set_translation(-this._px * ripple.width, -this._py * ripple.height, 0.0); ripple.set_translation( - this._px * ripple.width, - this._py * ripple.height, 0.0);
ripple.ease({ ripple.ease({
opacity: 0, opacity: 0,
delay, delay,
duration, duration,
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD
}); });
ripple.ease({ ripple.ease({
scale_x: finalScale, scale_x: finalScale,
@@ -67,7 +67,7 @@ var Ripples = class Ripples {
delay, delay,
duration, duration,
mode: Clutter.AnimationMode.LINEAR, mode: Clutter.AnimationMode.LINEAR,
onComplete: () => (ripple.visible = false), onComplete: () => (ripple.visible = false)
}); });
} }

View File

@@ -57,7 +57,9 @@ class RunDialog extends ModalDialog.ModalDialog {
let label = new St.Label({ style_class: 'run-dialog-label', let label = new St.Label({ style_class: 'run-dialog-label',
text: _("Enter a Command") }); text: _("Enter a Command") });
this.contentLayout.add_child(label); this.contentLayout.add(label, { x_fill: false,
x_align: St.Align.START,
y_align: St.Align.START });
let entry = new St.Entry({ style_class: 'run-dialog-entry', let entry = new St.Entry({ style_class: 'run-dialog-entry',
can_focus: true }); can_focus: true });
@@ -66,36 +68,36 @@ class RunDialog extends ModalDialog.ModalDialog {
entry.label_actor = label; entry.label_actor = label;
this._entryText = entry.clutter_text; this._entryText = entry.clutter_text;
this.contentLayout.add_child(entry); this.contentLayout.add(entry, { y_align: St.Align.START });
this.setInitialKeyFocus(this._entryText); this.setInitialKeyFocus(this._entryText);
this._errorBox = new St.BoxLayout({ style_class: 'run-dialog-error-box' }); this._errorBox = new St.BoxLayout({ style_class: 'run-dialog-error-box' });
this.contentLayout.add_child(this._errorBox); this.contentLayout.add(this._errorBox, { expand: true });
let errorIcon = new St.Icon({ icon_name: 'dialog-error-symbolic', let errorIcon = new St.Icon({ icon_name: 'dialog-error-symbolic',
icon_size: 24, icon_size: 24,
style_class: 'run-dialog-error-icon', style_class: 'run-dialog-error-icon' });
y_align: Clutter.ActorAlign.CENTER });
this._errorBox.add_child(errorIcon); this._errorBox.add(errorIcon, { y_align: St.Align.MIDDLE });
this._commandError = false; this._commandError = false;
this._errorMessage = new St.Label({ this._errorMessage = new St.Label({ style_class: 'run-dialog-error-label' });
style_class: 'run-dialog-error-label',
y_align: Clutter.ActorAlign.CENTER,
});
this._errorMessage.clutter_text.line_wrap = true; this._errorMessage.clutter_text.line_wrap = true;
this._errorBox.add_child(this._errorMessage); this._errorBox.add(this._errorMessage, { expand: true,
x_align: St.Align.START,
x_fill: false,
y_align: St.Align.MIDDLE,
y_fill: false });
this._errorBox.hide(); this._errorBox.hide();
this.setButtons([{ this.setButtons([{
action: this.close.bind(this), action: this.close.bind(this),
label: _("Close"), label: _("Close"),
key: Clutter.KEY_Escape, key: Clutter.Escape,
}]); }]);
this._pathCompleter = new Gio.FilenameCompleter(); this._pathCompleter = new Gio.FilenameCompleter();
@@ -112,7 +114,7 @@ class RunDialog extends ModalDialog.ModalDialog {
}); });
this._entryText.connect('key-press-event', (o, e) => { this._entryText.connect('key-press-event', (o, e) => {
let symbol = e.get_key_symbol(); let symbol = e.get_key_symbol();
if (symbol === Clutter.KEY_Tab) { if (symbol == Clutter.Tab) {
let text = o.get_text(); let text = o.get_text();
let prefix; let prefix;
if (text.lastIndexOf(' ') == -1) if (text.lastIndexOf(' ') == -1)
@@ -175,10 +177,11 @@ class RunDialog extends ModalDialog.ModalDialog {
} }
_getCompletion(text) { _getCompletion(text) {
if (text.includes('/')) if (text.includes('/')) {
return this._pathCompleter.get_completion_suffix(text); return this._pathCompleter.get_completion_suffix(text);
else } else {
return this._getCommandCompletion(text); return this._getCommandCompletion(text);
}
} }
_run(input, inTerminal) { _run(input, inTerminal) {
@@ -209,7 +212,7 @@ class RunDialog extends ModalDialog.ModalDialog {
} else { } else {
if (input.charAt(0) == '~') if (input.charAt(0) == '~')
input = input.slice(1); input = input.slice(1);
path = `${GLib.get_home_dir()}/${input}`; path = GLib.get_home_dir() + '/' + input;
} }
if (GLib.file_test(path, GLib.FileTest.EXISTS)) { if (GLib.file_test(path, GLib.FileTest.EXISTS)) {
@@ -217,12 +220,12 @@ class RunDialog extends ModalDialog.ModalDialog {
try { try {
Gio.app_info_launch_default_for_uri(file.get_uri(), Gio.app_info_launch_default_for_uri(file.get_uri(),
global.create_app_launch_context(0, -1)); global.create_app_launch_context(0, -1));
} catch (err) { } catch (e) {
// The exception from gjs contains an error string like: // The exception from gjs contains an error string like:
// Error invoking Gio.app_info_launch_default_for_uri: No application // Error invoking Gio.app_info_launch_default_for_uri: No application
// is registered as handling this file // is registered as handling this file
// We are only interested in the part after the first colon. // We are only interested in the part after the first colon.
let message = err.message.replace(/[^:]*: *(.+)/, '$1'); let message = e.message.replace(/[^:]*: *(.+)/, '$1');
this._showError(message); this._showError(message);
} }
} else { } else {
@@ -249,7 +252,7 @@ class RunDialog extends ModalDialog.ModalDialog {
onComplete: () => { onComplete: () => {
parentActor.set_height(-1); parentActor.set_height(-1);
this._errorBox.show(); this._errorBox.show();
}, }
}); });
} }
} }

View File

@@ -1,6 +1,6 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
const { AccountsService, Clutter, Gio, GLib, const { AccountsService, Clutter, Cogl, Gio, GLib,
GnomeDesktop, GObject, Graphene, Meta, Shell, St } = imports.gi; GnomeDesktop, GObject, Graphene, Meta, Shell, St } = imports.gi;
const Cairo = imports.cairo; const Cairo = imports.cairo;
const Signals = imports.signals; const Signals = imports.signals;
@@ -53,17 +53,11 @@ class ScreenShieldClock extends St.BoxLayout {
_init() { _init() {
super._init({ style_class: 'screen-shield-clock', vertical: true }); super._init({ style_class: 'screen-shield-clock', vertical: true });
this._time = new St.Label({ this._time = new St.Label({ style_class: 'screen-shield-clock-time' });
style_class: 'screen-shield-clock-time', this._date = new St.Label({ style_class: 'screen-shield-clock-date' });
x_align: Clutter.ActorAlign.CENTER,
});
this._date = new St.Label({
style_class: 'screen-shield-clock-date',
x_align: Clutter.ActorAlign.CENTER,
});
this.add_child(this._time); this.add(this._time, { x_align: St.Align.MIDDLE });
this.add_child(this._date); this.add(this._date, { x_align: St.Align.MIDDLE });
this._wallClock = new GnomeDesktop.WallClock({ time_only: true }); this._wallClock = new GnomeDesktop.WallClock({ time_only: true });
this._wallClock.connect('notify::clock', this._updateClock.bind(this)); this._wallClock.connect('notify::clock', this._updateClock.bind(this));
@@ -89,21 +83,22 @@ class ScreenShieldClock extends St.BoxLayout {
}); });
var NotificationsBox = GObject.registerClass({ var NotificationsBox = GObject.registerClass({
Signals: { 'wake-up-screen': {} }, Signals: { 'wake-up-screen': {} }
}, class NotificationsBox extends St.BoxLayout { }, class NotificationsBox extends St.BoxLayout {
_init() { _init() {
super._init({ super._init({
vertical: true, vertical: true,
name: 'screenShieldNotifications', name: 'screenShieldNotifications',
style_class: 'screen-shield-notifications-container', style_class: 'screen-shield-notifications-container'
}); });
this._scrollView = new St.ScrollView({ hscrollbar_policy: St.PolicyType.NEVER }); this._scrollView = new St.ScrollView({ x_fill: false, x_align: St.Align.START,
hscrollbar_policy: St.PolicyType.NEVER });
this._notificationBox = new St.BoxLayout({ vertical: true, this._notificationBox = new St.BoxLayout({ vertical: true,
style_class: 'screen-shield-notifications-container' }); style_class: 'screen-shield-notifications-container' });
this._scrollView.add_actor(this._notificationBox); this._scrollView.add_actor(this._notificationBox);
this.add_child(this._scrollView); this.add(this._scrollView, { x_fill: true, x_align: St.Align.START });
this._sources = new Map(); this._sources = new Map();
Main.messageTray.getSources().forEach(source => { Main.messageTray.getSources().forEach(source => {
@@ -123,8 +118,9 @@ var NotificationsBox = GObject.registerClass({
} }
let items = this._sources.entries(); let items = this._sources.entries();
for (let [source, obj] of items) for (let [source, obj] of items) {
this._removeSource(source, obj); this._removeSource(source, obj);
}
} }
_updateVisibility() { _updateVisibility() {
@@ -143,10 +139,10 @@ var NotificationsBox = GObject.registerClass({
_makeNotificationSource(source, box) { _makeNotificationSource(source, box) {
let sourceActor = new MessageTray.SourceActor(source, SUMMARY_ICON_SIZE); let sourceActor = new MessageTray.SourceActor(source, SUMMARY_ICON_SIZE);
box.add_child(sourceActor); box.add(sourceActor, { y_fill: true });
let textBox = new St.BoxLayout({ vertical: true }); let textBox = new St.BoxLayout({ vertical: true });
box.add_child(textBox); box.add(textBox, { y_fill: false, y_align: St.Align.START });
let title = new St.Label({ text: source.title, let title = new St.Label({ text: source.title,
style_class: 'screen-shield-notification-label' }); style_class: 'screen-shield-notification-label' });
@@ -163,11 +159,13 @@ var NotificationsBox = GObject.registerClass({
_makeNotificationDetailedSource(source, box) { _makeNotificationDetailedSource(source, box) {
let sourceActor = new MessageTray.SourceActor(source, SUMMARY_ICON_SIZE); let sourceActor = new MessageTray.SourceActor(source, SUMMARY_ICON_SIZE);
let sourceBin = new St.Bin({ child: sourceActor }); let sourceBin = new St.Bin({ y_align: St.Align.START,
x_align: St.Align.START,
child: sourceActor });
box.add(sourceBin); box.add(sourceBin);
let textBox = new St.BoxLayout({ vertical: true }); let textBox = new St.BoxLayout({ vertical: true });
box.add_child(textBox); box.add(textBox, { y_fill: false, y_align: St.Align.START });
let title = new St.Label({ text: source.title, let title = new St.Label({ text: source.title,
style_class: 'screen-shield-notification-label' }); style_class: 'screen-shield-notification-label' });
@@ -188,7 +186,7 @@ var NotificationsBox = GObject.registerClass({
} }
let label = new St.Label({ style_class: 'screen-shield-notification-count-text' }); let label = new St.Label({ style_class: 'screen-shield-notification-count-text' });
label.clutter_text.set_markup(`<b>${n.title}</b> ${body}`); label.clutter_text.set_markup('<b>' + n.title + '</b> ' + body);
textBox.add(label); textBox.add(label);
visible = true; visible = true;
@@ -204,10 +202,11 @@ var NotificationsBox = GObject.registerClass({
} }
_showSource(source, obj, box) { _showSource(source, obj, box) {
if (obj.detailed) if (obj.detailed) {
[obj.titleLabel, obj.countLabel] = this._makeNotificationDetailedSource(source, box); [obj.titleLabel, obj.countLabel] = this._makeNotificationDetailedSource(source, box);
else } else {
[obj.titleLabel, obj.countLabel] = this._makeNotificationSource(source, box); [obj.titleLabel, obj.countLabel] = this._makeNotificationSource(source, box);
}
box.visible = obj.visible && (source.unseenCount > 0); box.visible = obj.visible && (source.unseenCount > 0);
} }
@@ -228,12 +227,12 @@ var NotificationsBox = GObject.registerClass({
obj.sourceBox = new St.BoxLayout({ style_class: 'screen-shield-notification-source', obj.sourceBox = new St.BoxLayout({ style_class: 'screen-shield-notification-source',
x_expand: true }); x_expand: true });
this._showSource(source, obj, obj.sourceBox); this._showSource(source, obj, obj.sourceBox);
this._notificationBox.add_child(obj.sourceBox); this._notificationBox.add(obj.sourceBox, { x_fill: false, x_align: St.Align.START });
obj.sourceCountChangedId = source.connect('notify::count', () => { obj.sourceCountChangedId = source.connect('notify::count', source => {
this._countChanged(source, obj); this._countChanged(source, obj);
}); });
obj.sourceTitleChangedId = source.connect('notify::title', () => { obj.sourceTitleChangedId = source.connect('notify::title', source => {
this._titleChanged(source, obj); this._titleChanged(source, obj);
}); });
obj.policyChangedId = source.policy.connect('notify', (policy, pspec) => { obj.policyChangedId = source.policy.connect('notify', (policy, pspec) => {
@@ -242,7 +241,7 @@ var NotificationsBox = GObject.registerClass({
else else
this._detailedChanged(source, obj); this._detailedChanged(source, obj);
}); });
obj.sourceDestroyId = source.connect('destroy', () => { obj.sourceDestroyId = source.connect('destroy', source => {
this._onSourceDestroy(source, obj); this._onSourceDestroy(source, obj);
}); });
@@ -264,7 +263,7 @@ var NotificationsBox = GObject.registerClass({
onComplete: () => { onComplete: () => {
this._scrollView.vscrollbar_policy = St.PolicyType.AUTOMATIC; this._scrollView.vscrollbar_policy = St.PolicyType.AUTOMATIC;
widget.set_height(-1); widget.set_height(-1);
}, }
}); });
this._updateVisibility(); this._updateVisibility();
@@ -350,11 +349,9 @@ var Arrow = GObject.registerClass(
class ScreenShieldArrow extends St.Bin { class ScreenShieldArrow extends St.Bin {
_init(params) { _init(params) {
super._init(params); super._init(params);
this.x_fill = this.y_fill = true;
this._drawingArea = new St.DrawingArea({ this._drawingArea = new St.DrawingArea();
x_expand: true,
y_expand: true,
});
this._drawingArea.connect('repaint', this._drawArrow.bind(this)); this._drawingArea.connect('repaint', this._drawArrow.bind(this));
this.child = this._drawingArea; this.child = this._drawingArea;
@@ -407,18 +404,18 @@ class ScreenShieldArrow extends St.Bin {
super.vfunc_style_changed(); super.vfunc_style_changed();
} }
vfunc_paint(paintContext) { vfunc_paint() {
if (this._shadowHelper) { if (this._shadowHelper) {
this._shadowHelper.update(this._drawingArea); this._shadowHelper.update(this._drawingArea);
let allocation = this._drawingArea.get_allocation_box(); let allocation = this._drawingArea.get_allocation_box();
let paintOpacity = this._drawingArea.get_paint_opacity(); let paintOpacity = this._drawingArea.get_paint_opacity();
let framebuffer = paintContext.get_framebuffer(); let framebuffer = Cogl.get_draw_framebuffer();
this._shadowHelper.paint(framebuffer, allocation, paintOpacity); this._shadowHelper.paint(framebuffer, allocation, paintOpacity);
} }
this._drawingArea.paint(paintContext); this._drawingArea.paint();
} }
}); });
@@ -462,7 +459,7 @@ var ScreenShield = class {
this._backgroundGroup = new Clutter.Actor(); this._backgroundGroup = new Clutter.Actor();
this._lockScreenGroup.add_actor(this._backgroundGroup); this._lockScreenGroup.add_actor(this._backgroundGroup);
this._lockScreenGroup.set_child_below_sibling(this._backgroundGroup, null); this._backgroundGroup.lower_bottom();
this._bgManagers = []; this._bgManagers = [];
this._updateBackgrounds(); this._updateBackgrounds();
@@ -600,7 +597,7 @@ var ScreenShield = class {
height: monitor.height }); height: monitor.height });
let bgManager = new Background.BackgroundManager({ container: widget, let bgManager = new Background.BackgroundManager({ container: widget,
monitorIndex, monitorIndex: monitorIndex,
controlPosition: false, controlPosition: false,
settingsSchema: SCREENSAVER_SCHEMA }); settingsSchema: SCREENSAVER_SCHEMA });
@@ -671,12 +668,12 @@ var ScreenShield = class {
if (this._lockScreenState != MessageTray.State.SHOWN) if (this._lockScreenState != MessageTray.State.SHOWN)
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
let isEnter = symbol == Clutter.KEY_Return || let isEnter = (symbol == Clutter.KEY_Return ||
symbol == Clutter.KEY_KP_Enter || symbol == Clutter.KEY_KP_Enter ||
symbol == Clutter.KEY_ISO_Enter; symbol == Clutter.KEY_ISO_Enter);
let isEscape = symbol == Clutter.KEY_Escape; let isEscape = (symbol == Clutter.KEY_Escape);
let isLiftChar = GLib.unichar_isprint(unichar) && let isLiftChar = (GLib.unichar_isprint(unichar) &&
(this._isLocked || !GLib.unichar_isgraph(unichar)); (this._isLocked || !GLib.unichar_isgraph(unichar)));
if (!isEnter && !isEscape && !isLiftChar) if (!isEnter && !isEscape && !isLiftChar)
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
@@ -702,8 +699,9 @@ var ScreenShield = class {
this._lockScreenScrollCounter += delta; this._lockScreenScrollCounter += delta;
// 7 standard scrolls to lift up // 7 standard scrolls to lift up
if (this._lockScreenScrollCounter > 35) if (this._lockScreenScrollCounter > 35) {
this._liftShield(true, 0); this._liftShield(true, 0);
}
return Clutter.EVENT_STOP; return Clutter.EVENT_STOP;
} }
@@ -711,8 +709,8 @@ var ScreenShield = class {
_syncInhibitor() { _syncInhibitor() {
let lockEnabled = this._settings.get_boolean(LOCK_ENABLED_KEY); let lockEnabled = this._settings.get_boolean(LOCK_ENABLED_KEY);
let lockLocked = this._lockSettings.get_boolean(DISABLE_LOCK_KEY); let lockLocked = this._lockSettings.get_boolean(DISABLE_LOCK_KEY);
let inhibit = this._loginSession && this._loginSession.Active && let inhibit = (this._loginSession && this._loginSession.Active &&
!this._isActive && lockEnabled && !lockLocked; !this._isActive && lockEnabled && !lockLocked);
if (inhibit) { if (inhibit) {
this._loginManager.inhibit(_("GNOME needs to lock the screen"), this._loginManager.inhibit(_("GNOME needs to lock the screen"),
inhibitor => { inhibitor => {
@@ -751,9 +749,9 @@ var ScreenShield = class {
arrows[i].ease({ arrows[i].ease({
opacity: 0, opacity: 0,
duration: ARROW_ANIMATION_TIME / 2, duration: ARROW_ANIMATION_TIME / 2,
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD
}); });
}, }
}); });
} }
@@ -793,7 +791,7 @@ var ScreenShield = class {
// restore the lock screen to its original place // restore the lock screen to its original place
// try to use the same speed as the normal animation // try to use the same speed as the normal animation
let h = global.stage.height; let h = global.stage.height;
let duration = MANUAL_FADE_TIME * -this._lockScreenGroup.y / h; let duration = MANUAL_FADE_TIME * (-this._lockScreenGroup.y) / h;
this._lockScreenGroup.remove_all_transitions(); this._lockScreenGroup.remove_all_transitions();
this._lockScreenGroup.ease({ this._lockScreenGroup.ease({
y: 0, y: 0,
@@ -802,7 +800,7 @@ var ScreenShield = class {
onComplete: () => { onComplete: () => {
this._lockScreenGroup.fixed_position_set = false; this._lockScreenGroup.fixed_position_set = false;
this._lockScreenState = MessageTray.State.SHOWN; this._lockScreenState = MessageTray.State.SHOWN;
}, }
}); });
this._maybeCancelDialog(); this._maybeCancelDialog();
@@ -945,7 +943,7 @@ var ScreenShield = class {
// use the same speed regardless of original position // use the same speed regardless of original position
// if velocity is specified, it's in pixels per milliseconds // if velocity is specified, it's in pixels per milliseconds
let h = global.stage.height; let h = global.stage.height;
let delta = h + this._lockScreenGroup.y; let delta = (h + this._lockScreenGroup.y);
let minVelocity = global.stage.height / CURTAIN_SLIDE_TIME; let minVelocity = global.stage.height / CURTAIN_SLIDE_TIME;
velocity = Math.max(minVelocity, velocity); velocity = Math.max(minVelocity, velocity);
@@ -955,7 +953,7 @@ var ScreenShield = class {
y: -h, y: -h,
duration, duration,
mode: Clutter.AnimationMode.EASE_IN_QUAD, mode: Clutter.AnimationMode.EASE_IN_QUAD,
onComplete: () => this._hideLockScreenComplete(), onComplete: () => this._hideLockScreenComplete()
}); });
} else { } else {
this._hideLockScreenComplete(); this._hideLockScreenComplete();
@@ -1022,11 +1020,12 @@ var ScreenShield = class {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => { onComplete: () => {
this._lockScreenShown({ fadeToBlack, animateFade: true }); this._lockScreenShown({ fadeToBlack, animateFade: true });
}, }
}); });
} else { } else {
this._lockScreenGroup.fixed_position_set = false; this._lockScreenGroup.fixed_position_set = false;
this._lockScreenShown({ fadeToBlack, animateFade: false }); this._lockScreenShown({ fadeToBlack: fadeToBlack,
animateFade: false });
} }
this._lockScreenGroup.grab_key_focus(); this._lockScreenGroup.grab_key_focus();
@@ -1044,10 +1043,9 @@ var ScreenShield = class {
this._animateArrows(); this._animateArrows();
} }
if (!this._arrowWatchId) { if (!this._arrowWatchId)
this._arrowWatchId = this.idleMonitor.add_idle_watch(ARROW_IDLE_TIME, this._arrowWatchId = this.idleMonitor.add_idle_watch(ARROW_IDLE_TIME,
this._pauseArrowAnimation.bind(this)); this._pauseArrowAnimation.bind(this));
}
} }
_pauseArrowAnimation() { _pauseArrowAnimation() {
@@ -1140,13 +1138,20 @@ var ScreenShield = class {
vertical: true, vertical: true,
style_class: 'screen-shield-contents-box' }); style_class: 'screen-shield-contents-box' });
this._clock = new Clock(); this._clock = new Clock();
this._lockScreenContentsBox.add_child(this._clock); this._lockScreenContentsBox.add(this._clock, {
x_fill: true,
y_fill: true
});
this._lockScreenContents.add_actor(this._lockScreenContentsBox); this._lockScreenContents.add_actor(this._lockScreenContentsBox);
this._notificationsBox = new NotificationsBox(); this._notificationsBox = new NotificationsBox();
this._wakeUpScreenId = this._notificationsBox.connect('wake-up-screen', this._wakeUpScreen.bind(this)); this._wakeUpScreenId = this._notificationsBox.connect('wake-up-screen', this._wakeUpScreen.bind(this));
this._lockScreenContentsBox.add_child(this._notificationsBox); this._lockScreenContentsBox.add(this._notificationsBox, {
x_fill: true,
y_fill: true,
expand: true
});
this._hasLockScreen = true; this._hasLockScreen = true;
} }
@@ -1229,7 +1234,7 @@ var ScreenShield = class {
scale_y: 0, scale_y: 0,
duration: animate ? Overview.ANIMATION_TIME : 0, duration: animate ? Overview.ANIMATION_TIME : 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this._completeDeactivate(), onComplete: () => this._completeDeactivate()
}); });
} }

View File

@@ -64,55 +64,7 @@ var ScreenshotService = class {
y + height <= global.screen_height; y + height <= global.screen_height;
} }
*_resolveRelativeFilename(filename) { _onScreenshotComplete(result, area, filenameUsed, flash, invocation) {
if (GLib.str_has_suffix(filename, '.png'))
filename = filename.substr(0, -4);
let path = [
GLib.get_user_special_dir(GLib.UserDirectory.DIRECTORY_PICTURES),
GLib.get_home_dir(),
].find(p => GLib.file_test(p, GLib.FileTest.EXISTS));
if (!path)
return null;
yield Gio.File.new_for_path(
GLib.build_filenamev([path, `${filename}.png`]));
for (let idx = 1; ; idx++) {
yield Gio.File.new_for_path(
GLib.build_filenamev([path, `${filename}-${idx}.png`]));
}
}
_createStream(filename) {
if (filename == '')
return [Gio.MemoryOutputStream.new_resizable(), null];
if (GLib.path_is_absolute(filename)) {
try {
let file = Gio.File.new_for_path(filename);
let stream = file.replace(null, false, Gio.FileCreateFlags.NONE, null);
return [stream, file];
} catch (e) {
return [null, null];
}
}
for (let file of this._resolveRelativeFilename(filename)) {
try {
let stream = file.create(Gio.FileCreateFlags.NONE, null);
return [stream, file];
} catch (e) {
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.EXISTS))
return [null, null];
}
}
return [null, null];
}
_onScreenshotComplete(result, area, stream, file, flash, invocation) {
if (result) { if (result) {
if (flash) { if (flash) {
let flashspot = new Flashspot(area); let flashspot = new Flashspot(area);
@@ -124,17 +76,6 @@ var ScreenshotService = class {
} }
} }
stream.close(null);
let filenameUsed = '';
if (file) {
filenameUsed = file.get_path();
} else {
let bytes = stream.steal_as_bytes();
let clipboard = St.Clipboard.get_default();
clipboard.set_content(St.ClipboardType.CLIPBOARD, 'image/png', bytes);
}
let retval = GLib.Variant.new('(bs)', [result, filenameUsed]); let retval = GLib.Variant.new('(bs)', [result, filenameUsed]);
invocation.return_value(retval); invocation.return_value(retval);
} }
@@ -169,18 +110,15 @@ var ScreenshotService = class {
let screenshot = this._createScreenshot(invocation); let screenshot = this._createScreenshot(invocation);
if (!screenshot) if (!screenshot)
return; return;
screenshot.screenshot_area (x, y, width, height, filename,
let [stream, file] = this._createStream(filename);
screenshot.screenshot_area(x, y, width, height, stream,
(o, res) => { (o, res) => {
try { try {
let [result, area] = let [result, area, filenameUsed] =
screenshot.screenshot_area_finish(res); screenshot.screenshot_area_finish(res);
this._onScreenshotComplete( this._onScreenshotComplete(
result, area, stream, file, flash, invocation); result, area, filenameUsed, flash, invocation);
} catch (e) { } catch (e) {
invocation.return_gerror(e); invocation.return_gerror (e);
} }
}); });
} }
@@ -190,18 +128,15 @@ var ScreenshotService = class {
let screenshot = this._createScreenshot(invocation); let screenshot = this._createScreenshot(invocation);
if (!screenshot) if (!screenshot)
return; return;
screenshot.screenshot_window (includeFrame, includeCursor, filename,
let [stream, file] = this._createStream(filename);
screenshot.screenshot_window(includeFrame, includeCursor, stream,
(o, res) => { (o, res) => {
try { try {
let [result, area] = let [result, area, filenameUsed] =
screenshot.screenshot_window_finish(res); screenshot.screenshot_window_finish(res);
this._onScreenshotComplete( this._onScreenshotComplete(
result, area, stream, file, flash, invocation); result, area, filenameUsed, flash, invocation);
} catch (e) { } catch (e) {
invocation.return_gerror(e); invocation.return_gerror (e);
} }
}); });
} }
@@ -211,18 +146,15 @@ var ScreenshotService = class {
let screenshot = this._createScreenshot(invocation); let screenshot = this._createScreenshot(invocation);
if (!screenshot) if (!screenshot)
return; return;
screenshot.screenshot(includeCursor, filename,
let [stream, file] = this._createStream(filename);
screenshot.screenshot(includeCursor, stream,
(o, res) => { (o, res) => {
try { try {
let [result, area] = let [result, area, filenameUsed] =
screenshot.screenshot_finish(res); screenshot.screenshot_finish(res);
this._onScreenshotComplete( this._onScreenshotComplete(
result, area, stream, file, flash, invocation); result, area, filenameUsed, flash, invocation);
} catch (e) { } catch (e) {
invocation.return_gerror(e); invocation.return_gerror (e);
} }
}); });
} }
@@ -230,7 +162,7 @@ var ScreenshotService = class {
SelectAreaAsync(params, invocation) { SelectAreaAsync(params, invocation) {
let selectArea = new SelectArea(); let selectArea = new SelectArea();
selectArea.show(); selectArea.show();
selectArea.connect('finished', (o, areaRectangle) => { selectArea.connect('finished', (selectArea, areaRectangle) => {
if (areaRectangle) { if (areaRectangle) {
let retRectangle = this._unscaleArea(areaRectangle.x, areaRectangle.y, let retRectangle = this._unscaleArea(areaRectangle.x, areaRectangle.y,
areaRectangle.width, areaRectangle.height); areaRectangle.width, areaRectangle.height);
@@ -252,7 +184,7 @@ var ScreenshotService = class {
"Invalid params"); "Invalid params");
return; return;
} }
let flashspot = new Flashspot({ x, y, width, height }); let flashspot = new Flashspot({ x: x, y: y, width: width, height: height });
flashspot.fire(); flashspot.fire();
invocation.return_value(null); invocation.return_value(null);
} }
@@ -260,7 +192,7 @@ var ScreenshotService = class {
PickColorAsync(params, invocation) { PickColorAsync(params, invocation) {
let pickPixel = new PickPixel(); let pickPixel = new PickPixel();
pickPixel.show(); pickPixel.show();
pickPixel.connect('finished', (obj, coords) => { pickPixel.connect('finished', (pickPixel, coords) => {
if (coords) { if (coords) {
let screenshot = this._createScreenshot(invocation, false); let screenshot = this._createScreenshot(invocation, false);
if (!screenshot) if (!screenshot)
@@ -272,8 +204,8 @@ var ScreenshotService = class {
color: GLib.Variant.new('(ddd)', [ color: GLib.Variant.new('(ddd)', [
red / 255.0, red / 255.0,
green / 255.0, green / 255.0,
blue / 255.0, blue / 255.0
]), ])
}]); }]);
this._removeShooterForSender(invocation.get_sender()); this._removeShooterForSender(invocation.get_sender());
invocation.return_value(retval); invocation.return_value(retval);
@@ -287,7 +219,8 @@ var ScreenshotService = class {
}; };
var SelectArea = GObject.registerClass({ var SelectArea = GObject.registerClass({
Signals: { 'finished': { param_types: [Meta.Rectangle.$gtype] } }, GTypeName: 'Screenshot_SelectArea',
Signals: { 'finished': { param_types: [Meta.Rectangle.$gtype] } }
}, class SelectArea extends St.Widget { }, class SelectArea extends St.Widget {
_init() { _init() {
this._startX = -1; this._startX = -1;
@@ -300,7 +233,7 @@ var SelectArea = GObject.registerClass({
visible: false, visible: false,
reactive: true, reactive: true,
x: 0, x: 0,
y: 0, y: 0
}); });
Main.uiGroup.add_actor(this); Main.uiGroup.add_actor(this);
@@ -312,7 +245,7 @@ var SelectArea = GObject.registerClass({
this._rubberband = new St.Widget({ this._rubberband = new St.Widget({
style_class: 'select-area-rubberband', style_class: 'select-area-rubberband',
visible: false, visible: false
}); });
this.add_actor(this._rubberband); this.add_actor(this._rubberband);
} }
@@ -332,7 +265,7 @@ var SelectArea = GObject.registerClass({
x: Math.min(this._startX, this._lastX), x: Math.min(this._startX, this._lastX),
y: Math.min(this._startY, this._lastY), y: Math.min(this._startY, this._lastY),
width: Math.abs(this._startX - this._lastX) + 1, width: Math.abs(this._startX - this._lastX) + 1,
height: Math.abs(this._startY - this._lastY) + 1, height: Math.abs(this._startY - this._lastY) + 1
}); });
} }
@@ -367,7 +300,7 @@ var SelectArea = GObject.registerClass({
opacity: 0, opacity: 0,
duration: 200, duration: 200,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => this._grabHelper.ungrab(), onComplete: () => this._grabHelper.ungrab()
}); });
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
} }
@@ -384,7 +317,8 @@ var SelectArea = GObject.registerClass({
}); });
var PickPixel = GObject.registerClass({ var PickPixel = GObject.registerClass({
Signals: { 'finished': { param_types: [Graphene.Point.$gtype] } }, GTypeName: 'Screenshot_PickPixel',
Signals: { 'finished': { param_types: [Graphene.Point.$gtype] } }
}, class PickPixel extends St.Widget { }, class PickPixel extends St.Widget {
_init() { _init() {
super._init({ visible: false, reactive: true }); super._init({ visible: false, reactive: true });
@@ -436,7 +370,7 @@ class Flashspot extends Lightbox.Lightbox {
super._init(Main.uiGroup, { super._init(Main.uiGroup, {
inhibitEvents: true, inhibitEvents: true,
width: area.width, width: area.width,
height: area.height, height: area.height
}); });
this.style_class = 'flashspot'; this.style_class = 'flashspot';
this.set_position(area.x, area.y); this.set_position(area.x, area.y);
@@ -452,7 +386,7 @@ class Flashspot extends Lightbox.Lightbox {
if (doneCallback) if (doneCallback)
doneCallback(); doneCallback();
this.destroy(); this.destroy();
}, }
}); });
} }
}); });

View File

@@ -32,8 +32,7 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
/** /**
* sleep: * sleep:
* @param {number} milliseconds - number of milliseconds to wait * @milliseconds: number of milliseconds to wait
* @returns {Promise} that resolves after @milliseconds ms
* *
* Used within an automation script to pause the the execution of the * Used within an automation script to pause the the execution of the
* current script for the specified amount of time. Use as * current script for the specified amount of time. Use as
@@ -51,7 +50,6 @@ function sleep(milliseconds) {
/** /**
* waitLeisure: * waitLeisure:
* @returns {Promise} that resolves when the shell is idle
* *
* Used within an automation script to pause the the execution of the * Used within an automation script to pause the the execution of the
* current script until the shell is completely idle. Use as * current script until the shell is completely idle. Use as
@@ -92,13 +90,13 @@ function _callRemote(obj, method, ...args) {
/** /**
* createTestWindow: * createTestWindow:
* @param {Object} params: options for window creation. * @params: options for window creation.
* {number} [params.width=640] - width of window, in pixels * width - width of window, in pixels (default 640)
* {number} [params.height=480] - height of window, in pixels * height - height of window, in pixels (default 480)
* {bool} [params.alpha=false] - whether the window should have an alpha channel * alpha - whether the window should have an alpha channel (default false)
* {bool} [params.maximized=false] - whether the window should be created maximized * maximized - whether the window should be created maximized (default false)
* {bool} [params.redraws=false] - whether the window should continually redraw itself * redraws - whether the window should continually redraw itself (default false)
* @returns {Promise} * @maximized: whethe the window should be created maximized
* *
* Creates a window using gnome-shell-perf-helper for testing purposes. * Creates a window using gnome-shell-perf-helper for testing purposes.
* While this function can be used with yield in an automation * While this function can be used with yield in an automation
@@ -121,7 +119,6 @@ function createTestWindow(params) {
/** /**
* waitTestWindows: * waitTestWindows:
* @returns {Promise}
* *
* Used within an automation script to pause until all windows previously * Used within an automation script to pause until all windows previously
* created with createTestWindow have been mapped and exposed. * created with createTestWindow have been mapped and exposed.
@@ -133,7 +130,6 @@ function waitTestWindows() {
/** /**
* destroyTestWindows: * destroyTestWindows:
* @returns {Promise}
* *
* Destroys all windows previously created with createTestWindow(). * Destroys all windows previously created with createTestWindow().
* While this function can be used with yield in an automation * While this function can be used with yield in an automation
@@ -148,8 +144,8 @@ function destroyTestWindows() {
/** /**
* defineScriptEvent * defineScriptEvent
* @param {string} name: The event will be called script.<name> * @name: The event will be called script.<name>
* @param {string} description: Short human-readable description of the event * @description: Short human-readable description of the event
* *
* Convenience function to define a zero-argument performance event * Convenience function to define a zero-argument performance event
* within the 'script' namespace that is reserved for events defined locally * within the 'script' namespace that is reserved for events defined locally
@@ -163,7 +159,7 @@ function defineScriptEvent(name, description) {
/** /**
* scriptEvent * scriptEvent
* @param {string} name: Name registered with defineScriptEvent() * @name: Name registered with defineScriptEvent()
* *
* Convenience function to record a script-local performance event * Convenience function to record a script-local performance event
* previously defined with defineScriptEvent * previously defined with defineScriptEvent
@@ -204,8 +200,8 @@ function _collect(scriptModule, outputFile) {
let raw = f.replace(null, false, let raw = f.replace(null, false,
Gio.FileCreateFlags.NONE, Gio.FileCreateFlags.NONE,
null); null);
let out = Gio.BufferedOutputStream.new_sized(raw, 4096); let out = Gio.BufferedOutputStream.new_sized (raw, 4096);
Shell.write_string_to_stream(out, "{\n"); Shell.write_string_to_stream (out, "{\n");
Shell.write_string_to_stream(out, '"events":\n'); Shell.write_string_to_stream(out, '"events":\n');
Shell.PerfLog.get_default().dump_events(out); Shell.PerfLog.get_default().dump_events(out);
@@ -254,10 +250,10 @@ function _collect(scriptModule, outputFile) {
} }
Shell.write_string_to_stream(out, ' ]'); Shell.write_string_to_stream(out, ' ]');
Shell.write_string_to_stream(out, ',\n"log":\n'); Shell.write_string_to_stream (out, ',\n"log":\n');
Shell.PerfLog.get_default().dump_log(out); Shell.PerfLog.get_default().dump_log(out);
Shell.write_string_to_stream(out, '\n}\n'); Shell.write_string_to_stream (out, '\n}\n');
out.close(null); out.close(null);
} else { } else {
let metrics = []; let metrics = [];
@@ -266,21 +262,20 @@ function _collect(scriptModule, outputFile) {
metrics.sort(); metrics.sort();
print('------------------------------------------------------------'); print ('------------------------------------------------------------');
for (let i = 0; i < metrics.length; i++) { for (let i = 0; i < metrics.length; i++) {
let metric = metrics[i]; let metric = metrics[i];
print(`# ${scriptModule.METRICS[metric].description}`); print (`# ${scriptModule.METRICS[metric].description}`);
print(`${metric}: ${scriptModule.METRICS[metric].value}${scriptModule.METRICS[metric].units}`); print (`${metric}: ${scriptModule.METRICS[metric].value}${scriptModule.METRICS[metric].units}`);
} }
print('------------------------------------------------------------'); print ('------------------------------------------------------------');
} }
} }
/** /**
* runPerfScript * runPerfScript
* @param {Object} scriptModule: module object with run and finish * @scriptModule: module object with run and finish functions
* functions and event handlers * and event handlers
* @param {string} outputFile: path to write output to
* *
* Runs a script for automated collection of performance data. The * Runs a script for automated collection of performance data. The
* script is defined as a Javascript module with specified contents. * script is defined as a Javascript module with specified contents.

View File

@@ -1,5 +1,5 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported SearchResultsView */ /* exported SearchResultsView, SearchResultInterface */
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
@@ -32,8 +32,17 @@ class MaxWidthBox extends St.BoxLayout {
} }
}); });
var SearchResult = GObject.registerClass( var SearchResultInterface = GObject.registerClass({
class SearchResult extends St.Button { Requires: [Clutter.Actor],
}, class SearchResultInterface extends GObject.Interface {
activate() {
throw new GObject.NotImplementedError('activate in %s'.format(this.constructor.name));
}
});
var SearchResult = GObject.registerClass({
Implements: [SearchResultInterface]
}, class SearchResult extends St.Button {
_init(provider, metaInfo, resultsView) { _init(provider, metaInfo, resultsView) {
this.provider = provider; this.provider = provider;
this.metaInfo = metaInfo; this.metaInfo = metaInfo;
@@ -43,6 +52,8 @@ class SearchResult extends St.Button {
reactive: true, reactive: true,
can_focus: true, can_focus: true,
track_hover: true, track_hover: true,
x_align: St.Align.START,
y_fill: true
}); });
} }
@@ -53,10 +64,9 @@ class SearchResult extends St.Button {
activate() { activate() {
this.provider.activateResult(this.metaInfo.id, this._resultsView.terms); this.provider.activateResult(this.metaInfo.id, this._resultsView.terms);
if (this.metaInfo.clipboardText) { if (this.metaInfo.clipboardText)
St.Clipboard.get_default().set_text( St.Clipboard.get_default().set_text(
St.ClipboardType.CLIPBOARD, this.metaInfo.clipboardText); St.ClipboardType.CLIPBOARD, this.metaInfo.clipboardText);
}
Main.overview.toggle(); Main.overview.toggle();
} }
}); });
@@ -67,44 +77,41 @@ class ListSearchResult extends SearchResult {
super._init(provider, metaInfo, resultsView); super._init(provider, metaInfo, resultsView);
this.style_class = 'list-search-result'; this.style_class = 'list-search-result';
this.x_fill = true;
let content = new St.BoxLayout({ let content = new St.BoxLayout({ style_class: 'list-search-result-content',
style_class: 'list-search-result-content', vertical: false });
vertical: false,
x_align: Clutter.ActorAlign.START,
x_expand: true,
y_expand: true,
});
this.set_child(content); this.set_child(content);
this._termsChangedId = 0; this._termsChangedId = 0;
let titleBox = new St.BoxLayout({ let titleBox = new St.BoxLayout({ style_class: 'list-search-result-title' });
style_class: 'list-search-result-title',
y_align: Clutter.ActorAlign.CENTER,
});
content.add_child(titleBox); content.add(titleBox, { x_fill: true,
y_fill: false,
x_align: St.Align.START,
y_align: St.Align.MIDDLE });
// An icon for, or thumbnail of, content // An icon for, or thumbnail of, content
let icon = this.metaInfo['createIcon'](this.ICON_SIZE); let icon = this.metaInfo['createIcon'](this.ICON_SIZE);
if (icon) if (icon) {
titleBox.add(icon); titleBox.add(icon);
}
let title = new St.Label({ let title = new St.Label({ text: this.metaInfo['name'] });
text: this.metaInfo['name'], titleBox.add(title, { x_fill: false,
y_align: Clutter.ActorAlign.CENTER, y_fill: false,
}); x_align: St.Align.START,
titleBox.add_child(title); y_align: St.Align.MIDDLE });
this.label_actor = title; this.label_actor = title;
if (this.metaInfo['description']) { if (this.metaInfo['description']) {
this._descriptionLabel = new St.Label({ this._descriptionLabel = new St.Label({ style_class: 'list-search-result-description' });
style_class: 'list-search-result-description', content.add(this._descriptionLabel, { x_fill: false,
y_align: Clutter.ActorAlign.CENTER, y_fill: false,
}); x_align: St.Align.START,
content.add_child(this._descriptionLabel); y_align: St.Align.MIDDLE });
this._termsChangedId = this._termsChangedId =
this._resultsView.connect('terms-changed', this._resultsView.connect('terms-changed',
@@ -141,12 +148,7 @@ class GridSearchResult extends SearchResult {
this.icon = new IconGrid.BaseIcon(this.metaInfo['name'], this.icon = new IconGrid.BaseIcon(this.metaInfo['name'],
{ createIcon: this.metaInfo['createIcon'] }); { createIcon: this.metaInfo['createIcon'] });
let content = new St.Bin({ let content = new St.Bin({ child: this.icon });
child: this.icon,
x_align: Clutter.ActorAlign.START,
x_expand: true,
y_expand: true,
});
this.set_child(content); this.set_child(content);
this.label_actor = this.icon.label; this.label_actor = this.icon.label;
} }
@@ -159,7 +161,7 @@ var SearchResultsBase = GObject.registerClass({
'focus-child', 'focus-child', 'focus-child', 'focus-child', 'focus-child', 'focus-child',
GObject.ParamFlags.READABLE, GObject.ParamFlags.READABLE,
Clutter.Actor.$gtype), Clutter.Actor.$gtype),
}, }
}, class SearchResultsBase extends St.BoxLayout { }, class SearchResultsBase extends St.BoxLayout {
_init(provider, resultsView) { _init(provider, resultsView) {
super._init({ style_class: 'search-section', vertical: true }); super._init({ style_class: 'search-section', vertical: true });
@@ -170,8 +172,9 @@ var SearchResultsBase = GObject.registerClass({
this._terms = []; this._terms = [];
this._focusChild = null; this._focusChild = null;
this._resultDisplayBin = new St.Bin(); this._resultDisplayBin = new St.Bin({ x_fill: true,
this.add_child(this._resultDisplayBin); y_fill: true });
this.add(this._resultDisplayBin, { expand: true });
let separator = new St.Widget({ style_class: 'search-section-separator' }); let separator = new St.Widget({ style_class: 'search-section-separator' });
this.add(separator); this.add(separator);
@@ -250,6 +253,8 @@ var SearchResultsBase = GObject.registerClass({
metasNeeded.forEach((resultId, i) => { metasNeeded.forEach((resultId, i) => {
let meta = metas[i]; let meta = metas[i];
let display = this._createResultDisplay(meta); let display = this._createResultDisplay(meta);
if (!(display instanceof SearchResultInterface))
throw new Error(`${display} is not a valid search result`);
display.connect('key-focus-in', this._keyFocusIn.bind(this)); display.connect('key-focus-in', this._keyFocusIn.bind(this));
this._resultDisplays[resultId] = display; this._resultDisplays[resultId] = display;
}); });
@@ -308,14 +313,14 @@ class ListSearchResults extends SearchResultsBase {
Main.overview.toggle(); Main.overview.toggle();
}); });
this._container.add_child(this.providerInfo); this._container.add(this.providerInfo, { x_fill: false,
y_fill: false,
x_align: St.Align.START,
y_align: St.Align.START });
this._content = new St.BoxLayout({ this._content = new St.BoxLayout({ style_class: 'list-search-results',
style_class: 'list-search-results', vertical: true });
vertical: true, this._container.add(this._content, { expand: true });
x_expand: true,
});
this._container.add_child(this._content);
this._resultDisplayBin.set_child(this._container); this._resultDisplayBin.set_child(this._container);
} }
@@ -357,7 +362,7 @@ class GridSearchResults extends SearchResultsBase {
this._grid = new IconGrid.IconGrid({ rowLimit: MAX_GRID_SEARCH_RESULTS_ROWS, this._grid = new IconGrid.IconGrid({ rowLimit: MAX_GRID_SEARCH_RESULTS_ROWS,
xAlign: St.Align.START }); xAlign: St.Align.START });
this._bin = new St.Bin({ x_align: Clutter.ActorAlign.CENTER }); this._bin = new St.Bin({ x_align: St.Align.MIDDLE });
this._bin.set_child(this._grid); this._bin.set_child(this._grid);
this._resultDisplayBin.set_child(this._bin); this._resultDisplayBin.set_child(this._bin);
@@ -426,23 +431,18 @@ class GridSearchResults extends SearchResultsBase {
}); });
var SearchResultsView = GObject.registerClass({ var SearchResultsView = GObject.registerClass({
Signals: { 'terms-changed': {} }, Signals: { 'terms-changed': {} }
}, class SearchResultsView extends St.BoxLayout { }, class SearchResultsView extends St.BoxLayout {
_init() { _init() {
super._init({ name: 'searchResults', vertical: true }); super._init({ name: 'searchResults', vertical: true });
this._content = new MaxWidthBox({ this._content = new MaxWidthBox({ name: 'searchResultsContent',
name: 'searchResultsContent', vertical: true });
vertical: true,
x_expand: true,
});
this._scrollView = new St.ScrollView({ this._scrollView = new St.ScrollView({ x_fill: true,
overlay_scrollbars: true, y_fill: false,
style_class: 'search-display vfade', overlay_scrollbars: true,
x_expand: true, style_class: 'search-display vfade' });
y_expand: true,
});
this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC); this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
this._scrollView.add_actor(this._content); this._scrollView.add_actor(this._content);
@@ -450,15 +450,18 @@ var SearchResultsView = GObject.registerClass({
action.connect('pan', this._onPan.bind(this)); action.connect('pan', this._onPan.bind(this));
this._scrollView.add_action(action); this._scrollView.add_action(action);
this.add_child(this._scrollView); this.add(this._scrollView, {
x_fill: true,
this._statusText = new St.Label({ y_fill: true,
style_class: 'search-statustext', expand: true,
x_align: Clutter.ActorAlign.CENTER, x_align: St.Align.START,
y_align: Clutter.ActorAlign.CENTER, y_align: St.Align.STAR
}); });
this._statusBin = new St.Bin({ y_expand: true });
this.add_child(this._statusBin); this._statusText = new St.Label({ style_class: 'search-statustext' });
this._statusBin = new St.Bin({ x_align: St.Align.MIDDLE,
y_align: St.Align.MIDDLE });
this.add(this._statusBin, { expand: true });
this._statusBin.add_actor(this._statusText); this._statusBin.add_actor(this._statusText);
this._highlightDefault = false; this._highlightDefault = false;
@@ -550,20 +553,19 @@ var SearchResultsView = GObject.registerClass({
provider.searchInProgress = true; provider.searchInProgress = true;
let previousProviderResults = previousResults[provider.id]; let previousProviderResults = previousResults[provider.id];
if (this._isSubSearch && previousProviderResults) { if (this._isSubSearch && previousProviderResults)
provider.getSubsearchResultSet(previousProviderResults, provider.getSubsearchResultSet(previousProviderResults,
this._terms, this._terms,
results => { results => {
this._gotResults(results, provider); this._gotResults(results, provider);
}, },
this._cancellable); this._cancellable);
} else { else
provider.getInitialResultSet(this._terms, provider.getInitialResultSet(this._terms,
results => { results => {
this._gotResults(results, provider); this._gotResults(results, provider);
}, },
this._cancellable); this._cancellable);
}
}); });
this._updateSearchProgress(); this._updateSearchProgress();
@@ -683,17 +685,18 @@ var SearchResultsView = GObject.registerClass({
_updateSearchProgress() { _updateSearchProgress() {
let haveResults = this._providers.some(provider => { let haveResults = this._providers.some(provider => {
let display = provider.display; let display = provider.display;
return display.getFirstResult() != null; return (display.getFirstResult() != null);
}); });
this._scrollView.visible = haveResults; this._scrollView.visible = haveResults;
this._statusBin.visible = !haveResults; this._statusBin.visible = !haveResults;
if (!haveResults) { if (!haveResults) {
if (this.searchInProgress) if (this.searchInProgress) {
this._statusText.set_text(_("Searching…")); this._statusText.set_text(_("Searching…"));
else } else {
this._statusText.set_text(_("No results.")); this._statusText.set_text(_("No results."));
}
} }
} }
@@ -774,14 +777,11 @@ var ProviderInfo = GObject.registerClass(
class ProviderInfo extends St.Button { class ProviderInfo extends St.Button {
_init(provider) { _init(provider) {
this.provider = provider; this.provider = provider;
super._init({ super._init({ style_class: 'search-provider-icon',
style_class: 'search-provider-icon', reactive: true,
reactive: true, can_focus: true,
can_focus: true, accessible_name: provider.appInfo.get_name(),
accessible_name: provider.appInfo.get_name(), track_hover: true });
track_hover: true,
y_align: Clutter.ActorAlign.START,
});
this._content = new St.BoxLayout({ vertical: false, this._content = new St.BoxLayout({ vertical: false,
style_class: 'list-search-provider-content' }); style_class: 'list-search-provider-content' });

Some files were not shown because too many files have changed in this diff Show More