Compare commits
	
		
			3 Commits
		
	
	
		
			gbsneto/co
			...
			wip/aday/s
		
	
	| Author | SHA1 | Date | |
|---|---|---|---|
|   | 34e9513e1f | ||
|   | 40a772c884 | ||
|   | 2ccd87ae44 | 
| @@ -1,6 +0,0 @@ | ||||
| { | ||||
|     "extends": [ | ||||
|         "./lint/eslintrc-gjs.json", | ||||
|         "./lint/eslintrc-shell.json" | ||||
|     ] | ||||
| } | ||||
| @@ -1,5 +1,6 @@ | ||||
| stages: | ||||
|  - review | ||||
|  - source_check | ||||
|  - build | ||||
|  - test | ||||
|  | ||||
| @@ -25,27 +26,19 @@ check_commit_log: | ||||
|  | ||||
| js_check: | ||||
|     image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1 | ||||
|     stage: review | ||||
|     stage: source_check | ||||
|     script: | ||||
|         - find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG | ||||
|         - (! grep -q . $JS_LOG) | ||||
|     <<: *only_default | ||||
|     only: | ||||
|         changes: | ||||
|             - js/**/* | ||||
|     artifacts: | ||||
|         paths: | ||||
|             - ${JS_LOG} | ||||
|         when: on_failure | ||||
|  | ||||
| eslint: | ||||
|     image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1 | ||||
|     stage: review | ||||
|     script: | ||||
|         - ./.gitlab-ci/run-eslint.sh | ||||
|     <<: *only_default | ||||
|     artifacts: | ||||
|         paths: | ||||
|             - reports | ||||
|         when: always | ||||
|  | ||||
| build: | ||||
|     image: registry.gitlab.gnome.org/gnome/mutter/master:v2 | ||||
|     stage: build | ||||
| @@ -54,7 +47,7 @@ build: | ||||
|         - meson mutter mutter/build --prefix=/usr -Dtests=false | ||||
|         - ninja -C mutter/build install | ||||
|     script: | ||||
|         - meson . build -Dbuiltype=debugoptimized -Dman=false --werror | ||||
|         - meson . build -Dbuiltype=debugoptimized | ||||
|         - ninja -C build | ||||
|         - ninja -C build install | ||||
|     <<: *only_default | ||||
| @@ -67,8 +60,6 @@ build: | ||||
| test: | ||||
|     image: registry.gitlab.gnome.org/gnome/mutter/master:v2 | ||||
|     stage: test | ||||
|     variables: | ||||
|         XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir" | ||||
|     before_script: | ||||
|         - ninja -C mutter/build install | ||||
|     script: | ||||
|   | ||||
| @@ -1,7 +1,7 @@ | ||||
| FROM registry.fedoraproject.org/fedora:latest | ||||
|  | ||||
| RUN dnf -y update && dnf -y upgrade && \ | ||||
|     dnf install -y 'dnf-command(copr)' git && \ | ||||
|     dnf install -y 'dnf-command(copr)' && \ | ||||
|  | ||||
|     # For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'` | ||||
|     dnf install -y findutils mozjs60-devel && \ | ||||
|   | ||||
| @@ -1,105 +0,0 @@ | ||||
| #!/usr/bin/env bash | ||||
|  | ||||
| OUTPUT_REGULAR=reports/lint-regular-report.txt | ||||
| OUTPUT_LEGACY=reports/lint-legacy-report.txt | ||||
| OUTPUT_FINAL=reports/lint-common-report.txt | ||||
|  | ||||
| OUTPUT_MR=reports/lint-mr-report.txt | ||||
|  | ||||
| LINE_CHANGES=changed-lines.txt | ||||
|  | ||||
| is_empty() { | ||||
|   (! grep -q . $1) | ||||
| } | ||||
|  | ||||
| run_eslint() { | ||||
|   ARGS_LEGACY='--config lint/eslintrc-legacy.json' | ||||
|  | ||||
|   local extra_args=ARGS_$1 | ||||
|   local output=OUTPUT_$1 | ||||
|   eslint -f unix ${!extra_args} -o ${!output} js | ||||
| } | ||||
|  | ||||
| list_commit_range_additions() { | ||||
|   # Turn raw context-less git-diff into a list of | ||||
|   # filename:lineno pairs of new (+) lines | ||||
|   git diff -U0 "$@" -- js | | ||||
|   awk ' | ||||
|     BEGIN { file=""; } | ||||
|     /^+++ b/ { file=substr($0,7); } | ||||
|     /^@@ / { | ||||
|         len = split($3,a,",") | ||||
|         start=a[1] | ||||
|         count=(len > 1) ? a[2] : 1 | ||||
|  | ||||
|         for (line=start; line<start+count; line++) | ||||
|             printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line; | ||||
|     }' | ||||
| } | ||||
|  | ||||
| copy_matched_lines() { | ||||
|   local source=$1 | ||||
|   local matches=$2 | ||||
|   local target=$3 | ||||
|  | ||||
|   echo -n > $target | ||||
|   for l in $(<$matches); do | ||||
|     grep $l $source >> $target | ||||
|   done | ||||
| } | ||||
|  | ||||
| create_common() { | ||||
|   # comm requires sorted input; | ||||
|   # we also strip the error message to make the following a "common" error: | ||||
|   # regular: | ||||
|   #  file.js:42:23 Indentation of 55, expected 42 | ||||
|   # legacy: | ||||
|   #  file.js:42:23 Indentation of 55, extected 24 | ||||
|   prepare() { | ||||
|     sed 's: .*::' $1 | sort | ||||
|   } | ||||
|  | ||||
|   comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp | ||||
|  | ||||
|   # Now add back the stripped error messages | ||||
|   copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL | ||||
|   rm $OUTPUT_FINAL.tmp | ||||
| } | ||||
|  | ||||
| # Disable MR handling for now. We aren't ready to enforce | ||||
| # non-legacy style just yet ... | ||||
| unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME | ||||
|  | ||||
| if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then | ||||
|   git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME | ||||
|   branch_point=$(git merge-base HEAD FETCH_HEAD) | ||||
|   commit_range=$branch_point...$CI_COMMIT_SHA | ||||
|  | ||||
|   list_commit_range_additions $commit_range > $LINE_CHANGES | ||||
|  | ||||
|   # Don't bother with running lint when no JS changed | ||||
|   if is_empty $LINE_CHANGES; then | ||||
|     exit 0 | ||||
|   fi | ||||
| fi | ||||
|  | ||||
| echo Generating lint report using regular configuration | ||||
| run_eslint REGULAR | ||||
| echo Generating lint report using legacy configuration | ||||
| run_eslint LEGACY | ||||
| echo Done. | ||||
| create_common | ||||
|  | ||||
| if ! is_empty $OUTPUT_FINAL; then | ||||
|   cat $OUTPUT_FINAL | ||||
|   exit 1 | ||||
| fi | ||||
|  | ||||
| # Just show the report and succeed when not testing a MR | ||||
| if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then | ||||
|   exit 0 | ||||
| fi | ||||
|  | ||||
| copy_matched_lines $OUTPUT_REGULAR $LINE_CHANGES $OUTPUT_MR | ||||
| cat $OUTPUT_MR | ||||
| is_empty $OUTPUT_MR | ||||
							
								
								
									
										91
									
								
								HACKING.md
									
									
									
									
									
								
							
							
						
						
									
										91
									
								
								HACKING.md
									
									
									
									
									
								
							| @@ -84,6 +84,7 @@ don't use. | ||||
|  | ||||
|     const Main = imports.ui.main; | ||||
|     const Params = imports.misc.params; | ||||
|     const Tweener = imports.ui.tweener; | ||||
|     const Util = imports.misc.util; | ||||
| ``` | ||||
| The alphabetical ordering should be done independently of the location of the | ||||
| @@ -186,27 +187,15 @@ and "double quotes" for strings that the user may see. This allows us to | ||||
| quickly find untranslated or mistranslated strings by grepping through the | ||||
| sources for double quotes without a gettext call around them. | ||||
|  | ||||
| ## `actor` (deprecated) and `_delegate` | ||||
| ## `actor` and `_delegate` | ||||
|  | ||||
| gjs allows us to set so-called "expando properties" on introspected objects, | ||||
| allowing us to treat them like any other. Because the Shell was built before | ||||
| you could inherit from GTypes natively in JS, in some cases we have a wrapper | ||||
| class that has a property called `actor` (now deprecated). We call this | ||||
| wrapper class the "delegate". | ||||
| you could inherit from GTypes natively in JS, we usually have a wrapper class | ||||
| that has a property called `actor`. We call this wrapper class the "delegate". | ||||
|  | ||||
| We sometimes use expando properties to set a property called `_delegate` on | ||||
| the actor itself: | ||||
| ```javascript | ||||
|     var MyActor = GObject.registerClass( | ||||
|     class MyActor extends Clutter.Actor { | ||||
|         _init(params) { | ||||
|             super._init(params); | ||||
|             this._delegate = this; | ||||
|         } | ||||
|     }); | ||||
| ``` | ||||
|  | ||||
| Or using the deprecated `actor`: | ||||
| ```javascript | ||||
|     var MyClass = class { | ||||
|         constructor() { | ||||
| @@ -227,7 +216,6 @@ delegate object from an associated actor. For instance, the drag and drop | ||||
| system calls the `handleDragOver` function on the delegate of a "drop target" | ||||
| when the user drags an item over it. If you do not set the `_delegate` | ||||
| property, your actor will not be able to be dropped onto. | ||||
| In case the class is an actor itself, the `_delegate` can be just set to `this`. | ||||
|  | ||||
| ## Functional style | ||||
|  | ||||
| @@ -289,49 +277,34 @@ If your usage of an object is like a hash table (and thus conceptually the keys | ||||
| can have special chars in them), don't use quotes, but use brackets: `{ bar: 42 | ||||
| }`, `foo['bar']`. | ||||
|  | ||||
| ## Animations | ||||
|  | ||||
| Most objects that are animated are actors, and most properties used in animations | ||||
| are animatable, which means they can use implicit animations: | ||||
| ## Getters, setters, and Tweener | ||||
|  | ||||
| Getters and setters should be used when you are dealing with an API that is | ||||
| designed around setting properties, like Tweener. If you want to animate an | ||||
| arbitrary property, create a getter and setter, and use Tweener to animate the | ||||
| property. | ||||
| ```javascript | ||||
|     moveActor(actor, x, y) { | ||||
|         actor.ease({ | ||||
|             x, | ||||
|             y, | ||||
|             duration: 500, // ms | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|     } | ||||
| ``` | ||||
|  | ||||
| The above is a convenience wrapper around the actual Clutter API, and should generally | ||||
| be preferred over the more verbose: | ||||
|  | ||||
| ```javascript | ||||
|     moveActor(actor, x, y) { | ||||
|         actor.save_easing_state(); | ||||
|  | ||||
|         actor.set_easing_duration(500); | ||||
|         actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD); | ||||
|         actor.set({ | ||||
|             x, | ||||
|             y | ||||
|         }); | ||||
|  | ||||
|         actor.restore_easing_state(); | ||||
|     } | ||||
| ``` | ||||
|  | ||||
| There is a similar convenience API around Clutter.PropertyTransition to animate | ||||
| actor (or actor meta) properties that cannot use implicit animations: | ||||
|  | ||||
| ```javascript | ||||
|     desaturateActor(actor, desaturate) { | ||||
|         let factor = desaturate ? 1.0 : 0.0; | ||||
|         actor.ease_property('@effects.desaturate.factor', factor, { | ||||
|             duration: 500, // ms | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|     } | ||||
|     var ANIMATION_TIME = 2000; | ||||
|  | ||||
|     var MyClass = class { | ||||
|         constructor() { | ||||
|             this.actor = new St.BoxLayout(); | ||||
|             this._position = 0; | ||||
|         } | ||||
|  | ||||
|         get position() { | ||||
|             return this._position; | ||||
|         } | ||||
|  | ||||
|         set position(value) { | ||||
|             this._position = value; | ||||
|             this.actor.set_position(value, value); | ||||
|         } | ||||
|     }; | ||||
|  | ||||
|     let myThing = new MyClass(); | ||||
|     Tweener.addTween(myThing, | ||||
|                      { position: 100, | ||||
|                        time: ANIMATION_TIME, | ||||
|                        transition: 'easeOutQuad' }); | ||||
| ``` | ||||
|   | ||||
							
								
								
									
										151
									
								
								NEWS
									
									
									
									
									
								
							
							
						
						
									
										151
									
								
								NEWS
									
									
									
									
									
								
							| @@ -1,154 +1,3 @@ | ||||
| 3.35.1 | ||||
| ====== | ||||
| * Misc. bug fixes and cleanups [Marco; Matthias; !758, #701212] | ||||
|  | ||||
| Contributors: | ||||
|   Marco Trevisan (Treviño) | ||||
|  | ||||
| 3.34.1 | ||||
| ====== | ||||
| * Fix "Frequent" view icons disappearing on hover [Jonas D.; #1502] | ||||
| * Allow editing app folder names [Georges, Marco; !675, !720] | ||||
| * Skip property transitions while hidden [Florian; !708] | ||||
| * Make menu animations more consistent [Florian, GB_2; #1595, !717] | ||||
| * Improve performance when enabling/disabling all extensions [Jonas D.; !96] | ||||
| * Fix extra icons appearing in "Frequent" view animation [Georges; !696] | ||||
| * Fix fading out desktop icons [Harshula; #1616] | ||||
| * Fix box-shadow glitch with prerendered resources [Daniel; #1186] | ||||
| * Fix accidentally skipped animations [Florian; #1572] | ||||
| * Fix screenshots and window animations when scaled [Robert; !728] | ||||
| * Don't leak NOTIFY_SOCKET environment variable to applications [Benjamin; !741] | ||||
| * Fix lock-up on X11 when ibus is already running on startup [Marco; #1712] | ||||
| * Fix screen dimming on idle [Marco; #1683] | ||||
| * Do not notify systemd before initialization is complete [Iain; !750] | ||||
| * Support SAE secrets in network agent [Lubomir; !751] | ||||
| * Fix various regressions with dynamic workspaces [Florian; #1497] | ||||
| * Fixed crashes [Florian, Marco; #1678, !746] | ||||
| * Misc. bug fixes and cleanups [Marco, Jonas D., Florian, Iain, Georges, | ||||
|   Jonas Å., Martin, Takao, Carlos; !700, !705, !709, !711, !707, #1538, !710, | ||||
|   !713, !699, !715, !718, !716, !719, !721, #1243, !725, !731, #1614, !683, | ||||
|   !732, !121, !735, !736, !740, #573, #1641, #1571] | ||||
|  | ||||
| Contributors: | ||||
|   Marco Trevisan (Treviño), Benjamin Berg, Jonas Dreßler, Takao Fujiwara, GB_2, | ||||
|   Carlos Garnacho, Harshula Jayasuriya, Iain Lane, Robert Mader, | ||||
|   Daniel García Moreno, Florian Müllner, Georges Basile Stavracas Neto, | ||||
|   Lubomir Rintel, Martin Zurowietz, Jonas Ådahl | ||||
|  | ||||
| Translators: | ||||
|   Rafael Fontenelle [pt_BR], Fran Dieguez [gl], Balázs Úr [hu], | ||||
|   Milo Casagrande [it], Daniel Șerbănescu [ro], Kukuh Syafaat [id], | ||||
|   Jiri Grönroos [fi], Daniel Mustieles [es], Piotr Drąg [pl], | ||||
|   Anders Jonsson [sv], Marek Černocký [cs], Jordi Mas [ca], | ||||
|   Aurimas Černius [lt], Christian Kirbach [de], Emin Tufan Çetin [tr], | ||||
|   Enrico Nicoletto [pt_BR], Danial Behzadi [fa], Марко Костић [sr], | ||||
|   Alexandre Franke [fr], Charles Monzat [fr], Kjartan Maraas [nb], | ||||
|   Ryuta Fujii [ja], Nathan Follens [nl], Dušan Kazik [sk], Fabio Tomat [fur], | ||||
|   Matej Urbančič [sl], Ask Hjorth Larsen [da], Alan Mortensen [da] | ||||
|  | ||||
| 3.34.0 | ||||
| ====== | ||||
| * Handle startup/shutdown of misc X11 services [Carlos; !680] | ||||
| * Fix sound volume mute/unmute [Iain; #1557] | ||||
| * Correctly terminate pasted text [Carlos; #1570] | ||||
|  | ||||
| Contributors: | ||||
|   Carlos Garnacho, Iain Lane | ||||
|  | ||||
| Translators: | ||||
|   Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja], | ||||
|   Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr], | ||||
|   Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr] | ||||
|  | ||||
| 3.33.92 | ||||
| ======= | ||||
| * Animate pointer a11y pie timer [Jonas D.; !688] | ||||
| * Fix restarting shell in systemd user session [Benjamin; !690] | ||||
| * Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will; | ||||
|   !691, !689, !692, #1552, !698] | ||||
|  | ||||
| Contributors: | ||||
|   Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner, | ||||
|   Will Thompson | ||||
|  | ||||
| Translators: | ||||
|   Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es], | ||||
|   Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl], | ||||
|   Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca], | ||||
|   Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de], | ||||
|   Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko], | ||||
|   Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs], | ||||
|   Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR] | ||||
|  | ||||
| 3.33.91 | ||||
| ======= | ||||
| * Fix regression when adjusting brightness [Florian; #1500] | ||||
| * Fix pointer a11y timeout animation [Jonas D.; #1533] | ||||
| * Add new extensions CLI tool [Florian; #1234] | ||||
| * Only track top-level windows [Carlos; #556] | ||||
| * Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian; | ||||
|   !678, !682, !686] | ||||
|  | ||||
| Contributors: | ||||
|   Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner | ||||
|  | ||||
| Translators: | ||||
|   Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv], | ||||
|   Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi], | ||||
|   Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl], | ||||
|   Danial Behzadi [fa] | ||||
|  | ||||
| 3.33.90 | ||||
| ======= | ||||
| * Implement DND app picker folder management [Georges; !643, !645, !664, !671] | ||||
| * Make Clocks/Weather integration work with sandboxed apps [Florian; #1158] | ||||
| * Support startup via systemd user instance [Benjamin; !507] | ||||
| * Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669] | ||||
| * Minimize travel distance in overview animation [Sergey; !267] | ||||
| * Rescan icon theme when installed apps changed [Georges; !661] | ||||
| * Consistently animate new window actions [Jonas; !662, !673] | ||||
| * Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels, | ||||
|   Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647, | ||||
|   !385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665, | ||||
|   !667, !670, #1357, !672, !657, #1507, !674, !677] | ||||
|  | ||||
| Contributors: | ||||
|   Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner, | ||||
|   Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode, | ||||
|   Marco Trevisan (Treviño), verdre, Daniel van Vugt | ||||
|  | ||||
| Translators: | ||||
|   Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR], | ||||
|   Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es], | ||||
|   Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro], | ||||
|   Anders Jonsson [sv] | ||||
|  | ||||
| 3.33.4 | ||||
| ====== | ||||
| * Fix unintentional interference between gestures [Jonas; !598] | ||||
| * Fix unintentional loop while polkit dialog is active [Ray; !602] | ||||
| * Fix alt-tab icon size on HiDPI [Jonas; !587] | ||||
| * Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449] | ||||
| * Fix style updates for non-background CSS properties [Florian; #1212] | ||||
| * Fix cursor visibility in screen recordings [Illya; #1208] | ||||
| * Add option for disabling the hot corner [Florian; #688320] | ||||
| * Use more fine-grained levels in battery indicator [Florian; !561, #1442] | ||||
| * Fix the calculation of the maximum number of app search results [Jonas; !110] | ||||
| * Handle horizontal workspace layout with gestures/animations [Florian; !575] | ||||
| * Improve handling of session mode extensions [Florian, Didier; #789852] | ||||
| * Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin, | ||||
|   Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611, | ||||
|   !614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626, | ||||
|   !491, !631, !632, !633, #1457] | ||||
|  | ||||
| Contributors: | ||||
|   Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho, | ||||
|   Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada, | ||||
|   Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño) | ||||
|  | ||||
| Translators: | ||||
|   Jordi Mas [ca], Jor Teron [mjw] | ||||
|  | ||||
| 3.33.3 | ||||
| ====== | ||||
| * Prepare for optional X11 [Carlos; !378] | ||||
|   | ||||
| @@ -1,15 +0,0 @@ | ||||
| <node> | ||||
|  | ||||
|   <!-- | ||||
|       org.gnome.Shell.ClocksIntegration: | ||||
|       @short_description: Clocks integration interface | ||||
|  | ||||
|       The interface used for exporting location settings to GNOME Shell's | ||||
|       world clocks integration. | ||||
|   --> | ||||
|   <interface name="org.gnome.Shell.ClocksIntegration"> | ||||
|  | ||||
|   <property name="Locations" type="av" access="read"/> | ||||
|  | ||||
|   </interface> | ||||
| </node> | ||||
| @@ -173,30 +173,6 @@ | ||||
|       <arg type="s" direction="in" name="uuid"/> | ||||
|     </method> | ||||
|  | ||||
|     <!-- | ||||
|         EnableExtension: | ||||
|         @uuid: The UUID of the extension | ||||
|         @success: Whether the operation was successful | ||||
|  | ||||
|         Enable an extension. | ||||
|     --> | ||||
|     <method name="EnableExtension"> \ | ||||
|       <arg type="s" direction="in" name="uuid"/> \ | ||||
|       <arg type="b" direction="out" name="success"/> \ | ||||
|     </method> \ | ||||
|  | ||||
|     <!-- | ||||
|         DisableExtension: | ||||
|         @uuid: The UUID of the extension | ||||
|         @success: Whether the operation was successful | ||||
|  | ||||
|         Disable an extension. | ||||
|     --> | ||||
|     <method name="DisableExtension"> \ | ||||
|       <arg type="s" direction="in" name="uuid"/> \ | ||||
|       <arg type="b" direction="out" name="success"/> \ | ||||
|     </method> \ | ||||
|  | ||||
|     <!-- | ||||
|         LaunchExtensionPrefs: | ||||
|         @uuid: The UUID of the extension | ||||
| @@ -213,15 +189,6 @@ | ||||
|     --> | ||||
|     <method name="CheckForUpdates"/> | ||||
|  | ||||
|     <signal name="ExtensionStateChanged"> | ||||
|       <arg type="s" name="uuid"/> | ||||
|       <arg type="a{sv}" name="state"/> | ||||
|     </signal> | ||||
|  | ||||
|     <!-- | ||||
|         ExtensionStatusChanged: | ||||
|         Deprecated for ExtensionStateChanged | ||||
|     --> | ||||
|     <signal name="ExtensionStatusChanged"> | ||||
|       <arg type="s" name="uuid"/> | ||||
|       <arg type="i" name="state"/> | ||||
|   | ||||
| @@ -1,16 +0,0 @@ | ||||
| <node> | ||||
|  | ||||
|   <!-- | ||||
|       org.gnome.Shell.WeatherIntegration: | ||||
|       @short_description: Weather integration interface | ||||
|  | ||||
|       The interface used for exporting location settings to GNOME Shell's | ||||
|       weather integration. | ||||
|   --> | ||||
|   <interface name="org.gnome.Shell.WeatherIntegration"> | ||||
|  | ||||
|   <property name="AutomaticLocation" type="b" access="read"/> | ||||
|   <property name="Locations" type="av" access="read"/> | ||||
|  | ||||
|   </interface> | ||||
| </node> | ||||
| @@ -9,7 +9,7 @@ | ||||
|     <method name="ShowOSD"> | ||||
|       <arg type="a{sv}" direction="in" name="params"/> | ||||
|     </method> | ||||
|     <method name="ShowMonitorLabels"> | ||||
|     <method name="ShowMonitorLabels2"> | ||||
|       <arg type="a{sv}" direction="in" name="params"/> | ||||
|     </method> | ||||
|     <method name="HideMonitorLabels"/> | ||||
|   | ||||
| @@ -40,7 +40,6 @@ | ||||
|     <file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file> | ||||
| @@ -49,7 +48,6 @@ | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gnome.Shell.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file> | ||||
|     <file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file> | ||||
|   | ||||
| @@ -1,14 +0,0 @@ | ||||
| [Unit] | ||||
| Description=Disable GNOME Shell extensions after failure | ||||
| DefaultDependencies=no | ||||
|  | ||||
| # Only disable extensions for a short period of time after login. | ||||
| # This means we err on the side of failing the first login after a broken | ||||
| # extension was installed. | ||||
| Requisite=gnome-session-stable.timer | ||||
|  | ||||
| [Service] | ||||
| Type=simple | ||||
| # Disable extensions | ||||
| ExecStart=gsettings set org.gnome.shell disable-user-extensions true | ||||
| Restart=no | ||||
| @@ -1,27 +0,0 @@ | ||||
| [Unit] | ||||
| Description=GNOME Shell on Wayland | ||||
| # On wayland, force a session shutdown | ||||
| OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target | ||||
| OnFailureJobMode=replace-irreversibly | ||||
| CollectMode=inactive-or-failed | ||||
| RefuseManualStart=on | ||||
| RefuseManualStop=on | ||||
|  | ||||
| After=gnome-session-manager.target | ||||
|  | ||||
| Requisite=gnome-session-initialized.target | ||||
| PartOf=gnome-session-initialized.target | ||||
| Before=gnome-session-initialized.target | ||||
|  | ||||
| # The units already conflict because they use the same BusName | ||||
| #Conflicts=gnome-shell-x11.service | ||||
|  | ||||
| [Service] | ||||
| Type=notify | ||||
| ExecStart=@bindir@/gnome-shell | ||||
| # Exit code 1 means we are probably *not* dealing with an extension failure | ||||
| SuccessExitStatus=1 | ||||
| # On wayland we cannot restart | ||||
| Restart=no | ||||
| # Kill any stubborn child processes after this long | ||||
| TimeoutStopSec=5 | ||||
| @@ -1,10 +1,5 @@ | ||||
| [Unit] | ||||
| Description=GNOME Shell on Wayland | ||||
| DefaultDependencies=no | ||||
|  | ||||
| Requisite=gnome-session-initialized.target | ||||
| PartOf=gnome-session-initialized.target | ||||
| Before=gnome-session-initialized.target | ||||
|  | ||||
| Requires=gnome-shell-wayland.service | ||||
| After=gnome-shell-wayland.service | ||||
| Description=GNOME Shell (wayland sync point) | ||||
| After=gnome-shell.service | ||||
| BindsTo=gnome-shell.service | ||||
| Conflicts=gnome-shell-x11.target | ||||
|   | ||||
| @@ -1,33 +0,0 @@ | ||||
| [Unit] | ||||
| Description=GNOME Shell on X11 | ||||
| # On X11, try to show the GNOME Session Failed screen | ||||
| OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target | ||||
| OnFailureJobMode=replace | ||||
| CollectMode=inactive-or-failed | ||||
| RefuseManualStart=on | ||||
| RefuseManualStop=on | ||||
|  | ||||
| After=gnome-session-manager.target | ||||
|  | ||||
| Requisite=gnome-session-initialized.target | ||||
| PartOf=gnome-session-initialized.target | ||||
| Before=gnome-session-initialized.target | ||||
|  | ||||
| # The units already conflict because they use the same BusName | ||||
| #Conflicts=gnome-shell-wayland.service | ||||
|  | ||||
| # Limit startup frequency more than the default | ||||
| StartLimitIntervalSec=15s | ||||
| StartLimitBurst=3 | ||||
|  | ||||
| [Service] | ||||
| Type=notify | ||||
| ExecStart=@bindir@/gnome-shell | ||||
| # Exit code 1 means we are probably *not* dealing with an extension failure | ||||
| SuccessExitStatus=1 | ||||
| # On X11 we want to restart on-success (Alt+F2 + r) and on-failure. | ||||
| Restart=always | ||||
| # Do not wait before restarting the shell | ||||
| RestartSec=0ms | ||||
| # Kill any stubborn child processes after this long | ||||
| TimeoutStopSec=5 | ||||
| @@ -1,10 +1,5 @@ | ||||
| [Unit] | ||||
| Description=GNOME Shell on X11 | ||||
| DefaultDependencies=no | ||||
|  | ||||
| Requisite=gnome-session-initialized.target | ||||
| PartOf=gnome-session-initialized.target | ||||
| Before=gnome-session-initialized.target | ||||
|  | ||||
| Requires=gnome-shell-x11.service | ||||
| After=gnome-shell-x11.service | ||||
| Description=GNOME Shell (x11 sync point) | ||||
| After=gnome-shell.service | ||||
| BindsTo=gnome-shell.service | ||||
| Conflicts=gnome-shell-wayland.target | ||||
|   | ||||
							
								
								
									
										11
									
								
								data/gnome-shell.service.in
									
									
									
									
									
										Normal file
									
								
							
							
						
						
									
										11
									
								
								data/gnome-shell.service.in
									
									
									
									
									
										Normal file
									
								
							| @@ -0,0 +1,11 @@ | ||||
| [Unit] | ||||
| Description=GNOME Shell | ||||
| Wants=gnome-session.service | ||||
| After=graphical-session-pre.target gnome-session-bus.target | ||||
| PartOf=graphical-session.target | ||||
|  | ||||
| [Service] | ||||
| Type=dbus | ||||
| ExecStart=@bindir@/gnome-shell | ||||
| Restart=on-failure | ||||
| BusName=org.gnome.Shell | ||||
| @@ -14,8 +14,6 @@ desktopconf = configuration_data() | ||||
| # file when built in a non-system prefix | ||||
| desktopconf.set('bindir', bindir) | ||||
| desktopconf.set('VERSION', meson.project_version()) | ||||
| desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false') | ||||
|  | ||||
| foreach desktop_file : desktop_files | ||||
|   i18n.merge_file('desktop', | ||||
|     input: configure_file( | ||||
| @@ -24,7 +22,7 @@ foreach desktop_file : desktop_files | ||||
|       configuration: desktopconf | ||||
|     ), | ||||
|     output: desktop_file, | ||||
|     po_dir: po_dir, | ||||
|     po_dir: '../po', | ||||
|     install: true, | ||||
|     install_dir: desktopdir, | ||||
|     type: 'desktop' | ||||
| @@ -100,23 +98,15 @@ if have_systemd | ||||
|   unitconf = configuration_data() | ||||
|   unitconf.set('bindir', bindir) | ||||
|  | ||||
|   configure_file( | ||||
|     input: 'gnome-shell-x11.service.in', | ||||
|     output: 'gnome-shell-x11.service', | ||||
|   unit = configure_file( | ||||
|     input: 'gnome-shell.service.in', | ||||
|     output: 'gnome-shell.service', | ||||
|     configuration: unitconf, | ||||
|     install_dir: systemduserunitdir | ||||
|   ) | ||||
|  | ||||
|   configure_file( | ||||
|     input: 'gnome-shell-wayland.service.in', | ||||
|     output: 'gnome-shell-wayland.service', | ||||
|     configuration: unitconf, | ||||
|     install_dir: systemduserunitdir | ||||
|   ) | ||||
|  | ||||
|   units = files('gnome-shell-x11.target', | ||||
|                 'gnome-shell-wayland.target', | ||||
|                 'gnome-shell-disable-extensions.service') | ||||
|   units = files('gnome-shell-wayland.target', | ||||
|                 'gnome-shell-x11.target') | ||||
|  | ||||
|   install_data(units, install_dir: systemduserunitdir) | ||||
| endif | ||||
|   | ||||
| @@ -14,4 +14,3 @@ X-GNOME-Autostart-Phase=DisplayServer | ||||
| X-GNOME-Provides=panel;windowmanager; | ||||
| X-GNOME-Autostart-Notify=true | ||||
| X-GNOME-AutoRestart=false | ||||
| X-GNOME-HiddenUnderSystemd=@systemd_hidden@ | ||||
|   | ||||
| @@ -21,17 +21,6 @@ | ||||
|         EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell. | ||||
|       </description> | ||||
|     </key> | ||||
|     <key name="disabled-extensions" type="as"> | ||||
|       <default>[]</default> | ||||
|       <summary>UUIDs of extensions to force disabling</summary> | ||||
|       <description> | ||||
|         GNOME Shell extensions have a UUID property; this key lists extensions | ||||
|         which should be disabled, even if loaded as part of the current mode. | ||||
|         You can also manipulate this list with the EnableExtension and | ||||
|         DisableExtension D-Bus methods on org.gnome.Shell. | ||||
|         This key takes precedence over the “enabled-extensions” setting. | ||||
|       </description> | ||||
|     </key> | ||||
|     <key name="disable-user-extensions" type="b"> | ||||
|       <default>false</default> | ||||
|       <summary>Disable user extensions</summary> | ||||
| @@ -110,6 +99,7 @@ | ||||
|       </description> | ||||
|     </key> | ||||
|     <child name="keybindings" schema="org.gnome.shell.keybindings"/> | ||||
|     <child name="keyboard" schema="org.gnome.shell.keyboard"/> | ||||
|   </schema> | ||||
|  | ||||
|   <schema id="org.gnome.shell.keybindings" path="/org/gnome/shell/keybindings/" | ||||
| @@ -150,6 +140,11 @@ | ||||
|         Keybinding to focus the active notification. | ||||
|       </description> | ||||
|     </key> | ||||
|     <key name="pause-resume-tweens" type="as"> | ||||
|       <default>[]</default> | ||||
|       <summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary> | ||||
|       <description></description> | ||||
|     </key> | ||||
|     <key name="switch-to-application-1" type="as"> | ||||
|       <default>["<Super>1"]</default> | ||||
|       <summary>Switch to application 1</summary> | ||||
| @@ -188,6 +183,17 @@ | ||||
|     </key> | ||||
|   </schema> | ||||
|  | ||||
|   <schema id="org.gnome.shell.keyboard" path="/org/gnome/shell/keyboard/" | ||||
|           gettext-domain="@GETTEXT_PACKAGE@"> | ||||
|     <key name="keyboard-type" type="s"> | ||||
|       <default>'touch'</default> | ||||
|       <summary>Which keyboard to use</summary> | ||||
|       <description> | ||||
|         The type of keyboard to use. | ||||
|       </description> | ||||
|     </key> | ||||
|   </schema> | ||||
|  | ||||
|   <schema id="org.gnome.shell.app-switcher" | ||||
|           path="/org/gnome/shell/app-switcher/" | ||||
|           gettext-domain="@GETTEXT_PACKAGE@"> | ||||
| @@ -228,36 +234,6 @@ | ||||
|     </key> | ||||
|   </schema> | ||||
|  | ||||
|   <schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/" | ||||
|           gettext-domain="@GETTEXT_PACKAGE@"> | ||||
|     <key name="locations" type="av"> | ||||
|       <summary>Locations</summary> | ||||
|       <description> | ||||
|         The locations to show in world clocks | ||||
|       </description> | ||||
|       <default>[]</default> | ||||
|     </key> | ||||
|   </schema> | ||||
|  | ||||
|   <schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/" | ||||
|           gettext-domain="@GETTEXT_PACKAGE@"> | ||||
|     <key name="automatic-location" type="b"> | ||||
|       <summary>Automatic location</summary> | ||||
|       <description> | ||||
|         Whether to fetch the current location or not | ||||
|       </description> | ||||
|       <default>false</default> | ||||
|     </key> | ||||
|  | ||||
|     <key name="locations" type="av"> | ||||
|       <summary>Location</summary> | ||||
|       <description> | ||||
|         The location for which to show a forecast | ||||
|       </description> | ||||
|       <default>[]</default> | ||||
|     </key> | ||||
|   </schema> | ||||
|  | ||||
|   <!-- unused, change 00_org.gnome.shell.gschema.override instead --> | ||||
|   <schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/" | ||||
| 	  gettext-domain="@GETTEXT_PACKAGE@"> | ||||
|   | ||||
| @@ -25,10 +25,8 @@ $cakeisalie: "This stylesheet is generated, DO NOT EDIT"; | ||||
|  | ||||
| /* GLOBALS */ | ||||
|  | ||||
|  | ||||
| $modal_radius: 9px; | ||||
| $button_radius: 5px; | ||||
| $panel-corner-radius: $button_radius + 1; | ||||
| $panel-corner-radius: 6px; | ||||
| $medium_radius: 9px; | ||||
|  | ||||
| $_trough_color: transparentize($fg_color, 0.9); | ||||
| $_bubble_borders_color: lighten($borders_color, if($variant=='light', 0%, 5%)); | ||||
| @@ -48,7 +46,7 @@ stage { | ||||
|  | ||||
| /* Buttons */ | ||||
| .button, %button { | ||||
|   border-radius: $button_radius; | ||||
|   border-radius: 5px; | ||||
|   border-width: 1px; | ||||
|   min-height: 22px; | ||||
|   padding: 4px 32px; | ||||
| @@ -70,21 +68,21 @@ stage { | ||||
|   border-top: 1px solid $_bubble_borders_color; | ||||
|  | ||||
|   &:first-child { | ||||
|     border-radius: 0px 0px 0px $modal_radius; | ||||
|     border-radius: 0px 0px 0px $medium_radius; | ||||
|   } | ||||
|   &:last-child { | ||||
|     border-right-width: 0px; | ||||
|     border-radius: 0px 0px $modal_radius 0px; | ||||
|     border-radius: 0px 0px $medium_radius 0px; | ||||
|   } | ||||
|   &:first-child:last-child { | ||||
|     border-right-width: 0px; | ||||
|     border-radius: 0px 0px $modal_radius $modal_radius; | ||||
|     border-radius: 0px 0px $medium_radius $medium_radius; | ||||
|   } | ||||
| } | ||||
|  | ||||
| /* Entries */ | ||||
| StEntry { | ||||
|   border-radius: $button_radius; | ||||
|   border-radius: 5px; | ||||
|   padding: 4px; | ||||
|   border-width: 1px; | ||||
|   color: $fg_color; | ||||
| @@ -189,12 +187,12 @@ StScrollBar { | ||||
|  | ||||
| /* Modal Dialogs */ | ||||
|  | ||||
| .headline { font-size: 110%; } | ||||
| .headline { @extend %heading; } | ||||
| .lightbox { background-color: black; } | ||||
| .flashspot { background-color: white; } | ||||
|  | ||||
| .modal-dialog { | ||||
|   border-radius: $modal_radius; | ||||
|   border-radius: 9px; | ||||
|   @extend %bubble-panel; | ||||
|   .modal-dialog-content-box { | ||||
|     padding: 24px; | ||||
| @@ -206,8 +204,7 @@ StScrollBar { | ||||
|   } | ||||
|   .run-dialog-button-box { padding-top: 1em; } | ||||
|   .run-dialog-label { | ||||
|     @include fontsize($font-size + 1.1); | ||||
|     font-weight: normal; | ||||
|     @extend %title-4; | ||||
|     color: $fg_color; | ||||
|     padding-bottom: .4em; | ||||
|   } | ||||
| @@ -215,8 +212,8 @@ StScrollBar { | ||||
| } | ||||
|  | ||||
|   .mount-dialog-subject, | ||||
|   .end-session-dialog-subject { //this should be a generic header class | ||||
|     @include fontsize($font-size * 1.3); | ||||
|   .end-session-dialog-subject { | ||||
|     @extend %title-2; | ||||
|   } | ||||
|  | ||||
| /* Message Dialog */ | ||||
| @@ -236,12 +233,12 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .message-dialog-title { | ||||
|     font-weight: bold; | ||||
|     @extend %title-2; | ||||
|   } | ||||
|  | ||||
|   .message-dialog-subtitle { | ||||
|     @extend %heading; | ||||
|     color: $fg_color; | ||||
|     font-weight: bold; | ||||
|   } | ||||
|  | ||||
| /* End Session Dialog */ | ||||
| @@ -255,6 +252,7 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .end-session-dialog-layout { | ||||
|     spacing: 12px; | ||||
|     padding-left: 17px; | ||||
|     &:rtl { padding-right: 17px; } | ||||
|   } | ||||
| @@ -302,7 +300,7 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .end-session-dialog-list-header { | ||||
|     font-weight: bold; | ||||
|     @extend %heading; | ||||
|     &:rtl { text-align: right; } | ||||
|   } | ||||
|  | ||||
| @@ -313,12 +311,11 @@ StScrollBar { | ||||
|  | ||||
|   .end-session-dialog-app-list-item-name, | ||||
|   .end-session-dialog-session-list-item-name { | ||||
|     font-weight: bold; | ||||
|     @extend %heading; | ||||
|   } | ||||
|  | ||||
|   .end-session-dialog-app-list-item-description { | ||||
|     color: darken($fg_color,5%); | ||||
|     font-size: 10pt; | ||||
|   } | ||||
|  | ||||
| /* ShellMountOperation Dialogs */ | ||||
| @@ -374,11 +371,6 @@ StScrollBar { | ||||
|     &:rtl { padding-left: 17px; } | ||||
|   } | ||||
|  | ||||
|   .mount-dialog-app-list-item-name { | ||||
|     font-size: 10pt; | ||||
|   } | ||||
|  | ||||
|  | ||||
| /* Password or Authentication Dialog */ | ||||
|  | ||||
| .prompt-dialog { | ||||
| @@ -388,7 +380,7 @@ StScrollBar { | ||||
|  | ||||
|   .message-dialog-main-layout { spacing: 24px; padding: 10px; } | ||||
|   .message-dialog-content { spacing: 16px; } | ||||
|   .message-dialog-title { color: lighten($fg_color,15%); } | ||||
|   .message-dialog-title { @extend %title-2; color: lighten($fg_color,15%); } | ||||
| } | ||||
|  | ||||
|   .prompt-dialog-description:rtl { | ||||
| @@ -401,13 +393,11 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .prompt-dialog-error-label { | ||||
|     font-size: 10pt; | ||||
|     color: $warning_color; | ||||
|     padding-bottom: 8px; | ||||
|   } | ||||
|  | ||||
|   .prompt-dialog-info-label { | ||||
|     font-size: 10pt; | ||||
|     padding-bottom: 8px; | ||||
|   } | ||||
|  | ||||
| @@ -416,7 +406,6 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .prompt-dialog-null-label { | ||||
|     font-size: 10pt; | ||||
|     padding-bottom: 8px; | ||||
|   } | ||||
|  | ||||
| @@ -472,7 +461,7 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .audio-selection-title { | ||||
|     font-weight: bold; | ||||
|     @extend %title-2; | ||||
|     text-align: center; | ||||
|   } | ||||
|  | ||||
| @@ -515,7 +504,7 @@ StScrollBar { | ||||
| .extension-dialog { | ||||
|   @extend %bubble-panel; | ||||
|   .message-dialog-main-layout { spacing: 24px; padding: 10px; } | ||||
|   .message-dialog-title { font-weight: normal; color: $fg_color; } | ||||
|   .message-dialog-title { @extend %title-2; } | ||||
| } | ||||
|  | ||||
| /* Inhibit-Shortcuts Dialog */ | ||||
| @@ -556,9 +545,9 @@ StScrollBar { | ||||
|     &:ltr { padding: .4em 1.75em .4em 0em; } | ||||
|     &:rtl { padding: .4em 0em .4em 1.75em; } | ||||
|     &:checked { | ||||
|       @extend %heading; | ||||
|       background-color: $bg_color; | ||||
|       box-shadow: inset 0 -1px 0px $_bubble_borders_color; | ||||
|       font-weight: bold; | ||||
|     } | ||||
|     &.selected { | ||||
|       background-color: transparentize(white, if($variant=='light', 0.2, 0.9)); | ||||
| @@ -591,7 +580,7 @@ StScrollBar { | ||||
|   } | ||||
|   .popup-menu-boxpointer, | ||||
|   .candidate-popup-boxpointer { | ||||
|     -arrow-border-radius: $button_radius+4; | ||||
|     -arrow-border-radius: $medium_radius; | ||||
|     -arrow-background-color: $bg_color; | ||||
|     -arrow-border-width: 1px; | ||||
|     -arrow-border-color: if($variant=='light', transparentize(black, 0.6), $borders_color); | ||||
| @@ -610,13 +599,6 @@ StScrollBar { | ||||
|     border-bottom-style: solid; | ||||
|   } | ||||
|  | ||||
| // Rename popup | ||||
| .rename-folder-popup { | ||||
|   .rename-folder-popup-item { | ||||
|     spacing: 6px; | ||||
|     &:ltr, &:rtl { padding: 0, 12px; } | ||||
|   } | ||||
| } | ||||
|  | ||||
| // Background menu | ||||
| .background-menu { -boxpointer-gap: 4px; -arrow-rise: 0px; } | ||||
| @@ -626,18 +608,6 @@ StScrollBar { | ||||
|   app menu inside the main app window itself rather than the top bar | ||||
| */ | ||||
|  | ||||
| /************* | ||||
|  * App Icons * | ||||
|  *************/ | ||||
| /* Outline for low res icons */ | ||||
| .lowres-icon { | ||||
|     icon-shadow: 0 1px 2px rgba(0,0,0,0.3); | ||||
| } | ||||
|  | ||||
| /* Drapshadow for large icons */ | ||||
| .icon-dropshadow { | ||||
|   icon-shadow: 0 1px 2px rgba(0,0,0,0.4); | ||||
| } | ||||
|  | ||||
| /* OSD */ | ||||
| .osd-window { | ||||
| @@ -648,7 +618,7 @@ StScrollBar { | ||||
|   min-width: 64px; | ||||
|   min-height: 64px; | ||||
|  | ||||
|   .osd-monitor-label { font-size: 3em; } | ||||
|   .osd-monitor-label { @extend %title-1; } | ||||
|   .level { | ||||
|     height: 0.6em; | ||||
|     -barlevel-height: 0.6em; | ||||
| @@ -747,9 +717,8 @@ StScrollBar { | ||||
|     spacing: 8px; | ||||
|   } | ||||
|  | ||||
|   .ws-switcher-active-up, .ws-switcher-active-down, | ||||
|   .ws-switcher-active-left, .ws-switcher-active-right { | ||||
|     height: 52px; | ||||
|   .ws-switcher-active-up, .ws-switcher-active-down { | ||||
|     height: 50px; | ||||
|     background-color: $selected_bg_color; | ||||
|     color: $selected_fg_color; | ||||
|     background-size: 32px; | ||||
| @@ -822,8 +791,8 @@ StScrollBar { | ||||
| /* TOP BAR */ | ||||
|  | ||||
| #panel { | ||||
|   @extend %heading; | ||||
|   background-color: black; | ||||
|   font-weight: bold; | ||||
|   height: 1.86em; | ||||
|   font-feature-settings: "tnum"; | ||||
|  | ||||
| @@ -855,9 +824,9 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .panel-button { | ||||
|     @extend %heading; | ||||
|     -natural-hpadding: 12px; | ||||
|     -minimum-hpadding: 6px; | ||||
|     font-weight: bold; | ||||
|     color: #ccc; | ||||
|  | ||||
|     .app-menu-icon { | ||||
| @@ -949,33 +918,33 @@ StScrollBar { | ||||
|     .world-clocks-button, | ||||
|     .weather-button, | ||||
|     .events-section-title { | ||||
|       &:hover, &:focus { background-color: $_hover_bg_color } | ||||
|       &:hover, focus { background-color: $_hover_bg_color } | ||||
|       &:active { background-color: $_active_bg_color } | ||||
|     } | ||||
|  | ||||
|     .datemenu-today-button .day-label { | ||||
|       @extend %heading; | ||||
|     } | ||||
|  | ||||
|     .datemenu-today-button .date-label { | ||||
|       font-size: 1.5em; | ||||
|       font-weight: 300; | ||||
|       @extend %large-title; | ||||
|     } | ||||
|  | ||||
|     .world-clocks-header, | ||||
|     .weather-header, | ||||
|     .events-section-title { | ||||
|     .events-section-title, | ||||
|     .calendar-month-label { | ||||
|       @extend %heading; | ||||
|       color: darken($fg_color,40%); | ||||
|       font-weight: bold; | ||||
|     } | ||||
|  | ||||
|     .weather-header.location { | ||||
|       font-weight: normal; | ||||
|       font-size: 0.9em; | ||||
|       @extend %caption; | ||||
|     } | ||||
|  | ||||
|     .world-clocks-grid, | ||||
|     .weather-grid { | ||||
|       spacing-rows: 0.4em; | ||||
|       spacing-rows: 0.8em; | ||||
|       spacing-columns: 0.8em; | ||||
|     } | ||||
|  | ||||
| @@ -983,35 +952,26 @@ StScrollBar { | ||||
|       spacing: 0.4em; | ||||
|     } | ||||
|  | ||||
|     .world-clocks-city { | ||||
|       font-weight: bold; | ||||
|       font-size: 0.9em; | ||||
|     } | ||||
|  | ||||
|     .world-clocks-time { | ||||
|       color: darken($fg_color,20%); | ||||
|       font-feature-settings: "tnum"; | ||||
|       font-size: 1.2em; | ||||
|         font-feature-settings: "tnum"; | ||||
|     } | ||||
|  | ||||
|     .world-clocks-timezone { | ||||
|       color: $fg_color; | ||||
|       color: darken($fg_color,40%); | ||||
|       font-feature-settings: "tnum"; | ||||
|       font-size: 0.9em; | ||||
|       @extend %caption; | ||||
|     } | ||||
|  | ||||
|     .weather-forecast-icon { | ||||
|       icon-size: 2.18em; | ||||
|       icon-size: 32px; | ||||
|     } | ||||
|  | ||||
|     .weather-forecast-time { | ||||
|       @extend %caption; | ||||
|       color: darken($fg_color,40%); | ||||
|       font-size: 0.8em; | ||||
|     } | ||||
|  | ||||
|     .calendar-month-label { | ||||
|       color: lighten($fg_color,5%); | ||||
|       font-weight: bold; | ||||
|       padding: 8px 0; | ||||
|       &:focus {} | ||||
|     } | ||||
| @@ -1020,7 +980,7 @@ StScrollBar { | ||||
|       background-color: transparent; | ||||
|       width: 32px; | ||||
|       border-radius: 4px; | ||||
|       &:hover, &:focus { background-color: $_hover_bg_color; } | ||||
|       &:hover, focus { background-color: $_hover_bg_color; } | ||||
|       &:active { background-color: transparentize($fg_color, 0.84); } | ||||
|     } | ||||
|  | ||||
| @@ -1029,23 +989,22 @@ StScrollBar { | ||||
|       } | ||||
|  | ||||
|     .calendar-day-base { | ||||
|       font-size: 80%; | ||||
|       @extend %caption; | ||||
|       text-align: center; | ||||
|       width: 2.4em; height: 2.4em; | ||||
|       padding: 0.1em; | ||||
|       margin: 2px; | ||||
|       border-radius: 1.4em; | ||||
|       font-feature-settings: "tnum"; | ||||
|       &:hover, &:focus { background-color: $_hover_bg_color; } | ||||
|       &:hover, focus { background-color: $_hover_bg_color; } | ||||
|       &:active,&:selected { | ||||
|         color: lighten($selected_fg_color,5%); | ||||
|         background-color: $selected_bg_color; | ||||
|         border-color: transparent; //avoid jumparound due to today | ||||
|       } | ||||
|       &.calendar-day-heading {  //day of week heading | ||||
|         color: lighten($fg_color,5%); | ||||
|         margin-top: 1em; | ||||
|         font-size: 70%; | ||||
|         color: darken($fg_color,40%); | ||||
| //        margin-top: 1em; | ||||
|       } | ||||
|     } | ||||
|       .calendar-day { //border collapse hack - see calendar.js | ||||
| @@ -1060,14 +1019,15 @@ StScrollBar { | ||||
|         color: $insensitive_fg_color; | ||||
|       } | ||||
|       .calendar-today { | ||||
|         font-weight: bold; | ||||
|         @extend %caption-heading; | ||||
|         //color: lighten($fg_color,10%); | ||||
|         //background-color: darken($bg_color,5%); | ||||
|         border: 1px solid $_bubble_borders_color; | ||||
|       } | ||||
|       .calendar-day-with-events { | ||||
|         @extend %caption-heading; | ||||
|         color: lighten($fg_color,10%); | ||||
|         font-weight: bold; | ||||
|  | ||||
|         background-image: url("resource:///org/gnome/shell/theme/calendar-today.svg"); | ||||
|       } | ||||
|       .calendar-other-month-day { | ||||
| @@ -1075,8 +1035,7 @@ StScrollBar { | ||||
|         opacity: 0.5; | ||||
|       } | ||||
|       .calendar-week-number { | ||||
|         font-size: 70%; | ||||
|         font-weight: bold; | ||||
|         @extend %caption-heading; | ||||
|         width: 2.3em; height: 1.8em; | ||||
|         border-radius: 2px; | ||||
|         padding: 0.5em 0 0; | ||||
| @@ -1133,11 +1092,11 @@ StScrollBar { | ||||
|           } | ||||
|  | ||||
|           .message-secondary-bin > .event-time { | ||||
|             color: $fg_color; | ||||
|             font-size: 0.7em; | ||||
|             @extend %caption; | ||||
|             color: darken($fg_color,40%); | ||||
|             /* HACK: the label should be baseline-aligned with a 1em label, | ||||
|                      fake this with some bottom padding */ | ||||
|             padding-bottom: 0.13em; | ||||
|            padding-bottom: 1px; | ||||
|           } | ||||
|  | ||||
|           .message-secondary-bin > StIcon { | ||||
| @@ -1177,7 +1136,13 @@ StScrollBar { | ||||
|  | ||||
|   // a little unstructured mess: | ||||
|  | ||||
|   .system-switch-user-submenu-icon { | ||||
|     icon-size: 16px; | ||||
|     padding: 0 4px; | ||||
|   } | ||||
|  | ||||
|   #appMenu { | ||||
|     spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg"); | ||||
|     spacing: 4px; | ||||
|  | ||||
|     .label-shadow { color: transparent; } | ||||
| @@ -1299,17 +1264,16 @@ StScrollBar { | ||||
|   .nm-dialog-airplane-box { spacing: 12px; } | ||||
|  | ||||
|   .nm-dialog-airplane-headline { | ||||
|     font-weight: bold; | ||||
|     @extend %heading; | ||||
|     text-align: center; | ||||
|   } | ||||
|  | ||||
|   .nm-dialog-airplane-text { color: $fg_color; } | ||||
|   .nm-dialog-header-icon { icon-size: 32px; } | ||||
|   .nm-dialog-scroll-view { border: 2px solid $borders_color; } | ||||
|   .nm-dialog-header { font-weight: bold; } | ||||
|   .nm-dialog-header { @extend %title-2; } | ||||
|  | ||||
|   .nm-dialog-item { | ||||
|     font-size: 110%; | ||||
|     border-bottom: 1px solid $borders_color; | ||||
|     padding: 12px; | ||||
|     spacing: 20px; | ||||
| @@ -1345,8 +1309,8 @@ StScrollBar { | ||||
|  | ||||
|   .window-clone-border { | ||||
|     $_bg: transparentize(white, 0.65); | ||||
|     border: 7px solid $_bg; | ||||
|     border-radius: $modal_radius; | ||||
|     border: 5px solid $_bg; | ||||
|     border-radius: 6px; | ||||
|     // For window decorations with round corners we can't match | ||||
|     // the exact shape when the window is scaled. So apply a shadow | ||||
|     // to fix that case | ||||
| @@ -1383,8 +1347,11 @@ StScrollBar { | ||||
|  | ||||
|   //search results | ||||
|  | ||||
|   #searchResultsContent { | ||||
|   #searchResultsBin { | ||||
|     max-width: 1000px; | ||||
|   } | ||||
|  | ||||
|   #searchResultsContent { | ||||
|     padding-left: 20px; | ||||
|     padding-right: 20px; | ||||
|     spacing: 16px; | ||||
| @@ -1413,7 +1380,7 @@ StScrollBar { | ||||
|  | ||||
|   #dash { | ||||
|     @extend %overview-panel; | ||||
|     font-size: 9pt; | ||||
|     @extend %caption; | ||||
|     padding: 4px 0; | ||||
|     border-radius: 0px 9px 9px 0px; | ||||
|  | ||||
| @@ -1500,11 +1467,11 @@ StScrollBar { | ||||
|   .search-provider-icon, | ||||
|   .list-search-result { | ||||
|     @extend %icon_tile; | ||||
|     &:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); } | ||||
|     &:focus, &:selected, &:hover { | ||||
|       background-color: transparentize($osd_fg_color,.9); | ||||
|       transition-duration: 200ms; | ||||
|     } | ||||
|     &:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); } | ||||
|   } | ||||
|   .app-well-app, | ||||
|   .app-well-app.app-folder, | ||||
| @@ -1513,6 +1480,10 @@ StScrollBar { | ||||
|     & .overview-icon { | ||||
|       @extend %icon_tile; | ||||
|     } | ||||
|     &:active .overview-icon, | ||||
|     &:checked .overview-icon { | ||||
|       background-color: transparentize(darken($osd_bg_color,10%), 0.5); | ||||
|     } | ||||
|     &:hover .overview-icon, | ||||
|     &:focus .overview-icon, | ||||
|     &:selected .overview-icon { | ||||
| @@ -1521,13 +1492,7 @@ StScrollBar { | ||||
|       border-image: none; | ||||
|       background-image: none; | ||||
|     } | ||||
|     &:drop .overview-icon { | ||||
|       background-color: transparentize($selected_bg_color,.15); | ||||
|     } | ||||
|     &:active .overview-icon, | ||||
|     &:checked .overview-icon { | ||||
|       background-color: transparentize(darken($osd_bg_color,10%), 0.5); | ||||
|     } | ||||
|  | ||||
|   } | ||||
|  | ||||
|   .app-well-app-running-dot { //running apps indicator | ||||
| @@ -1538,7 +1503,7 @@ StScrollBar { | ||||
|  | ||||
|   %icon_tile { | ||||
|     color: $osd_fg_color; | ||||
|     border-radius: $button_radius+4; | ||||
|     border-radius: $medium_radius; | ||||
|     padding: 6px; | ||||
|     border: 1px solid transparent; | ||||
|     transition-duration: 100ms; | ||||
| @@ -1617,6 +1582,7 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   //Some hacks I don't even | ||||
|   .search-display > StBoxLayout, | ||||
|   .all-apps, | ||||
|   .frequent-apps > StBoxLayout { | ||||
|     // horizontal padding to make sure scrollbars or dash don't overlap content | ||||
| @@ -1629,9 +1595,9 @@ StScrollBar { | ||||
|   border: none; | ||||
| } | ||||
|  | ||||
| // Search status, like "Searching..." and "No results" | ||||
| %status_text { | ||||
|   font-size: 2em; | ||||
|   font-weight: bold; | ||||
|   @extend %large-title; | ||||
|   color: $osd_fg_color; | ||||
| } | ||||
|  | ||||
| @@ -1640,18 +1606,22 @@ StScrollBar { | ||||
|   .url-highlighter { link-color: lighten($selected_bg_color,10%); } | ||||
|  | ||||
|   // Banners | ||||
|   .message-body { | ||||
|     @extend %caption; | ||||
|     padding-top: 2px; | ||||
|   } | ||||
|  | ||||
|   .notification-banner { | ||||
|     font-size: 11pt; | ||||
|     width: 34em; | ||||
|     margin: 5px; | ||||
|     border-radius: $modal_radius; | ||||
|     border-radius: $medium-radius; | ||||
|     border: if($variant == 'light', none, $_bubble_borders_color); | ||||
|     min-height: 64px; | ||||
|     box-shadow: 0 1px 2px transparentize(black, 0.7); | ||||
|     &:hover { background: $bg_color; } | ||||
|     &, &:focus, &:active { | ||||
|       background-color: $bg_color; | ||||
|       .message-title { color: $fg_color } | ||||
|       .message-title { color: $fg_color; } | ||||
|       .message-content { color: $fg_color; } | ||||
|     } | ||||
|  | ||||
| @@ -1678,20 +1648,6 @@ StScrollBar { | ||||
|       border: none; | ||||
|     } | ||||
|   } | ||||
|   .summary-source-counter { | ||||
|     font-size: 10pt; | ||||
|     font-weight: bold; | ||||
|     height: 1.6em; width: 1.6em; | ||||
|     -shell-counter-overlap-x: 3px; | ||||
|     -shell-counter-overlap-y: 3px; | ||||
|     background-color: $selected_bg_color; | ||||
|     color: $selected_fg_color; | ||||
|     border: 2px solid $fg_color; | ||||
|     box-shadow: 0 2px 2px rgba(0,0,0,0.5); | ||||
|     border-radius: 0.9em; // should be 0.8 but whatever; wish I could do 50%; | ||||
|   } | ||||
|  | ||||
|   .secondary-icon { icon-size: 1.09em; } | ||||
|  | ||||
|   //chat bubbles | ||||
|   .chat-body { spacing: 5px; } | ||||
| @@ -1708,9 +1664,8 @@ StScrollBar { | ||||
|     &:rtl { padding-left: 0; padding-right: 18pt; } | ||||
|   } | ||||
|   .chat-meta-message { | ||||
|     @extend %caption-heading; | ||||
|     padding-left: 4px; | ||||
|     font-size: 9pt; | ||||
|     font-weight: bold; | ||||
|     color: lighten($fg_color,18%); | ||||
|     &:rtl { padding-left: 0; padding-right: 4px; } | ||||
|   } | ||||
| @@ -1796,36 +1751,30 @@ StScrollBar { | ||||
|   } | ||||
|  | ||||
|   .keyboard-key { | ||||
|     $_key_bg: opacify(lighten($osd_bg_color, 9%), 1); | ||||
|     background-color: $_key_bg; | ||||
|     background-color: #393f3f; | ||||
|     min-height: 1.2em; | ||||
|     min-width: 1.2em; | ||||
|     font-size: 16pt; | ||||
|     border-radius: $button_radius; | ||||
|     border: 1px solid $osd_outer_borders_color; | ||||
|     color: $osd_fg_color; | ||||
|     border-radius: 3px; | ||||
|     border: 1px solid #464d4d; | ||||
|     color: #e5e5e5; | ||||
|     &:focus { @include button(focus); } | ||||
|     &:hover, &:checked { background-color: lighten($_key_bg, 3%); } | ||||
|     &:active { background-color: darken($_key_bg, 2%); } | ||||
|     &:hover,&:checked { @include button(hover); } | ||||
|     &:active { @include button(active);} | ||||
|     &:grayed { //FIXME | ||||
|       background-color: $osd_bg_color; | ||||
|       color: $osd_fg_color; | ||||
|       border-color: $osd_borders_color; | ||||
|     } | ||||
|     &.default-key { | ||||
|       $_default_key_bg: opacify($osd_bg_color, 1); | ||||
|       border-color: $osd_outer_borders_color; | ||||
|       background-color: $_default_key_bg; | ||||
|       border-color: #2d3232; | ||||
|       background-color: #1d2020; | ||||
|       background-size: 20px; | ||||
|       &:hover, &:checked { background-color: lighten($_default_key_bg, 3%); } | ||||
|       &:active { background-color: darken($_default_key_bg, 2%); } | ||||
|     } | ||||
|     &.enter-key { | ||||
|       border-color: lighten($selected_bg_color, 5%); | ||||
|       background-color: $selected_bg_color; | ||||
|       border-color: #005684; | ||||
|       background-color: #006098; | ||||
|       background-image: url("resource:///org/gnome/shell/theme/key-enter.svg"); | ||||
|       &:hover, &:checked { background-color: lighten($selected_bg_color, 3%); } | ||||
|       &:active { background-color: darken($selected_bg_color, 2%); } | ||||
|     } | ||||
|     &.shift-key-lowercase { | ||||
|       background-image: url("resource:///org/gnome/shell/theme/key-shift.svg"); | ||||
| @@ -1864,8 +1813,8 @@ StScrollBar { | ||||
|  | ||||
| .emoji-panel { | ||||
|   .keyboard-key:latched { | ||||
|     border-color: lighten($selected_bg_color, 5%); | ||||
|     background-color: $selected_bg_color; | ||||
|     border-color: #005684; | ||||
|     background-color: #006098; | ||||
|   } | ||||
| } | ||||
|  | ||||
| @@ -1929,7 +1878,7 @@ StScrollBar { | ||||
|  | ||||
|   StEntry { | ||||
|     @extend %search_entry; | ||||
|     border-radius: $button_radius; | ||||
|     border-radius: 5px; | ||||
|     @if $variant=='dark' { | ||||
|       $_gdm_entry_bg: transparentize(lighten(desaturate(#241f31, 20%), 2%), 0.5); | ||||
|       background-color: $_gdm_entry_bg; | ||||
| @@ -2002,8 +1951,7 @@ StScrollBar { | ||||
|     } | ||||
|   } | ||||
|   .login-dialog-not-listed-label { | ||||
|     font-size: 90%; | ||||
|     font-weight: bold; | ||||
|     @extend %heading; | ||||
|     color: darken($osd_fg_color,30%); | ||||
|     padding-top: 1em; | ||||
|   } | ||||
| @@ -2032,8 +1980,7 @@ StScrollBar { | ||||
|   .login-dialog-username, | ||||
|   .user-widget-label { | ||||
|     color: $osd_fg_color; | ||||
|     font-size: 120%; | ||||
|     font-weight: bold; | ||||
|     @extend %title-3; | ||||
|     text-align: left; | ||||
|     padding-left: 15px; | ||||
|   } | ||||
| @@ -2051,7 +1998,6 @@ StScrollBar { | ||||
|  | ||||
|   .login-dialog-prompt-label { | ||||
|       color: darken($osd_fg_color, 20%); | ||||
|       font-size: 110%; | ||||
|       padding-top: 1em; | ||||
|   } | ||||
|  | ||||
| @@ -2123,7 +2069,7 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726); | ||||
|  | ||||
|  | ||||
| .screen-shield-notification-label { | ||||
|   font-weight: bold; | ||||
|   @extend %heading; | ||||
|   padding: 0px 0px 0px 12px; | ||||
| } | ||||
|  | ||||
| @@ -2163,9 +2109,9 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726); | ||||
|   } | ||||
|   .labels { spacing: 4px; } | ||||
|   .notebook-tab { | ||||
|     @extend %heading; | ||||
|     -natural-hpadding: 12px; | ||||
|     -minimum-hpadding: 6px; | ||||
|     font-weight: bold; | ||||
|     color: #ccc; | ||||
|     transition-duration: 100ms; | ||||
|     padding-left: .3em; | ||||
| @@ -2226,7 +2172,7 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726); | ||||
|   } | ||||
|  | ||||
|   .lg-extension-name { | ||||
|       font-weight: bold; | ||||
|       @extend %heading; | ||||
|   } | ||||
|  | ||||
|   .lg-extension-meta { | ||||
| @@ -2239,3 +2185,39 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726); | ||||
|     border-radius: 4px; | ||||
|     padding: 6px; | ||||
|   } | ||||
|  | ||||
| // text styles | ||||
|  | ||||
| %large-title { | ||||
|   font-weight: 300; | ||||
|   font-size: 24pt; | ||||
| // letter-spacing: 0.2rem; this breaks the style | ||||
| } | ||||
| %title-1 { | ||||
|   font-weight: 800; | ||||
|   font-size: 20pt; | ||||
| } | ||||
| %title-2 { | ||||
|   font-weight: 800; | ||||
|   font-size: 15pt; | ||||
| } | ||||
| %title-3 { | ||||
|   font-weight: 700; | ||||
|   font-size: 15pt; | ||||
| } | ||||
| %title-4 { | ||||
|   font-weight: 700; | ||||
|   font-size: 13pt; | ||||
| } | ||||
| %heading { | ||||
|   font-weight: 700; | ||||
|   font-size: 11pt; | ||||
| } | ||||
| %caption-heading { | ||||
|   font-weight: 700; | ||||
|   font-size: 9pt; | ||||
| } | ||||
| %caption { | ||||
|   font-weight: 400; | ||||
|   font-size: 9pt; | ||||
| } | ||||
|   | ||||
| @@ -28,7 +28,7 @@ foreach iface : ifaces | ||||
|     output: 'doc-gen-' + iface[1], | ||||
|     command: [ | ||||
|       'gdbus-codegen', | ||||
|       '--interface-prefix=@0@.'.format(iface[0]), | ||||
|       '--interface-prefix=@0@.'.format(iface), | ||||
|       '--generate-docbook', 'doc-gen', | ||||
|       '--output-directory', '@OUTDIR@', | ||||
|       '@INPUT@' | ||||
|   | ||||
| @@ -31,34 +31,34 @@ its dependencies to build from tarballs.</description> | ||||
|   <programming-language>JavaScript</programming-language> | ||||
|   <programming-language>C</programming-language> | ||||
|  | ||||
|   <author> | ||||
|   <maintainer> | ||||
|     <foaf:Person> | ||||
|       <foaf:name>William Jon McCann</foaf:name> | ||||
|       <foaf:mbox rdf:resource="mailto:jmccann@redhat.com" /> | ||||
|       <gnome:userid>mccann</gnome:userid> | ||||
|     </foaf:Person> | ||||
|   </author> | ||||
|   <author> | ||||
|   </maintainer> | ||||
|   <maintainer> | ||||
|     <foaf:Person> | ||||
|       <foaf:name>Owen Taylor</foaf:name> | ||||
|       <foaf:mbox rdf:resource="mailto:otaylor@redhat.com" /> | ||||
|       <gnome:userid>otaylor</gnome:userid> | ||||
|     </foaf:Person> | ||||
|   </author> | ||||
|   <author> | ||||
|   </maintainer> | ||||
|   <maintainer> | ||||
|     <foaf:Person> | ||||
|       <foaf:name>Colin Walters</foaf:name> | ||||
|       <foaf:mbox rdf:resource="mailto:walters@verbum.org" /> | ||||
|       <gnome:userid>walters</gnome:userid> | ||||
|     </foaf:Person> | ||||
|   </author> | ||||
|   <author> | ||||
|   </maintainer> | ||||
|   <maintainer> | ||||
|     <foaf:Person> | ||||
|       <foaf:name>Marina Zhurakhinskaya</foaf:name> | ||||
|       <foaf:mbox rdf:resource="mailto:marinaz@redhat.com" /> | ||||
|       <gnome:userid>marinaz</gnome:userid> | ||||
|     </foaf:Person> | ||||
|   </author> | ||||
|   </maintainer> | ||||
|   <maintainer> | ||||
|     <foaf:Person> | ||||
|       <foaf:name>Florian Müllner</foaf:name> | ||||
|   | ||||
| @@ -1,7 +1,3 @@ | ||||
| /* exported main */ | ||||
| imports.gi.versions.Gdk = '3.0'; | ||||
| imports.gi.versions.Gtk = '3.0'; | ||||
|  | ||||
| const Gettext = imports.gettext; | ||||
| const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi; | ||||
| const Format = imports.format; | ||||
| @@ -12,8 +8,6 @@ const Config = imports.misc.config; | ||||
| const ExtensionUtils = imports.misc.extensionUtils; | ||||
| const { loadInterfaceXML } = imports.misc.fileUtils; | ||||
|  | ||||
| const { ExtensionState } = ExtensionUtils; | ||||
|  | ||||
| const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions'); | ||||
| const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface); | ||||
|  | ||||
| @@ -23,54 +17,74 @@ function stripPrefix(string, prefix) { | ||||
|     return string; | ||||
| } | ||||
|  | ||||
| var Application = GObject.registerClass({ | ||||
|     GTypeName: 'ExtensionPrefs_Application' | ||||
| }, class Application extends Gtk.Application { | ||||
|     _init() { | ||||
| var Application = class { | ||||
|     constructor() { | ||||
|         GLib.set_prgname('gnome-shell-extension-prefs'); | ||||
|         super._init({ | ||||
|         this.application = new Gtk.Application({ | ||||
|             application_id: 'org.gnome.shell.ExtensionPrefs', | ||||
|             flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE | ||||
|         }); | ||||
|  | ||||
|         this.application.connect('activate', this._onActivate.bind(this)); | ||||
|         this.application.connect('command-line', this._onCommandLine.bind(this)); | ||||
|         this.application.connect('startup', this._onStartup.bind(this)); | ||||
|  | ||||
|         this._extensionPrefsModules = {}; | ||||
|  | ||||
|         this._startupUuid = null; | ||||
|         this._loaded = false; | ||||
|         this._skipMainWindow = false; | ||||
|         this._shellProxy = null; | ||||
|     } | ||||
|  | ||||
|     get shellProxy() { | ||||
|         return this._shellProxy; | ||||
|     } | ||||
|     _extensionAvailable(uuid) { | ||||
|         let extension = ExtensionUtils.extensions[uuid]; | ||||
|  | ||||
|     _showPrefs(uuid) { | ||||
|         let row = this._extensionSelector.get_children().find(c => { | ||||
|             return c.uuid === uuid && c.hasPrefs; | ||||
|         }); | ||||
|  | ||||
|         if (!row) | ||||
|         if (!extension) | ||||
|             return false; | ||||
|  | ||||
|         if (!extension.dir.get_child('prefs.js').query_exists(null)) | ||||
|             return false; | ||||
|  | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     _getExtensionPrefsModule(extension) { | ||||
|         let uuid = extension.metadata.uuid; | ||||
|  | ||||
|         if (this._extensionPrefsModules.hasOwnProperty(uuid)) | ||||
|             return this._extensionPrefsModules[uuid]; | ||||
|  | ||||
|         ExtensionUtils.installImporter(extension); | ||||
|  | ||||
|         let prefsModule = extension.imports.prefs; | ||||
|         prefsModule.init(extension.metadata); | ||||
|  | ||||
|         this._extensionPrefsModules[uuid] = prefsModule; | ||||
|         return prefsModule; | ||||
|     } | ||||
|  | ||||
|     _selectExtension(uuid) { | ||||
|         if (!this._extensionAvailable(uuid)) | ||||
|             return; | ||||
|  | ||||
|         let extension = ExtensionUtils.extensions[uuid]; | ||||
|         let widget; | ||||
|  | ||||
|         try { | ||||
|             widget = row.prefsModule.buildPrefsWidget(); | ||||
|             let prefsModule = this._getExtensionPrefsModule(extension); | ||||
|             widget = prefsModule.buildPrefsWidget(); | ||||
|         } catch (e) { | ||||
|             widget = this._buildErrorUI(row, e); | ||||
|             widget = this._buildErrorUI(extension, e); | ||||
|         } | ||||
|  | ||||
|         let dialog = new Gtk.Window({ | ||||
|             modal: !this._skipMainWindow, | ||||
|             type_hint: Gdk.WindowTypeHint.DIALOG | ||||
|         }); | ||||
|         dialog.set_titlebar(new Gtk.HeaderBar({ | ||||
|             show_close_button: true, | ||||
|             title: row.name, | ||||
|             visible: true | ||||
|         })); | ||||
|         let dialog = new Gtk.Window({ modal: !this._skipMainWindow, | ||||
|                                       type_hint: Gdk.WindowTypeHint.DIALOG }); | ||||
|         dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true, | ||||
|                                                 title: extension.metadata.name, | ||||
|                                                 visible: true })); | ||||
|  | ||||
|         if (this._skipMainWindow) { | ||||
|             this.add_window(dialog); | ||||
|             this.application.add_window(dialog); | ||||
|             if (this._window) | ||||
|                 this._window.destroy(); | ||||
|             this._window = dialog; | ||||
| @@ -82,11 +96,9 @@ var Application = GObject.registerClass({ | ||||
|         dialog.set_default_size(600, 400); | ||||
|         dialog.add(widget); | ||||
|         dialog.show(); | ||||
|  | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     _buildErrorUI(row, exc) { | ||||
|     _buildErrorUI(extension, exc) { | ||||
|         let scroll = new Gtk.ScrolledWindow({ | ||||
|             hscrollbar_policy: Gtk.PolicyType.NEVER, | ||||
|             propagate_natural_height: true | ||||
| @@ -156,20 +168,13 @@ var Application = GObject.registerClass({ | ||||
|  | ||||
|         copyButton.connect('clicked', w => { | ||||
|             let clipboard = Gtk.Clipboard.get_default(w.get_display()); | ||||
|             // markdown for pasting in gitlab issues | ||||
|             let lines = [ | ||||
|                 `The settings of extension ${row.uuid} had an error:`, | ||||
|                 '```', | ||||
|                 `${exc}`, | ||||
|                 '```', | ||||
|                 '', | ||||
|                 'Stack trace:', | ||||
|                 '```', | ||||
|                 exc.stack.replace(/\n$/, ''), // stack without trailing newline | ||||
|                 '```', | ||||
|                 '' | ||||
|             ]; | ||||
|             clipboard.set_text(lines.join('\n'), -1); | ||||
|             let backticks = '```'; | ||||
|             clipboard.set_text( | ||||
|                 // markdown for pasting in gitlab issues | ||||
|                 `The settings of extension ${extension.uuid} had an error:\n${ | ||||
|                 backticks}\n${exc}\n${backticks}\n\nStack trace:\n${ | ||||
|                 backticks}\n${exc.stack}${backticks}\n`, -1 | ||||
|             ); | ||||
|         }); | ||||
|  | ||||
|         let spacing = new Gtk.SeparatorToolItem({ draw: false }); | ||||
| @@ -180,13 +185,13 @@ var Application = GObject.registerClass({ | ||||
|             label: _("Homepage"), | ||||
|             tooltip_text: _("Visit extension homepage"), | ||||
|             no_show_all: true, | ||||
|             visible: row.url != null | ||||
|             visible: extension.metadata.url != null | ||||
|         }); | ||||
|         toolbar.add(urlButton); | ||||
|  | ||||
|         urlButton.connect('clicked', w => { | ||||
|             let context = w.get_display().get_app_launch_context(); | ||||
|             Gio.AppInfo.launch_default_for_uri(row.url, context); | ||||
|             Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context); | ||||
|         }); | ||||
|  | ||||
|         let expandedBox = new Gtk.Box({ | ||||
| @@ -201,8 +206,8 @@ var Application = GObject.registerClass({ | ||||
|         return scroll; | ||||
|     } | ||||
|  | ||||
|     _buildUI() { | ||||
|         this._window = new Gtk.ApplicationWindow({ application: this, | ||||
|     _buildUI(app) { | ||||
|         this._window = new Gtk.ApplicationWindow({ application: app, | ||||
|                                                    window_position: Gtk.WindowPosition.CENTER }); | ||||
|  | ||||
|         this._window.set_default_size(800, 500); | ||||
| @@ -236,14 +241,18 @@ var Application = GObject.registerClass({ | ||||
|         this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder'); | ||||
|  | ||||
|         this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell'); | ||||
|         this._shellProxy.connectSignal('ExtensionStateChanged', | ||||
|             this._onExtensionStateChanged.bind(this)); | ||||
|         this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => { | ||||
|             if (ExtensionUtils.extensions[uuid] !== undefined) | ||||
|                 this._scanExtensions(); | ||||
|         }); | ||||
|  | ||||
|         this._window.show_all(); | ||||
|     } | ||||
|  | ||||
|     _sortList(row1, row2) { | ||||
|         return row1.name.localeCompare(row2.name); | ||||
|         let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name; | ||||
|         let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name; | ||||
|         return name1.localeCompare(name2); | ||||
|     } | ||||
|  | ||||
|     _updateHeader(row, before) { | ||||
| @@ -254,56 +263,19 @@ var Application = GObject.registerClass({ | ||||
|         row.set_header(sep); | ||||
|     } | ||||
|  | ||||
|     _findExtensionRow(uuid) { | ||||
|         return this._extensionSelector.get_children().find(c => c.uuid === uuid); | ||||
|     } | ||||
|  | ||||
|     _onExtensionStateChanged(proxy, senderName, [uuid, newState]) { | ||||
|         let row = this._findExtensionRow(uuid); | ||||
|         if (row) { | ||||
|             let { state } = ExtensionUtils.deserializeExtension(newState); | ||||
|             if (state == ExtensionState.UNINSTALLED) | ||||
|                 row.destroy(); | ||||
|             return; // we only deal with new and deleted extensions here | ||||
|         } | ||||
|  | ||||
|         this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => { | ||||
|             let extension = ExtensionUtils.deserializeExtension(serialized); | ||||
|             if (!extension) | ||||
|                 return; | ||||
|             // check the extension wasn't added in between | ||||
|             if (this._findExtensionRow(uuid) != null) | ||||
|                 return; | ||||
|             this._addExtensionRow(extension); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     _scanExtensions() { | ||||
|         this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => { | ||||
|             if (e) { | ||||
|                 if (e instanceof Gio.DBusError) { | ||||
|                     log(`Failed to connect to shell proxy: ${e}`); | ||||
|                     this._mainStack.add_named(new NoShellPlaceholder(), 'noshell'); | ||||
|                     this._mainStack.visible_child_name = 'noshell'; | ||||
|                 } else { | ||||
|                     throw e; | ||||
|                 } | ||||
|                 return; | ||||
|             } | ||||
|  | ||||
|             for (let uuid in extensionsMap) { | ||||
|                 let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]); | ||||
|                 this._addExtensionRow(extension); | ||||
|             } | ||||
|             this._extensionsLoaded(); | ||||
|         }); | ||||
|         let finder = new ExtensionUtils.ExtensionFinder(); | ||||
|         finder.connect('extension-found', this._extensionFound.bind(this)); | ||||
|         finder.scanExtensions(); | ||||
|         this._extensionsLoaded(); | ||||
|     } | ||||
|  | ||||
|     _addExtensionRow(extension) { | ||||
|         let row = new ExtensionRow(extension); | ||||
|     _extensionFound(finder, extension) { | ||||
|         let row = new ExtensionRow(extension.uuid); | ||||
|  | ||||
|         row.prefsButton.visible = this._extensionAvailable(row.uuid); | ||||
|         row.prefsButton.connect('clicked', () => { | ||||
|             this._showPrefs(row.uuid); | ||||
|             this._selectExtension(row.uuid); | ||||
|         }); | ||||
|  | ||||
|         row.show_all(); | ||||
| @@ -316,26 +288,24 @@ var Application = GObject.registerClass({ | ||||
|         else | ||||
|             this._mainStack.visible_child_name = 'placeholder'; | ||||
|  | ||||
|         if (this._startupUuid) | ||||
|             this._showPrefs(this._startupUuid); | ||||
|         if (this._startupUuid && this._extensionAvailable(this._startupUuid)) | ||||
|             this._selectExtension(this._startupUuid); | ||||
|         this._startupUuid = null; | ||||
|         this._skipMainWindow = false; | ||||
|         this._loaded = true; | ||||
|     } | ||||
|  | ||||
|     vfunc_activate() { | ||||
|     _onActivate() { | ||||
|         this._window.present(); | ||||
|     } | ||||
|  | ||||
|     vfunc_startup() { | ||||
|         super.vfunc_startup(); | ||||
|  | ||||
|         this._buildUI(); | ||||
|     _onStartup(app) { | ||||
|         this._buildUI(app); | ||||
|         this._scanExtensions(); | ||||
|     } | ||||
|  | ||||
|     vfunc_command_line(commandLine) { | ||||
|         this.activate(); | ||||
|     _onCommandLine(app, commandLine) { | ||||
|         app.activate(); | ||||
|         let args = commandLine.get_arguments(); | ||||
|  | ||||
|         if (args.length) { | ||||
| @@ -346,14 +316,16 @@ var Application = GObject.registerClass({ | ||||
|             // Strip off "extension:///" prefix which fakes a URI, if it exists | ||||
|             uuid = stripPrefix(uuid, "extension:///"); | ||||
|  | ||||
|             if (!this._loaded) | ||||
|             if (this._extensionAvailable(uuid)) | ||||
|                 this._selectExtension(uuid); | ||||
|             else if (!this._loaded) | ||||
|                 this._startupUuid = uuid; | ||||
|             else if (!this._showPrefs(uuid)) | ||||
|             else | ||||
|                 this._skipMainWindow = false; | ||||
|         } | ||||
|         return 0; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var Expander = GObject.registerClass({ | ||||
|     Properties: { | ||||
| @@ -520,35 +492,6 @@ class EmptyPlaceholder extends Gtk.Box { | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var NoShellPlaceholder = GObject.registerClass( | ||||
| class NoShellPlaceholder extends Gtk.Box { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             orientation: Gtk.Orientation.VERTICAL, | ||||
|             spacing: 12, | ||||
|             margin: 100, | ||||
|             margin_bottom: 60 | ||||
|         }); | ||||
|  | ||||
|         let label = new Gtk.Label({ | ||||
|             label: '<span size="x-large">%s</span>'.format( | ||||
|                 _("Something’s gone wrong")), | ||||
|             use_markup: true | ||||
|         }); | ||||
|         label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL); | ||||
|         this.add(label); | ||||
|  | ||||
|         label = new Gtk.Label({ | ||||
|             label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."), | ||||
|             justify: Gtk.Justification.CENTER, | ||||
|             wrap: true | ||||
|         }); | ||||
|         this.add(label); | ||||
|  | ||||
|         this.show_all(); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var DescriptionLabel = GObject.registerClass( | ||||
| class DescriptionLabel extends Gtk.Label { | ||||
|     vfunc_get_preferred_height_for_width(width) { | ||||
| @@ -561,59 +504,30 @@ class DescriptionLabel extends Gtk.Label { | ||||
|  | ||||
| var ExtensionRow = GObject.registerClass( | ||||
| class ExtensionRow extends Gtk.ListBoxRow { | ||||
|     _init(extension) { | ||||
|     _init(uuid) { | ||||
|         super._init(); | ||||
|  | ||||
|         this._app = Gio.Application.get_default(); | ||||
|         this._extension = extension; | ||||
|         this._prefsModule = null; | ||||
|         this.uuid = uuid; | ||||
|  | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' }); | ||||
|         this._settings.connect('changed::enabled-extensions', () => { | ||||
|             this._switch.state = this._isEnabled(); | ||||
|         }); | ||||
|         this._settings.connect('changed::disable-extension-version-validation', | ||||
|             () => { | ||||
|                 this._switch.sensitive = this._canEnable(); | ||||
|             }); | ||||
|         this._settings.connect('changed::disable-user-extensions', | ||||
|             () => { | ||||
|                 this._switch.sensitive = this._canEnable(); | ||||
|             }); | ||||
|  | ||||
|         this._buildUI(); | ||||
|  | ||||
|         this._extensionStateChangedId = this._app.shellProxy.connectSignal( | ||||
|             'ExtensionStateChanged', (p, sender, [uuid, newState]) => { | ||||
|                 if (this.uuid !== uuid) | ||||
|                     return; | ||||
|  | ||||
|                 this._extension = ExtensionUtils.deserializeExtension(newState); | ||||
|                 let state = (this._extension.state == ExtensionState.ENABLED); | ||||
|  | ||||
|                 GObject.signal_handler_block(this._switch, this._notifyActiveId); | ||||
|                 this._switch.state = state; | ||||
|                 GObject.signal_handler_unblock(this._switch, this._notifyActiveId); | ||||
|  | ||||
|                 this._switch.sensitive = this._canToggle(); | ||||
|             }); | ||||
|     } | ||||
|  | ||||
|     get uuid() { | ||||
|         return this._extension.uuid; | ||||
|     } | ||||
|  | ||||
|     get name() { | ||||
|         return this._extension.metadata.name; | ||||
|     } | ||||
|  | ||||
|     get hasPrefs() { | ||||
|         return this._extension.hasPrefs; | ||||
|     } | ||||
|  | ||||
|     get url() { | ||||
|         return this._extension.metadata.url; | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
|         if (!this._app.shellProxy) | ||||
|             return; | ||||
|  | ||||
|         if (this._extensionStateChangedId) | ||||
|             this._app.shellProxy.disconnectSignal(this._extensionStateChangedId); | ||||
|         this._extensionStateChangedId = 0; | ||||
|     } | ||||
|  | ||||
|     _buildUI() { | ||||
|         let extension = ExtensionUtils.extensions[this.uuid]; | ||||
|  | ||||
|         let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL, | ||||
|                                  hexpand: true, margin_end: 24, spacing: 24, | ||||
|                                  margin: 12 }); | ||||
| @@ -623,20 +537,19 @@ class ExtensionRow extends Gtk.ListBoxRow { | ||||
|                                  spacing: 6, hexpand: true }); | ||||
|         hbox.add(vbox); | ||||
|  | ||||
|         let name = GLib.markup_escape_text(this.name, -1); | ||||
|         let name = GLib.markup_escape_text(extension.metadata.name, -1); | ||||
|         let label = new Gtk.Label({ label: '<b>' + name + '</b>', | ||||
|                                     use_markup: true, | ||||
|                                     halign: Gtk.Align.START }); | ||||
|         vbox.add(label); | ||||
|  | ||||
|         let desc = this._extension.metadata.description.split('\n')[0]; | ||||
|         let desc = extension.metadata.description.split('\n')[0]; | ||||
|         label = new DescriptionLabel({ label: desc, wrap: true, lines: 2, | ||||
|                                        ellipsize: Pango.EllipsizeMode.END, | ||||
|                                        xalign: 0, yalign: 0 }); | ||||
|         vbox.add(label); | ||||
|  | ||||
|         let button = new Gtk.Button({ valign: Gtk.Align.CENTER, | ||||
|                                       visible: this.hasPrefs, | ||||
|                                       no_show_all: true }); | ||||
|         button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic', | ||||
|                                          icon_size: Gtk.IconSize.BUTTON, | ||||
| @@ -646,37 +559,51 @@ class ExtensionRow extends Gtk.ListBoxRow { | ||||
|  | ||||
|         this.prefsButton = button; | ||||
|  | ||||
|         this._switch = new Gtk.Switch({ | ||||
|             valign: Gtk.Align.CENTER, | ||||
|             sensitive: this._canToggle(), | ||||
|             state: this._extension.state === ExtensionState.ENABLED | ||||
|         }); | ||||
|         this._notifyActiveId = this._switch.connect('notify::active', () => { | ||||
|         this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER, | ||||
|                                         sensitive: this._canEnable(), | ||||
|                                         state: this._isEnabled() }); | ||||
|         this._switch.connect('notify::active', () => { | ||||
|             if (this._switch.active) | ||||
|                 this._app.shellProxy.EnableExtensionRemote(this.uuid); | ||||
|                 this._enable(); | ||||
|             else | ||||
|                 this._app.shellProxy.DisableExtensionRemote(this.uuid); | ||||
|                 this._disable(); | ||||
|         }); | ||||
|         this._switch.connect('state-set', () => true); | ||||
|         hbox.add(this._switch); | ||||
|     } | ||||
|  | ||||
|     _canToggle() { | ||||
|         return this._extension.canChange; | ||||
|     _canEnable() { | ||||
|         let extension = ExtensionUtils.extensions[this.uuid]; | ||||
|         let checkVersion = !this._settings.get_boolean('disable-extension-version-validation'); | ||||
|  | ||||
|         return !this._settings.get_boolean('disable-user-extensions') && | ||||
|                !(checkVersion && ExtensionUtils.isOutOfDate(extension)); | ||||
|     } | ||||
|  | ||||
|     get prefsModule() { | ||||
|         if (!this._prefsModule) { | ||||
|             ExtensionUtils.installImporter(this._extension); | ||||
|     _isEnabled() { | ||||
|         let extensions = this._settings.get_strv('enabled-extensions'); | ||||
|         return extensions.indexOf(this.uuid) != -1; | ||||
|     } | ||||
|  | ||||
|             // give extension prefs access to their own extension object | ||||
|             ExtensionUtils.getCurrentExtension = () => this._extension; | ||||
|     _enable() { | ||||
|         let extensions = this._settings.get_strv('enabled-extensions'); | ||||
|         if (extensions.indexOf(this.uuid) != -1) | ||||
|             return; | ||||
|  | ||||
|             this._prefsModule = this._extension.imports.prefs; | ||||
|             this._prefsModule.init(this._extension.metadata); | ||||
|         } | ||||
|         extensions.push(this.uuid); | ||||
|         this._settings.set_strv('enabled-extensions', extensions); | ||||
|     } | ||||
|  | ||||
|         return this._prefsModule; | ||||
|     _disable() { | ||||
|         let extensions = this._settings.get_strv('enabled-extensions'); | ||||
|         let pos = extensions.indexOf(this.uuid); | ||||
|         if (pos == -1) | ||||
|             return; | ||||
|         do { | ||||
|             extensions.splice(pos, 1); | ||||
|             pos = extensions.indexOf(this.uuid); | ||||
|         } while (pos != -1); | ||||
|         this._settings.set_strv('enabled-extensions', extensions); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| @@ -684,12 +611,12 @@ function initEnvironment() { | ||||
|     // Monkey-patch in a "global" object that fakes some Shell utilities | ||||
|     // that ExtensionUtils depends on. | ||||
|     window.global = { | ||||
|         log(...args) { | ||||
|             print(args.join(', ')); | ||||
|         log() { | ||||
|             print([].join.call(arguments, ', ')); | ||||
|         }, | ||||
|  | ||||
|         logError(s) { | ||||
|             log(`ERROR: ${s}`); | ||||
|             log('ERROR: ' + s); | ||||
|         }, | ||||
|  | ||||
|         userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell']) | ||||
| @@ -704,5 +631,6 @@ function main(argv) { | ||||
|     Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR); | ||||
|     Gettext.textdomain(Config.GETTEXT_PACKAGE); | ||||
|  | ||||
|     new Application().run(argv); | ||||
|     let app = new Application(); | ||||
|     app.application.run(argv); | ||||
| } | ||||
|   | ||||
| @@ -1,20 +1,21 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported AuthPrompt */ | ||||
|  | ||||
| const { Clutter, GObject, Pango, Shell, St } = imports.gi; | ||||
| const { Clutter, Pango, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Animation = imports.ui.animation; | ||||
| const Batch = imports.gdm.batch; | ||||
| const GdmUtil = imports.gdm.util; | ||||
| const Params = imports.misc.params; | ||||
| const ShellEntry = imports.ui.shellEntry; | ||||
| const Tweener = imports.ui.tweener; | ||||
| const UserWidget = imports.ui.userWidget; | ||||
|  | ||||
| var DEFAULT_BUTTON_WELL_ICON_SIZE = 16; | ||||
| var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000; | ||||
| var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300; | ||||
| var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0; | ||||
| var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3; | ||||
|  | ||||
| var MESSAGE_FADE_OUT_ANIMATION_TIME = 500; | ||||
| var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5; | ||||
|  | ||||
| var AuthPromptMode = { | ||||
|     UNLOCK_ONLY: 0, | ||||
| @@ -33,21 +34,8 @@ var BeginRequestType = { | ||||
|     DONT_PROVIDE_USERNAME: 1 | ||||
| }; | ||||
|  | ||||
| var AuthPrompt = GObject.registerClass({ | ||||
|     Signals: { | ||||
|         'cancelled': {}, | ||||
|         'failed': {}, | ||||
|         'next': {}, | ||||
|         'prompted': {}, | ||||
|         'reset': { param_types: [GObject.TYPE_UINT] }, | ||||
|     } | ||||
| }, class AuthPrompt extends St.BoxLayout { | ||||
|     _init(gdmClient, mode) { | ||||
|         super._init({ | ||||
|             style_class: 'login-dialog-prompt-layout', | ||||
|             vertical: true | ||||
|         }); | ||||
|  | ||||
| var AuthPrompt = class { | ||||
|     constructor(gdmClient, mode) { | ||||
|         this.verificationStatus = AuthPromptStatus.NOT_VERIFYING; | ||||
|  | ||||
|         this._gdmClient = gdmClient; | ||||
| @@ -71,42 +59,47 @@ var AuthPrompt = GObject.registerClass({ | ||||
|         this.smartcardDetected = this._userVerifier.smartcardDetected; | ||||
|  | ||||
|         this.connect('next', () => { | ||||
|             this.updateSensitivity(false); | ||||
|             this.startSpinning(); | ||||
|             if (this._queryingService) { | ||||
|                 this._userVerifier.answerQuery(this._queryingService, this._entry.text); | ||||
|             } else { | ||||
|                 this._preemptiveAnswer = this._entry.text; | ||||
|             } | ||||
|         }); | ||||
|                 this.updateSensitivity(false); | ||||
|                 this.startSpinning(); | ||||
|                 if (this._queryingService) { | ||||
|                     this._userVerifier.answerQuery(this._queryingService, this._entry.text); | ||||
|                 } else { | ||||
|                     this._preemptiveAnswer = this._entry.text; | ||||
|                 } | ||||
|             }); | ||||
|  | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this.actor = new St.BoxLayout({ style_class: 'login-dialog-prompt-layout', | ||||
|                                         vertical: true }); | ||||
|         this.actor.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this.actor.connect('key-press-event', (actor, event) => { | ||||
|                 if (event.get_key_symbol() == Clutter.KEY_Escape) | ||||
|                     this.cancel(); | ||||
|                 return Clutter.EVENT_PROPAGATE; | ||||
|             }); | ||||
|  | ||||
|         this._userWell = new St.Bin({ x_fill: true, x_align: St.Align.START }); | ||||
|         this.add(this._userWell, { | ||||
|             x_align: St.Align.START, | ||||
|             x_fill: true, | ||||
|             y_fill: true, | ||||
|             expand: true | ||||
|         }); | ||||
|         this._userWell = new St.Bin({ x_fill: true, | ||||
|                                       x_align: St.Align.START }); | ||||
|         this.actor.add(this._userWell, | ||||
|                        { x_align: St.Align.START, | ||||
|                          x_fill: true, | ||||
|                          y_fill: true, | ||||
|                          expand: true }); | ||||
|         this._label = new St.Label({ style_class: 'login-dialog-prompt-label' }); | ||||
|  | ||||
|         this.add(this._label, { | ||||
|             expand: true, | ||||
|             x_fill: false, | ||||
|             y_fill: true, | ||||
|             x_align: St.Align.START | ||||
|         }); | ||||
|         this.actor.add(this._label, | ||||
|                        { expand: true, | ||||
|                          x_fill: false, | ||||
|                          y_fill: true, | ||||
|                          x_align: St.Align.START }); | ||||
|         this._entry = new St.Entry({ style_class: 'login-dialog-prompt-entry', | ||||
|                                      can_focus: true }); | ||||
|         ShellEntry.addContextMenu(this._entry, { isPassword: true, actionMode: Shell.ActionMode.NONE }); | ||||
|  | ||||
|         this.add(this._entry, { | ||||
|             expand: true, | ||||
|             x_fill: true, | ||||
|             y_fill: false, | ||||
|             x_align: St.Align.START | ||||
|         }); | ||||
|         this.actor.add(this._entry, | ||||
|                        { expand: true, | ||||
|                          x_fill: true, | ||||
|                          y_fill: false, | ||||
|                          x_align: St.Align.START }); | ||||
|  | ||||
|         this._entry.grab_key_focus(); | ||||
|  | ||||
| @@ -114,15 +107,14 @@ var AuthPrompt = GObject.registerClass({ | ||||
|                                        styleClass: 'login-dialog-message' }); | ||||
|         this._message.clutter_text.line_wrap = true; | ||||
|         this._message.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; | ||||
|         this.add(this._message, { x_fill: false, x_align: St.Align.START, y_align: St.Align.START }); | ||||
|         this.actor.add(this._message, { x_fill: false, x_align: St.Align.START, y_align: St.Align.START }); | ||||
|  | ||||
|         this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box', | ||||
|                                              vertical: false }); | ||||
|         this.add(this._buttonBox, { | ||||
|             expand: true, | ||||
|             x_align: St.Align.MIDDLE, | ||||
|             y_align: St.Align.END | ||||
|         }); | ||||
|         this.actor.add(this._buttonBox, | ||||
|                        { expand:  true, | ||||
|                          x_align: St.Align.MIDDLE, | ||||
|                          y_align: St.Align.END }); | ||||
|  | ||||
|         this._defaultButtonWell = new St.Widget({ layout_manager: new Clutter.BinLayout() }); | ||||
|         this._defaultButtonWellActor = null; | ||||
| @@ -130,9 +122,9 @@ var AuthPrompt = GObject.registerClass({ | ||||
|         this._initButtons(); | ||||
|  | ||||
|         this._spinner = new Animation.Spinner(DEFAULT_BUTTON_WELL_ICON_SIZE); | ||||
|         this._spinner.opacity = 0; | ||||
|         this._spinner.show(); | ||||
|         this._defaultButtonWell.add_child(this._spinner); | ||||
|         this._spinner.actor.opacity = 0; | ||||
|         this._spinner.actor.show(); | ||||
|         this._defaultButtonWell.add_child(this._spinner.actor); | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
| @@ -140,19 +132,13 @@ var AuthPrompt = GObject.registerClass({ | ||||
|         this._userVerifier = null; | ||||
|     } | ||||
|  | ||||
|     vfunc_key_press_event(keyPressEvent) { | ||||
|         if (keyPressEvent.keyval == Clutter.KEY_Escape) | ||||
|             this.cancel(); | ||||
|         return Clutter.EVENT_PROPAGATE; | ||||
|     } | ||||
|  | ||||
|     _initButtons() { | ||||
|         this.cancelButton = new St.Button({ style_class: 'modal-dialog-button button', | ||||
|                                             button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, | ||||
|                                             reactive: true, | ||||
|                                             can_focus: true, | ||||
|                                             label: _("Cancel") }); | ||||
|         this.cancelButton.connect('clicked', () => this.cancel()); | ||||
|         this.cancelButton.connect('clicked', () => { this.cancel(); }); | ||||
|         this._buttonBox.add(this.cancelButton, | ||||
|                             { expand: false, | ||||
|                               x_fill: false, | ||||
| @@ -171,7 +157,7 @@ var AuthPrompt = GObject.registerClass({ | ||||
|                                           reactive: true, | ||||
|                                           can_focus: true, | ||||
|                                           label: _("Next") }); | ||||
|         this.nextButton.connect('clicked', () => this.emit('next')); | ||||
|         this.nextButton.connect('clicked', () => { this.emit('next'); }); | ||||
|         this.nextButton.add_style_pseudo_class('default'); | ||||
|         this._buttonBox.add(this.nextButton, | ||||
|                             { expand: false, | ||||
| @@ -281,16 +267,16 @@ var AuthPrompt = GObject.registerClass({ | ||||
|         let oldActor = this._defaultButtonWellActor; | ||||
|  | ||||
|         if (oldActor) | ||||
|             oldActor.remove_all_transitions(); | ||||
|             Tweener.removeTweens(oldActor); | ||||
|  | ||||
|         let wasSpinner; | ||||
|         if (oldActor == this._spinner) | ||||
|         if (oldActor == this._spinner.actor) | ||||
|             wasSpinner = true; | ||||
|         else | ||||
|             wasSpinner = false; | ||||
|  | ||||
|         let isSpinner; | ||||
|         if (actor == this._spinner) | ||||
|         if (actor == this._spinner.actor) | ||||
|             isSpinner = true; | ||||
|         else | ||||
|             isSpinner = false; | ||||
| @@ -304,18 +290,19 @@ var AuthPrompt = GObject.registerClass({ | ||||
|                         this._spinner.stop(); | ||||
|                 } | ||||
|             } else { | ||||
|                 oldActor.ease({ | ||||
|                     opacity: 0, | ||||
|                     duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME, | ||||
|                     delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY, | ||||
|                     mode: Clutter.AnimationMode.LINEAR, | ||||
|                     onComplete: () => { | ||||
|                         if (wasSpinner) { | ||||
|                             if (this._spinner) | ||||
|                                 this._spinner.stop(); | ||||
|                         } | ||||
|                     } | ||||
|                 }); | ||||
|                 Tweener.addTween(oldActor, | ||||
|                                  { opacity: 0, | ||||
|                                    time: DEFAULT_BUTTON_WELL_ANIMATION_TIME, | ||||
|                                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY, | ||||
|                                    transition: 'linear', | ||||
|                                    onCompleteScope: this, | ||||
|                                    onComplete() { | ||||
|                                       if (wasSpinner) { | ||||
|                                           if (this._spinner) | ||||
|                                               this._spinner.stop(); | ||||
|                                       } | ||||
|                                    } | ||||
|                                  }); | ||||
|             } | ||||
|         } | ||||
|  | ||||
| @@ -326,19 +313,18 @@ var AuthPrompt = GObject.registerClass({ | ||||
|             if (!animate) | ||||
|                 actor.opacity = 255; | ||||
|             else | ||||
|                 actor.ease({ | ||||
|                     opacity: 255, | ||||
|                     duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME, | ||||
|                     delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY, | ||||
|                     mode: Clutter.AnimationMode.LINEAR | ||||
|                 }); | ||||
|                 Tweener.addTween(actor, | ||||
|                                  { opacity: 255, | ||||
|                                    time: DEFAULT_BUTTON_WELL_ANIMATION_TIME, | ||||
|                                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY, | ||||
|                                    transition: 'linear' }); | ||||
|         } | ||||
|  | ||||
|         this._defaultButtonWellActor = actor; | ||||
|     } | ||||
|  | ||||
|     startSpinning() { | ||||
|         this.setActorInDefaultButtonWell(this._spinner, true); | ||||
|         this.setActorInDefaultButtonWell(this._spinner.actor, true); | ||||
|     } | ||||
|  | ||||
|     stopSpinning() { | ||||
| @@ -380,12 +366,12 @@ var AuthPrompt = GObject.registerClass({ | ||||
|     _fadeOutMessage() { | ||||
|         if (this._message.opacity == 0) | ||||
|             return; | ||||
|         this._message.remove_all_transitions(); | ||||
|         this._message.ease({ | ||||
|             opacity: 0, | ||||
|             duration: MESSAGE_FADE_OUT_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|         Tweener.removeTweens(this._message); | ||||
|         Tweener.addTween(this._message, | ||||
|                          { opacity: 0, | ||||
|                            time: MESSAGE_FADE_OUT_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad' | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     setMessage(message, type) { | ||||
| @@ -400,7 +386,7 @@ var AuthPrompt = GObject.registerClass({ | ||||
|             this._message.remove_style_class_name('login-dialog-message-hint'); | ||||
|  | ||||
|         if (message) { | ||||
|             this._message.remove_all_transitions(); | ||||
|             Tweener.removeTweens(this._message); | ||||
|             this._message.text = message; | ||||
|             this._message.opacity = 255; | ||||
|         } else { | ||||
| @@ -419,9 +405,9 @@ var AuthPrompt = GObject.registerClass({ | ||||
|         this._entry.clutter_text.editable = sensitive; | ||||
|     } | ||||
|  | ||||
|     vfunc_hide() { | ||||
|     hide() { | ||||
|         this.setActorInDefaultButtonWell(null, true); | ||||
|         super.vfunc_hide(); | ||||
|         this.actor.hide(); | ||||
|         this._message.opacity = 0; | ||||
|  | ||||
|         this.setUser(null); | ||||
| @@ -437,7 +423,7 @@ var AuthPrompt = GObject.registerClass({ | ||||
|  | ||||
|         if (user) { | ||||
|             let userWidget = new UserWidget.UserWidget(user); | ||||
|             this._userWell.set_child(userWidget); | ||||
|             this._userWell.set_child(userWidget.actor); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -522,4 +508,5 @@ var AuthPrompt = GObject.registerClass({ | ||||
|         this.reset(); | ||||
|         this.emit('cancelled'); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(AuthPrompt.prototype); | ||||
|   | ||||
| @@ -20,7 +20,7 @@ | ||||
|  * In order for transformation animations to look good, they need to be | ||||
|  * incremental and have some order to them (e.g., fade out hidden items, | ||||
|  * then shrink to close the void left over). Chaining animations in this way can | ||||
|  * be error-prone and wordy using just ease() callbacks. | ||||
|  * be error-prone and wordy using just Tweener callbacks. | ||||
|  * | ||||
|  * The classes in this file help with this: | ||||
|  * | ||||
| @@ -44,7 +44,6 @@ | ||||
|  * replaced by something else. | ||||
|  */ | ||||
|  | ||||
| const { GObject } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| var Task = class { | ||||
| @@ -177,35 +176,36 @@ Signals.addSignalMethods(Batch.prototype); | ||||
|  | ||||
| var ConcurrentBatch = class extends Batch { | ||||
|     process() { | ||||
|         let hold = this.runTask(); | ||||
|        let hold = this.runTask(); | ||||
|  | ||||
|         if (hold) { | ||||
|             this.hold.acquireUntilAfter(hold); | ||||
|         } | ||||
|        if (hold) { | ||||
|            this.hold.acquireUntilAfter(hold); | ||||
|        } | ||||
|  | ||||
|         // Regardless of the state of the just run task, | ||||
|         // fire off the next one, so all the tasks can run | ||||
|         // concurrently. | ||||
|         this.nextTask(); | ||||
|        // Regardless of the state of the just run task, | ||||
|        // fire off the next one, so all the tasks can run | ||||
|        // concurrently. | ||||
|        this.nextTask(); | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(ConcurrentBatch.prototype); | ||||
|  | ||||
| var ConsecutiveBatch = class extends Batch { | ||||
|     process() { | ||||
|         let hold = this.runTask(); | ||||
|        let hold = this.runTask(); | ||||
|  | ||||
|         if (hold && hold.isAcquired()) { | ||||
|             // This task is inhibiting the batch. Wait on it | ||||
|             // before processing the next one. | ||||
|             let signalId = hold.connect('release', () => { | ||||
|                 hold.disconnect(signalId); | ||||
|                 this.nextTask(); | ||||
|             }); | ||||
|         } else { | ||||
|             // This task finished, process the next one | ||||
|             this.nextTask(); | ||||
|         } | ||||
|        if (hold && hold.isAcquired()) { | ||||
|            // This task is inhibiting the batch. Wait on it | ||||
|            // before processing the next one. | ||||
|            let signalId = hold.connect('release', () => { | ||||
|                hold.disconnect(signalId); | ||||
|                this.nextTask(); | ||||
|            }); | ||||
|            return; | ||||
|        } else { | ||||
|            // This task finished, process the next one | ||||
|            this.nextTask(); | ||||
|        } | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(ConsecutiveBatch.prototype); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported FprintManager */ | ||||
|  | ||||
| const Gio = imports.gi.Gio; | ||||
|  | ||||
| @@ -24,8 +23,8 @@ function FprintManager() { | ||||
|  | ||||
|     try { | ||||
|         self.init(null); | ||||
|     } catch (e) { | ||||
|         log(`Failed to connect to Fprint service: ${e.message}`); | ||||
|     } catch(e) { | ||||
|         log('Failed to connect to Fprint service: ' + e.message); | ||||
|         return null; | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported LoginDialog */ | ||||
| /* | ||||
|  * Copyright 2011 Red Hat, Inc | ||||
|  * | ||||
| @@ -19,6 +18,7 @@ | ||||
|  | ||||
| const { AccountsService, Atk, Clutter, Gdm, Gio, | ||||
|         GLib, GObject, Meta, Pango, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const AuthPrompt = imports.gdm.authPrompt; | ||||
| const Batch = imports.gdm.batch; | ||||
| @@ -30,88 +30,81 @@ const LoginManager = imports.misc.loginManager; | ||||
| const Main = imports.ui.main; | ||||
| const PopupMenu = imports.ui.popupMenu; | ||||
| const Realmd = imports.gdm.realmd; | ||||
| const Tweener = imports.ui.tweener; | ||||
| const UserWidget = imports.ui.userWidget; | ||||
|  | ||||
| const _FADE_ANIMATION_TIME = 250; | ||||
| const _SCROLL_ANIMATION_TIME = 500; | ||||
| const _FADE_ANIMATION_TIME = 0.25; | ||||
| const _SCROLL_ANIMATION_TIME = 0.5; | ||||
| const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0; | ||||
| const _LOGO_ICON_HEIGHT = 48; | ||||
| const _MAX_BOTTOM_MENU_ITEMS = 5; | ||||
|  | ||||
| var UserListItem = GObject.registerClass({ | ||||
|     GTypeName: 'LoginDialog_UserListItem', | ||||
|     Signals: { 'activate': {} } | ||||
| }, class UserListItem extends St.Button { | ||||
|     _init(user) { | ||||
|         let layout = new St.BoxLayout({ vertical: true }); | ||||
|         super._init({ | ||||
|             style_class: 'login-dialog-user-list-item', | ||||
|             button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, | ||||
|             can_focus: true, | ||||
|             child: layout, | ||||
|             reactive: true, | ||||
|             x_align: St.Align.START, | ||||
|             x_fill: true | ||||
|         }); | ||||
|  | ||||
| var UserListItem = class { | ||||
|     constructor(user) { | ||||
|         this.user = user; | ||||
|         this._userChangedId = this.user.connect('changed', | ||||
|                                                 this._onUserChanged.bind(this)); | ||||
|                                                  this._onUserChanged.bind(this)); | ||||
|  | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this.connect('notify::hover', () => { | ||||
|             this._setSelected(this.hover); | ||||
|         let layout = new St.BoxLayout({ vertical: true }); | ||||
|         this.actor = new St.Button({ style_class: 'login-dialog-user-list-item', | ||||
|                                      button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, | ||||
|                                      can_focus: true, | ||||
|                                      child: layout, | ||||
|                                      reactive: true, | ||||
|                                      x_align: St.Align.START, | ||||
|                                      x_fill: true }); | ||||
|         this.actor.connect('destroy', this._onDestroy.bind(this)); | ||||
|  | ||||
|         this.actor.connect('key-focus-in', () => { | ||||
|             this._setSelected(true); | ||||
|         }); | ||||
|         this.actor.connect('key-focus-out', () => { | ||||
|             this._setSelected(false); | ||||
|         }); | ||||
|         this.actor.connect('notify::hover', () => { | ||||
|             this._setSelected(this.actor.hover); | ||||
|         }); | ||||
|  | ||||
|         this._userWidget = new UserWidget.UserWidget(this.user); | ||||
|         layout.add(this._userWidget); | ||||
|         layout.add(this._userWidget.actor); | ||||
|  | ||||
|         this._userWidget.bind_property('label-actor', this, 'label-actor', | ||||
|                                        GObject.BindingFlags.SYNC_CREATE); | ||||
|         this._userWidget.actor.bind_property('label-actor', this.actor, 'label-actor', | ||||
|                                              GObject.BindingFlags.SYNC_CREATE); | ||||
|  | ||||
|         this._timedLoginIndicator = new St.Bin({ style_class: 'login-dialog-timed-login-indicator', | ||||
|                                                  scale_x: 0, | ||||
|                                                  visible: false }); | ||||
|         layout.add(this._timedLoginIndicator); | ||||
|  | ||||
|         this.actor.connect('clicked', this._onClicked.bind(this)); | ||||
|         this._onUserChanged(); | ||||
|     } | ||||
|  | ||||
|     vfunc_key_focus_in() { | ||||
|         super.vfunc_key_focus_in(); | ||||
|         this._setSelected(true); | ||||
|     } | ||||
|  | ||||
|     vfunc_key_focus_out() { | ||||
|         super.vfunc_key_focus_out(); | ||||
|         this._setSelected(false); | ||||
|     } | ||||
|  | ||||
|     _onUserChanged() { | ||||
|         this._updateLoggedIn(); | ||||
|     } | ||||
|  | ||||
|     _updateLoggedIn() { | ||||
|         if (this.user.is_logged_in()) | ||||
|             this.add_style_pseudo_class('logged-in'); | ||||
|             this.actor.add_style_pseudo_class('logged-in'); | ||||
|         else | ||||
|             this.remove_style_pseudo_class('logged-in'); | ||||
|             this.actor.remove_style_pseudo_class('logged-in'); | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
|         this.user.disconnect(this._userChangedId); | ||||
|     } | ||||
|  | ||||
|     vfunc_clicked() { | ||||
|     _onClicked() { | ||||
|         this.emit('activate'); | ||||
|     } | ||||
|  | ||||
|     _setSelected(selected) { | ||||
|         if (selected) { | ||||
|             this.add_style_pseudo_class('selected'); | ||||
|             this.grab_key_focus(); | ||||
|             this.actor.add_style_pseudo_class('selected'); | ||||
|             this.actor.grab_key_focus(); | ||||
|         } else { | ||||
|             this.remove_style_pseudo_class('selected'); | ||||
|             this.actor.remove_style_pseudo_class('selected'); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -152,30 +145,23 @@ var UserListItem = GObject.registerClass({ | ||||
|         this._timedLoginIndicator.visible = false; | ||||
|         this._timedLoginIndicator.scale_x = 0.; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(UserListItem.prototype); | ||||
|  | ||||
| var UserList = GObject.registerClass({ | ||||
|     GTypeName: 'LoginDialog_UserList', | ||||
|     Signals: { | ||||
|         'activate': { param_types: [UserListItem.$gtype] }, | ||||
|         'item-added': { param_types: [UserListItem.$gtype] }, | ||||
|     } | ||||
| }, class UserList extends St.ScrollView { | ||||
|     _init() { | ||||
|         super._init({ style_class: 'login-dialog-user-list-view' }); | ||||
|         this.set_policy(St.PolicyType.NEVER, | ||||
|                         St.PolicyType.AUTOMATIC); | ||||
| var UserList = class { | ||||
|     constructor() { | ||||
|         this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view'}); | ||||
|         this.actor.set_policy(St.PolicyType.NEVER, | ||||
|                               St.PolicyType.AUTOMATIC); | ||||
|  | ||||
|         this._box = new St.BoxLayout({ vertical: true, | ||||
|                                        style_class: 'login-dialog-user-list', | ||||
|                                        pseudo_class: 'expanded' }); | ||||
|  | ||||
|         this.add_actor(this._box); | ||||
|         this.actor.add_actor(this._box); | ||||
|         this._items = {}; | ||||
|     } | ||||
|  | ||||
|     vfunc_key_focus_in() { | ||||
|         this._moveFocusToItems(); | ||||
|         this.actor.connect('key-focus-in', this._moveFocusToItems.bind(this)); | ||||
|     } | ||||
|  | ||||
|     _moveFocusToItems() { | ||||
| @@ -184,10 +170,10 @@ var UserList = GObject.registerClass({ | ||||
|         if (!hasItems) | ||||
|             return; | ||||
|  | ||||
|         if (global.stage.get_key_focus() != this) | ||||
|         if (global.stage.get_key_focus() != this.actor) | ||||
|             return; | ||||
|  | ||||
|         let focusSet = this.navigate_focus(null, St.DirectionType.TAB_FORWARD, false); | ||||
|         let focusSet = this.actor.navigate_focus(null, St.DirectionType.TAB_FORWARD, false); | ||||
|         if (!focusSet) { | ||||
|             Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { | ||||
|                 this._moveFocusToItems(); | ||||
| @@ -201,6 +187,8 @@ var UserList = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     updateStyle(isExpanded) { | ||||
|         let tasks = []; | ||||
|  | ||||
|         if (isExpanded) | ||||
|             this._box.add_style_pseudo_class('expanded'); | ||||
|         else | ||||
| @@ -208,26 +196,27 @@ var UserList = GObject.registerClass({ | ||||
|  | ||||
|         for (let userName in this._items) { | ||||
|             let item = this._items[userName]; | ||||
|             item.sync_hover(); | ||||
|             item.actor.sync_hover(); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     scrollToItem(item) { | ||||
|         let box = item.get_allocation_box(); | ||||
|         let box = item.actor.get_allocation_box(); | ||||
|  | ||||
|         let adjustment = this.get_vscroll_bar().get_adjustment(); | ||||
|         let adjustment = this.actor.get_vscroll_bar().get_adjustment(); | ||||
|  | ||||
|         let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0); | ||||
|         adjustment.ease(value, { | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             duration: _SCROLL_ANIMATION_TIME | ||||
|         }); | ||||
|         Tweener.removeTweens(adjustment); | ||||
|         Tweener.addTween (adjustment, | ||||
|                           { value: value, | ||||
|                             time: _SCROLL_ANIMATION_TIME, | ||||
|                             transition: 'easeOutQuad' }); | ||||
|     } | ||||
|  | ||||
|     jumpToItem(item) { | ||||
|         let box = item.get_allocation_box(); | ||||
|         let box = item.actor.get_allocation_box(); | ||||
|  | ||||
|         let adjustment = this.get_vscroll_bar().get_adjustment(); | ||||
|         let adjustment = this.actor.get_vscroll_bar().get_adjustment(); | ||||
|  | ||||
|         let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0); | ||||
|  | ||||
| @@ -255,7 +244,7 @@ var UserList = GObject.registerClass({ | ||||
|             return; | ||||
|  | ||||
|         if (user.locked) | ||||
|             return; | ||||
|            return; | ||||
|  | ||||
|         let userName = user.get_user_name(); | ||||
|  | ||||
| @@ -265,14 +254,14 @@ var UserList = GObject.registerClass({ | ||||
|         this.removeUser(user); | ||||
|  | ||||
|         let item = new UserListItem(user); | ||||
|         this._box.add(item, { x_fill: true }); | ||||
|         this._box.add(item.actor, { x_fill: true }); | ||||
|  | ||||
|         this._items[userName] = item; | ||||
|  | ||||
|         item.connect('activate', this._onItemActivated.bind(this)); | ||||
|  | ||||
|         // Try to keep the focused item front-and-center | ||||
|         item.connect('key-focus-in', () => this.scrollToItem(item)); | ||||
|         item.actor.connect('key-focus-in', () => { this.scrollToItem(item); }); | ||||
|  | ||||
|         this._moveFocusToItems(); | ||||
|  | ||||
| @@ -293,38 +282,33 @@ var UserList = GObject.registerClass({ | ||||
|         if (!item) | ||||
|             return; | ||||
|  | ||||
|         item.destroy(); | ||||
|         item.actor.destroy(); | ||||
|         delete this._items[userName]; | ||||
|     } | ||||
|  | ||||
|     numItems() { | ||||
|         return Object.keys(this._items).length; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(UserList.prototype); | ||||
|  | ||||
| var SessionMenuButton = GObject.registerClass({ | ||||
|     GTypeName: 'LoginDialog_SessionMenuButton', | ||||
|     Signals: { 'session-activated': { param_types: [GObject.TYPE_STRING] } } | ||||
| }, class SessionMenuButton extends St.Bin { | ||||
|     _init() { | ||||
| var SessionMenuButton = class { | ||||
|     constructor() { | ||||
|         let gearIcon = new St.Icon({ icon_name: 'emblem-system-symbolic' }); | ||||
|         let button = new St.Button({ | ||||
|             style_class: 'login-dialog-session-list-button', | ||||
|             reactive: true, | ||||
|             track_hover: true, | ||||
|             can_focus: true, | ||||
|             accessible_name: _("Choose Session"), | ||||
|             accessible_role: Atk.Role.MENU, | ||||
|             child: gearIcon | ||||
|         }); | ||||
|         this._button = new St.Button({ style_class: 'login-dialog-session-list-button', | ||||
|                                        reactive: true, | ||||
|                                        track_hover: true, | ||||
|                                        can_focus: true, | ||||
|                                        accessible_name: _("Choose Session"), | ||||
|                                        accessible_role: Atk.Role.MENU, | ||||
|                                        child: gearIcon }); | ||||
|  | ||||
|         super._init({ child: button }); | ||||
|         this._button = button; | ||||
|         this.actor = new St.Bin({ child: this._button }); | ||||
|  | ||||
|         let side = St.Side.TOP; | ||||
|         let align = 0; | ||||
|         if (Gdm.get_session_ids().length > _MAX_BOTTOM_MENU_ITEMS) { | ||||
|             if (this.text_direction == Clutter.TextDirection.RTL) | ||||
|             if (this.actor.text_direction == Clutter.TextDirection.RTL) | ||||
|                 side = St.Side.RIGHT; | ||||
|             else | ||||
|                 side = St.Side.LEFT; | ||||
| @@ -335,17 +319,17 @@ var SessionMenuButton = GObject.registerClass({ | ||||
|         this._menu.actor.hide(); | ||||
|  | ||||
|         this._menu.connect('open-state-changed', (menu, isOpen) => { | ||||
|             if (isOpen) | ||||
|                 this._button.add_style_pseudo_class('active'); | ||||
|             else | ||||
|                 this._button.remove_style_pseudo_class('active'); | ||||
|              if (isOpen) | ||||
|                  this._button.add_style_pseudo_class('active'); | ||||
|              else | ||||
|                  this._button.remove_style_pseudo_class('active'); | ||||
|         }); | ||||
|  | ||||
|         this._manager = new PopupMenu.PopupMenuManager(this._button, | ||||
|                                                        { actionMode: Shell.ActionMode.NONE }); | ||||
|         this._manager.addMenu(this._menu); | ||||
|  | ||||
|         this._button.connect('clicked', () => this._menu.toggle()); | ||||
|         this._button.connect('clicked', () => { this._menu.toggle(); }); | ||||
|  | ||||
|         this._items = {}; | ||||
|         this._activeSessionId = null; | ||||
| @@ -369,11 +353,11 @@ var SessionMenuButton = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     setActiveSession(sessionId) { | ||||
|         if (sessionId == this._activeSessionId) | ||||
|             return; | ||||
|          if (sessionId == this._activeSessionId) | ||||
|              return; | ||||
|  | ||||
|         this._activeSessionId = sessionId; | ||||
|         this._updateOrnament(); | ||||
|          this._activeSessionId = sessionId; | ||||
|          this._updateOrnament(); | ||||
|     } | ||||
|  | ||||
|     close() { | ||||
| @@ -390,7 +374,7 @@ var SessionMenuButton = GObject.registerClass({ | ||||
|         } | ||||
|  | ||||
|         for (let i = 0; i < ids.length; i++) { | ||||
|             let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]); | ||||
|             let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]); | ||||
|  | ||||
|             let id = ids[i]; | ||||
|             let item = new PopupMenu.PopupMenuItem(sessionName); | ||||
| @@ -403,13 +387,15 @@ var SessionMenuButton = GObject.registerClass({ | ||||
|             }); | ||||
|         } | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(SessionMenuButton.prototype); | ||||
|  | ||||
| var LoginDialog = GObject.registerClass({ | ||||
|     Signals: { 'failed': {} }, | ||||
| }, class LoginDialog extends St.Widget { | ||||
|     _init(parentActor) { | ||||
|         super._init({ style_class: 'login-dialog', visible: false }); | ||||
|         super._init({ style_class: 'login-dialog', | ||||
|                       visible: false }); | ||||
|  | ||||
|         this.get_accessible().set_role(Atk.Role.WINDOW); | ||||
|  | ||||
| @@ -417,18 +403,18 @@ var LoginDialog = GObject.registerClass({ | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         parentActor.add_child(this); | ||||
|  | ||||
|         this._userManager = AccountsService.UserManager.get_default(); | ||||
|         this._userManager = AccountsService.UserManager.get_default() | ||||
|         this._gdmClient = new Gdm.Client(); | ||||
|  | ||||
|         this._settings = new Gio.Settings({ schema_id: GdmUtil.LOGIN_SCREEN_SCHEMA }); | ||||
|  | ||||
|         this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_KEY}`, | ||||
|         this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_KEY, | ||||
|                                this._updateBanner.bind(this)); | ||||
|         this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_TEXT_KEY}`, | ||||
|         this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_TEXT_KEY, | ||||
|                                this._updateBanner.bind(this)); | ||||
|         this._settings.connect(`changed::${GdmUtil.DISABLE_USER_LIST_KEY}`, | ||||
|         this._settings.connect('changed::' + GdmUtil.DISABLE_USER_LIST_KEY, | ||||
|                                this._updateDisableUserList.bind(this)); | ||||
|         this._settings.connect(`changed::${GdmUtil.LOGO_KEY}`, | ||||
|         this._settings.connect('changed::' + GdmUtil.LOGO_KEY, | ||||
|                                this._updateLogo.bind(this)); | ||||
|  | ||||
|         this._textureCache = St.TextureCache.get_default(); | ||||
| @@ -443,7 +429,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|         this.add_child(this._userSelectionBox); | ||||
|  | ||||
|         this._userList = new UserList(); | ||||
|         this._userSelectionBox.add(this._userList, | ||||
|         this._userSelectionBox.add(this._userList.actor, | ||||
|                                    { expand: true, | ||||
|                                      x_fill: true, | ||||
|                                      y_fill: true }); | ||||
| @@ -452,7 +438,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|         this._authPrompt.connect('prompted', this._onPrompted.bind(this)); | ||||
|         this._authPrompt.connect('reset', this._onReset.bind(this)); | ||||
|         this._authPrompt.hide(); | ||||
|         this.add_child(this._authPrompt); | ||||
|         this.add_child(this._authPrompt.actor); | ||||
|  | ||||
|         // translators: this message is shown below the user list on the | ||||
|         // login screen. It can be activated to reveal an entry for | ||||
| @@ -511,9 +497,9 @@ var LoginDialog = GObject.registerClass({ | ||||
|             (list, sessionId) => { | ||||
|                 this._greeter.call_select_session_sync (sessionId, null); | ||||
|             }); | ||||
|         this._sessionMenuButton.opacity = 0; | ||||
|         this._sessionMenuButton.show(); | ||||
|         this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton); | ||||
|         this._sessionMenuButton.actor.opacity = 0; | ||||
|         this._sessionMenuButton.actor.show(); | ||||
|         this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton.actor); | ||||
|  | ||||
|         this._disableUserList = undefined; | ||||
|         this._userListLoaded = false; | ||||
| @@ -534,7 +520,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|     _getBannerAllocation(dialogBox) { | ||||
|         let actorBox = new Clutter.ActorBox(); | ||||
|  | ||||
|         let [, , natWidth, natHeight] = this._bannerView.get_preferred_size(); | ||||
|         let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size(); | ||||
|         let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2; | ||||
|  | ||||
|         actorBox.x1 = Math.floor(centerX - natWidth / 2); | ||||
| @@ -548,7 +534,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|     _getLogoBinAllocation(dialogBox) { | ||||
|         let actorBox = new Clutter.ActorBox(); | ||||
|  | ||||
|         let [, , natWidth, natHeight] = this._logoBin.get_preferred_size(); | ||||
|         let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size(); | ||||
|         let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2; | ||||
|  | ||||
|         actorBox.x1 = Math.floor(centerX - natWidth / 2); | ||||
| @@ -562,7 +548,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|     _getCenterActorAllocation(dialogBox, actor) { | ||||
|         let actorBox = new Clutter.ActorBox(); | ||||
|  | ||||
|         let [, , natWidth, natHeight] = actor.get_preferred_size(); | ||||
|         let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size(); | ||||
|         let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2; | ||||
|         let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2; | ||||
|  | ||||
| @@ -589,15 +575,19 @@ var LoginDialog = GObject.registerClass({ | ||||
|         // First find out what space the children require | ||||
|         let bannerAllocation = null; | ||||
|         let bannerHeight = 0; | ||||
|         let bannerWidth = 0; | ||||
|         if (this._bannerView.visible) { | ||||
|             bannerAllocation = this._getBannerAllocation(dialogBox, this._bannerView); | ||||
|             bannerHeight = bannerAllocation.y2 - bannerAllocation.y1; | ||||
|             bannerWidth = bannerAllocation.x2 - bannerAllocation.x1; | ||||
|         } | ||||
|  | ||||
|         let authPromptAllocation = null; | ||||
|         let authPromptHeight = 0; | ||||
|         let authPromptWidth = 0; | ||||
|         if (this._authPrompt.visible) { | ||||
|             authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt); | ||||
|         if (this._authPrompt.actor.visible) { | ||||
|             authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt.actor); | ||||
|             authPromptHeight = authPromptAllocation.y2 - authPromptAllocation.y1; | ||||
|             authPromptWidth = authPromptAllocation.x2 - authPromptAllocation.x1; | ||||
|         } | ||||
|  | ||||
| @@ -629,64 +619,64 @@ var LoginDialog = GObject.registerClass({ | ||||
|             let leftOverYSpace = bannerSpace - bannerHeight; | ||||
|  | ||||
|             if (leftOverYSpace > 0) { | ||||
|                 // First figure out how much left over space is up top | ||||
|                 let leftOverTopSpace = leftOverYSpace / 2; | ||||
|                  // First figure out how much left over space is up top | ||||
|                  let leftOverTopSpace = leftOverYSpace / 2; | ||||
|  | ||||
|                 // Then, shift the banner into the middle of that extra space | ||||
|                 let yShift = Math.floor(leftOverTopSpace / 2); | ||||
|                  // Then, shift the banner into the middle of that extra space | ||||
|                  let yShift = Math.floor(leftOverTopSpace / 2); | ||||
|  | ||||
|                 bannerAllocation.y1 += yShift; | ||||
|                 bannerAllocation.y2 += yShift; | ||||
|                  bannerAllocation.y1 += yShift; | ||||
|                  bannerAllocation.y2 += yShift; | ||||
|             } else { | ||||
|                 // Then figure out how much space there would be if we switched to a | ||||
|                 // wide layout with banner on one side and authprompt on the other. | ||||
|                 let leftOverXSpace = dialogWidth - authPromptWidth; | ||||
|                  // Then figure out how much space there would be if we switched to a | ||||
|                  // wide layout with banner on one side and authprompt on the other. | ||||
|                  let leftOverXSpace = dialogWidth - authPromptWidth; | ||||
|  | ||||
|                 // In a wide view, half of the available space goes to the banner, | ||||
|                 // and the other half goes to the margins. | ||||
|                 let wideBannerWidth = leftOverXSpace / 2; | ||||
|                 let wideSpacing  = leftOverXSpace - wideBannerWidth; | ||||
|                  // In a wide view, half of the available space goes to the banner, | ||||
|                  // and the other half goes to the margins. | ||||
|                  let wideBannerWidth = leftOverXSpace / 2; | ||||
|                  let wideSpacing  = leftOverXSpace - wideBannerWidth; | ||||
|  | ||||
|                 // If we do go with a wide layout, we need there to be at least enough | ||||
|                 // space for the banner and the auth prompt to be the same width, | ||||
|                 // so it doesn't look unbalanced. | ||||
|                 if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) { | ||||
|                     let centerX = dialogBox.x1 + dialogWidth / 2; | ||||
|                     let centerY = dialogBox.y1 + dialogHeight / 2; | ||||
|                  // If we do go with a wide layout, we need there to be at least enough | ||||
|                  // space for the banner and the auth prompt to be the same width, | ||||
|                  // so it doesn't look unbalanced. | ||||
|                  if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) { | ||||
|                      let centerX = dialogBox.x1 + dialogWidth / 2; | ||||
|                      let centerY = dialogBox.y1 + dialogHeight / 2; | ||||
|  | ||||
|                     // A small portion of the spacing goes down the center of the | ||||
|                     // screen to help delimit the two columns of the wide view | ||||
|                     let centerGap = wideSpacing / 8; | ||||
|                      // A small portion of the spacing goes down the center of the | ||||
|                      // screen to help delimit the two columns of the wide view | ||||
|                      let centerGap = wideSpacing / 8; | ||||
|  | ||||
|                     // place the banner along the left edge of the center margin | ||||
|                     bannerAllocation.x2 = Math.floor(centerX - centerGap / 2); | ||||
|                     bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth); | ||||
|                      // place the banner along the left edge of the center margin | ||||
|                      bannerAllocation.x2 = Math.floor(centerX - centerGap / 2); | ||||
|                      bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth); | ||||
|  | ||||
|                     // figure out how tall it would like to be and try to accommodate | ||||
|                     // but don't let it get too close to the logo | ||||
|                     let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth); | ||||
|                      // figure out how tall it would like to be and try to accommodate | ||||
|                      // but don't let it get too close to the logo | ||||
|                      let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth); | ||||
|  | ||||
|                     let maxWideHeight = dialogHeight - 3 * logoHeight; | ||||
|                     wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight); | ||||
|                     bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2); | ||||
|                     bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight; | ||||
|                      let maxWideHeight = dialogHeight - 3 * logoHeight; | ||||
|                      wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight); | ||||
|                      bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2); | ||||
|                      bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight; | ||||
|  | ||||
|                     // place the auth prompt along the right edge of the center margin | ||||
|                     authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2); | ||||
|                     authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth; | ||||
|                 } else { | ||||
|                     // If we aren't going to do a wide view, then we need to limit | ||||
|                     // the height of the banner so it will present scrollbars | ||||
|                      // place the auth prompt along the right edge of the center margin | ||||
|                      authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2); | ||||
|                      authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth; | ||||
|                  } else { | ||||
|                      // If we aren't going to do a wide view, then we need to limit | ||||
|                      // the height of the banner so it will present scrollbars | ||||
|  | ||||
|                     // First figure out how much space there is without the banner | ||||
|                     leftOverYSpace += bannerHeight; | ||||
|                      // First figure out how much space there is without the banner | ||||
|                      leftOverYSpace += bannerHeight; | ||||
|  | ||||
|                     // Then figure out how much of that space is up top | ||||
|                     let availableTopSpace = Math.floor(leftOverYSpace / 2); | ||||
|                      // Then figure out how much of that space is up top | ||||
|                      let availableTopSpace = Math.floor(leftOverYSpace / 2); | ||||
|  | ||||
|                     // Then give all of that space to the banner | ||||
|                     bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace; | ||||
|                 } | ||||
|                      // Then give all of that space to the banner | ||||
|                      bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace; | ||||
|                  } | ||||
|             } | ||||
|         } else if (userSelectionAllocation) { | ||||
|             // Grow the user list to fill the space | ||||
| @@ -707,7 +697,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|         } | ||||
|  | ||||
|         if (authPromptAllocation) | ||||
|             this._authPrompt.allocate(authPromptAllocation, flags); | ||||
|             this._authPrompt.actor.allocate(authPromptAllocation, flags); | ||||
|  | ||||
|         if (userSelectionAllocation) | ||||
|             this._userSelectionBox.allocate(userSelectionAllocation, flags); | ||||
| @@ -774,15 +764,14 @@ var LoginDialog = GObject.registerClass({ | ||||
|  | ||||
|     _fadeInBannerView() { | ||||
|         this._bannerView.show(); | ||||
|         this._bannerView.ease({ | ||||
|             opacity: 255, | ||||
|             duration: _FADE_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|         Tweener.addTween(this._bannerView, | ||||
|                          { opacity: 255, | ||||
|                            time: _FADE_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad' }); | ||||
|     } | ||||
|  | ||||
|     _hideBannerView() { | ||||
|         this._bannerView.remove_all_transitions(); | ||||
|         Tweener.removeTweens(this._bannerView); | ||||
|         this._bannerView.opacity = 0; | ||||
|         this._bannerView.hide(); | ||||
|     } | ||||
| @@ -811,7 +800,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|     _onPrompted() { | ||||
|         if (this._shouldShowSessionMenuButton()) { | ||||
|             this._sessionMenuButton.updateSensitivity(true); | ||||
|             this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton); | ||||
|             this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton.actor); | ||||
|         } else { | ||||
|             this._sessionMenuButton.updateSensitivity(false); | ||||
|         } | ||||
| @@ -862,24 +851,23 @@ var LoginDialog = GObject.registerClass({ | ||||
|     _shouldShowSessionMenuButton() { | ||||
|         if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFYING && | ||||
|             this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFICATION_FAILED) | ||||
|             return false; | ||||
|           return false; | ||||
|  | ||||
|         if (this._user && this._user.is_loaded && this._user.is_logged_in()) | ||||
|             return false; | ||||
|           return false; | ||||
|  | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     _showPrompt() { | ||||
|         if (this._authPrompt.visible) | ||||
|         if (this._authPrompt.actor.visible) | ||||
|             return; | ||||
|         this._authPrompt.opacity = 0; | ||||
|         this._authPrompt.show(); | ||||
|         this._authPrompt.ease({ | ||||
|             opacity: 255, | ||||
|             duration: _FADE_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|         this._authPrompt.actor.opacity = 0; | ||||
|         this._authPrompt.actor.show(); | ||||
|         Tweener.addTween(this._authPrompt.actor, | ||||
|                          { opacity: 255, | ||||
|                            time: _FADE_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad' }); | ||||
|         this._fadeInBannerView(); | ||||
|     } | ||||
|  | ||||
| @@ -923,31 +911,28 @@ var LoginDialog = GObject.registerClass({ | ||||
|         this._showPrompt(); | ||||
|     } | ||||
|  | ||||
|     _bindOpacity() { | ||||
|         this._bindings = Main.layoutManager.uiGroup.get_children() | ||||
|             .filter(c => c != Main.layoutManager.screenShieldGroup) | ||||
|             .map(c => this.bind_property('opacity', c, 'opacity', 0)); | ||||
|     } | ||||
|  | ||||
|     _unbindOpacity() { | ||||
|         this._bindings.forEach(b => b.unbind()); | ||||
|     } | ||||
|  | ||||
|     _loginScreenSessionActivated() { | ||||
|         if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING) | ||||
|             return; | ||||
|  | ||||
|         this._bindOpacity(); | ||||
|         this.ease({ | ||||
|             opacity: 255, | ||||
|             duration: _FADE_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => { | ||||
|                 if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING) | ||||
|                     this._authPrompt.reset(); | ||||
|                 this._unbindOpacity(); | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(this, | ||||
|                          { opacity: 255, | ||||
|                            time: _FADE_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onUpdate() { | ||||
|                                let children = Main.layoutManager.uiGroup.get_children(); | ||||
|  | ||||
|                                for (let i = 0; i < children.length; i++) { | ||||
|                                    if (children[i] != Main.layoutManager.screenShieldGroup) | ||||
|                                        children[i].opacity = this.opacity; | ||||
|                                } | ||||
|                            }, | ||||
|                            onUpdateScope: this, | ||||
|                            onComplete() { | ||||
|                                if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING) | ||||
|                                    this._authPrompt.reset(); | ||||
|                            }, | ||||
|                            onCompleteScope: this }); | ||||
|     } | ||||
|  | ||||
|     _gotGreeterSessionProxy(proxy) { | ||||
| @@ -960,27 +945,34 @@ var LoginDialog = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _startSession(serviceName) { | ||||
|         this._bindOpacity(); | ||||
|         this.ease({ | ||||
|             opacity: 0, | ||||
|             duration: _FADE_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => { | ||||
|                 this._greeter.call_start_session_when_ready_sync(serviceName, true, null); | ||||
|                 this._unbindOpacity(); | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(this, | ||||
|                          { opacity: 0, | ||||
|                            time: _FADE_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onUpdate() { | ||||
|                                let children = Main.layoutManager.uiGroup.get_children(); | ||||
|  | ||||
|                                for (let i = 0; i < children.length; i++) { | ||||
|                                    if (children[i] != Main.layoutManager.screenShieldGroup) | ||||
|                                        children[i].opacity = this.opacity; | ||||
|                                } | ||||
|                            }, | ||||
|                            onUpdateScope: this, | ||||
|                            onComplete() { | ||||
|                                this._greeter.call_start_session_when_ready_sync(serviceName, true, null); | ||||
|                            }, | ||||
|                            onCompleteScope: this }); | ||||
|     } | ||||
|  | ||||
|     _onSessionOpened(client, serviceName) { | ||||
|         this._authPrompt.finish(() => this._startSession(serviceName)); | ||||
|         this._authPrompt.finish(() => { this._startSession(serviceName); }); | ||||
|     } | ||||
|  | ||||
|     _waitForItemForUser(userName) { | ||||
|         let item = this._userList.getItemFromUserName(userName); | ||||
|  | ||||
|         if (item) | ||||
|             return null; | ||||
|           return null; | ||||
|  | ||||
|         let hold = new Batch.Hold(); | ||||
|         let signalId = this._userList.connect('item-added', | ||||
| @@ -991,7 +983,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|                     hold.release(); | ||||
|             }); | ||||
|  | ||||
|         hold.connect('release', () => this._userList.disconnect(signalId)); | ||||
|         hold.connect('release', () => { this._userList.disconnect(signalId); }); | ||||
|  | ||||
|         return hold; | ||||
|     } | ||||
| @@ -1055,19 +1047,18 @@ var LoginDialog = GObject.registerClass({ | ||||
|                              return this._blockTimedLoginUntilIdle(); | ||||
|                          } else { | ||||
|                              animationTime = delay; | ||||
|                              return null; | ||||
|                          } | ||||
|                      }, | ||||
|  | ||||
|                      () => { | ||||
|                          // If idle timeout is done, make sure the timed login indicator is shown | ||||
|                          if (delay > _TIMED_LOGIN_IDLE_THRESHOLD && | ||||
|                              this._authPrompt.visible) | ||||
|                              this._authPrompt.actor.visible) | ||||
|                              this._authPrompt.cancel(); | ||||
|  | ||||
|                          if (delay > _TIMED_LOGIN_IDLE_THRESHOLD || firstRun) { | ||||
|                              this._userList.scrollToItem(loginItem); | ||||
|                              loginItem.grab_key_focus(); | ||||
|                              loginItem.actor.grab_key_focus(); | ||||
|                          } | ||||
|                      }, | ||||
|  | ||||
| @@ -1091,12 +1082,12 @@ var LoginDialog = GObject.registerClass({ | ||||
|  | ||||
|         // Restart timed login on user interaction | ||||
|         global.stage.connect('captured-event', (actor, event) => { | ||||
|             if (event.type() == Clutter.EventType.KEY_PRESS || | ||||
|            if (event.type() == Clutter.EventType.KEY_PRESS || | ||||
|                event.type() == Clutter.EventType.BUTTON_PRESS) { | ||||
|                 this._startTimedLogin(userName, seconds); | ||||
|             } | ||||
|                this._startTimedLogin(userName, seconds); | ||||
|            } | ||||
|  | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|            return Clutter.EVENT_PROPAGATE; | ||||
|         }); | ||||
|     } | ||||
|  | ||||
| @@ -1128,7 +1119,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|         this._sessionMenuButton.close(); | ||||
|         this._setUserListExpanded(true); | ||||
|         this._notListedButton.show(); | ||||
|         this._userList.grab_key_focus(); | ||||
|         this._userList.actor.grab_key_focus(); | ||||
|     } | ||||
|  | ||||
|     _beginVerificationForItem(item) { | ||||
| @@ -1236,17 +1227,16 @@ var LoginDialog = GObject.registerClass({ | ||||
|                                         _("Login Window"), | ||||
|                                         'dialog-password-symbolic', | ||||
|                                         { sortGroup: CtrlAltTab.SortGroup.MIDDLE }); | ||||
|         this._userList.grab_key_focus(); | ||||
|         this._userList.actor.grab_key_focus(); | ||||
|         this.show(); | ||||
|         this.opacity = 0; | ||||
|  | ||||
|         Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN }); | ||||
|  | ||||
|         this.ease({ | ||||
|             opacity: 255, | ||||
|             duration: 1000, | ||||
|             mode: Clutter.AnimationMode.EASE_IN_QUAD | ||||
|         }); | ||||
|         Tweener.addTween(this, | ||||
|                          { opacity: 255, | ||||
|                            time: 1, | ||||
|                            transition: 'easeInQuad' }); | ||||
|  | ||||
|         return true; | ||||
|     } | ||||
| @@ -1260,7 +1250,7 @@ var LoginDialog = GObject.registerClass({ | ||||
|         this._authPrompt.cancel(); | ||||
|     } | ||||
|  | ||||
|     addCharacter(_unichar) { | ||||
|     addCharacter(unichar) { | ||||
|         // Don't allow type ahead at the login screen | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported getOVirtCredentialsManager */ | ||||
|  | ||||
| const Gio = imports.gi.Gio; | ||||
| const Signals = imports.signals; | ||||
|   | ||||
| @@ -15,13 +15,12 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm"); | ||||
| const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface); | ||||
|  | ||||
| var Manager = class { | ||||
|     constructor() { | ||||
|     constructor(parentActor) { | ||||
|         this._aggregateProvider = Provider(Gio.DBus.system, | ||||
|                                            'org.freedesktop.realmd', | ||||
|                                            '/org/freedesktop/realmd', | ||||
|                                            this._reloadRealms.bind(this)); | ||||
|                                            this._reloadRealms.bind(this)) | ||||
|         this._realms = {}; | ||||
|         this._loginFormat = null; | ||||
|  | ||||
|         this._signalId = this._aggregateProvider.connect('g-properties-changed', | ||||
|             (proxy, properties) => { | ||||
| @@ -37,10 +36,10 @@ var Manager = class { | ||||
|             return; | ||||
|  | ||||
|         for (let i = 0; i < realmPaths.length; i++) { | ||||
|             Realm(Gio.DBus.system, | ||||
|                   'org.freedesktop.realmd', | ||||
|                   realmPaths[i], | ||||
|                   this._onRealmLoaded.bind(this)); | ||||
|             let realm = Realm(Gio.DBus.system, | ||||
|                               'org.freedesktop.realmd', | ||||
|                               realmPaths[i], | ||||
|                               this._onRealmLoaded.bind(this)); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -87,7 +86,7 @@ var Manager = class { | ||||
|     } | ||||
|  | ||||
|     get loginFormat() { | ||||
|         if (this._loginFormat) | ||||
|         if (this._loginFormat !== undefined) | ||||
|             return this._loginFormat; | ||||
|  | ||||
|         this._updateLoginFormat(); | ||||
| @@ -99,10 +98,10 @@ var Manager = class { | ||||
|         Service(Gio.DBus.system, | ||||
|                 'org.freedesktop.realmd', | ||||
|                 '/org/freedesktop/realmd', | ||||
|                 service => service.ReleaseRemote()); | ||||
|                 service => { service.ReleaseRemote(); }); | ||||
|         this._aggregateProvider.disconnect(this._signalId); | ||||
|         this._realms = { }; | ||||
|         this._updateLoginFormat(); | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(Manager.prototype); | ||||
| Signals.addSignalMethods(Manager.prototype) | ||||
|   | ||||
							
								
								
									
										126
									
								
								js/gdm/util.js
									
									
									
									
									
								
							
							
						
						
									
										126
									
								
								js/gdm/util.js
									
									
									
									
									
								
							| @@ -1,6 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY, | ||||
|             DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */ | ||||
|  | ||||
| const { Clutter, Gio, GLib } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
| @@ -11,13 +9,14 @@ const OVirt = imports.gdm.oVirt; | ||||
| const Main = imports.ui.main; | ||||
| const Params = imports.misc.params; | ||||
| const SmartcardManager = imports.misc.smartcardManager; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var PASSWORD_SERVICE_NAME = 'gdm-password'; | ||||
| var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint'; | ||||
| var SMARTCARD_SERVICE_NAME = 'gdm-smartcard'; | ||||
| var OVIRT_SERVICE_NAME = 'gdm-ovirtcred'; | ||||
| var FADE_ANIMATION_TIME = 160; | ||||
| var CLONE_FADE_ANIMATION_TIME = 250; | ||||
| var FADE_ANIMATION_TIME = 0.16; | ||||
| var CLONE_FADE_ANIMATION_TIME = 0.25; | ||||
|  | ||||
| var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen'; | ||||
| var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication'; | ||||
| @@ -31,7 +30,7 @@ var LOGO_KEY = 'logo'; | ||||
| var DISABLE_USER_LIST_KEY = 'disable-user-list'; | ||||
|  | ||||
| // Give user 48ms to read each character of a PAM message | ||||
| var USER_READ_TIME = 48; | ||||
| var USER_READ_TIME = 48 | ||||
|  | ||||
| var MessageType = { | ||||
|     NONE: 0, | ||||
| @@ -46,20 +45,20 @@ function fadeInActor(actor) { | ||||
|  | ||||
|     let hold = new Batch.Hold(); | ||||
|     actor.show(); | ||||
|     let [, naturalHeight] = actor.get_preferred_height(-1); | ||||
|     let [minHeight, naturalHeight] = actor.get_preferred_height(-1); | ||||
|  | ||||
|     actor.opacity = 0; | ||||
|     actor.set_height(0); | ||||
|     actor.ease({ | ||||
|         opacity: 255, | ||||
|         height: naturalHeight, | ||||
|         duration: FADE_ANIMATION_TIME, | ||||
|         mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|         onComplete: () => { | ||||
|             this.set_height(-1); | ||||
|             hold.release(); | ||||
|         } | ||||
|     }); | ||||
|     Tweener.addTween(actor, | ||||
|                      { opacity: 255, | ||||
|                        height: naturalHeight, | ||||
|                        time: FADE_ANIMATION_TIME, | ||||
|                        transition: 'easeOutQuad', | ||||
|                        onComplete() { | ||||
|                            this.set_height(-1); | ||||
|                            hold.release(); | ||||
|                        }, | ||||
|                      }); | ||||
|  | ||||
|     return hold; | ||||
| } | ||||
| @@ -72,17 +71,17 @@ function fadeOutActor(actor) { | ||||
|     } | ||||
|  | ||||
|     let hold = new Batch.Hold(); | ||||
|     actor.ease({ | ||||
|         opacity: 0, | ||||
|         height: 0, | ||||
|         duration: FADE_ANIMATION_TIME, | ||||
|         mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|         onComplete: () => { | ||||
|             this.hide(); | ||||
|             this.set_height(-1); | ||||
|             hold.release(); | ||||
|         } | ||||
|     }); | ||||
|     Tweener.addTween(actor, | ||||
|                      { opacity: 0, | ||||
|                        height: 0, | ||||
|                        time: FADE_ANIMATION_TIME, | ||||
|                        transition: 'easeOutQuad', | ||||
|                        onComplete() { | ||||
|                            this.hide(); | ||||
|                            this.set_height(-1); | ||||
|                            hold.release(); | ||||
|                        }, | ||||
|                      }); | ||||
|     return hold; | ||||
| } | ||||
|  | ||||
| @@ -102,15 +101,15 @@ function cloneAndFadeOutActor(actor) { | ||||
|     clone.set_position(x, y); | ||||
|  | ||||
|     let hold = new Batch.Hold(); | ||||
|     clone.ease({ | ||||
|         opacity: 0, | ||||
|         duration: CLONE_FADE_ANIMATION_TIME, | ||||
|         mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|         onComplete: () => { | ||||
|             clone.destroy(); | ||||
|             hold.release(); | ||||
|         } | ||||
|     }); | ||||
|     Tweener.addTween(clone, | ||||
|                      { opacity: 0, | ||||
|                        time: CLONE_FADE_ANIMATION_TIME, | ||||
|                        transition: 'easeOutQuad', | ||||
|                        onComplete() { | ||||
|                            clone.destroy(); | ||||
|                            hold.release(); | ||||
|                        } | ||||
|                      }); | ||||
|     return hold; | ||||
| } | ||||
|  | ||||
| @@ -304,7 +303,7 @@ var ShellUserVerifier = class { | ||||
|             }); | ||||
|     } | ||||
|  | ||||
|     _oVirtUserAuthenticated(_token) { | ||||
|     _oVirtUserAuthenticated(token) { | ||||
|         this._preemptingService = OVIRT_SERVICE_NAME; | ||||
|         this.emit('ovirt-user-authenticated'); | ||||
|     } | ||||
| @@ -343,7 +342,7 @@ var ShellUserVerifier = class { | ||||
|         try { | ||||
|             this._clearUserVerifier(); | ||||
|             this._userVerifier = client.open_reauthentication_channel_finish(result); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                 return; | ||||
|             if (e.matches(Gio.DBusError, Gio.DBusError.ACCESS_DENIED) && | ||||
| @@ -370,7 +369,7 @@ var ShellUserVerifier = class { | ||||
|         try { | ||||
|             this._clearUserVerifier(); | ||||
|             this._userVerifier = client.get_user_verifier_finish(result); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                 return; | ||||
|             this._reportInitError('Failed to obtain user verifier', e); | ||||
| @@ -424,31 +423,36 @@ var ShellUserVerifier = class { | ||||
|     _startService(serviceName) { | ||||
|         this._hold.acquire(); | ||||
|         if (this._userName) { | ||||
|             this._userVerifier.call_begin_verification_for_user(serviceName, this._userName, this._cancellable, (obj, result) => { | ||||
|                 try { | ||||
|                     obj.call_begin_verification_for_user_finish(result); | ||||
|                 } catch (e) { | ||||
|                     if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                         return; | ||||
|                     this._reportInitError('Failed to start verification for user', e); | ||||
|                     return; | ||||
|                 } | ||||
|            this._userVerifier.call_begin_verification_for_user(serviceName, | ||||
|                                                                this._userName, | ||||
|                                                                this._cancellable, | ||||
|                                                                (obj, result) => { | ||||
|                try { | ||||
|                    obj.call_begin_verification_for_user_finish(result); | ||||
|                } catch(e) { | ||||
|                    if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                        return; | ||||
|                    this._reportInitError('Failed to start verification for user', e); | ||||
|                    return; | ||||
|                } | ||||
|  | ||||
|                 this._hold.release(); | ||||
|             }); | ||||
|                this._hold.release(); | ||||
|            }); | ||||
|         } else { | ||||
|             this._userVerifier.call_begin_verification(serviceName, this._cancellable, (obj, result) => { | ||||
|                 try { | ||||
|                     obj.call_begin_verification_finish(result); | ||||
|                 } catch (e) { | ||||
|                     if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                         return; | ||||
|                     this._reportInitError('Failed to start verification', e); | ||||
|                     return; | ||||
|                 } | ||||
|            this._userVerifier.call_begin_verification(serviceName, | ||||
|                                                       this._cancellable, | ||||
|                                                       (obj, result) => { | ||||
|                try { | ||||
|                    obj.call_begin_verification_finish(result); | ||||
|                } catch(e) { | ||||
|                    if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                        return; | ||||
|                    this._reportInitError('Failed to start verification', e); | ||||
|                    return; | ||||
|                } | ||||
|  | ||||
|                 this._hold.release(); | ||||
|             }); | ||||
|                this._hold.release(); | ||||
|            }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -1,37 +1,23 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported ExtensionState, ExtensionType, getCurrentExtension, | ||||
|    getSettings, initTranslations, isOutOfDate, installImporter, | ||||
|    serializeExtension, deserializeExtension */ | ||||
|  | ||||
| // Common utils for the extension system and the extension | ||||
| // preferences tool | ||||
|  | ||||
| const { Gio, GLib } = imports.gi; | ||||
|  | ||||
| const Gettext = imports.gettext; | ||||
| const Lang = imports.lang; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Gio = imports.gi.Gio; | ||||
|  | ||||
| const Config = imports.misc.config; | ||||
| const FileUtils = imports.misc.fileUtils; | ||||
|  | ||||
| var ExtensionType = { | ||||
|     SYSTEM: 1, | ||||
|     PER_USER: 2 | ||||
| }; | ||||
|  | ||||
| var ExtensionState = { | ||||
|     ENABLED: 1, | ||||
|     DISABLED: 2, | ||||
|     ERROR: 3, | ||||
|     OUT_OF_DATE: 4, | ||||
|     DOWNLOADING: 5, | ||||
|     INITIALIZED: 6, | ||||
|  | ||||
|     // Used as an error state for operations on unknown extensions, | ||||
|     // should never be in a real extensionMeta object. | ||||
|     UNINSTALLED: 99 | ||||
| }; | ||||
|  | ||||
| const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange']; | ||||
| // Maps uuid -> metadata object | ||||
| var extensions = {}; | ||||
|  | ||||
| /** | ||||
|  * getCurrentExtension: | ||||
| @@ -45,7 +31,7 @@ function getCurrentExtension() { | ||||
|     // Search for an occurrence of an extension stack frame | ||||
|     // Start at 1 because 0 is the stack frame of this function | ||||
|     for (let i = 1; i < stack.length; i++) { | ||||
|         if (stack[i].includes('/gnome-shell/extensions/')) { | ||||
|         if (stack[i].indexOf('/gnome-shell/extensions/') > -1) { | ||||
|             extensionStackLine = stack[i]; | ||||
|             break; | ||||
|         } | ||||
| @@ -63,17 +49,13 @@ function getCurrentExtension() { | ||||
|     if (!match) | ||||
|         return null; | ||||
|  | ||||
|     // local import, as the module is used from outside the gnome-shell process | ||||
|     // as well (not this function though) | ||||
|     let extensionManager = imports.ui.main.extensionManager; | ||||
|  | ||||
|     let path = match[1]; | ||||
|     let file = Gio.File.new_for_path(path); | ||||
|  | ||||
|     // Walk up the directory tree, looking for an extension with | ||||
|     // the same UUID as a directory name. | ||||
|     while (file != null) { | ||||
|         let extension = extensionManager.lookup(file.get_basename()); | ||||
|         let extension = extensions[file.get_basename()]; | ||||
|         if (extension !== undefined) | ||||
|             return extension; | ||||
|         file = file.get_parent(); | ||||
| @@ -165,8 +147,8 @@ function versionCheck(required, current) { | ||||
|         let requiredArray = required[i].split('.'); | ||||
|         if (requiredArray[0] == major && | ||||
|             requiredArray[1] == minor && | ||||
|             ((requiredArray[2] === undefined && parseInt(minor) % 2 == 0) || | ||||
|              requiredArray[2] == point)) | ||||
|             (requiredArray[2] == point || | ||||
|              (requiredArray[2] == undefined && parseInt(minor) % 2 == 0))) | ||||
|             return true; | ||||
|     } | ||||
|     return false; | ||||
| @@ -179,50 +161,54 @@ function isOutOfDate(extension) { | ||||
|     return false; | ||||
| } | ||||
|  | ||||
| function serializeExtension(extension) { | ||||
|     let obj = {}; | ||||
|     Lang.copyProperties(extension.metadata, obj); | ||||
| function createExtensionObject(uuid, dir, type) { | ||||
|     let info; | ||||
|  | ||||
|     SERIALIZED_PROPERTIES.forEach(prop => { | ||||
|         obj[prop] = extension[prop]; | ||||
|     }); | ||||
|     let metadataFile = dir.get_child('metadata.json'); | ||||
|     if (!metadataFile.query_exists(null)) { | ||||
|         throw new Error('Missing metadata.json'); | ||||
|     } | ||||
|  | ||||
|     let res = {}; | ||||
|     for (let key in obj) { | ||||
|         let val = obj[key]; | ||||
|         let type; | ||||
|         switch (typeof val) { | ||||
|         case 'string': | ||||
|             type = 's'; | ||||
|             break; | ||||
|         case 'number': | ||||
|             type = 'd'; | ||||
|             break; | ||||
|         case 'boolean': | ||||
|             type = 'b'; | ||||
|             break; | ||||
|         default: | ||||
|             continue; | ||||
|     let metadataContents, success, tag; | ||||
|     try { | ||||
|         [success, metadataContents, tag] = metadataFile.load_contents(null); | ||||
|         if (metadataContents instanceof Uint8Array) | ||||
|             metadataContents = imports.byteArray.toString(metadataContents); | ||||
|     } catch (e) { | ||||
|         throw new Error('Failed to load metadata.json: ' + e); | ||||
|     } | ||||
|     let meta; | ||||
|     try { | ||||
|         meta = JSON.parse(metadataContents); | ||||
|     } catch (e) { | ||||
|         throw new Error('Failed to parse metadata.json: ' + e); | ||||
|     } | ||||
|  | ||||
|     let requiredProperties = ['uuid', 'name', 'description', 'shell-version']; | ||||
|     for (let i = 0; i < requiredProperties.length; i++) { | ||||
|         let prop = requiredProperties[i]; | ||||
|         if (!meta[prop]) { | ||||
|             throw new Error('missing "' + prop + '" property in metadata.json'); | ||||
|         } | ||||
|         res[key] = GLib.Variant.new(type, val); | ||||
|     } | ||||
|  | ||||
|     return res; | ||||
| } | ||||
|  | ||||
| function deserializeExtension(variant) { | ||||
|     let res = { metadata: {} }; | ||||
|     for (let prop in variant) { | ||||
|         let val = variant[prop].unpack(); | ||||
|         if (SERIALIZED_PROPERTIES.includes(prop)) | ||||
|             res[prop] = val; | ||||
|         else | ||||
|             res.metadata[prop] = val; | ||||
|     if (uuid != meta.uuid) { | ||||
|         throw new Error('uuid "' + meta.uuid + '" from metadata.json does not match directory name "' + uuid + '"'); | ||||
|     } | ||||
|     // add the 2 additional properties to create a valid extension object, as createExtensionObject() | ||||
|     res.uuid = res.metadata.uuid; | ||||
|     res.dir = Gio.File.new_for_path(res.path); | ||||
|     return res; | ||||
|  | ||||
|     let extension = {}; | ||||
|  | ||||
|     extension.metadata = meta; | ||||
|     extension.uuid = meta.uuid; | ||||
|     extension.type = type; | ||||
|     extension.dir = dir; | ||||
|     extension.path = dir.get_path(); | ||||
|     extension.error = ''; | ||||
|     extension.hasPrefs = dir.get_child('prefs.js').query_exists(null); | ||||
|  | ||||
|     extensions[uuid] = extension; | ||||
|  | ||||
|     return extension; | ||||
| } | ||||
|  | ||||
| function installImporter(extension) { | ||||
| @@ -233,3 +219,36 @@ function installImporter(extension) { | ||||
|     extension.imports = imports[extension.uuid]; | ||||
|     imports.searchPath = oldSearchPath; | ||||
| } | ||||
|  | ||||
| var ExtensionFinder = class { | ||||
|     _loadExtension(extensionDir, info, perUserDir) { | ||||
|         let fileType = info.get_file_type(); | ||||
|         if (fileType != Gio.FileType.DIRECTORY) | ||||
|             return; | ||||
|         let uuid = info.get_name(); | ||||
|         let existing = extensions[uuid]; | ||||
|         if (existing) { | ||||
|             log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path())); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         let extension; | ||||
|         let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER | ||||
|                                                        : ExtensionType.SYSTEM; | ||||
|         try { | ||||
|             extension = createExtensionObject(uuid, extensionDir, type); | ||||
|         } catch(e) { | ||||
|             logError(e, 'Could not load extension %s'.format(uuid)); | ||||
|             return; | ||||
|         } | ||||
|         this.emit('extension-found', extension); | ||||
|     } | ||||
|  | ||||
|     scanExtensions() { | ||||
|         let perUserDir = Gio.File.new_for_path(global.userdatadir); | ||||
|         FileUtils.collectFromDatadirs('extensions', true, (dir, info) => { | ||||
|             this._loadExtension(dir, info, perUserDir); | ||||
|         }); | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(ExtensionFinder.prototype); | ||||
|   | ||||
| @@ -1,6 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir, | ||||
|             recursivelyMoveDir, loadInterfaceXML */ | ||||
|  | ||||
| const { Gio, GLib } = imports.gi; | ||||
| const Config = imports.misc.config; | ||||
| @@ -38,7 +36,7 @@ function recursivelyDeleteDir(dir, deleteParent) { | ||||
|     let children = dir.enumerate_children('standard::name,standard::type', | ||||
|                                           Gio.FileQueryInfoFlags.NONE, null); | ||||
|  | ||||
|     let info; | ||||
|     let info, child; | ||||
|     while ((info = children.next_file(null)) != null) { | ||||
|         let type = info.get_file_type(); | ||||
|         let child = dir.get_child(info.get_name()); | ||||
| @@ -59,7 +57,7 @@ function recursivelyMoveDir(srcDir, destDir) { | ||||
|     if (!destDir.query_exists(null)) | ||||
|         destDir.make_directory_with_parents(null); | ||||
|  | ||||
|     let info; | ||||
|     let info, child; | ||||
|     while ((info = children.next_file(null)) != null) { | ||||
|         let type = info.get_file_type(); | ||||
|         let srcChild = srcDir.get_child(info.get_name()); | ||||
| @@ -86,13 +84,13 @@ function loadInterfaceXML(iface) { | ||||
|     let f = Gio.File.new_for_uri(uri); | ||||
|  | ||||
|     try { | ||||
|         let [ok_, bytes] = f.load_contents(null); | ||||
|         let [ok, bytes] = f.load_contents(null); | ||||
|         if (bytes instanceof Uint8Array) | ||||
|             xml = imports.byteArray.toString(bytes); | ||||
|             xml = imports.byteArray.toString(bytes) | ||||
|         else | ||||
|             xml = bytes.toString(); | ||||
|     } catch (e) { | ||||
|         log(`Failed to load D-Bus interface ${iface}`); | ||||
|         log('Failed to load D-Bus interface ' + iface); | ||||
|     } | ||||
|  | ||||
|     return xml; | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported PresenceStatus, Presence, Inhibitor, SessionManager */ | ||||
|  | ||||
| const Gio = imports.gi.Gio; | ||||
|  | ||||
|   | ||||
| @@ -18,7 +18,7 @@ var HistoryManager = class { | ||||
|         this._historyIndex = 0; | ||||
|         if (this._key) { | ||||
|             this._history = global.settings.get_strv(this._key); | ||||
|             global.settings.connect(`changed::${this._key}`, | ||||
|             global.settings.connect('changed::' + this._key, | ||||
|                                     this._historyChanged.bind(this)); | ||||
|  | ||||
|         } else { | ||||
| @@ -28,7 +28,7 @@ var HistoryManager = class { | ||||
|         this._entry = params.entry; | ||||
|  | ||||
|         if (this._entry) { | ||||
|             this._entry.connect('key-press-event', | ||||
|             this._entry.connect('key-press-event',  | ||||
|                                 this._onEntryKeyPress.bind(this)); | ||||
|         } | ||||
|     } | ||||
| @@ -66,7 +66,7 @@ var HistoryManager = class { | ||||
|             this._indexChanged(); | ||||
|         } | ||||
|  | ||||
|         return this._historyIndex ? this._history[this._historyIndex - 1] : null; | ||||
|         return this._historyIndex ? this._history[this._historyIndex -1] : null; | ||||
|     } | ||||
|  | ||||
|     addItem(input) { | ||||
|   | ||||
| @@ -1,7 +1,7 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported getIBusManager */ | ||||
|  | ||||
| const { Gio, GLib, IBus } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const IBusCandidatePopup = imports.ui.ibusCandidatePopup; | ||||
| @@ -18,9 +18,9 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) { | ||||
|          IBus.MICRO_VERSION >= requiredMicro)) | ||||
|         return; | ||||
|  | ||||
|     throw "Found IBus version %d.%d.%d but required is %d.%d.%d" | ||||
|         .format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION, | ||||
|                 requiredMajor, requiredMinor, requiredMicro); | ||||
|     throw "Found IBus version %d.%d.%d but required is %d.%d.%d". | ||||
|         format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION, | ||||
|                requiredMajor, requiredMinor, requiredMicro); | ||||
| } | ||||
|  | ||||
| function getIBusManager() { | ||||
| @@ -42,7 +42,7 @@ var IBusManager = class { | ||||
|         this._candidatePopup = new IBusCandidatePopup.CandidatePopup(); | ||||
|  | ||||
|         this._panelService = null; | ||||
|         this._engines = new Map(); | ||||
|         this._engines = {}; | ||||
|         this._ready = false; | ||||
|         this._registerPropertiesId = 0; | ||||
|         this._currentEngineName = null; | ||||
| @@ -58,79 +58,54 @@ var IBusManager = class { | ||||
|         this._spawn(); | ||||
|     } | ||||
|  | ||||
|     _spawn(extraArgs = []) { | ||||
|     _spawn() { | ||||
|         try { | ||||
|             let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs]; | ||||
|             Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE); | ||||
|         } catch (e) { | ||||
|             log(`Failed to launch ibus-daemon: ${e.message}`); | ||||
|             Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'], | ||||
|                                Gio.SubprocessFlags.NONE); | ||||
|         } catch(e) { | ||||
|             log('Failed to launch ibus-daemon: ' + e.message); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     restartDaemon(extraArgs = []) { | ||||
|         this._spawn(['-r', ...extraArgs]); | ||||
|     } | ||||
|  | ||||
|     _clear() { | ||||
|         if (this._cancellable) { | ||||
|             this._cancellable.cancel(); | ||||
|             this._cancellable = null; | ||||
|         } | ||||
|  | ||||
|         if (this._preloadEnginesId) { | ||||
|             GLib.source_remove(this._preloadEnginesId); | ||||
|             this._preloadEnginesId = 0; | ||||
|         } | ||||
|  | ||||
|         if (this._panelService) | ||||
|             this._panelService.destroy(); | ||||
|  | ||||
|         this._panelService = null; | ||||
|         this._candidatePopup.setPanelService(null); | ||||
|         this._engines.clear(); | ||||
|         this._engines = {}; | ||||
|         this._ready = false; | ||||
|         this._registerPropertiesId = 0; | ||||
|         this._currentEngineName = null; | ||||
|  | ||||
|         this.emit('ready', false); | ||||
|  | ||||
|         this._spawn(); | ||||
|     } | ||||
|  | ||||
|     _onConnected() { | ||||
|         this._cancellable = new Gio.Cancellable(); | ||||
|         this._ibus.list_engines_async(-1, this._cancellable, | ||||
|             this._initEngines.bind(this)); | ||||
|         this._ibus.list_engines_async(-1, null, this._initEngines.bind(this)); | ||||
|         this._ibus.request_name_async(IBus.SERVICE_PANEL, | ||||
|             IBus.BusNameFlag.REPLACE_EXISTING, -1, this._cancellable, | ||||
|             this._initPanelService.bind(this)); | ||||
|                                       IBus.BusNameFlag.REPLACE_EXISTING, | ||||
|                                       -1, null, | ||||
|                                       this._initPanelService.bind(this)); | ||||
|     } | ||||
|  | ||||
|     _initEngines(ibus, result) { | ||||
|         try { | ||||
|             let enginesList = this._ibus.list_engines_async_finish(result); | ||||
|         let enginesList = this._ibus.list_engines_async_finish(result); | ||||
|         if (enginesList) { | ||||
|             for (let i = 0; i < enginesList.length; ++i) { | ||||
|                 let name = enginesList[i].get_name(); | ||||
|                 this._engines.set(name, enginesList[i]); | ||||
|                 this._engines[name] = enginesList[i]; | ||||
|             } | ||||
|             this._updateReadiness(); | ||||
|         } catch (e) { | ||||
|             if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                 return; | ||||
|  | ||||
|             logError(e); | ||||
|         } else { | ||||
|             this._clear(); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _initPanelService(ibus, result) { | ||||
|         let success = false; | ||||
|         try { | ||||
|             success = !!this._ibus.request_name_async_finish(result); | ||||
|         } catch (e) { | ||||
|             if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                 return; | ||||
|             logError(e); | ||||
|         } | ||||
|  | ||||
|         let success = this._ibus.request_name_async_finish(result); | ||||
|         if (success) { | ||||
|             this._panelService = new IBus.PanelService({ connection: this._ibus.get_connection(), | ||||
|                                                          object_path: IBus.PATH_PANEL }); | ||||
| @@ -144,7 +119,7 @@ var IBusManager = class { | ||||
|                 if (!GLib.str_has_suffix(path, '/InputContext_1')) | ||||
|                     this.emit ('focus-in'); | ||||
|             }); | ||||
|             this._panelService.connect('focus-out', () => this.emit('focus-out')); | ||||
|             this._panelService.connect('focus-out', () => { this.emit('focus-out'); }); | ||||
|  | ||||
|             try { | ||||
|                 // IBus versions older than 1.5.10 have a bug which | ||||
| @@ -157,13 +132,13 @@ var IBusManager = class { | ||||
|             } catch (e) { | ||||
|             } | ||||
|             // If an engine is already active we need to get its properties | ||||
|             this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, result) => { | ||||
|             this._ibus.get_global_engine_async(-1, null, (i, result) => { | ||||
|                 let engine; | ||||
|                 try { | ||||
|                     engine = this._ibus.get_global_engine_async_finish(result); | ||||
|                     if (!engine) | ||||
|                         return; | ||||
|                 } catch (e) { | ||||
|                 } catch(e) { | ||||
|                     return; | ||||
|                 } | ||||
|                 this._engineChanged(this._ibus, engine.get_name()); | ||||
| @@ -175,7 +150,8 @@ var IBusManager = class { | ||||
|     } | ||||
|  | ||||
|     _updateReadiness() { | ||||
|         this._ready = this._engines.size > 0 && this._panelService != null; | ||||
|         this._ready = (Object.keys(this._engines).length > 0 && | ||||
|                        this._panelService != null); | ||||
|         this.emit('ready', this._ready); | ||||
|     } | ||||
|  | ||||
| @@ -213,10 +189,10 @@ var IBusManager = class { | ||||
|     } | ||||
|  | ||||
|     getEngineDesc(id) { | ||||
|         if (!this._ready || !this._engines.has(id)) | ||||
|         if (!this._ready || !this._engines.hasOwnProperty(id)) | ||||
|             return null; | ||||
|  | ||||
|         return this._engines.get(id); | ||||
|         return this._engines[id]; | ||||
|     } | ||||
|  | ||||
|     setEngine(id, callback) { | ||||
| @@ -229,18 +205,8 @@ var IBusManager = class { | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this._ibus.set_global_engine_async(id, | ||||
|             this._MAX_INPUT_SOURCE_ACTIVATION_TIME, | ||||
|             this._cancellable, (_bus, res) => { | ||||
|                 try { | ||||
|                     this._ibus.set_global_engine_async_finish(res); | ||||
|                 } catch (e) { | ||||
|                     if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                         logError(e); | ||||
|                 } | ||||
|                 if (callback) | ||||
|                     callback(); | ||||
|             }); | ||||
|         this._ibus.set_global_engine_async(id, this._MAX_INPUT_SOURCE_ACTIVATION_TIME, | ||||
|                                            null, callback || null); | ||||
|     } | ||||
|  | ||||
|     preloadEngines(ids) { | ||||
| @@ -248,23 +214,21 @@ var IBusManager = class { | ||||
|             return; | ||||
|  | ||||
|         if (this._preloadEnginesId != 0) { | ||||
|             GLib.source_remove(this._preloadEnginesId); | ||||
|             Mainloop.source_remove(this._preloadEnginesId); | ||||
|             this._preloadEnginesId = 0; | ||||
|         } | ||||
|  | ||||
|         this._preloadEnginesId = | ||||
|             GLib.timeout_add_seconds( | ||||
|                 GLib.PRIORITY_DEFAULT, | ||||
|                 this._PRELOAD_ENGINES_DELAY_TIME, | ||||
|                 () => { | ||||
|                     this._ibus.preload_engines_async( | ||||
|                         ids, | ||||
|                         -1, | ||||
|                         this._cancellable, | ||||
|                         null); | ||||
|                     this._preloadEnginesId = 0; | ||||
|                     return GLib.SOURCE_REMOVE; | ||||
|                 }); | ||||
|             Mainloop.timeout_add_seconds(this._PRELOAD_ENGINES_DELAY_TIME, | ||||
|                                          () => { | ||||
|                                              this._ibus.preload_engines_async( | ||||
|                                                  ids, | ||||
|                                                  -1, | ||||
|                                                  null, | ||||
|                                                  null); | ||||
|                                              this._preloadEnginesId = 0; | ||||
|                                              return GLib.SOURCE_REMOVE; | ||||
|                                          }); | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(IBusManager.prototype); | ||||
|   | ||||
| @@ -1,6 +1,5 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported InputMethod */ | ||||
| const { Clutter, GLib, Gio, GObject, IBus } = imports.gi; | ||||
| const { Clutter, GLib, GObject, IBus } = imports.gi; | ||||
|  | ||||
| const Keyboard = imports.ui.status.keyboard; | ||||
|  | ||||
| @@ -36,7 +35,15 @@ class InputMethod extends Clutter.InputMethod { | ||||
|     } | ||||
|  | ||||
|     _updateCapabilities() { | ||||
|         let caps = IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT; | ||||
|         let caps = 0; | ||||
|  | ||||
|         if (this.can_show_preedit) | ||||
|             caps |= IBus.Capabilite.PREEDIT_TEXT; | ||||
|  | ||||
|         if (this._currentFocus) | ||||
|             caps |= IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT; | ||||
|         else | ||||
|             caps |= IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.AUXILIARY_TEXT | IBus.Capabilite.LOOKUP_TABLE | IBus.Capabilite.PROPERTY; | ||||
|  | ||||
|         if (this._context) | ||||
|             this._context.set_capabilities(caps); | ||||
| @@ -47,22 +54,12 @@ class InputMethod extends Clutter.InputMethod { | ||||
|     } | ||||
|  | ||||
|     _onConnected() { | ||||
|         this._cancellable = new Gio.Cancellable(); | ||||
|         this._ibus.create_input_context_async ('gnome-shell', -1, | ||||
|             this._cancellable, this._setContext.bind(this)); | ||||
|         this._ibus.create_input_context_async ('gnome-shell', -1, null, | ||||
|                                                this._setContext.bind(this)); | ||||
|     } | ||||
|  | ||||
|     _setContext(bus, res) { | ||||
|         try { | ||||
|             this._context = this._ibus.create_input_context_async_finish(res); | ||||
|         } catch (e) { | ||||
|             if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) { | ||||
|                 logError(e); | ||||
|                 this._clear(); | ||||
|             } | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this._context = this._ibus.create_input_context_async_finish(res); | ||||
|         this._context.connect('commit-text', this._onCommitText.bind(this)); | ||||
|         this._context.connect('delete-surrounding-text', this._onDeleteSurroundingText.bind(this)); | ||||
|         this._context.connect('update-preedit-text', this._onUpdatePreeditText.bind(this)); | ||||
| @@ -74,15 +71,10 @@ class InputMethod extends Clutter.InputMethod { | ||||
|     } | ||||
|  | ||||
|     _clear() { | ||||
|         if (this._cancellable) { | ||||
|             this._cancellable.cancel(); | ||||
|             this._cancellable = null; | ||||
|         } | ||||
|  | ||||
|         this._context = null; | ||||
|         this._hints = 0; | ||||
|         this._purpose = 0; | ||||
|         this._preeditStr = ''; | ||||
|         this._preeditStr = '' | ||||
|         this._preeditPos = 0; | ||||
|         this._preeditVisible = false; | ||||
|     } | ||||
| @@ -92,15 +84,15 @@ class InputMethod extends Clutter.InputMethod { | ||||
|             this.emit('request-surrounding'); | ||||
|     } | ||||
|  | ||||
|     _onCommitText(_context, text) { | ||||
|     _onCommitText(context, text) { | ||||
|         this.commit(text.get_text()); | ||||
|     } | ||||
|  | ||||
|     _onDeleteSurroundingText() { | ||||
|     _onDeleteSurroundingText(context) { | ||||
|         this.delete_surrounding(); | ||||
|     } | ||||
|  | ||||
|     _onUpdatePreeditText(_context, text, pos, visible) { | ||||
|     _onUpdatePreeditText(context, text, pos, visible) { | ||||
|         if (text == null) | ||||
|             return; | ||||
|  | ||||
| @@ -116,17 +108,17 @@ class InputMethod extends Clutter.InputMethod { | ||||
|         this._preeditVisible = visible; | ||||
|     } | ||||
|  | ||||
|     _onShowPreeditText() { | ||||
|     _onShowPreeditText(context) { | ||||
|         this._preeditVisible = true; | ||||
|         this.set_preedit_text(this._preeditStr, this._preeditPos); | ||||
|     } | ||||
|  | ||||
|     _onHidePreeditText() { | ||||
|     _onHidePreeditText(context) { | ||||
|         this.set_preedit_text(null, this._preeditPos); | ||||
|         this._preeditVisible = false; | ||||
|     } | ||||
|  | ||||
|     _onForwardKeyEvent(_context, keyval, keycode, state) { | ||||
|     _onForwardKeyEvent(context, keyval, keycode, state) { | ||||
|         let press = (state & IBus.ModifierType.RELEASE_MASK) == 0; | ||||
|         state &= ~(IBus.ModifierType.RELEASE_MASK); | ||||
|  | ||||
| @@ -144,6 +136,7 @@ class InputMethod extends Clutter.InputMethod { | ||||
|         this._currentFocus = focus; | ||||
|         if (this._context) { | ||||
|             this._context.focus_in(); | ||||
|             this._updateCapabilities(); | ||||
|             this._emitRequestSurrounding(); | ||||
|         } | ||||
|  | ||||
| @@ -155,8 +148,10 @@ class InputMethod extends Clutter.InputMethod { | ||||
|  | ||||
|     vfunc_focus_out() { | ||||
|         this._currentFocus = null; | ||||
|         if (this._context) | ||||
|         if (this._context) { | ||||
|             this._context.focus_out(); | ||||
|             this._updateCapabilities(); | ||||
|         } | ||||
|  | ||||
|         if (this._preeditStr) { | ||||
|             // Unset any preedit text | ||||
| @@ -259,19 +254,17 @@ class InputMethod extends Clutter.InputMethod { | ||||
|         if (event.type() == Clutter.EventType.KEY_RELEASE) | ||||
|             state |= IBus.ModifierType.RELEASE_MASK; | ||||
|  | ||||
|         this._context.process_key_event_async( | ||||
|             event.get_key_symbol(), | ||||
|             event.get_key_code() - 8, // Convert XKB keycodes to evcodes | ||||
|             state, -1, this._cancellable, | ||||
|             (context, res) => { | ||||
|                 try { | ||||
|                     let retval = context.process_key_event_async_finish(res); | ||||
|                     this.notify_key_event(event, retval); | ||||
|                 } catch (e) { | ||||
|                     if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) | ||||
|                         log(`Error processing key on IM: ${e.message}`); | ||||
|                 } | ||||
|             }); | ||||
|         this._context.process_key_event_async(event.get_key_symbol(), | ||||
|                                               event.get_key_code() - 8, // Convert XKB keycodes to evcodes | ||||
|                                               state, -1, null, | ||||
|                                               (context, res) => { | ||||
|                                                   try { | ||||
|                                                       let retval = context.process_key_event_async_finish(res); | ||||
|                                                       this.notify_key_event(event, retval); | ||||
|                                                   } catch (e) { | ||||
|                                                       log('Error processing key on IM: ' + e.message); | ||||
|                                                   } | ||||
|                                               }); | ||||
|         return true; | ||||
|     } | ||||
| }); | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported IntrospectService */ | ||||
| const { Gio, GLib, Meta, Shell } = imports.gi; | ||||
|  | ||||
| const INTROSPECT_SCHEMA = 'org.gnome.shell'; | ||||
| @@ -47,11 +46,11 @@ var IntrospectService = class { | ||||
|     } | ||||
|  | ||||
|     _isIntrospectEnabled() { | ||||
|         return this._settings.get_boolean(INTROSPECT_KEY); | ||||
|        return this._settings.get_boolean(INTROSPECT_KEY); | ||||
|     } | ||||
|  | ||||
|     _isSenderWhitelisted(sender) { | ||||
|         return APP_WHITELIST.includes(sender); | ||||
|        return APP_WHITELIST.includes(sender); | ||||
|     } | ||||
|  | ||||
|     _getSandboxedAppId(app) { | ||||
| @@ -127,8 +126,7 @@ var IntrospectService = class { | ||||
|         let apps = this._appSystem.get_running(); | ||||
|         let windowsList = {}; | ||||
|  | ||||
|         if (!this._isIntrospectEnabled() && | ||||
|             !this._isSenderWhitelisted(invocation.get_sender())) { | ||||
|         if (!this._isIntrospectEnabled()) { | ||||
|             invocation.return_error_literal(Gio.DBusError, | ||||
|                                             Gio.DBusError.ACCESS_DENIED, | ||||
|                                             'App introspection not allowed'); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */ | ||||
| /* exported getCompletions, getCommonPrefix, getDeclaredConstants */ | ||||
|  | ||||
| // Returns a list of potential completions for text. Completions either | ||||
| // follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo) | ||||
| @@ -9,7 +8,7 @@ | ||||
| // This function is likely the one you want to call from external modules | ||||
| function getCompletions(text, commandHeader, globalCompletionList) { | ||||
|     let methods = []; | ||||
|     let expr_, base; | ||||
|     let expr, base; | ||||
|     let attrHead = ''; | ||||
|     if (globalCompletionList == null) { | ||||
|         globalCompletionList = []; | ||||
| @@ -22,7 +21,7 @@ function getCompletions(text, commandHeader, globalCompletionList) { | ||||
|         // Look for expressions like "Main.panel.foo" and match Main.panel and foo | ||||
|         let matches = text.match(/(.*)\.(.*)/); | ||||
|         if (matches) { | ||||
|             [expr_, base, attrHead] = matches; | ||||
|             [expr, base, attrHead] = matches; | ||||
|  | ||||
|             methods = getPropertyNamesFromExpression(base, commandHeader).filter( | ||||
|                 attr => attr.slice(0, attrHead.length) == attrHead | ||||
| @@ -33,7 +32,7 @@ function getCompletions(text, commandHeader, globalCompletionList) { | ||||
|         // not proceeded by a dot and match them against global constants | ||||
|         matches = text.match(/^(\w*)$/); | ||||
|         if (text == '' || matches) { | ||||
|             [expr_, attrHead] = matches; | ||||
|             [expr, attrHead] = matches; | ||||
|             methods = globalCompletionList.filter( | ||||
|                 attr => attr.slice(0, attrHead.length) == attrHead | ||||
|             ); | ||||
| @@ -52,14 +51,14 @@ function getCompletions(text, commandHeader, globalCompletionList) { | ||||
| // if we encounter anything that isn't a letter, '.', ')', or ']', | ||||
| // we should stop parsing. | ||||
| function isStopChar(c) { | ||||
|     return !c.match(/[\w.)\]]/); | ||||
|     return !c.match(/[\w\.\)\]]/); | ||||
| } | ||||
|  | ||||
| // Given the ending position of a quoted string, find where it starts | ||||
| function findMatchingQuote(expr, offset) { | ||||
|     let quoteChar = expr.charAt(offset); | ||||
|     for (let i = offset - 1; i >= 0; --i) { | ||||
|         if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') { | ||||
|         if (expr.charAt(i) == quoteChar && expr.charAt(i-1) != '\\'){ | ||||
|             return i; | ||||
|         } | ||||
|     } | ||||
| @@ -69,7 +68,7 @@ function findMatchingQuote(expr, offset) { | ||||
| // Given the ending position of a regex, find where it starts | ||||
| function findMatchingSlash(expr, offset) { | ||||
|     for (let i = offset - 1; i >= 0; --i) { | ||||
|         if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') { | ||||
|         if (expr.charAt(i) == '/' && expr.charAt(i-1) != '\\'){ | ||||
|             return i; | ||||
|         } | ||||
|     } | ||||
| @@ -82,7 +81,7 @@ function findMatchingSlash(expr, offset) { | ||||
| // findMatchingBrace("[(])", 3) returns 1. | ||||
| function findMatchingBrace(expr, offset) { | ||||
|     let closeBrace = expr.charAt(offset); | ||||
|     let openBrace = ({ ')': '(', ']': '[' })[closeBrace]; | ||||
|     let openBrace = ({')': '(', ']': '['})[closeBrace]; | ||||
|  | ||||
|     function findTheBrace(expr, offset) { | ||||
|         if (offset < 0) { | ||||
| @@ -118,11 +117,11 @@ function getExpressionOffset(expr, offset) { | ||||
|     while (offset >= 0) { | ||||
|         let currChar = expr.charAt(offset); | ||||
|  | ||||
|         if (isStopChar(currChar)) { | ||||
|         if (isStopChar(currChar)){ | ||||
|             return offset + 1; | ||||
|         } | ||||
|  | ||||
|         if (currChar.match(/[)\]]/)) { | ||||
|         if (currChar.match(/[\)\]]/)) { | ||||
|             offset = findMatchingBrace(expr, offset); | ||||
|         } | ||||
|  | ||||
| @@ -152,11 +151,15 @@ function getAllProps(obj) { | ||||
| // e.g., expr="({ foo: null, bar: null, 4: null })" will | ||||
| // return ["foo", "bar", ...] but the list will not include "4", | ||||
| // since methods accessed with '.' notation must star with a letter or _. | ||||
| function getPropertyNamesFromExpression(expr, commandHeader = '') { | ||||
| function getPropertyNamesFromExpression(expr, commandHeader) { | ||||
|     if (commandHeader == null) { | ||||
|         commandHeader = ''; | ||||
|     } | ||||
|  | ||||
|     let obj = {}; | ||||
|     if (!isUnsafeExpression(expr)) { | ||||
|         try { | ||||
|             obj = eval(commandHeader + expr); | ||||
|                 obj = eval(commandHeader + expr); | ||||
|         } catch (e) { | ||||
|             return []; | ||||
|         } | ||||
| @@ -165,14 +168,14 @@ function getPropertyNamesFromExpression(expr, commandHeader = '') { | ||||
|     } | ||||
|  | ||||
|     let propsUnique = {}; | ||||
|     if (typeof obj === 'object') { | ||||
|     if (typeof obj === 'object'){ | ||||
|         let allProps = getAllProps(obj); | ||||
|         // Get only things we are allowed to complete following a '.' | ||||
|         allProps = allProps.filter( isValidPropertyName ); | ||||
|  | ||||
|         // Make sure propsUnique contains one key for every | ||||
|         // property so we end up with a unique list of properties | ||||
|         allProps.map(p => (propsUnique[p] = null)); | ||||
|         allProps.map(p => propsUnique[p] = null); | ||||
|     } | ||||
|     return Object.keys(propsUnique).sort(); | ||||
| } | ||||
| @@ -217,7 +220,7 @@ function isUnsafeExpression(str) { | ||||
|     prunedStr = prunedStr.replace(/[=!]==/g, '');    //replace === and !== with nothing | ||||
|     prunedStr = prunedStr.replace(/[=<>!]=/g, '');    //replace ==, <=, >=, != with nothing | ||||
|  | ||||
|     if (prunedStr.match(/[=]/)) { | ||||
|     if (prunedStr.match(/=/)) { | ||||
|         return true; | ||||
|     } else if (prunedStr.match(/;/)) { | ||||
|         // If we contain a semicolon not inside of a quote/regex, assume we're unsafe as well | ||||
| @@ -231,10 +234,10 @@ function isUnsafeExpression(str) { | ||||
| function getDeclaredConstants(str) { | ||||
|     let ret = []; | ||||
|     str.split(';').forEach(s => { | ||||
|         let base_, keyword; | ||||
|         let base, keyword; | ||||
|         let match = s.match(/const\s+(\w+)\s*=/); | ||||
|         if (match) { | ||||
|             [base_, keyword] = match; | ||||
|             [base, keyword] = match; | ||||
|             ret.push(keyword); | ||||
|         } | ||||
|     }); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported getKeyboardManager, holdKeyboard, releaseKeyboard */ | ||||
|  | ||||
| const { GLib, GnomeDesktop, Meta } = imports.gi; | ||||
|  | ||||
| @@ -61,7 +60,7 @@ var KeyboardManager = class { | ||||
|             this._currentKeymap.options == options) | ||||
|             return; | ||||
|  | ||||
|         this._currentKeymap = { layouts, variants, options }; | ||||
|         this._currentKeymap = {layouts, variants, options}; | ||||
|         Meta.get_backend().set_keymap(layouts, variants, options); | ||||
|     } | ||||
|  | ||||
| @@ -126,7 +125,7 @@ var KeyboardManager = class { | ||||
|  | ||||
|     _getLocaleLayout() { | ||||
|         let locale = GLib.get_language_names()[0]; | ||||
|         if (!locale.includes('_')) | ||||
|         if (locale.indexOf('_') == -1) | ||||
|             locale = DEFAULT_LOCALE; | ||||
|  | ||||
|         let [found, , id] = GnomeDesktop.get_input_source_from_locale(locale); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported canLock, getLoginManager, registerSessionWithGDM */ | ||||
|  | ||||
| const { GLib, Gio } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
| @@ -44,7 +43,7 @@ function canLock() { | ||||
|  | ||||
|         let version = result.deep_unpack()[0].deep_unpack(); | ||||
|         return haveSystemd() && versionCompare('3.5.91', version); | ||||
|     } catch (e) { | ||||
|     } catch(e) { | ||||
|         return false; | ||||
|     } | ||||
| } | ||||
| @@ -110,7 +109,7 @@ var LoginManagerSystemd = class { | ||||
|         let sessionId = GLib.getenv('XDG_SESSION_ID'); | ||||
|         if (!sessionId) { | ||||
|             log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.'); | ||||
|             let [session, objectPath_] = this._userProxy.Display; | ||||
|             let [session, objectPath] = this._userProxy.Display; | ||||
|             if (session) { | ||||
|                 log(`Will monitor session ${session}`); | ||||
|                 sessionId = session; | ||||
| @@ -183,10 +182,10 @@ var LoginManagerSystemd = class { | ||||
|             (proxy, result) => { | ||||
|                 let fd = -1; | ||||
|                 try { | ||||
|                     let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result); | ||||
|                     let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result); | ||||
|                     fd = fdList.steal_fds()[0]; | ||||
|                     callback(new Gio.UnixInputStream({ fd: fd })); | ||||
|                 } catch (e) { | ||||
|                 } catch(e) { | ||||
|                     logError(e, "Error getting systemd inhibitor"); | ||||
|                     callback(null); | ||||
|                 } | ||||
| @@ -200,7 +199,7 @@ var LoginManagerSystemd = class { | ||||
| Signals.addSignalMethods(LoginManagerSystemd.prototype); | ||||
|  | ||||
| var LoginManagerDummy = class { | ||||
|     getCurrentSessionProxy(_callback) { | ||||
|     getCurrentSessionProxy(callback) { | ||||
|         // we could return a DummySession object that fakes whatever callers | ||||
|         // expect (at the time of writing: connect() and connectSignal() | ||||
|         // methods), but just never calling the callback should be safer | ||||
|   | ||||
| @@ -26,33 +26,33 @@ function _getMobileProvidersDatabase() { | ||||
| } | ||||
|  | ||||
| // _findProviderForMccMnc: | ||||
| // @operatorName: operator name | ||||
| // @operatorCode: operator code | ||||
| // @operator_name: operator name | ||||
| // @operator_code: operator code | ||||
| // | ||||
| // Given an operator name string (which may not be a real operator name) and an | ||||
| // operator code string, tries to find a proper operator name to display. | ||||
| // | ||||
| function _findProviderForMccMnc(operatorName, operatorCode) { | ||||
|     if (operatorName) { | ||||
|         if (operatorName.length != 0 && | ||||
|             (operatorName.length > 6 || operatorName.length < 5)) { | ||||
| function _findProviderForMccMnc(operator_name, operator_code) { | ||||
|     if (operator_name) { | ||||
|         if (operator_name.length != 0 && | ||||
|             (operator_name.length > 6 || operator_name.length < 5)) { | ||||
|             // this looks like a valid name, i.e. not an MCCMNC (that some | ||||
|             // devices return when not yet connected | ||||
|             return operatorName; | ||||
|             return operator_name; | ||||
|         } | ||||
|  | ||||
|         if (isNaN(parseInt(operatorName))) { | ||||
|         if (isNaN(parseInt(operator_name))) { | ||||
|             // name is definitely not a MCCMNC, so it may be a name | ||||
|             // after all; return that | ||||
|             return operatorName; | ||||
|             return operator_name; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     let needle; | ||||
|     if ((!operatorName || operatorName.length == 0) && operatorCode) | ||||
|         needle = operatorCode; | ||||
|     else if (operatorName && (operatorName.length == 6 || operatorName.length == 5)) | ||||
|         needle = operatorName; | ||||
|     if ((!operator_name || operator_name.length == 0) && operator_code) | ||||
|         needle = operator_code; | ||||
|     else if (operator_name && (operator_name.length == 6 || operator_name.length == 5)) | ||||
|         needle = operator_name; | ||||
|     else // nothing to search | ||||
|         return null; | ||||
|  | ||||
| @@ -84,9 +84,9 @@ function _findProviderForSid(sid) { | ||||
| } | ||||
|  | ||||
|  | ||||
| // ----------------------------------------------------- // | ||||
| // Support for the old ModemManager interface (MM < 0.7) // | ||||
| // ----------------------------------------------------- // | ||||
| //------------------------------------------------------------------------------ | ||||
| // Support for the old ModemManager interface (MM < 0.7) | ||||
| //------------------------------------------------------------------------------ | ||||
|  | ||||
|  | ||||
| // The following are not the complete interfaces, just the methods we need | ||||
| @@ -110,7 +110,7 @@ var ModemGsm = class { | ||||
|             this.signal_quality = quality; | ||||
|             this.emit('notify::signal-quality'); | ||||
|         }); | ||||
|         this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => { | ||||
|         this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => { | ||||
|             this.operator_name = _findProviderForMccMnc(name, code); | ||||
|             this.emit('notify::operator-name'); | ||||
|         }); | ||||
| @@ -120,7 +120,7 @@ var ModemGsm = class { | ||||
|                 return; | ||||
|             } | ||||
|  | ||||
|             let [status_, code, name] = result; | ||||
|             let [status, code, name] = result; | ||||
|             this.operator_name = _findProviderForMccMnc(name, code); | ||||
|             this.emit('notify::operator-name'); | ||||
|         }); | ||||
| @@ -171,9 +171,9 @@ var ModemCdma = class { | ||||
|                 // it will return an error if the device is not connected | ||||
|                 this.operator_name = null; | ||||
|             } else { | ||||
|                 let [bandClass_, band_, sid] = result; | ||||
|                 let [bandClass, band, sid] = result; | ||||
|  | ||||
|                 this.operator_name = _findProviderForSid(sid); | ||||
|                 this.operator_name = _findProviderForSid(sid) | ||||
|             } | ||||
|             this.emit('notify::operator-name'); | ||||
|         }); | ||||
| @@ -182,9 +182,9 @@ var ModemCdma = class { | ||||
| Signals.addSignalMethods(ModemCdma.prototype); | ||||
|  | ||||
|  | ||||
| // ------------------------------------------------------- // | ||||
| // Support for the new ModemManager1 interface (MM >= 0.7) // | ||||
| // ------------------------------------------------------- // | ||||
| //------------------------------------------------------------------------------ | ||||
| // Support for the new ModemManager1 interface (MM >= 0.7) | ||||
| //------------------------------------------------------------------------------ | ||||
|  | ||||
| const BroadbandModemInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem'); | ||||
| const BroadbandModemProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemInterface); | ||||
| @@ -224,23 +224,23 @@ var BroadbandModem = class { | ||||
|     } | ||||
|  | ||||
|     _reloadSignalQuality() { | ||||
|         let [quality, recent_] = this._proxy.SignalQuality; | ||||
|         let [quality, recent] = this._proxy.SignalQuality; | ||||
|         this.signal_quality = quality; | ||||
|         this.emit('notify::signal-quality'); | ||||
|     } | ||||
|  | ||||
|     _reloadOperatorName() { | ||||
|         let newName = ""; | ||||
|         let new_name = ""; | ||||
|         if (this.operator_name_3gpp && this.operator_name_3gpp.length > 0) | ||||
|             newName += this.operator_name_3gpp; | ||||
|             new_name += this.operator_name_3gpp; | ||||
|  | ||||
|         if (this.operator_name_cdma && this.operator_name_cdma.length > 0) { | ||||
|             if (newName != "") | ||||
|                 newName += ", "; | ||||
|             newName += this.operator_name_cdma; | ||||
|             if (new_name != "") | ||||
|                 new_name += ", "; | ||||
|             new_name += this.operator_name_cdma; | ||||
|         } | ||||
|  | ||||
|         this.operator_name = newName; | ||||
|         this.operator_name = new_name; | ||||
|         this.emit('notify::operator-name'); | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -77,51 +77,54 @@ var ObjectManager = class { | ||||
|         let info = this._interfaceInfos[interfaceName]; | ||||
|  | ||||
|         if (!info) { | ||||
|             if (onFinished) | ||||
|                 onFinished(); | ||||
|             return; | ||||
|            if (onFinished) | ||||
|                onFinished(); | ||||
|            return; | ||||
|         } | ||||
|  | ||||
|         let proxy = new Gio.DBusProxy({ g_connection: this._connection, | ||||
|                                         g_name: this._serviceName, | ||||
|                                         g_object_path: objectPath, | ||||
|                                         g_interface_name: interfaceName, | ||||
|                                         g_interface_info: info, | ||||
|                                         g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START }); | ||||
|                                        g_name: this._serviceName, | ||||
|                                        g_object_path: objectPath, | ||||
|                                        g_interface_name: interfaceName, | ||||
|                                        g_interface_info: info, | ||||
|                                        g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START }); | ||||
|  | ||||
|         proxy.init_async(GLib.PRIORITY_DEFAULT, this._cancellable, (initable, result) => { | ||||
|             try { | ||||
|                 initable.init_finish(result); | ||||
|             } catch (e) { | ||||
|                 logError(e, `could not initialize proxy for interface ${interfaceName}`); | ||||
|         proxy.init_async(GLib.PRIORITY_DEFAULT, | ||||
|                          this._cancellable, | ||||
|                          (initable, result) => { | ||||
|                let error = null; | ||||
|                try { | ||||
|                    initable.init_finish(result); | ||||
|                } catch(e) { | ||||
|                    logError(e, 'could not initialize proxy for interface ' + interfaceName); | ||||
|  | ||||
|                 if (onFinished) | ||||
|                     onFinished(); | ||||
|                 return; | ||||
|             } | ||||
|                    if (onFinished) | ||||
|                        onFinished(); | ||||
|                    return; | ||||
|                } | ||||
|  | ||||
|             let isNewObject; | ||||
|             if (!this._objects[objectPath]) { | ||||
|                 this._objects[objectPath] = {}; | ||||
|                 isNewObject = true; | ||||
|             } else { | ||||
|                 isNewObject = false; | ||||
|             } | ||||
|                let isNewObject; | ||||
|                if (!this._objects[objectPath]) { | ||||
|                    this._objects[objectPath] = {}; | ||||
|                    isNewObject = true; | ||||
|                } else { | ||||
|                    isNewObject = false; | ||||
|                } | ||||
|  | ||||
|             this._objects[objectPath][interfaceName] = proxy; | ||||
|                this._objects[objectPath][interfaceName] = proxy; | ||||
|  | ||||
|             if (!this._interfaces[interfaceName]) | ||||
|                 this._interfaces[interfaceName] = []; | ||||
|                if (!this._interfaces[interfaceName]) | ||||
|                    this._interfaces[interfaceName] = []; | ||||
|  | ||||
|             this._interfaces[interfaceName].push(proxy); | ||||
|                this._interfaces[interfaceName].push(proxy); | ||||
|  | ||||
|             if (isNewObject) | ||||
|                 this.emit('object-added', objectPath); | ||||
|                if (isNewObject) | ||||
|                    this.emit('object-added', objectPath); | ||||
|  | ||||
|             this.emit('interface-added', interfaceName, proxy); | ||||
|                this.emit('interface-added', interfaceName, proxy); | ||||
|  | ||||
|             if (onFinished) | ||||
|                 onFinished(); | ||||
|                if (onFinished) | ||||
|                    onFinished(); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
| @@ -152,10 +155,11 @@ var ObjectManager = class { | ||||
|     } | ||||
|  | ||||
|     _onManagerProxyLoaded(initable, result) { | ||||
|         let error = null; | ||||
|         try { | ||||
|             initable.init_finish(result); | ||||
|         } catch (e) { | ||||
|             logError(e, `could not initialize object manager for object ${this._serviceName}`); | ||||
|         } catch(e) { | ||||
|             logError(e, 'could not initialize object manager for object ' + this._serviceName); | ||||
|  | ||||
|             this._tryToCompleteLoad(); | ||||
|             return; | ||||
| @@ -193,7 +197,7 @@ var ObjectManager = class { | ||||
|         this._managerProxy.GetManagedObjectsRemote((result, error) => { | ||||
|             if (!result) { | ||||
|                 if (error) { | ||||
|                     logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`); | ||||
|                    logError(error, 'could not get remote objects for service ' + this._serviceName + ' path ' + this._managerPath); | ||||
|                 } | ||||
|  | ||||
|                 this._tryToCompleteLoad(); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported parse */ | ||||
|  | ||||
| // parse: | ||||
| // @params: caller-provided parameter object, or %null | ||||
| @@ -15,13 +14,22 @@ | ||||
| // | ||||
| // Return value: a new object, containing the merged parameters from | ||||
| // @params and @defaults | ||||
| function parse(params = {}, defaults, allowExtras) { | ||||
|     if (!allowExtras) { | ||||
|         for (let prop in params) | ||||
|             if (!(prop in defaults)) | ||||
|                 throw new Error(`Unrecognized parameter "${prop}"`); | ||||
| function parse(params, defaults, allowExtras) { | ||||
|     let ret = {}, prop; | ||||
|  | ||||
|     if (!params) | ||||
|         params = {}; | ||||
|  | ||||
|     for (prop in params) { | ||||
|         if (!(prop in defaults) && !allowExtras) | ||||
|             throw new Error('Unrecognized parameter "' + prop + '"'); | ||||
|         ret[prop] = params[prop]; | ||||
|     } | ||||
|  | ||||
|     let defaultsCopy = Object.assign({}, defaults); | ||||
|     return Object.assign(defaultsCopy, params); | ||||
| } | ||||
|     for (prop in defaults) { | ||||
|         if (!(prop in params)) | ||||
|             ret[prop] = defaults[prop]; | ||||
|     } | ||||
|  | ||||
|     return ret; | ||||
| } | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported PermissionStore */ | ||||
|  | ||||
| const Gio = imports.gi.Gio; | ||||
|  | ||||
| @@ -13,4 +12,4 @@ function PermissionStore(initCallback, cancellable) { | ||||
|                                     'org.freedesktop.impl.portal.PermissionStore', | ||||
|                                     '/org/freedesktop/impl/portal/PermissionStore', | ||||
|                                     initCallback, cancellable); | ||||
| } | ||||
| }; | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported getSmartcardManager */ | ||||
|  | ||||
| const Gio = imports.gi.Gio; | ||||
| const Signals = imports.signals; | ||||
| @@ -30,7 +29,7 @@ var SmartcardManager = class { | ||||
|         this._objectManager = new ObjectManager.ObjectManager({ connection: Gio.DBus.session, | ||||
|                                                                 name: "org.gnome.SettingsDaemon.Smartcard", | ||||
|                                                                 objectPath: '/org/gnome/SettingsDaemon/Smartcard', | ||||
|                                                                 knownInterfaces: [SmartcardTokenIface], | ||||
|                                                                 knownInterfaces: [ SmartcardTokenIface ], | ||||
|                                                                 onLoaded: this._onLoaded.bind(this) }); | ||||
|         this._insertedTokens = {}; | ||||
|         this._loginToken = null; | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported getDefault */ | ||||
| const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi; | ||||
|  | ||||
| const GnomeSession = imports.misc.gnomeSession; | ||||
| @@ -84,54 +83,48 @@ const SystemActions = GObject.registerClass({ | ||||
|         this._canHaveSuspend = true; | ||||
|  | ||||
|         this._actions = new Map(); | ||||
|         this._actions.set(POWER_OFF_ACTION_ID, { | ||||
|             // Translators: The name of the power-off action in search | ||||
|             name: C_("search-result", "Power Off"), | ||||
|             iconName: 'system-shutdown-symbolic', | ||||
|             // Translators: A list of keywords that match the power-off action, separated by semicolons | ||||
|             keywords: _("power off;shutdown;reboot;restart").split(/[; ]/), | ||||
|             available: false | ||||
|         }); | ||||
|         this._actions.set(LOCK_SCREEN_ACTION_ID, { | ||||
|             // Translators: The name of the lock screen action in search | ||||
|             name: C_("search-result", "Lock Screen"), | ||||
|             iconName: 'system-lock-screen-symbolic', | ||||
|             // Translators: A list of keywords that match the lock screen action, separated by semicolons | ||||
|             keywords: _("lock screen").split(/[; ]/), | ||||
|             available: false | ||||
|         }); | ||||
|         this._actions.set(LOGOUT_ACTION_ID, { | ||||
|             // Translators: The name of the logout action in search | ||||
|             name: C_("search-result", "Log Out"), | ||||
|             iconName: 'application-exit-symbolic', | ||||
|             // Translators: A list of keywords that match the logout action, separated by semicolons | ||||
|             keywords: _("logout;log out;sign off").split(/[; ]/), | ||||
|             available: false | ||||
|         }); | ||||
|         this._actions.set(SUSPEND_ACTION_ID, { | ||||
|             // Translators: The name of the suspend action in search | ||||
|             name: C_("search-result", "Suspend"), | ||||
|             iconName: 'media-playback-pause-symbolic', | ||||
|             // Translators: A list of keywords that match the suspend action, separated by semicolons | ||||
|             keywords: _("suspend;sleep").split(/[; ]/), | ||||
|             available: false | ||||
|         }); | ||||
|         this._actions.set(SWITCH_USER_ACTION_ID, { | ||||
|             // Translators: The name of the switch user action in search | ||||
|             name: C_("search-result", "Switch User"), | ||||
|             iconName: 'system-switch-user-symbolic', | ||||
|             // Translators: A list of keywords that match the switch user action, separated by semicolons | ||||
|             keywords: _("switch user").split(/[; ]/), | ||||
|             available: false | ||||
|         }); | ||||
|         this._actions.set(LOCK_ORIENTATION_ACTION_ID, { | ||||
|             // Translators: The name of the lock orientation action in search | ||||
|             name: C_("search-result", "Lock Orientation"), | ||||
|             iconName: '', | ||||
|             // Translators: A list of keywords that match the lock orientation action, separated by semicolons | ||||
|             keywords: _("lock orientation;screen;rotation").split(/[; ]/), | ||||
|             available: false | ||||
|         }); | ||||
|         this._actions.set(POWER_OFF_ACTION_ID, | ||||
|                           { // Translators: The name of the power-off action in search | ||||
|                             name: C_("search-result", "Power Off"), | ||||
|                             iconName: 'system-shutdown-symbolic', | ||||
|                             // Translators: A list of keywords that match the power-off action, separated by semicolons | ||||
|                             keywords: _("power off;shutdown;reboot;restart").split(/[; ]/), | ||||
|                             available: false }); | ||||
|         this._actions.set(LOCK_SCREEN_ACTION_ID, | ||||
|                           { // Translators: The name of the lock screen action in search | ||||
|                             name: C_("search-result", "Lock Screen"), | ||||
|                             iconName: 'system-lock-screen-symbolic', | ||||
|                             // Translators: A list of keywords that match the lock screen action, separated by semicolons | ||||
|                             keywords: _("lock screen").split(/[; ]/), | ||||
|                             available: false }); | ||||
|         this._actions.set(LOGOUT_ACTION_ID, | ||||
|                           { // Translators: The name of the logout action in search | ||||
|                             name: C_("search-result", "Log Out"), | ||||
|                             iconName: 'application-exit-symbolic', | ||||
|                             // Translators: A list of keywords that match the logout action, separated by semicolons | ||||
|                             keywords: _("logout;log out;sign off").split(/[; ]/), | ||||
|                             available: false }); | ||||
|         this._actions.set(SUSPEND_ACTION_ID, | ||||
|                           { // Translators: The name of the suspend action in search | ||||
|                             name: C_("search-result", "Suspend"), | ||||
|                             iconName: 'media-playback-pause-symbolic', | ||||
|                             // Translators: A list of keywords that match the suspend action, separated by semicolons | ||||
|                             keywords: _("suspend;sleep").split(/[; ]/), | ||||
|                             available: false }); | ||||
|         this._actions.set(SWITCH_USER_ACTION_ID, | ||||
|                           { // Translators: The name of the switch user action in search | ||||
|                             name: C_("search-result", "Switch User"), | ||||
|                             iconName: 'system-switch-user-symbolic', | ||||
|                             // Translators: A list of keywords that match the switch user action, separated by semicolons | ||||
|                             keywords: _("switch user").split(/[; ]/), | ||||
|                             available: false }); | ||||
|         this._actions.set(LOCK_ORIENTATION_ACTION_ID, | ||||
|                           { // Translators: The name of the lock orientation action in search | ||||
|                             name: C_("search-result", "Lock Orientation"), | ||||
|                             iconName: '', | ||||
|                             // Translators: A list of keywords that match the lock orientation action, separated by semicolons | ||||
|                             keywords: _("lock orientation;screen;rotation").split(/[; ]/), | ||||
|                             available: false }); | ||||
|  | ||||
|         this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA }); | ||||
|         this._lockdownSettings = new Gio.Settings({ schema_id: LOCKDOWN_SCHEMA }); | ||||
| @@ -144,96 +137,92 @@ const SystemActions = GObject.registerClass({ | ||||
|         this._userManager = AccountsService.UserManager.get_default(); | ||||
|  | ||||
|         this._userManager.connect('notify::is-loaded', | ||||
|                                   () => this._updateMultiUser()); | ||||
|                                   () => { this._updateMultiUser(); }); | ||||
|         this._userManager.connect('notify::has-multiple-users', | ||||
|                                   () => this._updateMultiUser()); | ||||
|                                   () => { this._updateMultiUser(); }); | ||||
|         this._userManager.connect('user-added', | ||||
|                                   () => this._updateMultiUser()); | ||||
|                                   () => { this._updateMultiUser(); }); | ||||
|         this._userManager.connect('user-removed', | ||||
|                                   () => this._updateMultiUser()); | ||||
|                                   () => { this._updateMultiUser(); }); | ||||
|  | ||||
|         this._lockdownSettings.connect(`changed::${DISABLE_USER_SWITCH_KEY}`, | ||||
|                                        () => this._updateSwitchUser()); | ||||
|         this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`, | ||||
|                                        () => this._updateLogout()); | ||||
|         global.settings.connect(`changed::${ALWAYS_SHOW_LOG_OUT_KEY}`, | ||||
|                                 () => this._updateLogout()); | ||||
|         this._lockdownSettings.connect('changed::' + DISABLE_USER_SWITCH_KEY, | ||||
|                                        () => { this._updateSwitchUser(); }); | ||||
|         this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY, | ||||
|                                        () => { this._updateLogout(); }); | ||||
|         global.settings.connect('changed::' + ALWAYS_SHOW_LOG_OUT_KEY, | ||||
|                                 () => { this._updateLogout(); }); | ||||
|  | ||||
|         this._lockdownSettings.connect(`changed::${DISABLE_LOCK_SCREEN_KEY}`, | ||||
|                                        () => this._updateLockScreen()); | ||||
|         this._lockdownSettings.connect('changed::' + DISABLE_LOCK_SCREEN_KEY, | ||||
|                                        () => { this._updateLockScreen(); }); | ||||
|  | ||||
|         this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`, | ||||
|                                        () => this._updateHaveShutdown()); | ||||
|         this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY, | ||||
|                                        () => { this._updateHaveShutdown(); }); | ||||
|  | ||||
|         this.forceUpdate(); | ||||
|  | ||||
|         this._orientationSettings.connect('changed::orientation-lock', | ||||
|                                           () => { | ||||
|                                               this._updateOrientationLock(); | ||||
|                                               this._updateOrientationLockIcon(); | ||||
|                                           }); | ||||
|                                           () => { this._updateOrientationLock(); | ||||
|                                                   this._updateOrientationLockIcon(); }); | ||||
|         Main.layoutManager.connect('monitors-changed', | ||||
|                                    () => this._updateOrientationLock()); | ||||
|         this._sensorProxy = new SensorProxy(Gio.DBus.system, | ||||
|             SENSOR_BUS_NAME, | ||||
|             SENSOR_OBJECT_PATH, | ||||
|             (proxy, error)  => { | ||||
|                 if (error) | ||||
|                     log(error.message); | ||||
|             }, | ||||
|             null, | ||||
|             Gio.DBusProxyFlags.DO_NOT_AUTO_START); | ||||
|         this._sensorProxy.connect('g-properties-changed', () => { | ||||
|             this._updateOrientationLock(); | ||||
|         }); | ||||
|         this._sensorProxy.connect('notify::g-name-owner', () => { | ||||
|             this._updateOrientationLock(); | ||||
|         }); | ||||
|                                    () => { this._updateOrientationLock(); }); | ||||
|         Gio.DBus.system.watch_name(SENSOR_BUS_NAME, | ||||
|                                    Gio.BusNameWatcherFlags.NONE, | ||||
|                                    () => { this._sensorProxyAppeared(); }, | ||||
|                                    () => { | ||||
|                                        this._sensorProxy = null; | ||||
|                                        this._updateOrientationLock(); | ||||
|                                    }); | ||||
|         this._updateOrientationLock(); | ||||
|         this._updateOrientationLockIcon(); | ||||
|  | ||||
|         Main.sessionMode.connect('updated', () => this._sessionUpdated()); | ||||
|         Main.sessionMode.connect('updated', () => { this._sessionUpdated(); }); | ||||
|         this._sessionUpdated(); | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get can_power_off() { | ||||
|         return this._actions.get(POWER_OFF_ACTION_ID).available; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get can_suspend() { | ||||
|         return this._actions.get(SUSPEND_ACTION_ID).available; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get can_lock_screen() { | ||||
|         return this._actions.get(LOCK_SCREEN_ACTION_ID).available; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get can_switch_user() { | ||||
|         return this._actions.get(SWITCH_USER_ACTION_ID).available; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get can_logout() { | ||||
|         return this._actions.get(LOGOUT_ACTION_ID).available; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get can_lock_orientation() { | ||||
|         return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get orientation_lock_icon() { | ||||
|         return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName; | ||||
|     } | ||||
|  | ||||
|     _sensorProxyAppeared() { | ||||
|         this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH, | ||||
|             (proxy, error)  => { | ||||
|                 if (error) { | ||||
|                     log(error.message); | ||||
|                     return; | ||||
|                 } | ||||
|                 this._sensorProxy.connect('g-properties-changed', | ||||
|                                           () => { this._updateOrientationLock(); }); | ||||
|                 this._updateOrientationLock(); | ||||
|             }); | ||||
|     } | ||||
|  | ||||
|     _updateOrientationLock() { | ||||
|         let available = false; | ||||
|         if (this._sensorProxy.g_name_owner) | ||||
|         if (this._sensorProxy) | ||||
|             available = this._sensorProxy.HasAccelerometer && | ||||
|                         this._monitorManager.get_is_builtin_display_on(); | ||||
|  | ||||
| @@ -244,9 +233,8 @@ const SystemActions = GObject.registerClass({ | ||||
|  | ||||
|     _updateOrientationLockIcon() { | ||||
|         let locked = this._orientationSettings.get_boolean('orientation-lock'); | ||||
|         let iconName = locked | ||||
|             ? 'rotation-locked-symbolic' | ||||
|             : 'rotation-allowed-symbolic'; | ||||
|         let iconName = locked ? 'rotation-locked-symbolic' | ||||
|                               : 'rotation-allowed-symbolic'; | ||||
|         this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName = iconName; | ||||
|  | ||||
|         this.notify('orientation-lock-icon'); | ||||
| @@ -269,11 +257,11 @@ const SystemActions = GObject.registerClass({ | ||||
|  | ||||
|     getMatchingActions(terms) { | ||||
|         // terms is a list of strings | ||||
|         terms = terms.map(term => term.toLowerCase()); | ||||
|         terms = terms.map((term) => { return term.toLowerCase(); }); | ||||
|  | ||||
|         let results = []; | ||||
|  | ||||
|         for (let [key, { available, keywords }] of this._actions) | ||||
|         for (let [key, {available, keywords}] of this._actions) | ||||
|             if (available && terms.every(t => keywords.some(k => k.startsWith(t)))) | ||||
|                 results.push(key); | ||||
|  | ||||
| @@ -290,24 +278,24 @@ const SystemActions = GObject.registerClass({ | ||||
|  | ||||
|     activateAction(id) { | ||||
|         switch (id) { | ||||
|         case POWER_OFF_ACTION_ID: | ||||
|             this.activatePowerOff(); | ||||
|             break; | ||||
|         case LOCK_SCREEN_ACTION_ID: | ||||
|             this.activateLockScreen(); | ||||
|             break; | ||||
|         case LOGOUT_ACTION_ID: | ||||
|             this.activateLogout(); | ||||
|             break; | ||||
|         case SUSPEND_ACTION_ID: | ||||
|             this.activateSuspend(); | ||||
|             break; | ||||
|         case SWITCH_USER_ACTION_ID: | ||||
|             this.activateSwitchUser(); | ||||
|             break; | ||||
|         case LOCK_ORIENTATION_ACTION_ID: | ||||
|             this.activateLockOrientation(); | ||||
|             break; | ||||
|             case POWER_OFF_ACTION_ID: | ||||
|                 this.activatePowerOff(); | ||||
|                 break; | ||||
|             case LOCK_SCREEN_ACTION_ID: | ||||
|                 this.activateLockScreen(); | ||||
|                 break; | ||||
|             case LOGOUT_ACTION_ID: | ||||
|                 this.activateLogout(); | ||||
|                 break; | ||||
|             case SUSPEND_ACTION_ID: | ||||
|                 this.activateSuspend(); | ||||
|                 break; | ||||
|             case SWITCH_USER_ACTION_ID: | ||||
|                 this.activateSwitchUser(); | ||||
|                 break; | ||||
|             case LOCK_ORIENTATION_ACTION_ID: | ||||
|                 this.activateLockOrientation(); | ||||
|                 break; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|   | ||||
							
								
								
									
										165
									
								
								js/misc/util.js
									
									
									
									
									
								
							
							
						
						
									
										165
									
								
								js/misc/util.js
									
									
									
									
									
								
							| @@ -1,23 +1,23 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine, | ||||
|             formatTime, formatTimeSpan, createTimeLabel, insertSorted, | ||||
|             makeCloseButton, ensureActorVisibleInScrollView */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi; | ||||
| const Gettext = imports.gettext; | ||||
| const Mainloop = imports.mainloop; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Main = imports.ui.main; | ||||
| const Tweener = imports.ui.tweener; | ||||
| const Params = imports.misc.params; | ||||
|  | ||||
| var SCROLL_TIME = 100; | ||||
| var SCROLL_TIME = 0.1; | ||||
|  | ||||
| // http://daringfireball.net/2010/07/improved_regex_for_matching_urls | ||||
| const _balancedParens = '\\([^\\s()<>]+\\)'; | ||||
| const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]'; | ||||
| const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u200E\u200F\u201C\u201D\u2018\u2019\u202A\u202C]'; | ||||
| const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u201C\u201D\u2018\u2019]'; | ||||
|  | ||||
| const _urlRegexp = new RegExp( | ||||
|     `(^|${_leadingJunk})` + | ||||
|     '(^|' + _leadingJunk + ')' + | ||||
|     '(' + | ||||
|         '(?:' + | ||||
|             '(?:http|https|ftp)://' +             // scheme:// | ||||
| @@ -29,12 +29,12 @@ const _urlRegexp = new RegExp( | ||||
|         '(?:' +                                   // one or more: | ||||
|             '[^\\s()<>]+' +                       // run of non-space non-() | ||||
|             '|' +                                 // or | ||||
|             `${_balancedParens}` +                // balanced parens | ||||
|             _balancedParens +                     // balanced parens | ||||
|         ')+' + | ||||
|         '(?:' +                                   // end with: | ||||
|             `${_balancedParens}` +                // balanced parens | ||||
|             _balancedParens +                     // balanced parens | ||||
|             '|' +                                 // or | ||||
|             `${_notTrailingJunk}` +               // last non-junk char | ||||
|             _notTrailingJunk +                    // last non-junk char | ||||
|         ')' + | ||||
|     ')', 'gi'); | ||||
|  | ||||
| @@ -69,16 +69,16 @@ function spawn(argv) { | ||||
| } | ||||
|  | ||||
| // spawnCommandLine: | ||||
| // @commandLine: a command line | ||||
| // @command_line: a command line | ||||
| // | ||||
| // Runs @commandLine in the background, handling any errors that | ||||
| // Runs @command_line in the background, handling any errors that | ||||
| // occur when trying to parse or start the program. | ||||
| function spawnCommandLine(commandLine) { | ||||
| function spawnCommandLine(command_line) { | ||||
|     try { | ||||
|         let [success_, argv] = GLib.shell_parse_argv(commandLine); | ||||
|         let [success, argv] = GLib.shell_parse_argv(command_line); | ||||
|         trySpawn(argv); | ||||
|     } catch (err) { | ||||
|         _handleSpawnError(commandLine, err); | ||||
|         _handleSpawnError(command_line, err); | ||||
|     } | ||||
| } | ||||
|  | ||||
| @@ -93,7 +93,7 @@ function spawnApp(argv) { | ||||
|  | ||||
|         let context = global.create_app_launch_context(0, -1); | ||||
|         app.launch([], context); | ||||
|     } catch (err) { | ||||
|     } catch(err) { | ||||
|         _handleSpawnError(argv[0], err); | ||||
|     } | ||||
| } | ||||
| @@ -103,12 +103,13 @@ function spawnApp(argv) { | ||||
| // | ||||
| // Runs @argv in the background. If launching @argv fails, | ||||
| // this will throw an error. | ||||
| function trySpawn(argv) { | ||||
|     var success_, pid; | ||||
| function trySpawn(argv) | ||||
| { | ||||
|     var success, pid; | ||||
|     try { | ||||
|         [success_, pid] = GLib.spawn_async(null, argv, null, | ||||
|                                            GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD, | ||||
|                                            null); | ||||
|         [success, pid] = GLib.spawn_async(null, argv, null, | ||||
|                                           GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD, | ||||
|                                           null); | ||||
|     } catch (err) { | ||||
|         /* Rewrite the error in case of ENOENT */ | ||||
|         if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) { | ||||
| @@ -134,19 +135,19 @@ function trySpawn(argv) { | ||||
| } | ||||
|  | ||||
| // trySpawnCommandLine: | ||||
| // @commandLine: a command line | ||||
| // @command_line: a command line | ||||
| // | ||||
| // Runs @commandLine in the background. If launching @commandLine | ||||
| // Runs @command_line in the background. If launching @command_line | ||||
| // fails, this will throw an error. | ||||
| function trySpawnCommandLine(commandLine) { | ||||
|     let success_, argv; | ||||
| function trySpawnCommandLine(command_line) { | ||||
|     let success, argv; | ||||
|  | ||||
|     try { | ||||
|         [success_, argv] = GLib.shell_parse_argv(commandLine); | ||||
|         [success, argv] = GLib.shell_parse_argv(command_line); | ||||
|     } catch (err) { | ||||
|         // Replace "Error invoking GLib.shell_parse_argv: " with | ||||
|         // something nicer | ||||
|         err.message = err.message.replace(/[^:]*: /, `${_("Could not parse command:")}\n`); | ||||
|         err.message = err.message.replace(/[^:]*: /, _("Could not parse command:") + "\n"); | ||||
|         throw err; | ||||
|     } | ||||
|  | ||||
| @@ -221,7 +222,7 @@ function formatTime(time, params) { | ||||
|             /* Translators: Time in 24h format */ | ||||
|             format = N_("%H\u2236%M"); | ||||
|         // Show the word "Yesterday" and time if date is on yesterday | ||||
|         else if (daysAgo < 2) | ||||
|         else if (daysAgo <2) | ||||
|             /* Translators: this is the word "Yesterday" followed by a | ||||
|              time string in 24h format. i.e. "Yesterday, 14:30" */ | ||||
|             // xgettext:no-c-format | ||||
| @@ -250,7 +251,7 @@ function formatTime(time, params) { | ||||
|             /* Translators: Time in 12h format */ | ||||
|             format = N_("%l\u2236%M %p"); | ||||
|         // Show the word "Yesterday" and time if date is on yesterday | ||||
|         else if (daysAgo < 2) | ||||
|         else if (daysAgo <2) | ||||
|             /* Translators: this is the word "Yesterday" followed by a | ||||
|              time string in 12h format. i.e. "Yesterday, 2:30 pm" */ | ||||
|             // xgettext:no-c-format | ||||
| @@ -288,7 +289,7 @@ function createTimeLabel(date, params) { | ||||
|     let id = _desktopSettings.connect('changed::clock-format', () => { | ||||
|         label.text = formatTime(date, params); | ||||
|     }); | ||||
|     label.connect('destroy', () => _desktopSettings.disconnect(id)); | ||||
|     label.connect('destroy', () => { _desktopSettings.disconnect(id); }); | ||||
|     return label; | ||||
| } | ||||
|  | ||||
| @@ -313,8 +314,7 @@ function lowerBound(array, val, cmp) { | ||||
|     if (array.length == 0) | ||||
|         return 0; | ||||
|  | ||||
|     min = 0; | ||||
|     max = array.length; | ||||
|     min = 0; max = array.length; | ||||
|     while (min < (max - 1)) { | ||||
|         mid = Math.floor((min + max) / 2); | ||||
|         v = cmp(array[mid], val); | ||||
| @@ -346,7 +346,7 @@ function insertSorted(array, val, cmp) { | ||||
| var CloseButton = GObject.registerClass( | ||||
| class CloseButton extends St.Button { | ||||
|     _init(boxpointer) { | ||||
|         super._init({ style_class: 'notification-close' }); | ||||
|         super._init({ style_class: 'notification-close'}); | ||||
|  | ||||
|         // This is a bit tricky. St.Bin has its own x-align/y-align properties | ||||
|         // that compete with Clutter's properties. This should be fixed for | ||||
| @@ -380,7 +380,7 @@ class CloseButton extends St.Button { | ||||
|         let themeNode = this.get_theme_node(); | ||||
|  | ||||
|         let offY = this._computeBoxPointerOffset(); | ||||
|         this.translation_x = themeNode.get_length('-shell-close-overlap-x'); | ||||
|         this.translation_x = themeNode.get_length('-shell-close-overlap-x') | ||||
|         this.translation_y = themeNode.get_length('-shell-close-overlap-y') + offY; | ||||
|     } | ||||
|  | ||||
| @@ -396,7 +396,7 @@ function makeCloseButton(boxpointer) { | ||||
|  | ||||
| function ensureActorVisibleInScrollView(scrollView, actor) { | ||||
|     let adjustment = scrollView.vscroll.adjustment; | ||||
|     let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values(); | ||||
|     let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values(); | ||||
|  | ||||
|     let offset = 0; | ||||
|     let vfade = scrollView.get_effect("fade"); | ||||
| @@ -424,8 +424,97 @@ function ensureActorVisibleInScrollView(scrollView, actor) { | ||||
|     else | ||||
|         return; | ||||
|  | ||||
|     adjustment.ease(value, { | ||||
|         mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|         duration: SCROLL_TIME | ||||
|     }); | ||||
|     Tweener.addTween(adjustment, | ||||
|                      { value: value, | ||||
|                        time: SCROLL_TIME, | ||||
|                        transition: 'easeOutQuad' }); | ||||
| } | ||||
|  | ||||
| var AppSettingsMonitor = class { | ||||
|     constructor(appId, schemaId) { | ||||
|         this._appId = appId; | ||||
|         this._schemaId = schemaId; | ||||
|  | ||||
|         this._app = null; | ||||
|         this._settings = null; | ||||
|         this._handlers = []; | ||||
|  | ||||
|         this._schemaSource = Gio.SettingsSchemaSource.get_default(); | ||||
|  | ||||
|         this._appSystem = Shell.AppSystem.get_default(); | ||||
|         this._appSystem.connect('installed-changed', | ||||
|                                 this._onInstalledChanged.bind(this)); | ||||
|         this._onInstalledChanged(); | ||||
|     } | ||||
|  | ||||
|     get available() { | ||||
|         return this._app != null && this._settings != null; | ||||
|     } | ||||
|  | ||||
|     activateApp() { | ||||
|         if (this._app) | ||||
|             this._app.activate(); | ||||
|     } | ||||
|  | ||||
|     watchSetting(key, callback) { | ||||
|         let handler = { id: 0, key: key, callback: callback }; | ||||
|         this._handlers.push(handler); | ||||
|  | ||||
|         this._connectHandler(handler); | ||||
|     } | ||||
|  | ||||
|     _connectHandler(handler) { | ||||
|         if (!this._settings || handler.id > 0) | ||||
|             return; | ||||
|  | ||||
|         handler.id = this._settings.connect('changed::' + handler.key, | ||||
|                                             handler.callback); | ||||
|         handler.callback(this._settings, handler.key); | ||||
|     } | ||||
|  | ||||
|     _disconnectHandler(handler) { | ||||
|         if (this._settings && handler.id > 0) | ||||
|             this._settings.disconnect(handler.id); | ||||
|         handler.id = 0; | ||||
|     } | ||||
|  | ||||
|     _onInstalledChanged() { | ||||
|         let hadApp = (this._app != null); | ||||
|         this._app = this._appSystem.lookup_app(this._appId); | ||||
|         let haveApp = (this._app != null); | ||||
|  | ||||
|         if (hadApp == haveApp) | ||||
|             return; | ||||
|  | ||||
|         if (haveApp) | ||||
|             this._checkSettings(); | ||||
|         else | ||||
|             this._setSettings(null); | ||||
|     } | ||||
|  | ||||
|     _setSettings(settings) { | ||||
|         this._handlers.forEach((handler) => { this._disconnectHandler(handler); }); | ||||
|  | ||||
|         let hadSettings = (this._settings != null); | ||||
|         this._settings = settings; | ||||
|         let haveSettings = (this._settings != null); | ||||
|  | ||||
|         this._handlers.forEach((handler) => { this._connectHandler(handler); }); | ||||
|  | ||||
|         if (hadSettings != haveSettings) | ||||
|             this.emit('available-changed'); | ||||
|     } | ||||
|  | ||||
|     _checkSettings() { | ||||
|         let schema = this._schemaSource.lookup(this._schemaId, true); | ||||
|         if (schema) { | ||||
|             this._setSettings(new Gio.Settings({ settings_schema: schema })); | ||||
|         } else if (this._app) { | ||||
|             Mainloop.timeout_add_seconds(1, () => { | ||||
|                 this._checkSettings(); | ||||
|                 return GLib.SOURCE_REMOVE; | ||||
|             }); | ||||
|         } | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(AppSettingsMonitor.prototype); | ||||
|   | ||||
| @@ -1,19 +1,10 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
|  | ||||
| const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi; | ||||
| const { Geoclue, Gio, GLib, GWeather } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const PermissionStore = imports.misc.permissionStore; | ||||
|  | ||||
| const { loadInterfaceXML } = imports.misc.fileUtils; | ||||
|  | ||||
| const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration'); | ||||
|  | ||||
| const WEATHER_BUS_NAME = 'org.gnome.Weather'; | ||||
| const WEATHER_OBJECT_PATH = '/org/gnome/Weather'; | ||||
| const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration'; | ||||
|  | ||||
| const WEATHER_APP_ID = 'org.gnome.Weather.desktop'; | ||||
| const Util = imports.misc.util; | ||||
|  | ||||
| // Minimum time between updates to show loading indication | ||||
| var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE; | ||||
| @@ -35,7 +26,7 @@ var WeatherClient = class { | ||||
|         this._weatherAuthorized = false; | ||||
|         this._permStore = new PermissionStore.PermissionStore((proxy, error) => { | ||||
|             if (error) { | ||||
|                 log(`Failed to connect to permissionStore: ${error.message}`); | ||||
|                 log('Failed to connect to permissionStore: ' + error.message); | ||||
|                 return; | ||||
|             } | ||||
|  | ||||
| @@ -49,7 +40,7 @@ var WeatherClient = class { | ||||
|  | ||||
|             this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => { | ||||
|                 if (error) | ||||
|                     log(`Error looking up permission: ${error.message}`); | ||||
|                     log('Error looking up permission: ' + error.message); | ||||
|  | ||||
|                 let [perms, data] = error ? [{}, null] : res; | ||||
|                 let  params = ['gnome', 'geolocation', false, data, perms]; | ||||
| @@ -75,38 +66,17 @@ var WeatherClient = class { | ||||
|             this.emit('changed'); | ||||
|         }); | ||||
|  | ||||
|         this._weatherApp = null; | ||||
|         this._weatherProxy = null; | ||||
|  | ||||
|         let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface); | ||||
|         Gio.DBusProxy.new( | ||||
|             Gio.DBus.session, | ||||
|             Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES, | ||||
|             nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE), | ||||
|             WEATHER_BUS_NAME, | ||||
|             WEATHER_OBJECT_PATH, | ||||
|             WEATHER_INTEGRATION_IFACE, | ||||
|             null, | ||||
|             this._onWeatherProxyReady.bind(this)); | ||||
|  | ||||
|         this._settings = new Gio.Settings({ | ||||
|             schema_id: 'org.gnome.shell.weather' | ||||
|         }); | ||||
|         this._settings.connect('changed::automatic-location', | ||||
|             this._onAutomaticLocationChanged.bind(this)); | ||||
|         this._onAutomaticLocationChanged(); | ||||
|         this._settings.connect('changed::locations', | ||||
|             this._onLocationsChanged.bind(this)); | ||||
|         this._onLocationsChanged(); | ||||
|  | ||||
|         this._appSystem = Shell.AppSystem.get_default(); | ||||
|         this._appSystem.connect('installed-changed', | ||||
|             this._onInstalledChanged.bind(this)); | ||||
|         this._onInstalledChanged(); | ||||
|         this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop', | ||||
|                                                           'org.gnome.Weather'); | ||||
|         this._weatherAppMon.connect('available-changed', () => { this.emit('changed'); }); | ||||
|         this._weatherAppMon.watchSetting('automatic-location', | ||||
|                                          this._onAutomaticLocationChanged.bind(this)); | ||||
|         this._weatherAppMon.watchSetting('locations', | ||||
|                                          this._onLocationsChanged.bind(this)); | ||||
|     } | ||||
|  | ||||
|     get available() { | ||||
|         return this._weatherApp != null; | ||||
|         return this._weatherAppMon.available; | ||||
|     } | ||||
|  | ||||
|     get loading() { | ||||
| @@ -122,8 +92,7 @@ var WeatherClient = class { | ||||
|     } | ||||
|  | ||||
|     activateApp() { | ||||
|         if (this._weatherApp) | ||||
|             this._weatherApp.activate(); | ||||
|         this._weatherAppMon.activateApp(); | ||||
|     } | ||||
|  | ||||
|     update() { | ||||
| @@ -145,38 +114,6 @@ var WeatherClient = class { | ||||
|                this._weatherAuthorized; | ||||
|     } | ||||
|  | ||||
|     _onWeatherProxyReady(o, res) { | ||||
|         try { | ||||
|             this._weatherProxy = Gio.DBusProxy.new_finish(res); | ||||
|         } catch (e) { | ||||
|             log(`Failed to create GNOME Weather proxy: ${e}`); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this._weatherProxy.connect('g-properties-changed', | ||||
|             this._onWeatherPropertiesChanged.bind(this)); | ||||
|         this._onWeatherPropertiesChanged(); | ||||
|     } | ||||
|  | ||||
|     _onWeatherPropertiesChanged() { | ||||
|         if (this._weatherProxy.g_name_owner == null) | ||||
|             return; | ||||
|  | ||||
|         this._settings.set_boolean('automatic-location', | ||||
|             this._weatherProxy.AutomaticLocation); | ||||
|         this._settings.set_value('locations', | ||||
|             new GLib.Variant('av', this._weatherProxy.Locations)); | ||||
|     } | ||||
|  | ||||
|     _onInstalledChanged() { | ||||
|         let hadApp = (this._weatherApp != null); | ||||
|         this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID); | ||||
|         let haveApp = (this._weatherApp != null); | ||||
|  | ||||
|         if (hadApp !== haveApp) | ||||
|             this.emit('changed'); | ||||
|     } | ||||
|  | ||||
|     _loadInfo() { | ||||
|         let id = this._weatherInfo.connect('updated', () => { | ||||
|             this._weatherInfo.disconnect(id); | ||||
| @@ -241,8 +178,8 @@ var WeatherClient = class { | ||||
|             (o, res) => { | ||||
|                 try { | ||||
|                     this._gclueService = Geoclue.Simple.new_finish(res); | ||||
|                 } catch (e) { | ||||
|                     log(`Failed to connect to Geoclue2 service: ${e.message}`); | ||||
|                 } catch(e) { | ||||
|                     log('Failed to connect to Geoclue2 service: ' + e.message); | ||||
|                     this._setLocation(this._mostRecentLocation); | ||||
|                     return; | ||||
|                 } | ||||
| @@ -261,8 +198,8 @@ var WeatherClient = class { | ||||
|         this._setLocation(location); | ||||
|     } | ||||
|  | ||||
|     _onAutomaticLocationChanged() { | ||||
|         let useAutoLocation = this._settings.get_boolean('automatic-location'); | ||||
|     _onAutomaticLocationChanged(settings, key) { | ||||
|         let useAutoLocation = settings.get_boolean(key); | ||||
|         if (this._autoLocationRequested == useAutoLocation) | ||||
|             return; | ||||
|  | ||||
| @@ -280,9 +217,8 @@ var WeatherClient = class { | ||||
|             this._setLocation(this._mostRecentLocation); | ||||
|     } | ||||
|  | ||||
|     _onLocationsChanged() { | ||||
|         let locations = this._settings.get_value('locations').deep_unpack(); | ||||
|         let serialized = locations.shift(); | ||||
|     _onLocationsChanged(settings, key) { | ||||
|         let serialized = settings.get_value(key).deep_unpack().shift(); | ||||
|         let mostRecentLocation = null; | ||||
|  | ||||
|         if (serialized) | ||||
| @@ -298,7 +234,7 @@ var WeatherClient = class { | ||||
|     } | ||||
|  | ||||
|     _onPermStoreChanged(proxy, sender, params) { | ||||
|         let [table, id, deleted_, data_, perms] = params; | ||||
|         let [table, id, deleted, data, perms] = params; | ||||
|  | ||||
|         if (table != 'gnome' || id != 'geolocation') | ||||
|             return; | ||||
|   | ||||
| @@ -1,9 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported run, script_overviewShowStart, script_overviewShowDone, | ||||
|             script_applicationsShowStart, script_applicationsShowDone, | ||||
|             script_afterShowHide, malloc_usedSize, glx_swapComplete, | ||||
|             clutter_stagePaintDone */ | ||||
| /* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */ | ||||
|  | ||||
| const System = imports.system; | ||||
|  | ||||
| @@ -24,7 +19,7 @@ var METRICS = { | ||||
|       units: "frames / s" }, | ||||
|     overviewLatencySubsequent: | ||||
|     { description: "Time to first frame after triggering overview, second time", | ||||
|       units: "us" }, | ||||
|       units: "us"}, | ||||
|     overviewFpsSubsequent: | ||||
|     { description: "Frames rate when going to the overview, second time", | ||||
|       units: "frames / s" }, | ||||
| @@ -57,7 +52,7 @@ var METRICS = { | ||||
|       units: "us" }, | ||||
|     applicationsShowTimeSubsequent: | ||||
|     { description: "Time to switch to applications view, second time", | ||||
|       units: "us" } | ||||
|       units: "us"} | ||||
| }; | ||||
|  | ||||
| let WINDOW_CONFIGS = [ | ||||
| @@ -126,12 +121,10 @@ function *run() { | ||||
|  | ||||
|     for (let i = 0; i < 2; i++) { | ||||
|         Scripting.scriptEvent('applicationsShowStart'); | ||||
|         // eslint-disable-next-line require-atomic-updates | ||||
|         Main.overview.dash.showAppsButton.checked = true; | ||||
|         Main.overview._dash.showAppsButton.checked = true; | ||||
|         yield Scripting.waitLeisure(); | ||||
|         Scripting.scriptEvent('applicationsShowDone'); | ||||
|         // eslint-disable-next-line require-atomic-updates | ||||
|         Main.overview.dash.showAppsButton.checked = false; | ||||
|         Main.overview._dash.showAppsButton.checked = false; | ||||
|         yield Scripting.waitLeisure(); | ||||
|     } | ||||
| } | ||||
| @@ -143,6 +136,7 @@ let overviewFrames; | ||||
| let overviewLatency; | ||||
| let mallocUsedSize = 0; | ||||
| let overviewShowCount = 0; | ||||
| let firstOverviewUsedSize; | ||||
| let haveSwapComplete = false; | ||||
| let applicationsShowStart; | ||||
| let applicationsShowCount = 0; | ||||
| @@ -154,7 +148,7 @@ function script_overviewShowStart(time) { | ||||
|     overviewFrames = 0; | ||||
| } | ||||
|  | ||||
| function script_overviewShowDone(_time) { | ||||
| function script_overviewShowDone(time) { | ||||
|     // We've set up the state at the end of the zoom out, but we | ||||
|     // need to wait for one more frame to paint before we count | ||||
|     // ourselves as done. | ||||
| @@ -173,7 +167,7 @@ function script_applicationsShowDone(time) { | ||||
|         METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart; | ||||
| } | ||||
|  | ||||
| function script_afterShowHide(_time) { | ||||
| function script_afterShowHide(time) { | ||||
|     if (overviewShowCount == 1) { | ||||
|         METRICS.usedAfterOverview.value = mallocUsedSize; | ||||
|     } else { | ||||
|   | ||||
| @@ -1,12 +1,3 @@ | ||||
| /* exported run, script_desktopShown, script_overviewShowStart, | ||||
|             script_overviewShowDone, script_applicationsShowStart, | ||||
|             script_applicationsShowDone, script_mainViewDrawStart, | ||||
|             script_mainViewDrawDone, script_overviewDrawStart, | ||||
|             script_overviewDrawDone, script_redrawTestStart, | ||||
|             script_redrawTestDone, script_collectTimings, | ||||
|             script_geditLaunch, script_geditFirstFrame, | ||||
|             clutter_stagePaintStart, clutter_paintCompletedTimestamp */ | ||||
| /* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */ | ||||
| const { Clutter, Gio, Shell } = imports.gi; | ||||
| const Main = imports.ui.main; | ||||
| const Scripting = imports.ui.scripting; | ||||
| @@ -39,7 +30,7 @@ var METRICS = { | ||||
|     geditStartTime: | ||||
|     { description: "Time from gedit launch to window drawn", | ||||
|       units: "us" }, | ||||
| }; | ||||
| } | ||||
|  | ||||
| function waitAndDraw(milliseconds) { | ||||
|     let cb; | ||||
| @@ -47,7 +38,7 @@ function waitAndDraw(milliseconds) { | ||||
|     let timeline = new Clutter.Timeline({ duration: milliseconds }); | ||||
|     timeline.start(); | ||||
|  | ||||
|     timeline.connect('new-frame', (_timeline, _frame) => { | ||||
|     timeline.connect('new-frame', (timeline, frame) => { | ||||
|         global.stage.queue_redraw(); | ||||
|     }); | ||||
|  | ||||
| @@ -57,7 +48,7 @@ function waitAndDraw(milliseconds) { | ||||
|             cb(); | ||||
|     }); | ||||
|  | ||||
|     return callback => (cb = callback); | ||||
|     return callback => { cb = callback; }; | ||||
| } | ||||
|  | ||||
| function waitSignal(object, signal) { | ||||
| @@ -69,7 +60,7 @@ function waitSignal(object, signal) { | ||||
|             cb(); | ||||
|     }); | ||||
|  | ||||
|     return callback => (cb = callback); | ||||
|     return callback => { cb = callback; }; | ||||
| } | ||||
|  | ||||
| function extractBootTimestamp() { | ||||
| @@ -82,8 +73,8 @@ function extractBootTimestamp() { | ||||
|     let result = null; | ||||
|  | ||||
|     let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe()); | ||||
|     while (true) { // eslint-disable-line no-constant-condition | ||||
|         let [line, length_] = datastream.read_line_utf8(null); | ||||
|     while (true) { | ||||
|         let [line, length] = datastream.read_line_utf8(null); | ||||
|         if (line === null) | ||||
|             break; | ||||
|  | ||||
| @@ -126,8 +117,7 @@ function *run() { | ||||
|     yield Scripting.sleep(1000); | ||||
|  | ||||
|     Scripting.scriptEvent('applicationsShowStart'); | ||||
|     // eslint-disable-next-line require-atomic-updates | ||||
|     Main.overview.dash.showAppsButton.checked = true; | ||||
|     Main.overview._dash.showAppsButton.checked = true; | ||||
|  | ||||
|     yield Scripting.waitLeisure(); | ||||
|     Scripting.scriptEvent('applicationsShowDone'); | ||||
| @@ -137,9 +127,9 @@ function *run() { | ||||
|     Main.overview.hide(); | ||||
|     yield Scripting.waitLeisure(); | ||||
|  | ||||
|     // --------------------- // | ||||
|     // Tests of redraw speed // | ||||
|     // --------------------- // | ||||
|     //////////////////////////////////////// | ||||
|     // Tests of redraw speed | ||||
|     //////////////////////////////////////// | ||||
|  | ||||
|     global.frame_timestamps = true; | ||||
|     global.frame_finish_timestamp = true; | ||||
| @@ -167,7 +157,7 @@ function *run() { | ||||
|     Main.overview.hide(); | ||||
|  | ||||
|     yield Scripting.createTestWindow({ maximized: true, | ||||
|                                        redraws: true }); | ||||
|                                        redraws: true}); | ||||
|     yield Scripting.waitTestWindows(); | ||||
|  | ||||
|     yield Scripting.sleep(1000); | ||||
| @@ -186,6 +176,8 @@ function *run() { | ||||
|  | ||||
|     yield Scripting.sleep(1000); | ||||
|  | ||||
|     //////////////////////////////////////// | ||||
|  | ||||
|     let appSys = Shell.AppSystem.get_default(); | ||||
|     let app = appSys.lookup_app('org.gnome.gedit.desktop'); | ||||
|  | ||||
| @@ -242,31 +234,31 @@ function script_applicationsShowDone(time) { | ||||
|     METRICS.applicationsShowTime.value = time - applicationsShowStart; | ||||
| } | ||||
|  | ||||
| function script_mainViewDrawStart(_time) { | ||||
| function script_mainViewDrawStart(time) { | ||||
|     redrawTiming = 'mainView'; | ||||
| } | ||||
|  | ||||
| function script_mainViewDrawDone(_time) { | ||||
| function script_mainViewDrawDone(time) { | ||||
|     redrawTiming = null; | ||||
| } | ||||
|  | ||||
| function script_overviewDrawStart(_time) { | ||||
| function script_overviewDrawStart(time) { | ||||
|     redrawTiming = 'overview'; | ||||
| } | ||||
|  | ||||
| function script_overviewDrawDone(_time) { | ||||
| function script_overviewDrawDone(time) { | ||||
|     redrawTiming = null; | ||||
| } | ||||
|  | ||||
| function script_redrawTestStart(_time) { | ||||
| function script_redrawTestStart(time) { | ||||
|     redrawTiming = 'application'; | ||||
| } | ||||
|  | ||||
| function script_redrawTestDone(_time) { | ||||
| function script_redrawTestDone(time) { | ||||
|     redrawTiming = null; | ||||
| } | ||||
|  | ||||
| function script_collectTimings(_time) { | ||||
| function script_collectTimings(time) { | ||||
|     for (let timing in redrawTimes) { | ||||
|         let times = redrawTimes[timing]; | ||||
|         times.sort((a, b) => a - b); | ||||
| @@ -277,11 +269,11 @@ function script_collectTimings(_time) { | ||||
|         if (len == 0) | ||||
|             median = -1; | ||||
|         else if (len % 2 == 1) | ||||
|             median = times[(len - 1) / 2]; | ||||
|             median = times[(len - 1)/ 2]; | ||||
|         else | ||||
|             median = Math.round((times[len / 2 - 1] + times[len / 2]) / 2); | ||||
|  | ||||
|         METRICS[`${timing}RedrawTime`].value = median; | ||||
|         METRICS[timing + 'RedrawTime'].value = median; | ||||
|     } | ||||
| } | ||||
|  | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported main */ | ||||
| const Format = imports.format; | ||||
| const Gettext = imports.gettext; | ||||
| const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi; | ||||
| @@ -20,6 +19,7 @@ const PortalHelperSecurityLevel = { | ||||
|     INSECURE: 2 | ||||
| }; | ||||
|  | ||||
| const INACTIVITY_TIMEOUT = 30000; //ms | ||||
| const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org'; | ||||
| const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST; | ||||
| const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC; | ||||
| @@ -59,7 +59,7 @@ class PortalHeaderBar extends Gtk.HeaderBar { | ||||
|                                              single_line_mode: true, | ||||
|                                              ellipsize: Pango.EllipsizeMode.END, | ||||
|                                              valign: Gtk.Align.BASELINE, | ||||
|                                              selectable: true }); | ||||
|                                              selectable: true}); | ||||
|         this.subtitleLabel.get_style_context().add_class('subtitle'); | ||||
|         hbox.add(this.subtitleLabel); | ||||
|  | ||||
| @@ -152,7 +152,7 @@ class PortalWindow extends Gtk.ApplicationWindow { | ||||
|         this._webView.load_uri(this._originalUrl); | ||||
|     } | ||||
|  | ||||
|     vfunc_delete_event(_event) { | ||||
|     vfunc_delete_event(event) { | ||||
|         if (this._recheckAtExit) | ||||
|             this._doneCallback(PortalHelperResult.RECHECK); | ||||
|         else | ||||
| @@ -178,7 +178,7 @@ class PortalWindow extends Gtk.ApplicationWindow { | ||||
|         this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE); | ||||
|     } | ||||
|  | ||||
|     _onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) { | ||||
|     _onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) { | ||||
|         this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE); | ||||
|         let uri = new Soup.URI(failingURI); | ||||
|         this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host()); | ||||
| @@ -265,7 +265,7 @@ class WebPortalHelper extends Gtk.Application { | ||||
|         this._queue = []; | ||||
|  | ||||
|         let action = new Gio.SimpleAction({ name: 'quit' }); | ||||
|         action.connect('activate', () => this.active_window.destroyWindow()); | ||||
|         action.connect('activate', () => { this.active_window.destroyWindow(); }); | ||||
|         this.add_action(action); | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported AccessDialogDBus */ | ||||
| const { Clutter, Gio, GLib, GObject, Shell } = imports.gi; | ||||
|  | ||||
| const CheckBox = imports.ui.checkBox; | ||||
| @@ -56,8 +55,8 @@ class AccessDialog extends ModalDialog.ModalDialog { | ||||
|  | ||||
|             let check = new CheckBox.CheckBox(); | ||||
|             check.getLabelActor().text = name; | ||||
|             check.checked = selected == "true"; | ||||
|             content.insertBeforeBody(check); | ||||
|             check.actor.checked = selected == "true"; | ||||
|             content.insertBeforeBody(check.actor); | ||||
|  | ||||
|             this._choices.set(id, check); | ||||
|         } | ||||
| @@ -70,7 +69,7 @@ class AccessDialog extends ModalDialog.ModalDialog { | ||||
|         this.addButton({ label: grantLabel, | ||||
|                          action: () => { | ||||
|                              this._sendResponse(DialogResponse.OK); | ||||
|                          } }); | ||||
|                          }}); | ||||
|     } | ||||
|  | ||||
|     open() { | ||||
| @@ -80,7 +79,7 @@ class AccessDialog extends ModalDialog.ModalDialog { | ||||
|         this._requestExported = this._request.export(connection, this._handle); | ||||
|     } | ||||
|  | ||||
|     CloseAsync(invocation, _params) { | ||||
|     CloseAsync(invocation, params) { | ||||
|         if (this._invocation.get_sender() != invocation.get_sender()) { | ||||
|             invocation.return_error_literal(Gio.DBusError, | ||||
|                                             Gio.DBusError.ACCESS_DENIED, | ||||
| @@ -99,7 +98,7 @@ class AccessDialog extends ModalDialog.ModalDialog { | ||||
|         let results = {}; | ||||
|         if (response == DialogResponse.OK) { | ||||
|             for (let [id, check] of this._choices) { | ||||
|                 let checked = check.checked ? 'true' : 'false'; | ||||
|                 let checked = check.actor.checked ? 'true' : 'false'; | ||||
|                 results[id] = new GLib.Variant('s', checked); | ||||
|             } | ||||
|         } | ||||
| @@ -133,10 +132,10 @@ var AccessDialogDBus = class { | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         let [handle, appId, parentWindow_, title, subtitle, body, options] = params; | ||||
|         let [handle, appId, parentWindow, title, subtitle, body, options] = params; | ||||
|         // We probably want to use parentWindow and global.display.focus_window | ||||
|         // for this check in the future | ||||
|         if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) { | ||||
|         if (appId && appId + '.desktop' != this._windowTracker.focus_app.id) { | ||||
|             invocation.return_error_literal(Gio.DBusError, | ||||
|                                             Gio.DBusError.ACCESS_DENIED, | ||||
|                                             'Only the focused app is allowed to show a system access dialog'); | ||||
| @@ -147,7 +146,7 @@ var AccessDialogDBus = class { | ||||
|                                       subtitle, body, options); | ||||
|         dialog.open(); | ||||
|  | ||||
|         dialog.connect('closed', () => (this._accessDialog = null)); | ||||
|         dialog.connect('closed', () => { this._accessDialog = null; }); | ||||
|  | ||||
|         this._accessDialog = dialog; | ||||
|     } | ||||
|   | ||||
							
								
								
									
										225
									
								
								js/ui/altTab.js
									
									
									
									
									
								
							
							
						
						
									
										225
									
								
								js/ui/altTab.js
									
									
									
									
									
								
							| @@ -1,17 +1,17 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup, | ||||
|             WindowCyclerPopup */ | ||||
|  | ||||
| const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
|  | ||||
| const Main = imports.ui.main; | ||||
| const SwitcherPopup = imports.ui.switcherPopup; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds | ||||
|  | ||||
| var THUMBNAIL_DEFAULT_SIZE = 256; | ||||
| var THUMBNAIL_POPUP_TIME = 500; // milliseconds | ||||
| var THUMBNAIL_FADE_TIME = 100; // milliseconds | ||||
| var THUMBNAIL_FADE_TIME = 0.1; // seconds | ||||
|  | ||||
| var WINDOW_PREVIEW_SIZE = 128; | ||||
| var APP_ICON_SIZE = 96; | ||||
| @@ -28,21 +28,15 @@ var AppIconMode = { | ||||
| function _createWindowClone(window, size) { | ||||
|     let [width, height] = window.get_size(); | ||||
|     let scale = Math.min(1.0, size / width, size / height); | ||||
|  | ||||
|     let cloneWidth = size; | ||||
|     let cloneHeight = size; | ||||
|  | ||||
|     if (width > height) | ||||
|         cloneHeight = size * (height / width); | ||||
|     else | ||||
|         cloneWidth = size * (width / height); | ||||
|  | ||||
|     return new Clutter.Actor({ | ||||
|         content: window.content, | ||||
|         width: cloneWidth, | ||||
|         height: cloneHeight, | ||||
|     }); | ||||
| } | ||||
|     return new Clutter.Clone({ source: window, | ||||
|                                width: width * scale, | ||||
|                                height: height * scale, | ||||
|                                x_align: Clutter.ActorAlign.CENTER, | ||||
|                                y_align: Clutter.ActorAlign.CENTER, | ||||
|                                // usual hack for the usual bug in ClutterBinLayout... | ||||
|                                x_expand: true, | ||||
|                                y_expand: true }); | ||||
| }; | ||||
|  | ||||
| function getWindows(workspace) { | ||||
|     // We ignore skip-taskbar windows in switchers, but if they are attached | ||||
| @@ -93,9 +87,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup { | ||||
|             let hPadding = leftPadding + rightPadding; | ||||
|  | ||||
|             let icon = this._items[this._selectedIndex]; | ||||
|             let [posX] = icon.get_transformed_position(); | ||||
|             let [posX, posY] = icon.get_transformed_position(); | ||||
|             let thumbnailCenter = posX + icon.width / 2; | ||||
|             let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1); | ||||
|             let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1); | ||||
|             childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2)); | ||||
|             if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) { | ||||
|                 let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding; | ||||
| @@ -109,7 +103,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup { | ||||
|                 childBox.x2 = primary.x + primary.width - rightPadding; | ||||
|             childBox.y1 = this._switcherList.allocation.y2 + spacing; | ||||
|             this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1); | ||||
|             let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1); | ||||
|             let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1); | ||||
|             childBox.y2 = childBox.y1 + childNaturalHeight; | ||||
|             this._thumbnails.allocate(childBox, flags); | ||||
|         } | ||||
| @@ -297,7 +291,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup { | ||||
|         if (this._thumbnails) | ||||
|             this._destroyThumbnails(); | ||||
|         if (this._thumbnailTimeoutId != 0) | ||||
|             GLib.source_remove(this._thumbnailTimeoutId); | ||||
|             Mainloop.source_remove(this._thumbnailTimeoutId); | ||||
|     } | ||||
|  | ||||
|     /** | ||||
| @@ -332,7 +326,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup { | ||||
|         } | ||||
|  | ||||
|         if (this._thumbnailTimeoutId != 0) { | ||||
|             GLib.source_remove(this._thumbnailTimeoutId); | ||||
|             Mainloop.source_remove(this._thumbnailTimeoutId); | ||||
|             this._thumbnailTimeoutId = 0; | ||||
|         } | ||||
|  | ||||
| @@ -349,8 +343,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup { | ||||
|             this._thumbnails.highlight(window, forceAppFocus); | ||||
|         } else if (this._items[this._selectedIndex].cachedWindows.length > 1 && | ||||
|                    !forceAppFocus) { | ||||
|             this._thumbnailTimeoutId = GLib.timeout_add( | ||||
|                 GLib.PRIORITY_DEFAULT, | ||||
|             this._thumbnailTimeoutId = Mainloop.timeout_add ( | ||||
|                 THUMBNAIL_POPUP_TIME, | ||||
|                 this._timeoutPopupThumbnails.bind(this)); | ||||
|             GLib.Source.set_name_by_id(this._thumbnailTimeoutId, '[gnome-shell] this._timeoutPopupThumbnails'); | ||||
| @@ -367,15 +360,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup { | ||||
|  | ||||
|     _destroyThumbnails() { | ||||
|         let thumbnailsActor = this._thumbnails; | ||||
|         this._thumbnails.ease({ | ||||
|             opacity: 0, | ||||
|             duration: THUMBNAIL_FADE_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => { | ||||
|                 thumbnailsActor.destroy(); | ||||
|                 this.thumbnailsVisible = false; | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(thumbnailsActor, | ||||
|                          { opacity: 0, | ||||
|                            time: THUMBNAIL_FADE_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: () => { | ||||
|                                thumbnailsActor.destroy(); | ||||
|                                this.thumbnailsVisible = false; | ||||
|                            } | ||||
|                          }); | ||||
|         this._thumbnails = null; | ||||
|         if (this._switcherList._items[this._selectedIndex]) | ||||
|             this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED); | ||||
| @@ -398,39 +391,38 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup { | ||||
|         this._thumbnails.get_allocation_box(); | ||||
|  | ||||
|         this._thumbnails.opacity = 0; | ||||
|         this._thumbnails.ease({ | ||||
|             opacity: 255, | ||||
|             duration: THUMBNAIL_FADE_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => { | ||||
|                 this.thumbnailsVisible = true; | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(this._thumbnails, | ||||
|                          { opacity: 255, | ||||
|                            time: THUMBNAIL_FADE_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: () => { this.thumbnailsVisible = true; } | ||||
|                          }); | ||||
|  | ||||
|         this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var CyclerHighlight = GObject.registerClass( | ||||
| class CyclerHighlight extends St.Widget { | ||||
|     _init() { | ||||
|         super._init({ layout_manager: new Clutter.BinLayout() }); | ||||
| class CyclerHighlight { | ||||
|     constructor() { | ||||
|         this._window = null; | ||||
|  | ||||
|         this._clone = new Clutter.Actor(); | ||||
|         this.add_actor(this._clone); | ||||
|         this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout() }); | ||||
|  | ||||
|         this._clone = new Clutter.Clone(); | ||||
|         this.actor.add_actor(this._clone); | ||||
|  | ||||
|         this._highlight = new St.Widget({ style_class: 'cycler-highlight' }); | ||||
|         this.add_actor(this._highlight); | ||||
|         this.actor.add_actor(this._highlight); | ||||
|  | ||||
|         let coordinate = Clutter.BindCoordinate.ALL; | ||||
|         let constraint = new Clutter.BindConstraint({ coordinate: coordinate }); | ||||
|         this._clone.bind_property('source', constraint, 'source', 0); | ||||
|  | ||||
|         this.add_constraint(constraint); | ||||
|         this.actor.add_constraint(constraint); | ||||
|  | ||||
|         this.connect('notify::allocation', this._onAllocationChanged.bind(this)); | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this.actor.connect('notify::allocation', | ||||
|                            this._onAllocationChanged.bind(this)); | ||||
|         this.actor.connect('destroy', this._onDestroy.bind(this)); | ||||
|     } | ||||
|  | ||||
|     set window(w) { | ||||
| @@ -439,16 +431,16 @@ class CyclerHighlight extends St.Widget { | ||||
|  | ||||
|         this._window = w; | ||||
|  | ||||
|         if (this._clone.content) | ||||
|             this._clone.content.window_actor.sync_visibility(); | ||||
|         if (this._clone.source) | ||||
|             this._clone.source.sync_visibility(); | ||||
|  | ||||
|         let windowActor = this._window | ||||
|             ? this._window.get_compositor_private() : null; | ||||
|         let windowActor = this._window ? this._window.get_compositor_private() | ||||
|                                        : null; | ||||
|  | ||||
|         if (windowActor) | ||||
|             windowActor.hide(); | ||||
|  | ||||
|         this._clone.content = windowActor.content; | ||||
|         this._clone.source = windowActor; | ||||
|     } | ||||
|  | ||||
|     _onAllocationChanged() { | ||||
| @@ -456,7 +448,7 @@ class CyclerHighlight extends St.Widget { | ||||
|             this._highlight.set_size(0, 0); | ||||
|             this._highlight.hide(); | ||||
|         } else { | ||||
|             let [x, y] = this.allocation.get_origin(); | ||||
|             let [x, y] = this.actor.allocation.get_origin(); | ||||
|             let rect = this._window.get_frame_rect(); | ||||
|             this._highlight.set_size(rect.width, rect.height); | ||||
|             this._highlight.set_position(rect.x - x, rect.y - y); | ||||
| @@ -467,7 +459,7 @@ class CyclerHighlight extends St.Widget { | ||||
|     _onDestroy() { | ||||
|         this.window = null; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| // We don't show an actual popup, so just provide what SwitcherPopup | ||||
| // expects instead of inheriting from SwitcherList | ||||
| @@ -477,7 +469,7 @@ var CyclerList = GObject.registerClass({ | ||||
|                'item-removed': { param_types: [GObject.TYPE_INT] }, | ||||
|                'item-highlighted': { param_types: [GObject.TYPE_INT] } }, | ||||
| }, class CyclerList extends St.Widget { | ||||
|     highlight(index, _justOutline) { | ||||
|     highlight(index, justOutline) { | ||||
|         this.emit('item-highlighted', index); | ||||
|     } | ||||
| }); | ||||
| @@ -494,7 +486,7 @@ var CyclerPopup = GObject.registerClass({ | ||||
|             return; | ||||
|  | ||||
|         this._highlight = new CyclerHighlight(); | ||||
|         global.window_group.add_actor(this._highlight); | ||||
|         global.window_group.add_actor(this._highlight.actor); | ||||
|  | ||||
|         this._switcherList = new CyclerList(); | ||||
|         this._switcherList.connect('item-highlighted', (list, index) => { | ||||
| @@ -502,9 +494,9 @@ var CyclerPopup = GObject.registerClass({ | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     _highlightItem(index, _justOutline) { | ||||
|     _highlightItem(index, justOutline) { | ||||
|         this._highlight.window = this._items[index]; | ||||
|         global.window_group.set_child_above_sibling(this._highlight, null); | ||||
|         global.window_group.set_child_above_sibling(this._highlight.actor, null); | ||||
|     } | ||||
|  | ||||
|     _finish() { | ||||
| @@ -534,7 +526,7 @@ var CyclerPopup = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
|         this._highlight.destroy(); | ||||
|         this._highlight.actor.destroy(); | ||||
|  | ||||
|         super._onDestroy(); | ||||
|     } | ||||
| @@ -653,9 +645,8 @@ class WindowCyclerPopup extends CyclerPopup { | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var AppIcon = GObject.registerClass({ | ||||
|     GTypeName: 'AltTab_AppIcon' | ||||
| }, class AppIcon extends St.BoxLayout { | ||||
| var AppIcon = GObject.registerClass( | ||||
| class AppIcon extends St.BoxLayout { | ||||
|     _init(app) { | ||||
|         super._init({ style_class: 'alt-tab-app', | ||||
|                       vertical: true }); | ||||
| @@ -669,10 +660,17 @@ var AppIcon = GObject.registerClass({ | ||||
|         this.add(this.label, { x_fill: false }); | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     set_size(size) { | ||||
|         this.icon = this.app.create_icon_texture(size); | ||||
|         this._iconBin.child = this.icon; | ||||
|         this._iconBin.set_size(size, size); | ||||
|     } | ||||
|  | ||||
|     vfunc_get_preferred_width(forHeight) { | ||||
|         let [minWidth, ] = super.vfunc_get_preferred_width(forHeight); | ||||
|  | ||||
|         minWidth = Math.max(minWidth, forHeight); | ||||
|         return [minWidth, minWidth]; | ||||
|     } | ||||
| }); | ||||
|  | ||||
| @@ -717,7 +715,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList { | ||||
|  | ||||
|     _onDestroy() { | ||||
|         if (this._mouseTimeOutId != 0) | ||||
|             GLib.source_remove(this._mouseTimeOutId); | ||||
|             Mainloop.source_remove(this._mouseTimeOutId); | ||||
|  | ||||
|         this.icons.forEach(icon => { | ||||
|             icon.app.disconnect(icon._stateChangedId); | ||||
| @@ -726,16 +724,15 @@ class AppSwitcher extends SwitcherPopup.SwitcherList { | ||||
|  | ||||
|     _setIconSize() { | ||||
|         let j = 0; | ||||
|         while (this._items.length > 1 && this._items[j].style_class != 'item-box') { | ||||
|             j++; | ||||
|         while(this._items.length > 1 && this._items[j].style_class != 'item-box') { | ||||
|                 j++; | ||||
|         } | ||||
|         let themeNode = this._items[j].get_theme_node(); | ||||
|         this._list.ensure_style(); | ||||
|  | ||||
|         let iconPadding = themeNode.get_horizontal_padding(); | ||||
|         let iconBorder = themeNode.get_border_width(St.Side.LEFT) + themeNode.get_border_width(St.Side.RIGHT); | ||||
|         let [, labelNaturalHeight] = this.icons[j].label.get_preferred_height(-1); | ||||
|         let iconSpacing = labelNaturalHeight + iconPadding + iconBorder; | ||||
|         let [iconMinHeight, iconNaturalHeight] = this.icons[j].label.get_preferred_height(-1); | ||||
|         let iconSpacing = iconNaturalHeight + iconPadding + iconBorder; | ||||
|         let totalSpacing = this._list.spacing * (this._items.length - 1); | ||||
|  | ||||
|         // We just assume the whole screen here due to weirdness happing with the passed width | ||||
| @@ -748,7 +745,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList { | ||||
|         let iconSize = baseIconSizes[0]; | ||||
|  | ||||
|         if (this._items.length > 1) { | ||||
|             for (let i =  0; i < baseIconSizes.length; i++) { | ||||
|             for(let i =  0; i < baseIconSizes.length; i++) { | ||||
|                 iconSize = baseIconSizes[i]; | ||||
|                 let height = iconSizes[i] + iconSpacing; | ||||
|                 let w = height * this._items.length + totalSpacing; | ||||
| @@ -759,7 +756,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList { | ||||
|  | ||||
|         this._iconSize = iconSize; | ||||
|  | ||||
|         for (let i = 0; i < this.icons.length; i++) { | ||||
|         for(let i = 0; i < this.icons.length; i++) { | ||||
|             if (this.icons[i].icon != null) | ||||
|                 break; | ||||
|             this.icons[i].set_size(iconSize); | ||||
| @@ -796,24 +793,21 @@ class AppSwitcher extends SwitcherPopup.SwitcherList { | ||||
|     // activation when the thumbnail list is open | ||||
|     _onItemEnter(index) { | ||||
|         if (this._mouseTimeOutId != 0) | ||||
|             GLib.source_remove(this._mouseTimeOutId); | ||||
|             Mainloop.source_remove(this._mouseTimeOutId); | ||||
|         if (this._altTabPopup.thumbnailsVisible) { | ||||
|             this._mouseTimeOutId = GLib.timeout_add( | ||||
|                 GLib.PRIORITY_DEFAULT, | ||||
|                 APP_ICON_HOVER_TIMEOUT, | ||||
|                 () => { | ||||
|                     this._enterItem(index); | ||||
|                     this._mouseTimeOutId = 0; | ||||
|                     return GLib.SOURCE_REMOVE; | ||||
|                 }); | ||||
|             this._mouseTimeOutId = Mainloop.timeout_add(APP_ICON_HOVER_TIMEOUT, | ||||
|                                                         () => { | ||||
|                                                             this._enterItem(index); | ||||
|                                                             this._mouseTimeOutId = 0; | ||||
|                                                             return GLib.SOURCE_REMOVE; | ||||
|                                                         }); | ||||
|             GLib.Source.set_name_by_id(this._mouseTimeOutId, '[gnome-shell] this._enterItem'); | ||||
|         } else { | ||||
|             this._itemEntered(index); | ||||
|         } | ||||
|         } else | ||||
|            this._itemEntered(index); | ||||
|     } | ||||
|  | ||||
|     _enterItem(index) { | ||||
|         let [x, y] = global.get_pointer(); | ||||
|         let [x, y, mask] = global.get_pointer(); | ||||
|         let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y); | ||||
|         if (this._items[index].contains(pickedActor)) | ||||
|             this._itemEntered(index); | ||||
| @@ -854,8 +848,9 @@ class AppSwitcher extends SwitcherPopup.SwitcherList { | ||||
|                 this._removeIcon(app); | ||||
|         }); | ||||
|  | ||||
|         let n = this._arrows.length; | ||||
|         let arrow = new St.DrawingArea({ style_class: 'switcher-arrow' }); | ||||
|         arrow.connect('repaint', () => SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM)); | ||||
|         arrow.connect('repaint', () => { SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM); }); | ||||
|         this.add_actor(arrow); | ||||
|         this._arrows.push(arrow); | ||||
|  | ||||
| @@ -882,9 +877,9 @@ class ThumbnailList extends SwitcherPopup.SwitcherList { | ||||
|     _init(windows) { | ||||
|         super._init(false); | ||||
|  | ||||
|         this._labels = []; | ||||
|         this._thumbnailBins = []; | ||||
|         this._clones = []; | ||||
|         this._labels = new Array(); | ||||
|         this._thumbnailBins = new Array(); | ||||
|         this._clones = new Array(); | ||||
|         this._windows = windows; | ||||
|  | ||||
|         for (let i = 0; i < windows.length; i++) { | ||||
| @@ -920,7 +915,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList { | ||||
|             return; | ||||
|         let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding(); | ||||
|         totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding(); | ||||
|         let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1); | ||||
|         let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1); | ||||
|         let spacing = this._items[0].child.get_theme_node().get_length('spacing'); | ||||
|         let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; | ||||
|         let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor; | ||||
| @@ -945,7 +940,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList { | ||||
|         } | ||||
|  | ||||
|         // Make sure we only do this once | ||||
|         this._thumbnailBins = []; | ||||
|         this._thumbnailBins = new Array(); | ||||
|     } | ||||
|  | ||||
|     _removeThumbnail(source, clone) { | ||||
| @@ -996,32 +991,32 @@ class WindowIcon extends St.BoxLayout { | ||||
|         let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; | ||||
|  | ||||
|         switch (mode) { | ||||
|         case AppIconMode.THUMBNAIL_ONLY: | ||||
|             size = WINDOW_PREVIEW_SIZE; | ||||
|             this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor)); | ||||
|             break; | ||||
|             case AppIconMode.THUMBNAIL_ONLY: | ||||
|                 size = WINDOW_PREVIEW_SIZE; | ||||
|                 this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor)); | ||||
|                 break; | ||||
|  | ||||
|         case AppIconMode.BOTH: | ||||
|             size = WINDOW_PREVIEW_SIZE; | ||||
|             this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor)); | ||||
|             case AppIconMode.BOTH: | ||||
|                 size = WINDOW_PREVIEW_SIZE; | ||||
|                 this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor)); | ||||
|  | ||||
|             if (this.app) | ||||
|                 this._icon.add_actor(this._createAppIcon(this.app, | ||||
|                                                          APP_ICON_SIZE_SMALL)); | ||||
|             break; | ||||
|                 if (this.app) | ||||
|                     this._icon.add_actor(this._createAppIcon(this.app, | ||||
|                                                              APP_ICON_SIZE_SMALL)); | ||||
|                 break; | ||||
|  | ||||
|         case AppIconMode.APP_ICON_ONLY: | ||||
|             size = APP_ICON_SIZE; | ||||
|             this._icon.add_actor(this._createAppIcon(this.app, size)); | ||||
|             case AppIconMode.APP_ICON_ONLY: | ||||
|                 size = APP_ICON_SIZE; | ||||
|                 this._icon.add_actor(this._createAppIcon(this.app, size)); | ||||
|         } | ||||
|  | ||||
|         this._icon.set_size(size * scaleFactor, size * scaleFactor); | ||||
|     } | ||||
|  | ||||
|     _createAppIcon(app, size) { | ||||
|         let appIcon = app | ||||
|             ? app.create_icon_texture(size) | ||||
|             : new St.Icon({ icon_name: 'icon-missing', icon_size: size }); | ||||
|         let appIcon = app ? app.create_icon_texture(size) | ||||
|                           : new St.Icon({ icon_name: 'icon-missing', | ||||
|                                           icon_size: size }); | ||||
|         appIcon.x_expand = appIcon.y_expand = true; | ||||
|         appIcon.x_align = appIcon.y_align = Clutter.ActorAlign.END; | ||||
|  | ||||
| @@ -1048,8 +1043,8 @@ class WindowList extends SwitcherPopup.SwitcherList { | ||||
|             this.addItem(icon, icon.label); | ||||
|             this.icons.push(icon); | ||||
|  | ||||
|             icon._unmanagedSignalId = icon.window.connect('unmanaged', window => { | ||||
|                 this._removeWindow(window); | ||||
|             icon._unmanagedSignalId = icon.window.connect('unmanaged', (window) => { | ||||
|                 this._removeWindow(window) | ||||
|             }); | ||||
|         } | ||||
|  | ||||
| @@ -1085,7 +1080,7 @@ class WindowList extends SwitcherPopup.SwitcherList { | ||||
|         childBox.y1 = childBox.y2 - this._label.height; | ||||
|         this._label.allocate(childBox, flags); | ||||
|  | ||||
|         let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM); | ||||
|         let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM) | ||||
|         childBox.x1 = box.x1; | ||||
|         childBox.x2 = box.x2; | ||||
|         childBox.y1 = box.y1; | ||||
|   | ||||
| @@ -1,18 +1,21 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Animation, AnimatedIcon, Spinner */ | ||||
|  | ||||
| const { Clutter, GLib, GObject, Gio, St } = imports.gi; | ||||
| const { GLib, Gio, St } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
|  | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var ANIMATED_ICON_UPDATE_TIMEOUT = 16; | ||||
| var SPINNER_ANIMATION_TIME = 300; | ||||
| var SPINNER_ANIMATION_DELAY = 1000; | ||||
| var SPINNER_ANIMATION_TIME = 0.3; | ||||
| var SPINNER_ANIMATION_DELAY = 1.0; | ||||
|  | ||||
| var Animation = GObject.registerClass( | ||||
| class Animation extends St.Bin { | ||||
|     _init(file, width, height, speed) { | ||||
|         super._init({ width: width, height: height }); | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this.connect('resource-scale-changed', | ||||
| var Animation = class { | ||||
|     constructor(file, width, height, speed) { | ||||
|         this.actor = new St.Bin(); | ||||
|         this.actor.set_size(width, height); | ||||
|         this.actor.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this.actor.connect('notify::size', this._syncAnimationSize.bind(this)); | ||||
|         this.actor.connect('resource-scale-changed', | ||||
|             this._loadFile.bind(this, file, width, height)); | ||||
|  | ||||
|         let themeContext = St.ThemeContext.get_for_stage(global.stage); | ||||
| @@ -43,7 +46,7 @@ class Animation extends St.Bin { | ||||
|  | ||||
|     stop() { | ||||
|         if (this._timeoutId > 0) { | ||||
|             GLib.source_remove(this._timeoutId); | ||||
|             Mainloop.source_remove(this._timeoutId); | ||||
|             this._timeoutId = 0; | ||||
|         } | ||||
|  | ||||
| @@ -51,30 +54,20 @@ class Animation extends St.Bin { | ||||
|     } | ||||
|  | ||||
|     _loadFile(file, width, height) { | ||||
|         let [validResourceScale, resourceScale] = this.get_resource_scale(); | ||||
|         let wasPlaying = this._isPlaying; | ||||
|  | ||||
|         if (this._isPlaying) | ||||
|             this.stop(); | ||||
|         let [validResourceScale, resourceScale] = this.actor.get_resource_scale(); | ||||
|  | ||||
|         this._isLoaded = false; | ||||
|         this.destroy_all_children(); | ||||
|         this.actor.destroy_all_children(); | ||||
|  | ||||
|         if (!validResourceScale) { | ||||
|             if (wasPlaying) | ||||
|                 this.play(); | ||||
|         if (!validResourceScale) | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         let textureCache = St.TextureCache.get_default(); | ||||
|         let texture_cache = St.TextureCache.get_default(); | ||||
|         let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; | ||||
|         this._animations = textureCache.load_sliced_image(file, width, height, | ||||
|                                                           scaleFactor, resourceScale, | ||||
|                                                           this._animationsLoaded.bind(this)); | ||||
|         this.set_child(this._animations); | ||||
|  | ||||
|         if (wasPlaying) | ||||
|             this.play(); | ||||
|         this._animations = texture_cache.load_sliced_image(file, width, height, | ||||
|                                                            scaleFactor, resourceScale, | ||||
|                                                            this._animationsLoaded.bind(this)); | ||||
|         this.actor.set_child(this._animations); | ||||
|     } | ||||
|  | ||||
|     _showFrame(frame) { | ||||
| @@ -98,7 +91,7 @@ class Animation extends St.Bin { | ||||
|         if (!this._isLoaded) | ||||
|             return; | ||||
|  | ||||
|         let [width, height] = this.get_size(); | ||||
|         let [width, height] = this.actor.get_size(); | ||||
|  | ||||
|         for (let i = 0; i < this._animations.get_n_children(); ++i) | ||||
|             this._animations.get_child_at_index(i).set_size(width, height); | ||||
| @@ -121,22 +114,20 @@ class Animation extends St.Bin { | ||||
|             themeContext.disconnect(this._scaleChangedId); | ||||
|         this._scaleChangedId = 0; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var AnimatedIcon = GObject.registerClass( | ||||
| class AnimatedIcon extends Animation { | ||||
|     _init(file, size) { | ||||
|         super._init(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT); | ||||
| var AnimatedIcon = class extends Animation { | ||||
|     constructor(file, size) { | ||||
|         super(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var Spinner = GObject.registerClass( | ||||
| class Spinner extends AnimatedIcon { | ||||
|     _init(size, animate = false) { | ||||
| var Spinner = class extends AnimatedIcon { | ||||
|     constructor(size, animate=false) { | ||||
|         let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg'); | ||||
|         super._init(file, size); | ||||
|         super(file, size); | ||||
|  | ||||
|         this.opacity = 0; | ||||
|         this.actor.opacity = 0; | ||||
|         this._animate = animate; | ||||
|     } | ||||
|  | ||||
| @@ -146,35 +137,37 @@ class Spinner extends AnimatedIcon { | ||||
|     } | ||||
|  | ||||
|     play() { | ||||
|         this.remove_all_transitions(); | ||||
|         Tweener.removeTweens(this.actor); | ||||
|  | ||||
|         if (this._animate) { | ||||
|             super.play(); | ||||
|             this.ease({ | ||||
|             Tweener.addTween(this.actor, { | ||||
|                 opacity: 255, | ||||
|                 delay: SPINNER_ANIMATION_DELAY, | ||||
|                 duration: SPINNER_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.LINEAR | ||||
|                 time: SPINNER_ANIMATION_TIME, | ||||
|                 transition: 'linear' | ||||
|             }); | ||||
|         } else { | ||||
|             this.opacity = 255; | ||||
|             this.actor.opacity = 255; | ||||
|             super.play(); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     stop() { | ||||
|         this.remove_all_transitions(); | ||||
|         Tweener.removeTweens(this.actor); | ||||
|  | ||||
|         if (this._animate) { | ||||
|             this.ease({ | ||||
|             Tweener.addTween(this.actor, { | ||||
|                 opacity: 0, | ||||
|                 duration: SPINNER_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.LINEAR, | ||||
|                 onComplete: () => super.stop() | ||||
|                 time: SPINNER_ANIMATION_TIME, | ||||
|                 transition: 'linear', | ||||
|                 onComplete: () => { | ||||
|                     this.stop(false); | ||||
|                 } | ||||
|             }); | ||||
|         } else { | ||||
|             this.opacity = 0; | ||||
|             this.actor.opacity = 0; | ||||
|             super.stop(); | ||||
|         } | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|   | ||||
							
								
								
									
										1547
									
								
								js/ui/appDisplay.js
									
									
									
									
									
								
							
							
						
						
									
										1547
									
								
								js/ui/appDisplay.js
									
									
									
									
									
								
							
										
											
												File diff suppressed because it is too large
												Load Diff
											
										
									
								
							| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported getAppFavorites */ | ||||
|  | ||||
| const Shell = imports.gi.Shell; | ||||
| const Signals = imports.signals; | ||||
| @@ -64,7 +63,7 @@ class AppFavorites { | ||||
|     constructor() { | ||||
|         this.FAVORITE_APPS_KEY = 'favorite-apps'; | ||||
|         this._favorites = {}; | ||||
|         global.settings.connect(`changed::${this.FAVORITE_APPS_KEY}`, this._onFavsChanged.bind(this)); | ||||
|         global.settings.connect('changed::' + this.FAVORITE_APPS_KEY, this._onFavsChanged.bind(this)); | ||||
|         this.reload(); | ||||
|     } | ||||
|  | ||||
| @@ -147,11 +146,12 @@ class AppFavorites { | ||||
|  | ||||
|         let app = Shell.AppSystem.get_default().lookup_app(appId); | ||||
|  | ||||
|         let msg = _("%s has been added to your favorites.").format(app.get_name()); | ||||
|         Main.overview.setMessage(msg, { | ||||
|             forFeedback: true, | ||||
|             undoCallback: () => this._removeFavorite(appId), | ||||
|         }); | ||||
|         Main.overview.setMessage(_("%s has been added to your favorites.").format(app.get_name()), | ||||
|                                  { forFeedback: true, | ||||
|                                    undoCallback: () => { | ||||
|                                        this._removeFavorite(appId); | ||||
|                                    } | ||||
|                                  }); | ||||
|     } | ||||
|  | ||||
|     addFavorite(appId) { | ||||
| @@ -180,13 +180,14 @@ class AppFavorites { | ||||
|         if (!this._removeFavorite(appId)) | ||||
|             return; | ||||
|  | ||||
|         let msg = _("%s has been removed from your favorites.").format(app.get_name()); | ||||
|         Main.overview.setMessage(msg, { | ||||
|             forFeedback: true, | ||||
|             undoCallback: () => this._addFavorite(appId, pos), | ||||
|         }); | ||||
|         Main.overview.setMessage(_("%s has been removed from your favorites.").format(app.get_name()), | ||||
|                                  { forFeedback: true, | ||||
|                                    undoCallback: () => { | ||||
|                                        this._addFavorite(appId, pos); | ||||
|                                    } | ||||
|                                  }); | ||||
|     } | ||||
| } | ||||
| }; | ||||
| Signals.addSignalMethods(AppFavorites.prototype); | ||||
|  | ||||
| var appFavoritesInstance = null; | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported AudioDeviceSelectionDBus */ | ||||
| const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
|  | ||||
| const Main = imports.ui.main; | ||||
| @@ -35,7 +34,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({ | ||||
|             throw new Error('Too few devices for a selection'); | ||||
|     } | ||||
|  | ||||
|     _buildLayout() { | ||||
|     _buildLayout(devices) { | ||||
|         let title = new St.Label({ style_class: 'audio-selection-title', | ||||
|                                    text: _("Select Audio Device"), | ||||
|                                    x_align: Clutter.ActorAlign.CENTER }); | ||||
| @@ -55,28 +54,28 @@ var AudioDeviceSelectionDialog = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _getDeviceLabel(device) { | ||||
|         switch (device) { | ||||
|         case AudioDevice.HEADPHONES: | ||||
|             return _("Headphones"); | ||||
|         case AudioDevice.HEADSET: | ||||
|             return _("Headset"); | ||||
|         case AudioDevice.MICROPHONE: | ||||
|             return _("Microphone"); | ||||
|         default: | ||||
|             return null; | ||||
|         switch(device) { | ||||
|             case AudioDevice.HEADPHONES: | ||||
|                 return _("Headphones"); | ||||
|             case AudioDevice.HEADSET: | ||||
|                 return _("Headset"); | ||||
|             case AudioDevice.MICROPHONE: | ||||
|                 return _("Microphone"); | ||||
|             default: | ||||
|                 return null; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _getDeviceIcon(device) { | ||||
|         switch (device) { | ||||
|         case AudioDevice.HEADPHONES: | ||||
|             return 'audio-headphones-symbolic'; | ||||
|         case AudioDevice.HEADSET: | ||||
|             return 'audio-headset-symbolic'; | ||||
|         case AudioDevice.MICROPHONE: | ||||
|             return 'audio-input-microphone-symbolic'; | ||||
|         default: | ||||
|             return null; | ||||
|         switch(device) { | ||||
|             case AudioDevice.HEADPHONES: | ||||
|                 return 'audio-headphones-symbolic'; | ||||
|             case AudioDevice.HEADSET: | ||||
|                 return 'audio-headset-symbolic'; | ||||
|             case AudioDevice.MICROPHONE: | ||||
|                 return 'audio-input-microphone-symbolic'; | ||||
|             default: | ||||
|                 return null; | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -86,7 +85,6 @@ var AudioDeviceSelectionDialog = GObject.registerClass({ | ||||
|         box.connect('notify::height', () => { | ||||
|             Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { | ||||
|                 box.width = box.height; | ||||
|                 return GLib.SOURCE_REMOVE; | ||||
|             }); | ||||
|         }); | ||||
|  | ||||
| @@ -112,11 +110,11 @@ var AudioDeviceSelectionDialog = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _openSettings() { | ||||
|         let desktopFile = 'gnome-sound-panel.desktop'; | ||||
|         let desktopFile = 'gnome-sound-panel.desktop' | ||||
|         let app = Shell.AppSystem.get_default().lookup_app(desktopFile); | ||||
|  | ||||
|         if (!app) { | ||||
|             log(`Settings panel for desktop file ${desktopFile} could not be loaded!`); | ||||
|             log('Settings panel for desktop file ' + desktopFile + ' could not be loaded!'); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
| @@ -161,12 +159,12 @@ var AudioDeviceSelectionDBus = class AudioDeviceSelectionDBus { | ||||
|  | ||||
|         let [deviceNames] = params; | ||||
|         let devices = 0; | ||||
|         deviceNames.forEach(n => (devices |= AudioDevice[n.toUpperCase()])); | ||||
|         deviceNames.forEach(n => { devices |= AudioDevice[n.toUpperCase()]; }); | ||||
|  | ||||
|         let dialog; | ||||
|         try { | ||||
|             dialog = new AudioDeviceSelectionDialog(devices); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             invocation.return_value(null); | ||||
|             return; | ||||
|         } | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported SystemBackground */ | ||||
|  | ||||
| // READ THIS FIRST | ||||
| // Background handling is a maze of objects, both objects in this file, and | ||||
| @@ -94,12 +93,13 @@ | ||||
| //     MetaBackgroundImage         MetaBackgroundImage | ||||
| //     MetaBackgroundImage         MetaBackgroundImage | ||||
|  | ||||
| const { Clutter, GDesktopEnums, Gio, GLib, GObject, GnomeDesktop, Meta } = imports.gi; | ||||
| const { Clutter, GDesktopEnums, Gio, GLib, GnomeDesktop, Meta } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const LoginManager = imports.misc.loginManager; | ||||
| const Main = imports.ui.main; | ||||
| const Params = imports.misc.params; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff); | ||||
|  | ||||
| @@ -108,9 +108,10 @@ const PRIMARY_COLOR_KEY = 'primary-color'; | ||||
| const SECONDARY_COLOR_KEY = 'secondary-color'; | ||||
| const COLOR_SHADING_TYPE_KEY = 'color-shading-type'; | ||||
| const BACKGROUND_STYLE_KEY = 'picture-options'; | ||||
| const PICTURE_OPACITY_KEY = 'picture-opacity'; | ||||
| const PICTURE_URI_KEY = 'picture-uri'; | ||||
|  | ||||
| var FADE_ANIMATION_TIME = 1000; | ||||
| var FADE_ANIMATION_TIME = 1.0; | ||||
|  | ||||
| // These parameters affect how often we redraw. | ||||
| // The first is how different (percent crossfaded) the slide show | ||||
| @@ -221,17 +222,16 @@ function getBackgroundCache() { | ||||
|     return _backgroundCache; | ||||
| } | ||||
|  | ||||
| var Background = GObject.registerClass({ | ||||
|     Signals: { 'loaded': {}, 'bg-changed': {} } | ||||
| }, class Background extends Meta.Background { | ||||
|     _init(params) { | ||||
| var Background = class Background { | ||||
|     constructor(params) { | ||||
|         params = Params.parse(params, { monitorIndex: 0, | ||||
|                                         layoutManager: Main.layoutManager, | ||||
|                                         settings: null, | ||||
|                                         file: null, | ||||
|                                         style: null }); | ||||
|  | ||||
|         super._init({ meta_display: global.display }); | ||||
|         this.background = new Meta.Background({ meta_display: global.display }); | ||||
|         this.background._delegate = this; | ||||
|  | ||||
|         this._settings = params.settings; | ||||
|         this._file = params.file; | ||||
| @@ -264,6 +264,8 @@ var Background = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     destroy() { | ||||
|         this.background = null; | ||||
|  | ||||
|         this._cancellable.cancel(); | ||||
|         this._removeAnimationTimeout(); | ||||
|  | ||||
| @@ -300,11 +302,9 @@ var Background = GObject.registerClass({ | ||||
|  | ||||
|         this._changedIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT, () => { | ||||
|             this._changedIdleId = 0; | ||||
|             this.emit('bg-changed'); | ||||
|             this.emit('changed'); | ||||
|             return GLib.SOURCE_REMOVE; | ||||
|         }); | ||||
|         GLib.Source.set_name_by_id(this._changedIdleId, | ||||
|             '[gnome-shell] Background._emitChangedSignal'); | ||||
|     } | ||||
|  | ||||
|     updateResolution() { | ||||
| @@ -330,23 +330,23 @@ var Background = GObject.registerClass({ | ||||
|             this.emit('loaded'); | ||||
|             return GLib.SOURCE_REMOVE; | ||||
|         }); | ||||
|         GLib.Source.set_name_by_id(id, '[gnome-shell] Background._setLoaded Idle'); | ||||
|         GLib.Source.set_name_by_id(id, '[gnome-shell] this.emit'); | ||||
|     } | ||||
|  | ||||
|     _loadPattern() { | ||||
|         let colorString, res_, color, secondColor; | ||||
|         let colorString, res, color, secondColor; | ||||
|  | ||||
|         colorString = this._settings.get_string(PRIMARY_COLOR_KEY); | ||||
|         [res_, color] = Clutter.Color.from_string(colorString); | ||||
|         [res, color] = Clutter.Color.from_string(colorString); | ||||
|         colorString = this._settings.get_string(SECONDARY_COLOR_KEY); | ||||
|         [res_, secondColor] = Clutter.Color.from_string(colorString); | ||||
|         [res, secondColor] = Clutter.Color.from_string(colorString); | ||||
|  | ||||
|         let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY); | ||||
|  | ||||
|         if (shadingType == GDesktopEnums.BackgroundShading.SOLID) | ||||
|             this.set_color(color); | ||||
|             this.background.set_color(color); | ||||
|         else | ||||
|             this.set_gradient(shadingType, color, secondColor); | ||||
|             this.background.set_gradient(shadingType, color, secondColor); | ||||
|     } | ||||
|  | ||||
|     _watchFile(file) { | ||||
| @@ -382,13 +382,13 @@ var Background = GObject.registerClass({ | ||||
|         let finish = () => { | ||||
|             this._setLoaded(); | ||||
|             if (files.length > 1) { | ||||
|                 this.set_blend(files[0], files[1], | ||||
|                                this._animation.transitionProgress, | ||||
|                                this._style); | ||||
|                 this.background.set_blend(files[0], files[1], | ||||
|                                           this._animation.transitionProgress, | ||||
|                                           this._style); | ||||
|             } else if (files.length > 0) { | ||||
|                 this.set_file(files[0], this._style); | ||||
|                 this.background.set_file(files[0], this._style); | ||||
|             } else { | ||||
|                 this.set_file(null, this._style); | ||||
|                 this.background.set_file(null, this._style); | ||||
|             } | ||||
|             this._queueUpdateAnimation(); | ||||
|         }; | ||||
| @@ -433,42 +433,41 @@ var Background = GObject.registerClass({ | ||||
|             return; | ||||
|  | ||||
|         this._updateAnimationTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, | ||||
|                                                           interval, | ||||
|                                                           () => { | ||||
|                                                               this._updateAnimationTimeoutId = 0; | ||||
|                                                               this._updateAnimation(); | ||||
|                                                               return GLib.SOURCE_REMOVE; | ||||
|                                                           }); | ||||
|                                                       interval, | ||||
|                                                       () => { | ||||
|                                                           this._updateAnimationTimeoutId = 0; | ||||
|                                                           this._updateAnimation(); | ||||
|                                                           return GLib.SOURCE_REMOVE; | ||||
|                                                       }); | ||||
|         GLib.Source.set_name_by_id(this._updateAnimationTimeoutId, '[gnome-shell] this._updateAnimation'); | ||||
|     } | ||||
|  | ||||
|     _loadAnimation(file) { | ||||
|         this._cache.getAnimation({ | ||||
|             file: file, | ||||
|             settingsSchema: this._settings.schema_id, | ||||
|             onLoaded: animation => { | ||||
|                 this._animation = animation; | ||||
|         this._cache.getAnimation({ file: file, | ||||
|                                    settingsSchema: this._settings.schema_id, | ||||
|                                    onLoaded: animation => { | ||||
|                                        this._animation = animation; | ||||
|  | ||||
|                 if (!this._animation || this._cancellable.is_cancelled()) { | ||||
|                     this._setLoaded(); | ||||
|                     return; | ||||
|                 } | ||||
|                                        if (!this._animation || this._cancellable.is_cancelled()) { | ||||
|                                            this._setLoaded(); | ||||
|                                            return; | ||||
|                                        } | ||||
|  | ||||
|                 this._updateAnimation(); | ||||
|                 this._watchFile(file); | ||||
|             } | ||||
|         }); | ||||
|                                        this._updateAnimation(); | ||||
|                                        this._watchFile(file); | ||||
|                                    } | ||||
|                                  }); | ||||
|     } | ||||
|  | ||||
|     _loadImage(file) { | ||||
|         this.set_file(file, this._style); | ||||
|         this.background.set_file(file, this._style); | ||||
|         this._watchFile(file); | ||||
|  | ||||
|         let cache = Meta.BackgroundImageCache.get_default(); | ||||
|         let image = cache.load(file); | ||||
|         if (image.is_loaded()) { | ||||
|         if (image.is_loaded()) | ||||
|             this._setLoaded(); | ||||
|         } else { | ||||
|         else { | ||||
|             let id = image.connect('loaded', () => { | ||||
|                 this._setLoaded(); | ||||
|                 image.disconnect(id); | ||||
| @@ -495,14 +494,13 @@ var Background = GObject.registerClass({ | ||||
|  | ||||
|         this._loadFile(this._file); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(Background.prototype); | ||||
|  | ||||
| let _systemBackground; | ||||
|  | ||||
| var SystemBackground = GObject.registerClass({ | ||||
|     Signals: { 'loaded': {} } | ||||
| }, class SystemBackground extends Meta.BackgroundActor { | ||||
|     _init() { | ||||
| var SystemBackground = class SystemBackground { | ||||
|     constructor() { | ||||
|         let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/noise-texture.png'); | ||||
|  | ||||
|         if (_systemBackground == null) { | ||||
| @@ -511,11 +509,9 @@ var SystemBackground = GObject.registerClass({ | ||||
|             _systemBackground.set_file(file, GDesktopEnums.BackgroundStyle.WALLPAPER); | ||||
|         } | ||||
|  | ||||
|         super._init({ | ||||
|             meta_display: global.display, | ||||
|             monitor: 0, | ||||
|             background: _systemBackground | ||||
|         }); | ||||
|         this.actor = new Meta.BackgroundActor({ meta_display: global.display, | ||||
|                                                 monitor: 0, | ||||
|                                                 background: _systemBackground }); | ||||
|  | ||||
|         let cache = Meta.BackgroundImageCache.get_default(); | ||||
|         let image = cache.load(file); | ||||
| @@ -534,7 +530,8 @@ var SystemBackground = GObject.registerClass({ | ||||
|             }); | ||||
|         } | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(SystemBackground.prototype); | ||||
|  | ||||
| var BackgroundSource = class BackgroundSource { | ||||
|     constructor(layoutManager, settingsSchema) { | ||||
| @@ -570,7 +567,7 @@ var BackgroundSource = class BackgroundSource { | ||||
|  | ||||
|         // We don't watch changes to settings here, | ||||
|         // instead we rely on Background to watch those | ||||
|         // and emit 'bg-changed' at the right time | ||||
|         // and emit 'changed' at the right time | ||||
|  | ||||
|         if (this._overrideImage != null) { | ||||
|             file = Gio.File.new_for_path(this._overrideImage); | ||||
| @@ -599,7 +596,7 @@ var BackgroundSource = class BackgroundSource { | ||||
|                 style: style | ||||
|             }); | ||||
|  | ||||
|             background._changedId = background.connect('bg-changed', () => { | ||||
|             background._changedId = background.connect('changed', () => { | ||||
|                 background.disconnect(background._changedId); | ||||
|                 background.destroy(); | ||||
|                 delete this._backgrounds[monitorIndex]; | ||||
| @@ -637,9 +634,9 @@ var Animation = class Animation { | ||||
|     } | ||||
|  | ||||
|     load(callback) { | ||||
|         this._show = new GnomeDesktop.BGSlideShow({ file: this.file }); | ||||
|         this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() }); | ||||
|  | ||||
|         this._show.load_async(null, () => { | ||||
|         this._show.load_async(null, (object, result) => { | ||||
|             this.loaded = true; | ||||
|             if (callback) | ||||
|                 callback(); | ||||
| @@ -655,7 +652,7 @@ var Animation = class Animation { | ||||
|         if (this._show.get_num_slides() < 1) | ||||
|             return; | ||||
|  | ||||
|         let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height); | ||||
|         let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height); | ||||
|  | ||||
|         this.transitionDuration = duration; | ||||
|         this.transitionProgress = progress; | ||||
| @@ -714,12 +711,14 @@ var BackgroundManager = class BackgroundManager { | ||||
|         this._newBackgroundActor = null; | ||||
|         this.emit('changed'); | ||||
|  | ||||
|         oldBackgroundActor.ease({ | ||||
|             opacity: 0, | ||||
|             duration: FADE_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => oldBackgroundActor.destroy() | ||||
|         }); | ||||
|         Tweener.addTween(oldBackgroundActor, | ||||
|                          { opacity: 0, | ||||
|                            time: FADE_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete() { | ||||
|                                oldBackgroundActor.destroy(); | ||||
|                            } | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     _updateBackgroundActor() { | ||||
| @@ -736,7 +735,7 @@ var BackgroundManager = class BackgroundManager { | ||||
|  | ||||
|         this._newBackgroundActor = newBackgroundActor; | ||||
|  | ||||
|         let background = newBackgroundActor.background; | ||||
|         let background = newBackgroundActor.background._delegate; | ||||
|  | ||||
|         if (background.isLoaded) { | ||||
|             this._swapBackgroundActor(); | ||||
| @@ -753,14 +752,13 @@ var BackgroundManager = class BackgroundManager { | ||||
|  | ||||
|     _createBackgroundActor() { | ||||
|         let background = this._backgroundSource.getBackground(this._monitorIndex); | ||||
|         let backgroundActor = new Meta.BackgroundActor({ | ||||
|             meta_display: global.display, | ||||
|             monitor: this._monitorIndex, | ||||
|             background, | ||||
|             vignette: this._vignette, | ||||
|             vignette_sharpness: 0.5, | ||||
|             brightness: 0.5, | ||||
|         }); | ||||
|         let backgroundActor = new Meta.BackgroundActor({ meta_display: global.display, | ||||
|                                                          monitor: this._monitorIndex, | ||||
|                                                          background: background.background, | ||||
|                                                          vignette: this._vignette, | ||||
|                                                          vignette_sharpness: 0.5, | ||||
|                                                          brightness: 0.5, | ||||
|                                                        }); | ||||
|  | ||||
|         this._container.add_child(backgroundActor); | ||||
|  | ||||
| @@ -770,7 +768,7 @@ var BackgroundManager = class BackgroundManager { | ||||
|             backgroundActor.lower_bottom(); | ||||
|         } | ||||
|  | ||||
|         let changeSignalId = background.connect('bg-changed', () => { | ||||
|         let changeSignalId = background.connect('changed', () => { | ||||
|             background.disconnect(changeSignalId); | ||||
|             changeSignalId = null; | ||||
|             this._updateBackgroundActor(); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported addBackgroundMenu */ | ||||
|  | ||||
| const { Clutter, St } = imports.gi; | ||||
|  | ||||
| @@ -31,7 +30,7 @@ function addBackgroundMenu(actor, layoutManager) { | ||||
|  | ||||
|     function openMenu(x, y) { | ||||
|         Main.layoutManager.setDummyCursorGeometry(x, y, 0, 0); | ||||
|         actor._backgroundMenu.open(BoxPointer.PopupAnimation.FULL); | ||||
|         actor._backgroundMenu.open(BoxPointer.PopupAnimation.NONE); | ||||
|     } | ||||
|  | ||||
|     let clickAction = new Clutter.ClickAction(); | ||||
|   | ||||
| @@ -1,106 +1,74 @@ | ||||
| /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */ | ||||
| /* exported BarLevel */ | ||||
|  | ||||
| const { Atk, Clutter, GObject, St } = imports.gi; | ||||
| const { Atk, Clutter, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| var BarLevel = GObject.registerClass({ | ||||
|     Properties: { | ||||
|         'value': GObject.ParamSpec.double( | ||||
|             'value', 'value', 'value', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             0, 2, 0), | ||||
|         'maximum-value': GObject.ParamSpec.double( | ||||
|             'maximum-value', 'maximum-value', 'maximum-value', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             1, 2, 1), | ||||
|         'overdrive-start': GObject.ParamSpec.double( | ||||
|             'overdrive-start', 'overdrive-start', 'overdrive-start', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             1, 2, 1) | ||||
|     } | ||||
| }, class BarLevel extends St.DrawingArea { | ||||
|     _init(params) { | ||||
| var BarLevel = class { | ||||
|     constructor(value, params) { | ||||
|         if (isNaN(value)) | ||||
|             // Avoid spreading NaNs around | ||||
|             throw TypeError('The bar level value must be a number'); | ||||
|         this._maxValue = 1; | ||||
|         this._value = 0; | ||||
|         this._value = Math.max(Math.min(value, this._maxValue), 0); | ||||
|         this._overdriveStart = 1; | ||||
|         this._barLevelWidth = 0; | ||||
|  | ||||
|         let defaultParams = { | ||||
|             style_class: 'barlevel', | ||||
|             accessible_role: Atk.Role.LEVEL_BAR | ||||
|         }; | ||||
|         super._init(Object.assign(defaultParams, params)); | ||||
|         this.connect('allocation-changed', (actor, box) => { | ||||
|         if (params == undefined) | ||||
|             params = {} | ||||
|  | ||||
|         this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel', | ||||
|                                           can_focus: params['canFocus'] || false, | ||||
|                                           reactive: params['reactive'] || false, | ||||
|                                           accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR }); | ||||
|         this.actor.connect('repaint', this._barLevelRepaint.bind(this)); | ||||
|         this.actor.connect('allocation-changed', (actor, box) => { | ||||
|             this._barLevelWidth = box.get_width(); | ||||
|         }); | ||||
|  | ||||
|         this._customAccessible = St.GenericAccessible.new_for_actor(this); | ||||
|         this.set_accessible(this._customAccessible); | ||||
|         this._customAccessible = St.GenericAccessible.new_for_actor(this.actor); | ||||
|         this.actor.set_accessible(this._customAccessible); | ||||
|  | ||||
|         this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this)); | ||||
|         this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this)); | ||||
|         this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this)); | ||||
|         this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this)); | ||||
|  | ||||
|         this.connect('notify::value', this._valueChanged.bind(this)); | ||||
|         this.connect('value-changed', this._valueChanged.bind(this)); | ||||
|     } | ||||
|  | ||||
|     get value() { | ||||
|         return this._value; | ||||
|     setValue(value) { | ||||
|         if (isNaN(value)) | ||||
|             throw TypeError('The bar level value must be a number'); | ||||
|  | ||||
|         this._value = Math.max(Math.min(value, this._maxValue), 0); | ||||
|         this.actor.queue_repaint(); | ||||
|     } | ||||
|  | ||||
|     set value(value) { | ||||
|         value = Math.max(Math.min(value, this._maxValue), 0); | ||||
|     setMaximumValue(value) { | ||||
|         if (isNaN(value)) | ||||
|             throw TypeError('The bar level max value must be a number'); | ||||
|  | ||||
|         if (this._value == value) | ||||
|             return; | ||||
|  | ||||
|         this._value = value; | ||||
|         this.notify('value'); | ||||
|         this.queue_repaint(); | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get maximum_value() { | ||||
|         return this._maxValue; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     set maximum_value(value) { | ||||
|         value = Math.max(value, 1); | ||||
|  | ||||
|         if (this._maxValue == value) | ||||
|             return; | ||||
|  | ||||
|         this._maxValue = value; | ||||
|         this._maxValue = Math.max(value, 1); | ||||
|         this._overdriveStart = Math.min(this._overdriveStart, this._maxValue); | ||||
|         this.notify('maximum-value'); | ||||
|         this.queue_repaint(); | ||||
|         this.actor.queue_repaint(); | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get overdrive_start() { | ||||
|         return this._overdriveStart; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     set overdrive_start(value) { | ||||
|         if (this._overdriveStart == value) | ||||
|             return; | ||||
|  | ||||
|     setOverdriveStart(value) { | ||||
|         if (isNaN(value)) | ||||
|             throw TypeError('The overdrive limit value must be a number'); | ||||
|         if (value > this._maxValue) | ||||
|             throw new Error(`Tried to set overdrive value to ${value}, ` + | ||||
|                 `which is a number greater than the maximum allowed value ${this._maxValue}`); | ||||
|  | ||||
|         this._overdriveStart = value; | ||||
|         this.notify('overdrive-start'); | ||||
|         this.queue_repaint(); | ||||
|         this._value = Math.max(Math.min(value, this._maxValue), 0); | ||||
|         this.actor.queue_repaint(); | ||||
|     } | ||||
|  | ||||
|     vfunc_repaint() { | ||||
|         let cr = this.get_context(); | ||||
|         let themeNode = this.get_theme_node(); | ||||
|         let [width, height] = this.get_surface_size(); | ||||
|     _barLevelRepaint(area) { | ||||
|         let cr = area.get_context(); | ||||
|         let themeNode = area.get_theme_node(); | ||||
|         let [width, height] = area.get_surface_size(); | ||||
|  | ||||
|         let barLevelHeight = themeNode.get_length('-barlevel-height'); | ||||
|         let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2; | ||||
| @@ -137,7 +105,7 @@ var BarLevel = GObject.registerClass({ | ||||
|             overdriveSeparatorWidth = themeNode.get_length('-barlevel-overdrive-separator-width'); | ||||
|  | ||||
|         /* background bar */ | ||||
|         cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4)); | ||||
|         cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4); | ||||
|         cr.lineTo(endX, (height + barLevelHeight) / 2); | ||||
|         cr.lineTo(endX, (height - barLevelHeight) / 2); | ||||
|         cr.lineTo(width - barLevelBorderRadius - barLevelBorderWidth, (height - barLevelHeight) / 2); | ||||
| @@ -149,12 +117,12 @@ var BarLevel = GObject.registerClass({ | ||||
|  | ||||
|         /* normal progress bar */ | ||||
|         let x = Math.min(endX, overdriveSeparatorX - overdriveSeparatorWidth / 2); | ||||
|         cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (1 / 4), TAU * (3 / 4)); | ||||
|         cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 1 / 4, TAU * 3 / 4); | ||||
|         cr.lineTo(x, (height - barLevelHeight) / 2); | ||||
|         cr.lineTo(x, (height + barLevelHeight) / 2); | ||||
|         cr.lineTo(barLevelBorderRadius + barLevelBorderWidth, (height + barLevelHeight) / 2); | ||||
|         if (this._value > 0) | ||||
|             Clutter.cairo_set_source_color(cr, barLevelActiveColor); | ||||
|           Clutter.cairo_set_source_color(cr, barLevelActiveColor); | ||||
|         cr.fillPreserve(); | ||||
|         Clutter.cairo_set_source_color(cr, barLevelActiveBorderColor); | ||||
|         cr.setLineWidth(barLevelBorderWidth); | ||||
| @@ -177,17 +145,17 @@ var BarLevel = GObject.registerClass({ | ||||
|  | ||||
|         /* end progress bar arc */ | ||||
|         if (this._value > 0) { | ||||
|             if (this._value <= this._overdriveStart) | ||||
|                 Clutter.cairo_set_source_color(cr, barLevelActiveColor); | ||||
|             else | ||||
|                 Clutter.cairo_set_source_color(cr, barLevelOverdriveColor); | ||||
|             cr.arc(endX, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4)); | ||||
|             cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2); | ||||
|             cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2); | ||||
|             cr.lineTo(endX, (height - barLevelHeight) / 2); | ||||
|             cr.fillPreserve(); | ||||
|             cr.setLineWidth(barLevelBorderWidth); | ||||
|             cr.stroke(); | ||||
|           if (this._value <= this._overdriveStart) | ||||
|               Clutter.cairo_set_source_color(cr, barLevelActiveColor); | ||||
|           else | ||||
|               Clutter.cairo_set_source_color(cr, barLevelOverdriveColor); | ||||
|           cr.arc(endX, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4); | ||||
|           cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2); | ||||
|           cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2); | ||||
|           cr.lineTo(endX, (height - barLevelHeight) / 2); | ||||
|           cr.fillPreserve(); | ||||
|           cr.setLineWidth(barLevelBorderWidth); | ||||
|           cr.stroke(); | ||||
|         } | ||||
|  | ||||
|         /* draw overdrive separator */ | ||||
| @@ -207,27 +175,32 @@ var BarLevel = GObject.registerClass({ | ||||
|         cr.$dispose(); | ||||
|     } | ||||
|  | ||||
|     _getCurrentValue() { | ||||
|     _getCurrentValue(actor) { | ||||
|         return this._value; | ||||
|     } | ||||
|  | ||||
|     _getOverdriveStart() { | ||||
|     _getOverdriveStart(actor) { | ||||
|         return this._overdriveStart; | ||||
|     } | ||||
|  | ||||
|     _getMinimumValue() { | ||||
|     _getMinimumValue(actor) { | ||||
|         return 0; | ||||
|     } | ||||
|  | ||||
|     _getMaximumValue() { | ||||
|     _getMaximumValue(actor) { | ||||
|         return this._maxValue; | ||||
|     } | ||||
|  | ||||
|     _setCurrentValue(_actor, value) { | ||||
|     _setCurrentValue(actor, value) { | ||||
|         this._value = value; | ||||
|     } | ||||
|  | ||||
|     _valueChanged() { | ||||
|     _valueChanged(barLevel, value, property) { | ||||
|         this._customAccessible.notify("accessible-value"); | ||||
|     } | ||||
| }); | ||||
|  | ||||
|     get value() { | ||||
|         return this._value; | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(BarLevel.prototype); | ||||
|   | ||||
| @@ -1,9 +1,9 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported BoxPointer */ | ||||
|  | ||||
| const { Clutter, GObject, Shell, St } = imports.gi; | ||||
| const { Clutter, GObject, Meta, Shell, St } = imports.gi; | ||||
|  | ||||
| const Main = imports.ui.main; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var PopupAnimation = { | ||||
|     NONE:  0, | ||||
| @@ -12,7 +12,7 @@ var PopupAnimation = { | ||||
|     FULL:  ~0, | ||||
| }; | ||||
|  | ||||
| var POPUP_ANIMATION_TIME = 150; | ||||
| var POPUP_ANIMATION_TIME = 0.15; | ||||
|  | ||||
| /** | ||||
|  * BoxPointer: | ||||
| @@ -46,18 +46,12 @@ var BoxPointer = GObject.registerClass({ | ||||
|         this.add_actor(this._border); | ||||
|         this.bin.raise(this._border); | ||||
|         this._sourceAlignment = 0.5; | ||||
|         this._muteInput = true; | ||||
|         this._capturedEventId = 0; | ||||
|         this._muteInput(); | ||||
|  | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|     } | ||||
|  | ||||
|     vfunc_captured_event() { | ||||
|         if (this._muteInput) | ||||
|             return Clutter.EVENT_STOP; | ||||
|  | ||||
|         return Clutter.EVENT_PROPAGATE; | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
|         if (this._sourceActorDestroyId) { | ||||
|             this._sourceActor.disconnect(this._sourceActorDestroyId); | ||||
| @@ -69,6 +63,19 @@ var BoxPointer = GObject.registerClass({ | ||||
|         return this._arrowSide; | ||||
|     } | ||||
|  | ||||
|     _muteInput() { | ||||
|         if (this._capturedEventId == 0) | ||||
|             this._capturedEventId = this.connect('captured-event', | ||||
|                                                  () => Clutter.EVENT_STOP); | ||||
|     } | ||||
|  | ||||
|     _unmuteInput() { | ||||
|         if (this._capturedEventId != 0) { | ||||
|             this.disconnect(this._capturedEventId); | ||||
|             this._capturedEventId = 0; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     open(animate, onComplete) { | ||||
|         let themeNode = this.get_theme_node(); | ||||
|         let rise = themeNode.get_length('-arrow-rise'); | ||||
| @@ -83,33 +90,31 @@ var BoxPointer = GObject.registerClass({ | ||||
|  | ||||
|         if (animate & PopupAnimation.SLIDE) { | ||||
|             switch (this._arrowSide) { | ||||
|             case St.Side.TOP: | ||||
|                 this.translation_y = -rise; | ||||
|                 break; | ||||
|             case St.Side.BOTTOM: | ||||
|                 this.translation_y = rise; | ||||
|                 break; | ||||
|             case St.Side.LEFT: | ||||
|                 this.translation_x = -rise; | ||||
|                 break; | ||||
|             case St.Side.RIGHT: | ||||
|                 this.translation_x = rise; | ||||
|                 break; | ||||
|                 case St.Side.TOP: | ||||
|                     this.translation_y = -rise; | ||||
|                     break; | ||||
|                 case St.Side.BOTTOM: | ||||
|                     this.translation_y = rise; | ||||
|                     break; | ||||
|                 case St.Side.LEFT: | ||||
|                     this.translation_x = -rise; | ||||
|                     break; | ||||
|                 case St.Side.RIGHT: | ||||
|                     this.translation_x = rise; | ||||
|                     break; | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         this.ease({ | ||||
|             opacity: 255, | ||||
|             translation_x: 0, | ||||
|             translation_y: 0, | ||||
|             duration: animationTime, | ||||
|             mode: Clutter.AnimationMode.LINEAR, | ||||
|             onComplete: () => { | ||||
|                 this._muteInput = false; | ||||
|                 if (onComplete) | ||||
|                     onComplete(); | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(this, { opacity: 255, | ||||
|                                  translation_x: 0, | ||||
|                                  translation_y: 0, | ||||
|                                  transition: 'linear', | ||||
|                                  onComplete: () => { | ||||
|                                      this._unmuteInput(); | ||||
|                                      if (onComplete) | ||||
|                                          onComplete(); | ||||
|                                  }, | ||||
|                                  time: animationTime }); | ||||
|     } | ||||
|  | ||||
|     close(animate, onComplete) { | ||||
| @@ -125,39 +130,38 @@ var BoxPointer = GObject.registerClass({ | ||||
|  | ||||
|         if (animate & PopupAnimation.SLIDE) { | ||||
|             switch (this._arrowSide) { | ||||
|             case St.Side.TOP: | ||||
|                 translationY = rise; | ||||
|                 break; | ||||
|             case St.Side.BOTTOM: | ||||
|                 translationY = -rise; | ||||
|                 break; | ||||
|             case St.Side.LEFT: | ||||
|                 translationX = rise; | ||||
|                 break; | ||||
|             case St.Side.RIGHT: | ||||
|                 translationX = -rise; | ||||
|                 break; | ||||
|                 case St.Side.TOP: | ||||
|                     translationY = rise; | ||||
|                     break; | ||||
|                 case St.Side.BOTTOM: | ||||
|                     translationY = -rise; | ||||
|                     break; | ||||
|                 case St.Side.LEFT: | ||||
|                     translationX = rise; | ||||
|                     break; | ||||
|                 case St.Side.RIGHT: | ||||
|                     translationX = -rise; | ||||
|                     break; | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         this._muteInput = true; | ||||
|         this._muteInput(); | ||||
|  | ||||
|         this.remove_all_transitions(); | ||||
|         this.ease({ | ||||
|             opacity: fade ? 0 : 255, | ||||
|             translation_x: translationX, | ||||
|             translation_y: translationY, | ||||
|             duration: animationTime, | ||||
|             mode: Clutter.AnimationMode.LINEAR, | ||||
|             onComplete: () => { | ||||
|                 this.hide(); | ||||
|                 this.opacity = 0; | ||||
|                 this.translation_x = 0; | ||||
|                 this.translation_y = 0; | ||||
|                 if (onComplete) | ||||
|                     onComplete(); | ||||
|             } | ||||
|         }); | ||||
|         Tweener.removeTweens(this); | ||||
|         Tweener.addTween(this, { opacity: fade ? 0 : 255, | ||||
|                                  translation_x: translationX, | ||||
|                                  translation_y: translationY, | ||||
|                                  transition: 'linear', | ||||
|                                  time: animationTime, | ||||
|                                  onComplete: () => { | ||||
|                                      this.hide(); | ||||
|                                      this.opacity = 0; | ||||
|                                      this.translation_x = 0; | ||||
|                                      this.translation_y = 0; | ||||
|                                      if (onComplete) | ||||
|                                          onComplete(); | ||||
|                                  } | ||||
|                                }); | ||||
|     } | ||||
|  | ||||
|     _adjustAllocationForArrow(isWidth, minSize, natSize) { | ||||
| @@ -165,8 +169,8 @@ var BoxPointer = GObject.registerClass({ | ||||
|         let borderWidth = themeNode.get_length('-arrow-border-width'); | ||||
|         minSize += borderWidth * 2; | ||||
|         natSize += borderWidth * 2; | ||||
|         if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)) || | ||||
|             (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) { | ||||
|         if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)) | ||||
|             || (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) { | ||||
|             let rise = themeNode.get_length('-arrow-rise'); | ||||
|             minSize += rise; | ||||
|             natSize += rise; | ||||
| @@ -216,18 +220,18 @@ var BoxPointer = GObject.registerClass({ | ||||
|         childBox.x2 = availWidth - borderWidth; | ||||
|         childBox.y2 = availHeight - borderWidth; | ||||
|         switch (this._arrowSide) { | ||||
|         case St.Side.TOP: | ||||
|             childBox.y1 += rise; | ||||
|             break; | ||||
|         case St.Side.BOTTOM: | ||||
|             childBox.y2 -= rise; | ||||
|             break; | ||||
|         case St.Side.LEFT: | ||||
|             childBox.x1 += rise; | ||||
|             break; | ||||
|         case St.Side.RIGHT: | ||||
|             childBox.x2 -= rise; | ||||
|             break; | ||||
|             case St.Side.TOP: | ||||
|                 childBox.y1 += rise; | ||||
|                 break; | ||||
|             case St.Side.BOTTOM: | ||||
|                 childBox.y2 -= rise; | ||||
|                 break; | ||||
|             case St.Side.LEFT: | ||||
|                 childBox.x1 += rise; | ||||
|                 break; | ||||
|             case St.Side.RIGHT: | ||||
|                 childBox.x2 -= rise; | ||||
|                 break; | ||||
|         } | ||||
|         this.bin.allocate(childBox, flags); | ||||
|  | ||||
| @@ -260,7 +264,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|         let borderRadius = themeNode.get_length('-arrow-border-radius'); | ||||
|  | ||||
|         let halfBorder = borderWidth / 2; | ||||
|         let halfBase = Math.floor(base / 2); | ||||
|         let halfBase = Math.floor(base/2); | ||||
|  | ||||
|         let backgroundColor = themeNode.get_color('-arrow-background-color'); | ||||
|  | ||||
| @@ -341,7 +345,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|         if (!skipTopRight) { | ||||
|             cr.lineTo(x2 - borderRadius, y1); | ||||
|             cr.arc(x2 - borderRadius, y1 + borderRadius, borderRadius, | ||||
|                    3 * Math.PI / 2, Math.PI * 2); | ||||
|                    3*Math.PI/2, Math.PI*2); | ||||
|         } | ||||
|  | ||||
|         if (this._arrowSide == St.Side.RIGHT && rise) { | ||||
| @@ -362,7 +366,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|         if (!skipBottomRight) { | ||||
|             cr.lineTo(x2, y2 - borderRadius); | ||||
|             cr.arc(x2 - borderRadius, y2 - borderRadius, borderRadius, | ||||
|                    0, Math.PI / 2); | ||||
|                    0, Math.PI/2); | ||||
|         } | ||||
|  | ||||
|         if (this._arrowSide == St.Side.BOTTOM && rise) { | ||||
| @@ -383,7 +387,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|         if (!skipBottomLeft) { | ||||
|             cr.lineTo(x1 + borderRadius, y2); | ||||
|             cr.arc(x1 + borderRadius, y2 - borderRadius, borderRadius, | ||||
|                    Math.PI / 2, Math.PI); | ||||
|                    Math.PI/2, Math.PI); | ||||
|         } | ||||
|  | ||||
|         if (this._arrowSide == St.Side.LEFT && rise) { | ||||
| @@ -392,7 +396,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|                 cr.lineTo(x1 - rise, y1); | ||||
|                 cr.lineTo(x1 + borderRadius, y1); | ||||
|             } else if (skipBottomLeft) { | ||||
|                 cr.lineTo(x1 - rise, y2); | ||||
|                 cr.lineTo(x1 - rise, y2) | ||||
|                 cr.lineTo(x1 - rise, y2 - halfBase); | ||||
|             } else { | ||||
|                 cr.lineTo(x1, this._arrowOrigin + halfBase); | ||||
| @@ -404,7 +408,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|         if (!skipTopLeft) { | ||||
|             cr.lineTo(x1, y1 + borderRadius); | ||||
|             cr.arc(x1 + borderRadius, y1 + borderRadius, borderRadius, | ||||
|                    Math.PI, 3 * Math.PI / 2); | ||||
|                    Math.PI, 3*Math.PI/2); | ||||
|         } | ||||
|  | ||||
|         Clutter.cairo_set_source_color(cr, backgroundColor); | ||||
| @@ -433,7 +437,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|                 this._sourceActorDestroyId = this._sourceActor.connect('destroy', () => { | ||||
|                     this._sourceActor = null; | ||||
|                     delete this._sourceActorDestroyId; | ||||
|                 }); | ||||
|                 }) | ||||
|             } | ||||
|         } | ||||
|  | ||||
| @@ -465,7 +469,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|         let sourceAllocation = this._sourceAllocation; | ||||
|         let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment; | ||||
|         let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment; | ||||
|         let [, , natWidth, natHeight] = this.get_preferred_size(); | ||||
|         let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size(); | ||||
|  | ||||
|         // We also want to keep it onscreen, and separated from the | ||||
|         // edge by the same distance as the main part of the box is | ||||
| @@ -509,7 +513,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|         //     of the box to maintain the arrow's accuracy. | ||||
|  | ||||
|         let arrowOrigin; | ||||
|         let halfBase = Math.floor(arrowBase / 2); | ||||
|         let halfBase = Math.floor(arrowBase/2); | ||||
|         let halfBorder = borderWidth / 2; | ||||
|         let halfMargin = margin / 2; | ||||
|         let [x1, y1] = [halfBorder, halfBorder]; | ||||
| @@ -590,7 +594,7 @@ var BoxPointer = GObject.registerClass({ | ||||
|  | ||||
|     _calculateArrowSide(arrowSide) { | ||||
|         let sourceAllocation = this._sourceAllocation; | ||||
|         let [, , boxWidth, boxHeight] = this.get_preferred_size(); | ||||
|         let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size(); | ||||
|         let workarea = this._workArea; | ||||
|  | ||||
|         switch (arrowSide) { | ||||
|   | ||||
| @@ -1,7 +1,6 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Calendar, CalendarMessageList */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi; | ||||
| const { Clutter, Gio, GLib, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Main = imports.ui.main; | ||||
| @@ -18,7 +17,7 @@ var ELLIPSIS_CHAR = '\u2026'; | ||||
|  | ||||
| var MESSAGE_ICON_SIZE = -1; // pick up from CSS | ||||
|  | ||||
| var NC_ = (context, str) => `${context}\u0004${str}`; | ||||
| var NC_ = (context, str) => context + '\u0004' + str; | ||||
|  | ||||
| function sameYear(dateA, dateB) { | ||||
|     return (dateA.getYear() == dateB.getYear()); | ||||
| @@ -39,7 +38,7 @@ function isToday(date) { | ||||
| function _isWorkDay(date) { | ||||
|     /* Translators: Enter 0-6 (Sunday-Saturday) for non-work days. Examples: "0" (Sunday) "6" (Saturday) "06" (Sunday and Saturday). */ | ||||
|     let days = C_('calendar-no-work', "06"); | ||||
|     return !days.includes(date.getDay().toString()); | ||||
|     return days.indexOf(date.getDay().toString()) == -1; | ||||
| } | ||||
|  | ||||
| function _getBeginningOfDay(date) { | ||||
| @@ -110,15 +109,15 @@ var EmptyEventSource = class EmptyEventSource { | ||||
|     destroy() { | ||||
|     } | ||||
|  | ||||
|     requestRange(_begin, _end) { | ||||
|     requestRange(begin, end) { | ||||
|     } | ||||
|  | ||||
|     getEvents(_begin, _end) { | ||||
|     getEvents(begin, end) { | ||||
|         let result = []; | ||||
|         return result; | ||||
|     } | ||||
|  | ||||
|     hasEvents(_day) { | ||||
|     hasEvents(day) { | ||||
|         return false; | ||||
|     } | ||||
| }; | ||||
| @@ -144,7 +143,8 @@ function _datesEqual(a, b) { | ||||
|     return true; | ||||
| } | ||||
|  | ||||
| function _dateIntervalsOverlap(a0, a1, b0, b1) { | ||||
| function _dateIntervalsOverlap(a0, a1, b0, b1) | ||||
| { | ||||
|     if (a1 <= b0) | ||||
|         return false; | ||||
|     else if (b1 <= a0) | ||||
| @@ -168,7 +168,7 @@ var DBusEventSource = class DBusEventSource { | ||||
|             try { | ||||
|                 this._dbusProxy.init_finish(result); | ||||
|                 loaded = true; | ||||
|             } catch (e) { | ||||
|             } catch(e) { | ||||
|                 if (e.matches(Gio.DBusError, Gio.DBusError.TIMED_OUT)) { | ||||
|                     // Ignore timeouts and install signals as normal, because with high | ||||
|                     // probability the service will appear later on, and we will get a | ||||
| @@ -178,7 +178,7 @@ var DBusEventSource = class DBusEventSource { | ||||
|                     // about the HasCalendars property and would cause an exception trying | ||||
|                     // to read it) | ||||
|                 } else { | ||||
|                     log(`Error loading calendars: ${e.message}`); | ||||
|                     log('Error loading calendars: ' + e.message); | ||||
|                     return; | ||||
|                 } | ||||
|             } | ||||
| @@ -221,13 +221,13 @@ var DBusEventSource = class DBusEventSource { | ||||
|         this._lastRequestEnd = null; | ||||
|     } | ||||
|  | ||||
|     _onNameAppeared() { | ||||
|     _onNameAppeared(owner) { | ||||
|         this._initialized = true; | ||||
|         this._resetCache(); | ||||
|         this._loadEvents(true); | ||||
|     } | ||||
|  | ||||
|     _onNameVanished() { | ||||
|     _onNameVanished(oldOwner) { | ||||
|         this._resetCache(); | ||||
|         this.emit('changed'); | ||||
|     } | ||||
| @@ -236,20 +236,22 @@ var DBusEventSource = class DBusEventSource { | ||||
|         this._loadEvents(false); | ||||
|     } | ||||
|  | ||||
|     _onEventsReceived(results, _error) { | ||||
|     _onEventsReceived(results, error) { | ||||
|         let newEvents = []; | ||||
|         let appointments = results[0] || []; | ||||
|         for (let n = 0; n < appointments.length; n++) { | ||||
|             let a = appointments[n]; | ||||
|             let date = new Date(a[4] * 1000); | ||||
|             let end = new Date(a[5] * 1000); | ||||
|             let id = a[0]; | ||||
|             let summary = a[1]; | ||||
|             let allDay = a[3]; | ||||
|             let event = new CalendarEvent(id, date, end, summary, allDay); | ||||
|             newEvents.push(event); | ||||
|         let appointments = results ? results[0] : null; | ||||
|         if (appointments != null) { | ||||
|             for (let n = 0; n < appointments.length; n++) { | ||||
|                 let a = appointments[n]; | ||||
|                 let date = new Date(a[4] * 1000); | ||||
|                 let end = new Date(a[5] * 1000); | ||||
|                 let id = a[0]; | ||||
|                 let summary = a[1]; | ||||
|                 let allDay = a[3]; | ||||
|                 let event = new CalendarEvent(id, date, end, summary, allDay); | ||||
|                 newEvents.push(event); | ||||
|             } | ||||
|             newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime()); | ||||
|         } | ||||
|         newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime()); | ||||
|  | ||||
|         this._events = newEvents; | ||||
|         this.isLoading = false; | ||||
| @@ -261,7 +263,7 @@ var DBusEventSource = class DBusEventSource { | ||||
|         if (!this._initialized) | ||||
|             return; | ||||
|  | ||||
|         if (this._curRequestBegin && this._curRequestEnd) { | ||||
|         if (this._curRequestBegin && this._curRequestEnd){ | ||||
|             this._dbusProxy.GetEventsRemote(this._curRequestBegin.getTime() / 1000, | ||||
|                                             this._curRequestEnd.getTime() / 1000, | ||||
|                                             forceReload, | ||||
| @@ -283,7 +285,7 @@ var DBusEventSource = class DBusEventSource { | ||||
|  | ||||
|     getEvents(begin, end) { | ||||
|         let result = []; | ||||
|         for (let n = 0; n < this._events.length; n++) { | ||||
|         for(let n = 0; n < this._events.length; n++) { | ||||
|             let event = this._events[n]; | ||||
|  | ||||
|             if (_dateIntervalsOverlap (event.date, event.end, begin, end)) { | ||||
| @@ -313,14 +315,12 @@ var DBusEventSource = class DBusEventSource { | ||||
| }; | ||||
| Signals.addSignalMethods(DBusEventSource.prototype); | ||||
|  | ||||
| var Calendar = GObject.registerClass({ | ||||
|     Signals: { 'selected-date-changed': { param_types: [GLib.DateTime.$gtype] } } | ||||
| }, class Calendar extends St.Widget { | ||||
|     _init() { | ||||
| var Calendar = class Calendar { | ||||
|     constructor() { | ||||
|         this._weekStart = Shell.util_get_week_start(); | ||||
|         this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.calendar' }); | ||||
|  | ||||
|         this._settings.connect(`changed::${SHOW_WEEKDATE_KEY}`, this._onSettingsChange.bind(this)); | ||||
|         this._settings.connect('changed::' + SHOW_WEEKDATE_KEY, this._onSettingsChange.bind(this)); | ||||
|         this._useWeekdate = this._settings.get_boolean(SHOW_WEEKDATE_KEY); | ||||
|  | ||||
|         /** | ||||
| @@ -346,11 +346,12 @@ var Calendar = GObject.registerClass({ | ||||
|  | ||||
|         this._shouldDateGrabFocus = false; | ||||
|  | ||||
|         super._init({ | ||||
|             style_class: 'calendar', | ||||
|             layout_manager: new Clutter.TableLayout(), | ||||
|             reactive: true | ||||
|         }); | ||||
|         this.actor = new St.Widget({ style_class: 'calendar', | ||||
|                                      layout_manager: new Clutter.TableLayout(), | ||||
|                                      reactive: true }); | ||||
|  | ||||
|         this.actor.connect('scroll-event', | ||||
|                            this._onScroll.bind(this)); | ||||
|  | ||||
|         this._buildHeader (); | ||||
|     } | ||||
| @@ -374,10 +375,7 @@ var Calendar = GObject.registerClass({ | ||||
|  | ||||
|         this._selectedDate = date; | ||||
|         this._update(); | ||||
|  | ||||
|         let datetime = GLib.DateTime.new_from_unix_local( | ||||
|             this._selectedDate.getTime() / 1000); | ||||
|         this.emit('selected-date-changed', datetime); | ||||
|         this.emit('selected-date-changed', new Date(this._selectedDate)); | ||||
|     } | ||||
|  | ||||
|     updateTimeZone() { | ||||
| @@ -388,9 +386,9 @@ var Calendar = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _buildHeader() { | ||||
|         let layout = this.layout_manager; | ||||
|         let layout = this.actor.layout_manager; | ||||
|         let offsetCols = this._useWeekdate ? 1 : 0; | ||||
|         this.destroy_all_children(); | ||||
|         this.actor.destroy_all_children(); | ||||
|  | ||||
|         // Top line of the calendar '<| September 2009 |>' | ||||
|         this._topBox = new St.BoxLayout(); | ||||
| @@ -404,8 +402,8 @@ var Calendar = GObject.registerClass({ | ||||
|         this._topBox.add(this._backButton); | ||||
|         this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this)); | ||||
|  | ||||
|         this._monthLabel = new St.Label({ style_class: 'calendar-month-label', | ||||
|                                           can_focus: true }); | ||||
|         this._monthLabel = new St.Label({style_class: 'calendar-month-label', | ||||
|                                          can_focus: true }); | ||||
|         this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE }); | ||||
|  | ||||
|         this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button', | ||||
| @@ -432,7 +430,7 @@ var Calendar = GObject.registerClass({ | ||||
|                                        can_focus: true }); | ||||
|             label.accessible_name = iter.toLocaleFormat('%A'); | ||||
|             let col; | ||||
|             if (this.get_text_direction() == Clutter.TextDirection.RTL) | ||||
|             if (this.actor.get_text_direction() == Clutter.TextDirection.RTL) | ||||
|                 col = 6 - (7 + iter.getDay() - this._weekStart) % 7; | ||||
|             else | ||||
|                 col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7; | ||||
| @@ -441,11 +439,11 @@ var Calendar = GObject.registerClass({ | ||||
|         } | ||||
|  | ||||
|         // All the children after this are days, and get removed when we update the calendar | ||||
|         this._firstDayIndex = this.get_n_children(); | ||||
|         this._firstDayIndex = this.actor.get_n_children(); | ||||
|     } | ||||
|  | ||||
|     vfunc_scroll_event(scrollEvent) { | ||||
|         switch (scrollEvent.direction) { | ||||
|     _onScroll(actor, event) { | ||||
|         switch (event.get_scroll_direction()) { | ||||
|         case Clutter.ScrollDirection.UP: | ||||
|         case Clutter.ScrollDirection.LEFT: | ||||
|             this._onPrevMonthButtonClicked(); | ||||
| @@ -468,7 +466,8 @@ var Calendar = GObject.registerClass({ | ||||
|                 let day = 32 - new Date(newDate.getFullYear() - 1, 11, 32).getDate(); | ||||
|                 newDate = new Date(newDate.getFullYear() - 1, 11, day); | ||||
|             } | ||||
|         } else { | ||||
|         } | ||||
|         else { | ||||
|             newDate.setMonth(oldMonth - 1); | ||||
|             if (newDate.getMonth() != oldMonth - 1) { | ||||
|                 let day = 32 - new Date(newDate.getFullYear(), oldMonth - 1, 32).getDate(); | ||||
| @@ -491,7 +490,8 @@ var Calendar = GObject.registerClass({ | ||||
|                 let day = 32 - new Date(newDate.getFullYear() + 1, 0, 32).getDate(); | ||||
|                 newDate = new Date(newDate.getFullYear() + 1, 0, day); | ||||
|             } | ||||
|         } else { | ||||
|         } | ||||
|         else { | ||||
|             newDate.setMonth(oldMonth + 1); | ||||
|             if (newDate.getMonth() != oldMonth + 1) { | ||||
|                 let day = 32 - new Date(newDate.getFullYear(), oldMonth + 1, 32).getDate(); | ||||
| @@ -515,7 +515,7 @@ var Calendar = GObject.registerClass({ | ||||
|         let now = new Date(); | ||||
|  | ||||
|         // Remove everything but the topBox and the weekday labels | ||||
|         let children = this.get_children(); | ||||
|         let children = this.actor.get_children(); | ||||
|         for (let i = this._firstDayIndex; i < children.length; i++) | ||||
|             children[i].destroy(); | ||||
|  | ||||
| @@ -546,18 +546,20 @@ var Calendar = GObject.registerClass({ | ||||
|         this._calendarBegin = new Date(beginDate); | ||||
|         this._markedAsToday = now; | ||||
|  | ||||
|         let year = beginDate.getYear(); | ||||
|  | ||||
|         let daysToWeekStart = (7 + beginDate.getDay() - this._weekStart) % 7; | ||||
|         let startsOnWeekStart = daysToWeekStart == 0; | ||||
|         let weekPadding = startsOnWeekStart ? 7 : 0; | ||||
|  | ||||
|         beginDate.setTime(beginDate.getTime() - (weekPadding + daysToWeekStart) * MSECS_IN_DAY); | ||||
|  | ||||
|         let layout = this.layout_manager; | ||||
|         let layout = this.actor.layout_manager; | ||||
|         let iter = new Date(beginDate); | ||||
|         let row = 2; | ||||
|         // nRows here means 6 weeks + one header + one navbar | ||||
|         let nRows = 8; | ||||
|         while (row < nRows) { | ||||
|         while (row < 8) { | ||||
|             // xgettext:no-javascript-format | ||||
|             let button = new St.Button({ label: iter.toLocaleFormat(C_("date day number format", "%d")), | ||||
|                                          can_focus: true }); | ||||
| @@ -583,13 +585,12 @@ var Calendar = GObject.registerClass({ | ||||
|  | ||||
|             // Hack used in lieu of border-collapse - see gnome-shell.css | ||||
|             if (row == 2) | ||||
|                 styleClass = `calendar-day-top ${styleClass}`; | ||||
|                 styleClass = 'calendar-day-top ' + styleClass; | ||||
|  | ||||
|             let leftMost = rtl | ||||
|                 ? iter.getDay() == (this._weekStart + 6) % 7 | ||||
|                 : iter.getDay() == this._weekStart; | ||||
|             let leftMost = rtl ? iter.getDay() == (this._weekStart + 6) % 7 | ||||
|                                : iter.getDay() == this._weekStart; | ||||
|             if (leftMost) | ||||
|                 styleClass = `calendar-day-left ${styleClass}`; | ||||
|                 styleClass = 'calendar-day-left ' + styleClass; | ||||
|  | ||||
|             if (sameDay(now, iter)) | ||||
|                 styleClass += ' calendar-today'; | ||||
| @@ -647,17 +648,17 @@ var Calendar = GObject.registerClass({ | ||||
|                 button.add_style_pseudo_class('selected'); | ||||
|                 if (this._shouldDateGrabFocus) | ||||
|                     button.grab_key_focus(); | ||||
|             } else { | ||||
|                 button.remove_style_pseudo_class('selected'); | ||||
|             } | ||||
|             else | ||||
|                 button.remove_style_pseudo_class('selected'); | ||||
|         }); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(Calendar.prototype); | ||||
|  | ||||
| var EventMessage = GObject.registerClass( | ||||
| class EventMessage extends MessageList.Message { | ||||
|     _init(event, date) { | ||||
|         super._init('', event.summary); | ||||
| var EventMessage = class EventMessage extends MessageList.Message { | ||||
|     constructor(event, date) { | ||||
|         super('', event.summary); | ||||
|  | ||||
|         this._event = event; | ||||
|         this._date = date; | ||||
| @@ -666,12 +667,11 @@ class EventMessage extends MessageList.Message { | ||||
|  | ||||
|         this._icon = new St.Icon({ icon_name: 'x-office-calendar-symbolic' }); | ||||
|         this.setIcon(this._icon); | ||||
|     } | ||||
|  | ||||
|     vfunc_style_changed() { | ||||
|         let iconVisible = this.get_parent().has_style_pseudo_class('first-child'); | ||||
|         this._icon.opacity = (iconVisible ? 255 : 0); | ||||
|         super.vfunc_style_changed(); | ||||
|         this.actor.connect('style-changed', () => { | ||||
|             let iconVisible = this.actor.get_parent().has_style_pseudo_class('first-child'); | ||||
|             this._icon.opacity = (iconVisible ? 255 : 0); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     _formatEventTime() { | ||||
| @@ -686,33 +686,32 @@ class EventMessage extends MessageList.Message { | ||||
|              */ | ||||
|             title = C_("event list time", "All Day"); | ||||
|         } else { | ||||
|             let date = this._event.date >= periodBegin | ||||
|                 ? this._event.date | ||||
|                 : this._event.end; | ||||
|             let date = this._event.date >= periodBegin ? this._event.date | ||||
|                                                        : this._event.end; | ||||
|             title = Util.formatTime(date, { timeOnly: true }); | ||||
|         } | ||||
|  | ||||
|         let rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL; | ||||
|         if (this._event.date < periodBegin && !this._event.allDay) { | ||||
|             if (rtl) | ||||
|                 title = `${title}${ELLIPSIS_CHAR}`; | ||||
|                 title = title + ELLIPSIS_CHAR; | ||||
|             else | ||||
|                 title = `${ELLIPSIS_CHAR}${title}`; | ||||
|                 title = ELLIPSIS_CHAR + title; | ||||
|         } | ||||
|         if (this._event.end > periodEnd && !this._event.allDay) { | ||||
|             if (rtl) | ||||
|                 title = `${ELLIPSIS_CHAR}${title}`; | ||||
|                 title = ELLIPSIS_CHAR + title; | ||||
|             else | ||||
|                 title = `${title}${ELLIPSIS_CHAR}`; | ||||
|                 title = title + ELLIPSIS_CHAR; | ||||
|         } | ||||
|         return title; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var NotificationMessage = GObject.registerClass( | ||||
| var NotificationMessage = | ||||
| class NotificationMessage extends MessageList.Message { | ||||
|     _init(notification) { | ||||
|         super._init(notification.title, notification.bannerBodyText); | ||||
|     constructor(notification) { | ||||
|         super(notification.title, notification.bannerBodyText); | ||||
|         this.setUseBodyMarkup(notification.bannerBodyMarkup); | ||||
|  | ||||
|         this.notification = notification; | ||||
| @@ -742,14 +741,14 @@ class NotificationMessage extends MessageList.Message { | ||||
|             return this.notification.source.createIcon(MESSAGE_ICON_SIZE); | ||||
|     } | ||||
|  | ||||
|     _onUpdated(n, _clear) { | ||||
|     _onUpdated(n, clear) { | ||||
|         this.setIcon(this._getIcon()); | ||||
|         this.setTitle(n.title); | ||||
|         this.setBody(n.bannerBodyText); | ||||
|         this.setUseBodyMarkup(n.bannerBodyMarkup); | ||||
|     } | ||||
|  | ||||
|     vfunc_clicked() { | ||||
|     _onClicked() { | ||||
|         this.notification.activate(); | ||||
|     } | ||||
|  | ||||
| @@ -771,12 +770,11 @@ class NotificationMessage extends MessageList.Message { | ||||
|     canClose() { | ||||
|         return true; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var EventsSection = GObject.registerClass( | ||||
| class EventsSection extends MessageList.MessageListSection { | ||||
|     _init() { | ||||
|         super._init(); | ||||
| var EventsSection = class EventsSection extends MessageList.MessageListSection { | ||||
|     constructor() { | ||||
|         super(); | ||||
|  | ||||
|         this._desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' }); | ||||
|         this._desktopSettings.connect('changed', this._reloadEvents.bind(this)); | ||||
| @@ -788,7 +786,7 @@ class EventsSection extends MessageList.MessageListSection { | ||||
|                                       label: '', | ||||
|                                       x_align: St.Align.START, | ||||
|                                       can_focus: true }); | ||||
|         this.insert_child_below(this._title, null); | ||||
|         this.actor.insert_child_below(this._title, null); | ||||
|  | ||||
|         this._title.connect('clicked', this._onTitleClicked.bind(this)); | ||||
|         this._title.connect('key-focus-in', this._onKeyFocusIn.bind(this)); | ||||
| @@ -907,29 +905,12 @@ class EventsSection extends MessageList.MessageListSection { | ||||
|  | ||||
|         super._sync(); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var TimeLabel = GObject.registerClass( | ||||
| class NotificationTimeLabel extends St.Label { | ||||
|     _init(datetime) { | ||||
|         super._init({ | ||||
|             style_class: 'event-time', | ||||
|             x_align: Clutter.ActorAlign.START, | ||||
|             y_align: Clutter.ActorAlign.END | ||||
|         }); | ||||
|         this._datetime = datetime; | ||||
|     } | ||||
|  | ||||
|     vfunc_map() { | ||||
|         this.text = Util.formatTimeSpan(this._datetime); | ||||
|         super.vfunc_map(); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var NotificationSection = GObject.registerClass( | ||||
| var NotificationSection = | ||||
| class NotificationSection extends MessageList.MessageListSection { | ||||
|     _init() { | ||||
|         super._init(); | ||||
|     constructor() { | ||||
|         super(); | ||||
|  | ||||
|         this._sources = new Map(); | ||||
|         this._nUrgent = 0; | ||||
| @@ -938,6 +919,8 @@ class NotificationSection extends MessageList.MessageListSection { | ||||
|         Main.messageTray.getSources().forEach(source => { | ||||
|             this._sourceAdded(Main.messageTray, source); | ||||
|         }); | ||||
|  | ||||
|         this.actor.connect('notify::mapped', this._onMapped.bind(this)); | ||||
|     } | ||||
|  | ||||
|     get allowed() { | ||||
| @@ -945,6 +928,17 @@ class NotificationSection extends MessageList.MessageListSection { | ||||
|                !Main.sessionMode.isGreeter; | ||||
|     } | ||||
|  | ||||
|     _createTimeLabel(datetime) { | ||||
|         let label = new St.Label({ style_class: 'event-time', | ||||
|                                    x_align: Clutter.ActorAlign.START, | ||||
|                                    y_align: Clutter.ActorAlign.END }); | ||||
|         label.connect('notify::mapped', () => { | ||||
|             if (label.mapped) | ||||
|                 label.text = Util.formatTimeSpan(datetime); | ||||
|         }); | ||||
|         return label; | ||||
|     } | ||||
|  | ||||
|     _sourceAdded(tray, source) { | ||||
|         let obj = { | ||||
|             destroyId: 0, | ||||
| @@ -962,13 +956,13 @@ class NotificationSection extends MessageList.MessageListSection { | ||||
|  | ||||
|     _onNotificationAdded(source, notification) { | ||||
|         let message = new NotificationMessage(notification); | ||||
|         message.setSecondaryActor(new TimeLabel(notification.datetime)); | ||||
|         message.setSecondaryActor(this._createTimeLabel(notification.datetime)); | ||||
|  | ||||
|         let isUrgent = notification.urgency == MessageTray.Urgency.CRITICAL; | ||||
|  | ||||
|         let updatedId = notification.connect('updated', () => { | ||||
|             message.setSecondaryActor(new TimeLabel(notification.datetime)); | ||||
|             this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.mapped); | ||||
|             message.setSecondaryActor(this._createTimeLabel(notification.datetime)); | ||||
|             this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.actor.mapped); | ||||
|         }); | ||||
|         let destroyId = notification.connect('destroy', () => { | ||||
|             notification.disconnect(destroyId); | ||||
| @@ -988,7 +982,7 @@ class NotificationSection extends MessageList.MessageListSection { | ||||
|         } | ||||
|  | ||||
|         let index = isUrgent ? 0 : this._nUrgent; | ||||
|         this.addMessageAtIndex(message, index, this.mapped); | ||||
|         this.addMessageAtIndex(message, index, this.actor.mapped); | ||||
|     } | ||||
|  | ||||
|     _onSourceDestroy(source, obj) { | ||||
| @@ -998,23 +992,25 @@ class NotificationSection extends MessageList.MessageListSection { | ||||
|         this._sources.delete(source); | ||||
|     } | ||||
|  | ||||
|     vfunc_map() { | ||||
|         this._messages.forEach(message => { | ||||
|     _onMapped() { | ||||
|         if (!this.actor.mapped) | ||||
|             return; | ||||
|  | ||||
|         for (let message of this._messages.keys()) | ||||
|             if (message.notification.urgency != MessageTray.Urgency.CRITICAL) | ||||
|                 message.notification.acknowledged = true; | ||||
|         }); | ||||
|         super.vfunc_map(); | ||||
|     } | ||||
|  | ||||
|     _shouldShow() { | ||||
|         return !this.empty && isToday(this._date); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var Placeholder = class Placeholder { | ||||
|     constructor() { | ||||
|         this.actor = new St.BoxLayout({ style_class: 'message-list-placeholder', | ||||
|                                         vertical: true }); | ||||
|  | ||||
| var Placeholder = GObject.registerClass( | ||||
| class Placeholder extends St.BoxLayout { | ||||
|     _init() { | ||||
|         super._init({ style_class: 'message-list-placeholder', vertical: true }); | ||||
|         this._date = new Date(); | ||||
|  | ||||
|         let todayFile = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/no-notifications.svg'); | ||||
| @@ -1023,10 +1019,10 @@ class Placeholder extends St.BoxLayout { | ||||
|         this._otherIcon = new Gio.FileIcon({ file: otherFile }); | ||||
|  | ||||
|         this._icon = new St.Icon(); | ||||
|         this.add_actor(this._icon); | ||||
|         this.actor.add_actor(this._icon); | ||||
|  | ||||
|         this._label = new St.Label(); | ||||
|         this.add_actor(this._label); | ||||
|         this.actor.add_actor(this._label); | ||||
|  | ||||
|         this._sync(); | ||||
|     } | ||||
| @@ -1053,24 +1049,20 @@ class Placeholder extends St.BoxLayout { | ||||
|             this._label.text = _("No Events"); | ||||
|         } | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var CalendarMessageList = GObject.registerClass( | ||||
| class CalendarMessageList extends St.Widget { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             style_class: 'message-list', | ||||
|             layout_manager: new Clutter.BinLayout(), | ||||
|             x_expand: true, | ||||
|             y_expand: true | ||||
|         }); | ||||
| var CalendarMessageList = class CalendarMessageList { | ||||
|     constructor() { | ||||
|         this.actor = new St.Widget({ style_class: 'message-list', | ||||
|                                      layout_manager: new Clutter.BinLayout(), | ||||
|                                      x_expand: true, y_expand: true }); | ||||
|  | ||||
|         this._placeholder = new Placeholder(); | ||||
|         this.add_actor(this._placeholder); | ||||
|         this.actor.add_actor(this._placeholder.actor); | ||||
|  | ||||
|         let box = new St.BoxLayout({ vertical: true, | ||||
|                                      x_expand: true, y_expand: true }); | ||||
|         this.add_actor(box); | ||||
|         this.actor.add_actor(box); | ||||
|  | ||||
|         this._scrollView = new St.ScrollView({ style_class: 'vfade', | ||||
|                                                overlay_scrollbars: true, | ||||
| @@ -1084,21 +1076,17 @@ class CalendarMessageList extends St.Widget { | ||||
|                                             can_focus: true }); | ||||
|         this._clearButton.set_x_align(Clutter.ActorAlign.END); | ||||
|         this._clearButton.connect('clicked', () => { | ||||
|             this._sectionList.get_children().forEach(s => s.clear()); | ||||
|             let sections = [...this._sections.keys()]; | ||||
|             sections.forEach((s) => { s.clear(); }); | ||||
|         }); | ||||
|         box.add_actor(this._clearButton); | ||||
|  | ||||
|         this._placeholder.bind_property('visible', | ||||
|             this._clearButton, 'visible', | ||||
|             GObject.BindingFlags.INVERT_BOOLEAN); | ||||
|  | ||||
|         this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections', | ||||
|                                                vertical: true, | ||||
|                                                y_expand: true, | ||||
|                                                y_align: Clutter.ActorAlign.START }); | ||||
|         this._sectionList.connect('actor-added', this._sync.bind(this)); | ||||
|         this._sectionList.connect('actor-removed', this._sync.bind(this)); | ||||
|         this._scrollView.add_actor(this._sectionList); | ||||
|         this._sections = new Map(); | ||||
|  | ||||
|         this._mediaSection = new Mpris.MediaSection(); | ||||
|         this._addSection(this._mediaSection); | ||||
| @@ -1113,35 +1101,59 @@ class CalendarMessageList extends St.Widget { | ||||
|     } | ||||
|  | ||||
|     _addSection(section) { | ||||
|         let connectionsIds = []; | ||||
|         let obj = { | ||||
|             destroyId: 0, | ||||
|             visibleId:  0, | ||||
|             emptyChangedId: 0, | ||||
|             canClearChangedId: 0, | ||||
|             keyFocusId: 0 | ||||
|         }; | ||||
|         obj.destroyId = section.actor.connect('destroy', () => { | ||||
|             this._removeSection(section); | ||||
|         }); | ||||
|         obj.visibleId = section.actor.connect('notify::visible', | ||||
|                                               this._sync.bind(this)); | ||||
|         obj.emptyChangedId = section.connect('empty-changed', | ||||
|                                              this._sync.bind(this)); | ||||
|         obj.canClearChangedId = section.connect('can-clear-changed', | ||||
|                                                 this._sync.bind(this)); | ||||
|         obj.keyFocusId = section.connect('key-focus-in', | ||||
|                                          this._onKeyFocusIn.bind(this)); | ||||
|  | ||||
|         for (let prop of ['visible', 'empty', 'can-clear']) { | ||||
|             connectionsIds.push( | ||||
|                 section.connect(`notify::${prop}`, this._sync.bind(this))); | ||||
|         } | ||||
|         connectionsIds.push(section.connect('message-focused', (_s, messageActor) => { | ||||
|             Util.ensureActorVisibleInScrollView(this._scrollView, messageActor); | ||||
|         })); | ||||
|         this._sections.set(section, obj); | ||||
|         this._sectionList.add_actor(section.actor); | ||||
|         this._sync(); | ||||
|     } | ||||
|  | ||||
|         connectionsIds.push(section.connect('destroy', (section) => { | ||||
|             connectionsIds.forEach(id => section.disconnect(id)); | ||||
|             this._sectionList.remove_actor(section); | ||||
|         })); | ||||
|     _removeSection(section) { | ||||
|         let obj = this._sections.get(section); | ||||
|         section.actor.disconnect(obj.destroyId); | ||||
|         section.actor.disconnect(obj.visibleId); | ||||
|         section.disconnect(obj.emptyChangedId); | ||||
|         section.disconnect(obj.canClearChangedId); | ||||
|         section.disconnect(obj.keyFocusId); | ||||
|  | ||||
|         this._sectionList.add_actor(section); | ||||
|         this._sections.delete(section); | ||||
|         this._sectionList.remove_actor(section.actor); | ||||
|         this._sync(); | ||||
|     } | ||||
|  | ||||
|     _onKeyFocusIn(section, actor) { | ||||
|         Util.ensureActorVisibleInScrollView(this._scrollView, actor); | ||||
|     } | ||||
|  | ||||
|     _sync() { | ||||
|         let sections = this._sectionList.get_children(); | ||||
|         let sections = [...this._sections.keys()]; | ||||
|         let visible = sections.some(s => s.allowed); | ||||
|         this.visible = visible; | ||||
|         this.actor.visible = visible; | ||||
|         if (!visible) | ||||
|             return; | ||||
|  | ||||
|         let empty = sections.every(s => s.empty || !s.visible); | ||||
|         this._placeholder.visible = empty; | ||||
|         let empty = sections.every(s => s.empty || !s.actor.visible); | ||||
|         this._placeholder.actor.visible = empty; | ||||
|         this._clearButton.visible = !empty; | ||||
|  | ||||
|         let canClear = sections.some(s => s.canClear && s.visible); | ||||
|         let canClear = sections.some(s => s.canClear && s.actor.visible); | ||||
|         this._clearButton.reactive = canClear; | ||||
|     } | ||||
|  | ||||
| @@ -1150,7 +1162,8 @@ class CalendarMessageList extends St.Widget { | ||||
|     } | ||||
|  | ||||
|     setDate(date) { | ||||
|         this._sectionList.get_children().forEach(s => s.setDate(date)); | ||||
|         for (let section of this._sections.keys()) | ||||
|             section.setDate(date); | ||||
|         this._placeholder.setDate(date); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|   | ||||
| @@ -1,19 +1,15 @@ | ||||
| /* exported CheckBox */ | ||||
| const { Clutter, GObject, Pango, St } = imports.gi; | ||||
| const { Clutter, Pango, St } = imports.gi; | ||||
|  | ||||
| var CheckBox = GObject.registerClass( | ||||
| class CheckBox extends St.Button { | ||||
|     _init(label) { | ||||
| var CheckBox = class CheckBox { | ||||
|     constructor(label) { | ||||
|         let container = new St.BoxLayout(); | ||||
|         super._init({ | ||||
|             style_class: 'check-box', | ||||
|             child: container, | ||||
|             button_mask: St.ButtonMask.ONE, | ||||
|             toggle_mode: true, | ||||
|             can_focus: true, | ||||
|             x_fill: true, | ||||
|             y_fill: true | ||||
|         }); | ||||
|         this.actor = new St.Button({ style_class: 'check-box', | ||||
|                                      child: container, | ||||
|                                      button_mask: St.ButtonMask.ONE, | ||||
|                                      toggle_mode: true, | ||||
|                                      can_focus: true, | ||||
|                                      x_fill: true, | ||||
|                                      y_fill: true }); | ||||
|  | ||||
|         this._box = new St.Bin(); | ||||
|         this._box.set_y_align(Clutter.ActorAlign.START); | ||||
| @@ -35,4 +31,4 @@ class CheckBox extends St.Button { | ||||
|     getLabelActor() { | ||||
|         return this._label; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|   | ||||
| @@ -1,17 +1,17 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported CloseDialog */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi; | ||||
|  | ||||
| const Dialog = imports.ui.dialog; | ||||
| const Main = imports.ui.main; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var FROZEN_WINDOW_BRIGHTNESS = -0.3; | ||||
| var DIALOG_TRANSITION_TIME = 150; | ||||
| var FROZEN_WINDOW_BRIGHTNESS = -0.3 | ||||
| var DIALOG_TRANSITION_TIME = 0.15 | ||||
| var ALIVE_TIMEOUT = 5000; | ||||
|  | ||||
| var CloseDialog = GObject.registerClass({ | ||||
|     Implements: [Meta.CloseDialog], | ||||
|     Implements: [ Meta.CloseDialog ], | ||||
|     Properties: { | ||||
|         'window': GObject.ParamSpec.override('window', Meta.CloseDialog) | ||||
|     }, | ||||
| @@ -56,12 +56,12 @@ var CloseDialog = GObject.registerClass({ | ||||
|         this._dialog.height = windowActor.height; | ||||
|  | ||||
|         this._dialog.addContent(this._createDialogContent()); | ||||
|         this._dialog.addButton({ label: _('Force Quit'), | ||||
|                                  action: this._onClose.bind(this), | ||||
|         this._dialog.addButton({ label:   _('Force Quit'), | ||||
|                                  action:  this._onClose.bind(this), | ||||
|                                  default: true }); | ||||
|         this._dialog.addButton({ label: _('Wait'), | ||||
|         this._dialog.addButton({ label:  _('Wait'), | ||||
|                                  action: this._onWait.bind(this), | ||||
|                                  key: Clutter.Escape }); | ||||
|                                  key:    Clutter.Escape }); | ||||
|  | ||||
|         global.focus_manager.add_group(this._dialog); | ||||
|     } | ||||
| @@ -148,12 +148,12 @@ var CloseDialog = GObject.registerClass({ | ||||
|         this._dialog.scale_y = 0; | ||||
|         this._dialog.set_pivot_point(0.5, 0.5); | ||||
|  | ||||
|         this._dialog.ease({ | ||||
|             scale_y: 1, | ||||
|             mode: Clutter.AnimationMode.LINEAR, | ||||
|             duration: DIALOG_TRANSITION_TIME, | ||||
|             onComplete: this._onFocusChanged.bind(this) | ||||
|         }); | ||||
|         Tweener.addTween(this._dialog, | ||||
|                          { scale_y: 1, | ||||
|                            transition: 'linear', | ||||
|                            time: DIALOG_TRANSITION_TIME, | ||||
|                            onComplete: this._onFocusChanged.bind(this) | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     vfunc_hide() { | ||||
| @@ -165,7 +165,7 @@ var CloseDialog = GObject.registerClass({ | ||||
|         GLib.source_remove(this._timeoutId); | ||||
|         this._timeoutId = 0; | ||||
|  | ||||
|         global.display.disconnect(this._windowFocusChangedId); | ||||
|         global.display.disconnect(this._windowFocusChangedId) | ||||
|         this._windowFocusChangedId = 0; | ||||
|  | ||||
|         global.stage.disconnect(this._keyFocusChangedId); | ||||
| @@ -175,12 +175,14 @@ var CloseDialog = GObject.registerClass({ | ||||
|         this._dialog = null; | ||||
|         this._removeWindowEffect(); | ||||
|  | ||||
|         dialog.ease({ | ||||
|             scale_y: 0, | ||||
|             mode: Clutter.AnimationMode.LINEAR, | ||||
|             duration: DIALOG_TRANSITION_TIME, | ||||
|             onComplete: () => dialog.destroy() | ||||
|         }); | ||||
|         Tweener.addTween(dialog, | ||||
|                          { scale_y: 0, | ||||
|                            transition: 'linear', | ||||
|                            time: DIALOG_TRANSITION_TIME, | ||||
|                            onComplete: () => { | ||||
|                                dialog.destroy(); | ||||
|                            } | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     vfunc_focus() { | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported ComponentManager */ | ||||
| const Main = imports.ui.main; | ||||
|  | ||||
| var ComponentManager = class { | ||||
| @@ -14,13 +13,13 @@ var ComponentManager = class { | ||||
|         let newEnabledComponents = Main.sessionMode.components; | ||||
|  | ||||
|         newEnabledComponents.filter( | ||||
|             name => !this._enabledComponents.includes(name) | ||||
|             name => this._enabledComponents.indexOf(name) == -1 | ||||
|         ).forEach(name => { | ||||
|             this._enableComponent(name); | ||||
|         }); | ||||
|  | ||||
|         this._enabledComponents.filter( | ||||
|             name => !newEnabledComponents.includes(name) | ||||
|             name => newEnabledComponents.indexOf(name) == -1 | ||||
|         ).forEach(name => { | ||||
|             this._disableComponent(name); | ||||
|         }); | ||||
| @@ -38,8 +37,8 @@ var ComponentManager = class { | ||||
|         if (component) | ||||
|             return component; | ||||
|  | ||||
|         if (Main.sessionMode.isLocked) | ||||
|             return null; | ||||
| 	if (Main.sessionMode.isLocked) | ||||
| 	    return null; | ||||
|  | ||||
|         let constructor = this._importComponent(name); | ||||
|         component = new constructor(); | ||||
| @@ -49,7 +48,7 @@ var ComponentManager = class { | ||||
|  | ||||
|     _enableComponent(name) { | ||||
|         let component = this._ensureComponent(name); | ||||
|         if (component) | ||||
| 	if (component) | ||||
|             component.enable(); | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -1,7 +1,7 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Component */ | ||||
|  | ||||
| const { Gio, GLib } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
| const Params = imports.misc.params; | ||||
|  | ||||
| const GnomeSession = imports.misc.gnomeSession; | ||||
| @@ -38,7 +38,7 @@ var AutomountManager = class { | ||||
|         this._driveDisconnectedId = this._volumeMonitor.connect('drive-disconnected', this._onDriveDisconnected.bind(this)); | ||||
|         this._driveEjectButtonId = this._volumeMonitor.connect('drive-eject-button', this._onDriveEjectButton.bind(this)); | ||||
|  | ||||
|         this._mountAllId = GLib.idle_add(GLib.PRIORITY_DEFAULT, this._startupMountAll.bind(this)); | ||||
|         this._mountAllId = Mainloop.idle_add(this._startupMountAll.bind(this)); | ||||
|         GLib.Source.set_name_by_id(this._mountAllId, '[gnome-shell] this._startupMountAll'); | ||||
|     } | ||||
|  | ||||
| @@ -50,12 +50,12 @@ var AutomountManager = class { | ||||
|         this._volumeMonitor.disconnect(this._driveEjectButtonId); | ||||
|  | ||||
|         if (this._mountAllId > 0) { | ||||
|             GLib.source_remove(this._mountAllId); | ||||
|             Mainloop.source_remove(this._mountAllId); | ||||
|             this._mountAllId = 0; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _InhibitorsChanged(_object, _senderName, [_inhibitor]) { | ||||
|     _InhibitorsChanged(object, senderName, [inhibtor]) { | ||||
|         this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT, | ||||
|             (result, error) => { | ||||
|                 if (!error) { | ||||
| @@ -109,23 +109,25 @@ var AutomountManager = class { | ||||
|         // we force stop/eject in this case, so we don't have to pass a | ||||
|         // mount operation object | ||||
|         if (drive.can_stop()) { | ||||
|             drive.stop(Gio.MountUnmountFlags.FORCE, null, null, | ||||
|                 (drive, res) => { | ||||
|                     try { | ||||
|                         drive.stop_finish(res); | ||||
|                     } catch (e) { | ||||
|                         log(`Unable to stop the drive after drive-eject-button ${e.toString()}`); | ||||
|                     } | ||||
|                 }); | ||||
|             drive.stop | ||||
|                 (Gio.MountUnmountFlags.FORCE, null, null, | ||||
|                  (drive, res) => { | ||||
|                      try { | ||||
|                          drive.stop_finish(res); | ||||
|                      } catch (e) { | ||||
|                          log("Unable to stop the drive after drive-eject-button " + e.toString()); | ||||
|                      } | ||||
|                  }); | ||||
|         } else if (drive.can_eject()) { | ||||
|             drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null, | ||||
|                 (drive, res) => { | ||||
|                     try { | ||||
|                         drive.eject_with_operation_finish(res); | ||||
|                     } catch (e) { | ||||
|                         log(`Unable to eject the drive after drive-eject-button ${e.toString()}`); | ||||
|                     } | ||||
|                 }); | ||||
|             drive.eject_with_operation  | ||||
|                 (Gio.MountUnmountFlags.FORCE, null, null, | ||||
|                  (drive, res) => { | ||||
|                      try { | ||||
|                          drive.eject_with_operation_finish(res); | ||||
|                      } catch (e) { | ||||
|                          log("Unable to eject the drive after drive-eject-button " + e.toString()); | ||||
|                      } | ||||
|                  }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -156,7 +158,7 @@ var AutomountManager = class { | ||||
|             !volume.should_automount() || | ||||
|             !volume.can_mount()) { | ||||
|             // allow the autorun to run anyway; this can happen if the | ||||
|             // mount gets added programmatically later, even if | ||||
|             // mount gets added programmatically later, even if  | ||||
|             // should_automount() or can_mount() are false, like for | ||||
|             // blank optical media. | ||||
|             this._allowAutorun(volume); | ||||
| @@ -211,7 +213,7 @@ var AutomountManager = class { | ||||
|                 } | ||||
|  | ||||
|                 if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.FAILED_HANDLED)) | ||||
|                     log(`Unable to mount volume ${volume.get_name()}: ${e.toString()}`); | ||||
|                     log('Unable to mount volume ' + volume.get_name() + ': ' + e.toString()); | ||||
|                 this._closeOperation(volume); | ||||
|             } | ||||
|         } | ||||
| @@ -219,17 +221,17 @@ var AutomountManager = class { | ||||
|  | ||||
|     _onVolumeRemoved(monitor, volume) { | ||||
|         if (volume._allowAutorunExpireId && volume._allowAutorunExpireId > 0) { | ||||
|             GLib.source_remove(volume._allowAutorunExpireId); | ||||
|             Mainloop.source_remove(volume._allowAutorunExpireId); | ||||
|             delete volume._allowAutorunExpireId; | ||||
|         } | ||||
|         this._volumeQueue = | ||||
|         this._volumeQueue =  | ||||
|             this._volumeQueue.filter(element => (element != volume)); | ||||
|     } | ||||
|  | ||||
|     _reaskPassword(volume) { | ||||
|         let prevOperation = this._activeOperations.get(volume); | ||||
|         let existingDialog = prevOperation ? prevOperation.borrowDialog() : null; | ||||
|         let operation = | ||||
|         let operation =  | ||||
|             new ShellMountOperation.ShellMountOperation(volume, | ||||
|                                                         { existingDialog: existingDialog }); | ||||
|         this._mountVolume(volume, operation); | ||||
| @@ -248,7 +250,7 @@ var AutomountManager = class { | ||||
|     } | ||||
|  | ||||
|     _allowAutorunExpire(volume) { | ||||
|         let id = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, AUTORUN_EXPIRE_TIMEOUT_SECS, () => { | ||||
|         let id = Mainloop.timeout_add_seconds(AUTORUN_EXPIRE_TIMEOUT_SECS, () => { | ||||
|             volume.allowAutorun = false; | ||||
|             delete volume._allowAutorunExpireId; | ||||
|             return GLib.SOURCE_REMOVE; | ||||
|   | ||||
| @@ -1,7 +1,6 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Component */ | ||||
|  | ||||
| const { Gio, GObject, St } = imports.gi; | ||||
| const { Gio, St } = imports.gi; | ||||
|  | ||||
| const GnomeSession = imports.misc.gnomeSession; | ||||
| const Main = imports.ui.main; | ||||
| @@ -41,7 +40,7 @@ function isMountRootHidden(root) { | ||||
|     let path = root.get_path(); | ||||
|  | ||||
|     // skip any mounts in hidden directory hierarchies | ||||
|     return (path.includes('/.')); | ||||
|     return (path.indexOf('/.') != -1); | ||||
| } | ||||
|  | ||||
| function isMountNonLocal(mount) { | ||||
| @@ -63,15 +62,18 @@ function startAppForMount(app, mount) { | ||||
|     files.push(root); | ||||
|  | ||||
|     try { | ||||
|         retval = app.launch(files, | ||||
|         retval = app.launch(files,  | ||||
|                             global.create_app_launch_context(0, -1)); | ||||
|     } catch (e) { | ||||
|         log(`Unable to launch the application ${app.get_name()}: ${e}`); | ||||
|         log('Unable to launch the application ' + app.get_name() | ||||
|             + ': ' + e.toString()); | ||||
|     } | ||||
|  | ||||
|     return retval; | ||||
| } | ||||
|  | ||||
| /******************************************/ | ||||
|  | ||||
| const HotplugSnifferIface = loadInterfaceXML('org.gnome.Shell.HotplugSniffer'); | ||||
| const HotplugSnifferProxy = Gio.DBusProxy.makeProxyWrapper(HotplugSnifferIface); | ||||
| function HotplugSniffer() { | ||||
| @@ -105,7 +107,8 @@ var ContentTypeDiscoverer = class { | ||||
|         try { | ||||
|             contentTypes = mount.guess_content_type_finish(res); | ||||
|         } catch (e) { | ||||
|             log(`Unable to guess content types on added mount ${mount.get_name()}: ${e}`); | ||||
|             log('Unable to guess content types on added mount ' + mount.get_name() | ||||
|                 + ': ' + e.toString()); | ||||
|         } | ||||
|  | ||||
|         if (contentTypes.length) { | ||||
| @@ -115,13 +118,16 @@ var ContentTypeDiscoverer = class { | ||||
|  | ||||
|             let hotplugSniffer = new HotplugSniffer(); | ||||
|             hotplugSniffer.SniffURIRemote(root.get_uri(), | ||||
|                 ([contentTypes]) => { | ||||
|                     this._emitCallback(mount, contentTypes); | ||||
|                 }); | ||||
|                  ([contentTypes]) => { | ||||
|                      this._emitCallback(mount, contentTypes); | ||||
|                  }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _emitCallback(mount, contentTypes = []) { | ||||
|     _emitCallback(mount, contentTypes) { | ||||
|         if (!contentTypes) | ||||
|             contentTypes = []; | ||||
|  | ||||
|         // we're not interested in win32 software content types here | ||||
|         contentTypes = contentTypes.filter( | ||||
|             type => (type != 'x-content/win32-software') | ||||
| @@ -186,15 +192,15 @@ var AutorunDispatcher = class { | ||||
|  | ||||
|     _getAutorunSettingForType(contentType) { | ||||
|         let runApp = this._settings.get_strv(SETTING_START_APP); | ||||
|         if (runApp.includes(contentType)) | ||||
|         if (runApp.indexOf(contentType) != -1) | ||||
|             return AutorunSetting.RUN; | ||||
|  | ||||
|         let ignore = this._settings.get_strv(SETTING_IGNORE); | ||||
|         if (ignore.includes(contentType)) | ||||
|         if (ignore.indexOf(contentType) != -1) | ||||
|             return AutorunSetting.IGNORE; | ||||
|  | ||||
|         let openFiles = this._settings.get_strv(SETTING_OPEN_FOLDER); | ||||
|         if (openFiles.includes(contentType)) | ||||
|         if (openFiles.indexOf(contentType) != -1) | ||||
|             return AutorunSetting.FILES; | ||||
|  | ||||
|         return AutorunSetting.ASK; | ||||
| @@ -213,11 +219,11 @@ var AutorunDispatcher = class { | ||||
|     } | ||||
|  | ||||
|     _addSource(mount, apps) { | ||||
|         // if we already have a source showing for this | ||||
|         // if we already have a source showing for this  | ||||
|         // mount, return | ||||
|         if (this._getSourceForMount(mount)) | ||||
|             return; | ||||
|  | ||||
|       | ||||
|         // add a new source | ||||
|         this._sources.push(new AutorunSource(this._manager, mount, apps)); | ||||
|     } | ||||
| @@ -262,7 +268,7 @@ var AutorunDispatcher = class { | ||||
|  | ||||
|     removeMount(mount) { | ||||
|         let source = this._getSourceForMount(mount); | ||||
|  | ||||
|          | ||||
|         // if we aren't tracking this mount, don't do anything | ||||
|         if (!source) | ||||
|             return; | ||||
| @@ -272,10 +278,9 @@ var AutorunDispatcher = class { | ||||
|     } | ||||
| }; | ||||
|  | ||||
| var AutorunSource = GObject.registerClass( | ||||
| class AutorunSource extends MessageTray.Source { | ||||
|     _init(manager, mount, apps) { | ||||
|         super._init(mount.get_name()); | ||||
| var AutorunSource = class extends MessageTray.Source { | ||||
|     constructor(manager, mount, apps) { | ||||
|         super(mount.get_name()); | ||||
|  | ||||
|         this._manager = manager; | ||||
|         this.mount = mount; | ||||
| @@ -285,7 +290,7 @@ class AutorunSource extends MessageTray.Source { | ||||
|  | ||||
|         // add ourselves as a source, and popup the notification | ||||
|         Main.messageTray.add(this); | ||||
|         this.showNotification(this._notification); | ||||
|         this.notify(this._notification); | ||||
|     } | ||||
|  | ||||
|     getIcon() { | ||||
| @@ -295,12 +300,11 @@ class AutorunSource extends MessageTray.Source { | ||||
|     _createPolicy() { | ||||
|         return new MessageTray.NotificationApplicationPolicy('org.gnome.Nautilus'); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var AutorunNotification = GObject.registerClass( | ||||
| class AutorunNotification extends MessageTray.Notification { | ||||
|     _init(manager, source) { | ||||
|         super._init(source, source.title); | ||||
| var AutorunNotification = class extends MessageTray.Notification { | ||||
|     constructor(manager, source) { | ||||
|         super(source, source.title); | ||||
|  | ||||
|         this._manager = manager; | ||||
|         this._mount = source.mount; | ||||
| @@ -325,10 +329,10 @@ class AutorunNotification extends MessageTray.Notification { | ||||
|                                  style_class: 'hotplug-notification-item-icon' }); | ||||
|         box.add(icon); | ||||
|  | ||||
|         let label = new St.Bin({ | ||||
|             y_align: St.Align.MIDDLE, | ||||
|             child: new St.Label({ text: _("Open with %s").format(app.get_name()) }), | ||||
|         }); | ||||
|         let label = new St.Bin({ y_align: St.Align.MIDDLE, | ||||
|                                  child: new St.Label | ||||
|                                  ({ text: _("Open with %s").format(app.get_name()) }) | ||||
|                                }); | ||||
|         box.add(label); | ||||
|  | ||||
|         let button = new St.Button({ child: box, | ||||
| @@ -352,6 +356,6 @@ class AutorunNotification extends MessageTray.Notification { | ||||
|         let app = Gio.app_info_get_default_for_type('inode/directory', false); | ||||
|         startAppForMount(app, this._mount); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var Component = AutorunManager; | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Component */ | ||||
|  | ||||
| const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi; | ||||
|  | ||||
| @@ -77,13 +76,13 @@ class KeyringDialog extends ModalDialog.ModalDialog { | ||||
|             this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true); | ||||
|  | ||||
|             if (rtl) { | ||||
|                 layout.attach(this._workSpinner, 0, row, 1, 1); | ||||
|                 layout.attach(this._workSpinner.actor, 0, row, 1, 1); | ||||
|                 layout.attach(this._passwordEntry, 1, row, 1, 1); | ||||
|                 layout.attach(label, 2, row, 1, 1); | ||||
|             } else { | ||||
|                 layout.attach(label, 0, row, 1, 1); | ||||
|                 layout.attach(this._passwordEntry, 1, row, 1, 1); | ||||
|                 layout.attach(this._workSpinner, 2, row, 1, 1); | ||||
|                 layout.attach(this._workSpinner.actor, 2, row, 1, 1); | ||||
|             } | ||||
|             row++; | ||||
|         } else { | ||||
| @@ -121,8 +120,8 @@ class KeyringDialog extends ModalDialog.ModalDialog { | ||||
|         if (this.prompt.choice_visible) { | ||||
|             let choice = new CheckBox.CheckBox(); | ||||
|             this.prompt.bind_property('choice-label', choice.getLabelActor(), 'text', GObject.BindingFlags.SYNC_CREATE); | ||||
|             this.prompt.bind_property('choice-chosen', choice, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL); | ||||
|             layout.attach(choice, rtl ? 0 : 1, row, 1, 1); | ||||
|             this.prompt.bind_property('choice-chosen', choice.actor, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL); | ||||
|             layout.attach(choice.actor, rtl ? 0 : 1, row, 1, 1); | ||||
|             row++; | ||||
|         } | ||||
|  | ||||
| @@ -163,7 +162,7 @@ class KeyringDialog extends ModalDialog.ModalDialog { | ||||
|         // NOTE: ModalDialog.open() is safe to call if the dialog is | ||||
|         // already open - it just returns true without side-effects | ||||
|         if (this.open()) | ||||
|             return true; | ||||
|           return true; | ||||
|  | ||||
|         // The above fail if e.g. unable to get input grab | ||||
|         // | ||||
| @@ -173,25 +172,25 @@ class KeyringDialog extends ModalDialog.ModalDialog { | ||||
|  | ||||
|         log('keyringPrompt: Failed to show modal dialog.' + | ||||
|             ' Dismissing prompt request'); | ||||
|         this.prompt.cancel(); | ||||
|         this.prompt.cancel() | ||||
|         return false; | ||||
|     } | ||||
|  | ||||
|     _onShowPassword() { | ||||
|     _onShowPassword(prompt) { | ||||
|         this._buildControlTable(); | ||||
|         this._ensureOpen(); | ||||
|         this._updateSensitivity(true); | ||||
|         this._passwordEntry.grab_key_focus(); | ||||
|     } | ||||
|  | ||||
|     _onShowConfirm() { | ||||
|     _onShowConfirm(prompt) { | ||||
|         this._buildControlTable(); | ||||
|         this._ensureOpen(); | ||||
|         this._updateSensitivity(true); | ||||
|         this._continueButton.grab_key_focus(); | ||||
|     } | ||||
|  | ||||
|     _onHidePrompt() { | ||||
|     _onHidePrompt(prompt) { | ||||
|         this.close(); | ||||
|     } | ||||
|  | ||||
| @@ -232,9 +231,8 @@ var KeyringPrompter = class { | ||||
|     constructor() { | ||||
|         this._prompter = new Gcr.SystemPrompter(); | ||||
|         this._prompter.connect('new-prompt', () => { | ||||
|             let dialog = this._enabled | ||||
|                 ? new KeyringDialog() | ||||
|                 : new KeyringDummyDialog(); | ||||
|             let dialog = this._enabled ? new KeyringDialog() | ||||
|                                        : new KeyringDummyDialog(); | ||||
|             this._currentPrompt = dialog.prompt; | ||||
|             return this._currentPrompt; | ||||
|         }); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Component */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
| @@ -81,9 +80,8 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|                         secret.valid = secret.value.length > 0; | ||||
|                     this._updateOkButton(); | ||||
|                 }); | ||||
|             } else { | ||||
|             } else | ||||
|                 secret.valid = true; | ||||
|             } | ||||
|  | ||||
|             if (rtl) { | ||||
|                 layout.attach(secret.entry, 0, pos, 1, 1); | ||||
| @@ -107,22 +105,21 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|             descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; | ||||
|  | ||||
|             contentBox.messageBox.add(descriptionLabel, | ||||
|                                       { y_fill: true, | ||||
|                                       { y_fill:  true, | ||||
|                                         y_align: St.Align.START, | ||||
|                                         expand: true }); | ||||
|         } | ||||
|  | ||||
|         this._okButton = { | ||||
|             label: _("Connect"), | ||||
|             action: this._onOk.bind(this), | ||||
|             default: true, | ||||
|         }; | ||||
|         this._okButton = { label:  _("Connect"), | ||||
|                            action: this._onOk.bind(this), | ||||
|                            default: true | ||||
|                          }; | ||||
|  | ||||
|         this.setButtons([{ | ||||
|             label: _("Cancel"), | ||||
|             action: this.cancel.bind(this), | ||||
|             key: Clutter.KEY_Escape, | ||||
|         }, this._okButton]); | ||||
|         this.setButtons([{ label: _("Cancel"), | ||||
|                            action: this.cancel.bind(this), | ||||
|                            key:    Clutter.KEY_Escape, | ||||
|                          }, | ||||
|                          this._okButton]); | ||||
|  | ||||
|         this._updateOkButton(); | ||||
|     } | ||||
| @@ -164,9 +161,9 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|         if (value.length == 64) { | ||||
|             // must be composed of hexadecimal digits only | ||||
|             for (let i = 0; i < 64; i++) { | ||||
|                 if (!((value[i] >= 'a' && value[i] <= 'f') || | ||||
|                       (value[i] >= 'A' && value[i] <= 'F') || | ||||
|                       (value[i] >= '0' && value[i] <= '9'))) | ||||
|                 if (!((value[i] >= 'a' && value[i] <= 'f') | ||||
|                       || (value[i] >= 'A' && value[i] <= 'F') | ||||
|                       || (value[i] >= '0' && value[i] <= '9'))) | ||||
|                     return false; | ||||
|             } | ||||
|             return true; | ||||
| @@ -179,29 +176,28 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|         let value = secret.value; | ||||
|         if (secret.wep_key_type == NM.WepKeyType.KEY) { | ||||
|             if (value.length == 10 || value.length == 26) { | ||||
|                 for (let i = 0; i < value.length; i++) { | ||||
|                     if (!((value[i] >= 'a' && value[i] <= 'f') || | ||||
|                           (value[i] >= 'A' && value[i] <= 'F') || | ||||
|                           (value[i] >= '0' && value[i] <= '9'))) | ||||
| 		for (let i = 0; i < value.length; i++) { | ||||
|                     if (!((value[i] >= 'a' && value[i] <= 'f') | ||||
|                           || (value[i] >= 'A' && value[i] <= 'F') | ||||
|                           || (value[i] >= '0' && value[i] <= '9'))) | ||||
|                         return false; | ||||
| 		} | ||||
| 	    } else if (value.length == 5 || value.length == 13) { | ||||
| 		for (let i = 0; i < value.length; i++) { | ||||
|                     if (!((value[i] >= 'a' && value[i] <= 'z') | ||||
|                           || (value[i] >= 'A' && value[i] <= 'Z'))) | ||||
|                         return false; | ||||
|                 } | ||||
|             } else if (value.length == 5 || value.length == 13) { | ||||
|                 for (let i = 0; i < value.length; i++) { | ||||
|                     if (!((value[i] >= 'a' && value[i] <= 'z') || | ||||
|                           (value[i] >= 'A' && value[i] <= 'Z'))) | ||||
|                         return false; | ||||
|                 } | ||||
|             } else { | ||||
|             } else | ||||
|                 return false; | ||||
|             } | ||||
|         } else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) { | ||||
|             if (value.length < 0 || value.length > 64) | ||||
|                 return false; | ||||
|         } | ||||
| 	} else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) { | ||||
| 	    if (value.length < 0 || value.length > 64) | ||||
| 	        return false; | ||||
| 	} | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     _getWirelessSecrets(secrets, _wirelessSetting) { | ||||
|     _getWirelessSecrets(secrets, wirelessSetting) { | ||||
|         let wirelessSecuritySetting = this._connection.get_setting_wireless_security(); | ||||
|  | ||||
|         if (this._settingName == '802-1x') { | ||||
| @@ -213,13 +209,12 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|         // First the easy ones | ||||
|         case 'wpa-none': | ||||
|         case 'wpa-psk': | ||||
|         case 'sae': | ||||
|             secrets.push({ label: _("Password: "), key: 'psk', | ||||
|                            value: wirelessSecuritySetting.psk || '', | ||||
|                            validate: this._validateWpaPsk, password: true }); | ||||
|             break; | ||||
|         case 'none': // static WEP | ||||
|             secrets.push({ label: _("Key: "), key: `wep-key${wirelessSecuritySetting.wep_tx_keyidx}`, | ||||
|             secrets.push({ label: _("Key: "), key: 'wep-key' + wirelessSecuritySetting.wep_tx_keyidx, | ||||
|                            value: wirelessSecuritySetting.get_wep_key(wirelessSecuritySetting.wep_tx_keyidx) || '', | ||||
|                            wep_key_type: wirelessSecuritySetting.wep_key_type, | ||||
|                            validate: this._validateStaticWep, password: true }); | ||||
| @@ -235,12 +230,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|             this._get8021xSecrets(secrets); | ||||
|             break; | ||||
|         default: | ||||
|             log(`Invalid wireless key management: ${wirelessSecuritySetting.key_mgmt}`); | ||||
|             log('Invalid wireless key management: ' + wirelessSecuritySetting.key_mgmt); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _get8021xSecrets(secrets) { | ||||
|         let ieee8021xSetting = this._connection.get_setting_802_1x(); | ||||
|         let phase2method; | ||||
|  | ||||
|         /* If hints were given we know exactly what we need to ask */ | ||||
|         if (this._settingName == "802-1x" && this._hints.length) { | ||||
| @@ -277,7 +273,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|                            value: ieee8021xSetting.private_key_password || '', password: true }); | ||||
|             break; | ||||
|         default: | ||||
|             log(`Invalid EAP/IEEE802.1x method: ${ieee8021xSetting.get_eap_method(0)}`); | ||||
|             log('Invalid EAP/IEEE802.1x method: ' + ieee8021xSetting.get_eap_method(0)); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -308,13 +304,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|         let ssid; | ||||
|  | ||||
|         let content = { }; | ||||
|         content.secrets = []; | ||||
|         content.secrets = [ ]; | ||||
|  | ||||
|         switch (connectionType) { | ||||
|         case '802-11-wireless': | ||||
|             wirelessSetting = this._connection.get_setting_wireless(); | ||||
|             ssid = NM.utils_ssid_to_utf8(wirelessSetting.get_ssid().get_data()); | ||||
|             content.title = _("Authentication required by wireless network"); | ||||
|             content.title = _("Authentication required"); | ||||
|             content.message = _("Passwords or encryption keys are required to access the wireless network “%s”.").format(ssid); | ||||
|             this._getWirelessSecrets(content.secrets, wirelessSetting); | ||||
|             break; | ||||
| @@ -331,7 +327,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|             this._getPPPoESecrets(content.secrets); | ||||
|             break; | ||||
|         case 'gsm': | ||||
|             if (this._hints.includes('pin')) { | ||||
|             if (this._hints.indexOf('pin') != -1) { | ||||
|                 let gsmSetting = this._connection.get_setting_gsm(); | ||||
|                 content.title = _("PIN code required"); | ||||
|                 content.message = _("PIN code is needed for the mobile broadband device"); | ||||
| @@ -342,13 +338,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog { | ||||
|             // fall through | ||||
|         case 'cdma': | ||||
|         case 'bluetooth': | ||||
|             content.title = _("Mobile broadband network password"); | ||||
|             content.title = _("Mobile broadband password"); | ||||
|             content.message = _("A password is required to connect to “%s”.").format(connectionSetting.get_id()); | ||||
|             this._getMobileSecrets(content.secrets, connectionType); | ||||
|             break; | ||||
|         default: | ||||
|             log(`Invalid connection type: ${connectionType}`); | ||||
|         } | ||||
|             log('Invalid connection type: ' + connectionType); | ||||
|         }; | ||||
|  | ||||
|         return content; | ||||
|     } | ||||
| @@ -363,15 +359,16 @@ var VPNRequestHandler = class { | ||||
|         this._pluginOutBuffer = []; | ||||
|         this._title = null; | ||||
|         this._description = null; | ||||
|         this._content = []; | ||||
|         this._content = [ ]; | ||||
|         this._shellDialog = null; | ||||
|  | ||||
|         let connectionSetting = connection.get_setting_connection(); | ||||
|  | ||||
|         let argv = [authHelper.fileName, | ||||
|                     '-u', connectionSetting.uuid, | ||||
|                     '-n', connectionSetting.id, | ||||
|                     '-s', serviceType]; | ||||
|         let argv = [ authHelper.fileName, | ||||
|                      '-u', connectionSetting.uuid, | ||||
|                      '-n', connectionSetting.id, | ||||
|                      '-s', serviceType | ||||
|                    ]; | ||||
|         if (authHelper.externalUIMode) | ||||
|             argv.push('--external-ui-mode'); | ||||
|         if (flags & NM.SecretAgentGetSecretsFlags.ALLOW_INTERACTION) | ||||
| @@ -388,7 +385,7 @@ var VPNRequestHandler = class { | ||||
|         this._newStylePlugin = authHelper.externalUIMode; | ||||
|  | ||||
|         try { | ||||
|             let [success_, pid, stdin, stdout, stderr] = | ||||
|             let [success, pid, stdin, stdout, stderr] = | ||||
|                 GLib.spawn_async_with_pipes(null, /* pwd */ | ||||
|                                             argv, | ||||
|                                             null, /* envp */ | ||||
| @@ -410,7 +407,7 @@ var VPNRequestHandler = class { | ||||
|                                                     this._vpnChildFinished.bind(this)); | ||||
|  | ||||
|             this._writeConnection(); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             logError(e, 'error while spawning VPN auth helper'); | ||||
|  | ||||
|             this._agent.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); | ||||
| @@ -427,7 +424,7 @@ var VPNRequestHandler = class { | ||||
|         } else { | ||||
|             try { | ||||
|                 this._stdin.write('QUIT\n\n', null); | ||||
|             } catch (e) { /* ignore broken pipe errors */ } | ||||
|             } catch(e) { /* ignore broken pipe errors */ } | ||||
|         } | ||||
|  | ||||
|         this.destroy(); | ||||
| @@ -447,7 +444,7 @@ var VPNRequestHandler = class { | ||||
|         this._destroyed = true; | ||||
|     } | ||||
|  | ||||
|     _vpnChildFinished(pid, status, _requestObj) { | ||||
|     _vpnChildFinished(pid, status, requestObj) { | ||||
|         this._childWatch = 0; | ||||
|         if (this._newStylePlugin) { | ||||
|             // For new style plugin, all work is done in the async reading functions | ||||
| @@ -462,9 +459,8 @@ var VPNRequestHandler = class { | ||||
|                 this._agent.respond(this._requestId, Shell.NetworkAgentResponse.USER_CANCELED); | ||||
|             else | ||||
|                 this._agent.respond(this._requestId, Shell.NetworkAgentResponse.CONFIRMED); | ||||
|         } else { | ||||
|         } else | ||||
|             this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); | ||||
|         } | ||||
|  | ||||
|         this.destroy(); | ||||
|     } | ||||
| @@ -477,7 +473,7 @@ var VPNRequestHandler = class { | ||||
|             if (line == '' && this._previousLine == '') { | ||||
|                 try { | ||||
|                     this._stdin.write('QUIT\n\n', null); | ||||
|                 } catch (e) { /* ignore broken pipe errors */ } | ||||
|                 } catch(e) { /* ignore broken pipe errors */ } | ||||
|             } else { | ||||
|                 this._agent.set_password(this._requestId, this._previousLine, line); | ||||
|                 this._previousLine = undefined; | ||||
| @@ -489,7 +485,7 @@ var VPNRequestHandler = class { | ||||
|  | ||||
|     _readStdoutOldStyle() { | ||||
|         this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => { | ||||
|             let [line, len_] = this._dataStdout.read_line_finish_utf8(result); | ||||
|             let [line, len] = this._dataStdout.read_line_finish_utf8(result); | ||||
|  | ||||
|             if (line == null) { | ||||
|                 // end of file | ||||
| @@ -544,7 +540,7 @@ var VPNRequestHandler = class { | ||||
|                                 message: keyfile.get_string(VPN_UI_GROUP, 'Description'), | ||||
|                                 secrets: [] }; | ||||
|  | ||||
|             let [groups, len_] = keyfile.get_groups(); | ||||
|             let [groups, len] = keyfile.get_groups(); | ||||
|             for (let i = 0; i < groups.length; i++) { | ||||
|                 if (groups[i] == VPN_UI_GROUP) | ||||
|                     continue; | ||||
| @@ -553,12 +549,11 @@ var VPNRequestHandler = class { | ||||
|                 let shouldAsk = keyfile.get_boolean(groups[i], 'ShouldAsk'); | ||||
|  | ||||
|                 if (shouldAsk) { | ||||
|                     contentOverride.secrets.push({ | ||||
|                         label: keyfile.get_string(groups[i], 'Label'), | ||||
|                         key: groups[i], | ||||
|                         value: value, | ||||
|                         password: keyfile.get_boolean(groups[i], 'IsSecret'), | ||||
|                     }); | ||||
|                     contentOverride.secrets.push({ label: keyfile.get_string(groups[i], 'Label'), | ||||
|                                                    key: groups[i], | ||||
|                                                    value: value, | ||||
|                                                    password: keyfile.get_boolean(groups[i], 'IsSecret') | ||||
|                                                  }); | ||||
|                 } else { | ||||
|                     if (!value.length) // Ignore empty secrets | ||||
|                         continue; | ||||
| @@ -566,7 +561,7 @@ var VPNRequestHandler = class { | ||||
|                     this._agent.set_password(this._requestId, groups[i], value); | ||||
|                 } | ||||
|             } | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             // No output is a valid case it means "both secrets are stored" | ||||
|             if (data.length > 0) { | ||||
|                 logError(e, 'error while reading VPN plugin output keyfile'); | ||||
| @@ -592,15 +587,15 @@ var VPNRequestHandler = class { | ||||
|  | ||||
|         try { | ||||
|             vpnSetting.foreach_data_item((key, value) => { | ||||
|                 this._stdin.write(`DATA_KEY=${key}\n`, null); | ||||
|                 this._stdin.write(`DATA_VAL=${value || ''}\n\n`, null); | ||||
|                 this._stdin.write('DATA_KEY=' + key + '\n', null); | ||||
|                 this._stdin.write('DATA_VAL=' + (value || '') + '\n\n', null); | ||||
|             }); | ||||
|             vpnSetting.foreach_secret((key, value) => { | ||||
|                 this._stdin.write(`SECRET_KEY=${key}\n`, null); | ||||
|                 this._stdin.write(`SECRET_VAL=${value || ''}\n\n`, null); | ||||
|                 this._stdin.write('SECRET_KEY=' + key + '\n', null); | ||||
|                 this._stdin.write('SECRET_VAL=' + (value || '') + '\n\n', null); | ||||
|             }); | ||||
|             this._stdin.write('DONE\n\n', null); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             logError(e, 'internal error while writing connection to helper'); | ||||
|  | ||||
|             this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); | ||||
| @@ -612,11 +607,10 @@ Signals.addSignalMethods(VPNRequestHandler.prototype); | ||||
|  | ||||
| var NetworkAgent = class { | ||||
|     constructor() { | ||||
|         this._native = new Shell.NetworkAgent({ | ||||
|             identifier: 'org.gnome.Shell.NetworkAgent', | ||||
|             capabilities: NM.SecretAgentCapabilities.VPN_HINTS, | ||||
|             auto_register: false, | ||||
|         }); | ||||
|         this._native = new Shell.NetworkAgent({ identifier: 'org.gnome.Shell.NetworkAgent', | ||||
|                                                 capabilities: NM.SecretAgentCapabilities.VPN_HINTS, | ||||
|                                                 auto_register: false | ||||
|                                               }); | ||||
|  | ||||
|         this._dialogs = { }; | ||||
|         this._vpnRequests = { }; | ||||
| @@ -625,9 +619,9 @@ var NetworkAgent = class { | ||||
|         this._pluginDir = Gio.file_new_for_path(Config.VPNDIR); | ||||
|         try { | ||||
|             let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null); | ||||
|             monitor.connect('changed', () => (this._vpnCacheBuilt = false)); | ||||
|         } catch (e) { | ||||
|             log(`Failed to create monitor for VPN plugin dir: ${e.message}`); | ||||
|             monitor.connect('changed', () => { this._vpnCacheBuilt = false; }); | ||||
|         } catch(e) { | ||||
|             log('Failed to create monitor for VPN plugin dir: ' + e.message); | ||||
|         } | ||||
|  | ||||
|         this._native.connect('new-request', this._newRequest.bind(this)); | ||||
| @@ -638,7 +632,7 @@ var NetworkAgent = class { | ||||
|             try { | ||||
|                 this._native.init_finish(res); | ||||
|                 this._initialized = true; | ||||
|             } catch (e) { | ||||
|             } catch(e) { | ||||
|                 this._native = null; | ||||
|                 logError(e, 'error initializing the NetworkManager Agent'); | ||||
|             } | ||||
| @@ -686,13 +680,12 @@ var NetworkAgent = class { | ||||
|         let connectionSetting = connection.get_setting_connection(); | ||||
|         let connectionType = connectionSetting.get_connection_type(); | ||||
|         switch (connectionType) { | ||||
|         case '802-11-wireless': { | ||||
|         case '802-11-wireless': | ||||
|             let wirelessSetting = connection.get_setting_wireless(); | ||||
|             let ssid = NM.utils_ssid_to_utf8(wirelessSetting.get_ssid().get_data()); | ||||
|             title = _("Authentication required by wireless network"); | ||||
|             title = _("Authentication required"); | ||||
|             body = _("Passwords or encryption keys are required to access the wireless network “%s”.").format(ssid); | ||||
|             break; | ||||
|         } | ||||
|         case '802-3-ethernet': | ||||
|             title = _("Wired 802.1X authentication"); | ||||
|             body = _("A password is required to connect to “%s”.".format(connection.get_id())); | ||||
| @@ -702,7 +695,8 @@ var NetworkAgent = class { | ||||
|             body = _("A password is required to connect to “%s”.".format(connection.get_id())); | ||||
|             break; | ||||
|         case 'gsm': | ||||
|             if (hints.includes('pin')) { | ||||
|             if (hints.indexOf('pin') != -1) { | ||||
|                 let gsmSetting = connection.get_setting_gsm(); | ||||
|                 title = _("PIN code required"); | ||||
|                 body = _("PIN code is needed for the mobile broadband device"); | ||||
|                 break; | ||||
| @@ -714,7 +708,7 @@ var NetworkAgent = class { | ||||
|             body = _("A password is required to connect to “%s”.").format(connectionSetting.get_id()); | ||||
|             break; | ||||
|         default: | ||||
|             log(`Invalid connection type: ${connectionType}`); | ||||
|             log('Invalid connection type: ' + connectionType); | ||||
|             this._native.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); | ||||
|             return; | ||||
|         } | ||||
| @@ -734,7 +728,7 @@ var NetworkAgent = class { | ||||
|         }); | ||||
|  | ||||
|         Main.messageTray.add(source); | ||||
|         source.showNotification(notification); | ||||
|         source.notify(notification); | ||||
|     } | ||||
|  | ||||
|     _newRequest(agent, requestId, connection, settingName, hints, flags) { | ||||
|   | ||||
| @@ -1,8 +1,8 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Component */ | ||||
|  | ||||
| const { AccountsService, Clutter, Gio, GLib, | ||||
|         GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Animation = imports.ui.animation; | ||||
| const Dialog = imports.ui.dialog; | ||||
| @@ -39,19 +39,19 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|         this.contentLayout.add_actor(content); | ||||
|  | ||||
|         if (userNames.length > 1) { | ||||
|             log(`polkitAuthenticationAgent: Received ${userNames.length} ` + | ||||
|                 'identities that can be used for authentication. Only ' + | ||||
|             log('polkitAuthenticationAgent: Received ' + userNames.length + | ||||
|                 ' identities that can be used for authentication. Only ' + | ||||
|                 'considering one.'); | ||||
|         } | ||||
|  | ||||
|         let userName = GLib.get_user_name(); | ||||
|         if (!userNames.includes(userName)) | ||||
|         if (userNames.indexOf(userName) < 0) | ||||
|             userName = 'root'; | ||||
|         if (!userNames.includes(userName)) | ||||
|         if (userNames.indexOf(userName) < 0) | ||||
|             userName = userNames[0]; | ||||
|  | ||||
|         this._user = AccountsService.UserManager.get_default().get_user(userName); | ||||
|         let userRealName = this._user.get_real_name(); | ||||
|         let userRealName = this._user.get_real_name() | ||||
|         this._userLoadedId = this._user.connect('notify::is_loaded', | ||||
|                                                 this._onUserChanged.bind(this)); | ||||
|         this._userChangedId = this._user.connect('changed', | ||||
| @@ -76,17 +76,17 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|             this._userAvatar = new UserWidget.Avatar(this._user, | ||||
|                                                      { iconSize: DIALOG_ICON_SIZE, | ||||
|                                                        styleClass: 'polkit-dialog-user-icon' }); | ||||
|             this._userAvatar.hide(); | ||||
|             userBox.add(this._userAvatar, | ||||
|                         { x_fill: true, | ||||
|                           y_fill: false, | ||||
|             this._userAvatar.actor.hide(); | ||||
|             userBox.add(this._userAvatar.actor, | ||||
|                         { x_fill:  true, | ||||
|                           y_fill:  false, | ||||
|                           x_align: St.Align.END, | ||||
|                           y_align: St.Align.START }); | ||||
|             let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label', | ||||
|                                             text: userRealName })); | ||||
|             userBox.add(userLabel, | ||||
|                         { x_fill: true, | ||||
|                           y_fill: false, | ||||
|                         { x_fill:  true, | ||||
|                           y_fill:  false, | ||||
|                           x_align: St.Align.END, | ||||
|                           y_align: St.Align.MIDDLE }); | ||||
|         } | ||||
| @@ -99,14 +99,14 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|         this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE }); | ||||
|         this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry', | ||||
|                                              text: "", | ||||
|                                              can_focus: true }); | ||||
|                                              can_focus: true}); | ||||
|         ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true }); | ||||
|         this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this)); | ||||
|         this._passwordBox.add(this._passwordEntry, | ||||
|                               { expand: true }); | ||||
|  | ||||
|         this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true); | ||||
|         this._passwordBox.add(this._workSpinner); | ||||
|         this._passwordBox.add(this._workSpinner.actor); | ||||
|  | ||||
|         this.setInitialKeyFocus(this._passwordEntry); | ||||
|         this._passwordBox.hide(); | ||||
| @@ -128,7 +128,7 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|          * gnome-shell.css sets the color to be transparent | ||||
|          */ | ||||
|         this._nullMessageLabel = new St.Label({ style_class: 'prompt-dialog-null-label', | ||||
|                                                 text: 'abc' }); | ||||
|                                                 text: 'abc'}); | ||||
|         this._nullMessageLabel.add_style_class_name('hidden'); | ||||
|         this._nullMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; | ||||
|         this._nullMessageLabel.clutter_text.line_wrap = true; | ||||
| @@ -138,7 +138,7 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|         this._cancelButton = this.addButton({ label: _("Cancel"), | ||||
|                                               action: this.cancel.bind(this), | ||||
|                                               key: Clutter.Escape }); | ||||
|         this._okButton = this.addButton({ label: _("Authenticate"), | ||||
|         this._okButton = this.addButton({ label:  _("Authenticate"), | ||||
|                                           action: this._onAuthenticateButtonPressed.bind(this), | ||||
|                                           default: true }); | ||||
|  | ||||
| @@ -181,9 +181,9 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|             // | ||||
|             // We could add retrying if this turns out to be a problem | ||||
|  | ||||
|             log('polkitAuthenticationAgent: Failed to show modal dialog. ' + | ||||
|                 `Dismissing authentication request for action-id ${this.actionId} ` + | ||||
|                 `cookie ${this._cookie}`); | ||||
|             log('polkitAuthenticationAgent: Failed to show modal dialog.' + | ||||
|                 ' Dismissing authentication request for action-id ' + this.actionId + | ||||
|                 ' cookie ' + this._cookie); | ||||
|             this._emitDone(true); | ||||
|         } | ||||
|     } | ||||
| @@ -251,14 +251,14 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _onSessionRequest(session, request, echoOn) { | ||||
|     _onSessionRequest(session, request, echo_on) { | ||||
|         // Cheap localization trick | ||||
|         if (request == 'Password:' || request == 'Password: ') | ||||
|             this._passwordLabel.set_text(_("Password:")); | ||||
|         else | ||||
|             this._passwordLabel.set_text(request); | ||||
|  | ||||
|         if (echoOn) | ||||
|         if (echo_on) | ||||
|             this._passwordEntry.clutter_text.set_password_char(''); | ||||
|         else | ||||
|             this._passwordEntry.clutter_text.set_password_char('\u25cf'); // ● U+25CF BLACK CIRCLE | ||||
| @@ -305,7 +305,7 @@ var AuthenticationDialog = GObject.registerClass({ | ||||
|     _onUserChanged() { | ||||
|         if (this._user.is_loaded && this._userAvatar) { | ||||
|             this._userAvatar.update(); | ||||
|             this._userAvatar.show(); | ||||
|             this._userAvatar.actor.show(); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -343,7 +343,7 @@ var AuthenticationAgent = class { | ||||
|     enable() { | ||||
|         try { | ||||
|             this._native.register(); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             log('Failed to register AuthenticationAgent'); | ||||
|         } | ||||
|     } | ||||
| @@ -351,7 +351,7 @@ var AuthenticationAgent = class { | ||||
|     disable() { | ||||
|         try { | ||||
|             this._native.unregister(); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             log('Failed to unregister AuthenticationAgent'); | ||||
|         } | ||||
|     } | ||||
| @@ -384,11 +384,11 @@ var AuthenticationAgent = class { | ||||
|         this._currentDialog.performAuthentication(); | ||||
|     } | ||||
|  | ||||
|     _onCancel(_nativeAgent) { | ||||
|     _onCancel(nativeAgent) { | ||||
|         this._completeRequest(false); | ||||
|     } | ||||
|  | ||||
|     _onDialogDone(_dialog, dismissed) { | ||||
|     _onDialogDone(dialog, dismissed) { | ||||
|         this._completeRequest(dismissed); | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -1,14 +1,14 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Component */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, St } = imports.gi; | ||||
| const Lang = imports.lang; | ||||
| const Mainloop = imports.mainloop; | ||||
|  | ||||
| var Tpl = null; | ||||
| var Tp = null; | ||||
| try { | ||||
|     ({ TelepathyGLib: Tp, TelepathyLogger: Tpl } = imports.gi); | ||||
| } catch (e) { | ||||
| } catch(e) { | ||||
|     log('Telepathy is not available, chat integration will be disabled.'); | ||||
| } | ||||
|  | ||||
| @@ -40,8 +40,10 @@ var NotificationDirection = { | ||||
|     RECEIVED: 'chat-received' | ||||
| }; | ||||
|  | ||||
| var N_ = s => s; | ||||
|  | ||||
| function makeMessageFromTpMessage(tpMessage, direction) { | ||||
|     let [text, flags_] = tpMessage.to_text(); | ||||
|     let [text, flags] = tpMessage.to_text(); | ||||
|  | ||||
|     let timestamp = tpMessage.get_sent_timestamp(); | ||||
|     if (timestamp == 0) | ||||
| @@ -87,7 +89,7 @@ var TelepathyComponent = class { | ||||
|         try { | ||||
|             this._client.register(); | ||||
|         } catch (e) { | ||||
|             throw new Error(`Could not register Telepathy client. Error: ${e}`); | ||||
|             throw new Error('Couldn\'t register Telepathy client. Error: \n' + e); | ||||
|         } | ||||
|  | ||||
|         if (!this._client.account_manager.is_prepared(Tp.AccountManager.get_feature_quark_core())) | ||||
| @@ -147,20 +149,20 @@ class TelepathyClient extends Tp.BaseClient { | ||||
|             this._delegatedChannelsCb.bind(this)); | ||||
|     } | ||||
|  | ||||
|     vfunc_observe_channels(...args) { | ||||
|         let [account, conn, channels, dispatchOp_, requests_, context] = args; | ||||
|     vfunc_observe_channels(account, conn, channels, | ||||
|                                      dispatchOp, requests, context) { | ||||
|         let len = channels.length; | ||||
|         for (let i = 0; i < len; i++) { | ||||
|             let channel = channels[i]; | ||||
|             let [targetHandle_, targetHandleType] = channel.get_handle(); | ||||
|             let [targetHandle, targetHandleType] = channel.get_handle(); | ||||
|  | ||||
|             if (channel.get_invalidated()) | ||||
|                 continue; | ||||
|               continue; | ||||
|  | ||||
|             /* Only observe contact text channels */ | ||||
|             if ((!(channel instanceof Tp.TextChannel)) || | ||||
|                targetHandleType != Tp.HandleType.CONTACT) | ||||
|                 continue; | ||||
|                continue; | ||||
|  | ||||
|             this._createChatSource(account, conn, channel, channel.get_target_contact()); | ||||
|         } | ||||
| @@ -180,8 +182,8 @@ class TelepathyClient extends Tp.BaseClient { | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     vfunc_handle_channels(...args) { | ||||
|         let [account, conn, channels, requests_, userActionTime_, context] = args; | ||||
|     vfunc_handle_channels(account, conn, channels, requests, | ||||
|                                     user_action_time, context) { | ||||
|         this._handlingChannels(account, conn, channels, true); | ||||
|         context.accept(); | ||||
|     } | ||||
| @@ -198,7 +200,7 @@ class TelepathyClient extends Tp.BaseClient { | ||||
|             } | ||||
|  | ||||
|             if (channel.get_invalidated()) | ||||
|                 continue; | ||||
|               continue; | ||||
|  | ||||
|             // 'notify' will be true when coming from an actual HandleChannels | ||||
|             // call, and not when from a successful Claim call. The point is | ||||
| @@ -215,13 +217,13 @@ class TelepathyClient extends Tp.BaseClient { | ||||
|                 // We are already handling the channel, display the source | ||||
|                 let source = this._chatSources[channel.get_object_path()]; | ||||
|                 if (source) | ||||
|                     source.showNotification(); | ||||
|                     source.notify(); | ||||
|             } | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     vfunc_add_dispatch_operation(...args) { | ||||
|         let [account, conn, channels, dispatchOp, context] = args; | ||||
|     vfunc_add_dispatch_operation(account, conn, channels, | ||||
|                                            dispatchOp, context) { | ||||
|         let channel = channels[0]; | ||||
|         let chanType = channel.get_channel_type(); | ||||
|  | ||||
| @@ -239,7 +241,7 @@ class TelepathyClient extends Tp.BaseClient { | ||||
|     } | ||||
|  | ||||
|     _approveTextChannel(account, conn, channel, dispatchOp, context) { | ||||
|         let [targetHandle_, targetHandleType] = channel.get_handle(); | ||||
|         let [targetHandle, targetHandleType] = channel.get_handle(); | ||||
|  | ||||
|         if (targetHandleType != Tp.HandleType.CONTACT) { | ||||
|             context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT, | ||||
| @@ -253,23 +255,22 @@ class TelepathyClient extends Tp.BaseClient { | ||||
|                 dispatchOp.claim_with_finish(result); | ||||
|                 this._handlingChannels(account, conn, [channel], false); | ||||
|             } catch (err) { | ||||
|                 log(`Failed to Claim channel: ${err}`); | ||||
|                 log('Failed to Claim channel: ' + err); | ||||
|             } | ||||
|         }); | ||||
|  | ||||
|         context.accept(); | ||||
|     } | ||||
|  | ||||
|     _delegatedChannelsCb(_client, _channels) { | ||||
|     _delegatedChannelsCb(client, channels) { | ||||
|         // Nothing to do as we don't make a distinction between observed and | ||||
|         // handled channels. | ||||
|     } | ||||
| }) : null; | ||||
|  | ||||
| var ChatSource = HAVE_TP ? GObject.registerClass( | ||||
| class ChatSource extends MessageTray.Source { | ||||
|     _init(account, conn, channel, contact, client) { | ||||
|         super._init(contact.get_alias()); | ||||
| var ChatSource = class extends MessageTray.Source { | ||||
|     constructor(account, conn, channel, contact, client) { | ||||
|         super(contact.get_alias()); | ||||
|  | ||||
|         this._account = account; | ||||
|         this._contact = contact; | ||||
| @@ -327,7 +328,7 @@ class ChatSource extends MessageTray.Source { | ||||
|  | ||||
|         // We ack messages when the user expands the new notification | ||||
|         let id = this._banner.connect('expanded', this._ackMessages.bind(this)); | ||||
|         this._banner.connect('destroy', () => { | ||||
|         this._banner.actor.connect('destroy', () => { | ||||
|             this._banner.disconnect(id); | ||||
|             this._banner = null; | ||||
|         }); | ||||
| @@ -361,28 +362,28 @@ class ChatSource extends MessageTray.Source { | ||||
|         let presenceType = this._contact.get_presence_type(); | ||||
|  | ||||
|         switch (presenceType) { | ||||
|         case Tp.ConnectionPresenceType.AVAILABLE: | ||||
|             iconName = 'user-available'; | ||||
|             break; | ||||
|         case Tp.ConnectionPresenceType.BUSY: | ||||
|             iconName = 'user-busy'; | ||||
|             break; | ||||
|         case Tp.ConnectionPresenceType.OFFLINE: | ||||
|             iconName = 'user-offline'; | ||||
|             break; | ||||
|         case Tp.ConnectionPresenceType.HIDDEN: | ||||
|             iconName = 'user-invisible'; | ||||
|             break; | ||||
|         case Tp.ConnectionPresenceType.AWAY: | ||||
|             iconName = 'user-away'; | ||||
|             break; | ||||
|         case Tp.ConnectionPresenceType.EXTENDED_AWAY: | ||||
|             iconName = 'user-idle'; | ||||
|             break; | ||||
|         default: | ||||
|             iconName = 'user-offline'; | ||||
|         } | ||||
|         return new Gio.ThemedIcon({ name: iconName }); | ||||
|             case Tp.ConnectionPresenceType.AVAILABLE: | ||||
|                 iconName = 'user-available'; | ||||
|                 break; | ||||
|             case Tp.ConnectionPresenceType.BUSY: | ||||
|                 iconName = 'user-busy'; | ||||
|                 break; | ||||
|             case Tp.ConnectionPresenceType.OFFLINE: | ||||
|                 iconName = 'user-offline'; | ||||
|                 break; | ||||
|             case Tp.ConnectionPresenceType.HIDDEN: | ||||
|                 iconName = 'user-invisible'; | ||||
|                 break; | ||||
|             case Tp.ConnectionPresenceType.AWAY: | ||||
|                 iconName = 'user-away'; | ||||
|                 break; | ||||
|             case Tp.ConnectionPresenceType.EXTENDED_AWAY: | ||||
|                 iconName = 'user-idle'; | ||||
|                 break; | ||||
|             default: | ||||
|                 iconName = 'user-offline'; | ||||
|        } | ||||
|        return new Gio.ThemedIcon({ name: iconName }); | ||||
|     } | ||||
|  | ||||
|     _updateAvatarIcon() { | ||||
| @@ -428,7 +429,7 @@ class ChatSource extends MessageTray.Source { | ||||
|     } | ||||
|  | ||||
|     _displayPendingMessages(logManager, result) { | ||||
|         let [success_, events] = logManager.get_filtered_events_finish(result); | ||||
|         let [success, events] = logManager.get_filtered_events_finish(result); | ||||
|  | ||||
|         let logMessages = events.map(makeMessageFromTplEvent); | ||||
|         this._ensureNotification(); | ||||
| @@ -477,7 +478,7 @@ class ChatSource extends MessageTray.Source { | ||||
|             this._notification.appendMessage(pendingMessages[i], true); | ||||
|  | ||||
|         if (pendingMessages.length > 0) | ||||
|             this.showNotification(); | ||||
|             this.notify(); | ||||
|     } | ||||
|  | ||||
|     destroy(reason) { | ||||
| @@ -546,15 +547,15 @@ class ChatSource extends MessageTray.Source { | ||||
|         // Wait a bit before notifying for the received message, a handler | ||||
|         // could ack it in the meantime. | ||||
|         if (this._notifyTimeoutId != 0) | ||||
|             GLib.source_remove(this._notifyTimeoutId); | ||||
|         this._notifyTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, | ||||
|             Mainloop.source_remove(this._notifyTimeoutId); | ||||
|         this._notifyTimeoutId = Mainloop.timeout_add(500, | ||||
|             this._notifyTimeout.bind(this)); | ||||
|         GLib.Source.set_name_by_id(this._notifyTimeoutId, '[gnome-shell] this._notifyTimeout'); | ||||
|     } | ||||
|  | ||||
|     _notifyTimeout() { | ||||
|         if (this._pendingMessages.length != 0) | ||||
|             this.showNotification(); | ||||
|             this.notify(); | ||||
|  | ||||
|         this._notifyTimeoutId = 0; | ||||
|  | ||||
| @@ -563,14 +564,14 @@ class ChatSource extends MessageTray.Source { | ||||
|  | ||||
|     // This is called for both messages we send from | ||||
|     // our client and other clients as well. | ||||
|     _messageSent(channel, message, _flags, _token) { | ||||
|     _messageSent(channel, message, flags, token) { | ||||
|         this._ensureNotification(); | ||||
|         message = makeMessageFromTpMessage(message, NotificationDirection.SENT); | ||||
|         this._notification.appendMessage(message); | ||||
|     } | ||||
|  | ||||
|     showNotification() { | ||||
|         super.showNotification(this._notification); | ||||
|     notify() { | ||||
|         super.notify(this._notification); | ||||
|     } | ||||
|  | ||||
|     respond(text) { | ||||
| @@ -584,7 +585,7 @@ class ChatSource extends MessageTray.Source { | ||||
|  | ||||
|         let msg = Tp.ClientMessage.new_text(type, text); | ||||
|         this._channel.send_message_async(msg, 0, (src, result) => { | ||||
|             this._channel.send_message_finish(result); | ||||
|             this._channel.send_message_finish(result);  | ||||
|         }); | ||||
|     } | ||||
|  | ||||
| @@ -596,12 +597,12 @@ class ChatSource extends MessageTray.Source { | ||||
|         // keep track of it with the ChatStateChanged signal but it is good | ||||
|         // enough right now. | ||||
|         if (state != this._chatState) { | ||||
|             this._chatState = state; | ||||
|             this._channel.set_chat_state_async(state, null); | ||||
|           this._chatState = state; | ||||
|           this._channel.set_chat_state_async(state, null); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _presenceChanged(_contact, _presence, _status, _message) { | ||||
|     _presenceChanged(contact, presence, status, message) { | ||||
|         if (this._notification) | ||||
|             this._notification.update(this._notification.title, | ||||
|                                       this._notification.bannerBodyText, | ||||
| @@ -626,18 +627,12 @@ class ChatSource extends MessageTray.Source { | ||||
|         // 'pending-message-removed' for each one. | ||||
|         this._channel.ack_all_pending_messages_async(null); | ||||
|     } | ||||
| }) : null; | ||||
| }; | ||||
|  | ||||
| var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|     Signals: { | ||||
|         'message-removed': { param_types: [Tp.Message.$gtype] }, | ||||
|         'message-added': { param_types: [Tp.Message.$gtype] }, | ||||
|         'timestamp-changed': { param_types: [Tp.Message.$gtype] }, | ||||
|     } | ||||
| }, class ChatNotification extends MessageTray.Notification { | ||||
|     _init(source) { | ||||
|         super._init(source, source.title, null, | ||||
|             { secondaryGIcon: source.getSecondaryIcon() }); | ||||
| var ChatNotification = class extends MessageTray.Notification { | ||||
|     constructor(source) { | ||||
|         super(source, source.title, null, | ||||
|               { secondaryGIcon: source.getSecondaryIcon() }); | ||||
|         this.setUrgency(MessageTray.Urgency.HIGH); | ||||
|         this.setResident(true); | ||||
|  | ||||
| @@ -647,7 +642,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|  | ||||
|     destroy(reason) { | ||||
|         if (this._timestampTimeoutId) | ||||
|             GLib.source_remove(this._timestampTimeoutId); | ||||
|             Mainloop.source_remove(this._timestampTimeoutId); | ||||
|         this._timestampTimeoutId = 0; | ||||
|         super.destroy(reason); | ||||
|     } | ||||
| @@ -660,7 +655,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|      *   sender: the name of the sender, | ||||
|      *   timestamp: the time the message was sent | ||||
|      *   direction: a #NotificationDirection | ||||
|      * | ||||
|      *  | ||||
|      * @noTimestamp: Whether to add a timestamp. If %true, no timestamp | ||||
|      *   will be added, regardless of the difference since the | ||||
|      *   last timestamp | ||||
| @@ -680,8 +675,8 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|                         { datetime: GLib.DateTime.new_from_unix_local (message.timestamp), | ||||
|                           bannerMarkup: true }); | ||||
|  | ||||
|         let group = (message.direction == NotificationDirection.RECEIVED | ||||
|             ? 'received' : 'sent'); | ||||
|         let group = (message.direction == NotificationDirection.RECEIVED ? | ||||
|                      'received' : 'sent'); | ||||
|  | ||||
|         this._append({ body: messageBody, | ||||
|                        group: group, | ||||
| @@ -703,8 +698,8 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|         // SCROLLBACK_RECENT_LENGTH previous messages. Otherwise | ||||
|         // we'll keep SCROLLBACK_IDLE_LENGTH messages. | ||||
|  | ||||
|         let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) | ||||
|             ? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH; | ||||
|         let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) ? | ||||
|             SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH; | ||||
|  | ||||
|         let filteredHistory = this.messages.filter(item => item.realMessage); | ||||
|         if (filteredHistory.length > maxLength) { | ||||
| @@ -735,7 +730,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|  | ||||
|         // Reset the old message timeout | ||||
|         if (this._timestampTimeoutId) | ||||
|             GLib.source_remove(this._timestampTimeoutId); | ||||
|             Mainloop.source_remove(this._timestampTimeoutId); | ||||
|         this._timestampTimeoutId = 0; | ||||
|  | ||||
|         let message = { realMessage: props.group != 'meta', | ||||
| @@ -753,8 +748,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|             } else { | ||||
|                 // Schedule a new timestamp in SCROLLBACK_IMMEDIATE_TIME | ||||
|                 // from the timestamp of the message. | ||||
|                 this._timestampTimeoutId = GLib.timeout_add_seconds( | ||||
|                     GLib.PRIORITY_DEFAULT, | ||||
|                 this._timestampTimeoutId = Mainloop.timeout_add_seconds( | ||||
|                     SCROLLBACK_IMMEDIATE_TIME - (currentTime - timestamp), | ||||
|                     this.appendTimestamp.bind(this)); | ||||
|                 GLib.Source.set_name_by_id(this._timestampTimeoutId, '[gnome-shell] this.appendTimestamp'); | ||||
| @@ -789,7 +783,7 @@ var ChatNotification = HAVE_TP ? GObject.registerClass({ | ||||
|  | ||||
|         this._filterMessages(); | ||||
|     } | ||||
| }) : null; | ||||
| }; | ||||
|  | ||||
| var ChatLineBox = GObject.registerClass( | ||||
| class ChatLineBox extends St.BoxLayout { | ||||
| @@ -799,10 +793,9 @@ class ChatLineBox extends St.BoxLayout { | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var ChatNotificationBanner = GObject.registerClass( | ||||
| class ChatNotificationBanner extends MessageTray.NotificationBanner { | ||||
|     _init(notification) { | ||||
|         super._init(notification); | ||||
| var ChatNotificationBanner = class extends MessageTray.NotificationBanner { | ||||
|     constructor(notification) { | ||||
|         super(notification); | ||||
|  | ||||
|         this._responseEntry = new St.Entry({ style_class: 'chat-response', | ||||
|                                              x_expand: true, | ||||
| @@ -887,7 +880,8 @@ class ChatNotificationBanner extends MessageTray.NotificationBanner { | ||||
|     } | ||||
|  | ||||
|     _addMessage(message) { | ||||
|         let body = new MessageList.URLHighlighter(message.body, true, true); | ||||
|         let highlighter = new MessageList.URLHighlighter(message.body, true, true); | ||||
|         let body = highlighter.actor; | ||||
|  | ||||
|         let styles = message.styles; | ||||
|         for (let i = 0; i < styles.length; i++) | ||||
| @@ -959,15 +953,14 @@ class ChatNotificationBanner extends MessageTray.NotificationBanner { | ||||
|  | ||||
|         // Remove composing timeout. | ||||
|         if (this._composingTimeoutId > 0) { | ||||
|             GLib.source_remove(this._composingTimeoutId); | ||||
|             Mainloop.source_remove(this._composingTimeoutId); | ||||
|             this._composingTimeoutId = 0; | ||||
|         } | ||||
|  | ||||
|         if (text != '') { | ||||
|             this.notification.source.setChatState(Tp.ChannelChatState.COMPOSING); | ||||
|  | ||||
|             this._composingTimeoutId = GLib.timeout_add_seconds( | ||||
|                 GLib.PRIORITY_DEFAULT, | ||||
|             this._composingTimeoutId = Mainloop.timeout_add_seconds( | ||||
|                 COMPOSING_STOP_TIMEOUT, | ||||
|                 this._composingStopTimeout.bind(this)); | ||||
|             GLib.Source.set_name_by_id(this._composingTimeoutId, '[gnome-shell] this._composingStopTimeout'); | ||||
| @@ -975,6 +968,6 @@ class ChatNotificationBanner extends MessageTray.NotificationBanner { | ||||
|             this.notification.source.setChatState(Tp.ChannelChatState.ACTIVE); | ||||
|         } | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var Component = TelepathyComponent; | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported CtrlAltTabManager */ | ||||
|  | ||||
| const { Clutter, GObject, Meta, Shell, St } = imports.gi; | ||||
|  | ||||
| @@ -8,6 +7,7 @@ const SwitcherPopup = imports.ui.switcherPopup; | ||||
| const Params = imports.misc.params; | ||||
|  | ||||
| var POPUP_APPICON_SIZE = 96; | ||||
| var POPUP_FADE_TIME = 0.1; // seconds | ||||
|  | ||||
| var SortGroup = { | ||||
|     TOP:    0, | ||||
| @@ -33,7 +33,7 @@ var CtrlAltTabManager = class CtrlAltTabManager { | ||||
|         item.iconName = icon; | ||||
|  | ||||
|         this._items.push(item); | ||||
|         root.connect('destroy', () => this.removeGroup(root)); | ||||
|         root.connect('destroy', () => { this.removeGroup(root); }); | ||||
|         if (root instanceof St.Widget) | ||||
|             global.focus_manager.add_group(root); | ||||
|     } | ||||
| @@ -64,8 +64,9 @@ var CtrlAltTabManager = class CtrlAltTabManager { | ||||
|         if (a.sortGroup != b.sortGroup) | ||||
|             return a.sortGroup - b.sortGroup; | ||||
|  | ||||
|         let [ax] = a.proxy.get_transformed_position(); | ||||
|         let [bx] = b.proxy.get_transformed_position(); | ||||
|         let ax, bx, y; | ||||
|         [ax, y] = a.proxy.get_transformed_position(); | ||||
|         [bx, y] = b.proxy.get_transformed_position(); | ||||
|  | ||||
|         return ax - bx; | ||||
|     } | ||||
|   | ||||
							
								
								
									
										231
									
								
								js/ui/dash.js
									
									
									
									
									
								
							
							
						
						
									
										231
									
								
								js/ui/dash.js
									
									
									
									
									
								
							| @@ -1,18 +1,19 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Dash */ | ||||
|  | ||||
| const { Clutter, GLib, GObject, | ||||
|         Graphene, Meta, Shell, St } = imports.gi; | ||||
| const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const AppDisplay = imports.ui.appDisplay; | ||||
| const AppFavorites = imports.ui.appFavorites; | ||||
| const DND = imports.ui.dnd; | ||||
| const IconGrid = imports.ui.iconGrid; | ||||
| const Main = imports.ui.main; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var DASH_ANIMATION_TIME = 200; | ||||
| var DASH_ITEM_LABEL_SHOW_TIME = 150; | ||||
| var DASH_ITEM_LABEL_HIDE_TIME = 100; | ||||
| var DASH_ANIMATION_TIME = 0.2; | ||||
| var DASH_ITEM_LABEL_SHOW_TIME = 0.15; | ||||
| var DASH_ITEM_LABEL_HIDE_TIME = 0.1; | ||||
| var DASH_ITEM_HOVER_TIMEOUT = 300; | ||||
|  | ||||
| function getAppFromSource(source) { | ||||
| @@ -23,56 +24,27 @@ function getAppFromSource(source) { | ||||
|     } | ||||
| } | ||||
|  | ||||
| var DashIcon = GObject.registerClass( | ||||
| class DashIcon extends AppDisplay.AppIcon { | ||||
|     _init(app) { | ||||
|         super._init(app, { | ||||
|             setSizeManually: true, | ||||
|             showLabel: false | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     // Disable all DnD methods | ||||
|     _onDragBegin() { | ||||
|     } | ||||
|  | ||||
|     _onDragEnd() { | ||||
|     } | ||||
|  | ||||
|     handleDragOver() { | ||||
|         return DND.DragMotionResult.CONTINUE; | ||||
|     } | ||||
|  | ||||
|     acceptDrop() { | ||||
|         return false; | ||||
|     } | ||||
| }); | ||||
|  | ||||
| // A container like StBin, but taking the child's scale into account | ||||
| // when requesting a size | ||||
| var DashItemContainer = GObject.registerClass( | ||||
| class DashItemContainer extends St.Widget { | ||||
|     _init() { | ||||
|         super._init({ style_class: 'dash-item-container', | ||||
|                       pivot_point: new Graphene.Point({ x: .5, y: .5 }), | ||||
|                       scale_x: 0, | ||||
|                       scale_y: 0, | ||||
|                       opacity: 0, | ||||
|                       pivot_point: new Clutter.Point({ x: .5, y: .5 }), | ||||
|                       x_expand: true, | ||||
|                       x_align: Clutter.ActorAlign.CENTER }); | ||||
|  | ||||
|         this._labelText = ""; | ||||
|         this.label = new St.Label({ style_class: 'dash-label' }); | ||||
|         this.label = new St.Label({ style_class: 'dash-label'}); | ||||
|         this.label.hide(); | ||||
|         Main.layoutManager.addChrome(this.label); | ||||
|         this.label_actor = this.label; | ||||
|  | ||||
|         this.child = null; | ||||
|         this._childScale = 0; | ||||
|         this._childOpacity = 0; | ||||
|         this.animatingOut = false; | ||||
|  | ||||
|         this.connect('notify::scale-x', () => this.queue_relayout()); | ||||
|         this.connect('notify::scale-y', () => this.queue_relayout()); | ||||
|  | ||||
|         this.connect('destroy', () => { | ||||
|             if (this.child != null) | ||||
|                 this.child.destroy(); | ||||
| @@ -109,7 +81,7 @@ class DashItemContainer extends St.Widget { | ||||
|         let itemHeight = this.allocation.y2 - this.allocation.y1; | ||||
|  | ||||
|         let labelHeight = this.label.get_height(); | ||||
|         let yOffset = Math.floor((itemHeight - labelHeight) / 2); | ||||
|         let yOffset = Math.floor((itemHeight - labelHeight) / 2) | ||||
|  | ||||
|         let y = stageY + yOffset; | ||||
|  | ||||
| @@ -123,11 +95,11 @@ class DashItemContainer extends St.Widget { | ||||
|             x = stageX + this.get_width() + xOffset; | ||||
|  | ||||
|         this.label.set_position(x, y); | ||||
|         this.label.ease({ | ||||
|             opacity: 255, | ||||
|             duration: DASH_ITEM_LABEL_SHOW_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|         Tweener.addTween(this.label, | ||||
|                          { opacity: 255, | ||||
|                            time: DASH_ITEM_LABEL_SHOW_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     setLabelText(text) { | ||||
| @@ -136,12 +108,14 @@ class DashItemContainer extends St.Widget { | ||||
|     } | ||||
|  | ||||
|     hideLabel() { | ||||
|         this.label.ease({ | ||||
|             opacity: 0, | ||||
|             duration: DASH_ITEM_LABEL_HIDE_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => this.label.hide() | ||||
|         }); | ||||
|         Tweener.addTween(this.label, | ||||
|                          { opacity: 0, | ||||
|                            time: DASH_ITEM_LABEL_HIDE_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: () => { | ||||
|                                this.label.hide(); | ||||
|                            } | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     setChild(actor) { | ||||
| @@ -152,6 +126,9 @@ class DashItemContainer extends St.Widget { | ||||
|  | ||||
|         this.child = actor; | ||||
|         this.add_actor(this.child); | ||||
|  | ||||
|         this.set_scale(this._childScale, this._childScale); | ||||
|         this.set_opacity(this._childOpacity); | ||||
|     } | ||||
|  | ||||
|     show(animate) { | ||||
| @@ -159,13 +136,12 @@ class DashItemContainer extends St.Widget { | ||||
|             return; | ||||
|  | ||||
|         let time = animate ? DASH_ANIMATION_TIME : 0; | ||||
|         this.ease({ | ||||
|             scale_x: 1, | ||||
|             scale_y: 1, | ||||
|             opacity: 255, | ||||
|             duration: time, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|         Tweener.addTween(this, | ||||
|                          { childScale: 1.0, | ||||
|                            childOpacity: 255, | ||||
|                            time: time, | ||||
|                            transition: 'easeOutQuad' | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     animateOutAndDestroy() { | ||||
| @@ -177,14 +153,37 @@ class DashItemContainer extends St.Widget { | ||||
|         } | ||||
|  | ||||
|         this.animatingOut = true; | ||||
|         this.ease({ | ||||
|             scale_x: 0, | ||||
|             scale_y: 0, | ||||
|             opacity: 0, | ||||
|             duration: DASH_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => this.destroy() | ||||
|         }); | ||||
|         Tweener.addTween(this, | ||||
|                          { childScale: 0.0, | ||||
|                            childOpacity: 0, | ||||
|                            time: DASH_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: () => { | ||||
|                                this.destroy(); | ||||
|                            } | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     set childScale(scale) { | ||||
|         this._childScale = scale; | ||||
|  | ||||
|         this.set_scale(scale, scale); | ||||
|         this.queue_relayout(); | ||||
|     } | ||||
|  | ||||
|     get childScale() { | ||||
|         return this._childScale; | ||||
|     } | ||||
|  | ||||
|     set childOpacity(opacity) { | ||||
|         this._childOpacity = opacity; | ||||
|  | ||||
|         this.set_opacity(opacity); | ||||
|         this.queue_redraw(); | ||||
|     } | ||||
|  | ||||
|     get childOpacity() { | ||||
|         return this._childOpacity; | ||||
|     } | ||||
| }); | ||||
|  | ||||
| @@ -199,9 +198,9 @@ class ShowAppsIcon extends DashItemContainer { | ||||
|                                             toggle_mode: true }); | ||||
|         this._iconActor = null; | ||||
|         this.icon = new IconGrid.BaseIcon(_("Show Applications"), | ||||
|                                           { setSizeManually: true, | ||||
|                                             showLabel: false, | ||||
|                                             createIcon: this._createIcon.bind(this) }); | ||||
|                                            { setSizeManually: true, | ||||
|                                              showLabel: false, | ||||
|                                              createIcon: this._createIcon.bind(this) }); | ||||
|         this.toggleButton.add_actor(this.icon); | ||||
|         this.toggleButton._delegate = this; | ||||
|  | ||||
| @@ -242,14 +241,14 @@ class ShowAppsIcon extends DashItemContainer { | ||||
|             this.setLabelText(_("Show Applications")); | ||||
|     } | ||||
|  | ||||
|     handleDragOver(source, _actor, _x, _y, _time) { | ||||
|     handleDragOver(source, actor, x, y, time) { | ||||
|         if (!this._canRemoveApp(getAppFromSource(source))) | ||||
|             return DND.DragMotionResult.NO_DROP; | ||||
|  | ||||
|         return DND.DragMotionResult.MOVE_DROP; | ||||
|     } | ||||
|  | ||||
|     acceptDrop(source, _actor, _x, _y, _time) { | ||||
|     acceptDrop(source, actor, x, y, time) { | ||||
|         let app = getAppFromSource(source); | ||||
|         if (!this._canRemoveApp(app)) | ||||
|             return false; | ||||
| @@ -297,7 +296,7 @@ class DashActor extends St.Widget { | ||||
|         this.set_allocation(box, flags); | ||||
|  | ||||
|         let [appIcons, showAppsButton] = this.get_children(); | ||||
|         let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth); | ||||
|         let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth); | ||||
|  | ||||
|         let childBox = new Clutter.ActorBox(); | ||||
|         childBox.x1 = contentBox.x1; | ||||
| @@ -322,19 +321,17 @@ class DashActor extends St.Widget { | ||||
|         let themeNode = this.get_theme_node(); | ||||
|         let adjustedForWidth = themeNode.adjust_for_width(forWidth); | ||||
|         let [, showAppsButton] = this.get_children(); | ||||
|         let [minHeight] = showAppsButton.get_preferred_height(adjustedForWidth); | ||||
|         [minHeight] = themeNode.adjust_preferred_height(minHeight, natHeight); | ||||
|         let [minHeight, ] = showAppsButton.get_preferred_height(adjustedForWidth); | ||||
|         [minHeight, ] = themeNode.adjust_preferred_height(minHeight, natHeight); | ||||
|  | ||||
|         return [minHeight, natHeight]; | ||||
|     } | ||||
| }); | ||||
|  | ||||
| const baseIconSizes = [16, 22, 24, 32, 48, 64]; | ||||
| const baseIconSizes = [ 16, 22, 24, 32, 48, 64 ]; | ||||
|  | ||||
| var Dash = GObject.registerClass({ | ||||
|     Signals: { 'icon-size-changed': {} } | ||||
| }, class Dash extends St.Bin { | ||||
|     _init() { | ||||
| var Dash = class Dash { | ||||
|     constructor() { | ||||
|         this._maxHeight = -1; | ||||
|         this.iconSize = 64; | ||||
|         this._shownInitially = false; | ||||
| @@ -354,7 +351,8 @@ var Dash = GObject.registerClass({ | ||||
|         this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS); | ||||
|  | ||||
|         this._showAppsIcon = new ShowAppsIcon(); | ||||
|         this._showAppsIcon.show(false); | ||||
|         this._showAppsIcon.childScale = 1; | ||||
|         this._showAppsIcon.childOpacity = 255; | ||||
|         this._showAppsIcon.icon.setIconSize(this.iconSize); | ||||
|         this._hookUpLabel(this._showAppsIcon); | ||||
|  | ||||
| @@ -362,11 +360,11 @@ var Dash = GObject.registerClass({ | ||||
|  | ||||
|         this._container.add_actor(this._showAppsIcon); | ||||
|  | ||||
|         super._init({ child: this._container }); | ||||
|         this.connect('notify::height', () => { | ||||
|             if (this._maxHeight != this.height) | ||||
|         this.actor = new St.Bin({ child: this._container }); | ||||
|         this.actor.connect('notify::height', () => { | ||||
|             if (this._maxHeight != this.actor.height) | ||||
|                 this._queueRedisplay(); | ||||
|             this._maxHeight = this.height; | ||||
|             this._maxHeight = this.actor.height; | ||||
|         }); | ||||
|  | ||||
|         this._workId = Main.initializeDeferredWork(this._box, this._redisplay.bind(this)); | ||||
| @@ -389,7 +387,7 @@ var Dash = GObject.registerClass({ | ||||
|  | ||||
|         // Translators: this is the name of the dock/favorites area on | ||||
|         // the left of the overview | ||||
|         Main.ctrlAltTabManager.addGroup(this, _("Dash"), 'user-bookmarks-symbolic'); | ||||
|         Main.ctrlAltTabManager.addGroup(this.actor, _("Dash"), 'user-bookmarks-symbolic'); | ||||
|     } | ||||
|  | ||||
|     _onDragBegin() { | ||||
| @@ -476,7 +474,19 @@ var Dash = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _createAppItem(app) { | ||||
|         let appIcon = new DashIcon(app); | ||||
|         let appIcon = new AppDisplay.AppIcon(app, | ||||
|                                              { setSizeManually: true, | ||||
|                                                showLabel: false }); | ||||
|         if (appIcon._draggable) { | ||||
|             appIcon._draggable.connect('drag-begin', | ||||
|                                        () => { | ||||
|                                            appIcon.actor.opacity = 50; | ||||
|                                        }); | ||||
|             appIcon._draggable.connect('drag-end', | ||||
|                                        () => { | ||||
|                                            appIcon.actor.opacity = 255; | ||||
|                                        }); | ||||
|         } | ||||
|  | ||||
|         appIcon.connect('menu-state-changed', | ||||
|                         (appIcon, opened) => { | ||||
| @@ -484,11 +494,11 @@ var Dash = GObject.registerClass({ | ||||
|                         }); | ||||
|  | ||||
|         let item = new DashItemContainer(); | ||||
|         item.setChild(appIcon); | ||||
|         item.setChild(appIcon.actor); | ||||
|  | ||||
|         // Override default AppIcon label_actor, now the | ||||
|         // accessible_name is set at DashItemContainer.setLabelText | ||||
|         appIcon.label_actor = null; | ||||
|         appIcon.actor.label_actor = null; | ||||
|         item.setLabelText(app.get_name()); | ||||
|  | ||||
|         appIcon.icon.setIconSize(this.iconSize); | ||||
| @@ -502,7 +512,7 @@ var Dash = GObject.registerClass({ | ||||
|         // that the notify::hover handler does everything we need to. | ||||
|         if (opened) { | ||||
|             if (this._showLabelTimeoutId > 0) { | ||||
|                 GLib.source_remove(this._showLabelTimeoutId); | ||||
|                 Mainloop.source_remove(this._showLabelTimeoutId); | ||||
|                 this._showLabelTimeoutId = 0; | ||||
|             } | ||||
|  | ||||
| @@ -516,7 +526,7 @@ var Dash = GObject.registerClass({ | ||||
|         if (shouldShow) { | ||||
|             if (this._showLabelTimeoutId == 0) { | ||||
|                 let timeout = this._labelShowing ? 0 : DASH_ITEM_HOVER_TIMEOUT; | ||||
|                 this._showLabelTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, | ||||
|                 this._showLabelTimeoutId = Mainloop.timeout_add(timeout, | ||||
|                     () => { | ||||
|                         this._labelShowing = true; | ||||
|                         item.showLabel(); | ||||
| @@ -525,17 +535,17 @@ var Dash = GObject.registerClass({ | ||||
|                     }); | ||||
|                 GLib.Source.set_name_by_id(this._showLabelTimeoutId, '[gnome-shell] item.showLabel'); | ||||
|                 if (this._resetHoverTimeoutId > 0) { | ||||
|                     GLib.source_remove(this._resetHoverTimeoutId); | ||||
|                     Mainloop.source_remove(this._resetHoverTimeoutId); | ||||
|                     this._resetHoverTimeoutId = 0; | ||||
|                 } | ||||
|             } | ||||
|         } else { | ||||
|             if (this._showLabelTimeoutId > 0) | ||||
|                 GLib.source_remove(this._showLabelTimeoutId); | ||||
|                 Mainloop.source_remove(this._showLabelTimeoutId); | ||||
|             this._showLabelTimeoutId = 0; | ||||
|             item.hideLabel(); | ||||
|             if (this._labelShowing) { | ||||
|                 this._resetHoverTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, DASH_ITEM_HOVER_TIMEOUT, | ||||
|                 this._resetHoverTimeoutId = Mainloop.timeout_add(DASH_ITEM_HOVER_TIMEOUT, | ||||
|                     () => { | ||||
|                         this._labelShowing = false; | ||||
|                         this._resetHoverTimeoutId = 0; | ||||
| @@ -623,12 +633,12 @@ var Dash = GObject.registerClass({ | ||||
|             icon.icon.set_size(icon.icon.width * scale, | ||||
|                                icon.icon.height * scale); | ||||
|  | ||||
|             icon.icon.ease({ | ||||
|                 width: targetWidth, | ||||
|                 height: targetHeight, | ||||
|                 duration: DASH_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|             }); | ||||
|             Tweener.addTween(icon.icon, | ||||
|                              { width: targetWidth, | ||||
|                                height: targetHeight, | ||||
|                                time: DASH_ANIMATION_TIME, | ||||
|                                transition: 'easeOutQuad', | ||||
|                              }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -638,10 +648,10 @@ var Dash = GObject.registerClass({ | ||||
|         let running = this._appSystem.get_running(); | ||||
|  | ||||
|         let children = this._box.get_children().filter(actor => { | ||||
|             return actor.child && | ||||
|                    actor.child._delegate && | ||||
|                    actor.child._delegate.app; | ||||
|         }); | ||||
|                 return actor.child && | ||||
|                        actor.child._delegate && | ||||
|                        actor.child._delegate.app; | ||||
|             }); | ||||
|         // Apps currently in the dash | ||||
|         let oldApps = children.map(actor => actor.child._delegate.app); | ||||
|         // Apps supposed to be in the dash | ||||
| @@ -690,14 +700,14 @@ var Dash = GObject.registerClass({ | ||||
|             } | ||||
|  | ||||
|             // App removed at oldIndex | ||||
|             if (oldApp && !newApps.includes(oldApp)) { | ||||
|             if (oldApp && newApps.indexOf(oldApp) == -1) { | ||||
|                 removedActors.push(children[oldIndex]); | ||||
|                 oldIndex++; | ||||
|                 continue; | ||||
|             } | ||||
|  | ||||
|             // App added at newIndex | ||||
|             if (newApp && !oldApps.includes(newApp)) { | ||||
|             if (newApp && oldApps.indexOf(newApp) == -1) { | ||||
|                 addedItems.push({ app: newApp, | ||||
|                                   item: this._createAppItem(newApp), | ||||
|                                   pos: newIndex }); | ||||
| @@ -706,8 +716,8 @@ var Dash = GObject.registerClass({ | ||||
|             } | ||||
|  | ||||
|             // App moved | ||||
|             let nextApp = newApps.length > newIndex + 1 | ||||
|                 ? newApps[newIndex + 1] : null; | ||||
|             let nextApp = newApps.length > newIndex + 1 ? newApps[newIndex + 1] | ||||
|                                                         : null; | ||||
|             let insertHere = nextApp && nextApp == oldApp; | ||||
|             let alreadyRemoved = removedActors.reduce((result, actor) => { | ||||
|                 let removedApp = actor.child._delegate.app; | ||||
| @@ -780,7 +790,7 @@ var Dash = GObject.registerClass({ | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     handleDragOver(source, actor, x, y, _time) { | ||||
|     handleDragOver(source, actor, x, y, time) { | ||||
|         let app = getAppFromSource(source); | ||||
|  | ||||
|         // Don't allow favoriting of transient apps | ||||
| @@ -858,7 +868,7 @@ var Dash = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     // Draggable target interface | ||||
|     acceptDrop(source, _actor, _x, _y, _time) { | ||||
|     acceptDrop(source, actor, x, y, time) { | ||||
|         let app = getAppFromSource(source); | ||||
|  | ||||
|         // Don't allow favoriting of transient apps | ||||
| @@ -905,4 +915,5 @@ var Dash = GObject.registerClass({ | ||||
|  | ||||
|         return true; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(Dash.prototype); | ||||
|   | ||||
| @@ -1,7 +1,6 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported DateMenuButton */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GnomeDesktop, | ||||
| const { Clutter, GLib, GnomeDesktop, | ||||
|         GObject, GWeather, Shell, St } = imports.gi; | ||||
|  | ||||
| const Util = imports.misc.util; | ||||
| @@ -11,13 +10,8 @@ const Calendar = imports.ui.calendar; | ||||
| const Weather = imports.misc.weather; | ||||
| const System = imports.system; | ||||
|  | ||||
| const { loadInterfaceXML } = imports.misc.fileUtils; | ||||
|  | ||||
| const MAX_FORECASTS = 5; | ||||
|  | ||||
| const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration'); | ||||
| const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface); | ||||
|  | ||||
| function _isToday(date) { | ||||
|     let now = new Date(); | ||||
|     return now.getYear() == date.getYear() && | ||||
| @@ -25,26 +19,22 @@ function _isToday(date) { | ||||
|            now.getDate() == date.getDate(); | ||||
| } | ||||
|  | ||||
| function _gDateTimeToDate(datetime) { | ||||
|     return new Date(datetime.to_unix() * 1000 + datetime.get_microsecond() / 1000); | ||||
| } | ||||
|  | ||||
| var TodayButton = GObject.registerClass( | ||||
| class TodayButton extends St.Button { | ||||
|     _init(calendar) { | ||||
| var TodayButton = class TodayButton { | ||||
|     constructor(calendar) { | ||||
|         // Having the ability to go to the current date if the user is already | ||||
|         // on the current date can be confusing. So don't make the button reactive | ||||
|         // until the selected date changes. | ||||
|         super._init({ | ||||
|             style_class: 'datemenu-today-button', | ||||
|             x_align: St.Align.START, | ||||
|             x_expand: true, | ||||
|             can_focus: true, | ||||
|             reactive: false | ||||
|         this.actor = new St.Button({ style_class: 'datemenu-today-button', | ||||
|                                      x_expand: true, x_align: St.Align.START, | ||||
|                                      can_focus: true, | ||||
|                                      reactive: false | ||||
|                                    }); | ||||
|         this.actor.connect('clicked', () => { | ||||
|             this._calendar.setDate(new Date(), false); | ||||
|         }); | ||||
|  | ||||
|         let hbox = new St.BoxLayout({ vertical: true }); | ||||
|         this.add_actor(hbox); | ||||
|         this.actor.add_actor(hbox); | ||||
|  | ||||
|         this._dayLabel = new St.Label({ style_class: 'day-label', | ||||
|                                         x_align: Clutter.ActorAlign.START }); | ||||
| @@ -54,17 +44,13 @@ class TodayButton extends St.Button { | ||||
|         hbox.add_actor(this._dateLabel); | ||||
|  | ||||
|         this._calendar = calendar; | ||||
|         this._calendar.connect('selected-date-changed', (_calendar, datetime) => { | ||||
|         this._calendar.connect('selected-date-changed', (calendar, date) => { | ||||
|             // Make the button reactive only if the selected date is not the | ||||
|             // current date. | ||||
|             this.reactive = !_isToday(_gDateTimeToDate(datetime)); | ||||
|             this.actor.reactive = !_isToday(date) | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     vfunc_clicked() { | ||||
|         this._calendar.setDate(new Date(), false); | ||||
|     } | ||||
|  | ||||
|     setDate(date) { | ||||
|         this._dayLabel.set_text(date.toLocaleFormat('%A')); | ||||
|  | ||||
| @@ -81,72 +67,57 @@ class TodayButton extends St.Button { | ||||
|          * date, e.g. "Tuesday February 17 2015". | ||||
|          */ | ||||
|         dateFormat = Shell.util_translate_time_string (N_("%A %B %e %Y")); | ||||
|         this.accessible_name = date.toLocaleFormat(dateFormat); | ||||
|         this.actor.accessible_name = date.toLocaleFormat(dateFormat); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var WorldClocksSection = GObject.registerClass( | ||||
| class WorldClocksSection extends St.Button { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             style_class: 'world-clocks-button', | ||||
|             x_fill: true, | ||||
|             can_focus: true | ||||
|         }); | ||||
| var WorldClocksSection = class WorldClocksSection { | ||||
|     constructor() { | ||||
|         this._clock = new GnomeDesktop.WallClock(); | ||||
|         this._clockNotifyId = 0; | ||||
|  | ||||
|         this._locations = []; | ||||
|  | ||||
|         this.actor = new St.Button({ style_class: 'world-clocks-button', | ||||
|                                      x_fill: true, | ||||
|                                      can_focus: true }); | ||||
|         this.actor.connect('clicked', () => { | ||||
|             this._clockAppMon.activateApp(); | ||||
|  | ||||
|             Main.overview.hide(); | ||||
|             Main.panel.closeCalendar(); | ||||
|         }); | ||||
|  | ||||
|         let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL }); | ||||
|         this._grid = new St.Widget({ style_class: 'world-clocks-grid', | ||||
|                                      layout_manager: layout }); | ||||
|         layout.hookup_style(this._grid); | ||||
|  | ||||
|         this.child = this._grid; | ||||
|         this.actor.child = this._grid; | ||||
|  | ||||
|         this._clocksApp = null; | ||||
|         this._clocksProxy = new ClocksProxy( | ||||
|             Gio.DBus.session, | ||||
|             'org.gnome.clocks', | ||||
|             '/org/gnome/clocks', | ||||
|             this._onProxyReady.bind(this), | ||||
|             null /* cancellable */, | ||||
|             Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES); | ||||
|  | ||||
|         this._settings = new Gio.Settings({ | ||||
|             schema_id: 'org.gnome.shell.world-clocks' | ||||
|         }); | ||||
|         this._settings.connect('changed', this._clocksChanged.bind(this)); | ||||
|         this._clocksChanged(); | ||||
|  | ||||
|         this._appSystem = Shell.AppSystem.get_default(); | ||||
|         this._appSystem.connect('installed-changed', | ||||
|             this._sync.bind(this)); | ||||
|         this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop', | ||||
|                                                         'org.gnome.clocks'); | ||||
|         this._clockAppMon.connect('available-changed', | ||||
|                                   this._sync.bind(this)); | ||||
|         this._clockAppMon.watchSetting('world-clocks', | ||||
|                                        this._clocksChanged.bind(this)); | ||||
|         this._sync(); | ||||
|     } | ||||
|  | ||||
|     vfunc_clicked() { | ||||
|         if (this._clocksApp) | ||||
|             this._clocksApp.activate(); | ||||
|  | ||||
|         Main.overview.hide(); | ||||
|         Main.panel.closeCalendar(); | ||||
|     } | ||||
|  | ||||
|     _sync() { | ||||
|         this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop'); | ||||
|         this.visible = this._clocksApp != null; | ||||
|         this.actor.visible = this._clockAppMon.available; | ||||
|     } | ||||
|  | ||||
|     _clocksChanged() { | ||||
|     _clocksChanged(settings) { | ||||
|         this._grid.destroy_all_children(); | ||||
|         this._locations = []; | ||||
|  | ||||
|         let world = GWeather.Location.get_world(); | ||||
|         let clocks = this._settings.get_value('locations').deep_unpack(); | ||||
|         let clocks = settings.get_value('world-clocks').deep_unpack(); | ||||
|         for (let i = 0; i < clocks.length; i++) { | ||||
|             let l = world.deserialize(clocks[i]); | ||||
|             if (!clocks[i].location) | ||||
|                 continue; | ||||
|             let l = world.deserialize(clocks[i].location); | ||||
|             if (l && l.get_timezone() != null) | ||||
|                 this._locations.push({ location: l }); | ||||
|         } | ||||
| @@ -157,14 +128,13 @@ class WorldClocksSection extends St.Button { | ||||
|         }); | ||||
|  | ||||
|         let layout = this._grid.layout_manager; | ||||
|         let title = (this._locations.length == 0) | ||||
|             ? _("Add world clocks…") | ||||
|             : _("World Clocks"); | ||||
|         let title = (this._locations.length == 0) ? _("Add world clocks…") | ||||
|                                                   : _("World Clocks"); | ||||
|         let header = new St.Label({ style_class: 'world-clocks-header', | ||||
|                                     x_align: Clutter.ActorAlign.START, | ||||
|                                     text: title }); | ||||
|         layout.attach(header, 0, 0, 2, 1); | ||||
|         this.label_actor = header; | ||||
|         this.actor.label_actor = header; | ||||
|  | ||||
|         let localOffset = GLib.DateTime.new_now_local().get_utc_offset(); | ||||
|  | ||||
| @@ -226,42 +196,30 @@ class WorldClocksSection extends St.Button { | ||||
|             l.actor.text = Util.formatTime(now, { timeOnly: true }); | ||||
|         } | ||||
|     } | ||||
| }; | ||||
|  | ||||
|     _onProxyReady(proxy, error) { | ||||
|         if (error) { | ||||
|             log(`Failed to create GNOME Clocks proxy: ${error}`); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this._clocksProxy.connect('g-properties-changed', | ||||
|             this._onClocksPropertiesChanged.bind(this)); | ||||
|         this._onClocksPropertiesChanged(); | ||||
|     } | ||||
|  | ||||
|     _onClocksPropertiesChanged() { | ||||
|         if (this._clocksProxy.g_name_owner == null) | ||||
|             return; | ||||
|  | ||||
|         this._settings.set_value('locations', | ||||
|             new GLib.Variant('av', this._clocksProxy.Locations)); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var WeatherSection = GObject.registerClass( | ||||
| class WeatherSection extends St.Button { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             style_class: 'weather-button', | ||||
|             x_fill: true, | ||||
|             can_focus: true | ||||
|         }); | ||||
|  | ||||
| var WeatherSection = class WeatherSection { | ||||
|     constructor() { | ||||
|         this._weatherClient = new Weather.WeatherClient(); | ||||
|  | ||||
|         let box = new St.BoxLayout({ style_class: 'weather-box', | ||||
|                                      vertical: true }); | ||||
|         this.actor = new St.Button({ style_class: 'weather-button', | ||||
|                                      x_fill: true, | ||||
|                                      can_focus: true }); | ||||
|         this.actor.connect('clicked', () => { | ||||
|             this._weatherClient.activateApp(); | ||||
|  | ||||
|         this.child = box; | ||||
|             Main.overview.hide(); | ||||
|             Main.panel.closeCalendar(); | ||||
|         }); | ||||
|         this.actor.connect('notify::mapped', () => { | ||||
|             if (this.actor.mapped) | ||||
|                 this._weatherClient.update(); | ||||
|         }); | ||||
|  | ||||
|         let box = new St.BoxLayout({ style_class: 'weather-box', | ||||
|                                       vertical: true }); | ||||
|  | ||||
|         this.actor.child = box; | ||||
|  | ||||
|         let titleBox = new St.BoxLayout(); | ||||
|         titleBox.add_child(new St.Label({ style_class: 'weather-header', | ||||
| @@ -284,18 +242,6 @@ class WeatherSection extends St.Button { | ||||
|         this._sync(); | ||||
|     } | ||||
|  | ||||
|     vfunc_map() { | ||||
|         this._weatherClient.update(); | ||||
|         super.vfunc_map(); | ||||
|     } | ||||
|  | ||||
|     vfunc_clicked() { | ||||
|         this._weatherClient.activateApp(); | ||||
|  | ||||
|         Main.overview.hide(); | ||||
|         Main.panel.closeCalendar(); | ||||
|     } | ||||
|  | ||||
|     _getInfos() { | ||||
|         let info = this._weatherClient.info; | ||||
|         let forecasts = info.get_forecast_list(); | ||||
| @@ -303,12 +249,12 @@ class WeatherSection extends St.Button { | ||||
|         let current = info; | ||||
|         let infos = [info]; | ||||
|         for (let i = 0; i < forecasts.length; i++) { | ||||
|             let [ok_, timestamp] = forecasts[i].get_value_update(); | ||||
|             let [ok, timestamp] = forecasts[i].get_value_update(); | ||||
|             let datetime = new Date(timestamp * 1000); | ||||
|             if (!_isToday(datetime)) | ||||
|                 continue; // Ignore forecasts from other days | ||||
|  | ||||
|             [ok_, timestamp] = current.get_value_update(); | ||||
|             [ok, timestamp] = current.get_value_update(); | ||||
|             let currenttime = new Date(timestamp * 1000); | ||||
|             if (currenttime.getHours() == datetime.getHours()) | ||||
|                 continue; // Enforce a minimum interval of 1h | ||||
| @@ -329,7 +275,7 @@ class WeatherSection extends St.Button { | ||||
|  | ||||
|         let col = 0; | ||||
|         infos.forEach(fc => { | ||||
|             let [ok_, timestamp] = fc.get_value_update(); | ||||
|             let [ok, timestamp] = fc.get_value_update(); | ||||
|             let timeStr = Util.formatTime(new Date(timestamp * 1000), { | ||||
|                 timeOnly: true | ||||
|             }); | ||||
| @@ -386,27 +332,23 @@ class WeatherSection extends St.Button { | ||||
|     } | ||||
|  | ||||
|     _sync() { | ||||
|         this.visible = this._weatherClient.available; | ||||
|         this.actor.visible = this._weatherClient.available; | ||||
|  | ||||
|         if (!this.visible) | ||||
|         if (!this.actor.visible) | ||||
|             return; | ||||
|  | ||||
|         this._titleLocation.visible = this._weatherClient.hasLocation; | ||||
|  | ||||
|         this._updateForecasts(); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var MessagesIndicator = GObject.registerClass( | ||||
| class MessagesIndicator extends St.Icon { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             icon_name: 'message-indicator-symbolic', | ||||
|             icon_size: 16, | ||||
|             visible: false, | ||||
|             y_expand: true, | ||||
|             y_align: Clutter.ActorAlign.CENTER | ||||
|         }); | ||||
| var MessagesIndicator = class MessagesIndicator { | ||||
|     constructor() { | ||||
|         this.actor = new St.Icon({ icon_name: 'message-indicator-symbolic', | ||||
|                                    icon_size: 16, | ||||
|                                    visible: false, y_expand: true, | ||||
|                                    y_align: Clutter.ActorAlign.CENTER }); | ||||
|  | ||||
|         this._sources = []; | ||||
|  | ||||
| @@ -415,11 +357,11 @@ class MessagesIndicator extends St.Icon { | ||||
|         Main.messageTray.connect('queue-changed', this._updateCount.bind(this)); | ||||
|  | ||||
|         let sources = Main.messageTray.getSources(); | ||||
|         sources.forEach(source => this._onSourceAdded(null, source)); | ||||
|         sources.forEach(source => { this._onSourceAdded(null, source); }); | ||||
|     } | ||||
|  | ||||
|     _onSourceAdded(tray, source) { | ||||
|         source.connect('notify::count', this._updateCount.bind(this)); | ||||
|         source.connect('count-updated', this._updateCount.bind(this)); | ||||
|         this._sources.push(source); | ||||
|         this._updateCount(); | ||||
|     } | ||||
| @@ -431,19 +373,19 @@ class MessagesIndicator extends St.Icon { | ||||
|  | ||||
|     _updateCount() { | ||||
|         let count = 0; | ||||
|         this._sources.forEach(source => (count += source.unseenCount)); | ||||
|         this._sources.forEach(source => { count += source.unseenCount; }); | ||||
|         count -= Main.messageTray.queueCount; | ||||
|  | ||||
|         this.visible = (count > 0); | ||||
|         this.actor.visible = (count > 0); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var IndicatorPad = GObject.registerClass( | ||||
| class IndicatorPad extends St.Widget { | ||||
|     _init(actor) { | ||||
|         this._source = actor; | ||||
|         this._source.connect('notify::visible', () => this.queue_relayout()); | ||||
|         this._source.connect('notify::size', () => this.queue_relayout()); | ||||
|         this._source.connect('notify::visible', () => { this.queue_relayout(); }); | ||||
|         this._source.connect('notify::size', () => { this.queue_relayout(); }); | ||||
|         super._init(); | ||||
|     } | ||||
|  | ||||
| @@ -517,6 +459,7 @@ class CalendarColumnLayout extends Clutter.BoxLayout { | ||||
| var DateMenuButton = GObject.registerClass( | ||||
| class DateMenuButton extends PanelMenu.Button { | ||||
|     _init() { | ||||
|         let item; | ||||
|         let hbox; | ||||
|         let vbox; | ||||
|  | ||||
| @@ -529,9 +472,9 @@ class DateMenuButton extends PanelMenu.Button { | ||||
|         this._indicator = new MessagesIndicator(); | ||||
|  | ||||
|         let box = new St.BoxLayout(); | ||||
|         box.add_actor(new IndicatorPad(this._indicator)); | ||||
|         box.add_actor(new IndicatorPad(this._indicator.actor)); | ||||
|         box.add_actor(this._clockDisplay); | ||||
|         box.add_actor(this._indicator); | ||||
|         box.add_actor(this._indicator.actor); | ||||
|  | ||||
|         this.label_actor = this._clockDisplay; | ||||
|         this.add_actor(box); | ||||
| @@ -547,11 +490,11 @@ class DateMenuButton extends PanelMenu.Button { | ||||
|         bin.add_actor(hbox); | ||||
|  | ||||
|         this._calendar = new Calendar.Calendar(); | ||||
|         this._calendar.connect('selected-date-changed', (_calendar, datetime) => { | ||||
|             let date = _gDateTimeToDate(datetime); | ||||
|             layout.frozen = !_isToday(date); | ||||
|             this._messageList.setDate(date); | ||||
|         }); | ||||
|         this._calendar.connect('selected-date-changed', | ||||
|                                (calendar, date) => { | ||||
|                                    layout.frozen = !_isToday(date); | ||||
|                                    this._messageList.setDate(date); | ||||
|                                }); | ||||
|  | ||||
|         this.menu.connect('open-state-changed', (menu, isOpen) => { | ||||
|             // Whenever the menu is opened, select today | ||||
| @@ -565,19 +508,19 @@ class DateMenuButton extends PanelMenu.Button { | ||||
|  | ||||
|         // Fill up the first column | ||||
|         this._messageList = new Calendar.CalendarMessageList(); | ||||
|         hbox.add(this._messageList, { expand: true, y_fill: false, y_align: St.Align.START }); | ||||
|         hbox.add(this._messageList.actor, { expand: true, y_fill: false, y_align: St.Align.START }); | ||||
|  | ||||
|         // Fill up the second column | ||||
|         let boxLayout = new CalendarColumnLayout(this._calendar); | ||||
|         let boxLayout = new CalendarColumnLayout(this._calendar.actor); | ||||
|         vbox = new St.Widget({ style_class: 'datemenu-calendar-column', | ||||
|                                layout_manager: boxLayout }); | ||||
|         boxLayout.hookup_style(vbox); | ||||
|         hbox.add(vbox); | ||||
|  | ||||
|         this._date = new TodayButton(this._calendar); | ||||
|         vbox.add_actor(this._date); | ||||
|         vbox.add_actor(this._date.actor); | ||||
|  | ||||
|         vbox.add_actor(this._calendar); | ||||
|         vbox.add_actor(this._calendar.actor); | ||||
|  | ||||
|         this._displaysSection = new St.ScrollView({ style_class: 'datemenu-displays-section vfade', | ||||
|                                                     x_expand: true, x_fill: true, | ||||
| @@ -590,10 +533,10 @@ class DateMenuButton extends PanelMenu.Button { | ||||
|         this._displaysSection.add_actor(displaysBox); | ||||
|  | ||||
|         this._clocksItem = new WorldClocksSection(); | ||||
|         displaysBox.add(this._clocksItem, { x_fill: true }); | ||||
|         displaysBox.add(this._clocksItem.actor, { x_fill: true }); | ||||
|  | ||||
|         this._weatherItem = new WeatherSection(); | ||||
|         displaysBox.add(this._weatherItem, { x_fill: true }); | ||||
|         displaysBox.add(this._weatherItem.actor, { x_fill: true }); | ||||
|  | ||||
|         // Done with hbox for calendar and event list | ||||
|  | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Dialog, MessageDialogContent */ | ||||
|  | ||||
| const { Clutter, Gio, GObject, Pango, St } = imports.gi; | ||||
|  | ||||
| @@ -26,9 +25,9 @@ class Dialog extends St.Widget { | ||||
|  | ||||
|     _createDialog() { | ||||
|         this._dialog = new St.BoxLayout({ style_class: 'modal-dialog', | ||||
|                                           x_align: Clutter.ActorAlign.CENTER, | ||||
|                                           y_align: Clutter.ActorAlign.CENTER, | ||||
|                                           vertical: true }); | ||||
|                                           x_align:     Clutter.ActorAlign.CENTER, | ||||
|                                           y_align:     Clutter.ActorAlign.CENTER, | ||||
|                                           vertical:    true }); | ||||
|  | ||||
|         // modal dialogs are fixed width and grow vertically; set the request | ||||
|         // mode accordingly so wrapped labels are handled correctly during | ||||
| @@ -39,13 +38,13 @@ class Dialog extends St.Widget { | ||||
|         this.contentLayout = new St.BoxLayout({ vertical: true, | ||||
|                                                 style_class: "modal-dialog-content-box" }); | ||||
|         this._dialog.add(this.contentLayout, | ||||
|                          { expand: true, | ||||
|                            x_fill: true, | ||||
|                            y_fill: true, | ||||
|                          { expand:  true, | ||||
|                            x_fill:  true, | ||||
|                            y_fill:  true, | ||||
|                            x_align: St.Align.MIDDLE, | ||||
|                            y_align: St.Align.START }); | ||||
|  | ||||
|         this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) }); | ||||
|         this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous:true }) }); | ||||
|         this._dialog.add(this.buttonLayout, | ||||
|                          { x_align: St.Align.MIDDLE, | ||||
|                            y_align: St.Align.START }); | ||||
| @@ -117,11 +116,11 @@ class Dialog extends St.Widget { | ||||
|  | ||||
|         let button = new St.Button({ style_class: 'modal-dialog-linked-button', | ||||
|                                      button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, | ||||
|                                      reactive: true, | ||||
|                                      can_focus: true, | ||||
|                                      x_expand: true, | ||||
|                                      y_expand: true, | ||||
|                                      label: label }); | ||||
|                                      reactive:    true, | ||||
|                                      can_focus:   true, | ||||
|                                      x_expand:    true, | ||||
|                                      y_expand:    true, | ||||
|                                      label:       label }); | ||||
|         button.connect('clicked', action); | ||||
|  | ||||
|         buttonInfo['button'] = button; | ||||
| @@ -181,8 +180,10 @@ var MessageDialogContent = GObject.registerClass({ | ||||
|         this._subtitle.clutter_text.set(textProps); | ||||
|         this._body.clutter_text.set(textProps); | ||||
|  | ||||
|         let defaultParams = { style_class: 'message-dialog-main-layout' }; | ||||
|         super._init(Object.assign(defaultParams, params)); | ||||
|         if (!params.hasOwnProperty('style_class')) | ||||
|             params.style_class = 'message-dialog-main-layout'; | ||||
|  | ||||
|         super._init(params); | ||||
|  | ||||
|         this.messageBox = new St.BoxLayout({ style_class: 'message-dialog-content', | ||||
|                                              x_expand: true, | ||||
|   | ||||
							
								
								
									
										104
									
								
								js/ui/dnd.js
									
									
									
									
									
								
							
							
						
						
									
										104
									
								
								js/ui/dnd.js
									
									
									
									
									
								
							| @@ -1,18 +1,18 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported addDragMonitor, removeDragMonitor, makeDraggable */ | ||||
|  | ||||
| const { Clutter, GLib, Meta, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Main = imports.ui.main; | ||||
| const Params = imports.misc.params; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| // Time to scale down to maxDragActorSize | ||||
| var SCALE_ANIMATION_TIME = 250; | ||||
| var SCALE_ANIMATION_TIME = 0.25; | ||||
| // Time to animate to original position on cancel | ||||
| var SNAP_BACK_ANIMATION_TIME = 250; | ||||
| var SNAP_BACK_ANIMATION_TIME = 0.25; | ||||
| // Time to animate to original position on success | ||||
| var REVERT_ANIMATION_TIME = 750; | ||||
| var REVERT_ANIMATION_TIME = 0.75; | ||||
|  | ||||
| var DragMotionResult = { | ||||
|     NO_DROP:   0, | ||||
| @@ -111,6 +111,9 @@ var _Draggable = class _Draggable { | ||||
|         if (event.get_button() != 1) | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         if (Tweener.getTweenCount(actor)) | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         this._buttonDown = true; | ||||
|         this._grabActor(event.get_device()); | ||||
|  | ||||
| @@ -136,6 +139,9 @@ var _Draggable = class _Draggable { | ||||
|             !global.display.is_pointer_emulating_sequence(event.get_event_sequence())) | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         if (Tweener.getTweenCount(actor)) | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         this._buttonDown = true; | ||||
|         this._grabActor(event.get_device(), event.get_event_sequence()); | ||||
|  | ||||
| @@ -422,22 +428,20 @@ var _Draggable = class _Draggable { | ||||
|                 // to the final position because that tween would | ||||
|                 // fight with updates as the user continues dragging | ||||
|                 // the mouse; instead we do the position computations in | ||||
|                 // a ::new-frame handler. | ||||
|                 this._dragActor.ease({ | ||||
|                     scale_x: scale * origScale, | ||||
|                     scale_y: scale * origScale, | ||||
|                     duration: SCALE_ANIMATION_TIME, | ||||
|                     mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|                 }); | ||||
|  | ||||
|                 this._dragActor.get_transition('scale-x').connect('new-frame', () => { | ||||
|                     let currentScale = this._dragActor.scale_x / origScale; | ||||
|                     this._dragOffsetX = currentScale * origDragOffsetX; | ||||
|                     this._dragOffsetY = currentScale * origDragOffsetY; | ||||
|                     this._dragActor.set_position( | ||||
|                         this._dragX + this._dragOffsetX, | ||||
|                         this._dragY + this._dragOffsetY); | ||||
|                 }); | ||||
|                 // an onUpdate() function. | ||||
|                 Tweener.addTween(this._dragActor, | ||||
|                                  { scale_x: scale * origScale, | ||||
|                                    scale_y: scale * origScale, | ||||
|                                    time: SCALE_ANIMATION_TIME, | ||||
|                                    transition: 'easeOutQuad', | ||||
|                                    onUpdate() { | ||||
|                                        let currentScale = this._dragActor.scale_x / origScale; | ||||
|                                        this._dragOffsetX = currentScale * origDragOffsetX; | ||||
|                                        this._dragOffsetY = currentScale * origDragOffsetY; | ||||
|                                        this._dragActor.set_position(this._dragX + this._dragOffsetX, | ||||
|                                                                     this._dragY + this._dragOffsetY); | ||||
|                                    }, | ||||
|                                    onUpdateScope: this }); | ||||
|             } | ||||
|         } | ||||
|     } | ||||
| @@ -500,7 +504,7 @@ var _Draggable = class _Draggable { | ||||
|  | ||||
|         while (target) { | ||||
|             if (target._delegate && target._delegate.handleDragOver) { | ||||
|                 let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY); | ||||
|                 let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY); | ||||
|                 // We currently loop through all parents on drag-over even if one of the children has handled it. | ||||
|                 // We can check the return value of the function and break the loop if it's true if we don't want | ||||
|                 // to continue checking the parents. | ||||
| @@ -557,11 +561,11 @@ var _Draggable = class _Draggable { | ||||
|             let dropFunc = dragMonitors[i].dragDrop; | ||||
|             if (dropFunc) | ||||
|                 switch (dropFunc(dropEvent)) { | ||||
|                 case DragDropResult.FAILURE: | ||||
|                 case DragDropResult.SUCCESS: | ||||
|                     return true; | ||||
|                 case DragDropResult.CONTINUE: | ||||
|                     continue; | ||||
|                     case DragDropResult.FAILURE: | ||||
|                     case DragDropResult.SUCCESS: | ||||
|                         return true; | ||||
|                     case DragDropResult.CONTINUE: | ||||
|                         continue; | ||||
|                 } | ||||
|         } | ||||
|  | ||||
| @@ -572,7 +576,7 @@ var _Draggable = class _Draggable { | ||||
|  | ||||
|         while (target) { | ||||
|             if (target._delegate && target._delegate.acceptDrop) { | ||||
|                 let [r_, targX, targY] = target.transform_stage_point(dropX, dropY); | ||||
|                 let [r, targX, targY] = target.transform_stage_point(dropX, dropY); | ||||
|                 if (target._delegate.acceptDrop(this.actor._delegate, | ||||
|                                                 this._dragActor, | ||||
|                                                 targX, | ||||
| @@ -584,9 +588,8 @@ var _Draggable = class _Draggable { | ||||
|                         if (this._restoreOnSuccess) { | ||||
|                             this._restoreDragActor(event.get_time()); | ||||
|                             return true; | ||||
|                         } else { | ||||
|                         } else | ||||
|                             this._dragActor.destroy(); | ||||
|                         } | ||||
|                     } | ||||
|  | ||||
|                     this._dragState = DragState.INIT; | ||||
| @@ -610,15 +613,15 @@ var _Draggable = class _Draggable { | ||||
|         if (this._dragActorSource && this._dragActorSource.visible) { | ||||
|             // Snap the clone back to its source | ||||
|             [x, y] = this._dragActorSource.get_transformed_position(); | ||||
|             let [sourceScaledWidth] = this._dragActorSource.get_transformed_size(); | ||||
|             scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0; | ||||
|             let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size(); | ||||
|             scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0; | ||||
|         } else if (this._dragOrigParent) { | ||||
|             // Snap the actor back to its original position within | ||||
|             // its parent, adjusting for the fact that the parent | ||||
|             // may have been moved or scaled | ||||
|             let [parentX, parentY] = this._dragOrigParent.get_transformed_position(); | ||||
|             let [parentWidth] = this._dragOrigParent.get_size(); | ||||
|             let [parentScaledWidth] = this._dragOrigParent.get_transformed_size(); | ||||
|             let [parentWidth, parentHeight] = this._dragOrigParent.get_size(); | ||||
|             let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size(); | ||||
|             let parentScale = 1.0; | ||||
|             if (parentWidth != 0) | ||||
|                 parentScale = parentScaledWidth / parentWidth; | ||||
| @@ -654,13 +657,13 @@ var _Draggable = class _Draggable { | ||||
|  | ||||
|         let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation(); | ||||
|  | ||||
|         this._animateDragEnd(eventTime, { | ||||
|             x: snapBackX, | ||||
|             y: snapBackY, | ||||
|             scale_x: snapBackScale, | ||||
|             scale_y: snapBackScale, | ||||
|             duration: SNAP_BACK_ANIMATION_TIME | ||||
|         }); | ||||
|         this._animateDragEnd(eventTime, | ||||
|                              { x: snapBackX, | ||||
|                                y: snapBackY, | ||||
|                                scale_x: snapBackScale, | ||||
|                                scale_y: snapBackScale, | ||||
|                                time: SNAP_BACK_ANIMATION_TIME, | ||||
|                              }); | ||||
|     } | ||||
|  | ||||
|     _restoreDragActor(eventTime) { | ||||
| @@ -672,27 +675,26 @@ var _Draggable = class _Draggable { | ||||
|         this._dragActor.set_scale(restoreScale, restoreScale); | ||||
|         this._dragActor.opacity = 0; | ||||
|  | ||||
|         this._animateDragEnd(eventTime, { | ||||
|             duration: REVERT_ANIMATION_TIME | ||||
|         }); | ||||
|         this._animateDragEnd(eventTime, | ||||
|                              { time: REVERT_ANIMATION_TIME }); | ||||
|     } | ||||
|  | ||||
|     _animateDragEnd(eventTime, params) { | ||||
|         this._animationInProgress = true; | ||||
|  | ||||
|         params['opacity']          = this._dragOrigOpacity; | ||||
|         params['transition']       = 'easeOutQuad'; | ||||
|         params['onComplete']       = this._onAnimationComplete; | ||||
|         params['onCompleteScope']  = this; | ||||
|         params['onCompleteParams'] = [this._dragActor, eventTime]; | ||||
|  | ||||
|         // start the animation | ||||
|         this._dragActor.ease(Object.assign(params, { | ||||
|             opacity: this._dragOrigOpacity, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => { | ||||
|                 this._onAnimationComplete(this._dragActor, eventTime); | ||||
|             } | ||||
|         })); | ||||
|         Tweener.addTween(this._dragActor, params) | ||||
|     } | ||||
|  | ||||
|     _finishAnimation() { | ||||
|         if (!this._animationInProgress) | ||||
|             return; | ||||
|             return | ||||
|  | ||||
|         this._animationInProgress = false; | ||||
|         if (!this._buttonDown) | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported EdgeDragAction */ | ||||
|  | ||||
| const { Clutter, GObject, Meta, St } = imports.gi; | ||||
|  | ||||
| @@ -17,7 +16,7 @@ var EdgeDragAction = GObject.registerClass({ | ||||
|         this._allowedModes = allowedModes; | ||||
|         this.set_n_touch_points(1); | ||||
|  | ||||
|         global.display.connect('grab-op-begin', () => this.cancel()); | ||||
|         global.display.connect('grab-op-begin', () => { this.cancel(); }); | ||||
|     } | ||||
|  | ||||
|     _getMonitorRect(x, y) { | ||||
| @@ -27,7 +26,7 @@ var EdgeDragAction = GObject.registerClass({ | ||||
|         return global.display.get_monitor_geometry(monitorIndex); | ||||
|     } | ||||
|  | ||||
|     vfunc_gesture_prepare(_actor) { | ||||
|     vfunc_gesture_prepare(actor) { | ||||
|         if (this.get_n_current_points() == 0) | ||||
|             return false; | ||||
|  | ||||
| @@ -43,7 +42,7 @@ var EdgeDragAction = GObject.registerClass({ | ||||
|                 (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD)); | ||||
|     } | ||||
|  | ||||
|     vfunc_gesture_progress(_actor) { | ||||
|     vfunc_gesture_progress(actor) { | ||||
|         let [startX, startY] = this.get_press_coords(0); | ||||
|         let [x, y] = this.get_motion_coords(0); | ||||
|         let offsetX = Math.abs (x - startX); | ||||
| @@ -63,7 +62,7 @@ var EdgeDragAction = GObject.registerClass({ | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     vfunc_gesture_end(_actor) { | ||||
|     vfunc_gesture_end(actor) { | ||||
|         let [startX, startY] = this.get_press_coords(0); | ||||
|         let [x, y] = this.get_motion_coords(0); | ||||
|         let monitorRect = this._getMonitorRect(startX, startY); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported init, EndSessionDialog */ | ||||
| /* | ||||
|  * Copyright 2010-2016 Red Hat, Inc | ||||
|  * | ||||
| @@ -17,6 +16,8 @@ | ||||
|  * along with this program; if not, see <http://www.gnu.org/licenses/>. | ||||
|  */ | ||||
|  | ||||
| const Mainloop = imports.mainloop; | ||||
|  | ||||
| const { AccountsService, Clutter, Gio, | ||||
|         GLib, GObject, Pango, Polkit, Shell, St }  = imports.gi; | ||||
|  | ||||
| @@ -28,9 +29,13 @@ const UserWidget = imports.ui.userWidget; | ||||
|  | ||||
| const { loadInterfaceXML } = imports.misc.fileUtils; | ||||
|  | ||||
| let _endSessionDialog = null; | ||||
|  | ||||
| const _ITEM_ICON_SIZE = 48; | ||||
| const _DIALOG_ICON_SIZE = 48; | ||||
|  | ||||
| var GSM_SESSION_MANAGER_LOGOUT_FORCE = 2; | ||||
|  | ||||
| const EndSessionDialogIface = loadInterfaceXML('org.gnome.SessionManager.EndSessionDialog'); | ||||
|  | ||||
| const logoutDialogContent = { | ||||
| @@ -48,7 +53,7 @@ const logoutDialogContent = { | ||||
|     }, | ||||
|     showBatteryWarning: false, | ||||
|     confirmButtons: [{ signal: 'ConfirmedLogout', | ||||
|                        label: C_("button", "Log Out") }], | ||||
|                        label:  C_("button", "Log Out") }], | ||||
|     iconStyleClass: 'end-session-dialog-logout-icon', | ||||
|     showOtherSessions: false, | ||||
| }; | ||||
| @@ -64,9 +69,9 @@ const shutdownDialogContent = { | ||||
|     checkBoxText: C_("checkbox", "Install pending software updates"), | ||||
|     showBatteryWarning: true, | ||||
|     confirmButtons: [{ signal: 'ConfirmedReboot', | ||||
|                        label: C_("button", "Restart") }, | ||||
|                        label:  C_("button", "Restart") }, | ||||
|                      { signal: 'ConfirmedShutdown', | ||||
|                        label: C_("button", "Power Off") }], | ||||
|                        label:  C_("button", "Power Off") }], | ||||
|     iconName: 'system-shutdown-symbolic', | ||||
|     iconStyleClass: 'end-session-dialog-shutdown-icon', | ||||
|     showOtherSessions: true, | ||||
| @@ -81,7 +86,7 @@ const restartDialogContent = { | ||||
|     }, | ||||
|     showBatteryWarning: false, | ||||
|     confirmButtons: [{ signal: 'ConfirmedReboot', | ||||
|                        label: C_("button", "Restart") }], | ||||
|                        label:  C_("button", "Restart") }], | ||||
|     iconName: 'view-refresh-symbolic', | ||||
|     iconStyleClass: 'end-session-dialog-shutdown-icon', | ||||
|     showOtherSessions: true, | ||||
| @@ -97,7 +102,7 @@ const restartUpdateDialogContent = { | ||||
|     }, | ||||
|     showBatteryWarning: true, | ||||
|     confirmButtons: [{ signal: 'ConfirmedReboot', | ||||
|                        label: C_("button", "Restart & Install") }], | ||||
|                        label:  C_("button", "Restart & Install") }], | ||||
|     unusedFutureButtonForTranslation: C_("button", "Install & Power Off"), | ||||
|     unusedFutureCheckBoxForTranslation: C_("checkbox", "Power off after updates are installed"), | ||||
|     iconName: 'view-refresh-symbolic', | ||||
| @@ -117,18 +122,18 @@ const restartUpgradeDialogContent = { | ||||
|     disableTimer: true, | ||||
|     showBatteryWarning: false, | ||||
|     confirmButtons: [{ signal: 'ConfirmedReboot', | ||||
|                        label: C_("button", "Restart & Install") }], | ||||
|                        label:  C_("button", "Restart & Install") }], | ||||
|     iconName: 'view-refresh-symbolic', | ||||
|     iconStyleClass: 'end-session-dialog-shutdown-icon', | ||||
|     showOtherSessions: true, | ||||
| }; | ||||
|  | ||||
| const DialogType = { | ||||
|     LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */, | ||||
|     SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */, | ||||
|     RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */, | ||||
|     UPDATE_RESTART: 3, | ||||
|     UPGRADE_RESTART: 4 | ||||
|   LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */, | ||||
|   SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */, | ||||
|   RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */, | ||||
|   UPDATE_RESTART: 3, | ||||
|   UPGRADE_RESTART: 4 | ||||
| }; | ||||
|  | ||||
| const DialogContent = { | ||||
| @@ -154,7 +159,7 @@ function findAppFromInhibitor(inhibitor) { | ||||
|     let desktopFile; | ||||
|     try { | ||||
|         [desktopFile] = inhibitor.GetAppIdSync(); | ||||
|     } catch (e) { | ||||
|     } catch(e) { | ||||
|         // XXX -- sometimes JIT inhibitors generated by gnome-session | ||||
|         // get removed too soon. Don't fail in this case. | ||||
|         log('gnome-session gave us a dead inhibitor: %s'.format(inhibitor.get_object_path())); | ||||
| @@ -207,10 +212,10 @@ function _setCheckBoxLabel(checkBox, text) { | ||||
|  | ||||
|     if (text) { | ||||
|         label.set_text(text); | ||||
|         checkBox.show(); | ||||
|         checkBox.actor.show(); | ||||
|     } else { | ||||
|         label.set_text(''); | ||||
|         checkBox.hide(); | ||||
|         checkBox.actor.hide(); | ||||
|     } | ||||
| } | ||||
|  | ||||
| @@ -218,7 +223,7 @@ function init() { | ||||
|     // This always returns the same singleton object | ||||
|     // By instantiating it initially, we register the | ||||
|     // bus object, etc. | ||||
|     (new EndSessionDialog()); | ||||
|     _endSessionDialog = new EndSessionDialog(); | ||||
| } | ||||
|  | ||||
| var EndSessionDialog = GObject.registerClass( | ||||
| @@ -230,13 +235,14 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         this._loginManager = LoginManager.getLoginManager(); | ||||
|         this._userManager = AccountsService.UserManager.get_default(); | ||||
|         this._user = this._userManager.get_user(GLib.get_user_name()); | ||||
|         this._updatesPermission = null; | ||||
|  | ||||
|         this._pkOfflineProxy = new PkOfflineProxy(Gio.DBus.system, | ||||
|                                                   'org.freedesktop.PackageKit', | ||||
|                                                   '/org/freedesktop/PackageKit', | ||||
|                                                   this._onPkOfflineProxyCreated.bind(this)); | ||||
|  | ||||
|                                                   (proxy, error) => { | ||||
|                                                       if (error) | ||||
|                                                           log(error.message); | ||||
|                                                   }); | ||||
|         this._powerProxy = new UPowerProxy(Gio.DBus.system, | ||||
|                                            'org.freedesktop.UPower', | ||||
|                                            '/org/freedesktop/UPower', | ||||
| @@ -270,8 +276,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|  | ||||
|         this._iconBin = new St.Bin(); | ||||
|         mainContentLayout.add(this._iconBin, | ||||
|                               { x_fill: true, | ||||
|                                 y_fill: false, | ||||
|                               { x_fill:  true, | ||||
|                                 y_fill:  false, | ||||
|                                 x_align: St.Align.END, | ||||
|                                 y_align: St.Align.START }); | ||||
|  | ||||
| @@ -284,7 +290,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|  | ||||
|         messageLayout.add(this._subjectLabel, | ||||
|                           { x_fill: false, | ||||
|                             y_fill: false, | ||||
|                             y_fill:  false, | ||||
|                             x_align: St.Align.START, | ||||
|                             y_align: St.Align.START }); | ||||
|  | ||||
| @@ -293,12 +299,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         this._descriptionLabel.clutter_text.line_wrap = true; | ||||
|  | ||||
|         messageLayout.add(this._descriptionLabel, | ||||
|                           { y_fill: true, | ||||
|                           { y_fill:  true, | ||||
|                             y_align: St.Align.START }); | ||||
|  | ||||
|         this._checkBox = new CheckBox.CheckBox(); | ||||
|         this._checkBox.connect('clicked', this._sync.bind(this)); | ||||
|         messageLayout.add(this._checkBox); | ||||
|         this._checkBox.actor.connect('clicked', this._sync.bind(this)); | ||||
|         messageLayout.add(this._checkBox.actor); | ||||
|  | ||||
|         this._batteryWarning = new St.Label({ style_class: 'end-session-dialog-warning', | ||||
|                                               text: _("Running on battery power: please plug in before installing updates.") }); | ||||
| @@ -331,36 +337,16 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         this._inhibitorSection.add_actor(this._sessionHeader); | ||||
|         this._inhibitorSection.add_actor(this._sessionList); | ||||
|  | ||||
|         try { | ||||
|             this._updatesPermission = Polkit.Permission.new_sync("org.freedesktop.packagekit.trigger-offline-update", null, null); | ||||
|         } catch(e) { | ||||
|             log('No permission to trigger offline updates: %s'.format(e.toString())); | ||||
|         } | ||||
|  | ||||
|         this._dbusImpl = Gio.DBusExportedObject.wrapJSObject(EndSessionDialogIface, this); | ||||
|         this._dbusImpl.export(Gio.DBus.session, '/org/gnome/SessionManager/EndSessionDialog'); | ||||
|     } | ||||
|  | ||||
|     _onPkOfflineProxyCreated(proxy, error) { | ||||
|         if (error) { | ||||
|             log(error.message); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         // Creating a D-Bus proxy won't propagate SERVICE_UNKNOWN or NAME_HAS_NO_OWNER | ||||
|         // errors if PackageKit is not available, but the GIO implementation will make | ||||
|         // sure in that case that the proxy's g-name-owner is set to null, so check that. | ||||
|         if (this._pkOfflineProxy.g_name_owner === null) { | ||||
|             this._pkOfflineProxy = null; | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         // It only makes sense to check for this permission if PackageKit is available. | ||||
|         Polkit.Permission.new( | ||||
|             'org.freedesktop.packagekit.trigger-offline-update', null, null, | ||||
|             (source, res) => { | ||||
|                 try { | ||||
|                     this._updatesPermission = Polkit.Permission.new_finish(res); | ||||
|                 } catch (e) { | ||||
|                     log(`No permission to trigger offline updates: ${e}`); | ||||
|                 } | ||||
|             }); | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
|         this._user.disconnect(this._userLoadedId); | ||||
|         this._user.disconnect(this._userChangedId); | ||||
| @@ -376,12 +362,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         let subject = dialogContent.subject; | ||||
|  | ||||
|         // Use different title when we are installing updates | ||||
|         if (dialogContent.subjectWithUpdates && this._checkBox.checked) | ||||
|         if (dialogContent.subjectWithUpdates && this._checkBox.actor.checked) | ||||
|             subject = dialogContent.subjectWithUpdates; | ||||
|  | ||||
|         if (dialogContent.showBatteryWarning) { | ||||
|             // Warn when running on battery power | ||||
|             if (this._powerProxy.OnBattery && this._checkBox.checked) | ||||
|             if (this._powerProxy.OnBattery && this._checkBox.actor.checked) | ||||
|                 this._batteryWarning.opacity = 255; | ||||
|             else | ||||
|                 this._batteryWarning.opacity = 0; | ||||
| @@ -405,8 +391,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         } | ||||
|  | ||||
|         // Use a different description when we are installing a system upgrade | ||||
|         // if the PackageKit proxy is available (i.e. PackageKit is available). | ||||
|         if (this._pkOfflineProxy && dialogContent.upgradeDescription) { | ||||
|         if (dialogContent.upgradeDescription) { | ||||
|             let name = this._pkOfflineProxy.PreparedUpgrade['name'].deep_unpack(); | ||||
|             let version = this._pkOfflineProxy.PreparedUpgrade['version'].deep_unpack(); | ||||
|  | ||||
| @@ -429,7 +414,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|             let avatarWidget = new UserWidget.Avatar(this._user, | ||||
|                                                      { iconSize: _DIALOG_ICON_SIZE, | ||||
|                                                        styleClass: dialogContent.iconStyleClass }); | ||||
|             this._iconBin.child = avatarWidget; | ||||
|             this._iconBin.child = avatarWidget.actor; | ||||
|             avatarWidget.update(); | ||||
|         } | ||||
|  | ||||
| @@ -443,22 +428,20 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|     _updateButtons() { | ||||
|         let dialogContent = DialogContent[this._type]; | ||||
|         let buttons = [{ action: this.cancel.bind(this), | ||||
|                          label: _("Cancel"), | ||||
|                          key: Clutter.Escape }]; | ||||
|                          label:  _("Cancel"), | ||||
|                          key:    Clutter.Escape }]; | ||||
|  | ||||
|         for (let i = 0; i < dialogContent.confirmButtons.length; i++) { | ||||
|             let signal = dialogContent.confirmButtons[i].signal; | ||||
|             let label = dialogContent.confirmButtons[i].label; | ||||
|             buttons.push({ | ||||
|                 action: () => { | ||||
|                     this.close(true); | ||||
|                     let signalId = this.connect('closed', () => { | ||||
|                         this.disconnect(signalId); | ||||
|                         this._confirm(signal); | ||||
|                     }); | ||||
|                 }, | ||||
|                 label: label, | ||||
|             }); | ||||
|             buttons.push({ action: () => { | ||||
|                                this.close(true); | ||||
|                                let signalId = this.connect('closed', () => { | ||||
|                                    this.disconnect(signalId); | ||||
|                                    this._confirm(signal); | ||||
|                                }); | ||||
|                            }, | ||||
|                            label: label }); | ||||
|         } | ||||
|  | ||||
|         this.setButtons(buttons); | ||||
| @@ -485,27 +468,27 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         }; | ||||
|  | ||||
|         // Offline update not available; just emit the signal | ||||
|         if (!this._checkBox.visible) { | ||||
|         if (!this._checkBox.actor.visible) { | ||||
|             callback(); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         // Trigger the offline update as requested | ||||
|         if (this._checkBox.checked) { | ||||
|         if (this._checkBox.actor.checked) { | ||||
|             switch (signal) { | ||||
|             case "ConfirmedReboot": | ||||
|                 this._triggerOfflineUpdateReboot(callback); | ||||
|                 break; | ||||
|             case "ConfirmedShutdown": | ||||
|                 // To actually trigger the offline update, we need to | ||||
|                 // reboot to do the upgrade. When the upgrade is complete, | ||||
|                 // the computer will shut down automatically. | ||||
|                 signal = "ConfirmedReboot"; | ||||
|                 this._triggerOfflineUpdateShutdown(callback); | ||||
|                 break; | ||||
|             default: | ||||
|                 callback(); | ||||
|                 break; | ||||
|                 case "ConfirmedReboot": | ||||
|                     this._triggerOfflineUpdateReboot(callback); | ||||
|                     break; | ||||
|                 case "ConfirmedShutdown": | ||||
|                     // To actually trigger the offline update, we need to | ||||
|                     // reboot to do the upgrade. When the upgrade is complete, | ||||
|                     // the computer will shut down automatically. | ||||
|                     signal = "ConfirmedReboot"; | ||||
|                     this._triggerOfflineUpdateShutdown(callback); | ||||
|                     break; | ||||
|                 default: | ||||
|                     callback(); | ||||
|                     break; | ||||
|             } | ||||
|         } else { | ||||
|             this._triggerOfflineUpdateCancel(callback); | ||||
| @@ -517,12 +500,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|     } | ||||
|  | ||||
|     _triggerOfflineUpdateReboot(callback) { | ||||
|         // Handle this gracefully if PackageKit is not available. | ||||
|         if (!this._pkOfflineProxy) { | ||||
|             callback(); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this._pkOfflineProxy.TriggerRemote('reboot', (result, error) => { | ||||
|             if (error) | ||||
|                 log(error.message); | ||||
| @@ -532,12 +509,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|     } | ||||
|  | ||||
|     _triggerOfflineUpdateShutdown(callback) { | ||||
|         // Handle this gracefully if PackageKit is not available. | ||||
|         if (!this._pkOfflineProxy) { | ||||
|             callback(); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this._pkOfflineProxy.TriggerRemote('power-off', (result, error) => { | ||||
|             if (error) | ||||
|                 log(error.message); | ||||
| @@ -547,12 +518,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|     } | ||||
|  | ||||
|     _triggerOfflineUpdateCancel(callback) { | ||||
|         // Handle this gracefully if PackageKit is not available. | ||||
|         if (!this._pkOfflineProxy) { | ||||
|             callback(); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this._pkOfflineProxy.CancelRemote((result, error) => { | ||||
|             if (error) | ||||
|                 log(error.message); | ||||
| @@ -565,7 +530,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         let startTime = GLib.get_monotonic_time(); | ||||
|         this._secondsLeft = this._totalSecondsToStayOpen; | ||||
|  | ||||
|         this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => { | ||||
|         this._timerId = Mainloop.timeout_add_seconds(1, () => { | ||||
|             let currentTime = GLib.get_monotonic_time(); | ||||
|             let secondsElapsed = ((currentTime - startTime) / 1000000); | ||||
|  | ||||
| @@ -587,7 +552,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|  | ||||
|     _stopTimer() { | ||||
|         if (this._timerId > 0) { | ||||
|             GLib.source_remove(this._timerId); | ||||
|             Mainloop.source_remove(this._timerId); | ||||
|             this._timerId = 0; | ||||
|         } | ||||
|  | ||||
| @@ -620,7 +585,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|     } | ||||
|  | ||||
|     _onInhibitorLoaded(inhibitor) { | ||||
|         if (!this._applications.includes(inhibitor)) { | ||||
|         if (this._applications.indexOf(inhibitor) < 0) { | ||||
|             // Stale inhibitor | ||||
|             return; | ||||
|         } | ||||
| @@ -656,7 +621,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|  | ||||
|         let actor = new St.BoxLayout({ style_class: 'end-session-dialog-session-list-item', | ||||
|                                        can_focus: true }); | ||||
|         actor.add(avatar); | ||||
|         actor.add(avatar.actor); | ||||
|  | ||||
|         let nameLabel = new St.Label({ text: userLabelText, | ||||
|                                        style_class: 'end-session-dialog-session-list-item-name', | ||||
| @@ -672,7 +637,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         this._loginManager.listSessions(result => { | ||||
|             let n = 0; | ||||
|             for (let i = 0; i < result.length; i++) { | ||||
|                 let [id_, uid_, userName, seat_, sessionPath] = result[i]; | ||||
|                 let[id, uid, userName, seat, sessionPath] = result[i]; | ||||
|                 let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath); | ||||
|  | ||||
|                 if (proxy.Class != 'user') | ||||
| @@ -715,8 +680,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         this._totalSecondsToStayOpen = totalSecondsToStayOpen; | ||||
|         this._type = type; | ||||
|  | ||||
|         // Only consider updates and upgrades if PackageKit is available. | ||||
|         if (this._pkOfflineProxy && this._type == DialogType.RESTART) { | ||||
|         if (this._type == DialogType.RESTART) { | ||||
|             if (this._pkOfflineProxy.UpdateTriggered) | ||||
|                 this._type = DialogType.UPDATE_RESTART; | ||||
|             else if (this._pkOfflineProxy.UpgradeTriggered) | ||||
| @@ -738,7 +702,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         let dialogContent = DialogContent[this._type]; | ||||
|  | ||||
|         for (let i = 0; i < inhibitorObjectPaths.length; i++) { | ||||
|             let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => { | ||||
|             let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => { | ||||
|                 this._onInhibitorLoaded(proxy); | ||||
|             }); | ||||
|  | ||||
| @@ -748,20 +712,19 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         if (dialogContent.showOtherSessions) | ||||
|             this._loadSessions(); | ||||
|  | ||||
|         // Only consider updates and upgrades if PackageKit is available. | ||||
|         let updateTriggered = this._pkOfflineProxy ? this._pkOfflineProxy.UpdateTriggered : false; | ||||
|         let updatePrepared = this._pkOfflineProxy ? this._pkOfflineProxy.UpdatePrepared : false; | ||||
|         let updateTriggered = this._pkOfflineProxy.UpdateTriggered; | ||||
|         let updatePrepared = this._pkOfflineProxy.UpdatePrepared; | ||||
|         let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed; | ||||
|  | ||||
|         _setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || ''); | ||||
|         this._checkBox.visible = (dialogContent.checkBoxText && updatePrepared && updatesAllowed); | ||||
|         this._checkBox.checked = (updatePrepared && updateTriggered); | ||||
|         this._checkBox.actor.visible = (dialogContent.checkBoxText && updatePrepared && updatesAllowed); | ||||
|         this._checkBox.actor.checked = (updatePrepared && updateTriggered); | ||||
|  | ||||
|         // We show the warning either together with the checkbox, or when | ||||
|         // updates have already been triggered, but the user doesn't have | ||||
|         // enough permissions to cancel them. | ||||
|         this._batteryWarning.visible = (dialogContent.showBatteryWarning && | ||||
|                                         (this._checkBox.visible || updatePrepared && updateTriggered && !updatesAllowed)); | ||||
|                                         (this._checkBox.actor.visible || updatePrepared && updateTriggered && !updatesAllowed)); | ||||
|  | ||||
|         this._updateButtons(); | ||||
|  | ||||
| @@ -782,7 +745,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog { | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     Close(_parameters, _invocation) { | ||||
|     Close(parameters, invocation) { | ||||
|         this.close(); | ||||
|     } | ||||
| }); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported init */ | ||||
|  | ||||
| const Config = imports.misc.config; | ||||
|  | ||||
| @@ -10,7 +9,7 @@ imports.gi.versions.Gtk = '3.0'; | ||||
| imports.gi.versions.TelepathyGLib = '0.12'; | ||||
| imports.gi.versions.TelepathyLogger = '0.2'; | ||||
|  | ||||
| const { Clutter, GLib, Meta, Shell, St } = imports.gi; | ||||
| const { Clutter, GLib, Shell, St } = imports.gi; | ||||
| const Gettext = imports.gettext; | ||||
|  | ||||
| // We can't import shell JS modules yet, because they may have | ||||
| @@ -58,132 +57,8 @@ function _patchLayoutClass(layoutClass, styleProps) { | ||||
|     }; | ||||
| } | ||||
|  | ||||
| function _makeEaseCallback(params, cleanup) { | ||||
|     let onComplete = params.onComplete; | ||||
|     delete params.onComplete; | ||||
|  | ||||
|     let onStopped = params.onStopped; | ||||
|     delete params.onStopped; | ||||
|  | ||||
|     return isFinished => { | ||||
|         cleanup(); | ||||
|  | ||||
|         if (onStopped) | ||||
|             onStopped(isFinished); | ||||
|         if (onComplete && isFinished) | ||||
|             onComplete(); | ||||
|     }; | ||||
| } | ||||
|  | ||||
| function _getPropertyTarget(actor, propName) { | ||||
|     if (!propName.startsWith('@')) | ||||
|         return [actor, propName]; | ||||
|  | ||||
|     let [type, name, prop] = propName.split('.'); | ||||
|     switch (type) { | ||||
|     case '@layout': | ||||
|         return [actor.layout_manager, name]; | ||||
|     case '@actions': | ||||
|         return [actor.get_action(name), prop]; | ||||
|     case '@constraints': | ||||
|         return [actor.get_constraint(name), prop]; | ||||
|     case '@effects': | ||||
|         return [actor.get_effect(name), prop]; | ||||
|     } | ||||
|  | ||||
|     throw new Error(`Invalid property name ${propName}`); | ||||
| } | ||||
|  | ||||
| function _easeActor(actor, params) { | ||||
|     actor.save_easing_state(); | ||||
|  | ||||
|     if (params.duration != undefined) | ||||
|         actor.set_easing_duration(params.duration); | ||||
|     delete params.duration; | ||||
|  | ||||
|     if (params.delay != undefined) | ||||
|         actor.set_easing_delay(params.delay); | ||||
|     delete params.delay; | ||||
|  | ||||
|     if (params.mode != undefined) | ||||
|         actor.set_easing_mode(params.mode); | ||||
|     delete params.mode; | ||||
|  | ||||
|     let cleanup = () => Meta.enable_unredirect_for_display(global.display); | ||||
|     let callback = _makeEaseCallback(params, cleanup); | ||||
|  | ||||
|     // cancel overwritten transitions | ||||
|     let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g')); | ||||
|     animatedProps.forEach(p => actor.remove_transition(p)); | ||||
|  | ||||
|     actor.set(params); | ||||
|     actor.restore_easing_state(); | ||||
|  | ||||
|     let transition = animatedProps.map(p => actor.get_transition(p)) | ||||
|         .find(t => t !== null); | ||||
|  | ||||
|     if (transition && transition.delay) | ||||
|         transition.connect('started', () => Meta.disable_unredirect_for_display(global.display)); | ||||
|     else | ||||
|         Meta.disable_unredirect_for_display(global.display); | ||||
|  | ||||
|     if (transition) | ||||
|         transition.connect('stopped', (t, finished) => callback(finished)); | ||||
|     else | ||||
|         callback(true); | ||||
| } | ||||
|  | ||||
| function _easeActorProperty(actor, propName, target, params) { | ||||
|     // Avoid pointless difference with ease() | ||||
|     if (params.mode) | ||||
|         params.progress_mode = params.mode; | ||||
|     delete params.mode; | ||||
|  | ||||
|     if (params.duration) | ||||
|         params.duration = adjustAnimationTime(params.duration); | ||||
|     let duration = Math.floor(params.duration || 0); | ||||
|  | ||||
|     // Copy Clutter's behavior for implicit animations, see | ||||
|     // should_skip_implicit_transition() | ||||
|     if (actor instanceof Clutter.Actor && !actor.mapped) | ||||
|         duration = 0; | ||||
|  | ||||
|     let cleanup = () => Meta.enable_unredirect_for_display(global.display); | ||||
|     let callback = _makeEaseCallback(params, cleanup); | ||||
|  | ||||
|     // cancel overwritten transition | ||||
|     actor.remove_transition(propName); | ||||
|  | ||||
|     if (duration == 0) { | ||||
|         let [obj, prop] = _getPropertyTarget(actor, propName); | ||||
|         obj[prop] = target; | ||||
|  | ||||
|         Meta.disable_unredirect_for_display(global.display); | ||||
|         callback(true); | ||||
|  | ||||
|         return; | ||||
|     } | ||||
|  | ||||
|     let pspec = actor.find_property(propName); | ||||
|     let transition = new Clutter.PropertyTransition(Object.assign({ | ||||
|         property_name: propName, | ||||
|         interval: new Clutter.Interval({ value_type: pspec.value_type }), | ||||
|         remove_on_complete: true | ||||
|     }, params)); | ||||
|     actor.add_transition(propName, transition); | ||||
|  | ||||
|     transition.set_to(target); | ||||
|  | ||||
|     if (transition.delay) | ||||
|         transition.connect('started', () => Meta.disable_unredirect_for_display(global.display)); | ||||
|     else | ||||
|         Meta.disable_unredirect_for_display(global.display); | ||||
|  | ||||
|     transition.connect('stopped', (t, finished) => callback(finished)); | ||||
| } | ||||
|  | ||||
| function _loggingFunc(...args) { | ||||
|     let fields = { 'MESSAGE': args.join(', ') }; | ||||
| function _loggingFunc() { | ||||
|     let fields = {'MESSAGE': [].join.call(arguments, ', ')}; | ||||
|     let domain = "GNOME Shell"; | ||||
|  | ||||
|     // If the caller is an extension, add it as metadata | ||||
| @@ -218,27 +93,6 @@ function init() { | ||||
|                                             column_spacing: 'spacing-columns' }); | ||||
|     _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' }); | ||||
|  | ||||
|     let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration; | ||||
|     Clutter.Actor.prototype.set_easing_duration = function(msecs) { | ||||
|         origSetEasingDuration.call(this, adjustAnimationTime(msecs)); | ||||
|     }; | ||||
|     let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay; | ||||
|     Clutter.Actor.prototype.set_easing_delay = function(msecs) { | ||||
|         origSetEasingDelay.call(this, adjustAnimationTime(msecs)); | ||||
|     }; | ||||
|  | ||||
|     Clutter.Actor.prototype.ease = function(props, easingParams) { | ||||
|         _easeActor(this, props, easingParams); | ||||
|     }; | ||||
|     Clutter.Actor.prototype.ease_property = function(propName, target, params) { | ||||
|         _easeActorProperty(this, propName, target, params); | ||||
|     }; | ||||
|     St.Adjustment.prototype.ease = function(target, params) { | ||||
|         // we're not an actor of course, but we implement the same | ||||
|         // transition API as Clutter.Actor, so this works anyway | ||||
|         _easeActorProperty(this, 'value', target, params); | ||||
|     }; | ||||
|  | ||||
|     Clutter.Actor.prototype.toString = function() { | ||||
|         return St.describe_actor(this); | ||||
|     }; | ||||
| @@ -252,21 +106,15 @@ function init() { | ||||
|         } | ||||
|     }); | ||||
|  | ||||
|     St.set_slow_down_factor = function(factor) { | ||||
|         let { stack } = new Error(); | ||||
|         log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`); | ||||
|         St.Settings.get().slow_down_factor = factor; | ||||
|     }; | ||||
|  | ||||
|     let origToString = Object.prototype.toString; | ||||
|     Object.prototype.toString = function() { | ||||
|         let base = origToString.call(this); | ||||
|         try { | ||||
|             if ('actor' in this && this.actor instanceof Clutter.Actor) | ||||
|                 return base.replace(/\]$/, ` delegate for ${this.actor.toString().substring(1)}`); | ||||
|                 return base.replace(/\]$/, ' delegate for ' + this.actor.toString().substring(1)); | ||||
|             else | ||||
|                 return base; | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             return base; | ||||
|         } | ||||
|     }; | ||||
| @@ -280,7 +128,7 @@ function init() { | ||||
|     if (slowdownEnv) { | ||||
|         let factor = parseFloat(slowdownEnv); | ||||
|         if (!isNaN(factor) && factor > 0.0) | ||||
|             St.Settings.get().slow_down_factor = factor; | ||||
|             St.set_slow_down_factor(factor); | ||||
|     } | ||||
|  | ||||
|     // OK, now things are initialized enough that we can import shell JS | ||||
| @@ -290,17 +138,3 @@ function init() { | ||||
|     Tweener.init(); | ||||
|     String.prototype.format = Format.format; | ||||
| } | ||||
|  | ||||
| // adjustAnimationTime: | ||||
| // @msecs: time in milliseconds | ||||
| // | ||||
| // Adjust @msecs to account for St's enable-animations | ||||
| // and slow-down-factor settings | ||||
| function adjustAnimationTime(msecs) { | ||||
|     let settings = St.Settings.get(); | ||||
|  | ||||
|     if (!settings.enable_animations) | ||||
|         return 1; | ||||
|     return settings.slow_down_factor * msecs; | ||||
| } | ||||
|  | ||||
|   | ||||
| @@ -1,20 +1,20 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported init, installExtension, uninstallExtension, | ||||
|             checkForUpdates, updateExtension */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, Soup } = imports.gi; | ||||
| const { Clutter, Gio, GLib, GObject, Pango, Soup, St } = imports.gi; | ||||
|  | ||||
| const Config = imports.misc.config; | ||||
| const Dialog = imports.ui.dialog; | ||||
| const ExtensionUtils = imports.misc.extensionUtils; | ||||
| const ExtensionSystem = imports.ui.extensionSystem; | ||||
| const FileUtils = imports.misc.fileUtils; | ||||
| const Main = imports.ui.main; | ||||
| const ModalDialog = imports.ui.modalDialog; | ||||
|  | ||||
| const _signals = ExtensionSystem._signals; | ||||
|  | ||||
| var REPOSITORY_URL_BASE = 'https://extensions.gnome.org'; | ||||
| var REPOSITORY_URL_DOWNLOAD = `${REPOSITORY_URL_BASE}/download-extension/%s.shell-extension.zip`; | ||||
| var REPOSITORY_URL_INFO     = `${REPOSITORY_URL_BASE}/extension-info/`; | ||||
| var REPOSITORY_URL_UPDATE   = `${REPOSITORY_URL_BASE}/update-info/`; | ||||
| var REPOSITORY_URL_DOWNLOAD = REPOSITORY_URL_BASE + '/download-extension/%s.shell-extension.zip'; | ||||
| var REPOSITORY_URL_INFO     = REPOSITORY_URL_BASE + '/extension-info/'; | ||||
| var REPOSITORY_URL_UPDATE   = REPOSITORY_URL_BASE + '/update-info/'; | ||||
|  | ||||
| let _httpSession; | ||||
|  | ||||
| @@ -26,7 +26,7 @@ function installExtension(uuid, invocation) { | ||||
|  | ||||
|     _httpSession.queue_message(message, (session, message) => { | ||||
|         if (message.status_code != Soup.KnownStatusCode.OK) { | ||||
|             Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`); | ||||
|             ExtensionSystem.logExtensionError(uuid, 'downloading info: ' + message.status_code); | ||||
|             invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString()); | ||||
|             return; | ||||
|         } | ||||
| @@ -35,7 +35,7 @@ function installExtension(uuid, invocation) { | ||||
|         try { | ||||
|             info = JSON.parse(message.response_body.data); | ||||
|         } catch (e) { | ||||
|             Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`); | ||||
|             ExtensionSystem.logExtensionError(uuid, 'parsing info: ' + e); | ||||
|             invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString()); | ||||
|             return; | ||||
|         } | ||||
| @@ -46,7 +46,7 @@ function installExtension(uuid, invocation) { | ||||
| } | ||||
|  | ||||
| function uninstallExtension(uuid) { | ||||
|     let extension = Main.extensionManager.lookup(uuid); | ||||
|     let extension = ExtensionUtils.extensions[uuid]; | ||||
|     if (!extension) | ||||
|         return false; | ||||
|  | ||||
| @@ -54,7 +54,7 @@ function uninstallExtension(uuid) { | ||||
|     if (extension.type != ExtensionUtils.ExtensionType.PER_USER) | ||||
|         return false; | ||||
|  | ||||
|     if (!Main.extensionManager.unloadExtension(extension)) | ||||
|     if (!ExtensionSystem.unloadExtension(extension)) | ||||
|         return false; | ||||
|  | ||||
|     FileUtils.recursivelyDeleteDir(extension.dir, true); | ||||
| @@ -115,10 +115,10 @@ function updateExtension(uuid) { | ||||
|  | ||||
|     _httpSession.queue_message(message, (session, message) => { | ||||
|         gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => { | ||||
|             let oldExtension = Main.extensionManager.lookup(uuid); | ||||
|             let oldExtension = ExtensionUtils.extensions[uuid]; | ||||
|             let extensionDir = oldExtension.dir; | ||||
|  | ||||
|             if (!Main.extensionManager.unloadExtension(oldExtension)) | ||||
|             if (!ExtensionSystem.unloadExtension(oldExtension)) | ||||
|                 return; | ||||
|  | ||||
|             FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir); | ||||
| @@ -127,11 +127,11 @@ function updateExtension(uuid) { | ||||
|             let extension = null; | ||||
|  | ||||
|             try { | ||||
|                 extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER); | ||||
|                 Main.extensionManager.loadExtension(extension); | ||||
|             } catch (e) { | ||||
|                 extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER); | ||||
|                 ExtensionSystem.loadExtension(extension); | ||||
|             } catch(e) { | ||||
|                 if (extension) | ||||
|                     Main.extensionManager.unloadExtension(extension); | ||||
|                     ExtensionSystem.unloadExtension(extension); | ||||
|  | ||||
|                 logError(e, 'Error loading extension %s'.format(uuid)); | ||||
|  | ||||
| @@ -140,7 +140,7 @@ function updateExtension(uuid) { | ||||
|  | ||||
|                 // Restore what was there before. We can't do much if we | ||||
|                 // fail here. | ||||
|                 Main.extensionManager.loadExtension(oldExtension); | ||||
|                 ExtensionSystem.loadExtension(oldExtension); | ||||
|                 return; | ||||
|             } | ||||
|  | ||||
| @@ -153,9 +153,9 @@ function updateExtension(uuid) { | ||||
|  | ||||
| function checkForUpdates() { | ||||
|     let metadatas = {}; | ||||
|     Main.extensionManager.getUuids().forEach(uuid => { | ||||
|         metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata; | ||||
|     }); | ||||
|     for (let uuid in ExtensionUtils.extensions) { | ||||
|         metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata; | ||||
|     } | ||||
|  | ||||
|     let params = { shell_version: Config.PACKAGE_VERSION, | ||||
|                    installed: JSON.stringify(metadatas) }; | ||||
| @@ -186,15 +186,14 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog { | ||||
|         this._info = info; | ||||
|         this._invocation = invocation; | ||||
|  | ||||
|         this.setButtons([{ | ||||
|             label: _("Cancel"), | ||||
|             action: this._onCancelButtonPressed.bind(this), | ||||
|             key: Clutter.Escape, | ||||
|         }, { | ||||
|             label: _("Install"), | ||||
|             action: this._onInstallButtonPressed.bind(this), | ||||
|             default: true, | ||||
|         }]); | ||||
|         this.setButtons([{ label: _("Cancel"), | ||||
|                            action: this._onCancelButtonPressed.bind(this), | ||||
|                            key:    Clutter.Escape | ||||
|                          }, | ||||
|                          { label:  _("Install"), | ||||
|                            action: this._onInstallButtonPressed.bind(this), | ||||
|                            default: true | ||||
|                          }]); | ||||
|  | ||||
|         let content = new Dialog.MessageDialogContent({ | ||||
|             title: _("Download and install “%s” from extensions.gnome.org?").format(info.name), | ||||
| @@ -206,12 +205,12 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog { | ||||
|         this.contentLayout.add(content); | ||||
|     } | ||||
|  | ||||
|     _onCancelButtonPressed() { | ||||
|     _onCancelButtonPressed(button, event) { | ||||
|         this.close(); | ||||
|         this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled'])); | ||||
|     } | ||||
|  | ||||
|     _onInstallButtonPressed() { | ||||
|     _onInstallButtonPressed(button, event) { | ||||
|         let params = { shell_version: Config.PACKAGE_VERSION }; | ||||
|  | ||||
|         let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid); | ||||
| @@ -223,16 +222,21 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog { | ||||
|         function errback(code, message) { | ||||
|             let msg = message ? message.toString() : ''; | ||||
|             log('Error while installing %s: %s (%s)'.format(uuid, code, msg)); | ||||
|             invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg); | ||||
|             invocation.return_dbus_error('org.gnome.Shell.' + code, msg); | ||||
|         } | ||||
|  | ||||
|         function callback() { | ||||
|             // Add extension to 'enabled-extensions' for the user, always... | ||||
|             let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY); | ||||
|             if (enabledExtensions.indexOf(uuid) == -1) { | ||||
|                 enabledExtensions.push(uuid); | ||||
|                 global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions); | ||||
|             } | ||||
|  | ||||
|             try { | ||||
|                 let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER); | ||||
|                 Main.extensionManager.loadExtension(extension); | ||||
|                 if (!Main.extensionManager.enableExtension(uuid)) | ||||
|                     throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`); | ||||
|             } catch (e) { | ||||
|                 let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER); | ||||
|                 ExtensionSystem.loadExtension(extension); | ||||
|             } catch(e) { | ||||
|                 uninstallExtension(uuid); | ||||
|                 errback('LoadExtensionError', e); | ||||
|                 return; | ||||
|   | ||||
| @@ -1,519 +1,374 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported init connect disconnect */ | ||||
|  | ||||
| const { Gio, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const ExtensionUtils = imports.misc.extensionUtils; | ||||
| const FileUtils = imports.misc.fileUtils; | ||||
| const Main = imports.ui.main; | ||||
|  | ||||
| const { ExtensionState, ExtensionType } = ExtensionUtils; | ||||
| var ExtensionState = { | ||||
|     ENABLED: 1, | ||||
|     DISABLED: 2, | ||||
|     ERROR: 3, | ||||
|     OUT_OF_DATE: 4, | ||||
|     DOWNLOADING: 5, | ||||
|     INITIALIZED: 6, | ||||
|  | ||||
|     // Used as an error state for operations on unknown extensions, | ||||
|     // should never be in a real extensionMeta object. | ||||
|     UNINSTALLED: 99 | ||||
| }; | ||||
|  | ||||
| // Arrays of uuids | ||||
| var enabledExtensions; | ||||
| // Contains the order that extensions were enabled in. | ||||
| var extensionOrder = []; | ||||
|  | ||||
| // We don't really have a class to add signals on. So, create | ||||
| // a simple dummy object, add the signal methods, and export those | ||||
| // publically. | ||||
| var _signals = {}; | ||||
| Signals.addSignalMethods(_signals); | ||||
|  | ||||
| var connect = _signals.connect.bind(_signals); | ||||
| var disconnect = _signals.disconnect.bind(_signals); | ||||
|  | ||||
| const ENABLED_EXTENSIONS_KEY = 'enabled-extensions'; | ||||
| const DISABLED_EXTENSIONS_KEY = 'disabled-extensions'; | ||||
| const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions'; | ||||
| const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation'; | ||||
|  | ||||
| var ExtensionManager = class { | ||||
|     constructor() { | ||||
|         this._initialized = false; | ||||
|         this._enabled = false; | ||||
| var initted = false; | ||||
| var enabled; | ||||
|  | ||||
|         this._extensions = new Map(); | ||||
|         this._enabledExtensions = []; | ||||
|         this._extensionOrder = []; | ||||
| function disableExtension(uuid) { | ||||
|     let extension = ExtensionUtils.extensions[uuid]; | ||||
|     if (!extension) | ||||
|         return; | ||||
|  | ||||
|         Main.sessionMode.connect('updated', this._sessionUpdated.bind(this)); | ||||
|     } | ||||
|     if (extension.state != ExtensionState.ENABLED) | ||||
|         return; | ||||
|  | ||||
|     init() { | ||||
|         this._sessionUpdated(); | ||||
|     } | ||||
|     // "Rebase" the extension order by disabling and then enabling extensions | ||||
|     // in order to help prevent conflicts. | ||||
|  | ||||
|     lookup(uuid) { | ||||
|         return this._extensions.get(uuid); | ||||
|     } | ||||
|     // Example: | ||||
|     //   order = [A, B, C, D, E] | ||||
|     //   user disables C | ||||
|     //   this should: disable E, disable D, disable C, enable D, enable E | ||||
|  | ||||
|     getUuids() { | ||||
|         return [...this._extensions.keys()]; | ||||
|     } | ||||
|     let orderIdx = extensionOrder.indexOf(uuid); | ||||
|     let order = extensionOrder.slice(orderIdx + 1); | ||||
|     let orderReversed = order.slice().reverse(); | ||||
|  | ||||
|     _callExtensionDisable(uuid) { | ||||
|         let extension = this.lookup(uuid); | ||||
|         if (!extension) | ||||
|             return; | ||||
|  | ||||
|         if (extension.state != ExtensionState.ENABLED) | ||||
|             return; | ||||
|  | ||||
|         // "Rebase" the extension order by disabling and then enabling extensions | ||||
|         // in order to help prevent conflicts. | ||||
|  | ||||
|         // Example: | ||||
|         //   order = [A, B, C, D, E] | ||||
|         //   user disables C | ||||
|         //   this should: disable E, disable D, disable C, enable D, enable E | ||||
|  | ||||
|         let orderIdx = this._extensionOrder.indexOf(uuid); | ||||
|         let order = this._extensionOrder.slice(orderIdx + 1); | ||||
|         let orderReversed = order.slice().reverse(); | ||||
|  | ||||
|         for (let i = 0; i < orderReversed.length; i++) { | ||||
|             let uuid = orderReversed[i]; | ||||
|             try { | ||||
|                 this.lookup(uuid).stateObj.disable(); | ||||
|             } catch (e) { | ||||
|                 this.logExtensionError(uuid, e); | ||||
|             } | ||||
|     for (let i = 0; i < orderReversed.length; i++) { | ||||
|         let uuid = orderReversed[i]; | ||||
|         try { | ||||
|             ExtensionUtils.extensions[uuid].stateObj.disable(); | ||||
|         } catch(e) { | ||||
|             logExtensionError(uuid, e); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     if (extension.stylesheet) { | ||||
|         let theme = St.ThemeContext.get_for_stage(global.stage).get_theme(); | ||||
|         theme.unload_stylesheet(extension.stylesheet); | ||||
|         delete extension.stylesheet; | ||||
|     } | ||||
|  | ||||
|     try { | ||||
|         extension.stateObj.disable(); | ||||
|     } catch(e) { | ||||
|         logExtensionError(uuid, e); | ||||
|     } | ||||
|  | ||||
|     for (let i = 0; i < order.length; i++) { | ||||
|         let uuid = order[i]; | ||||
|         try { | ||||
|             ExtensionUtils.extensions[uuid].stateObj.enable(); | ||||
|         } catch(e) { | ||||
|             logExtensionError(uuid, e); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     extensionOrder.splice(orderIdx, 1); | ||||
|  | ||||
|     if ( extension.state != ExtensionState.ERROR ) { | ||||
|         extension.state = ExtensionState.DISABLED; | ||||
|         _signals.emit('extension-state-changed', extension); | ||||
|     } | ||||
| } | ||||
|  | ||||
| function enableExtension(uuid) { | ||||
|     let extension = ExtensionUtils.extensions[uuid]; | ||||
|     if (!extension) | ||||
|         return; | ||||
|  | ||||
|     if (extension.state == ExtensionState.INITIALIZED) | ||||
|         initExtension(uuid); | ||||
|  | ||||
|     if (extension.state != ExtensionState.DISABLED) | ||||
|         return; | ||||
|  | ||||
|     extensionOrder.push(uuid); | ||||
|  | ||||
|     let stylesheetNames = [global.session_mode + '.css', 'stylesheet.css']; | ||||
|     let theme = St.ThemeContext.get_for_stage(global.stage).get_theme(); | ||||
|     for (let i = 0; i < stylesheetNames.length; i++) { | ||||
|         try { | ||||
|             let stylesheetFile = extension.dir.get_child(stylesheetNames[i]); | ||||
|             theme.load_stylesheet(stylesheetFile); | ||||
|             extension.stylesheet = stylesheetFile; | ||||
|             break; | ||||
|         } catch (e) { | ||||
|             if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND)) | ||||
|                 continue; // not an error | ||||
|             log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`); | ||||
|             return; | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     try { | ||||
|         extension.stateObj.enable(); | ||||
|         extension.state = ExtensionState.ENABLED; | ||||
|         _signals.emit('extension-state-changed', extension); | ||||
|         return; | ||||
|     } catch(e) { | ||||
|         if (extension.stylesheet) { | ||||
|             let theme = St.ThemeContext.get_for_stage(global.stage).get_theme(); | ||||
|             theme.unload_stylesheet(extension.stylesheet); | ||||
|             delete extension.stylesheet; | ||||
|         } | ||||
|  | ||||
|         try { | ||||
|             extension.stateObj.disable(); | ||||
|         } catch (e) { | ||||
|             this.logExtensionError(uuid, e); | ||||
|         } | ||||
|  | ||||
|         for (let i = 0; i < order.length; i++) { | ||||
|             let uuid = order[i]; | ||||
|             try { | ||||
|                 this.lookup(uuid).stateObj.enable(); | ||||
|             } catch (e) { | ||||
|                 this.logExtensionError(uuid, e); | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         this._extensionOrder.splice(orderIdx, 1); | ||||
|  | ||||
|         if (extension.state != ExtensionState.ERROR) { | ||||
|             extension.state = ExtensionState.DISABLED; | ||||
|             this.emit('extension-state-changed', extension); | ||||
|         } | ||||
|         logExtensionError(uuid, e); | ||||
|         return; | ||||
|     } | ||||
| } | ||||
|  | ||||
|     _callExtensionEnable(uuid) { | ||||
|         if (!Main.sessionMode.allowExtensions) | ||||
|             return; | ||||
| function logExtensionError(uuid, error) { | ||||
|     let extension = ExtensionUtils.extensions[uuid]; | ||||
|     if (!extension) | ||||
|         return; | ||||
|  | ||||
|         let extension = this.lookup(uuid); | ||||
|         if (!extension) | ||||
|             return; | ||||
|     let message = '' + error; | ||||
|  | ||||
|         if (extension.state == ExtensionState.INITIALIZED) | ||||
|             this._callExtensionInit(uuid); | ||||
|     extension.state = ExtensionState.ERROR; | ||||
|     if (!extension.errors) | ||||
|         extension.errors = []; | ||||
|     extension.errors.push(message); | ||||
|  | ||||
|         if (extension.state != ExtensionState.DISABLED) | ||||
|             return; | ||||
|     log('Extension "%s" had error: %s'.format(uuid, message)); | ||||
|     _signals.emit('extension-state-changed', { uuid: uuid, | ||||
|                                                error: message, | ||||
|                                                state: extension.state }); | ||||
| } | ||||
|  | ||||
|         let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css']; | ||||
|         let theme = St.ThemeContext.get_for_stage(global.stage).get_theme(); | ||||
|         for (let i = 0; i < stylesheetNames.length; i++) { | ||||
|             try { | ||||
|                 let stylesheetFile = extension.dir.get_child(stylesheetNames[i]); | ||||
|                 theme.load_stylesheet(stylesheetFile); | ||||
|                 extension.stylesheet = stylesheetFile; | ||||
|                 break; | ||||
|             } catch (e) { | ||||
|                 if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND)) | ||||
|                     continue; // not an error | ||||
|                 this.logExtensionError(uuid, e); | ||||
| function loadExtension(extension) { | ||||
|     // Default to error, we set success as the last step | ||||
|     extension.state = ExtensionState.ERROR; | ||||
|  | ||||
|     let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY); | ||||
|  | ||||
|     if (checkVersion && ExtensionUtils.isOutOfDate(extension)) { | ||||
|         extension.state = ExtensionState.OUT_OF_DATE; | ||||
|     } else { | ||||
|         let enabled = enabledExtensions.indexOf(extension.uuid) != -1; | ||||
|         if (enabled) { | ||||
|             if (!initExtension(extension.uuid)) | ||||
|                 return; | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         try { | ||||
|             extension.stateObj.enable(); | ||||
|             extension.state = ExtensionState.ENABLED; | ||||
|             this._extensionOrder.push(uuid); | ||||
|             this.emit('extension-state-changed', extension); | ||||
|         } catch (e) { | ||||
|             if (extension.stylesheet) { | ||||
|                 theme.unload_stylesheet(extension.stylesheet); | ||||
|                 delete extension.stylesheet; | ||||
|             } | ||||
|             this.logExtensionError(uuid, e); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     enableExtension(uuid) { | ||||
|         if (!this._extensions.has(uuid)) | ||||
|             return false; | ||||
|  | ||||
|         let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY); | ||||
|         let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY); | ||||
|  | ||||
|         if (disabledExtensions.includes(uuid)) { | ||||
|             disabledExtensions = disabledExtensions.filter(item => item !== uuid); | ||||
|             global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions); | ||||
|         } | ||||
|  | ||||
|         if (!enabledExtensions.includes(uuid)) { | ||||
|             enabledExtensions.push(uuid); | ||||
|             global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions); | ||||
|         } | ||||
|  | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     disableExtension(uuid) { | ||||
|         if (!this._extensions.has(uuid)) | ||||
|             return false; | ||||
|  | ||||
|         let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY); | ||||
|         let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY); | ||||
|  | ||||
|         if (enabledExtensions.includes(uuid)) { | ||||
|             enabledExtensions = enabledExtensions.filter(item => item !== uuid); | ||||
|             global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions); | ||||
|         } | ||||
|  | ||||
|         if (!disabledExtensions.includes(uuid)) { | ||||
|             disabledExtensions.push(uuid); | ||||
|             global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions); | ||||
|         } | ||||
|  | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     logExtensionError(uuid, error) { | ||||
|         let extension = this.lookup(uuid); | ||||
|         if (!extension) | ||||
|             return; | ||||
|  | ||||
|         let message = `${error}`; | ||||
|  | ||||
|         extension.error = message; | ||||
|         extension.state = ExtensionState.ERROR; | ||||
|         if (!extension.errors) | ||||
|             extension.errors = []; | ||||
|         extension.errors.push(message); | ||||
|  | ||||
|         logError(error, `Extension ${uuid}`); | ||||
|         this.emit('extension-state-changed', extension); | ||||
|     } | ||||
|  | ||||
|     createExtensionObject(uuid, dir, type) { | ||||
|         let metadataFile = dir.get_child('metadata.json'); | ||||
|         if (!metadataFile.query_exists(null)) { | ||||
|             throw new Error('Missing metadata.json'); | ||||
|         } | ||||
|  | ||||
|         let metadataContents, success_; | ||||
|         try { | ||||
|             [success_, metadataContents] = metadataFile.load_contents(null); | ||||
|             if (metadataContents instanceof Uint8Array) | ||||
|                 metadataContents = imports.byteArray.toString(metadataContents); | ||||
|         } catch (e) { | ||||
|             throw new Error(`Failed to load metadata.json: ${e}`); | ||||
|         } | ||||
|         let meta; | ||||
|         try { | ||||
|             meta = JSON.parse(metadataContents); | ||||
|         } catch (e) { | ||||
|             throw new Error(`Failed to parse metadata.json: ${e}`); | ||||
|         } | ||||
|  | ||||
|         let requiredProperties = ['uuid', 'name', 'description', 'shell-version']; | ||||
|         for (let i = 0; i < requiredProperties.length; i++) { | ||||
|             let prop = requiredProperties[i]; | ||||
|             if (!meta[prop]) { | ||||
|                 throw new Error(`missing "${prop}" property in metadata.json`); | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         if (uuid != meta.uuid) { | ||||
|             throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`); | ||||
|         } | ||||
|  | ||||
|         let extension = { | ||||
|             metadata: meta, | ||||
|             uuid: meta.uuid, | ||||
|             type, | ||||
|             dir, | ||||
|             path: dir.get_path(), | ||||
|             error: '', | ||||
|             hasPrefs: dir.get_child('prefs.js').query_exists(null), | ||||
|             canChange: false | ||||
|         }; | ||||
|         this._extensions.set(uuid, extension); | ||||
|  | ||||
|         return extension; | ||||
|     } | ||||
|  | ||||
|     loadExtension(extension) { | ||||
|         // Default to error, we set success as the last step | ||||
|         extension.state = ExtensionState.ERROR; | ||||
|  | ||||
|         let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY); | ||||
|  | ||||
|         if (checkVersion && ExtensionUtils.isOutOfDate(extension)) { | ||||
|             extension.state = ExtensionState.OUT_OF_DATE; | ||||
|             if (extension.state == ExtensionState.DISABLED) | ||||
|                 enableExtension(extension.uuid); | ||||
|         } else { | ||||
|             let enabled = this._enabledExtensions.includes(extension.uuid); | ||||
|             if (enabled) { | ||||
|                 if (!this._callExtensionInit(extension.uuid)) | ||||
|                     return; | ||||
|                 if (extension.state == ExtensionState.DISABLED) | ||||
|                     this._callExtensionEnable(extension.uuid); | ||||
|             } else { | ||||
|                 extension.state = ExtensionState.INITIALIZED; | ||||
|             } | ||||
|             extension.state = ExtensionState.INITIALIZED; | ||||
|         } | ||||
|  | ||||
|         this._updateCanChange(extension); | ||||
|         this.emit('extension-state-changed', extension); | ||||
|     } | ||||
|  | ||||
|     unloadExtension(extension) { | ||||
|         // Try to disable it -- if it's ERROR'd, we can't guarantee that, | ||||
|         // but it will be removed on next reboot, and hopefully nothing | ||||
|         // broke too much. | ||||
|         this._callExtensionDisable(extension.uuid); | ||||
|     _signals.emit('extension-state-changed', extension); | ||||
| } | ||||
|  | ||||
|         extension.state = ExtensionState.UNINSTALLED; | ||||
|         this.emit('extension-state-changed', extension); | ||||
| function unloadExtension(extension) { | ||||
|     // Try to disable it -- if it's ERROR'd, we can't guarantee that, | ||||
|     // but it will be removed on next reboot, and hopefully nothing | ||||
|     // broke too much. | ||||
|     disableExtension(extension.uuid); | ||||
|  | ||||
|         this._extensions.delete(extension.uuid); | ||||
|         return true; | ||||
|     extension.state = ExtensionState.UNINSTALLED; | ||||
|     _signals.emit('extension-state-changed', extension); | ||||
|  | ||||
|     delete ExtensionUtils.extensions[extension.uuid]; | ||||
|     return true; | ||||
| } | ||||
|  | ||||
| function reloadExtension(oldExtension) { | ||||
|     // Grab the things we'll need to pass to createExtensionObject | ||||
|     // to reload it. | ||||
|     let { uuid: uuid, dir: dir, type: type } = oldExtension; | ||||
|  | ||||
|     // Then unload the old extension. | ||||
|     unloadExtension(oldExtension); | ||||
|  | ||||
|     // Now, recreate the extension and load it. | ||||
|     let newExtension; | ||||
|     try { | ||||
|         newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type); | ||||
|     } catch(e) { | ||||
|         logExtensionError(uuid, e); | ||||
|         return; | ||||
|     } | ||||
|  | ||||
|     reloadExtension(oldExtension) { | ||||
|         // Grab the things we'll need to pass to createExtensionObject | ||||
|         // to reload it. | ||||
|         let { uuid, dir, type } = oldExtension; | ||||
|     loadExtension(newExtension); | ||||
| } | ||||
|  | ||||
|         // Then unload the old extension. | ||||
|         this.unloadExtension(oldExtension); | ||||
| function initExtension(uuid) { | ||||
|     let extension = ExtensionUtils.extensions[uuid]; | ||||
|     let dir = extension.dir; | ||||
|  | ||||
|         // Now, recreate the extension and load it. | ||||
|         let newExtension; | ||||
|     if (!extension) | ||||
|         throw new Error("Extension was not properly created. Call loadExtension first"); | ||||
|  | ||||
|     let extensionJs = dir.get_child('extension.js'); | ||||
|     if (!extensionJs.query_exists(null)) { | ||||
|         logExtensionError(uuid, new Error('Missing extension.js')); | ||||
|         return false; | ||||
|     } | ||||
|  | ||||
|     let extensionModule; | ||||
|     let extensionState = null; | ||||
|  | ||||
|     ExtensionUtils.installImporter(extension); | ||||
|     try { | ||||
|         extensionModule = extension.imports.extension; | ||||
|     } catch(e) { | ||||
|         logExtensionError(uuid, e); | ||||
|         return false; | ||||
|     } | ||||
|  | ||||
|     if (extensionModule.init) { | ||||
|         try { | ||||
|             newExtension = this.createExtensionObject(uuid, dir, type); | ||||
|         } catch (e) { | ||||
|             this.logExtensionError(uuid, e); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         this.loadExtension(newExtension); | ||||
|     } | ||||
|  | ||||
|     _callExtensionInit(uuid) { | ||||
|         if (!Main.sessionMode.allowExtensions) | ||||
|             return false; | ||||
|  | ||||
|         let extension = this.lookup(uuid); | ||||
|         if (!extension) | ||||
|             throw new Error("Extension was not properly created. Call createExtensionObject first"); | ||||
|  | ||||
|         let dir = extension.dir; | ||||
|         let extensionJs = dir.get_child('extension.js'); | ||||
|         if (!extensionJs.query_exists(null)) { | ||||
|             this.logExtensionError(uuid, new Error('Missing extension.js')); | ||||
|             extensionState = extensionModule.init(extension); | ||||
|         } catch(e) { | ||||
|             logExtensionError(uuid, e); | ||||
|             return false; | ||||
|         } | ||||
|  | ||||
|         let extensionModule; | ||||
|         let extensionState = null; | ||||
|  | ||||
|         ExtensionUtils.installImporter(extension); | ||||
|         try { | ||||
|             extensionModule = extension.imports.extension; | ||||
|         } catch (e) { | ||||
|             this.logExtensionError(uuid, e); | ||||
|             return false; | ||||
|         } | ||||
|  | ||||
|         if (extensionModule.init) { | ||||
|             try { | ||||
|                 extensionState = extensionModule.init(extension); | ||||
|             } catch (e) { | ||||
|                 this.logExtensionError(uuid, e); | ||||
|                 return false; | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         if (!extensionState) | ||||
|             extensionState = extensionModule; | ||||
|         extension.stateObj = extensionState; | ||||
|  | ||||
|         extension.state = ExtensionState.DISABLED; | ||||
|         this.emit('extension-loaded', uuid); | ||||
|         return true; | ||||
|     } | ||||
|  | ||||
|     _getModeExtensions() { | ||||
|         if (Array.isArray(Main.sessionMode.enabledExtensions)) | ||||
|             return Main.sessionMode.enabledExtensions; | ||||
|         return []; | ||||
|     } | ||||
|     if (!extensionState) | ||||
|         extensionState = extensionModule; | ||||
|     extension.stateObj = extensionState; | ||||
|  | ||||
|     _updateCanChange(extension) { | ||||
|         let hasError = | ||||
|             extension.state == ExtensionState.ERROR || | ||||
|             extension.state == ExtensionState.OUT_OF_DATE; | ||||
|     extension.state = ExtensionState.DISABLED; | ||||
|     _signals.emit('extension-loaded', uuid); | ||||
|     return true; | ||||
| } | ||||
|  | ||||
|         let isMode = this._getModeExtensions().includes(extension.uuid); | ||||
|         let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY); | ||||
| function getEnabledExtensions() { | ||||
|     let extensions; | ||||
|     if (Array.isArray(Main.sessionMode.enabledExtensions)) | ||||
|         extensions = Main.sessionMode.enabledExtensions; | ||||
|     else | ||||
|         extensions = []; | ||||
|  | ||||
|         let changeKey = isMode | ||||
|             ? DISABLE_USER_EXTENSIONS_KEY | ||||
|             : ENABLED_EXTENSIONS_KEY; | ||||
|     if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY)) | ||||
|         return extensions; | ||||
|  | ||||
|         extension.canChange = | ||||
|             !hasError && | ||||
|             global.settings.is_writable(changeKey) && | ||||
|             (isMode || !modeOnly); | ||||
|     } | ||||
|     return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY)); | ||||
| } | ||||
|  | ||||
|     _getEnabledExtensions() { | ||||
|         let extensions = this._getModeExtensions(); | ||||
| function onEnabledExtensionsChanged() { | ||||
|     let newEnabledExtensions = getEnabledExtensions(); | ||||
|  | ||||
|         if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY)) | ||||
|             extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY)); | ||||
|     if (!enabled) | ||||
|         return; | ||||
|  | ||||
|         // filter out 'disabled-extensions' which takes precedence | ||||
|         let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY); | ||||
|         return extensions.filter(item => !disabledExtensions.includes(item)); | ||||
|     } | ||||
|     // Find and enable all the newly enabled extensions: UUIDs found in the | ||||
|     // new setting, but not in the old one. | ||||
|     newEnabledExtensions.filter( | ||||
|         uuid => !enabledExtensions.includes(uuid) | ||||
|     ).forEach(uuid => { | ||||
|         enableExtension(uuid); | ||||
|     }); | ||||
|  | ||||
|     _onUserExtensionsEnabledChanged() { | ||||
|         this._onEnabledExtensionsChanged(); | ||||
|         this._onSettingsWritableChanged(); | ||||
|     } | ||||
|     // Find and disable all the newly disabled extensions: UUIDs found in the | ||||
|     // old setting, but not in the new one. | ||||
|     enabledExtensions.filter( | ||||
|         item => !newEnabledExtensions.includes(item) | ||||
|     ).forEach(uuid => { | ||||
|         disableExtension(uuid); | ||||
|     }); | ||||
|  | ||||
|     _onEnabledExtensionsChanged() { | ||||
|         let newEnabledExtensions = this._getEnabledExtensions(); | ||||
|     enabledExtensions = newEnabledExtensions; | ||||
| } | ||||
|  | ||||
|         // Find and enable all the newly enabled extensions: UUIDs found in the | ||||
|         // new setting, but not in the old one. | ||||
|         newEnabledExtensions.filter( | ||||
|             uuid => !this._enabledExtensions.includes(uuid) | ||||
|         ).forEach(uuid => { | ||||
|             this._callExtensionEnable(uuid); | ||||
| function _onVersionValidationChanged() { | ||||
|     // we want to reload all extensions, but only enable | ||||
|     // extensions when allowed by the sessionMode, so | ||||
|     // temporarily disable them all | ||||
|     enabledExtensions = []; | ||||
|     for (let uuid in ExtensionUtils.extensions) | ||||
|         reloadExtension(ExtensionUtils.extensions[uuid]); | ||||
|     enabledExtensions = getEnabledExtensions(); | ||||
|  | ||||
|     if (Main.sessionMode.allowExtensions) { | ||||
|         enabledExtensions.forEach(uuid => { | ||||
|             enableExtension(uuid); | ||||
|         }); | ||||
|     } | ||||
| } | ||||
|  | ||||
|         // Find and disable all the newly disabled extensions: UUIDs found in the | ||||
|         // old setting, but not in the new one. | ||||
|         this._extensionOrder.filter( | ||||
|             uuid => !newEnabledExtensions.includes(uuid) | ||||
|         ).reverse().forEach(uuid => { | ||||
|             this._callExtensionDisable(uuid); | ||||
| function _loadExtensions() { | ||||
|     global.settings.connect('changed::' + ENABLED_EXTENSIONS_KEY, onEnabledExtensionsChanged); | ||||
|     global.settings.connect('changed::' + DISABLE_USER_EXTENSIONS_KEY, onEnabledExtensionsChanged); | ||||
|     global.settings.connect('changed::' + EXTENSION_DISABLE_VERSION_CHECK_KEY, _onVersionValidationChanged); | ||||
|  | ||||
|     enabledExtensions = getEnabledExtensions(); | ||||
|  | ||||
|     let finder = new ExtensionUtils.ExtensionFinder(); | ||||
|     finder.connect('extension-found', (finder, extension) => { | ||||
|         loadExtension(extension); | ||||
|     }); | ||||
|     finder.scanExtensions(); | ||||
| } | ||||
|  | ||||
| function enableAllExtensions() { | ||||
|     if (enabled) | ||||
|         return; | ||||
|  | ||||
|     if (!initted) { | ||||
|         _loadExtensions(); | ||||
|         initted = true; | ||||
|     } else { | ||||
|         enabledExtensions.forEach(uuid => { | ||||
|             enableExtension(uuid); | ||||
|         }); | ||||
|  | ||||
|         this._enabledExtensions = newEnabledExtensions; | ||||
|     } | ||||
|     enabled = true; | ||||
| } | ||||
|  | ||||
|     _onSettingsWritableChanged() { | ||||
|         for (let extension of this._extensions.values()) { | ||||
|             this._updateCanChange(extension); | ||||
|             this.emit('extension-state-changed', extension); | ||||
|         } | ||||
|     } | ||||
| function disableAllExtensions() { | ||||
|     if (!enabled) | ||||
|         return; | ||||
|  | ||||
|     _onVersionValidationChanged() { | ||||
|         // Disabling extensions modifies the order array, so use a copy | ||||
|         let extensionOrder = this._extensionOrder.slice(); | ||||
|  | ||||
|         // Disable enabled extensions in the reverse order first to avoid | ||||
|         // the "rebasing" done in _callExtensionDisable... | ||||
|     if (initted) { | ||||
|         extensionOrder.slice().reverse().forEach(uuid => { | ||||
|             this._callExtensionDisable(uuid); | ||||
|         }); | ||||
|  | ||||
|         // ...and then reload and enable extensions in the correct order again. | ||||
|         [...this._extensions.values()].sort((a, b) => { | ||||
|             return extensionOrder.indexOf(a.uuid) - extensionOrder.indexOf(b.uuid); | ||||
|         }).forEach(extension => this.reloadExtension(extension)); | ||||
|     } | ||||
|  | ||||
|     _loadExtensions() { | ||||
|         global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`, | ||||
|             this._onEnabledExtensionsChanged.bind(this)); | ||||
|         global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`, | ||||
|             this._onEnabledExtensionsChanged.bind(this)); | ||||
|         global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`, | ||||
|             this._onUserExtensionsEnabledChanged.bind(this)); | ||||
|         global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`, | ||||
|             this._onVersionValidationChanged.bind(this)); | ||||
|         global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`, | ||||
|             this._onSettingsWritableChanged.bind(this)); | ||||
|         global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`, | ||||
|             this._onSettingsWritableChanged.bind(this)); | ||||
|  | ||||
|         this._enabledExtensions = this._getEnabledExtensions(); | ||||
|  | ||||
|         let perUserDir = Gio.File.new_for_path(global.userdatadir); | ||||
|         FileUtils.collectFromDatadirs('extensions', true, (dir, info) => { | ||||
|             let fileType = info.get_file_type(); | ||||
|             if (fileType != Gio.FileType.DIRECTORY) | ||||
|                 return; | ||||
|             let uuid = info.get_name(); | ||||
|             let existing = this.lookup(uuid); | ||||
|             if (existing) { | ||||
|                 log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`); | ||||
|                 return; | ||||
|             } | ||||
|  | ||||
|             let extension; | ||||
|             let type = dir.has_prefix(perUserDir) | ||||
|                 ? ExtensionType.PER_USER | ||||
|                 : ExtensionType.SYSTEM; | ||||
|             try { | ||||
|                 extension = this.createExtensionObject(uuid, dir, type); | ||||
|             } catch (e) { | ||||
|                 logError(e, `Could not load extension ${uuid}`); | ||||
|                 return; | ||||
|             } | ||||
|             this.loadExtension(extension); | ||||
|             disableExtension(uuid); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     _enableAllExtensions() { | ||||
|         if (this._enabled) | ||||
|             return; | ||||
|     enabled = false; | ||||
| } | ||||
|  | ||||
|         if (!this._initialized) { | ||||
|             this._loadExtensions(); | ||||
|             this._initialized = true; | ||||
|         } else { | ||||
|             this._enabledExtensions.forEach(uuid => { | ||||
|                 this._callExtensionEnable(uuid); | ||||
|             }); | ||||
|         } | ||||
|         this._enabled = true; | ||||
| function _sessionUpdated() { | ||||
|     // For now sessionMode.allowExtensions controls extensions from both the | ||||
|     // 'enabled-extensions' preference and the sessionMode.enabledExtensions | ||||
|     // property; it might make sense to make enabledExtensions independent | ||||
|     // from allowExtensions in the future | ||||
|     if (Main.sessionMode.allowExtensions) { | ||||
|         if (initted) | ||||
|             enabledExtensions = getEnabledExtensions(); | ||||
|         enableAllExtensions(); | ||||
|     } else { | ||||
|         disableAllExtensions(); | ||||
|     } | ||||
| } | ||||
|  | ||||
|     _disableAllExtensions() { | ||||
|         if (!this._enabled) | ||||
|             return; | ||||
|  | ||||
|         if (this._initialized) { | ||||
|             this._extensionOrder.slice().reverse().forEach(uuid => { | ||||
|                 this._callExtensionDisable(uuid); | ||||
|             }); | ||||
|         } | ||||
|  | ||||
|         this._enabled = false; | ||||
|     } | ||||
|  | ||||
|     _sessionUpdated() { | ||||
|         // For now sessionMode.allowExtensions controls extensions from both the | ||||
|         // 'enabled-extensions' preference and the sessionMode.enabledExtensions | ||||
|         // property; it might make sense to make enabledExtensions independent | ||||
|         // from allowExtensions in the future | ||||
|         if (Main.sessionMode.allowExtensions) { | ||||
|             // Take care of added or removed sessionMode extensions | ||||
|             this._onEnabledExtensionsChanged(); | ||||
|             this._enableAllExtensions(); | ||||
|         } else { | ||||
|             this._disableAllExtensions(); | ||||
|         } | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(ExtensionManager.prototype); | ||||
| function init() { | ||||
|     Main.sessionMode.connect('updated', _sessionUpdated); | ||||
|     _sessionUpdated(); | ||||
| } | ||||
|   | ||||
| @@ -49,15 +49,15 @@ var FocusCaretTracker = class FocusCaretTracker { | ||||
|             this._atspiInited = true; | ||||
|         } | ||||
|  | ||||
|         return this._atspiInited; | ||||
| 	return this._atspiInited; | ||||
|     } | ||||
|  | ||||
|     registerFocusListener() { | ||||
|         if (!this._initAtspi() || this._focusListenerRegistered) | ||||
|             return; | ||||
|  | ||||
|         this._atspiListener.register(`${STATECHANGED}:focused`); | ||||
|         this._atspiListener.register(`${STATECHANGED}:selected`); | ||||
|         this._atspiListener.register(STATECHANGED + ':focused'); | ||||
|         this._atspiListener.register(STATECHANGED + ':selected'); | ||||
|         this._focusListenerRegistered = true; | ||||
|     } | ||||
|  | ||||
| @@ -73,8 +73,8 @@ var FocusCaretTracker = class FocusCaretTracker { | ||||
|         if (!this._focusListenerRegistered) | ||||
|             return; | ||||
|  | ||||
|         this._atspiListener.deregister(`${STATECHANGED}:focused`); | ||||
|         this._atspiListener.deregister(`${STATECHANGED}:selected`); | ||||
|         this._atspiListener.deregister(STATECHANGED + ':focused'); | ||||
|         this._atspiListener.deregister(STATECHANGED + ':selected'); | ||||
|         this._focusListenerRegistered = false; | ||||
|     } | ||||
|  | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported GrabHelper */ | ||||
|  | ||||
| const { Clutter, St } = imports.gi; | ||||
|  | ||||
| @@ -88,7 +87,7 @@ var GrabHelper = class GrabHelper { | ||||
|     _isWithinGrabbedActor(actor) { | ||||
|         let currentActor = this.currentGrab.actor; | ||||
|         while (actor) { | ||||
|             if (this._actors.includes(actor)) | ||||
|             if (this._actors.indexOf(actor) != -1) | ||||
|                 return true; | ||||
|             if (actor == currentActor) | ||||
|                 return true; | ||||
|   | ||||
| @@ -1,33 +1,21 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported CandidatePopup */ | ||||
|  | ||||
| const { Clutter, GObject, IBus, St } = imports.gi; | ||||
| const { Clutter, IBus, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const BoxPointer = imports.ui.boxpointer; | ||||
| const Main = imports.ui.main; | ||||
|  | ||||
| var MAX_CANDIDATES_PER_PAGE = 16; | ||||
|  | ||||
| var DEFAULT_INDEX_LABELS = ['1', '2', '3', '4', '5', '6', '7', '8', | ||||
|                             '9', '0', 'a', 'b', 'c', 'd', 'e', 'f']; | ||||
| var DEFAULT_INDEX_LABELS = [ '1', '2', '3', '4', '5', '6', '7', '8', | ||||
|                              '9', '0', 'a', 'b', 'c', 'd', 'e', 'f' ]; | ||||
|  | ||||
| var CandidateArea = GObject.registerClass({ | ||||
|     Signals: { | ||||
|         'candidate-clicked': { param_types: [GObject.TYPE_UINT, | ||||
|                                              GObject.TYPE_UINT, | ||||
|                                              Clutter.ModifierType.$gtype] }, | ||||
|         'cursor-down': {}, | ||||
|         'cursor-up': {}, | ||||
|         'next-page': {}, | ||||
|         'previous-page': {}, | ||||
|     } | ||||
| }, class CandidateArea extends St.BoxLayout { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             vertical: true, | ||||
|             reactive: true, | ||||
|             visible: false | ||||
|         }); | ||||
| var CandidateArea = class CandidateArea { | ||||
|     constructor() { | ||||
|         this.actor = new St.BoxLayout({ vertical: true, | ||||
|                                         reactive: true, | ||||
|                                         visible: false }); | ||||
|         this._candidateBoxes = []; | ||||
|         for (let i = 0; i < MAX_CANDIDATES_PER_PAGE; ++i) { | ||||
|             let box = new St.BoxLayout({ style_class: 'candidate-box', | ||||
| @@ -38,7 +26,7 @@ var CandidateArea = GObject.registerClass({ | ||||
|             box.add(box._indexLabel, { y_fill: false }); | ||||
|             box.add(box._candidateLabel, { y_fill: false }); | ||||
|             this._candidateBoxes.push(box); | ||||
|             this.add(box); | ||||
|             this.actor.add(box); | ||||
|  | ||||
|             let j = i; | ||||
|             box.connect('button-release-event', (actor, event) => { | ||||
| @@ -47,6 +35,19 @@ var CandidateArea = GObject.registerClass({ | ||||
|             }); | ||||
|         } | ||||
|  | ||||
|         this.actor.connect('scroll-event', (actor, event) => { | ||||
|             let direction = event.get_scroll_direction(); | ||||
|             switch(direction) { | ||||
|             case Clutter.ScrollDirection.UP: | ||||
|                 this.emit('cursor-up'); | ||||
|                 break; | ||||
|             case Clutter.ScrollDirection.DOWN: | ||||
|                 this.emit('cursor-down'); | ||||
|                 break; | ||||
|             }; | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|         }); | ||||
|  | ||||
|         this._buttonBox = new St.BoxLayout({ style_class: 'candidate-page-button-box' }); | ||||
|  | ||||
|         this._previousButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-previous button' }); | ||||
| @@ -57,7 +58,7 @@ var CandidateArea = GObject.registerClass({ | ||||
|         this._nextButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' }); | ||||
|         this._buttonBox.add(this._nextButton, { expand: true }); | ||||
|  | ||||
|         this.add(this._buttonBox); | ||||
|         this.actor.add(this._buttonBox); | ||||
|  | ||||
|         this._previousButton.connect('clicked', () => { | ||||
|             this.emit('previous-page'); | ||||
| @@ -70,18 +71,6 @@ var CandidateArea = GObject.registerClass({ | ||||
|         this._cursorPosition = 0; | ||||
|     } | ||||
|  | ||||
|     vfunc_scroll_event(scrollEvent) { | ||||
|         switch (scrollEvent.direction) { | ||||
|         case Clutter.ScrollDirection.UP: | ||||
|             this.emit('cursor-up'); | ||||
|             break; | ||||
|         case Clutter.ScrollDirection.DOWN: | ||||
|             this.emit('cursor-down'); | ||||
|             break; | ||||
|         } | ||||
|         return Clutter.EVENT_PROPAGATE; | ||||
|     } | ||||
|  | ||||
|     setOrientation(orientation) { | ||||
|         if (this._orientation == orientation) | ||||
|             return; | ||||
| @@ -89,15 +78,15 @@ var CandidateArea = GObject.registerClass({ | ||||
|         this._orientation = orientation; | ||||
|  | ||||
|         if (this._orientation == IBus.Orientation.HORIZONTAL) { | ||||
|             this.vertical = false; | ||||
|             this.remove_style_class_name('vertical'); | ||||
|             this.add_style_class_name('horizontal'); | ||||
|             this.actor.vertical = false; | ||||
|             this.actor.remove_style_class_name('vertical'); | ||||
|             this.actor.add_style_class_name('horizontal'); | ||||
|             this._previousButton.child.icon_name = 'go-previous-symbolic'; | ||||
|             this._nextButton.child.icon_name = 'go-next-symbolic'; | ||||
|         } else {                // VERTICAL || SYSTEM | ||||
|             this.vertical = true; | ||||
|             this.add_style_class_name('vertical'); | ||||
|             this.remove_style_class_name('horizontal'); | ||||
|             this.actor.vertical = true; | ||||
|             this.actor.add_style_class_name('vertical'); | ||||
|             this.actor.remove_style_class_name('horizontal'); | ||||
|             this._previousButton.child.icon_name = 'go-up-symbolic'; | ||||
|             this._nextButton.child.icon_name = 'go-down-symbolic'; | ||||
|         } | ||||
| @@ -131,23 +120,19 @@ var CandidateArea = GObject.registerClass({ | ||||
|         this._previousButton.reactive = wrapsAround || page > 0; | ||||
|         this._nextButton.reactive = wrapsAround || page < nPages - 1; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(CandidateArea.prototype); | ||||
|  | ||||
| var CandidatePopup = GObject.registerClass( | ||||
| class IbusCandidatePopup extends BoxPointer.BoxPointer { | ||||
|     _init() { | ||||
|         super._init(St.Side.TOP); | ||||
|         this.visible = false; | ||||
|         this.style_class = 'candidate-popup-boxpointer'; | ||||
|  | ||||
|         this._dummyCursor = new St.Widget({ opacity: 0 }); | ||||
|         Main.layoutManager.uiGroup.add_actor(this._dummyCursor); | ||||
|  | ||||
|         Main.layoutManager.addChrome(this); | ||||
| var CandidatePopup = class CandidatePopup { | ||||
|     constructor() { | ||||
|         this._boxPointer = new BoxPointer.BoxPointer(St.Side.TOP); | ||||
|         this._boxPointer.visible = false; | ||||
|         this._boxPointer.style_class = 'candidate-popup-boxpointer'; | ||||
|         Main.layoutManager.addChrome(this._boxPointer); | ||||
|  | ||||
|         let box = new St.BoxLayout({ style_class: 'candidate-popup-content', | ||||
|                                      vertical: true }); | ||||
|         this.bin.set_child(box); | ||||
|         this._boxPointer.bin.set_child(box); | ||||
|  | ||||
|         this._preeditText = new St.Label({ style_class: 'candidate-popup-text', | ||||
|                                            visible: false }); | ||||
| @@ -158,7 +143,7 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer { | ||||
|         box.add(this._auxText); | ||||
|  | ||||
|         this._candidateArea = new CandidateArea(); | ||||
|         box.add(this._candidateArea); | ||||
|         box.add(this._candidateArea.actor); | ||||
|  | ||||
|         this._candidateArea.connect('previous-page', () => { | ||||
|             this._panelService.page_up(); | ||||
| @@ -196,7 +181,7 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer { | ||||
|                 let window = global.display.focus_window.get_compositor_private(); | ||||
|                 this._setDummyCursorGeometry(window.x + x, window.y + y, w, h); | ||||
|             }); | ||||
|         } catch (e) { | ||||
|         } catch(e) { | ||||
|             // Only recent IBus versions have support for this signal | ||||
|             // which is used for wayland clients. In order to work | ||||
|             // with older IBus versions we can silently ignore the | ||||
| @@ -213,30 +198,30 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer { | ||||
|                 this._setTextAttributes(this._preeditText.clutter_text, | ||||
|                                         attrs); | ||||
|         }); | ||||
|         panelService.connect('show-preedit-text', () => { | ||||
|         panelService.connect('show-preedit-text', ps => { | ||||
|             this._preeditText.show(); | ||||
|             this._updateVisibility(); | ||||
|         }); | ||||
|         panelService.connect('hide-preedit-text', () => { | ||||
|         panelService.connect('hide-preedit-text', ps => { | ||||
|             this._preeditText.hide(); | ||||
|             this._updateVisibility(); | ||||
|         }); | ||||
|         panelService.connect('update-auxiliary-text', (_ps, text, visible) => { | ||||
|         panelService.connect('update-auxiliary-text', (ps, text, visible) => { | ||||
|             this._auxText.visible = visible; | ||||
|             this._updateVisibility(); | ||||
|  | ||||
|             this._auxText.text = text.get_text(); | ||||
|         }); | ||||
|         panelService.connect('show-auxiliary-text', () => { | ||||
|         panelService.connect('show-auxiliary-text', ps => { | ||||
|             this._auxText.show(); | ||||
|             this._updateVisibility(); | ||||
|         }); | ||||
|         panelService.connect('hide-auxiliary-text', () => { | ||||
|         panelService.connect('hide-auxiliary-text', ps => { | ||||
|             this._auxText.hide(); | ||||
|             this._updateVisibility(); | ||||
|         }); | ||||
|         panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => { | ||||
|             this._candidateArea.visible = visible; | ||||
|         panelService.connect('update-lookup-table', (ps, lookupTable, visible) => { | ||||
|             this._candidateArea.actor.visible = visible; | ||||
|             this._updateVisibility(); | ||||
|  | ||||
|             let nCandidates = lookupTable.get_number_of_candidates(); | ||||
| @@ -250,7 +235,7 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer { | ||||
|             let indexes = []; | ||||
|             let indexLabel; | ||||
|             for (let i = 0; (indexLabel = lookupTable.get_label(i)); ++i) | ||||
|                 indexes.push(indexLabel.get_text()); | ||||
|                  indexes.push(indexLabel.get_text()); | ||||
|  | ||||
|             Main.keyboard.resetSuggestions(); | ||||
|  | ||||
| @@ -271,40 +256,38 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer { | ||||
|             this._candidateArea.setOrientation(lookupTable.get_orientation()); | ||||
|             this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages); | ||||
|         }); | ||||
|         panelService.connect('show-lookup-table', () => { | ||||
|             this._candidateArea.show(); | ||||
|         panelService.connect('show-lookup-table', ps => { | ||||
|             this._candidateArea.actor.show(); | ||||
|             this._updateVisibility(); | ||||
|         }); | ||||
|         panelService.connect('hide-lookup-table', () => { | ||||
|             this._candidateArea.hide(); | ||||
|         panelService.connect('hide-lookup-table', ps => { | ||||
|             this._candidateArea.actor.hide(); | ||||
|             this._updateVisibility(); | ||||
|         }); | ||||
|         panelService.connect('focus-out', () => { | ||||
|             this.close(BoxPointer.PopupAnimation.NONE); | ||||
|         panelService.connect('focus-out', ps => { | ||||
|             this._boxPointer.close(BoxPointer.PopupAnimation.NONE); | ||||
|             Main.keyboard.resetSuggestions(); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     _setDummyCursorGeometry(x, y, w, h) { | ||||
|         this._dummyCursor.set_position(Math.round(x), Math.round(y)); | ||||
|         this._dummyCursor.set_size(Math.round(w), Math.round(h)); | ||||
|  | ||||
|         if (this.visible) | ||||
|             this.setPosition(this._dummyCursor, 0); | ||||
|         Main.layoutManager.setDummyCursorGeometry(x, y, w, h); | ||||
|         if (this._boxPointer.visible) | ||||
|             this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0); | ||||
|     } | ||||
|  | ||||
|     _updateVisibility() { | ||||
|         let isVisible = (!Main.keyboard.visible && | ||||
|                          (this._preeditText.visible || | ||||
|                           this._auxText.visible || | ||||
|                           this._candidateArea.visible)); | ||||
|                           this._candidateArea.actor.visible)); | ||||
|  | ||||
|         if (isVisible) { | ||||
|             this.setPosition(this._dummyCursor, 0); | ||||
|             this.open(BoxPointer.PopupAnimation.NONE); | ||||
|             this.raise_top(); | ||||
|             this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0); | ||||
|             this._boxPointer.open(BoxPointer.PopupAnimation.NONE); | ||||
|             this._boxPointer.raise_top(); | ||||
|         } else { | ||||
|             this.close(BoxPointer.PopupAnimation.NONE); | ||||
|             this._boxPointer.close(BoxPointer.PopupAnimation.NONE); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -314,4 +297,4 @@ class IbusCandidatePopup extends BoxPointer.BoxPointer { | ||||
|             if (attr.get_attr_type() == IBus.AttrType.BACKGROUND) | ||||
|                 clutterText.set_selection(attr.get_start_index(), attr.get_end_index()); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|   | ||||
| @@ -1,22 +1,22 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported BaseIcon, IconGrid, PaginatedIconGrid */ | ||||
|  | ||||
| const { Clutter, GLib, GObject, Graphene, Meta, St } = imports.gi; | ||||
| const { Clutter, GObject, Meta, St } = imports.gi; | ||||
|  | ||||
| const Params = imports.misc.params; | ||||
| const Tweener = imports.ui.tweener; | ||||
| const Main = imports.ui.main; | ||||
|  | ||||
| var ICON_SIZE = 96; | ||||
| var MIN_ICON_SIZE = 16; | ||||
|  | ||||
| var EXTRA_SPACE_ANIMATION_TIME = 250; | ||||
| var EXTRA_SPACE_ANIMATION_TIME = 0.25; | ||||
|  | ||||
| var ANIMATION_TIME_IN = 350; | ||||
| var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN; | ||||
| var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN; | ||||
| var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM; | ||||
| var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2 / 3 * ANIMATION_TIME_OUT; | ||||
| var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1 / 4 * ANIMATION_TIME_IN; | ||||
| var ANIMATION_TIME_IN = 0.350; | ||||
| var ANIMATION_TIME_OUT = 1/2 * ANIMATION_TIME_IN; | ||||
| var ANIMATION_MAX_DELAY_FOR_ITEM = 2/3 * ANIMATION_TIME_IN; | ||||
| var ANIMATION_BASE_DELAY_FOR_ITEM = 1/4 * ANIMATION_MAX_DELAY_FOR_ITEM; | ||||
| var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2/3 * ANIMATION_TIME_OUT; | ||||
| var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1/4 * ANIMATION_TIME_IN; | ||||
|  | ||||
| var ANIMATION_BOUNCE_ICON_SCALE = 1.1; | ||||
|  | ||||
| @@ -26,7 +26,7 @@ var AnimationDirection = { | ||||
| }; | ||||
|  | ||||
| var APPICON_ANIMATION_OUT_SCALE = 3; | ||||
| var APPICON_ANIMATION_OUT_TIME = 250; | ||||
| var APPICON_ANIMATION_OUT_TIME = 0.25; | ||||
|  | ||||
| var BaseIcon = GObject.registerClass( | ||||
| class BaseIcon extends St.Bin { | ||||
| @@ -56,10 +56,6 @@ class BaseIcon extends St.Bin { | ||||
|  | ||||
|         if (params.showLabel) { | ||||
|             this.label = new St.Label({ text: label }); | ||||
|             this.label.clutter_text.set({ | ||||
|                 x_align: Clutter.ActorAlign.CENTER, | ||||
|                 y_align: Clutter.ActorAlign.CENTER | ||||
|             }); | ||||
|             this._box.add_actor(this.label); | ||||
|         } else { | ||||
|             this.label = null; | ||||
| @@ -75,14 +71,14 @@ class BaseIcon extends St.Bin { | ||||
|         this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this)); | ||||
|     } | ||||
|  | ||||
|     vfunc_get_preferred_width(_forHeight) { | ||||
|     vfunc_get_preferred_width(forHeight) { | ||||
|         // Return the actual height to keep the squared aspect | ||||
|         return this.get_preferred_height(-1); | ||||
|     } | ||||
|  | ||||
|     // This can be overridden by a subclass, or by the createIcon | ||||
|     // parameter to _init() | ||||
|     createIcon(_size) { | ||||
|     createIcon(size) { | ||||
|         throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`); | ||||
|     } | ||||
|  | ||||
| @@ -141,30 +137,17 @@ class BaseIcon extends St.Bin { | ||||
|         // animating. | ||||
|         zoomOutActor(this.child); | ||||
|     } | ||||
|  | ||||
|     animateZoomOutAtPos(x, y) { | ||||
|         zoomOutActorAtPos(this.child, x, y); | ||||
|     } | ||||
|  | ||||
|     update() { | ||||
|         this._createIconTexture(this.iconSize); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| function clamp(value, min, max) { | ||||
|     return Math.max(Math.min(value, max), min); | ||||
| } | ||||
| }; | ||||
|  | ||||
| function zoomOutActor(actor) { | ||||
|     let [x, y] = actor.get_transformed_position(); | ||||
|     zoomOutActorAtPos(actor, x, y); | ||||
| } | ||||
|  | ||||
| function zoomOutActorAtPos(actor, x, y) { | ||||
|     let actorClone = new Clutter.Clone({ source: actor, | ||||
|                                          reactive: false }); | ||||
|     let [width, height] = actor.get_transformed_size(); | ||||
|  | ||||
|     let [x, y] = actor.get_transformed_position(); | ||||
|     actorClone.set_size(width, height); | ||||
|     actorClone.set_position(x, y); | ||||
|     actorClone.opacity = 255; | ||||
| @@ -181,21 +164,23 @@ function zoomOutActorAtPos(actor, x, y) { | ||||
|     let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth); | ||||
|     let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight); | ||||
|  | ||||
|     actorClone.ease({ | ||||
|         scale_x: APPICON_ANIMATION_OUT_SCALE, | ||||
|         scale_y: APPICON_ANIMATION_OUT_SCALE, | ||||
|         translation_x: containedX - scaledX, | ||||
|         translation_y: containedY - scaledY, | ||||
|         opacity: 0, | ||||
|         duration: APPICON_ANIMATION_OUT_TIME, | ||||
|         mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|         onComplete: () => actorClone.destroy() | ||||
|     }); | ||||
|     Tweener.addTween(actorClone, | ||||
|                      { time: APPICON_ANIMATION_OUT_TIME, | ||||
|                        scale_x: APPICON_ANIMATION_OUT_SCALE, | ||||
|                        scale_y: APPICON_ANIMATION_OUT_SCALE, | ||||
|                        translation_x: containedX - scaledX, | ||||
|                        translation_y: containedY - scaledY, | ||||
|                        opacity: 0, | ||||
|                        transition: 'easeOutQuad', | ||||
|                        onComplete() { | ||||
|                            actorClone.destroy(); | ||||
|                        } | ||||
|                     }); | ||||
| } | ||||
|  | ||||
| var IconGrid = GObject.registerClass({ | ||||
|     Signals: { 'animation-done': {}, | ||||
|                'child-focused': { param_types: [Clutter.Actor.$gtype] } }, | ||||
|     Signals: {'animation-done': {}, | ||||
|               'child-focused': { param_types: [Clutter.Actor.$gtype]} }, | ||||
| }, class IconGrid extends St.Widget { | ||||
|     _init(params) { | ||||
|         super._init({ style_class: 'icon-grid', | ||||
| @@ -221,8 +206,6 @@ var IconGrid = GObject.registerClass({ | ||||
|         this.rightPadding = 0; | ||||
|         this.leftPadding = 0; | ||||
|  | ||||
|         this._updateIconSizesLaterId = 0; | ||||
|  | ||||
|         this._items = []; | ||||
|         this._clonesAnimating = []; | ||||
|         // Pulled from CSS, but hardcode some defaults here | ||||
| @@ -231,23 +214,15 @@ var IconGrid = GObject.registerClass({ | ||||
|         this._fixedHItemSize = this._fixedVItemSize = undefined; | ||||
|         this.connect('style-changed', this._onStyleChanged.bind(this)); | ||||
|  | ||||
|         this.connect('actor-added', this._childAdded.bind(this)); | ||||
|         this.connect('actor-removed', this._childRemoved.bind(this)); | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|     } | ||||
|  | ||||
|     vfunc_unmap() { | ||||
|         // Cancel animations when hiding the overview, to avoid icons | ||||
|         // swarming into the void ... | ||||
|         this._resetAnimationActors(); | ||||
|         super.vfunc_unmap(); | ||||
|     } | ||||
|         this.connect('notify::mapped', () => { | ||||
|             if (!this.mapped) | ||||
|                 this._cancelAnimation(); | ||||
|         }); | ||||
|  | ||||
|     _onDestroy() { | ||||
|         if (this._updateIconSizesLaterId) { | ||||
|             Meta.later_remove (this._updateIconSizesLaterId); | ||||
|             this._updateIconSizesLaterId = 0; | ||||
|         } | ||||
|         this.connect('actor-added', this._childAdded.bind(this)); | ||||
|         this.connect('actor-removed', this._childRemoved.bind(this)); | ||||
|     } | ||||
|  | ||||
|     _keyFocusIn(actor) { | ||||
| @@ -256,35 +231,22 @@ var IconGrid = GObject.registerClass({ | ||||
|  | ||||
|     _childAdded(grid, child) { | ||||
|         child._iconGridKeyFocusInId = child.connect('key-focus-in', this._keyFocusIn.bind(this)); | ||||
|  | ||||
|         child._paintVisible = child.opacity > 0; | ||||
|         child._opacityChangedId = child.connect('notify::opacity', () => { | ||||
|             let paintVisible = child._paintVisible; | ||||
|             child._paintVisible = child.opacity > 0; | ||||
|             if (paintVisible !== child._paintVisible) | ||||
|                 this.queue_relayout(); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     _childRemoved(grid, child) { | ||||
|         child.disconnect(child._iconGridKeyFocusInId); | ||||
|         delete child._iconGridKeyFocusInId; | ||||
|  | ||||
|         child.disconnect(child._opacityChangedId); | ||||
|         delete child._opacityChangedId; | ||||
|         delete child._paintVisible; | ||||
|     } | ||||
|  | ||||
|     vfunc_get_preferred_width(_forHeight) { | ||||
|     vfunc_get_preferred_width(forHeight) { | ||||
|         if (this._fillParent) | ||||
|             // Ignore all size requests of children and request a size of 0; | ||||
|             // later we'll allocate as many children as fit the parent | ||||
|             return [0, 0]; | ||||
|  | ||||
|         let nChildren = this.get_n_children(); | ||||
|         let nColumns = this._colLimit | ||||
|             ? Math.min(this._colLimit, nChildren) | ||||
|             : nChildren; | ||||
|         let nColumns = this._colLimit ? Math.min(this._colLimit, | ||||
|                                                  nChildren) | ||||
|                                       : nChildren; | ||||
|         let totalSpacing = Math.max(0, nColumns - 1) * this._getSpacing(); | ||||
|         // Kind of a lie, but not really an issue right now.  If | ||||
|         // we wanted to support some sort of hidden/overflow that would | ||||
| @@ -314,7 +276,7 @@ var IconGrid = GObject.registerClass({ | ||||
|         if (forWidth < 0) | ||||
|             nColumns = children.length; | ||||
|         else | ||||
|             [nColumns] = this._computeLayout(forWidth); | ||||
|             [nColumns, ] = this._computeLayout(forWidth); | ||||
|  | ||||
|         let nRows; | ||||
|         if (nColumns > 0) | ||||
| @@ -349,15 +311,15 @@ var IconGrid = GObject.registerClass({ | ||||
|         let [nColumns, usedWidth] = this._computeLayout(availWidth); | ||||
|  | ||||
|         let leftEmptySpace; | ||||
|         switch (this._xAlign) { | ||||
|         case St.Align.START: | ||||
|             leftEmptySpace = 0; | ||||
|             break; | ||||
|         case St.Align.MIDDLE: | ||||
|             leftEmptySpace = Math.floor((availWidth - usedWidth) / 2); | ||||
|             break; | ||||
|         case St.Align.END: | ||||
|             leftEmptySpace = availWidth - usedWidth; | ||||
|         switch(this._xAlign) { | ||||
|             case St.Align.START: | ||||
|                 leftEmptySpace = 0; | ||||
|                 break; | ||||
|             case St.Align.MIDDLE: | ||||
|                 leftEmptySpace = Math.floor((availWidth - usedWidth) / 2); | ||||
|                 break; | ||||
|             case St.Align.END: | ||||
|                 leftEmptySpace = availWidth - usedWidth; | ||||
|         } | ||||
|  | ||||
|         let animating = this._clonesAnimating.length > 0; | ||||
| @@ -402,7 +364,7 @@ var IconGrid = GObject.registerClass({ | ||||
|         let allocationBox = this.get_allocation_box(); | ||||
|         let paintBox = themeNode.get_paint_box(allocationBox); | ||||
|  | ||||
|         let origin = new Graphene.Point3D(); | ||||
|         let origin = new Clutter.Vertex(); | ||||
|         origin.x = paintBox.x1 - allocationBox.x1; | ||||
|         origin.y = paintBox.y1 - allocationBox.y1; | ||||
|         origin.z = 0.0; | ||||
| @@ -415,15 +377,15 @@ var IconGrid = GObject.registerClass({ | ||||
|             return true; | ||||
|  | ||||
|         for (let child = this.get_first_child(); | ||||
|             child != null; | ||||
|             child = child.get_next_sibling()) { | ||||
|              child != null; | ||||
|              child = child.get_next_sibling()) { | ||||
|  | ||||
|             if (!child.visible || !child.opacity) | ||||
|                 continue; | ||||
|  | ||||
|             let childVolume = child.get_transformed_paint_volume(this); | ||||
|             if (!childVolume) | ||||
|                 return false; | ||||
|                 return false | ||||
|  | ||||
|             paintVolume.union(childVolume); | ||||
|         } | ||||
| @@ -436,20 +398,21 @@ var IconGrid = GObject.registerClass({ | ||||
|      * set of items to be animated. | ||||
|      */ | ||||
|     _getChildrenToAnimate() { | ||||
|         return this._getVisibleChildren().filter(child => child.opacity > 0); | ||||
|         return this._getVisibleChildren(); | ||||
|     } | ||||
|  | ||||
|     _resetAnimationActors() { | ||||
|     _cancelAnimation() { | ||||
|         this._clonesAnimating.forEach(clone => { clone.destroy(); }); | ||||
|         this._clonesAnimating = []; | ||||
|     } | ||||
|  | ||||
|     _animationDone() { | ||||
|         this._clonesAnimating.forEach(clone => { | ||||
|             clone.source.reactive = true; | ||||
|             clone.source.opacity = 255; | ||||
|             clone.destroy(); | ||||
|         }); | ||||
|         this._clonesAnimating = []; | ||||
|     } | ||||
|  | ||||
|     _animationDone() { | ||||
|         this._resetAnimationActors(); | ||||
|         this.emit('animation-done'); | ||||
|     } | ||||
|  | ||||
| @@ -458,7 +421,7 @@ var IconGrid = GObject.registerClass({ | ||||
|             throw new GObject.NotImplementedError("Pulse animation only implements " + | ||||
|                                                   "'in' animation direction"); | ||||
|  | ||||
|         this._resetAnimationActors(); | ||||
|         this._cancelAnimation(); | ||||
|  | ||||
|         let actors = this._getChildrenToAnimate(); | ||||
|         if (actors.length == 0) { | ||||
| @@ -481,32 +444,30 @@ var IconGrid = GObject.registerClass({ | ||||
|             let delay = index / actors.length * maxDelay; | ||||
|             let bounceUpTime = ANIMATION_TIME_IN / 4; | ||||
|             let isLastItem = index == actors.length - 1; | ||||
|             actor.ease({ | ||||
|                 scale_x: ANIMATION_BOUNCE_ICON_SCALE, | ||||
|                 scale_y: ANIMATION_BOUNCE_ICON_SCALE, | ||||
|                 duration: bounceUpTime, | ||||
|                 mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, | ||||
|                 delay: delay, | ||||
|                 onComplete: () => { | ||||
|                     let duration = ANIMATION_TIME_IN - bounceUpTime; | ||||
|                     actor.ease({ | ||||
|                         scale_x: 1, | ||||
|                         scale_y: 1, | ||||
|                         duration, | ||||
|                         mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, | ||||
|                         onComplete: () => { | ||||
|                             if (isLastItem) | ||||
|                                 this._animationDone(); | ||||
|                             actor.reactive = true; | ||||
|                         } | ||||
|                     }); | ||||
|                 } | ||||
|             }); | ||||
|             Tweener.addTween(actor, | ||||
|                             { time: bounceUpTime, | ||||
|                               transition: 'easeInOutQuad', | ||||
|                               delay: delay, | ||||
|                               scale_x: ANIMATION_BOUNCE_ICON_SCALE, | ||||
|                               scale_y: ANIMATION_BOUNCE_ICON_SCALE, | ||||
|                               onComplete: () => { | ||||
|                                   Tweener.addTween(actor, | ||||
|                                                    { time: ANIMATION_TIME_IN - bounceUpTime, | ||||
|                                                      transition: 'easeInOutQuad', | ||||
|                                                      scale_x: 1, | ||||
|                                                      scale_y: 1, | ||||
|                                                      onComplete: () => { | ||||
|                                                         if (isLastItem) | ||||
|                                                             this._animationDone(); | ||||
|                                                     } | ||||
|                                                    }); | ||||
|                               } | ||||
|                             }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     animateSpring(animationDirection, sourceActor) { | ||||
|         this._resetAnimationActors(); | ||||
|         this._cancelAnimation(); | ||||
|  | ||||
|         let actors = this._getChildrenToAnimate(); | ||||
|         if (actors.length == 0) { | ||||
| @@ -543,7 +504,7 @@ var IconGrid = GObject.registerClass({ | ||||
|             this._clonesAnimating.push(actorClone); | ||||
|             Main.uiGroup.add_actor(actorClone); | ||||
|  | ||||
|             let [width, height] = this._getAllocatedChildSizeAndSpacing(actor); | ||||
|             let [width, height,,] = this._getAllocatedChildSizeAndSpacing(actor); | ||||
|             actorClone.set_size(width, height); | ||||
|             let scaleX = sourceScaledWidth / width; | ||||
|             let scaleY = sourceScaledHeight / height; | ||||
| @@ -560,25 +521,21 @@ var IconGrid = GObject.registerClass({ | ||||
|  | ||||
|                 let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM; | ||||
|                 let [finalX, finalY]  = actor._transformedPosition; | ||||
|                 movementParams = { | ||||
|                     x: finalX, | ||||
|                     y: finalY, | ||||
|                     scale_x: 1, | ||||
|                     scale_y: 1, | ||||
|                     duration: ANIMATION_TIME_IN, | ||||
|                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, | ||||
|                     delay | ||||
|                 }; | ||||
|  | ||||
|                 if (isLastItem) | ||||
|                     movementParams.onComplete = this._animationDone.bind(this); | ||||
|  | ||||
|                 fadeParams = { | ||||
|                     opacity: 255, | ||||
|                     duration: ANIMATION_FADE_IN_TIME_FOR_ITEM, | ||||
|                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, | ||||
|                     delay | ||||
|                 }; | ||||
|                 movementParams = { time: ANIMATION_TIME_IN, | ||||
|                                    transition: 'easeInOutQuad', | ||||
|                                    delay: delay, | ||||
|                                    x: finalX, | ||||
|                                    y: finalY, | ||||
|                                    scale_x: 1, | ||||
|                                    scale_y: 1, | ||||
|                                    onComplete: () => { | ||||
|                                        if (isLastItem) | ||||
|                                            this._animationDone(); | ||||
|                                    }}; | ||||
|                 fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM, | ||||
|                                transition: 'easeInOutQuad', | ||||
|                                delay: delay, | ||||
|                                opacity: 255 }; | ||||
|             } else { | ||||
|                 let isLastItem = actor._distance == maxDist; | ||||
|  | ||||
| @@ -586,29 +543,26 @@ var IconGrid = GObject.registerClass({ | ||||
|                 actorClone.set_position(startX, startY); | ||||
|  | ||||
|                 let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM; | ||||
|                 movementParams = { | ||||
|                     x: adjustedSourcePositionX, | ||||
|                     y: adjustedSourcePositionY, | ||||
|                     scale_x: scaleX, | ||||
|                     scale_y: scaleY, | ||||
|                     duration: ANIMATION_TIME_OUT, | ||||
|                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, | ||||
|                     delay | ||||
|                 }; | ||||
|  | ||||
|                 if (isLastItem) | ||||
|                     movementParams.onComplete = this._animationDone.bind(this); | ||||
|  | ||||
|                 fadeParams = { | ||||
|                     opacity: 0, | ||||
|                     duration: ANIMATION_FADE_IN_TIME_FOR_ITEM, | ||||
|                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, | ||||
|                     delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM | ||||
|                 }; | ||||
|                 movementParams = { time: ANIMATION_TIME_OUT, | ||||
|                                    transition: 'easeInOutQuad', | ||||
|                                    delay: delay, | ||||
|                                    x: adjustedSourcePositionX, | ||||
|                                    y: adjustedSourcePositionY, | ||||
|                                    scale_x: scaleX, | ||||
|                                    scale_y: scaleY, | ||||
|                                    onComplete: () => { | ||||
|                                        if (isLastItem) | ||||
|                                            this._animationDone(); | ||||
|                                    }}; | ||||
|                 fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM, | ||||
|                                transition: 'easeInOutQuad', | ||||
|                                delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM, | ||||
|                                opacity: 0 }; | ||||
|             } | ||||
|  | ||||
|             actorClone.ease(movementParams); | ||||
|             actorClone.ease(fadeParams); | ||||
|  | ||||
|             Tweener.addTween(actorClone, movementParams); | ||||
|             Tweener.addTween(actorClone, fadeParams); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -648,8 +602,6 @@ var IconGrid = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _computeLayout(forWidth) { | ||||
|         this.ensure_style(); | ||||
|  | ||||
|         let nColumns = 0; | ||||
|         let usedWidth = this.leftPadding + this.rightPadding; | ||||
|         let spacing = this._getSpacing(); | ||||
| @@ -717,13 +669,13 @@ var IconGrid = GObject.registerClass({ | ||||
|  | ||||
|         this._items.push(item); | ||||
|         if (index !== undefined) | ||||
|             this.insert_child_at_index(item, index); | ||||
|             this.insert_child_at_index(item.actor, index); | ||||
|         else | ||||
|             this.add_actor(item); | ||||
|             this.add_actor(item.actor); | ||||
|     } | ||||
|  | ||||
|     removeItem(item) { | ||||
|         this.remove_child(item); | ||||
|         this.remove_child(item.actor); | ||||
|     } | ||||
|  | ||||
|     getItemAtIndex(index) { | ||||
| @@ -758,8 +710,8 @@ var IconGrid = GObject.registerClass({ | ||||
|         if (this._padWithSpacing) { | ||||
|             // minRows + 1 because we want to put spacing before the first row, so it is like we have one more row | ||||
|             // to divide the empty space | ||||
|             maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows + 1)); | ||||
|             maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns + 1)); | ||||
|             maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows +1)); | ||||
|             maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns +1)); | ||||
|         } else { | ||||
|             if (this._minRows <=  1) | ||||
|                 maxVSpacing = maxEmptyVArea; | ||||
| @@ -791,39 +743,36 @@ var IconGrid = GObject.registerClass({ | ||||
|         this._fixedHItemSize = this._hItemSize; | ||||
|         this._fixedVItemSize = this._vItemSize; | ||||
|         this._updateSpacingForSize(availWidth, availHeight); | ||||
|         let spacing = this._getSpacing(); | ||||
|  | ||||
|         if (this.columnsForWidth(availWidth) < this._minColumns || this.rowsForHeight(availHeight) < this._minRows) { | ||||
|             let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth; | ||||
|             let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight; | ||||
|             let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth ; | ||||
|             let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight ; | ||||
|  | ||||
|             let neededSpacePerItem = (neededWidth > neededHeight) | ||||
|                 ? Math.ceil(neededWidth / this._minColumns) | ||||
|                 : Math.ceil(neededHeight / this._minRows); | ||||
|             let neededSpacePerItem = (neededWidth > neededHeight) ? Math.ceil(neededWidth / this._minColumns) | ||||
|                                                                   : Math.ceil(neededHeight / this._minRows); | ||||
|             this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE); | ||||
|             this._fixedVItemSize = Math.max(this._vItemSize - neededSpacePerItem, MIN_ICON_SIZE); | ||||
|  | ||||
|             this._updateSpacingForSize(availWidth, availHeight); | ||||
|         } | ||||
|         if (!this._updateIconSizesLaterId) | ||||
|             this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW, | ||||
|                                                           this._updateIconSizes.bind(this)); | ||||
|         Meta.later_add(Meta.LaterType.BEFORE_REDRAW, | ||||
|                        this._updateIconSizes.bind(this)); | ||||
|     } | ||||
|  | ||||
|     // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up | ||||
|     _updateIconSizes() { | ||||
|         this._updateIconSizesLaterId = 0; | ||||
|         let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize); | ||||
|         let newIconSize = Math.floor(ICON_SIZE * scale); | ||||
|         for (let i in this._items) { | ||||
|             this._items[i].icon.setIconSize(newIconSize); | ||||
|         } | ||||
|         return GLib.SOURCE_REMOVE; | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var PaginatedIconGrid = GObject.registerClass({ | ||||
|     Signals: { 'space-opened': {}, | ||||
|                'space-closed': {} }, | ||||
|     Signals: {'space-opened': {}, | ||||
|               'space-closed': {} }, | ||||
| }, class PaginatedIconGrid extends IconGrid { | ||||
|     _init(params) { | ||||
|         super._init(params); | ||||
| @@ -834,13 +783,13 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|         this._childrenPerPage = 0; | ||||
|     } | ||||
|  | ||||
|     vfunc_get_preferred_height(_forWidth) { | ||||
|     vfunc_get_preferred_height(forWidth) { | ||||
|         let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages; | ||||
|         return [height, height]; | ||||
|     } | ||||
|  | ||||
|     vfunc_allocate(box, flags) { | ||||
|         if (this._childrenPerPage == 0) | ||||
|          if (this._childrenPerPage == 0) | ||||
|             log('computePages() must be called before allocate(); pagination will not work.'); | ||||
|  | ||||
|         this.set_allocation(box, flags); | ||||
| @@ -853,24 +802,26 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|         } | ||||
|         let children = this._getVisibleChildren(); | ||||
|         let availWidth = box.x2 - box.x1; | ||||
|         let availHeight = box.y2 - box.y1; | ||||
|         let spacing = this._getSpacing(); | ||||
|         let [nColumns, usedWidth] = this._computeLayout(availWidth); | ||||
|  | ||||
|         let leftEmptySpace; | ||||
|         switch (this._xAlign) { | ||||
|         case St.Align.START: | ||||
|             leftEmptySpace = 0; | ||||
|             break; | ||||
|         case St.Align.MIDDLE: | ||||
|             leftEmptySpace = Math.floor((availWidth - usedWidth) / 2); | ||||
|             break; | ||||
|         case St.Align.END: | ||||
|             leftEmptySpace = availWidth - usedWidth; | ||||
|         switch(this._xAlign) { | ||||
|             case St.Align.START: | ||||
|                 leftEmptySpace = 0; | ||||
|                 break; | ||||
|             case St.Align.MIDDLE: | ||||
|                 leftEmptySpace = Math.floor((availWidth - usedWidth) / 2); | ||||
|                 break; | ||||
|             case St.Align.END: | ||||
|                 leftEmptySpace = availWidth - usedWidth; | ||||
|         } | ||||
|  | ||||
|         let x = box.x1 + leftEmptySpace + this.leftPadding; | ||||
|         let y = box.y1 + this.topPadding; | ||||
|         let columnIndex = 0; | ||||
|         let rowIndex = 0; | ||||
|  | ||||
|         for (let i = 0; i < children.length; i++) { | ||||
|             let childBox = this._calculateChildBox(children[i], x, y, box); | ||||
| @@ -880,21 +831,21 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|             columnIndex++; | ||||
|             if (columnIndex == nColumns) { | ||||
|                 columnIndex = 0; | ||||
|                 rowIndex++; | ||||
|             } | ||||
|             if (columnIndex == 0) { | ||||
|                 y += this._getVItemSize() + spacing; | ||||
|                 if ((i + 1) % this._childrenPerPage == 0) | ||||
|                     y +=  this._spaceBetweenPages - spacing + this.bottomPadding + this.topPadding; | ||||
|                 x = box.x1 + leftEmptySpace + this.leftPadding; | ||||
|             } else { | ||||
|             } else | ||||
|                 x += this._getHItemSize() + spacing; | ||||
|             } | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     // Overridden from IconGrid | ||||
|     _getChildrenToAnimate() { | ||||
|         let children = super._getChildrenToAnimate(); | ||||
|         let children = this._getVisibleChildren(); | ||||
|         let firstIndex = this._childrenPerPage * this.currentPage; | ||||
|         let lastIndex = firstIndex + this._childrenPerPage; | ||||
|  | ||||
| @@ -902,7 +853,7 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _computePages(availWidthPerPage, availHeightPerPage) { | ||||
|         let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage); | ||||
|         let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage); | ||||
|         let nRows; | ||||
|         let children = this._getVisibleChildren(); | ||||
|         if (nColumns > 0) | ||||
| @@ -912,6 +863,7 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|         if (this._rowLimit) | ||||
|             nRows = Math.min(nRows, this._rowLimit); | ||||
|  | ||||
|         let spacing = this._getSpacing(); | ||||
|         // We want to contain the grid inside the parent box with padding | ||||
|         this._rowsPerPage = this.rowsForHeight(availHeightPerPage); | ||||
|         this._nPages = Math.ceil(nRows / this._rowsPerPage); | ||||
| @@ -940,7 +892,7 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|         if (!this._nPages) | ||||
|             return 0; | ||||
|  | ||||
|         let firstPageItem = pageNumber * this._childrenPerPage; | ||||
|         let firstPageItem = pageNumber * this._childrenPerPage | ||||
|         let childBox = this._getVisibleChildren()[firstPageItem].get_allocation_box(); | ||||
|         return childBox.y1 - this.topPadding; | ||||
|     } | ||||
| @@ -963,7 +915,7 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|     */ | ||||
|     openExtraSpace(sourceItem, side, nRows) { | ||||
|         let children = this._getVisibleChildren(); | ||||
|         let index = children.indexOf(sourceItem); | ||||
|         let index = children.indexOf(sourceItem.actor); | ||||
|         if (index == -1) | ||||
|             throw new Error('Item not found.'); | ||||
|  | ||||
| @@ -973,7 +925,8 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|         let childrenPerRow = this._childrenPerPage / this._rowsPerPage; | ||||
|         let sourceRow = Math.floor((index - pageOffset) / childrenPerRow); | ||||
|  | ||||
|         let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1 : sourceRow; | ||||
|         let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1 | ||||
|                                                : sourceRow; | ||||
|         let nRowsBelow = this._rowsPerPage - nRowsAbove; | ||||
|  | ||||
|         let nRowsUp, nRowsDown; | ||||
| @@ -1013,14 +966,13 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|  | ||||
|         for (let i = 0; i < children.length; i++) { | ||||
|             children[i].translation_y = 0; | ||||
|             let params = { | ||||
|                 translation_y: translationY, | ||||
|                 duration: EXTRA_SPACE_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD | ||||
|             }; | ||||
|             let params = { translation_y: translationY, | ||||
|                            time: EXTRA_SPACE_ANIMATION_TIME, | ||||
|                            transition: 'easeInOutQuad' | ||||
|                          }; | ||||
|             if (i == (children.length - 1)) | ||||
|                 params.onComplete = () => this.emit('space-opened'); | ||||
|             children[i].ease(params); | ||||
|                 params.onComplete = () => { this.emit('space-opened'); }; | ||||
|             Tweener.addTween(children[i], params); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -1033,12 +985,12 @@ var PaginatedIconGrid = GObject.registerClass({ | ||||
|         for (let i = 0; i < this._translatedChildren.length; i++) { | ||||
|             if (!this._translatedChildren[i].translation_y) | ||||
|                 continue; | ||||
|             this._translatedChildren[i].ease({ | ||||
|                 translation_y: 0, | ||||
|                 duration: EXTRA_SPACE_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, | ||||
|                 onComplete: () => this.emit('space-closed') | ||||
|             }); | ||||
|             Tweener.addTween(this._translatedChildren[i], | ||||
|                              { translation_y: 0, | ||||
|                                time: EXTRA_SPACE_ANIMATION_TIME, | ||||
|                                transition: 'easeInOutQuad', | ||||
|                                onComplete: () => { this.emit('space-closed'); } | ||||
|                              }); | ||||
|         } | ||||
|     } | ||||
| }); | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported InhibitShortcutsDialog */ | ||||
| const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi; | ||||
|  | ||||
| const Dialog = imports.ui.dialog; | ||||
| @@ -76,9 +75,8 @@ var InhibitShortcutsDialog = GObject.registerClass({ | ||||
|         let name = this._app ? this._app.get_name() : this._window.title; | ||||
|  | ||||
|         /* Translators: %s is an application name like "Settings" */ | ||||
|         let title = name | ||||
|             ? _("%s wants to inhibit shortcuts").format(name) | ||||
|             : _("Application wants to inhibit shortcuts"); | ||||
|         let title = name ? _("%s wants to inhibit shortcuts").format(name) | ||||
|                          : _("Application wants to inhibit shortcuts"); | ||||
|         let icon = new Gio.ThemedIcon({ name: 'dialog-warning-symbolic' }); | ||||
|  | ||||
|         let contentParams = { icon, title }; | ||||
| @@ -113,7 +111,7 @@ var InhibitShortcutsDialog = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     vfunc_show() { | ||||
|         if (this._app && APP_WHITELIST.includes(this._app.get_id())) { | ||||
|         if (this._app && APP_WHITELIST.indexOf(this._app.get_id()) != -1) { | ||||
|             this._emitResponse(DialogResponse.ALLOW); | ||||
|             return; | ||||
|         } | ||||
| @@ -141,7 +139,7 @@ var InhibitShortcutsDialog = GObject.registerClass({ | ||||
|                         return; | ||||
|                     } | ||||
|  | ||||
|                     let [permissions] = res; | ||||
|                     let [permissions, data] = res; | ||||
|                     if (permissions[appId] === undefined) // Not found | ||||
|                         this._dialog.open(); | ||||
|                     else if (permissions[appId] == GRANTED) | ||||
|   | ||||
| @@ -1,4 +1,3 @@ | ||||
| /* exported KbdA11yDialog */ | ||||
| const { Clutter, Gio, GObject } = imports.gi; | ||||
|  | ||||
| const Dialog = imports.ui.dialog; | ||||
| @@ -27,24 +26,24 @@ class KbdA11yDialog extends GObject.Object { | ||||
|  | ||||
|         if (whatChanged & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) { | ||||
|             key = KEY_SLOW_KEYS_ENABLED; | ||||
|             enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) > 0; | ||||
|             title = enabled | ||||
|                 ? _("Slow Keys Turned On") | ||||
|                 : _("Slow Keys Turned Off"); | ||||
|             enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) ? true : false; | ||||
|             title = enabled ? | ||||
|                     _("Slow Keys Turned On") : | ||||
|                     _("Slow Keys Turned Off"); | ||||
|             body = _("You just held down the Shift key for 8 seconds. This is the shortcut " + | ||||
|                      "for the Slow Keys feature, which affects the way your keyboard works."); | ||||
|  | ||||
|         } else  if (whatChanged & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) { | ||||
|             key = KEY_STICKY_KEYS_ENABLED; | ||||
|             enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) > 0; | ||||
|             title = enabled | ||||
|                 ? _("Sticky Keys Turned On") | ||||
|                 : _("Sticky Keys Turned Off"); | ||||
|             body = enabled | ||||
|                 ? _("You just pressed the Shift key 5 times in a row. This is the shortcut " + | ||||
|                   "for the Sticky Keys feature, which affects the way your keyboard works.") | ||||
|                 : _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " + | ||||
|                   "This turns off the Sticky Keys feature, which affects the way your keyboard works."); | ||||
|             enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) ? true : false; | ||||
|             title = enabled ? | ||||
|                     _("Sticky Keys Turned On") : | ||||
|                     _("Sticky Keys Turned Off"); | ||||
|             body = enabled ? | ||||
|                    _("You just pressed the Shift key 5 times in a row. This is the shortcut " + | ||||
|                      "for the Sticky Keys feature, which affects the way your keyboard works.") : | ||||
|                    _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " + | ||||
|                      "This turns off the Sticky Keys feature, which affects the way your keyboard works."); | ||||
|         } else { | ||||
|             return; | ||||
|         } | ||||
|   | ||||
										
											
												File diff suppressed because it is too large
												Load Diff
											
										
									
								
							
							
								
								
									
										235
									
								
								js/ui/layout.js
									
									
									
									
									
								
							
							
						
						
									
										235
									
								
								js/ui/layout.js
									
									
									
									
									
								
							| @@ -1,7 +1,6 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported MonitorConstraint, LayoutManager */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
| const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Background = imports.ui.background; | ||||
| @@ -11,17 +10,18 @@ const LoginManager = imports.misc.loginManager; | ||||
| const DND = imports.ui.dnd; | ||||
| const Main = imports.ui.main; | ||||
| const Params = imports.misc.params; | ||||
| const Tweener = imports.ui.tweener; | ||||
| const Ripples = imports.ui.ripples; | ||||
|  | ||||
| var STARTUP_ANIMATION_TIME = 500; | ||||
| var KEYBOARD_ANIMATION_TIME = 150; | ||||
| var BACKGROUND_FADE_ANIMATION_TIME = 1000; | ||||
| var STARTUP_ANIMATION_TIME = 0.5; | ||||
| var KEYBOARD_ANIMATION_TIME = 0.15; | ||||
| var BACKGROUND_FADE_ANIMATION_TIME = 1.0; | ||||
|  | ||||
| var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels | ||||
| var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms | ||||
|  | ||||
| function isPopupMetaWindow(actor) { | ||||
|     switch (actor.meta_window.get_window_type()) { | ||||
|     switch(actor.meta_window.get_window_type()) { | ||||
|     case Meta.WindowType.DROPDOWN_MENU: | ||||
|     case Meta.WindowType.POPUP_MENU: | ||||
|     case Meta.WindowType.COMBO: | ||||
| @@ -32,20 +32,18 @@ function isPopupMetaWindow(actor) { | ||||
| } | ||||
|  | ||||
| var MonitorConstraint = GObject.registerClass({ | ||||
|     Properties: { | ||||
|         'primary': GObject.ParamSpec.boolean('primary', | ||||
|                                              'Primary', 'Track primary monitor', | ||||
|                                              GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                              false), | ||||
|         'index': GObject.ParamSpec.int('index', | ||||
|                                        'Monitor index', 'Track specific monitor', | ||||
|                                        GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                        -1, 64, -1), | ||||
|         'work-area': GObject.ParamSpec.boolean('work-area', | ||||
|                                                'Work-area', 'Track monitor\'s work-area', | ||||
|                                                GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                                false) | ||||
|     }, | ||||
|     Properties: {'primary': GObject.ParamSpec.boolean('primary',  | ||||
|                                                       'Primary', 'Track primary monitor', | ||||
|                                                       GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                                       false), | ||||
|                  'index': GObject.ParamSpec.int('index', | ||||
|                                                 'Monitor index', 'Track specific monitor', | ||||
|                                                 GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                                 -1, 64, -1), | ||||
|                  'work-area': GObject.ParamSpec.boolean('work-area', | ||||
|                                                         'Work-area', 'Track monitor\'s work-area', | ||||
|                                                         GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                                         false)}, | ||||
| }, class MonitorConstraint extends Clutter.Constraint { | ||||
|     _init(props) { | ||||
|         this._primary = false; | ||||
| @@ -80,12 +78,10 @@ var MonitorConstraint = GObject.registerClass({ | ||||
|         this.notify('index'); | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     get work_area() { | ||||
|         return this._workArea; | ||||
|     } | ||||
|  | ||||
|     // eslint-disable-next-line camelcase | ||||
|     set work_area(v) { | ||||
|         if (v == this._workArea) | ||||
|             return; | ||||
| @@ -151,13 +147,13 @@ var MonitorConstraint = GObject.registerClass({ | ||||
| }); | ||||
|  | ||||
| var Monitor = class Monitor { | ||||
|     constructor(index, geometry, geometryScale) { | ||||
|     constructor(index, geometry, geometry_scale) { | ||||
|         this.index = index; | ||||
|         this.x = geometry.x; | ||||
|         this.y = geometry.y; | ||||
|         this.width = geometry.width; | ||||
|         this.height = geometry.height; | ||||
|         this.geometry_scale = geometryScale; | ||||
|         this.geometry_scale = geometry_scale; | ||||
|     } | ||||
|  | ||||
|     get inFullscreen() { | ||||
| @@ -167,12 +163,12 @@ var Monitor = class Monitor { | ||||
|  | ||||
| const UiActor = GObject.registerClass( | ||||
| class UiActor extends St.Widget { | ||||
|     vfunc_get_preferred_width (_forHeight) { | ||||
|     vfunc_get_preferred_width (forHeight) { | ||||
|         let width = global.stage.width; | ||||
|         return [width, width]; | ||||
|     } | ||||
|  | ||||
|     vfunc_get_preferred_height (_forWidth) { | ||||
|     vfunc_get_preferred_height (forWidth) { | ||||
|         let height = global.stage.height; | ||||
|         return [height, height]; | ||||
|     } | ||||
| @@ -238,12 +234,11 @@ var LayoutManager = GObject.registerClass({ | ||||
|                                              reactive: true }); | ||||
|         this.addChrome(this.overviewGroup); | ||||
|  | ||||
|         this.screenShieldGroup = new St.Widget({ | ||||
|             name: 'screenShieldGroup', | ||||
|             visible: false, | ||||
|             clip_to_allocation: true, | ||||
|             layout_manager: new Clutter.BinLayout(), | ||||
|         }); | ||||
|         this.screenShieldGroup = new St.Widget({ name: 'screenShieldGroup', | ||||
|                                                  visible: false, | ||||
|                                                  clip_to_allocation: true, | ||||
|                                                  layout_manager: new Clutter.BinLayout(), | ||||
|                                                }); | ||||
|         this.addChrome(this.screenShieldGroup); | ||||
|  | ||||
|         this.panelBox = new St.BoxLayout({ name: 'panelBox', | ||||
| @@ -277,13 +272,6 @@ var LayoutManager = GObject.registerClass({ | ||||
|         this._backgroundGroup.lower_bottom(); | ||||
|         this._bgManagers = []; | ||||
|  | ||||
|         this._interfaceSettings = new Gio.Settings({ | ||||
|             schema_id: 'org.gnome.desktop.interface' | ||||
|         }); | ||||
|  | ||||
|         this._interfaceSettings.connect('changed::enable-hot-corners', | ||||
|                                         this._updateHotCorners.bind(this)); | ||||
|  | ||||
|         // Need to update struts on new workspaces when they are added | ||||
|         let workspaceManager = global.workspace_manager; | ||||
|         workspaceManager.connect('notify::n-workspaces', | ||||
| @@ -387,11 +375,6 @@ var LayoutManager = GObject.registerClass({ | ||||
|         }); | ||||
|         this.hotCorners = []; | ||||
|  | ||||
|         if (!this._interfaceSettings.get_boolean('enable-hot-corners')) { | ||||
|             this.emit('hot-corners-changed'); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         let size = this.panelBox.height; | ||||
|  | ||||
|         // build new hot corners | ||||
| @@ -464,11 +447,10 @@ var LayoutManager = GObject.registerClass({ | ||||
|                 let backgroundActor = this._bgManagers[i].backgroundActor; | ||||
|                 backgroundActor.show(); | ||||
|                 backgroundActor.opacity = 0; | ||||
|                 backgroundActor.ease({ | ||||
|                     opacity: 255, | ||||
|                     duration: BACKGROUND_FADE_ANIMATION_TIME, | ||||
|                     mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|                 }); | ||||
|                 Tweener.addTween(backgroundActor, | ||||
|                                  { opacity: 255, | ||||
|                                    time: BACKGROUND_FADE_ANIMATION_TIME, | ||||
|                                    transition: 'easeOutQuad' }); | ||||
|             } | ||||
|         } | ||||
|     } | ||||
| @@ -606,17 +588,17 @@ var LayoutManager = GObject.registerClass({ | ||||
|             return; | ||||
|         } | ||||
|         this._systemBackground = new Background.SystemBackground(); | ||||
|         this._systemBackground.hide(); | ||||
|         this._systemBackground.actor.hide(); | ||||
|  | ||||
|         global.stage.insert_child_below(this._systemBackground, null); | ||||
|         global.stage.insert_child_below(this._systemBackground.actor, null); | ||||
|  | ||||
|         let constraint = new Clutter.BindConstraint({ source: global.stage, | ||||
|                                                       coordinate: Clutter.BindCoordinate.ALL }); | ||||
|         this._systemBackground.add_constraint(constraint); | ||||
|         this._systemBackground.actor.add_constraint(constraint); | ||||
|  | ||||
|         let signalId = this._systemBackground.connect('loaded', () => { | ||||
|             this._systemBackground.disconnect(signalId); | ||||
|             this._systemBackground.show(); | ||||
|             this._systemBackground.actor.show(); | ||||
|             global.stage.show(); | ||||
|  | ||||
|             this._prepareStartupAnimation(); | ||||
| @@ -699,30 +681,30 @@ var LayoutManager = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _startupAnimationGreeter() { | ||||
|         this.panelBox.ease({ | ||||
|             translation_y: 0, | ||||
|             duration: STARTUP_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => this._startupAnimationComplete() | ||||
|         }); | ||||
|         Tweener.addTween(this.panelBox, | ||||
|                          { translation_y: 0, | ||||
|                            time: STARTUP_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: this._startupAnimationComplete, | ||||
|                            onCompleteScope: this }); | ||||
|     } | ||||
|  | ||||
|     _startupAnimationSession() { | ||||
|         this.uiGroup.ease({ | ||||
|             scale_x: 1, | ||||
|             scale_y: 1, | ||||
|             opacity: 255, | ||||
|             duration: STARTUP_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => this._startupAnimationComplete() | ||||
|         }); | ||||
|         Tweener.addTween(this.uiGroup, | ||||
|                          { scale_x: 1, | ||||
|                            scale_y: 1, | ||||
|                            opacity: 255, | ||||
|                            time: STARTUP_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: this._startupAnimationComplete, | ||||
|                            onCompleteScope: this }); | ||||
|     } | ||||
|  | ||||
|     _startupAnimationComplete() { | ||||
|         this._coverPane.destroy(); | ||||
|         this._coverPane = null; | ||||
|  | ||||
|         this._systemBackground.destroy(); | ||||
|         this._systemBackground.actor.destroy(); | ||||
|         this._systemBackground = null; | ||||
|  | ||||
|         this._startingUp = false; | ||||
| @@ -741,15 +723,14 @@ var LayoutManager = GObject.registerClass({ | ||||
|  | ||||
|     showKeyboard() { | ||||
|         this.keyboardBox.show(); | ||||
|         this.keyboardBox.ease({ | ||||
|             anchor_y: this.keyboardBox.height, | ||||
|             opacity: 255, | ||||
|             duration: KEYBOARD_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => { | ||||
|                 this._showKeyboardComplete(); | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(this.keyboardBox, | ||||
|                          { anchor_y: this.keyboardBox.height, | ||||
|                            opacity: 255, | ||||
|                            time: KEYBOARD_ANIMATION_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: this._showKeyboardComplete, | ||||
|                            onCompleteScope: this | ||||
|                          }); | ||||
|         this.emit('keyboard-visible-changed', true); | ||||
|     } | ||||
|  | ||||
| @@ -768,15 +749,14 @@ var LayoutManager = GObject.registerClass({ | ||||
|             this.keyboardBox.disconnect(this._keyboardHeightNotifyId); | ||||
|             this._keyboardHeightNotifyId = 0; | ||||
|         } | ||||
|         this.keyboardBox.ease({ | ||||
|             anchor_y: 0, | ||||
|             opacity: 0, | ||||
|             duration: immediate ? 0 : KEYBOARD_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_IN_QUAD, | ||||
|             onComplete: () => { | ||||
|                 this._hideKeyboardComplete(); | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(this.keyboardBox, | ||||
|                          { anchor_y: 0, | ||||
|                            opacity: 0, | ||||
|                            time: immediate ? 0 : KEYBOARD_ANIMATION_TIME, | ||||
|                            transition: 'easeInQuad', | ||||
|                            onComplete: this._hideKeyboardComplete, | ||||
|                            onCompleteScope: this | ||||
|                          }); | ||||
|  | ||||
|         this.emit('keyboard-visible-changed', false); | ||||
|     } | ||||
| @@ -847,7 +827,7 @@ var LayoutManager = GObject.registerClass({ | ||||
|     // @params can have any of the same values as in addChrome(), | ||||
|     // though some possibilities don't make sense. By default, @actor has | ||||
|     // the same params as its chrome ancestor. | ||||
|     trackChrome(actor, params = {}) { | ||||
|     trackChrome(actor, params) { | ||||
|         let ancestor = actor.get_parent(); | ||||
|         let index = this._findActor(ancestor); | ||||
|         while (ancestor && index == -1) { | ||||
| @@ -855,13 +835,14 @@ var LayoutManager = GObject.registerClass({ | ||||
|             index = this._findActor(ancestor); | ||||
|         } | ||||
|  | ||||
|         let ancestorData = ancestor | ||||
|             ? this._trackedActors[index] | ||||
|             : defaultParams; | ||||
|         let ancestorData = ancestor ? this._trackedActors[index] | ||||
|                                     : defaultParams; | ||||
|         if (!params) | ||||
|             params = {}; | ||||
|         // We can't use Params.parse here because we want to drop | ||||
|         // the extra values like ancestorData.actor | ||||
|         for (let prop in defaultParams) { | ||||
|             if (!Object.prototype.hasOwnProperty.call(params, prop)) | ||||
|             if (!params.hasOwnProperty(prop)) | ||||
|                 params[prop] = ancestorData[prop]; | ||||
|         } | ||||
|  | ||||
| @@ -1015,6 +996,11 @@ var LayoutManager = GObject.registerClass({ | ||||
|         if (Main.modalCount > 0) | ||||
|             return GLib.SOURCE_REMOVE; | ||||
|  | ||||
|         // Bug workaround - get_transformed_position()/get_transformed_size() don't work after | ||||
|         // a change in stage size until the first pick or paint. | ||||
|         // https://bugzilla.gnome.org/show_bug.cgi?id=761565 | ||||
|         global.stage.get_actor_at_pos(Clutter.PickMode.ALL, 0, 0); | ||||
|  | ||||
|         let rects = [], struts = [], i; | ||||
|         let isPopupMenuVisible = global.top_window_group.get_children().some(isPopupMetaWindow); | ||||
|         let wantsInputRegion = !isPopupMenuVisible; | ||||
| @@ -1070,19 +1056,18 @@ var LayoutManager = GObject.registerClass({ | ||||
|                         side = Meta.Side.RIGHT; | ||||
|                     else | ||||
|                         continue; | ||||
|                 } else if (x1 <= monitor.x) { | ||||
|                 } else if (x1 <= monitor.x) | ||||
|                     side = Meta.Side.LEFT; | ||||
|                 } else if (y1 <= monitor.y) { | ||||
|                 else if (y1 <= monitor.y) | ||||
|                     side = Meta.Side.TOP; | ||||
|                 } else if (x2 >= monitor.x + monitor.width) { | ||||
|                 else if (x2 >= monitor.x + monitor.width) | ||||
|                     side = Meta.Side.RIGHT; | ||||
|                 } else if (y2 >= monitor.y + monitor.height) { | ||||
|                 else if (y2 >= monitor.y + monitor.height) | ||||
|                     side = Meta.Side.BOTTOM; | ||||
|                 } else { | ||||
|                 else | ||||
|                     continue; | ||||
|                 } | ||||
|  | ||||
|                 let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 }); | ||||
|                 let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1}); | ||||
|                 let strut = new Meta.Strut({ rect: strutRect, side: side }); | ||||
|                 struts.push(strut); | ||||
|             } | ||||
| @@ -1112,11 +1097,8 @@ var LayoutManager = GObject.registerClass({ | ||||
| // | ||||
| // This class manages a "hot corner" that can toggle switching to | ||||
| // overview. | ||||
| var HotCorner = GObject.registerClass( | ||||
| class HotCorner extends Clutter.Actor { | ||||
|     _init(layoutManager, monitor, x, y) { | ||||
|         super._init(); | ||||
|  | ||||
| var HotCorner = class HotCorner { | ||||
|     constructor(layoutManager, monitor, x, y) { | ||||
|         // We use this flag to mark the case where the user has entered the | ||||
|         // hot corner and has not left both the hot corner and a surrounding | ||||
|         // guard area (the "environs"). This avoids triggering the hot corner | ||||
| @@ -1145,8 +1127,6 @@ class HotCorner extends Clutter.Actor { | ||||
|  | ||||
|         this._ripples = new Ripples.Ripples(px, py, 'ripple-box'); | ||||
|         this._ripples.addTo(layoutManager.uiGroup); | ||||
|  | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|     } | ||||
|  | ||||
|     setBarrierSize(size) { | ||||
| @@ -1186,14 +1166,11 @@ class HotCorner extends Clutter.Actor { | ||||
|  | ||||
|     _setupFallbackCornerIfNeeded(layoutManager) { | ||||
|         if (!global.display.supports_extended_barriers()) { | ||||
|             this.set({ | ||||
|                 name: 'hot-corner-environs', | ||||
|                 x: this._x, | ||||
|                 y: this._y, | ||||
|                 width: 3, | ||||
|                 height: 3, | ||||
|                 reactive: true | ||||
|             }); | ||||
|             this.actor = new Clutter.Actor({ name: 'hot-corner-environs', | ||||
|                                              x: this._x, y: this._y, | ||||
|                                              width: 3, | ||||
|                                              height: 3, | ||||
|                                              reactive: true }); | ||||
|  | ||||
|             this._corner = new Clutter.Actor({ name: 'hot-corner', | ||||
|                                                width: 1, | ||||
| @@ -1202,16 +1179,19 @@ class HotCorner extends Clutter.Actor { | ||||
|                                                reactive: true }); | ||||
|             this._corner._delegate = this; | ||||
|  | ||||
|             this.add_child(this._corner); | ||||
|             layoutManager.addChrome(this); | ||||
|             this.actor.add_child(this._corner); | ||||
|             layoutManager.addChrome(this.actor); | ||||
|  | ||||
|             if (Clutter.get_default_text_direction() == Clutter.TextDirection.RTL) { | ||||
|                 this._corner.set_position(this.width - this._corner.width, 0); | ||||
|                 this.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST); | ||||
|                 this._corner.set_position(this.actor.width - this._corner.width, 0); | ||||
|                 this.actor.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST); | ||||
|             } else { | ||||
|                 this._corner.set_position(0, 0); | ||||
|             } | ||||
|  | ||||
|             this.actor.connect('leave-event', | ||||
|                                this._onEnvironsLeft.bind(this)); | ||||
|  | ||||
|             this._corner.connect('enter-event', | ||||
|                                  this._onCornerEntered.bind(this)); | ||||
|             this._corner.connect('leave-event', | ||||
| @@ -1219,12 +1199,13 @@ class HotCorner extends Clutter.Actor { | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
|     destroy() { | ||||
|         this.setBarrierSize(0); | ||||
|         this._pressureBarrier.destroy(); | ||||
|         this._pressureBarrier = null; | ||||
|  | ||||
|         this._ripples.destroy(); | ||||
|         if (this.actor) | ||||
|             this.actor.destroy(); | ||||
|     } | ||||
|  | ||||
|     _toggleOverview() { | ||||
| @@ -1237,7 +1218,7 @@ class HotCorner extends Clutter.Actor { | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     handleDragOver(source, _actor, _x, _y, _time) { | ||||
|     handleDragOver(source, actor, x, y, time) { | ||||
|         if (source != Main.xdndHandler) | ||||
|             return DND.DragMotionResult.CONTINUE; | ||||
|  | ||||
| @@ -1255,18 +1236,18 @@ class HotCorner extends Clutter.Actor { | ||||
|     } | ||||
|  | ||||
|     _onCornerLeft(actor, event) { | ||||
|         if (event.get_related() != this) | ||||
|         if (event.get_related() != this.actor) | ||||
|             this._entered = false; | ||||
|         // Consume event, otherwise this will confuse onEnvironsLeft | ||||
|         return Clutter.EVENT_STOP; | ||||
|     } | ||||
|  | ||||
|     vfunc_leave_event(crossingEvent) { | ||||
|         if (crossingEvent.related != this._corner) | ||||
|     _onEnvironsLeft(actor, event) { | ||||
|         if (event.get_related() != this._corner) | ||||
|             this._entered = false; | ||||
|         return Clutter.EVENT_PROPAGATE; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var PressureBarrier = class PressureBarrier { | ||||
|     constructor(threshold, timeout, actionMode) { | ||||
| @@ -1338,7 +1319,7 @@ var PressureBarrier = class PressureBarrier { | ||||
|         let threshold = this._lastTime - this._timeout; | ||||
|  | ||||
|         while (i < this._barrierEvents.length) { | ||||
|             let [time, distance_] = this._barrierEvents[i]; | ||||
|             let [time, distance] = this._barrierEvents[i]; | ||||
|             if (time >= threshold) | ||||
|                 break; | ||||
|             i++; | ||||
| @@ -1347,14 +1328,14 @@ var PressureBarrier = class PressureBarrier { | ||||
|         let firstNewEvent = i; | ||||
|  | ||||
|         for (i = 0; i < firstNewEvent; i++) { | ||||
|             let [time_, distance] = this._barrierEvents[i]; | ||||
|             let [time, distance] = this._barrierEvents[i]; | ||||
|             this._currentPressure -= distance; | ||||
|         } | ||||
|  | ||||
|         this._barrierEvents = this._barrierEvents.slice(firstNewEvent); | ||||
|     } | ||||
|  | ||||
|     _onBarrierLeft(barrier, _event) { | ||||
|     _onBarrierLeft(barrier, event) { | ||||
|         barrier._isHit = false; | ||||
|         if (this._barriers.every(b => !b._isHit)) { | ||||
|             this._reset(); | ||||
|   | ||||
| @@ -1,9 +1,10 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported Lightbox */ | ||||
|  | ||||
| const { Clutter, GObject, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Params = imports.misc.params; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var DEFAULT_FADE_FACTOR = 0.4; | ||||
| var VIGNETTE_BRIGHTNESS = 0.2; | ||||
| @@ -22,31 +23,16 @@ t = clamp(t, 0.0, 1.0);\n\ | ||||
| float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\ | ||||
| cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);'; | ||||
|  | ||||
| var RadialShaderEffect = GObject.registerClass({ | ||||
|     Properties: { | ||||
|         'brightness': GObject.ParamSpec.float( | ||||
|             'brightness', 'brightness', 'brightness', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             0, 1, 1 | ||||
|         ), | ||||
|         'sharpness': GObject.ParamSpec.float( | ||||
|             'sharpness', 'sharpness', 'sharpness', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             0, 1, 0 | ||||
|         ) | ||||
|     } | ||||
| }, class RadialShaderEffect extends Shell.GLSLEffect { | ||||
| var RadialShaderQuad = GObject.registerClass( | ||||
| class RadialShaderQuad extends Shell.GLSLQuad { | ||||
|     _init(params) { | ||||
|         this._brightness = undefined; | ||||
|         this._sharpness = undefined; | ||||
|  | ||||
|         super._init(params); | ||||
|  | ||||
|         this._brightnessLocation = this.get_uniform_location('brightness'); | ||||
|         this._sharpnessLocation = this.get_uniform_location('vignette_sharpness'); | ||||
|  | ||||
|         this.brightness = 1.0; | ||||
|         this.sharpness = 0.0; | ||||
|         this.vignetteSharpness = 0.0; | ||||
|     } | ||||
|  | ||||
|     vfunc_build_pipeline() { | ||||
| @@ -59,25 +45,19 @@ var RadialShaderEffect = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     set brightness(v) { | ||||
|         if (this._brightness == v) | ||||
|             return; | ||||
|         this._brightness = v; | ||||
|         this.set_uniform_float(this._brightnessLocation, | ||||
|                                1, [this._brightness]); | ||||
|         this.notify('brightness'); | ||||
|     } | ||||
|  | ||||
|     get sharpness() { | ||||
|     get vignetteSharpness() { | ||||
|         return this._sharpness; | ||||
|     } | ||||
|  | ||||
|     set sharpness(v) { | ||||
|         if (this._sharpness == v) | ||||
|             return; | ||||
|     set vignetteSharpness(v) { | ||||
|         this._sharpness = v; | ||||
|         this.set_uniform_float(this._sharpnessLocation, | ||||
|                                1, [this._sharpness]); | ||||
|         this.notify('sharpness'); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| @@ -88,8 +68,8 @@ var RadialShaderEffect = GObject.registerClass({ | ||||
|  *           - inhibitEvents: whether to inhibit events for @container | ||||
|  *           - width: shade actor width | ||||
|  *           - height: shade actor height | ||||
|  *           - fadeFactor: fading opacity factor | ||||
|  *           - radialEffect: whether to enable the GLSL radial effect | ||||
|  *           - fadeInTime: seconds used to fade in | ||||
|  *           - fadeOutTime: seconds used to fade out | ||||
|  * | ||||
|  * Lightbox creates a dark translucent "shade" actor to hide the | ||||
|  * contents of @container, and allows you to specify particular actors | ||||
| @@ -105,49 +85,44 @@ var RadialShaderEffect = GObject.registerClass({ | ||||
|  * @container and will track any changes in its size. You can override | ||||
|  * this by passing an explicit width and height in @params. | ||||
|  */ | ||||
| var Lightbox = GObject.registerClass({ | ||||
|     Properties: { | ||||
|         'active': GObject.ParamSpec.boolean( | ||||
|             'active', 'active', 'active', GObject.ParamFlags.READABLE, false), | ||||
|     } | ||||
| }, class Lightbox extends St.Bin { | ||||
|     _init(container, params) { | ||||
|         params = Params.parse(params, { | ||||
|             inhibitEvents: false, | ||||
|             width: null, | ||||
|             height: null, | ||||
|             fadeFactor: DEFAULT_FADE_FACTOR, | ||||
|             radialEffect: false, | ||||
|         }); | ||||
| var Lightbox = class Lightbox { | ||||
|     constructor(container, params) { | ||||
|         params = Params.parse(params, { inhibitEvents: false, | ||||
|                                         width: null, | ||||
|                                         height: null, | ||||
|                                         fadeFactor: DEFAULT_FADE_FACTOR, | ||||
|                                         radialEffect: false, | ||||
|                                       }); | ||||
|  | ||||
|         super._init({ | ||||
|             reactive: params.inhibitEvents, | ||||
|             width: params.width, | ||||
|             height: params.height, | ||||
|             visible: false | ||||
|         }); | ||||
|  | ||||
|         this._active = false; | ||||
|         this._container = container; | ||||
|         this._children = container.get_children(); | ||||
|         this._fadeFactor = params.fadeFactor; | ||||
|         this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect; | ||||
|  | ||||
|         if (this._radialEffect) | ||||
|             this.add_effect(new RadialShaderEffect({ name: 'radial' })); | ||||
|             this.actor = new RadialShaderQuad({ x: 0, | ||||
|                                                 y: 0, | ||||
|                                                 reactive: params.inhibitEvents }); | ||||
|         else | ||||
|             this.set({ opacity: 0, style_class: 'lightbox' }); | ||||
|             this.actor = new St.Bin({ x: 0, | ||||
|                                       y: 0, | ||||
|                                       opacity: 0, | ||||
|                                       style_class: 'lightbox', | ||||
|                                       reactive: params.inhibitEvents }); | ||||
|  | ||||
|         container.add_actor(this); | ||||
|         this.raise_top(); | ||||
|         container.add_actor(this.actor); | ||||
|         this.actor.raise_top(); | ||||
|         this.actor.hide(); | ||||
|         this.shown = false; | ||||
|  | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this.actor.connect('destroy', this._onDestroy.bind(this)); | ||||
|  | ||||
|         if (!params.width || !params.height) { | ||||
|             this.add_constraint(new Clutter.BindConstraint({ | ||||
|                 source: container, | ||||
|                 coordinate: Clutter.BindCoordinate.ALL | ||||
|             })); | ||||
|         if (params.width && params.height) { | ||||
|             this.actor.width = params.width; | ||||
|             this.actor.height = params.height; | ||||
|         } else { | ||||
|             let constraint = new Clutter.BindConstraint({ source: container, | ||||
|                                                           coordinate: Clutter.BindCoordinate.ALL }); | ||||
|             this.actor.add_constraint(constraint); | ||||
|         } | ||||
|  | ||||
|         this._actorAddedSignalId = container.connect('actor-added', this._actorAdded.bind(this)); | ||||
| @@ -156,20 +131,16 @@ var Lightbox = GObject.registerClass({ | ||||
|         this._highlighted = null; | ||||
|     } | ||||
|  | ||||
|     get active() { | ||||
|         return this._active; | ||||
|     } | ||||
|  | ||||
|     _actorAdded(container, newChild) { | ||||
|         let children = this._container.get_children(); | ||||
|         let myIndex = children.indexOf(this); | ||||
|         let myIndex = children.indexOf(this.actor); | ||||
|         let newChildIndex = children.indexOf(newChild); | ||||
|  | ||||
|         if (newChildIndex > myIndex) { | ||||
|             // The child was added above the shade (presumably it was | ||||
|             // made the new top-most child). Move it below the shade, | ||||
|             // and add it to this._children as the new topmost actor. | ||||
|             this._container.set_child_above_sibling(this, newChild); | ||||
|             newChild.lower(this.actor); | ||||
|             this._children.push(newChild); | ||||
|         } else if (newChildIndex == 0) { | ||||
|             // Bottom of stack | ||||
| @@ -182,55 +153,61 @@ var Lightbox = GObject.registerClass({ | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     lightOn(fadeInTime) { | ||||
|         this.remove_all_transitions(); | ||||
|  | ||||
|         let easeProps = { | ||||
|             duration: fadeInTime || 0, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }; | ||||
|  | ||||
|         let onComplete = () => { | ||||
|             this._active = true; | ||||
|             this.notify('active'); | ||||
|         }; | ||||
|  | ||||
|         this.show(); | ||||
|     show(fadeInTime) { | ||||
|         fadeInTime = fadeInTime || 0; | ||||
|  | ||||
|         Tweener.removeTweens(this.actor); | ||||
|         if (this._radialEffect) { | ||||
|             this.ease_property( | ||||
|                 '@effects.radial.brightness', VIGNETTE_BRIGHTNESS, easeProps); | ||||
|             this.ease_property( | ||||
|                 '@effects.radial.sharpness', VIGNETTE_SHARPNESS, | ||||
|                 Object.assign({ onComplete }, easeProps)); | ||||
|             Tweener.addTween(this.actor, | ||||
|                              { brightness: VIGNETTE_BRIGHTNESS, | ||||
|                                vignetteSharpness: VIGNETTE_SHARPNESS, | ||||
|                                time: fadeInTime, | ||||
|                                transition: 'easeOutQuad', | ||||
|                                onComplete: () => { | ||||
|                                    this.shown = true; | ||||
|                                    this.emit('shown'); | ||||
|                                } | ||||
|                              }); | ||||
|         } else { | ||||
|             this.ease(Object.assign(easeProps, { | ||||
|                 opacity: 255 * this._fadeFactor, | ||||
|                 onComplete | ||||
|             })); | ||||
|             Tweener.addTween(this.actor, | ||||
|                              { opacity: 255 * this._fadeFactor, | ||||
|                                time: fadeInTime, | ||||
|                                transition: 'easeOutQuad', | ||||
|                                onComplete: () => { | ||||
|                                    this.shown = true; | ||||
|                                    this.emit('shown'); | ||||
|                                } | ||||
|                              }); | ||||
|         } | ||||
|  | ||||
|         this.actor.show(); | ||||
|     } | ||||
|  | ||||
|     lightOff(fadeOutTime) { | ||||
|         this.remove_all_transitions(); | ||||
|  | ||||
|         this._active = false; | ||||
|         this.notify('active'); | ||||
|  | ||||
|         let easeProps = { | ||||
|             duration: fadeOutTime || 0, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }; | ||||
|  | ||||
|         let onComplete = () => this.hide(); | ||||
|     hide(fadeOutTime) { | ||||
|         fadeOutTime = fadeOutTime || 0; | ||||
|  | ||||
|         this.shown = false; | ||||
|         Tweener.removeTweens(this.actor); | ||||
|         if (this._radialEffect) { | ||||
|             this.ease_property( | ||||
|                 '@effects.radial.brightness', 1.0, easeProps); | ||||
|             this.ease_property( | ||||
|                 '@effects.radial.sharpness', 0.0, Object.assign({ onComplete }, easeProps)); | ||||
|             Tweener.addTween(this.actor, | ||||
|                              { brightness: 1.0, | ||||
|                                vignetteSharpness: 0.0, | ||||
|                                opacity: 0, | ||||
|                                time: fadeOutTime, | ||||
|                                transition: 'easeOutQuad', | ||||
|                                onComplete: () => { | ||||
|                                    this.actor.hide(); | ||||
|                                } | ||||
|                              }); | ||||
|         } else { | ||||
|             this.ease(Object.assign(easeProps, { opacity: 0, onComplete })); | ||||
|             Tweener.addTween(this.actor, | ||||
|                              { opacity: 0, | ||||
|                                time: fadeOutTime, | ||||
|                                transition: 'easeOutQuad', | ||||
|                                onComplete: () => { | ||||
|                                    this.actor.hide(); | ||||
|                                } | ||||
|                              }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -261,7 +238,7 @@ var Lightbox = GObject.registerClass({ | ||||
|         // case we may need to indicate some *other* actor as the new | ||||
|         // sibling of the to-be-lowered one. | ||||
|  | ||||
|         let below = this; | ||||
|         let below = this.actor; | ||||
|         for (let i = this._children.length - 1; i >= 0; i--) { | ||||
|             if (this._children[i] == window) | ||||
|                 this._children[i].raise_top(); | ||||
| @@ -274,6 +251,15 @@ var Lightbox = GObject.registerClass({ | ||||
|         this._highlighted = window; | ||||
|     } | ||||
|  | ||||
|     /** | ||||
|      * destroy: | ||||
|      * | ||||
|      * Destroys the lightbox. | ||||
|      */ | ||||
|     destroy() { | ||||
|         this.actor.destroy(); | ||||
|     } | ||||
|  | ||||
|     /** | ||||
|      * _onDestroy: | ||||
|      * | ||||
| @@ -281,15 +267,10 @@ var Lightbox = GObject.registerClass({ | ||||
|      * by destroying its container or by explicitly calling this.destroy(). | ||||
|      */ | ||||
|     _onDestroy() { | ||||
|         if (this._actorAddedSignalId) { | ||||
|             this._container.disconnect(this._actorAddedSignalId); | ||||
|             this._actorAddedSignalId = 0; | ||||
|         } | ||||
|         if (this._actorRemovedSignalId) { | ||||
|             this._container.disconnect(this._actorRemovedSignalId); | ||||
|             this._actorRemovedSignalId = 0; | ||||
|         } | ||||
|         this._container.disconnect(this._actorAddedSignalId); | ||||
|         this._container.disconnect(this._actorRemovedSignalId); | ||||
|  | ||||
|         this.highlight(null); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(Lightbox.prototype); | ||||
|   | ||||
| @@ -1,39 +1,24 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported LocatePointer */ | ||||
|  | ||||
| const { Gio } = imports.gi; | ||||
| const { Clutter, Gio, GLib, St } = imports.gi; | ||||
| const Ripples = imports.ui.ripples; | ||||
| const Main = imports.ui.main; | ||||
|  | ||||
| const LOCATE_POINTER_KEY = "locate-pointer"; | ||||
| const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface"; | ||||
| const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface" | ||||
|  | ||||
| var LocatePointer = class { | ||||
| var locatePointer = class { | ||||
|     constructor() { | ||||
|         this._settings = new Gio.Settings({ schema_id: LOCATE_POINTER_SCHEMA }); | ||||
|         this._settings.connect(`changed::${LOCATE_POINTER_KEY}`, () => this._syncEnabled()); | ||||
|         this._syncEnabled(); | ||||
|     } | ||||
|  | ||||
|     _syncEnabled() { | ||||
|         let enabled = this._settings.get_boolean(LOCATE_POINTER_KEY); | ||||
|         if (enabled == !!this._ripples) | ||||
|             return; | ||||
|  | ||||
|         if (enabled) { | ||||
|             this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location'); | ||||
|             this._ripples.addTo(Main.uiGroup); | ||||
|         } else { | ||||
|             this._ripples.destroy(); | ||||
|             this._ripples = null; | ||||
|         } | ||||
|         this._settings = new Gio.Settings({schema_id: LOCATE_POINTER_SCHEMA}); | ||||
|         this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location'); | ||||
|         this._ripples.addTo(Main.uiGroup); | ||||
|     } | ||||
|  | ||||
|     show() { | ||||
|         if (!this._ripples) | ||||
|         if (!this._settings.get_boolean("locate-pointer")) | ||||
|             return; | ||||
|  | ||||
|         let [x, y] = global.get_pointer(); | ||||
|         let [x, y, mods] = global.get_pointer(); | ||||
|         this._ripples.playAnimation(x, y); | ||||
|     } | ||||
| }; | ||||
|   | ||||
| @@ -1,24 +1,26 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported LookingGlass */ | ||||
|  | ||||
| const { Clutter, Cogl, Gio, GLib, GObject, | ||||
|         Graphene, Meta, Pango, Shell, St } = imports.gi; | ||||
| const { Clutter, Cogl, Gio, GLib, | ||||
|         GObject, Meta, Pango, Shell, St } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
| const Signals = imports.signals; | ||||
| const System = imports.system; | ||||
|  | ||||
| const History = imports.misc.history; | ||||
| const ExtensionSystem = imports.ui.extensionSystem; | ||||
| const ExtensionUtils = imports.misc.extensionUtils; | ||||
| const ShellEntry = imports.ui.shellEntry; | ||||
| const Tweener = imports.ui.tweener; | ||||
| const Main = imports.ui.main; | ||||
| const JsParse = imports.misc.jsParse; | ||||
|  | ||||
| const { ExtensionState } = ExtensionUtils; | ||||
|  | ||||
| const CHEVRON = '>>> '; | ||||
|  | ||||
| /* Imports...feel free to add here as needed */ | ||||
| var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' + | ||||
|                     'const Main = imports.ui.main; ' + | ||||
|                     'const Mainloop = imports.mainloop; ' + | ||||
|                     'const Tweener = imports.ui.tweener; ' + | ||||
|                     /* Utility functions...we should probably be able to use these | ||||
|                      * in the shell core code too. */ | ||||
|                     'const stage = global.stage; ' + | ||||
| @@ -30,11 +32,9 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im | ||||
| const HISTORY_KEY = 'looking-glass-history'; | ||||
| // Time between tabs for them to count as a double-tab event | ||||
| var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500; | ||||
| var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200; | ||||
| var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2; | ||||
| var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords(); | ||||
|  | ||||
| const LG_ANIMATION_TIME = 500; | ||||
|  | ||||
| function _getAutoCompleteGlobalKeywords() { | ||||
|     const keywords = ['true', 'false', 'null', 'new']; | ||||
|     // Don't add the private properties of window (i.e., ones starting with '_') | ||||
| @@ -68,10 +68,10 @@ var AutoComplete = class AutoComplete { | ||||
|             if (commonPrefix.length > 0) { | ||||
|                 this.additionalCompletionText(commonPrefix, event.attrHead); | ||||
|                 this.emit('completion', { completion: commonPrefix, type: 'prefix' }); | ||||
|                 this.emit('suggest', { completions: event.completions }); | ||||
|                 this.emit('suggest', { completions: event.completions}); | ||||
|             } | ||||
|         } else if (event.completions.length > 1 && event.tabType === 'double') { | ||||
|             this.emit('suggest', { completions: event.completions }); | ||||
|             this.emit('suggest', { completions: event.completions}); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -110,11 +110,9 @@ var AutoComplete = class AutoComplete { | ||||
| Signals.addSignalMethods(AutoComplete.prototype); | ||||
|  | ||||
|  | ||||
| var Notebook = GObject.registerClass({ | ||||
|     Signals: { 'selection': { param_types: [Clutter.Actor.$gtype] } }, | ||||
| }, class Notebook extends St.BoxLayout { | ||||
|     _init() { | ||||
|         super._init({ vertical: true }); | ||||
| var Notebook = class Notebook { | ||||
|     constructor() { | ||||
|         this.actor = new St.BoxLayout({ vertical: true }); | ||||
|  | ||||
|         this.tabControls = new St.BoxLayout({ style_class: 'labels' }); | ||||
|  | ||||
| @@ -145,11 +143,11 @@ var Notebook = GObject.registerClass({ | ||||
|                         _scrollToBottom: false }; | ||||
|         this._tabs.push(tabData); | ||||
|         scrollview.hide(); | ||||
|         this.add(scrollview, { expand: true }); | ||||
|         this.actor.add(scrollview, { expand: true }); | ||||
|  | ||||
|         let vAdjust = scrollview.vscroll.adjustment; | ||||
|         vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData)); | ||||
|         vAdjust.connect('notify::value', () => this._onAdjustValueChanged(tabData)); | ||||
|         vAdjust.connect('changed', () => { this._onAdjustScopeChanged(tabData); }); | ||||
|         vAdjust.connect('notify::value', () => { this._onAdjustValueChanged(tabData); }); | ||||
|  | ||||
|         if (this._selectedIndex == -1) | ||||
|             this.selectIndex(0); | ||||
| @@ -176,7 +174,7 @@ var Notebook = GObject.registerClass({ | ||||
|         // Focus the new tab before unmapping the old one | ||||
|         let tabData = this._tabs[index]; | ||||
|         if (!tabData.scrollView.navigate_focus(null, St.DirectionType.TAB_FORWARD, false)) | ||||
|             this.grab_key_focus(); | ||||
|             this.actor.grab_key_focus(); | ||||
|  | ||||
|         this._unselect(); | ||||
|  | ||||
| @@ -187,9 +185,9 @@ var Notebook = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     selectChild(child) { | ||||
|         if (child == null) { | ||||
|         if (child == null) | ||||
|             this.selectIndex(-1); | ||||
|         } else { | ||||
|         else { | ||||
|             for (let i = 0; i < this._tabs.length; i++) { | ||||
|                 let tabData = this._tabs[i]; | ||||
|                 if (tabData.child == child) { | ||||
| @@ -236,75 +234,69 @@ var Notebook = GObject.registerClass({ | ||||
|  | ||||
|         this.selectIndex(prevIndex); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(Notebook.prototype); | ||||
|  | ||||
| function objectToString(o) { | ||||
|     if (typeof o == typeof objectToString) { | ||||
|     if (typeof(o) == typeof(objectToString)) { | ||||
|         // special case this since the default is way, way too verbose | ||||
|         return '<js function>'; | ||||
|     } else { | ||||
|         return `${o}`; | ||||
|         return '' + o; | ||||
|     } | ||||
| } | ||||
|  | ||||
| var ObjLink = GObject.registerClass( | ||||
| class ObjLink extends St.Button { | ||||
|     _init(lookingGlass, o, title) { | ||||
| var ObjLink = class ObjLink { | ||||
|     constructor(lookingGlass, o, title) { | ||||
|         let text; | ||||
|         if (title) | ||||
|             text = title; | ||||
|         else | ||||
|             text = objectToString(o); | ||||
|         text = GLib.markup_escape_text(text, -1); | ||||
|  | ||||
|         super._init({ | ||||
|             reactive: true, | ||||
|             track_hover: true, | ||||
|             style_class: 'shell-link', | ||||
|             label: text | ||||
|         }); | ||||
|         this.get_child().single_line_mode = true; | ||||
|  | ||||
|         this._obj = o; | ||||
|  | ||||
|         this.actor = new St.Button({ reactive: true, | ||||
|                                      track_hover: true, | ||||
|                                      style_class: 'shell-link', | ||||
|                                      label: text }); | ||||
|         this.actor.get_child().single_line_mode = true; | ||||
|         this.actor.connect('clicked', this._onClicked.bind(this)); | ||||
|  | ||||
|         this._lookingGlass = lookingGlass; | ||||
|     } | ||||
|  | ||||
|     vfunc_clicked() { | ||||
|         this._lookingGlass.inspectObject(this._obj, this); | ||||
|     _onClicked(link) { | ||||
|         this._lookingGlass.inspectObject(this._obj, this.actor); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var Result = GObject.registerClass({ | ||||
|     GTypeName: 'LookingClass_Result' | ||||
| }, class Result extends St.BoxLayout { | ||||
|     _init(lookingGlass, command, o, index) { | ||||
|         super._init({ vertical: true }); | ||||
| }; | ||||
|  | ||||
| var Result = class Result { | ||||
|     constructor(lookingGlass, command, o, index) { | ||||
|         this.index = index; | ||||
|         this.o = o; | ||||
|  | ||||
|         this.actor = new St.BoxLayout({ vertical: true }); | ||||
|         this._lookingGlass = lookingGlass; | ||||
|  | ||||
|         let cmdTxt = new St.Label({ text: command }); | ||||
|         cmdTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END; | ||||
|         this.add(cmdTxt); | ||||
|         this.actor.add(cmdTxt); | ||||
|         let box = new St.BoxLayout({}); | ||||
|         this.add(box); | ||||
|         let resultTxt = new St.Label({ text: `r(${index}) = ` }); | ||||
|         this.actor.add(box); | ||||
|         let resultTxt = new St.Label({ text: 'r(' + index + ') = ' }); | ||||
|         resultTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END; | ||||
|         box.add(resultTxt); | ||||
|         let objLink = new ObjLink(this._lookingGlass, o); | ||||
|         box.add(objLink); | ||||
|         box.add(objLink.actor); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var WindowList = GObject.registerClass({ | ||||
|     GTypeName: 'LookingClass_WindowList' | ||||
| }, class WindowList extends St.BoxLayout { | ||||
|     _init(lookingGlass) { | ||||
|         super._init({ name: 'Windows', vertical: true, style: 'spacing: 8px' }); | ||||
| var WindowList = class WindowList { | ||||
|     constructor(lookingGlass) { | ||||
|         this.actor = new St.BoxLayout({ name: 'Windows', vertical: true, style: 'spacing: 8px' }); | ||||
|         let tracker = Shell.WindowTracker.get_default(); | ||||
|         this._updateId = Main.initializeDeferredWork(this, this._updateWindowList.bind(this)); | ||||
|         this._updateId = Main.initializeDeferredWork(this.actor, this._updateWindowList.bind(this)); | ||||
|         global.display.connect('window-created', this._updateWindowList.bind(this)); | ||||
|         tracker.connect('tracked-windows-changed', this._updateWindowList.bind(this)); | ||||
|  | ||||
| @@ -312,10 +304,7 @@ var WindowList = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _updateWindowList() { | ||||
|         if (!this._lookingGlass.isOpen) | ||||
|             return; | ||||
|  | ||||
|         this.destroy_all_children(); | ||||
|         this.actor.destroy_all_children(); | ||||
|         let windows = global.get_window_actors(); | ||||
|         let tracker = Shell.WindowTracker.get_default(); | ||||
|         for (let i = 0; i < windows.length; i++) { | ||||
| @@ -326,12 +315,12 @@ var WindowList = GObject.registerClass({ | ||||
|                 metaWindow._lookingGlassManaged = true; | ||||
|             } | ||||
|             let box = new St.BoxLayout({ vertical: true }); | ||||
|             this.add(box); | ||||
|             this.actor.add(box); | ||||
|             let windowLink = new ObjLink(this._lookingGlass, metaWindow, metaWindow.title); | ||||
|             box.add(windowLink, { x_align: St.Align.START, x_fill: false }); | ||||
|             box.add(windowLink.actor, { x_align: St.Align.START, x_fill: false }); | ||||
|             let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' }); | ||||
|             box.add(propsBox); | ||||
|             propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` })); | ||||
|             propsBox.add(new St.Label({ text: 'wmclass: ' + metaWindow.get_wm_class() })); | ||||
|             let app = tracker.get_window_app(metaWindow); | ||||
|             if (app != null && !app.is_window_backed()) { | ||||
|                 let icon = app.create_icon_texture(22); | ||||
| @@ -339,38 +328,30 @@ var WindowList = GObject.registerClass({ | ||||
|                 propsBox.add(propBox); | ||||
|                 propBox.add(new St.Label({ text: 'app: ' }), { y_fill: false }); | ||||
|                 let appLink = new ObjLink(this._lookingGlass, app, app.get_id()); | ||||
|                 propBox.add(appLink, { y_fill: false }); | ||||
|                 propBox.add(appLink.actor, { y_fill: false }); | ||||
|                 propBox.add(icon, { y_fill: false }); | ||||
|             } else { | ||||
|                 propsBox.add(new St.Label({ text: '<untracked>' })); | ||||
|             } | ||||
|         } | ||||
|     } | ||||
| }; | ||||
| Signals.addSignalMethods(WindowList.prototype); | ||||
|  | ||||
|     update() { | ||||
|         this._updateWindowList(); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var ObjInspector = GObject.registerClass( | ||||
| class ObjInspector extends St.ScrollView { | ||||
|     _init(lookingGlass) { | ||||
|         super._init({ | ||||
|             pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }), | ||||
|             x_fill: true, | ||||
|             y_fill: true | ||||
|         }); | ||||
|  | ||||
| var ObjInspector = class ObjInspector { | ||||
|     constructor(lookingGlass) { | ||||
|         this._obj = null; | ||||
|         this._previousObj = null; | ||||
|  | ||||
|         this._parentList = []; | ||||
|  | ||||
|         this.get_hscroll_bar().hide(); | ||||
|         this.actor = new St.ScrollView({ pivot_point: new Clutter.Point({ x: 0.5, y: 0.5 }), | ||||
|                                          x_fill: true, y_fill: true }); | ||||
|         this.actor.get_hscroll_bar().hide(); | ||||
|         this._container = new St.BoxLayout({ name: 'LookingGlassPropertyInspector', | ||||
|                                              style_class: 'lg-dialog', | ||||
|                                              vertical: true }); | ||||
|         this.add_actor(this._container); | ||||
|         this.actor.add_actor(this._container); | ||||
|  | ||||
|         this._lookingGlass = lookingGlass; | ||||
|     } | ||||
| @@ -386,7 +367,7 @@ class ObjInspector extends St.ScrollView { | ||||
|  | ||||
|         let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' }); | ||||
|         this._container.add_actor(hbox); | ||||
|         let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof obj, | ||||
|         let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof(obj), | ||||
|                                                                      objectToString(obj)) }); | ||||
|         label.single_line_mode = true; | ||||
|         hbox.add(label, { expand: true, y_fill: false }); | ||||
| @@ -404,7 +385,7 @@ class ObjInspector extends St.ScrollView { | ||||
|         button.add_actor(new St.Icon({ icon_name: 'window-close-symbolic' })); | ||||
|         button.connect('clicked', this.close.bind(this)); | ||||
|         hbox.add(button); | ||||
|         if (typeof obj == typeof {}) { | ||||
|         if (typeof(obj) == typeof({})) { | ||||
|             let properties = []; | ||||
|             for (let propName in obj) { | ||||
|                 properties.push(propName); | ||||
| @@ -413,15 +394,17 @@ class ObjInspector extends St.ScrollView { | ||||
|  | ||||
|             for (let i = 0; i < properties.length; i++) { | ||||
|                 let propName = properties[i]; | ||||
|                 let valueStr; | ||||
|                 let link; | ||||
|                 try { | ||||
|                     let prop = obj[propName]; | ||||
|                     link = new ObjLink(this._lookingGlass, prop); | ||||
|                     link = new ObjLink(this._lookingGlass, prop).actor; | ||||
|                 } catch (e) { | ||||
|                     link = new St.Label({ text: '<error>' }); | ||||
|                 } | ||||
|                 let hbox = new St.BoxLayout(); | ||||
|                 hbox.add(new St.Label({ text: `${propName}: ` })); | ||||
|                 let propText = propName + ': ' + valueStr; | ||||
|                 hbox.add(new St.Label({ text: propName + ': ' })); | ||||
|                 hbox.add(link); | ||||
|                 this._container.add_actor(hbox); | ||||
|             } | ||||
| @@ -433,17 +416,14 @@ class ObjInspector extends St.ScrollView { | ||||
|             return; | ||||
|         this._previousObj = null; | ||||
|         this._open = true; | ||||
|         this.show(); | ||||
|         this.actor.show(); | ||||
|         if (sourceActor) { | ||||
|             this.set_scale(0, 0); | ||||
|             this.ease({ | ||||
|                 scale_x: 1, | ||||
|                 scale_y: 1, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                 duration: 200 | ||||
|             }); | ||||
|             this.actor.set_scale(0, 0); | ||||
|             Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1, | ||||
|                                            transition: 'easeOutQuad', | ||||
|                                            time: 0.2 }); | ||||
|         } else { | ||||
|             this.set_scale(1, 1); | ||||
|             this.actor.set_scale(1, 1); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -451,7 +431,7 @@ class ObjInspector extends St.ScrollView { | ||||
|         if (!this._open) | ||||
|             return; | ||||
|         this._open = false; | ||||
|         this.hide(); | ||||
|         this.actor.hide(); | ||||
|         this._previousObj = null; | ||||
|         this._obj = null; | ||||
|     } | ||||
| @@ -465,7 +445,7 @@ class ObjInspector extends St.ScrollView { | ||||
|     _onBack() { | ||||
|         this.selectObject(this._previousObj, true); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var RedBorderEffect = GObject.registerClass( | ||||
| class RedBorderEffect extends Clutter.Effect { | ||||
| @@ -496,7 +476,8 @@ var Inspector = GObject.registerClass({ | ||||
|                'target': { param_types: [Clutter.Actor.$gtype, GObject.TYPE_DOUBLE, GObject.TYPE_DOUBLE] } }, | ||||
| }, class Inspector extends Clutter.Actor { | ||||
|     _init(lookingGlass) { | ||||
|         super._init({ width: 0, height: 0 }); | ||||
|         super._init({ width: 0, | ||||
|                       height: 0 }); | ||||
|  | ||||
|         Main.uiGroup.add_actor(this); | ||||
|  | ||||
| @@ -512,13 +493,8 @@ var Inspector = GObject.registerClass({ | ||||
|         eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this)); | ||||
|         eventHandler.connect('scroll-event', this._onScrollEvent.bind(this)); | ||||
|         eventHandler.connect('motion-event', this._onMotionEvent.bind(this)); | ||||
|  | ||||
|         let dm = Clutter.DeviceManager.get_default(); | ||||
|         this._pointerDevice = dm.get_core_device(Clutter.InputDeviceType.POINTER_DEVICE); | ||||
|         this._keyboardDevice = dm.get_core_device(Clutter.InputDeviceType.KEYBOARD_DEVICE); | ||||
|  | ||||
|         this._pointerDevice.grab(eventHandler); | ||||
|         this._keyboardDevice.grab(eventHandler); | ||||
|         Clutter.grab_pointer(eventHandler); | ||||
|         Clutter.grab_keyboard(eventHandler); | ||||
|  | ||||
|         // this._target is the actor currently shown by the inspector. | ||||
|         // this._pointerTarget is the actor directly under the pointer. | ||||
| @@ -539,7 +515,7 @@ var Inspector = GObject.registerClass({ | ||||
|  | ||||
|         let primary = Main.layoutManager.primaryMonitor; | ||||
|  | ||||
|         let [, , natWidth, natHeight] = | ||||
|         let [minWidth, minHeight, natWidth, natHeight] = | ||||
|             this._eventHandler.get_preferred_size(); | ||||
|  | ||||
|         let childBox = new Clutter.ActorBox(); | ||||
| @@ -551,8 +527,8 @@ var Inspector = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _close() { | ||||
|         this._pointerDevice.ungrab(); | ||||
|         this._keyboardDevice.ungrab(); | ||||
|         Clutter.ungrab_pointer(); | ||||
|         Clutter.ungrab_keyboard(); | ||||
|         this._eventHandler.destroy(); | ||||
|         this._eventHandler = null; | ||||
|         this.emit('closed'); | ||||
| @@ -575,7 +551,7 @@ var Inspector = GObject.registerClass({ | ||||
|  | ||||
|     _onScrollEvent(actor, event) { | ||||
|         switch (event.get_scroll_direction()) { | ||||
|         case Clutter.ScrollDirection.UP: { | ||||
|         case Clutter.ScrollDirection.UP: | ||||
|             // select parent | ||||
|             let parent = this._target.get_parent(); | ||||
|             if (parent != null) { | ||||
| @@ -583,7 +559,6 @@ var Inspector = GObject.registerClass({ | ||||
|                 this._update(event); | ||||
|             } | ||||
|             break; | ||||
|         } | ||||
|  | ||||
|         case Clutter.ScrollDirection.DOWN: | ||||
|             // select child | ||||
| @@ -623,39 +598,36 @@ var Inspector = GObject.registerClass({ | ||||
|             this._target = target; | ||||
|         this._pointerTarget = target; | ||||
|  | ||||
|         let position = `[inspect x: ${stageX} y: ${stageY}]`; | ||||
|         let position = '[inspect x: ' + stageX + ' y: ' + stageY + ']'; | ||||
|         this._displayText.text = ''; | ||||
|         this._displayText.text = `${position} ${this._target}`; | ||||
|         this._displayText.text = position + ' ' + this._target; | ||||
|  | ||||
|         this._lookingGlass.setBorderPaintTarget(this._target); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var Extensions = GObject.registerClass({ | ||||
|     GTypeName: 'LookingClass_Extensions' | ||||
| }, class Extensions extends St.BoxLayout { | ||||
|     _init(lookingGlass) { | ||||
|         super._init({ vertical: true, name: 'lookingGlassExtensions' }); | ||||
|  | ||||
| var Extensions = class Extensions { | ||||
|     constructor(lookingGlass) { | ||||
|         this._lookingGlass = lookingGlass; | ||||
|         this.actor = new St.BoxLayout({ vertical: true, | ||||
|                                         name: 'lookingGlassExtensions' }); | ||||
|         this._noExtensions = new St.Label({ style_class: 'lg-extensions-none', | ||||
|                                             text: _("No extensions installed") }); | ||||
|                                              text: _("No extensions installed") }); | ||||
|         this._numExtensions = 0; | ||||
|         this._extensionsList = new St.BoxLayout({ vertical: true, | ||||
|                                                   style_class: 'lg-extensions-list' }); | ||||
|         this._extensionsList.add(this._noExtensions); | ||||
|         this.add(this._extensionsList); | ||||
|         this.actor.add(this._extensionsList); | ||||
|  | ||||
|         Main.extensionManager.getUuids().forEach(uuid => { | ||||
|         for (let uuid in ExtensionUtils.extensions) | ||||
|             this._loadExtension(null, uuid); | ||||
|         }); | ||||
|  | ||||
|         Main.extensionManager.connect('extension-loaded', | ||||
|                                       this._loadExtension.bind(this)); | ||||
|         ExtensionSystem.connect('extension-loaded', | ||||
|                                 this._loadExtension.bind(this)); | ||||
|     } | ||||
|  | ||||
|     _loadExtension(o, uuid) { | ||||
|         let extension = Main.extensionManager.lookup(uuid); | ||||
|         let extension = ExtensionUtils.extensions[uuid]; | ||||
|         // There can be cases where we create dummy extension metadata | ||||
|         // that's not really a proper extension. Don't bother with these. | ||||
|         if (!extension.metadata.name) | ||||
| @@ -712,17 +684,17 @@ var Extensions = GObject.registerClass({ | ||||
|  | ||||
|     _stateToString(extensionState) { | ||||
|         switch (extensionState) { | ||||
|         case ExtensionState.ENABLED: | ||||
|             return _("Enabled"); | ||||
|         case ExtensionState.DISABLED: | ||||
|         case ExtensionState.INITIALIZED: | ||||
|             return _("Disabled"); | ||||
|         case ExtensionState.ERROR: | ||||
|             return _("Error"); | ||||
|         case ExtensionState.OUT_OF_DATE: | ||||
|             return _("Out of date"); | ||||
|         case ExtensionState.DOWNLOADING: | ||||
|             return _("Downloading"); | ||||
|             case ExtensionSystem.ExtensionState.ENABLED: | ||||
|                 return _("Enabled"); | ||||
|             case ExtensionSystem.ExtensionState.DISABLED: | ||||
|             case ExtensionSystem.ExtensionState.INITIALIZED: | ||||
|                 return _("Disabled"); | ||||
|             case ExtensionSystem.ExtensionState.ERROR: | ||||
|                 return _("Error"); | ||||
|             case ExtensionSystem.ExtensionState.OUT_OF_DATE: | ||||
|                 return _("Out of date"); | ||||
|             case ExtensionSystem.ExtensionState.DOWNLOADING: | ||||
|                 return _("Downloading"); | ||||
|         } | ||||
|         return 'Unknown'; // Not translated, shouldn't appear | ||||
|     } | ||||
| @@ -730,7 +702,7 @@ var Extensions = GObject.registerClass({ | ||||
|     _createExtensionDisplay(extension) { | ||||
|         let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true }); | ||||
|         let name = new St.Label({ style_class: 'lg-extension-name', | ||||
|                                   text: extension.metadata.name }); | ||||
|                                    text: extension.metadata.name }); | ||||
|         box.add(name, { expand: true }); | ||||
|         let description = new St.Label({ style_class: 'lg-extension-description', | ||||
|                                          text: extension.metadata.description || 'No description' }); | ||||
| @@ -738,6 +710,7 @@ var Extensions = GObject.registerClass({ | ||||
|  | ||||
|         let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' }); | ||||
|         box.add(metaBox); | ||||
|         let stateString = this._stateToString(extension.state); | ||||
|         let state = new St.Label({ style_class: 'lg-extension-state', | ||||
|                                    text: this._stateToString(extension.state) }); | ||||
|         metaBox.add(state); | ||||
| @@ -772,19 +745,10 @@ var Extensions = GObject.registerClass({ | ||||
|  | ||||
|         return box; | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var LookingGlass = GObject.registerClass( | ||||
| class LookingGlass extends St.BoxLayout { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             name: 'LookingGlassDialog', | ||||
|             style_class: 'lg-dialog', | ||||
|             vertical: true, | ||||
|             visible: false, | ||||
|             reactive: true | ||||
|         }); | ||||
| }; | ||||
|  | ||||
| var LookingGlass = class LookingGlass { | ||||
|     constructor() { | ||||
|         this._borderPaintTarget = null; | ||||
|         this._redBorderEffect = new RedBorderEffect(); | ||||
|  | ||||
| @@ -792,18 +756,26 @@ class LookingGlass extends St.BoxLayout { | ||||
|  | ||||
|         this._it = null; | ||||
|         this._offset = 0; | ||||
|         this._results = []; | ||||
|  | ||||
|         // Sort of magic, but...eh. | ||||
|         this._maxItems = 150; | ||||
|  | ||||
|         this.actor = new St.BoxLayout({ name: 'LookingGlassDialog', | ||||
|                                         style_class: 'lg-dialog', | ||||
|                                         vertical: true, | ||||
|                                         visible: false, | ||||
|                                         reactive: true }); | ||||
|         this.actor.connect('key-press-event', this._globalKeyPressEvent.bind(this)); | ||||
|  | ||||
|         this._interfaceSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' }); | ||||
|         this._interfaceSettings.connect('changed::monospace-font-name', | ||||
|                                         this._updateFont.bind(this)); | ||||
|         this._updateFont(); | ||||
|  | ||||
|         // We want it to appear to slide out from underneath the panel | ||||
|         Main.uiGroup.add_actor(this); | ||||
|         Main.uiGroup.set_child_below_sibling(this, | ||||
|         Main.uiGroup.add_actor(this.actor); | ||||
|         Main.uiGroup.set_child_below_sibling(this.actor, | ||||
|                                              Main.layoutManager.panelBox); | ||||
|         Main.layoutManager.panelBox.connect('allocation-changed', | ||||
|                                             this._queueResize.bind(this)); | ||||
| @@ -811,11 +783,11 @@ class LookingGlass extends St.BoxLayout { | ||||
|                                                this._queueResize.bind(this)); | ||||
|  | ||||
|         this._objInspector = new ObjInspector(this); | ||||
|         Main.uiGroup.add_actor(this._objInspector); | ||||
|         this._objInspector.hide(); | ||||
|         Main.uiGroup.add_actor(this._objInspector.actor); | ||||
|         this._objInspector.actor.hide(); | ||||
|  | ||||
|         let toolbar = new St.BoxLayout({ name: 'Toolbar' }); | ||||
|         this.add_actor(toolbar); | ||||
|         this.actor.add_actor(toolbar); | ||||
|         let inspectIcon = new St.Icon({ icon_name: 'gtk-color-picker', | ||||
|                                         icon_size: 24 }); | ||||
|         toolbar.add_actor(inspectIcon); | ||||
| @@ -823,13 +795,13 @@ class LookingGlass extends St.BoxLayout { | ||||
|         inspectIcon.connect('button-press-event', () => { | ||||
|             let inspector = new Inspector(this); | ||||
|             inspector.connect('target', (i, target, stageX, stageY) => { | ||||
|                 this._pushResult(`inspect(${Math.round(stageX)}, ${Math.round(stageY)})`, target); | ||||
|                 this._pushResult('inspect(' + Math.round(stageX) + ', ' + Math.round(stageY) + ')', target); | ||||
|             }); | ||||
|             inspector.connect('closed', () => { | ||||
|                 this.show(); | ||||
|                 this.actor.show(); | ||||
|                 global.stage.set_key_focus(this._entry); | ||||
|             }); | ||||
|             this.hide(); | ||||
|             this.actor.hide(); | ||||
|             return Clutter.EVENT_STOP; | ||||
|         }); | ||||
|  | ||||
| @@ -838,20 +810,20 @@ class LookingGlass extends St.BoxLayout { | ||||
|         toolbar.add_actor(gcIcon); | ||||
|         gcIcon.reactive = true; | ||||
|         gcIcon.connect('button-press-event', () => { | ||||
|             gcIcon.icon_name = 'user-trash'; | ||||
|             System.gc(); | ||||
|             this._timeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, () => { | ||||
|            gcIcon.icon_name = 'user-trash'; | ||||
|            System.gc(); | ||||
|            this._timeoutId = Mainloop.timeout_add(500, () => { | ||||
|                 gcIcon.icon_name = 'user-trash-full'; | ||||
|                 this._timeoutId = 0; | ||||
|                 return GLib.SOURCE_REMOVE; | ||||
|             }); | ||||
|             GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\''); | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|            }); | ||||
|            GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\''); | ||||
|            return Clutter.EVENT_PROPAGATE; | ||||
|         }); | ||||
|  | ||||
|         let notebook = new Notebook(); | ||||
|         this._notebook = notebook; | ||||
|         this.add(notebook, { expand: true }); | ||||
|         this.actor.add(notebook.actor, { expand: true }); | ||||
|  | ||||
|         let emptyBox = new St.Bin(); | ||||
|         toolbar.add(emptyBox, { expand: true }); | ||||
| @@ -874,12 +846,12 @@ class LookingGlass extends St.BoxLayout { | ||||
|         this._entryArea.add(this._entry, { expand: true }); | ||||
|  | ||||
|         this._windowList = new WindowList(this); | ||||
|         notebook.appendPage('Windows', this._windowList); | ||||
|         notebook.appendPage('Windows', this._windowList.actor); | ||||
|  | ||||
|         this._extensions = new Extensions(this); | ||||
|         notebook.appendPage('Extensions', this._extensions); | ||||
|         notebook.appendPage('Extensions', this._extensions.actor); | ||||
|  | ||||
|         this._entry.clutter_text.connect('activate', (o, _e) => { | ||||
|         this._entry.clutter_text.connect('activate', (o, e) => { | ||||
|             // Hide any completions we are currently showing | ||||
|             this._hideCompletions(); | ||||
|  | ||||
| @@ -895,7 +867,7 @@ class LookingGlass extends St.BoxLayout { | ||||
|             return true; | ||||
|         }); | ||||
|  | ||||
|         this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY, | ||||
|         this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY,  | ||||
|                                                      entry: this._entry.clutter_text }); | ||||
|  | ||||
|         this._autoComplete = new AutoComplete(this._entry); | ||||
| @@ -917,11 +889,9 @@ class LookingGlass extends St.BoxLayout { | ||||
|         let fontDesc = Pango.FontDescription.from_string(fontName); | ||||
|         // We ignore everything but size and style; you'd be crazy to set your system-wide | ||||
|         // monospace font to be bold/oblique/etc. Could easily be added here. | ||||
|         let size = fontDesc.get_size() / 1024.; | ||||
|         let unit = fontDesc.get_size_is_absolute() ? 'px' : 'pt'; | ||||
|         this.style = ` | ||||
|             font-size: ${size}${unit}; | ||||
|             font-family: "${fontDesc.get_family()}";`; | ||||
|         this.actor.style = | ||||
|             'font-size: ' + fontDesc.get_size() / 1024. + (fontDesc.get_size_is_absolute() ? 'px' : 'pt') + ';' | ||||
|             + 'font-family: "' + fontDesc.get_family() + '";'; | ||||
|     } | ||||
|  | ||||
|     setBorderPaintTarget(obj) { | ||||
| @@ -933,14 +903,17 @@ class LookingGlass extends St.BoxLayout { | ||||
|     } | ||||
|  | ||||
|     _pushResult(command, obj) { | ||||
|         let index = this._resultsArea.get_n_children() + this._offset; | ||||
|         let index = this._results.length + this._offset; | ||||
|         let result = new Result(this, CHEVRON + command, obj, index); | ||||
|         this._resultsArea.add(result); | ||||
|         this._results.push(result); | ||||
|         this._resultsArea.add(result.actor); | ||||
|         if (obj instanceof Clutter.Actor) | ||||
|             this.setBorderPaintTarget(obj); | ||||
|  | ||||
|         if (this._resultsArea.get_n_children() > this._maxItems) { | ||||
|             this._resultsArea.get_first_child().destroy(); | ||||
|         let children = this._resultsArea.get_children(); | ||||
|         if (children.length > this._maxItems) { | ||||
|             this._results.shift(); | ||||
|             children[0].destroy(); | ||||
|             this._offset++; | ||||
|         } | ||||
|         this._it = obj; | ||||
| @@ -960,41 +933,35 @@ class LookingGlass extends St.BoxLayout { | ||||
|         this._completionActor.set_text(completions.join(', ')); | ||||
|  | ||||
|         // Setting the height to -1 allows us to get its actual preferred height rather than | ||||
|         // whatever was last set when animating | ||||
|         // whatever was last given in set_height by Tweener. | ||||
|         this._completionActor.set_height(-1); | ||||
|         let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width()); | ||||
|         let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width()); | ||||
|  | ||||
|         // Don't reanimate if we are already visible | ||||
|         if (this._completionActor.visible) { | ||||
|             this._completionActor.height = naturalHeight; | ||||
|         } else { | ||||
|             let settings = St.Settings.get(); | ||||
|             let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor; | ||||
|             this._completionActor.show(); | ||||
|             this._completionActor.remove_all_transitions(); | ||||
|             this._completionActor.ease({ | ||||
|                 height: naturalHeight, | ||||
|                 opacity: 255, | ||||
|                 duration, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|             }); | ||||
|             Tweener.removeTweens(this._completionActor); | ||||
|             Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(), | ||||
|                                                       transition: 'easeOutQuad', | ||||
|                                                       height: naturalHeight, | ||||
|                                                       opacity: 255 | ||||
|                                                     }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _hideCompletions() { | ||||
|         if (this._completionActor) { | ||||
|             let settings = St.Settings.get(); | ||||
|             let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor; | ||||
|             this._completionActor.remove_all_transitions(); | ||||
|             this._completionActor.ease({ | ||||
|                 height: 0, | ||||
|                 opacity: 0, | ||||
|                 duration, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                 onComplete: () => { | ||||
|                     this._completionActor.hide(); | ||||
|                 } | ||||
|             }); | ||||
|             Tweener.removeTweens(this._completionActor); | ||||
|             Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(), | ||||
|                                                       transition: 'easeOutQuad', | ||||
|                                                       height: 0, | ||||
|                                                       opacity: 0, | ||||
|                                                       onComplete: () => { | ||||
|                                                           this._completionActor.hide(); | ||||
|                                                       } | ||||
|                                                     }); | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -1010,7 +977,7 @@ class LookingGlass extends St.BoxLayout { | ||||
|         try { | ||||
|             resultObj = Function(fullCmd)(); | ||||
|         } catch (e) { | ||||
|             resultObj = `<exception ${e}>`; | ||||
|             resultObj = '<exception ' + e + '>'; | ||||
|         } | ||||
|  | ||||
|         this._pushResult(command, resultObj); | ||||
| @@ -1026,11 +993,7 @@ class LookingGlass extends St.BoxLayout { | ||||
|     } | ||||
|  | ||||
|     getResult(idx) { | ||||
|         try { | ||||
|             return this._resultsArea.get_child_at_index(idx - this._offset).o; | ||||
|         } catch (e) { | ||||
|             throw new Error(`Unknown result at index ${idx}`); | ||||
|         } | ||||
|         return this._results[idx - this._offset].o; | ||||
|     } | ||||
|  | ||||
|     toggle() { | ||||
| @@ -1041,10 +1004,7 @@ class LookingGlass extends St.BoxLayout { | ||||
|     } | ||||
|  | ||||
|     _queueResize() { | ||||
|         Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { | ||||
|             this._resize(); | ||||
|             return GLib.SOURCE_REMOVE; | ||||
|         }); | ||||
|         Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { this._resize(); }); | ||||
|     } | ||||
|  | ||||
|     _resize() { | ||||
| @@ -1052,15 +1012,15 @@ class LookingGlass extends St.BoxLayout { | ||||
|         let myWidth = primary.width * 0.7; | ||||
|         let availableHeight = primary.height - Main.layoutManager.keyboardBox.height; | ||||
|         let myHeight = Math.min(primary.height * 0.7, availableHeight * 0.9); | ||||
|         this.x = primary.x + (primary.width - myWidth) / 2; | ||||
|         this.actor.x = primary.x + (primary.width - myWidth) / 2; | ||||
|         this._hiddenY = primary.y + Main.layoutManager.panelBox.height - myHeight; | ||||
|         this._targetY = this._hiddenY + myHeight; | ||||
|         this.y = this._hiddenY; | ||||
|         this.width = myWidth; | ||||
|         this.height = myHeight; | ||||
|         this._objInspector.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8)); | ||||
|         this._objInspector.set_position(this.x + Math.floor(myWidth * 0.1), | ||||
|                                         this._targetY + Math.floor(myHeight * 0.1)); | ||||
|         this.actor.y = this._hiddenY; | ||||
|         this.actor.width = myWidth; | ||||
|         this.actor.height = myHeight; | ||||
|         this._objInspector.actor.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8)); | ||||
|         this._objInspector.actor.set_position(this.actor.x + Math.floor(myWidth * 0.1), | ||||
|                                               this._targetY + Math.floor(myHeight * 0.1)); | ||||
|     } | ||||
|  | ||||
|     insertObject(obj) { | ||||
| @@ -1073,10 +1033,11 @@ class LookingGlass extends St.BoxLayout { | ||||
|     } | ||||
|  | ||||
|     // Handle key events which are relevant for all tabs of the LookingGlass | ||||
|     vfunc_key_press_event(keyPressEvent) { | ||||
|         let symbol = keyPressEvent.keyval; | ||||
|     _globalKeyPressEvent(actor, event) { | ||||
|         let symbol = event.get_key_symbol(); | ||||
|         let modifierState = event.get_state(); | ||||
|         if (symbol == Clutter.Escape) { | ||||
|             if (this._objInspector.visible) { | ||||
|             if (this._objInspector.actor.visible) { | ||||
|                 this._objInspector.close(); | ||||
|             } else { | ||||
|                 this.close(); | ||||
| @@ -1084,7 +1045,7 @@ class LookingGlass extends St.BoxLayout { | ||||
|             return Clutter.EVENT_STOP; | ||||
|         } | ||||
|         // Ctrl+PgUp and Ctrl+PgDown switches tabs in the notebook view | ||||
|         if (keyPressEvent.modifier_state & Clutter.ModifierType.CONTROL_MASK) { | ||||
|         if (modifierState & Clutter.ModifierType.CONTROL_MASK) { | ||||
|             if (symbol == Clutter.KEY_Page_Up) { | ||||
|                 this._notebook.prevTab(); | ||||
|             } else if (symbol == Clutter.KEY_Page_Down) { | ||||
| @@ -1102,49 +1063,40 @@ class LookingGlass extends St.BoxLayout { | ||||
|             return; | ||||
|  | ||||
|         this._notebook.selectIndex(0); | ||||
|         this.show(); | ||||
|         this.actor.show(); | ||||
|         this._open = true; | ||||
|         this._history.lastItem(); | ||||
|  | ||||
|         this.remove_all_transitions(); | ||||
|         Tweener.removeTweens(this.actor); | ||||
|  | ||||
|         // We inverse compensate for the slow-down so you can change the factor | ||||
|         // through LookingGlass without long waits. | ||||
|         let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor; | ||||
|         this.ease({ | ||||
|             y: this._targetY, | ||||
|             duration, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|         }); | ||||
|  | ||||
|         this._windowList.update(); | ||||
|         Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(), | ||||
|                                        transition: 'easeOutQuad', | ||||
|                                        y: this._targetY | ||||
|                                      }); | ||||
|     } | ||||
|  | ||||
|     close() { | ||||
|         if (!this._open) | ||||
|             return; | ||||
|  | ||||
|         this._objInspector.hide(); | ||||
|         this._objInspector.actor.hide(); | ||||
|  | ||||
|         this._open = false; | ||||
|         this.remove_all_transitions(); | ||||
|         Tweener.removeTweens(this.actor); | ||||
|  | ||||
|         this.setBorderPaintTarget(null); | ||||
|  | ||||
|         Main.popModal(this._entry); | ||||
|  | ||||
|         let settings = St.Settings.get(); | ||||
|         let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor, | ||||
|                                 LG_ANIMATION_TIME); | ||||
|         this.ease({ | ||||
|             y: this._hiddenY, | ||||
|             duration, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => this.hide() | ||||
|         }); | ||||
|         Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5), | ||||
|                                        transition: 'easeOutQuad', | ||||
|                                        y: this._hiddenY, | ||||
|                                        onComplete: () => { | ||||
|                                            this.actor.hide(); | ||||
|                                        } | ||||
|                                      }); | ||||
|     } | ||||
|  | ||||
|     get isOpen() { | ||||
|         return this._open; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(LookingGlass.prototype); | ||||
|   | ||||
| @@ -2,6 +2,7 @@ | ||||
|  | ||||
| const { Atspi, Clutter, GDesktopEnums, | ||||
|         Gio, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Background = imports.ui.background; | ||||
| @@ -40,8 +41,10 @@ const CROSS_HAIRS_OPACITY_KEY   = 'cross-hairs-opacity'; | ||||
| const CROSS_HAIRS_LENGTH_KEY    = 'cross-hairs-length'; | ||||
| const CROSS_HAIRS_CLIP_KEY      = 'cross-hairs-clip'; | ||||
|  | ||||
| let magDBusService = null; | ||||
|  | ||||
| var MouseSpriteContent = GObject.registerClass({ | ||||
|     Implements: [Clutter.Content], | ||||
|     Implements: [ Clutter.Content ], | ||||
| }, class MouseSpriteContent extends GObject.Object { | ||||
|     _init() { | ||||
|         super._init(); | ||||
| @@ -106,7 +109,8 @@ var Magnifier = class Magnifier { | ||||
|         // Create the first ZoomRegion and initialize it according to the | ||||
|         // magnification settings. | ||||
|  | ||||
|         [this.xMouse, this.yMouse] = global.get_pointer(); | ||||
|         let mask; | ||||
|         [this.xMouse, this.yMouse, mask] = global.get_pointer(); | ||||
|  | ||||
|         let aZoomRegion = new ZoomRegion(this, this._cursorRoot); | ||||
|         this._zoomRegions.push(aZoomRegion); | ||||
| @@ -118,7 +122,7 @@ var Magnifier = class Magnifier { | ||||
|         }); | ||||
|  | ||||
|         // Export to dbus. | ||||
|         (new MagnifierDBus.ShellMagnifier()); | ||||
|         magDBusService = new MagnifierDBus.ShellMagnifier(); | ||||
|         this.setActive(St.Settings.get().magnifier_active); | ||||
|     } | ||||
|  | ||||
| @@ -146,7 +150,7 @@ var Magnifier = class Magnifier { | ||||
|     setActive(activate) { | ||||
|         let isActive = this.isActive(); | ||||
|  | ||||
|         this._zoomRegions.forEach(zoomRegion => { | ||||
|         this._zoomRegions.forEach ((zoomRegion, index, array) => { | ||||
|             zoomRegion.setActive(activate); | ||||
|         }); | ||||
|  | ||||
| @@ -225,14 +229,14 @@ var Magnifier = class Magnifier { | ||||
|      * @return      true. | ||||
|      */ | ||||
|     scrollToMousePos() { | ||||
|         let [xMouse, yMouse] = global.get_pointer(); | ||||
|         let [xMouse, yMouse, mask] = global.get_pointer(); | ||||
|  | ||||
|         if (xMouse != this.xMouse || yMouse != this.yMouse) { | ||||
|             this.xMouse = xMouse; | ||||
|             this.yMouse = yMouse; | ||||
|  | ||||
|             let sysMouseOverAny = false; | ||||
|             this._zoomRegions.forEach(zoomRegion => { | ||||
|             this._zoomRegions.forEach((zoomRegion, index, array) => { | ||||
|                 if (zoomRegion.scrollToMousePos()) | ||||
|                     sysMouseOverAny = true; | ||||
|             }); | ||||
| @@ -264,7 +268,7 @@ var Magnifier = class Magnifier { | ||||
|         zoomRegion.setViewPort(viewPort); | ||||
|  | ||||
|         // We ignore the redundant width/height on the ROI | ||||
|         let fixedROI = Object.create(roi); | ||||
|         let fixedROI = new Object(roi); | ||||
|         fixedROI.width = viewPort.width / xMagFactor; | ||||
|         fixedROI.height = viewPort.height / yMagFactor; | ||||
|         zoomRegion.setROI(fixedROI); | ||||
| @@ -280,7 +284,7 @@ var Magnifier = class Magnifier { | ||||
|      * @zoomRegion:     The zoomRegion to add. | ||||
|      */ | ||||
|     addZoomRegion(zoomRegion) { | ||||
|         if (zoomRegion) { | ||||
|         if(zoomRegion) { | ||||
|             this._zoomRegions.push(zoomRegion); | ||||
|             if (!this.isTrackingMouse()) | ||||
|                 this.startTrackingMouse(); | ||||
| @@ -330,7 +334,7 @@ var Magnifier = class Magnifier { | ||||
|         this.setCrosshairsClip(clip); | ||||
|  | ||||
|         let theCrossHairs = this._crossHairs; | ||||
|         this._zoomRegions.forEach (zoomRegion => { | ||||
|         this._zoomRegions.forEach ((zoomRegion, index, array) => { | ||||
|             zoomRegion.addCrosshairs(theCrossHairs); | ||||
|         }); | ||||
|     } | ||||
| @@ -345,7 +349,8 @@ var Magnifier = class Magnifier { | ||||
|             if (!this._crossHairs) | ||||
|                 this.addCrosshairs(); | ||||
|             this._crossHairs.show(); | ||||
|         } else { | ||||
|         } | ||||
|         else { | ||||
|             if (this._crossHairs) | ||||
|                 this._crossHairs.hide(); | ||||
|         } | ||||
| @@ -358,7 +363,7 @@ var Magnifier = class Magnifier { | ||||
|      */ | ||||
|     setCrosshairsColor(color) { | ||||
|         if (this._crossHairs) { | ||||
|             let [res_, clutterColor] = Clutter.Color.from_string(color); | ||||
|             let [res, clutterColor] = Clutter.Color.from_string(color); | ||||
|             this._crossHairs.setColor(clutterColor); | ||||
|         } | ||||
|     } | ||||
| @@ -372,9 +377,9 @@ var Magnifier = class Magnifier { | ||||
|         if (this._crossHairs) { | ||||
|             let clutterColor = this._crossHairs.getColor(); | ||||
|             return clutterColor.to_string(); | ||||
|         } else { | ||||
|             return '#00000000'; | ||||
|         } | ||||
|         else | ||||
|             return '#00000000'; | ||||
|     } | ||||
|  | ||||
|     /** | ||||
| @@ -451,11 +456,16 @@ var Magnifier = class Magnifier { | ||||
|      * @clip:   Flag to indicate whether to clip the crosshairs. | ||||
|      */ | ||||
|     setCrosshairsClip(clip) { | ||||
|         if (!this._crossHairs) | ||||
|             return; | ||||
|  | ||||
|         // Setting no clipping on crosshairs means a zero sized clip rectangle. | ||||
|         this._crossHairs.setClip(clip ? CROSSHAIRS_CLIP_SIZE : [0, 0]); | ||||
|         if (clip) { | ||||
|             if (this._crossHairs) | ||||
|                 this._crossHairs.setClip(CROSSHAIRS_CLIP_SIZE); | ||||
|         } | ||||
|         else { | ||||
|             // Setting no clipping on crosshairs means a zero sized clip | ||||
|             // rectangle. | ||||
|             if (this._crossHairs) | ||||
|                 this._crossHairs.setClip([0, 0]); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     /** | ||||
| @@ -463,14 +473,14 @@ var Magnifier = class Magnifier { | ||||
|      * Get whether the crosshairs are clipped by the mouse image. | ||||
|      * @return:   Whether the crosshairs are clipped. | ||||
|      */ | ||||
|     getCrosshairsClip() { | ||||
|      getCrosshairsClip() { | ||||
|         if (this._crossHairs) { | ||||
|             let [clipWidth, clipHeight] = this._crossHairs.getClip(); | ||||
|             return (clipWidth > 0 && clipHeight > 0); | ||||
|         } else { | ||||
|             return false; | ||||
|         } | ||||
|     } | ||||
|         else | ||||
|             return false; | ||||
|      } | ||||
|  | ||||
|     //// Private methods //// | ||||
|  | ||||
| @@ -494,61 +504,61 @@ var Magnifier = class Magnifier { | ||||
|     _settingsInit(zoomRegion) { | ||||
|         this._settings = new Gio.Settings({ schema_id: MAGNIFIER_SCHEMA }); | ||||
|  | ||||
|         this._settings.connect(`changed::${SCREEN_POSITION_KEY}`, | ||||
|         this._settings.connect('changed::' + SCREEN_POSITION_KEY, | ||||
|                                this._updateScreenPosition.bind(this)); | ||||
|         this._settings.connect(`changed::${MAG_FACTOR_KEY}`, | ||||
|         this._settings.connect('changed::' + MAG_FACTOR_KEY, | ||||
|                                this._updateMagFactor.bind(this)); | ||||
|         this._settings.connect(`changed::${LENS_MODE_KEY}`, | ||||
|         this._settings.connect('changed::' + LENS_MODE_KEY, | ||||
|                                this._updateLensMode.bind(this)); | ||||
|         this._settings.connect(`changed::${CLAMP_MODE_KEY}`, | ||||
|         this._settings.connect('changed::' + CLAMP_MODE_KEY, | ||||
|                                this._updateClampMode.bind(this)); | ||||
|         this._settings.connect(`changed::${MOUSE_TRACKING_KEY}`, | ||||
|         this._settings.connect('changed::' + MOUSE_TRACKING_KEY, | ||||
|                                this._updateMouseTrackingMode.bind(this)); | ||||
|         this._settings.connect(`changed::${FOCUS_TRACKING_KEY}`, | ||||
|         this._settings.connect('changed::' + FOCUS_TRACKING_KEY, | ||||
|                                this._updateFocusTrackingMode.bind(this)); | ||||
|         this._settings.connect(`changed::${CARET_TRACKING_KEY}`, | ||||
|         this._settings.connect('changed::' + CARET_TRACKING_KEY, | ||||
|                                this._updateCaretTrackingMode.bind(this)); | ||||
|  | ||||
|         this._settings.connect(`changed::${INVERT_LIGHTNESS_KEY}`, | ||||
|         this._settings.connect('changed::' + INVERT_LIGHTNESS_KEY, | ||||
|                                this._updateInvertLightness.bind(this)); | ||||
|         this._settings.connect(`changed::${COLOR_SATURATION_KEY}`, | ||||
|         this._settings.connect('changed::' + COLOR_SATURATION_KEY, | ||||
|                                this._updateColorSaturation.bind(this)); | ||||
|  | ||||
|         this._settings.connect(`changed::${BRIGHT_RED_KEY}`, | ||||
|         this._settings.connect('changed::' + BRIGHT_RED_KEY, | ||||
|                                this._updateBrightness.bind(this)); | ||||
|         this._settings.connect(`changed::${BRIGHT_GREEN_KEY}`, | ||||
|         this._settings.connect('changed::' + BRIGHT_GREEN_KEY, | ||||
|                                this._updateBrightness.bind(this)); | ||||
|         this._settings.connect(`changed::${BRIGHT_BLUE_KEY}`, | ||||
|         this._settings.connect('changed::' + BRIGHT_BLUE_KEY, | ||||
|                                this._updateBrightness.bind(this)); | ||||
|  | ||||
|         this._settings.connect(`changed::${CONTRAST_RED_KEY}`, | ||||
|         this._settings.connect('changed::' + CONTRAST_RED_KEY, | ||||
|                                this._updateContrast.bind(this)); | ||||
|         this._settings.connect(`changed::${CONTRAST_GREEN_KEY}`, | ||||
|         this._settings.connect('changed::' + CONTRAST_GREEN_KEY, | ||||
|                                this._updateContrast.bind(this)); | ||||
|         this._settings.connect(`changed::${CONTRAST_BLUE_KEY}`, | ||||
|         this._settings.connect('changed::' + CONTRAST_BLUE_KEY, | ||||
|                                this._updateContrast.bind(this)); | ||||
|  | ||||
|         this._settings.connect(`changed::${SHOW_CROSS_HAIRS_KEY}`, () => { | ||||
|         this._settings.connect('changed::' + SHOW_CROSS_HAIRS_KEY, () => { | ||||
|             this.setCrosshairsVisible(this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY)); | ||||
|         }); | ||||
|  | ||||
|         this._settings.connect(`changed::${CROSS_HAIRS_THICKNESS_KEY}`, () => { | ||||
|         this._settings.connect('changed::' + CROSS_HAIRS_THICKNESS_KEY, () => { | ||||
|             this.setCrosshairsThickness(this._settings.get_int(CROSS_HAIRS_THICKNESS_KEY)); | ||||
|         }); | ||||
|  | ||||
|         this._settings.connect(`changed::${CROSS_HAIRS_COLOR_KEY}`, () => { | ||||
|         this._settings.connect('changed::' + CROSS_HAIRS_COLOR_KEY, () => { | ||||
|             this.setCrosshairsColor(this._settings.get_string(CROSS_HAIRS_COLOR_KEY)); | ||||
|         }); | ||||
|  | ||||
|         this._settings.connect(`changed::${CROSS_HAIRS_OPACITY_KEY}`, () => { | ||||
|         this._settings.connect('changed::' + CROSS_HAIRS_OPACITY_KEY, () => { | ||||
|             this.setCrosshairsOpacity(this._settings.get_double(CROSS_HAIRS_OPACITY_KEY)); | ||||
|         }); | ||||
|  | ||||
|         this._settings.connect(`changed::${CROSS_HAIRS_LENGTH_KEY}`, () => { | ||||
|         this._settings.connect('changed::' + CROSS_HAIRS_LENGTH_KEY, () => { | ||||
|             this.setCrosshairsLength(this._settings.get_int(CROSS_HAIRS_LENGTH_KEY)); | ||||
|         }); | ||||
|  | ||||
|         this._settings.connect(`changed::${CROSS_HAIRS_CLIP_KEY}`, () => { | ||||
|         this._settings.connect('changed::' + CROSS_HAIRS_CLIP_KEY, () => { | ||||
|             this.setCrosshairsClip(this._settings.get_boolean(CROSS_HAIRS_CLIP_KEY)); | ||||
|         }); | ||||
|  | ||||
| @@ -600,7 +610,7 @@ var Magnifier = class Magnifier { | ||||
|         let showCrosshairs = this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY); | ||||
|         this.addCrosshairs(); | ||||
|         this.setCrosshairsVisible(showCrosshairs); | ||||
|     } | ||||
|    } | ||||
|  | ||||
|     _updateScreenPosition() { | ||||
|         // Applies only to the first zoom region. | ||||
| @@ -790,8 +800,8 @@ var ZoomRegion = class ZoomRegion { | ||||
|         let extents; | ||||
|         try { | ||||
|             extents = component.get_extents(Atspi.CoordType.SCREEN); | ||||
|         } catch (e) { | ||||
|             log(`Failed to read extents of focused component: ${e.message}`); | ||||
|         } catch(e) { | ||||
|             log('Failed to read extents of focused component: ' + e.message); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
| @@ -807,8 +817,8 @@ var ZoomRegion = class ZoomRegion { | ||||
|         let extents; | ||||
|         try { | ||||
|             extents = text.get_character_extents(text.get_caret_offset(), 0); | ||||
|         } catch (e) { | ||||
|             log(`Failed to read extents of text caret: ${e.message}`); | ||||
|         } catch(e) { | ||||
|             log('Failed to read extents of text caret: ' + e.message); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
| @@ -1020,7 +1030,7 @@ var ZoomRegion = class ZoomRegion { | ||||
|         viewPort.x = 0; | ||||
|         viewPort.y = 0; | ||||
|         viewPort.width = global.screen_width; | ||||
|         viewPort.height = global.screen_height / 2; | ||||
|         viewPort.height = global.screen_height/2; | ||||
|         this._setViewPort(viewPort); | ||||
|         this._screenPosition = GDesktopEnums.MagnifierScreenPosition.TOP_HALF; | ||||
|     } | ||||
| @@ -1032,9 +1042,9 @@ var ZoomRegion = class ZoomRegion { | ||||
|     setBottomHalf() { | ||||
|         let viewPort = {}; | ||||
|         viewPort.x = 0; | ||||
|         viewPort.y = global.screen_height / 2; | ||||
|         viewPort.y = global.screen_height/2; | ||||
|         viewPort.width = global.screen_width; | ||||
|         viewPort.height = global.screen_height / 2; | ||||
|         viewPort.height = global.screen_height/2; | ||||
|         this._setViewPort(viewPort); | ||||
|         this._screenPosition = GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF; | ||||
|     } | ||||
| @@ -1047,7 +1057,7 @@ var ZoomRegion = class ZoomRegion { | ||||
|         let viewPort = {}; | ||||
|         viewPort.x = 0; | ||||
|         viewPort.y = 0; | ||||
|         viewPort.width = global.screen_width / 2; | ||||
|         viewPort.width = global.screen_width/2; | ||||
|         viewPort.height = global.screen_height; | ||||
|         this._setViewPort(viewPort); | ||||
|         this._screenPosition = GDesktopEnums.MagnifierScreenPosition.LEFT_HALF; | ||||
| @@ -1059,9 +1069,9 @@ var ZoomRegion = class ZoomRegion { | ||||
|      */ | ||||
|     setRightHalf() { | ||||
|         let viewPort = {}; | ||||
|         viewPort.x = global.screen_width / 2; | ||||
|         viewPort.x = global.screen_width/2; | ||||
|         viewPort.y = 0; | ||||
|         viewPort.width = global.screen_width / 2; | ||||
|         viewPort.width = global.screen_width/2; | ||||
|         viewPort.height = global.screen_height; | ||||
|         this._setViewPort(viewPort); | ||||
|         this._screenPosition = GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF; | ||||
| @@ -1093,21 +1103,21 @@ var ZoomRegion = class ZoomRegion { | ||||
|      */ | ||||
|     setScreenPosition(inPosition) { | ||||
|         switch (inPosition) { | ||||
|         case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN: | ||||
|             this.setFullScreenMode(); | ||||
|             break; | ||||
|         case GDesktopEnums.MagnifierScreenPosition.TOP_HALF: | ||||
|             this.setTopHalf(); | ||||
|             break; | ||||
|         case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF: | ||||
|             this.setBottomHalf(); | ||||
|             break; | ||||
|         case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF: | ||||
|             this.setLeftHalf(); | ||||
|             break; | ||||
|         case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF: | ||||
|             this.setRightHalf(); | ||||
|             break; | ||||
|             case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN: | ||||
|                 this.setFullScreenMode(); | ||||
|                 break; | ||||
|             case GDesktopEnums.MagnifierScreenPosition.TOP_HALF: | ||||
|                 this.setTopHalf(); | ||||
|                 break; | ||||
|             case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF: | ||||
|                 this.setBottomHalf(); | ||||
|                 break; | ||||
|             case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF: | ||||
|                 this.setLeftHalf(); | ||||
|                 break; | ||||
|             case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF: | ||||
|                 this.setRightHalf(); | ||||
|                 break; | ||||
|         } | ||||
|     } | ||||
|  | ||||
| @@ -1139,7 +1149,7 @@ var ZoomRegion = class ZoomRegion { | ||||
|  | ||||
|     _clearScrollContentsTimer() { | ||||
|         if (this._scrollContentsTimerId != 0) { | ||||
|             GLib.source_remove(this._scrollContentsTimerId); | ||||
|             Mainloop.source_remove(this._scrollContentsTimerId); | ||||
|             this._scrollContentsTimerId = 0; | ||||
|         } | ||||
|     } | ||||
| @@ -1151,7 +1161,7 @@ var ZoomRegion = class ZoomRegion { | ||||
|         } | ||||
|  | ||||
|         this._clearScrollContentsTimer(); | ||||
|         this._scrollContentsTimerId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, POINTER_REST_TIME, () => { | ||||
|         this._scrollContentsTimerId = Mainloop.timeout_add(POINTER_REST_TIME, () => { | ||||
|             this._scrollContentsToDelayed(x, y); | ||||
|             return GLib.SOURCE_REMOVE; | ||||
|         }); | ||||
| @@ -1290,7 +1300,7 @@ var ZoomRegion = class ZoomRegion { | ||||
|  | ||||
|         // Add a background for when the magnified uiGroup is scrolled | ||||
|         // out of view (don't want to see desktop showing through). | ||||
|         this._background = new Background.SystemBackground(); | ||||
|         this._background = (new Background.SystemBackground()).actor; | ||||
|         mainGroup.add_actor(this._background); | ||||
|  | ||||
|         // Clone the group that contains all of UI on the screen.  This is the | ||||
| @@ -1450,9 +1460,11 @@ var ZoomRegion = class ZoomRegion { | ||||
|  | ||||
|         if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) { | ||||
|             return this._centerFromPointProportional(xMouse, yMouse); | ||||
|         } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) { | ||||
|         } | ||||
|         else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) { | ||||
|             return this._centerFromPointPush(xMouse, yMouse); | ||||
|         } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) { | ||||
|         } | ||||
|         else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) { | ||||
|             return this._centerFromPointCentered(xMouse, yMouse); | ||||
|         } | ||||
|  | ||||
| @@ -1509,7 +1521,7 @@ var ZoomRegion = class ZoomRegion { | ||||
|     } | ||||
|  | ||||
|     _centerFromPointProportional(xPoint, yPoint) { | ||||
|         let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI(); | ||||
|         let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI(); | ||||
|         let halfScreenWidth = global.screen_width / 2; | ||||
|         let halfScreenHeight = global.screen_height / 2; | ||||
|         // We want to pad with a constant distance after zooming, so divide | ||||
| @@ -1520,7 +1532,7 @@ var ZoomRegion = class ZoomRegion { | ||||
|         let xProportion = (xPoint - halfScreenWidth) / halfScreenWidth;   // -1 ... 1 | ||||
|         let yProportion = (yPoint - halfScreenHeight) / halfScreenHeight; // -1 ... 1 | ||||
|         let xPos = xPoint - xProportion * (widthRoi / 2 - xPadding); | ||||
|         let yPos = yPoint - yProportion * (heightRoi / 2 - yPadding); | ||||
|         let yPos = yPoint - yProportion * (heightRoi /2 - yPadding); | ||||
|  | ||||
|         return [xPos, yPos]; | ||||
|     } | ||||
| @@ -1587,9 +1599,8 @@ var ZoomRegion = class ZoomRegion { | ||||
|     } | ||||
| }; | ||||
|  | ||||
| var Crosshairs = GObject.registerClass( | ||||
| class Crosshairs extends Clutter.Actor { | ||||
|     _init() { | ||||
| var Crosshairs = class Crosshairs { | ||||
|     constructor() { | ||||
|  | ||||
|         // Set the group containing the crosshairs to three times the desktop | ||||
|         // size in case the crosshairs need to appear to be infinite in | ||||
| @@ -1597,7 +1608,7 @@ class Crosshairs extends Clutter.Actor { | ||||
|         let groupWidth = global.screen_width * 3; | ||||
|         let groupHeight = global.screen_height * 3; | ||||
|  | ||||
|         super._init({ | ||||
|         this._actor = new Clutter.Actor({ | ||||
|             clip_to_allocation: false, | ||||
|             width: groupWidth, | ||||
|             height: groupHeight | ||||
| @@ -1606,10 +1617,10 @@ class Crosshairs extends Clutter.Actor { | ||||
|         this._horizRightHair = new Clutter.Actor(); | ||||
|         this._vertTopHair = new Clutter.Actor(); | ||||
|         this._vertBottomHair = new Clutter.Actor(); | ||||
|         this.add_actor(this._horizLeftHair); | ||||
|         this.add_actor(this._horizRightHair); | ||||
|         this.add_actor(this._vertTopHair); | ||||
|         this.add_actor(this._vertBottomHair); | ||||
|         this._actor.add_actor(this._horizLeftHair); | ||||
|         this._actor.add_actor(this._horizRightHair); | ||||
|         this._actor.add_actor(this._vertTopHair); | ||||
|         this._actor.add_actor(this._vertBottomHair); | ||||
|         this._clipSize = [0, 0]; | ||||
|         this._clones = []; | ||||
|         this.reCenter(); | ||||
| @@ -1619,11 +1630,11 @@ class Crosshairs extends Clutter.Actor { | ||||
|     } | ||||
|  | ||||
|     _monitorsChanged() { | ||||
|         this.set_size(global.screen_width * 3, global.screen_height * 3); | ||||
|         this._actor.set_size(global.screen_width * 3, global.screen_height * 3); | ||||
|         this.reCenter(); | ||||
|     } | ||||
|  | ||||
|     /** | ||||
|    /** | ||||
|     * addToZoomRegion | ||||
|     * Either add the crosshairs actor to the given ZoomRegion, or, if it is | ||||
|     * already part of some other ZoomRegion, create a clone of the crosshairs | ||||
| @@ -1640,21 +1651,18 @@ class Crosshairs extends Clutter.Actor { | ||||
|         if (zoomRegion && magnifiedMouse) { | ||||
|             let container = magnifiedMouse.get_parent(); | ||||
|             if (container) { | ||||
|                 crosshairsActor = this; | ||||
|                 if (this.get_parent() != null) { | ||||
|                     crosshairsActor = new Clutter.Clone({ source: this }); | ||||
|                 crosshairsActor = this._actor; | ||||
|                 if (this._actor.get_parent() != null) { | ||||
|                     crosshairsActor = new Clutter.Clone({ source: this._actor }); | ||||
|                     this._clones.push(crosshairsActor); | ||||
|  | ||||
|                     // Clones don't share visibility. | ||||
|                     this.bind_property('visible', crosshairsActor, 'visible', | ||||
|                                        GObject.BindingFlags.SYNC_CREATE); | ||||
|                 } | ||||
|                 crosshairsActor.visible = this._actor.visible; | ||||
|  | ||||
|                 container.add_actor(crosshairsActor); | ||||
|                 container.raise_child(magnifiedMouse, crosshairsActor); | ||||
|                 let [xMouse, yMouse] = magnifiedMouse.get_position(); | ||||
|                 let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size(); | ||||
|                 crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2); | ||||
|                 crosshairsActor.set_position(xMouse - crosshairsWidth / 2 , yMouse - crosshairsHeight / 2); | ||||
|             } | ||||
|         } | ||||
|         return crosshairsActor; | ||||
| @@ -1667,7 +1675,7 @@ class Crosshairs extends Clutter.Actor { | ||||
|      * child actor if it was just a clone of the crosshairs actor. | ||||
|      */ | ||||
|     removeFromParent(childActor) { | ||||
|         if (childActor == this) | ||||
|         if (childActor == this._actor) | ||||
|             childActor.get_parent().remove_actor(childActor); | ||||
|         else | ||||
|             childActor.destroy(); | ||||
| @@ -1770,11 +1778,34 @@ class Crosshairs extends Clutter.Actor { | ||||
|             // mouse. | ||||
|             this._clipSize = size; | ||||
|             this.reCenter(); | ||||
|         } else { | ||||
|         } | ||||
|         else { | ||||
|             // Restore the missing chunk. | ||||
|             this._clipSize = [0, 0]; | ||||
|             this.reCenter(); | ||||
|         } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * show: | ||||
|      * Show the crosshairs. | ||||
|      */ | ||||
|     show() { | ||||
|         this._actor.show(); | ||||
|         // Clones don't share visibility. | ||||
|         for (let i = 0; i < this._clones.length; i++) | ||||
|             this._clones[i].show(); | ||||
|     } | ||||
|  | ||||
|     /** | ||||
|      * hide: | ||||
|      * Hide the crosshairs. | ||||
|      */ | ||||
|     hide() { | ||||
|         this._actor.hide(); | ||||
|         // Clones don't share visibility. | ||||
|         for (let i = 0; i < this._clones.length; i++) | ||||
|             this._clones[i].hide(); | ||||
|     } | ||||
|  | ||||
|     /** | ||||
| @@ -1785,9 +1816,11 @@ class Crosshairs extends Clutter.Actor { | ||||
|      * @clipSize:  Optional.  If present, an array of the form [width, height]. | ||||
|      */ | ||||
|     reCenter(clipSize) { | ||||
|         let [groupWidth, groupHeight] = this.get_size(); | ||||
|         let [groupWidth, groupHeight] = this._actor.get_size(); | ||||
|         let leftLength = this._horizLeftHair.get_width(); | ||||
|         let rightLength = this._horizRightHair.get_width(); | ||||
|         let topLength = this._vertTopHair.get_height(); | ||||
|         let bottomLength = this._vertBottomHair.get_height(); | ||||
|         let thickness = this._horizLeftHair.get_height(); | ||||
|  | ||||
|         // Deal with clip rectangle. | ||||
| @@ -1807,7 +1840,7 @@ class Crosshairs extends Clutter.Actor { | ||||
|         this._vertTopHair.set_position((groupWidth - thickness) / 2, top); | ||||
|         this._vertBottomHair.set_position((groupWidth - thickness) / 2, bottom); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var MagShaderEffects = class MagShaderEffects { | ||||
|     constructor(uiGroupClone) { | ||||
| @@ -1894,8 +1927,8 @@ var MagShaderEffects = class MagShaderEffects { | ||||
|         // a null first argument. | ||||
|         let [bRed, bGreen, bBlue] = this._brightnessContrast.get_brightness(); | ||||
|         this._brightnessContrast.set_enabled( | ||||
|             cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE || | ||||
|             bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE | ||||
|              cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE || | ||||
|              bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE | ||||
|         ); | ||||
|     } | ||||
| }; | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported ShellMagnifier */ | ||||
|  | ||||
| const Gio = imports.gi.Gio; | ||||
| const Main = imports.ui.main; | ||||
| @@ -86,7 +85,7 @@ var ShellMagnifier = class ShellMagnifier { | ||||
|         let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] }; | ||||
|         let viewBox = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] }; | ||||
|         let realZoomRegion = Main.magnifier.createZoomRegion(xMagFactor, yMagFactor, ROI, viewBox); | ||||
|         let objectPath = `${ZOOM_SERVICE_PATH}/zoomer${_zoomRegionInstanceCount}`; | ||||
|         let objectPath = ZOOM_SERVICE_PATH + '/zoomer' + _zoomRegionInstanceCount; | ||||
|         _zoomRegionInstanceCount++; | ||||
|  | ||||
|         let zoomRegionProxy = new ShellMagnifierZoomRegion(objectPath, realZoomRegion); | ||||
| @@ -107,9 +106,9 @@ var ShellMagnifier = class ShellMagnifier { | ||||
|         if (proxyAndZoomRegion && proxyAndZoomRegion.zoomRegion) { | ||||
|             Main.magnifier.addZoomRegion(proxyAndZoomRegion.zoomRegion); | ||||
|             return true; | ||||
|         } else { | ||||
|             return false; | ||||
|         } | ||||
|         else | ||||
|             return false; | ||||
|     } | ||||
|  | ||||
|     /** | ||||
| @@ -125,7 +124,7 @@ var ShellMagnifier = class ShellMagnifier { | ||||
|         let zoomRegions = Main.magnifier.getZoomRegions(); | ||||
|         let objectPaths = []; | ||||
|         let thoseZoomers = this._zoomers; | ||||
|         zoomRegions.forEach (aZoomRegion => { | ||||
|         zoomRegions.forEach ((aZoomRegion, index, array) => { | ||||
|             let found = false; | ||||
|             for (let objectPath in thoseZoomers) { | ||||
|                 let proxyAndZoomRegion = thoseZoomers[objectPath]; | ||||
| @@ -180,74 +179,74 @@ var ShellMagnifier = class ShellMagnifier { | ||||
|      * Set the crosswire size of all ZoomRegions. | ||||
|      * @size:   The thickness of each line in the cross wire. | ||||
|      */ | ||||
|     setCrosswireSize(size) { | ||||
|      setCrosswireSize(size) { | ||||
|         Main.magnifier.setCrosshairsThickness(size); | ||||
|     } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * getCrosswireSize: | ||||
|      * Get the crosswire size of all ZoomRegions. | ||||
|      * @return:   The thickness of each line in the cross wire. | ||||
|      */ | ||||
|     getCrosswireSize() { | ||||
|      getCrosswireSize() { | ||||
|         return Main.magnifier.getCrosshairsThickness(); | ||||
|     } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * setCrosswireLength: | ||||
|      * Set the crosswire length of all zoom-regions.. | ||||
|      * @size:   The length of each line in the cross wire. | ||||
|      */ | ||||
|     setCrosswireLength(length) { | ||||
|      setCrosswireLength(length) { | ||||
|         Main.magnifier.setCrosshairsLength(length); | ||||
|     } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * setCrosswireSize: | ||||
|      * Set the crosswire size of all zoom-regions. | ||||
|      * @size:   The thickness of each line in the cross wire. | ||||
|      */ | ||||
|     getCrosswireLength() { | ||||
|      getCrosswireLength() { | ||||
|         return Main.magnifier.getCrosshairsLength(); | ||||
|     } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * setCrosswireClip: | ||||
|      * Set if the crosswire will be clipped by the cursor image.. | ||||
|      * @clip:   Flag to indicate whether to clip the crosswire. | ||||
|      */ | ||||
|     setCrosswireClip(clip) { | ||||
|      setCrosswireClip(clip) { | ||||
|         Main.magnifier.setCrosshairsClip(clip); | ||||
|     } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * getCrosswireClip: | ||||
|      * Get the crosswire clip value. | ||||
|      * @return:   Whether the crosswire is clipped by the cursor image. | ||||
|      */ | ||||
|     getCrosswireClip() { | ||||
|      getCrosswireClip() { | ||||
|         return Main.magnifier.getCrosshairsClip(); | ||||
|     } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * setCrosswireColor: | ||||
|      * Set the crosswire color of all ZoomRegions. | ||||
|      * @color:   Unsigned int of the form rrggbbaa. | ||||
|      */ | ||||
|     setCrosswireColor(color) { | ||||
|      setCrosswireColor(color) { | ||||
|         Main.magnifier.setCrosshairsColor('#%08x'.format(color)); | ||||
|     } | ||||
|      } | ||||
|  | ||||
|     /** | ||||
|      * getCrosswireClip: | ||||
|      * Get the crosswire color of all ZoomRegions. | ||||
|      * @return:   The crosswire color as an unsigned int in the form rrggbbaa. | ||||
|      */ | ||||
|     getCrosswireColor() { | ||||
|      getCrosswireColor() { | ||||
|         let colorString = Main.magnifier.getCrosshairsColor(); | ||||
|         // Drop the leading '#'. | ||||
|         return parseInt(colorString.slice(1), 16); | ||||
|     } | ||||
|      } | ||||
| }; | ||||
|  | ||||
| /** | ||||
|   | ||||
| @@ -1,14 +1,7 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported componentManager, notificationDaemon, windowAttentionHandler, | ||||
|             ctrlAltTabManager, padOsdService, osdWindowManager, | ||||
|             osdMonitorLabeler, shellMountOpDBusService, shellDBusService, | ||||
|             shellAccessDialogDBusService, shellAudioSelectionDBusService, | ||||
|             screenSaverDBus, screencastService, uiGroup, magnifier, | ||||
|             xdndHandler, keyboard, kbdA11yDialog, introspectService, | ||||
|             start, pushModal, popModal, activateWindow, createLookingGlass, | ||||
|             initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
|  | ||||
| const AccessDialog = imports.ui.accessDialog; | ||||
| const AudioDeviceSelection = imports.ui.audioDeviceSelection; | ||||
| @@ -53,7 +46,6 @@ const LOG_DOMAIN = 'GNOME Shell'; | ||||
| const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a'; | ||||
|  | ||||
| var componentManager = null; | ||||
| var extensionManager = null; | ||||
| var panel = null; | ||||
| var overview = null; | ||||
| var runDialog = null; | ||||
| @@ -92,6 +84,7 @@ let _cssStylesheet = null; | ||||
| let _a11ySettings = null; | ||||
| let _themeResource = null; | ||||
| let _oskResource = null; | ||||
| let pointerA11yTimeout = null; | ||||
|  | ||||
| function _sessionUpdated() { | ||||
|     if (sessionMode.isPrimary) | ||||
| @@ -179,7 +172,7 @@ function _initializeUI() { | ||||
|     kbdA11yDialog = new KbdA11yDialog.KbdA11yDialog(); | ||||
|     wm = new WindowManager.WindowManager(); | ||||
|     magnifier = new Magnifier.Magnifier(); | ||||
|     locatePointer = new LocatePointer.LocatePointer(); | ||||
|     locatePointer = new LocatePointer.locatePointer(); | ||||
|  | ||||
|     if (LoginManager.canLock()) | ||||
|         screenShield = new ScreenShield.ScreenShield(); | ||||
| @@ -189,7 +182,7 @@ function _initializeUI() { | ||||
|  | ||||
|     messageTray = new MessageTray.MessageTray(); | ||||
|     panel = new Panel.Panel(); | ||||
|     keyboard = new Keyboard.KeyboardManager(); | ||||
|     keyboard = new Keyboard.Keyboard(); | ||||
|     notificationDaemon = new NotificationDaemon.NotificationDaemon(); | ||||
|     windowAttentionHandler = new WindowAttentionHandler.WindowAttentionHandler(); | ||||
|     componentManager = new Components.ComponentManager(); | ||||
| @@ -199,7 +192,7 @@ function _initializeUI() { | ||||
|     layoutManager.init(); | ||||
|     overview.init(); | ||||
|  | ||||
|     (new PointerA11yTimeout.PointerA11yTimeout()); | ||||
|     pointerA11yTimeout = new PointerA11yTimeout.PointerA11yTimeout(); | ||||
|  | ||||
|     _a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA }); | ||||
|  | ||||
| @@ -229,17 +222,12 @@ function _initializeUI() { | ||||
|     EndSessionDialog.init(); | ||||
|  | ||||
|     // We're ready for the session manager to move to the next phase | ||||
|     GLib.idle_add(GLib.PRIORITY_DEFAULT, () => { | ||||
|         Shell.util_sd_notify(); | ||||
|         Meta.register_with_session(); | ||||
|         return GLib.SOURCE_REMOVE; | ||||
|     }); | ||||
|     Meta.register_with_session(); | ||||
|  | ||||
|     _startDate = new Date(); | ||||
|  | ||||
|     ExtensionDownloader.init(); | ||||
|     extensionManager = new ExtensionSystem.ExtensionManager(); | ||||
|     extensionManager.init(); | ||||
|     ExtensionSystem.init(); | ||||
|  | ||||
|     if (sessionMode.isGreeter && screenShield) { | ||||
|         layoutManager.connect('startup-prepared', () => { | ||||
| @@ -262,25 +250,12 @@ function _initializeUI() { | ||||
|             }); | ||||
|         } | ||||
|  | ||||
|         let credentials = new Gio.Credentials(); | ||||
|         if (credentials.get_unix_user() === 0) { | ||||
|             notify(_('Logged in as a privileged user'), | ||||
|                    _('Running a session as a privileged user should be avoided for security reasons. If possible, you should log in as a normal user.')); | ||||
|         } | ||||
|  | ||||
|         if (sessionMode.currentMode !== 'gdm' && | ||||
|             sessionMode.currentMode !== 'initial-setup' && | ||||
|             screenShield === null) { | ||||
|             notify(_('Screen Lock disabled'), | ||||
|                    _('Screen Locking requires the GNOME display manager.')); | ||||
|         } | ||||
|  | ||||
|         LoginManager.registerSessionWithGDM(); | ||||
|  | ||||
|         let perfModuleName = GLib.getenv("SHELL_PERF_MODULE"); | ||||
|         if (perfModuleName) { | ||||
|             let perfOutput = GLib.getenv("SHELL_PERF_OUTPUT"); | ||||
|             let module = eval(`imports.perf.${perfModuleName};`); | ||||
|             let module = eval('imports.perf.' + perfModuleName + ';'); | ||||
|             Scripting.runPerfScript(module, perfOutput); | ||||
|         } | ||||
|     }); | ||||
| @@ -403,7 +378,7 @@ function notify(msg, details) { | ||||
|     messageTray.add(source); | ||||
|     let notification = new MessageTray.Notification(source, msg, details); | ||||
|     notification.setTransient(true); | ||||
|     source.showNotification(notification); | ||||
|     source.notify(notification); | ||||
| } | ||||
|  | ||||
| /** | ||||
| @@ -416,9 +391,9 @@ function notify(msg, details) { | ||||
| function notifyError(msg, details) { | ||||
|     // Also print to stderr so it's logged somewhere | ||||
|     if (details) | ||||
|         log(`error: ${msg}: ${details}`); | ||||
|         log('error: ' + msg + ': ' + details); | ||||
|     else | ||||
|         log(`error: ${msg}`); | ||||
|         log('error: ' + msg); | ||||
|  | ||||
|     notify(msg, details); | ||||
| } | ||||
| @@ -636,7 +611,7 @@ function _runDeferredWork(workId) { | ||||
|     _deferredWorkQueue.splice(index, 1); | ||||
|     _deferredWorkData[workId].callback(); | ||||
|     if (_deferredWorkQueue.length == 0 && _deferredTimeoutId > 0) { | ||||
|         GLib.source_remove(_deferredTimeoutId); | ||||
|         Mainloop.source_remove(_deferredTimeoutId); | ||||
|         _deferredTimeoutId = 0; | ||||
|     } | ||||
| } | ||||
| @@ -682,13 +657,13 @@ function _queueBeforeRedraw(workId) { | ||||
|  * | ||||
|  * Returns: A string work identifier | ||||
|  */ | ||||
| function initializeDeferredWork(actor, callback) { | ||||
| function initializeDeferredWork(actor, callback, props) { | ||||
|     // Turn into a string so we can use as an object property | ||||
|     let workId = `${(++_deferredWorkSequence)}`; | ||||
|     let workId = '' + (++_deferredWorkSequence); | ||||
|     _deferredWorkData[workId] = { 'actor': actor, | ||||
|                                   'callback': callback }; | ||||
|     actor.connect('notify::mapped', () => { | ||||
|         if (!(actor.mapped && _deferredWorkQueue.includes(workId))) | ||||
|         if (!(actor.mapped && _deferredWorkQueue.indexOf(workId) >= 0)) | ||||
|             return; | ||||
|         _queueBeforeRedraw(workId); | ||||
|     }); | ||||
| @@ -718,12 +693,13 @@ function queueDeferredWork(workId) { | ||||
|         logError(new Error(message), message); | ||||
|         return; | ||||
|     } | ||||
|     if (!_deferredWorkQueue.includes(workId)) | ||||
|     if (_deferredWorkQueue.indexOf(workId) < 0) | ||||
|         _deferredWorkQueue.push(workId); | ||||
|     if (data.actor.mapped) { | ||||
|         _queueBeforeRedraw(workId); | ||||
|         return; | ||||
|     } else if (_deferredTimeoutId == 0) { | ||||
|         _deferredTimeoutId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, DEFERRED_TIMEOUT_SECONDS, () => { | ||||
|         _deferredTimeoutId = Mainloop.timeout_add_seconds(DEFERRED_TIMEOUT_SECONDS, () => { | ||||
|             _runAllDeferredWork(); | ||||
|             _deferredTimeoutId = 0; | ||||
|             return GLib.SOURCE_REMOVE; | ||||
|   | ||||
| @@ -1,13 +1,13 @@ | ||||
| /* exported MessageListSection */ | ||||
| const { Atk, Clutter, Gio, GLib, | ||||
|         GObject, Graphene, Meta, Pango, St } = imports.gi; | ||||
| const { Atk, Clutter, Gio, GLib, GObject, Meta, Pango, St } = imports.gi; | ||||
| const Main = imports.ui.main; | ||||
| const MessageTray = imports.ui.messageTray; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Calendar = imports.ui.calendar; | ||||
| const Tweener = imports.ui.tweener; | ||||
| const Util = imports.misc.util; | ||||
|  | ||||
| var MESSAGE_ANIMATION_TIME = 100; | ||||
| var MESSAGE_ANIMATION_TIME = 0.1; | ||||
|  | ||||
| var DEFAULT_EXPAND_LINES = 6; | ||||
|  | ||||
| @@ -32,18 +32,15 @@ function _fixMarkup(text, allowMarkup) { | ||||
|     return GLib.markup_escape_text(text, -1); | ||||
| } | ||||
|  | ||||
| var URLHighlighter = GObject.registerClass( | ||||
| class URLHighlighter extends St.Label { | ||||
|     _init(text = '', lineWrap, allowMarkup) { | ||||
|         super._init({ | ||||
|             reactive: true, | ||||
|             style_class: 'url-highlighter', | ||||
|             x_expand: true, | ||||
|             x_align: Clutter.ActorAlign.START | ||||
|         }); | ||||
| var URLHighlighter = class URLHighlighter { | ||||
|     constructor(text, lineWrap, allowMarkup) { | ||||
|         if (!text) | ||||
|             text = ''; | ||||
|         this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter', | ||||
|                                     x_expand: true, x_align: Clutter.ActorAlign.START }); | ||||
|         this._linkColor = '#ccccff'; | ||||
|         this.connect('style-changed', () => { | ||||
|             let [hasColor, color] = this.get_theme_node().lookup_color('link-color', false); | ||||
|         this.actor.connect('style-changed', () => { | ||||
|             let [hasColor, color] = this.actor.get_theme_node().lookup_color('link-color', false); | ||||
|             if (hasColor) { | ||||
|                 let linkColor = color.to_string().substr(0, 7); | ||||
|                 if (linkColor != this._linkColor) { | ||||
| @@ -52,75 +49,70 @@ class URLHighlighter extends St.Label { | ||||
|                 } | ||||
|             } | ||||
|         }); | ||||
|         this.clutter_text.line_wrap = lineWrap; | ||||
|         this.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR; | ||||
|         this.actor.clutter_text.line_wrap = lineWrap; | ||||
|         this.actor.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR; | ||||
|  | ||||
|         this.setMarkup(text, allowMarkup); | ||||
|     } | ||||
|         this.actor.connect('button-press-event', (actor, event) => { | ||||
|             // Don't try to URL highlight when invisible. | ||||
|             // The MessageTray doesn't actually hide us, so | ||||
|             // we need to check for paint opacities as well. | ||||
|             if (!actor.visible || actor.get_paint_opacity() == 0) | ||||
|                 return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|     vfunc_button_press_event(buttonEvent) { | ||||
|         // Don't try to URL highlight when invisible. | ||||
|         // The MessageTray doesn't actually hide us, so | ||||
|         // we need to check for paint opacities as well. | ||||
|         if (!this.visible || this.get_paint_opacity() == 0) | ||||
|             // Keep Notification.actor from seeing this and taking | ||||
|             // a pointer grab, which would block our button-release-event | ||||
|             // handler, if an URL is clicked | ||||
|             return this._findUrlAtPos(event) != -1; | ||||
|         }); | ||||
|         this.actor.connect('button-release-event', (actor, event) => { | ||||
|             if (!actor.visible || actor.get_paint_opacity() == 0) | ||||
|                 return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|             let urlId = this._findUrlAtPos(event); | ||||
|             if (urlId != -1) { | ||||
|                 let url = this._urls[urlId].url; | ||||
|                 if (url.indexOf(':') == -1) | ||||
|                     url = 'http://' + url; | ||||
|  | ||||
|                 Gio.app_info_launch_default_for_uri(url, global.create_app_launch_context(0, -1)); | ||||
|                 return Clutter.EVENT_STOP; | ||||
|             } | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|         }); | ||||
|         this.actor.connect('motion-event', (actor, event) => { | ||||
|             if (!actor.visible || actor.get_paint_opacity() == 0) | ||||
|                 return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         // Keep Notification from seeing this and taking | ||||
|         // a pointer grab, which would block our button-release-event | ||||
|         // handler, if an URL is clicked | ||||
|         return this._findUrlAtPos(buttonEvent) != -1; | ||||
|     } | ||||
|  | ||||
|     vfunc_button_release_event(buttonEvent) { | ||||
|         if (!this.visible || this.get_paint_opacity() == 0) | ||||
|             let urlId = this._findUrlAtPos(event); | ||||
|             if (urlId != -1 && !this._cursorChanged) { | ||||
|                 global.display.set_cursor(Meta.Cursor.POINTING_HAND); | ||||
|                 this._cursorChanged = true; | ||||
|             } else if (urlId == -1) { | ||||
|                 global.display.set_cursor(Meta.Cursor.DEFAULT); | ||||
|                 this._cursorChanged = false; | ||||
|             } | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|         }); | ||||
|         this.actor.connect('leave-event', () => { | ||||
|             if (!this.actor.visible || this.actor.get_paint_opacity() == 0) | ||||
|                 return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         let urlId = this._findUrlAtPos(buttonEvent); | ||||
|         if (urlId != -1) { | ||||
|             let url = this._urls[urlId].url; | ||||
|             if (!url.includes(':')) | ||||
|                 url = 'http://' + url; | ||||
|  | ||||
|             Gio.app_info_launch_default_for_uri( | ||||
|                 url, global.create_app_launch_context(0, -1)); | ||||
|             return Clutter.EVENT_STOP; | ||||
|         } | ||||
|         return Clutter.EVENT_PROPAGATE; | ||||
|     } | ||||
|  | ||||
|     vfunc_motion_event(motionEvent) { | ||||
|         if (!this.visible || this.get_paint_opacity() == 0) | ||||
|             if (this._cursorChanged) { | ||||
|                 this._cursorChanged = false; | ||||
|                 global.display.set_cursor(Meta.Cursor.DEFAULT); | ||||
|             } | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         let urlId = this._findUrlAtPos(motionEvent); | ||||
|         if (urlId != -1 && !this._cursorChanged) { | ||||
|             global.display.set_cursor(Meta.Cursor.POINTING_HAND); | ||||
|             this._cursorChanged = true; | ||||
|         } else if (urlId == -1) { | ||||
|             global.display.set_cursor(Meta.Cursor.DEFAULT); | ||||
|             this._cursorChanged = false; | ||||
|         } | ||||
|         return Clutter.EVENT_PROPAGATE; | ||||
|     } | ||||
|  | ||||
|     vfunc_leave_event(crossingEvent) { | ||||
|         if (!this.visible || this.get_paint_opacity() == 0) | ||||
|             return Clutter.EVENT_PROPAGATE; | ||||
|  | ||||
|         if (this._cursorChanged) { | ||||
|             this._cursorChanged = false; | ||||
|             global.display.set_cursor(Meta.Cursor.DEFAULT); | ||||
|         } | ||||
|         return super.vfunc_leave_event(crossingEvent); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     setMarkup(text, allowMarkup) { | ||||
|         text = text ? _fixMarkup(text, allowMarkup) : ''; | ||||
|         this._text = text; | ||||
|  | ||||
|         this.clutter_text.set_markup(text); | ||||
|         this.actor.clutter_text.set_markup(text); | ||||
|         /* clutter_text.text contain text without markup */ | ||||
|         this._urls = Util.findUrls(this.clutter_text.text); | ||||
|         this._urls = Util.findUrls(this.actor.clutter_text.text); | ||||
|         this._highlightUrls(); | ||||
|     } | ||||
|  | ||||
| @@ -136,28 +128,29 @@ class URLHighlighter extends St.Label { | ||||
|             pos = url.pos + url.url.length; | ||||
|         } | ||||
|         markup += this._text.substr(pos); | ||||
|         this.clutter_text.set_markup(markup); | ||||
|         this.actor.clutter_text.set_markup(markup); | ||||
|     } | ||||
|  | ||||
|     _findUrlAtPos(event) { | ||||
|         let { x, y } = event; | ||||
|         [, x, y] = this.transform_stage_point(x, y); | ||||
|         let findPos = -1; | ||||
|         for (let i = 0; i < this.clutter_text.text.length; i++) { | ||||
|             let [, px, py, lineHeight] = this.clutter_text.position_to_coords(i); | ||||
|             if (py > y || py + lineHeight < y || x < px) | ||||
|         let success; | ||||
|         let [x, y] = event.get_coords(); | ||||
|         [success, x, y] = this.actor.transform_stage_point(x, y); | ||||
|         let find_pos = -1; | ||||
|         for (let i = 0; i < this.actor.clutter_text.text.length; i++) { | ||||
|             let [success, px, py, line_height] = this.actor.clutter_text.position_to_coords(i); | ||||
|             if (py > y || py + line_height < y || x < px) | ||||
|                 continue; | ||||
|             findPos = i; | ||||
|             find_pos = i; | ||||
|         } | ||||
|         if (findPos != -1) { | ||||
|         if (find_pos != -1) { | ||||
|             for (let i = 0; i < this._urls.length; i++) | ||||
|                 if (findPos >= this._urls[i].pos && | ||||
|                     this._urls[i].pos + this._urls[i].url.length > findPos) | ||||
|                     return i; | ||||
|             if (find_pos >= this._urls[i].pos && | ||||
|                 this._urls[i].pos + this._urls[i].url.length > find_pos) | ||||
|                 return i; | ||||
|         } | ||||
|         return -1; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var ScaleLayout = GObject.registerClass( | ||||
| class ScaleLayout extends Clutter.BinLayout { | ||||
| @@ -204,14 +197,12 @@ class ScaleLayout extends Clutter.BinLayout { | ||||
| }); | ||||
|  | ||||
| var LabelExpanderLayout = GObject.registerClass({ | ||||
|     Properties: { | ||||
|         'expansion': GObject.ParamSpec.double('expansion', | ||||
|                                               'Expansion', | ||||
|                                               'Expansion of the layout, between 0 (collapsed) ' + | ||||
|                                               'and 1 (fully expanded', | ||||
|                                               GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                               0, 1, 0) | ||||
|     }, | ||||
|     Properties: { 'expansion': GObject.ParamSpec.double('expansion', | ||||
|                                                         'Expansion', | ||||
|                                                         'Expansion of the layout, between 0 (collapsed) ' + | ||||
|                                                         'and 1 (fully expanded', | ||||
|                                                          GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, | ||||
|                                                          0, 1, 0)}, | ||||
| }, class LabelExpanderLayout extends Clutter.LayoutManager { | ||||
|     _init(params) { | ||||
|         this._expansion = 0; | ||||
| @@ -293,29 +284,21 @@ var LabelExpanderLayout = GObject.registerClass({ | ||||
|     } | ||||
| }); | ||||
|  | ||||
|  | ||||
| var Message = GObject.registerClass({ | ||||
|     GTypeName: 'MessageList_Message', | ||||
|     Signals: { | ||||
|         'close': {}, | ||||
|         'expanded': {}, | ||||
|         'unexpanded': {}, | ||||
|     } | ||||
| }, class Message extends St.Button { | ||||
|     _init(title, body) { | ||||
|         super._init({ | ||||
|             style_class: 'message', | ||||
|             accessible_role: Atk.Role.NOTIFICATION, | ||||
|             can_focus: true, | ||||
|             x_expand: true, | ||||
|             x_fill: true | ||||
|         }); | ||||
|  | ||||
| var Message = class Message { | ||||
|     constructor(title, body) { | ||||
|         this.expanded = false; | ||||
|  | ||||
|         this._useBodyMarkup = false; | ||||
|  | ||||
|         this.actor = new St.Button({ style_class: 'message', | ||||
|                                      accessible_role: Atk.Role.NOTIFICATION, | ||||
|                                      can_focus: true, | ||||
|                                      x_expand: true, x_fill: true }); | ||||
|         this.actor.connect('key-press-event', | ||||
|                            this._onKeyPressed.bind(this)); | ||||
|  | ||||
|         let vbox = new St.BoxLayout({ vertical: true }); | ||||
|         this.set_child(vbox); | ||||
|         this.actor.set_child(vbox); | ||||
|  | ||||
|         let hbox = new St.BoxLayout(); | ||||
|         vbox.add_actor(hbox); | ||||
| @@ -359,14 +342,15 @@ var Message = GObject.registerClass({ | ||||
|         contentBox.add_actor(this._bodyStack); | ||||
|  | ||||
|         this.bodyLabel = new URLHighlighter('', false, this._useBodyMarkup); | ||||
|         this.bodyLabel.add_style_class_name('message-body'); | ||||
|         this._bodyStack.add_actor(this.bodyLabel); | ||||
|         this.bodyLabel.actor.add_style_class_name('message-body'); | ||||
|         this._bodyStack.add_actor(this.bodyLabel.actor); | ||||
|         this.setBody(body); | ||||
|  | ||||
|         this._closeButton.connect('clicked', this.close.bind(this)); | ||||
|         let actorHoverId = this.connect('notify::hover', this._sync.bind(this)); | ||||
|         this._closeButton.connect('destroy', this.disconnect.bind(this, actorHoverId)); | ||||
|         this.connect('destroy', this._onDestroy.bind(this)); | ||||
|         let actorHoverId = this.actor.connect('notify::hover', this._sync.bind(this)); | ||||
|         this._closeButton.connect('destroy', this.actor.disconnect.bind(this.actor, actorHoverId)); | ||||
|         this.actor.connect('clicked', this._onClicked.bind(this)); | ||||
|         this.actor.connect('destroy', this._onDestroy.bind(this)); | ||||
|         this._sync(); | ||||
|     } | ||||
|  | ||||
| @@ -452,21 +436,19 @@ var Message = GObject.registerClass({ | ||||
|         if (this._bodyStack.get_n_children() < 2) { | ||||
|             this._expandedLabel = new URLHighlighter(this._bodyText, | ||||
|                                                      true, this._useBodyMarkup); | ||||
|             this.setExpandedBody(this._expandedLabel); | ||||
|             this.setExpandedBody(this._expandedLabel.actor); | ||||
|         } | ||||
|  | ||||
|         if (animate) { | ||||
|             this._bodyStack.ease_property('@layout.expansion', 1, { | ||||
|                 progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                 duration: MessageTray.ANIMATION_TIME, | ||||
|             }); | ||||
|  | ||||
|             Tweener.addTween(this._bodyStack.layout_manager, | ||||
|                              { expansion: 1, | ||||
|                                time: MessageTray.ANIMATION_TIME, | ||||
|                                transition: 'easeOutQuad' }); | ||||
|             this._actionBin.scale_y = 0; | ||||
|             this._actionBin.ease({ | ||||
|                 scale_y: 1, | ||||
|                 duration: MessageTray.ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|             }); | ||||
|             Tweener.addTween(this._actionBin, | ||||
|                              { scale_y: 1, | ||||
|                                time: MessageTray.ANIMATION_TIME, | ||||
|                                transition: 'easeOutQuad' }); | ||||
|         } else { | ||||
|             this._bodyStack.layout_manager.expansion = 1; | ||||
|             this._actionBin.scale_y = 1; | ||||
| @@ -477,20 +459,19 @@ var Message = GObject.registerClass({ | ||||
|  | ||||
|     unexpand(animate) { | ||||
|         if (animate) { | ||||
|             this._bodyStack.ease_property('@layout.expansion', 0, { | ||||
|                 progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                 duration: MessageTray.ANIMATION_TIME, | ||||
|             }); | ||||
|  | ||||
|             this._actionBin.ease({ | ||||
|                 scale_y: 0, | ||||
|                 duration: MessageTray.ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                 onComplete: () => { | ||||
|                     this._actionBin.hide(); | ||||
|                     this.expanded = false; | ||||
|                 } | ||||
|             }); | ||||
|             Tweener.addTween(this._bodyStack.layout_manager, | ||||
|                              { expansion: 0, | ||||
|                                time: MessageTray.ANIMATION_TIME, | ||||
|                                transition: 'easeOutQuad' }); | ||||
|             Tweener.addTween(this._actionBin, | ||||
|                              { scale_y: 0, | ||||
|                                time: MessageTray.ANIMATION_TIME, | ||||
|                                transition: 'easeOutQuad', | ||||
|                                onCompleteScope: this, | ||||
|                                onComplete() { | ||||
|                                    this._actionBin.hide(); | ||||
|                                    this.expanded = false; | ||||
|                                }}); | ||||
|         } else { | ||||
|             this._bodyStack.layout_manager.expansion = 0; | ||||
|             this._actionBin.scale_y = 0; | ||||
| @@ -505,16 +486,19 @@ var Message = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _sync() { | ||||
|         let visible = this.hover && this.canClose(); | ||||
|         let visible = this.actor.hover && this.canClose(); | ||||
|         this._closeButton.opacity = visible ? 255 : 0; | ||||
|         this._closeButton.reactive = visible; | ||||
|     } | ||||
|  | ||||
|     _onClicked() { | ||||
|     } | ||||
|  | ||||
|     _onDestroy() { | ||||
|     } | ||||
|  | ||||
|     vfunc_key_press_event(keyEvent) { | ||||
|         let keysym = keyEvent.keyval; | ||||
|     _onKeyPressed(a, event) { | ||||
|         let keysym = event.get_key_symbol(); | ||||
|  | ||||
|         if (keysym == Clutter.KEY_Delete || | ||||
|             keysym == Clutter.KEY_KP_Delete) { | ||||
| @@ -523,66 +507,37 @@ var Message = GObject.registerClass({ | ||||
|         } | ||||
|         return Clutter.EVENT_PROPAGATE; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(Message.prototype); | ||||
|  | ||||
| var MessageListSection = GObject.registerClass({ | ||||
|     Properties: { | ||||
|         'can-clear': GObject.ParamSpec.boolean( | ||||
|             'can-clear', 'can-clear', 'can-clear', | ||||
|             GObject.ParamFlags.READABLE, | ||||
|             false), | ||||
|         'empty': GObject.ParamSpec.boolean( | ||||
|             'empty', 'empty', 'empty', | ||||
|             GObject.ParamFlags.READABLE, | ||||
|             true), | ||||
|     }, | ||||
|     Signals: { | ||||
|         'can-clear-changed': {}, | ||||
|         'empty-changed': {}, | ||||
|         'message-focused': { param_types: [Message.$gtype] }, | ||||
|     } | ||||
| }, class MessageListSection extends St.BoxLayout { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             style_class: 'message-list-section', | ||||
|             clip_to_allocation: true, | ||||
|             vertical: true, | ||||
|             x_expand: true | ||||
|         }); | ||||
| var MessageListSection = class MessageListSection { | ||||
|     constructor() { | ||||
|         this.actor = new St.BoxLayout({ style_class: 'message-list-section', | ||||
|                                         clip_to_allocation: true, | ||||
|                                         x_expand: true, vertical: true }); | ||||
|  | ||||
|         this._list = new St.BoxLayout({ style_class: 'message-list-section-list', | ||||
|                                         vertical: true }); | ||||
|         this.add_actor(this._list); | ||||
|         this.actor.add_actor(this._list); | ||||
|  | ||||
|         this._list.connect('actor-added', this._sync.bind(this)); | ||||
|         this._list.connect('actor-removed', this._sync.bind(this)); | ||||
|  | ||||
|         let id = Main.sessionMode.connect('updated', | ||||
|                                           this._sync.bind(this)); | ||||
|         this.connect('destroy', () => { | ||||
|         this.actor.connect('destroy', () => { | ||||
|             Main.sessionMode.disconnect(id); | ||||
|         }); | ||||
|  | ||||
|         this._messages = new Map(); | ||||
|         this._date = new Date(); | ||||
|         this._empty = true; | ||||
|         this._canClear = false; | ||||
|         this.empty = true; | ||||
|         this.canClear = false; | ||||
|         this._sync(); | ||||
|     } | ||||
|  | ||||
|     get empty() { | ||||
|         return this._empty; | ||||
|     } | ||||
|  | ||||
|     get canClear() { | ||||
|         return this._canClear; | ||||
|     } | ||||
|  | ||||
|     get _messages() { | ||||
|         return this._list.get_children().map(i => i.child); | ||||
|     } | ||||
|  | ||||
|     _onKeyFocusIn(messageActor) { | ||||
|         this.emit('message-focused', messageActor); | ||||
|     _onKeyFocusIn(actor) { | ||||
|         this.emit('key-focus-in', actor); | ||||
|     } | ||||
|  | ||||
|     get allowed() { | ||||
| @@ -601,96 +556,85 @@ var MessageListSection = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     addMessageAtIndex(message, index, animate) { | ||||
|         if (this._messages.includes(message)) | ||||
|             throw new Error('Message was already added previously'); | ||||
|  | ||||
|         let listItem = new St.Bin({ | ||||
|             child: message, | ||||
|             x_fill: true, | ||||
|             y_fill: true, | ||||
|             layout_manager: new ScaleLayout(), | ||||
|             pivot_point: new Graphene.Point({ x: .5, y: .5 }), | ||||
|         let obj = { | ||||
|             container: null, | ||||
|             destroyId: 0, | ||||
|             keyFocusId: 0, | ||||
|             closeId: 0 | ||||
|         }; | ||||
|         let pivot = new Clutter.Point({ x: .5, y: .5 }); | ||||
|         let scale = animate ? 0 : 1; | ||||
|         obj.container = new St.Widget({ layout_manager: new ScaleLayout(), | ||||
|                                         pivot_point: pivot, | ||||
|                                         scale_x: scale, scale_y: scale }); | ||||
|         obj.keyFocusId = message.actor.connect('key-focus-in', | ||||
|             this._onKeyFocusIn.bind(this)); | ||||
|         obj.destroyId = message.actor.connect('destroy', () => { | ||||
|             this.removeMessage(message, false); | ||||
|         }); | ||||
|         listItem._connectionsIds = []; | ||||
|  | ||||
|         listItem._connectionsIds.push(message.connect('key-focus-in', | ||||
|             this._onKeyFocusIn.bind(this))); | ||||
|         listItem._connectionsIds.push(message.connect('close', () => { | ||||
|         obj.closeId = message.connect('close', () => { | ||||
|             this.removeMessage(message, true); | ||||
|         })); | ||||
|         listItem._connectionsIds.push(message.connect('destroy', () => { | ||||
|             listItem._connectionsIds.forEach(id => message.disconnect(id)); | ||||
|             listItem.destroy(); | ||||
|         })); | ||||
|         }); | ||||
|  | ||||
|         this._list.insert_child_at_index(listItem, index); | ||||
|         this._messages.set(message, obj); | ||||
|         obj.container.add_actor(message.actor); | ||||
|  | ||||
|         if (animate) { | ||||
|             listItem.set({ scale_x: 0, scale_y: 0 }); | ||||
|             listItem.ease({ | ||||
|                 scale_x: 1, | ||||
|                 scale_y: 1, | ||||
|                 duration: MESSAGE_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|             }); | ||||
|         } | ||||
|         this._list.insert_child_at_index(obj.container, index); | ||||
|  | ||||
|         if (animate) | ||||
|             Tweener.addTween(obj.container, { scale_x: 1, | ||||
|                                               scale_y: 1, | ||||
|                                               time: MESSAGE_ANIMATION_TIME, | ||||
|                                               transition: 'easeOutQuad' }); | ||||
|     } | ||||
|  | ||||
|     moveMessage(message, index, animate) { | ||||
|         if (!this._messages.includes(message)) | ||||
|             throw new Error(`Impossible to move the untracked message ${message}`); | ||||
|  | ||||
|         let listItem = message.get_parent(); | ||||
|         let obj = this._messages.get(message); | ||||
|  | ||||
|         if (!animate) { | ||||
|             this._list.set_child_at_index(listItem, index); | ||||
|             this._list.set_child_at_index(obj.container, index); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         let onComplete = () => { | ||||
|             this._list.set_child_at_index(listItem, index); | ||||
|             listItem.ease({ | ||||
|                 scale_x: 1, | ||||
|                 scale_y: 1, | ||||
|                 duration: MESSAGE_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD | ||||
|             }); | ||||
|             this._list.set_child_at_index(obj.container, index); | ||||
|             Tweener.addTween(obj.container, { scale_x: 1, | ||||
|                                               scale_y: 1, | ||||
|                                               time: MESSAGE_ANIMATION_TIME, | ||||
|                                               transition: 'easeOutQuad' }); | ||||
|         }; | ||||
|         listItem.ease({ | ||||
|             scale_x: 0, | ||||
|             scale_y: 0, | ||||
|             duration: MESSAGE_ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete | ||||
|         }); | ||||
|         Tweener.addTween(obj.container, { scale_x: 0, | ||||
|                                           scale_y: 0, | ||||
|                                           time: MESSAGE_ANIMATION_TIME, | ||||
|                                           transition: 'easeOutQuad', | ||||
|                                           onComplete: onComplete }); | ||||
|     } | ||||
|  | ||||
|     removeMessage(message, animate) { | ||||
|         if (!this._messages.includes(message)) | ||||
|             throw new Error(`Impossible to remove the untracked message ${message}`); | ||||
|         let obj = this._messages.get(message); | ||||
|  | ||||
|         let listItem = message.get_parent(); | ||||
|         listItem._connectionsIds.forEach(id => message.disconnect(id)); | ||||
|         message.actor.disconnect(obj.destroyId); | ||||
|         message.actor.disconnect(obj.keyFocusId); | ||||
|         message.disconnect(obj.closeId); | ||||
|  | ||||
|         this._messages.delete(message); | ||||
|  | ||||
|         if (animate) { | ||||
|             listItem.ease({ | ||||
|                 scale_x: 0, | ||||
|                 scale_y: 0, | ||||
|                 duration: MESSAGE_ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                 onComplete: () => { | ||||
|                     listItem.destroy(); | ||||
|                     global.sync_pointer(); | ||||
|                 } | ||||
|             }); | ||||
|             Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0, | ||||
|                                               time: MESSAGE_ANIMATION_TIME, | ||||
|                                               transition: 'easeOutQuad', | ||||
|                                               onComplete() { | ||||
|                                                   obj.container.destroy(); | ||||
|                                                   global.sync_pointer(); | ||||
|                                               }}); | ||||
|         } else { | ||||
|             listItem.destroy(); | ||||
|             obj.container.destroy(); | ||||
|             global.sync_pointer(); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     clear() { | ||||
|         let messages = this._messages.filter(msg => msg.canClose()); | ||||
|         let messages = [...this._messages.keys()].filter(msg => msg.canClose()); | ||||
|  | ||||
|         // If there are few messages, letting them all zoom out looks OK | ||||
|         if (messages.length < 2) { | ||||
| @@ -703,37 +647,47 @@ var MessageListSection = GObject.registerClass({ | ||||
|             let delay = MESSAGE_ANIMATION_TIME / Math.max(messages.length, 5); | ||||
|             for (let i = 0; i < messages.length; i++) { | ||||
|                 let message = messages[i]; | ||||
|                 message.get_parent().ease({ | ||||
|                     translation_x: this._list.width, | ||||
|                     opacity: 0, | ||||
|                     duration: MESSAGE_ANIMATION_TIME, | ||||
|                     delay: i * delay, | ||||
|                     mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                     onComplete: () => message.close() | ||||
|                 }); | ||||
|                 let obj = this._messages.get(message); | ||||
|                 Tweener.addTween(obj.container, | ||||
|                                  { anchor_x: this._list.width, | ||||
|                                    opacity: 0, | ||||
|                                    time: MESSAGE_ANIMATION_TIME, | ||||
|                                    delay: i * delay, | ||||
|                                    transition: 'easeOutQuad', | ||||
|                                    onComplete() { | ||||
|                                        message.close(); | ||||
|                                    }}); | ||||
|             } | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _canClear() { | ||||
|         for (let message of this._messages.keys()) | ||||
|             if (message.canClose()) | ||||
|                 return true; | ||||
|         return false; | ||||
|     } | ||||
|  | ||||
|     _shouldShow() { | ||||
|         return !this.empty; | ||||
|     } | ||||
|  | ||||
|     _sync() { | ||||
|         let messages = this._messages; | ||||
|         let empty = messages.length == 0; | ||||
|         let empty = this._list.get_n_children() == 0; | ||||
|         let changed = this.empty !== empty; | ||||
|         this.empty = empty; | ||||
|  | ||||
|         if (this._empty != empty) { | ||||
|             this._empty = empty; | ||||
|             this.notify('empty'); | ||||
|         } | ||||
|         if (changed) | ||||
|             this.emit('empty-changed'); | ||||
|  | ||||
|         let canClear = messages.some(m => m.canClose()); | ||||
|         if (this._canClear != canClear) { | ||||
|             this._canClear = canClear; | ||||
|             this.notify('can-clear'); | ||||
|         } | ||||
|         let canClear = this._canClear(); | ||||
|         changed = this.canClear !== canClear; | ||||
|         this.canClear = canClear; | ||||
|  | ||||
|         this.visible = this.allowed && this._shouldShow(); | ||||
|         if (changed) | ||||
|             this.emit('can-clear-changed'); | ||||
|  | ||||
|         this.actor.visible = this.allowed && this._shouldShow(); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(MessageListSection.prototype); | ||||
|   | ||||
| @@ -1,23 +1,23 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported NotificationPolicy, NotificationGenericPolicy, | ||||
|    NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel, | ||||
|    SystemNotificationSource, MessageTray */ | ||||
|  | ||||
| const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; | ||||
| const Mainloop = imports.mainloop; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Calendar = imports.ui.calendar; | ||||
| const GnomeSession = imports.misc.gnomeSession; | ||||
| const Layout = imports.ui.layout; | ||||
| const Main = imports.ui.main; | ||||
| const Params = imports.misc.params; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings'; | ||||
|  | ||||
| var ANIMATION_TIME = 200; | ||||
| var NOTIFICATION_TIMEOUT = 4000; | ||||
| var ANIMATION_TIME = 0.2; | ||||
| var NOTIFICATION_TIMEOUT = 4; | ||||
|  | ||||
| var HIDE_TIMEOUT = 200; | ||||
| var LONGER_HIDE_TIMEOUT = 600; | ||||
| var HIDE_TIMEOUT = 0.2; | ||||
| var LONGER_HIDE_TIMEOUT = 0.6; | ||||
|  | ||||
| var MAX_NOTIFICATIONS_IN_QUEUE = 3; | ||||
| var MAX_NOTIFICATIONS_PER_SOURCE = 3; | ||||
| @@ -133,84 +133,70 @@ var FocusGrabber = class FocusGrabber { | ||||
| // source, such as whether to play sound or honour the critical bit. | ||||
| // | ||||
| // A notification without a policy object will inherit the default one. | ||||
| var NotificationPolicy = GObject.registerClass({ | ||||
|     GTypeName: 'MessageTray_NotificationPolicy', | ||||
|     Properties: { | ||||
|         'enable': GObject.ParamSpec.boolean( | ||||
|             'enable', 'enable', 'enable', | ||||
|             GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY, | ||||
|             true), | ||||
|         'enable-sound': GObject.ParamSpec.boolean( | ||||
|             'enable-sound', 'enable-sound', 'enable-sound', | ||||
|             GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY, | ||||
|             true), | ||||
|         'show-banners': GObject.ParamSpec.boolean( | ||||
|             'show-banners', 'show-banners', 'show-banners', | ||||
|             GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY, | ||||
|             true), | ||||
|         'force-expanded': GObject.ParamSpec.boolean( | ||||
|             'force-expanded', 'force-expanded', 'force-expanded', | ||||
|             GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY, | ||||
|             false), | ||||
|         'show-in-lock-screen': GObject.ParamSpec.boolean( | ||||
|             'show-in-lock-screen', 'show-in-lock-screen', 'show-in-lock-screen', | ||||
|             GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY, | ||||
|             false), | ||||
|         'details-in-lock-screen': GObject.ParamSpec.boolean( | ||||
|             'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen', | ||||
|             GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY, | ||||
|             false), | ||||
| var NotificationPolicy = class NotificationPolicy { | ||||
|     constructor(params) { | ||||
|         params = Params.parse(params, { enable: true, | ||||
|                                         enableSound: true, | ||||
|                                         showBanners: true, | ||||
|                                         forceExpanded: false, | ||||
|                                         showInLockScreen: true, | ||||
|                                         detailsInLockScreen: false | ||||
|                                       }); | ||||
|         Object.getOwnPropertyNames(params).forEach(key => { | ||||
|             let desc = Object.getOwnPropertyDescriptor(params, key); | ||||
|             Object.defineProperty(this, `_${key}`, desc); | ||||
|         }); | ||||
|     } | ||||
| }, class NotificationPolicy extends GObject.Object { | ||||
|  | ||||
|     // Do nothing for the default policy. These methods are only useful for the | ||||
|     // GSettings policy. | ||||
|     store() { } | ||||
|     destroy() { } | ||||
|  | ||||
|     destroy() { | ||||
|         this.run_dispose(); | ||||
|     get enable() { | ||||
|         return this._enable; | ||||
|     } | ||||
|  | ||||
|     get enableSound() { | ||||
|         return this.enable_sound; | ||||
|         return this._enableSound; | ||||
|     } | ||||
|  | ||||
|     get showBanners() { | ||||
|         return this.show_banners; | ||||
|         return this._showBanners; | ||||
|     } | ||||
|  | ||||
|     get forceExpanded() { | ||||
|         return this.force_expanded; | ||||
|         return this._forceExpanded; | ||||
|     } | ||||
|  | ||||
|     get showInLockScreen() { | ||||
|         return this.show_in_lock_screen; | ||||
|         return this._showInLockScreen; | ||||
|     } | ||||
|  | ||||
|     get detailsInLockScreen() { | ||||
|         return this.details_in_lock_screen; | ||||
|         return this._detailsInLockScreen; | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(NotificationPolicy.prototype); | ||||
|  | ||||
| var NotificationGenericPolicy = GObject.registerClass({ | ||||
|     GTypeName: 'MessageTray_NotificationGenericPolicy' | ||||
| }, class NotificationGenericPolicy extends NotificationPolicy { | ||||
|     _init() { | ||||
|         super._init(); | ||||
| var NotificationGenericPolicy = | ||||
| class NotificationGenericPolicy extends NotificationPolicy { | ||||
|     constructor() { | ||||
|         super(); | ||||
|         this.id = 'generic'; | ||||
|  | ||||
|         this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' }); | ||||
|         this._masterSettings.connect('changed', this._changed.bind(this)); | ||||
|     } | ||||
|  | ||||
|     store() { } | ||||
|  | ||||
|     destroy() { | ||||
|         this._masterSettings.run_dispose(); | ||||
|  | ||||
|         super.destroy(); | ||||
|     } | ||||
|  | ||||
|     _changed(settings, key) { | ||||
|         if (this.constructor.find_property(key)) | ||||
|             this.notify(key); | ||||
|         this.emit('policy-changed', key); | ||||
|     } | ||||
|  | ||||
|     get showBanners() { | ||||
| @@ -220,30 +206,29 @@ var NotificationGenericPolicy = GObject.registerClass({ | ||||
|     get showInLockScreen() { | ||||
|         return this._masterSettings.get_boolean('show-in-lock-screen'); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var NotificationApplicationPolicy = GObject.registerClass({ | ||||
|     GTypeName: 'MessageTray_NotificationApplicationPolicy' | ||||
| }, class NotificationApplicationPolicy extends NotificationPolicy { | ||||
|     _init(id) { | ||||
|         super._init(); | ||||
| var NotificationApplicationPolicy = | ||||
| class NotificationApplicationPolicy extends NotificationPolicy { | ||||
|     constructor(id) { | ||||
|         super(); | ||||
|  | ||||
|         this.id = id; | ||||
|         this._canonicalId = this._canonicalizeId(id); | ||||
|  | ||||
|         this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' }); | ||||
|         this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications.application', | ||||
|                                             path: `/org/gnome/desktop/notifications/application/${this._canonicalId}/` }); | ||||
|                                             path: '/org/gnome/desktop/notifications/application/' + this._canonicalId + '/' }); | ||||
|  | ||||
|         this._masterSettings.connect('changed', this._changed.bind(this)); | ||||
|         this._settings.connect('changed', this._changed.bind(this)); | ||||
|     } | ||||
|  | ||||
|     store() { | ||||
|         this._settings.set_string('application-id', `${this.id}.desktop`); | ||||
|         this._settings.set_string('application-id', this.id + '.desktop'); | ||||
|  | ||||
|         let apps = this._masterSettings.get_strv('application-children'); | ||||
|         if (!apps.includes(this._canonicalId)) { | ||||
|         if (apps.indexOf(this._canonicalId) < 0) { | ||||
|             apps.push(this._canonicalId); | ||||
|             this._masterSettings.set_strv('application-children', apps); | ||||
|         } | ||||
| @@ -252,19 +237,18 @@ var NotificationApplicationPolicy = GObject.registerClass({ | ||||
|     destroy() { | ||||
|         this._masterSettings.run_dispose(); | ||||
|         this._settings.run_dispose(); | ||||
|  | ||||
|         super.destroy(); | ||||
|     } | ||||
|  | ||||
|     _changed(settings, key) { | ||||
|         if (this.constructor.find_property(key)) | ||||
|             this.notify(key); | ||||
|         this.emit('policy-changed', key); | ||||
|         if (key == 'enable') | ||||
|             this.emit('enable-changed'); | ||||
|     } | ||||
|  | ||||
|     _canonicalizeId(id) { | ||||
|         // Keys are restricted to lowercase alphanumeric characters and dash, | ||||
|         // and two dashes cannot be in succession | ||||
|         return id.toLowerCase().replace(/[^a-z0-9-]/g, '-').replace(/--+/g, '-'); | ||||
|         return id.toLowerCase().replace(/[^a-z0-9\-]/g, '-').replace(/--+/g, '-'); | ||||
|     } | ||||
|  | ||||
|     get enable() { | ||||
| @@ -292,7 +276,7 @@ var NotificationApplicationPolicy = GObject.registerClass({ | ||||
|     get detailsInLockScreen() { | ||||
|         return this._settings.get_boolean('details-in-lock-screen'); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| // Notification: | ||||
| // @source: the notification's Source | ||||
| @@ -348,27 +332,13 @@ var NotificationApplicationPolicy = GObject.registerClass({ | ||||
| // event sound is played when the notification is shown (if the policy for | ||||
| // @source allows playing sounds). | ||||
| // | ||||
| // [1] https://developer.gnome.org/notification-spec/#markup | ||||
| var Notification = GObject.registerClass({ | ||||
|     GTypeName: 'MessageTray_Notification', | ||||
|     Properties: { | ||||
|         'acknowledged': GObject.ParamSpec.boolean( | ||||
|             'acknowledged', 'acknowledged', 'acknowledged', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             false), | ||||
|     }, | ||||
|     Signals: { | ||||
|         'activated': {}, | ||||
|         'destroy': { param_types: [GObject.TYPE_UINT] }, | ||||
|         'updated': { param_types: [GObject.TYPE_BOOLEAN] }, | ||||
|     } | ||||
| }, class Notification extends GObject.Object { | ||||
|     _init(source, title, banner, params) { | ||||
|         super._init(); | ||||
|  | ||||
| // [1] https://developer.gnome.org/notification-spec/#markup  | ||||
| var Notification = class Notification { | ||||
|     constructor(source, title, banner, params) { | ||||
|         this.source = source; | ||||
|         this.title = title; | ||||
|         this.urgency = Urgency.NORMAL; | ||||
|         this.resident = false; | ||||
|         // 'transient' is a reserved keyword in JS, so we have to use an alternate variable name | ||||
|         this.isTransient = false; | ||||
|         this.privacyScope = PrivacyScope.USER; | ||||
| @@ -380,7 +350,6 @@ var Notification = GObject.registerClass({ | ||||
|         this._soundFile = null; | ||||
|         this._soundPlayed = false; | ||||
|         this.actions = []; | ||||
|         this.setResident(false); | ||||
|  | ||||
|         // If called with only one argument we assume the caller | ||||
|         // will call .update() later on. This is the case of | ||||
| @@ -450,7 +419,7 @@ var Notification = GObject.registerClass({ | ||||
|         if (this._acknowledged == v) | ||||
|             return; | ||||
|         this._acknowledged = v; | ||||
|         this.notify('acknowledged'); | ||||
|         this.emit('acknowledged-changed'); | ||||
|     } | ||||
|  | ||||
|     setUrgency(urgency) { | ||||
| @@ -459,15 +428,6 @@ var Notification = GObject.registerClass({ | ||||
|  | ||||
|     setResident(resident) { | ||||
|         this.resident = resident; | ||||
|  | ||||
|         if (this.resident) { | ||||
|             if (this._activatedId) { | ||||
|                 this.disconnect(this._activatedId); | ||||
|                 this._activatedId = 0; | ||||
|             } | ||||
|         } else if (!this._activatedId) { | ||||
|             this._activatedId = this.connect_after('activated', () => this.destroy()); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     setTransient(isTransient) { | ||||
| @@ -509,30 +469,25 @@ var Notification = GObject.registerClass({ | ||||
|  | ||||
|     activate() { | ||||
|         this.emit('activated'); | ||||
|         if (!this.resident) | ||||
|             this.destroy(); | ||||
|     } | ||||
|  | ||||
|     destroy(reason = NotificationDestroyedReason.DISMISSED) { | ||||
|         if (this._activatedId) { | ||||
|             this.disconnect(this._activatedId); | ||||
|             delete this._activatedId; | ||||
|         } | ||||
|  | ||||
|     destroy(reason) { | ||||
|         if (!reason) | ||||
|             reason = NotificationDestroyedReason.DISMISSED; | ||||
|         this.emit('destroy', reason); | ||||
|         this.run_dispose(); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(Notification.prototype); | ||||
|  | ||||
| var NotificationBanner = GObject.registerClass({ | ||||
|     Signals: { | ||||
|         'done-displaying': {}, | ||||
|         'unfocused': {}, | ||||
|     } | ||||
| }, class NotificationBanner extends Calendar.NotificationMessage { | ||||
|     _init(notification) { | ||||
|         super._init(notification); | ||||
| var NotificationBanner = | ||||
| class NotificationBanner extends Calendar.NotificationMessage { | ||||
|     constructor(notification) { | ||||
|         super(notification); | ||||
|  | ||||
|         this.can_focus = false; | ||||
|         this.add_style_class_name('notification-banner'); | ||||
|         this.actor.can_focus = false; | ||||
|         this.actor.add_style_class_name('notification-banner'); | ||||
|  | ||||
|         this._buttonBox = null; | ||||
|  | ||||
| @@ -619,7 +574,7 @@ var NotificationBanner = GObject.registerClass({ | ||||
|  | ||||
|         return this.addButton(button, callback); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var SourceActor = GObject.registerClass( | ||||
| class SourceActor extends St.Widget { | ||||
| @@ -635,11 +590,11 @@ class SourceActor extends St.Widget { | ||||
|         }); | ||||
|         this._actorDestroyed = false; | ||||
|  | ||||
|         let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; | ||||
|         let scale_factor = St.ThemeContext.get_for_stage(global.stage).scale_factor; | ||||
|         this._iconBin = new St.Bin({ x_fill: true, | ||||
|                                      x_expand: true, | ||||
|                                      height: size * scaleFactor, | ||||
|                                      width: size * scaleFactor }); | ||||
|                                      height: size * scale_factor, | ||||
|                                      width: size * scale_factor }); | ||||
|  | ||||
|         this.add_actor(this._iconBin); | ||||
|  | ||||
| @@ -661,105 +616,11 @@ class SourceActor extends St.Widget { | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var SourceActorWithLabel = GObject.registerClass( | ||||
| class SourceActorWithLabel extends SourceActor { | ||||
|     _init(source, size) { | ||||
|         super._init(source, size); | ||||
|  | ||||
|         this._counterLabel = new St.Label({ x_align: Clutter.ActorAlign.CENTER, | ||||
|                                             x_expand: true, | ||||
|                                             y_align: Clutter.ActorAlign.CENTER, | ||||
|                                             y_expand: true }); | ||||
|  | ||||
|         this._counterBin = new St.Bin({ style_class: 'summary-source-counter', | ||||
|                                         child: this._counterLabel, | ||||
|                                         layout_manager: new Clutter.BinLayout() }); | ||||
|         this._counterBin.hide(); | ||||
|  | ||||
|         this._counterBin.connect('style-changed', () => { | ||||
|             let themeNode = this._counterBin.get_theme_node(); | ||||
|             this._counterBin.translation_x = themeNode.get_length('-shell-counter-overlap-x'); | ||||
|             this._counterBin.translation_y = themeNode.get_length('-shell-counter-overlap-y'); | ||||
|         }); | ||||
|  | ||||
|         this.add_actor(this._counterBin); | ||||
|  | ||||
|         this._countUpdatedId = this._source.connect('notify::count', this._updateCount.bind(this)); | ||||
|         this._updateCount(); | ||||
|  | ||||
|         this.connect('destroy', () => { | ||||
|             this._source.disconnect(this._countUpdatedId); | ||||
|         }); | ||||
|     } | ||||
|  | ||||
|     vfunc_allocate(box, flags) { | ||||
|         super.vfunc_allocate(box, flags); | ||||
|  | ||||
|         let childBox = new Clutter.ActorBox(); | ||||
|  | ||||
|         let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size(); | ||||
|         let direction = this.get_text_direction(); | ||||
|  | ||||
|         if (direction == Clutter.TextDirection.LTR) { | ||||
|             // allocate on the right in LTR | ||||
|             childBox.x1 = box.x2 - naturalWidth; | ||||
|             childBox.x2 = box.x2; | ||||
|         } else { | ||||
|             // allocate on the left in RTL | ||||
|             childBox.x1 = 0; | ||||
|             childBox.x2 = naturalWidth; | ||||
|         } | ||||
|  | ||||
|         childBox.y1 = box.y2 - naturalHeight; | ||||
|         childBox.y2 = box.y2; | ||||
|  | ||||
|         this._counterBin.allocate(childBox, flags); | ||||
|     } | ||||
|  | ||||
|     _updateCount() { | ||||
|         if (this._actorDestroyed) | ||||
|             return; | ||||
|  | ||||
|         this._counterBin.visible = this._source.countVisible; | ||||
|  | ||||
|         let text; | ||||
|         if (this._source.count < 100) | ||||
|             text = this._source.count.toString(); | ||||
|         else | ||||
|             text = String.fromCharCode(0x22EF); // midline horizontal ellipsis | ||||
|  | ||||
|         this._counterLabel.set_text(text); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var Source = GObject.registerClass({ | ||||
|     GTypeName: 'MessageTray_Source', | ||||
|     Properties: { | ||||
|         'count': GObject.ParamSpec.int( | ||||
|             'count', 'count', 'count', | ||||
|             GObject.ParamFlags.READABLE, | ||||
|             0, GLib.MAXINT32, 0), | ||||
|         'policy': GObject.ParamSpec.object( | ||||
|             'policy', 'policy', 'policy', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             NotificationPolicy.$gtype), | ||||
|         'title': GObject.ParamSpec.string( | ||||
|             'title', 'title', 'title', | ||||
|             GObject.ParamFlags.READWRITE, | ||||
|             null), | ||||
|     }, | ||||
|     Signals: { | ||||
|         'destroy': { param_types: [GObject.TYPE_UINT] }, | ||||
|         'icon-updated': {}, | ||||
|         'notification-added': { param_types: [Notification.$gtype] }, | ||||
|         'notification-show': { param_types: [Notification.$gtype] }, | ||||
|     } | ||||
| }, class Source extends GObject.Object { | ||||
|     _init(title, iconName) { | ||||
|         super._init({ title: title }); | ||||
|  | ||||
| var Source = class Source { | ||||
|     constructor(title, iconName) { | ||||
|         this.SOURCE_ICON_SIZE = 48; | ||||
|  | ||||
|         this.title = title; | ||||
|         this.iconName = iconName; | ||||
|  | ||||
|         this.isChat = false; | ||||
| @@ -794,7 +655,7 @@ var Source = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     countUpdated() { | ||||
|         super.notify('count'); | ||||
|         this.emit('count-updated'); | ||||
|     } | ||||
|  | ||||
|     _createPolicy() { | ||||
| @@ -802,17 +663,13 @@ var Source = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     get narrowestPrivacyScope() { | ||||
|         return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) | ||||
|             ? PrivacyScope.SYSTEM | ||||
|             : PrivacyScope.USER; | ||||
|         return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) ? PrivacyScope.SYSTEM | ||||
|                                                                                     : PrivacyScope.USER; | ||||
|     } | ||||
|  | ||||
|     setTitle(newTitle) { | ||||
|         if (this.title == newTitle) | ||||
|             return; | ||||
|  | ||||
|         this.title = newTitle; | ||||
|         this.notify('title'); | ||||
|         this.emit('title-changed'); | ||||
|     } | ||||
|  | ||||
|     createBanner(notification) { | ||||
| @@ -837,53 +694,38 @@ var Source = GObject.registerClass({ | ||||
|             return; | ||||
|  | ||||
|         this.notifications.splice(index, 1); | ||||
|         this.countUpdated(); | ||||
|  | ||||
|         if (this.notifications.length == 0) | ||||
|             this.destroy(); | ||||
|  | ||||
|         this.countUpdated(); | ||||
|     } | ||||
|  | ||||
|     pushNotification(notification) { | ||||
|         if (this.notifications.includes(notification)) | ||||
|         if (this.notifications.indexOf(notification) >= 0) | ||||
|             return; | ||||
|  | ||||
|         while (this.notifications.length >= MAX_NOTIFICATIONS_PER_SOURCE) | ||||
|             this.notifications.shift().destroy(NotificationDestroyedReason.EXPIRED); | ||||
|  | ||||
|         notification.connect('destroy', this._onNotificationDestroy.bind(this)); | ||||
|         notification.connect('notify::acknowledged', this.countUpdated.bind(this)); | ||||
|         notification.connect('acknowledged-changed', this.countUpdated.bind(this)); | ||||
|         this.notifications.push(notification); | ||||
|         this.emit('notification-added', notification); | ||||
|  | ||||
|         this.countUpdated(); | ||||
|     } | ||||
|  | ||||
|     showNotification(notification) { | ||||
|     notify(notification) { | ||||
|         notification.acknowledged = false; | ||||
|         this.pushNotification(notification); | ||||
|  | ||||
|         if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL) { | ||||
|             this.emit('notification-show', notification); | ||||
|             this.emit('notify', notification); | ||||
|         } else { | ||||
|             notification.playSound(); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     notify(propName) { | ||||
|         if (propName instanceof Notification) { | ||||
|             try { | ||||
|                 throw new Error('Source.notify() has been moved to Source.showNotification()' + | ||||
|                                 'this code will break in the future'); | ||||
|             } catch (e) { | ||||
|                 logError(e); | ||||
|                 this.showNotification(propName); | ||||
|                 return; | ||||
|             } | ||||
|         } | ||||
|  | ||||
|         super.notify(propName); | ||||
|     } | ||||
|  | ||||
|     destroy(reason) { | ||||
|         this.policy.destroy(); | ||||
|  | ||||
| @@ -894,8 +736,6 @@ var Source = GObject.registerClass({ | ||||
|             notifications[i].destroy(reason); | ||||
|  | ||||
|         this.emit('destroy', reason); | ||||
|  | ||||
|         this.run_dispose(); | ||||
|     } | ||||
|  | ||||
|     iconUpdated() { | ||||
| @@ -910,24 +750,15 @@ var Source = GObject.registerClass({ | ||||
|         for (let i = this.notifications.length - 1; i >= 0; i--) | ||||
|             if (!this.notifications[i].resident) | ||||
|                 this.notifications[i].destroy(); | ||||
|     } | ||||
| }); | ||||
|  | ||||
| var MessageTray = GObject.registerClass({ | ||||
|     Signals: { | ||||
|         'queue-changed': {}, | ||||
|         'source-added': { param_types: [Source.$gtype] }, | ||||
|         'source-removed': { param_types: [Source.$gtype] }, | ||||
|         this.countUpdated(); | ||||
|     } | ||||
| }, class MessageTray extends St.Widget { | ||||
|     _init() { | ||||
|         super._init({ | ||||
|             visible: false, | ||||
|             clip_to_allocation: true, | ||||
|             layout_manager: new Clutter.BinLayout() | ||||
|         }); | ||||
| }; | ||||
| Signals.addSignalMethods(Source.prototype); | ||||
|  | ||||
|         this._presence = new GnomeSession.Presence((proxy, _error) => { | ||||
| var MessageTray = class MessageTray { | ||||
|     constructor() { | ||||
|         this._presence = new GnomeSession.Presence((proxy, error) => { | ||||
|             this._onStatusChanged(proxy.status); | ||||
|         }); | ||||
|         this._busy = false; | ||||
| @@ -943,15 +774,18 @@ var MessageTray = GObject.registerClass({ | ||||
|             // so fix up Clutter's view of the pointer position in | ||||
|             // that case. | ||||
|             let related = ev.get_related(); | ||||
|             if (!related || this.contains(related)) | ||||
|             if (!related || this.actor.contains(related)) | ||||
|                 global.sync_pointer(); | ||||
|         }); | ||||
|  | ||||
|         this.actor = new St.Widget({ visible: false, | ||||
|                                      clip_to_allocation: true, | ||||
|                                      layout_manager: new Clutter.BinLayout() }); | ||||
|         let constraint = new Layout.MonitorConstraint({ primary: true }); | ||||
|         Main.layoutManager.panelBox.bind_property('visible', | ||||
|                                                   constraint, 'work-area', | ||||
|                                                   GObject.BindingFlags.SYNC_CREATE); | ||||
|         this.add_constraint(constraint); | ||||
|         this.actor.add_constraint(constraint); | ||||
|  | ||||
|         this._bannerBin = new St.Widget({ name: 'notification-container', | ||||
|                                           reactive: true, | ||||
| @@ -965,7 +799,7 @@ var MessageTray = GObject.registerClass({ | ||||
|                                 this._onNotificationKeyRelease.bind(this)); | ||||
|         this._bannerBin.connect('notify::hover', | ||||
|                                 this._onNotificationHoverChanged.bind(this)); | ||||
|         this.add_actor(this._bannerBin); | ||||
|         this.actor.add_actor(this._bannerBin); | ||||
|  | ||||
|         this._notificationFocusGrabber = new FocusGrabber(this._bannerBin); | ||||
|         this._notificationQueue = []; | ||||
| @@ -994,7 +828,7 @@ var MessageTray = GObject.registerClass({ | ||||
|         this._notificationTimeoutId = 0; | ||||
|         this._notificationRemoved = false; | ||||
|  | ||||
|         Main.layoutManager.addChrome(this, { affectsInputRegion: false }); | ||||
|         Main.layoutManager.addChrome(this.actor, { affectsInputRegion: false }); | ||||
|         Main.layoutManager.trackChrome(this._bannerBin, { affectsInputRegion: true }); | ||||
|  | ||||
|         global.display.connect('in-fullscreen-changed', this._updateState.bind(this)); | ||||
| @@ -1037,11 +871,11 @@ var MessageTray = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _onDragBegin() { | ||||
|         Shell.util_set_hidden_from_pick(this, true); | ||||
|         Shell.util_set_hidden_from_pick(this.actor, true); | ||||
|     } | ||||
|  | ||||
|     _onDragEnd() { | ||||
|         Shell.util_set_hidden_from_pick(this, false); | ||||
|         Shell.util_set_hidden_from_pick(this.actor, false); | ||||
|     } | ||||
|  | ||||
|     get bannerAlignment() { | ||||
| @@ -1083,29 +917,30 @@ var MessageTray = GObject.registerClass({ | ||||
|  | ||||
|     add(source) { | ||||
|         if (this.contains(source)) { | ||||
|             log(`Trying to re-add source ${source.title}`); | ||||
|             log('Trying to re-add source ' + source.title); | ||||
|             return; | ||||
|         } | ||||
|  | ||||
|         // Register that we got a notification for this source | ||||
|         source.policy.store(); | ||||
|  | ||||
|         source.policy.connect('notify::enable', () => { | ||||
|         source.policy.connect('enable-changed', () => { | ||||
|             this._onSourceEnableChanged(source.policy, source); | ||||
|         }); | ||||
|         source.policy.connect('notify', this._updateState.bind(this)); | ||||
|         source.policy.connect('policy-changed', this._updateState.bind(this)); | ||||
|         this._onSourceEnableChanged(source.policy, source); | ||||
|     } | ||||
|  | ||||
|     _addSource(source) { | ||||
|         let obj = { | ||||
|             showId: 0, | ||||
|             source: source, | ||||
|             notifyId: 0, | ||||
|             destroyId: 0, | ||||
|         }; | ||||
|  | ||||
|         this._sources.set(source, obj); | ||||
|  | ||||
|         obj.showId = source.connect('notification-show', this._onNotificationShow.bind(this)); | ||||
|         obj.notifyId = source.connect('notify', this._onNotify.bind(this)); | ||||
|         obj.destroyId = source.connect('destroy', this._onSourceDestroy.bind(this)); | ||||
|  | ||||
|         this.emit('source-added', source); | ||||
| @@ -1115,7 +950,7 @@ var MessageTray = GObject.registerClass({ | ||||
|         let obj = this._sources.get(source); | ||||
|         this._sources.delete(source); | ||||
|  | ||||
|         source.disconnect(obj.showId); | ||||
|         source.disconnect(obj.notifyId); | ||||
|         source.disconnect(obj.destroyId); | ||||
|  | ||||
|         this.emit('source-removed', source); | ||||
| @@ -1156,14 +991,14 @@ var MessageTray = GObject.registerClass({ | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _onNotificationShow(_source, notification) { | ||||
|     _onNotify(source, notification) { | ||||
|         if (this._notification == notification) { | ||||
|             // If a notification that is being shown is updated, we update | ||||
|             // how it is shown and extend the time until it auto-hides. | ||||
|             // If a new notification is updated while it is being hidden, | ||||
|             // we stop hiding it and show it again. | ||||
|             this._updateShowingNotification(); | ||||
|         } else if (!this._notificationQueue.includes(notification)) { | ||||
|         } else if (this._notificationQueue.indexOf(notification) < 0) { | ||||
|             // If the queue is "full", we skip banner mode and just show a small | ||||
|             // indicator in the panel; however do make an exception for CRITICAL | ||||
|             // notifications, as only banner mode allows expansion. | ||||
| @@ -1185,7 +1020,7 @@ var MessageTray = GObject.registerClass({ | ||||
|     _resetNotificationLeftTimeout() { | ||||
|         this._useLongerNotificationLeftTimeout = false; | ||||
|         if (this._notificationLeftTimeoutId) { | ||||
|             GLib.source_remove(this._notificationLeftTimeoutId); | ||||
|             Mainloop.source_remove(this._notificationLeftTimeoutId); | ||||
|             this._notificationLeftTimeoutId = 0; | ||||
|             this._notificationLeftMouseX = -1; | ||||
|             this._notificationLeftMouseY = -1; | ||||
| @@ -1223,15 +1058,15 @@ var MessageTray = GObject.registerClass({ | ||||
|             // this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us | ||||
|             // to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still | ||||
|             // close to its previous position, we extend the timeout once. | ||||
|             let [x, y] = global.get_pointer(); | ||||
|             let [x, y, mods] = global.get_pointer(); | ||||
|             this._notificationLeftMouseX = x; | ||||
|             this._notificationLeftMouseY = y; | ||||
|  | ||||
|             // We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it. | ||||
|             // We wait for a longer period if the notification popped up where the mouse pointer was already positioned. | ||||
|             // That gives the user more time to mouse away from the notification and mouse back in in order to expand it. | ||||
|             let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT; | ||||
|             this._notificationLeftTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, this._onNotificationLeftTimeout.bind(this)); | ||||
|             let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000; | ||||
|             this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this)); | ||||
|             GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout'); | ||||
|         } | ||||
|     } | ||||
| @@ -1252,7 +1087,7 @@ var MessageTray = GObject.registerClass({ | ||||
|     } | ||||
|  | ||||
|     _onNotificationLeftTimeout() { | ||||
|         let [x, y] = global.get_pointer(); | ||||
|         let [x, y, mods] = global.get_pointer(); | ||||
|         // We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side. | ||||
|         if (this._notificationLeftMouseX > -1 && | ||||
|             y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD && | ||||
| @@ -1260,10 +1095,8 @@ var MessageTray = GObject.registerClass({ | ||||
|             x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD && | ||||
|             x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) { | ||||
|             this._notificationLeftMouseX = -1; | ||||
|             this._notificationLeftTimeoutId = GLib.timeout_add( | ||||
|                 GLib.PRIORITY_DEFAULT, | ||||
|                 LONGER_HIDE_TIMEOUT, | ||||
|                 this._onNotificationLeftTimeout.bind(this)); | ||||
|             this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000, | ||||
|                                                              this._onNotificationLeftTimeout.bind(this)); | ||||
|             GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout'); | ||||
|         } else { | ||||
|             this._notificationLeftTimeoutId = 0; | ||||
| @@ -1288,7 +1121,7 @@ var MessageTray = GObject.registerClass({ | ||||
|     // at the present time. | ||||
|     _updateState() { | ||||
|         let hasMonitor = Main.layoutManager.primaryMonitor != null; | ||||
|         this.visible = !this._bannerBlocked && hasMonitor && this._banner != null; | ||||
|         this.actor.visible = !this._bannerBlocked && hasMonitor && this._banner != null; | ||||
|         if (this._bannerBlocked || !hasMonitor) | ||||
|             return; | ||||
|  | ||||
| @@ -1344,6 +1177,34 @@ var MessageTray = GObject.registerClass({ | ||||
|         this._notificationExpired = false; | ||||
|     } | ||||
|  | ||||
|     _tween(actor, statevar, value, params) { | ||||
|         let onComplete = params.onComplete; | ||||
|         let onCompleteScope = params.onCompleteScope; | ||||
|         let onCompleteParams = params.onCompleteParams; | ||||
|  | ||||
|         params.onComplete = this._tweenComplete; | ||||
|         params.onCompleteScope = this; | ||||
|         params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams]; | ||||
|  | ||||
|         // Remove other tweens that could mess with the state machine | ||||
|         Tweener.removeTweens(actor); | ||||
|         Tweener.addTween(actor, params); | ||||
|  | ||||
|         let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING; | ||||
|         this[statevar] = valuing; | ||||
|     } | ||||
|  | ||||
|     _tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) { | ||||
|         this[statevar] = value; | ||||
|         if (onComplete) | ||||
|             onComplete.apply(onCompleteScope, onCompleteParams); | ||||
|         this._updateState(); | ||||
|     } | ||||
|  | ||||
|     _clampOpacity() { | ||||
|         this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255)); | ||||
|     } | ||||
|  | ||||
|     _onIdleMonitorBecameActive() { | ||||
|         this._userActiveWhileNotificationShown = true; | ||||
|         this._updateNotificationTimeout(2000); | ||||
| @@ -1368,16 +1229,17 @@ var MessageTray = GObject.registerClass({ | ||||
|             this._updateState(); | ||||
|         }); | ||||
|  | ||||
|         this._bannerBin.add_actor(this._banner); | ||||
|         this._bannerBin.add_actor(this._banner.actor); | ||||
|  | ||||
|         this._bannerBin._opacity = 0; | ||||
|         this._bannerBin.opacity = 0; | ||||
|         this._bannerBin.y = -this._banner.height; | ||||
|         this.show(); | ||||
|         this._bannerBin.y = -this._banner.actor.height; | ||||
|         this.actor.show(); | ||||
|  | ||||
|         Meta.disable_unredirect_for_display(global.display); | ||||
|         this._updateShowingNotification(); | ||||
|  | ||||
|         let [x, y] = global.get_pointer(); | ||||
|         let [x, y, mods] = global.get_pointer(); | ||||
|         // We save the position of the mouse at the time when we started showing the notification | ||||
|         // in order to determine if the notification popped up under it. We make that check if | ||||
|         // the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't | ||||
| @@ -1415,45 +1277,39 @@ var MessageTray = GObject.registerClass({ | ||||
|         // We use this._showNotificationCompleted() onComplete callback to extend the time the updated | ||||
|         // notification is being shown. | ||||
|  | ||||
|         this._notificationState = State.SHOWING; | ||||
|         this._bannerBin.remove_all_transitions(); | ||||
|         this._bannerBin.ease({ | ||||
|             opacity: 255, | ||||
|             duration: ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.LINEAR | ||||
|         }); | ||||
|         this._bannerBin.ease({ | ||||
|             y: 0, | ||||
|             duration: ANIMATION_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_BACK, | ||||
|             onComplete: () => { | ||||
|                 this._notificationState = State.SHOWN; | ||||
|                 this._showNotificationCompleted(); | ||||
|                 this._updateState(); | ||||
|             } | ||||
|         }); | ||||
|         let tweenParams = { y: 0, | ||||
|                             _opacity: 255, | ||||
|                             time: ANIMATION_TIME, | ||||
|                             transition: 'easeOutBack', | ||||
|                             onUpdate: this._clampOpacity, | ||||
|                             onUpdateScope: this, | ||||
|                             onComplete: this._showNotificationCompleted, | ||||
|                             onCompleteScope: this | ||||
|                           }; | ||||
|  | ||||
|         this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams); | ||||
|     } | ||||
|  | ||||
|     _showNotificationCompleted() { | ||||
|         if (this._notification.urgency != Urgency.CRITICAL) | ||||
|             this._updateNotificationTimeout(NOTIFICATION_TIMEOUT); | ||||
|             this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000); | ||||
|     } | ||||
|  | ||||
|     _updateNotificationTimeout(timeout) { | ||||
|         if (this._notificationTimeoutId) { | ||||
|             GLib.source_remove(this._notificationTimeoutId); | ||||
|             Mainloop.source_remove(this._notificationTimeoutId); | ||||
|             this._notificationTimeoutId = 0; | ||||
|         } | ||||
|         if (timeout > 0) { | ||||
|             this._notificationTimeoutId = | ||||
|                 GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, | ||||
|                     this._notificationTimeout.bind(this)); | ||||
|                 Mainloop.timeout_add(timeout, | ||||
|                                      this._notificationTimeout.bind(this)); | ||||
|             GLib.Source.set_name_by_id(this._notificationTimeoutId, '[gnome-shell] this._notificationTimeout'); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     _notificationTimeout() { | ||||
|         let [x, y] = global.get_pointer(); | ||||
|         let [x, y, mods] = global.get_pointer(); | ||||
|         if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) { | ||||
|             // The mouse is moving towards the notification, so don't | ||||
|             // hide it yet. (We just create a new timeout (and destroy | ||||
| @@ -1489,26 +1345,20 @@ var MessageTray = GObject.registerClass({ | ||||
|         } | ||||
|  | ||||
|         this._resetNotificationLeftTimeout(); | ||||
|         this._bannerBin.remove_all_transitions(); | ||||
|  | ||||
|         if (animate) { | ||||
|             this._notificationState = State.HIDING; | ||||
|             this._bannerBin.ease({ | ||||
|                 opacity: 0, | ||||
|                 duration: ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_BACK | ||||
|             }); | ||||
|             this._bannerBin.ease({ | ||||
|                 y: -this._bannerBin.height, | ||||
|                 duration: ANIMATION_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_BACK, | ||||
|                 onComplete: () => { | ||||
|                     this._notificationState = State.HIDDEN; | ||||
|                     this._hideNotificationCompleted(); | ||||
|                     this._updateState(); | ||||
|                 } | ||||
|             }); | ||||
|             this._tween(this._bannerBin, '_notificationState', State.HIDDEN, | ||||
|                         { y: -this._bannerBin.height, | ||||
|                           _opacity: 0, | ||||
|                           time: ANIMATION_TIME, | ||||
|                           transition: 'easeOutBack', | ||||
|                           onUpdate: this._clampOpacity, | ||||
|                           onUpdateScope: this, | ||||
|                           onComplete: this._hideNotificationCompleted, | ||||
|                           onCompleteScope: this | ||||
|                         }); | ||||
|         } else { | ||||
|             Tweener.removeTweens(this._bannerBin); | ||||
|             this._bannerBin.y = -this._bannerBin.height; | ||||
|             this._bannerBin.opacity = 0; | ||||
|             this._notificationState = State.HIDDEN; | ||||
| @@ -1519,16 +1369,16 @@ var MessageTray = GObject.registerClass({ | ||||
|     _hideNotificationCompleted() { | ||||
|         let notification = this._notification; | ||||
|         this._notification = null; | ||||
|         if (!this._notificationRemoved && notification.isTransient) | ||||
|         if (notification.isTransient) | ||||
|             notification.destroy(NotificationDestroyedReason.EXPIRED); | ||||
|  | ||||
|         this._pointerInNotification = false; | ||||
|         this._notificationRemoved = false; | ||||
|         Meta.enable_unredirect_for_display(global.display); | ||||
|  | ||||
|         this._banner.destroy(); | ||||
|         this._banner.actor.destroy(); | ||||
|         this._banner = null; | ||||
|         this.hide(); | ||||
|         this.actor.hide(); | ||||
|     } | ||||
|  | ||||
|     _expandActiveNotification() { | ||||
| @@ -1550,15 +1400,15 @@ var MessageTray = GObject.registerClass({ | ||||
|     _ensureBannerFocused() { | ||||
|         this._notificationFocusGrabber.grabFocus(); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
| Signals.addSignalMethods(MessageTray.prototype); | ||||
|  | ||||
| var SystemNotificationSource = GObject.registerClass( | ||||
| class SystemNotificationSource extends Source { | ||||
|     _init() { | ||||
|         super._init(_("System Information"), 'dialog-information-symbolic'); | ||||
| var SystemNotificationSource = class SystemNotificationSource extends Source { | ||||
|     constructor() { | ||||
|         super(_("System Information"), 'dialog-information-symbolic'); | ||||
|     } | ||||
|  | ||||
|     open() { | ||||
|         this.destroy(); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|   | ||||
| @@ -1,16 +1,17 @@ | ||||
| // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- | ||||
| /* exported ModalDialog */ | ||||
|  | ||||
| const { Atk, Clutter, GObject, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Dialog = imports.ui.dialog; | ||||
| const Layout = imports.ui.layout; | ||||
| const Lightbox = imports.ui.lightbox; | ||||
| const Main = imports.ui.main; | ||||
| const Params = imports.misc.params; | ||||
| const Tweener = imports.ui.tweener; | ||||
|  | ||||
| var OPEN_AND_CLOSE_TIME = 100; | ||||
| var FADE_OUT_DIALOG_TIME = 1000; | ||||
| var OPEN_AND_CLOSE_TIME = 0.1; | ||||
| var FADE_OUT_DIALOG_TIME = 1.0; | ||||
|  | ||||
| var State = { | ||||
|     OPENED: 0, | ||||
| @@ -21,13 +22,11 @@ var State = { | ||||
| }; | ||||
|  | ||||
| var ModalDialog = GObject.registerClass({ | ||||
|     Properties: { | ||||
|         'state': GObject.ParamSpec.int('state', 'Dialog state', 'state', | ||||
|                                        GObject.ParamFlags.READABLE, | ||||
|                                        Math.min(...Object.values(State)), | ||||
|                                        Math.max(...Object.values(State)), | ||||
|                                        State.CLOSED) | ||||
|     }, | ||||
|     Properties: { 'state': GObject.ParamSpec.int('state', 'Dialog state', 'state', | ||||
|                                                  GObject.ParamFlags.READABLE, | ||||
|                                                  Math.min(...Object.values(State)), | ||||
|                                                  Math.max(...Object.values(State)), | ||||
|                                                  State.CLOSED) }, | ||||
|     Signals: { 'opened': {}, 'closed': {} } | ||||
| }, class ModalDialog extends St.Widget { | ||||
|     _init(params) { | ||||
| @@ -121,18 +120,18 @@ var ModalDialog = GObject.registerClass({ | ||||
|  | ||||
|         this.dialogLayout.opacity = 255; | ||||
|         if (this._lightbox) | ||||
|             this._lightbox.lightOn(); | ||||
|             this._lightbox.show(); | ||||
|         this.opacity = 0; | ||||
|         this.show(); | ||||
|         this.ease({ | ||||
|             opacity: 255, | ||||
|             duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => { | ||||
|                 this._setState(State.OPENED); | ||||
|                 this.emit('opened'); | ||||
|             } | ||||
|         }); | ||||
|         Tweener.addTween(this, | ||||
|                          { opacity: 255, | ||||
|                            time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: () => { | ||||
|                                this._setState(State.OPENED); | ||||
|                                this.emit('opened'); | ||||
|                            } | ||||
|                          }); | ||||
|     } | ||||
|  | ||||
|     setInitialKeyFocus(actor) { | ||||
| @@ -175,16 +174,15 @@ var ModalDialog = GObject.registerClass({ | ||||
|         this.popModal(timestamp); | ||||
|         this._savedKeyFocus = null; | ||||
|  | ||||
|         if (this._shouldFadeOut) { | ||||
|             this.ease({ | ||||
|                 opacity: 0, | ||||
|                 duration: OPEN_AND_CLOSE_TIME, | ||||
|                 mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|                 onComplete: () => this._closeComplete() | ||||
|             }); | ||||
|         } else { | ||||
|         if (this._shouldFadeOut) | ||||
|             Tweener.addTween(this, | ||||
|                              { opacity: 0, | ||||
|                                time: OPEN_AND_CLOSE_TIME, | ||||
|                                transition: 'easeOutQuad', | ||||
|                                onComplete: this._closeComplete.bind(this) | ||||
|                              }) | ||||
|         else | ||||
|             this._closeComplete(); | ||||
|         } | ||||
|     } | ||||
|  | ||||
|     // Drop modal status without closing the dialog; this makes the | ||||
| @@ -249,11 +247,13 @@ var ModalDialog = GObject.registerClass({ | ||||
|             return; | ||||
|  | ||||
|         this.popModal(timestamp); | ||||
|         this.dialogLayout.ease({ | ||||
|             opacity: 0, | ||||
|             duration: FADE_OUT_DIALOG_TIME, | ||||
|             mode: Clutter.AnimationMode.EASE_OUT_QUAD, | ||||
|             onComplete: () => (this.state = State.FADED_OUT) | ||||
|         }); | ||||
|         Tweener.addTween(this.dialogLayout, | ||||
|                          { opacity: 0, | ||||
|                            time:    FADE_OUT_DIALOG_TIME, | ||||
|                            transition: 'easeOutQuad', | ||||
|                            onComplete: () => { | ||||
|                                this._setState(State.FADED_OUT); | ||||
|                            } | ||||
|                          }); | ||||
|     } | ||||
| }); | ||||
|   | ||||
| @@ -1,5 +1,4 @@ | ||||
| /* exported MediaSection */ | ||||
| const { Gio, GObject, Shell, St } = imports.gi; | ||||
| const { Gio, Shell, St } = imports.gi; | ||||
| const Signals = imports.signals; | ||||
|  | ||||
| const Calendar = imports.ui.calendar; | ||||
| @@ -19,10 +18,9 @@ const MprisPlayerProxy = Gio.DBusProxy.makeProxyWrapper(MprisPlayerIface); | ||||
|  | ||||
| const MPRIS_PLAYER_PREFIX = 'org.mpris.MediaPlayer2.'; | ||||
|  | ||||
| var MediaMessage = GObject.registerClass( | ||||
| class MediaMessage extends MessageList.Message { | ||||
|     _init(player) { | ||||
|         super._init('', ''); | ||||
| var MediaMessage = class MediaMessage extends MessageList.Message { | ||||
|     constructor(player) { | ||||
|         super('', ''); | ||||
|  | ||||
|         this._player = player; | ||||
|  | ||||
| @@ -49,7 +47,7 @@ class MediaMessage extends MessageList.Message { | ||||
|         this._update(); | ||||
|     } | ||||
|  | ||||
|     vfunc_clicked() { | ||||
|     _onClicked() { | ||||
|         this._player.raise(); | ||||
|         Main.panel.closeCalendar(); | ||||
|     } | ||||
| @@ -72,15 +70,14 @@ class MediaMessage extends MessageList.Message { | ||||
|         } | ||||
|  | ||||
|         let isPlaying = this._player.status == 'Playing'; | ||||
|         let iconName = isPlaying | ||||
|             ? 'media-playback-pause-symbolic' | ||||
|             : 'media-playback-start-symbolic'; | ||||
|         let iconName = isPlaying ? 'media-playback-pause-symbolic' | ||||
|                                  : 'media-playback-start-symbolic'; | ||||
|         this._playPauseButton.child.icon_name = iconName; | ||||
|  | ||||
|         this._updateNavButton(this._prevButton, this._player.canGoPrevious); | ||||
|         this._updateNavButton(this._nextButton, this._player.canGoNext); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|  | ||||
| var MprisPlayer = class MprisPlayer { | ||||
|     constructor(busName) { | ||||
| @@ -138,7 +135,7 @@ var MprisPlayer = class MprisPlayer { | ||||
|         // so prefer activating the app via .desktop file if possible | ||||
|         let app = null; | ||||
|         if (this._mprisProxy.DesktopEntry) { | ||||
|             let desktopId = `${this._mprisProxy.DesktopEntry}.desktop`; | ||||
|             let desktopId = this._mprisProxy.DesktopEntry + '.desktop'; | ||||
|             app = Shell.AppSystem.get_default().lookup_app(desktopId); | ||||
|         } | ||||
|  | ||||
| @@ -195,10 +192,9 @@ var MprisPlayer = class MprisPlayer { | ||||
| }; | ||||
| Signals.addSignalMethods(MprisPlayer.prototype); | ||||
|  | ||||
| var MediaSection = GObject.registerClass( | ||||
| class MediaSection extends MessageList.MessageListSection { | ||||
|     _init() { | ||||
|         super._init(); | ||||
| var MediaSection = class MediaSection extends MessageList.MessageListSection { | ||||
|     constructor() { | ||||
|         super(); | ||||
|  | ||||
|         this._players = new Map(); | ||||
|  | ||||
| @@ -249,4 +245,4 @@ class MediaSection extends MessageList.MessageListSection { | ||||
|         if (newOwner && !oldOwner) | ||||
|             this._addPlayer(name); | ||||
|     } | ||||
| }); | ||||
| }; | ||||
|   | ||||
Some files were not shown because too many files have changed in this diff Show More
		Reference in New Issue
	
	Block a user