gnome-shell-sass: Add top padding to unlock-dialog-clock-time

The (imaginary)center line for clock time of unlock dialog and the user
avatar should be the same. Since the clock font is 64pt, we need
32pt padding (or 42px).

.eslintrc.json

@@ -1,6 +0,0 @@
-{
-    "extends": [
-        "./lint/eslintrc-gjs.json",
-        "./lint/eslintrc-shell.json"
-    ]
-}

.eslintrc.yml

@@ -0,0 +1,3 @@
+extends:
+ - ./lint/eslintrc-gjs.yml
+ - ./lint/eslintrc-shell.yml

.gitlab-ci.yml

@@ -14,7 +14,7 @@ variables:
         - merge_requests
 
 check_commit_log:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
     stage: review
     variables:
         GIT_DEPTH: "100"
@@ -47,14 +47,14 @@ eslint:
         when: always
 
 build:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
     stage: build
     before_script:
         - .gitlab-ci/checkout-mutter.sh
         - meson mutter mutter/build --prefix=/usr -Dtests=false
         - ninja -C mutter/build install
     script:
-        - meson . build -Dbuiltype=debugoptimized -Dman=false
+        - meson . build -Dbuiltype=debugoptimized -Dman=false --werror
         - ninja -C build
         - ninja -C build install
     <<: *only_default
@@ -65,14 +65,15 @@ build:
             - build
 
 test:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
     stage: test
     variables:
         XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
+        NO_AT_BRIDGE: "1"
     before_script:
         - ninja -C mutter/build install
     script:
-        - xvfb-run meson test -C build --no-rebuild
+        - dbus-run-session -- xvfb-run meson test -C build --no-rebuild
     <<: *only_default
     artifacts:
         expire_in: 1 day
@@ -81,7 +82,7 @@ test:
         when: on_failure
 
 test-pot:
-    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
+    image: registry.gitlab.gnome.org/gnome/mutter/master:v3
     stage: test
     before_script:
         - ninja -C mutter/build install

.gitlab-ci/checkout-mutter.sh

@@ -1,6 +1,5 @@
 #!/usr/bin/bash
 
-shell_branch=$(git describe --contains --all HEAD)
 mutter_target=
 
 git clone https://gitlab.gnome.org/GNOME/mutter.git
@@ -26,8 +25,7 @@ if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
 fi
 
 if [ -z "$mutter_target" ]; then
-  mutter_target=$(git branch -r -l origin/$shell_branch)
-  mutter_target=${mutter_target:-$(git branch -r -l ${shell_branch#remotes/})}
+  mutter_target=$(git branch -r -l origin/$CI_COMMIT_REF_NAME)
   mutter_target=${mutter_target:-origin/master}
   echo Using $mutter_target instead
 fi

.gitlab-ci/run-eslint.sh

@@ -13,11 +13,17 @@ is_empty() {
 }
 
 run_eslint() {
-  ARGS_LEGACY='--config lint/eslintrc-legacy.json'
+  ARGS_LEGACY='--config lint/eslintrc-legacy.yml'
 
   local extra_args=ARGS_$1
-  local output=OUTPUT_$1
-  eslint -f unix ${!extra_args} -o ${!output} js
+  local output_var=OUTPUT_$1
+  local output=${!output_var}
+
+  # ensure output exists even if eslint doesn't report any errors
+  mkdir -p $(dirname $output)
+  touch $output
+
+  eslint -f unix ${!extra_args} -o $output js
 }
 
 list_commit_range_additions() {
@@ -66,10 +72,17 @@ create_common() {
   rm $OUTPUT_FINAL.tmp
 }
 
-if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
-  git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME
+# Disable MR handling for now. We aren't ready to enforce
+# non-legacy style just yet ...
+unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME
+
+REMOTE=${1:-$CI_MERGE_REQUEST_PROJECT_URL.git}
+BRANCH_NAME=${2:-$CI_MERGE_REQUEST_TARGET_BRANCH_NAME}
+
+if [ "$BRANCH_NAME" ]; then
+  git fetch $REMOTE $BRANCH_NAME
   branch_point=$(git merge-base HEAD FETCH_HEAD)
-  commit_range=$branch_point...$CI_COMMIT_SHA
+  commit_range=$branch_point...HEAD
 
   list_commit_range_additions $commit_range > $LINE_CHANGES
 
@@ -86,12 +99,16 @@ run_eslint LEGACY
 echo Done.
 create_common
 
-# Just show the report and succeed when not testing a MR
-if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
+if ! is_empty $OUTPUT_FINAL; then
   cat $OUTPUT_FINAL
+  exit 1
+fi
+
+# Just show the report and succeed when not testing a MR
+if [ -z "$BRANCH_NAME" ]; then
   exit 0
 fi
 
-copy_matched_lines $OUTPUT_FINAL $LINE_CHANGES $OUTPUT_MR
+copy_matched_lines $OUTPUT_REGULAR $LINE_CHANGES $OUTPUT_MR
 cat $OUTPUT_MR
 is_empty $OUTPUT_MR

HACKING.md

@@ -163,11 +163,17 @@ you to inherit from a type to use it, you can do so:
              return [100, 100];
         }
 
-        vfunc_paint() {
+        vfunc_paint(paintContext) {
+             let framebuffer = paintContext.get_framebuffer();
+             let coglContext = framebuffer.get_context();
              let alloc = this.get_allocation_box();
-             Cogl.set_source_color4ub(255, 0, 0, 255);
-             Cogl.rectangle(alloc.x1, alloc.y1,
-                            alloc.x2, alloc.y2);
+
+             let pipeline = new Cogl.Pipeline(coglContext);
+             pipeline.set_color4ub(255, 0, 0, 255);
+
+             framebuffer.draw_rectangle(pipeline,
+		 alloc.x1, alloc.y1,
+		 alloc.x2, alloc.y2);
         }
     });
 ```
@@ -186,15 +192,27 @@ and "double quotes" for strings that the user may see. This allows us to
 quickly find untranslated or mistranslated strings by grepping through the
 sources for double quotes without a gettext call around them.
 
-## `actor` and `_delegate`
+## `actor` (deprecated) and `_delegate`
 
 gjs allows us to set so-called "expando properties" on introspected objects,
 allowing us to treat them like any other. Because the Shell was built before
-you could inherit from GTypes natively in JS, we usually have a wrapper class
-that has a property called `actor`. We call this wrapper class the "delegate".
+you could inherit from GTypes natively in JS, in some cases we have a wrapper
+class that has a property called `actor` (now deprecated). We call this
+wrapper class the "delegate".
 
 We sometimes use expando properties to set a property called `_delegate` on
 the actor itself:
+```javascript
+    var MyActor = GObject.registerClass(
+    class MyActor extends Clutter.Actor {
+        _init(params) {
+            super._init(params);
+            this._delegate = this;
+        }
+    });
+```
+
+Or using the deprecated `actor`:
 ```javascript
     var MyClass = class {
         constructor() {
@@ -215,6 +233,7 @@ delegate object from an associated actor. For instance, the drag and drop
 system calls the `handleDragOver` function on the delegate of a "drop target"
 when the user drags an item over it. If you do not set the `_delegate`
 property, your actor will not be able to be dropped onto.
+In case the class is an actor itself, the `_delegate` can be just set to `this`.
 
 ## Functional style
 

NEWS

@@ -1,3 +1,150 @@
+3.35.2
+======
+* Fix unredirection after cancelled animations [Florian; #1788]
+* Include shadow in window screenshots [Robert; !762]
+* Show indicator when microphone is active [Florian; !729]
+* Use inheritance instead of delegate pattern [Marco; !559]
+* Use cached coordinates for window sorting in overview [Andrew; !763]
+* Wiggle login/unlock password entries on failure [Georges; !769]
+* Update window titles in app menu [Florian; #1830]
+* Fix window animations getting stuck by workspace switches [Jonas D.; !784]
+* Fix not-responding dialog size when using geometry scaling [Jonas D.; !783]
+* Handle buggy MPRIS clients more gracefully [Philip; #1362]
+* Deprecate StBoxLayout's child properties [Florian; !780]
+* Remove StBin's align properties [Florian; !803]
+* Use correct timezones for events [Milan, Florian; !806, #1895]
+* Reduce overhead of tracking stylesheet changes [Carlos; !779]
+* Replace action icons in system menu with regular menu items [Florian; #270]
+* Refine polkit dialogs [Jonas D.; !788]
+* Fix battery icon glitch in "100% but charging" case [Philip; !814]
+* Fix windows getting stuck on screen if closed while animating [Florian; !815]
+* Use font from interface settings [Florian; #688288]
+* Show polkit confirmation dialog for users with no password
+  [Joaquim, Jonas D.; !829]
+* Use better OSK layout fallback for unsupported variants [Florian; #1907]
+* Hide stopped spinner in top bar [Joonas; !832]
+* Reuse existing icons when updating the app picker grid [Georges; !841]
+* Show switcher popups immediately on second key press [Florian; #1928]
+* Add position-based animation to page indicators [Alexander; !843]
+* Improve modifier-less keyboard navigation of switcher popups [Florian; #1883]
+* Improve weather integration [Florian; #1927, #1926]
+* Add back sound feedback when scrolling volume indicator [Florian; #53]
+* Fix creating app folders with no pre-existing folders [Jonas D.; #1652]
+* Improve DND page switching in app picker [Florian, Jonas D.; #1693]
+* Fix disable command of gnome-extensions tool [Florian; #1946]
+* Tweak styling of notifications/media constrols [Joonas; !855, !865]
+* Enable clean session shutdown after gnome-shell failure [Benjamin; !858]
+* Also remove scaled keys when texture cache is cleared [Daniel M.; !567]
+* Don't show overflow indicator in switchers that fit screen [Florian; #1834]
+* Move libcroco dependency in-tree [Federico; !861]
+* Move to app folder location when it is created/renamed [Georges; !883]
+* Dismiss switcher popups when a system modal dialogs opens [Florian; #1536]
+* Fix weather forecasts for automatic location when Weather is not sandboxed
+  [Florian; #1823]
+* Place launched applications into a systemd scope [Benjamin; !863]
+* Fixed crashes [Jonas D., Carlos; !787, !813]
+* Misc. bug fixes and cleanups [Marco, Georges, Daniel V., Florian, Robert,
+  Kalev, Philip, Jonas D., Will, Carlos, Jonas Å., cunidev, Joonas, Federico;
+  !747, !765, !421, !759, !749, !730, !770, #1799, !774, !773, !776, !777,
+  !782, !794, !778, !792, !790, !190, !796, !795, !797, !798, !800, !804, !808,
+  !807, !810, !811, !563, !809, !805, !817, !818, !822, !830, !828, !823, !835,
+  !840, !842, !833, !845, !846, !847, !851, #1916, !862, !866, #1979, !827,
+  #1976, !884, !873, !885, !799, !887, !891, !816]
+
+Contributors:
+  Marco Trevisan (Treviño), Benjamin Berg, Philip Chimento, Milan Crha,
+  Jonas Dreßler, Carlos Garnacho, Joonas Henriksson, Kalev Lember, Robert Mader,
+  Alexander Mikhaylenko, Daniel García Moreno, Florian Müllner,
+  Georges Basile Stavracas Neto, Federico Mena Quintero, Joaquim Rocha,
+  Will Thompson, Daniel van Vugt, Andrew Watson, cunidev, Jonas Ådahl
+
+Translators:
+  Daniel Mustieles [es], Goran Vidović [hr], Fabio Tomat [fur],
+  Danial Behzadi [fa], Andika Triwidada [id], Efstathios Iosifidis [el],
+  Ricardo Silva Veloso [pt_BR]
+
+3.35.1
+======
+* Misc. bug fixes and cleanups [Marco; Matthias; !758, #701212]
+
+Contributors:
+  Marco Trevisan (Treviño)
+
+3.34.1
+======
+* Fix "Frequent" view icons disappearing on hover [Jonas D.; #1502]
+* Allow editing app folder names [Georges, Marco; !675, !720]
+* Skip property transitions while hidden [Florian; !708]
+* Make menu animations more consistent [Florian, GB_2; #1595, !717]
+* Improve performance when enabling/disabling all extensions [Jonas D.; !96]
+* Fix extra icons appearing in "Frequent" view animation [Georges; !696]
+* Fix fading out desktop icons [Harshula; #1616]
+* Fix box-shadow glitch with prerendered resources [Daniel; #1186]
+* Fix accidentally skipped animations [Florian; #1572]
+* Fix screenshots and window animations when scaled [Robert; !728]
+* Don't leak NOTIFY_SOCKET environment variable to applications [Benjamin; !741]
+* Fix lock-up on X11 when ibus is already running on startup [Marco; #1712]
+* Fix screen dimming on idle [Marco; #1683]
+* Do not notify systemd before initialization is complete [Iain; !750]
+* Support SAE secrets in network agent [Lubomir; !751]
+* Fix various regressions with dynamic workspaces [Florian; #1497]
+* Fixed crashes [Florian, Marco; #1678, !746]
+* Misc. bug fixes and cleanups [Marco, Jonas D., Florian, Iain, Georges,
+  Jonas Å., Martin, Takao, Carlos; !700, !705, !709, !711, !707, #1538, !710,
+  !713, !699, !715, !718, !716, !719, !721, #1243, !725, !731, #1614, !683,
+  !732, !121, !735, !736, !740, #573, #1641, #1571]
+
+Contributors:
+  Marco Trevisan (Treviño), Benjamin Berg, Jonas Dreßler, Takao Fujiwara, GB_2,
+  Carlos Garnacho, Harshula Jayasuriya, Iain Lane, Robert Mader,
+  Daniel García Moreno, Florian Müllner, Georges Basile Stavracas Neto,
+  Lubomir Rintel, Martin Zurowietz, Jonas Ådahl
+
+Translators:
+  Rafael Fontenelle [pt_BR], Fran Dieguez [gl], Balázs Úr [hu],
+  Milo Casagrande [it], Daniel Șerbănescu [ro], Kukuh Syafaat [id],
+  Jiri Grönroos [fi], Daniel Mustieles [es], Piotr Drąg [pl],
+  Anders Jonsson [sv], Marek Černocký [cs], Jordi Mas [ca],
+  Aurimas Černius [lt], Christian Kirbach [de], Emin Tufan Çetin [tr],
+  Enrico Nicoletto [pt_BR], Danial Behzadi [fa], Марко Костић [sr],
+  Alexandre Franke [fr], Charles Monzat [fr], Kjartan Maraas [nb],
+  Ryuta Fujii [ja], Nathan Follens [nl], Dušan Kazik [sk], Fabio Tomat [fur],
+  Matej Urbančič [sl], Ask Hjorth Larsen [da], Alan Mortensen [da]
+
+3.34.0
+======
+* Handle startup/shutdown of misc X11 services [Carlos; !680]
+* Fix sound volume mute/unmute [Iain; #1557]
+* Correctly terminate pasted text [Carlos; #1570]
+
+Contributors:
+  Carlos Garnacho, Iain Lane
+
+Translators:
+  Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
+  Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
+  Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
+
+3.33.92
+=======
+* Animate pointer a11y pie timer [Jonas D.; !688]
+* Fix restarting shell in systemd user session [Benjamin; !690]
+* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
+  !691, !689, !692, #1552, !698]
+
+Contributors:
+  Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
+  Will Thompson
+
+Translators:
+  Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
+  Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
+  Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
+  Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
+  Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
+  Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
+  Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
+
 3.33.91
 =======
 * Fix regression when adjusting brightness [Florian; #1500]

data/dbus-interfaces/net.hadess.SwitcherooControl.xml

@@ -1,5 +1,46 @@
+<!DOCTYPE node PUBLIC "-//freedesktop//DTD D-BUS Object Introspection 1.0//EN"
+"http://www.freedesktop.org/standards/dbus/1.0/introspect.dtd">
+
 <node>
+
+  <!--
+      net.hadess.SwitcherooControl:
+      @short_description: D-Bus proxy to access dual-GPU controls.
+
+      After checking the availability of two switchable GPUs in the machine,
+      check the value of net.hadess.SwitcherooControl.HasDualGpu to see
+      if running applications on the discrete GPU should be offered.
+
+      The object path will be "/net/hadess/SwitcherooControl".
+  -->
   <interface name="net.hadess.SwitcherooControl">
+    <!--
+        HasDualGpu:
+
+        Whether two switchable GPUs are present on the system. This property
+        has been obsoleted in favour of the "NumGPUs" property.
+    -->
     <property name="HasDualGpu" type="b" access="read"/>
+
+    <!--
+        NumGPUs:
+
+        The number of GPUs available on the system. Note that while having no
+        GPUs is unlikely, consumers of this API should probably not throw errors
+        if that were the case.
+    -->
+    <property name="NumGPUs" type="u" access="read"/>
+
+    <!--
+        GPUs:
+
+        An array of key-pair values representing each GPU. The key named "Name" (s)
+        will contain a user-facing name for the GPU, the "Environment" (as) key will
+        contain an array of even number of strings, each being an environment
+        variable to set to use the GPU, followed by its value, the "Default" (b) key
+        will tag the default (usually integrated) GPU.
+    -->
+    <property name="GPUs" type="aa{sv}" access="read"/>
+
   </interface>
 </node>

data/gnome-shell-disable-extensions.service

@@ -1,11 +1,12 @@
 [Unit]
 Description=Disable GNOME Shell extensions after failure
+# Note that this unit must not conflict with anything, and must
+# be able to run in parallel with the gnome-session-shutdown.target.
 DefaultDependencies=no
 
-# Only disable extensions for a short period of time after login.
-# This means we err on the side of failing the first login after a broken
-# extension was installed.
-Requisite=gnome-session-stable.timer
+# We want to disable extensions only if gnome-shell has flagged the extensions
+# to be a likely cause of trouble.
+ConditionPathExists=%t/gnome-shell-disable-extensions
 
 [Service]
 Type=simple

data/gnome-shell-wayland.service.in

@@ -23,3 +23,5 @@ ExecStart=@bindir@/gnome-shell
 SuccessExitStatus=1
 # On wayland we cannot restart
 Restart=no
+# Kill any stubborn child processes after this long
+TimeoutStopSec=5

data/gnome-shell-x11.service.in

@@ -29,3 +29,5 @@ SuccessExitStatus=1
 Restart=always
 # Do not wait before restarting the shell
 RestartSec=0ms
+# Kill any stubborn child processes after this long
+TimeoutStopSec=5

data/org.gnome.shell.gschema.xml.in

@@ -50,7 +50,7 @@
       </description>
     </key>
     <key name="favorite-apps" type="as">
-      <default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default>
+      <default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'org.gnome.Shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default>
       <summary>List of desktop file IDs for favorite applications</summary>
       <description>
         The applications corresponding to these identifiers

data/theme/gnome-shell-sass/_common.scss

@@ -36,10 +36,8 @@ $_hover_bg_color: lighten($bg_color,if($variant=='light', 5%, 3%));
 $_active_bg_color: if($variant == 'light', darken($bg_color, 14%), darken($bg_color, 9%));
 
 $font-size: 11;
-$font-family: Cantarell, Sans-Serif;
 
 stage {
-  font-family: $font-family;
   @include fontsize($font-size);
   color: $fg_color;
 }
@@ -610,6 +608,13 @@ StScrollBar {
     border-bottom-style: solid;
   }
 
+// Rename popup
+.rename-folder-popup {
+  .rename-folder-popup-item {
+    spacing: 6px;
+    &:ltr, &:rtl { padding: 0, 12px; }
+  }
+}
 
 // Background menu
 .background-menu { -boxpointer-gap: 4px; -arrow-rise: 0px; }
@@ -742,7 +747,7 @@ StScrollBar {
 
   .ws-switcher-active-up, .ws-switcher-active-down,
   .ws-switcher-active-left, .ws-switcher-active-right {
-    height: 50px;
+    height: 52px;
     background-color: $selected_bg_color;
     color: $selected_fg_color;
     background-size: 32px;
@@ -821,8 +826,7 @@ StScrollBar {
   font-feature-settings: "tnum";
 
   &.unlock-screen,
-  &.login-screen,
-  &.lock-screen {
+  &.login-screen {
     background-color: transparent;
   }
 
@@ -840,7 +844,7 @@ StScrollBar {
       -panel-corner-border-color: lighten($selected_bg_color,5%);
     }
 
-    &.lock-screen, &.login-screen, &.unlock-screen {
+    &.login-screen, &.unlock-screen {
       -panel-corner-radius: 0;
       -panel-corner-background-color: transparent;
       -panel-corner-border-color: transparent;
@@ -874,8 +878,7 @@ StScrollBar {
 
     .system-status-icon { icon-size: 1.09em; padding: 0 5px; }
     .unlock-screen &,
-    .login-screen &,
-    .lock-screen & {
+    .login-screen & {
       color: lighten($fg_color, 10%);
       &:focus, &:hover, &:active { color: lighten($fg_color, 10%); }
     }
@@ -972,6 +975,7 @@ StScrollBar {
       spacing-columns: 0.8em;
     }
 
+    .weather-header-box,
     .weather-box {
       spacing: 0.4em;
     }
@@ -1054,9 +1058,9 @@ StScrollBar {
       }
       .calendar-today {
         font-weight: bold;
-        //color: lighten($fg_color,10%);
-        //background-color: darken($bg_color,5%);
-        border: 1px solid $_bubble_borders_color;
+        color: lighten($fg_color,5%);
+        background-color: darken($bg_color,5%);
+        // border: 1px solid lighten($_bubble_borders_color,20%);
       }
       .calendar-day-with-events {
         color: lighten($fg_color,10%);
@@ -1146,14 +1150,21 @@ StScrollBar {
             padding: 10px;
           }
 
+          .message-close-button {
+            color: lighten($fg_color, 15%);
+            &:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
+            &:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
+          }
+
           .message-media-control {
             padding: 12px;
             color: lighten($fg_color, 15%);
 
             &:last-child:ltr { padding-right: 18px; }
             &:last-child:rtl { padding-left: 18px; }
-            &:hover { color: $fg_color; }
-            &:insensitive { color: darken($fg_color,40%); }
+            &:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
+            &:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
+            &:insensitive { color: if($variant=='light', lighten($fg_color, 50%), darken($fg_color, 40%)); }
           }
 
           .media-message-cover-icon {
@@ -1183,7 +1194,8 @@ StScrollBar {
 
   .aggregate-menu {
     min-width: 21em;
-    .popup-menu-icon { padding: 0 4px; }
+    .popup-menu-icon { padding: 0 4px;
+                       -st-icon-style: symbolic; }
     .popup-sub-menu .popup-menu-item > :first-child {
       &:ltr { /* 12px spacing + 2*4px padding */
               padding-left: 20px; margin-left: 1.09em; }
@@ -1192,27 +1204,6 @@ StScrollBar {
     }
   }
 
-  .system-menu-action {
-    -st-icon-style: symbolic;
-    color: $fg_color;
-    border-radius: 32px; /* wish we could do 50% */
-    padding: 13px;
-    border: 1px solid $_bubble_borders_color;
-
-    &:hover, &:focus {
-      background-color: $_hover_bg_color;
-      color: $fg_color;
-      border: none;
-      padding: 14px;
-    }
-    &:active { 
-      background-color: $selected_bg_color;
-      color: $selected_fg_color;
-    }
-
-    & > StIcon { icon-size: 16px; }
-  }
-
 // Activities Ripples
 .ripple-box {
   width: 52px;
@@ -1564,20 +1555,14 @@ StScrollBar {
   }
 
   .page-indicator {
-    padding: 15px 20px;
+    padding: 7px 16px;
 
     .page-indicator-icon {
       width: 12px;
       height: 12px;
-      background-color: transparent;
-      border: 2px solid rgba(255, 255, 255, 0.4);
-      border-radius: 12px;
+      background-color: white;
+      border-radius: 6px;
     }
-
-    &:hover .page-indicator-icon { border-color: white; }
-    &:active .page-indicator-icon { border: none; margin: 2px; background-color: white; }
-    &:checked .page-indicator-icon,
-    &:checked:active .page-indicator-icon { background-color: white;}
   }
 
   .no-frequent-applications-label { @extend %status_text; }
@@ -1777,8 +1762,8 @@ StScrollBar {
         padding: 4px 4px;
 
         .page-indicator-icon {
-            width: 6px;
-            height: 6px
+            width: 8px;
+            height: 8px;
         }
     }
 }
@@ -1899,6 +1884,7 @@ StScrollBar {
 .user-icon {
   background-size: contain;
   color: $osd_fg_color;
+  text-align: center;
   border-radius: 99px;
   &:hover {
     color: lighten($osd_fg_color,30%);
@@ -1979,6 +1965,16 @@ StScrollBar {
       }
     }
   }
+  .cancel-button {
+    padding: 0;
+    border-radius: 16px;
+    width: 32px;
+    height: 32px;
+    border-color: transparentize($bg_color,0.7);
+    background-color: transparentize($bg_color,0.7);
+
+	  StIcon { icon-size: 16px; }
+  }
 }
 
   .login-dialog-logo-bin { padding: 24px 0px; }
@@ -2025,15 +2021,10 @@ StScrollBar {
   .login-dialog-username,
   .user-widget-label {
     color: $osd_fg_color;
-    font-size: 120%;
-    font-weight: bold;
-    text-align: left;
-    padding-left: 15px;
+    font-size: 16pt;
+    text-align: center;
+    padding-top: 24px;
   }
-    .user-widget-label {
-      &:ltr { padding-left: 14px; }
-      &:rtl { padding-right: 14px; }
-    }
 
   .login-dialog-prompt-layout {
       padding-top: 24px;
@@ -2060,69 +2051,58 @@ StScrollBar {
 
 //SCREEN SHIELD
 
-$_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
+$_unlockdialog_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
 
-.screen-shield-arrows {
-    padding-bottom: 3em;
-}
-
-.screen-shield-arrows Gjs_Arrow {
-    color: white;
-    width: 80px;
-    height: 48px;
-    -arrow-thickness: 12px;
-    -arrow-shadow: $_screenshield_shadow;
-}
-
-.screen-shield-clock {
+.unlock-dialog-clock {
   color: white;
-  text-shadow: $_screenshield_shadow;
-  font-weight: bold;
+  font-weight: 300;
   text-align: center;
-  padding-bottom: 1.5em;
+  padding-bottom: 2.5em;
 }
 
-.screen-shield-clock-time {
-  font-size: 72pt;
-  text-shadow: $_screenshield_shadow;
+.unlock-dialog-clock-time {
+  font-size: 64pt;
+  padding-bottom: 24px;
+  padding-top: 42px;
   font-feature-settings: "tnum";
 }
 
-.screen-shield-clock-date { 
-  font-size: 28pt;
-  font-weight: normal;
+.unlock-dialog-clock-date {
+  font-size: 16pt;
 }
 
-.screen-shield-notifications-container {
+.unlock-dialog-user-name {
+  padding: 12px 0px;
+}
+
+.unlock-dialog-notifications-container {
+  margin: 12px 0;
   spacing: 6px;
-  width: 30em;
   background-color: transparent;
-  max-height: 500px;
   .summary-notification-stack-scrollview {
     padding-top: 0;
     padding-bottom: 0;
   }
 
   .notification,
-  .screen-shield-notification-source {
+  .unlock-dialog-notification-source {
     padding: 12px 6px;
     border: 1px solid $osd_outer_borders_color;
     background-color: transparentize($osd_bg_color,0.5);
     color: $osd_fg_color;
     border-radius: 4px;
   }
-  .notification { margin-right: 15px; } //compensate for space allocated to the scrollbar
 }
 
 
-.screen-shield-notification-label {
-  font-weight: bold;
+.unlock-dialog-notification-label {
   padding: 0px 0px 0px 12px;
 }
 
-.screen-shield-notification-count-text { padding: 0px 0px 0px 12px; }
-
-#panel.lock-screen { background-color: transparentize($osd_bg_color, 0.5); }
+.unlock-dialog-notification-count-text {
+  weight: bold;
+  padding: 0px 12px 0px 12px;
+}
 
 .screen-shield-background { //just the shadow, really
   background: black;
@@ -2134,7 +2114,7 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
   background-repeat: repeat;
 }
 
-#screenShieldNotifications {
+#unlockDialogNotifications {
   StButton#vhandle, StButton#hhandle {
     background-color: transparentize($bg_color,0.7);
     &:hover, &:focus { background-color: transparentize($bg_color,0.5); }

gnome-shell.doap

@@ -31,34 +31,34 @@ its dependencies to build from tarballs.</description>
   <programming-language>JavaScript</programming-language>
   <programming-language>C</programming-language>
 
-  <maintainer>
+  <author>
     <foaf:Person>
       <foaf:name>William Jon McCann</foaf:name>
       <foaf:mbox rdf:resource="mailto:jmccann@redhat.com" />
       <gnome:userid>mccann</gnome:userid>
     </foaf:Person>
-  </maintainer>
-  <maintainer>
+  </author>
+  <author>
     <foaf:Person>
       <foaf:name>Owen Taylor</foaf:name>
       <foaf:mbox rdf:resource="mailto:otaylor@redhat.com" />
       <gnome:userid>otaylor</gnome:userid>
     </foaf:Person>
-  </maintainer>
-  <maintainer>
+  </author>
+  <author>
     <foaf:Person>
       <foaf:name>Colin Walters</foaf:name>
       <foaf:mbox rdf:resource="mailto:walters@verbum.org" />
       <gnome:userid>walters</gnome:userid>
     </foaf:Person>
-  </maintainer>
-  <maintainer>
+  </author>
+  <author>
     <foaf:Person>
       <foaf:name>Marina Zhurakhinskaya</foaf:name>
       <foaf:mbox rdf:resource="mailto:marinaz@redhat.com" />
       <gnome:userid>marinaz</gnome:userid>
     </foaf:Person>
-  </maintainer>
+  </author>
   <maintainer>
     <foaf:Person>
       <foaf:name>Florian Müllner</foaf:name>

js/extensionPrefs/main.js

@@ -23,14 +23,13 @@ function stripPrefix(string, prefix) {
     return string;
 }
 
-var Application = GObject.registerClass({
-    GTypeName: 'ExtensionPrefs_Application'
-}, class Application extends Gtk.Application {
+var Application = GObject.registerClass(
+class Application extends Gtk.Application {
     _init() {
         GLib.set_prgname('gnome-shell-extension-prefs');
         super._init({
             application_id: 'org.gnome.shell.ExtensionPrefs',
-            flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
+            flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE,
         });
 
         this._startupUuid = null;
@@ -61,12 +60,12 @@ var Application = GObject.registerClass({
 
         let dialog = new Gtk.Window({
             modal: !this._skipMainWindow,
-            type_hint: Gdk.WindowTypeHint.DIALOG
+            type_hint: Gdk.WindowTypeHint.DIALOG,
         });
         dialog.set_titlebar(new Gtk.HeaderBar({
             show_close_button: true,
             title: row.name,
-            visible: true
+            visible: true,
         }));
 
         if (this._skipMainWindow) {
@@ -89,20 +88,20 @@ var Application = GObject.registerClass({
     _buildErrorUI(row, exc) {
         let scroll = new Gtk.ScrolledWindow({
             hscrollbar_policy: Gtk.PolicyType.NEVER,
-            propagate_natural_height: true
+            propagate_natural_height: true,
         });
 
         let box = new Gtk.Box({
             orientation: Gtk.Orientation.VERTICAL,
             spacing: 12,
             margin: 100,
-            margin_bottom: 60
+            margin_bottom: 60,
         });
         scroll.add(box);
 
         let label = new Gtk.Label({
             label: '<span size="x-large">%s</span>'.format(_("Something’s gone wrong")),
-            use_markup: true
+            use_markup: true,
         });
         label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
         box.add(label);
@@ -110,13 +109,13 @@ var Application = GObject.registerClass({
         label = new Gtk.Label({
             label: _("We’re very sorry, but there’s been a problem: the settings for this extension can’t be displayed. We recommend that you report the issue to the extension authors."),
             justify: Gtk.Justification.CENTER,
-            wrap: true
+            wrap: true,
         });
         box.add(label);
 
         let expander = new Expander({
             label: _("Technical Details"),
-            margin_top: 12
+            margin_top: 12,
         });
         box.add(expander);
 
@@ -127,14 +126,14 @@ var Application = GObject.registerClass({
 
         let buffer = new Gtk.TextBuffer({ text: errortext });
         let textview = new Gtk.TextView({
-            buffer: buffer,
+            buffer,
             wrap_mode: Gtk.WrapMode.WORD,
             monospace: true,
             editable: false,
             top_margin: 12,
             bottom_margin: 12,
             left_margin: 12,
-            right_margin: 12
+            right_margin: 12,
         });
 
         let toolbar = new Gtk.Toolbar();
@@ -150,7 +149,7 @@ var Application = GObject.registerClass({
 
         let copyButton = new Gtk.ToolButton({
             icon_name: 'edit-copy-symbolic',
-            tooltip_text: _("Copy Error")
+            tooltip_text: _("Copy Error"),
         });
         toolbar.add(copyButton);
 
@@ -159,15 +158,15 @@ var Application = GObject.registerClass({
             // markdown for pasting in gitlab issues
             let lines = [
                 `The settings of extension ${row.uuid} had an error:`,
-                '```',
+                '```', // '`' (xgettext throws up on odd number of backticks)
                 `${exc}`,
-                '```',
+                '```', // '`'
                 '',
                 'Stack trace:',
-                '```',
+                '```', // '`'
                 exc.stack.replace(/\n$/, ''), // stack without trailing newline
-                '```',
-                ''
+                '```', // '`'
+                '',
             ];
             clipboard.set_text(lines.join('\n'), -1);
         });
@@ -180,7 +179,7 @@ var Application = GObject.registerClass({
             label: _("Homepage"),
             tooltip_text: _("Visit extension homepage"),
             no_show_all: true,
-            visible: row.url != null
+            visible: row.url != null,
         });
         toolbar.add(urlButton);
 
@@ -190,7 +189,7 @@ var Application = GObject.registerClass({
         });
 
         let expandedBox = new Gtk.Box({
-            orientation: Gtk.Orientation.VERTICAL
+            orientation: Gtk.Orientation.VERTICAL,
         });
         expandedBox.add(textview);
         expandedBox.add(toolbar);
@@ -220,7 +219,7 @@ var Application = GObject.registerClass({
                             Gio.SettingsBindFlags.INVERT_BOOLEAN);
 
         this._mainStack = new Gtk.Stack({
-            transition_type: Gtk.StackTransitionType.CROSSFADE
+            transition_type: Gtk.StackTransitionType.CROSSFADE,
         });
         this._window.add(this._mainStack);
 
@@ -259,23 +258,15 @@ var Application = GObject.registerClass({
     }
 
     _onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
+        let extension = ExtensionUtils.deserializeExtension(newState);
         let row = this._findExtensionRow(uuid);
+
         if (row) {
-            let { state } = ExtensionUtils.deserializeExtension(newState);
-            if (state == ExtensionState.UNINSTALLED)
+            if (extension.state === ExtensionState.UNINSTALLED)
                 row.destroy();
             return; // we only deal with new and deleted extensions here
         }
-
-        this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
-            let extension = ExtensionUtils.deserializeExtension(serialized);
-            if (!extension)
-                return;
-            // check the extension wasn't added in between
-            if (this._findExtensionRow(uuid) != null)
-                return;
-            this._addExtensionRow(extension);
-        });
+        this._addExtensionRow(extension);
     }
 
     _scanExtensions() {
@@ -285,8 +276,9 @@ var Application = GObject.registerClass({
                     log(`Failed to connect to shell proxy: ${e}`);
                     this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
                     this._mainStack.visible_child_name = 'noshell';
-                } else
+                } else {
                     throw e;
+                }
                 return;
             }
 
@@ -360,20 +352,20 @@ var Expander = GObject.registerClass({
             'label', 'label', 'label',
             GObject.ParamFlags.READWRITE,
             null
-        )
-    }
+        ),
+    },
 }, class Expander extends Gtk.Box {
     _init(params = {}) {
         this._labelText = null;
 
         super._init(Object.assign(params, {
             orientation: Gtk.Orientation.VERTICAL,
-            spacing: 0
+            spacing: 0,
         }));
 
         this._frame = new Gtk.Frame({
             shadow_type: Gtk.ShadowType.IN,
-            hexpand: true
+            hexpand: true,
         });
 
         let eventBox = new Gtk.EventBox();
@@ -381,12 +373,12 @@ var Expander = GObject.registerClass({
 
         let hbox = new Gtk.Box({
             spacing: 6,
-            margin: 12
+            margin: 12,
         });
         eventBox.add(hbox);
 
         this._arrow = new Gtk.Image({
-            icon_name: 'pan-end-symbolic'
+            icon_name: 'pan-end-symbolic',
         });
         hbox.add(this._arrow);
 
@@ -396,7 +388,7 @@ var Expander = GObject.registerClass({
         this._revealer = new Gtk.Revealer();
 
         this._childBin = new Gtk.Frame({
-            shadow_type: Gtk.ShadowType.IN
+            shadow_type: Gtk.ShadowType.IN,
         });
         this._revealer.add(this._childBin);
 
@@ -414,7 +406,7 @@ var Expander = GObject.registerClass({
         this._gesture = new Gtk.GestureMultiPress({
             widget: this._frame,
             button: 0,
-            exclusive: true
+            exclusive: true,
         });
         this._gesture.connect('released', (gesture, nPress) => {
             if (nPress == 1)
@@ -459,7 +451,7 @@ class EmptyPlaceholder extends Gtk.Box {
         super._init({
             orientation: Gtk.Orientation.VERTICAL,
             spacing: 6,
-            margin: 32
+            margin: 32,
         });
 
         let image = new Gtk.Image({
@@ -467,15 +459,15 @@ class EmptyPlaceholder extends Gtk.Box {
             pixel_size: 96,
             visible: true,
             vexpand: true,
-            valign: Gtk.Align.END
+            valign: Gtk.Align.END,
         });
         image.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
         this.add(image);
 
         let label = new Gtk.Label({
-            label: `<b><span size="x-large">${_("No Extensions Installed" )}</span></b>`,
+            label: `<b><span size="x-large">${_("No Extensions Installed")}</span></b>`,
             use_markup: true,
-            visible: true
+            visible: true,
         });
         label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
         this.add(label);
@@ -490,9 +482,9 @@ class EmptyPlaceholder extends Gtk.Box {
             visible: true,
             max_width_chars: 50,
             hexpand: true,
-            vexpand: (appInfo == null),
+            vexpand: appInfo == null,
             halign: Gtk.Align.CENTER,
-            valign: Gtk.Align.START
+            valign: Gtk.Align.START,
         });
         this.add(desc);
 
@@ -500,14 +492,14 @@ class EmptyPlaceholder extends Gtk.Box {
             let button = new Gtk.Button({
                 label: _("Browse in Software"),
                 image: new Gtk.Image({
-                    icon_name: "org.gnome.Software-symbolic"
+                    icon_name: "org.gnome.Software-symbolic",
                 }),
                 always_show_image: true,
                 margin_top: 12,
                 visible: true,
                 halign: Gtk.Align.CENTER,
                 valign: Gtk.Align.START,
-                vexpand: true
+                vexpand: true,
             });
             this.add(button);
 
@@ -526,13 +518,13 @@ class NoShellPlaceholder extends Gtk.Box {
             orientation: Gtk.Orientation.VERTICAL,
             spacing: 12,
             margin: 100,
-            margin_bottom: 60
+            margin_bottom: 60,
         });
 
         let label = new Gtk.Label({
             label: '<span size="x-large">%s</span>'.format(
                 _("Something’s gone wrong")),
-            use_markup: true
+            use_markup: true,
         });
         label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
         this.add(label);
@@ -540,7 +532,7 @@ class NoShellPlaceholder extends Gtk.Box {
         label = new Gtk.Label({
             label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
             justify: Gtk.Justification.CENTER,
-            wrap: true
+            wrap: true,
         });
         this.add(label);
 
@@ -567,20 +559,24 @@ class ExtensionRow extends Gtk.ListBoxRow {
         this._extension = extension;
         this._prefsModule = null;
 
+        this.connect('destroy', this._onDestroy.bind(this));
+
+        this._buildUI();
+
         this._extensionStateChangedId = this._app.shellProxy.connectSignal(
             'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
                 if (this.uuid !== uuid)
                     return;
 
                 this._extension = ExtensionUtils.deserializeExtension(newState);
-                let state = (this._extension.state == ExtensionState.ENABLED);
+                let state = this._extension.state == ExtensionState.ENABLED;
+
+                this._switch.block_signal_handler(this._notifyActiveId);
                 this._switch.state = state;
+                this._switch.unblock_signal_handler(this._notifyActiveId);
+
                 this._switch.sensitive = this._canToggle();
             });
-
-        this.connect('destroy', this._onDestroy.bind(this));
-
-        this._buildUI();
     }
 
     get uuid() {
@@ -644,9 +640,9 @@ class ExtensionRow extends Gtk.ListBoxRow {
         this._switch = new Gtk.Switch({
             valign: Gtk.Align.CENTER,
             sensitive: this._canToggle(),
-            state: this._extension.state === ExtensionState.ENABLED
+            state: this._extension.state === ExtensionState.ENABLED,
         });
-        this._switch.connect('notify::active', () => {
+        this._notifyActiveId = this._switch.connect('notify::active', () => {
             if (this._switch.active)
                 this._app.shellProxy.EnableExtensionRemote(this.uuid);
             else
@@ -661,12 +657,12 @@ class ExtensionRow extends Gtk.ListBoxRow {
     }
 
     get prefsModule() {
+        // give extension prefs access to their own extension object
+        ExtensionUtils.getCurrentExtension = () => this._extension;
+
         if (!this._prefsModule) {
             ExtensionUtils.installImporter(this._extension);
 
-            // give extension prefs access to their own extension object
-            ExtensionUtils.getCurrentExtension = () => this._extension;
-
             this._prefsModule = this._extension.imports.prefs;
             this._prefsModule.init(this._extension.metadata);
         }
@@ -687,7 +683,7 @@ function initEnvironment() {
             log(`ERROR: ${s}`);
         },
 
-        userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell'])
+        userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell']),
     };
 
     String.prototype.format = Format.format;

js/gdm/authPrompt.js

@@ -1,11 +1,12 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported AuthPrompt */
 
-const { Clutter, Pango, Shell, St } = imports.gi;
-const Signals = imports.signals;
+const { Clutter, GObject, Pango, Shell, St } = imports.gi;
 
 const Animation = imports.ui.animation;
 const Batch = imports.gdm.batch;
 const GdmUtil = imports.gdm.util;
+const Util = imports.misc.util;
 const Params = imports.misc.params;
 const ShellEntry = imports.ui.shellEntry;
 const UserWidget = imports.ui.userWidget;
@@ -16,25 +17,42 @@ var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
 
 var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
 
+const WIGGLE_OFFSET = 6;
+const WIGGLE_DURATION = 65;
+const N_WIGGLES = 3;
+
 var AuthPromptMode = {
     UNLOCK_ONLY: 0,
-    UNLOCK_OR_LOG_IN: 1
+    UNLOCK_OR_LOG_IN: 1,
 };
 
 var AuthPromptStatus = {
     NOT_VERIFYING: 0,
     VERIFYING: 1,
     VERIFICATION_FAILED: 2,
-    VERIFICATION_SUCCEEDED: 3
+    VERIFICATION_SUCCEEDED: 3,
 };
 
 var BeginRequestType = {
     PROVIDE_USERNAME: 0,
-    DONT_PROVIDE_USERNAME: 1
+    DONT_PROVIDE_USERNAME: 1,
 };
 
-var AuthPrompt = class {
-    constructor(gdmClient, mode) {
+var AuthPrompt = GObject.registerClass({
+    Signals: {
+        'cancelled': {},
+        'failed': {},
+        'next': {},
+        'prompted': {},
+        'reset': { param_types: [GObject.TYPE_UINT] },
+    },
+}, class AuthPrompt extends St.BoxLayout {
+    _init(gdmClient, mode) {
+        super._init({
+            style_class: 'login-dialog-prompt-layout',
+            vertical: true,
+        });
+
         this.verificationStatus = AuthPromptStatus.NOT_VERIFYING;
 
         this._gdmClient = gdmClient;
@@ -46,7 +64,7 @@ var AuthPrompt = class {
         else if (this._mode == AuthPromptMode.UNLOCK_OR_LOG_IN)
             reauthenticationOnly = false;
 
-        this._userVerifier = new GdmUtil.ShellUserVerifier(this._gdmClient, { reauthenticationOnly: reauthenticationOnly });
+        this._userVerifier = new GdmUtil.ShellUserVerifier(this._gdmClient, { reauthenticationOnly });
 
         this._userVerifier.connect('ask-question', this._onAskQuestion.bind(this));
         this._userVerifier.connect('show-message', this._onShowMessage.bind(this));
@@ -60,70 +78,39 @@ var AuthPrompt = class {
         this.connect('next', () => {
             this.updateSensitivity(false);
             this.startSpinning();
-            if (this._queryingService) {
+            if (this._queryingService)
                 this._userVerifier.answerQuery(this._queryingService, this._entry.text);
-            } else {
+            else
                 this._preemptiveAnswer = this._entry.text;
-            }
         });
 
-        this.actor = new St.BoxLayout({ style_class: 'login-dialog-prompt-layout',
-                                        vertical: true });
-        this.actor.connect('destroy', this._onDestroy.bind(this));
-        this.actor.connect('key-press-event', (actor, event) => {
-            if (event.get_key_symbol() == Clutter.KEY_Escape)
-                this.cancel();
-            return Clutter.EVENT_PROPAGATE;
+        this.connect('destroy', this._onDestroy.bind(this));
+
+        this._userWell = new St.Bin({
+            x_expand: true,
+            y_expand: true,
+        });
+        this.add_child(this._userWell);
+        this._label = new St.Label({
+            style_class: 'login-dialog-prompt-label',
+            x_expand: false,
+            y_expand: true,
         });
 
-        this._userWell = new St.Bin({ x_fill: true,
-                                      x_align: St.Align.START });
-        this.actor.add(this._userWell,
-                       { x_align: St.Align.START,
-                         x_fill: true,
-                         y_fill: true,
-                         expand: true });
-        this._label = new St.Label({ style_class: 'login-dialog-prompt-label' });
+        this.add_child(this._label);
 
-        this.actor.add(this._label,
-                       { expand: true,
-                         x_fill: false,
-                         y_fill: true,
-                         x_align: St.Align.START });
-        this._entry = new St.Entry({ style_class: 'login-dialog-prompt-entry',
-                                     can_focus: true });
-        ShellEntry.addContextMenu(this._entry, { isPassword: true, actionMode: Shell.ActionMode.NONE });
+        this._initEntryRow();
 
-        this.actor.add(this._entry,
-                       { expand: true,
-                         x_fill: true,
-                         y_fill: false,
-                         x_align: St.Align.START });
-
-        this._entry.grab_key_focus();
-
-        this._message = new St.Label({ opacity: 0,
-                                       styleClass: 'login-dialog-message' });
+        this._message = new St.Label({
+            opacity: 0,
+            styleClass: 'login-dialog-message',
+            x_expand: false,
+            y_expand: true,
+            y_align: Clutter.ActorAlign.START,
+        });
         this._message.clutter_text.line_wrap = true;
         this._message.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
-        this.actor.add(this._message, { x_fill: false, x_align: St.Align.START, y_align: St.Align.START });
-
-        this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box',
-                                             vertical: false });
-        this.actor.add(this._buttonBox,
-                       { expand: true,
-                         x_align: St.Align.MIDDLE,
-                         y_align: St.Align.END });
-
-        this._defaultButtonWell = new St.Widget({ layout_manager: new Clutter.BinLayout() });
-        this._defaultButtonWellActor = null;
-
-        this._initButtons();
-
-        this._spinner = new Animation.Spinner(DEFAULT_BUTTON_WELL_ICON_SIZE);
-        this._spinner.actor.opacity = 0;
-        this._spinner.actor.show();
-        this._defaultButtonWell.add_child(this._spinner.actor);
+        this.add_child(this._message);
     }
 
     _onDestroy() {
@@ -131,52 +118,61 @@ var AuthPrompt = class {
         this._userVerifier = null;
     }
 
-    _initButtons() {
-        this.cancelButton = new St.Button({ style_class: 'modal-dialog-button button',
-                                            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-                                            reactive: true,
-                                            can_focus: true,
-                                            label: _("Cancel") });
+    vfunc_key_press_event(keyPressEvent) {
+        if (keyPressEvent.keyval == Clutter.KEY_Escape)
+            this.cancel();
+        return Clutter.EVENT_PROPAGATE;
+    }
+
+    _initEntryRow() {
+        let mainBox = new St.BoxLayout({
+            style_class: 'login-dialog-button-box',
+            vertical: false,
+        });
+        this.add_child(mainBox);
+
+        this.cancelButton = new St.Button({
+            style_class: 'modal-dialog-button button cancel-button',
+            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
+            reactive: true,
+            can_focus: true,
+            x_expand: true,
+            x_align: Clutter.ActorAlign.START,
+            y_align: Clutter.ActorAlign.END,
+            child: new St.Icon({ icon_name: 'go-previous-symbolic' }),
+        });
         this.cancelButton.connect('clicked', () => this.cancel());
-        this._buttonBox.add(this.cancelButton,
-                            { expand: false,
-                              x_fill: false,
-                              y_fill: false,
-                              x_align: St.Align.START,
-                              y_align: St.Align.END });
+        mainBox.add_child(this.cancelButton);
 
-        this._buttonBox.add(this._defaultButtonWell,
-                            { expand: true,
-                              x_fill: false,
-                              y_fill: false,
-                              x_align: St.Align.END,
-                              y_align: St.Align.MIDDLE });
-        this.nextButton = new St.Button({ style_class: 'modal-dialog-button button',
-                                          button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-                                          reactive: true,
-                                          can_focus: true,
-                                          label: _("Next") });
-        this.nextButton.connect('clicked', () => this.emit('next'));
-        this.nextButton.add_style_pseudo_class('default');
-        this._buttonBox.add(this.nextButton,
-                            { expand: false,
-                              x_fill: false,
-                              y_fill: false,
-                              x_align: St.Align.END,
-                              y_align: St.Align.END });
+        this._entry = new St.Entry({
+            style_class: 'login-dialog-prompt-entry',
+            can_focus: true,
+            x_expand: false,
+            y_expand: true,
+            hint_text: "Enter Password…",
+        });
+        ShellEntry.addContextMenu(this._entry, { isPassword: true, actionMode: Shell.ActionMode.NONE });
 
-        this._updateNextButtonSensitivity(this._entry.text.length > 0);
+        mainBox.add_child(this._entry);
 
+        this._entry.grab_key_focus();
+        this._entry.clutter_text.connect('activate', () => this.emit('next'));
         this._entry.clutter_text.connect('text-changed', () => {
             if (!this._userVerifier.hasPendingMessages)
                 this._fadeOutMessage();
+        });
 
-            this._updateNextButtonSensitivity(this._entry.text.length > 0 || this.verificationStatus == AuthPromptStatus.VERIFYING);
-        });
-        this._entry.clutter_text.connect('activate', () => {
-            if (this.nextButton.reactive)
-                this.emit('next');
+        this._defaultButtonWell = new St.Widget({
+            layout_manager: new Clutter.BinLayout(),
+            x_align: Clutter.ActorAlign.END,
+            y_align: Clutter.ActorAlign.CENTER,
         });
+        mainBox.add_child(this._defaultButtonWell);
+
+        this._spinner = new Animation.Spinner(DEFAULT_BUTTON_WELL_ICON_SIZE);
+        this._spinner.opacity = 0;
+        this._spinner.show();
+        this._defaultButtonWell.add_child(this._spinner);
     }
 
     _onAskQuestion(verifier, serviceName, question, passwordChar) {
@@ -192,15 +188,6 @@ var AuthPrompt = class {
         this.setPasswordChar(passwordChar);
         this.setQuestion(question);
 
-        if (passwordChar) {
-            if (this._userVerifier.reauthenticating)
-                this.nextButton.label = _("Unlock");
-            else
-                this.nextButton.label = C_("button", "Sign In");
-        } else {
-            this.nextButton.label = _("Next");
-        }
-
         this.updateSensitivity(true);
         this.emit('prompted');
     }
@@ -241,6 +228,12 @@ var AuthPrompt = class {
         this.updateSensitivity(canRetry);
         this.setActorInDefaultButtonWell(null);
         this.verificationStatus = AuthPromptStatus.VERIFICATION_FAILED;
+
+        Util.wiggle(this._entry, {
+            offset: WIGGLE_OFFSET,
+            duration: WIGGLE_DURATION,
+            wiggleCount: N_WIGGLES,
+        });
     }
 
     _onVerificationComplete() {
@@ -269,13 +262,13 @@ var AuthPrompt = class {
             oldActor.remove_all_transitions();
 
         let wasSpinner;
-        if (oldActor == this._spinner.actor)
+        if (oldActor == this._spinner)
             wasSpinner = true;
         else
             wasSpinner = false;
 
         let isSpinner;
-        if (actor == this._spinner.actor)
+        if (actor == this._spinner)
             isSpinner = true;
         else
             isSpinner = false;
@@ -299,7 +292,7 @@ var AuthPrompt = class {
                             if (this._spinner)
                                 this._spinner.stop();
                         }
-                    }
+                    },
                 });
             }
         }
@@ -308,22 +301,23 @@ var AuthPrompt = class {
             if (isSpinner)
                 this._spinner.play();
 
-            if (!animate)
+            if (!animate) {
                 actor.opacity = 255;
-            else
+            } else {
                 actor.ease({
                     opacity: 255,
                     duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
                     delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                    mode: Clutter.AnimationMode.LINEAR
+                    mode: Clutter.AnimationMode.LINEAR,
                 });
+            }
         }
 
         this._defaultButtonWellActor = actor;
     }
 
     startSpinning() {
-        this.setActorInDefaultButtonWell(this._spinner.actor, true);
+        this.setActorInDefaultButtonWell(this._spinner, true);
     }
 
     stopSpinning() {
@@ -369,7 +363,7 @@ var AuthPrompt = class {
         this._message.ease({
             opacity: 0,
             duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
     }
 
@@ -393,20 +387,14 @@ var AuthPrompt = class {
         }
     }
 
-    _updateNextButtonSensitivity(sensitive) {
-        this.nextButton.reactive = sensitive;
-        this.nextButton.can_focus = sensitive;
-    }
-
     updateSensitivity(sensitive) {
-        this._updateNextButtonSensitivity(sensitive && (this._entry.text.length > 0 || this.verificationStatus == AuthPromptStatus.VERIFYING));
         this._entry.reactive = sensitive;
         this._entry.clutter_text.editable = sensitive;
     }
 
-    hide() {
+    vfunc_hide() {
         this.setActorInDefaultButtonWell(null, true);
-        this.actor.hide();
+        super.vfunc_hide();
         this._message.opacity = 0;
 
         this.setUser(null);
@@ -422,7 +410,8 @@ var AuthPrompt = class {
 
         if (user) {
             let userWidget = new UserWidget.UserWidget(user);
-            this._userWell.set_child(userWidget.actor);
+            userWidget.x_align = Clutter.ActorAlign.CENTER;
+            this._userWell.set_child(userWidget);
         }
     }
 
@@ -430,7 +419,6 @@ var AuthPrompt = class {
         let oldStatus = this.verificationStatus;
         this.verificationStatus = AuthPromptStatus.NOT_VERIFYING;
         this.cancelButton.reactive = true;
-        this.nextButton.label = _("Next");
         this._preemptiveAnswer = null;
 
         if (this._userVerifier)
@@ -501,11 +489,10 @@ var AuthPrompt = class {
     }
 
     cancel() {
-        if (this.verificationStatus == AuthPromptStatus.VERIFICATION_SUCCEEDED) {
+        if (this.verificationStatus == AuthPromptStatus.VERIFICATION_SUCCEEDED)
             return;
-        }
+
         this.reset();
         this.emit('cancelled');
     }
-};
-Signals.addSignalMethods(AuthPrompt.prototype);
+});

js/gdm/batch.js

@@ -112,13 +112,12 @@ var Batch = class extends Task {
         for (let i = 0; i < tasks.length; i++) {
             let task;
 
-            if (tasks[i] instanceof Task) {
+            if (tasks[i] instanceof Task)
                 task = tasks[i];
-            } else if (typeof tasks[i] == 'function') {
+            else if (typeof tasks[i] == 'function')
                 task = new Task(scope, tasks[i]);
-            } else {
+            else
                 throw new Error('Batch tasks must be functions or Task, Hold or Batch objects');
-            }
 
             this.tasks.push(task);
         }
@@ -129,9 +128,8 @@ var Batch = class extends Task {
     }
 
     runTask() {
-        if (!(this._currentTaskIndex in this.tasks)) {
+        if (!(this._currentTaskIndex in this.tasks))
             return null;
-        }
 
         return this.tasks[this._currentTaskIndex].run();
     }
@@ -179,9 +177,8 @@ var ConcurrentBatch = class extends Batch {
     process() {
         let hold = this.runTask();
 
-        if (hold) {
+        if (hold)
             this.hold.acquireUntilAfter(hold);
-        }
 
         // Regardless of the state of the just run task,
         // fire off the next one, so all the tasks can run
@@ -202,7 +199,6 @@ var ConsecutiveBatch = class extends Batch {
                 hold.disconnect(signalId);
                 this.nextTask();
             });
-            return;
         } else {
             // This task finished, process the next one
             this.nextTask();

js/gdm/fingerprint.js

@@ -20,7 +20,7 @@ function FprintManager() {
                                    g_interface_info: FprintManagerInfo,
                                    g_name: 'net.reactivated.Fprint',
                                    g_object_path: '/net/reactivated/Fprint/Manager',
-                                   g_flags: (Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES) });
+                                   g_flags: Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES });
 
     try {
         self.init(null);

js/gdm/loginDialog.js

@@ -19,7 +19,6 @@
 
 const { AccountsService, Atk, Clutter, Gdm, Gio,
         GLib, GObject, Meta, Pango, Shell, St } = imports.gi;
-const Signals = imports.signals;
 
 const AuthPrompt = imports.gdm.authPrompt;
 const Batch = imports.gdm.batch;
@@ -39,72 +38,81 @@ const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
 const _LOGO_ICON_HEIGHT = 48;
 const _MAX_BOTTOM_MENU_ITEMS = 5;
 
-var UserListItem = class {
-    constructor(user) {
+var UserListItem = GObject.registerClass({
+    Signals: { 'activate': {} },
+}, class UserListItem extends St.Button {
+    _init(user) {
+        let layout = new St.BoxLayout({
+            vertical: true,
+            x_align: Clutter.ActorAlign.START,
+        });
+        super._init({
+            style_class: 'login-dialog-user-list-item',
+            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
+            can_focus: true,
+            x_expand: true,
+            child: layout,
+            reactive: true,
+        });
+
         this.user = user;
         this._userChangedId = this.user.connect('changed',
                                                 this._onUserChanged.bind(this));
 
-        let layout = new St.BoxLayout({ vertical: true });
-        this.actor = new St.Button({ style_class: 'login-dialog-user-list-item',
-                                     button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-                                     can_focus: true,
-                                     child: layout,
-                                     reactive: true,
-                                     x_align: St.Align.START,
-                                     x_fill: true });
-        this.actor.connect('destroy', this._onDestroy.bind(this));
-
-        this.actor.connect('key-focus-in', () => {
-            this._setSelected(true);
-        });
-        this.actor.connect('key-focus-out', () => {
-            this._setSelected(false);
-        });
-        this.actor.connect('notify::hover', () => {
-            this._setSelected(this.actor.hover);
+        this.connect('destroy', this._onDestroy.bind(this));
+        this.connect('notify::hover', () => {
+            this._setSelected(this.hover);
         });
 
         this._userWidget = new UserWidget.UserWidget(this.user);
-        layout.add(this._userWidget.actor);
+        layout.add(this._userWidget);
 
-        this._userWidget.actor.bind_property('label-actor', this.actor, 'label-actor',
-                                             GObject.BindingFlags.SYNC_CREATE);
+        this._userWidget.bind_property('label-actor', this, 'label-actor',
+                                       GObject.BindingFlags.SYNC_CREATE);
 
         this._timedLoginIndicator = new St.Bin({ style_class: 'login-dialog-timed-login-indicator',
                                                  scale_x: 0,
                                                  visible: false });
         layout.add(this._timedLoginIndicator);
 
-        this.actor.connect('clicked', this._onClicked.bind(this));
         this._onUserChanged();
     }
 
+    vfunc_key_focus_in() {
+        super.vfunc_key_focus_in();
+        this._setSelected(true);
+    }
+
+    vfunc_key_focus_out() {
+        super.vfunc_key_focus_out();
+        this._setSelected(false);
+    }
+
     _onUserChanged() {
         this._updateLoggedIn();
     }
 
     _updateLoggedIn() {
         if (this.user.is_logged_in())
-            this.actor.add_style_pseudo_class('logged-in');
+            this.add_style_pseudo_class('logged-in');
         else
-            this.actor.remove_style_pseudo_class('logged-in');
+            this.remove_style_pseudo_class('logged-in');
     }
 
     _onDestroy() {
         this.user.disconnect(this._userChangedId);
     }
 
-    _onClicked() {
+    vfunc_clicked() {
         this.emit('activate');
     }
 
     _setSelected(selected) {
         if (selected) {
-            this.actor.add_style_pseudo_class('selected');
-            this.actor.grab_key_focus();
+            this.add_style_pseudo_class('selected');
+            this.grab_key_focus();
         } else {
-            this.actor.remove_style_pseudo_class('selected');
+            this.remove_style_pseudo_class('selected');
         }
     }
 
@@ -117,7 +125,7 @@ var UserListItem = class {
 
         let startTime = GLib.get_monotonic_time();
 
-        this._timedLoginTimeoutId = GLib.timeout_add (GLib.PRIORITY_DEFAULT, 33,
+        this._timedLoginTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 33,
             () => {
                 let currentTime = GLib.get_monotonic_time();
                 let elapsedTime = (currentTime - startTime) / GLib.USEC_PER_SEC;
@@ -145,23 +153,33 @@ var UserListItem = class {
         this._timedLoginIndicator.visible = false;
         this._timedLoginIndicator.scale_x = 0.;
     }
-};
-Signals.addSignalMethods(UserListItem.prototype);
+});
 
-var UserList = class {
-    constructor() {
-        this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view' });
-        this.actor.set_policy(St.PolicyType.NEVER,
-                              St.PolicyType.AUTOMATIC);
+var UserList = GObject.registerClass({
+    Signals: {
+        'activate': { param_types: [UserListItem.$gtype] },
+        'item-added': { param_types: [UserListItem.$gtype] },
+    },
+}, class UserList extends St.ScrollView {
+    _init() {
+        super._init({
+            style_class: 'login-dialog-user-list-view',
+            x_expand: true,
+            y_expand: true,
+        });
+        this.set_policy(St.PolicyType.NEVER,
+                        St.PolicyType.AUTOMATIC);
 
         this._box = new St.BoxLayout({ vertical: true,
                                        style_class: 'login-dialog-user-list',
                                        pseudo_class: 'expanded' });
 
-        this.actor.add_actor(this._box);
+        this.add_actor(this._box);
         this._items = {};
+    }
 
-        this.actor.connect('key-focus-in', this._moveFocusToItems.bind(this));
+    vfunc_key_focus_in() {
+        this._moveFocusToItems();
     }
 
     _moveFocusToItems() {
@@ -170,10 +188,10 @@ var UserList = class {
         if (!hasItems)
             return;
 
-        if (global.stage.get_key_focus() != this.actor)
+        if (global.stage.get_key_focus() != this)
             return;
 
-        let focusSet = this.actor.navigate_focus(null, St.DirectionType.TAB_FORWARD, false);
+        let focusSet = this.navigate_focus(null, St.DirectionType.TAB_FORWARD, false);
         if (!focusSet) {
             Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
                 this._moveFocusToItems();
@@ -194,26 +212,26 @@ var UserList = class {
 
         for (let userName in this._items) {
             let item = this._items[userName];
-            item.actor.sync_hover();
+            item.sync_hover();
         }
     }
 
     scrollToItem(item) {
-        let box = item.actor.get_allocation_box();
+        let box = item.get_allocation_box();
 
-        let adjustment = this.actor.get_vscroll_bar().get_adjustment();
+        let adjustment = this.get_vscroll_bar().get_adjustment();
 
         let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
         adjustment.ease(value, {
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: _SCROLL_ANIMATION_TIME
+            duration: _SCROLL_ANIMATION_TIME,
         });
     }
 
     jumpToItem(item) {
-        let box = item.actor.get_allocation_box();
+        let box = item.get_allocation_box();
 
-        let adjustment = this.actor.get_vscroll_bar().get_adjustment();
+        let adjustment = this.get_vscroll_bar().get_adjustment();
 
         let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
 
@@ -251,14 +269,14 @@ var UserList = class {
         this.removeUser(user);
 
         let item = new UserListItem(user);
-        this._box.add(item.actor, { x_fill: true });
+        this._box.add_child(item);
 
         this._items[userName] = item;
 
         item.connect('activate', this._onItemActivated.bind(this));
 
         // Try to keep the focused item front-and-center
-        item.actor.connect('key-focus-in', () => this.scrollToItem(item));
+        item.connect('key-focus-in', () => this.scrollToItem(item));
 
         this._moveFocusToItems();
 
@@ -279,33 +297,37 @@ var UserList = class {
         if (!item)
             return;
 
-        item.actor.destroy();
+        item.destroy();
         delete this._items[userName];
     }
 
     numItems() {
         return Object.keys(this._items).length;
     }
-};
-Signals.addSignalMethods(UserList.prototype);
+});
 
-var SessionMenuButton = class {
-    constructor() {
+var SessionMenuButton = GObject.registerClass({
+    Signals: { 'session-activated': { param_types: [GObject.TYPE_STRING] } },
+}, class SessionMenuButton extends St.Bin {
+    _init() {
         let gearIcon = new St.Icon({ icon_name: 'emblem-system-symbolic' });
-        this._button = new St.Button({ style_class: 'login-dialog-session-list-button',
-                                       reactive: true,
-                                       track_hover: true,
-                                       can_focus: true,
-                                       accessible_name: _("Choose Session"),
-                                       accessible_role: Atk.Role.MENU,
-                                       child: gearIcon });
+        let button = new St.Button({
+            style_class: 'login-dialog-session-list-button',
+            reactive: true,
+            track_hover: true,
+            can_focus: true,
+            accessible_name: _("Choose Session"),
+            accessible_role: Atk.Role.MENU,
+            child: gearIcon,
+        });
 
-        this.actor = new St.Bin({ child: this._button });
+        super._init({ child: button });
+        this._button = button;
 
         let side = St.Side.TOP;
         let align = 0;
         if (Gdm.get_session_ids().length > _MAX_BOTTOM_MENU_ITEMS) {
-            if (this.actor.text_direction == Clutter.TextDirection.RTL)
+            if (this.text_direction == Clutter.TextDirection.RTL)
                 side = St.Side.RIGHT;
             else
                 side = St.Side.LEFT;
@@ -384,15 +406,16 @@ var SessionMenuButton = class {
             });
         }
     }
-};
-Signals.addSignalMethods(SessionMenuButton.prototype);
+});
 
 var LoginDialog = GObject.registerClass({
-    Signals: { 'failed': {} },
+    Signals: {
+        'failed': {},
+        'wake-up-screen': {},
+    },
 }, class LoginDialog extends St.Widget {
     _init(parentActor) {
-        super._init({ style_class: 'login-dialog',
-                      visible: false });
+        super._init({ style_class: 'login-dialog', visible: false });
 
         this.get_accessible().set_role(Atk.Role.WINDOW);
 
@@ -426,38 +449,35 @@ var LoginDialog = GObject.registerClass({
         this.add_child(this._userSelectionBox);
 
         this._userList = new UserList();
-        this._userSelectionBox.add(this._userList.actor,
-                                   { expand: true,
-                                     x_fill: true,
-                                     y_fill: true });
+        this._userSelectionBox.add_child(this._userList);
 
         this._authPrompt = new AuthPrompt.AuthPrompt(this._gdmClient, AuthPrompt.AuthPromptMode.UNLOCK_OR_LOG_IN);
         this._authPrompt.connect('prompted', this._onPrompted.bind(this));
         this._authPrompt.connect('reset', this._onReset.bind(this));
         this._authPrompt.hide();
-        this.add_child(this._authPrompt.actor);
+        this.add_child(this._authPrompt);
 
         // translators: this message is shown below the user list on the
         // login screen. It can be activated to reveal an entry for
         // manually entering the username.
-        let notListedLabel = new St.Label({ text: _("Not listed?"),
-                                            style_class: 'login-dialog-not-listed-label' });
-        this._notListedButton = new St.Button({ style_class: 'login-dialog-not-listed-button',
-                                                button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-                                                can_focus: true,
-                                                child: notListedLabel,
-                                                reactive: true,
-                                                x_align: St.Align.START,
-                                                x_fill: true });
+        let notListedLabel = new St.Label({
+            text: _("Not listed?"),
+            style_class: 'login-dialog-not-listed-label',
+            x_align: Clutter.ActorAlign.START,
+        });
+        this._notListedButton = new St.Button({
+            style_class: 'login-dialog-not-listed-button',
+            button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
+            can_focus: true,
+            child: notListedLabel,
+            reactive: true,
+        });
 
         this._notListedButton.connect('clicked', this._hideUserListAskForUsernameAndBeginVerification.bind(this));
 
         this._notListedButton.hide();
 
-        this._userSelectionBox.add(this._notListedButton,
-                                   { expand: false,
-                                     x_align: St.Align.START,
-                                     x_fill: true });
+        this._userSelectionBox.add_child(this._notListedButton);
 
         this._bannerView = new St.ScrollView({ style_class: 'login-dialog-banner-view',
                                                opacity: 0,
@@ -492,11 +512,11 @@ var LoginDialog = GObject.registerClass({
         this._sessionMenuButton = new SessionMenuButton();
         this._sessionMenuButton.connect('session-activated',
             (list, sessionId) => {
-                this._greeter.call_select_session_sync (sessionId, null);
+                this._greeter.call_select_session_sync(sessionId, null);
             });
-        this._sessionMenuButton.actor.opacity = 0;
-        this._sessionMenuButton.actor.show();
-        this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton.actor);
+        this._sessionMenuButton.opacity = 0;
+        this._sessionMenuButton.show();
+        this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton);
 
         this._disableUserList = undefined;
         this._userListLoaded = false;
@@ -579,8 +599,8 @@ var LoginDialog = GObject.registerClass({
 
         let authPromptAllocation = null;
         let authPromptWidth = 0;
-        if (this._authPrompt.actor.visible) {
-            authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt.actor);
+        if (this._authPrompt.visible) {
+            authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt);
             authPromptWidth = authPromptAllocation.x2 - authPromptAllocation.x1;
         }
 
@@ -685,12 +705,11 @@ var LoginDialog = GObject.registerClass({
         }
 
         // Finally hand out the allocations
-        if (bannerAllocation) {
+        if (bannerAllocation)
             this._bannerView.allocate(bannerAllocation, flags);
-        }
 
         if (authPromptAllocation)
-            this._authPrompt.actor.allocate(authPromptAllocation, flags);
+            this._authPrompt.allocate(authPromptAllocation, flags);
 
         if (userSelectionAllocation)
             this._userSelectionBox.allocate(userSelectionAllocation, flags);
@@ -760,7 +779,7 @@ var LoginDialog = GObject.registerClass({
         this._bannerView.ease({
             opacity: 255,
             duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
     }
 
@@ -794,7 +813,7 @@ var LoginDialog = GObject.registerClass({
     _onPrompted() {
         if (this._shouldShowSessionMenuButton()) {
             this._sessionMenuButton.updateSensitivity(true);
-            this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton.actor);
+            this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton);
         } else {
             this._sessionMenuButton.updateSensitivity(false);
         }
@@ -803,9 +822,9 @@ var LoginDialog = GObject.registerClass({
 
     _resetGreeterProxy() {
         if (GLib.getenv('GDM_GREETER_TEST') != '1') {
-            if (this._greeter) {
+            if (this._greeter)
                 this._greeter.run_dispose();
-            }
+
             this._greeter = this._gdmClient.get_greeter_sync(null);
 
             this._defaultSessionChangedId = this._greeter.connect('default-session-name-changed',
@@ -854,14 +873,14 @@ var LoginDialog = GObject.registerClass({
     }
 
     _showPrompt() {
-        if (this._authPrompt.actor.visible)
+        if (this._authPrompt.visible)
             return;
-        this._authPrompt.actor.opacity = 0;
-        this._authPrompt.actor.show();
-        this._authPrompt.actor.ease({
+        this._authPrompt.opacity = 0;
+        this._authPrompt.show();
+        this._authPrompt.ease({
             opacity: 255,
             duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
         this._fadeInBannerView();
     }
@@ -921,7 +940,7 @@ var LoginDialog = GObject.registerClass({
             return;
 
         this._bindOpacity();
-        this.actor.ease({
+        this.ease({
             opacity: 255,
             duration: _FADE_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
@@ -929,7 +948,7 @@ var LoginDialog = GObject.registerClass({
                 if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
                     this._authPrompt.reset();
                 this._unbindOpacity();
-            }
+            },
         });
     }
 
@@ -944,14 +963,14 @@ var LoginDialog = GObject.registerClass({
 
     _startSession(serviceName) {
         this._bindOpacity();
-        this.actor.ease({
+        this.ease({
             opacity: 0,
             duration: _FADE_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             onComplete: () => {
                 this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
                 this._unbindOpacity();
-            }
+            },
         });
     }
 
@@ -968,7 +987,7 @@ var LoginDialog = GObject.registerClass({
         let hold = new Batch.Hold();
         let signalId = this._userList.connect('item-added',
             () => {
-                let item = this._userList.getItemFromUserName(userName);
+                item = this._userList.getItemFromUserName(userName);
 
                 if (item)
                     hold.release();
@@ -1022,9 +1041,8 @@ var LoginDialog = GObject.registerClass({
 
                      () => {
                          // If we're just starting out, start on the right item.
-                         if (!this._userManager.is_loaded) {
+                         if (!this._userManager.is_loaded)
                              this._userList.jumpToItem(loginItem);
-                         }
                      },
 
                      () => {
@@ -1045,12 +1063,12 @@ var LoginDialog = GObject.registerClass({
                      () => {
                          // If idle timeout is done, make sure the timed login indicator is shown
                          if (delay > _TIMED_LOGIN_IDLE_THRESHOLD &&
-                             this._authPrompt.actor.visible)
+                             this._authPrompt.visible)
                              this._authPrompt.cancel();
 
                          if (delay > _TIMED_LOGIN_IDLE_THRESHOLD || firstRun) {
                              this._userList.scrollToItem(loginItem);
-                             loginItem.actor.grab_key_focus();
+                             loginItem.grab_key_focus();
                          }
                      },
 
@@ -1075,9 +1093,8 @@ var LoginDialog = GObject.registerClass({
         // Restart timed login on user interaction
         global.stage.connect('captured-event', (actor, event) => {
             if (event.type() == Clutter.EventType.KEY_PRESS ||
-               event.type() == Clutter.EventType.BUTTON_PRESS) {
+                event.type() == Clutter.EventType.BUTTON_PRESS)
                 this._startTimedLogin(userName, seconds);
-            }
 
             return Clutter.EVENT_PROPAGATE;
         });
@@ -1111,7 +1128,7 @@ var LoginDialog = GObject.registerClass({
         this._sessionMenuButton.close();
         this._setUserListExpanded(true);
         this._notListedButton.show();
-        this._userList.actor.grab_key_focus();
+        this._userList.grab_key_focus();
     }
 
     _beginVerificationForItem(item) {
@@ -1120,8 +1137,7 @@ var LoginDialog = GObject.registerClass({
         let userName = item.user.get_user_name();
         let hold = new Batch.Hold();
 
-        this._authPrompt.begin({ userName: userName,
-                                 hold: hold });
+        this._authPrompt.begin({ userName, hold });
         return hold;
     }
 
@@ -1184,9 +1200,8 @@ var LoginDialog = GObject.registerClass({
 
         let users = this._userManager.list_users();
 
-        for (let i = 0; i < users.length; i++) {
+        for (let i = 0; i < users.length; i++)
             this._userList.addUser(users[i]);
-        }
 
         this._updateDisableUserList();
 
@@ -1219,7 +1234,7 @@ var LoginDialog = GObject.registerClass({
                                         _("Login Window"),
                                         'dialog-password-symbolic',
                                         { sortGroup: CtrlAltTab.SortGroup.MIDDLE });
-        this._userList.actor.grab_key_focus();
+        this._userList.grab_key_focus();
         this.show();
         this.opacity = 0;
 
@@ -1228,7 +1243,7 @@ var LoginDialog = GObject.registerClass({
         this.ease({
             opacity: 255,
             duration: 1000,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD
+            mode: Clutter.AnimationMode.EASE_IN_QUAD,
         });
 
         return true;

js/gdm/oVirt.js

@@ -23,7 +23,7 @@ function OVirtCredentials() {
                                    g_interface_info: OVirtCredentialsInfo,
                                    g_name: 'org.ovirt.vdsm.Credentials',
                                    g_object_path: '/org/ovirt/vdsm/Credentials',
-                                   g_flags: (Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES) });
+                                   g_flags: Gio.DBusProxyFlags.DO_NOT_LOAD_PROPERTIES });
     self.init(null);
     return self;
 }

js/gdm/realmd.js

@@ -21,6 +21,7 @@ var Manager = class {
                                            '/org/freedesktop/realmd',
                                            this._reloadRealms.bind(this));
         this._realms = {};
+        this._loginFormat = null;
 
         this._signalId = this._aggregateProvider.connect('g-properties-changed',
             (proxy, properties) => {
@@ -86,7 +87,7 @@ var Manager = class {
     }
 
     get loginFormat() {
-        if (this._loginFormat !== undefined)
+        if (this._loginFormat)
             return this._loginFormat;
 
         this._updateLoginFormat();

js/gdm/util.js

@@ -37,7 +37,7 @@ var MessageType = {
     NONE: 0,
     ERROR: 1,
     INFO: 2,
-    HINT: 3
+    HINT: 3,
 };
 
 function fadeInActor(actor) {
@@ -58,7 +58,7 @@ function fadeInActor(actor) {
         onComplete: () => {
             this.set_height(-1);
             hold.release();
-        }
+        },
     });
 
     return hold;
@@ -81,7 +81,7 @@ function fadeOutActor(actor) {
             this.hide();
             this.set_height(-1);
             hold.release();
-        }
+        },
     });
     return hold;
 }
@@ -109,7 +109,7 @@ function cloneAndFadeOutActor(actor) {
         onComplete: () => {
             clone.destroy();
             hold.release();
-        }
+        },
     });
     return hold;
 }
@@ -272,7 +272,7 @@ var ShellUserVerifier = class {
         let interval = this._getIntervalForMessage(message);
 
         this.hasPendingMessages = true;
-        this._messageQueue.push({ text: message, type: messageType, interval: interval });
+        this._messageQueue.push({ text: message, type: messageType, interval });
         this._queueMessageTimeout();
     }
 
@@ -496,6 +496,8 @@ var ShellUserVerifier = class {
             // The only question asked by this service is "Token?"
             this.answerQuery(serviceName, this._oVirtCredentialsManager.getToken());
             return;
+        } else if (serviceName == PASSWORD_SERVICE_NAME) {
+            secretQuestion = '';
         }
 
         this.emit('ask-question', serviceName, secretQuestion, '\u25cf');
@@ -544,6 +546,7 @@ var ShellUserVerifier = class {
                 });
             }
         } else {
+            // eslint-disable-next-line no-lonely-if
             if (!this.hasPendingMessages) {
                 this._cancelAndReset();
             } else {
@@ -571,9 +574,8 @@ var ShellUserVerifier = class {
         // if the password service fails, then cancel everything.
         // But if, e.g., fingerprint fails, still give
         // password authentication a chance to succeed
-        if (this.serviceIsForeground(serviceName)) {
+        if (this.serviceIsForeground(serviceName))
             this._verificationFailed(true);
-        }
     }
 };
 Signals.addSignalMethods(ShellUserVerifier.prototype);

js/misc/extensionUtils.js

@@ -15,7 +15,7 @@ const Config = imports.misc.config;
 
 var ExtensionType = {
     SYSTEM: 1,
-    PER_USER: 2
+    PER_USER: 2,
 };
 
 var ExtensionState = {
@@ -28,7 +28,7 @@ var ExtensionState = {
 
     // Used as an error state for operations on unknown extensions,
     // should never be in a real extensionMeta object.
-    UNINSTALLED: 99
+    UNINSTALLED: 99,
 };
 
 const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
@@ -36,10 +36,11 @@ const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'ca
 /**
  * getCurrentExtension:
  *
- * Returns the current extension, or null if not called from an extension.
+ * @returns {?object} - The current extension, or null if not called from
+ * an extension.
  */
 function getCurrentExtension() {
-    let stack = (new Error()).stack.split('\n');
+    let stack = new Error().stack.split('\n');
     let extensionStackLine;
 
     // Search for an occurrence of an extension stack frame
@@ -84,7 +85,7 @@ function getCurrentExtension() {
 
 /**
  * initTranslations:
- * @domain: (optional): the gettext domain to use
+ * @param {string=} domain - the gettext domain to use
  *
  * Initialize Gettext to load translations from extensionsdir/locale.
  * If @domain is not provided, it will be taken from metadata['gettext-domain']
@@ -108,7 +109,8 @@ function initTranslations(domain) {
 
 /**
  * getSettings:
- * @schema: (optional): the GSettings schema id
+ * @param {string=} schema - the GSettings schema id
+ * @returns {Gio.Settings} - a new settings object for @schema
  *
  * Builds and returns a GSettings schema for @schema, using schema files
  * in extensionsdir/schemas. If @schema is omitted, it is taken from
@@ -128,12 +130,13 @@ function getSettings(schema) {
     // SYSTEM extension that has been installed in the same prefix as the shell
     let schemaDir = extension.dir.get_child('schemas');
     let schemaSource;
-    if (schemaDir.query_exists(null))
+    if (schemaDir.query_exists(null)) {
         schemaSource = GioSSS.new_from_directory(schemaDir.get_path(),
                                                  GioSSS.get_default(),
                                                  false);
-    else
+    } else {
         schemaSource = GioSSS.get_default();
+    }
 
     let schemaObj = schemaSource.lookup(schema, true);
     if (!schemaObj)
@@ -144,8 +147,9 @@ function getSettings(schema) {
 
 /**
  * versionCheck:
- * @required: an array of versions we're compatible with
- * @current: the version we have
+ * @param {string[]} required - an array of versions we're compatible with
+ * @param {string} current - the version we have
+ * @returns {bool} - true if @current is compatible with @required
  *
  * Check if a component is compatible for an extension.
  * @required is an array, and at least one version must match.
@@ -165,8 +169,8 @@ function versionCheck(required, current) {
         let requiredArray = required[i].split('.');
         if (requiredArray[0] == major &&
             requiredArray[1] == minor &&
-            (requiredArray[2] == point ||
-             (requiredArray[2] == undefined && parseInt(minor) % 2 == 0)))
+            ((requiredArray[2] === undefined && parseInt(minor) % 2 == 0) ||
+             requiredArray[2] == point))
             return true;
     }
     return false;

js/misc/fileUtils.js

@@ -1,5 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
+/* exported collectFromDatadirs, recursivelyDeleteDir,
             recursivelyMoveDir, loadInterfaceXML */
 
 const { Gio, GLib } = imports.gi;
@@ -29,11 +29,6 @@ function collectFromDatadirs(subdir, includeUserDir, processFile) {
     }
 }
 
-function deleteGFile(file) {
-    // Work around 'delete' being a keyword in JS.
-    return file['delete'](null);
-}
-
 function recursivelyDeleteDir(dir, deleteParent) {
     let children = dir.enumerate_children('standard::name,standard::type',
                                           Gio.FileQueryInfoFlags.NONE, null);
@@ -43,13 +38,13 @@ function recursivelyDeleteDir(dir, deleteParent) {
         let type = info.get_file_type();
         let child = dir.get_child(info.get_name());
         if (type == Gio.FileType.REGULAR)
-            deleteGFile(child);
+            child.delete(null);
         else if (type == Gio.FileType.DIRECTORY)
             recursivelyDeleteDir(child, true);
     }
 
     if (deleteParent)
-        deleteGFile(dir);
+        dir.delete(null);
 }
 
 function recursivelyMoveDir(srcDir, destDir) {
@@ -75,14 +70,14 @@ let _ifaceResource = null;
 function loadInterfaceXML(iface) {
     if (!_ifaceResource) {
         // don't use global.datadir so the method is usable from tests/tools
-        let dir = GLib.getenv ('GNOME_SHELL_DATADIR') || Config.PKGDATADIR;
-        let path = dir + '/gnome-shell-dbus-interfaces.gresource';
+        let dir = GLib.getenv('GNOME_SHELL_DATADIR') || Config.PKGDATADIR;
+        let path = `${dir}/gnome-shell-dbus-interfaces.gresource`;
         _ifaceResource = Gio.Resource.load(path);
         _ifaceResource._register();
     }
 
     let xml = null;
-    let uri = 'resource:///org/gnome/shell/dbus-interfaces/' + iface + '.xml';
+    let uri = `resource:///org/gnome/shell/dbus-interfaces/${iface}.xml`;
     let f = Gio.File.new_for_uri(uri);
 
     try {

js/misc/gnomeSession.js

@@ -11,7 +11,7 @@ var PresenceStatus = {
     AVAILABLE: 0,
     INVISIBLE: 1,
     BUSY: 2,
-    IDLE: 3
+    IDLE: 3,
 };
 
 var PresenceProxy = Gio.DBusProxy.makeProxyWrapper(PresenceIface);

js/misc/history.js

@@ -28,7 +28,7 @@ var HistoryManager = class {
         this._entry = params.entry;
 
         if (this._entry) {
-            this._entry.connect('key-press-event', 
+            this._entry.connect('key-press-event',
                                 this._onEntryKeyPress.bind(this));
         }
     }
@@ -82,11 +82,11 @@ var HistoryManager = class {
 
     _onEntryKeyPress(entry, event) {
         let symbol = event.get_key_symbol();
-        if (symbol == Clutter.KEY_Up) {
+        if (symbol == Clutter.KEY_Up)
             return this._setPrevItem(entry.get_text());
-        } else if (symbol == Clutter.KEY_Down) {
+        else if (symbol == Clutter.KEY_Down)
             return this._setNextItem(entry.get_text());
-        }
+
         return Clutter.EVENT_PROPAGATE;
     }
 

js/misc/ibusManager.js

@@ -2,7 +2,6 @@
 /* exported getIBusManager */
 
 const { Gio, GLib, IBus } = imports.gi;
-const Mainloop = imports.mainloop;
 const Signals = imports.signals;
 
 const IBusCandidatePopup = imports.ui.ibusCandidatePopup;
@@ -19,9 +18,9 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) {
          IBus.MICRO_VERSION >= requiredMicro))
         return;
 
-    throw "Found IBus version %d.%d.%d but required is %d.%d.%d".
-        format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
-               requiredMajor, requiredMinor, requiredMicro);
+    throw "Found IBus version %d.%d.%d but required is %d.%d.%d"
+        .format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
+                requiredMajor, requiredMinor, requiredMicro);
 }
 
 function getIBusManager() {
@@ -59,16 +58,30 @@ var IBusManager = class {
         this._spawn();
     }
 
-    _spawn() {
+    _spawn(extraArgs = []) {
         try {
-            Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
-                               Gio.SubprocessFlags.NONE);
+            let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs];
+            Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE);
         } catch (e) {
             log(`Failed to launch ibus-daemon: ${e.message}`);
         }
     }
 
+    restartDaemon(extraArgs = []) {
+        this._spawn(['-r', ...extraArgs]);
+    }
+
     _clear() {
+        if (this._cancellable) {
+            this._cancellable.cancel();
+            this._cancellable = null;
+        }
+
+        if (this._preloadEnginesId) {
+            GLib.source_remove(this._preloadEnginesId);
+            this._preloadEnginesId = 0;
+        }
+
         if (this._panelService)
             this._panelService.destroy();
 
@@ -80,33 +93,44 @@ var IBusManager = class {
         this._currentEngineName = null;
 
         this.emit('ready', false);
-
-        this._spawn();
     }
 
     _onConnected() {
-        this._ibus.list_engines_async(-1, null, this._initEngines.bind(this));
+        this._cancellable = new Gio.Cancellable();
+        this._ibus.list_engines_async(-1, this._cancellable,
+            this._initEngines.bind(this));
         this._ibus.request_name_async(IBus.SERVICE_PANEL,
-                                      IBus.BusNameFlag.REPLACE_EXISTING,
-                                      -1, null,
-                                      this._initPanelService.bind(this));
+            IBus.BusNameFlag.REPLACE_EXISTING, -1, this._cancellable,
+            this._initPanelService.bind(this));
     }
 
     _initEngines(ibus, result) {
-        let enginesList = this._ibus.list_engines_async_finish(result);
-        if (enginesList) {
+        try {
+            let enginesList = this._ibus.list_engines_async_finish(result);
             for (let i = 0; i < enginesList.length; ++i) {
                 let name = enginesList[i].get_name();
                 this._engines.set(name, enginesList[i]);
             }
             this._updateReadiness();
-        } else {
+        } catch (e) {
+            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
+                return;
+
+            logError(e);
             this._clear();
         }
     }
 
     _initPanelService(ibus, result) {
-        let success = this._ibus.request_name_async_finish(result);
+        let success = false;
+        try {
+            success = !!this._ibus.request_name_async_finish(result);
+        } catch (e) {
+            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
+                return;
+            logError(e);
+        }
+
         if (success) {
             this._panelService = new IBus.PanelService({ connection: this._ibus.get_connection(),
                                                          object_path: IBus.PATH_PANEL });
@@ -118,7 +142,7 @@ var IBusManager = class {
             });
             this._panelService.connect('focus-in', (panel, path) => {
                 if (!GLib.str_has_suffix(path, '/InputContext_1'))
-                    this.emit ('focus-in');
+                    this.emit('focus-in');
             });
             this._panelService.connect('focus-out', () => this.emit('focus-out'));
 
@@ -133,10 +157,10 @@ var IBusManager = class {
             } catch (e) {
             }
             // If an engine is already active we need to get its properties
-            this._ibus.get_global_engine_async(-1, null, (i, result) => {
+            this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, res) => {
                 let engine;
                 try {
-                    engine = this._ibus.get_global_engine_async_finish(result);
+                    engine = this._ibus.get_global_engine_async_finish(res);
                     if (!engine)
                         return;
                 } catch (e) {
@@ -205,8 +229,18 @@ var IBusManager = class {
             return;
         }
 
-        this._ibus.set_global_engine_async(id, this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
-                                           null, callback || null);
+        this._ibus.set_global_engine_async(id,
+            this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
+            this._cancellable, (_bus, res) => {
+                try {
+                    this._ibus.set_global_engine_async_finish(res);
+                } catch (e) {
+                    if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
+                        logError(e);
+                }
+                if (callback)
+                    callback();
+            });
     }
 
     preloadEngines(ids) {
@@ -214,21 +248,23 @@ var IBusManager = class {
             return;
 
         if (this._preloadEnginesId != 0) {
-            Mainloop.source_remove(this._preloadEnginesId);
+            GLib.source_remove(this._preloadEnginesId);
             this._preloadEnginesId = 0;
         }
 
         this._preloadEnginesId =
-            Mainloop.timeout_add_seconds(this._PRELOAD_ENGINES_DELAY_TIME,
-                                         () => {
-                                             this._ibus.preload_engines_async(
-                                                 ids,
-                                                 -1,
-                                                 null,
-                                                 null);
-                                             this._preloadEnginesId = 0;
-                                             return GLib.SOURCE_REMOVE;
-                                         });
+            GLib.timeout_add_seconds(
+                GLib.PRIORITY_DEFAULT,
+                this._PRELOAD_ENGINES_DELAY_TIME,
+                () => {
+                    this._ibus.preload_engines_async(
+                        ids,
+                        -1,
+                        this._cancellable,
+                        null);
+                    this._preloadEnginesId = 0;
+                    return GLib.SOURCE_REMOVE;
+                });
     }
 };
 Signals.addSignalMethods(IBusManager.prototype);

js/misc/inputMethod.js

@@ -1,6 +1,6 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported InputMethod */
-const { Clutter, GLib, GObject, IBus } = imports.gi;
+const { Clutter, GLib, Gio, GObject, IBus } = imports.gi;
 
 const Keyboard = imports.ui.status.keyboard;
 
@@ -36,15 +36,7 @@ class InputMethod extends Clutter.InputMethod {
     }
 
     _updateCapabilities() {
-        let caps = 0;
-
-        if (this.can_show_preedit)
-            caps |= IBus.Capabilite.PREEDIT_TEXT;
-
-        if (this._currentFocus)
-            caps |= IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
-        else
-            caps |= IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.AUXILIARY_TEXT | IBus.Capabilite.LOOKUP_TABLE | IBus.Capabilite.PROPERTY;
+        let caps = IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
 
         if (this._context)
             this._context.set_capabilities(caps);
@@ -55,23 +47,39 @@ class InputMethod extends Clutter.InputMethod {
     }
 
     _onConnected() {
-        this._ibus.create_input_context_async ('gnome-shell', -1, null,
-                                               this._setContext.bind(this));
+        this._cancellable = new Gio.Cancellable();
+        this._ibus.create_input_context_async('gnome-shell', -1,
+            this._cancellable, this._setContext.bind(this));
     }
 
     _setContext(bus, res) {
-        this._context = this._ibus.create_input_context_async_finish(res);
+        try {
+            this._context = this._ibus.create_input_context_async_finish(res);
+        } catch (e) {
+            if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) {
+                logError(e);
+                this._clear();
+            }
+            return;
+        }
+
         this._context.connect('commit-text', this._onCommitText.bind(this));
         this._context.connect('delete-surrounding-text', this._onDeleteSurroundingText.bind(this));
         this._context.connect('update-preedit-text', this._onUpdatePreeditText.bind(this));
         this._context.connect('show-preedit-text', this._onShowPreeditText.bind(this));
         this._context.connect('hide-preedit-text', this._onHidePreeditText.bind(this));
         this._context.connect('forward-key-event', this._onForwardKeyEvent.bind(this));
+        this._context.connect('destroy', this._clear.bind(this));
 
         this._updateCapabilities();
     }
 
     _clear() {
+        if (this._cancellable) {
+            this._cancellable.cancel();
+            this._cancellable = null;
+        }
+
         this._context = null;
         this._hints = 0;
         this._purpose = 0;
@@ -121,7 +129,7 @@ class InputMethod extends Clutter.InputMethod {
 
     _onForwardKeyEvent(_context, keyval, keycode, state) {
         let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
-        state &= ~(IBus.ModifierType.RELEASE_MASK);
+        state &= ~IBus.ModifierType.RELEASE_MASK;
 
         let curEvent = Clutter.get_current_event();
         let time;
@@ -137,7 +145,6 @@ class InputMethod extends Clutter.InputMethod {
         this._currentFocus = focus;
         if (this._context) {
             this._context.focus_in();
-            this._updateCapabilities();
             this._emitRequestSurrounding();
         }
 
@@ -149,10 +156,8 @@ class InputMethod extends Clutter.InputMethod {
 
     vfunc_focus_out() {
         this._currentFocus = null;
-        if (this._context) {
+        if (this._context)
             this._context.focus_out();
-            this._updateCapabilities();
-        }
 
         if (this._preeditStr) {
             // Unset any preedit text
@@ -255,17 +260,22 @@ class InputMethod extends Clutter.InputMethod {
         if (event.type() == Clutter.EventType.KEY_RELEASE)
             state |= IBus.ModifierType.RELEASE_MASK;
 
-        this._context.process_key_event_async(event.get_key_symbol(),
-                                              event.get_key_code() - 8, // Convert XKB keycodes to evcodes
-                                              state, -1, null,
-                                              (context, res) => {
-                                                  try {
-                                                      let retval = context.process_key_event_async_finish(res);
-                                                      this.notify_key_event(event, retval);
-                                                  } catch (e) {
-                                                      log(`Error processing key on IM: ${e.message}`);
-                                                  }
-                                              });
+        this._context.process_key_event_async(
+            event.get_key_symbol(),
+            event.get_key_code() - 8, // Convert XKB keycodes to evcodes
+            state, -1, this._cancellable,
+            (context, res) => {
+                if (context != this._context)
+                    return;
+
+                try {
+                    let retval = context.process_key_event_async_finish(res);
+                    this.notify_key_event(event, retval);
+                } catch (e) {
+                    if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
+                        log(`Error processing key on IM: ${e.message}`);
+                }
+            });
         return true;
     }
 });

js/misc/introspect.js

@@ -40,6 +40,15 @@ var IntrospectService = class {
                         });
 
         this._syncRunningApplications();
+
+        this._whitelistMap = new Map();
+        APP_WHITELIST.forEach(appName => {
+            Gio.DBus.watch_name(Gio.BusType.SESSION,
+                appName,
+                Gio.BusNameWatcherFlags.NONE,
+                (conn, name, owner) => this._whitelistMap.set(name, owner),
+                (conn, name) => this._whitelistMap.delete(name));
+        });
     }
 
     _isStandaloneApp(app) {
@@ -51,7 +60,7 @@ var IntrospectService = class {
     }
 
     _isSenderWhitelisted(sender) {
-        return APP_WHITELIST.includes(sender);
+        return [...this._whitelistMap.values()].includes(sender);
     }
 
     _getSandboxedAppId(app) {
@@ -70,7 +79,7 @@ var IntrospectService = class {
 
         for (let app of apps) {
             let appInfo = {};
-            let isAppActive = (focusedApp == app);
+            let isAppActive = focusedApp == app;
 
             if (!this._isStandaloneApp(app))
                 continue;
@@ -104,10 +113,10 @@ var IntrospectService = class {
             return false;
 
         let type = window.get_window_type();
-        return (type == Meta.WindowType.NORMAL ||
+        return type == Meta.WindowType.NORMAL ||
                 type == Meta.WindowType.DIALOG ||
                 type == Meta.WindowType.MODAL_DIALOG ||
-                type == Meta.WindowType.UTILITY);
+                type == Meta.WindowType.UTILITY;
     }
 
     GetRunningApplicationsAsync(params, invocation) {
@@ -127,7 +136,8 @@ var IntrospectService = class {
         let apps = this._appSystem.get_running();
         let windowsList = {};
 
-        if (!this._isIntrospectEnabled()) {
+        if (!this._isIntrospectEnabled() &&
+            !this._isSenderWhitelisted(invocation.get_sender())) {
             invocation.return_error_literal(Gio.DBusError,
                                             Gio.DBusError.ACCESS_DENIED,
                                             'App introspection not allowed');
@@ -151,9 +161,9 @@ var IntrospectService = class {
                     'app-id': GLib.Variant.new('s', app.get_id()),
                     'client-type': GLib.Variant.new('u', window.get_client_type()),
                     'is-hidden': GLib.Variant.new('b', window.is_hidden()),
-                    'has-focus': GLib.Variant.new('b', (window == focusWindow)),
+                    'has-focus': GLib.Variant.new('b', window == focusWindow),
                     'width': GLib.Variant.new('u', frameRect.width),
-                    'height': GLib.Variant.new('u', frameRect.height)
+                    'height': GLib.Variant.new('u', frameRect.height),
                 };
 
                 // These properties may not be available for all windows:
@@ -163,9 +173,10 @@ var IntrospectService = class {
                 if (wmClass != null)
                     windowsList[windowId]['wm-class'] = GLib.Variant.new('s', wmClass);
 
-                if (sandboxedAppId != null)
+                if (sandboxedAppId != null) {
                     windowsList[windowId]['sandboxed-app-id'] =
                         GLib.Variant.new('s', sandboxedAppId);
+                }
             }
         }
         invocation.return_value(new GLib.Variant('(a{ta{sv}})', [windowsList]));

js/misc/jsParse.js

@@ -11,9 +11,8 @@ function getCompletions(text, commandHeader, globalCompletionList) {
     let methods = [];
     let expr_, base;
     let attrHead = '';
-    if (globalCompletionList == null) {
+    if (globalCompletionList == null)
         globalCompletionList = [];
-    }
 
     let offset = getExpressionOffset(text, text.length - 1);
     if (offset >= 0) {
@@ -59,9 +58,8 @@ function isStopChar(c) {
 function findMatchingQuote(expr, offset) {
     let quoteChar = expr.charAt(offset);
     for (let i = offset - 1; i >= 0; --i) {
-        if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') {
+        if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\')
             return i;
-        }
     }
     return -1;
 }
@@ -69,9 +67,8 @@ function findMatchingQuote(expr, offset) {
 // Given the ending position of a regex, find where it starts
 function findMatchingSlash(expr, offset) {
     for (let i = offset - 1; i >= 0; --i) {
-        if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') {
+        if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\')
             return i;
-        }
     }
     return -1;
 }
@@ -82,31 +79,30 @@ function findMatchingSlash(expr, offset) {
 // findMatchingBrace("[(])", 3) returns 1.
 function findMatchingBrace(expr, offset) {
     let closeBrace = expr.charAt(offset);
-    let openBrace = ({ ')': '(', ']': '[' })[closeBrace];
+    let openBrace = { ')': '(', ']': '[' }[closeBrace];
 
-    function findTheBrace(expr, offset) {
-        if (offset < 0) {
-            return -1;
-        }
+    return findTheBrace(expr, offset - 1, openBrace, closeBrace);
+}
 
-        if (expr.charAt(offset) == openBrace) {
-            return offset;
-        }
-        if (expr.charAt(offset).match(/['"]/)) {
-            return findTheBrace(expr, findMatchingQuote(expr, offset) - 1);
-        }
-        if (expr.charAt(offset) == '/') {
-            return findTheBrace(expr, findMatchingSlash(expr, offset) - 1);
-        }
-        if (expr.charAt(offset) == closeBrace) {
-            return findTheBrace(expr, findTheBrace(expr, offset - 1) - 1);
-        }
+function findTheBrace(expr, offset, ...braces) {
+    let [openBrace, closeBrace] = braces;
 
-        return findTheBrace(expr, offset - 1);
+    if (offset < 0)
+        return -1;
 
-    }
+    if (expr.charAt(offset) == openBrace)
+        return offset;
 
-    return findTheBrace(expr, offset - 1);
+    if (expr.charAt(offset).match(/['"]/))
+        return findTheBrace(expr, findMatchingQuote(expr, offset) - 1, ...braces);
+
+    if (expr.charAt(offset) == '/')
+        return findTheBrace(expr, findMatchingSlash(expr, offset) - 1, ...braces);
+
+    if (expr.charAt(offset) == closeBrace)
+        return findTheBrace(expr, findTheBrace(expr, offset - 1, ...braces) - 1, ...braces);
+
+    return findTheBrace(expr, offset - 1, ...braces);
 }
 
 // Walk expr backwards from offset looking for the beginning of an
@@ -118,13 +114,11 @@ function getExpressionOffset(expr, offset) {
     while (offset >= 0) {
         let currChar = expr.charAt(offset);
 
-        if (isStopChar(currChar)) {
+        if (isStopChar(currChar))
             return offset + 1;
-        }
 
-        if (currChar.match(/[)\]]/)) {
+        if (currChar.match(/[)\]]/))
             offset = findMatchingBrace(expr, offset);
-        }
 
         --offset;
     }
@@ -141,10 +135,10 @@ function isValidPropertyName(w) {
 // To get all properties (enumerable and not), we need to walk
 // the prototype chain ourselves
 function getAllProps(obj) {
-    if (obj === null || obj === undefined) {
+    if (obj === null || obj === undefined)
         return [];
-    }
-    return Object.getOwnPropertyNames(obj).concat( getAllProps(Object.getPrototypeOf(obj)) );
+
+    return Object.getOwnPropertyNames(obj).concat(getAllProps(Object.getPrototypeOf(obj)));
 }
 
 // Given a string _expr_, returns all methods
@@ -168,11 +162,11 @@ function getPropertyNamesFromExpression(expr, commandHeader = '') {
     if (typeof obj === 'object') {
         let allProps = getAllProps(obj);
         // Get only things we are allowed to complete following a '.'
-        allProps = allProps.filter( isValidPropertyName );
+        allProps = allProps.filter(isValidPropertyName);
 
         // Make sure propsUnique contains one key for every
         // property so we end up with a unique list of properties
-        allProps.map(p => propsUnique[p] = null);
+        allProps.map(p => (propsUnique[p] = null));
     }
     return Object.keys(propsUnique).sort();
 }
@@ -189,24 +183,26 @@ function getCommonPrefix(words) {
     return word;
 }
 
+// Remove any blocks that are quoted or are in a regex
+function removeLiterals(str) {
+    if (str.length == 0)
+        return '';
+
+    let currChar = str.charAt(str.length - 1);
+    if (currChar == '"' || currChar == '\'') {
+        return removeLiterals(
+            str.slice(0, findMatchingQuote(str, str.length - 1)));
+    } else if (currChar == '/') {
+        return removeLiterals(
+            str.slice(0, findMatchingSlash(str, str.length - 1)));
+    }
+
+    return removeLiterals(str.slice(0, str.length - 1)) + currChar;
+}
+
 // Returns true if there is reason to think that eval(str)
 // will modify the global scope
 function isUnsafeExpression(str) {
-    // Remove any blocks that are quoted or are in a regex
-    function removeLiterals(str) {
-        if (str.length == 0) {
-            return '';
-        }
-
-        let currChar = str.charAt(str.length - 1);
-        if (currChar == '"' || currChar == '\'') {
-            return removeLiterals(str.slice(0, findMatchingQuote(str, str.length - 1)));
-        } else if (currChar == '/') {
-            return removeLiterals(str.slice(0, findMatchingSlash(str, str.length - 1)));
-        }
-
-        return removeLiterals(str.slice(0, str.length - 1)) + currChar;
-    }
 
     // Check for any sort of assignment
     // The strategy used is dumb: remove any quotes
@@ -214,10 +210,10 @@ function isUnsafeExpression(str) {
     // If there is, it might be an unsafe assignment.
 
     let prunedStr = removeLiterals(str);
-    prunedStr = prunedStr.replace(/[=!]==/g, '');    //replace === and !== with nothing
-    prunedStr = prunedStr.replace(/[=<>!]=/g, '');    //replace ==, <=, >=, != with nothing
+    prunedStr = prunedStr.replace(/[=!]==/g, '');    // replace === and !== with nothing
+    prunedStr = prunedStr.replace(/[=<>!]=/g, '');    // replace ==, <=, >=, != with nothing
 
-    if (prunedStr.match(/=/)) {
+    if (prunedStr.match(/[=]/)) {
         return true;
     } else if (prunedStr.match(/;/)) {
         // If we contain a semicolon not inside of a quote/regex, assume we're unsafe as well

js/misc/loginManager.js

@@ -74,8 +74,9 @@ function registerSessionWithGDM() {
 let _loginManager = null;
 
 /**
- * LoginManager:
+ * getLoginManager:
  * An abstraction over systemd/logind and ConsoleKit.
+ * @returns {object} - the LoginManager singleton
  *
  */
 function getLoginManager() {
@@ -103,21 +104,21 @@ var LoginManagerSystemd = class {
 
     getCurrentSessionProxy(callback) {
         if (this._currentSession) {
-            callback (this._currentSession);
+            callback(this._currentSession);
             return;
         }
 
         let sessionId = GLib.getenv('XDG_SESSION_ID');
         if (!sessionId) {
             log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
-            let [session, objectPath_] = this._userProxy.Display;
+            let [session, objectPath] = this._userProxy.Display;
             if (session) {
                 log(`Will monitor session ${session}`);
                 sessionId = session;
             } else {
                 log('Failed to find "Display" session; are we the greeter?');
 
-                for (let [session, objectPath] of this._userProxy.Sessions) {
+                for ([session, objectPath] of this._userProxy.Sessions) {
                     let sessionProxy = new SystemdLoginSession(Gio.DBus.system,
                                                                'org.freedesktop.login1',
                                                                objectPath);
@@ -185,7 +186,7 @@ var LoginManagerSystemd = class {
                 try {
                     let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
                     fd = fdList.steal_fds()[0];
-                    callback(new Gio.UnixInputStream({ fd: fd }));
+                    callback(new Gio.UnixInputStream({ fd }));
                 } catch (e) {
                     logError(e, "Error getting systemd inhibitor");
                     callback(null);

js/misc/modemManager.js

@@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported ModemBase, ModemGsm, ModemCdma, BroadbandModem  */
 
-const { Gio, NMA } = imports.gi;
-const Signals = imports.signals;
+const { Gio, GObject, NM, NMA } = imports.gi;
 
 const { loadInterfaceXML } = imports.misc.fileUtils;
 
@@ -84,9 +84,9 @@ function _findProviderForSid(sid) {
 }
 
 
-//------------------------------------------------------------------------------
-// Support for the old ModemManager interface (MM < 0.7)
-//------------------------------------------------------------------------------
+// ----------------------------------------------------- //
+// Support for the old ModemManager interface (MM < 0.7) //
+// ----------------------------------------------------- //
 
 
 // The following are not the complete interfaces, just the methods we need
@@ -98,21 +98,46 @@ const ModemGsmNetworkProxy = Gio.DBusProxy.makeProxyWrapper(ModemGsmNetworkInter
 const ModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager.Modem.Cdma');
 const ModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(ModemCdmaInterface);
 
-var ModemGsm = class {
-    constructor(path) {
-        this._proxy = new ModemGsmNetworkProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
+var ModemBase = GObject.registerClass({
+    GTypeFlags: GObject.TypeFlags.ABSTRACT,
+    Properties: {
+        'operator-name': GObject.ParamSpec.string(
+            'operator-name', 'operator-name', 'operator-name',
+            GObject.ParamFlags.READABLE,
+            null),
+        'signal-quality': GObject.ParamSpec.int(
+            'signal-quality', 'signal-quality', 'signal-quality',
+            GObject.ParamFlags.READABLE,
+            0, 100, 0),
+    },
+}, class ModemBase extends GObject.Object {
+    _setOperatorName(operatorName) {
+        if (this.operator_name == operatorName)
+            return;
+        this.operator_name = operatorName;
+        this.notify('operator-name');
+    }
 
-        this.signal_quality = 0;
-        this.operator_name = null;
+    _setSignalQuality(signalQuality) {
+        if (this.signal_quality == signalQuality)
+            return;
+        this.signal_quality = signalQuality;
+        this.notify('signal-quality');
+    }
+});
+
+var ModemGsm = GObject.registerClass(
+class ModemGsm extends ModemBase {
+    _init(path) {
+        super._init();
+        this._proxy = new ModemGsmNetworkProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
 
         // Code is duplicated because the function have different signatures
         this._proxy.connectSignal('SignalQuality', (proxy, sender, [quality]) => {
-            this.signal_quality = quality;
-            this.emit('notify::signal-quality');
+            this._setSignalQuality(quality);
         });
         this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
-            this.operator_name = _findProviderForMccMnc(name, code);
-            this.emit('notify::operator-name');
+            this._setOperatorName(_findProviderForMccMnc(name, code));
         });
         this._proxy.GetRegistrationInfoRemote(([result], err) => {
             if (err) {
@@ -121,32 +146,28 @@ var ModemGsm = class {
             }
 
             let [status_, code, name] = result;
-            this.operator_name = _findProviderForMccMnc(name, code);
-            this.emit('notify::operator-name');
+            this._setOperatorName(_findProviderForMccMnc(name, code));
         });
         this._proxy.GetSignalQualityRemote((result, err) => {
             if (err) {
                 // it will return an error if the device is not connected
-                this.signal_quality = 0;
+                this._setSignalQuality(0);
             } else {
                 let [quality] = result;
-                this.signal_quality = quality;
+                this._setSignalQuality(quality);
             }
-            this.emit('notify::signal-quality');
         });
     }
-};
-Signals.addSignalMethods(ModemGsm.prototype);
+});
 
-var ModemCdma = class {
-    constructor(path) {
+var ModemCdma = GObject.registerClass(
+class ModemCdma extends ModemBase {
+    _init(path) {
+        super._init();
         this._proxy = new ModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
 
-        this.signal_quality = 0;
-        this.operator_name = null;
         this._proxy.connectSignal('SignalQuality', (proxy, sender, params) => {
-            this.signal_quality = params[0];
-            this.emit('notify::signal-quality');
+            this._setSignalQuality(params[0]);
 
             // receiving this signal means the device got activated
             // and we can finally call GetServingSystem
@@ -156,12 +177,11 @@ var ModemCdma = class {
         this._proxy.GetSignalQualityRemote((result, err) => {
             if (err) {
                 // it will return an error if the device is not connected
-                this.signal_quality = 0;
+                this._setSignalQuality(0);
             } else {
                 let [quality] = result;
-                this.signal_quality = quality;
+                this._setSignalQuality(quality);
             }
-            this.emit('notify::signal-quality');
         });
     }
 
@@ -169,22 +189,19 @@ var ModemCdma = class {
         this._proxy.GetServingSystemRemote(([result], err) => {
             if (err) {
                 // it will return an error if the device is not connected
-                this.operator_name = null;
+                this._setOperatorName(null);
             } else {
                 let [bandClass_, band_, sid] = result;
-
-                this.operator_name = _findProviderForSid(sid);
+                this._setOperatorName(_findProviderForSid(sid));
             }
-            this.emit('notify::operator-name');
         });
     }
-};
-Signals.addSignalMethods(ModemCdma.prototype);
+});
 
 
-//------------------------------------------------------------------------------
-// Support for the new ModemManager1 interface (MM >= 0.7)
-//------------------------------------------------------------------------------
+// ------------------------------------------------------- //
+// Support for the new ModemManager1 interface (MM >= 0.7) //
+// ------------------------------------------------------- //
 
 const BroadbandModemInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem');
 const BroadbandModemProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemInterface);
@@ -195,12 +212,20 @@ const BroadbandModem3gppProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModem3gp
 const BroadbandModemCdmaInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem.ModemCdma');
 const BroadbandModemCdmaProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemCdmaInterface);
 
-var BroadbandModem = class {
-    constructor(path, capabilities) {
-        this._proxy = new BroadbandModemProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
+var BroadbandModem = GObject.registerClass({
+    Properties: {
+        'capabilities': GObject.ParamSpec.flags(
+            'capabilities', 'capabilities', 'capabilities',
+            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
+            NM.DeviceModemCapabilities.$gtype,
+            NM.DeviceModemCapabilities.NONE),
+    },
+}, class BroadbandModem extends ModemBase {
+    _init(path, capabilities) {
+        super._init({ capabilities });
+        this._proxy = new BroadbandModemProxy(Gio.DBus.system, 'org.freedesktop.ModemManager', path);
         this._proxy_3gpp = new BroadbandModem3gppProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
         this._proxy_cdma = new BroadbandModemCdmaProxy(Gio.DBus.system, 'org.freedesktop.ModemManager1', path);
-        this._capabilities = capabilities;
 
         this._proxy.connect('g-properties-changed', (proxy, properties) => {
             if ('SignalQuality' in properties.deep_unpack())
@@ -224,9 +249,8 @@ var BroadbandModem = class {
     }
 
     _reloadSignalQuality() {
-        let [quality, recent_] = this._proxy.SignalQuality;
-        this.signal_quality = quality;
-        this.emit('notify::signal-quality');
+        let [quality, recent_] = this.SignalQuality;
+        this._setSignalQuality(quality);
     }
 
     _reloadOperatorName() {
@@ -240,8 +264,7 @@ var BroadbandModem = class {
             newName += this.operator_name_cdma;
         }
 
-        this.operator_name = newName;
-        this.emit('notify::operator-name');
+        this._setOperatorName(newName);
     }
 
     _reload3gppOperatorName() {
@@ -256,5 +279,4 @@ var BroadbandModem = class {
         this.operator_name_cdma = _findProviderForSid(sid);
         this._reloadOperatorName();
     }
-};
-Signals.addSignalMethods(BroadbandModem.prototype);
+});

js/misc/objectManager.js

@@ -192,9 +192,8 @@ var ObjectManager = class {
     _onNameAppeared() {
         this._managerProxy.GetManagedObjectsRemote((result, error) => {
             if (!result) {
-                if (error) {
+                if (error)
                     logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`);
-                }
 
                 this._tryToCompleteLoad();
                 return;

js/misc/params.js

@@ -17,9 +17,10 @@
 // @params and @defaults
 function parse(params = {}, defaults, allowExtras) {
     if (!allowExtras) {
-        for (let prop in params)
+        for (let prop in params) {
             if (!(prop in defaults))
                 throw new Error(`Unrecognized parameter "${prop}"`);
+        }
     }
 
     let defaultsCopy = Object.assign({}, defaults);

js/misc/smartcardManager.js

@@ -72,11 +72,10 @@ var SmartcardManager = class {
             if ('IsInserted' in properties.deep_unpack()) {
                 this._updateToken(token);
 
-                if (token.IsInserted) {
+                if (token.IsInserted)
                     this.emit('smartcard-inserted', token);
-                } else {
+                else
                     this.emit('smartcard-removed', token);
-                }
             }
         });
 

js/misc/systemActions.js

@@ -74,8 +74,8 @@ const SystemActions = GObject.registerClass({
                                                           'orientation-lock-icon',
                                                           'orientation-lock-icon',
                                                           GObject.ParamFlags.READWRITE,
-                                                          null)
-    }
+                                                          null),
+    },
 }, class SystemActions extends GObject.Object {
     _init() {
         super._init();
@@ -90,7 +90,7 @@ const SystemActions = GObject.registerClass({
             iconName: 'system-shutdown-symbolic',
             // Translators: A list of keywords that match the power-off action, separated by semicolons
             keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
-            available: false
+            available: false,
         });
         this._actions.set(LOCK_SCREEN_ACTION_ID, {
             // Translators: The name of the lock screen action in search
@@ -98,7 +98,7 @@ const SystemActions = GObject.registerClass({
             iconName: 'system-lock-screen-symbolic',
             // Translators: A list of keywords that match the lock screen action, separated by semicolons
             keywords: _("lock screen").split(/[; ]/),
-            available: false
+            available: false,
         });
         this._actions.set(LOGOUT_ACTION_ID, {
             // Translators: The name of the logout action in search
@@ -106,7 +106,7 @@ const SystemActions = GObject.registerClass({
             iconName: 'application-exit-symbolic',
             // Translators: A list of keywords that match the logout action, separated by semicolons
             keywords: _("logout;log out;sign off").split(/[; ]/),
-            available: false
+            available: false,
         });
         this._actions.set(SUSPEND_ACTION_ID, {
             // Translators: The name of the suspend action in search
@@ -114,7 +114,7 @@ const SystemActions = GObject.registerClass({
             iconName: 'media-playback-pause-symbolic',
             // Translators: A list of keywords that match the suspend action, separated by semicolons
             keywords: _("suspend;sleep").split(/[; ]/),
-            available: false
+            available: false,
         });
         this._actions.set(SWITCH_USER_ACTION_ID, {
             // Translators: The name of the switch user action in search
@@ -122,7 +122,7 @@ const SystemActions = GObject.registerClass({
             iconName: 'system-switch-user-symbolic',
             // Translators: A list of keywords that match the switch user action, separated by semicolons
             keywords: _("switch user").split(/[; ]/),
-            available: false
+            available: false,
         });
         this._actions.set(LOCK_ORIENTATION_ACTION_ID, {
             // Translators: The name of the lock orientation action in search
@@ -130,7 +130,7 @@ const SystemActions = GObject.registerClass({
             iconName: '',
             // Translators: A list of keywords that match the lock orientation action, separated by semicolons
             keywords: _("lock orientation;screen;rotation").split(/[; ]/),
-            available: false
+            available: false,
         });
 
         this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA });
@@ -233,9 +233,10 @@ const SystemActions = GObject.registerClass({
 
     _updateOrientationLock() {
         let available = false;
-        if (this._sensorProxy.g_name_owner)
+        if (this._sensorProxy.g_name_owner) {
             available = this._sensorProxy.HasAccelerometer &&
                         this._monitorManager.get_is_builtin_display_on();
+        }
 
         this._actions.get(LOCK_ORIENTATION_ACTION_ID).available = available;
 
@@ -244,8 +245,9 @@ const SystemActions = GObject.registerClass({
 
     _updateOrientationLockIcon() {
         let locked = this._orientationSettings.get_boolean('orientation-lock');
-        let iconName = locked ? 'rotation-locked-symbolic'
-                              : 'rotation-allowed-symbolic';
+        let iconName = locked
+            ? 'rotation-locked-symbolic'
+            : 'rotation-allowed-symbolic';
         this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName = iconName;
 
         this.notify('orientation-lock-icon');
@@ -268,13 +270,14 @@ const SystemActions = GObject.registerClass({
 
     getMatchingActions(terms) {
         // terms is a list of strings
-        terms = terms.map((term) => term.toLowerCase());
+        terms = terms.map(term => term.toLowerCase());
 
         let results = [];
 
-        for (let [key, { available, keywords }] of this._actions)
+        for (let [key, { available, keywords }] of this._actions) {
             if (available && terms.every(t => keywords.some(k => k.startsWith(t))))
                 results.push(key);
+        }
 
         return results;
     }

js/misc/util.js

@@ -1,11 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
             formatTime, formatTimeSpan, createTimeLabel, insertSorted,
-            makeCloseButton, ensureActorVisibleInScrollView */
+            makeCloseButton, ensureActorVisibleInScrollView, wiggle */
 
-const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
+const { Clutter, Gio, GLib, GObject, Shell, St, GnomeDesktop } = imports.gi;
 const Gettext = imports.gettext;
-const Mainloop = imports.mainloop;
 
 const Main = imports.ui.main;
 const Params = imports.misc.params;
@@ -15,7 +14,7 @@ var SCROLL_TIME = 100;
 // http://daringfireball.net/2010/07/improved_regex_for_matching_urls
 const _balancedParens = '\\([^\\s()<>]+\\)';
 const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]';
-const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u201C\u201D\u2018\u2019]';
+const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u200E\u200F\u201C\u201D\u2018\u2019\u202A\u202C]';
 
 const _urlRegexp = new RegExp(
     `(^|${_leadingJunk})` +
@@ -122,12 +121,15 @@ function trySpawn(argv) {
             // We are only interested in the part in the parentheses. (And
             // we can't pattern match the text, since it gets localized.)
             let message = err.message.replace(/.*\((.+)\)/, '$1');
-            throw new (err.constructor)({ code: err.code,
-                                          message: message });
+            throw new err.constructor({ code: err.code, message });
         } else {
             throw err;
         }
     }
+
+    // Async call, we don't need the reply though
+    GnomeDesktop.start_systemd_scope(argv[0], pid, null, null, null, () => {});
+
     // Dummy child watch; we don't want to double-fork internally
     // because then we lose the parent-child relationship, which
     // can break polkit.  See https://bugzilla.redhat.com//show_bug.cgi?id=819275
@@ -173,23 +175,28 @@ function formatTimeSpan(date) {
 
     if (minutesAgo < 5)
         return _("Just now");
-    if (hoursAgo < 1)
+    if (hoursAgo < 1) {
         return Gettext.ngettext("%d minute ago",
                                 "%d minutes ago", minutesAgo).format(minutesAgo);
-    if (daysAgo < 1)
+    }
+    if (daysAgo < 1) {
         return Gettext.ngettext("%d hour ago",
                                 "%d hours ago", hoursAgo).format(hoursAgo);
+    }
     if (daysAgo < 2)
         return _("Yesterday");
-    if (daysAgo < 15)
+    if (daysAgo < 15) {
         return Gettext.ngettext("%d day ago",
                                 "%d days ago", daysAgo).format(daysAgo);
-    if (weeksAgo < 8)
+    }
+    if (weeksAgo < 8) {
         return Gettext.ngettext("%d week ago",
                                 "%d weeks ago", weeksAgo).format(weeksAgo);
-    if (yearsAgo < 1)
+    }
+    if (yearsAgo < 1) {
         return Gettext.ngettext("%d month ago",
                                 "%d months ago", monthsAgo).format(monthsAgo);
+    }
     return Gettext.ngettext("%d year ago",
                             "%d years ago", yearsAgo).format(yearsAgo);
 }
@@ -214,7 +221,10 @@ function formatTime(time, params) {
         _desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
     let clockFormat = _desktopSettings.get_string('clock-format');
 
-    params = Params.parse(params, { timeOnly: false });
+    params = Params.parse(params, {
+        timeOnly: false,
+        ampm: true,
+    });
 
     if (clockFormat == '24h') {
         // Show only the time if date is on today
@@ -247,7 +257,7 @@ function formatTime(time, params) {
             format = N_("%B %-d %Y, %H\u2236%M");
     } else {
         // Show only the time if date is on today
-        if (daysAgo < 1 || params.timeOnly)
+        if (daysAgo < 1 || params.timeOnly) // eslint-disable-line no-lonely-if
             /* Translators: Time in 12h format */
             format = N_("%l\u2236%M %p");
         // Show the word "Yesterday" and time if date is on yesterday
@@ -276,6 +286,11 @@ function formatTime(time, params) {
             format = N_("%B %-d %Y, %l\u2236%M %p");
     }
 
+    // Time in short 12h format, without the equivalent of "AM" or "PM"; used
+    // when it is clear from the context
+    if (!params.ampm)
+        format = format.replace(/\s*%p/g, '');
+
     let formattedTime = date.format(Shell.util_translate_time_string(format));
     // prepend LTR-mark to colon/ratio to force a text direction on times
     return formattedTime.replace(/([:\u2236])/g, '\u200e$1');
@@ -314,7 +329,8 @@ function lowerBound(array, val, cmp) {
     if (array.length == 0)
         return 0;
 
-    min = 0; max = array.length;
+    min = 0;
+    max = array.length;
     while (min < (max - 1)) {
         mid = Math.floor((min + max) / 2);
         v = cmp(array[mid], val);
@@ -325,7 +341,7 @@ function lowerBound(array, val, cmp) {
             max = mid;
     }
 
-    return (min == max || cmp(array[min], val) < 0) ? max : min;
+    return min == max || cmp(array[min], val) < 0 ? max : min;
 }
 
 // insertSorted:
@@ -346,19 +362,13 @@ function insertSorted(array, val, cmp) {
 var CloseButton = GObject.registerClass(
 class CloseButton extends St.Button {
     _init(boxpointer) {
-        super._init({ style_class: 'notification-close' });
-
-        // This is a bit tricky. St.Bin has its own x-align/y-align properties
-        // that compete with Clutter's properties. This should be fixed for
-        // Clutter 2.0. Since St.Bin doesn't define its own setters, the
-        // setters are a workaround to get Clutter's version.
-        this.set_x_align(Clutter.ActorAlign.END);
-        this.set_y_align(Clutter.ActorAlign.START);
-
-        // XXX Clutter 2.0 workaround: ClutterBinLayout needs expand
-        // to respect the alignments.
-        this.set_x_expand(true);
-        this.set_y_expand(true);
+        super._init({
+            style_class: 'notification-close',
+            x_expand: true,
+            y_expand: true,
+            x_align: Clutter.ActorAlign.END,
+            y_align: Clutter.ActorAlign.START,
+        });
 
         this._boxPointer = boxpointer;
         if (boxpointer)
@@ -411,7 +421,7 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
         if (!parent)
             throw new Error("actor not in scroll view");
 
-        let box = parent.get_allocation_box();
+        box = parent.get_allocation_box();
         y1 += box.y1;
         y2 += box.y1;
         parent = parent.get_parent();
@@ -426,6 +436,40 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
 
     adjustment.ease(value, {
         mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        duration: SCROLL_TIME
+        duration: SCROLL_TIME,
+    });
+}
+
+function wiggle(actor, params) {
+    params = Params.parse(params, {
+        offset: 0,
+        duration: 0,
+        wiggleCount: 0,
+    });
+    actor.translation_x = 0;
+
+    // Accelerate before wiggling
+    actor.ease({
+        translation_x: -params.offset,
+        duration: params.duration,
+        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+        onComplete: () => {
+            // Wiggle
+            actor.ease({
+                translation_x: params.offset,
+                duration: params.duration,
+                mode: Clutter.AnimationMode.LINEAR,
+                repeatCount: params.wiggleCount,
+                autoReverse: true,
+                onComplete: () => {
+                    // Decelerate and return to the original position
+                    actor.ease({
+                        translation_x: 0,
+                        duration: params.duration,
+                        mode: Clutter.AnimationMode.EASE_IN_QUAD,
+                    });
+                },
+            });
+        },
     });
 }

js/misc/weather.js

@@ -32,6 +32,7 @@ var WeatherClient = class {
         this._gclueStarting = false;
         this._gclueLocationChangedId = 0;
 
+        this._needsAuth = true;
         this._weatherAuthorized = false;
         this._permStore = new PermissionStore.PermissionStore((proxy, error) => {
             if (error) {
@@ -47,11 +48,11 @@ var WeatherClient = class {
                 return;
             }
 
-            this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => {
-                if (error)
-                    log(`Error looking up permission: ${error.message}`);
+            this._permStore.LookupRemote('gnome', 'geolocation', (res, err) => {
+                if (err)
+                    log(`Error looking up permission: ${err.message}`);
 
-                let [perms, data] = error ? [{}, null] : res;
+                let [perms, data] = err ? [{}, null] : res;
                 let  params = ['gnome', 'geolocation', false, data, perms];
                 this._onPermStoreChanged(this._permStore, '', params);
             });
@@ -90,7 +91,7 @@ var WeatherClient = class {
             this._onWeatherProxyReady.bind(this));
 
         this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.weather'
+            schema_id: 'org.gnome.shell.weather',
         });
         this._settings.connect('changed::automatic-location',
             this._onAutomaticLocationChanged.bind(this));
@@ -142,7 +143,7 @@ var WeatherClient = class {
     get _useAutoLocation() {
         return this._autoLocationRequested &&
                this._locationSettings.get_boolean('enabled') &&
-               this._weatherAuthorized;
+               (!this._needsAuth || this._weatherAuthorized);
     }
 
     _onWeatherProxyReady(o, res) {
@@ -169,12 +170,19 @@ var WeatherClient = class {
     }
 
     _onInstalledChanged() {
-        let hadApp = (this._weatherApp != null);
+        let hadApp = this._weatherApp != null;
         this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
-        let haveApp = (this._weatherApp != null);
+        let haveApp = this._weatherApp != null;
 
         if (hadApp !== haveApp)
             this.emit('changed');
+
+        let neededAuth = this._needsAuth;
+        this._needsAuth = this._weatherApp === null ||
+                          this._weatherApp.app_info.has_key('X-Flatpak');
+
+        if (neededAuth !== this._needsAuth)
+            this._updateAutoLocation();
     }
 
     _loadInfo() {
@@ -205,7 +213,7 @@ var WeatherClient = class {
 
         this._weatherInfo.abort();
         this._weatherInfo.set_location(location);
-        this._locationValid = (location != null);
+        this._locationValid = location != null;
 
         this._weatherInfo.set_enabled_providers(location ? this._providers : 0);
 

js/perf/core.js

@@ -57,7 +57,7 @@ var METRICS = {
       units: "us" },
     applicationsShowTimeSubsequent:
     { description: "Time to switch to applications view, second time",
-      units: "us" }
+      units: "us" },
 };
 
 let WINDOW_CONFIGS = [
@@ -67,7 +67,7 @@ let WINDOW_CONFIGS = [
     { width: 640, height: 480, alpha: false, maximized: true,  count: 5,  metric: 'overviewFps5Maximized' },
     { width: 640, height: 480, alpha: false, maximized: true,  count: 10, metric: 'overviewFps10Maximized' },
     { width: 640, height: 480, alpha: true,  maximized: false, count: 5,  metric: 'overviewFps5Alpha' },
-    { width: 640, height: 480, alpha: true,  maximized: false, count: 10, metric: 'overviewFps10Alpha' }
+    { width: 640, height: 480, alpha: true,  maximized: false, count: 10, metric: 'overviewFps10Alpha' },
 ];
 
 function *run() {
@@ -94,11 +94,12 @@ function *run() {
             let config = WINDOW_CONFIGS[i / 2];
             yield Scripting.destroyTestWindows();
 
-            for (let k = 0; k < config.count; k++)
+            for (let k = 0; k < config.count; k++) {
                 yield Scripting.createTestWindow({ width: config.width,
                                                    height: config.height,
                                                    alpha: config.alpha,
                                                    maximized: config.maximized });
+            }
 
             yield Scripting.waitTestWindows();
             yield Scripting.sleep(1000);
@@ -127,11 +128,11 @@ function *run() {
     for (let i = 0; i < 2; i++) {
         Scripting.scriptEvent('applicationsShowStart');
         // eslint-disable-next-line require-atomic-updates
-        Main.overview._dash.showAppsButton.checked = true;
+        Main.overview.dash.showAppsButton.checked = true;
         yield Scripting.waitLeisure();
         Scripting.scriptEvent('applicationsShowDone');
         // eslint-disable-next-line require-atomic-updates
-        Main.overview._dash.showAppsButton.checked = false;
+        Main.overview.dash.showAppsButton.checked = false;
         yield Scripting.waitLeisure();
     }
 }
@@ -174,11 +175,10 @@ function script_applicationsShowDone(time) {
 }
 
 function script_afterShowHide(_time) {
-    if (overviewShowCount == 1) {
+    if (overviewShowCount == 1)
         METRICS.usedAfterOverview.value = mallocUsedSize;
-    } else {
+    else
         METRICS.leakedAfterOverview.value = mallocUsedSize - METRICS.usedAfterOverview.value;
-    }
 }
 
 function malloc_usedSize(time, bytes) {

js/perf/hwtest.js

@@ -57,7 +57,7 @@ function waitAndDraw(milliseconds) {
             cb();
     });
 
-    return callback => cb = callback;
+    return callback => (cb = callback);
 }
 
 function waitSignal(object, signal) {
@@ -69,7 +69,7 @@ function waitSignal(object, signal) {
             cb();
     });
 
-    return callback => cb = callback;
+    return callback => (cb = callback);
 }
 
 function extractBootTimestamp() {
@@ -114,7 +114,7 @@ function *run() {
     Scripting.scriptEvent('desktopShown');
 
     let interfaceSettings = new Gio.Settings({
-        schema_id: 'org.gnome.desktop.interface'
+        schema_id: 'org.gnome.desktop.interface',
     });
     interfaceSettings.set_boolean('enable-animations', false);
 
@@ -127,7 +127,7 @@ function *run() {
 
     Scripting.scriptEvent('applicationsShowStart');
     // eslint-disable-next-line require-atomic-updates
-    Main.overview._dash.showAppsButton.checked = true;
+    Main.overview.dash.showAppsButton.checked = true;
 
     yield Scripting.waitLeisure();
     Scripting.scriptEvent('applicationsShowDone');
@@ -137,9 +137,9 @@ function *run() {
     Main.overview.hide();
     yield Scripting.waitLeisure();
 
-    ////////////////////////////////////////
-    // Tests of redraw speed
-    ////////////////////////////////////////
+    // --------------------- //
+    // Tests of redraw speed //
+    // --------------------- //
 
     global.frame_timestamps = true;
     global.frame_finish_timestamp = true;
@@ -186,8 +186,6 @@ function *run() {
 
     yield Scripting.sleep(1000);
 
-    ////////////////////////////////////////
-
     let appSys = Shell.AppSystem.get_default();
     let app = appSys.lookup_app('org.gnome.gedit.desktop');
 

js/portalHelper/main.js

@@ -11,17 +11,17 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
 const PortalHelperResult = {
     CANCELLED: 0,
     COMPLETED: 1,
-    RECHECK: 2
+    RECHECK: 2,
 };
 
 const PortalHelperSecurityLevel = {
     NOT_YET_DETERMINED: 0,
     SECURE: 1,
-    INSECURE: 2
+    INSECURE: 2,
 };
 
 const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org';
-const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST;
+const CONNECTIVITY_CHECK_URI = `http://${CONNECTIVITY_CHECK_HOST}`;
 const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC;
 
 const HelperDBusInterface = loadInterfaceXML('org.gnome.Shell.PortalHelper');
@@ -92,7 +92,7 @@ class PortalHeaderBar extends Gtk.HeaderBar {
 var PortalWindow = GObject.registerClass(
 class PortalWindow extends Gtk.ApplicationWindow {
     _init(application, url, timestamp, doneCallback) {
-        super._init({ application: application });
+        super._init({ application });
 
         this.connect('delete-event', this.destroyWindow.bind(this));
         this._headerBar = new PortalHeaderBar();
@@ -287,7 +287,7 @@ class WebPortalHelper extends Gtk.Application {
     }
 
     Authenticate(connection, url, timestamp) {
-        this._queue.push({ connection: connection, url: url, timestamp: timestamp });
+        this._queue.push({ connection, url, timestamp });
 
         this._processQueue();
     }

js/ui/accessDialog.js

@@ -13,7 +13,7 @@ const AccessIface = loadInterfaceXML('org.freedesktop.impl.portal.Access');
 var DialogResponse = {
     OK: 0,
     CANCEL: 1,
-    CLOSED: 2
+    CLOSED: 2,
 };
 
 var AccessDialog = GObject.registerClass(
@@ -35,7 +35,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
 
     _buildLayout(title, subtitle, body, options) {
         // No support for non-modal system dialogs, so ignore the option
-        //let modal = options['modal'] || true;
+        // let modal = options['modal'] || true;
         let denyLabel = options['deny_label'] || _("Deny Access");
         let grantLabel = options['grant_label'] || _("Grant Access");
         let iconName = options['icon'] || null;
@@ -56,8 +56,8 @@ class AccessDialog extends ModalDialog.ModalDialog {
 
             let check = new CheckBox.CheckBox();
             check.getLabelActor().text = name;
-            check.actor.checked = selected == "true";
-            content.insertBeforeBody(check.actor);
+            check.checked = selected == "true";
+            content.insertBeforeBody(check);
 
             this._choices.set(id, check);
         }
@@ -99,7 +99,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
         let results = {};
         if (response == DialogResponse.OK) {
             for (let [id, check] of this._choices) {
-                let checked = check.actor.checked ? 'true' : 'false';
+                let checked = check.checked ? 'true' : 'false';
                 results[id] = new GLib.Variant('s', checked);
             }
         }
@@ -147,7 +147,7 @@ var AccessDialogDBus = class {
                                       subtitle, body, options);
         dialog.open();
 
-        dialog.connect('closed', () => this._accessDialog = null);
+        dialog.connect('closed', () => (this._accessDialog = null));
 
         this._accessDialog = dialog;
     }

js/ui/altTab.js

@@ -3,7 +3,6 @@
             WindowCyclerPopup */
 
 const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
 
 const Main = imports.ui.main;
 const SwitcherPopup = imports.ui.switcherPopup;
@@ -63,7 +62,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
 
         this.thumbnailsVisible = false;
 
-        let apps = Shell.AppSystem.get_default().get_running ();
+        let apps = Shell.AppSystem.get_default().get_running();
 
         if (apps.length == 0)
             return;
@@ -112,14 +111,12 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
 
     _initialSelection(backward, binding) {
         if (binding == 'switch-group') {
-            if (backward) {
+            if (backward)
                 this._select(0, this._items[0].cachedWindows.length - 1);
-            } else {
-                if (this._items[0].cachedWindows.length > 1)
-                    this._select(0, 1);
-                else
-                    this._select(0, 0);
-            }
+            else if (this._items[0].cachedWindows.length > 1)
+                this._select(0, 1);
+            else
+                this._select(0, 0);
         } else if (binding == 'switch-group-backward') {
             this._select(0, this._items[0].cachedWindows.length - 1);
         } else if (binding == 'switch-applications-backward') {
@@ -181,28 +178,27 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
             this._select(this._next());
         } else if (action == Meta.KeyBindingAction.SWITCH_APPLICATIONS_BACKWARD) {
             this._select(this._previous());
-        } else if (keysym == Clutter.q) {
+        } else if (keysym === Clutter.KEY_q) {
             this._quitApplication(this._selectedIndex);
         } else if (this._thumbnailsFocused) {
-            if (keysym == Clutter.Left)
+            if (keysym === Clutter.KEY_Left)
                 this._select(this._selectedIndex, this._previousWindow());
-            else if (keysym == Clutter.Right)
+            else if (keysym === Clutter.KEY_Right)
                 this._select(this._selectedIndex, this._nextWindow());
-            else if (keysym == Clutter.Up)
+            else if (keysym === Clutter.KEY_Up)
                 this._select(this._selectedIndex, null, true);
-            else if (keysym == Clutter.w || keysym == Clutter.F4)
+            else if (keysym === Clutter.KEY_w || keysym === Clutter.KEY_F4)
                 this._closeAppWindow(this._selectedIndex, this._currentWindow);
             else
                 return Clutter.EVENT_PROPAGATE;
+        } else if (keysym == Clutter.KEY_Left) {
+            this._select(this._previous());
+        } else if (keysym == Clutter.KEY_Right) {
+            this._select(this._next());
+        } else if (keysym == Clutter.KEY_Down) {
+            this._select(this._selectedIndex, 0);
         } else {
-            if (keysym == Clutter.Left)
-                this._select(this._previous());
-            else if (keysym == Clutter.Right)
-                this._select(this._next());
-            else if (keysym == Clutter.Down)
-                this._select(this._selectedIndex, 0);
-            else
-                return Clutter.EVENT_PROPAGATE;
+            return Clutter.EVENT_PROPAGATE;
         }
 
         return Clutter.EVENT_STOP;
@@ -292,14 +288,14 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
         if (this._thumbnails)
             this._destroyThumbnails();
         if (this._thumbnailTimeoutId != 0)
-            Mainloop.source_remove(this._thumbnailTimeoutId);
+            GLib.source_remove(this._thumbnailTimeoutId);
     }
 
     /**
      * _select:
-     * @app: index of the app to select
-     * @window: (optional) index of which of @app's windows to select
-     * @forceAppFocus: optional flag, see below
+     * @param {number} app: index of the app to select
+     * @param {number=} window: index of which of @app's windows to select
+     * @param {bool} forceAppFocus: optional flag, see below
      *
      * Selects the indicated @app, and optional @window, and sets
      * this._thumbnailsFocused appropriately to indicate whether the
@@ -327,7 +323,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
         }
 
         if (this._thumbnailTimeoutId != 0) {
-            Mainloop.source_remove(this._thumbnailTimeoutId);
+            GLib.source_remove(this._thumbnailTimeoutId);
             this._thumbnailTimeoutId = 0;
         }
 
@@ -344,7 +340,8 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
             this._thumbnails.highlight(window, forceAppFocus);
         } else if (this._items[this._selectedIndex].cachedWindows.length > 1 &&
                    !forceAppFocus) {
-            this._thumbnailTimeoutId = Mainloop.timeout_add (
+            this._thumbnailTimeoutId = GLib.timeout_add(
+                GLib.PRIORITY_DEFAULT,
                 THUMBNAIL_POPUP_TIME,
                 this._timeoutPopupThumbnails.bind(this));
             GLib.Source.set_name_by_id(this._thumbnailTimeoutId, '[gnome-shell] this._timeoutPopupThumbnails');
@@ -368,15 +365,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
             onComplete: () => {
                 thumbnailsActor.destroy();
                 this.thumbnailsVisible = false;
-            }
+            },
         });
         this._thumbnails = null;
         if (this._switcherList._items[this._selectedIndex])
-            this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
+            this._switcherList._items[this._selectedIndex].remove_accessible_state(Atk.StateType.EXPANDED);
     }
 
     _createThumbnails() {
-        this._thumbnails = new ThumbnailList (this._items[this._selectedIndex].cachedWindows);
+        this._thumbnails = new ThumbnailList(this._items[this._selectedIndex].cachedWindows);
         this._thumbnails.connect('item-activated', this._windowActivated.bind(this));
         this._thumbnails.connect('item-entered', this._windowEntered.bind(this));
         this._thumbnails.connect('item-removed', this._windowRemoved.bind(this));
@@ -398,34 +395,33 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             onComplete: () => {
                 this.thumbnailsVisible = true;
-            }
+            },
         });
 
-        this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
+        this._switcherList._items[this._selectedIndex].add_accessible_state(Atk.StateType.EXPANDED);
     }
 });
 
-class CyclerHighlight {
-    constructor() {
+var CyclerHighlight = GObject.registerClass(
+class CyclerHighlight extends St.Widget {
+    _init() {
+        super._init({ layout_manager: new Clutter.BinLayout() });
         this._window = null;
 
-        this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout() });
-
         this._clone = new Clutter.Clone();
-        this.actor.add_actor(this._clone);
+        this.add_actor(this._clone);
 
         this._highlight = new St.Widget({ style_class: 'cycler-highlight' });
-        this.actor.add_actor(this._highlight);
+        this.add_actor(this._highlight);
 
         let coordinate = Clutter.BindCoordinate.ALL;
-        let constraint = new Clutter.BindConstraint({ coordinate: coordinate });
+        let constraint = new Clutter.BindConstraint({ coordinate });
         this._clone.bind_property('source', constraint, 'source', 0);
 
-        this.actor.add_constraint(constraint);
+        this.add_constraint(constraint);
 
-        this.actor.connect('notify::allocation',
-                           this._onAllocationChanged.bind(this));
-        this.actor.connect('destroy', this._onDestroy.bind(this));
+        this.connect('notify::allocation', this._onAllocationChanged.bind(this));
+        this.connect('destroy', this._onDestroy.bind(this));
     }
 
     set window(w) {
@@ -437,8 +433,8 @@ class CyclerHighlight {
         if (this._clone.source)
             this._clone.source.sync_visibility();
 
-        let windowActor = this._window ? this._window.get_compositor_private()
-                                       : null;
+        let windowActor = this._window
+            ? this._window.get_compositor_private() : null;
 
         if (windowActor)
             windowActor.hide();
@@ -451,7 +447,7 @@ class CyclerHighlight {
             this._highlight.set_size(0, 0);
             this._highlight.hide();
         } else {
-            let [x, y] = this.actor.allocation.get_origin();
+            let [x, y] = this.allocation.get_origin();
             let rect = this._window.get_frame_rect();
             this._highlight.set_size(rect.width, rect.height);
             this._highlight.set_position(rect.x - x, rect.y - y);
@@ -462,7 +458,7 @@ class CyclerHighlight {
     _onDestroy() {
         this.window = null;
     }
-}
+});
 
 // We don't show an actual popup, so just provide what SwitcherPopup
 // expects instead of inheriting from SwitcherList
@@ -478,7 +474,7 @@ var CyclerList = GObject.registerClass({
 });
 
 var CyclerPopup = GObject.registerClass({
-    GTypeFlags: GObject.TypeFlags.ABSTRACT
+    GTypeFlags: GObject.TypeFlags.ABSTRACT,
 }, class CyclerPopup extends SwitcherPopup.SwitcherPopup {
     _init() {
         super._init();
@@ -489,7 +485,7 @@ var CyclerPopup = GObject.registerClass({
             return;
 
         this._highlight = new CyclerHighlight();
-        global.window_group.add_actor(this._highlight.actor);
+        global.window_group.add_actor(this._highlight);
 
         this._switcherList = new CyclerList();
         this._switcherList.connect('item-highlighted', (list, index) => {
@@ -499,7 +495,7 @@ var CyclerPopup = GObject.registerClass({
 
     _highlightItem(index, _justOutline) {
         this._highlight.window = this._items[index];
-        global.window_group.set_child_above_sibling(this._highlight.actor, null);
+        global.window_group.set_child_above_sibling(this._highlight, null);
     }
 
     _finish() {
@@ -529,7 +525,7 @@ var CyclerPopup = GObject.registerClass({
     }
 
     _onDestroy() {
-        this._highlight.actor.destroy();
+        this._highlight.destroy();
 
         super._onDestroy();
     }
@@ -592,20 +588,18 @@ class WindowSwitcherPopup extends SwitcherPopup.SwitcherPopup {
     }
 
     _keyPressHandler(keysym, action) {
-        if (action == Meta.KeyBindingAction.SWITCH_WINDOWS) {
+        if (action == Meta.KeyBindingAction.SWITCH_WINDOWS)
             this._select(this._next());
-        } else if (action == Meta.KeyBindingAction.SWITCH_WINDOWS_BACKWARD) {
+        else if (action == Meta.KeyBindingAction.SWITCH_WINDOWS_BACKWARD)
             this._select(this._previous());
-        } else {
-            if (keysym == Clutter.Left)
-                this._select(this._previous());
-            else if (keysym == Clutter.Right)
-                this._select(this._next());
-            else if (keysym == Clutter.w || keysym == Clutter.F4)
-                this._closeWindow(this._selectedIndex);
-            else
-                return Clutter.EVENT_PROPAGATE;
-        }
+        else if (keysym == Clutter.KEY_Left)
+            this._select(this._previous());
+        else if (keysym == Clutter.KEY_Right)
+            this._select(this._next());
+        else if (keysym == Clutter.KEY_w || keysym == Clutter.KEY_F4)
+            this._closeWindow(this._selectedIndex);
+        else
+            return Clutter.EVENT_PROPAGATE;
 
         return Clutter.EVENT_STOP;
     }
@@ -656,11 +650,14 @@ class AppIcon extends St.BoxLayout {
 
         this.app = app;
         this.icon = null;
-        this._iconBin = new St.Bin({ x_fill: true, y_fill: true });
+        this._iconBin = new St.Bin();
 
-        this.add(this._iconBin, { x_fill: false, y_fill: false } );
-        this.label = new St.Label({ text: this.app.get_name() });
-        this.add(this.label, { x_fill: false });
+        this.add_child(this._iconBin);
+        this.label = new St.Label({
+            text: this.app.get_name(),
+            x_align: Clutter.ActorAlign.CENTER,
+        });
+        this.add_child(this.label);
     }
 
     // eslint-disable-next-line camelcase
@@ -696,7 +693,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
             // Cache the window list now; we don't handle dynamic changes here,
             // and we don't want to be continually retrieving it
             appIcon.cachedWindows = allWindows.filter(
-                w => windowTracker.get_window_app (w) == appIcon.app
+                w => windowTracker.get_window_app(w) == appIcon.app
             );
             if (appIcon.cachedWindows.length > 0)
                 this._addIcon(appIcon);
@@ -711,7 +708,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
 
     _onDestroy() {
         if (this._mouseTimeOutId != 0)
-            Mainloop.source_remove(this._mouseTimeOutId);
+            GLib.source_remove(this._mouseTimeOutId);
 
         this.icons.forEach(icon => {
             icon.app.disconnect(icon._stateChangedId);
@@ -720,9 +717,9 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
 
     _setIconSize() {
         let j = 0;
-        while (this._items.length > 1 && this._items[j].style_class != 'item-box') {
+        while (this._items.length > 1 && this._items[j].style_class != 'item-box')
             j++;
-        }
+
         let themeNode = this._items[j].get_theme_node();
         this._list.ensure_style();
 
@@ -790,14 +787,16 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
     // activation when the thumbnail list is open
     _onItemEnter(index) {
         if (this._mouseTimeOutId != 0)
-            Mainloop.source_remove(this._mouseTimeOutId);
+            GLib.source_remove(this._mouseTimeOutId);
         if (this._altTabPopup.thumbnailsVisible) {
-            this._mouseTimeOutId = Mainloop.timeout_add(APP_ICON_HOVER_TIMEOUT,
-                                                        () => {
-                                                            this._enterItem(index);
-                                                            this._mouseTimeOutId = 0;
-                                                            return GLib.SOURCE_REMOVE;
-                                                        });
+            this._mouseTimeOutId = GLib.timeout_add(
+                GLib.PRIORITY_DEFAULT,
+                APP_ICON_HOVER_TIMEOUT,
+                () => {
+                    this._enterItem(index);
+                    this._mouseTimeOutId = 0;
+                    return GLib.SOURCE_REMOVE;
+                });
             GLib.Source.set_name_by_id(this._mouseTimeOutId, '[gnome-shell] this._enterItem');
         } else {
             this._itemEntered(index);
@@ -854,7 +853,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
         if (appIcon.cachedWindows.length == 1)
             arrow.hide();
         else
-            item.add_accessible_state (Atk.StateType.EXPANDABLE);
+            item.add_accessible_state(Atk.StateType.EXPANDABLE);
     }
 
     _removeIcon(app) {
@@ -874,9 +873,9 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
     _init(windows) {
         super._init(false);
 
-        this._labels = new Array();
-        this._thumbnailBins = new Array();
-        this._clones = new Array();
+        this._labels = [];
+        this._thumbnailBins = [];
+        this._clones = [];
         this._windows = windows;
 
         for (let i = 0; i < windows.length; i++) {
@@ -890,12 +889,13 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
 
             let title = windows[i].get_title();
             if (title) {
-                let name = new St.Label({ text: title });
-                // St.Label doesn't support text-align so use a Bin
-                let bin = new St.Bin({ x_align: St.Align.MIDDLE });
-                this._labels.push(bin);
-                bin.add_actor(name);
-                box.add_actor(bin);
+                let name = new St.Label({
+                    text: title,
+                    // St.Label doesn't support text-align
+                    x_align: Clutter.ActorAlign.CENTER,
+                });
+                this._labels.push(name);
+                box.add_actor(name);
 
                 this.addItem(box, name);
             } else {
@@ -937,7 +937,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
         }
 
         // Make sure we only do this once
-        this._thumbnailBins = new Array();
+        this._thumbnailBins = [];
     }
 
     _removeThumbnail(source, clone) {
@@ -974,7 +974,7 @@ class WindowIcon extends St.BoxLayout {
 
         this._icon = new St.Widget({ layout_manager: new Clutter.BinLayout() });
 
-        this.add(this._icon, { x_fill: false, y_fill: false } );
+        this.add_child(this._icon);
         this.label = new St.Label({ text: window.get_title() });
 
         let tracker = Shell.WindowTracker.get_default();
@@ -997,9 +997,10 @@ class WindowIcon extends St.BoxLayout {
             size = WINDOW_PREVIEW_SIZE;
             this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
 
-            if (this.app)
+            if (this.app) {
                 this._icon.add_actor(this._createAppIcon(this.app,
                                                          APP_ICON_SIZE_SMALL));
+            }
             break;
 
         case AppIconMode.APP_ICON_ONLY:
@@ -1011,9 +1012,9 @@ class WindowIcon extends St.BoxLayout {
     }
 
     _createAppIcon(app, size) {
-        let appIcon = app ? app.create_icon_texture(size)
-                          : new St.Icon({ icon_name: 'icon-missing',
-                                          icon_size: size });
+        let appIcon = app
+            ? app.create_icon_texture(size)
+            : new St.Icon({ icon_name: 'icon-missing', icon_size: size });
         appIcon.x_expand = appIcon.y_expand = true;
         appIcon.x_align = appIcon.y_align = Clutter.ActorAlign.END;
 
@@ -1040,7 +1041,7 @@ class WindowList extends SwitcherPopup.SwitcherList {
             this.addItem(icon, icon.label);
             this.icons.push(icon);
 
-            icon._unmanagedSignalId = icon.window.connect('unmanaged', (window) => {
+            icon._unmanagedSignalId = icon.window.connect('unmanaged', window => {
                 this._removeWindow(window);
             });
         }

js/ui/animation.js

@@ -1,20 +1,20 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported Animation, AnimatedIcon, Spinner */
 
-const { Clutter, GLib, Gio, St } = imports.gi;
-const Mainloop = imports.mainloop;
+const { Clutter, GLib, GObject, Gio, St } = imports.gi;
+
+const Params = imports.misc.params;
 
 var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
 var SPINNER_ANIMATION_TIME = 300;
 var SPINNER_ANIMATION_DELAY = 1000;
 
-var Animation = class {
-    constructor(file, width, height, speed) {
-        this.actor = new St.Bin();
-        this.actor.set_size(width, height);
-        this.actor.connect('destroy', this._onDestroy.bind(this));
-        this.actor.connect('notify::size', this._syncAnimationSize.bind(this));
-        this.actor.connect('resource-scale-changed',
+var Animation = GObject.registerClass(
+class Animation extends St.Bin {
+    _init(file, width, height, speed) {
+        super._init({ width, height });
+        this.connect('destroy', this._onDestroy.bind(this));
+        this.connect('resource-scale-changed',
             this._loadFile.bind(this, file, width, height));
 
         let themeContext = St.ThemeContext.get_for_stage(global.stage);
@@ -45,7 +45,7 @@ var Animation = class {
 
     stop() {
         if (this._timeoutId > 0) {
-            Mainloop.source_remove(this._timeoutId);
+            GLib.source_remove(this._timeoutId);
             this._timeoutId = 0;
         }
 
@@ -53,20 +53,34 @@ var Animation = class {
     }
 
     _loadFile(file, width, height) {
-        let [validResourceScale, resourceScale] = this.actor.get_resource_scale();
+        let [validResourceScale, resourceScale] = this.get_resource_scale();
+        let wasPlaying = this._isPlaying;
+
+        if (this._isPlaying)
+            this.stop();
 
         this._isLoaded = false;
-        this.actor.destroy_all_children();
+        this.destroy_all_children();
 
-        if (!validResourceScale)
+        if (!validResourceScale) {
+            if (wasPlaying)
+                this.play();
             return;
+        }
 
         let textureCache = St.TextureCache.get_default();
         let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
         this._animations = textureCache.load_sliced_image(file, width, height,
                                                           scaleFactor, resourceScale,
                                                           this._animationsLoaded.bind(this));
-        this.actor.set_child(this._animations);
+        this._animations.set({
+            x_align: Clutter.ActorAlign.CENTER,
+            y_align: Clutter.ActorAlign.CENTER,
+        });
+        this.set_child(this._animations);
+
+        if (wasPlaying)
+            this.play();
     }
 
     _showFrame(frame) {
@@ -74,7 +88,7 @@ var Animation = class {
         if (oldFrameActor)
             oldFrameActor.hide();
 
-        this._frame = (frame % this._animations.get_n_children());
+        this._frame = frame % this._animations.get_n_children();
 
         let newFrameActor = this._animations.get_child_at_index(this._frame);
         if (newFrameActor)
@@ -90,7 +104,7 @@ var Animation = class {
         if (!this._isLoaded)
             return;
 
-        let [width, height] = this.actor.get_size();
+        let [width, height] = this.get_size();
 
         for (let i = 0; i < this._animations.get_n_children(); ++i)
             this._animations.get_child_at_index(i).set_size(width, height);
@@ -113,21 +127,29 @@ var Animation = class {
             themeContext.disconnect(this._scaleChangedId);
         this._scaleChangedId = 0;
     }
-};
+});
 
-var AnimatedIcon = class extends Animation {
-    constructor(file, size) {
-        super(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT);
+var AnimatedIcon = GObject.registerClass(
+class AnimatedIcon extends Animation {
+    _init(file, size) {
+        super._init(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT);
     }
-};
+});
 
-var Spinner = class extends AnimatedIcon {
-    constructor(size, animate = false) {
+var Spinner = GObject.registerClass(
+class Spinner extends AnimatedIcon {
+    _init(size, params) {
+        params = Params.parse(params, {
+            animate: false,
+            hideOnStop: false,
+        });
         let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg');
-        super(file, size);
+        super._init(file, size);
 
-        this.actor.opacity = 0;
-        this._animate = animate;
+        this.opacity = 0;
+        this._animate = params.animate;
+        this._hideOnStop = params.hideOnStop;
+        this.visible = !this._hideOnStop;
     }
 
     _onDestroy() {
@@ -136,35 +158,43 @@ var Spinner = class extends AnimatedIcon {
     }
 
     play() {
-        this.actor.remove_all_transitions();
+        this.remove_all_transitions();
+        this.show();
 
         if (this._animate) {
             super.play();
-            this.actor.ease({
+            this.ease({
                 opacity: 255,
                 delay: SPINNER_ANIMATION_DELAY,
                 duration: SPINNER_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.LINEAR
+                mode: Clutter.AnimationMode.LINEAR,
             });
         } else {
-            this.actor.opacity = 255;
+            this.opacity = 255;
             super.play();
         }
     }
 
     stop() {
-        this.actor.remove_all_transitions();
+        this.remove_all_transitions();
 
         if (this._animate) {
-            this.actor.ease({
+            this.ease({
                 opacity: 0,
-                time: SPINNER_ANIMATION_TIME,
-                transition: 'linear',
-                onComplete: () => super.stop()
+                duration: SPINNER_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.LINEAR,
+                onComplete: () => {
+                    super.stop();
+                    if (this._hideOnStop)
+                        this.hide();
+                },
             });
         } else {
-            this.actor.opacity = 0;
+            this.opacity = 0;
             super.stop();
+
+            if (this._hideOnStop)
+                this.hide();
         }
     }
-};
+});

js/ui/appFavorites.js

@@ -55,6 +55,7 @@ const RENAMED_DESKTOP_IDS = {
     'org.gnome.taquin.desktop': 'org.gnome.Taquin.desktop',
     'org.gnome.Weather.Application.desktop': 'org.gnome.Weather.desktop',
     'polari.desktop': 'org.gnome.Polari.desktop',
+    'shotwell.desktop': 'org.gnome.Shotwell.desktop',
     'tali.desktop': 'org.gnome.Tali.desktop',
     'totem.desktop': 'org.gnome.Totem.desktop',
     'evince.desktop': 'org.gnome.Evince.desktop',
@@ -147,12 +148,11 @@ class AppFavorites {
 
         let app = Shell.AppSystem.get_default().lookup_app(appId);
 
-        Main.overview.setMessage(_("%s has been added to your favorites.").format(app.get_name()),
-                                 { forFeedback: true,
-                                   undoCallback: () => {
-                                       this._removeFavorite(appId);
-                                   }
-                                 });
+        let msg = _("%s has been added to your favorites.").format(app.get_name());
+        Main.overview.setMessage(msg, {
+            forFeedback: true,
+            undoCallback: () => this._removeFavorite(appId),
+        });
     }
 
     addFavorite(appId) {
@@ -181,12 +181,11 @@ class AppFavorites {
         if (!this._removeFavorite(appId))
             return;
 
-        Main.overview.setMessage(_("%s has been removed from your favorites.").format(app.get_name()),
-                                 { forFeedback: true,
-                                   undoCallback: () => {
-                                       this._addFavorite(appId, pos);
-                                   }
-                                 });
+        let msg = _("%s has been removed from your favorites.").format(app.get_name());
+        Main.overview.setMessage(msg, {
+            forFeedback: true,
+            undoCallback: () => this._addFavorite(appId, pos),
+        });
     }
 }
 Signals.addSignalMethods(AppFavorites.prototype);

js/ui/audioDeviceSelection.js

@@ -9,13 +9,13 @@ const { loadInterfaceXML } = imports.misc.fileUtils;
 var AudioDevice = {
     HEADPHONES: 1 << 0,
     HEADSET:    1 << 1,
-    MICROPHONE: 1 << 2
+    MICROPHONE: 1 << 2,
 };
 
 const AudioDeviceSelectionIface = loadInterfaceXML('org.gnome.Shell.AudioDeviceSelection');
 
 var AudioDeviceSelectionDialog = GObject.registerClass({
-    Signals: { 'device-selected': { param_types: [GObject.TYPE_UINT] } }
+    Signals: { 'device-selected': { param_types: [GObject.TYPE_UINT] } },
 }, class AudioDeviceSelectionDialog extends ModalDialog.ModalDialog {
     _init(devices) {
         super._init({ styleClass: 'audio-device-selection-dialog' });
@@ -43,15 +43,19 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
         this.contentLayout.style_class = 'audio-selection-content';
         this.contentLayout.add(title);
 
-        this._selectionBox = new St.BoxLayout({ style_class: 'audio-selection-box' });
-        this.contentLayout.add(this._selectionBox, { expand: true });
+        this._selectionBox = new St.BoxLayout({
+            style_class: 'audio-selection-box',
+            x_expand: true,
+        });
+        this.contentLayout.add_child(this._selectionBox);
 
-        if (Main.sessionMode.allowSettings)
+        if (Main.sessionMode.allowSettings) {
             this.addButton({ action: this._openSettings.bind(this),
                              label: _("Sound Settings") });
+        }
         this.addButton({ action: this.close.bind(this),
                          label: _("Cancel"),
-                         key: Clutter.Escape });
+                         key: Clutter.KEY_Escape });
     }
 
     _getDeviceLabel(device) {
@@ -161,7 +165,7 @@ var AudioDeviceSelectionDBus = class AudioDeviceSelectionDBus {
 
         let [deviceNames] = params;
         let devices = 0;
-        deviceNames.forEach(n => devices |= AudioDevice[n.toUpperCase()]);
+        deviceNames.forEach(n => (devices |= AudioDevice[n.toUpperCase()]));
 
         let dialog;
         try {

js/ui/background.js

@@ -1,4 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
+/* exported SystemBackground */
 
 // READ THIS FIRST
 // Background handling is a maze of objects, both objects in this file, and
@@ -93,7 +94,7 @@
 //     MetaBackgroundImage         MetaBackgroundImage
 //     MetaBackgroundImage         MetaBackgroundImage
 
-const { Clutter, GDesktopEnums, Gio, GLib, GnomeDesktop, Meta } = imports.gi;
+const { Clutter, GDesktopEnums, Gio, GLib, GObject, GnomeDesktop, Meta } = imports.gi;
 const Signals = imports.signals;
 
 const LoginManager = imports.misc.loginManager;
@@ -144,7 +145,7 @@ var BackgroundCache = class BackgroundCache {
 
         let monitor = file.monitor(Gio.FileMonitorFlags.NONE, null);
         monitor.connect('changed',
-                        (obj, file, otherFile, eventType) => {
+                        (obj, theFile, otherFile, eventType) => {
                             // Ignore CHANGED and CREATED events, since in both cases
                             // we'll get a CHANGES_DONE_HINT event when done.
                             if (eventType != Gio.FileMonitorEvent.CHANGED &&
@@ -220,16 +221,17 @@ function getBackgroundCache() {
     return _backgroundCache;
 }
 
-var Background = class Background {
-    constructor(params) {
+var Background = GObject.registerClass({
+    Signals: { 'loaded': {}, 'bg-changed': {} },
+}, class Background extends Meta.Background {
+    _init(params) {
         params = Params.parse(params, { monitorIndex: 0,
                                         layoutManager: Main.layoutManager,
                                         settings: null,
                                         file: null,
                                         style: null });
 
-        this.background = new Meta.Background({ meta_display: global.display });
-        this.background._delegate = this;
+        super._init({ meta_display: global.display });
 
         this._settings = params.settings;
         this._file = params.file;
@@ -262,16 +264,14 @@ var Background = class Background {
     }
 
     destroy() {
-        this.background = null;
-
         this._cancellable.cancel();
         this._removeAnimationTimeout();
 
         let i;
         let keys = Object.keys(this._fileWatches);
-        for (i = 0; i < keys.length; i++) {
+        for (i = 0; i < keys.length; i++)
             this._cache.disconnect(this._fileWatches[keys[i]]);
-        }
+
         this._fileWatches = null;
 
         if (this._timezoneChangedId != 0)
@@ -300,9 +300,11 @@ var Background = class Background {
 
         this._changedIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
             this._changedIdleId = 0;
-            this.emit('changed');
+            this.emit('bg-changed');
             return GLib.SOURCE_REMOVE;
         });
+        GLib.Source.set_name_by_id(this._changedIdleId,
+            '[gnome-shell] Background._emitChangedSignal');
     }
 
     updateResolution() {
@@ -328,7 +330,7 @@ var Background = class Background {
             this.emit('loaded');
             return GLib.SOURCE_REMOVE;
         });
-        GLib.Source.set_name_by_id(id, '[gnome-shell] this.emit');
+        GLib.Source.set_name_by_id(id, '[gnome-shell] Background._setLoaded Idle');
     }
 
     _loadPattern() {
@@ -342,9 +344,9 @@ var Background = class Background {
         let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);
 
         if (shadingType == GDesktopEnums.BackgroundShading.SOLID)
-            this.background.set_color(color);
+            this.set_color(color);
         else
-            this.background.set_gradient(shadingType, color, secondColor);
+            this.set_gradient(shadingType, color, secondColor);
     }
 
     _watchFile(file) {
@@ -380,13 +382,13 @@ var Background = class Background {
         let finish = () => {
             this._setLoaded();
             if (files.length > 1) {
-                this.background.set_blend(files[0], files[1],
-                                          this._animation.transitionProgress,
-                                          this._style);
+                this.set_blend(files[0], files[1],
+                               this._animation.transitionProgress,
+                               this._style);
             } else if (files.length > 0) {
-                this.background.set_file(files[0], this._style);
+                this.set_file(files[0], this._style);
             } else {
-                this.background.set_file(null, this._style);
+                this.set_file(null, this._style);
             }
             this._queueUpdateAnimation();
         };
@@ -401,6 +403,7 @@ var Background = class Background {
                 if (numPendingImages == 0)
                     finish();
             } else {
+                // eslint-disable-next-line no-loop-func
                 let id = image.connect('loaded', () => {
                     image.disconnect(id);
                     numPendingImages--;
@@ -441,24 +444,25 @@ var Background = class Background {
     }
 
     _loadAnimation(file) {
-        this._cache.getAnimation({ file: file,
-                                   settingsSchema: this._settings.schema_id,
-                                   onLoaded: animation => {
-                                       this._animation = animation;
+        this._cache.getAnimation({
+            file,
+            settingsSchema: this._settings.schema_id,
+            onLoaded: animation => {
+                this._animation = animation;
 
-                                       if (!this._animation || this._cancellable.is_cancelled()) {
-                                           this._setLoaded();
-                                           return;
-                                       }
+                if (!this._animation || this._cancellable.is_cancelled()) {
+                    this._setLoaded();
+                    return;
+                }
 
-                                       this._updateAnimation();
-                                       this._watchFile(file);
-                                   }
-                                 });
+                this._updateAnimation();
+                this._watchFile(file);
+            },
+        });
     }
 
     _loadImage(file) {
-        this.background.set_file(file, this._style);
+        this.set_file(file, this._style);
         this._watchFile(file);
 
         let cache = Meta.BackgroundImageCache.get_default();
@@ -492,13 +496,14 @@ var Background = class Background {
 
         this._loadFile(this._file);
     }
-};
-Signals.addSignalMethods(Background.prototype);
+});
 
 let _systemBackground;
 
-var SystemBackground = class SystemBackground {
-    constructor() {
+var SystemBackground = GObject.registerClass({
+    Signals: { 'loaded': {} },
+}, class SystemBackground extends Meta.BackgroundActor {
+    _init() {
         let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/noise-texture.png');
 
         if (_systemBackground == null) {
@@ -507,9 +512,11 @@ var SystemBackground = class SystemBackground {
             _systemBackground.set_file(file, GDesktopEnums.BackgroundStyle.WALLPAPER);
         }
 
-        this.actor = new Meta.BackgroundActor({ meta_display: global.display,
-                                                monitor: 0,
-                                                background: _systemBackground });
+        super._init({
+            meta_display: global.display,
+            monitor: 0,
+            background: _systemBackground,
+        });
 
         let cache = Meta.BackgroundImageCache.get_default();
         let image = cache.load(file);
@@ -528,8 +535,7 @@ var SystemBackground = class SystemBackground {
             });
         }
     }
-};
-Signals.addSignalMethods(SystemBackground.prototype);
+});
 
 var BackgroundSource = class BackgroundSource {
     constructor(layoutManager, settingsSchema) {
@@ -565,7 +571,7 @@ var BackgroundSource = class BackgroundSource {
 
         // We don't watch changes to settings here,
         // instead we rely on Background to watch those
-        // and emit 'changed' at the right time
+        // and emit 'bg-changed' at the right time
 
         if (this._overrideImage != null) {
             file = Gio.File.new_for_path(this._overrideImage);
@@ -587,14 +593,14 @@ var BackgroundSource = class BackgroundSource {
 
         if (!(monitorIndex in this._backgrounds)) {
             let background = new Background({
-                monitorIndex: monitorIndex,
+                monitorIndex,
                 layoutManager: this._layoutManager,
                 settings: this._settings,
-                file: file,
-                style: style
+                file,
+                style,
             });
 
-            background._changedId = background.connect('changed', () => {
+            background._changedId = background.connect('bg-changed', () => {
                 background.disconnect(background._changedId);
                 background.destroy();
                 delete this._backgrounds[monitorIndex];
@@ -620,11 +626,11 @@ var BackgroundSource = class BackgroundSource {
     }
 };
 
-var Animation = class Animation {
-    constructor(params) {
-        params = Params.parse(params, { file: null });
+var Animation = GObject.registerClass(
+class Animation extends GnomeDesktop.BGSlideShow {
+    _init(params) {
+        super._init(params);
 
-        this.file = params.file;
         this.keyFrameFiles = [];
         this.transitionProgress = 0.0;
         this.transitionDuration = 0.0;
@@ -632,9 +638,7 @@ var Animation = class Animation {
     }
 
     load(callback) {
-        this._show = new GnomeDesktop.BGSlideShow({ file: this.file });
-
-        this._show.load_async(null, () => {
+        this.load_async(null, () => {
             this.loaded = true;
             if (callback)
                 callback();
@@ -644,13 +648,11 @@ var Animation = class Animation {
     update(monitor) {
         this.keyFrameFiles = [];
 
-        if (!this._show)
+        if (this.get_num_slides() < 1)
             return;
 
-        if (this._show.get_num_slides() < 1)
-            return;
-
-        let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
+        let [progress, duration, isFixed_, filename1, filename2] =
+            this.get_current_slide(monitor.width, monitor.height);
 
         this.transitionDuration = duration;
         this.transitionProgress = progress;
@@ -661,8 +663,7 @@ var Animation = class Animation {
         if (filename2)
             this.keyFrameFiles.push(Gio.File.new_for_path(filename2));
     }
-};
-Signals.addSignalMethods(Animation.prototype);
+});
 
 var BackgroundManager = class BackgroundManager {
     constructor(params) {
@@ -713,7 +714,7 @@ var BackgroundManager = class BackgroundManager {
             opacity: 0,
             duration: FADE_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => oldBackgroundActor.destroy()
+            onComplete: () => oldBackgroundActor.destroy(),
         });
     }
 
@@ -731,7 +732,7 @@ var BackgroundManager = class BackgroundManager {
 
         this._newBackgroundActor = newBackgroundActor;
 
-        let background = newBackgroundActor.background._delegate;
+        let background = newBackgroundActor.background;
 
         if (background.isLoaded) {
             this._swapBackgroundActor();
@@ -748,23 +749,24 @@ var BackgroundManager = class BackgroundManager {
 
     _createBackgroundActor() {
         let background = this._backgroundSource.getBackground(this._monitorIndex);
-        let backgroundActor = new Meta.BackgroundActor({ meta_display: global.display,
-                                                         monitor: this._monitorIndex,
-                                                         background: background.background,
-                                                         vignette: this._vignette,
-                                                         vignette_sharpness: 0.5,
-                                                         brightness: 0.5,
-                                                       });
+        let backgroundActor = new Meta.BackgroundActor({
+            meta_display: global.display,
+            monitor: this._monitorIndex,
+            background,
+            vignette: this._vignette,
+            vignette_sharpness: 0.5,
+            brightness: 0.5,
+        });
 
         this._container.add_child(backgroundActor);
 
         if (this._controlPosition) {
             let monitor = this._layoutManager.monitors[this._monitorIndex];
             backgroundActor.set_position(monitor.x, monitor.y);
-            backgroundActor.lower_bottom();
+            this._container.set_child_below_sibling(backgroundActor, null);
         }
 
-        let changeSignalId = background.connect('changed', () => {
+        let changeSignalId = background.connect('bg-changed', () => {
             background.disconnect(changeSignalId);
             changeSignalId = null;
             this._updateBackgroundActor();

js/ui/backgroundMenu.js

@@ -31,15 +31,16 @@ function addBackgroundMenu(actor, layoutManager) {
 
     function openMenu(x, y) {
         Main.layoutManager.setDummyCursorGeometry(x, y, 0, 0);
-        actor._backgroundMenu.open(BoxPointer.PopupAnimation.NONE);
+        actor._backgroundMenu.open(BoxPointer.PopupAnimation.FULL);
     }
 
     let clickAction = new Clutter.ClickAction();
-    clickAction.connect('long-press', (action, actor, state) => {
-        if (state == Clutter.LongPressState.QUERY)
-            return ((action.get_button() == 0 ||
+    clickAction.connect('long-press', (action, theActor, state) => {
+        if (state == Clutter.LongPressState.QUERY) {
+            return (action.get_button() == 0 ||
                      action.get_button() == 1) &&
-                    !actor._backgroundMenu.isOpen);
+                    !actor._backgroundMenu.isOpen;
+        }
         if (state == Clutter.LongPressState.ACTIVATE) {
             let [x, y] = action.get_coords();
             openMenu(x, y);

js/ui/barLevel.js

@@ -16,8 +16,8 @@ var BarLevel = GObject.registerClass({
         'overdrive-start': GObject.ParamSpec.double(
             'overdrive-start', 'overdrive-start', 'overdrive-start',
             GObject.ParamFlags.READWRITE,
-            1, 2, 1)
-    }
+            1, 2, 1),
+    },
 }, class BarLevel extends St.DrawingArea {
     _init(params) {
         this._maxValue = 1;
@@ -27,7 +27,7 @@ var BarLevel = GObject.registerClass({
 
         let defaultParams = {
             style_class: 'barlevel',
-            accessible_role: Atk.Role.LEVEL_BAR
+            accessible_role: Atk.Role.LEVEL_BAR,
         };
         super._init(Object.assign(defaultParams, params));
         this.connect('allocation-changed', (actor, box) => {
@@ -88,9 +88,10 @@ var BarLevel = GObject.registerClass({
         if (this._overdriveStart == value)
             return;
 
-        if (value > this._maxValue)
+        if (value > this._maxValue) {
             throw new Error(`Tried to set overdrive value to ${value}, ` +
                 `which is a number greater than the maximum allowed value ${this._maxValue}`);
+        }
 
         this._overdriveStart = value;
         this.notify('overdrive-start');

js/ui/boxpointer.js

@@ -44,14 +44,20 @@ var BoxPointer = GObject.registerClass({
         this._border = new St.DrawingArea();
         this._border.connect('repaint', this._drawBorder.bind(this));
         this.add_actor(this._border);
-        this.bin.raise(this._border);
+        this.set_child_above_sibling(this.bin, this._border);
         this._sourceAlignment = 0.5;
-        this._capturedEventId = 0;
-        this._muteInput();
+        this._muteInput = true;
 
         this.connect('destroy', this._onDestroy.bind(this));
     }
 
+    vfunc_captured_event() {
+        if (this._muteInput)
+            return Clutter.EVENT_STOP;
+
+        return Clutter.EVENT_PROPAGATE;
+    }
+
     _onDestroy() {
         if (this._sourceActorDestroyId) {
             this._sourceActor.disconnect(this._sourceActorDestroyId);
@@ -63,23 +69,10 @@ var BoxPointer = GObject.registerClass({
         return this._arrowSide;
     }
 
-    _muteInput() {
-        if (this._capturedEventId == 0)
-            this._capturedEventId = this.connect('captured-event',
-                                                 () => Clutter.EVENT_STOP);
-    }
-
-    _unmuteInput() {
-        if (this._capturedEventId != 0) {
-            this.disconnect(this._capturedEventId);
-            this._capturedEventId = 0;
-        }
-    }
-
     open(animate, onComplete) {
         let themeNode = this.get_theme_node();
         let rise = themeNode.get_length('-arrow-rise');
-        let animationTime = (animate & PopupAnimation.FULL) ? POPUP_ANIMATION_TIME : 0;
+        let animationTime = animate & PopupAnimation.FULL ? POPUP_ANIMATION_TIME : 0;
 
         if (animate & PopupAnimation.FADE)
             this.opacity = 0;
@@ -112,10 +105,10 @@ var BoxPointer = GObject.registerClass({
             duration: animationTime,
             mode: Clutter.AnimationMode.LINEAR,
             onComplete: () => {
-                this._unmuteInput();
+                this._muteInput = false;
                 if (onComplete)
                     onComplete();
-            }
+            },
         });
     }
 
@@ -127,8 +120,8 @@ var BoxPointer = GObject.registerClass({
         let translationY = 0;
         let themeNode = this.get_theme_node();
         let rise = themeNode.get_length('-arrow-rise');
-        let fade = (animate & PopupAnimation.FADE);
-        let animationTime = (animate & PopupAnimation.FULL) ? POPUP_ANIMATION_TIME : 0;
+        let fade = animate & PopupAnimation.FADE;
+        let animationTime = animate & PopupAnimation.FULL ? POPUP_ANIMATION_TIME : 0;
 
         if (animate & PopupAnimation.SLIDE) {
             switch (this._arrowSide) {
@@ -147,7 +140,7 @@ var BoxPointer = GObject.registerClass({
             }
         }
 
-        this._muteInput();
+        this._muteInput = true;
 
         this.remove_all_transitions();
         this.ease({
@@ -163,7 +156,7 @@ var BoxPointer = GObject.registerClass({
                 this.translation_y = 0;
                 if (onComplete)
                     onComplete();
-            }
+            },
         });
     }
 
@@ -172,8 +165,8 @@ var BoxPointer = GObject.registerClass({
         let borderWidth = themeNode.get_length('-arrow-border-width');
         minSize += borderWidth * 2;
         natSize += borderWidth * 2;
-        if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM))
-            || (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
+        if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)) ||
+            (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
             let rise = themeNode.get_length('-arrow-rise');
             minSize += rise;
             natSize += rise;
@@ -254,11 +247,10 @@ var BoxPointer = GObject.registerClass({
             let [absX, absY] = this.get_transformed_position();
 
             if (this._arrowSide == St.Side.TOP ||
-                this._arrowSide == St.Side.BOTTOM) {
+                this._arrowSide == St.Side.BOTTOM)
                 this._arrowOrigin = sourceX - absX + sourceWidth / 2;
-            } else {
+            else
                 this._arrowOrigin = sourceY - absY + sourceHeight / 2;
-            }
         }
 
         let borderWidth = themeNode.get_length('-arrow-border-width');
@@ -273,20 +265,19 @@ var BoxPointer = GObject.registerClass({
 
         let [width, height] = area.get_surface_size();
         let [boxWidth, boxHeight] = [width, height];
-        if (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM) {
+        if (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)
             boxHeight -= rise;
-        } else {
+        else
             boxWidth -= rise;
-        }
+
         let cr = area.get_context();
 
         // Translate so that box goes from 0,0 to boxWidth,boxHeight,
         // with the arrow poking out of that
-        if (this._arrowSide == St.Side.TOP) {
+        if (this._arrowSide == St.Side.TOP)
             cr.translate(0, rise);
-        } else if (this._arrowSide == St.Side.LEFT) {
+        else if (this._arrowSide == St.Side.LEFT)
             cr.translate(rise, 0);
-        }
 
         let [x1, y1] = [halfBorder, halfBorder];
         let [x2, y2] = [boxWidth - halfBorder, boxHeight - halfBorder];
@@ -482,7 +473,7 @@ var BoxPointer = GObject.registerClass({
         let borderWidth = themeNode.get_length('-arrow-border-width');
         let arrowBase = themeNode.get_length('-arrow-base');
         let borderRadius = themeNode.get_length('-arrow-border-radius');
-        let margin = (4 * borderRadius + borderWidth + arrowBase);
+        let margin = 4 * borderRadius + borderWidth + arrowBase;
 
         let gap = themeNode.get_length('-boxpointer-gap');
         let padding = themeNode.get_length('-arrow-rise');
@@ -533,11 +524,11 @@ var BoxPointer = GObject.registerClass({
             arrowOrigin = sourceCenterX - resX;
             if (arrowOrigin <= (x1 + (borderRadius + halfBase))) {
                 if (arrowOrigin > x1)
-                    resX += (arrowOrigin - x1);
+                    resX += arrowOrigin - x1;
                 arrowOrigin = x1;
             } else if (arrowOrigin >= (x2 - (borderRadius + halfBase))) {
                 if (arrowOrigin < x2)
-                    resX -= (x2 - arrowOrigin);
+                    resX -= x2 - arrowOrigin;
                 arrowOrigin = x2;
             }
             break;
@@ -552,11 +543,11 @@ var BoxPointer = GObject.registerClass({
             arrowOrigin = sourceCenterY - resY;
             if (arrowOrigin <= (y1 + (borderRadius + halfBase))) {
                 if (arrowOrigin > y1)
-                    resY += (arrowOrigin - y1);
+                    resY += arrowOrigin - y1;
                 arrowOrigin = y1;
             } else if (arrowOrigin >= (y2 - (borderRadius + halfBase))) {
                 if (arrowOrigin < y2)
-                    resX -= (y2 - arrowOrigin);
+                    resX -= y2 - arrowOrigin;
                 arrowOrigin = y2;
             }
             break;

js/ui/calendar.js

@@ -1,8 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Calendar, CalendarMessageList */
+/* exported Calendar, CalendarMessageList, DBusEventSource */
 
-const { Clutter, Gio, GLib, Shell, St } = imports.gi;
-const Signals = imports.signals;
+const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
 
 const Main = imports.ui.main;
 const MessageList = imports.ui.messageList;
@@ -21,7 +20,7 @@ var MESSAGE_ICON_SIZE = -1; // pick up from CSS
 var NC_ = (context, str) => `${context}\u0004${str}`;
 
 function sameYear(dateA, dateB) {
-    return (dateA.getYear() == dateB.getYear());
+    return dateA.getYear() == dateB.getYear();
 }
 
 function sameMonth(dateA, dateB) {
@@ -79,7 +78,7 @@ function _getCalendarDayAbbreviation(dayNumber) {
         /* Translators: Calendar grid abbreviation for Friday */
         NC_("grid friday", "F"),
         /* Translators: Calendar grid abbreviation for Saturday */
-        NC_("grid saturday", "S")
+        NC_("grid saturday", "S"),
     ];
     return Shell.util_translate_time_string(abbreviations[dayNumber]);
 }
@@ -99,17 +98,54 @@ var CalendarEvent = class CalendarEvent {
 // Interface for appointments/events - e.g. the contents of a calendar
 //
 
-// First, an implementation with no events
-var EmptyEventSource = class EmptyEventSource {
-    constructor() {
-        this.isLoading = false;
-        this.isDummy = true;
-        this.hasCalendars = false;
+var EventSourceBase = GObject.registerClass({
+    GTypeFlags: GObject.TypeFlags.ABSTRACT,
+    Properties: {
+        'has-calendars': GObject.ParamSpec.boolean(
+            'has-calendars', 'has-calendars', 'has-calendars',
+            GObject.ParamFlags.READABLE,
+            false),
+        'is-loading': GObject.ParamSpec.boolean(
+            'is-loading', 'is-loading', 'is-loading',
+            GObject.ParamFlags.READABLE,
+            false),
+    },
+    Signals: { 'changed': {} },
+}, class EventSourceBase extends GObject.Object {
+    get isLoading() {
+        throw new GObject.NotImplementedError(`isLoading in ${this.constructor.name}`);
+    }
+
+    get hasCalendars() {
+        throw new GObject.NotImplementedError(`hasCalendars in ${this.constructor.name}`);
     }
 
     destroy() {
     }
 
+    requestRange(_begin, _end) {
+        throw new GObject.NotImplementedError(`requestRange in ${this.constructor.name}`);
+    }
+
+    getEvents(_begin, _end) {
+        throw new GObject.NotImplementedError(`getEvents in ${this.constructor.name}`);
+    }
+
+    hasEvents(_day) {
+        throw new GObject.NotImplementedError(`hasEvents in ${this.constructor.name}`);
+    }
+});
+
+var EmptyEventSource = GObject.registerClass(
+class EmptyEventSource extends EventSourceBase {
+    get isLoading() {
+        return false;
+    }
+
+    get hasCalendars() {
+        return false;
+    }
+
     requestRange(_begin, _end) {
     }
 
@@ -121,8 +157,7 @@ var EmptyEventSource = class EmptyEventSource {
     hasEvents(_day) {
         return false;
     }
-};
-Signals.addSignalMethods(EmptyEventSource.prototype);
+});
 
 const CalendarServerIface = loadInterfaceXML('org.gnome.Shell.CalendarServer');
 
@@ -154,11 +189,12 @@ function _dateIntervalsOverlap(a0, a1, b0, b1) {
 }
 
 // an implementation that reads data from a session bus service
-var DBusEventSource = class DBusEventSource {
-    constructor() {
+var DBusEventSource = GObject.registerClass(
+class DBusEventSource extends EventSourceBase {
+    _init() {
+        super._init();
         this._resetCache();
-        this.isLoading = false;
-        this.isDummy = false;
+        this._isLoading = false;
 
         this._initialized = false;
         this._dbusProxy = new CalendarServer();
@@ -193,12 +229,12 @@ var DBusEventSource = class DBusEventSource {
             });
 
             this._dbusProxy.connect('g-properties-changed', () => {
-                this.emit('notify::has-calendars');
+                this.notify('has-calendars');
             });
 
             this._initialized = loaded;
             if (loaded) {
-                this.emit('notify::has-calendars');
+                this.notify('has-calendars');
                 this._onNameAppeared();
             }
         });
@@ -215,6 +251,10 @@ var DBusEventSource = class DBusEventSource {
             return false;
     }
 
+    get isLoading() {
+        return this._isLoading;
+    }
+
     _resetCache() {
         this._events = [];
         this._lastRequestBegin = null;
@@ -252,7 +292,7 @@ var DBusEventSource = class DBusEventSource {
         newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
 
         this._events = newEvents;
-        this.isLoading = false;
+        this._isLoading = false;
         this.emit('changed');
     }
 
@@ -272,7 +312,7 @@ var DBusEventSource = class DBusEventSource {
 
     requestRange(begin, end) {
         if (!(_datesEqual(begin, this._lastRequestBegin) && _datesEqual(end, this._lastRequestEnd))) {
-            this.isLoading = true;
+            this._isLoading = true;
             this._lastRequestBegin = begin;
             this._lastRequestEnd = end;
             this._curRequestBegin = begin;
@@ -286,9 +326,8 @@ var DBusEventSource = class DBusEventSource {
         for (let n = 0; n < this._events.length; n++) {
             let event = this._events[n];
 
-            if (_dateIntervalsOverlap (event.date, event.end, begin, end)) {
+            if (_dateIntervalsOverlap(event.date, event.end, begin, end))
                 result.push(event);
-            }
         }
         result.sort((event1, event2) => {
             // sort events by end time on ending day
@@ -310,11 +349,12 @@ var DBusEventSource = class DBusEventSource {
 
         return true;
     }
-};
-Signals.addSignalMethods(DBusEventSource.prototype);
+});
 
-var Calendar = class Calendar {
-    constructor() {
+var Calendar = GObject.registerClass({
+    Signals: { 'selected-date-changed': { param_types: [GLib.DateTime.$gtype] } },
+}, class Calendar extends St.Widget {
+    _init() {
         this._weekStart = Shell.util_get_week_start();
         this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.calendar' });
 
@@ -344,19 +384,19 @@ var Calendar = class Calendar {
 
         this._shouldDateGrabFocus = false;
 
-        this.actor = new St.Widget({ style_class: 'calendar',
-                                     layout_manager: new Clutter.TableLayout(),
-                                     reactive: true });
+        super._init({
+            style_class: 'calendar',
+            layout_manager: new Clutter.GridLayout(),
+            reactive: true,
+        });
 
-        this.actor.connect('scroll-event',
-                           this._onScroll.bind(this));
-
-        this._buildHeader ();
+        this._buildHeader();
     }
 
-    // @eventSource: is an object implementing the EventSource API, e.g. the
-    // requestRange(), getEvents(), hasEvents() methods and the ::changed signal.
     setEventSource(eventSource) {
+        if (!(eventSource instanceof EventSourceBase))
+            throw new Error('Event source is not valid type');
+
         this._eventSource = eventSource;
         this._eventSource.connect('changed', () => {
             this._rebuildCalendar();
@@ -373,7 +413,10 @@ var Calendar = class Calendar {
 
         this._selectedDate = date;
         this._update();
-        this.emit('selected-date-changed', new Date(this._selectedDate));
+
+        let datetime = GLib.DateTime.new_from_unix_local(
+            this._selectedDate.getTime() / 1000);
+        this.emit('selected-date-changed', datetime);
     }
 
     updateTimeZone() {
@@ -384,14 +427,13 @@ var Calendar = class Calendar {
     }
 
     _buildHeader() {
-        let layout = this.actor.layout_manager;
+        let layout = this.layout_manager;
         let offsetCols = this._useWeekdate ? 1 : 0;
-        this.actor.destroy_all_children();
+        this.destroy_all_children();
 
         // Top line of the calendar '<| September 2009 |>'
         this._topBox = new St.BoxLayout();
-        layout.pack(this._topBox, 0, 0);
-        layout.set_span(this._topBox, offsetCols + 7, 1);
+        layout.attach(this._topBox, 0, 0, offsetCols + 7, 1);
 
         this._backButton = new St.Button({ style_class: 'calendar-change-month-back pager-button',
                                            accessible_name: _("Previous month"),
@@ -400,9 +442,13 @@ var Calendar = class Calendar {
         this._topBox.add(this._backButton);
         this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this));
 
-        this._monthLabel = new St.Label({ style_class: 'calendar-month-label',
-                                          can_focus: true });
-        this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE });
+        this._monthLabel = new St.Label({
+            style_class: 'calendar-month-label',
+            can_focus: true,
+            x_align: Clutter.ActorAlign.CENTER,
+            x_expand: true,
+        });
+        this._topBox.add_child(this._monthLabel);
 
         this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button',
                                               accessible_name: _("Next month"),
@@ -428,20 +474,20 @@ var Calendar = class Calendar {
                                        can_focus: true });
             label.accessible_name = iter.toLocaleFormat('%A');
             let col;
-            if (this.actor.get_text_direction() == Clutter.TextDirection.RTL)
+            if (this.get_text_direction() == Clutter.TextDirection.RTL)
                 col = 6 - (7 + iter.getDay() - this._weekStart) % 7;
             else
                 col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7;
-            layout.pack(label, col, 1);
+            layout.attach(label, col, 1, 1, 1);
             iter.setTime(iter.getTime() + MSECS_IN_DAY);
         }
 
         // All the children after this are days, and get removed when we update the calendar
-        this._firstDayIndex = this.actor.get_n_children();
+        this._firstDayIndex = this.get_n_children();
     }
 
-    _onScroll(actor, event) {
-        switch (event.get_scroll_direction()) {
+    vfunc_scroll_event(scrollEvent) {
+        switch (scrollEvent.direction) {
         case Clutter.ScrollDirection.UP:
         case Clutter.ScrollDirection.LEFT:
             this._onPrevMonthButtonClicked();
@@ -511,7 +557,7 @@ var Calendar = class Calendar {
         let now = new Date();
 
         // Remove everything but the topBox and the weekday labels
-        let children = this.actor.get_children();
+        let children = this.get_children();
         for (let i = this._firstDayIndex; i < children.length; i++)
             children[i].destroy();
 
@@ -548,7 +594,7 @@ var Calendar = class Calendar {
 
         beginDate.setTime(beginDate.getTime() - (weekPadding + daysToWeekStart) * MSECS_IN_DAY);
 
-        let layout = this.actor.layout_manager;
+        let layout = this.layout_manager;
         let iter = new Date(beginDate);
         let row = 2;
         // nRows here means 6 weeks + one header + one navbar
@@ -559,7 +605,7 @@ var Calendar = class Calendar {
                                          can_focus: true });
             let rtl = button.get_text_direction() == Clutter.TextDirection.RTL;
 
-            if (this._eventSource.isDummy)
+            if (this._eventSource instanceof EmptyEventSource)
                 button.reactive = false;
 
             button._date = new Date(iter);
@@ -581,8 +627,9 @@ var Calendar = class Calendar {
             if (row == 2)
                 styleClass = `calendar-day-top ${styleClass}`;
 
-            let leftMost = rtl ? iter.getDay() == (this._weekStart + 6) % 7
-                               : iter.getDay() == this._weekStart;
+            let leftMost = rtl
+                ? iter.getDay() == (this._weekStart + 6) % 7
+                : iter.getDay() == this._weekStart;
             if (leftMost)
                 styleClass = `calendar-day-left ${styleClass}`;
 
@@ -602,7 +649,7 @@ var Calendar = class Calendar {
                 col = 6 - (7 + iter.getDay() - this._weekStart) % 7;
             else
                 col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7;
-            layout.pack(button, col, row);
+            layout.attach(button, col, row, 1, 1);
 
             this._buttons.push(button);
 
@@ -612,7 +659,7 @@ var Calendar = class Calendar {
                                            can_focus: true });
                 let weekFormat = Shell.util_translate_time_string(N_("Week %V"));
                 label.accessible_name = iter.toLocaleFormat(weekFormat);
-                layout.pack(label, rtl ? 7 : 0, row);
+                layout.attach(label, rtl ? 7 : 0, row, 1, 1);
             }
 
             iter.setTime(iter.getTime() + MSECS_IN_DAY);
@@ -647,12 +694,12 @@ var Calendar = class Calendar {
             }
         });
     }
-};
-Signals.addSignalMethods(Calendar.prototype);
+});
 
-var EventMessage = class EventMessage extends MessageList.Message {
-    constructor(event, date) {
-        super('', event.summary);
+var EventMessage = GObject.registerClass(
+class EventMessage extends MessageList.Message {
+    _init(event, date) {
+        super._init('', event.summary);
 
         this._event = event;
         this._date = date;
@@ -661,18 +708,19 @@ var EventMessage = class EventMessage extends MessageList.Message {
 
         this._icon = new St.Icon({ icon_name: 'x-office-calendar-symbolic' });
         this.setIcon(this._icon);
+    }
 
-        this.actor.connect('style-changed', () => {
-            let iconVisible = this.actor.get_parent().has_style_pseudo_class('first-child');
-            this._icon.opacity = (iconVisible ? 255 : 0);
-        });
+    vfunc_style_changed() {
+        let iconVisible = this.get_parent().has_style_pseudo_class('first-child');
+        this._icon.opacity = iconVisible ? 255 : 0;
+        super.vfunc_style_changed();
     }
 
     _formatEventTime() {
         let periodBegin = _getBeginningOfDay(this._date);
         let periodEnd = _getEndOfDay(this._date);
-        let allDay = (this._event.allDay || (this._event.date <= periodBegin &&
-                                             this._event.end >= periodEnd));
+        let allDay = this._event.allDay || (this._event.date <= periodBegin &&
+                                             this._event.end >= periodEnd);
         let title;
         if (allDay) {
             /* Translators: Shown in calendar event list for all day events
@@ -680,32 +728,33 @@ var EventMessage = class EventMessage extends MessageList.Message {
              */
             title = C_("event list time", "All Day");
         } else {
-            let date = this._event.date >= periodBegin ? this._event.date
-                                                       : this._event.end;
+            let date = this._event.date >= periodBegin
+                ? this._event.date
+                : this._event.end;
             title = Util.formatTime(date, { timeOnly: true });
         }
 
         let rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL;
         if (this._event.date < periodBegin && !this._event.allDay) {
             if (rtl)
-                title = title + ELLIPSIS_CHAR;
+                title = `${title}${ELLIPSIS_CHAR}`;
             else
-                title = ELLIPSIS_CHAR + title;
+                title = `${ELLIPSIS_CHAR}${title}`;
         }
         if (this._event.end > periodEnd && !this._event.allDay) {
             if (rtl)
-                title = ELLIPSIS_CHAR + title;
+                title = `${ELLIPSIS_CHAR}${title}`;
             else
-                title = title + ELLIPSIS_CHAR;
+                title = `${title}${ELLIPSIS_CHAR}`;
         }
         return title;
     }
-};
+});
 
-var NotificationMessage =
+var NotificationMessage = GObject.registerClass(
 class NotificationMessage extends MessageList.Message {
-    constructor(notification) {
-        super(notification.title, notification.bannerBodyText);
+    _init(notification) {
+        super._init(notification.title, notification.bannerBodyText);
         this.setUseBodyMarkup(notification.bannerBodyMarkup);
 
         this.notification = notification;
@@ -728,11 +777,12 @@ class NotificationMessage extends MessageList.Message {
     }
 
     _getIcon() {
-        if (this.notification.gicon)
+        if (this.notification.gicon) {
             return new St.Icon({ gicon: this.notification.gicon,
                                  icon_size: MESSAGE_ICON_SIZE });
-        else
+        } else {
             return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
+        }
     }
 
     _onUpdated(n, _clear) {
@@ -742,7 +792,7 @@ class NotificationMessage extends MessageList.Message {
         this.setUseBodyMarkup(n.bannerBodyMarkup);
     }
 
-    _onClicked() {
+    vfunc_clicked() {
         this.notification.activate();
     }
 
@@ -764,11 +814,12 @@ class NotificationMessage extends MessageList.Message {
     canClose() {
         return true;
     }
-};
+});
 
-var EventsSection = class EventsSection extends MessageList.MessageListSection {
-    constructor() {
-        super();
+var EventsSection = GObject.registerClass(
+class EventsSection extends MessageList.MessageListSection {
+    _init() {
+        super._init();
 
         this._desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
         this._desktopSettings.connect('changed', this._reloadEvents.bind(this));
@@ -778,9 +829,9 @@ var EventsSection = class EventsSection extends MessageList.MessageListSection {
 
         this._title = new St.Button({ style_class: 'events-section-title',
                                       label: '',
-                                      x_align: St.Align.START,
                                       can_focus: true });
-        this.actor.insert_child_below(this._title, null);
+        this._title.child.x_align = Clutter.ActorAlign.START;
+        this.insert_child_below(this._title, null);
 
         this._title.connect('clicked', this._onTitleClicked.bind(this));
         this._title.connect('key-focus-in', this._onKeyFocusIn.bind(this));
@@ -791,6 +842,9 @@ var EventsSection = class EventsSection extends MessageList.MessageListSection {
     }
 
     setEventSource(eventSource) {
+        if (!(eventSource instanceof EventSourceBase))
+            throw new Error('Event source is not valid type');
+
         this._eventSource = eventSource;
         this._eventSource.connect('changed', this._reloadEvents.bind(this));
     }
@@ -807,14 +861,15 @@ var EventsSection = class EventsSection extends MessageList.MessageListSection {
 
         let dayFormat;
         let now = new Date();
-        if (sameYear(this._date, now))
+        if (sameYear(this._date, now)) {
             /* Translators: Shown on calendar heading when selected day occurs on current year */
             dayFormat = Shell.util_translate_time_string(NC_("calendar heading",
                                                              "%A, %B %-d"));
-        else
+        } else {
             /* Translators: Shown on calendar heading when selected day occurs on different year */
             dayFormat = Shell.util_translate_time_string(NC_("calendar heading",
                                                              "%A, %B %-d, %Y"));
+        }
         this._title.label = this._date.toLocaleFormat(dayFormat);
     }
 
@@ -855,7 +910,7 @@ var EventsSection = class EventsSection extends MessageList.MessageListSection {
 
     _appInstalledChanged() {
         this._calendarApp = undefined;
-        this._title.reactive = (this._getCalendarApp() != null);
+        this._title.reactive = this._getCalendarApp() != null;
     }
 
     _getCalendarApp() {
@@ -899,12 +954,29 @@ var EventsSection = class EventsSection extends MessageList.MessageListSection {
 
         super._sync();
     }
-};
+});
 
-var NotificationSection =
+var TimeLabel = GObject.registerClass(
+class NotificationTimeLabel extends St.Label {
+    _init(datetime) {
+        super._init({
+            style_class: 'event-time',
+            x_align: Clutter.ActorAlign.START,
+            y_align: Clutter.ActorAlign.END,
+        });
+        this._datetime = datetime;
+    }
+
+    vfunc_map() {
+        this.text = Util.formatTimeSpan(this._datetime);
+        super.vfunc_map();
+    }
+});
+
+var NotificationSection = GObject.registerClass(
 class NotificationSection extends MessageList.MessageListSection {
-    constructor() {
-        super();
+    _init() {
+        super._init();
 
         this._sources = new Map();
         this._nUrgent = 0;
@@ -913,8 +985,6 @@ class NotificationSection extends MessageList.MessageListSection {
         Main.messageTray.getSources().forEach(source => {
             this._sourceAdded(Main.messageTray, source);
         });
-
-        this.actor.connect('notify::mapped', this._onMapped.bind(this));
     }
 
     get allowed() {
@@ -922,24 +992,13 @@ class NotificationSection extends MessageList.MessageListSection {
                !Main.sessionMode.isGreeter;
     }
 
-    _createTimeLabel(datetime) {
-        let label = new St.Label({ style_class: 'event-time',
-                                   x_align: Clutter.ActorAlign.START,
-                                   y_align: Clutter.ActorAlign.END });
-        label.connect('notify::mapped', () => {
-            if (label.mapped)
-                label.text = Util.formatTimeSpan(datetime);
-        });
-        return label;
-    }
-
     _sourceAdded(tray, source) {
         let obj = {
             destroyId: 0,
             notificationAddedId: 0,
         };
 
-        obj.destroyId = source.connect('destroy', source => {
+        obj.destroyId = source.connect('destroy', () => {
             this._onSourceDestroy(source, obj);
         });
         obj.notificationAddedId = source.connect('notification-added',
@@ -950,13 +1009,13 @@ class NotificationSection extends MessageList.MessageListSection {
 
     _onNotificationAdded(source, notification) {
         let message = new NotificationMessage(notification);
-        message.setSecondaryActor(this._createTimeLabel(notification.datetime));
+        message.setSecondaryActor(new TimeLabel(notification.datetime));
 
         let isUrgent = notification.urgency == MessageTray.Urgency.CRITICAL;
 
         let updatedId = notification.connect('updated', () => {
-            message.setSecondaryActor(this._createTimeLabel(notification.datetime));
-            this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.actor.mapped);
+            message.setSecondaryActor(new TimeLabel(notification.datetime));
+            this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.mapped);
         });
         let destroyId = notification.connect('destroy', () => {
             notification.disconnect(destroyId);
@@ -976,7 +1035,7 @@ class NotificationSection extends MessageList.MessageListSection {
         }
 
         let index = isUrgent ? 0 : this._nUrgent;
-        this.addMessageAtIndex(message, index, this.actor.mapped);
+        this.addMessageAtIndex(message, index, this.mapped);
     }
 
     _onSourceDestroy(source, obj) {
@@ -986,25 +1045,23 @@ class NotificationSection extends MessageList.MessageListSection {
         this._sources.delete(source);
     }
 
-    _onMapped() {
-        if (!this.actor.mapped)
-            return;
-
-        for (let message of this._messages.keys())
+    vfunc_map() {
+        this._messages.forEach(message => {
             if (message.notification.urgency != MessageTray.Urgency.CRITICAL)
                 message.notification.acknowledged = true;
+        });
+        super.vfunc_map();
     }
 
     _shouldShow() {
         return !this.empty && isToday(this._date);
     }
-};
-
-var Placeholder = class Placeholder {
-    constructor() {
-        this.actor = new St.BoxLayout({ style_class: 'message-list-placeholder',
-                                        vertical: true });
+});
 
+var Placeholder = GObject.registerClass(
+class Placeholder extends St.BoxLayout {
+    _init() {
+        super._init({ style_class: 'message-list-placeholder', vertical: true });
         this._date = new Date();
 
         let todayFile = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/no-notifications.svg');
@@ -1013,10 +1070,10 @@ var Placeholder = class Placeholder {
         this._otherIcon = new Gio.FileIcon({ file: otherFile });
 
         this._icon = new St.Icon();
-        this.actor.add_actor(this._icon);
+        this.add_actor(this._icon);
 
         this._label = new St.Label();
-        this.actor.add_actor(this._label);
+        this.add_actor(this._label);
 
         this._sync();
     }
@@ -1043,44 +1100,56 @@ var Placeholder = class Placeholder {
             this._label.text = _("No Events");
         }
     }
-};
+});
 
-var CalendarMessageList = class CalendarMessageList {
-    constructor() {
-        this.actor = new St.Widget({ style_class: 'message-list',
-                                     layout_manager: new Clutter.BinLayout(),
-                                     x_expand: true, y_expand: true });
+var CalendarMessageList = GObject.registerClass(
+class CalendarMessageList extends St.Widget {
+    _init() {
+        super._init({
+            style_class: 'message-list',
+            layout_manager: new Clutter.BinLayout(),
+            x_expand: true,
+            y_expand: true,
+        });
 
         this._placeholder = new Placeholder();
-        this.actor.add_actor(this._placeholder.actor);
+        this.add_actor(this._placeholder);
 
         let box = new St.BoxLayout({ vertical: true,
                                      x_expand: true, y_expand: true });
-        this.actor.add_actor(box);
+        this.add_actor(box);
 
-        this._scrollView = new St.ScrollView({ style_class: 'vfade',
-                                               overlay_scrollbars: true,
-                                               x_expand: true, y_expand: true,
-                                               x_fill: true, y_fill: true });
+        this._scrollView = new St.ScrollView({
+            style_class: 'vfade',
+            overlay_scrollbars: true,
+            x_expand: true, y_expand: true,
+        });
         this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
         box.add_actor(this._scrollView);
 
-        this._clearButton = new St.Button({ style_class: 'message-list-clear-button button',
-                                            label: _("Clear"),
-                                            can_focus: true });
-        this._clearButton.set_x_align(Clutter.ActorAlign.END);
+        this._clearButton = new St.Button({
+            style_class: 'message-list-clear-button button',
+            label: _('Clear'),
+            can_focus: true,
+            x_align: Clutter.ActorAlign.END,
+        });
         this._clearButton.connect('clicked', () => {
-            let sections = [...this._sections.keys()];
-            sections.forEach((s) => s.clear());
+            this._sectionList.get_children().forEach(s => s.clear());
         });
         box.add_actor(this._clearButton);
 
+        this._placeholder.bind_property('visible',
+            this._clearButton, 'visible',
+            GObject.BindingFlags.INVERT_BOOLEAN);
+
         this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections',
                                                vertical: true,
+                                               x_expand: true,
                                                y_expand: true,
                                                y_align: Clutter.ActorAlign.START });
+        this._sectionList.connect('actor-added', this._sync.bind(this));
+        this._sectionList.connect('actor-removed', this._sync.bind(this));
         this._scrollView.add_actor(this._sectionList);
-        this._sections = new Map();
 
         this._mediaSection = new Mpris.MediaSection();
         this._addSection(this._mediaSection);
@@ -1095,59 +1164,35 @@ var CalendarMessageList = class CalendarMessageList {
     }
 
     _addSection(section) {
-        let obj = {
-            destroyId: 0,
-            visibleId: 0,
-            emptyChangedId: 0,
-            canClearChangedId: 0,
-            keyFocusId: 0
-        };
-        obj.destroyId = section.actor.connect('destroy', () => {
-            this._removeSection(section);
-        });
-        obj.visibleId = section.actor.connect('notify::visible',
-                                              this._sync.bind(this));
-        obj.emptyChangedId = section.connect('empty-changed',
-                                             this._sync.bind(this));
-        obj.canClearChangedId = section.connect('can-clear-changed',
-                                                this._sync.bind(this));
-        obj.keyFocusId = section.connect('key-focus-in',
-                                         this._onKeyFocusIn.bind(this));
+        let connectionsIds = [];
 
-        this._sections.set(section, obj);
-        this._sectionList.add_actor(section.actor);
-        this._sync();
-    }
+        for (let prop of ['visible', 'empty', 'can-clear']) {
+            connectionsIds.push(
+                section.connect(`notify::${prop}`, this._sync.bind(this)));
+        }
+        connectionsIds.push(section.connect('message-focused', (_s, messageActor) => {
+            Util.ensureActorVisibleInScrollView(this._scrollView, messageActor);
+        }));
 
-    _removeSection(section) {
-        let obj = this._sections.get(section);
-        section.actor.disconnect(obj.destroyId);
-        section.actor.disconnect(obj.visibleId);
-        section.disconnect(obj.emptyChangedId);
-        section.disconnect(obj.canClearChangedId);
-        section.disconnect(obj.keyFocusId);
+        connectionsIds.push(section.connect('destroy', () => {
+            connectionsIds.forEach(id => section.disconnect(id));
+            this._sectionList.remove_actor(section);
+        }));
 
-        this._sections.delete(section);
-        this._sectionList.remove_actor(section.actor);
-        this._sync();
-    }
-
-    _onKeyFocusIn(section, actor) {
-        Util.ensureActorVisibleInScrollView(this._scrollView, actor);
+        this._sectionList.add_actor(section);
     }
 
     _sync() {
-        let sections = [...this._sections.keys()];
+        let sections = this._sectionList.get_children();
         let visible = sections.some(s => s.allowed);
-        this.actor.visible = visible;
+        this.visible = visible;
         if (!visible)
             return;
 
-        let empty = sections.every(s => s.empty || !s.actor.visible);
-        this._placeholder.actor.visible = empty;
-        this._clearButton.visible = !empty;
+        let empty = sections.every(s => s.empty || !s.visible);
+        this._placeholder.visible = empty;
 
-        let canClear = sections.some(s => s.canClear && s.actor.visible);
+        let canClear = sections.some(s => s.canClear && s.visible);
         this._clearButton.reactive = canClear;
     }
 
@@ -1156,8 +1201,7 @@ var CalendarMessageList = class CalendarMessageList {
     }
 
     setDate(date) {
-        for (let section of this._sections.keys())
-            section.setDate(date);
+        this._sectionList.get_children().forEach(s => s.setDate(date));
         this._placeholder.setDate(date);
     }
-};
+});

js/ui/checkBox.js

@@ -1,19 +1,22 @@
 /* exported CheckBox */
-const { Clutter, Pango, St } = imports.gi;
+const { Clutter, GObject, Pango, St } = imports.gi;
 
-var CheckBox = class CheckBox {
-    constructor(label) {
-        let container = new St.BoxLayout();
-        this.actor = new St.Button({ style_class: 'check-box',
-                                     child: container,
-                                     button_mask: St.ButtonMask.ONE,
-                                     toggle_mode: true,
-                                     can_focus: true,
-                                     x_fill: true,
-                                     y_fill: true });
+var CheckBox = GObject.registerClass(
+class CheckBox extends St.Button {
+    _init(label) {
+        let container = new St.BoxLayout({
+            x_expand: true,
+            y_expand: true,
+        });
+        super._init({
+            style_class: 'check-box',
+            child: container,
+            button_mask: St.ButtonMask.ONE,
+            toggle_mode: true,
+            can_focus: true,
+        });
 
-        this._box = new St.Bin();
-        this._box.set_y_align(Clutter.ActorAlign.START);
+        this._box = new St.Bin({ y_align: Clutter.ActorAlign.START });
         container.add_actor(this._box);
 
         this._label = new St.Label();
@@ -32,4 +35,4 @@ var CheckBox = class CheckBox {
     getLabelActor() {
         return this._label;
     }
-};
+});

js/ui/closeDialog.js

@@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported CloseDialog */
 
-const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;
+const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 
 const Dialog = imports.ui.dialog;
 const Main = imports.ui.main;
@@ -13,7 +13,7 @@ var ALIVE_TIMEOUT = 5000;
 var CloseDialog = GObject.registerClass({
     Implements: [Meta.CloseDialog],
     Properties: {
-        'window': GObject.ParamSpec.override('window', Meta.CloseDialog)
+        'window': GObject.ParamSpec.override('window', Meta.CloseDialog),
     },
 }, class CloseDialog extends GObject.Object {
     _init(window) {
@@ -46,6 +46,18 @@ var CloseDialog = GObject.registerClass({
         return new Dialog.MessageDialogContent({ icon, title, subtitle });
     }
 
+    _updateScale() {
+        // Since this is a child of MetaWindowActor (which, for Wayland clients,
+        // applies the geometry scale factor to its children itself, see
+        // meta_window_actor_set_geometry_scale()), make sure we don't apply
+        // the factor twice in the end.
+        if (this._window.get_client_type() !== Meta.WindowClientType.WAYLAND)
+            return;
+
+        let { scaleFactor } = St.ThemeContext.get_for_stage(global.stage);
+        this._dialog.set_scale(1 / scaleFactor, 1 / scaleFactor);
+    }
+
     _initDialog() {
         if (this._dialog)
             return;
@@ -61,9 +73,14 @@ var CloseDialog = GObject.registerClass({
                                  default: true });
         this._dialog.addButton({ label: _('Wait'),
                                  action: this._onWait.bind(this),
-                                 key: Clutter.Escape });
+                                 key: Clutter.KEY_Escape });
 
         global.focus_manager.add_group(this._dialog);
+
+        let themeContext = St.ThemeContext.get_for_stage(global.stage);
+        themeContext.connect('notify::scale-factor', this._updateScale.bind(this));
+
+        this._updateScale();
     }
 
     _addWindowEffect() {
@@ -107,11 +124,12 @@ var CloseDialog = GObject.registerClass({
         if (this._tracked === shouldTrack)
             return;
 
-        if (shouldTrack)
+        if (shouldTrack) {
             Main.layoutManager.trackChrome(this._dialog,
                                            { affectsInputRegion: true });
-        else
+        } else {
             Main.layoutManager.untrackChrome(this._dialog);
+        }
 
         // The buttons are broken when they aren't added to the input region,
         // so disable them properly in that case
@@ -145,14 +163,14 @@ var CloseDialog = GObject.registerClass({
         this._addWindowEffect();
         this._initDialog();
 
-        this._dialog.scale_y = 0;
-        this._dialog.set_pivot_point(0.5, 0.5);
+        this._dialog._dialog.scale_y = 0;
+        this._dialog._dialog.set_pivot_point(0.5, 0.5);
 
-        this._dialog.ease({
+        this._dialog._dialog.ease({
             scale_y: 1,
             mode: Clutter.AnimationMode.LINEAR,
             duration: DIALOG_TRANSITION_TIME,
-            onComplete: this._onFocusChanged.bind(this)
+            onComplete: this._onFocusChanged.bind(this),
         });
     }
 
@@ -175,11 +193,11 @@ var CloseDialog = GObject.registerClass({
         this._dialog = null;
         this._removeWindowEffect();
 
-        dialog.ease({
+        dialog._dialog.ease({
             scale_y: 0,
             mode: Clutter.AnimationMode.LINEAR,
             duration: DIALOG_TRANSITION_TIME,
-            onComplete: () => dialog.destroy()
+            onComplete: () => dialog.destroy(),
         });
     }
 

js/ui/components/automountManager.js

@@ -2,7 +2,6 @@
 /* exported Component */
 
 const { Gio, GLib } = imports.gi;
-const Mainloop = imports.mainloop;
 const Params = imports.misc.params;
 
 const GnomeSession = imports.misc.gnomeSession;
@@ -39,7 +38,7 @@ var AutomountManager = class {
         this._driveDisconnectedId = this._volumeMonitor.connect('drive-disconnected', this._onDriveDisconnected.bind(this));
         this._driveEjectButtonId = this._volumeMonitor.connect('drive-eject-button', this._onDriveEjectButton.bind(this));
 
-        this._mountAllId = Mainloop.idle_add(this._startupMountAll.bind(this));
+        this._mountAllId = GLib.idle_add(GLib.PRIORITY_DEFAULT, this._startupMountAll.bind(this));
         GLib.Source.set_name_by_id(this._mountAllId, '[gnome-shell] this._startupMountAll');
     }
 
@@ -51,7 +50,7 @@ var AutomountManager = class {
         this._volumeMonitor.disconnect(this._driveEjectButtonId);
 
         if (this._mountAllId > 0) {
-            Mainloop.source_remove(this._mountAllId);
+            GLib.source_remove(this._mountAllId);
             this._mountAllId = 0;
         }
     }
@@ -59,9 +58,8 @@ var AutomountManager = class {
     _InhibitorsChanged(_object, _senderName, [_inhibitor]) {
         this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
             (result, error) => {
-                if (!error) {
+                if (!error)
                     this._inhibited = result[0];
-                }
             });
     }
 
@@ -111,7 +109,7 @@ var AutomountManager = class {
         // mount operation object
         if (drive.can_stop()) {
             drive.stop(Gio.MountUnmountFlags.FORCE, null, null,
-                (drive, res) => {
+                (o, res) => {
                     try {
                         drive.stop_finish(res);
                     } catch (e) {
@@ -120,7 +118,7 @@ var AutomountManager = class {
                 });
         } else if (drive.can_eject()) {
             drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null,
-                (drive, res) => {
+                (o, res) => {
                     try {
                         drive.eject_with_operation_finish(res);
                     } catch (e) {
@@ -157,7 +155,7 @@ var AutomountManager = class {
             !volume.should_automount() ||
             !volume.can_mount()) {
             // allow the autorun to run anyway; this can happen if the
-            // mount gets added programmatically later, even if 
+            // mount gets added programmatically later, even if
             // should_automount() or can_mount() are false, like for
             // blank optical media.
             this._allowAutorun(volume);
@@ -220,19 +218,19 @@ var AutomountManager = class {
 
     _onVolumeRemoved(monitor, volume) {
         if (volume._allowAutorunExpireId && volume._allowAutorunExpireId > 0) {
-            Mainloop.source_remove(volume._allowAutorunExpireId);
+            GLib.source_remove(volume._allowAutorunExpireId);
             delete volume._allowAutorunExpireId;
         }
-        this._volumeQueue = 
-            this._volumeQueue.filter(element => (element != volume));
+        this._volumeQueue =
+            this._volumeQueue.filter(element => element != volume);
     }
 
     _reaskPassword(volume) {
         let prevOperation = this._activeOperations.get(volume);
         let existingDialog = prevOperation ? prevOperation.borrowDialog() : null;
-        let operation = 
+        let operation =
             new ShellMountOperation.ShellMountOperation(volume,
-                                                        { existingDialog: existingDialog });
+                                                        { existingDialog });
         this._mountVolume(volume, operation);
     }
 
@@ -249,7 +247,7 @@ var AutomountManager = class {
     }
 
     _allowAutorunExpire(volume) {
-        let id = Mainloop.timeout_add_seconds(AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
+        let id = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
             volume.allowAutorun = false;
             delete volume._allowAutorunExpireId;
             return GLib.SOURCE_REMOVE;

js/ui/components/autorunManager.js

@@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported Component */
 
-const { Gio, St } = imports.gi;
+const { Clutter, Gio, GObject, St } = imports.gi;
 
 const GnomeSession = imports.misc.gnomeSession;
 const Main = imports.ui.main;
@@ -20,7 +20,7 @@ var AutorunSetting = {
     RUN: 0,
     IGNORE: 1,
     FILES: 2,
-    ASK: 3
+    ASK: 3,
 };
 
 // misc utils
@@ -41,7 +41,7 @@ function isMountRootHidden(root) {
     let path = root.get_path();
 
     // skip any mounts in hidden directory hierarchies
-    return (path.includes('/.'));
+    return path.includes('/.');
 }
 
 function isMountNonLocal(mount) {
@@ -52,7 +52,7 @@ function isMountNonLocal(mount) {
     if (volume == null)
         return true;
 
-    return (volume.get_identifier("class") == "network");
+    return volume.get_identifier("class") == "network";
 }
 
 function startAppForMount(app, mount) {
@@ -63,7 +63,7 @@ function startAppForMount(app, mount) {
     files.push(root);
 
     try {
-        retval = app.launch(files, 
+        retval = app.launch(files,
                             global.create_app_launch_context(0, -1));
     } catch (e) {
         log(`Unable to launch the application ${app.get_name()}: ${e}`);
@@ -72,8 +72,6 @@ function startAppForMount(app, mount) {
     return retval;
 }
 
-/******************************************/
-
 const HotplugSnifferIface = loadInterfaceXML('org.gnome.Shell.HotplugSniffer');
 const HotplugSnifferProxy = Gio.DBusProxy.makeProxyWrapper(HotplugSnifferIface);
 function HotplugSniffer() {
@@ -117,16 +115,17 @@ var ContentTypeDiscoverer = class {
 
             let hotplugSniffer = new HotplugSniffer();
             hotplugSniffer.SniffURIRemote(root.get_uri(),
-                 ([contentTypes]) => {
-                     this._emitCallback(mount, contentTypes);
-                 });
+                result => {
+                    [contentTypes] = result;
+                    this._emitCallback(mount, contentTypes);
+                });
         }
     }
 
     _emitCallback(mount, contentTypes = []) {
         // we're not interested in win32 software content types here
         contentTypes = contentTypes.filter(
-            type => (type != 'x-content/win32-software')
+            type => type != 'x-content/win32-software'
         );
 
         let apps = [];
@@ -168,7 +167,7 @@ var AutorunManager = class {
         if (!this._session.SessionIsActive)
             return;
 
-        let discoverer = new ContentTypeDiscoverer((mount, apps, contentTypes) => {
+        let discoverer = new ContentTypeDiscoverer((m, apps, contentTypes) => {
             this._dispatcher.addMount(mount, apps, contentTypes);
         });
         discoverer.guessContentTypes(mount);
@@ -203,7 +202,7 @@ var AutorunDispatcher = class {
     }
 
     _getSourceForMount(mount) {
-        let filtered = this._sources.filter(source => (source.mount == mount));
+        let filtered = this._sources.filter(source => source.mount == mount);
 
         // we always make sure not to add two sources for the same
         // mount in addMount(), so it's safe to assume filtered.length
@@ -215,11 +214,11 @@ var AutorunDispatcher = class {
     }
 
     _addSource(mount, apps) {
-        // if we already have a source showing for this 
+        // if we already have a source showing for this
         // mount, return
         if (this._getSourceForMount(mount))
             return;
-     
+
         // add a new source
         this._sources.push(new AutorunSource(this._manager, mount, apps));
     }
@@ -247,11 +246,10 @@ var AutorunDispatcher = class {
         let success = false;
         let app = null;
 
-        if (setting == AutorunSetting.RUN) {
+        if (setting == AutorunSetting.RUN)
             app = Gio.app_info_get_default_for_type(contentTypes[0], false);
-        } else if (setting == AutorunSetting.FILES) {
+        else if (setting == AutorunSetting.FILES)
             app = Gio.app_info_get_default_for_type('inode/directory', false);
-        }
 
         if (app)
             success = startAppForMount(app, mount);
@@ -264,7 +262,7 @@ var AutorunDispatcher = class {
 
     removeMount(mount) {
         let source = this._getSourceForMount(mount);
-        
+
         // if we aren't tracking this mount, don't do anything
         if (!source)
             return;
@@ -274,9 +272,10 @@ var AutorunDispatcher = class {
     }
 };
 
-var AutorunSource = class extends MessageTray.Source {
-    constructor(manager, mount, apps) {
-        super(mount.get_name());
+var AutorunSource = GObject.registerClass(
+class AutorunSource extends MessageTray.Source {
+    _init(manager, mount, apps) {
+        super._init(mount.get_name());
 
         this._manager = manager;
         this.mount = mount;
@@ -286,7 +285,7 @@ var AutorunSource = class extends MessageTray.Source {
 
         // add ourselves as a source, and popup the notification
         Main.messageTray.add(this);
-        this.notify(this._notification);
+        this.showNotification(this._notification);
     }
 
     getIcon() {
@@ -296,11 +295,12 @@ var AutorunSource = class extends MessageTray.Source {
     _createPolicy() {
         return new MessageTray.NotificationApplicationPolicy('org.gnome.Nautilus');
     }
-};
+});
 
-var AutorunNotification = class extends MessageTray.Notification {
-    constructor(manager, source) {
-        super(source, source.title);
+var AutorunNotification = GObject.registerClass(
+class AutorunNotification extends MessageTray.Notification {
+    _init(manager, source) {
+        super._init(source, source.title);
 
         this._manager = manager;
         this._mount = source.mount;
@@ -320,20 +320,23 @@ var AutorunNotification = class extends MessageTray.Notification {
     }
 
     _buttonForApp(app) {
-        let box = new St.BoxLayout();
+        let box = new St.BoxLayout({
+            x_expand: true,
+            x_align: Clutter.ActorAlign.START,
+        });
         let icon = new St.Icon({ gicon: app.get_icon(),
                                  style_class: 'hotplug-notification-item-icon' });
         box.add(icon);
 
-        let label = new St.Bin({ y_align: St.Align.MIDDLE,
-                                 child: new St.Label
-                                 ({ text: _("Open with %s").format(app.get_name()) })
-                               });
+        let label = new St.Bin({
+            child: new St.Label({
+                text: _("Open with %s").format(app.get_name()),
+                y_align: Clutter.ActorAlign.CENTER,
+            }),
+        });
         box.add(label);
 
         let button = new St.Button({ child: box,
-                                     x_fill: true,
-                                     x_align: St.Align.START,
                                      x_expand: true,
                                      button_mask: St.ButtonMask.ONE,
                                      style_class: 'hotplug-notification-item button' });
@@ -352,6 +355,6 @@ var AutorunNotification = class extends MessageTray.Notification {
         let app = Gio.app_info_get_default_for_type('inode/directory', false);
         startAppForMount(app, this._mount);
     }
-};
+});
 
 var Component = AutorunManager;

js/ui/components/keyring.js

@@ -33,7 +33,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
 
         this._cancelButton = this.addButton({ label: '',
                                               action: this._onCancelButton.bind(this),
-                                              key: Clutter.Escape });
+                                              key: Clutter.KEY_Escape });
         this._continueButton = this.addButton({ label: '',
                                                 action: this._onContinueButton.bind(this),
                                                 default: true });
@@ -54,8 +54,12 @@ class KeyringDialog extends ModalDialog.ModalDialog {
 
     _buildControlTable() {
         let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
-        let table = new St.Widget({ style_class: 'keyring-dialog-control-table',
-                                    layout_manager: layout });
+        let table = new St.Widget({
+            style_class: 'keyring-dialog-control-table',
+            layout_manager: layout,
+            x_expand: true,
+            y_expand: true,
+        });
         layout.hookup_style(table);
         let rtl = table.get_text_direction() == Clutter.TextDirection.RTL;
         let row = 0;
@@ -74,16 +78,18 @@ class KeyringDialog extends ModalDialog.ModalDialog {
             ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
             this._passwordEntry.clutter_text.connect('activate', this._onPasswordActivate.bind(this));
 
-            this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
+            this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, {
+                animate: true,
+            });
 
             if (rtl) {
-                layout.attach(this._workSpinner.actor, 0, row, 1, 1);
+                layout.attach(this._workSpinner, 0, row, 1, 1);
                 layout.attach(this._passwordEntry, 1, row, 1, 1);
                 layout.attach(label, 2, row, 1, 1);
             } else {
                 layout.attach(label, 0, row, 1, 1);
                 layout.attach(this._passwordEntry, 1, row, 1, 1);
-                layout.attach(this._workSpinner.actor, 2, row, 1, 1);
+                layout.attach(this._workSpinner, 2, row, 1, 1);
             }
             row++;
         } else {
@@ -92,9 +98,9 @@ class KeyringDialog extends ModalDialog.ModalDialog {
         }
 
         if (this.prompt.confirm_visible) {
-            var label = new St.Label(({ style_class: 'prompt-dialog-password-label',
-                                        x_align: Clutter.ActorAlign.START,
-                                        y_align: Clutter.ActorAlign.CENTER }));
+            var label = new St.Label({ style_class: 'prompt-dialog-password-label',
+                                       x_align: Clutter.ActorAlign.START,
+                                       y_align: Clutter.ActorAlign.CENTER });
             label.set_text(_("Type again:"));
             this._confirmEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
                                                 text: '',
@@ -121,8 +127,8 @@ class KeyringDialog extends ModalDialog.ModalDialog {
         if (this.prompt.choice_visible) {
             let choice = new CheckBox.CheckBox();
             this.prompt.bind_property('choice-label', choice.getLabelActor(), 'text', GObject.BindingFlags.SYNC_CREATE);
-            this.prompt.bind_property('choice-chosen', choice.actor, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL);
-            layout.attach(choice.actor, rtl ? 0 : 1, row, 1, 1);
+            this.prompt.bind_property('choice-chosen', choice, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL);
+            layout.attach(choice, rtl ? 0 : 1, row, 1, 1);
             row++;
         }
 
@@ -140,7 +146,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
         }
 
         this._controlTable = table;
-        this._content.messageBox.add(table, { x_fill: true, y_fill: true });
+        this._content.messageBox.add_child(table);
     }
 
     _updateSensitivity(sensitive) {
@@ -228,12 +234,14 @@ var KeyringDummyDialog = class {
     }
 };
 
-var KeyringPrompter = class {
-    constructor() {
-        this._prompter = new Gcr.SystemPrompter();
-        this._prompter.connect('new-prompt', () => {
-            let dialog = this._enabled ? new KeyringDialog()
-                                       : new KeyringDummyDialog();
+var KeyringPrompter = GObject.registerClass(
+class KeyringPrompter extends Gcr.SystemPrompter {
+    _init() {
+        super._init();
+        this.connect('new-prompt', () => {
+            let dialog = this._enabled
+                ? new KeyringDialog()
+                : new KeyringDummyDialog();
             this._currentPrompt = dialog.prompt;
             return this._currentPrompt;
         });
@@ -245,7 +253,7 @@ var KeyringPrompter = class {
 
     enable() {
         if (!this._registered) {
-            this._prompter.register(Gio.DBus.session);
+            this.register(Gio.DBus.session);
             this._dbusId = Gio.DBus.session.own_name('org.gnome.keyring.SystemPrompter',
                                                      Gio.BusNameOwnerFlags.ALLOW_REPLACEMENT, null, null);
             this._registered = true;
@@ -256,10 +264,10 @@ var KeyringPrompter = class {
     disable() {
         this._enabled = false;
 
-        if (this._prompter.prompting)
+        if (this.prompting)
             this._currentPrompt.cancel();
         this._currentPrompt = null;
     }
-};
+});
 
 var Component = KeyringPrompter;

js/ui/components/networkAgent.js

@@ -56,7 +56,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
 
             secret.entry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
                                           text: secret.value, can_focus: reactive,
-                                          reactive: reactive,
+                                          reactive,
                                           x_expand: true });
             ShellEntry.addContextMenu(secret.entry,
                                       { isPassword: secret.password });
@@ -106,22 +106,20 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
             descriptionLabel.clutter_text.line_wrap = true;
             descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
 
-            contentBox.messageBox.add(descriptionLabel,
-                                      { y_fill: true,
-                                        y_align: St.Align.START,
-                                        expand: true });
+            contentBox.messageBox.add_child(descriptionLabel);
         }
 
-        this._okButton = { label: _("Connect"),
-                           action: this._onOk.bind(this),
-                           default: true
-                         };
+        this._okButton = {
+            label: _("Connect"),
+            action: this._onOk.bind(this),
+            default: true,
+        };
 
-        this.setButtons([{ label: _("Cancel"),
-                           action: this.cancel.bind(this),
-                           key: Clutter.KEY_Escape,
-                         },
-                         this._okButton]);
+        this.setButtons([{
+            label: _("Cancel"),
+            action: this.cancel.bind(this),
+            key: Clutter.KEY_Escape,
+        }, this._okButton]);
 
         this._updateOkButton();
     }
@@ -163,15 +161,15 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
         if (value.length == 64) {
             // must be composed of hexadecimal digits only
             for (let i = 0; i < 64; i++) {
-                if (!((value[i] >= 'a' && value[i] <= 'f')
-                      || (value[i] >= 'A' && value[i] <= 'F')
-                      || (value[i] >= '0' && value[i] <= '9')))
+                if (!((value[i] >= 'a' && value[i] <= 'f') ||
+                      (value[i] >= 'A' && value[i] <= 'F') ||
+                      (value[i] >= '0' && value[i] <= '9')))
                     return false;
             }
             return true;
         }
 
-        return (value.length >= 8 && value.length <= 63);
+        return value.length >= 8 && value.length <= 63;
     }
 
     _validateStaticWep(secret) {
@@ -179,15 +177,15 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
         if (secret.wep_key_type == NM.WepKeyType.KEY) {
             if (value.length == 10 || value.length == 26) {
                 for (let i = 0; i < value.length; i++) {
-                    if (!((value[i] >= 'a' && value[i] <= 'f')
-                          || (value[i] >= 'A' && value[i] <= 'F')
-                          || (value[i] >= '0' && value[i] <= '9')))
+                    if (!((value[i] >= 'a' && value[i] <= 'f') ||
+                          (value[i] >= 'A' && value[i] <= 'F') ||
+                          (value[i] >= '0' && value[i] <= '9')))
                         return false;
                 }
             } else if (value.length == 5 || value.length == 13) {
                 for (let i = 0; i < value.length; i++) {
-                    if (!((value[i] >= 'a' && value[i] <= 'z')
-                          || (value[i] >= 'A' && value[i] <= 'Z')))
+                    if (!((value[i] >= 'a' && value[i] <= 'z') ||
+                          (value[i] >= 'A' && value[i] <= 'Z')))
                         return false;
                 }
             } else {
@@ -212,6 +210,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
         // First the easy ones
         case 'wpa-none':
         case 'wpa-psk':
+        case 'sae':
             secrets.push({ label: _("Password: "), key: 'psk',
                            value: wirelessSecuritySetting.psk || '',
                            validate: this._validateWpaPsk, password: true });
@@ -223,11 +222,12 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
                            validate: this._validateStaticWep, password: true });
             break;
         case 'ieee8021x':
-            if (wirelessSecuritySetting.auth_alg == 'leap') // Cisco LEAP
+            if (wirelessSecuritySetting.auth_alg == 'leap') { // Cisco LEAP
                 secrets.push({ label: _("Password: "), key: 'leap-password',
                                value: wirelessSecuritySetting.leap_password || '', password: true });
-            else // Dynamic (IEEE 802.1x) WEP
+            } else { // Dynamic (IEEE 802.1x) WEP
                 this._get8021xSecrets(secrets);
+            }
             break;
         case 'wpa-eap':
             this._get8021xSecrets(secrets);
@@ -242,15 +242,18 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
 
         /* If hints were given we know exactly what we need to ask */
         if (this._settingName == "802-1x" && this._hints.length) {
-            if (this._hints.includes('identity'))
+            if (this._hints.includes('identity')) {
                 secrets.push({ label: _("Username: "), key: 'identity',
                                value: ieee8021xSetting.identity || '', password: false });
-            if (this._hints.includes('password'))
+            }
+            if (this._hints.includes('password')) {
                 secrets.push({ label: _("Password: "), key: 'password',
                                value: ieee8021xSetting.password || '', password: true });
-            if (this._hints.includes('private-key-password'))
+            }
+            if (this._hints.includes('private-key-password')) {
                 secrets.push({ label: _("Private key password: "), key: 'private-key-password',
                                value: ieee8021xSetting.private_key_password || '', password: true });
+            }
             return;
         }
 
@@ -551,11 +554,12 @@ var VPNRequestHandler = class {
                 let shouldAsk = keyfile.get_boolean(groups[i], 'ShouldAsk');
 
                 if (shouldAsk) {
-                    contentOverride.secrets.push({ label: keyfile.get_string(groups[i], 'Label'),
-                                                   key: groups[i],
-                                                   value: value,
-                                                   password: keyfile.get_boolean(groups[i], 'IsSecret')
-                                                 });
+                    contentOverride.secrets.push({
+                        label: keyfile.get_string(groups[i], 'Label'),
+                        key: groups[i],
+                        value,
+                        password: keyfile.get_boolean(groups[i], 'IsSecret'),
+                    });
                 } else {
                     if (!value.length) // Ignore empty secrets
                         continue;
@@ -609,10 +613,11 @@ Signals.addSignalMethods(VPNRequestHandler.prototype);
 
 var NetworkAgent = class {
     constructor() {
-        this._native = new Shell.NetworkAgent({ identifier: 'org.gnome.Shell.NetworkAgent',
-                                                capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
-                                                auto_register: false
-                                              });
+        this._native = new Shell.NetworkAgent({
+            identifier: 'org.gnome.Shell.NetworkAgent',
+            capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
+            auto_register: false,
+        });
 
         this._dialogs = { };
         this._vpnRequests = { };
@@ -621,7 +626,7 @@ var NetworkAgent = class {
         this._pluginDir = Gio.file_new_for_path(Config.VPNDIR);
         try {
             let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null);
-            monitor.connect('changed', () => this._vpnCacheBuilt = false);
+            monitor.connect('changed', () => (this._vpnCacheBuilt = false));
         } catch (e) {
             log(`Failed to create monitor for VPN plugin dir: ${e.message}`);
         }
@@ -730,7 +735,7 @@ var NetworkAgent = class {
         });
 
         Main.messageTray.add(source);
-        source.notify(notification);
+        source.showNotification(notification);
     }
 
     _newRequest(agent, requestId, connection, settingName, hints, flags) {

js/ui/components/polkitAgent.js

@@ -11,12 +11,19 @@ const ModalDialog = imports.ui.modalDialog;
 const ShellEntry = imports.ui.shellEntry;
 const UserWidget = imports.ui.userWidget;
 
+const DialogMode = {
+    AUTH: 0,
+    CONFIRM: 1,
+};
+
 var DIALOG_ICON_SIZE = 48;
 
 var WORK_SPINNER_ICON_SIZE = 16;
 
+const DELAYED_RESET_TIMEOUT = 200;
+
 var AuthenticationDialog = GObject.registerClass({
-    Signals: { 'done': { param_types: [GObject.TYPE_BOOLEAN] } }
+    Signals: { 'done': { param_types: [GObject.TYPE_BOOLEAN] } },
 }, class AuthenticationDialog extends ModalDialog.ModalDialog {
     _init(actionId, body, cookie, userNames) {
         super._init({ styleClass: 'prompt-dialog' });
@@ -24,7 +31,6 @@ var AuthenticationDialog = GObject.registerClass({
         this.actionId = actionId;
         this.message = body;
         this.userNames = userNames;
-        this._wasDismissed = false;
 
         this._sessionUpdatedId = Main.sessionMode.connect('updated', () => {
             this.visible = !Main.sessionMode.isLocked;
@@ -51,70 +57,63 @@ var AuthenticationDialog = GObject.registerClass({
             userName = userNames[0];
 
         this._user = AccountsService.UserManager.get_default().get_user(userName);
-        let userRealName = this._user.get_real_name();
-        this._userLoadedId = this._user.connect('notify::is_loaded',
-                                                this._onUserChanged.bind(this));
-        this._userChangedId = this._user.connect('changed',
-                                                 this._onUserChanged.bind(this));
 
-        // Special case 'root'
-        let userIsRoot = false;
-        if (userName == 'root') {
-            userIsRoot = true;
-            userRealName = _("Administrator");
-        }
+        let userBox = new St.BoxLayout({
+            style_class: 'polkit-dialog-user-layout',
+            vertical: false,
+        });
+        content.messageBox.add(userBox);
 
-        if (userIsRoot) {
-            let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-root-label',
-                                            text: userRealName }));
-            content.messageBox.add(userLabel, { x_fill: false,
-                                                x_align: St.Align.START });
-        } else {
-            let userBox = new St.BoxLayout({ style_class: 'polkit-dialog-user-layout',
-                                             vertical: false });
-            content.messageBox.add(userBox);
-            this._userAvatar = new UserWidget.Avatar(this._user,
-                                                     { iconSize: DIALOG_ICON_SIZE,
-                                                       styleClass: 'polkit-dialog-user-icon' });
-            this._userAvatar.actor.hide();
-            userBox.add(this._userAvatar.actor,
-                        { x_fill: true,
-                          y_fill: false,
-                          x_align: St.Align.END,
-                          y_align: St.Align.START });
-            let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label',
-                                            text: userRealName }));
-            userBox.add(userLabel,
-                        { x_fill: true,
-                          y_fill: false,
-                          x_align: St.Align.END,
-                          y_align: St.Align.MIDDLE });
-        }
+        this._userAvatar = new UserWidget.Avatar(this._user, {
+            iconSize: DIALOG_ICON_SIZE,
+            styleClass: 'polkit-dialog-user-icon',
+        });
+        userBox.add_child(this._userAvatar);
 
-        this._onUserChanged();
+        this._userLabel = new St.Label({
+            style_class: userName === 'root'
+                ? 'polkit-dialog-user-root-label'
+                : 'polkit-dialog-user-label',
+            x_expand: true,
+            y_align: Clutter.ActorAlign.CENTER,
+        });
+
+        if (userName === 'root')
+            this._userLabel.text = _('Administrator');
+
+        userBox.add_child(this._userLabel);
 
         this._passwordBox = new St.BoxLayout({ vertical: false, style_class: 'prompt-dialog-password-box' });
         content.messageBox.add(this._passwordBox);
-        this._passwordLabel = new St.Label(({ style_class: 'prompt-dialog-password-label' }));
-        this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE });
-        this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
-                                             text: "",
-                                             can_focus: true });
+        this._passwordLabel = new St.Label({
+            style_class: 'prompt-dialog-password-label',
+            y_align: Clutter.ActorAlign.CENTER,
+        });
+        this._passwordBox.add_child(this._passwordLabel);
+        this._passwordEntry = new St.Entry({
+            style_class: 'prompt-dialog-password-entry',
+            text: "",
+            can_focus: true,
+            x_expand: true,
+        });
         ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
         this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this));
-        this._passwordBox.add(this._passwordEntry,
-                              { expand: true });
+        this._passwordEntry.bind_property('reactive',
+            this._passwordEntry.clutter_text, 'editable',
+            GObject.BindingFlags.SYNC_CREATE);
+        this._passwordBox.add_child(this._passwordEntry);
 
-        this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
-        this._passwordBox.add(this._workSpinner.actor);
+        this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, {
+            animate: true,
+        });
+        this._passwordBox.add(this._workSpinner);
 
-        this.setInitialKeyFocus(this._passwordEntry);
         this._passwordBox.hide();
 
         this._errorMessageLabel = new St.Label({ style_class: 'prompt-dialog-error-label' });
         this._errorMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
         this._errorMessageLabel.clutter_text.line_wrap = true;
-        content.messageBox.add(this._errorMessageLabel, { x_fill: false, x_align: St.Align.START });
+        content.messageBox.add_child(this._errorMessageLabel);
         this._errorMessageLabel.hide();
 
         this._infoMessageLabel = new St.Label({ style_class: 'prompt-dialog-info-label' });
@@ -137,15 +136,30 @@ var AuthenticationDialog = GObject.registerClass({
 
         this._cancelButton = this.addButton({ label: _("Cancel"),
                                               action: this.cancel.bind(this),
-                                              key: Clutter.Escape });
+                                              key: Clutter.KEY_Escape });
         this._okButton = this.addButton({ label: _("Authenticate"),
                                           action: this._onAuthenticateButtonPressed.bind(this),
-                                          default: true });
+                                          reactive: false });
+        this._okButton.bind_property('reactive',
+            this._okButton, 'can-focus',
+            GObject.BindingFlags.SYNC_CREATE);
+
+        this._passwordEntry.clutter_text.connect('text-changed', text => {
+            this._okButton.reactive = text.get_text().length > 0;
+        });
 
         this._doneEmitted = false;
 
+        this._mode = -1;
+
         this._identityToAuth = Polkit.UnixUser.new_for_name(userName);
         this._cookie = cookie;
+
+        this._userLoadedId = this._user.connect('notify::is-loaded',
+            this._onUserChanged.bind(this));
+        this._userChangedId = this._user.connect('changed',
+            this._onUserChanged.bind(this));
+        this._onUserChanged();
     }
 
     _setWorking(working) {
@@ -155,8 +169,9 @@ var AuthenticationDialog = GObject.registerClass({
             this._workSpinner.stop();
     }
 
-    performAuthentication() {
-        this._destroySession();
+    _initiateSession() {
+        this._destroySession(DELAYED_RESET_TIMEOUT);
+
         this._session = new PolkitAgent.Session({ identity: this._identityToAuth,
                                                   cookie: this._cookie });
         this._sessionCompletedId = this._session.connect('completed', this._onSessionCompleted.bind(this));
@@ -195,18 +210,15 @@ var AuthenticationDialog = GObject.registerClass({
         }
     }
 
-    _updateSensitivity(sensitive) {
-        this._passwordEntry.reactive = sensitive;
-        this._passwordEntry.clutter_text.editable = sensitive;
-
-        this._okButton.can_focus = sensitive;
-        this._okButton.reactive = sensitive;
-        this._setWorking(!sensitive);
-    }
-
     _onEntryActivate() {
         let response = this._passwordEntry.get_text();
-        this._updateSensitivity(false);
+        if (response.length === 0)
+            return;
+
+        this._passwordEntry.reactive = false;
+        this._okButton.reactive = false;
+        this._setWorking(true);
+
         this._session.response(response);
         // When the user responds, dismiss already shown info and
         // error texts (if any)
@@ -216,7 +228,10 @@ var AuthenticationDialog = GObject.registerClass({
     }
 
     _onAuthenticateButtonPressed() {
-        this._onEntryActivate();
+        if (this._mode === DialogMode.CONFIRM)
+            this._initiateSession();
+        else
+            this._onEntryActivate();
     }
 
     _onSessionCompleted(session, gainedAuthorization) {
@@ -235,7 +250,7 @@ var AuthenticationDialog = GObject.registerClass({
              * error providing authentication-method specific information),
              * show "Sorry, that didn't work. Please try again."
              */
-            if (!this._errorMessageLabel.visible && !this._wasDismissed) {
+            if (!this._errorMessageLabel.visible) {
                 /* Translators: "that didn't work" refers to the fact that the
                  * requested authentication was not gained; this can happen
                  * because of an authentication error (like invalid password),
@@ -247,11 +262,16 @@ var AuthenticationDialog = GObject.registerClass({
             }
 
             /* Try and authenticate again */
-            this.performAuthentication();
+            this._initiateSession();
         }
     }
 
     _onSessionRequest(session, request, echoOn) {
+        if (this._sessionRequestTimeoutId) {
+            GLib.source_remove(this._sessionRequestTimeoutId);
+            this._sessionRequestTimeoutId = 0;
+        }
+
         // Cheap localization trick
         if (request == 'Password:' || request == 'Password: ')
             this._passwordLabel.set_text(_("Password:"));
@@ -265,9 +285,12 @@ var AuthenticationDialog = GObject.registerClass({
 
         this._passwordBox.show();
         this._passwordEntry.set_text('');
-        this._passwordEntry.grab_key_focus();
-        this._updateSensitivity(true);
+        this._passwordEntry.reactive  = true;
+        this._okButton.reactive = false;
+        this._setWorking(false);
+
         this._ensureOpen();
+        this._passwordEntry.grab_key_focus();
     }
 
     _onSessionShowError(session, text) {
@@ -288,29 +311,78 @@ var AuthenticationDialog = GObject.registerClass({
         this._ensureOpen();
     }
 
-    _destroySession() {
+    _destroySession(delay = 0) {
         if (this._session) {
-            if (!this._completed)
-                this._session.cancel();
-            this._completed = false;
-
             this._session.disconnect(this._sessionCompletedId);
             this._session.disconnect(this._sessionRequestId);
             this._session.disconnect(this._sessionShowErrorId);
             this._session.disconnect(this._sessionShowInfoId);
+
+            if (!this._completed)
+                this._session.cancel();
+
+            this._completed = false;
             this._session = null;
         }
+
+        if (this._sessionRequestTimeoutId) {
+            GLib.source_remove(this._sessionRequestTimeoutId);
+            this._sessionRequestTimeoutId = 0;
+        }
+
+        let resetDialog = () => {
+            if (this.state != ModalDialog.State.OPENED)
+                return;
+
+            this._passwordBox.hide();
+            this._cancelButton.grab_key_focus();
+            this._okButton.reactive = false;
+        };
+
+        if (delay) {
+            this._sessionRequestTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, delay, resetDialog);
+            GLib.Source.set_name_by_id(this._sessionRequestTimeoutId, '[gnome-shell] this._sessionRequestTimeoutId');
+        } else {
+            resetDialog();
+        }
     }
 
     _onUserChanged() {
-        if (this._user.is_loaded && this._userAvatar) {
-            this._userAvatar.update();
-            this._userAvatar.actor.show();
+        if (!this._user.is_loaded)
+            return;
+
+        let userName = this._user.get_user_name();
+        let realName = this._user.get_real_name();
+
+        if (userName !== 'root')
+            this._userLabel.set_text(realName);
+
+        this._userAvatar.update();
+
+        if (this._user.get_password_mode() === AccountsService.UserPasswordMode.NONE) {
+            if (this._mode === DialogMode.CONFIRM)
+                return;
+
+            this._mode = DialogMode.CONFIRM;
+            this._destroySession();
+
+            this._okButton.reactive = true;
+
+            /* We normally open the dialog when we get a "request" signal, but
+             * since in this case initiating a session would perform the
+             * authentication, only open the dialog and initiate the session
+             * when the user confirmed. */
+            this._ensureOpen();
+        } else {
+            if (this._mode === DialogMode.AUTH)
+                return;
+
+            this._mode = DialogMode.AUTH;
+            this._initiateSession();
         }
     }
 
     cancel() {
-        this._wasDismissed = true;
         this.close(global.get_current_time());
         this._emitDone(true);
     }
@@ -318,7 +390,10 @@ var AuthenticationDialog = GObject.registerClass({
     _onDialogClosed() {
         if (this._sessionUpdatedId)
             Main.sessionMode.disconnect(this._sessionUpdatedId);
-        this._sessionUpdatedId = 0;
+
+        if (this._sessionRequestTimeoutId)
+            GLib.source_remove(this._sessionRequestTimeoutId);
+        this._sessionRequestTimeoutId = 0;
 
         if (this._user) {
             this._user.disconnect(this._userLoadedId);
@@ -330,19 +405,20 @@ var AuthenticationDialog = GObject.registerClass({
     }
 });
 
-var AuthenticationAgent = class {
-    constructor() {
+var AuthenticationAgent = GObject.registerClass(
+class AuthenticationAgent extends Shell.PolkitAuthenticationAgent {
+    _init() {
+        super._init();
+
         this._currentDialog = null;
-        this._handle = null;
-        this._native = new Shell.PolkitAuthenticationAgent();
-        this._native.connect('initiate', this._onInitiate.bind(this));
-        this._native.connect('cancel', this._onCancel.bind(this));
+        this.connect('initiate', this._onInitiate.bind(this));
+        this.connect('cancel', this._onCancel.bind(this));
         this._sessionUpdatedId = 0;
     }
 
     enable() {
         try {
-            this._native.register();
+            this.register();
         } catch (e) {
             log('Failed to register AuthenticationAgent');
         }
@@ -350,7 +426,7 @@ var AuthenticationAgent = class {
 
     disable() {
         try {
-            this._native.unregister();
+            this.unregister();
         } catch (e) {
             log('Failed to unregister AuthenticationAgent');
         }
@@ -369,19 +445,7 @@ var AuthenticationAgent = class {
         }
 
         this._currentDialog = new AuthenticationDialog(actionId, message, cookie, userNames);
-
-        // We actually don't want to open the dialog until we know for
-        // sure that we're going to interact with the user. For
-        // example, if the password for the identity to auth is blank
-        // (which it will be on a live CD) then there will be no
-        // conversation at all... of course, we don't *know* that
-        // until we actually try it.
-        //
-        // See https://bugzilla.gnome.org/show_bug.cgi?id=643062 for more
-        // discussion.
-
         this._currentDialog.connect('done', this._onDialogDone.bind(this));
-        this._currentDialog.performAuthentication();
     }
 
     _onCancel(_nativeAgent) {
@@ -400,8 +464,8 @@ var AuthenticationAgent = class {
             Main.sessionMode.disconnect(this._sessionUpdatedId);
         this._sessionUpdatedId = 0;
 
-        this._native.complete(dismissed);
+        this.complete(dismissed);
     }
-};
+});
 
 var Component = AuthenticationAgent;

js/ui/components/telepathyClient.js

@@ -3,7 +3,6 @@
 
 const { Clutter, Gio, GLib, GObject, St } = imports.gi;
 const Lang = imports.lang;
-const Mainloop = imports.mainloop;
 
 var Tpl = null;
 var Tp = null;
@@ -20,7 +19,7 @@ const MessageTray = imports.ui.messageTray;
 const Params = imports.misc.params;
 const Util = imports.misc.util;
 
-const HAVE_TP = (Tp != null && Tpl != null);
+const HAVE_TP = Tp != null && Tpl != null;
 
 // See Notification.appendMessage
 var SCROLLBACK_IMMEDIATE_TIME = 3 * 60; // 3 minutes
@@ -38,7 +37,7 @@ var CHAT_EXPAND_LINES = 12;
 
 var NotificationDirection = {
     SENT: 'chat-sent',
-    RECEIVED: 'chat-received'
+    RECEIVED: 'chat-received',
 };
 
 function makeMessageFromTpMessage(tpMessage, direction) {
@@ -50,10 +49,10 @@ function makeMessageFromTpMessage(tpMessage, direction) {
 
     return {
         messageType: tpMessage.get_message_type(),
-        text: text,
+        text,
         sender: tpMessage.sender.alias,
-        timestamp: timestamp,
-        direction: direction
+        timestamp,
+        direction,
     };
 }
 
@@ -67,7 +66,7 @@ function makeMessageFromTplEvent(event) {
         text: event.get_message(),
         sender: event.get_sender().get_alias(),
         timestamp: event.get_timestamp(),
-        direction: direction
+        direction,
     };
 }
 
@@ -159,7 +158,7 @@ class TelepathyClient extends Tp.BaseClient {
                 continue;
 
             /* Only observe contact text channels */
-            if ((!(channel instanceof Tp.TextChannel)) ||
+            if (!(channel instanceof Tp.TextChannel) ||
                targetHandleType != Tp.HandleType.CONTACT)
                 continue;
 
@@ -216,7 +215,7 @@ class TelepathyClient extends Tp.BaseClient {
                 // We are already handling the channel, display the source
                 let source = this._chatSources[channel.get_object_path()];
                 if (source)
-                    source.notify();
+                    source.showNotification();
             }
         }
     }
@@ -232,11 +231,12 @@ class TelepathyClient extends Tp.BaseClient {
             return;
         }
 
-        if (chanType == Tp.IFACE_CHANNEL_TYPE_TEXT)
+        if (chanType == Tp.IFACE_CHANNEL_TYPE_TEXT) {
             this._approveTextChannel(account, conn, channel, dispatchOp, context);
-        else
+        } else {
             context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
                                         message: 'Unsupported channel type' }));
+        }
     }
 
     _approveTextChannel(account, conn, channel, dispatchOp, context) {
@@ -249,7 +249,7 @@ class TelepathyClient extends Tp.BaseClient {
         }
 
         // Approve private text channels right away as we are going to handle it
-        dispatchOp.claim_with_async(this, (dispatchOp, result) => {
+        dispatchOp.claim_with_async(this, (o, result) => {
             try {
                 dispatchOp.claim_with_finish(result);
                 this._handlingChannels(account, conn, [channel], false);
@@ -267,9 +267,10 @@ class TelepathyClient extends Tp.BaseClient {
     }
 }) : null;
 
-var ChatSource = class extends MessageTray.Source {
-    constructor(account, conn, channel, contact, client) {
-        super(contact.get_alias());
+var ChatSource = HAVE_TP ? GObject.registerClass(
+class ChatSource extends MessageTray.Source {
+    _init(account, conn, channel, contact, client) {
+        super._init(contact.get_alias());
 
         this._account = account;
         this._contact = contact;
@@ -327,7 +328,7 @@ var ChatSource = class extends MessageTray.Source {
 
         // We ack messages when the user expands the new notification
         let id = this._banner.connect('expanded', this._ackMessages.bind(this));
-        this._banner.actor.connect('destroy', () => {
+        this._banner.connect('destroy', () => {
             this._banner.disconnect(id);
             this._banner = null;
         });
@@ -349,11 +350,10 @@ var ChatSource = class extends MessageTray.Source {
 
     getIcon() {
         let file = this._contact.get_avatar_file();
-        if (file) {
-            return new Gio.FileIcon({ file: file });
-        } else {
+        if (file)
+            return new Gio.FileIcon({ file });
+        else
             return new Gio.ThemedIcon({ name: 'avatar-default' });
-        }
     }
 
     getSecondaryIcon() {
@@ -387,10 +387,11 @@ var ChatSource = class extends MessageTray.Source {
 
     _updateAvatarIcon() {
         this.iconUpdated();
-        if (this._notifiction)
+        if (this._notifiction) {
             this._notification.update(this._notification.title,
                                       this._notification.bannerBodyText,
                                       { gicon: this.getIcon() });
+        }
     }
 
     open() {
@@ -477,7 +478,7 @@ var ChatSource = class extends MessageTray.Source {
             this._notification.appendMessage(pendingMessages[i], true);
 
         if (pendingMessages.length > 0)
-            this.notify();
+            this.showNotification();
     }
 
     destroy(reason) {
@@ -546,15 +547,15 @@ var ChatSource = class extends MessageTray.Source {
         // Wait a bit before notifying for the received message, a handler
         // could ack it in the meantime.
         if (this._notifyTimeoutId != 0)
-            Mainloop.source_remove(this._notifyTimeoutId);
-        this._notifyTimeoutId = Mainloop.timeout_add(500,
+            GLib.source_remove(this._notifyTimeoutId);
+        this._notifyTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500,
             this._notifyTimeout.bind(this));
         GLib.Source.set_name_by_id(this._notifyTimeoutId, '[gnome-shell] this._notifyTimeout');
     }
 
     _notifyTimeout() {
         if (this._pendingMessages.length != 0)
-            this.notify();
+            this.showNotification();
 
         this._notifyTimeoutId = 0;
 
@@ -569,8 +570,8 @@ var ChatSource = class extends MessageTray.Source {
         this._notification.appendMessage(message);
     }
 
-    notify() {
-        super.notify(this._notification);
+    showNotification() {
+        super.showNotification(this._notification);
     }
 
     respond(text) {
@@ -584,7 +585,7 @@ var ChatSource = class extends MessageTray.Source {
 
         let msg = Tp.ClientMessage.new_text(type, text);
         this._channel.send_message_async(msg, 0, (src, result) => {
-            this._channel.send_message_finish(result); 
+            this._channel.send_message_finish(result);
         });
     }
 
@@ -602,10 +603,11 @@ var ChatSource = class extends MessageTray.Source {
     }
 
     _presenceChanged(_contact, _presence, _status, _message) {
-        if (this._notification)
+        if (this._notification) {
             this._notification.update(this._notification.title,
                                       this._notification.bannerBodyText,
                                       { secondaryGIcon: this.getSecondaryIcon() });
+        }
     }
 
     _pendingRemoved(channel, message) {
@@ -626,12 +628,18 @@ var ChatSource = class extends MessageTray.Source {
         // 'pending-message-removed' for each one.
         this._channel.ack_all_pending_messages_async(null);
     }
-};
+}) : null;
 
-var ChatNotification = class extends MessageTray.Notification {
-    constructor(source) {
-        super(source, source.title, null,
-              { secondaryGIcon: source.getSecondaryIcon() });
+var ChatNotification = HAVE_TP ? GObject.registerClass({
+    Signals: {
+        'message-removed': { param_types: [Tp.Message.$gtype] },
+        'message-added': { param_types: [Tp.Message.$gtype] },
+        'timestamp-changed': { param_types: [Tp.Message.$gtype] },
+    },
+}, class ChatNotification extends MessageTray.Notification {
+    _init(source) {
+        super._init(source, source.title, null,
+            { secondaryGIcon: source.getSecondaryIcon() });
         this.setUrgency(MessageTray.Urgency.HIGH);
         this.setResident(true);
 
@@ -641,23 +649,23 @@ var ChatNotification = class extends MessageTray.Notification {
 
     destroy(reason) {
         if (this._timestampTimeoutId)
-            Mainloop.source_remove(this._timestampTimeoutId);
+            GLib.source_remove(this._timestampTimeoutId);
         this._timestampTimeoutId = 0;
         super.destroy(reason);
     }
 
     /**
      * appendMessage:
-     * @message: An object with the properties:
-     *   text: the body of the message,
-     *   messageType: a #Tp.ChannelTextMessageType,
-     *   sender: the name of the sender,
-     *   timestamp: the time the message was sent
-     *   direction: a #NotificationDirection
-     * 
-     * @noTimestamp: Whether to add a timestamp. If %true, no timestamp
-     *   will be added, regardless of the difference since the
-     *   last timestamp
+     * @param {Object} message: An object with the properties
+     *   {string} message.text: the body of the message,
+     *   {Tp.ChannelTextMessageType} message.messageType: the type
+     *   {string} message.sender: the name of the sender,
+     *   {number} message.timestamp: the time the message was sent
+     *   {NotificationDirection} message.direction: a #NotificationDirection
+     *
+     * @param {bool} noTimestamp: Whether to add a timestamp. If %true,
+     *   no timestamp will be added, regardless of the difference since
+     *   the last timestamp
      */
     appendMessage(message, noTimestamp) {
         let messageBody = GLib.markup_escape_text(message.text, -1);
@@ -669,19 +677,20 @@ var ChatNotification = class extends MessageTray.Notification {
             styles.push('chat-action');
         }
 
-        if (message.direction == NotificationDirection.RECEIVED)
+        if (message.direction == NotificationDirection.RECEIVED) {
             this.update(this.source.title, messageBody,
-                        { datetime: GLib.DateTime.new_from_unix_local (message.timestamp),
+                        { datetime: GLib.DateTime.new_from_unix_local(message.timestamp),
                           bannerMarkup: true });
+        }
 
-        let group = (message.direction == NotificationDirection.RECEIVED ?
-                     'received' : 'sent');
+        let group = message.direction == NotificationDirection.RECEIVED
+            ? 'received' : 'sent';
 
         this._append({ body: messageBody,
-                       group: group,
-                       styles: styles,
+                       group,
+                       styles,
                        timestamp: message.timestamp,
-                       noTimestamp: noTimestamp });
+                       noTimestamp });
     }
 
     _filterMessages() {
@@ -689,7 +698,7 @@ var ChatNotification = class extends MessageTray.Notification {
             return;
 
         let lastMessageTime = this.messages[0].timestamp;
-        let currentTime = (Date.now() / 1000);
+        let currentTime = Date.now() / 1000;
 
         // Keep the scrollback from growing too long. If the most
         // recent message (before the one we just added) is within
@@ -697,8 +706,8 @@ var ChatNotification = class extends MessageTray.Notification {
         // SCROLLBACK_RECENT_LENGTH previous messages. Otherwise
         // we'll keep SCROLLBACK_IDLE_LENGTH messages.
 
-        let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) ?
-            SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
+        let maxLength = lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME
+            ? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
 
         let filteredHistory = this.messages.filter(item => item.realMessage);
         if (filteredHistory.length > maxLength) {
@@ -711,16 +720,16 @@ var ChatNotification = class extends MessageTray.Notification {
 
     /**
      * _append:
-     * @props: An object with the properties:
-     *  body: The text of the message.
-     *  group: The group of the message, one of:
+     * @param {Object} props: An object with the properties:
+     *  {string} props.body: The text of the message.
+     *  {string} props.group: The group of the message, one of:
      *         'received', 'sent', 'meta'.
-     *  styles: Style class names for the message to have.
-     *  timestamp: The timestamp of the message.
-     *  noTimestamp: suppress timestamp signal?
+     *  {string[]} props.styles: Style class names for the message to have.
+     *  {number} props.timestamp: The timestamp of the message.
+     *  {bool} props.noTimestamp: suppress timestamp signal?
      */
     _append(props) {
-        let currentTime = (Date.now() / 1000);
+        let currentTime = Date.now() / 1000;
         props = Params.parse(props, { body: null,
                                       group: null,
                                       styles: [],
@@ -729,7 +738,7 @@ var ChatNotification = class extends MessageTray.Notification {
 
         // Reset the old message timeout
         if (this._timestampTimeoutId)
-            Mainloop.source_remove(this._timestampTimeoutId);
+            GLib.source_remove(this._timestampTimeoutId);
         this._timestampTimeoutId = 0;
 
         let message = { realMessage: props.group != 'meta',
@@ -747,7 +756,8 @@ var ChatNotification = class extends MessageTray.Notification {
             } else {
                 // Schedule a new timestamp in SCROLLBACK_IMMEDIATE_TIME
                 // from the timestamp of the message.
-                this._timestampTimeoutId = Mainloop.timeout_add_seconds(
+                this._timestampTimeoutId = GLib.timeout_add_seconds(
+                    GLib.PRIORITY_DEFAULT,
                     SCROLLBACK_IMMEDIATE_TIME - (currentTime - timestamp),
                     this.appendTimestamp.bind(this));
                 GLib.Source.set_name_by_id(this._timestampTimeoutId, '[gnome-shell] this.appendTimestamp');
@@ -782,7 +792,7 @@ var ChatNotification = class extends MessageTray.Notification {
 
         this._filterMessages();
     }
-};
+}) : null;
 
 var ChatLineBox = GObject.registerClass(
 class ChatLineBox extends St.BoxLayout {
@@ -792,9 +802,10 @@ class ChatLineBox extends St.BoxLayout {
     }
 });
 
-var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
-    constructor(notification) {
-        super(notification);
+var ChatNotificationBanner = GObject.registerClass(
+class ChatNotificationBanner extends MessageTray.NotificationBanner {
+    _init(notification) {
+        super._init(notification);
 
         this._responseEntry = new St.Entry({ style_class: 'chat-response',
                                              x_expand: true,
@@ -879,8 +890,7 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
     }
 
     _addMessage(message) {
-        let highlighter = new MessageList.URLHighlighter(message.body, true, true);
-        let body = highlighter.actor;
+        let body = new MessageList.URLHighlighter(message.body, true, true);
 
         let styles = message.styles;
         for (let i = 0; i < styles.length; i++)
@@ -952,14 +962,15 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
 
         // Remove composing timeout.
         if (this._composingTimeoutId > 0) {
-            Mainloop.source_remove(this._composingTimeoutId);
+            GLib.source_remove(this._composingTimeoutId);
             this._composingTimeoutId = 0;
         }
 
         if (text != '') {
             this.notification.source.setChatState(Tp.ChannelChatState.COMPOSING);
 
-            this._composingTimeoutId = Mainloop.timeout_add_seconds(
+            this._composingTimeoutId = GLib.timeout_add_seconds(
+                GLib.PRIORITY_DEFAULT,
                 COMPOSING_STOP_TIMEOUT,
                 this._composingStopTimeout.bind(this));
             GLib.Source.set_name_by_id(this._composingTimeoutId, '[gnome-shell] this._composingStopTimeout');
@@ -967,6 +978,6 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
             this.notification.source.setChatState(Tp.ChannelChatState.ACTIVE);
         }
     }
-};
+});
 
 var Component = TelepathyComponent;

js/ui/ctrlAltTab.js

@@ -12,7 +12,7 @@ var POPUP_APPICON_SIZE = 96;
 var SortGroup = {
     TOP:    0,
     MIDDLE: 1,
-    BOTTOM: 2
+    BOTTOM: 2,
 };
 
 var CtrlAltTabManager = class CtrlAltTabManager {
@@ -86,25 +86,26 @@ var CtrlAltTabManager = class CtrlAltTabManager {
             for (let i = 0; i < windows.length; i++) {
                 let icon = null;
                 let iconName = null;
-                if (windows[i].get_window_type () == Meta.WindowType.DESKTOP) {
+                if (windows[i].get_window_type() == Meta.WindowType.DESKTOP) {
                     iconName = 'video-display-symbolic';
                 } else {
                     let app = windowTracker.get_window_app(windows[i]);
-                    if (app)
+                    if (app) {
                         icon = app.create_icon_texture(POPUP_APPICON_SIZE);
-                    else
+                    } else {
                         icon = textureCache.bind_cairo_surface_property(windows[i],
                                                                         'icon',
                                                                         POPUP_APPICON_SIZE);
+                    }
                 }
 
                 items.push({ name: windows[i].title,
                              proxy: windows[i].get_compositor_private(),
-                             focusCallback: function(timestamp) {
-                                 Main.activateWindow(this, timestamp);
-                             }.bind(windows[i]),
+                             focusCallback: timestamp => {
+                                 Main.activateWindow(windows[i], timestamp);
+                             },
                              iconActor: icon,
-                             iconName: iconName,
+                             iconName,
                              sortGroup: SortGroup.MIDDLE });
             }
         }
@@ -143,9 +144,9 @@ class CtrlAltTabPopup extends SwitcherPopup.SwitcherPopup {
             this._select(this._next());
         else if (action == Meta.KeyBindingAction.SWITCH_PANELS_BACKWARD)
             this._select(this._previous());
-        else if (keysym == Clutter.Left)
+        else if (keysym == Clutter.KEY_Left)
             this._select(this._previous());
-        else if (keysym == Clutter.Right)
+        else if (keysym == Clutter.KEY_Right)
             this._select(this._next());
         else
             return Clutter.EVENT_PROPAGATE;
@@ -177,10 +178,13 @@ class CtrlAltTabSwitcher extends SwitcherPopup.SwitcherList {
             icon = new St.Icon({ icon_name: item.iconName,
                                  icon_size: POPUP_APPICON_SIZE });
         }
-        box.add(icon, { x_fill: false, y_fill: false } );
+        box.add_child(icon);
 
-        let text = new St.Label({ text: item.name });
-        box.add(text, { x_fill: false });
+        let text = new St.Label({
+            text: item.name,
+            x_align: Clutter.ActorAlign.CENTER,
+        });
+        box.add_child(text);
 
         this.addItem(box, text);
     }

js/ui/dash.js

@@ -1,9 +1,8 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported Dash */
 
-const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
-const Signals = imports.signals;
+const { Clutter, GLib, GObject,
+        Graphene, Meta, Shell, St } = imports.gi;
 
 const AppDisplay = imports.ui.appDisplay;
 const AppFavorites = imports.ui.appFavorites;
@@ -17,18 +16,18 @@ var DASH_ITEM_LABEL_HIDE_TIME = 100;
 var DASH_ITEM_HOVER_TIMEOUT = 300;
 
 function getAppFromSource(source) {
-    if (source instanceof AppDisplay.AppIcon) {
+    if (source instanceof AppDisplay.AppIcon)
         return source.app;
-    } else {
+    else
         return null;
-    }
 }
 
-var DashIcon = class DashIcon extends AppDisplay.AppIcon {
-    constructor(app) {
-        super(app, {
+var DashIcon = GObject.registerClass(
+class DashIcon extends AppDisplay.AppIcon {
+    _init(app) {
+        super._init(app, {
             setSizeManually: true,
-            showLabel: false
+            showLabel: false,
         });
     }
 
@@ -46,7 +45,7 @@ var DashIcon = class DashIcon extends AppDisplay.AppIcon {
     acceptDrop() {
         return false;
     }
-};
+});
 
 // A container like StBin, but taking the child's scale into account
 // when requesting a size
@@ -54,7 +53,7 @@ var DashItemContainer = GObject.registerClass(
 class DashItemContainer extends St.Widget {
     _init() {
         super._init({ style_class: 'dash-item-container',
-                      pivot_point: new Clutter.Point({ x: .5, y: .5 }),
+                      pivot_point: new Graphene.Point({ x: .5, y: .5 }),
                       scale_x: 0,
                       scale_y: 0,
                       opacity: 0,
@@ -126,7 +125,7 @@ class DashItemContainer extends St.Widget {
         this.label.ease({
             opacity: 255,
             duration: DASH_ITEM_LABEL_SHOW_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
     }
 
@@ -140,7 +139,7 @@ class DashItemContainer extends St.Widget {
             opacity: 0,
             duration: DASH_ITEM_LABEL_HIDE_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.label.hide()
+            onComplete: () => this.label.hide(),
         });
     }
 
@@ -164,7 +163,7 @@ class DashItemContainer extends St.Widget {
             scale_y: 1,
             opacity: 255,
             duration: time,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
     }
 
@@ -183,7 +182,7 @@ class DashItemContainer extends St.Widget {
             opacity: 0,
             duration: DASH_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.destroy()
+            onComplete: () => this.destroy(),
         });
     }
 });
@@ -285,9 +284,12 @@ var DashActor = GObject.registerClass(
 class DashActor extends St.Widget {
     _init() {
         let layout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.VERTICAL });
-        super._init({ name: 'dash',
-                      layout_manager: layout,
-                      clip_to_allocation: true });
+        super._init({
+            name: 'dash',
+            layout_manager: layout,
+            clip_to_allocation: true,
+            y_align: Clutter.ActorAlign.CENTER,
+        });
     }
 
     vfunc_allocate(box, flags) {
@@ -331,8 +333,10 @@ class DashActor extends St.Widget {
 
 const baseIconSizes = [16, 22, 24, 32, 48, 64];
 
-var Dash = class Dash {
-    constructor() {
+var Dash = GObject.registerClass({
+    Signals: { 'icon-size-changed': {} },
+}, class Dash extends St.Bin {
+    _init() {
         this._maxHeight = -1;
         this.iconSize = 64;
         this._shownInitially = false;
@@ -360,11 +364,11 @@ var Dash = class Dash {
 
         this._container.add_actor(this._showAppsIcon);
 
-        this.actor = new St.Bin({ child: this._container });
-        this.actor.connect('notify::height', () => {
-            if (this._maxHeight != this.actor.height)
+        super._init({ child: this._container });
+        this.connect('notify::height', () => {
+            if (this._maxHeight != this.height)
                 this._queueRedisplay();
-            this._maxHeight = this.actor.height;
+            this._maxHeight = this.height;
         });
 
         this._workId = Main.initializeDeferredWork(this._box, this._redisplay.bind(this));
@@ -387,13 +391,13 @@ var Dash = class Dash {
 
         // Translators: this is the name of the dock/favorites area on
         // the left of the overview
-        Main.ctrlAltTabManager.addGroup(this.actor, _("Dash"), 'user-bookmarks-symbolic');
+        Main.ctrlAltTabManager.addGroup(this, _("Dash"), 'user-bookmarks-symbolic');
     }
 
     _onDragBegin() {
         this._dragCancelled = false;
         this._dragMonitor = {
-            dragMotion: this._onDragMotion.bind(this)
+            dragMotion: this._onDragMotion.bind(this),
         };
         DND.addDragMonitor(this._dragMonitor);
 
@@ -477,16 +481,16 @@ var Dash = class Dash {
         let appIcon = new DashIcon(app);
 
         appIcon.connect('menu-state-changed',
-                        (appIcon, opened) => {
+                        (o, opened) => {
                             this._itemMenuStateChanged(item, opened);
                         });
 
         let item = new DashItemContainer();
-        item.setChild(appIcon.actor);
+        item.setChild(appIcon);
 
         // Override default AppIcon label_actor, now the
         // accessible_name is set at DashItemContainer.setLabelText
-        appIcon.actor.label_actor = null;
+        appIcon.label_actor = null;
         item.setLabelText(app.get_name());
 
         appIcon.icon.setIconSize(this.iconSize);
@@ -500,7 +504,7 @@ var Dash = class Dash {
         // that the notify::hover handler does everything we need to.
         if (opened) {
             if (this._showLabelTimeoutId > 0) {
-                Mainloop.source_remove(this._showLabelTimeoutId);
+                GLib.source_remove(this._showLabelTimeoutId);
                 this._showLabelTimeoutId = 0;
             }
 
@@ -514,7 +518,7 @@ var Dash = class Dash {
         if (shouldShow) {
             if (this._showLabelTimeoutId == 0) {
                 let timeout = this._labelShowing ? 0 : DASH_ITEM_HOVER_TIMEOUT;
-                this._showLabelTimeoutId = Mainloop.timeout_add(timeout,
+                this._showLabelTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
                     () => {
                         this._labelShowing = true;
                         item.showLabel();
@@ -523,17 +527,17 @@ var Dash = class Dash {
                     });
                 GLib.Source.set_name_by_id(this._showLabelTimeoutId, '[gnome-shell] item.showLabel');
                 if (this._resetHoverTimeoutId > 0) {
-                    Mainloop.source_remove(this._resetHoverTimeoutId);
+                    GLib.source_remove(this._resetHoverTimeoutId);
                     this._resetHoverTimeoutId = 0;
                 }
             }
         } else {
             if (this._showLabelTimeoutId > 0)
-                Mainloop.source_remove(this._showLabelTimeoutId);
+                GLib.source_remove(this._showLabelTimeoutId);
             this._showLabelTimeoutId = 0;
             item.hideLabel();
             if (this._labelShowing) {
-                this._resetHoverTimeoutId = Mainloop.timeout_add(DASH_ITEM_HOVER_TIMEOUT,
+                this._resetHoverTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, DASH_ITEM_HOVER_TIMEOUT,
                     () => {
                         this._labelShowing = false;
                         this._resetHoverTimeoutId = 0;
@@ -624,8 +628,8 @@ var Dash = class Dash {
             icon.icon.ease({
                 width: targetWidth,
                 height: targetHeight,
-                time: DASH_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                duration: DASH_ANIMATION_TIME,
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
         }
     }
@@ -704,8 +708,8 @@ var Dash = class Dash {
             }
 
             // App moved
-            let nextApp = newApps.length > newIndex + 1 ? newApps[newIndex + 1]
-                                                        : null;
+            let nextApp = newApps.length > newIndex + 1
+                ? newApps[newIndex + 1] : null;
             let insertHere = nextApp && nextApp == oldApp;
             let alreadyRemoved = removedActors.reduce((result, actor) => {
                 let removedApp = actor.child._delegate.app;
@@ -724,9 +728,10 @@ var Dash = class Dash {
             }
         }
 
-        for (let i = 0; i < addedItems.length; i++)
+        for (let i = 0; i < addedItems.length; i++) {
             this._box.insert_child_at_index(addedItems[i].item,
                                             addedItems[i].pos);
+        }
 
         for (let i = 0; i < removedActors.length; i++) {
             let item = removedActors[i];
@@ -750,9 +755,8 @@ var Dash = class Dash {
         if (!this._shownInitially)
             this._shownInitially = true;
 
-        for (let i = 0; i < addedItems.length; i++) {
+        for (let i = 0; i < addedItems.length; i++)
             addedItems[i].item.show(animate);
-        }
 
         // Workaround for https://bugzilla.gnome.org/show_bug.cgi?id=692744
         // Without it, StBoxLayout may use a stale size cache
@@ -832,8 +836,8 @@ var Dash = class Dash {
             }
 
             this._dragPlaceholder = new DragPlaceholderItem();
-            this._dragPlaceholder.child.set_width (this.iconSize);
-            this._dragPlaceholder.child.set_height (this.iconSize / 2);
+            this._dragPlaceholder.child.set_width(this.iconSize);
+            this._dragPlaceholder.child.set_height(this.iconSize / 2);
             this._box.insert_child_at_index(this._dragPlaceholder,
                                             this._dragPlaceholderPos);
             this._dragPlaceholder.show(fadeIn);
@@ -847,7 +851,7 @@ var Dash = class Dash {
         if (!this._dragPlaceholder)
             return DND.DragMotionResult.NO_DROP;
 
-        let srcIsFavorite = (favPos != -1);
+        let srcIsFavorite = favPos != -1;
 
         if (srcIsFavorite)
             return DND.DragMotionResult.MOVE_DROP;
@@ -860,9 +864,8 @@ var Dash = class Dash {
         let app = getAppFromSource(source);
 
         // Don't allow favoriting of transient apps
-        if (app == null || app.is_window_backed()) {
+        if (app == null || app.is_window_backed())
             return false;
-        }
 
         if (!global.settings.is_writable('favorite-apps'))
             return false;
@@ -871,7 +874,7 @@ var Dash = class Dash {
 
         let favorites = AppFavorites.getAppFavorites().getFavoriteMap();
 
-        let srcIsFavorite = (id in favorites);
+        let srcIsFavorite = id in favorites;
 
         let favPos = 0;
         let children = this._box.get_children();
@@ -903,5 +906,4 @@ var Dash = class Dash {
 
         return true;
     }
-};
-Signals.addSignalMethods(Dash.prototype);
+});

js/ui/dateMenu.js

@@ -2,7 +2,7 @@
 /* exported DateMenuButton */
 
 const { Clutter, Gio, GLib, GnomeDesktop,
-        GObject, GWeather, Shell, St } = imports.gi;
+        GObject, GWeather, Pango, Shell, St } = imports.gi;
 
 const Util = imports.misc.util;
 const Main = imports.ui.main;
@@ -25,22 +25,25 @@ function _isToday(date) {
            now.getDate() == date.getDate();
 }
 
-var TodayButton = class TodayButton {
-    constructor(calendar) {
+function _gDateTimeToDate(datetime) {
+    return new Date(datetime.to_unix() * 1000 + datetime.get_microsecond() / 1000);
+}
+
+var TodayButton = GObject.registerClass(
+class TodayButton extends St.Button {
+    _init(calendar) {
         // Having the ability to go to the current date if the user is already
         // on the current date can be confusing. So don't make the button reactive
         // until the selected date changes.
-        this.actor = new St.Button({ style_class: 'datemenu-today-button',
-                                     x_expand: true, x_align: St.Align.START,
-                                     can_focus: true,
-                                     reactive: false
-                                   });
-        this.actor.connect('clicked', () => {
-            this._calendar.setDate(new Date(), false);
+        super._init({
+            style_class: 'datemenu-today-button',
+            x_expand: true,
+            can_focus: true,
+            reactive: false,
         });
 
         let hbox = new St.BoxLayout({ vertical: true });
-        this.actor.add_actor(hbox);
+        this.add_actor(hbox);
 
         this._dayLabel = new St.Label({ style_class: 'day-label',
                                         x_align: Clutter.ActorAlign.START });
@@ -50,13 +53,17 @@ var TodayButton = class TodayButton {
         hbox.add_actor(this._dateLabel);
 
         this._calendar = calendar;
-        this._calendar.connect('selected-date-changed', (calendar, date) => {
+        this._calendar.connect('selected-date-changed', (_calendar, datetime) => {
             // Make the button reactive only if the selected date is not the
             // current date.
-            this.actor.reactive = !_isToday(date);
+            this.reactive = !_isToday(_gDateTimeToDate(datetime));
         });
     }
 
+    vfunc_clicked() {
+        this._calendar.setDate(new Date(), false);
+    }
+
     setDate(date) {
         this._dayLabel.set_text(date.toLocaleFormat('%A'));
 
@@ -65,42 +72,38 @@ var TodayButton = class TodayButton {
          * "Tue 9:29 AM").  The string itself should become a full date, e.g.,
          * "February 17 2015".
          */
-        let dateFormat = Shell.util_translate_time_string (N_("%B %-d %Y"));
+        let dateFormat = Shell.util_translate_time_string(N_("%B %-d %Y"));
         this._dateLabel.set_text(date.toLocaleFormat(dateFormat));
 
         /* Translators: This is the accessible name of the date button shown
          * below the time in the shell; it should combine the weekday and the
          * date, e.g. "Tuesday February 17 2015".
          */
-        dateFormat = Shell.util_translate_time_string (N_("%A %B %e %Y"));
-        this.actor.accessible_name = date.toLocaleFormat(dateFormat);
+        dateFormat = Shell.util_translate_time_string(N_("%A %B %e %Y"));
+        this.accessible_name = date.toLocaleFormat(dateFormat);
     }
-};
+});
 
-var WorldClocksSection = class WorldClocksSection {
-    constructor() {
+var WorldClocksSection = GObject.registerClass(
+class WorldClocksSection extends St.Button {
+    _init() {
+        super._init({
+            style_class: 'world-clocks-button',
+            can_focus: true,
+            x_expand: true,
+        });
         this._clock = new GnomeDesktop.WallClock();
         this._clockNotifyId = 0;
 
         this._locations = [];
 
-        this.actor = new St.Button({ style_class: 'world-clocks-button',
-                                     x_fill: true,
-                                     can_focus: true });
-        this.actor.connect('clicked', () => {
-            if (this._clocksApp)
-                this._clocksApp.activate();
-
-            Main.overview.hide();
-            Main.panel.closeCalendar();
-        });
-
         let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
         this._grid = new St.Widget({ style_class: 'world-clocks-grid',
+                                     x_expand: true,
                                      layout_manager: layout });
         layout.hookup_style(this._grid);
 
-        this.actor.child = this._grid;
+        this.child = this._grid;
 
         this._clocksApp = null;
         this._clocksProxy = new ClocksProxy(
@@ -112,7 +115,7 @@ var WorldClocksSection = class WorldClocksSection {
             Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
 
         this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.world-clocks'
+            schema_id: 'org.gnome.shell.world-clocks',
         });
         this._settings.connect('changed', this._clocksChanged.bind(this));
         this._clocksChanged();
@@ -123,9 +126,17 @@ var WorldClocksSection = class WorldClocksSection {
         this._sync();
     }
 
+    vfunc_clicked() {
+        if (this._clocksApp)
+            this._clocksApp.activate();
+
+        Main.overview.hide();
+        Main.panel.closeCalendar();
+    }
+
     _sync() {
         this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop');
-        this.actor.visible = this._clocksApp != null;
+        this.visible = this._clocksApp != null;
     }
 
     _clocksChanged() {
@@ -146,13 +157,14 @@ var WorldClocksSection = class WorldClocksSection {
         });
 
         let layout = this._grid.layout_manager;
-        let title = (this._locations.length == 0) ? _("Add world clocks…")
-                                                  : _("World Clocks");
+        let title = this._locations.length == 0
+            ? _("Add world clocks…")
+            : _("World Clocks");
         let header = new St.Label({ style_class: 'world-clocks-header',
                                     x_align: Clutter.ActorAlign.START,
                                     text: title });
         layout.attach(header, 0, 0, 2, 1);
-        this.actor.label_actor = header;
+        this.label_actor = header;
 
         let localOffset = GLib.DateTime.new_now_local().get_utc_offset();
 
@@ -170,8 +182,8 @@ var WorldClocksSection = class WorldClocksSection {
 
             let otherOffset = this._getTimeAtLocation(l).get_utc_offset();
             let offset = (otherOffset - localOffset) / GLib.TIME_SPAN_HOUR;
-            let fmt = (Math.trunc(offset) == offset) ? '%s%.0f' : '%s%.1f';
-            let prefix = (offset >= 0) ? '+' : '-';
+            let fmt = Math.trunc(offset) == offset ? '%s%.0f' : '%s%.1f';
+            let prefix = offset >= 0 ? '+' : '-';
             let tz = new St.Label({ style_class: 'world-clocks-timezone',
                                     text: fmt.format(prefix, Math.abs(offset)),
                                     x_align: Clutter.ActorAlign.END,
@@ -191,9 +203,10 @@ var WorldClocksSection = class WorldClocksSection {
         }
 
         if (this._grid.get_n_children() > 1) {
-            if (!this._clockNotifyId)
+            if (!this._clockNotifyId) {
                 this._clockNotifyId =
                     this._clock.connect('notify::clock', this._updateLabels.bind(this));
+            }
             this._updateLabels();
         } else {
             if (this._clockNotifyId)
@@ -233,45 +246,49 @@ var WorldClocksSection = class WorldClocksSection {
         this._settings.set_value('locations',
             new GLib.Variant('av', this._clocksProxy.Locations));
     }
-};
+});
+
+var WeatherSection = GObject.registerClass(
+class WeatherSection extends St.Button {
+    _init() {
+        super._init({
+            style_class: 'weather-button',
+            can_focus: true,
+            x_expand: true,
+        });
 
-var WeatherSection = class WeatherSection {
-    constructor() {
         this._weatherClient = new Weather.WeatherClient();
 
-        this.actor = new St.Button({ style_class: 'weather-button',
-                                     x_fill: true,
-                                     can_focus: true });
-        this.actor.connect('clicked', () => {
-            this._weatherClient.activateApp();
-
-            Main.overview.hide();
-            Main.panel.closeCalendar();
-        });
-        this.actor.connect('notify::mapped', () => {
-            if (this.actor.mapped)
-                this._weatherClient.update();
+        let box = new St.BoxLayout({
+            style_class: 'weather-box',
+            vertical: true,
+            x_expand: true,
         });
 
-        let box = new St.BoxLayout({ style_class: 'weather-box',
-                                     vertical: true });
+        this.child = box;
 
-        this.actor.child = box;
-
-        let titleBox = new St.BoxLayout();
-        titleBox.add_child(new St.Label({ style_class: 'weather-header',
-                                          x_align: Clutter.ActorAlign.START,
-                                          x_expand: true,
-                                          text: _("Weather") }));
+        let titleBox = new St.BoxLayout({ style_class: 'weather-header-box' });
+        titleBox.add_child(new St.Label({
+            style_class: 'weather-header',
+            x_align: Clutter.ActorAlign.START,
+            x_expand: true,
+            y_align: Clutter.ActorAlign.END,
+            text: _('Weather'),
+        }));
         box.add_child(titleBox);
 
-        this._titleLocation = new St.Label({ style_class: 'weather-header location',
-                                             x_align: Clutter.ActorAlign.END });
+        this._titleLocation = new St.Label({
+            style_class: 'weather-header location',
+            x_align: Clutter.ActorAlign.END,
+            y_align: Clutter.ActorAlign.END,
+        });
         titleBox.add_child(this._titleLocation);
 
         let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
-        this._forecastGrid = new St.Widget({ style_class: 'weather-grid',
-                                             layout_manager: layout });
+        this._forecastGrid = new St.Widget({
+            style_class: 'weather-grid',
+            layout_manager: layout,
+        });
         layout.hookup_style(this._forecastGrid);
         box.add_child(this._forecastGrid);
 
@@ -279,26 +296,40 @@ var WeatherSection = class WeatherSection {
         this._sync();
     }
 
+    vfunc_map() {
+        this._weatherClient.update();
+        super.vfunc_map();
+    }
+
+    vfunc_clicked() {
+        this._weatherClient.activateApp();
+
+        Main.overview.hide();
+        Main.panel.closeCalendar();
+    }
+
     _getInfos() {
-        let info = this._weatherClient.info;
-        let forecasts = info.get_forecast_list();
+        let forecasts = this._weatherClient.info.get_forecast_list();
 
-        let current = info;
-        let infos = [info];
+        let now = GLib.DateTime.new_now_local();
+        let current = GLib.DateTime.new_from_unix_local(0);
+        let infos = [];
         for (let i = 0; i < forecasts.length; i++) {
-            let [ok_, timestamp] = forecasts[i].get_value_update();
-            let datetime = new Date(timestamp * 1000);
-            if (!_isToday(datetime))
-                continue; // Ignore forecasts from other days
+            const [valid, timestamp] = forecasts[i].get_value_update();
+            if (!valid || timestamp === 0)
+                continue;  // 0 means 'never updated'
 
-            [ok_, timestamp] = current.get_value_update();
-            let currenttime = new Date(timestamp * 1000);
-            if (currenttime.getHours() == datetime.getHours())
+            const datetime = GLib.DateTime.new_from_unix_local(timestamp);
+            if (now.difference(datetime) > 0)
+                continue; // Ignore earlier forecasts
+
+            if (datetime.difference(current) < GLib.TIME_SPAN_HOUR)
                 continue; // Enforce a minimum interval of 1h
 
-            current = forecasts[i];
-            if (infos.push(current) == MAX_FORECASTS)
+            if (infos.push(forecasts[i]) == MAX_FORECASTS)
                 break; // Use a maximum of five forecasts
+
+            current = datetime;
         }
         return infos;
     }
@@ -312,21 +343,31 @@ var WeatherSection = class WeatherSection {
 
         let col = 0;
         infos.forEach(fc => {
-            let [ok_, timestamp] = fc.get_value_update();
+            const [valid_, timestamp] = fc.get_value_update();
             let timeStr = Util.formatTime(new Date(timestamp * 1000), {
-                timeOnly: true
+                timeOnly: true,
+                ampm: false,
             });
 
-            let icon = new St.Icon({ style_class: 'weather-forecast-icon',
-                                     icon_name: fc.get_symbolic_icon_name(),
-                                     x_align: Clutter.ActorAlign.CENTER,
-                                     x_expand: true });
-            let temp = new St.Label({ style_class: 'weather-forecast-temp',
-                                      text: fc.get_temp_summary(),
-                                      x_align: Clutter.ActorAlign.CENTER });
-            let time = new St.Label({ style_class: 'weather-forecast-time',
-                                      text: timeStr,
-                                      x_align: Clutter.ActorAlign.CENTER });
+            let icon = new St.Icon({
+                style_class: 'weather-forecast-icon',
+                icon_name: fc.get_symbolic_icon_name(),
+                x_align: Clutter.ActorAlign.CENTER,
+                x_expand: true,
+            });
+            let temp = new St.Label({
+                style_class: 'weather-forecast-temp',
+                text: fc.get_temp_summary(),
+                x_align: Clutter.ActorAlign.CENTER,
+            });
+            let time = new St.Label({
+                style_class: 'weather-forecast-time',
+                text: timeStr,
+                x_align: Clutter.ActorAlign.CENTER,
+            });
+
+            temp.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
+            time.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
 
             layout.attach(icon, col, 0, 1, 1);
             layout.attach(temp, col, 1, 1, 1);
@@ -350,7 +391,12 @@ var WeatherSection = class WeatherSection {
         }
 
         let info = this._weatherClient.info;
-        this._titleLocation.text = info.get_location().get_name();
+        let loc = info.get_location();
+        if (loc.get_level() !== GWeather.LocationLevel.CITY && loc.has_coords()) {
+            let world = GWeather.Location.get_world();
+            loc = world.find_nearest_city(...loc.get_coords());
+        }
+        this._titleLocation.text = loc.get_name();
 
         if (this._weatherClient.loading) {
             this._setStatusLabel(_("Loading…"));
@@ -369,23 +415,27 @@ var WeatherSection = class WeatherSection {
     }
 
     _sync() {
-        this.actor.visible = this._weatherClient.available;
+        this.visible = this._weatherClient.available;
 
-        if (!this.actor.visible)
+        if (!this.visible)
             return;
 
         this._titleLocation.visible = this._weatherClient.hasLocation;
 
         this._updateForecasts();
     }
-};
+});
 
-var MessagesIndicator = class MessagesIndicator {
-    constructor() {
-        this.actor = new St.Icon({ icon_name: 'message-indicator-symbolic',
-                                   icon_size: 16,
-                                   visible: false, y_expand: true,
-                                   y_align: Clutter.ActorAlign.CENTER });
+var MessagesIndicator = GObject.registerClass(
+class MessagesIndicator extends St.Icon {
+    _init() {
+        super._init({
+            icon_name: 'message-indicator-symbolic',
+            icon_size: 16,
+            visible: false,
+            y_expand: true,
+            y_align: Clutter.ActorAlign.CENTER,
+        });
 
         this._sources = [];
 
@@ -398,7 +448,7 @@ var MessagesIndicator = class MessagesIndicator {
     }
 
     _onSourceAdded(tray, source) {
-        source.connect('count-updated', this._updateCount.bind(this));
+        source.connect('notify::count', this._updateCount.bind(this));
         this._sources.push(source);
         this._updateCount();
     }
@@ -410,12 +460,12 @@ var MessagesIndicator = class MessagesIndicator {
 
     _updateCount() {
         let count = 0;
-        this._sources.forEach(source => count += source.unseenCount);
+        this._sources.forEach(source => (count += source.unseenCount));
         count -= Main.messageTray.queueCount;
 
-        this.actor.visible = (count > 0);
+        this.visible = count > 0;
     }
-};
+});
 
 var IndicatorPad = GObject.registerClass(
 class IndicatorPad extends St.Widget {
@@ -508,13 +558,13 @@ class DateMenuButton extends PanelMenu.Button {
         this._indicator = new MessagesIndicator();
 
         let box = new St.BoxLayout();
-        box.add_actor(new IndicatorPad(this._indicator.actor));
+        box.add_actor(new IndicatorPad(this._indicator));
         box.add_actor(this._clockDisplay);
-        box.add_actor(this._indicator.actor);
+        box.add_actor(this._indicator);
 
         this.label_actor = this._clockDisplay;
         this.add_actor(box);
-        this.add_style_class_name ('clock-display');
+        this.add_style_class_name('clock-display');
 
         let layout = new FreezableBinLayout();
         let bin = new St.Widget({ layout_manager: layout });
@@ -526,11 +576,11 @@ class DateMenuButton extends PanelMenu.Button {
         bin.add_actor(hbox);
 
         this._calendar = new Calendar.Calendar();
-        this._calendar.connect('selected-date-changed',
-                               (calendar, date) => {
-                                   layout.frozen = !_isToday(date);
-                                   this._messageList.setDate(date);
-                               });
+        this._calendar.connect('selected-date-changed', (_calendar, datetime) => {
+            let date = _gDateTimeToDate(datetime);
+            layout.frozen = !_isToday(date);
+            this._messageList.setDate(date);
+        });
 
         this.menu.connect('open-state-changed', (menu, isOpen) => {
             // Whenever the menu is opened, select today
@@ -544,35 +594,36 @@ class DateMenuButton extends PanelMenu.Button {
 
         // Fill up the first column
         this._messageList = new Calendar.CalendarMessageList();
-        hbox.add(this._messageList.actor, { expand: true, y_fill: false, y_align: St.Align.START });
+        hbox.add_child(this._messageList);
 
         // Fill up the second column
-        let boxLayout = new CalendarColumnLayout(this._calendar.actor);
+        let boxLayout = new CalendarColumnLayout(this._calendar);
         vbox = new St.Widget({ style_class: 'datemenu-calendar-column',
                                layout_manager: boxLayout });
         boxLayout.hookup_style(vbox);
         hbox.add(vbox);
 
         this._date = new TodayButton(this._calendar);
-        vbox.add_actor(this._date.actor);
+        vbox.add_actor(this._date);
 
-        vbox.add_actor(this._calendar.actor);
+        vbox.add_actor(this._calendar);
 
         this._displaysSection = new St.ScrollView({ style_class: 'datemenu-displays-section vfade',
-                                                    x_expand: true, x_fill: true,
+                                                    x_expand: true,
                                                     overlay_scrollbars: true });
         this._displaysSection.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
         vbox.add_actor(this._displaysSection);
 
         let displaysBox = new St.BoxLayout({ vertical: true,
+                                             x_expand: true,
                                              style_class: 'datemenu-displays-box' });
         this._displaysSection.add_actor(displaysBox);
 
         this._clocksItem = new WorldClocksSection();
-        displaysBox.add(this._clocksItem.actor, { x_fill: true });
+        displaysBox.add_child(this._clocksItem);
 
         this._weatherItem = new WeatherSection();
-        displaysBox.add(this._weatherItem.actor, { x_fill: true });
+        displaysBox.add_child(this._weatherItem);
 
         // Done with hbox for calendar and event list
 
@@ -610,11 +661,11 @@ class DateMenuButton extends PanelMenu.Button {
     _sessionUpdated() {
         let eventSource;
         let showEvents = Main.sessionMode.showCalendarEvents;
-        if (showEvents) {
+        if (showEvents)
             eventSource = this._getEventSource();
-        } else {
+        else
             eventSource = new Calendar.EmptyEventSource();
-        }
+
         this._setEventSource(eventSource);
 
         // Displays are not actually expected to launch Settings when activated

js/ui/dialog.js

@@ -36,19 +36,15 @@ class Dialog extends St.Widget {
         this._dialog.request_mode = Clutter.RequestMode.HEIGHT_FOR_WIDTH;
         this._dialog.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
 
-        this.contentLayout = new St.BoxLayout({ vertical: true,
-                                                style_class: "modal-dialog-content-box" });
-        this._dialog.add(this.contentLayout,
-                         { expand: true,
-                           x_fill: true,
-                           y_fill: true,
-                           x_align: St.Align.MIDDLE,
-                           y_align: St.Align.START });
+        this.contentLayout = new St.BoxLayout({
+            vertical: true,
+            style_class: 'modal-dialog-content-box',
+            y_expand: true,
+        });
+        this._dialog.add_child(this.contentLayout);
 
-        this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) });
-        this._dialog.add(this.buttonLayout,
-                         { x_align: St.Align.MIDDLE,
-                           y_align: St.Align.START });
+        this.buttonLayout = new St.Widget({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) });
+        this._dialog.add_child(this.buttonLayout);
     }
 
     _onDestroy() {
@@ -100,7 +96,7 @@ class Dialog extends St.Widget {
     }
 
     addContent(actor) {
-        this.contentLayout.add (actor, { expand: true });
+        this.contentLayout.add(actor, { expand: true });
     }
 
     addButton(buttonInfo) {
@@ -121,7 +117,7 @@ class Dialog extends St.Widget {
                                      can_focus: true,
                                      x_expand: true,
                                      y_expand: true,
-                                     label: label });
+                                     label });
         button.connect('clicked', action);
 
         buttonInfo['button'] = button;
@@ -163,8 +159,8 @@ var MessageDialogContent = GObject.registerClass({
         'body': GObject.ParamSpec.string('body', 'body', 'body',
                                          GObject.ParamFlags.READWRITE |
                                          GObject.ParamFlags.CONSTRUCT,
-                                         null)
-    }
+                                         null),
+    },
 }, class MessageDialogContent extends St.BoxLayout {
     _init(params) {
         this._icon = new St.Icon({ y_align: Clutter.ActorAlign.START });
@@ -215,7 +211,7 @@ var MessageDialogContent = GObject.registerClass({
     set icon(icon) {
         this._icon.set({
             gicon: icon,
-            visible: icon != null
+            visible: icon != null,
         });
         this.notify('icon');
     }
@@ -235,7 +231,7 @@ var MessageDialogContent = GObject.registerClass({
     _setLabel(label, prop, value) {
         label.set({
             text: value || '',
-            visible: value != null
+            visible: value != null,
         });
         this.notify(prop);
     }

js/ui/dnd.js

@@ -18,7 +18,7 @@ var DragMotionResult = {
     NO_DROP:   0,
     COPY_DROP: 1,
     MOVE_DROP: 2,
-    CONTINUE:  3
+    CONTINUE:  3,
 };
 
 var DragState = {
@@ -30,13 +30,13 @@ var DragState = {
 var DRAG_CURSOR_MAP = {
     0: Meta.Cursor.DND_UNSUPPORTED_TARGET,
     1: Meta.Cursor.DND_COPY,
-    2: Meta.Cursor.DND_MOVE
+    2: Meta.Cursor.DND_MOVE,
 };
 
 var DragDropResult = {
     FAILURE:  0,
     SUCCESS:  1,
-    CONTINUE: 2
+    CONTINUE: 2,
 };
 var dragMonitors = [];
 
@@ -61,11 +61,12 @@ function addDragMonitor(monitor) {
 }
 
 function removeDragMonitor(monitor) {
-    for (let i = 0; i < dragMonitors.length; i++)
+    for (let i = 0; i < dragMonitors.length; i++) {
         if (dragMonitors[i] == monitor) {
             dragMonitors.splice(i, 1);
             return;
         }
+    }
 }
 
 var _Draggable = class _Draggable {
@@ -150,12 +151,12 @@ var _Draggable = class _Draggable {
         if (touchSequence)
             pointer.sequence_grab(touchSequence, actor);
         else if (pointer)
-            pointer.grab (actor);
+            pointer.grab(actor);
 
         this._grabbedDevice = pointer;
         this._touchSequence = touchSequence;
 
-        this._capturedEventId = global.stage.connect('captured-event', (actor, event) => {
+        this._capturedEventId = global.stage.connect('captured-event', (o, event) => {
             let device = event.get_device();
             if (device != this._grabbedDevice &&
                 device.get_device_type() != Clutter.InputDeviceType.KEYBOARD_DEVICE)
@@ -171,7 +172,7 @@ var _Draggable = class _Draggable {
         }
 
         if (this._touchSequence)
-            this._grabbedDevice.sequence_ungrab (this._touchSequence);
+            this._grabbedDevice.sequence_ungrab(this._touchSequence);
         else
             this._grabbedDevice.ungrab();
 
@@ -212,9 +213,9 @@ var _Draggable = class _Draggable {
 
     _eventIsRelease(event) {
         if (event.type() == Clutter.EventType.BUTTON_RELEASE) {
-            let buttonMask = (Clutter.ModifierType.BUTTON1_MASK |
+            let buttonMask = Clutter.ModifierType.BUTTON1_MASK |
                               Clutter.ModifierType.BUTTON2_MASK |
-                              Clutter.ModifierType.BUTTON3_MASK);
+                              Clutter.ModifierType.BUTTON3_MASK;
             /* We only obey the last button release from the device,
              * other buttons may get pressed/released during the DnD op.
              */
@@ -258,16 +259,16 @@ var _Draggable = class _Draggable {
         } else if (event.type() == Clutter.EventType.MOTION ||
                    (event.type() == Clutter.EventType.TOUCH_UPDATE &&
                     global.display.is_pointer_emulating_sequence(event.get_event_sequence()))) {
-            if (this._dragActor && this._dragState == DragState.DRAGGING) {
+            if (this._dragActor && this._dragState == DragState.DRAGGING)
                 return this._updateDragPosition(event);
-            } else if (this._dragActor == null && this._dragState != DragState.CANCELLED) {
+            else if (this._dragActor == null && this._dragState != DragState.CANCELLED)
                 return this._maybeStartDrag(event);
-            }
+
         // We intercept KEY_PRESS event so that we can process Esc key press to cancel
         // dragging and ignore all other key presses.
         } else if (event.type() == Clutter.EventType.KEY_PRESS && this._dragState == DragState.DRAGGING) {
             let symbol = event.get_key_symbol();
-            if (symbol == Clutter.Escape) {
+            if (symbol == Clutter.KEY_Escape) {
                 this._cancelDrag(event.get_time());
                 return Clutter.EVENT_STOP;
             }
@@ -291,9 +292,11 @@ var _Draggable = class _Draggable {
 
     /**
      * startDrag:
-     * @stageX: X coordinate of event
-     * @stageY: Y coordinate of event
-     * @time: Event timestamp
+     * @param {number} stageX: X coordinate of event
+     * @param {number} stageY: Y coordinate of event
+     * @param {number} time: Event timestamp
+     * @param {Clutter.EventSequence=} sequence: Event sequence
+     * @param {Clutter.InputDevice=} device: device that originated the event
      *
      * Directly initiate a drag and drop operation from the given actor.
      * This function is useful to call if you've specified manualMode
@@ -338,7 +341,7 @@ var _Draggable = class _Draggable {
         if (this.actor._delegate && this.actor._delegate.getDragActor) {
             this._dragActor = this.actor._delegate.getDragActor();
             Main.uiGroup.add_child(this._dragActor);
-            this._dragActor.raise_top();
+            Main.uiGroup.set_child_above_sibling(this._dragActor, null);
             Shell.util_set_hidden_from_pick(this._dragActor, true);
 
             // Drag actor does not always have to be the same as actor. For example drag actor
@@ -388,7 +391,7 @@ var _Draggable = class _Draggable {
 
             this._dragOrigParent.remove_actor(this._dragActor);
             Main.uiGroup.add_child(this._dragActor);
-            this._dragActor.raise_top();
+            Main.uiGroup.set_child_above_sibling(this._dragActor, null);
             Shell.util_set_hidden_from_pick(this._dragActor, true);
         }
 
@@ -427,7 +430,7 @@ var _Draggable = class _Draggable {
                     scale_x: scale * origScale,
                     scale_y: scale * origScale,
                     duration: SCALE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
                 });
 
                 this._dragActor.get_transition('scale-x').connect('new-frame', () => {
@@ -472,7 +475,7 @@ var _Draggable = class _Draggable {
             y: this._dragY,
             dragActor: this._dragActor,
             source: this.actor._delegate,
-            targetActor: target
+            targetActor: target,
         };
 
         let targetActorDestroyHandlerId;
@@ -551,11 +554,11 @@ var _Draggable = class _Draggable {
         let dropEvent = {
             dropActor: this._dragActor,
             targetActor: target,
-            clutterEvent: event
+            clutterEvent: event,
         };
         for (let i = 0; i < dragMonitors.length; i++) {
             let dropFunc = dragMonitors[i].dragDrop;
-            if (dropFunc)
+            if (dropFunc) {
                 switch (dropFunc(dropEvent)) {
                 case DragDropResult.FAILURE:
                 case DragDropResult.SUCCESS:
@@ -563,6 +566,7 @@ var _Draggable = class _Draggable {
                 case DragDropResult.CONTINUE:
                     continue;
                 }
+            }
         }
 
         // At this point it is too late to cancel a drag by destroying
@@ -573,11 +577,15 @@ var _Draggable = class _Draggable {
         while (target) {
             if (target._delegate && target._delegate.acceptDrop) {
                 let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
-                if (target._delegate.acceptDrop(this.actor._delegate,
-                                                this._dragActor,
-                                                targX,
-                                                targY,
-                                                event.get_time())) {
+                let accepted = false;
+                try {
+                    accepted = target._delegate.acceptDrop(this.actor._delegate,
+                        this._dragActor, targX, targY, event.get_time());
+                } catch (e) {
+                    // On error, skip this target
+                    logError(e, "Skipping drag target");
+                }
+                if (accepted) {
                     // If it accepted the drop without taking the actor,
                     // handle it ourselves.
                     if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) {
@@ -638,7 +646,7 @@ var _Draggable = class _Draggable {
 
     _cancelDrag(eventTime) {
         this.emit('drag-cancelled', eventTime);
-        let wasCancelled = (this._dragState == DragState.CANCELLED);
+        let wasCancelled = this._dragState == DragState.CANCELLED;
         this._dragState = DragState.CANCELLED;
 
         if (this._actorDestroyed || wasCancelled) {
@@ -659,7 +667,7 @@ var _Draggable = class _Draggable {
             y: snapBackY,
             scale_x: snapBackScale,
             scale_y: snapBackScale,
-            duration: SNAP_BACK_ANIMATION_TIME
+            duration: SNAP_BACK_ANIMATION_TIME,
         });
     }
 
@@ -673,7 +681,7 @@ var _Draggable = class _Draggable {
         this._dragActor.opacity = 0;
 
         this._animateDragEnd(eventTime, {
-            duration: REVERT_ANIMATION_TIME
+            duration: REVERT_ANIMATION_TIME,
         });
     }
 
@@ -686,7 +694,7 @@ var _Draggable = class _Draggable {
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             onComplete: () => {
                 this._onAnimationComplete(this._dragActor, eventTime);
-            }
+            },
         }));
     }
 
@@ -740,8 +748,9 @@ Signals.addSignalMethods(_Draggable.prototype);
 
 /**
  * makeDraggable:
- * @actor: Source actor
- * @params: (optional) Additional parameters
+ * @param {Clutter.Actor} actor: Source actor
+ * @param {Object=} params: Additional parameters
+ * @returns {Object} a new Draggable
  *
  * Create an object which controls drag and drop for the given actor.
  *

js/ui/edgeDragAction.js

@@ -37,17 +37,17 @@ var EdgeDragAction = GObject.registerClass({
         let [x, y] = this.get_press_coords(0);
         let monitorRect = this._getMonitorRect(x, y);
 
-        return ((this._side == St.Side.LEFT && x < monitorRect.x + EDGE_THRESHOLD) ||
+        return (this._side == St.Side.LEFT && x < monitorRect.x + EDGE_THRESHOLD) ||
                 (this._side == St.Side.RIGHT && x > monitorRect.x + monitorRect.width - EDGE_THRESHOLD) ||
                 (this._side == St.Side.TOP && y < monitorRect.y + EDGE_THRESHOLD) ||
-                (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
+                (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD);
     }
 
     vfunc_gesture_progress(_actor) {
         let [startX, startY] = this.get_press_coords(0);
         let [x, y] = this.get_motion_coords(0);
-        let offsetX = Math.abs (x - startX);
-        let offsetY = Math.abs (y - startY);
+        let offsetX = Math.abs(x - startX);
+        let offsetY = Math.abs(y - startY);
 
         if (offsetX < EDGE_THRESHOLD && offsetY < EDGE_THRESHOLD)
             return true;

js/ui/endSessionDialog.js

@@ -17,8 +17,6 @@
  * along with this program; if not, see <http://www.gnu.org/licenses/>.
  */
 
-const Mainloop = imports.mainloop;
-
 const { AccountsService, Clutter, Gio,
         GLib, GObject, Pango, Polkit, Shell, St }  = imports.gi;
 
@@ -130,7 +128,7 @@ const DialogType = {
     SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
     RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
     UPDATE_RESTART: 3,
-    UPGRADE_RESTART: 4
+    UPGRADE_RESTART: 4,
 };
 
 const DialogContent = {
@@ -138,7 +136,7 @@ const DialogContent = {
     1 /* DialogType.SHUTDOWN */: shutdownDialogContent,
     2 /* DialogType.RESTART */: restartDialogContent,
     3 /* DialogType.UPDATE_RESTART */: restartUpdateDialogContent,
-    4 /* DialogType.UPGRADE_RESTART */: restartUpgradeDialogContent
+    4 /* DialogType.UPGRADE_RESTART */: restartUpgradeDialogContent,
 };
 
 var MAX_USERS_IN_SESSION_DIALOG = 5;
@@ -209,10 +207,10 @@ function _setCheckBoxLabel(checkBox, text) {
 
     if (text) {
         label.set_text(text);
-        checkBox.actor.show();
+        checkBox.show();
     } else {
         label.set_text('');
-        checkBox.actor.hide();
+        checkBox.hide();
     }
 }
 
@@ -220,7 +218,7 @@ function init() {
     // This always returns the same singleton object
     // By instantiating it initially, we register the
     // bus object, etc.
-    (new EndSessionDialog());
+    new EndSessionDialog();
 }
 
 var EndSessionDialog = GObject.registerClass(
@@ -265,42 +263,39 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         this._userLoadedId = this._user.connect('notify::is_loaded', this._sync.bind(this));
         this._userChangedId = this._user.connect('changed', this._sync.bind(this));
 
-        let mainContentLayout = new St.BoxLayout({ vertical: false });
-        this.contentLayout.add(mainContentLayout,
-                               { x_fill: true,
-                                 y_fill: false });
+        let mainContentLayout = new St.BoxLayout({
+            vertical: false,
+            x_expand: true,
+            y_expand: false,
+        });
+        this.contentLayout.add_child(mainContentLayout);
 
-        this._iconBin = new St.Bin();
-        mainContentLayout.add(this._iconBin,
-                              { x_fill: true,
-                                y_fill: false,
-                                x_align: St.Align.END,
-                                y_align: St.Align.START });
+        this._iconBin = new St.Bin({
+            x_expand: true,
+            x_align: Clutter.ActorAlign.END,
+        });
+        mainContentLayout.add_child(this._iconBin);
 
         let messageLayout = new St.BoxLayout({ vertical: true,
                                                style_class: 'end-session-dialog-layout' });
-        mainContentLayout.add(messageLayout,
-                              { y_align: St.Align.START });
+        mainContentLayout.add_child(messageLayout);
 
         this._subjectLabel = new St.Label({ style_class: 'end-session-dialog-subject' });
 
-        messageLayout.add(this._subjectLabel,
-                          { x_fill: false,
-                            y_fill: false,
-                            x_align: St.Align.START,
-                            y_align: St.Align.START });
+        messageLayout.add_child(this._subjectLabel);
 
-        this._descriptionLabel = new St.Label({ style_class: 'end-session-dialog-description' });
+        this._descriptionLabel = new St.Label({
+            style_class: 'end-session-dialog-description',
+            y_expand: true,
+        });
         this._descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
         this._descriptionLabel.clutter_text.line_wrap = true;
 
-        messageLayout.add(this._descriptionLabel,
-                          { y_fill: true,
-                            y_align: St.Align.START });
+        messageLayout.add_child(this._descriptionLabel);
 
         this._checkBox = new CheckBox.CheckBox();
-        this._checkBox.actor.connect('clicked', this._sync.bind(this));
-        messageLayout.add(this._checkBox.actor);
+        this._checkBox.connect('clicked', this._sync.bind(this));
+        messageLayout.add(this._checkBox);
 
         this._batteryWarning = new St.Label({ style_class: 'end-session-dialog-warning',
                                               text: _("Running on battery power: please plug in before installing updates.") });
@@ -308,11 +303,13 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         this._batteryWarning.clutter_text.line_wrap = true;
         messageLayout.add(this._batteryWarning);
 
-        this._scrollView = new St.ScrollView({ style_class: 'end-session-dialog-list' });
+        this._scrollView = new St.ScrollView({
+            style_class: 'end-session-dialog-list',
+            x_expand: true,
+            y_expand: true,
+        });
         this._scrollView.set_policy(St.PolicyType.NEVER, St.PolicyType.AUTOMATIC);
-        this.contentLayout.add(this._scrollView,
-                               { x_fill: true,
-                                 y_fill: true });
+        this.contentLayout.add_child(this._scrollView);
         this._scrollView.hide();
 
         this._inhibitorSection = new St.BoxLayout({ vertical: true,
@@ -352,12 +349,15 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         }
 
         // It only makes sense to check for this permission if PackageKit is available.
-        try {
-            this._updatesPermission = Polkit.Permission.new_sync(
-                'org.freedesktop.packagekit.trigger-offline-update', null, null);
-        } catch (e) {
-            log('No permission to trigger offline updates: %s'.format(e.toString()));
-        }
+        Polkit.Permission.new(
+            'org.freedesktop.packagekit.trigger-offline-update', null, null,
+            (source, res) => {
+                try {
+                    this._updatesPermission = Polkit.Permission.new_finish(res);
+                } catch (e) {
+                    log(`No permission to trigger offline updates: ${e}`);
+                }
+            });
     }
 
     _onDestroy() {
@@ -366,7 +366,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
     }
 
     _sync() {
-        let open = (this.state == ModalDialog.State.OPENING || this.state == ModalDialog.State.OPENED);
+        let open = this.state == ModalDialog.State.OPENING || this.state == ModalDialog.State.OPENED;
         if (!open)
             return;
 
@@ -375,12 +375,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         let subject = dialogContent.subject;
 
         // Use different title when we are installing updates
-        if (dialogContent.subjectWithUpdates && this._checkBox.actor.checked)
+        if (dialogContent.subjectWithUpdates && this._checkBox.checked)
             subject = dialogContent.subjectWithUpdates;
 
         if (dialogContent.showBatteryWarning) {
             // Warn when running on battery power
-            if (this._powerProxy.OnBattery && this._checkBox.actor.checked)
+            if (this._powerProxy.OnBattery && this._checkBox.checked)
                 this._batteryWarning.opacity = 255;
             else
                 this._batteryWarning.opacity = 0;
@@ -428,7 +428,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
             let avatarWidget = new UserWidget.Avatar(this._user,
                                                      { iconSize: _DIALOG_ICON_SIZE,
                                                        styleClass: dialogContent.iconStyleClass });
-            this._iconBin.child = avatarWidget.actor;
+            this._iconBin.child = avatarWidget;
             avatarWidget.update();
         }
 
@@ -443,19 +443,21 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         let dialogContent = DialogContent[this._type];
         let buttons = [{ action: this.cancel.bind(this),
                          label: _("Cancel"),
-                         key: Clutter.Escape }];
+                         key: Clutter.KEY_Escape }];
 
         for (let i = 0; i < dialogContent.confirmButtons.length; i++) {
             let signal = dialogContent.confirmButtons[i].signal;
             let label = dialogContent.confirmButtons[i].label;
-            buttons.push({ action: () => {
-                               this.close(true);
-                               let signalId = this.connect('closed', () => {
-                                   this.disconnect(signalId);
-                                   this._confirm(signal);
-                               });
-                           },
-                           label: label });
+            buttons.push({
+                action: () => {
+                    this.close(true);
+                    let signalId = this.connect('closed', () => {
+                        this.disconnect(signalId);
+                        this._confirm(signal);
+                    });
+                },
+                label,
+            });
         }
 
         this.setButtons(buttons);
@@ -482,13 +484,13 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         };
 
         // Offline update not available; just emit the signal
-        if (!this._checkBox.actor.visible) {
+        if (!this._checkBox.visible) {
             callback();
             return;
         }
 
         // Trigger the offline update as requested
-        if (this._checkBox.actor.checked) {
+        if (this._checkBox.checked) {
             switch (signal) {
             case "ConfirmedReboot":
                 this._triggerOfflineUpdateReboot(callback);
@@ -562,9 +564,9 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         let startTime = GLib.get_monotonic_time();
         this._secondsLeft = this._totalSecondsToStayOpen;
 
-        this._timerId = Mainloop.timeout_add_seconds(1, () => {
+        this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => {
             let currentTime = GLib.get_monotonic_time();
-            let secondsElapsed = ((currentTime - startTime) / 1000000);
+            let secondsElapsed = (currentTime - startTime) / 1000000;
 
             this._secondsLeft = this._totalSecondsToStayOpen - secondsElapsed;
             if (this._secondsLeft > 0) {
@@ -584,7 +586,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
 
     _stopTimer() {
         if (this._timerId > 0) {
-            Mainloop.source_remove(this._timerId);
+            GLib.source_remove(this._timerId);
             this._timerId = 0;
         }
 
@@ -653,7 +655,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
 
         let actor = new St.BoxLayout({ style_class: 'end-session-dialog-session-list-item',
                                        can_focus: true });
-        actor.add(avatar.actor);
+        actor.add(avatar);
 
         let nameLabel = new St.Label({ text: userLabelText,
                                        style_class: 'end-session-dialog-session-list-item-name',
@@ -679,11 +681,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
                     continue;
 
                 let sessionId = GLib.getenv('XDG_SESSION_ID');
-                if (!sessionId)
+                if (!sessionId) {
                     this._loginManager.getCurrentSessionProxy(currentSessionProxy => {
                         sessionId = currentSessionProxy.Id;
                         log(`endSessionDialog: No XDG_SESSION_ID, fetched from logind: ${sessionId}`);
                     });
+                }
 
                 if (proxy.Id == sessionId)
                     continue;
@@ -751,14 +754,14 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
         let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed;
 
         _setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || '');
-        this._checkBox.actor.visible = (dialogContent.checkBoxText && updatePrepared && updatesAllowed);
-        this._checkBox.actor.checked = (updatePrepared && updateTriggered);
+        this._checkBox.visible = dialogContent.checkBoxText && updatePrepared && updatesAllowed;
+        this._checkBox.checked = updatePrepared && updateTriggered;
 
         // We show the warning either together with the checkbox, or when
         // updates have already been triggered, but the user doesn't have
         // enough permissions to cancel them.
-        this._batteryWarning.visible = (dialogContent.showBatteryWarning &&
-                                        (this._checkBox.actor.visible || updatePrepared && updateTriggered && !updatesAllowed));
+        this._batteryWarning.visible = dialogContent.showBatteryWarning &&
+                                        (this._checkBox.visible || updatePrepared && updateTriggered && !updatesAllowed);
 
         this._updateButtons();
 

js/ui/environment.js

@@ -10,7 +10,7 @@ imports.gi.versions.Gtk = '3.0';
 imports.gi.versions.TelepathyGLib = '0.12';
 imports.gi.versions.TelepathyLogger = '0.2';
 
-const { Clutter, GLib, Shell, St } = imports.gi;
+const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Gettext = imports.gettext;
 
 // We can't import shell JS modules yet, because they may have
@@ -23,7 +23,7 @@ const Gettext = imports.gettext;
 // of interfaces in Javascript
 function _patchContainerClass(containerClass) {
     // This one is a straightforward mapping of the C method
-    containerClass.prototype.child_set = function(actor, props) {
+    containerClass.prototype.child_set = function (actor, props) {
         let meta = this.get_child_meta(actor);
         for (let prop in props)
             meta[prop] = props[prop];
@@ -32,7 +32,7 @@ function _patchContainerClass(containerClass) {
     // clutter_container_add() actually is a an add-many-actors
     // method. We conveniently, but somewhat dubiously, take the
     // this opportunity to make it do something more useful.
-    containerClass.prototype.add = function(actor, props) {
+    containerClass.prototype.add = function (actor, props) {
         this.add_actor(actor);
         if (props)
             this.child_set(actor, props);
@@ -40,8 +40,8 @@ function _patchContainerClass(containerClass) {
 }
 
 function _patchLayoutClass(layoutClass, styleProps) {
-    if (styleProps)
-        layoutClass.prototype.hookup_style = function(container) {
+    if (styleProps) {
+        layoutClass.prototype.hookup_style = function (container) {
             container.connect('style-changed', () => {
                 let node = container.get_theme_node();
                 for (let prop in styleProps) {
@@ -51,24 +51,19 @@ function _patchLayoutClass(layoutClass, styleProps) {
                 }
             });
         };
-    layoutClass.prototype.child_set = function(actor, props) {
-        let meta = this.get_child_meta(actor.get_parent(), actor);
-        for (let prop in props)
-            meta[prop] = props[prop];
-    };
+    }
 }
 
-function _makeEaseCallback(params) {
+function _makeEaseCallback(params, cleanup) {
     let onComplete = params.onComplete;
     delete params.onComplete;
 
     let onStopped = params.onStopped;
     delete params.onStopped;
 
-    if (!onComplete && !onStopped)
-        return null;
-
     return isFinished => {
+        cleanup();
+
         if (onStopped)
             onStopped(isFinished);
         if (onComplete && isFinished)
@@ -106,11 +101,22 @@ function _easeActor(actor, params) {
         actor.set_easing_delay(params.delay);
     delete params.delay;
 
+    let repeatCount = 0;
+    if (params.repeatCount != undefined)
+        repeatCount = params.repeatCount;
+    delete params.repeatCount;
+
+    let autoReverse = false;
+    if (params.autoReverse != undefined)
+        autoReverse = params.autoReverse;
+    delete params.autoReverse;
+
     if (params.mode != undefined)
         actor.set_easing_mode(params.mode);
     delete params.mode;
 
-    let callback = _makeEaseCallback(params);
+    let cleanup = () => Meta.enable_unredirect_for_display(global.display);
+    let callback = _makeEaseCallback(params, cleanup);
 
     // cancel overwritten transitions
     let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
@@ -119,13 +125,19 @@ function _easeActor(actor, params) {
     actor.set(params);
     actor.restore_easing_state();
 
-    if (callback) {
-        let transition = actor.get_transition(animatedProps[0]);
+    let transition = animatedProps.map(p => actor.get_transition(p))
+        .find(t => t !== null);
 
-        if (transition)
-            transition.connect('stopped', (t, finished) => callback(finished));
-        else
-            callback(true);
+    if (transition && transition.delay)
+        transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
+    else
+        Meta.disable_unredirect_for_display(global.display);
+
+    if (transition) {
+        transition.set({ repeatCount, autoReverse });
+        transition.connect('stopped', (t, finished) => callback(finished));
+    } else {
+        callback(true);
     }
 }
 
@@ -139,7 +151,23 @@ function _easeActorProperty(actor, propName, target, params) {
         params.duration = adjustAnimationTime(params.duration);
     let duration = Math.floor(params.duration || 0);
 
-    let callback = _makeEaseCallback(params);
+    let repeatCount = 0;
+    if (params.repeatCount != undefined)
+        repeatCount = params.repeatCount;
+    delete params.repeatCount;
+
+    let autoReverse = false;
+    if (params.autoReverse != undefined)
+        autoReverse = params.autoReverse;
+    delete params.autoReverse;
+
+    // Copy Clutter's behavior for implicit animations, see
+    // should_skip_implicit_transition()
+    if (actor instanceof Clutter.Actor && !actor.mapped)
+        duration = 0;
+
+    let cleanup = () => Meta.enable_unredirect_for_display(global.display);
+    let callback = _makeEaseCallback(params, cleanup);
 
     // cancel overwritten transition
     actor.remove_transition(propName);
@@ -148,8 +176,8 @@ function _easeActorProperty(actor, propName, target, params) {
         let [obj, prop] = _getPropertyTarget(actor, propName);
         obj[prop] = target;
 
-        if (callback)
-            callback(true);
+        Meta.disable_unredirect_for_display(global.display);
+        callback(true);
 
         return;
     }
@@ -158,14 +186,20 @@ function _easeActorProperty(actor, propName, target, params) {
     let transition = new Clutter.PropertyTransition(Object.assign({
         property_name: propName,
         interval: new Clutter.Interval({ value_type: pspec.value_type }),
-        remove_on_complete: true
+        remove_on_complete: true,
+        repeat_count: repeatCount,
+        auto_reverse: autoReverse,
     }, params));
     actor.add_transition(propName, transition);
 
     transition.set_to(target);
 
-    if (callback)
-        transition.connect('stopped', (t, finished) => callback(finished));
+    if (transition.delay)
+        transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
+    else
+        Meta.disable_unredirect_for_display(global.display);
+
+    transition.connect('stopped', (t, finished) => callback(finished));
 }
 
 function _loggingFunc(...args) {
@@ -195,37 +229,37 @@ function init() {
     window.ngettext = Gettext.ngettext;
     window.N_ = s => s;
 
+    GObject.gtypeNameBasedOnJSPath = true;
+
     // Miscellaneous monkeypatching
     _patchContainerClass(St.BoxLayout);
 
-    _patchLayoutClass(Clutter.TableLayout, { row_spacing: 'spacing-rows',
-                                             column_spacing: 'spacing-columns' });
     _patchLayoutClass(Clutter.GridLayout, { row_spacing: 'spacing-rows',
                                             column_spacing: 'spacing-columns' });
     _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });
 
     let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
-    Clutter.Actor.prototype.set_easing_duration = function(msecs) {
+    Clutter.Actor.prototype.set_easing_duration = function (msecs) {
         origSetEasingDuration.call(this, adjustAnimationTime(msecs));
     };
     let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
-    Clutter.Actor.prototype.set_easing_delay = function(msecs) {
+    Clutter.Actor.prototype.set_easing_delay = function (msecs) {
         origSetEasingDelay.call(this, adjustAnimationTime(msecs));
     };
 
-    Clutter.Actor.prototype.ease = function(props, easingParams) {
+    Clutter.Actor.prototype.ease = function (props, easingParams) {
         _easeActor(this, props, easingParams);
     };
-    Clutter.Actor.prototype.ease_property = function(propName, target, params) {
+    Clutter.Actor.prototype.ease_property = function (propName, target, params) {
         _easeActorProperty(this, propName, target, params);
     };
-    St.Adjustment.prototype.ease = function(target, params) {
+    St.Adjustment.prototype.ease = function (target, params) {
         // we're not an actor of course, but we implement the same
         // transition API as Clutter.Actor, so this works anyway
         _easeActorProperty(this, 'value', target, params);
     };
 
-    Clutter.Actor.prototype.toString = function() {
+    Clutter.Actor.prototype.toString = function () {
         return St.describe_actor(this);
     };
     // Deprecation warning for former JS classes turned into an actor subclass
@@ -235,17 +269,17 @@ function init() {
             let { stack } = new Error();
             log(`Usage of object.actor is deprecated for ${klass}\n${stack}`);
             return this;
-        }
+        },
     });
 
-    St.set_slow_down_factor = function(factor) {
+    St.set_slow_down_factor = function (factor) {
         let { stack } = new Error();
         log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
         St.Settings.get().slow_down_factor = factor;
     };
 
     let origToString = Object.prototype.toString;
-    Object.prototype.toString = function() {
+    Object.prototype.toString = function () {
         let base = origToString.call(this);
         try {
             if ('actor' in this && this.actor instanceof Clutter.Actor)
@@ -258,8 +292,9 @@ function init() {
     };
 
     // Work around https://bugzilla.mozilla.org/show_bug.cgi?id=508783
-    Date.prototype.toLocaleFormat = function(format) {
-        return Shell.util_format_date(format, this.getTime());
+    Date.prototype.toLocaleFormat = function (format) {
+        let dt = GLib.DateTime.new_from_unix_local(this.getTime() / 1000);
+        return dt ? dt.format(format) : '';
     };
 
     let slowdownEnv = GLib.getenv('GNOME_SHELL_SLOWDOWN_FACTOR');

js/ui/extensionDownloader.js

@@ -19,12 +19,12 @@ var REPOSITORY_URL_UPDATE   = `${REPOSITORY_URL_BASE}/update-info/`;
 let _httpSession;
 
 function installExtension(uuid, invocation) {
-    let params = { uuid: uuid,
+    let params = { uuid,
                    shell_version: Config.PACKAGE_VERSION };
 
     let message = Soup.form_request_new_from_hash('GET', REPOSITORY_URL_INFO, params);
 
-    _httpSession.queue_message(message, (session, message) => {
+    _httpSession.queue_message(message, () => {
         if (message.status_code != Soup.KnownStatusCode.OK) {
             Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
             invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
@@ -90,7 +90,7 @@ function gotExtensionZipFile(session, message, uuid, dir, callback, errback) {
         return;
     }
 
-    GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, (pid, status) => {
+    GLib.child_watch_add(GLib.PRIORITY_DEFAULT, pid, (o, status) => {
         GLib.spawn_close_pid(pid);
 
         if (status != 0)
@@ -113,7 +113,7 @@ function updateExtension(uuid) {
     let url = REPOSITORY_URL_DOWNLOAD.format(uuid);
     let message = Soup.form_request_new_from_hash('GET', url, params);
 
-    _httpSession.queue_message(message, (session, message) => {
+    _httpSession.queue_message(message, session => {
         gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
             let oldExtension = Main.extensionManager.lookup(uuid);
             let extensionDir = oldExtension.dir;
@@ -145,8 +145,8 @@ function updateExtension(uuid) {
             }
 
             FileUtils.recursivelyDeleteDir(oldExtensionTmpDir, true);
-        }, (code, message) => {
-            log('Error while updating extension %s: %s (%s)'.format(uuid, code, message ? message : ''));
+        }, (code, msg) => {
+            log(`Error while updating extension ${uuid}: ${code} (${msg})`);
         });
     });
 }
@@ -162,7 +162,7 @@ function checkForUpdates() {
 
     let url = REPOSITORY_URL_UPDATE;
     let message = Soup.form_request_new_from_hash('GET', url, params);
-    _httpSession.queue_message(message, (session, message) => {
+    _httpSession.queue_message(message, () => {
         if (message.status_code != Soup.KnownStatusCode.OK)
             return;
 
@@ -186,20 +186,21 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
         this._info = info;
         this._invocation = invocation;
 
-        this.setButtons([{ label: _("Cancel"),
-                           action: this._onCancelButtonPressed.bind(this),
-                           key: Clutter.Escape
-                         },
-                         { label: _("Install"),
-                           action: this._onInstallButtonPressed.bind(this),
-                           default: true
-                         }]);
+        this.setButtons([{
+            label: _("Cancel"),
+            action: this._onCancelButtonPressed.bind(this),
+            key: Clutter.KEY_Escape,
+        }, {
+            label: _("Install"),
+            action: this._onInstallButtonPressed.bind(this),
+            default: true,
+        }]);
 
         let content = new Dialog.MessageDialogContent({
             title: _("Download and install “%s” from extensions.gnome.org?").format(info.name),
             icon: new Gio.FileIcon({
-                file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`)
-            })
+                file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`),
+            }),
         });
 
         this.contentLayout.add(content);
@@ -219,10 +220,9 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
         let uuid = this._uuid;
         let dir = Gio.File.new_for_path(GLib.build_filenamev([global.userdatadir, 'extensions', uuid]));
         let invocation = this._invocation;
-        function errback(code, message) {
-            let msg = message ? message.toString() : '';
-            log('Error while installing %s: %s (%s)'.format(uuid, code, msg));
-            invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg);
+        function errback(code, msg) {
+            log(`Error while installing ${uuid}: ${code} (${msg})`);
+            invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg || '');
         }
 
         function callback() {
@@ -240,7 +240,7 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
             invocation.return_value(GLib.Variant.new('(s)', ['successful']));
         }
 
-        _httpSession.queue_message(message, (session, message) => {
+        _httpSession.queue_message(message, session => {
             gotExtensionZipFile(session, message, uuid, dir, callback, errback);
         });
 

js/ui/extensionSystem.js

@@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported init connect disconnect */
 
-const { Gio, St } = imports.gi;
+const { GLib, Gio, St } = imports.gi;
 const Signals = imports.signals;
 
 const ExtensionUtils = imports.misc.extensionUtils;
@@ -17,7 +17,7 @@ const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validatio
 
 var ExtensionManager = class {
     constructor() {
-        this._initted = false;
+        this._initialized = false;
         this._enabled = false;
 
         this._extensions = new Map();
@@ -28,6 +28,23 @@ var ExtensionManager = class {
     }
 
     init() {
+        // The following file should exist for a period of time when extensions
+        // are enabled after start. If it exists, then the systemd unit will
+        // disable extensions should gnome-shell crash.
+        // Should the file already exist from a previous login, then this is OK.
+        let disableFilename = GLib.build_filenamev([GLib.get_user_runtime_dir(), 'gnome-shell-disable-extensions']);
+        let disableFile = Gio.File.new_for_path(disableFilename);
+        try {
+            disableFile.create(Gio.FileCreateFlags.REPLACE_DESTINATION, null);
+        } catch (e) {
+            log(`Failed to create file ${disableFilename}: ${e.message}`);
+        }
+
+        GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 60, () => {
+            disableFile.delete(null);
+            return GLib.SOURCE_REMOVE;
+        });
+
         this._sessionUpdated();
     }
 
@@ -60,11 +77,11 @@ var ExtensionManager = class {
         let orderReversed = order.slice().reverse();
 
         for (let i = 0; i < orderReversed.length; i++) {
-            let uuid = orderReversed[i];
+            let otherUuid = orderReversed[i];
             try {
-                this.lookup(uuid).stateObj.disable();
+                this.lookup(otherUuid).stateObj.disable();
             } catch (e) {
-                this.logExtensionError(uuid, e);
+                this.logExtensionError(otherUuid, e);
             }
         }
 
@@ -81,11 +98,11 @@ var ExtensionManager = class {
         }
 
         for (let i = 0; i < order.length; i++) {
-            let uuid = order[i];
+            let otherUuid = order[i];
             try {
-                this.lookup(uuid).stateObj.enable();
+                this.lookup(otherUuid).stateObj.enable();
             } catch (e) {
-                this.logExtensionError(uuid, e);
+                this.logExtensionError(otherUuid, e);
             }
         }
 
@@ -98,6 +115,9 @@ var ExtensionManager = class {
     }
 
     _callExtensionEnable(uuid) {
+        if (!Main.sessionMode.allowExtensions)
+            return;
+
         let extension = this.lookup(uuid);
         if (!extension)
             return;
@@ -108,8 +128,6 @@ var ExtensionManager = class {
         if (extension.state != ExtensionState.DISABLED)
             return;
 
-        this._extensionOrder.push(uuid);
-
         let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
         let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
         for (let i = 0; i < stylesheetNames.length; i++) {
@@ -121,7 +139,7 @@ var ExtensionManager = class {
             } catch (e) {
                 if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
                     continue; // not an error
-                log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+                this.logExtensionError(uuid, e);
                 return;
             }
         }
@@ -129,15 +147,14 @@ var ExtensionManager = class {
         try {
             extension.stateObj.enable();
             extension.state = ExtensionState.ENABLED;
+            this._extensionOrder.push(uuid);
             this.emit('extension-state-changed', extension);
-            return;
         } catch (e) {
             if (extension.stylesheet) {
                 theme.unload_stylesheet(extension.stylesheet);
                 delete extension.stylesheet;
             }
             this.logExtensionError(uuid, e);
-            return;
         }
     }
 
@@ -194,15 +211,14 @@ var ExtensionManager = class {
             extension.errors = [];
         extension.errors.push(message);
 
-        log('Extension "%s" had error: %s'.format(uuid, message));
+        logError(error, `Extension ${uuid}`);
         this.emit('extension-state-changed', extension);
     }
 
     createExtensionObject(uuid, dir, type) {
         let metadataFile = dir.get_child('metadata.json');
-        if (!metadataFile.query_exists(null)) {
+        if (!metadataFile.query_exists(null))
             throw new Error('Missing metadata.json');
-        }
 
         let metadataContents, success_;
         try {
@@ -222,14 +238,12 @@ var ExtensionManager = class {
         let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
         for (let i = 0; i < requiredProperties.length; i++) {
             let prop = requiredProperties[i];
-            if (!meta[prop]) {
+            if (!meta[prop])
                 throw new Error(`missing "${prop}" property in metadata.json`);
-            }
         }
 
-        if (uuid != meta.uuid) {
+        if (uuid != meta.uuid)
             throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
-        }
 
         let extension = {
             metadata: meta,
@@ -239,7 +253,7 @@ var ExtensionManager = class {
             path: dir.get_path(),
             error: '',
             hasPrefs: dir.get_child('prefs.js').query_exists(null),
-            canChange: false
+            canChange: false,
         };
         this._extensions.set(uuid, extension);
 
@@ -286,7 +300,7 @@ var ExtensionManager = class {
     reloadExtension(oldExtension) {
         // Grab the things we'll need to pass to createExtensionObject
         // to reload it.
-        let { uuid: uuid, dir: dir, type: type } = oldExtension;
+        let { uuid, dir, type } = oldExtension;
 
         // Then unload the old extension.
         this.unloadExtension(oldExtension);
@@ -304,12 +318,14 @@ var ExtensionManager = class {
     }
 
     _callExtensionInit(uuid) {
+        if (!Main.sessionMode.allowExtensions)
+            return false;
+
         let extension = this.lookup(uuid);
-        let dir = extension.dir;
-
         if (!extension)
-            throw new Error("Extension was not properly created. Call loadExtension first");
+            throw new Error("Extension was not properly created. Call createExtensionObject first");
 
+        let dir = extension.dir;
         let extensionJs = dir.get_child('extension.js');
         if (!extensionJs.query_exists(null)) {
             this.logExtensionError(uuid, new Error('Missing extension.js'));
@@ -388,9 +404,6 @@ var ExtensionManager = class {
     _onEnabledExtensionsChanged() {
         let newEnabledExtensions = this._getEnabledExtensions();
 
-        if (!this._enabled)
-            return;
-
         // Find and enable all the newly enabled extensions: UUIDs found in the
         // new setting, but not in the old one.
         newEnabledExtensions.filter(
@@ -401,9 +414,9 @@ var ExtensionManager = class {
 
         // Find and disable all the newly disabled extensions: UUIDs found in the
         // old setting, but not in the new one.
-        this._enabledExtensions.filter(
-            item => !newEnabledExtensions.includes(item)
-        ).forEach(uuid => {
+        this._extensionOrder.filter(
+            uuid => !newEnabledExtensions.includes(uuid)
+        ).reverse().forEach(uuid => {
             this._callExtensionDisable(uuid);
         });
 
@@ -418,22 +431,19 @@ var ExtensionManager = class {
     }
 
     _onVersionValidationChanged() {
-        // we want to reload all extensions, but only enable
-        // extensions when allowed by the sessionMode, so
-        // temporarily disable them all
-        this._enabledExtensions = [];
+        // Disabling extensions modifies the order array, so use a copy
+        let extensionOrder = this._extensionOrder.slice();
 
-        // The loop modifies the extensions map, so iterate over a copy
-        let extensions = [...this._extensions.values()];
-        for (let extension of extensions)
-            this.reloadExtension(extension);
-        this._enabledExtensions = this._getEnabledExtensions();
+        // Disable enabled extensions in the reverse order first to avoid
+        // the "rebasing" done in _callExtensionDisable...
+        extensionOrder.slice().reverse().forEach(uuid => {
+            this._callExtensionDisable(uuid);
+        });
 
-        if (Main.sessionMode.allowExtensions) {
-            this._enabledExtensions.forEach(uuid => {
-                this._callExtensionEnable(uuid);
-            });
-        }
+        // ...and then reload and enable extensions in the correct order again.
+        [...this._extensions.values()].sort((a, b) => {
+            return extensionOrder.indexOf(a.uuid) - extensionOrder.indexOf(b.uuid);
+        }).forEach(extension => this.reloadExtension(extension));
     }
 
     _loadExtensions() {
@@ -482,9 +492,9 @@ var ExtensionManager = class {
         if (this._enabled)
             return;
 
-        if (!this._initted) {
+        if (!this._initialized) {
             this._loadExtensions();
-            this._initted = true;
+            this._initialized = true;
         } else {
             this._enabledExtensions.forEach(uuid => {
                 this._callExtensionEnable(uuid);
@@ -497,7 +507,7 @@ var ExtensionManager = class {
         if (!this._enabled)
             return;
 
-        if (this._initted) {
+        if (this._initialized) {
             this._extensionOrder.slice().reverse().forEach(uuid => {
                 this._callExtensionDisable(uuid);
             });
@@ -512,8 +522,8 @@ var ExtensionManager = class {
         // property; it might make sense to make enabledExtensions independent
         // from allowExtensions in the future
         if (Main.sessionMode.allowExtensions) {
-            if (this._initted)
-                this._enabledExtensions = this._getEnabledExtensions();
+            // Take care of added or removed sessionMode extensions
+            this._onEnabledExtensionsChanged();
             this._enableAllExtensions();
         } else {
             this._disableAllExtensions();

js/ui/grabHelper.js

@@ -195,7 +195,7 @@ var GrabHelper = class GrabHelper {
     }
 
     _takeModalGrab() {
-        let firstGrab = (this._modalCount == 0);
+        let firstGrab = this._modalCount == 0;
         if (firstGrab) {
             if (!Main.pushModal(this._owner, this._modalParams))
                 return false;
@@ -292,7 +292,7 @@ var GrabHelper = class GrabHelper {
         let touchEnd = type == Clutter.EventType.TOUCH_END;
         let touch = touchUpdate || touchBegin || touchEnd;
 
-        if (touch && !global.display.is_pointer_emulating_sequence (event.get_event_sequence()))
+        if (touch && !global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
             return Clutter.EVENT_PROPAGATE;
 
         if (this._ignoreUntilRelease && (motion || release || touch)) {

js/ui/ibusCandidatePopup.js

@@ -1,8 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported CandidatePopup */
 
-const { Clutter, IBus, St } = imports.gi;
-const Signals = imports.signals;
+const { Clutter, GObject, IBus, St } = imports.gi;
 
 const BoxPointer = imports.ui.boxpointer;
 const Main = imports.ui.main;
@@ -12,11 +11,23 @@ var MAX_CANDIDATES_PER_PAGE = 16;
 var DEFAULT_INDEX_LABELS = ['1', '2', '3', '4', '5', '6', '7', '8',
                             '9', '0', 'a', 'b', 'c', 'd', 'e', 'f'];
 
-var CandidateArea = class CandidateArea {
-    constructor() {
-        this.actor = new St.BoxLayout({ vertical: true,
-                                        reactive: true,
-                                        visible: false });
+var CandidateArea = GObject.registerClass({
+    Signals: {
+        'candidate-clicked': { param_types: [GObject.TYPE_UINT,
+                                             GObject.TYPE_UINT,
+                                             Clutter.ModifierType.$gtype] },
+        'cursor-down': {},
+        'cursor-up': {},
+        'next-page': {},
+        'previous-page': {},
+    },
+}, class CandidateArea extends St.BoxLayout {
+    _init() {
+        super._init({
+            vertical: true,
+            reactive: true,
+            visible: false,
+        });
         this._candidateBoxes = [];
         for (let i = 0; i < MAX_CANDIDATES_PER_PAGE; ++i) {
             let box = new St.BoxLayout({ style_class: 'candidate-box',
@@ -24,10 +35,10 @@ var CandidateArea = class CandidateArea {
                                          track_hover: true });
             box._indexLabel = new St.Label({ style_class: 'candidate-index' });
             box._candidateLabel = new St.Label({ style_class: 'candidate-label' });
-            box.add(box._indexLabel, { y_fill: false });
-            box.add(box._candidateLabel, { y_fill: false });
+            box.add_child(box._indexLabel);
+            box.add_child(box._candidateLabel);
             this._candidateBoxes.push(box);
-            this.actor.add(box);
+            this.add(box);
 
             let j = i;
             box.connect('button-release-event', (actor, event) => {
@@ -36,30 +47,23 @@ var CandidateArea = class CandidateArea {
             });
         }
 
-        this.actor.connect('scroll-event', (actor, event) => {
-            let direction = event.get_scroll_direction();
-            switch (direction) {
-            case Clutter.ScrollDirection.UP:
-                this.emit('cursor-up');
-                break;
-            case Clutter.ScrollDirection.DOWN:
-                this.emit('cursor-down');
-                break;
-            }
-            return Clutter.EVENT_PROPAGATE;
-        });
-
         this._buttonBox = new St.BoxLayout({ style_class: 'candidate-page-button-box' });
 
-        this._previousButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-previous button' });
+        this._previousButton = new St.Button({
+            style_class: 'candidate-page-button candidate-page-button-previous button',
+            x_expand: true,
+        });
         this._previousButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' });
-        this._buttonBox.add(this._previousButton, { expand: true });
+        this._buttonBox.add_child(this._previousButton);
 
-        this._nextButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-next button' });
+        this._nextButton = new St.Button({
+            style_class: 'candidate-page-button candidate-page-button-next button',
+            x_expand: true,
+        });
         this._nextButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' });
-        this._buttonBox.add(this._nextButton, { expand: true });
+        this._buttonBox.add_child(this._nextButton);
 
-        this.actor.add(this._buttonBox);
+        this.add(this._buttonBox);
 
         this._previousButton.connect('clicked', () => {
             this.emit('previous-page');
@@ -72,6 +76,18 @@ var CandidateArea = class CandidateArea {
         this._cursorPosition = 0;
     }
 
+    vfunc_scroll_event(scrollEvent) {
+        switch (scrollEvent.direction) {
+        case Clutter.ScrollDirection.UP:
+            this.emit('cursor-up');
+            break;
+        case Clutter.ScrollDirection.DOWN:
+            this.emit('cursor-down');
+            break;
+        }
+        return Clutter.EVENT_PROPAGATE;
+    }
+
     setOrientation(orientation) {
         if (this._orientation == orientation)
             return;
@@ -79,15 +95,15 @@ var CandidateArea = class CandidateArea {
         this._orientation = orientation;
 
         if (this._orientation == IBus.Orientation.HORIZONTAL) {
-            this.actor.vertical = false;
-            this.actor.remove_style_class_name('vertical');
-            this.actor.add_style_class_name('horizontal');
+            this.vertical = false;
+            this.remove_style_class_name('vertical');
+            this.add_style_class_name('horizontal');
             this._previousButton.child.icon_name = 'go-previous-symbolic';
             this._nextButton.child.icon_name = 'go-next-symbolic';
         } else {                // VERTICAL || SYSTEM
-            this.actor.vertical = true;
-            this.actor.add_style_class_name('vertical');
-            this.actor.remove_style_class_name('horizontal');
+            this.vertical = true;
+            this.add_style_class_name('vertical');
+            this.remove_style_class_name('horizontal');
             this._previousButton.child.icon_name = 'go-up-symbolic';
             this._nextButton.child.icon_name = 'go-down-symbolic';
         }
@@ -102,7 +118,7 @@ var CandidateArea = class CandidateArea {
             if (!visible)
                 continue;
 
-            box._indexLabel.text = ((indexes && indexes[i]) ? indexes[i] : DEFAULT_INDEX_LABELS[i]);
+            box._indexLabel.text = indexes && indexes[i] ? indexes[i] : DEFAULT_INDEX_LABELS[i];
             box._candidateLabel.text = candidates[i];
         }
 
@@ -121,19 +137,23 @@ var CandidateArea = class CandidateArea {
         this._previousButton.reactive = wrapsAround || page > 0;
         this._nextButton.reactive = wrapsAround || page < nPages - 1;
     }
-};
-Signals.addSignalMethods(CandidateArea.prototype);
+});
 
-var CandidatePopup = class CandidatePopup {
-    constructor() {
-        this._boxPointer = new BoxPointer.BoxPointer(St.Side.TOP);
-        this._boxPointer.visible = false;
-        this._boxPointer.style_class = 'candidate-popup-boxpointer';
-        Main.layoutManager.addChrome(this._boxPointer);
+var CandidatePopup = GObject.registerClass(
+class IbusCandidatePopup extends BoxPointer.BoxPointer {
+    _init() {
+        super._init(St.Side.TOP);
+        this.visible = false;
+        this.style_class = 'candidate-popup-boxpointer';
+
+        this._dummyCursor = new St.Widget({ opacity: 0 });
+        Main.layoutManager.uiGroup.add_actor(this._dummyCursor);
+
+        Main.layoutManager.addChrome(this);
 
         let box = new St.BoxLayout({ style_class: 'candidate-popup-content',
                                      vertical: true });
-        this._boxPointer.bin.set_child(box);
+        this.bin.set_child(box);
 
         this._preeditText = new St.Label({ style_class: 'candidate-popup-text',
                                            visible: false });
@@ -144,7 +164,7 @@ var CandidatePopup = class CandidatePopup {
         box.add(this._auxText);
 
         this._candidateArea = new CandidateArea();
-        box.add(this._candidateArea.actor);
+        box.add(this._candidateArea);
 
         this._candidateArea.connect('previous-page', () => {
             this._panelService.page_up();
@@ -195,9 +215,10 @@ var CandidatePopup = class CandidatePopup {
             this._preeditText.text = text.get_text();
 
             let attrs = text.get_attributes();
-            if (attrs)
+            if (attrs) {
                 this._setTextAttributes(this._preeditText.clutter_text,
                                         attrs);
+            }
         });
         panelService.connect('show-preedit-text', () => {
             this._preeditText.show();
@@ -222,14 +243,14 @@ var CandidatePopup = class CandidatePopup {
             this._updateVisibility();
         });
         panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => {
-            this._candidateArea.actor.visible = visible;
+            this._candidateArea.visible = visible;
             this._updateVisibility();
 
             let nCandidates = lookupTable.get_number_of_candidates();
             let cursorPos = lookupTable.get_cursor_pos();
             let pageSize = lookupTable.get_page_size();
             let nPages = Math.ceil(nCandidates / pageSize);
-            let page = ((cursorPos == 0) ? 0 : Math.floor(cursorPos / pageSize));
+            let page = cursorPos == 0 ? 0 : Math.floor(cursorPos / pageSize);
             let startIndex = page * pageSize;
             let endIndex = Math.min((page + 1) * pageSize, nCandidates);
 
@@ -258,44 +279,47 @@ var CandidatePopup = class CandidatePopup {
             this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
         });
         panelService.connect('show-lookup-table', () => {
-            this._candidateArea.actor.show();
+            this._candidateArea.show();
             this._updateVisibility();
         });
         panelService.connect('hide-lookup-table', () => {
-            this._candidateArea.actor.hide();
+            this._candidateArea.hide();
             this._updateVisibility();
         });
         panelService.connect('focus-out', () => {
-            this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
+            this.close(BoxPointer.PopupAnimation.NONE);
             Main.keyboard.resetSuggestions();
         });
     }
 
     _setDummyCursorGeometry(x, y, w, h) {
-        Main.layoutManager.setDummyCursorGeometry(x, y, w, h);
-        if (this._boxPointer.visible)
-            this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
+        this._dummyCursor.set_position(Math.round(x), Math.round(y));
+        this._dummyCursor.set_size(Math.round(w), Math.round(h));
+
+        if (this.visible)
+            this.setPosition(this._dummyCursor, 0);
     }
 
     _updateVisibility() {
-        let isVisible = (!Main.keyboard.visible &&
+        let isVisible = !Main.keyboard.visible &&
                          (this._preeditText.visible ||
                           this._auxText.visible ||
-                          this._candidateArea.actor.visible));
+                          this._candidateArea.visible);
 
         if (isVisible) {
-            this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
-            this._boxPointer.open(BoxPointer.PopupAnimation.NONE);
-            this._boxPointer.raise_top();
+            this.setPosition(this._dummyCursor, 0);
+            this.open(BoxPointer.PopupAnimation.NONE);
+            this.get_parent().set_child_above_sibling(this, null);
         } else {
-            this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
+            this.close(BoxPointer.PopupAnimation.NONE);
         }
     }
 
     _setTextAttributes(clutterText, ibusAttrList) {
         let attr;
-        for (let i = 0; (attr = ibusAttrList.get(i)); ++i)
+        for (let i = 0; (attr = ibusAttrList.get(i)); ++i) {
             if (attr.get_attr_type() == IBus.AttrType.BACKGROUND)
                 clutterText.set_selection(attr.get_start_index(), attr.get_end_index());
+        }
     }
-};
+});

js/ui/iconGrid.js

@@ -1,7 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported BaseIcon, IconGrid, PaginatedIconGrid */
 
-const { Clutter, GLib, GObject, Meta, St } = imports.gi;
+const { Clutter, GLib, GObject, Graphene, Meta, St } = imports.gi;
 
 const Params = imports.misc.params;
 const Main = imports.ui.main;
@@ -22,7 +22,7 @@ var ANIMATION_BOUNCE_ICON_SCALE = 1.1;
 
 var AnimationDirection = {
     IN: 0,
-    OUT: 1
+    OUT: 1,
 };
 
 var APPICON_ANIMATION_OUT_SCALE = 3;
@@ -39,18 +39,19 @@ class BaseIcon extends St.Bin {
         if (params.showLabel)
             styleClass += ' overview-icon-with-label';
 
-        super._init({ style_class: styleClass,
-                      x_fill: true,
-                      y_fill: true });
+        super._init({ style_class: styleClass });
 
         this.connect('destroy', this._onDestroy.bind(this));
 
-        this._box = new St.BoxLayout({ vertical: true });
+        this._box = new St.BoxLayout({
+            vertical: true,
+            x_expand: true,
+            y_expand: true,
+        });
         this.set_child(this._box);
 
         this.iconSize = ICON_SIZE;
-        this._iconBin = new St.Bin({ x_align: St.Align.MIDDLE,
-                                     y_align: St.Align.MIDDLE });
+        this._iconBin = new St.Bin();
 
         this._box.add_actor(this._iconBin);
 
@@ -58,7 +59,7 @@ class BaseIcon extends St.Bin {
             this.label = new St.Label({ text: label });
             this.label.clutter_text.set({
                 x_align: Clutter.ActorAlign.CENTER,
-                y_align: Clutter.ActorAlign.CENTER
+                y_align: Clutter.ActorAlign.CENTER,
             });
             this._box.add_actor(this.label);
         } else {
@@ -142,6 +143,10 @@ class BaseIcon extends St.Bin {
         zoomOutActor(this.child);
     }
 
+    animateZoomOutAtPos(x, y) {
+        zoomOutActorAtPos(this.child, x, y);
+    }
+
     update() {
         this._createIconTexture(this.iconSize);
     }
@@ -152,10 +157,15 @@ function clamp(value, min, max) {
 }
 
 function zoomOutActor(actor) {
+    let [x, y] = actor.get_transformed_position();
+    zoomOutActorAtPos(actor, x, y);
+}
+
+function zoomOutActorAtPos(actor, x, y) {
     let actorClone = new Clutter.Clone({ source: actor,
                                          reactive: false });
     let [width, height] = actor.get_transformed_size();
-    let [x, y] = actor.get_transformed_position();
+
     actorClone.set_size(width, height);
     actorClone.set_position(x, y);
     actorClone.opacity = 255;
@@ -180,7 +190,7 @@ function zoomOutActor(actor) {
         opacity: 0,
         duration: APPICON_ANIMATION_OUT_TIME,
         mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => actorClone.destroy()
+        onComplete: () => actorClone.destroy(),
     });
 }
 
@@ -222,21 +232,21 @@ var IconGrid = GObject.registerClass({
         this._fixedHItemSize = this._fixedVItemSize = undefined;
         this.connect('style-changed', this._onStyleChanged.bind(this));
 
-        // Cancel animations when hiding the overview, to avoid icons
-        // swarming into the void ...
-        this.connect('notify::mapped', () => {
-            if (!this.mapped)
-                this._resetAnimationActors();
-        });
-
         this.connect('actor-added', this._childAdded.bind(this));
         this.connect('actor-removed', this._childRemoved.bind(this));
         this.connect('destroy', this._onDestroy.bind(this));
     }
 
+    vfunc_unmap() {
+        // Cancel animations when hiding the overview, to avoid icons
+        // swarming into the void ...
+        this._resetAnimationActors();
+        super.vfunc_unmap();
+    }
+
     _onDestroy() {
         if (this._updateIconSizesLaterId) {
-            Meta.later_remove (this._updateIconSizesLaterId);
+            Meta.later_remove(this._updateIconSizesLaterId);
             this._updateIconSizesLaterId = 0;
         }
     }
@@ -247,10 +257,23 @@ var IconGrid = GObject.registerClass({
 
     _childAdded(grid, child) {
         child._iconGridKeyFocusInId = child.connect('key-focus-in', this._keyFocusIn.bind(this));
+
+        child._paintVisible = child.opacity > 0;
+        child._opacityChangedId = child.connect('notify::opacity', () => {
+            let paintVisible = child._paintVisible;
+            child._paintVisible = child.opacity > 0;
+            if (paintVisible !== child._paintVisible)
+                this.queue_relayout();
+        });
     }
 
     _childRemoved(grid, child) {
         child.disconnect(child._iconGridKeyFocusInId);
+        delete child._iconGridKeyFocusInId;
+
+        child.disconnect(child._opacityChangedId);
+        delete child._opacityChangedId;
+        delete child._paintVisible;
     }
 
     vfunc_get_preferred_width(_forHeight) {
@@ -260,9 +283,9 @@ var IconGrid = GObject.registerClass({
             return [0, 0];
 
         let nChildren = this.get_n_children();
-        let nColumns = this._colLimit ? Math.min(this._colLimit,
-                                                 nChildren)
-                                      : nChildren;
+        let nColumns = this._colLimit
+            ? Math.min(this._colLimit, nChildren)
+            : nChildren;
         let totalSpacing = Math.max(0, nColumns - 1) * this._getSpacing();
         // Kind of a lie, but not really an issue right now.  If
         // we wanted to support some sort of hidden/overflow that would
@@ -380,7 +403,7 @@ var IconGrid = GObject.registerClass({
         let allocationBox = this.get_allocation_box();
         let paintBox = themeNode.get_paint_box(allocationBox);
 
-        let origin = new Clutter.Vertex();
+        let origin = new Graphene.Point3D();
         origin.x = paintBox.x1 - allocationBox.x1;
         origin.y = paintBox.y1 - allocationBox.y1;
         origin.z = 0.0;
@@ -409,12 +432,12 @@ var IconGrid = GObject.registerClass({
         return true;
     }
 
-    /**
+    /*
      * Intended to be override by subclasses if they need a different
      * set of items to be animated.
      */
     _getChildrenToAnimate() {
-        return this._getVisibleChildren();
+        return this._getVisibleChildren().filter(child => child.opacity > 0);
     }
 
     _resetAnimationActors() {
@@ -432,9 +455,10 @@ var IconGrid = GObject.registerClass({
     }
 
     animatePulse(animationDirection) {
-        if (animationDirection != AnimationDirection.IN)
+        if (animationDirection != AnimationDirection.IN) {
             throw new GObject.NotImplementedError("Pulse animation only implements " +
                                                   "'in' animation direction");
+        }
 
         this._resetAnimationActors();
 
@@ -464,7 +488,7 @@ var IconGrid = GObject.registerClass({
                 scale_y: ANIMATION_BOUNCE_ICON_SCALE,
                 duration: bounceUpTime,
                 mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                delay: delay,
+                delay,
                 onComplete: () => {
                     let duration = ANIMATION_TIME_IN - bounceUpTime;
                     actor.ease({
@@ -476,9 +500,9 @@ var IconGrid = GObject.registerClass({
                             if (isLastItem)
                                 this._animationDone();
                             actor.reactive = true;
-                        }
+                        },
                     });
-                }
+                },
             });
         }
     }
@@ -545,7 +569,7 @@ var IconGrid = GObject.registerClass({
                     scale_y: 1,
                     duration: ANIMATION_TIME_IN,
                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
+                    delay,
                 };
 
                 if (isLastItem)
@@ -555,7 +579,7 @@ var IconGrid = GObject.registerClass({
                     opacity: 255,
                     duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
+                    delay,
                 };
             } else {
                 let isLastItem = actor._distance == maxDist;
@@ -571,7 +595,7 @@ var IconGrid = GObject.registerClass({
                     scale_y: scaleY,
                     duration: ANIMATION_TIME_OUT,
                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
+                    delay,
                 };
 
                 if (isLastItem)
@@ -581,7 +605,7 @@ var IconGrid = GObject.registerClass({
                     opacity: 0,
                     duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
                     mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
+                    delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
                 };
             }
 
@@ -654,8 +678,8 @@ var IconGrid = GObject.registerClass({
 
     nRows(forWidth) {
         let children = this._getVisibleChildren();
-        let nColumns = (forWidth < 0) ? children.length : this._computeLayout(forWidth)[0];
-        let nRows = (nColumns > 0) ? Math.ceil(children.length / nColumns) : 0;
+        let nColumns = forWidth < 0 ? children.length : this._computeLayout(forWidth)[0];
+        let nRows = nColumns > 0 ? Math.ceil(children.length / nColumns) : 0;
         if (this._rowLimit)
             nRows = Math.min(nRows, this._rowLimit);
         return nRows;
@@ -695,13 +719,13 @@ var IconGrid = GObject.registerClass({
 
         this._items.push(item);
         if (index !== undefined)
-            this.insert_child_at_index(item.actor, index);
+            this.insert_child_at_index(item, index);
         else
-            this.add_actor(item.actor);
+            this.add_actor(item);
     }
 
     removeItem(item) {
-        this.remove_child(item.actor);
+        this.remove_child(item);
     }
 
     getItemAtIndex(index) {
@@ -761,7 +785,7 @@ var IconGrid = GObject.registerClass({
             this.topPadding = this.rightPadding = this.bottomPadding = this.leftPadding = spacing;
     }
 
-    /**
+    /*
      * This function must to be called before iconGrid allocation,
      * to know how much spacing can the grid has
      */
@@ -774,16 +798,18 @@ var IconGrid = GObject.registerClass({
             let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth;
             let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight;
 
-            let neededSpacePerItem = (neededWidth > neededHeight) ? Math.ceil(neededWidth / this._minColumns)
-                                                                  : Math.ceil(neededHeight / this._minRows);
+            let neededSpacePerItem = neededWidth > neededHeight
+                ? Math.ceil(neededWidth / this._minColumns)
+                : Math.ceil(neededHeight / this._minRows);
             this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE);
             this._fixedVItemSize = Math.max(this._vItemSize - neededSpacePerItem, MIN_ICON_SIZE);
 
             this._updateSpacingForSize(availWidth, availHeight);
         }
-        if (!this._updateIconSizesLaterId)
+        if (!this._updateIconSizesLaterId) {
             this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
                                                           this._updateIconSizes.bind(this));
+        }
     }
 
     // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
@@ -791,9 +817,9 @@ var IconGrid = GObject.registerClass({
         this._updateIconSizesLaterId = 0;
         let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
         let newIconSize = Math.floor(ICON_SIZE * scale);
-        for (let i in this._items) {
+        for (let i in this._items)
             this._items[i].icon.setIconSize(newIconSize);
-        }
+
         return GLib.SOURCE_REMOVE;
     }
 });
@@ -855,9 +881,9 @@ var PaginatedIconGrid = GObject.registerClass({
             children[i].show();
 
             columnIndex++;
-            if (columnIndex == nColumns) {
+            if (columnIndex == nColumns)
                 columnIndex = 0;
-            }
+
             if (columnIndex == 0) {
                 y += this._getVItemSize() + spacing;
                 if ((i + 1) % this._childrenPerPage == 0)
@@ -871,7 +897,7 @@ var PaginatedIconGrid = GObject.registerClass({
 
     // Overridden from IconGrid
     _getChildrenToAnimate() {
-        let children = this._getVisibleChildren();
+        let children = super._getChildrenToAnimate();
         let firstIndex = this._childrenPerPage * this.currentPage;
         let lastIndex = firstIndex + this._childrenPerPage;
 
@@ -932,15 +958,16 @@ var PaginatedIconGrid = GObject.registerClass({
 
     /**
     * openExtraSpace:
-    * @sourceItem: the item for which to create extra space
-    * @side: where @sourceItem should be located relative to the created space
-    * @nRows: the amount of space to create
+    * @param {Clutter.Actor} sourceItem: item for which to create extra space
+    * @param {St.Side} side: where @sourceItem should be located relative to
+    *   the created space
+    * @param {number} nRows: the amount of space to create
     *
     * Pan view to create extra space for @nRows above or below @sourceItem.
     */
     openExtraSpace(sourceItem, side, nRows) {
         let children = this._getVisibleChildren();
-        let index = children.indexOf(sourceItem.actor);
+        let index = children.indexOf(sourceItem);
         if (index == -1)
             throw new Error('Item not found.');
 
@@ -950,8 +977,7 @@ var PaginatedIconGrid = GObject.registerClass({
         let childrenPerRow = this._childrenPerPage / this._rowsPerPage;
         let sourceRow = Math.floor((index - pageOffset) / childrenPerRow);
 
-        let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1
-                                               : sourceRow;
+        let nRowsAbove = side == St.Side.TOP ? sourceRow + 1 : sourceRow;
         let nRowsBelow = this._rowsPerPage - nRowsAbove;
 
         let nRowsUp, nRowsDown;
@@ -994,7 +1020,7 @@ var PaginatedIconGrid = GObject.registerClass({
             let params = {
                 translation_y: translationY,
                 duration: EXTRA_SPACE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
             };
             if (i == (children.length - 1))
                 params.onComplete = () => this.emit('space-opened');
@@ -1015,7 +1041,7 @@ var PaginatedIconGrid = GObject.registerClass({
                 translation_y: 0,
                 duration: EXTRA_SPACE_ANIMATION_TIME,
                 mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                onComplete: () => this.emit('space-closed')
+                onComplete: () => this.emit('space-closed'),
             });
         }
     }

js/ui/inhibitShortcutsDialog.js

@@ -18,8 +18,8 @@ var DialogResponse = Meta.InhibitShortcutsDialogResponse;
 var InhibitShortcutsDialog = GObject.registerClass({
     Implements: [Meta.InhibitShortcutsDialog],
     Properties: {
-        'window': GObject.ParamSpec.override('window', Meta.InhibitShortcutsDialog)
-    }
+        'window': GObject.ParamSpec.override('window', Meta.InhibitShortcutsDialog),
+    },
 }, class InhibitShortcutsDialog extends GObject.Object {
     _init(window) {
         super._init();
@@ -76,17 +76,19 @@ var InhibitShortcutsDialog = GObject.registerClass({
         let name = this._app ? this._app.get_name() : this._window.title;
 
         /* Translators: %s is an application name like "Settings" */
-        let title = name ? _("%s wants to inhibit shortcuts").format(name)
-                         : _("Application wants to inhibit shortcuts");
+        let title = name
+            ? _("%s wants to inhibit shortcuts").format(name)
+            : _("Application wants to inhibit shortcuts");
         let icon = new Gio.ThemedIcon({ name: 'dialog-warning-symbolic' });
 
         let contentParams = { icon, title };
 
         let restoreAccel = this._getRestoreAccel();
-        if (restoreAccel)
+        if (restoreAccel) {
             contentParams.subtitle =
                 /* Translators: %s is a keyboard shortcut like "Super+x" */
                 _("You can restore shortcuts by pressing %s.").format(restoreAccel);
+        }
 
         let content = new Dialog.MessageDialogContent(contentParams);
         this._dialog.contentLayout.add_actor(content);
@@ -133,10 +135,10 @@ var InhibitShortcutsDialog = GObject.registerClass({
 
             this._permStore.LookupRemote(APP_PERMISSIONS_TABLE,
                                          APP_PERMISSIONS_ID,
-                (res, error) => {
-                    if (error) {
+                (res, err) => {
+                    if (err) {
                         this._dialog.open();
-                        log(error.message);
+                        log(err.message);
                         return;
                     }
 

js/ui/kbdA11yDialog.js

@@ -27,24 +27,24 @@ class KbdA11yDialog extends GObject.Object {
 
         if (whatChanged & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) {
             key = KEY_SLOW_KEYS_ENABLED;
-            enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) ? true : false;
-            title = enabled ?
-                    _("Slow Keys Turned On") :
-                    _("Slow Keys Turned Off");
+            enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) > 0;
+            title = enabled
+                ? _("Slow Keys Turned On")
+                : _("Slow Keys Turned Off");
             body = _("You just held down the Shift key for 8 seconds. This is the shortcut " +
                      "for the Slow Keys feature, which affects the way your keyboard works.");
 
         } else  if (whatChanged & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) {
             key = KEY_STICKY_KEYS_ENABLED;
-            enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) ? true : false;
-            title = enabled ?
-                    _("Sticky Keys Turned On") :
-                    _("Sticky Keys Turned Off");
-            body = enabled ?
-                   _("You just pressed the Shift key 5 times in a row. This is the shortcut " +
-                     "for the Sticky Keys feature, which affects the way your keyboard works.") :
-                   _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
-                     "This turns off the Sticky Keys feature, which affects the way your keyboard works.");
+            enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) > 0;
+            title = enabled
+                ? _("Sticky Keys Turned On")
+                : _("Sticky Keys Turned Off");
+            body = enabled
+                ? _("You just pressed the Shift key 5 times in a row. This is the shortcut " +
+                  "for the Sticky Keys feature, which affects the way your keyboard works.")
+                : _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
+                  "This turns off the Sticky Keys feature, which affects the way your keyboard works.");
         } else {
             return;
         }
@@ -61,7 +61,7 @@ class KbdA11yDialog extends GObject.Object {
                                dialog.close();
                            },
                            default: enabled,
-                           key: !enabled ? Clutter.Escape : null });
+                           key: !enabled ? Clutter.KEY_Escape : null });
 
         dialog.addButton({ label: enabled ? _("Turn Off") : _("Leave Off"),
                            action: () => {
@@ -69,7 +69,7 @@ class KbdA11yDialog extends GObject.Object {
                                dialog.close();
                            },
                            default: !enabled,
-                           key: enabled ? Clutter.Escape : null });
+                           key: enabled ? Clutter.KEY_Escape : null });
 
         dialog.open();
     }

js/ui/layout.js

@@ -44,7 +44,7 @@ var MonitorConstraint = GObject.registerClass({
         'work-area': GObject.ParamSpec.boolean('work-area',
                                                'Work-area', 'Track monitor\'s work-area',
                                                GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                               false)
+                                               false),
     },
 }, class MonitorConstraint extends Clutter.Constraint {
     _init(props) {
@@ -167,12 +167,12 @@ var Monitor = class Monitor {
 
 const UiActor = GObject.registerClass(
 class UiActor extends St.Widget {
-    vfunc_get_preferred_width (_forHeight) {
+    vfunc_get_preferred_width(_forHeight) {
         let width = global.stage.width;
         return [width, width];
     }
 
-    vfunc_get_preferred_height (_forWidth) {
+    vfunc_get_preferred_height(_forWidth) {
         let height = global.stage.height;
         return [height, height];
     }
@@ -181,7 +181,7 @@ class UiActor extends St.Widget {
 const defaultParams = {
     trackFullscreen: false,
     affectsStruts: false,
-    affectsInputRegion: true
+    affectsInputRegion: true,
 };
 
 var LayoutManager = GObject.registerClass({
@@ -189,12 +189,13 @@ var LayoutManager = GObject.registerClass({
                'startup-complete': {},
                'startup-prepared': {},
                'monitors-changed': {},
+               'system-modal-opened': {},
                'keyboard-visible-changed': { param_types: [GObject.TYPE_BOOLEAN] } },
 }, class LayoutManager extends GObject.Object {
     _init() {
         super._init();
 
-        this._rtl = (Clutter.get_default_text_direction() == Clutter.TextDirection.RTL);
+        this._rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL;
         this.monitors = [];
         this.primaryMonitor = null;
         this.primaryIndex = -1;
@@ -212,11 +213,6 @@ var LayoutManager = GObject.registerClass({
         this._startingUp = true;
         this._pendingLoadBackground = false;
 
-        // We don't want to paint the stage background color because either
-        // the SystemBackground we create or the MetaBackgroundActor inside
-        // global.window_group covers the entirety of the screen.
-        global.stage.no_clear_hint = true;
-
         // Set up stage hierarchy to group all UI actors under one container.
         this.uiGroup = new UiActor({ name: 'uiGroup' });
         this.uiGroup.set_flags(Clutter.ActorFlags.NO_LAYOUT);
@@ -238,11 +234,12 @@ var LayoutManager = GObject.registerClass({
                                              reactive: true });
         this.addChrome(this.overviewGroup);
 
-        this.screenShieldGroup = new St.Widget({ name: 'screenShieldGroup',
-                                                 visible: false,
-                                                 clip_to_allocation: true,
-                                                 layout_manager: new Clutter.BinLayout(),
-                                               });
+        this.screenShieldGroup = new St.Widget({
+            name: 'screenShieldGroup',
+            visible: false,
+            clip_to_allocation: true,
+            layout_manager: new Clutter.BinLayout(),
+        });
         this.addChrome(this.screenShieldGroup);
 
         this.panelBox = new St.BoxLayout({ name: 'panelBox',
@@ -273,11 +270,11 @@ var LayoutManager = GObject.registerClass({
 
         this._backgroundGroup = new Meta.BackgroundGroup();
         global.window_group.add_child(this._backgroundGroup);
-        this._backgroundGroup.lower_bottom();
+        global.window_group.set_child_below_sibling(this._backgroundGroup, null);
         this._bgManagers = [];
 
         this._interfaceSettings = new Gio.Settings({
-            schema_id: 'org.gnome.desktop.interface'
+            schema_id: 'org.gnome.desktop.interface',
         });
 
         this._interfaceSettings.connect('changed::enable-hot-corners',
@@ -343,10 +340,11 @@ var LayoutManager = GObject.registerClass({
 
         this.monitors = [];
         let nMonitors = display.get_n_monitors();
-        for (let i = 0; i < nMonitors; i++)
+        for (let i = 0; i < nMonitors; i++) {
             this.monitors.push(new Monitor(i,
                                            display.get_monitor_geometry(i),
                                            display.get_monitor_scale(i)));
+        }
 
         if (nMonitors == 0) {
             this.primaryIndex = this.bottomIndex = -1;
@@ -449,7 +447,7 @@ var LayoutManager = GObject.registerClass({
     _createBackgroundManager(monitorIndex) {
         let bgManager = new Background.BackgroundManager({ container: this._backgroundGroup,
                                                            layoutManager: this,
-                                                           monitorIndex: monitorIndex });
+                                                           monitorIndex });
 
         bgManager.connect('changed', this._addBackgroundMenu.bind(this));
         this._addBackgroundMenu(bgManager);
@@ -466,15 +464,14 @@ var LayoutManager = GObject.registerClass({
                 backgroundActor.ease({
                     opacity: 255,
                     duration: BACKGROUND_FADE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
                 });
             }
         }
     }
 
     _updateBackgrounds() {
-        let i;
-        for (i = 0; i < this._bgManagers.length; i++)
+        for (let i = 0; i < this._bgManagers.length; i++)
             this._bgManagers[i].destroy();
 
         this._bgManagers = [];
@@ -605,17 +602,17 @@ var LayoutManager = GObject.registerClass({
             return;
         }
         this._systemBackground = new Background.SystemBackground();
-        this._systemBackground.actor.hide();
+        this._systemBackground.hide();
 
-        global.stage.insert_child_below(this._systemBackground.actor, null);
+        global.stage.insert_child_below(this._systemBackground, null);
 
         let constraint = new Clutter.BindConstraint({ source: global.stage,
                                                       coordinate: Clutter.BindCoordinate.ALL });
-        this._systemBackground.actor.add_constraint(constraint);
+        this._systemBackground.add_constraint(constraint);
 
         let signalId = this._systemBackground.connect('loaded', () => {
             this._systemBackground.disconnect(signalId);
-            this._systemBackground.actor.show();
+            this._systemBackground.show();
             global.stage.show();
 
             this._prepareStartupAnimation();
@@ -702,7 +699,7 @@ var LayoutManager = GObject.registerClass({
             translation_y: 0,
             duration: STARTUP_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete()
+            onComplete: () => this._startupAnimationComplete(),
         });
     }
 
@@ -713,7 +710,7 @@ var LayoutManager = GObject.registerClass({
             opacity: 255,
             duration: STARTUP_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete()
+            onComplete: () => this._startupAnimationComplete(),
         });
     }
 
@@ -721,7 +718,7 @@ var LayoutManager = GObject.registerClass({
         this._coverPane.destroy();
         this._coverPane = null;
 
-        this._systemBackground.actor.destroy();
+        this._systemBackground.destroy();
         this._systemBackground = null;
 
         this._startingUp = false;
@@ -747,7 +744,7 @@ var LayoutManager = GObject.registerClass({
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             onComplete: () => {
                 this._showKeyboardComplete();
-            }
+            },
         });
         this.emit('keyboard-visible-changed', true);
     }
@@ -770,12 +767,11 @@ var LayoutManager = GObject.registerClass({
         this.keyboardBox.ease({
             anchor_y: 0,
             opacity: 0,
-            duration: immediate ? 0
-                                : KEYBOARD_ANIMATION_TIME,
+            duration: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_IN_QUAD,
             onComplete: () => {
                 this._hideKeyboardComplete();
-            }
+            },
         });
 
         this.emit('keyboard-visible-changed', false);
@@ -855,12 +851,13 @@ var LayoutManager = GObject.registerClass({
             index = this._findActor(ancestor);
         }
 
-        let ancestorData = ancestor ? this._trackedActors[index]
-                                    : defaultParams;
+        let ancestorData = ancestor
+            ? this._trackedActors[index]
+            : defaultParams;
         // We can't use Params.parse here because we want to drop
         // the extra values like ancestorData.actor
         for (let prop in defaultParams) {
-            if (!params.hasOwnProperty(prop))
+            if (!Object.prototype.hasOwnProperty.call(params, prop))
                 params[prop] = ancestorData[prop];
         }
 
@@ -960,7 +957,7 @@ var LayoutManager = GObject.registerClass({
     findIndexForActor(actor) {
         let [x, y] = actor.get_transformed_position();
         let [w, h] = actor.get_transformed_size();
-        let rect = new Meta.Rectangle({ x: x, y: y, width: w, height: h });
+        let rect = new Meta.Rectangle({ x, y, width: w, height: h });
         return global.display.get_monitor_index_for_rect(rect);
     }
 
@@ -975,9 +972,10 @@ var LayoutManager = GObject.registerClass({
         if (this._startingUp)
             return;
 
-        if (!this._updateRegionIdle)
+        if (!this._updateRegionIdle) {
             this._updateRegionIdle = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
                                                     this._updateRegions.bind(this));
+        }
     }
 
     _getWindowActorsForWorkspace(workspace) {
@@ -1014,11 +1012,6 @@ var LayoutManager = GObject.registerClass({
         if (Main.modalCount > 0)
             return GLib.SOURCE_REMOVE;
 
-        // Bug workaround - get_transformed_position()/get_transformed_size() don't work after
-        // a change in stage size until the first pick or paint.
-        // https://bugzilla.gnome.org/show_bug.cgi?id=761565
-        global.stage.get_actor_at_pos(Clutter.PickMode.ALL, 0, 0);
-
         let rects = [], struts = [], i;
         let isPopupMenuVisible = global.top_window_group.get_children().some(isPopupMetaWindow);
         let wantsInputRegion = !isPopupMenuVisible;
@@ -1036,7 +1029,7 @@ var LayoutManager = GObject.registerClass({
             h = Math.round(h);
 
             if (actorData.affectsInputRegion && wantsInputRegion && actorData.actor.get_paint_visibility())
-                rects.push(new Meta.Rectangle({ x: x, y: y, width: w, height: h }));
+                rects.push(new Meta.Rectangle({ x, y, width: w, height: h }));
 
             let monitor = null;
             if (actorData.affectsStruts)
@@ -1074,19 +1067,20 @@ var LayoutManager = GObject.registerClass({
                         side = Meta.Side.RIGHT;
                     else
                         continue;
-                } else if (x1 <= monitor.x)
+                } else if (x1 <= monitor.x) {
                     side = Meta.Side.LEFT;
-                else if (y1 <= monitor.y)
+                } else if (y1 <= monitor.y) {
                     side = Meta.Side.TOP;
-                else if (x2 >= monitor.x + monitor.width)
+                } else if (x2 >= monitor.x + monitor.width) {
                     side = Meta.Side.RIGHT;
-                else if (y2 >= monitor.y + monitor.height)
+                } else if (y2 >= monitor.y + monitor.height) {
                     side = Meta.Side.BOTTOM;
-                else
+                } else {
                     continue;
+                }
 
                 let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 });
-                let strut = new Meta.Strut({ rect: strutRect, side: side });
+                let strut = new Meta.Strut({ rect: strutRect, side });
                 struts.push(strut);
             }
         }
@@ -1115,8 +1109,11 @@ var LayoutManager = GObject.registerClass({
 //
 // This class manages a "hot corner" that can toggle switching to
 // overview.
-var HotCorner = class HotCorner {
-    constructor(layoutManager, monitor, x, y) {
+var HotCorner = GObject.registerClass(
+class HotCorner extends Clutter.Actor {
+    _init(layoutManager, monitor, x, y) {
+        super._init();
+
         // We use this flag to mark the case where the user has entered the
         // hot corner and has not left both the hot corner and a surrounding
         // guard area (the "environs"). This avoids triggering the hot corner
@@ -1145,6 +1142,8 @@ var HotCorner = class HotCorner {
 
         this._ripples = new Ripples.Ripples(px, py, 'ripple-box');
         this._ripples.addTo(layoutManager.uiGroup);
+
+        this.connect('destroy', this._onDestroy.bind(this));
     }
 
     setBarrierSize(size) {
@@ -1184,11 +1183,14 @@ var HotCorner = class HotCorner {
 
     _setupFallbackCornerIfNeeded(layoutManager) {
         if (!global.display.supports_extended_barriers()) {
-            this.actor = new Clutter.Actor({ name: 'hot-corner-environs',
-                                             x: this._x, y: this._y,
-                                             width: 3,
-                                             height: 3,
-                                             reactive: true });
+            this.set({
+                name: 'hot-corner-environs',
+                x: this._x,
+                y: this._y,
+                width: 3,
+                height: 3,
+                reactive: true,
+            });
 
             this._corner = new Clutter.Actor({ name: 'hot-corner',
                                                width: 1,
@@ -1197,19 +1199,16 @@ var HotCorner = class HotCorner {
                                                reactive: true });
             this._corner._delegate = this;
 
-            this.actor.add_child(this._corner);
-            layoutManager.addChrome(this.actor);
+            this.add_child(this._corner);
+            layoutManager.addChrome(this);
 
             if (Clutter.get_default_text_direction() == Clutter.TextDirection.RTL) {
-                this._corner.set_position(this.actor.width - this._corner.width, 0);
-                this.actor.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST);
+                this._corner.set_position(this.width - this._corner.width, 0);
+                this.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST);
             } else {
                 this._corner.set_position(0, 0);
             }
 
-            this.actor.connect('leave-event',
-                               this._onEnvironsLeft.bind(this));
-
             this._corner.connect('enter-event',
                                  this._onCornerEntered.bind(this));
             this._corner.connect('leave-event',
@@ -1217,13 +1216,12 @@ var HotCorner = class HotCorner {
         }
     }
 
-    destroy() {
+    _onDestroy() {
         this.setBarrierSize(0);
         this._pressureBarrier.destroy();
         this._pressureBarrier = null;
 
-        if (this.actor)
-            this.actor.destroy();
+        this._ripples.destroy();
     }
 
     _toggleOverview() {
@@ -1254,18 +1252,18 @@ var HotCorner = class HotCorner {
     }
 
     _onCornerLeft(actor, event) {
-        if (event.get_related() != this.actor)
+        if (event.get_related() != this)
             this._entered = false;
         // Consume event, otherwise this will confuse onEnvironsLeft
         return Clutter.EVENT_STOP;
     }
 
-    _onEnvironsLeft(actor, event) {
-        if (event.get_related() != this._corner)
+    vfunc_leave_event(crossingEvent) {
+        if (crossingEvent.related != this._corner)
             this._entered = false;
         return Clutter.EVENT_PROPAGATE;
     }
-};
+});
 
 var PressureBarrier = class PressureBarrier {
     constructor(threshold, timeout, actionMode) {

js/ui/lightbox.js

@@ -2,7 +2,6 @@
 /* exported Lightbox */
 
 const { Clutter, GObject, Shell, St } = imports.gi;
-const Signals = imports.signals;
 
 const Params = imports.misc.params;
 
@@ -34,8 +33,8 @@ var RadialShaderEffect = GObject.registerClass({
             'sharpness', 'sharpness', 'sharpness',
             GObject.ParamFlags.READWRITE,
             0, 1, 0
-        )
-    }
+        ),
+    },
 }, class RadialShaderEffect extends Shell.GLSLEffect {
     _init(params) {
         this._brightness = undefined;
@@ -89,8 +88,8 @@ var RadialShaderEffect = GObject.registerClass({
  *           - inhibitEvents: whether to inhibit events for @container
  *           - width: shade actor width
  *           - height: shade actor height
- *           - fadeInTime: milliseconds used to fade in
- *           - fadeOutTime: milliseconds used to fade out
+ *           - fadeFactor: fading opacity factor
+ *           - radialEffect: whether to enable the GLSL radial effect
  *
  * Lightbox creates a dark translucent "shade" actor to hide the
  * contents of @container, and allows you to specify particular actors
@@ -106,41 +105,49 @@ var RadialShaderEffect = GObject.registerClass({
  * @container and will track any changes in its size. You can override
  * this by passing an explicit width and height in @params.
  */
-var Lightbox = class Lightbox {
-    constructor(container, params) {
-        params = Params.parse(params, { inhibitEvents: false,
-                                        width: null,
-                                        height: null,
-                                        fadeFactor: DEFAULT_FADE_FACTOR,
-                                        radialEffect: false,
-                                      });
+var Lightbox = GObject.registerClass({
+    Properties: {
+        'active': GObject.ParamSpec.boolean(
+            'active', 'active', 'active', GObject.ParamFlags.READABLE, false),
+    },
+}, class Lightbox extends St.Bin {
+    _init(container, params) {
+        params = Params.parse(params, {
+            inhibitEvents: false,
+            width: null,
+            height: null,
+            fadeFactor: DEFAULT_FADE_FACTOR,
+            radialEffect: false,
+        });
 
+        super._init({
+            reactive: params.inhibitEvents,
+            width: params.width,
+            height: params.height,
+            visible: false,
+        });
+
+        this._active = false;
         this._container = container;
         this._children = container.get_children();
         this._fadeFactor = params.fadeFactor;
         this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
 
-        this.actor = new St.Bin({ reactive: params.inhibitEvents });
-
         if (this._radialEffect)
-            this.actor.add_effect(new RadialShaderEffect({ name: 'radial' }));
+            this.add_effect(new RadialShaderEffect({ name: 'radial' }));
         else
-            this.actor.set({ opacity: 0, style_class: 'lightbox' });
+            this.set({ opacity: 0, style_class: 'lightbox' });
 
-        container.add_actor(this.actor);
-        this.actor.raise_top();
-        this.actor.hide();
-        this.shown = false;
+        container.add_actor(this);
+        container.set_child_above_sibling(this, null);
 
-        this.actor.connect('destroy', this._onDestroy.bind(this));
+        this.connect('destroy', this._onDestroy.bind(this));
 
-        if (params.width && params.height) {
-            this.actor.width = params.width;
-            this.actor.height = params.height;
-        } else {
-            let constraint = new Clutter.BindConstraint({ source: container,
-                                                          coordinate: Clutter.BindCoordinate.ALL });
-            this.actor.add_constraint(constraint);
+        if (!params.width || !params.height) {
+            this.add_constraint(new Clutter.BindConstraint({
+                source: container,
+                coordinate: Clutter.BindCoordinate.ALL,
+            }));
         }
 
         this._actorAddedSignalId = container.connect('actor-added', this._actorAdded.bind(this));
@@ -149,16 +156,20 @@ var Lightbox = class Lightbox {
         this._highlighted = null;
     }
 
+    get active() {
+        return this._active;
+    }
+
     _actorAdded(container, newChild) {
         let children = this._container.get_children();
-        let myIndex = children.indexOf(this.actor);
+        let myIndex = children.indexOf(this);
         let newChildIndex = children.indexOf(newChild);
 
         if (newChildIndex > myIndex) {
             // The child was added above the shade (presumably it was
             // made the new top-most child). Move it below the shade,
             // and add it to this._children as the new topmost actor.
-            newChild.lower(this.actor);
+            this._container.set_child_above_sibling(this, newChild);
             this._children.push(newChild);
         } else if (newChildIndex == 0) {
             // Bottom of stack
@@ -171,67 +182,55 @@ var Lightbox = class Lightbox {
         }
     }
 
-    show(fadeInTime) {
-        fadeInTime = fadeInTime || 0;
+    lightOn(fadeInTime) {
+        this.remove_all_transitions();
 
-        this.actor.remove_all_transitions();
-
-        let onComplete = () => {
-            this.shown = true;
-            this.emit('shown');
+        let easeProps = {
+            duration: fadeInTime || 0,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         };
 
-        if (this._radialEffect) {
-            this.actor.ease_property(
-                '@effects.radial.brightness', VIGNETTE_BRIGHTNESS, {
-                    duration: fadeInTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-            this.actor.ease_property(
-                '@effects.radial.sharpness', VIGNETTE_SHARPNESS, {
-                    duration: fadeInTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete
-                });
-        } else {
-            this.actor.ease({
-                opacity: 255 * this._fadeFactor,
-                duration: fadeInTime,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete
-            });
-        }
+        let onComplete = () => {
+            this._active = true;
+            this.notify('active');
+        };
 
-        this.actor.show();
+        this.show();
+
+        if (this._radialEffect) {
+            this.ease_property(
+                '@effects.radial.brightness', VIGNETTE_BRIGHTNESS, easeProps);
+            this.ease_property(
+                '@effects.radial.sharpness', VIGNETTE_SHARPNESS,
+                Object.assign({ onComplete }, easeProps));
+        } else {
+            this.ease(Object.assign(easeProps, {
+                opacity: 255 * this._fadeFactor,
+                onComplete,
+            }));
+        }
     }
 
-    hide(fadeOutTime) {
-        fadeOutTime = fadeOutTime || 0;
+    lightOff(fadeOutTime) {
+        this.remove_all_transitions();
 
-        this.shown = false;
-        this.actor.remove_all_transitions();
+        this._active = false;
+        this.notify('active');
 
-        let onComplete = () => this.actor.hide();
+        let easeProps = {
+            duration: fadeOutTime || 0,
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+        };
+
+        let onComplete = () => this.hide();
 
         if (this._radialEffect) {
-            this.actor.ease_property(
-                '@effects.radial.brightness', 1.0, {
-                    duration: fadeOutTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-            this.actor.ease_property(
-                '@effects.radial.sharpness', 0.0, {
-                    duration: fadeOutTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete
-                });
+            this.ease_property(
+                '@effects.radial.brightness', 1.0, easeProps);
+            this.ease_property(
+                '@effects.radial.sharpness', 0.0, Object.assign({ onComplete }, easeProps));
         } else {
-            this.actor.ease({
-                opacity: 0,
-                duration: fadeOutTime,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete
-            });
+            this.ease(Object.assign(easeProps, { opacity: 0, onComplete }));
         }
     }
 
@@ -246,7 +245,7 @@ var Lightbox = class Lightbox {
 
     /**
      * highlight:
-     * @window: actor to highlight
+     * @param {Clutter.Actor=} window: actor to highlight
      *
      * Highlights the indicated actor and unhighlights any other
      * currently-highlighted actor. With no arguments or a false/null
@@ -262,12 +261,12 @@ var Lightbox = class Lightbox {
         // case we may need to indicate some *other* actor as the new
         // sibling of the to-be-lowered one.
 
-        let below = this.actor;
+        let below = this;
         for (let i = this._children.length - 1; i >= 0; i--) {
             if (this._children[i] == window)
-                this._children[i].raise_top();
+                this._container.set_child_above_sibling(this._children[i], null);
             else if (this._children[i] == this._highlighted)
-                this._children[i].lower(below);
+                this._container.set_child_below_sibling(this._children[i], below);
             else
                 below = this._children[i];
         }
@@ -275,15 +274,6 @@ var Lightbox = class Lightbox {
         this._highlighted = window;
     }
 
-    /**
-     * destroy:
-     *
-     * Destroys the lightbox.
-     */
-    destroy() {
-        this.actor.destroy();
-    }
-
     /**
      * _onDestroy:
      *
@@ -291,10 +281,15 @@ var Lightbox = class Lightbox {
      * by destroying its container or by explicitly calling this.destroy().
      */
     _onDestroy() {
-        this._container.disconnect(this._actorAddedSignalId);
-        this._container.disconnect(this._actorRemovedSignalId);
+        if (this._actorAddedSignalId) {
+            this._container.disconnect(this._actorAddedSignalId);
+            this._actorAddedSignalId = 0;
+        }
+        if (this._actorRemovedSignalId) {
+            this._container.disconnect(this._actorRemovedSignalId);
+            this._actorRemovedSignalId = 0;
+        }
 
         this.highlight(null);
     }
-};
-Signals.addSignalMethods(Lightbox.prototype);
+});

js/ui/locatePointer.js

@@ -11,12 +11,26 @@ const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface";
 var LocatePointer = class {
     constructor() {
         this._settings = new Gio.Settings({ schema_id: LOCATE_POINTER_SCHEMA });
-        this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
-        this._ripples.addTo(Main.uiGroup);
+        this._settings.connect(`changed::${LOCATE_POINTER_KEY}`, () => this._syncEnabled());
+        this._syncEnabled();
+    }
+
+    _syncEnabled() {
+        let enabled = this._settings.get_boolean(LOCATE_POINTER_KEY);
+        if (enabled == !!this._ripples)
+            return;
+
+        if (enabled) {
+            this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
+            this._ripples.addTo(Main.uiGroup);
+        } else {
+            this._ripples.destroy();
+            this._ripples = null;
+        }
     }
 
     show() {
-        if (!this._settings.get_boolean(LOCATE_POINTER_KEY))
+        if (!this._ripples)
             return;
 
         let [x, y] = global.get_pointer();

js/ui/lookingGlass.js

@@ -1,9 +1,8 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported LookingGlass */
 
-const { Clutter, Cogl, Gio, GLib,
-        GObject, Meta, Pango, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
+const { Clutter, Cogl, Gio, GLib, GObject,
+        Graphene, Meta, Pango, Shell, St } = imports.gi;
 const Signals = imports.signals;
 const System = imports.system;
 
@@ -20,7 +19,6 @@ const CHEVRON = '>>> ';
 /* Imports...feel free to add here as needed */
 var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
                     'const Main = imports.ui.main; ' +
-                    'const Mainloop = imports.mainloop; ' +
                     /* Utility functions...we should probably be able to use these
                      * in the shell core code too. */
                     'const stage = global.stage; ' +
@@ -56,9 +54,9 @@ var AutoComplete = class AutoComplete {
     }
 
     _processCompletionRequest(event) {
-        if (event.completions.length == 0) {
+        if (event.completions.length == 0)
             return;
-        }
+
         // Unique match = go ahead and complete; multiple matches + single tab = complete the common starting string;
         // multiple matches + double tab = emit a suggest event with all possible options
         if (event.completions.length == 1) {
@@ -80,20 +78,20 @@ var AutoComplete = class AutoComplete {
     _entryKeyPressEvent(actor, event) {
         let cursorPos = this._entry.clutter_text.get_cursor_position();
         let text = this._entry.get_text();
-        if (cursorPos != -1) {
+        if (cursorPos != -1)
             text = text.slice(0, cursorPos);
-        }
-        if (event.get_key_symbol() == Clutter.Tab) {
+
+        if (event.get_key_symbol() == Clutter.KEY_Tab) {
             let [completions, attrHead] = JsParse.getCompletions(text, commandHeader, AUTO_COMPLETE_GLOBAL_KEYWORDS);
             let currTime = global.get_current_time();
             if ((currTime - this._lastTabTime) < AUTO_COMPLETE_DOUBLE_TAB_DELAY) {
                 this._processCompletionRequest({ tabType: 'double',
-                                                 completions: completions,
-                                                 attrHead: attrHead });
+                                                 completions,
+                                                 attrHead });
             } else {
                 this._processCompletionRequest({ tabType: 'single',
-                                                 completions: completions,
-                                                 attrHead: attrHead });
+                                                 completions,
+                                                 attrHead });
             }
             this._lastTabTime = currTime;
         }
@@ -112,9 +110,14 @@ var AutoComplete = class AutoComplete {
 Signals.addSignalMethods(AutoComplete.prototype);
 
 
-var Notebook = class Notebook {
-    constructor() {
-        this.actor = new St.BoxLayout({ vertical: true });
+var Notebook = GObject.registerClass({
+    Signals: { 'selection': { param_types: [Clutter.Actor.$gtype] } },
+}, class Notebook extends St.BoxLayout {
+    _init() {
+        super._init({
+            vertical: true,
+            y_expand: true,
+        });
 
         this.tabControls = new St.BoxLayout({ style_class: 'labels' });
 
@@ -131,21 +134,21 @@ var Notebook = class Notebook {
             this.selectChild(child);
             return true;
         });
-        labelBox.add(label, { expand: true });
+        labelBox.add_child(label);
         this.tabControls.add(labelBox);
 
-        let scrollview = new St.ScrollView({ x_fill: true, y_fill: true });
+        let scrollview = new St.ScrollView({ y_expand: true });
         scrollview.get_hscroll_bar().hide();
         scrollview.add_actor(child);
 
-        let tabData = { child: child,
-                        labelBox: labelBox,
-                        label: label,
+        let tabData = { child,
+                        labelBox,
+                        label,
                         scrollView: scrollview,
                         _scrollToBottom: false };
         this._tabs.push(tabData);
         scrollview.hide();
-        this.actor.add(scrollview, { expand: true });
+        this.add_child(scrollview);
 
         let vAdjust = scrollview.vscroll.adjustment;
         vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData));
@@ -176,7 +179,7 @@ var Notebook = class Notebook {
         // Focus the new tab before unmapping the old one
         let tabData = this._tabs[index];
         if (!tabData.scrollView.navigate_focus(null, St.DirectionType.TAB_FORWARD, false))
-            this.actor.grab_key_focus();
+            this.grab_key_focus();
 
         this._unselect();
 
@@ -221,26 +224,23 @@ var Notebook = class Notebook {
 
     nextTab() {
         let nextIndex = this._selectedIndex;
-        if (nextIndex < this._tabs.length - 1) {
+        if (nextIndex < this._tabs.length - 1)
             ++nextIndex;
-        }
 
         this.selectIndex(nextIndex);
     }
 
     prevTab() {
         let prevIndex = this._selectedIndex;
-        if (prevIndex > 0) {
+        if (prevIndex > 0)
             --prevIndex;
-        }
 
         this.selectIndex(prevIndex);
     }
-};
-Signals.addSignalMethods(Notebook.prototype);
+});
 
 function objectToString(o) {
-    if (typeof(o) == typeof(objectToString)) {
+    if (typeof o == typeof objectToString) {
         // special case this since the default is way, way too verbose
         return '<js function>';
     } else {
@@ -248,57 +248,63 @@ function objectToString(o) {
     }
 }
 
-var ObjLink = class ObjLink {
-    constructor(lookingGlass, o, title) {
+var ObjLink = GObject.registerClass(
+class ObjLink extends St.Button {
+    _init(lookingGlass, o, title) {
         let text;
         if (title)
             text = title;
         else
             text = objectToString(o);
         text = GLib.markup_escape_text(text, -1);
+
+        super._init({
+            reactive: true,
+            track_hover: true,
+            style_class: 'shell-link',
+            label: text,
+            x_align: Clutter.ActorAlign.START,
+        });
+        this.get_child().single_line_mode = true;
+
         this._obj = o;
-
-        this.actor = new St.Button({ reactive: true,
-                                     track_hover: true,
-                                     style_class: 'shell-link',
-                                     label: text });
-        this.actor.get_child().single_line_mode = true;
-        this.actor.connect('clicked', this._onClicked.bind(this));
-
         this._lookingGlass = lookingGlass;
     }
 
-    _onClicked() {
-        this._lookingGlass.inspectObject(this._obj, this.actor);
+    vfunc_clicked() {
+        this._lookingGlass.inspectObject(this._obj, this);
     }
-};
+});
+
+var Result = GObject.registerClass(
+class Result extends St.BoxLayout {
+    _init(lookingGlass, command, o, index) {
+        super._init({ vertical: true });
 
-var Result = class Result {
-    constructor(lookingGlass, command, o, index) {
         this.index = index;
         this.o = o;
 
-        this.actor = new St.BoxLayout({ vertical: true });
         this._lookingGlass = lookingGlass;
 
         let cmdTxt = new St.Label({ text: command });
         cmdTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
-        this.actor.add(cmdTxt);
+        this.add(cmdTxt);
         let box = new St.BoxLayout({});
-        this.actor.add(box);
+        this.add(box);
         let resultTxt = new St.Label({ text: `r(${index}) = ` });
         resultTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
         box.add(resultTxt);
         let objLink = new ObjLink(this._lookingGlass, o);
-        box.add(objLink.actor);
+        box.add(objLink);
     }
-};
+});
 
-var WindowList = class WindowList {
-    constructor(lookingGlass) {
-        this.actor = new St.BoxLayout({ name: 'Windows', vertical: true, style: 'spacing: 8px' });
+var WindowList = GObject.registerClass({
+}, class WindowList extends St.BoxLayout {
+    _init(lookingGlass) {
+        super._init({ name: 'Windows', vertical: true, style: 'spacing: 8px' });
         let tracker = Shell.WindowTracker.get_default();
-        this._updateId = Main.initializeDeferredWork(this.actor, this._updateWindowList.bind(this));
+        this._updateId = Main.initializeDeferredWork(this, this._updateWindowList.bind(this));
         global.display.connect('window-created', this._updateWindowList.bind(this));
         tracker.connect('tracked-windows-changed', this._updateWindowList.bind(this));
 
@@ -306,7 +312,10 @@ var WindowList = class WindowList {
     }
 
     _updateWindowList() {
-        this.actor.destroy_all_children();
+        if (!this._lookingGlass.isOpen)
+            return;
+
+        this.destroy_all_children();
         let windows = global.get_window_actors();
         let tracker = Shell.WindowTracker.get_default();
         for (let i = 0; i < windows.length; i++) {
@@ -317,9 +326,9 @@ var WindowList = class WindowList {
                 metaWindow._lookingGlassManaged = true;
             }
             let box = new St.BoxLayout({ vertical: true });
-            this.actor.add(box);
+            this.add(box);
             let windowLink = new ObjLink(this._lookingGlass, metaWindow, metaWindow.title);
-            box.add(windowLink.actor, { x_align: St.Align.START, x_fill: false });
+            box.add_child(windowLink);
             let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' });
             box.add(propsBox);
             propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` }));
@@ -328,32 +337,42 @@ var WindowList = class WindowList {
                 let icon = app.create_icon_texture(22);
                 let propBox = new St.BoxLayout({ style: 'spacing: 6px; ' });
                 propsBox.add(propBox);
-                propBox.add(new St.Label({ text: 'app: ' }), { y_fill: false });
+                propBox.add_child(new St.Label({ text: 'app: ' }));
                 let appLink = new ObjLink(this._lookingGlass, app, app.get_id());
-                propBox.add(appLink.actor, { y_fill: false });
-                propBox.add(icon, { y_fill: false });
+                propBox.add_child(appLink);
+                propBox.add_child(icon);
             } else {
                 propsBox.add(new St.Label({ text: '<untracked>' }));
             }
         }
     }
-};
-Signals.addSignalMethods(WindowList.prototype);
 
-var ObjInspector = class ObjInspector {
-    constructor(lookingGlass) {
+    update() {
+        this._updateWindowList();
+    }
+});
+
+var ObjInspector = GObject.registerClass(
+class ObjInspector extends St.ScrollView {
+    _init(lookingGlass) {
+        super._init({
+            pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }),
+        });
+
         this._obj = null;
         this._previousObj = null;
 
         this._parentList = [];
 
-        this.actor = new St.ScrollView({ pivot_point: new Clutter.Point({ x: 0.5, y: 0.5 }),
-                                         x_fill: true, y_fill: true });
-        this.actor.get_hscroll_bar().hide();
-        this._container = new St.BoxLayout({ name: 'LookingGlassPropertyInspector',
-                                             style_class: 'lg-dialog',
-                                             vertical: true });
-        this.actor.add_actor(this._container);
+        this.get_hscroll_bar().hide();
+        this._container = new St.BoxLayout({
+            name: 'LookingGlassPropertyInspector',
+            style_class: 'lg-dialog',
+            vertical: true,
+            x_expand: true,
+            y_expand: true,
+        });
+        this.add_actor(this._container);
 
         this._lookingGlass = lookingGlass;
     }
@@ -369,10 +388,12 @@ var ObjInspector = class ObjInspector {
 
         let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' });
         this._container.add_actor(hbox);
-        let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof(obj),
-                                                                     objectToString(obj)) });
+        let label = new St.Label({
+            text: 'Inspecting: %s: %s'.format(typeof obj, objectToString(obj)),
+            x_expand: true,
+        });
         label.single_line_mode = true;
-        hbox.add(label, { expand: true, y_fill: false });
+        hbox.add_child(label);
         let button = new St.Button({ label: 'Insert', style_class: 'lg-obj-inspector-button' });
         button.connect('clicked', this._onInsert.bind(this));
         hbox.add(button);
@@ -387,11 +408,10 @@ var ObjInspector = class ObjInspector {
         button.add_actor(new St.Icon({ icon_name: 'window-close-symbolic' }));
         button.connect('clicked', this.close.bind(this));
         hbox.add(button);
-        if (typeof(obj) == typeof({})) {
+        if (typeof obj == typeof {}) {
             let properties = [];
-            for (let propName in obj) {
+            for (let propName in obj)
                 properties.push(propName);
-            }
             properties.sort();
 
             for (let i = 0; i < properties.length; i++) {
@@ -399,14 +419,14 @@ var ObjInspector = class ObjInspector {
                 let link;
                 try {
                     let prop = obj[propName];
-                    link = new ObjLink(this._lookingGlass, prop).actor;
+                    link = new ObjLink(this._lookingGlass, prop);
                 } catch (e) {
                     link = new St.Label({ text: '<error>' });
                 }
-                let hbox = new St.BoxLayout();
-                hbox.add(new St.Label({ text: `${propName}: ` }));
-                hbox.add(link);
-                this._container.add_actor(hbox);
+                let box = new St.BoxLayout();
+                box.add(new St.Label({ text: `${propName}: ` }));
+                box.add(link);
+                this._container.add_actor(box);
             }
         }
     }
@@ -416,17 +436,17 @@ var ObjInspector = class ObjInspector {
             return;
         this._previousObj = null;
         this._open = true;
-        this.actor.show();
+        this.show();
         if (sourceActor) {
-            this.actor.set_scale(0, 0);
-            this.actor.ease({
+            this.set_scale(0, 0);
+            this.ease({
                 scale_x: 1,
                 scale_y: 1,
                 mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                time: 200
+                duration: 200,
             });
         } else {
-            this.actor.set_scale(1, 1);
+            this.set_scale(1, 1);
         }
     }
 
@@ -434,7 +454,7 @@ var ObjInspector = class ObjInspector {
         if (!this._open)
             return;
         this._open = false;
-        this.actor.hide();
+        this.hide();
         this._previousObj = null;
         this._obj = null;
     }
@@ -448,29 +468,44 @@ var ObjInspector = class ObjInspector {
     _onBack() {
         this.selectObject(this._previousObj, true);
     }
-};
+});
 
 var RedBorderEffect = GObject.registerClass(
 class RedBorderEffect extends Clutter.Effect {
-    vfunc_paint() {
+    _init() {
+        super._init();
+        this._pipeline = null;
+    }
+
+    vfunc_paint(paintContext) {
+        let framebuffer = paintContext.get_framebuffer();
+        let coglContext = framebuffer.get_context();
         let actor = this.get_actor();
-        actor.continue_paint();
+        actor.continue_paint(paintContext);
 
-        let color = new Cogl.Color();
-        color.init_from_4ub(0xff, 0, 0, 0xc4);
-        Cogl.set_source_color(color);
+        if (!this._pipeline) {
+            let color = new Cogl.Color();
+            color.init_from_4ub(0xff, 0, 0, 0xc4);
 
-        let geom = actor.get_allocation_geometry();
+            this._pipeline = new Cogl.Pipeline(coglContext);
+            this._pipeline.set_color(color);
+        }
+
+        let alloc = actor.get_allocation_box();
         let width = 2;
 
         // clockwise order
-        Cogl.rectangle(0, 0, geom.width, width);
-        Cogl.rectangle(geom.width - width, width,
-                       geom.width, geom.height);
-        Cogl.rectangle(0, geom.height,
-                       geom.width - width, geom.height - width);
-        Cogl.rectangle(0, geom.height - width,
-                       width, width);
+        framebuffer.draw_rectangle(this._pipeline,
+            0, 0, alloc.get_width(), width);
+        framebuffer.draw_rectangle(this._pipeline,
+            alloc.get_width() - width, width,
+            alloc.get_width(), alloc.get_height());
+        framebuffer.draw_rectangle(this._pipeline,
+            0, alloc.get_height(),
+            alloc.get_width() - width, alloc.get_height() - width);
+        framebuffer.draw_rectangle(this._pipeline,
+            0, alloc.get_height() - width,
+            width, width);
     }
 });
 
@@ -479,8 +514,7 @@ var Inspector = GObject.registerClass({
                'target': { param_types: [Clutter.Actor.$gtype, GObject.TYPE_DOUBLE, GObject.TYPE_DOUBLE] } },
 }, class Inspector extends Clutter.Actor {
     _init(lookingGlass) {
-        super._init({ width: 0,
-                      height: 0 });
+        super._init({ width: 0, height: 0 });
 
         Main.uiGroup.add_actor(this);
 
@@ -489,8 +523,8 @@ var Inspector = GObject.registerClass({
                                               reactive: true });
         this._eventHandler = eventHandler;
         this.add_actor(eventHandler);
-        this._displayText = new St.Label();
-        eventHandler.add(this._displayText, { expand: true });
+        this._displayText = new St.Label({ x_expand: true });
+        eventHandler.add_child(this._displayText);
 
         eventHandler.connect('key-press-event', this._onKeyPressEvent.bind(this));
         eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this));
@@ -543,7 +577,7 @@ var Inspector = GObject.registerClass({
     }
 
     _onKeyPressEvent(actor, event) {
-        if (event.get_key_symbol() == Clutter.Escape)
+        if (event.get_key_symbol() === Clutter.KEY_Escape)
             this._close();
         return Clutter.EVENT_STOP;
     }
@@ -615,18 +649,19 @@ var Inspector = GObject.registerClass({
     }
 });
 
-var Extensions = class Extensions {
-    constructor(lookingGlass) {
+var Extensions = GObject.registerClass({
+}, class Extensions extends St.BoxLayout {
+    _init(lookingGlass) {
+        super._init({ vertical: true, name: 'lookingGlassExtensions' });
+
         this._lookingGlass = lookingGlass;
-        this.actor = new St.BoxLayout({ vertical: true,
-                                        name: 'lookingGlassExtensions' });
         this._noExtensions = new St.Label({ style_class: 'lg-extensions-none',
                                             text: _("No extensions installed") });
         this._numExtensions = 0;
         this._extensionsList = new St.BoxLayout({ vertical: true,
                                                   style_class: 'lg-extensions-list' });
         this._extensionsList.add(this._noExtensions);
-        this.actor.add(this._extensionsList);
+        this.add(this._extensionsList);
 
         Main.extensionManager.getUuids().forEach(uuid => {
             this._loadExtension(null, uuid);
@@ -647,7 +682,7 @@ var Extensions = class Extensions {
         if (this._numExtensions == 0)
             this._extensionsList.remove_actor(this._noExtensions);
 
-        this._numExtensions ++;
+        this._numExtensions++;
         this._extensionsList.add(extensionDisplay);
     }
 
@@ -672,7 +707,7 @@ var Extensions = class Extensions {
             let errors = extension.errors;
             let errorDisplay = new St.BoxLayout({ vertical: true });
             if (errors && errors.length) {
-                for (let i = 0; i < errors.length; i ++)
+                for (let i = 0; i < errors.length; i++)
                     errorDisplay.add(new St.Label({ text: errors[i] }));
             } else {
                 /* Translators: argument is an extension UUID. */
@@ -711,12 +746,18 @@ var Extensions = class Extensions {
 
     _createExtensionDisplay(extension) {
         let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true });
-        let name = new St.Label({ style_class: 'lg-extension-name',
-                                  text: extension.metadata.name });
-        box.add(name, { expand: true });
-        let description = new St.Label({ style_class: 'lg-extension-description',
-                                         text: extension.metadata.description || 'No description' });
-        box.add(description, { expand: true });
+        let name = new St.Label({
+            style_class: 'lg-extension-name',
+            text: extension.metadata.name,
+            x_expand: true,
+        });
+        box.add_child(name);
+        let description = new St.Label({
+            style_class: 'lg-extension-description',
+            text: extension.metadata.description || 'No description',
+            x_expand: true,
+        });
+        box.add_child(description);
 
         let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' });
         box.add(metaBox);
@@ -754,10 +795,19 @@ var Extensions = class Extensions {
 
         return box;
     }
-};
+});
+
+var LookingGlass = GObject.registerClass(
+class LookingGlass extends St.BoxLayout {
+    _init() {
+        super._init({
+            name: 'LookingGlassDialog',
+            style_class: 'lg-dialog',
+            vertical: true,
+            visible: false,
+            reactive: true,
+        });
 
-var LookingGlass = class LookingGlass {
-    constructor() {
         this._borderPaintTarget = null;
         this._redBorderEffect = new RedBorderEffect();
 
@@ -765,26 +815,18 @@ var LookingGlass = class LookingGlass {
 
         this._it = null;
         this._offset = 0;
-        this._results = [];
 
         // Sort of magic, but...eh.
         this._maxItems = 150;
 
-        this.actor = new St.BoxLayout({ name: 'LookingGlassDialog',
-                                        style_class: 'lg-dialog',
-                                        vertical: true,
-                                        visible: false,
-                                        reactive: true });
-        this.actor.connect('key-press-event', this._globalKeyPressEvent.bind(this));
-
         this._interfaceSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
         this._interfaceSettings.connect('changed::monospace-font-name',
                                         this._updateFont.bind(this));
         this._updateFont();
 
         // We want it to appear to slide out from underneath the panel
-        Main.uiGroup.add_actor(this.actor);
-        Main.uiGroup.set_child_below_sibling(this.actor,
+        Main.uiGroup.add_actor(this);
+        Main.uiGroup.set_child_below_sibling(this,
                                              Main.layoutManager.panelBox);
         Main.layoutManager.panelBox.connect('allocation-changed',
                                             this._queueResize.bind(this));
@@ -792,11 +834,11 @@ var LookingGlass = class LookingGlass {
                                                this._queueResize.bind(this));
 
         this._objInspector = new ObjInspector(this);
-        Main.uiGroup.add_actor(this._objInspector.actor);
-        this._objInspector.actor.hide();
+        Main.uiGroup.add_actor(this._objInspector);
+        this._objInspector.hide();
 
         let toolbar = new St.BoxLayout({ name: 'Toolbar' });
-        this.actor.add_actor(toolbar);
+        this.add_actor(toolbar);
         let inspectIcon = new St.Icon({ icon_name: 'gtk-color-picker',
                                         icon_size: 24 });
         toolbar.add_actor(inspectIcon);
@@ -807,10 +849,10 @@ var LookingGlass = class LookingGlass {
                 this._pushResult(`inspect(${Math.round(stageX)}, ${Math.round(stageY)})`, target);
             });
             inspector.connect('closed', () => {
-                this.actor.show();
+                this.show();
                 global.stage.set_key_focus(this._entry);
             });
-            this.actor.hide();
+            this.hide();
             return Clutter.EVENT_STOP;
         });
 
@@ -821,7 +863,7 @@ var LookingGlass = class LookingGlass {
         gcIcon.connect('button-press-event', () => {
             gcIcon.icon_name = 'user-trash';
             System.gc();
-            this._timeoutId = Mainloop.timeout_add(500, () => {
+            this._timeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, () => {
                 gcIcon.icon_name = 'user-trash-full';
                 this._timeoutId = 0;
                 return GLib.SOURCE_REMOVE;
@@ -832,33 +874,43 @@ var LookingGlass = class LookingGlass {
 
         let notebook = new Notebook();
         this._notebook = notebook;
-        this.actor.add(notebook.actor, { expand: true });
+        this.add_child(notebook);
 
-        let emptyBox = new St.Bin();
-        toolbar.add(emptyBox, { expand: true });
+        let emptyBox = new St.Bin({ x_expand: true });
+        toolbar.add_child(emptyBox);
         toolbar.add_actor(notebook.tabControls);
 
         this._evalBox = new St.BoxLayout({ name: 'EvalBox', vertical: true });
         notebook.appendPage('Evaluator', this._evalBox);
 
-        this._resultsArea = new St.BoxLayout({ name: 'ResultsArea', vertical: true });
-        this._evalBox.add(this._resultsArea, { expand: true });
+        this._resultsArea = new St.BoxLayout({
+            name: 'ResultsArea',
+            vertical: true,
+            y_expand: true,
+        });
+        this._evalBox.add_child(this._resultsArea);
 
-        this._entryArea = new St.BoxLayout({ name: 'EntryArea' });
+        this._entryArea = new St.BoxLayout({
+            name: 'EntryArea',
+            y_align: Clutter.ActorAlign.END,
+        });
         this._evalBox.add_actor(this._entryArea);
 
         let label = new St.Label({ text: CHEVRON });
         this._entryArea.add(label);
 
-        this._entry = new St.Entry({ can_focus: true });
+        this._entry = new St.Entry({
+            can_focus: true,
+            x_expand: true,
+        });
         ShellEntry.addContextMenu(this._entry);
-        this._entryArea.add(this._entry, { expand: true });
+        this._entryArea.add_child(this._entry);
 
         this._windowList = new WindowList(this);
-        notebook.appendPage('Windows', this._windowList.actor);
+        notebook.appendPage('Windows', this._windowList);
 
         this._extensions = new Extensions(this);
-        notebook.appendPage('Extensions', this._extensions.actor);
+        notebook.appendPage('Extensions', this._extensions);
 
         this._entry.clutter_text.connect('activate', (o, _e) => {
             // Hide any completions we are currently showing
@@ -876,7 +928,7 @@ var LookingGlass = class LookingGlass {
             return true;
         });
 
-        this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY, 
+        this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY,
                                                      entry: this._entry.clutter_text });
 
         this._autoComplete = new AutoComplete(this._entry);
@@ -900,7 +952,7 @@ var LookingGlass = class LookingGlass {
         // monospace font to be bold/oblique/etc. Could easily be added here.
         let size = fontDesc.get_size() / 1024.;
         let unit = fontDesc.get_size_is_absolute() ? 'px' : 'pt';
-        this.actor.style = `
+        this.style = `
             font-size: ${size}${unit};
             font-family: "${fontDesc.get_family()}";`;
     }
@@ -914,17 +966,14 @@ var LookingGlass = class LookingGlass {
     }
 
     _pushResult(command, obj) {
-        let index = this._results.length + this._offset;
+        let index = this._resultsArea.get_n_children() + this._offset;
         let result = new Result(this, CHEVRON + command, obj, index);
-        this._results.push(result);
-        this._resultsArea.add(result.actor);
+        this._resultsArea.add(result);
         if (obj instanceof Clutter.Actor)
             this.setBorderPaintTarget(obj);
 
-        let children = this._resultsArea.get_children();
-        if (children.length > this._maxItems) {
-            this._results.shift();
-            children[0].destroy();
+        if (this._resultsArea.get_n_children() > this._maxItems) {
+            this._resultsArea.get_first_child().destroy();
             this._offset++;
         }
         this._it = obj;
@@ -960,7 +1009,7 @@ var LookingGlass = class LookingGlass {
                 height: naturalHeight,
                 opacity: 255,
                 duration,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
         }
     }
@@ -977,7 +1026,7 @@ var LookingGlass = class LookingGlass {
                 mode: Clutter.AnimationMode.EASE_OUT_QUAD,
                 onComplete: () => {
                     this._completionActor.hide();
-                }
+                },
             });
         }
     }
@@ -1010,7 +1059,11 @@ var LookingGlass = class LookingGlass {
     }
 
     getResult(idx) {
-        return this._results[idx - this._offset].o;
+        try {
+            return this._resultsArea.get_child_at_index(idx - this._offset).o;
+        } catch (e) {
+            throw new Error(`Unknown result at index ${idx}`);
+        }
     }
 
     toggle() {
@@ -1032,15 +1085,15 @@ var LookingGlass = class LookingGlass {
         let myWidth = primary.width * 0.7;
         let availableHeight = primary.height - Main.layoutManager.keyboardBox.height;
         let myHeight = Math.min(primary.height * 0.7, availableHeight * 0.9);
-        this.actor.x = primary.x + (primary.width - myWidth) / 2;
+        this.x = primary.x + (primary.width - myWidth) / 2;
         this._hiddenY = primary.y + Main.layoutManager.panelBox.height - myHeight;
         this._targetY = this._hiddenY + myHeight;
-        this.actor.y = this._hiddenY;
-        this.actor.width = myWidth;
-        this.actor.height = myHeight;
-        this._objInspector.actor.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8));
-        this._objInspector.actor.set_position(this.actor.x + Math.floor(myWidth * 0.1),
-                                              this._targetY + Math.floor(myHeight * 0.1));
+        this.y = this._hiddenY;
+        this.width = myWidth;
+        this.height = myHeight;
+        this._objInspector.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8));
+        this._objInspector.set_position(this.x + Math.floor(myWidth * 0.1),
+                                        this._targetY + Math.floor(myHeight * 0.1));
     }
 
     insertObject(obj) {
@@ -1053,24 +1106,21 @@ var LookingGlass = class LookingGlass {
     }
 
     // Handle key events which are relevant for all tabs of the LookingGlass
-    _globalKeyPressEvent(actor, event) {
-        let symbol = event.get_key_symbol();
-        let modifierState = event.get_state();
-        if (symbol == Clutter.Escape) {
-            if (this._objInspector.actor.visible) {
+    vfunc_key_press_event(keyPressEvent) {
+        let symbol = keyPressEvent.keyval;
+        if (symbol == Clutter.KEY_Escape) {
+            if (this._objInspector.visible)
                 this._objInspector.close();
-            } else {
+            else
                 this.close();
-            }
             return Clutter.EVENT_STOP;
         }
         // Ctrl+PgUp and Ctrl+PgDown switches tabs in the notebook view
-        if (modifierState & Clutter.ModifierType.CONTROL_MASK) {
-            if (symbol == Clutter.KEY_Page_Up) {
+        if (keyPressEvent.modifier_state & Clutter.ModifierType.CONTROL_MASK) {
+            if (symbol == Clutter.KEY_Page_Up)
                 this._notebook.prevTab();
-            } else if (symbol == Clutter.KEY_Page_Down) {
+            else if (symbol == Clutter.KEY_Page_Down)
                 this._notebook.nextTab();
-            }
         }
         return Clutter.EVENT_PROPAGATE;
     }
@@ -1083,30 +1133,32 @@ var LookingGlass = class LookingGlass {
             return;
 
         this._notebook.selectIndex(0);
-        this.actor.show();
+        this.show();
         this._open = true;
         this._history.lastItem();
 
-        this.actor.remove_all_transitions();
+        this.remove_all_transitions();
 
         // We inverse compensate for the slow-down so you can change the factor
         // through LookingGlass without long waits.
         let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor;
-        this.actor.ease({
+        this.ease({
             y: this._targetY,
             duration,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
+
+        this._windowList.update();
     }
 
     close() {
         if (!this._open)
             return;
 
-        this._objInspector.actor.hide();
+        this._objInspector.hide();
 
         this._open = false;
-        this.actor.remove_all_transitions();
+        this.remove_all_transitions();
 
         this.setBorderPaintTarget(null);
 
@@ -1115,12 +1167,15 @@ var LookingGlass = class LookingGlass {
         let settings = St.Settings.get();
         let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor,
                                 LG_ANIMATION_TIME);
-        this.actor.ease({
+        this.ease({
             y: this._hiddenY,
             duration,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.actor.hide()
+            onComplete: () => this.hide(),
         });
     }
-};
-Signals.addSignalMethods(LookingGlass.prototype);
+
+    get isOpen() {
+        return this._open;
+    }
+});

js/ui/magnifier.js

@@ -2,7 +2,6 @@
 
 const { Atspi, Clutter, GDesktopEnums,
         Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
 const Signals = imports.signals;
 
 const Background = imports.ui.background;
@@ -56,7 +55,7 @@ var MouseSpriteContent = GObject.registerClass({
         return [true, this._texture.get_width(), this._texture.get_height()];
     }
 
-    vfunc_paint_content(actor, node) {
+    vfunc_paint_content(actor, node, _paintContext) {
         if (!this._texture)
             return;
 
@@ -119,7 +118,7 @@ var Magnifier = class Magnifier {
         });
 
         // Export to dbus.
-        (new MagnifierDBus.ShellMagnifier());
+        new MagnifierDBus.ShellMagnifier();
         this.setActive(St.Settings.get().magnifier_active);
     }
 
@@ -142,7 +141,7 @@ var Magnifier = class Magnifier {
     /**
      * setActive:
      * Show/hide all the zoom regions.
-     * @activate:   Boolean to activate or de-activate the magnifier.
+     * @param {bool} activate: Boolean to activate or de-activate the magnifier.
      */
     setActive(activate) {
         let isActive = this.isActive();
@@ -178,7 +177,7 @@ var Magnifier = class Magnifier {
 
     /**
      * isActive:
-     * @return  Whether the magnifier is active (boolean).
+     * @returns {bool} Whether the magnifier is active.
      */
     isActive() {
         // Sufficient to check one ZoomRegion since Magnifier's active
@@ -213,7 +212,7 @@ var Magnifier = class Magnifier {
 
     /**
      * isTrackingMouse:
-     * Is the magnifier tracking the mouse currently?
+     * @returns {bool} whether the magnifier is currently tracking the mouse
      */
     isTrackingMouse() {
         return !!this._mouseTrackingId;
@@ -223,7 +222,7 @@ var Magnifier = class Magnifier {
      * scrollToMousePos:
      * Position all zoom regions' ROI relative to the current location of the
      * system pointer.
-     * @return      true.
+     * @returns {bool} true.
      */
     scrollToMousePos() {
         let [xMouse, yMouse] = global.get_pointer();
@@ -248,24 +247,24 @@ var Magnifier = class Magnifier {
     /**
      * createZoomRegion:
      * Create a ZoomRegion instance with the given properties.
-     * @xMagFactor:     The power to set horizontal magnification of the
-     *                  ZoomRegion.  A value of 1.0 means no magnification.  A
-     *                  value of 2.0 doubles the size.
-     * @yMagFactor:     The power to set the vertical magnification of the
-     *                  ZoomRegion.
-     * @roi             Object in the form { x, y, width, height } that
-     *                  defines the region to magnify.  Given in unmagnified
-     *                  coordinates.
-     * @viewPort        Object in the form { x, y, width, height } that defines
-     *                  the position of the ZoomRegion on screen.
-     * @return          The newly created ZoomRegion.
+     * @param {number} xMagFactor:
+     *     The power to set horizontal magnification of the ZoomRegion. A value
+     *     of 1.0 means no magnification, a value of 2.0 doubles the size.
+     * @param {number} yMagFactor:
+     *    The power to set the vertical magnification of the ZoomRegion.
+     * @param {{x: number, y: number, width: number, height: number}} roi:
+     *    The reg Object that defines the region to magnify, given in
+     *    unmagnified coordinates.
+     * @param {{x: number, y: number, width: number, height: number}} viewPort:
+     *     Object that defines the position of the ZoomRegion on screen.
+     * @returns {ZoomRegion} the newly created ZoomRegion.
      */
     createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) {
         let zoomRegion = new ZoomRegion(this, this._cursorRoot);
         zoomRegion.setViewPort(viewPort);
 
         // We ignore the redundant width/height on the ROI
-        let fixedROI = new Object(roi);
+        let fixedROI = Object.create(roi);
         fixedROI.width = viewPort.width / xMagFactor;
         fixedROI.height = viewPort.height / yMagFactor;
         zoomRegion.setROI(fixedROI);
@@ -278,7 +277,7 @@ var Magnifier = class Magnifier {
      * addZoomRegion:
      * Append the given ZoomRegion to the list of currently defined ZoomRegions
      * for this Magnifier instance.
-     * @zoomRegion:     The zoomRegion to add.
+     * @param {ZoomRegion} zoomRegion: The zoomRegion to add.
      */
     addZoomRegion(zoomRegion) {
         if (zoomRegion) {
@@ -291,7 +290,7 @@ var Magnifier = class Magnifier {
     /**
      * getZoomRegions:
      * Return a list of ZoomRegion's for this Magnifier.
-     * @return:     The Magnifier's zoom region list (array).
+     * @returns {number[]} The Magnifier's zoom region list.
      */
     getZoomRegions() {
         return this._zoomRegions;
@@ -331,7 +330,7 @@ var Magnifier = class Magnifier {
         this.setCrosshairsClip(clip);
 
         let theCrossHairs = this._crossHairs;
-        this._zoomRegions.forEach (zoomRegion => {
+        this._zoomRegions.forEach(zoomRegion => {
             zoomRegion.addCrosshairs(theCrossHairs);
         });
     }
@@ -339,7 +338,7 @@ var Magnifier = class Magnifier {
     /**
      * setCrosshairsVisible:
      * Show or hide the cross hair.
-     * @visible    Flag that indicates show (true) or hide (false).
+     * @param {bool} visible: Flag that indicates show (true) or hide (false).
      */
     setCrosshairsVisible(visible) {
         if (visible) {
@@ -347,6 +346,7 @@ var Magnifier = class Magnifier {
                 this.addCrosshairs();
             this._crossHairs.show();
         } else {
+            // eslint-disable-next-line no-lonely-if
             if (this._crossHairs)
                 this._crossHairs.hide();
         }
@@ -355,7 +355,7 @@ var Magnifier = class Magnifier {
     /**
      * setCrosshairsColor:
      * Set the color of the crosshairs for all ZoomRegions.
-     * @color:  The color as a string, e.g. '#ff0000ff' or 'red'.
+     * @param {string} color: The color as a string, e.g. '#ff0000ff' or 'red'.
      */
     setCrosshairsColor(color) {
         if (this._crossHairs) {
@@ -367,7 +367,7 @@ var Magnifier = class Magnifier {
     /**
      * getCrosshairsColor:
      * Get the color of the crosshairs.
-     * @return: The color as a string, e.g. '#0000ffff' or 'blue'.
+     * @returns {string} The color as a string, e.g. '#0000ffff' or 'blue'.
      */
     getCrosshairsColor() {
         if (this._crossHairs) {
@@ -381,8 +381,8 @@ var Magnifier = class Magnifier {
     /**
      * setCrosshairsThickness:
      * Set the crosshairs thickness for all ZoomRegions.
-     * @thickness:  The width of the vertical and horizontal lines of the
-     *              crosshairs.
+     * @param {number} thickness: The width of the vertical and
+     *     horizontal lines of the crosshairs.
      */
     setCrosshairsThickness(thickness) {
         if (this._crossHairs)
@@ -392,8 +392,8 @@ var Magnifier = class Magnifier {
     /**
      * getCrosshairsThickness:
      * Get the crosshairs thickness.
-     * @return: The width of the vertical and horizontal lines of the
-     *          crosshairs.
+     * @returns {number} The width of the vertical and horizontal
+     *     lines of the crosshairs.
      */
     getCrosshairsThickness() {
         if (this._crossHairs)
@@ -404,7 +404,8 @@ var Magnifier = class Magnifier {
 
     /**
      * setCrosshairsOpacity:
-     * @opacity:    Value between 0.0 (transparent) and 1.0 (fully opaque).
+     * @param {number} opacity: Value between 0.0 (transparent)
+     *     and 1.0 (fully opaque).
      */
     setCrosshairsOpacity(opacity) {
         if (this._crossHairs)
@@ -413,7 +414,7 @@ var Magnifier = class Magnifier {
 
     /**
      * getCrosshairsOpacity:
-     * @return:     Value between 0.0 (transparent) and 1.0 (fully opaque).
+     * @returns {number} Value between 0.0 (transparent) and 1.0 (fully opaque).
      */
     getCrosshairsOpacity() {
         if (this._crossHairs)
@@ -425,8 +426,8 @@ var Magnifier = class Magnifier {
     /**
      * setCrosshairsLength:
      * Set the crosshairs length for all ZoomRegions.
-     * @length: The length of the vertical and horizontal lines making up the
-     *          crosshairs.
+     * @param {number} length: The length of the vertical and horizontal
+     *     lines making up the crosshairs.
      */
     setCrosshairsLength(length) {
         if (this._crossHairs)
@@ -436,8 +437,8 @@ var Magnifier = class Magnifier {
     /**
      * getCrosshairsLength:
      * Get the crosshairs length.
-     * @return: The length of the vertical and horizontal lines making up the
-     *          crosshairs.
+     * @returns {number} The length of the vertical and horizontal
+     *     lines making up the crosshairs.
      */
     getCrosshairsLength() {
         if (this._crossHairs)
@@ -449,35 +450,31 @@ var Magnifier = class Magnifier {
     /**
      * setCrosshairsClip:
      * Set whether the crosshairs are clipped at their intersection.
-     * @clip:   Flag to indicate whether to clip the crosshairs.
+     * @param {bool} clip: Flag to indicate whether to clip the crosshairs.
      */
     setCrosshairsClip(clip) {
-        if (clip) {
-            if (this._crossHairs)
-                this._crossHairs.setClip(CROSSHAIRS_CLIP_SIZE);
-        } else {
-            // Setting no clipping on crosshairs means a zero sized clip
-            // rectangle.
-            if (this._crossHairs)
-                this._crossHairs.setClip([0, 0]);
-        }
+        if (!this._crossHairs)
+            return;
+
+        // Setting no clipping on crosshairs means a zero sized clip rectangle.
+        this._crossHairs.setClip(clip ? CROSSHAIRS_CLIP_SIZE : [0, 0]);
     }
 
     /**
      * getCrosshairsClip:
      * Get whether the crosshairs are clipped by the mouse image.
-     * @return:   Whether the crosshairs are clipped.
+     * @returns {bool} Whether the crosshairs are clipped.
      */
     getCrosshairsClip() {
         if (this._crossHairs) {
             let [clipWidth, clipHeight] = this._crossHairs.getClip();
-            return (clipWidth > 0 && clipHeight > 0);
+            return clipWidth > 0 && clipHeight > 0;
         } else {
             return false;
         }
     }
 
-    //// Private methods ////
+    // Private methods //
 
     _updateMouseSprite() {
         this._updateSpriteTexture();
@@ -628,9 +625,8 @@ var Magnifier = class Magnifier {
 
     _updateLensMode() {
         // Applies only to the first zoom region.
-        if (this._zoomRegions.length) {
+        if (this._zoomRegions.length)
             this._zoomRegions[0].setLensMode(this._settings.get_boolean(LENS_MODE_KEY));
-        }
     }
 
     _updateClampMode() {
@@ -777,15 +773,16 @@ var ZoomRegion = class ZoomRegion {
     }
 
     _updateScreenPosition() {
-        if (this._screenPosition == GDesktopEnums.MagnifierScreenPosition.NONE)
+        if (this._screenPosition == GDesktopEnums.MagnifierScreenPosition.NONE) {
             this._setViewPort({
                 x: this._viewPortX,
                 y: this._viewPortY,
                 width: this._viewPortWidth,
-                height: this._viewPortHeight
+                height: this._viewPortHeight,
             });
-        else
+        } else {
             this.setScreenPosition(this._screenPosition);
+        }
     }
 
     _updateFocus(caller, event) {
@@ -823,7 +820,7 @@ var ZoomRegion = class ZoomRegion {
 
     /**
      * setActive:
-     * @activate:   Boolean to show/hide the ZoomRegion.
+     * @param {bool} activate: Boolean to show/hide the ZoomRegion.
      */
     setActive(activate) {
         if (activate == this.isActive())
@@ -849,7 +846,7 @@ var ZoomRegion = class ZoomRegion {
 
     /**
      * isActive:
-     * @return  Whether this ZoomRegion is active (boolean).
+     * @returns {bool} Whether this ZoomRegion is active
      */
     isActive() {
         return this._magView != null;
@@ -857,24 +854,24 @@ var ZoomRegion = class ZoomRegion {
 
     /**
      * setMagFactor:
-     * @xMagFactor:     The power to set the horizontal magnification factor to
-     *                  of the magnified view.  A value of 1.0 means no
-     *                  magnification.  A value of 2.0 doubles the size.
-     * @yMagFactor:     The power to set the vertical magnification factor to
-     *                  of the magnified view.
+     * @param {number} xMagFactor: The power to set the horizontal
+     *     magnification factor to of the magnified view. A value of 1.0
+     *     means no magnification. A value of 2.0 doubles the size.
+     * @param {number} yMagFactor: The power to set the vertical
+     *     magnification factor to of the magnified view.
      */
     setMagFactor(xMagFactor, yMagFactor) {
-        this._changeROI({ xMagFactor: xMagFactor,
-                          yMagFactor: yMagFactor,
+        this._changeROI({ xMagFactor,
+                          yMagFactor,
                           redoCursorTracking: this._followingCursor });
     }
 
     /**
      * getMagFactor:
-     * @return  an array, [xMagFactor, yMagFactor], containing the horizontal
-     *          and vertical magnification powers.  A value of 1.0 means no
-     *          magnification.  A value of 2.0 means the contents are doubled
-     *          in size, and so on.
+     * @returns {number[]} an array, [xMagFactor, yMagFactor], containing
+     *     the horizontal and vertical magnification powers. A value of
+     *     1.0 means no magnification. A value of 2.0 means the contents
+     *     are doubled in size, and so on.
      */
     getMagFactor() {
         return [this._xMagFactor, this._yMagFactor];
@@ -882,7 +879,7 @@ var ZoomRegion = class ZoomRegion {
 
     /**
      * setMouseTrackingMode
-     * @mode:     One of the enum MouseTrackingMode values.
+     * @param {GDesktopEnums.MagnifierMouseTrackingMode} mode: the new mode
      */
     setMouseTrackingMode(mode) {
         if (mode >= GDesktopEnums.MagnifierMouseTrackingMode.NONE &&
@@ -892,7 +889,7 @@ var ZoomRegion = class ZoomRegion {
 
     /**
      * getMouseTrackingMode
-     * @return:     One of the enum MouseTrackingMode values.
+     * @returns {GDesktopEnums.MagnifierMouseTrackingMode} the current mode
      */
     getMouseTrackingMode() {
         return this._mouseTrackingMode;
@@ -900,7 +897,7 @@ var ZoomRegion = class ZoomRegion {
 
     /**
      * setFocusTrackingMode
-     * @mode:     One of the enum FocusTrackingMode values.
+     * @param {GDesktopEnums.MagnifierFocusTrackingMode} mode: the new mode
      */
     setFocusTrackingMode(mode) {
         this._focusTrackingMode = mode;
@@ -909,7 +906,7 @@ var ZoomRegion = class ZoomRegion {
 
     /**
      * setCaretTrackingMode
-     * @mode:     One of the enum CaretTrackingMode values.
+     * @param {GDesktopEnums.MagnifierCaretTrackingMode} mode: the new mode
      */
     setCaretTrackingMode(mode) {
         this._caretTrackingMode = mode;
@@ -939,9 +936,9 @@ var ZoomRegion = class ZoomRegion {
     /**
      * setViewPort
      * Sets the position and size of the ZoomRegion on screen.
-     * @viewPort:   Object defining the position and size of the view port.
-     *              It has members x, y, width, height.  The values are in
-     *              stage coordinate space.
+     * @param {{x: number, y: number, width: number, height: number}} viewPort:
+     *     Object defining the position and size of the view port.
+     *     The values are in stage coordinate space.
      */
     setViewPort(viewPort) {
         this._setViewPort(viewPort);
@@ -951,9 +948,9 @@ var ZoomRegion = class ZoomRegion {
     /**
      * setROI
      * Sets the "region of interest" that the ZoomRegion is magnifying.
-     * @roi:    Object that defines the region of the screen to magnify.  It
-     *          has members x, y, width, height.  The values are in
-     *          screen (unmagnified) coordinate space.
+     * @param {{x: number, y: number, width: number, height: number}} roi:
+     *     Object that defines the region of the screen to magnify.
+     *     The values are in screen (unmagnified) coordinate space.
      */
     setROI(roi) {
         if (roi.width <= 0 || roi.height <= 0)
@@ -971,8 +968,8 @@ var ZoomRegion = class ZoomRegion {
      * Retrieves the "region of interest" -- the rectangular bounds of that part
      * of the desktop that the magnified view is showing (x, y, width, height).
      * The bounds are given in non-magnified coordinates.
-     * @return  an array, [x, y, width, height], representing the bounding
-     *          rectangle of what is shown in the magnified view.
+     * @returns {number[]} an array, [x, y, width, height], representing
+     *     the bounding rectangle of what is shown in the magnified view.
      */
     getROI() {
         let roiWidth = this._viewPortWidth / this._xMagFactor;
@@ -987,18 +984,18 @@ var ZoomRegion = class ZoomRegion {
      * setLensMode:
      * Turn lens mode on/off.  In full screen mode, lens mode does nothing since
      * a lens the size of the screen is pointless.
-     * @lensMode:   A boolean to set the sense of lens mode.
+     * @param {bool} lensMode: Whether lensMode should be active
      */
     setLensMode(lensMode) {
         this._lensMode = lensMode;
         if (!this._lensMode)
-            this.setScreenPosition (this._screenPosition);
+            this.setScreenPosition(this._screenPosition);
     }
 
     /**
      * isLensMode:
      * Is lens mode on or off?
-     * @return  The lens mode state as a boolean.
+     * @returns {bool} The lens mode state.
      */
     isLensMode() {
         return this._lensMode;
@@ -1008,7 +1005,7 @@ var ZoomRegion = class ZoomRegion {
      * setClampScrollingAtEdges:
      * Stop vs. allow scrolling of the magnified contents when it scroll beyond
      * the edges of the screen.
-     * @clamp:   Boolean to turn on/off clamping.
+     * @param {bool} clamp: Boolean to turn on/off clamping.
      */
     setClampScrollingAtEdges(clamp) {
         this._clampScrollingAtEdges = clamp;
@@ -1092,9 +1089,7 @@ var ZoomRegion = class ZoomRegion {
      * setScreenPosition:
      * Positions the zoom region to one of the enumerated positions on the
      * screen.
-     * @position:   one of Magnifier.FULL_SCREEN, Magnifier.TOP_HALF,
-     *              Magnifier.BOTTOM_HALF,Magnifier.LEFT_HALF, or
-     *              Magnifier.RIGHT_HALF.
+     * @param {GDesktopEnums.MagnifierScreenPosition} inPosition: the position
      */
     setScreenPosition(inPosition) {
         switch (inPosition) {
@@ -1120,7 +1115,7 @@ var ZoomRegion = class ZoomRegion {
      * getScreenPosition:
      * Tell the outside world what the current mode is -- magnifiying the
      * top half, bottom half, etc.
-     * @return:  the current mode.
+     * @returns {GDesktopEnums.MagnifierScreenPosition}: the current position.
      */
     getScreenPosition() {
         return this._screenPosition;
@@ -1129,7 +1124,8 @@ var ZoomRegion = class ZoomRegion {
     /**
      * scrollToMousePos:
      * Set the region of interest based on the position of the system pointer.
-     * @return:     Whether the system mouse pointer is over the magnified view.
+     * @returns {bool}: Whether the system mouse pointer is over the
+     *     magnified view.
      */
     scrollToMousePos() {
         this._followingCursor = true;
@@ -1144,7 +1140,7 @@ var ZoomRegion = class ZoomRegion {
 
     _clearScrollContentsTimer() {
         if (this._scrollContentsTimerId != 0) {
-            Mainloop.source_remove(this._scrollContentsTimerId);
+            GLib.source_remove(this._scrollContentsTimerId);
             this._scrollContentsTimerId = 0;
         }
     }
@@ -1156,7 +1152,7 @@ var ZoomRegion = class ZoomRegion {
         }
 
         this._clearScrollContentsTimer();
-        this._scrollContentsTimerId = Mainloop.timeout_add(POINTER_REST_TIME, () => {
+        this._scrollContentsTimerId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, POINTER_REST_TIME, () => {
             this._scrollContentsToDelayed(x, y);
             return GLib.SOURCE_REMOVE;
         });
@@ -1166,8 +1162,8 @@ var ZoomRegion = class ZoomRegion {
      * scrollContentsTo:
      * Shift the contents of the magnified view such it is centered on the given
      * coordinate.
-     * @x:      The x-coord of the point to center on.
-     * @y:      The y-coord of the point to center on.
+     * @param {number} x: The x-coord of the point to center on.
+     * @param {number} y: The y-coord of the point to center on.
      */
     scrollContentsTo(x, y) {
         this._clearScrollContentsTimer();
@@ -1180,22 +1176,21 @@ var ZoomRegion = class ZoomRegion {
     /**
      * addCrosshairs:
      * Add crosshairs centered on the magnified mouse.
-     * @crossHairs: Crosshairs instance
+     * @param {Crosshairs} crossHairs: Crosshairs instance
      */
     addCrosshairs(crossHairs) {
         this._crossHairs = crossHairs;
 
         // If the crossHairs is not already within a larger container, add it
         // to this zoom region.  Otherwise, add a clone.
-        if (crossHairs && this.isActive()) {
+        if (crossHairs && this.isActive())
             this._crossHairsActor = crossHairs.addToZoomRegion(this, this._mouseActor);
-        }
     }
 
     /**
      * setInvertLightness:
      * Set whether to invert the lightness of the magnified view.
-     * @flag    Boolean to either invert brightness (true), or not (false).
+     * @param {bool} flag: whether brightness should be inverted
      */
     setInvertLightness(flag) {
         this._invertLightness = flag;
@@ -1206,7 +1201,7 @@ var ZoomRegion = class ZoomRegion {
     /**
      * getInvertLightness:
      * Retrieve whether the lightness is inverted.
-     * @return    Boolean indicating inversion (true), or not (false).
+     * @returns {bool} whether brightness should be inverted
      */
     getInvertLightness() {
         return this._invertLightness;
@@ -1215,9 +1210,9 @@ var ZoomRegion = class ZoomRegion {
     /**
      * setColorSaturation:
      * Set the color saturation of the magnified view.
-     * @sauration  A value from 0.0 to 1.0 that defines the color
-     *             saturation, with 0.0 defining no color (grayscale),
-     *             and 1.0 defining full color.
+     * @param {number} saturation: A value from 0.0 to 1.0 that defines
+     *     the color saturation, with 0.0 defining no color (grayscale),
+     *     and 1.0 defining full color.
      */
     setColorSaturation(saturation) {
         this._colorSaturation = saturation;
@@ -1228,6 +1223,7 @@ var ZoomRegion = class ZoomRegion {
     /**
      * getColorSaturation:
      * Retrieve the color saturation of the magnified view.
+     * @returns {number} the color saturation
      */
     getColorSaturation() {
         return this._colorSaturation;
@@ -1236,10 +1232,14 @@ var ZoomRegion = class ZoomRegion {
     /**
      * setBrightness:
      * Alter the brightness of the magnified view.
-     * @brightness  Object containing the contrast for the red, green,
-     *              and blue channels.  Values of 0.0 represent "standard"
-     *              brightness (no change), whereas values less or greater than
-     *              0.0 indicate decreased or incresaed brightness, respectively.
+     * @param {Object} brightness: Object containing the contrast for the
+     *     red, green, and blue channels. Values of 0.0 represent "standard"
+     *     brightness (no change), whereas values less or greater than
+     *     0.0 indicate decreased or incresaed brightness, respectively.
+     *
+     *     {number} brightness.r - the red component
+     *     {number} brightness.g - the green component
+     *     {number} brightness.b - the blue component
      */
     setBrightness(brightness) {
         this._brightness.r = brightness.r;
@@ -1252,10 +1252,14 @@ var ZoomRegion = class ZoomRegion {
     /**
      * setContrast:
      * Alter the contrast of the magnified view.
-     * @contrast    Object containing the contrast for the red, green,
-     *              and blue channels.  Values of 0.0 represent "standard"
-     *              contrast (no change), whereas values less or greater than
-     *              0.0 indicate decreased or incresaed contrast, respectively.
+     * @param {Object} contrast: Object containing the contrast for the
+     *     red, green, and blue channels. Values of 0.0 represent "standard"
+     *     contrast (no change), whereas values less or greater than
+     *     0.0 indicate decreased or incresaed contrast, respectively.
+     *
+     *     {number} contrast.r - the red component
+     *     {number} contrast.g - the green component
+     *     {number} contrast.b - the blue component
      */
     setContrast(contrast) {
         this._contrast.r = contrast.r;
@@ -1268,8 +1272,8 @@ var ZoomRegion = class ZoomRegion {
     /**
      * getContrast:
      * Retrieve the contrast of the magnified view.
-     * @return  Object containing the contrast for the red, green,
-     *          and blue channels.
+     * @returns {{r: number, g: number, b: number}}: Object containing
+     *     the contrast for the red, green, and blue channels.
      */
     getContrast() {
         let contrast = {};
@@ -1279,15 +1283,15 @@ var ZoomRegion = class ZoomRegion {
         return contrast;
     }
 
-    //// Private methods ////
+    // Private methods //
 
     _createActors() {
         // The root actor for the zoom region
-        this._magView = new St.Bin({ style_class: 'magnifier-zoom-region', x_fill: true, y_fill: true });
+        this._magView = new St.Bin({ style_class: 'magnifier-zoom-region' });
         global.stage.add_actor(this._magView);
 
         // hide the magnified region from CLUTTER_PICK_ALL
-        Shell.util_set_hidden_from_pick (this._magView, true);
+        Shell.util_set_hidden_from_pick(this._magView, true);
 
         // Add a group to clip the contents of the magnified view.
         let mainGroup = new Clutter.Actor({ clip_to_allocation: true });
@@ -1295,7 +1299,7 @@ var ZoomRegion = class ZoomRegion {
 
         // Add a background for when the magnified uiGroup is scrolled
         // out of view (don't want to see desktop showing through).
-        this._background = (new Background.SystemBackground()).actor;
+        this._background = new Background.SystemBackground();
         mainGroup.add_actor(this._background);
 
         // Clone the group that contains all of UI on the screen.  This is the
@@ -1327,7 +1331,7 @@ var ZoomRegion = class ZoomRegion {
 
     _destroyActors() {
         if (this._mouseActor == this._mouseSourceActor)
-            this._mouseActor.get_parent().remove_actor (this._mouseActor);
+            this._mouseActor.get_parent().remove_actor(this._mouseActor);
         if (this._crossHairs)
             this._crossHairs.removeFromParent(this._crossHairsActor);
 
@@ -1407,11 +1411,12 @@ var ZoomRegion = class ZoomRegion {
         // If in lens mode, move the magnified view such that it is centered
         // over the actual mouse. However, in full screen mode, the "lens" is
         // the size of the screen -- pointless to move such a large lens around.
-        if (this._lensMode && !this._isFullScreen())
+        if (this._lensMode && !this._isFullScreen()) {
             this._setViewPort({ x: this._xCenter - this._viewPortWidth / 2,
                                 y: this._yCenter - this._viewPortHeight / 2,
                                 width: this._viewPortWidth,
                                 height: this._viewPortHeight }, true);
+        }
 
         this._updateCloneGeometry();
         this._updateMousePosition();
@@ -1425,10 +1430,9 @@ var ZoomRegion = class ZoomRegion {
             let xMouse = this._magnifier.xMouse;
             let yMouse = this._magnifier.yMouse;
 
-            mouseIsOver = (
+            mouseIsOver =
                 xMouse >= this._viewPortX && xMouse < (this._viewPortX + this._viewPortWidth) &&
-                yMouse >= this._viewPortY && yMouse < (this._viewPortY + this._viewPortHeight)
-            );
+                yMouse >= this._viewPortY && yMouse < (this._viewPortY + this._viewPortHeight);
         }
         return mouseIsOver;
     }
@@ -1453,13 +1457,12 @@ var ZoomRegion = class ZoomRegion {
         let xMouse = this._magnifier.xMouse;
         let yMouse = this._magnifier.yMouse;
 
-        if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) {
+        if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL)
             return this._centerFromPointProportional(xMouse, yMouse);
-        } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
+        else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH)
             return this._centerFromPointPush(xMouse, yMouse);
-        } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
+        else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED)
             return this._centerFromPointCentered(xMouse, yMouse);
-        }
 
         return null; // Should never be hit
     }
@@ -1501,14 +1504,14 @@ var ZoomRegion = class ZoomRegion {
         let yRoiBottom = yRoi + heightRoi - cursorHeight;
 
         if (xPoint < xRoi)
-            xPos -= (xRoi - xPoint);
+            xPos -= xRoi - xPoint;
         else if (xPoint > xRoiRight)
-            xPos += (xPoint - xRoiRight);
+            xPos += xPoint - xRoiRight;
 
         if (yPoint < yRoi)
-            yPos -= (yRoi - yPoint);
+            yPos -= yRoi - yPoint;
         else if (yPoint > yRoiBottom)
-            yPos += (yPoint - yRoiBottom);
+            yPos += yPoint - yRoiBottom;
 
         return [xPos, yPos];
     }
@@ -1592,8 +1595,9 @@ var ZoomRegion = class ZoomRegion {
     }
 };
 
-var Crosshairs = class Crosshairs {
-    constructor() {
+var Crosshairs = GObject.registerClass(
+class Crosshairs extends Clutter.Actor {
+    _init() {
 
         // Set the group containing the crosshairs to three times the desktop
         // size in case the crosshairs need to appear to be infinite in
@@ -1601,19 +1605,19 @@ var Crosshairs = class Crosshairs {
         let groupWidth = global.screen_width * 3;
         let groupHeight = global.screen_height * 3;
 
-        this._actor = new Clutter.Actor({
+        super._init({
             clip_to_allocation: false,
             width: groupWidth,
-            height: groupHeight
+            height: groupHeight,
         });
         this._horizLeftHair = new Clutter.Actor();
         this._horizRightHair = new Clutter.Actor();
         this._vertTopHair = new Clutter.Actor();
         this._vertBottomHair = new Clutter.Actor();
-        this._actor.add_actor(this._horizLeftHair);
-        this._actor.add_actor(this._horizRightHair);
-        this._actor.add_actor(this._vertTopHair);
-        this._actor.add_actor(this._vertBottomHair);
+        this.add_actor(this._horizLeftHair);
+        this.add_actor(this._horizRightHair);
+        this.add_actor(this._vertTopHair);
+        this.add_actor(this._vertBottomHair);
         this._clipSize = [0, 0];
         this._clones = [];
         this.reCenter();
@@ -1623,7 +1627,7 @@ var Crosshairs = class Crosshairs {
     }
 
     _monitorsChanged() {
-        this._actor.set_size(global.screen_width * 3, global.screen_height * 3);
+        this.set_size(global.screen_width * 3, global.screen_height * 3);
         this.reCenter();
     }
 
@@ -1633,26 +1637,30 @@ var Crosshairs = class Crosshairs {
     * already part of some other ZoomRegion, create a clone of the crosshairs
     * actor, and add the clone instead.  Returns either the original or the
     * clone.
-    * @zoomRegion:      The container to add the crosshairs group to.
-    * @magnifiedMouse:  The mouse actor for the zoom region -- used to
-    *                   position the crosshairs and properly layer them below
-    *                   the mouse.
-    * @return           The crosshairs actor, or its clone.
+    * @param {ZoomRegion} zoomRegion: The container to add the crosshairs
+    *     group to.
+    * @param {Clutter.Actor} magnifiedMouse: The mouse actor for the
+    *     zoom region -- used to position the crosshairs and properly
+    *     layer them below the mouse.
+    * @returns {Clutter.Actor} The crosshairs actor, or its clone.
     */
     addToZoomRegion(zoomRegion, magnifiedMouse) {
         let crosshairsActor = null;
         if (zoomRegion && magnifiedMouse) {
             let container = magnifiedMouse.get_parent();
             if (container) {
-                crosshairsActor = this._actor;
-                if (this._actor.get_parent() != null) {
-                    crosshairsActor = new Clutter.Clone({ source: this._actor });
+                crosshairsActor = this;
+                if (this.get_parent() != null) {
+                    crosshairsActor = new Clutter.Clone({ source: this });
                     this._clones.push(crosshairsActor);
+
+                    // Clones don't share visibility.
+                    this.bind_property('visible', crosshairsActor, 'visible',
+                                       GObject.BindingFlags.SYNC_CREATE);
                 }
-                crosshairsActor.visible = this._actor.visible;
 
                 container.add_actor(crosshairsActor);
-                container.raise_child(magnifiedMouse, crosshairsActor);
+                container.set_child_above_sibling(magnifiedMouse, crosshairsActor);
                 let [xMouse, yMouse] = magnifiedMouse.get_position();
                 let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size();
                 crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2);
@@ -1663,12 +1671,13 @@ var Crosshairs = class Crosshairs {
 
     /**
      * removeFromParent:
-     * @childActor: the actor returned from addToZoomRegion
+     * @param {Clutter.Actor} childActor: the actor returned from
+     *     addToZoomRegion
      * Remove the crosshairs actor from its parent container, or destroy the
      * child actor if it was just a clone of the crosshairs actor.
      */
     removeFromParent(childActor) {
-        if (childActor == this._actor)
+        if (childActor == this)
             childActor.get_parent().remove_actor(childActor);
         else
             childActor.destroy();
@@ -1677,7 +1686,7 @@ var Crosshairs = class Crosshairs {
     /**
      * setColor:
      * Set the color of the crosshairs.
-     * @clutterColor:   The color as a Clutter.Color.
+     * @param {Clutter.Color} clutterColor: The color
      */
     setColor(clutterColor) {
         this._horizLeftHair.background_color = clutterColor;
@@ -1689,7 +1698,7 @@ var Crosshairs = class Crosshairs {
     /**
      * getColor:
      * Get the color of the crosshairs.
-     * @color:  The color as a Clutter.Color.
+     * @returns {ClutterColor} the crosshairs color
      */
     getColor() {
         return this._horizLeftHair.get_color();
@@ -1698,7 +1707,7 @@ var Crosshairs = class Crosshairs {
     /**
      * setThickness:
      * Set the width of the vertical and horizontal lines of the crosshairs.
-     * @thickness
+     * @param {number} thickness: the new thickness value
      */
     setThickness(thickness) {
         this._horizLeftHair.set_height(thickness);
@@ -1711,7 +1720,7 @@ var Crosshairs = class Crosshairs {
     /**
      * getThickness:
      * Get the width of the vertical and horizontal lines of the crosshairs.
-     * @return:     The thickness of the crosshairs.
+     * @returns {number} The thickness of the crosshairs.
      */
     getThickness() {
         return this._horizLeftHair.get_height();
@@ -1720,7 +1729,8 @@ var Crosshairs = class Crosshairs {
     /**
      * setOpacity:
      * Set how opaque the crosshairs are.
-     * @opacity:    Value between 0 (fully transparent) and 255 (full opaque).
+     * @param {number} opacity: Value between 0 (fully transparent)
+     *     and 255 (full opaque).
      */
     setOpacity(opacity) {
         // set_opacity() throws an exception for values outside the range
@@ -1739,7 +1749,7 @@ var Crosshairs = class Crosshairs {
     /**
      * setLength:
      * Set the length of the vertical and horizontal lines in the crosshairs.
-     * @length: The length of the crosshairs.
+     * @param {number} length: The length of the crosshairs.
      */
     setLength(length) {
         this._horizLeftHair.set_width(length);
@@ -1752,7 +1762,7 @@ var Crosshairs = class Crosshairs {
     /**
      * getLength:
      * Get the length of the vertical and horizontal lines in the crosshairs.
-     * @return: The length of the crosshairs.
+     * @returns {number} The length of the crosshairs.
      */
     getLength() {
         return this._horizLeftHair.get_width();
@@ -1762,8 +1772,8 @@ var Crosshairs = class Crosshairs {
      * setClip:
      * Set the width and height of the rectangle that clips the crosshairs at
      * their intersection
-     * @size:   Array of [width, height] defining the size of the clip
-     *          rectangle.
+     * @param {number[]} size: Array of [width, height] defining the size
+     *     of the clip rectangle.
      */
     setClip(size) {
         if (size) {
@@ -1778,37 +1788,15 @@ var Crosshairs = class Crosshairs {
         }
     }
 
-    /**
-     * show:
-     * Show the crosshairs.
-     */
-    show() {
-        this._actor.show();
-        // Clones don't share visibility.
-        for (let i = 0; i < this._clones.length; i++)
-            this._clones[i].show();
-    }
-
-    /**
-     * hide:
-     * Hide the crosshairs.
-     */
-    hide() {
-        this._actor.hide();
-        // Clones don't share visibility.
-        for (let i = 0; i < this._clones.length; i++)
-            this._clones[i].hide();
-    }
-
     /**
      * reCenter:
      * Reposition the horizontal and vertical hairs such that they cross at
      * the center of crosshairs group.  If called with the dimensions of
      * the clip rectangle, these are used to update the size of the clip.
-     * @clipSize:  Optional.  If present, an array of the form [width, height].
+     * @param {number[]=} clipSize: If present, the clip's [width, height].
      */
     reCenter(clipSize) {
-        let [groupWidth, groupHeight] = this._actor.get_size();
+        let [groupWidth, groupHeight] = this.get_size();
         let leftLength = this._horizLeftHair.get_width();
         let topLength = this._vertTopHair.get_height();
         let thickness = this._horizLeftHair.get_height();
@@ -1830,7 +1818,7 @@ var Crosshairs = class Crosshairs {
         this._vertTopHair.set_position((groupWidth - thickness) / 2, top);
         this._vertBottomHair.set_position((groupWidth - thickness) / 2, bottom);
     }
-};
+});
 
 var MagShaderEffects = class MagShaderEffects {
     constructor(uiGroupClone) {
@@ -1863,7 +1851,7 @@ var MagShaderEffects = class MagShaderEffects {
     /**
      * setInvertLightness:
      * Enable/disable invert lightness effect.
-     * @invertFlag:     Enabled flag.
+     * @param {bool} invertFlag: Enabled flag.
      */
     setInvertLightness(invertFlag) {
         this._inverse.set_enabled(invertFlag);
@@ -1876,11 +1864,14 @@ var MagShaderEffects = class MagShaderEffects {
     /**
      * setBrightness:
      * Set the brightness of the magnified view.
-     * @brightness: Object containing the brightness for the red, green,
-     *              and blue channels.  Values of 0.0 represent "standard"
-     *              brightness (no change), whereas values less or greater than
-     *              0.0 indicate decreased or incresaed brightness,
-     *              respectively.
+     * @param {Object} brightness: Object containing the contrast for the
+     *     red, green, and blue channels. Values of 0.0 represent "standard"
+     *     brightness (no change), whereas values less or greater than
+     *     0.0 indicate decreased or incresaed brightness, respectively.
+     *
+     *     {number} brightness.r - the red component
+     *     {number} brightness.g - the green component
+     *     {number} brightness.b - the blue component
      */
     setBrightness(brightness) {
         let bRed = brightness.r;
@@ -1892,17 +1883,21 @@ var MagShaderEffects = class MagShaderEffects {
         // it modifies the brightness and/or contrast.
         let [cRed, cGreen, cBlue] = this._brightnessContrast.get_contrast();
         this._brightnessContrast.set_enabled(
-            (bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE ||
-             cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE)
+            bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE ||
+             cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE
         );
     }
 
     /**
      * Set the contrast of the magnified view.
-     * @contrast:   Object containing the contrast for the red, green,
-     *              and blue channels.  Values of 0.0 represent "standard"
-     *              contrast (no change), whereas values less or greater than
-     *              0.0 indicate decreased or incresaed contrast, respectively.
+     * @param {Object} contrast: Object containing the contrast for the
+     *     red, green, and blue channels. Values of 0.0 represent "standard"
+     *     contrast (no change), whereas values less or greater than
+     *     0.0 indicate decreased or incresaed contrast, respectively.
+     *
+     *     {number} contrast.r - the red component
+     *     {number} contrast.g - the green component
+     *     {number} contrast.b - the blue component
      */
     setContrast(contrast) {
         let cRed = contrast.r;

js/ui/magnifierDBus.js

@@ -32,7 +32,7 @@ var ShellMagnifier = class ShellMagnifier {
 
     /**
      * setActive:
-     * @activate:   Boolean to activate or de-activate the magnifier.
+     * @param {bool} activate: activate or de-activate the magnifier.
      */
     setActive(activate) {
         Main.magnifier.setActive(activate);
@@ -40,7 +40,7 @@ var ShellMagnifier = class ShellMagnifier {
 
     /**
      * isActive:
-     * @return  Whether the magnifier is active (boolean).
+     * @returns {bool} Whether the magnifier is active.
      */
     isActive() {
         return Main.magnifier.isActive();
@@ -65,22 +65,25 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * createZoomRegion:
      * Create a new ZoomRegion and return its object path.
-     * @xMagFactor:     The power to set horizontal magnification of the
-     *                  ZoomRegion.  A value of 1.0 means no magnification.  A
-     *                  value of 2.0 doubles the size.
-     * @yMagFactor:     The power to set the vertical magnification of the
-     *                  ZoomRegion.
-     * @roi             Array of integers defining the region of the
-     *                  screen/desktop to magnify.  The array has the form
-     *                  [left, top, right, bottom].
-     * @viewPort        Array of integers, [left, top, right, bottom] that defines
-     *                  the position of the ZoomRegion on screen.
+     * @param {number} xMagFactor:
+     *     The power to set horizontal magnification of the ZoomRegion.
+     *     A value of 1.0 means no magnification. A value of 2.0 doubles
+     *     the size.
+     * @param {number} yMagFactor:
+     *     The power to set the vertical magnification of the
+     *     ZoomRegion.
+     * @param {number[]} roi
+     *     Array of integers defining the region of the screen/desktop
+     *     to magnify.  The array has the form [left, top, right, bottom].
+     * @param {number[]} viewPort
+     *     Array of integers, [left, top, right, bottom] that defines
+     *     the position of the ZoomRegion on screen.
      *
      * FIXME: The arguments here are redundant, since the width and height of
      *   the ROI are determined by the viewport and magnification factors.
      *   We ignore the passed in width and height.
      *
-     * @return          The newly created ZoomRegion.
+     * @returns {ZoomRegion} The newly created ZoomRegion.
      */
     createZoomRegion(xMagFactor, yMagFactor, roi, viewPort) {
         let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
@@ -100,7 +103,9 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * addZoomRegion:
      * Append the given ZoomRegion to the magnifier's list of ZoomRegions.
-     * @zoomerObjectPath:   The object path for the zoom region proxy.
+     * @param {string} zoomerObjectPath: The object path for the zoom
+     *     region proxy.
+     * @returns {bool} whether the region was added successfully
      */
     addZoomRegion(zoomerObjectPath) {
         let proxyAndZoomRegion = this._zoomers[zoomerObjectPath];
@@ -115,8 +120,8 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * getZoomRegions:
      * Return a list of ZoomRegion object paths for this Magnifier.
-     * @return:     The Magnifier's zoom region list as an array of DBus object
-     *              paths.
+     * @returns {string[]}: The Magnifier's zoom region list as an array
+     *     of DBus object paths.
      */
     getZoomRegions() {
         // There may be more ZoomRegions in the magnifier itself than have
@@ -125,7 +130,7 @@ var ShellMagnifier = class ShellMagnifier {
         let zoomRegions = Main.magnifier.getZoomRegions();
         let objectPaths = [];
         let thoseZoomers = this._zoomers;
-        zoomRegions.forEach (aZoomRegion => {
+        zoomRegions.forEach(aZoomRegion => {
             let found = false;
             for (let objectPath in thoseZoomers) {
                 let proxyAndZoomRegion = thoseZoomers[objectPath];
@@ -137,7 +142,7 @@ var ShellMagnifier = class ShellMagnifier {
             }
             if (!found) {
                 // Got a ZoomRegion with no DBus proxy, make one.
-                let newPath =  ZOOM_SERVICE_PATH + '/zoomer' + _zoomRegionInstanceCount;
+                let newPath = `${ZOOM_SERVICE_PATH}/zoomer${_zoomRegionInstanceCount}`;
                 _zoomRegionInstanceCount++;
                 let zoomRegionProxy = new ShellMagnifierZoomRegion(newPath, aZoomRegion);
                 let proxyAndZoomer = {};
@@ -169,7 +174,7 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * fullScreenCapable:
      * Consult if the Magnifier can magnify in full-screen mode.
-     * @return  Always return true.
+     * @returns {bool} Always return true.
      */
     fullScreenCapable() {
         return true;
@@ -178,7 +183,7 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * setCrosswireSize:
      * Set the crosswire size of all ZoomRegions.
-     * @size:   The thickness of each line in the cross wire.
+     * @param {number} size: The thickness of each line in the cross wire.
      */
     setCrosswireSize(size) {
         Main.magnifier.setCrosshairsThickness(size);
@@ -187,7 +192,7 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * getCrosswireSize:
      * Get the crosswire size of all ZoomRegions.
-     * @return:   The thickness of each line in the cross wire.
+     * @returns {number}: The thickness of each line in the cross wire.
      */
     getCrosswireSize() {
         return Main.magnifier.getCrosshairsThickness();
@@ -196,16 +201,16 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * setCrosswireLength:
      * Set the crosswire length of all zoom-regions..
-     * @size:   The length of each line in the cross wire.
+     * @param {number} length: The length of each line in the cross wire.
      */
     setCrosswireLength(length) {
         Main.magnifier.setCrosshairsLength(length);
     }
 
     /**
-     * setCrosswireSize:
-     * Set the crosswire size of all zoom-regions.
-     * @size:   The thickness of each line in the cross wire.
+     * getCrosswireSize:
+     * Get the crosswire length of all zoom-regions.
+     * @returns {number} size: The length of each line in the cross wire.
      */
     getCrosswireLength() {
         return Main.magnifier.getCrosshairsLength();
@@ -214,7 +219,7 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * setCrosswireClip:
      * Set if the crosswire will be clipped by the cursor image..
-     * @clip:   Flag to indicate whether to clip the crosswire.
+     * @param {bool} clip: Flag to indicate whether to clip the crosswire.
      */
     setCrosswireClip(clip) {
         Main.magnifier.setCrosshairsClip(clip);
@@ -223,7 +228,7 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * getCrosswireClip:
      * Get the crosswire clip value.
-     * @return:   Whether the crosswire is clipped by the cursor image.
+     * @returns {bool}: Whether the crosswire is clipped by the cursor image.
      */
     getCrosswireClip() {
         return Main.magnifier.getCrosshairsClip();
@@ -232,7 +237,7 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * setCrosswireColor:
      * Set the crosswire color of all ZoomRegions.
-     * @color:   Unsigned int of the form rrggbbaa.
+     * @param {number} color: Unsigned int of the form rrggbbaa.
      */
     setCrosswireColor(color) {
         Main.magnifier.setCrosshairsColor('#%08x'.format(color));
@@ -241,7 +246,8 @@ var ShellMagnifier = class ShellMagnifier {
     /**
      * getCrosswireClip:
      * Get the crosswire color of all ZoomRegions.
-     * @return:   The crosswire color as an unsigned int in the form rrggbbaa.
+     * @returns {number}: The crosswire color as an unsigned int in
+     *     the form rrggbbaa.
      */
     getCrosswireColor() {
         let colorString = Main.magnifier.getCrosshairsColor();
@@ -266,11 +272,11 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
 
     /**
      * setMagFactor:
-     * @xMagFactor:     The power to set the horizontal magnification factor to
-     *                  of the magnified view.  A value of 1.0 means no
-     *                  magnification.  A value of 2.0 doubles the size.
-     * @yMagFactor:     The power to set the vertical magnification factor to
-     *                  of the magnified view.
+     * @param {number} xMagFactor: The power to set the horizontal
+     *     magnification factor to of the magnified view. A value of
+     *     1.0 means no magnification. A value of 2.0 doubles the size.
+     * @param {number} yMagFactor: The power to set the vertical
+     *     magnification factor to of the magnified view.
      */
     setMagFactor(xMagFactor, yMagFactor) {
         this._zoomRegion.setMagFactor(xMagFactor, yMagFactor);
@@ -278,7 +284,7 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
 
     /**
      * getMagFactor:
-     * @return  an array, [xMagFactor, yMagFactor], containing the horizontal
+     * @returns {number[]}: [xMagFactor, yMagFactor], containing the horizontal
      *          and vertical magnification powers.  A value of 1.0 means no
      *          magnification.  A value of 2.0 means the contents are doubled
      *          in size, and so on.
@@ -290,9 +296,9 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
     /**
      * setRoi:
      * Sets the "region of interest" that the ZoomRegion is magnifying.
-     * @roi     Array, [left, top, right, bottom], defining the region of the
-     *          screen to magnify. The values are in screen (unmagnified)
-     *          coordinate space.
+     * @param {number[]} roi: [left, top, right, bottom], defining the
+     *     region of the screen to magnify.
+     *     The values are in screen (unmagnified) coordinate space.
      */
     setRoi(roi) {
         let roiObject = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
@@ -304,7 +310,7 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
      * Retrieves the "region of interest" -- the rectangular bounds of that part
      * of the desktop that the magnified view is showing (x, y, width, height).
      * The bounds are given in non-magnified coordinates.
-     * @return  an array, [left, top, right, bottom], representing the bounding
+     * @returns {Array}: [left, top, right, bottom], representing the bounding
      *          rectangle of what is shown in the magnified view.
      */
     getRoi() {
@@ -317,10 +323,11 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
     /**
      * Set the "region of interest" by centering the given screen coordinate
      * within the zoom region.
-     * @x       The x-coord of the point to place at the center of the zoom region.
-     * @y       The y-coord.
-     * @return  Whether the shift was successful (for GS-mag, this is always
-     *          true).
+     * @param {number} x: The x-coord of the point to place at the
+     *     center of the zoom region.
+     * @param {number} y: The y-coord.
+     * @returns {bool} Whether the shift was successful (for GS-mag, this
+     *     is always true).
      */
     shiftContentsTo(x, y) {
         this._zoomRegion.scrollContentsTo(x, y);
@@ -330,8 +337,8 @@ var ShellMagnifierZoomRegion = class ShellMagnifierZoomRegion {
     /**
      * moveResize
      * Sets the position and size of the ZoomRegion on screen.
-     * @viewPort    Array, [left, top, right, bottom], defining the position and
-     *              size on screen to place the zoom region.
+     * @param {number[]} viewPort: [left, top, right, bottom], defining
+     *     the position and size on screen to place the zoom region.
      */
     moveResize(viewPort) {
         let viewRect = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] };

js/ui/main.js

@@ -9,7 +9,6 @@
             initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */
 
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
 
 const AccessDialog = imports.ui.accessDialog;
 const AudioDeviceSelection = imports.ui.audioDeviceSelection;
@@ -190,7 +189,7 @@ function _initializeUI() {
 
     messageTray = new MessageTray.MessageTray();
     panel = new Panel.Panel();
-    keyboard = new Keyboard.Keyboard();
+    keyboard = new Keyboard.KeyboardManager();
     notificationDaemon = new NotificationDaemon.NotificationDaemon();
     windowAttentionHandler = new WindowAttentionHandler.WindowAttentionHandler();
     componentManager = new Components.ComponentManager();
@@ -200,12 +199,12 @@ function _initializeUI() {
     layoutManager.init();
     overview.init();
 
-    (new PointerA11yTimeout.PointerA11yTimeout());
+    new PointerA11yTimeout.PointerA11yTimeout();
 
     _a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA });
 
     global.display.connect('overlay-key', () => {
-        if (!_a11ySettings.get_boolean (STICKY_KEYS_ENABLE))
+        if (!_a11ySettings.get_boolean(STICKY_KEYS_ENABLE))
             overview.toggle();
     });
 
@@ -230,7 +229,11 @@ function _initializeUI() {
     EndSessionDialog.init();
 
     // We're ready for the session manager to move to the next phase
-    Meta.register_with_session();
+    GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
+        Shell.util_sd_notify();
+        Meta.register_with_session();
+        return GLib.SOURCE_REMOVE;
+    });
 
     _startDate = new Date();
 
@@ -245,20 +248,33 @@ function _initializeUI() {
     }
 
     layoutManager.connect('startup-complete', () => {
-        if (actionMode == Shell.ActionMode.NONE) {
+        if (actionMode == Shell.ActionMode.NONE)
             actionMode = Shell.ActionMode.NORMAL;
-        }
-        if (screenShield) {
+
+        if (screenShield)
             screenShield.lockIfWasLocked();
-        }
+
         if (sessionMode.currentMode != 'gdm' &&
             sessionMode.currentMode != 'initial-setup') {
             GLib.log_structured(LOG_DOMAIN, GLib.LogLevelFlags.LEVEL_MESSAGE, {
                 'MESSAGE': `GNOME Shell started at ${_startDate}`,
-                'MESSAGE_ID': GNOMESHELL_STARTED_MESSAGE_ID
+                'MESSAGE_ID': GNOMESHELL_STARTED_MESSAGE_ID,
             });
         }
 
+        let credentials = new Gio.Credentials();
+        if (credentials.get_unix_user() === 0) {
+            notify(_('Logged in as a privileged user'),
+                   _('Running a session as a privileged user should be avoided for security reasons. If possible, you should log in as a normal user.'));
+        }
+
+        if (sessionMode.currentMode !== 'gdm' &&
+            sessionMode.currentMode !== 'initial-setup' &&
+            screenShield === null) {
+            notify(_('Screen Lock disabled'),
+                   _('Screen Locking requires the GNOME display manager.'));
+        }
+
         LoginManager.registerSessionWithGDM();
 
         let perfModuleName = GLib.getenv("SHELL_PERF_MODULE");
@@ -273,19 +289,19 @@ function _initializeUI() {
 function _getStylesheet(name) {
     let stylesheet;
 
-    stylesheet = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/' + name);
+    stylesheet = Gio.File.new_for_uri(`resource:///org/gnome/shell/theme/${name}`);
     if (stylesheet.query_exists(null))
         return stylesheet;
 
     let dataDirs = GLib.get_system_data_dirs();
     for (let i = 0; i < dataDirs.length; i++) {
         let path = GLib.build_filenamev([dataDirs[i], 'gnome-shell', 'theme', name]);
-        let stylesheet = Gio.file_new_for_path(path);
+        stylesheet = Gio.file_new_for_path(path);
         if (stylesheet.query_exists(null))
             return stylesheet;
     }
 
-    stylesheet = Gio.File.new_for_path(global.datadir + '/theme/' + name);
+    stylesheet = Gio.File.new_for_path(`${global.datadir}/theme/${name}`);
     if (stylesheet.query_exists(null))
         return stylesheet;
 
@@ -321,7 +337,7 @@ function _loadDefaultStylesheet() {
  *
  * Get the theme CSS file that the shell will load
  *
- * Returns: A #GFile that contains the theme CSS,
+ * @returns {?Gio.File}: A #GFile that contains the theme CSS,
  *          null if using the default
  */
 function getThemeStylesheet() {
@@ -330,8 +346,8 @@ function getThemeStylesheet() {
 
 /**
  * setThemeStylesheet:
- * @cssStylesheet: A file path that contains the theme CSS,
- *                 set it to null to use the default
+ * @param {string=} cssStylesheet: A file path that contains the theme CSS,
+ *     set it to null to use the default
  *
  * Set the theme CSS file that the shell will load
  */
@@ -343,12 +359,12 @@ function reloadThemeResource() {
     if (_themeResource)
         _themeResource._unregister();
 
-    _themeResource = Gio.Resource.load(global.datadir + '/gnome-shell-theme.gresource');
+    _themeResource = Gio.Resource.load(`${global.datadir}/gnome-shell-theme.gresource`);
     _themeResource._register();
 }
 
 function _loadOskLayouts() {
-    _oskResource = Gio.Resource.load(global.datadir + '/gnome-shell-osk-layouts.gresource');
+    _oskResource = Gio.Resource.load(`${global.datadir}/gnome-shell-osk-layouts.gresource`);
     _oskResource._register();
 }
 
@@ -358,11 +374,13 @@ function _loadOskLayouts() {
  * Reloads the theme CSS file
  */
 function loadTheme() {
-    let themeContext = St.ThemeContext.get_for_stage (global.stage);
+    let themeContext = St.ThemeContext.get_for_stage(global.stage);
     let previousTheme = themeContext.get_theme();
 
-    let theme = new St.Theme ({ application_stylesheet: _cssStylesheet,
-                                default_stylesheet: _defaultCssStylesheet });
+    let theme = new St.Theme({
+        application_stylesheet: _cssStylesheet,
+        default_stylesheet: _defaultCssStylesheet,
+    });
 
     if (theme.default_stylesheet == null)
         throw new Error("No valid stylesheet found for '%s'".format(sessionMode.stylesheetName));
@@ -374,26 +392,26 @@ function loadTheme() {
             theme.load_stylesheet(customStylesheets[i]);
     }
 
-    themeContext.set_theme (theme);
+    themeContext.set_theme(theme);
 }
 
 /**
  * notify:
- * @msg: A message
- * @details: Additional information
+ * @param {string} msg: A message
+ * @param {string} details: Additional information
  */
 function notify(msg, details) {
     let source = new MessageTray.SystemNotificationSource();
     messageTray.add(source);
     let notification = new MessageTray.Notification(source, msg, details);
     notification.setTransient(true);
-    source.notify(notification);
+    source.showNotification(notification);
 }
 
 /**
  * notifyError:
- * @msg: An error message
- * @details: Additional information
+ * @param {string} msg: An error message
+ * @param {string} details: Additional information
  *
  * See shell_global_notify_problem().
  */
@@ -417,8 +435,8 @@ function _findModal(actor) {
 
 /**
  * pushModal:
- * @actor: #ClutterActor which will be given keyboard focus
- * @params: optional parameters
+ * @param {Clutter.Actor} actor: actor which will be given keyboard focus
+ * @param {Object=} params: optional parameters
  *
  * Ensure we are in a mode where all keyboard and mouse input goes to
  * the stage, and focus @actor. Multiple calls to this function act in
@@ -441,7 +459,7 @@ function _findModal(actor) {
  *                global keybindings; the default of NONE will filter
  *                out all keybindings
  *
- * Returns: true iff we successfully acquired a grab or already had one
+ * @returns {bool}: true iff we successfully acquired a grab or already had one
  */
 function pushModal(actor, params) {
     params = Params.parse(params, { timestamp: global.get_current_time(),
@@ -472,11 +490,11 @@ function pushModal(actor, params) {
                 modalActorFocusStack[index].prevFocus = null;
         });
     }
-    modalActorFocusStack.push({ actor: actor,
+    modalActorFocusStack.push({ actor,
                                 destroyId: actorDestroyId,
-                                prevFocus: prevFocus,
-                                prevFocusDestroyId: prevFocusDestroyId,
-                                actionMode: actionMode });
+                                prevFocus,
+                                prevFocusDestroyId,
+                                actionMode });
 
     actionMode = params.actionMode;
     global.stage.set_key_focus(actor);
@@ -485,8 +503,9 @@ function pushModal(actor, params) {
 
 /**
  * popModal:
- * @actor: #ClutterActor passed to original invocation of pushModal()
- * @timestamp: optional timestamp
+ * @param {Clutter.Actor} actor: the actor passed to original invocation
+ *     of pushModal()
+ * @param {number=} timestamp: optional timestamp
  *
  * Reverse the effect of pushModal(). If this invocation is undoing
  * the topmost invocation, then the focus will be restored to the
@@ -557,24 +576,24 @@ function popModal(actor, timestamp) {
 }
 
 function createLookingGlass() {
-    if (lookingGlass == null) {
+    if (lookingGlass == null)
         lookingGlass = new LookingGlass.LookingGlass();
-    }
+
     return lookingGlass;
 }
 
 function openRunDialog() {
-    if (runDialog == null) {
+    if (runDialog == null)
         runDialog = new RunDialog.RunDialog();
-    }
+
     runDialog.open();
 }
 
 /**
  * activateWindow:
- * @window: the Meta.Window to activate
- * @time: (optional) current event time
- * @workspaceNum: (optional) window's workspace number
+ * @param {Meta.Window} window: the window to activate
+ * @param {number=} time: current event time
+ * @param {number=} workspaceNum:  window's workspace number
  *
  * Activates @window, switching to its workspace first if necessary,
  * and switching out of the overview if it's currently active
@@ -582,7 +601,7 @@ function openRunDialog() {
 function activateWindow(window, time, workspaceNum) {
     let workspaceManager = global.workspace_manager;
     let activeWorkspaceNum = workspaceManager.get_active_workspace_index();
-    let windowWorkspaceNum = (workspaceNum !== undefined) ? workspaceNum : window.get_workspace().index();
+    let windowWorkspaceNum = workspaceNum !== undefined ? workspaceNum : window.get_workspace().index();
 
     if (!time)
         time = global.get_current_time();
@@ -620,7 +639,7 @@ function _runDeferredWork(workId) {
     _deferredWorkQueue.splice(index, 1);
     _deferredWorkData[workId].callback();
     if (_deferredWorkQueue.length == 0 && _deferredTimeoutId > 0) {
-        Mainloop.source_remove(_deferredTimeoutId);
+        GLib.source_remove(_deferredTimeoutId);
         _deferredTimeoutId = 0;
     }
 }
@@ -650,8 +669,8 @@ function _queueBeforeRedraw(workId) {
 
 /**
  * initializeDeferredWork:
- * @actor: A #ClutterActor
- * @callback: Function to invoke to perform work
+ * @param {Clutter.Actor} actor: an actor
+ * @param {callback} callback: Function to invoke to perform work
  *
  * This function sets up a callback to be invoked when either the
  * given actor is mapped, or after some period of time when the machine
@@ -664,13 +683,13 @@ function _queueBeforeRedraw(workId) {
  * initialization as well, under the assumption that new actors
  * will need it.
  *
- * Returns: A string work identifier
+ * @returns {string}: A string work identifier
  */
 function initializeDeferredWork(actor, callback) {
     // Turn into a string so we can use as an object property
-    let workId = `${(++_deferredWorkSequence)}`;
-    _deferredWorkData[workId] = { 'actor': actor,
-                                  'callback': callback };
+    let workId = `${++_deferredWorkSequence}`;
+    _deferredWorkData[workId] = { actor,
+                                  callback };
     actor.connect('notify::mapped', () => {
         if (!(actor.mapped && _deferredWorkQueue.includes(workId)))
             return;
@@ -688,7 +707,7 @@ function initializeDeferredWork(actor, callback) {
 
 /**
  * queueDeferredWork:
- * @workId: work identifier
+ * @param {string} workId: work identifier
  *
  * Ensure that the work identified by @workId will be
  * run on map or timeout. You should call this function
@@ -706,9 +725,8 @@ function queueDeferredWork(workId) {
         _deferredWorkQueue.push(workId);
     if (data.actor.mapped) {
         _queueBeforeRedraw(workId);
-        return;
     } else if (_deferredTimeoutId == 0) {
-        _deferredTimeoutId = Mainloop.timeout_add_seconds(DEFERRED_TIMEOUT_SECONDS, () => {
+        _deferredTimeoutId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, DEFERRED_TIMEOUT_SECONDS, () => {
             _runAllDeferredWork();
             _deferredTimeoutId = 0;
             return GLib.SOURCE_REMOVE;
@@ -725,12 +743,13 @@ class RestartMessage extends ModalDialog.ModalDialog {
                       shouldFadeIn: false,
                       destroyOnClose: true });
 
-        let label = new St.Label({ text: message });
+        let label = new St.Label({
+            text: message,
+            x_align: Clutter.ActorAlign.CENTER,
+            y_align: Clutter.ActorAlign.CENTER,
+        });
 
-        this.contentLayout.add(label, { x_fill: false,
-                                        y_fill: false,
-                                        x_align: St.Align.MIDDLE,
-                                        y_align: St.Align.MIDDLE });
+        this.contentLayout.add_child(label);
         this.buttonLayout.hide();
     }
 });

js/ui/messageList.js

@@ -1,7 +1,8 @@
-const { Atk, Clutter, Gio, GLib, GObject, Meta, Pango, St } = imports.gi;
+/* exported MessageListSection */
+const { Atk, Clutter, Gio, GLib,
+        GObject, Graphene, Meta, Pango, St } = imports.gi;
 const Main = imports.ui.main;
 const MessageTray = imports.ui.messageTray;
-const Signals = imports.signals;
 
 const Calendar = imports.ui.calendar;
 const Util = imports.misc.util;
@@ -31,13 +32,18 @@ function _fixMarkup(text, allowMarkup) {
     return GLib.markup_escape_text(text, -1);
 }
 
-var URLHighlighter = class URLHighlighter {
-    constructor(text = '', lineWrap, allowMarkup) {
-        this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter',
-                                    x_expand: true, x_align: Clutter.ActorAlign.START });
+var URLHighlighter = GObject.registerClass(
+class URLHighlighter extends St.Label {
+    _init(text = '', lineWrap, allowMarkup) {
+        super._init({
+            reactive: true,
+            style_class: 'url-highlighter',
+            x_expand: true,
+            x_align: Clutter.ActorAlign.START,
+        });
         this._linkColor = '#ccccff';
-        this.actor.connect('style-changed', () => {
-            let [hasColor, color] = this.actor.get_theme_node().lookup_color('link-color', false);
+        this.connect('style-changed', () => {
+            let [hasColor, color] = this.get_theme_node().lookup_color('link-color', false);
             if (hasColor) {
                 let linkColor = color.to_string().substr(0, 7);
                 if (linkColor != this._linkColor) {
@@ -46,70 +52,75 @@ var URLHighlighter = class URLHighlighter {
                 }
             }
         });
-        this.actor.clutter_text.line_wrap = lineWrap;
-        this.actor.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR;
+        this.clutter_text.line_wrap = lineWrap;
+        this.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR;
 
         this.setMarkup(text, allowMarkup);
-        this.actor.connect('button-press-event', (actor, event) => {
-            // Don't try to URL highlight when invisible.
-            // The MessageTray doesn't actually hide us, so
-            // we need to check for paint opacities as well.
-            if (!actor.visible || actor.get_paint_opacity() == 0)
-                return Clutter.EVENT_PROPAGATE;
+    }
 
-            // Keep Notification.actor from seeing this and taking
-            // a pointer grab, which would block our button-release-event
-            // handler, if an URL is clicked
-            return this._findUrlAtPos(event) != -1;
-        });
-        this.actor.connect('button-release-event', (actor, event) => {
-            if (!actor.visible || actor.get_paint_opacity() == 0)
-                return Clutter.EVENT_PROPAGATE;
-
-            let urlId = this._findUrlAtPos(event);
-            if (urlId != -1) {
-                let url = this._urls[urlId].url;
-                if (!url.includes(':'))
-                    url = 'http://' + url;
-
-                Gio.app_info_launch_default_for_uri(url, global.create_app_launch_context(0, -1));
-                return Clutter.EVENT_STOP;
-            }
+    vfunc_button_press_event(buttonEvent) {
+        // Don't try to URL highlight when invisible.
+        // The MessageTray doesn't actually hide us, so
+        // we need to check for paint opacities as well.
+        if (!this.visible || this.get_paint_opacity() == 0)
             return Clutter.EVENT_PROPAGATE;
-        });
-        this.actor.connect('motion-event', (actor, event) => {
-            if (!actor.visible || actor.get_paint_opacity() == 0)
-                return Clutter.EVENT_PROPAGATE;
 
-            let urlId = this._findUrlAtPos(event);
-            if (urlId != -1 && !this._cursorChanged) {
-                global.display.set_cursor(Meta.Cursor.POINTING_HAND);
-                this._cursorChanged = true;
-            } else if (urlId == -1) {
-                global.display.set_cursor(Meta.Cursor.DEFAULT);
-                this._cursorChanged = false;
-            }
-            return Clutter.EVENT_PROPAGATE;
-        });
-        this.actor.connect('leave-event', () => {
-            if (!this.actor.visible || this.actor.get_paint_opacity() == 0)
-                return Clutter.EVENT_PROPAGATE;
+        // Keep Notification from seeing this and taking
+        // a pointer grab, which would block our button-release-event
+        // handler, if an URL is clicked
+        return this._findUrlAtPos(buttonEvent) != -1;
+    }
 
-            if (this._cursorChanged) {
-                this._cursorChanged = false;
-                global.display.set_cursor(Meta.Cursor.DEFAULT);
-            }
+    vfunc_button_release_event(buttonEvent) {
+        if (!this.visible || this.get_paint_opacity() == 0)
             return Clutter.EVENT_PROPAGATE;
-        });
+
+        let urlId = this._findUrlAtPos(buttonEvent);
+        if (urlId != -1) {
+            let url = this._urls[urlId].url;
+            if (!url.includes(':'))
+                url = `http://${url}`;
+
+            Gio.app_info_launch_default_for_uri(
+                url, global.create_app_launch_context(0, -1));
+            return Clutter.EVENT_STOP;
+        }
+        return Clutter.EVENT_PROPAGATE;
+    }
+
+    vfunc_motion_event(motionEvent) {
+        if (!this.visible || this.get_paint_opacity() == 0)
+            return Clutter.EVENT_PROPAGATE;
+
+        let urlId = this._findUrlAtPos(motionEvent);
+        if (urlId != -1 && !this._cursorChanged) {
+            global.display.set_cursor(Meta.Cursor.POINTING_HAND);
+            this._cursorChanged = true;
+        } else if (urlId == -1) {
+            global.display.set_cursor(Meta.Cursor.DEFAULT);
+            this._cursorChanged = false;
+        }
+        return Clutter.EVENT_PROPAGATE;
+    }
+
+    vfunc_leave_event(crossingEvent) {
+        if (!this.visible || this.get_paint_opacity() == 0)
+            return Clutter.EVENT_PROPAGATE;
+
+        if (this._cursorChanged) {
+            this._cursorChanged = false;
+            global.display.set_cursor(Meta.Cursor.DEFAULT);
+        }
+        return super.vfunc_leave_event(crossingEvent);
     }
 
     setMarkup(text, allowMarkup) {
         text = text ? _fixMarkup(text, allowMarkup) : '';
         this._text = text;
 
-        this.actor.clutter_text.set_markup(text);
+        this.clutter_text.set_markup(text);
         /* clutter_text.text contain text without markup */
-        this._urls = Util.findUrls(this.actor.clutter_text.text);
+        this._urls = Util.findUrls(this.clutter_text.text);
         this._highlightUrls();
     }
 
@@ -121,33 +132,33 @@ var URLHighlighter = class URLHighlighter {
         for (let i = 0; i < urls.length; i++) {
             let url = urls[i];
             let str = this._text.substr(pos, url.pos - pos);
-            markup += str + '<span foreground="' + this._linkColor + '"><u>' + url.url + '</u></span>';
+            markup += `${str}<span foreground="${this._linkColor}"><u>${url.url}</u></span>`;
             pos = url.pos + url.url.length;
         }
         markup += this._text.substr(pos);
-        this.actor.clutter_text.set_markup(markup);
+        this.clutter_text.set_markup(markup);
     }
 
     _findUrlAtPos(event) {
-        let success_;
-        let [x, y] = event.get_coords();
-        [success_, x, y] = this.actor.transform_stage_point(x, y);
+        let { x, y } = event;
+        [, x, y] = this.transform_stage_point(x, y);
         let findPos = -1;
-        for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
-            let [success_, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
+        for (let i = 0; i < this.clutter_text.text.length; i++) {
+            let [, px, py, lineHeight] = this.clutter_text.position_to_coords(i);
             if (py > y || py + lineHeight < y || x < px)
                 continue;
             findPos = i;
         }
         if (findPos != -1) {
-            for (let i = 0; i < this._urls.length; i++)
+            for (let i = 0; i < this._urls.length; i++) {
                 if (findPos >= this._urls[i].pos &&
                     this._urls[i].pos + this._urls[i].url.length > findPos)
                     return i;
+            }
         }
         return -1;
     }
-};
+});
 
 var ScaleLayout = GObject.registerClass(
 class ScaleLayout extends Clutter.BinLayout {
@@ -160,20 +171,22 @@ class ScaleLayout extends Clutter.BinLayout {
         if (this._container == container)
             return;
 
-        if (this._container)
+        if (this._container) {
             for (let id of this._signals)
                 this._container.disconnect(id);
+        }
 
         this._container = container;
         this._signals = [];
 
-        if (this._container)
+        if (this._container) {
             for (let signal of ['notify::scale-x', 'notify::scale-y']) {
                 let id = this._container.connect(signal, () => {
                     this.layout_changed();
                 });
                 this._signals.push(id);
             }
+        }
     }
 
     vfunc_get_preferred_width(container, forHeight) {
@@ -200,7 +213,7 @@ var LabelExpanderLayout = GObject.registerClass({
                                               'Expansion of the layout, between 0 (collapsed) ' +
                                               'and 1 (fully expanded',
                                               GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                              0, 1, 0)
+                                              0, 1, 0),
     },
 }, class LabelExpanderLayout extends Clutter.LayoutManager {
     _init(params) {
@@ -222,7 +235,7 @@ var LabelExpanderLayout = GObject.registerClass({
 
         let visibleIndex = this._expansion > 0 ? 1 : 0;
         for (let i = 0; this._container && i < this._container.get_n_children(); i++)
-            this._container.get_child_at_index(i).visible = (i == visibleIndex);
+            this._container.get_child_at_index(i).visible = i == visibleIndex;
 
         this.layout_changed();
     }
@@ -283,21 +296,31 @@ var LabelExpanderLayout = GObject.registerClass({
     }
 });
 
-var Message = class Message {
-    constructor(title, body) {
-        this.expanded = false;
 
+var Message = GObject.registerClass({
+    Signals: {
+        'close': {},
+        'expanded': {},
+        'unexpanded': {},
+    },
+}, class Message extends St.Button {
+    _init(title, body) {
+        super._init({
+            style_class: 'message',
+            accessible_role: Atk.Role.NOTIFICATION,
+            can_focus: true,
+            x_expand: true,
+            y_expand: true,
+        });
+
+        this.expanded = false;
         this._useBodyMarkup = false;
 
-        this.actor = new St.Button({ style_class: 'message',
-                                     accessible_role: Atk.Role.NOTIFICATION,
-                                     can_focus: true,
-                                     x_expand: true, x_fill: true });
-        this.actor.connect('key-press-event',
-                           this._onKeyPressed.bind(this));
-
-        let vbox = new St.BoxLayout({ vertical: true });
-        this.actor.set_child(vbox);
+        let vbox = new St.BoxLayout({
+            vertical: true,
+            x_expand: true,
+        });
+        this.set_child(vbox);
 
         let hbox = new St.BoxLayout();
         vbox.add_actor(hbox);
@@ -308,7 +331,7 @@ var Message = class Message {
 
         this._iconBin = new St.Bin({ style_class: 'message-icon-bin',
                                      y_expand: true,
-                                     y_align: St.Align.START,
+                                     y_align: Clutter.ActorAlign.START,
                                      visible: false });
         hbox.add_actor(this._iconBin);
 
@@ -326,14 +349,18 @@ var Message = class Message {
         this.setTitle(title);
         titleBox.add_actor(this.titleLabel);
 
-        this._secondaryBin = new St.Bin({ style_class: 'message-secondary-bin',
-                                          x_expand: true, y_expand: true,
-                                          x_fill: true, y_fill: true });
+        this._secondaryBin = new St.Bin({
+            style_class: 'message-secondary-bin',
+            x_expand: true, y_expand: true,
+        });
         titleBox.add_actor(this._secondaryBin);
 
         let closeIcon = new St.Icon({ icon_name: 'window-close-symbolic',
                                       icon_size: 16 });
-        this._closeButton = new St.Button({ child: closeIcon, opacity: 0 });
+        this._closeButton = new St.Button({
+            style_class: 'message-close-button',
+            child: closeIcon, opacity: 0,
+        });
         titleBox.add_actor(this._closeButton);
 
         this._bodyStack = new St.Widget({ x_expand: true });
@@ -341,15 +368,14 @@ var Message = class Message {
         contentBox.add_actor(this._bodyStack);
 
         this.bodyLabel = new URLHighlighter('', false, this._useBodyMarkup);
-        this.bodyLabel.actor.add_style_class_name('message-body');
-        this._bodyStack.add_actor(this.bodyLabel.actor);
+        this.bodyLabel.add_style_class_name('message-body');
+        this._bodyStack.add_actor(this.bodyLabel);
         this.setBody(body);
 
         this._closeButton.connect('clicked', this.close.bind(this));
-        let actorHoverId = this.actor.connect('notify::hover', this._sync.bind(this));
-        this._closeButton.connect('destroy', this.actor.disconnect.bind(this.actor, actorHoverId));
-        this.actor.connect('clicked', this._onClicked.bind(this));
-        this.actor.connect('destroy', this._onDestroy.bind(this));
+        let actorHoverId = this.connect('notify::hover', this._sync.bind(this));
+        this._closeButton.connect('destroy', this.disconnect.bind(this, actorHoverId));
+        this.connect('destroy', this._onDestroy.bind(this));
         this._sync();
     }
 
@@ -359,7 +385,7 @@ var Message = class Message {
 
     setIcon(actor) {
         this._iconBin.child = actor;
-        this._iconBin.visible = (actor != null);
+        this._iconBin.visible = actor != null;
     }
 
     setSecondaryActor(actor) {
@@ -430,12 +456,12 @@ var Message = class Message {
     expand(animate) {
         this.expanded = true;
 
-        this._actionBin.visible = (this._actionBin.get_n_children() > 0);
+        this._actionBin.visible = this._actionBin.get_n_children() > 0;
 
         if (this._bodyStack.get_n_children() < 2) {
             this._expandedLabel = new URLHighlighter(this._bodyText,
                                                      true, this._useBodyMarkup);
-            this.setExpandedBody(this._expandedLabel.actor);
+            this.setExpandedBody(this._expandedLabel);
         }
 
         if (animate) {
@@ -448,7 +474,7 @@ var Message = class Message {
             this._actionBin.ease({
                 scale_y: 1,
                 duration: MessageTray.ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
         } else {
             this._bodyStack.layout_manager.expansion = 1;
@@ -472,7 +498,7 @@ var Message = class Message {
                 onComplete: () => {
                     this._actionBin.hide();
                     this.expanded = false;
-                }
+                },
             });
         } else {
             this._bodyStack.layout_manager.expansion = 0;
@@ -488,19 +514,16 @@ var Message = class Message {
     }
 
     _sync() {
-        let visible = this.actor.hover && this.canClose();
+        let visible = this.hover && this.canClose();
         this._closeButton.opacity = visible ? 255 : 0;
         this._closeButton.reactive = visible;
     }
 
-    _onClicked() {
-    }
-
     _onDestroy() {
     }
 
-    _onKeyPressed(a, event) {
-        let keysym = event.get_key_symbol();
+    vfunc_key_press_event(keyEvent) {
+        let keysym = keyEvent.keyval;
 
         if (keysym == Clutter.KEY_Delete ||
             keysym == Clutter.KEY_KP_Delete) {
@@ -509,37 +532,66 @@ var Message = class Message {
         }
         return Clutter.EVENT_PROPAGATE;
     }
-};
-Signals.addSignalMethods(Message.prototype);
+});
 
-var MessageListSection = class MessageListSection {
-    constructor() {
-        this.actor = new St.BoxLayout({ style_class: 'message-list-section',
-                                        clip_to_allocation: true,
-                                        x_expand: true, vertical: true });
+var MessageListSection = GObject.registerClass({
+    Properties: {
+        'can-clear': GObject.ParamSpec.boolean(
+            'can-clear', 'can-clear', 'can-clear',
+            GObject.ParamFlags.READABLE,
+            false),
+        'empty': GObject.ParamSpec.boolean(
+            'empty', 'empty', 'empty',
+            GObject.ParamFlags.READABLE,
+            true),
+    },
+    Signals: {
+        'can-clear-changed': {},
+        'empty-changed': {},
+        'message-focused': { param_types: [Message.$gtype] },
+    },
+}, class MessageListSection extends St.BoxLayout {
+    _init() {
+        super._init({
+            style_class: 'message-list-section',
+            clip_to_allocation: true,
+            vertical: true,
+            x_expand: true,
+        });
 
         this._list = new St.BoxLayout({ style_class: 'message-list-section-list',
                                         vertical: true });
-        this.actor.add_actor(this._list);
+        this.add_actor(this._list);
 
         this._list.connect('actor-added', this._sync.bind(this));
         this._list.connect('actor-removed', this._sync.bind(this));
 
         let id = Main.sessionMode.connect('updated',
                                           this._sync.bind(this));
-        this.actor.connect('destroy', () => {
+        this.connect('destroy', () => {
             Main.sessionMode.disconnect(id);
         });
 
-        this._messages = new Map();
         this._date = new Date();
-        this.empty = true;
-        this.canClear = false;
+        this._empty = true;
+        this._canClear = false;
         this._sync();
     }
 
-    _onKeyFocusIn(actor) {
-        this.emit('key-focus-in', actor);
+    get empty() {
+        return this._empty;
+    }
+
+    get canClear() {
+        return this._canClear;
+    }
+
+    get _messages() {
+        return this._list.get_children().map(i => i.child);
+    }
+
+    _onKeyFocusIn(messageActor) {
+        this.emit('message-focused', messageActor);
     }
 
     get allowed() {
@@ -558,94 +610,94 @@ var MessageListSection = class MessageListSection {
     }
 
     addMessageAtIndex(message, index, animate) {
-        let obj = {
-            container: null,
-            destroyId: 0,
-            keyFocusId: 0,
-            closeId: 0
-        };
-        let pivot = new Clutter.Point({ x: .5, y: .5 });
-        let scale = animate ? 0 : 1;
-        obj.container = new St.Widget({ layout_manager: new ScaleLayout(),
-                                        pivot_point: pivot,
-                                        scale_x: scale, scale_y: scale });
-        obj.keyFocusId = message.actor.connect('key-focus-in',
-            this._onKeyFocusIn.bind(this));
-        obj.destroyId = message.actor.connect('destroy', () => {
-            this.removeMessage(message, false);
+        if (this._messages.includes(message))
+            throw new Error('Message was already added previously');
+
+        let listItem = new St.Bin({
+            child: message,
+            layout_manager: new ScaleLayout(),
+            pivot_point: new Graphene.Point({ x: .5, y: .5 }),
         });
-        obj.closeId = message.connect('close', () => {
+        listItem._connectionsIds = [];
+
+        listItem._connectionsIds.push(message.connect('key-focus-in',
+            this._onKeyFocusIn.bind(this)));
+        listItem._connectionsIds.push(message.connect('close', () => {
             this.removeMessage(message, true);
-        });
+        }));
+        listItem._connectionsIds.push(message.connect('destroy', () => {
+            listItem._connectionsIds.forEach(id => message.disconnect(id));
+            listItem.destroy();
+        }));
 
-        this._messages.set(message, obj);
-        obj.container.add_actor(message.actor);
+        this._list.insert_child_at_index(listItem, index);
 
-        this._list.insert_child_at_index(obj.container, index);
-
-        if (animate)
-            obj.container.ease({
+        if (animate) {
+            listItem.set({ scale_x: 0, scale_y: 0 });
+            listItem.ease({
                 scale_x: 1,
                 scale_y: 1,
                 duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
+        }
     }
 
     moveMessage(message, index, animate) {
-        let obj = this._messages.get(message);
+        if (!this._messages.includes(message))
+            throw new Error(`Impossible to move untracked message`);
+
+        let listItem = message.get_parent();
 
         if (!animate) {
-            this._list.set_child_at_index(obj.container, index);
+            this._list.set_child_at_index(listItem, index);
             return;
         }
 
         let onComplete = () => {
-            this._list.set_child_at_index(obj.container, index);
-            obj.container.ease({
+            this._list.set_child_at_index(listItem, index);
+            listItem.ease({
                 scale_x: 1,
                 scale_y: 1,
                 duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
         };
-        obj.container.ease({
+        listItem.ease({
             scale_x: 0,
             scale_y: 0,
             duration: MESSAGE_ANIMATION_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete
+            onComplete,
         });
     }
 
     removeMessage(message, animate) {
-        let obj = this._messages.get(message);
+        if (!this._messages.includes(message))
+            throw new Error(`Impossible to remove untracked message`);
 
-        message.actor.disconnect(obj.destroyId);
-        message.actor.disconnect(obj.keyFocusId);
-        message.disconnect(obj.closeId);
-
-        this._messages.delete(message);
+        let listItem = message.get_parent();
+        listItem._connectionsIds.forEach(id => message.disconnect(id));
 
         if (animate) {
-            obj.container.ease({
+            listItem.ease({
                 scale_x: 0,
                 scale_y: 0,
                 duration: MESSAGE_ANIMATION_TIME,
                 mode: Clutter.AnimationMode.EASE_OUT_QUAD,
                 onComplete: () => {
-                    obj.container.destroy();
+                    listItem.destroy();
                     global.sync_pointer();
-                }
+                },
             });
         } else {
-            obj.container.destroy();
+            listItem.destroy();
             global.sync_pointer();
         }
     }
 
     clear() {
-        let messages = [...this._messages.keys()].filter(msg => msg.canClose());
+        let messages = this._messages.filter(msg => msg.canClose());
 
         // If there are few messages, letting them all zoom out looks OK
         if (messages.length < 2) {
@@ -658,46 +710,37 @@ var MessageListSection = class MessageListSection {
             let delay = MESSAGE_ANIMATION_TIME / Math.max(messages.length, 5);
             for (let i = 0; i < messages.length; i++) {
                 let message = messages[i];
-                let obj = this._messages.get(message);
-                obj.container.ease({
-                    anchor_x: this._list.width,
+                message.get_parent().ease({
+                    translation_x: this._list.width,
                     opacity: 0,
                     duration: MESSAGE_ANIMATION_TIME,
                     delay: i * delay,
                     mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete: () => message.close()
+                    onComplete: () => message.close(),
                 });
             }
         }
     }
 
-    _canClear() {
-        for (let message of this._messages.keys())
-            if (message.canClose())
-                return true;
-        return false;
-    }
-
     _shouldShow() {
         return !this.empty;
     }
 
     _sync() {
-        let empty = this._list.get_n_children() == 0;
-        let changed = this.empty !== empty;
-        this.empty = empty;
+        let messages = this._messages;
+        let empty = messages.length == 0;
 
-        if (changed)
-            this.emit('empty-changed');
+        if (this._empty != empty) {
+            this._empty = empty;
+            this.notify('empty');
+        }
 
-        let canClear = this._canClear();
-        changed = this.canClear !== canClear;
-        this.canClear = canClear;
+        let canClear = messages.some(m => m.canClose());
+        if (this._canClear != canClear) {
+            this._canClear = canClear;
+            this.notify('can-clear');
+        }
 
-        if (changed)
-            this.emit('can-clear-changed');
-
-        this.actor.visible = this.allowed && this._shouldShow();
+        this.visible = this.allowed && this._shouldShow();
     }
-};
-Signals.addSignalMethods(MessageListSection.prototype);
+});

js/ui/messageTray.js

@@ -4,8 +4,6 @@
    SystemNotificationSource, MessageTray */
 
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
-const Signals = imports.signals;
 
 const Calendar = imports.ui.calendar;
 const GnomeSession = imports.misc.gnomeSession;
@@ -35,7 +33,7 @@ var State = {
     HIDDEN:  0,
     SHOWING: 1,
     SHOWN:   2,
-    HIDING:  3
+    HIDING:  3,
 };
 
 // These reasons are useful when we destroy the notifications received through
@@ -49,7 +47,7 @@ var NotificationDestroyedReason = {
     EXPIRED: 1,
     DISMISSED: 2,
     SOURCE_CLOSED: 3,
-    REPLACED: 4
+    REPLACED: 4,
 };
 
 // Message tray has its custom Urgency enumeration. LOW, NORMAL and CRITICAL
@@ -60,7 +58,7 @@ var Urgency = {
     LOW: 0,
     NORMAL: 1,
     HIGH: 2,
-    CRITICAL: 3
+    CRITICAL: 3,
 };
 
 // The privacy of the details of a notification. USER is for notifications which
@@ -135,70 +133,82 @@ var FocusGrabber = class FocusGrabber {
 // source, such as whether to play sound or honour the critical bit.
 //
 // A notification without a policy object will inherit the default one.
-var NotificationPolicy = class NotificationPolicy {
-    constructor(params) {
-        params = Params.parse(params, { enable: true,
-                                        enableSound: true,
-                                        showBanners: true,
-                                        forceExpanded: false,
-                                        showInLockScreen: true,
-                                        detailsInLockScreen: false
-                                      });
-        Object.getOwnPropertyNames(params).forEach(key => {
-            let desc = Object.getOwnPropertyDescriptor(params, key);
-            Object.defineProperty(this, `_${key}`, desc);
-        });
-    }
-
+var NotificationPolicy = GObject.registerClass({
+    Properties: {
+        'enable': GObject.ParamSpec.boolean(
+            'enable', 'enable', 'enable',
+            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
+            true),
+        'enable-sound': GObject.ParamSpec.boolean(
+            'enable-sound', 'enable-sound', 'enable-sound',
+            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
+            true),
+        'show-banners': GObject.ParamSpec.boolean(
+            'show-banners', 'show-banners', 'show-banners',
+            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
+            true),
+        'force-expanded': GObject.ParamSpec.boolean(
+            'force-expanded', 'force-expanded', 'force-expanded',
+            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
+            false),
+        'show-in-lock-screen': GObject.ParamSpec.boolean(
+            'show-in-lock-screen', 'show-in-lock-screen', 'show-in-lock-screen',
+            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
+            false),
+        'details-in-lock-screen': GObject.ParamSpec.boolean(
+            'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen',
+            GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
+            false),
+    },
+}, class NotificationPolicy extends GObject.Object {
     // Do nothing for the default policy. These methods are only useful for the
     // GSettings policy.
     store() { }
-    destroy() { }
 
-    get enable() {
-        return this._enable;
+    destroy() {
+        this.run_dispose();
     }
 
     get enableSound() {
-        return this._enableSound;
+        return this.enable_sound;
     }
 
     get showBanners() {
-        return this._showBanners;
+        return this.show_banners;
     }
 
     get forceExpanded() {
-        return this._forceExpanded;
+        return this.force_expanded;
     }
 
     get showInLockScreen() {
-        return this._showInLockScreen;
+        return this.show_in_lock_screen;
     }
 
     get detailsInLockScreen() {
-        return this._detailsInLockScreen;
+        return this.details_in_lock_screen;
     }
-};
-Signals.addSignalMethods(NotificationPolicy.prototype);
+});
 
-var NotificationGenericPolicy =
-class NotificationGenericPolicy extends NotificationPolicy {
-    constructor() {
-        super();
+var NotificationGenericPolicy = GObject.registerClass({
+}, class NotificationGenericPolicy extends NotificationPolicy {
+    _init() {
+        super._init();
         this.id = 'generic';
 
         this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' });
         this._masterSettings.connect('changed', this._changed.bind(this));
     }
 
-    store() { }
-
     destroy() {
         this._masterSettings.run_dispose();
+
+        super.destroy();
     }
 
     _changed(settings, key) {
-        this.emit('policy-changed', key);
+        if (this.constructor.find_property(key))
+            this.notify(key);
     }
 
     get showBanners() {
@@ -208,12 +218,12 @@ class NotificationGenericPolicy extends NotificationPolicy {
     get showInLockScreen() {
         return this._masterSettings.get_boolean('show-in-lock-screen');
     }
-};
+});
 
-var NotificationApplicationPolicy =
-class NotificationApplicationPolicy extends NotificationPolicy {
-    constructor(id) {
-        super();
+var NotificationApplicationPolicy = GObject.registerClass({
+}, class NotificationApplicationPolicy extends NotificationPolicy {
+    _init(id) {
+        super._init();
 
         this.id = id;
         this._canonicalId = this._canonicalizeId(id);
@@ -239,12 +249,13 @@ class NotificationApplicationPolicy extends NotificationPolicy {
     destroy() {
         this._masterSettings.run_dispose();
         this._settings.run_dispose();
+
+        super.destroy();
     }
 
     _changed(settings, key) {
-        this.emit('policy-changed', key);
-        if (key == 'enable')
-            this.emit('enable-changed');
+        if (this.constructor.find_property(key))
+            this.notify(key);
     }
 
     _canonicalizeId(id) {
@@ -278,7 +289,7 @@ class NotificationApplicationPolicy extends NotificationPolicy {
     get detailsInLockScreen() {
         return this._settings.get_boolean('details-in-lock-screen');
     }
-};
+});
 
 // Notification:
 // @source: the notification's Source
@@ -334,13 +345,26 @@ class NotificationApplicationPolicy extends NotificationPolicy {
 // event sound is played when the notification is shown (if the policy for
 // @source allows playing sounds).
 //
-// [1] https://developer.gnome.org/notification-spec/#markup 
-var Notification = class Notification {
-    constructor(source, title, banner, params) {
+// [1] https://developer.gnome.org/notification-spec/#markup
+var Notification = GObject.registerClass({
+    Properties: {
+        'acknowledged': GObject.ParamSpec.boolean(
+            'acknowledged', 'acknowledged', 'acknowledged',
+            GObject.ParamFlags.READWRITE,
+            false),
+    },
+    Signals: {
+        'activated': {},
+        'destroy': { param_types: [GObject.TYPE_UINT] },
+        'updated': { param_types: [GObject.TYPE_BOOLEAN] },
+    },
+}, class Notification extends GObject.Object {
+    _init(source, title, banner, params) {
+        super._init();
+
         this.source = source;
         this.title = title;
         this.urgency = Urgency.NORMAL;
-        this.resident = false;
         // 'transient' is a reserved keyword in JS, so we have to use an alternate variable name
         this.isTransient = false;
         this.privacyScope = PrivacyScope.USER;
@@ -352,6 +376,7 @@ var Notification = class Notification {
         this._soundFile = null;
         this._soundPlayed = false;
         this.actions = [];
+        this.setResident(false);
 
         // If called with only one argument we assume the caller
         // will call .update() later on. This is the case of
@@ -410,7 +435,7 @@ var Notification = class Notification {
     // @label: the label for the action's button
     // @callback: the callback for the action
     addAction(label, callback) {
-        this.actions.push({ label: label, callback: callback });
+        this.actions.push({ label, callback });
     }
 
     get acknowledged() {
@@ -421,7 +446,7 @@ var Notification = class Notification {
         if (this._acknowledged == v)
             return;
         this._acknowledged = v;
-        this.emit('acknowledged-changed');
+        this.notify('acknowledged');
     }
 
     setUrgency(urgency) {
@@ -430,6 +455,15 @@ var Notification = class Notification {
 
     setResident(resident) {
         this.resident = resident;
+
+        if (this.resident) {
+            if (this._activatedId) {
+                this.disconnect(this._activatedId);
+                this._activatedId = 0;
+            }
+        } else if (!this._activatedId) {
+            this._activatedId = this.connect_after('activated', () => this.destroy());
+        }
     }
 
     setTransient(isTransient) {
@@ -471,23 +505,30 @@ var Notification = class Notification {
 
     activate() {
         this.emit('activated');
-        if (!this.resident)
-            this.destroy();
     }
 
     destroy(reason = NotificationDestroyedReason.DISMISSED) {
+        if (this._activatedId) {
+            this.disconnect(this._activatedId);
+            delete this._activatedId;
+        }
+
         this.emit('destroy', reason);
+        this.run_dispose();
     }
-};
-Signals.addSignalMethods(Notification.prototype);
+});
 
-var NotificationBanner =
-class NotificationBanner extends Calendar.NotificationMessage {
-    constructor(notification) {
-        super(notification);
+var NotificationBanner = GObject.registerClass({
+    Signals: {
+        'done-displaying': {},
+        'unfocused': {},
+    },
+}, class NotificationBanner extends Calendar.NotificationMessage {
+    _init(notification) {
+        super._init(notification);
 
-        this.actor.can_focus = false;
-        this.actor.add_style_class_name('notification-banner');
+        this.can_focus = false;
+        this.add_style_class_name('notification-banner');
 
         this._buttonBox = null;
 
@@ -568,13 +609,13 @@ class NotificationBanner extends Calendar.NotificationMessage {
 
     addAction(label, callback) {
         let button = new St.Button({ style_class: 'notification-button',
-                                     label: label,
+                                     label,
                                      x_expand: true,
                                      can_focus: true });
 
         return this.addButton(button, callback);
     }
-};
+});
 
 var SourceActor = GObject.registerClass(
 class SourceActor extends St.Widget {
@@ -591,8 +632,7 @@ class SourceActor extends St.Widget {
         this._actorDestroyed = false;
 
         let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
-        this._iconBin = new St.Bin({ x_fill: true,
-                                     x_expand: true,
+        this._iconBin = new St.Bin({ x_expand: true,
                                      height: size * scaleFactor,
                                      width: size * scaleFactor });
 
@@ -639,7 +679,7 @@ class SourceActorWithLabel extends SourceActor {
 
         this.add_actor(this._counterBin);
 
-        this._countUpdatedId = this._source.connect('count-updated', this._updateCount.bind(this));
+        this._countUpdatedId = this._source.connect('notify::count', this._updateCount.bind(this));
         this._updateCount();
 
         this.connect('destroy', () => {
@@ -687,11 +727,33 @@ class SourceActorWithLabel extends SourceActor {
     }
 });
 
-var Source = class Source {
-    constructor(title, iconName) {
+var Source = GObject.registerClass({
+    Properties: {
+        'count': GObject.ParamSpec.int(
+            'count', 'count', 'count',
+            GObject.ParamFlags.READABLE,
+            0, GLib.MAXINT32, 0),
+        'policy': GObject.ParamSpec.object(
+            'policy', 'policy', 'policy',
+            GObject.ParamFlags.READWRITE,
+            NotificationPolicy.$gtype),
+        'title': GObject.ParamSpec.string(
+            'title', 'title', 'title',
+            GObject.ParamFlags.READWRITE,
+            null),
+    },
+    Signals: {
+        'destroy': { param_types: [GObject.TYPE_UINT] },
+        'icon-updated': {},
+        'notification-added': { param_types: [Notification.$gtype] },
+        'notification-show': { param_types: [Notification.$gtype] },
+    },
+}, class Source extends GObject.Object {
+    _init(title, iconName) {
+        super._init({ title });
+
         this.SOURCE_ICON_SIZE = 48;
 
-        this.title = title;
         this.iconName = iconName;
 
         this.isChat = false;
@@ -726,7 +788,7 @@ var Source = class Source {
     }
 
     countUpdated() {
-        this.emit('count-updated');
+        super.notify('count');
     }
 
     _createPolicy() {
@@ -734,13 +796,17 @@ var Source = class Source {
     }
 
     get narrowestPrivacyScope() {
-        return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) ? PrivacyScope.SYSTEM
-                                                                                    : PrivacyScope.USER;
+        return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM)
+            ? PrivacyScope.SYSTEM
+            : PrivacyScope.USER;
     }
 
     setTitle(newTitle) {
+        if (this.title == newTitle)
+            return;
+
         this.title = newTitle;
-        this.emit('title-changed');
+        this.notify('title');
     }
 
     createBanner(notification) {
@@ -765,10 +831,10 @@ var Source = class Source {
             return;
 
         this.notifications.splice(index, 1);
+        this.countUpdated();
+
         if (this.notifications.length == 0)
             this.destroy();
-
-        this.countUpdated();
     }
 
     pushNotification(notification) {
@@ -779,22 +845,36 @@ var Source = class Source {
             this.notifications.shift().destroy(NotificationDestroyedReason.EXPIRED);
 
         notification.connect('destroy', this._onNotificationDestroy.bind(this));
-        notification.connect('acknowledged-changed', this.countUpdated.bind(this));
+        notification.connect('notify::acknowledged', this.countUpdated.bind(this));
         this.notifications.push(notification);
         this.emit('notification-added', notification);
 
         this.countUpdated();
     }
 
-    notify(notification) {
+    showNotification(notification) {
         notification.acknowledged = false;
         this.pushNotification(notification);
 
-        if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL) {
-            this.emit('notify', notification);
-        } else {
+        if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL)
+            this.emit('notification-show', notification);
+        else
             notification.playSound();
+    }
+
+    notify(propName) {
+        if (propName instanceof Notification) {
+            try {
+                throw new Error('Source.notify() has been moved to Source.showNotification()' +
+                                'this code will break in the future');
+            } catch (e) {
+                logError(e);
+                this.showNotification(propName);
+                return;
+            }
         }
+
+        super.notify(propName);
     }
 
     destroy(reason) {
@@ -807,6 +887,8 @@ var Source = class Source {
             notifications[i].destroy(reason);
 
         this.emit('destroy', reason);
+
+        this.run_dispose();
     }
 
     iconUpdated() {
@@ -818,17 +900,27 @@ var Source = class Source {
     }
 
     destroyNonResidentNotifications() {
-        for (let i = this.notifications.length - 1; i >= 0; i--)
+        for (let i = this.notifications.length - 1; i >= 0; i--) {
             if (!this.notifications[i].resident)
                 this.notifications[i].destroy();
-
-        this.countUpdated();
+        }
     }
-};
-Signals.addSignalMethods(Source.prototype);
+});
+
+var MessageTray = GObject.registerClass({
+    Signals: {
+        'queue-changed': {},
+        'source-added': { param_types: [Source.$gtype] },
+        'source-removed': { param_types: [Source.$gtype] },
+    },
+}, class MessageTray extends St.Widget {
+    _init() {
+        super._init({
+            visible: false,
+            clip_to_allocation: true,
+            layout_manager: new Clutter.BinLayout(),
+        });
 
-var MessageTray = class MessageTray {
-    constructor() {
         this._presence = new GnomeSession.Presence((proxy, _error) => {
             this._onStatusChanged(proxy.status);
         });
@@ -845,18 +937,15 @@ var MessageTray = class MessageTray {
             // so fix up Clutter's view of the pointer position in
             // that case.
             let related = ev.get_related();
-            if (!related || this.actor.contains(related))
+            if (!related || this.contains(related))
                 global.sync_pointer();
         });
 
-        this.actor = new St.Widget({ visible: false,
-                                     clip_to_allocation: true,
-                                     layout_manager: new Clutter.BinLayout() });
         let constraint = new Layout.MonitorConstraint({ primary: true });
         Main.layoutManager.panelBox.bind_property('visible',
                                                   constraint, 'work-area',
                                                   GObject.BindingFlags.SYNC_CREATE);
-        this.actor.add_constraint(constraint);
+        this.add_constraint(constraint);
 
         this._bannerBin = new St.Widget({ name: 'notification-container',
                                           reactive: true,
@@ -870,7 +959,7 @@ var MessageTray = class MessageTray {
                                 this._onNotificationKeyRelease.bind(this));
         this._bannerBin.connect('notify::hover',
                                 this._onNotificationHoverChanged.bind(this));
-        this.actor.add_actor(this._bannerBin);
+        this.add_actor(this._bannerBin);
 
         this._notificationFocusGrabber = new FocusGrabber(this._bannerBin);
         this._notificationQueue = [];
@@ -899,7 +988,7 @@ var MessageTray = class MessageTray {
         this._notificationTimeoutId = 0;
         this._notificationRemoved = false;
 
-        Main.layoutManager.addChrome(this.actor, { affectsInputRegion: false });
+        Main.layoutManager.addChrome(this, { affectsInputRegion: false });
         Main.layoutManager.trackChrome(this._bannerBin, { affectsInputRegion: true });
 
         global.display.connect('in-fullscreen-changed', this._updateState.bind(this));
@@ -942,11 +1031,11 @@ var MessageTray = class MessageTray {
     }
 
     _onDragBegin() {
-        Shell.util_set_hidden_from_pick(this.actor, true);
+        Shell.util_set_hidden_from_pick(this, true);
     }
 
     _onDragEnd() {
-        Shell.util_set_hidden_from_pick(this.actor, false);
+        Shell.util_set_hidden_from_pick(this, false);
     }
 
     get bannerAlignment() {
@@ -995,23 +1084,22 @@ var MessageTray = class MessageTray {
         // Register that we got a notification for this source
         source.policy.store();
 
-        source.policy.connect('enable-changed', () => {
+        source.policy.connect('notify::enable', () => {
             this._onSourceEnableChanged(source.policy, source);
         });
-        source.policy.connect('policy-changed', this._updateState.bind(this));
+        source.policy.connect('notify', this._updateState.bind(this));
         this._onSourceEnableChanged(source.policy, source);
     }
 
     _addSource(source) {
         let obj = {
-            source: source,
-            notifyId: 0,
+            showId: 0,
             destroyId: 0,
         };
 
         this._sources.set(source, obj);
 
-        obj.notifyId = source.connect('notify', this._onNotify.bind(this));
+        obj.showId = source.connect('notification-show', this._onNotificationShow.bind(this));
         obj.destroyId = source.connect('destroy', this._onSourceDestroy.bind(this));
 
         this.emit('source-added', source);
@@ -1021,7 +1109,7 @@ var MessageTray = class MessageTray {
         let obj = this._sources.get(source);
         this._sources.delete(source);
 
-        source.disconnect(obj.notifyId);
+        source.disconnect(obj.showId);
         source.disconnect(obj.destroyId);
 
         this.emit('source-removed', source);
@@ -1062,7 +1150,7 @@ var MessageTray = class MessageTray {
         }
     }
 
-    _onNotify(source, notification) {
+    _onNotificationShow(_source, notification) {
         if (this._notification == notification) {
             // If a notification that is being shown is updated, we update
             // how it is shown and extend the time until it auto-hides.
@@ -1074,7 +1162,7 @@ var MessageTray = class MessageTray {
             // indicator in the panel; however do make an exception for CRITICAL
             // notifications, as only banner mode allows expansion.
             let bannerCount = this._notification ? 1 : 0;
-            let full = (this.queueCount + bannerCount >= MAX_NOTIFICATIONS_IN_QUEUE);
+            let full = this.queueCount + bannerCount >= MAX_NOTIFICATIONS_IN_QUEUE;
             if (!full || notification.urgency == Urgency.CRITICAL) {
                 notification.connect('destroy',
                                      this._onNotificationDestroy.bind(this));
@@ -1091,7 +1179,7 @@ var MessageTray = class MessageTray {
     _resetNotificationLeftTimeout() {
         this._useLongerNotificationLeftTimeout = false;
         if (this._notificationLeftTimeoutId) {
-            Mainloop.source_remove(this._notificationLeftTimeoutId);
+            GLib.source_remove(this._notificationLeftTimeoutId);
             this._notificationLeftTimeoutId = 0;
             this._notificationLeftMouseX = -1;
             this._notificationLeftMouseY = -1;
@@ -1137,7 +1225,7 @@ var MessageTray = class MessageTray {
             // We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
             // That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
             let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT;
-            this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
+            this._notificationLeftTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, this._onNotificationLeftTimeout.bind(this));
             GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
         }
     }
@@ -1166,8 +1254,10 @@ var MessageTray = class MessageTray {
             x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
             x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
             this._notificationLeftMouseX = -1;
-            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT,
-                                                                   this._onNotificationLeftTimeout.bind(this));
+            this._notificationLeftTimeoutId = GLib.timeout_add(
+                GLib.PRIORITY_DEFAULT,
+                LONGER_HIDE_TIMEOUT,
+                this._onNotificationLeftTimeout.bind(this));
             GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
         } else {
             this._notificationLeftTimeoutId = 0;
@@ -1192,7 +1282,7 @@ var MessageTray = class MessageTray {
     // at the present time.
     _updateState() {
         let hasMonitor = Main.layoutManager.primaryMonitor != null;
-        this.actor.visible = !this._bannerBlocked && hasMonitor && this._banner != null;
+        this.visible = !this._bannerBlocked && hasMonitor && this._banner != null;
         if (this._bannerBlocked || !hasMonitor)
             return;
 
@@ -1219,7 +1309,7 @@ var MessageTray = class MessageTray {
             let nextNotification = this._notificationQueue[0] || null;
             if (hasNotifications && nextNotification) {
                 let limited = this._busy || Main.layoutManager.primaryMonitor.inFullscreen;
-                let showNextNotification = (!limited || nextNotification.forFeedback || nextNotification.urgency == Urgency.CRITICAL);
+                let showNextNotification = !limited || nextNotification.forFeedback || nextNotification.urgency == Urgency.CRITICAL;
                 if (showNextNotification)
                     this._showNotification();
             }
@@ -1229,7 +1319,7 @@ var MessageTray = class MessageTray {
                            this._notification.urgency != Urgency.CRITICAL &&
                            !this._banner.focused &&
                            !this._pointerInNotification) || this._notificationExpired;
-            let mustClose = (this._notificationRemoved || !hasNotifications || expired);
+            let mustClose = this._notificationRemoved || !hasNotifications || expired;
 
             if (mustClose) {
                 let animate = hasNotifications && !this._notificationRemoved;
@@ -1272,11 +1362,11 @@ var MessageTray = class MessageTray {
             this._updateState();
         });
 
-        this._bannerBin.add_actor(this._banner.actor);
+        this._bannerBin.add_actor(this._banner);
 
         this._bannerBin.opacity = 0;
-        this._bannerBin.y = -this._banner.actor.height;
-        this.actor.show();
+        this._bannerBin.y = -this._banner.height;
+        this.show();
 
         Meta.disable_unredirect_for_display(global.display);
         this._updateShowingNotification();
@@ -1324,7 +1414,7 @@ var MessageTray = class MessageTray {
         this._bannerBin.ease({
             opacity: 255,
             duration: ANIMATION_TIME,
-            mode: Clutter.AnimationMode.LINEAR
+            mode: Clutter.AnimationMode.LINEAR,
         });
         this._bannerBin.ease({
             y: 0,
@@ -1334,7 +1424,7 @@ var MessageTray = class MessageTray {
                 this._notificationState = State.SHOWN;
                 this._showNotificationCompleted();
                 this._updateState();
-            }
+            },
         });
     }
 
@@ -1345,13 +1435,13 @@ var MessageTray = class MessageTray {
 
     _updateNotificationTimeout(timeout) {
         if (this._notificationTimeoutId) {
-            Mainloop.source_remove(this._notificationTimeoutId);
+            GLib.source_remove(this._notificationTimeoutId);
             this._notificationTimeoutId = 0;
         }
         if (timeout > 0) {
             this._notificationTimeoutId =
-                Mainloop.timeout_add(timeout,
-                                     this._notificationTimeout.bind(this));
+                GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
+                    this._notificationTimeout.bind(this));
             GLib.Source.set_name_by_id(this._notificationTimeoutId, '[gnome-shell] this._notificationTimeout');
         }
     }
@@ -1400,7 +1490,7 @@ var MessageTray = class MessageTray {
             this._bannerBin.ease({
                 opacity: 0,
                 duration: ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_BACK
+                mode: Clutter.AnimationMode.EASE_OUT_BACK,
             });
             this._bannerBin.ease({
                 y: -this._bannerBin.height,
@@ -1410,7 +1500,7 @@ var MessageTray = class MessageTray {
                     this._notificationState = State.HIDDEN;
                     this._hideNotificationCompleted();
                     this._updateState();
-                }
+                },
             });
         } else {
             this._bannerBin.y = -this._bannerBin.height;
@@ -1423,16 +1513,16 @@ var MessageTray = class MessageTray {
     _hideNotificationCompleted() {
         let notification = this._notification;
         this._notification = null;
-        if (notification.isTransient)
+        if (!this._notificationRemoved && notification.isTransient)
             notification.destroy(NotificationDestroyedReason.EXPIRED);
 
         this._pointerInNotification = false;
         this._notificationRemoved = false;
         Meta.enable_unredirect_for_display(global.display);
 
-        this._banner.actor.destroy();
+        this._banner.destroy();
         this._banner = null;
-        this.actor.hide();
+        this.hide();
     }
 
     _expandActiveNotification() {
@@ -1454,15 +1544,15 @@ var MessageTray = class MessageTray {
     _ensureBannerFocused() {
         this._notificationFocusGrabber.grabFocus();
     }
-};
-Signals.addSignalMethods(MessageTray.prototype);
+});
 
-var SystemNotificationSource = class SystemNotificationSource extends Source {
-    constructor() {
-        super(_("System Information"), 'dialog-information-symbolic');
+var SystemNotificationSource = GObject.registerClass(
+class SystemNotificationSource extends Source {
+    _init() {
+        super._init(_("System Information"), 'dialog-information-symbolic');
     }
 
     open() {
         this.destroy();
     }
-};
+});

js/ui/modalDialog.js

@@ -17,7 +17,7 @@ var State = {
     CLOSED: 1,
     OPENING: 2,
     CLOSING: 3,
-    FADED_OUT: 4
+    FADED_OUT: 4,
 };
 
 var ModalDialog = GObject.registerClass({
@@ -26,9 +26,9 @@ var ModalDialog = GObject.registerClass({
                                        GObject.ParamFlags.READABLE,
                                        Math.min(...Object.values(State)),
                                        Math.max(...Object.values(State)),
-                                       State.CLOSED)
+                                       State.CLOSED),
     },
-    Signals: { 'opened': {}, 'closed': {} }
+    Signals: { 'opened': {}, 'closed': {} },
 }, class ModalDialog extends St.Widget {
     _init(params) {
         super._init({ visible: false,
@@ -57,9 +57,12 @@ var ModalDialog = GObject.registerClass({
                                                       coordinate: Clutter.BindCoordinate.ALL });
         this.add_constraint(constraint);
 
-        this.backgroundStack = new St.Widget({ layout_manager: new Clutter.BinLayout() });
-        this._backgroundBin = new St.Bin({ child: this.backgroundStack,
-                                           x_fill: true, y_fill: true });
+        this.backgroundStack = new St.Widget({
+            layout_manager: new Clutter.BinLayout(),
+            x_expand: true,
+            y_expand: true,
+        });
+        this._backgroundBin = new St.Bin({ child: this.backgroundStack });
         this._monitorConstraint = new Layout.MonitorConstraint();
         this._backgroundBin.add_constraint(this._monitorConstraint);
         this.add_actor(this._backgroundBin);
@@ -121,7 +124,7 @@ var ModalDialog = GObject.registerClass({
 
         this.dialogLayout.opacity = 255;
         if (this._lightbox)
-            this._lightbox.show();
+            this._lightbox.lightOn();
         this.opacity = 0;
         this.show();
         this.ease({
@@ -131,7 +134,7 @@ var ModalDialog = GObject.registerClass({
             onComplete: () => {
                 this._setState(State.OPENED);
                 this.emit('opened');
-            }
+            },
         });
     }
 
@@ -180,7 +183,7 @@ var ModalDialog = GObject.registerClass({
                 opacity: 0,
                 duration: OPEN_AND_CLOSE_TIME,
                 mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => this._closeComplete()
+                onComplete: () => this._closeComplete(),
             });
         } else {
             this._closeComplete();
@@ -203,7 +206,7 @@ var ModalDialog = GObject.registerClass({
         this._hasModal = false;
 
         if (!this._shellReactive)
-            this._eventBlocker.raise_top();
+            this.backgroundStack.set_child_above_sibling(this._eventBlocker, null);
     }
 
     pushModal(timestamp) {
@@ -216,6 +219,8 @@ var ModalDialog = GObject.registerClass({
         if (!Main.pushModal(this, params))
             return false;
 
+        Main.layoutManager.emit('system-modal-opened');
+
         this._hasModal = true;
         if (this._savedKeyFocus) {
             this._savedKeyFocus.grab_key_focus();
@@ -226,7 +231,7 @@ var ModalDialog = GObject.registerClass({
         }
 
         if (!this._shellReactive)
-            this._eventBlocker.lower_bottom();
+            this.backgroundStack.set_child_below_sibling(this._eventBlocker, null);
         return true;
     }
 
@@ -253,7 +258,7 @@ var ModalDialog = GObject.registerClass({
             opacity: 0,
             duration: FADE_OUT_DIALOG_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.state = State.FADED_OUT
+            onComplete: () => (this.state = State.FADED_OUT),
         });
     }
 });

js/ui/mpris.js

@@ -1,5 +1,5 @@
 /* exported MediaSection */
-const { Gio, Shell, St } = imports.gi;
+const { Gio, GObject, Shell, St } = imports.gi;
 const Signals = imports.signals;
 
 const Calendar = imports.ui.calendar;
@@ -19,9 +19,10 @@ const MprisPlayerProxy = Gio.DBusProxy.makeProxyWrapper(MprisPlayerIface);
 
 const MPRIS_PLAYER_PREFIX = 'org.mpris.MediaPlayer2.';
 
-var MediaMessage = class MediaMessage extends MessageList.Message {
-    constructor(player) {
-        super('', '');
+var MediaMessage = GObject.registerClass(
+class MediaMessage extends MessageList.Message {
+    _init(player) {
+        super._init('', '');
 
         this._player = player;
 
@@ -43,12 +44,20 @@ var MediaMessage = class MediaMessage extends MessageList.Message {
                 this._player.next();
             });
 
-        this._player.connect('changed', this._update.bind(this));
-        this._player.connect('closed', this.close.bind(this));
+        this._updateHandlerId =
+            this._player.connect('changed', this._update.bind(this));
+        this._closedHandlerId =
+            this._player.connect('closed', this.close.bind(this));
         this._update();
     }
 
-    _onClicked() {
+    _onDestroy() {
+        super._onDestroy();
+        this._player.disconnect(this._updateHandlerId);
+        this._player.disconnect(this._closedHandlerId);
+    }
+
+    vfunc_clicked() {
         this._player.raise();
         Main.panel.closeCalendar();
     }
@@ -63,7 +72,7 @@ var MediaMessage = class MediaMessage extends MessageList.Message {
 
         if (this._player.trackCoverUrl) {
             let file = Gio.File.new_for_uri(this._player.trackCoverUrl);
-            this._icon.gicon = new Gio.FileIcon({ file: file });
+            this._icon.gicon = new Gio.FileIcon({ file });
             this._icon.remove_style_class_name('fallback');
         } else {
             this._icon.icon_name = 'audio-x-generic-symbolic';
@@ -71,14 +80,15 @@ var MediaMessage = class MediaMessage extends MessageList.Message {
         }
 
         let isPlaying = this._player.status == 'Playing';
-        let iconName = isPlaying ? 'media-playback-pause-symbolic'
-                                 : 'media-playback-start-symbolic';
+        let iconName = isPlaying
+            ? 'media-playback-pause-symbolic'
+            : 'media-playback-start-symbolic';
         this._playPauseButton.child.icon_name = iconName;
 
         this._updateNavButton(this._prevButton, this._player.canGoPrevious);
         this._updateNavButton(this._nextButton, this._player.canGoNext);
     }
-};
+});
 
 var MprisPlayer = class MprisPlayer {
     constructor(busName) {
@@ -93,6 +103,7 @@ var MprisPlayer = class MprisPlayer {
         this._trackArtists = [];
         this._trackTitle = '';
         this._trackCoverUrl = '';
+        this._busName = busName;
     }
 
     get status() {
@@ -175,9 +186,39 @@ var MprisPlayer = class MprisPlayer {
         for (let prop in this._playerProxy.Metadata)
             metadata[prop] = this._playerProxy.Metadata[prop].deep_unpack();
 
-        this._trackArtists = metadata['xesam:artist'] || [_("Unknown artist")];
-        this._trackTitle = metadata['xesam:title'] || _("Unknown title");
-        this._trackCoverUrl = metadata['mpris:artUrl'] || '';
+        // Validate according to the spec; some clients send buggy metadata:
+        // https://www.freedesktop.org/wiki/Specifications/mpris-spec/metadata
+        this._trackArtists = metadata['xesam:artist'];
+        if (!Array.isArray(this._trackArtists) ||
+            !this._trackArtists.every(artist => typeof artist === 'string')) {
+            if (typeof this._trackArtists !== 'undefined') {
+                log(`Received faulty track artist metadata from ${
+                    this._busName}; expected an array of strings, got ${
+                    this._trackArtists} (${typeof this._trackArtists})`);
+            }
+            this._trackArtists =  [_("Unknown artist")];
+        }
+
+        this._trackTitle = metadata['xesam:title'];
+        if (typeof this._trackTitle !== 'string') {
+            if (typeof this._trackTitle !== 'undefined') {
+                log(`Received faulty track title metadata from ${
+                    this._busName}; expected a string, got ${
+                    this._trackTitle} (${typeof this._trackTitle})`);
+            }
+            this._trackTitle = _("Unknown title");
+        }
+
+        this._trackCoverUrl = metadata['mpris:artUrl'];
+        if (typeof this._trackCoverUrl !== 'string') {
+            if (typeof this._trackCoverUrl !== 'undefined') {
+                log(`Received faulty track cover art metadata from ${
+                    this._busName}; expected a string, got ${
+                    this._trackCoverUrl} (${typeof this._trackCoverUrl})`);
+            }
+            this._trackCoverUrl = '';
+        }
+
         this.emit('changed');
 
         let visible = this._playerProxy.CanPlay;
@@ -187,15 +228,16 @@ var MprisPlayer = class MprisPlayer {
             if (visible)
                 this.emit('show');
             else
-                this._close();
+                this.emit('hide');
         }
     }
 };
 Signals.addSignalMethods(MprisPlayer.prototype);
 
-var MediaSection = class MediaSection extends MessageList.MessageListSection {
-    constructor() {
-        super();
+var MediaSection = GObject.registerClass(
+class MediaSection extends MessageList.MessageListSection {
+    _init() {
+        super._init();
 
         this._players = new Map();
 
@@ -214,15 +256,20 @@ var MediaSection = class MediaSection extends MessageList.MessageListSection {
             return;
 
         let player = new MprisPlayer(busName);
+        let message = null;
         player.connect('closed',
             () => {
                 this._players.delete(busName);
             });
-        player.connect('show',
-            () => {
-                let message = new MediaMessage(player);
-                this.addMessage(message, true);
-            });
+        player.connect('show', () => {
+            message = new MediaMessage(player);
+            this.addMessage(message, true);
+        });
+        player.connect('hide', () => {
+            this.removeMessage(message, true);
+            message = null;
+        });
+
         this._players.set(busName, player);
     }
 
@@ -246,4 +293,4 @@ var MediaSection = class MediaSection extends MessageList.MessageListSection {
         if (newOwner && !oldOwner)
             this._addPlayer(name);
     }
-};
+});

js/ui/notificationDaemon.js

@@ -1,8 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported NotificationDaemon */
 
-const { GdkPixbuf, Gio, GLib, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
+const { GdkPixbuf, Gio, GLib, GObject, Shell, St } = imports.gi;
 
 const Config = imports.misc.config;
 const Main = imports.ui.main;
@@ -24,13 +23,13 @@ var NotificationClosedReason = {
     EXPIRED: 1,
     DISMISSED: 2,
     APP_CLOSED: 3,
-    UNDEFINED: 4
+    UNDEFINED: 4,
 };
 
 var Urgency = {
     LOW: 0,
     NORMAL: 1,
-    CRITICAL: 2
+    CRITICAL: 2,
 };
 
 const rewriteRules = {
@@ -40,8 +39,8 @@ const rewriteRules = {
         { pattern:     /^XChat: New public message from: (\S*) \((.*)\)$/,
           replacement: '$2 <$1>' },
         { pattern:     /^XChat: Highlighted message from: (\S*) \((.*)\)$/,
-          replacement: '$2 <$1>' }
-    ]
+          replacement: '$2 <$1>' },
+    ],
 };
 
 var FdoNotificationDaemon = class FdoNotificationDaemon {
@@ -171,7 +170,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
             // Ignore replacesId since we already sent back a
             // NotificationClosed for that id.
             id = this._nextNotificationId++;
-            let idleId = Mainloop.idle_add(() => {
+            let idleId = GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
                 this._emitNotificationClosed(id, NotificationClosedReason.DISMISSED);
                 return GLib.SOURCE_REMOVE;
             });
@@ -202,13 +201,13 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
                 hints['image-data'] = hints['icon_data'];
         }
 
-        let ndata = { appName: appName,
-                      icon: icon,
-                      summary: summary,
-                      body: body,
-                      actions: actions,
-                      hints: hints,
-                      timeout: timeout };
+        let ndata = { appName,
+                      icon,
+                      summary,
+                      body,
+                      actions,
+                      hints,
+                      timeout };
         if (replacesId != 0 && this._notifications[replacesId]) {
             ndata.id = id = replacesId;
             ndata.notification = this._notifications[replacesId].notification;
@@ -246,7 +245,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
                 return;
             }
 
-            let [pid] = result;
+            [pid] = result;
             source = this._getSource(appName, pid, ndata, sender, null);
 
             this._senderToPid[sender] = pid;
@@ -300,7 +299,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
         else if (!gicon)
             gicon = this._fallbackIconForNotificationData(hints);
 
-        notification.update(summary, body, { gicon: gicon,
+        notification.update(summary, body, { gicon,
                                              bannerMarkup: true,
                                              clear: true,
                                              soundFile: hints['sound-file'],
@@ -311,12 +310,13 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
         if (actions.length) {
             for (let i = 0; i < actions.length - 1; i += 2) {
                 let [actionId, label] = [actions[i], actions[i + 1]];
-                if (actionId == 'default')
+                if (actionId == 'default') {
                     hasDefaultAction = true;
-                else
+                } else {
                     notification.addAction(label, () => {
                         this._emitActionInvoked(ndata.id, actionId);
                     });
+                }
             }
         }
 
@@ -346,9 +346,10 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
         // of the 'transient' hint with hints['transient'] rather than hints.transient
         notification.setTransient(!!hints['transient']);
 
-        let privacyScope = (hints['x-gnome-privacy-scope'] || 'user');
-        notification.setPrivacyScope(privacyScope == 'system' ? MessageTray.PrivacyScope.SYSTEM
-                                                              : MessageTray.PrivacyScope.USER);
+        let privacyScope = hints['x-gnome-privacy-scope'] || 'user';
+        notification.setPrivacyScope(privacyScope == 'system'
+            ? MessageTray.PrivacyScope.SYSTEM
+            : MessageTray.PrivacyScope.USER);
 
         let sourceGIcon = source.useNotificationIcon ? gicon : null;
         source.processNotification(notification, sourceGIcon);
@@ -383,7 +384,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
             Config.PACKAGE_NAME,
             'GNOME',
             Config.PACKAGE_VERSION,
-            '1.2'
+            '1.2',
         ];
     }
 
@@ -412,10 +413,10 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
     }
 };
 
-var FdoNotificationDaemonSource =
+var FdoNotificationDaemonSource = GObject.registerClass(
 class FdoNotificationDaemonSource extends MessageTray.Source {
-    constructor(title, pid, sender, appId) {
-        super(title);
+    _init(title, pid, sender, appId) {
+        super._init(title);
 
         this.pid = pid;
         this.app = this._getApp(appId);
@@ -427,13 +428,14 @@ class FdoNotificationDaemonSource extends MessageTray.Source {
         else
             this.useNotificationIcon = true;
 
-        if (sender)
+        if (sender) {
             this._nameWatcherId = Gio.DBus.session.watch_name(sender,
                                                               Gio.BusNameWatcherFlags.NONE,
                                                               null,
                                                               this._onNameVanished.bind(this));
-        else
+        } else {
             this._nameWatcherId = 0;
+        }
     }
 
     _createPolicy() {
@@ -464,7 +466,7 @@ class FdoNotificationDaemonSource extends MessageTray.Source {
         if (notification.resident && this.app && tracker.focus_app == this.app)
             this.pushNotification(notification);
         else
-            this.notify(notification);
+            this.showNotification(notification);
     }
 
     _getApp(appId) {
@@ -526,37 +528,38 @@ class FdoNotificationDaemonSource extends MessageTray.Source {
             return null;
         }
     }
-};
+});
 
 const PRIORITY_URGENCY_MAP = {
     low: MessageTray.Urgency.LOW,
     normal: MessageTray.Urgency.NORMAL,
     high: MessageTray.Urgency.HIGH,
-    urgent: MessageTray.Urgency.CRITICAL
+    urgent: MessageTray.Urgency.CRITICAL,
 };
 
-var GtkNotificationDaemonNotification =
+var GtkNotificationDaemonNotification = GObject.registerClass(
 class GtkNotificationDaemonNotification extends MessageTray.Notification {
-    constructor(source, notification) {
-        super(source);
+    _init(source, notification) {
+        super._init(source);
         this._serialized = GLib.Variant.new('a{sv}', notification);
 
-        let { "title": title,
-              "body": body,
-              "icon": gicon,
-              "urgent": urgent,
-              "priority": priority,
-              "buttons": buttons,
+        let { title,
+              body,
+              icon: gicon,
+              urgent,
+              priority,
+              buttons,
               "default-action": defaultAction,
               "default-action-target": defaultActionTarget,
-              "timestamp": time } = notification;
+              timestamp: time } = notification;
 
         if (priority) {
             let urgency = PRIORITY_URGENCY_MAP[priority.unpack()];
             this.setUrgency(urgency != undefined ? urgency : MessageTray.Urgency.NORMAL);
         } else if (urgent) {
-            this.setUrgency(urgent.unpack() ? MessageTray.Urgency.CRITICAL
-                            : MessageTray.Urgency.NORMAL);
+            this.setUrgency(urgent.unpack()
+                ? MessageTray.Urgency.CRITICAL
+                : MessageTray.Urgency.NORMAL);
         } else {
             this.setUrgency(MessageTray.Urgency.NORMAL);
         }
@@ -589,8 +592,8 @@ class GtkNotificationDaemonNotification extends MessageTray.Notification {
     }
 
     _onButtonClicked(button) {
-        let { 'action': action, 'target': actionTarget } = button;
-        this._activateAction(action.unpack(), actionTarget);
+        let { action, target } = button;
+        this._activateAction(action.unpack(), target);
     }
 
     activate() {
@@ -601,7 +604,7 @@ class GtkNotificationDaemonNotification extends MessageTray.Notification {
     serialize() {
         return this._serialized;
     }
-};
+});
 
 const FdoApplicationIface = loadInterfaceXML('org.freedesktop.Application');
 const FdoApplicationProxy = Gio.DBusProxy.makeProxyWrapper(FdoApplicationIface);
@@ -617,9 +620,9 @@ function getPlatformData() {
 
 function InvalidAppError() {}
 
-var GtkNotificationDaemonAppSource = 
+var GtkNotificationDaemonAppSource = GObject.registerClass(
 class GtkNotificationDaemonAppSource extends MessageTray.Source {
-    constructor(appId) {
+    _init(appId) {
         let objectPath = objectPathFromAppId(appId);
         if (!GLib.Variant.is_object_path(objectPath))
             throw new InvalidAppError();
@@ -628,7 +631,7 @@ class GtkNotificationDaemonAppSource extends MessageTray.Source {
         if (!app)
             throw new InvalidAppError();
 
-        super(app.get_name());
+        super._init(app.get_name());
 
         this._appId = appId;
         this._app = app;
@@ -689,7 +692,7 @@ class GtkNotificationDaemonAppSource extends MessageTray.Source {
         this._notifications[notificationId] = notification;
 
         if (showBanner)
-            this.notify(notification);
+            this.showNotification(notification);
         else
             this.pushNotification(notification);
 
@@ -715,7 +718,7 @@ class GtkNotificationDaemonAppSource extends MessageTray.Source {
         }
         return [this._appId, notifications];
     }
-};
+});
 
 const GtkNotificationsIface = loadInterfaceXML('org.gtk.Notifications');
 
@@ -741,7 +744,7 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
             delete this._sources[appId];
             this._saveNotifications();
         });
-        source.connect('count-updated', this._saveNotifications.bind(this));
+        source.connect('notify::count', this._saveNotifications.bind(this));
         Main.messageTray.add(source);
         this._sources[appId] = source;
         return source;
@@ -750,29 +753,33 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
     _loadNotifications() {
         this._isLoading = true;
 
-        let value = global.get_persistent_state('a(sa(sv))', 'notifications');
-        if (value) {
-            let sources = value.deep_unpack();
-            sources.forEach(([appId, notifications]) => {
-                if (notifications.length == 0)
-                    return;
-
-                let source;
-                try {
-                    source = this._ensureAppSource(appId);
-                } catch (e) {
-                    if (e instanceof InvalidAppError)
+        try {
+            let value = global.get_persistent_state('a(sa(sv))', 'notifications');
+            if (value) {
+                let sources = value.deep_unpack();
+                sources.forEach(([appId, notifications]) => {
+                    if (notifications.length == 0)
                         return;
-                    throw e;
-                }
 
-                notifications.forEach(([notificationId, notification]) => {
-                    source.addNotification(notificationId, notification.deep_unpack(), false);
+                    let source;
+                    try {
+                        source = this._ensureAppSource(appId);
+                    } catch (e) {
+                        if (e instanceof InvalidAppError)
+                            return;
+                        throw e;
+                    }
+
+                    notifications.forEach(([notificationId, notification]) => {
+                        source.addNotification(notificationId, notification.deep_unpack(), false);
+                    });
                 });
-            });
+            }
+        } catch (e) {
+            logError(e, 'Failed to load saved notifications');
+        } finally {
+            this._isLoading = false;
         }
-
-        this._isLoading = false;
     }
 
     _saveNotifications() {

js/ui/osdMonitorLabeler.js

@@ -1,30 +1,33 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported OsdMonitorLabeler */
 
-const { Clutter, Gio, Meta, St } = imports.gi;
+const { Clutter, Gio, GObject, Meta, St } = imports.gi;
 
 const Main = imports.ui.main;
 
-var OsdMonitorLabel = class {
-    constructor(monitor, label) {
-        this._actor = new St.Widget({ x_expand: true,
-                                      y_expand: true });
+var OsdMonitorLabel = GObject.registerClass(
+class OsdMonitorLabel extends St.Widget {
+    _init(monitor, label) {
+        super._init({ x_expand: true, y_expand: true });
 
         this._monitor = monitor;
 
         this._box = new St.BoxLayout({ style_class: 'osd-window',
                                        vertical: true });
-        this._actor.add_actor(this._box);
+        this.add_actor(this._box);
 
         this._label = new St.Label({ style_class: 'osd-monitor-label',
                                      text: label });
         this._box.add(this._label);
 
-        Main.uiGroup.add_child(this._actor);
-        Main.uiGroup.set_child_above_sibling(this._actor, null);
+        Main.uiGroup.add_child(this);
+        Main.uiGroup.set_child_above_sibling(this, null);
         this._position();
 
         Meta.disable_unredirect_for_display(global.display);
+        this.connect('destroy', () => {
+            Meta.enable_unredirect_for_display(global.display);
+        });
     }
 
     _position() {
@@ -37,12 +40,7 @@ var OsdMonitorLabel = class {
 
         this._box.y = workArea.y;
     }
-
-    destroy() {
-        this._actor.destroy();
-        Meta.enable_unredirect_for_display(global.display);
-    }
-};
+});
 
 var OsdMonitorLabeler = class {
     constructor() {
@@ -68,7 +66,7 @@ var OsdMonitorLabeler = class {
 
     _trackClient(client) {
         if (this._client)
-            return (this._client == client);
+            return this._client == client;
 
         this._client = client;
         this._clientWatchId = Gio.bus_watch_name(Gio.BusType.SESSION, client, 0, null,

js/ui/osdWindow.js

@@ -2,7 +2,6 @@
 /* exported OsdWindowManager */
 
 const { Clutter, GLib, GObject, Meta, St } = imports.gi;
-const Mainloop = imports.mainloop;
 
 const BarLevel = imports.ui.barLevel;
 const Layout = imports.ui.layout;
@@ -42,39 +41,42 @@ class OsdWindowConstraint extends Clutter.Constraint {
     }
 });
 
-var OsdWindow = class {
-    constructor(monitorIndex) {
-        this.actor = new St.Widget({ x_expand: true,
-                                     y_expand: true,
-                                     x_align: Clutter.ActorAlign.CENTER,
-                                     y_align: Clutter.ActorAlign.CENTER });
+var OsdWindow = GObject.registerClass(
+class OsdWindow extends St.Widget {
+    _init(monitorIndex) {
+        super._init({
+            x_expand: true,
+            y_expand: true,
+            x_align: Clutter.ActorAlign.CENTER,
+            y_align: Clutter.ActorAlign.CENTER,
+        });
 
         this._monitorIndex = monitorIndex;
         let constraint = new Layout.MonitorConstraint({ index: monitorIndex });
-        this.actor.add_constraint(constraint);
+        this.add_constraint(constraint);
 
         this._boxConstraint = new OsdWindowConstraint();
         this._box = new St.BoxLayout({ style_class: 'osd-window',
                                        vertical: true });
         this._box.add_constraint(this._boxConstraint);
-        this.actor.add_actor(this._box);
+        this.add_actor(this._box);
 
-        this._icon = new St.Icon();
-        this._box.add(this._icon, { expand: true });
+        this._icon = new St.Icon({ y_expand: true });
+        this._box.add_child(this._icon);
 
         this._label = new St.Label();
         this._box.add(this._label);
 
         this._level = new BarLevel.BarLevel({
             style_class: 'level',
-            value: 0
+            value: 0,
         });
         this._box.add(this._level);
 
         this._hideTimeoutId = 0;
         this._reset();
 
-        this.actor.connect('destroy', this._onDestroy.bind(this));
+        this.connect('destroy', this._onDestroy.bind(this));
 
         this._monitorsChangedId =
             Main.layoutManager.connect('monitors-changed',
@@ -84,7 +86,7 @@ var OsdWindow = class {
             themeContext.connect('notify::scale-factor',
                                  this._relayout.bind(this));
         this._relayout();
-        Main.uiGroup.add_child(this.actor);
+        Main.uiGroup.add_child(this);
     }
 
     _onDestroy() {
@@ -103,21 +105,22 @@ var OsdWindow = class {
     }
 
     setLabel(label) {
-        this._label.visible = (label != undefined);
+        this._label.visible = label != undefined;
         if (label)
             this._label.text = label;
     }
 
     setLevel(value) {
-        this._level.visible = (value != undefined);
+        this._level.visible = value != undefined;
         if (value != undefined) {
-            if (this.actor.visible)
+            if (this.visible) {
                 this._level.ease_property('value', value, {
                     mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    duration: LEVEL_ANIMATION_TIME
+                    duration: LEVEL_ANIMATION_TIME,
                 });
-            else
+            } else {
                 this._level.value = value;
+            }
         }
     }
 
@@ -129,23 +132,23 @@ var OsdWindow = class {
         if (!this._icon.gicon)
             return;
 
-        if (!this.actor.visible) {
+        if (!this.visible) {
             Meta.disable_unredirect_for_display(global.display);
-            this.actor.show();
-            this.actor.opacity = 0;
-            this.actor.get_parent().set_child_above_sibling(this.actor, null);
+            super.show();
+            this.opacity = 0;
+            this.get_parent().set_child_above_sibling(this, null);
 
-            this.actor.ease({
+            this.ease({
                 opacity: 255,
                 duration: FADE_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
         }
 
         if (this._hideTimeoutId)
-            Mainloop.source_remove(this._hideTimeoutId);
-        this._hideTimeoutId = Mainloop.timeout_add(HIDE_TIMEOUT,
-                                                   this._hide.bind(this));
+            GLib.source_remove(this._hideTimeoutId);
+        this._hideTimeoutId = GLib.timeout_add(
+            GLib.PRIORITY_DEFAULT, HIDE_TIMEOUT, this._hide.bind(this));
         GLib.Source.set_name_by_id(this._hideTimeoutId, '[gnome-shell] this._hide');
     }
 
@@ -153,26 +156,26 @@ var OsdWindow = class {
         if (!this._hideTimeoutId)
             return;
 
-        Mainloop.source_remove(this._hideTimeoutId);
+        GLib.source_remove(this._hideTimeoutId);
         this._hide();
     }
 
     _hide() {
         this._hideTimeoutId = 0;
-        this.actor.ease({
+        this.ease({
             opacity: 0,
             duration: FADE_TIME,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             onComplete: () => {
                 this._reset();
                 Meta.enable_unredirect_for_display(global.display);
-            }
+            },
         });
         return GLib.SOURCE_REMOVE;
     }
 
     _reset() {
-        this.actor.hide();
+        super.hide();
         this.setLabel(null);
         this.setMaxLevel(null);
         this.setLevel(null);
@@ -194,7 +197,7 @@ var OsdWindow = class {
         this._box.translation_y = Math.round(monitor.height / 4);
         this._boxConstraint.minSize = popupSize;
     }
-};
+});
 
 var OsdWindowManager = class {
     constructor() {
@@ -211,7 +214,7 @@ var OsdWindowManager = class {
         }
 
         for (let i = Main.layoutManager.monitors.length; i < this._osdWindows.length; i++) {
-            this._osdWindows[i].actor.destroy();
+            this._osdWindows[i].destroy();
             this._osdWindows[i] = null;
         }
 

js/ui/overview.js

@@ -1,8 +1,7 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported Overview */
 
-const { Clutter, GLib, Meta, Shell, St } = imports.gi;
-const Mainloop = imports.mainloop;
+const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;
 
 const Background = imports.ui.background;
@@ -43,9 +42,10 @@ var ShellInfo = class {
     }
 
     setMessage(text, options) {
-        options = Params.parse(options, { undoCallback: null,
-                                          forFeedback: false
-                                        });
+        options = Params.parse(options, {
+            undoCallback: null,
+            forFeedback: false,
+        });
 
         let undoCallback = options.undoCallback;
         let forFeedback = options.forFeedback;
@@ -72,36 +72,109 @@ var ShellInfo = class {
         if (undoCallback)
             notification.addAction(_("Undo"), this._onUndoClicked.bind(this));
 
-        this._source.notify(notification);
+        this._source.showNotification(notification);
     }
 };
 
+var OverviewActor = GObject.registerClass(
+class OverviewActor extends St.BoxLayout {
+    _init() {
+        super._init({
+            name: 'overview',
+            /* Translators: This is the main view to select
+                activities. See also note for "Activities" string. */
+            accessible_name: _("Overview"),
+            vertical: true,
+        });
+
+        this.add_constraint(new LayoutManager.MonitorConstraint({ primary: true }));
+
+        // Add a clone of the panel to the overview so spacing and such is
+        // automatic
+        let panelGhost = new St.Bin({
+            child: new Clutter.Clone({ source: Main.panel }),
+            reactive: false,
+            opacity: 0,
+        });
+        this.add_actor(panelGhost);
+
+        this._searchEntry = new St.Entry({
+            style_class: 'search-entry',
+            /* Translators: this is the text displayed
+               in the search entry when no search is
+               active; it should not exceed ~30
+               characters. */
+            hint_text: _("Type to search…"),
+            track_hover: true,
+            can_focus: true,
+        });
+        this._searchEntry.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
+        let searchEntryBin = new St.Bin({
+            child: this._searchEntry,
+            x_align: Clutter.ActorAlign.CENTER,
+        });
+        this.add_actor(searchEntryBin);
+
+        this._controls = new OverviewControls.ControlsManager(this._searchEntry);
+
+        // Add our same-line elements after the search entry
+        this.add_child(this._controls);
+    }
+
+    get dash() {
+        return this._controls.dash;
+    }
+
+    get searchEntry() {
+        return this._searchEntry;
+    }
+
+    get viewSelector() {
+        return this._controls.viewSelector;
+    }
+});
+
 var Overview = class {
     constructor() {
-        this._overviewCreated = false;
         this._initCalled = false;
 
         Main.sessionMode.connect('updated', this._sessionUpdated.bind(this));
         this._sessionUpdated();
     }
 
+    get dash() {
+        return this._overview.dash;
+    }
+
+    get dashIconSize() {
+        logError(new Error('Usage of Overview.\'dashIconSize\' is deprecated, ' +
+            'use \'dash.iconSize\' property instead'));
+        return this.dash.iconSize;
+    }
+
+    get viewSelector() {
+        return this._overview.viewSelector;
+    }
+
+    get animationInProgress() {
+        return this._animationInProgress;
+    }
+
+    get visible() {
+        return this._visible;
+    }
+
+    get visibleTarget() {
+        return this._visibleTarget;
+    }
+
     _createOverview() {
-        if (this._overviewCreated)
+        if (this._overview)
             return;
 
         if (this.isDummy)
             return;
 
-        this._overviewCreated = true;
-
-        this._overview = new St.BoxLayout({ name: 'overview',
-                                            /* Translators: This is the main view to select
-                                               activities. See also note for "Activities" string. */
-                                            accessible_name: _("Overview"),
-                                            vertical: true });
-        this._overview.add_constraint(new LayoutManager.MonitorConstraint({ primary: true }));
-        this._overview._delegate = this;
-
         // The main Background actors are inside global.window_group which are
         // hidden when displaying the overview, so we create a new
         // one. Instances of this class share a single CoglTexture behind the
@@ -116,11 +189,11 @@ var Overview = class {
 
         this._activationTime = 0;
 
-        this.visible = false;           // animating to overview, in overview, animating out
+        this._visible = false;          // animating to overview, in overview, animating out
         this._shown = false;            // show() and not hide()
         this._modal = false;            // have a modal grab
-        this.animationInProgress = false;
-        this.visibleTarget = false;
+        this._animationInProgress = false;
+        this._visibleTarget = false;
 
         // During transitions, we raise this to the top to avoid having the overview
         // area be reactive; it causes too many issues such as double clicks on
@@ -129,14 +202,11 @@ var Overview = class {
                                               reactive: true });
         Main.layoutManager.overviewGroup.add_child(this._coverPane);
         this._coverPane.connect('event', () => Clutter.EVENT_STOP);
-
-        Main.layoutManager.overviewGroup.add_child(this._overview);
-
         this._coverPane.hide();
 
         // XDND
         this._dragMonitor = {
-            dragMotion: this._onDragMotion.bind(this)
+            dragMotion: this._onDragMotion.bind(this),
         };
 
 
@@ -175,11 +245,11 @@ var Overview = class {
         for (let i = 0; i < backgrounds.length; i++) {
             backgrounds[i].ease_property('brightness', 1.0, {
                 duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
             backgrounds[i].ease_property('vignette-sharpness', 0.0, {
                 duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
         }
     }
@@ -189,11 +259,11 @@ var Overview = class {
         for (let i = 0; i < backgrounds.length; i++) {
             backgrounds[i].ease_property('brightness', Lightbox.VIGNETTE_BRIGHTNESS, {
                 duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
             backgrounds[i].ease_property('vignette-sharpness', Lightbox.VIGNETTE_SHARPNESS, {
                 duration: SHADE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
+                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             });
         }
     }
@@ -213,41 +283,12 @@ var Overview = class {
         if (this.isDummy)
             return;
 
+        this._overview = new OverviewActor();
+        this._overview._delegate = this;
+        Main.layoutManager.overviewGroup.add_child(this._overview);
+
         this._shellInfo = new ShellInfo();
 
-        // Add a clone of the panel to the overview so spacing and such is
-        // automatic
-        this._panelGhost = new St.Bin({ child: new Clutter.Clone({ source: Main.panel }),
-                                        reactive: false,
-                                        opacity: 0 });
-        this._overview.add_actor(this._panelGhost);
-
-        this._searchEntry = new St.Entry({ style_class: 'search-entry',
-                                           /* Translators: this is the text displayed
-                                              in the search entry when no search is
-                                              active; it should not exceed ~30
-                                              characters. */
-                                           hint_text: _("Type to search…"),
-                                           track_hover: true,
-                                           can_focus: true });
-        this._searchEntryBin = new St.Bin({ child: this._searchEntry,
-                                            x_align: St.Align.MIDDLE });
-        this._overview.add_actor(this._searchEntryBin);
-
-        // Create controls
-        this._controls = new OverviewControls.ControlsManager(this._searchEntry);
-        this._dash = this._controls.dash;
-        this.viewSelector = this._controls.viewSelector;
-
-        // Add our same-line elements after the search entry
-        this._overview.add(this._controls.actor, { y_fill: true, expand: true });
-
-        // TODO - recalculate everything when desktop size changes
-        this.dashIconSize = this._dash.iconSize;
-        this._dash.connect('icon-size-changed', () => {
-            this.dashIconSize = this._dash.iconSize;
-        });
-
         Main.layoutManager.connect('monitors-changed', this._relayout.bind(this));
         this._relayout();
     }
@@ -300,7 +341,7 @@ var Overview = class {
 
     _resetWindowSwitchTimeout() {
         if (this._windowSwitchTimeoutId != 0) {
-            Mainloop.source_remove(this._windowSwitchTimeoutId);
+            GLib.source_remove(this._windowSwitchTimeoutId);
             this._windowSwitchTimeoutId = 0;
         }
     }
@@ -323,7 +364,9 @@ var Overview = class {
 
         if (targetIsWindow) {
             this._lastHoveredWindow = dragEvent.targetActor._delegate.metaWindow;
-            this._windowSwitchTimeoutId = Mainloop.timeout_add(DND_WINDOW_SWITCH_TIMEOUT,
+            this._windowSwitchTimeoutId = GLib.timeout_add(
+                GLib.PRIORITY_DEFAULT,
+                DND_WINDOW_SWITCH_TIMEOUT,
                 () => {
                     this._windowSwitchTimeoutId = 0;
                     Main.activateWindow(dragEvent.targetActor._delegate.metaWindow,
@@ -424,7 +467,7 @@ var Overview = class {
 
     focusSearch() {
         this.show();
-        this._searchEntry.grab_key_focus();
+        this._overview.searchEntry.grab_key_focus();
     }
 
     fadeInDesktop() {
@@ -433,7 +476,7 @@ var Overview = class {
         this._desktopFade.ease({
             opacity: 255,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: ANIMATION_TIME
+            duration: ANIMATION_TIME,
         });
     }
 
@@ -450,8 +493,8 @@ var Overview = class {
         this._desktopFade.show();
         this._desktopFade.ease({
             opacity: 0,
-            mode: Clutter.Animates.EASE_OUT_QUAD,
-            duration: ANIMATION_TIME
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
+            duration: ANIMATION_TIME,
         });
     }
 
@@ -462,11 +505,11 @@ var Overview = class {
     // the overview if the user both triggered the hot corner and
     // clicked the Activities button.
     shouldToggleByCornerOrButton() {
-        if (this.animationInProgress)
+        if (this._animationInProgress)
             return false;
         if (this._inItemDrag || this._inWindowDrag)
             return false;
-        if (this._activationTime == 0 ||
+        if (!this._activationTime ||
             GLib.get_monotonic_time() / GLib.USEC_PER_SEC - this._activationTime > OVERVIEW_ACTIVATION_TIMEOUT)
             return true;
         return false;
@@ -476,23 +519,22 @@ var Overview = class {
         // We delay grab changes during animation so that when removing the
         // overview we don't have a problem with the release of a press/release
         // going to an application.
-        if (this.animationInProgress)
+        if (this._animationInProgress)
             return true;
 
         if (this._shown) {
             let shouldBeModal = !this._inXdndDrag;
-            if (shouldBeModal) {
-                if (!this._modal) {
-                    if (Main.pushModal(this._overview,
-                                       { actionMode: Shell.ActionMode.OVERVIEW })) {
-                        this._modal = true;
-                    } else {
-                        this.hide();
-                        return false;
-                    }
+            if (shouldBeModal && !this._modal) {
+                let actionMode = Shell.ActionMode.OVERVIEW;
+                if (Main.pushModal(this._overview, { actionMode })) {
+                    this._modal = true;
+                } else {
+                    this.hide();
+                    return false;
                 }
             }
         } else {
+            // eslint-disable-next-line no-lonely-if
             if (this._modal) {
                 Main.popModal(this._overview);
                 this._modal = false;
@@ -520,12 +562,12 @@ var Overview = class {
 
 
     _animateVisible() {
-        if (this.visible || this.animationInProgress)
+        if (this._visible || this._animationInProgress)
             return;
 
-        this.visible = true;
-        this.animationInProgress = true;
-        this.visibleTarget = true;
+        this._visible = true;
+        this._animationInProgress = true;
+        this._visibleTarget = true;
         this._activationTime = GLib.get_monotonic_time() / GLib.USEC_PER_SEC;
 
         Meta.disable_unredirect_for_display(global.display);
@@ -536,17 +578,18 @@ var Overview = class {
             opacity: 255,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             duration: ANIMATION_TIME,
-            onComplete: () => this._showDone()
+            onComplete: () => this._showDone(),
         });
         this._shadeBackgrounds();
 
-        this._coverPane.raise_top();
+        Main.layoutManager.overviewGroup.set_child_above_sibling(
+            this._coverPane, null);
         this._coverPane.show();
         this.emit('showing');
     }
 
     _showDone() {
-        this.animationInProgress = false;
+        this._animationInProgress = false;
         this._desktopFade.hide();
         this._coverPane.hide();
 
@@ -572,8 +615,8 @@ var Overview = class {
         let event = Clutter.get_current_event();
         if (event) {
             let type = event.type();
-            let button = (type == Clutter.EventType.BUTTON_PRESS ||
-                          type == Clutter.EventType.BUTTON_RELEASE);
+            let button = type == Clutter.EventType.BUTTON_PRESS ||
+                          type == Clutter.EventType.BUTTON_RELEASE;
             let ctrl = (event.get_state() & Clutter.ModifierType.CONTROL_MASK) != 0;
             if (button && ctrl)
                 return;
@@ -586,11 +629,11 @@ var Overview = class {
     }
 
     _animateNotVisible() {
-        if (!this.visible || this.animationInProgress)
+        if (!this._visible || this._animationInProgress)
             return;
 
-        this.animationInProgress = true;
-        this.visibleTarget = false;
+        this._animationInProgress = true;
+        this._visibleTarget = false;
 
         this.viewSelector.animateFromOverview();
 
@@ -599,11 +642,12 @@ var Overview = class {
             opacity: 0,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             duration: ANIMATION_TIME,
-            onComplete: () => this._hideDone()
+            onComplete: () => this._hideDone(),
         });
         this._unshadeBackgrounds();
 
-        this._coverPane.raise_top();
+        Main.layoutManager.overviewGroup.set_child_above_sibling(
+            this._coverPane, null);
         this._coverPane.show();
         this.emit('hiding');
     }
@@ -616,8 +660,8 @@ var Overview = class {
         this._desktopFade.hide();
         this._coverPane.hide();
 
-        this.visible = false;
-        this.animationInProgress = false;
+        this._visible = false;
+        this._animationInProgress = false;
 
         this.emit('hidden');
         // Handle any calls to show* while we were hiding
@@ -633,14 +677,17 @@ var Overview = class {
         if (this.isDummy)
             return;
 
-        if (this.visible)
+        if (this._visible)
             this.hide();
         else
             this.show();
     }
 
     getShowAppsButton() {
-        return this._dash.showAppsButton;
+        logError(new Error('Usage of Overview.\'getShowAppsButton\' is deprecated, ' +
+            'use \'dash.showAppsButton\' property instead'));
+
+        return this.dash.showAppsButton;
     }
 };
 Signals.addSignalMethods(Overview.prototype);

js/ui/overviewControls.js

@@ -12,17 +12,17 @@ const WorkspaceThumbnail = imports.ui.workspaceThumbnail;
 var SIDE_CONTROLS_ANIMATION_TIME = 160;
 
 function getRtlSlideDirection(direction, actor) {
-    let rtl = (actor.text_direction == Clutter.TextDirection.RTL);
-    if (rtl)
-        direction = (direction == SlideDirection.LEFT) ?
-            SlideDirection.RIGHT : SlideDirection.LEFT;
-
+    let rtl = actor.text_direction == Clutter.TextDirection.RTL;
+    if (rtl) {
+        direction = direction == SlideDirection.LEFT
+            ? SlideDirection.RIGHT : SlideDirection.LEFT;
+    }
     return direction;
 }
 
 var SlideDirection = {
     LEFT: 0,
-    RIGHT: 1
+    RIGHT: 1,
 };
 
 var SlideLayout = GObject.registerClass({
@@ -34,8 +34,8 @@ var SlideLayout = GObject.registerClass({
         'translation-x': GObject.ParamSpec.double(
             'translation-x', 'translation-x', 'translation-x',
             GObject.ParamFlags.READWRITE,
-            -Infinity, Infinity, 0)
-    }
+            -Infinity, Infinity, 0),
+    },
 }, class SlideLayout extends Clutter.FixedLayout {
     _init(params) {
         this._slideX = 1;
@@ -67,8 +67,9 @@ var SlideLayout = GObject.registerClass({
         // flags only determine what to do if the allocated box is bigger
         // than the actor's box.
         let realDirection = getRtlSlideDirection(this._direction, child);
-        let alignX = (realDirection == SlideDirection.LEFT) ? (availWidth - natWidth)
-                                                            : (availWidth - natWidth * this._slideX);
+        let alignX = realDirection == SlideDirection.LEFT
+            ? availWidth - natWidth
+            : availWidth - natWidth * this._slideX;
 
         let actorBox = new Clutter.ActorBox();
         actorBox.x1 = box.x1 + alignX + this._translationX;
@@ -117,18 +118,21 @@ var SlideLayout = GObject.registerClass({
     }
 });
 
-var SlidingControl = class {
-    constructor(params) {
+var SlidingControl = GObject.registerClass(
+class SlidingControl extends St.Widget {
+    _init(params) {
         params = Params.parse(params, { slideDirection: SlideDirection.LEFT });
 
-        this._visible = true;
-        this._inDrag = false;
-
         this.layout = new SlideLayout();
         this.layout.slideDirection = params.slideDirection;
-        this.actor = new St.Widget({ layout_manager: this.layout,
-                                     style_class: 'overview-controls',
-                                     clip_to_allocation: true });
+        super._init({
+            layout_manager: this.layout,
+            style_class: 'overview-controls',
+            clip_to_allocation: true,
+        });
+
+        this._visible = true;
+        this._inDrag = false;
 
         Main.overview.connect('hiding', this._onOverviewHiding.bind(this));
 
@@ -146,25 +150,25 @@ var SlidingControl = class {
     }
 
     _updateSlide() {
-        this.actor.ease_property('@layout.slide-x', this._getSlide(), {
+        this.ease_property('@layout.slide-x', this._getSlide(), {
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             duration: SIDE_CONTROLS_ANIMATION_TIME,
         });
     }
 
     getVisibleWidth() {
-        let child = this.actor.get_first_child();
+        let child = this.get_first_child();
         let [, , natWidth] = child.get_preferred_size();
         return natWidth;
     }
 
     _getTranslation() {
-        let child = this.actor.get_first_child();
+        let child = this.get_first_child();
         let direction = getRtlSlideDirection(this.layout.slideDirection, child);
         let visibleWidth = this.getVisibleWidth();
 
         if (direction == SlideDirection.LEFT)
-            return - visibleWidth;
+            return -visibleWidth;
         else
             return visibleWidth;
     }
@@ -174,18 +178,17 @@ var SlidingControl = class {
         let translationEnd = 0;
         let translation = this._getTranslation();
 
-        let shouldShow = (this._getSlide() > 0);
-        if (shouldShow) {
+        let shouldShow = this._getSlide() > 0;
+        if (shouldShow)
             translationStart = translation;
-        } else {
+        else
             translationEnd = translation;
-        }
 
         if (this.layout.translation_x == translationEnd)
             return;
 
         this.layout.translation_x = translationStart;
-        this.actor.ease_property('@layout.translation-x', translationEnd, {
+        this.ease_property('@layout.translation-x', translationEnd, {
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
             duration: SIDE_CONTROLS_ANIMATION_TIME,
         });
@@ -217,18 +220,18 @@ var SlidingControl = class {
     }
 
     fadeIn() {
-        this.actor.ease({
+        this.ease({
             opacity: 255,
             duration: SIDE_CONTROLS_ANIMATION_TIME / 2,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD
+            mode: Clutter.AnimationMode.EASE_IN_QUAD,
         });
     }
 
     fadeHalf() {
-        this.actor.ease({
+        this.ease({
             opacity: 128,
             duration: SIDE_CONTROLS_ANIMATION_TIME / 2,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
     }
 
@@ -248,36 +251,38 @@ var SlidingControl = class {
         // selector; this means we can now safely set the full slide for
         // the next page, since slideIn or slideOut might have been called,
         // changing the visiblity
+        this.remove_transition('@layout.slide-x');
         this.layout.slide_x = this._getSlide();
         this._updateTranslation();
     }
-};
+});
 
-var ThumbnailsSlider = class extends SlidingControl {
-    constructor(thumbnailsBox) {
-        super({ slideDirection: SlideDirection.RIGHT });
+var ThumbnailsSlider = GObject.registerClass(
+class ThumbnailsSlider extends SlidingControl {
+    _init(thumbnailsBox) {
+        super._init({ slideDirection: SlideDirection.RIGHT });
 
         this._thumbnailsBox = thumbnailsBox;
 
-        this.actor.request_mode = Clutter.RequestMode.WIDTH_FOR_HEIGHT;
-        this.actor.reactive = true;
-        this.actor.track_hover = true;
-        this.actor.add_actor(this._thumbnailsBox);
+        this.request_mode = Clutter.RequestMode.WIDTH_FOR_HEIGHT;
+        this.reactive = true;
+        this.track_hover = true;
+        this.add_actor(this._thumbnailsBox);
 
         Main.layoutManager.connect('monitors-changed', this._updateSlide.bind(this));
         global.workspace_manager.connect('active-workspace-changed',
                                          this._updateSlide.bind(this));
         global.workspace_manager.connect('notify::n-workspaces',
                                          this._updateSlide.bind(this));
-        this.actor.connect('notify::hover', this._updateSlide.bind(this));
-        this._thumbnailsBox.bind_property('visible', this.actor, 'visible', GObject.BindingFlags.SYNC_CREATE);
+        this.connect('notify::hover', this._updateSlide.bind(this));
+        this._thumbnailsBox.bind_property('visible', this, 'visible', GObject.BindingFlags.SYNC_CREATE);
     }
 
     _getAlwaysZoomOut() {
         // Always show the pager on hover, during a drag, or if workspaces are
         // actually used, e.g. there are windows on any non-active workspace
         let workspaceManager = global.workspace_manager;
-        let alwaysZoomOut = this.actor.hover ||
+        let alwaysZoomOut = this.hover ||
                             this._inDrag ||
                             !Meta.prefs_get_dynamic_workspaces() ||
                             workspaceManager.n_workspaces > 2 ||
@@ -302,12 +307,12 @@ var ThumbnailsSlider = class extends SlidingControl {
     }
 
     getNonExpandedWidth() {
-        let child = this.actor.get_first_child();
+        let child = this.get_first_child();
         return child.get_theme_node().get_length('visible-width');
     }
 
     _onDragEnd() {
-        this.actor.sync_hover();
+        this.sync_hover();
         super._onDragEnd();
     }
 
@@ -319,7 +324,7 @@ var ThumbnailsSlider = class extends SlidingControl {
         if (alwaysZoomOut)
             return 1;
 
-        let child = this.actor.get_first_child();
+        let child = this.get_first_child();
         let preferredHeight = child.get_preferred_height(-1)[1];
         let expandedWidth = child.get_preferred_width(preferredHeight)[1];
 
@@ -333,24 +338,25 @@ var ThumbnailsSlider = class extends SlidingControl {
         else
             return this.getNonExpandedWidth();
     }
-};
+});
 
-var DashSlider = class extends SlidingControl {
-    constructor(dash) {
-        super({ slideDirection: SlideDirection.LEFT });
+var DashSlider = GObject.registerClass(
+class DashSlider extends SlidingControl {
+    _init(dash) {
+        super._init({ slideDirection: SlideDirection.LEFT });
 
         this._dash = dash;
 
         // SlideLayout reads the actor's expand flags to decide
         // whether to allocate the natural size to its child, or the whole
         // available allocation
-        this._dash.actor.x_expand = true;
+        this._dash.x_expand = true;
 
-        this.actor.x_expand = true;
-        this.actor.x_align = Clutter.ActorAlign.START;
-        this.actor.y_expand = true;
+        this.x_expand = true;
+        this.x_align = Clutter.ActorAlign.START;
+        this.y_expand = true;
 
-        this.actor.add_actor(this._dash.actor);
+        this.add_actor(this._dash);
 
         this._dash.connect('icon-size-changed', this._updateSlide.bind(this));
     }
@@ -369,7 +375,7 @@ var DashSlider = class extends SlidingControl {
     _onWindowDragEnd() {
         this.fadeIn();
     }
-};
+});
 
 var DashSpacer = GObject.registerClass(
 class DashSpacer extends St.Widget {
@@ -414,12 +420,21 @@ var ControlsLayout = GObject.registerClass({
     }
 });
 
-var ControlsManager = class {
-    constructor(searchEntry) {
+var ControlsManager = GObject.registerClass(
+class ControlsManager extends St.Widget {
+    _init(searchEntry) {
+        let layout = new ControlsLayout();
+        super._init({
+            layout_manager: layout,
+            x_expand: true,
+            y_expand: true,
+            clip_to_allocation: true,
+        });
+
         this.dash = new Dash.Dash();
         this._dashSlider = new DashSlider(this.dash);
         this._dashSpacer = new DashSpacer();
-        this._dashSpacer.setDashActor(this._dashSlider.actor);
+        this._dashSpacer.setDashActor(this._dashSlider);
 
         this._thumbnailsBox = new WorkspaceThumbnail.ThumbnailsBox();
         this._thumbnailsSlider = new ThumbnailsSlider(this._thumbnailsBox);
@@ -429,20 +444,15 @@ var ControlsManager = class {
         this.viewSelector.connect('page-changed', this._setVisibility.bind(this));
         this.viewSelector.connect('page-empty', this._onPageEmpty.bind(this));
 
-        let layout = new ControlsLayout();
-        this.actor = new St.Widget({ layout_manager: layout,
-                                     x_expand: true, y_expand: true,
-                                     clip_to_allocation: true });
         this._group = new St.BoxLayout({ name: 'overview-group',
                                          x_expand: true, y_expand: true });
-        this.actor.add_actor(this._group);
+        this.add_actor(this._group);
 
-        this.actor.add_actor(this._dashSlider.actor);
+        this.add_actor(this._dashSlider);
 
         this._group.add_actor(this._dashSpacer);
-        this._group.add(this.viewSelector.actor, { x_fill: true,
-                                                   expand: true });
-        this._group.add_actor(this._thumbnailsSlider.actor);
+        this._group.add_child(this.viewSelector);
+        this._group.add_actor(this._thumbnailsSlider);
 
         layout.connect('allocation-changed', this._updateWorkspacesGeometry.bind(this));
 
@@ -450,18 +460,18 @@ var ControlsManager = class {
     }
 
     _updateWorkspacesGeometry() {
-        let [x, y] = this.actor.get_transformed_position();
-        let [width, height] = this.actor.get_transformed_size();
-        let geometry = { x: x, y: y, width: width, height: height };
+        let [x, y] = this.get_transformed_position();
+        let [width, height] = this.get_transformed_size();
+        let geometry = { x, y, width, height };
 
-        let spacing = this.actor.get_theme_node().get_length('spacing');
+        let spacing = this.get_theme_node().get_length('spacing');
         let dashWidth = this._dashSlider.getVisibleWidth() + spacing;
         let thumbnailsWidth = this._thumbnailsSlider.getNonExpandedWidth() + spacing;
 
         geometry.width -= dashWidth;
         geometry.width -= thumbnailsWidth;
 
-        if (this.actor.get_text_direction() == Clutter.TextDirection.LTR)
+        if (this.get_text_direction() == Clutter.TextDirection.LTR)
             geometry.x += dashWidth;
         else
             geometry.x += thumbnailsWidth;
@@ -479,9 +489,9 @@ var ControlsManager = class {
             return;
 
         let activePage = this.viewSelector.getActivePage();
-        let dashVisible = (activePage == ViewSelector.ViewPage.WINDOWS ||
-                           activePage == ViewSelector.ViewPage.APPS);
-        let thumbnailsVisible = (activePage == ViewSelector.ViewPage.WINDOWS);
+        let dashVisible = activePage == ViewSelector.ViewPage.WINDOWS ||
+                           activePage == ViewSelector.ViewPage.APPS;
+        let thumbnailsVisible = activePage == ViewSelector.ViewPage.WINDOWS;
 
         if (dashVisible)
             this._dashSlider.slideIn();
@@ -499,7 +509,7 @@ var ControlsManager = class {
             return;
 
         let activePage = this.viewSelector.getActivePage();
-        this._dashSpacer.visible = (activePage == ViewSelector.ViewPage.WINDOWS);
+        this._dashSpacer.visible = activePage == ViewSelector.ViewPage.WINDOWS;
     }
 
     _onPageEmpty() {
@@ -508,4 +518,4 @@ var ControlsManager = class {
 
         this._updateSpacerVisibility();
     }
-};
+});

js/ui/padOsd.js

@@ -1,5 +1,5 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PadOsdService */
+/* exported PadOsd, PadOsdService */
 
 const { Atk, Clutter, GDesktopEnums, Gio,
         GLib, GObject, Gtk, Meta, Rsvg, St } = imports.gi;
@@ -22,40 +22,45 @@ const CCW = 1;
 const UP = 0;
 const DOWN = 1;
 
-var PadChooser = class {
-    constructor(device, groupDevices) {
-        this.actor = new St.Button({ style_class: 'pad-chooser-button',
-                                     toggle_mode: true,
-                                     x_fill: false,
-                                     y_fill: false,
-                                     x_align: St.Align.MIDDLE,
-                                     y_align: St.Align.MIDDLE });
+var PadChooser = GObject.registerClass({
+    Signals: { 'pad-selected': { param_types: [Clutter.InputDevice.$gtype] } },
+}, class PadChooser extends St.Button {
+    _init(device, groupDevices) {
+        super._init({
+            style_class: 'pad-chooser-button',
+            toggle_mode: true,
+        });
         this.currentDevice = device;
         this._padChooserMenu = null;
 
-        let arrow = new St.Icon({ style_class: 'popup-menu-arrow',
-                                  icon_name: 'pan-down-symbolic',
-                                  accessible_role: Atk.Role.ARROW });
-        this.actor.set_child(arrow);
+        let arrow = new St.Icon({
+            style_class: 'popup-menu-arrow',
+            icon_name: 'pan-down-symbolic',
+            accessible_role: Atk.Role.ARROW,
+            x_align: Clutter.ActorAlign.CENTER,
+            y_align: Clutter.ActorAlign.CENTER,
+        });
+        this.set_child(arrow);
         this._ensureMenu(groupDevices);
 
-        this.actor.connect('destroy', this._onDestroy.bind(this));
-        this.actor.connect('clicked', actor => {
-            if (actor.get_checked()) {
-                if (this._padChooserMenu != null)
-                    this._padChooserMenu.open(true);
-                else
-                    this.set_checked(false);
-            } else {
-                this._padChooserMenu.close(true);
-            }
-        });
+        this.connect('destroy', this._onDestroy.bind(this));
+    }
+
+    vfunc_clicked() {
+        if (this.get_checked()) {
+            if (this._padChooserMenu != null)
+                this._padChooserMenu.open(true);
+            else
+                this.set_checked(false);
+        } else {
+            this._padChooserMenu.close(true);
+        }
     }
 
     _ensureMenu(devices) {
-        this._padChooserMenu =  new PopupMenu.PopupMenu(this.actor, 0.5, St.Side.TOP);
+        this._padChooserMenu =  new PopupMenu.PopupMenu(this, 0.5, St.Side.TOP);
         this._padChooserMenu.connect('menu-closed', () => {
-            this.actor.set_checked(false);
+            this.set_checked(false);
         });
         this._padChooserMenu.actor.hide();
         Main.uiGroup.add_actor(this._padChooserMenu.actor);
@@ -78,24 +83,19 @@ var PadChooser = class {
     update(devices) {
         if (this._padChooserMenu)
             this._padChooserMenu.actor.destroy();
-        this.actor.set_checked(false);
+        this.set_checked(false);
         this._ensureMenu(devices);
     }
+});
 
-    destroy() {
-        this.actor.destroy();
-    }
-};
-Signals.addSignalMethods(PadChooser.prototype);
-
-var KeybindingEntry = class {
-    constructor() {
-        this.actor = new St.Entry({ hint_text: _("New shortcut…"),
-                                    style: 'width: 10em' });
-        this.actor.connect('captured-event', this._onCapturedEvent.bind(this));
+var KeybindingEntry = GObject.registerClass({
+    Signals: { 'keybinding-edited': {} },
+}, class KeybindingEntry extends St.Entry {
+    _init() {
+        super._init({ hint_text: _("New shortcut…"), style: 'width: 10em' });
     }
 
-    _onCapturedEvent(actor, event) {
+    vfunc_captured_event(event) {
         if (event.type() != Clutter.EventType.KEY_PRESS)
             return Clutter.EVENT_PROPAGATE;
 
@@ -103,23 +103,23 @@ var KeybindingEntry = class {
                                                     event.get_key_symbol(),
                                                     event.get_key_code(),
                                                     event.get_state());
-        this.actor.set_text(str);
+        this.set_text(str);
         this.emit('keybinding-edited', str);
         return Clutter.EVENT_STOP;
     }
-};
-Signals.addSignalMethods(KeybindingEntry.prototype);
+});
 
-var ActionComboBox = class {
-    constructor() {
-        this.actor = new St.Button({ style_class: 'button' });
-        this.actor.connect('clicked', this._onButtonClicked.bind(this));
-        this.actor.set_toggle_mode(true);
+var ActionComboBox = GObject.registerClass({
+    Signals: { 'action-selected': { param_types: [GObject.TYPE_INT] } },
+}, class ActionComboBox extends St.Button {
+    _init() {
+        super._init({ style_class: 'button' });
+        this.set_toggle_mode(true);
 
         let boxLayout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.HORIZONTAL,
                                                 spacing: 6 });
         let box = new St.Widget({ layout_manager: boxLayout });
-        this.actor.set_child(box);
+        this.set_child(box);
 
         this._label = new St.Label({ style_class: 'combo-box-label' });
         box.add_child(this._label);
@@ -131,9 +131,9 @@ var ActionComboBox = class {
                                   y_align: Clutter.ActorAlign.CENTER });
         box.add_child(arrow);
 
-        this._editMenu = new PopupMenu.PopupMenu(this.actor, 0, St.Side.TOP);
+        this._editMenu = new PopupMenu.PopupMenu(this, 0, St.Side.TOP);
         this._editMenu.connect('menu-closed', () => {
-            this.actor.set_checked(false);
+            this.set_checked(false);
         });
         this._editMenu.actor.hide();
         Main.uiGroup.add_actor(this._editMenu.actor);
@@ -179,8 +179,8 @@ var ActionComboBox = class {
         this._editMenu.close(true);
     }
 
-    _onButtonClicked() {
-        if (this.actor.get_checked())
+    vfunc_clicked() {
+        if (this.get_checked())
             this.popup();
         else
             this.popdown();
@@ -189,38 +189,39 @@ var ActionComboBox = class {
     setButtonActionsActive(active) {
         this._buttonItems.forEach(item => item.setSensitive(active));
     }
-};
-Signals.addSignalMethods(ActionComboBox.prototype);
+});
 
-var ActionEditor = class {
-    constructor() {
+var ActionEditor = GObject.registerClass({
+    Signals: { 'done': {} },
+}, class ActionEditor extends St.Widget {
+    _init() {
         let boxLayout = new Clutter.BoxLayout({ orientation: Clutter.Orientation.HORIZONTAL,
                                                 spacing: 12 });
 
-        this.actor = new St.Widget({ layout_manager: boxLayout });
+        super._init({ layout_manager: boxLayout });
 
         this._actionComboBox = new ActionComboBox();
         this._actionComboBox.connect('action-selected', this._onActionSelected.bind(this));
-        this.actor.add_actor(this._actionComboBox.actor);
+        this.add_actor(this._actionComboBox);
 
         this._keybindingEdit = new KeybindingEntry();
         this._keybindingEdit.connect('keybinding-edited', this._onKeybindingEdited.bind(this));
-        this.actor.add_actor(this._keybindingEdit.actor);
+        this.add_actor(this._keybindingEdit);
 
         this._doneButton = new St.Button({ label: _("Done"),
                                            style_class: 'button',
                                            x_expand: false });
         this._doneButton.connect('clicked', this._onEditingDone.bind(this));
-        this.actor.add_actor(this._doneButton);
+        this.add_actor(this._doneButton);
     }
 
     _updateKeybindingEntryState() {
         if (this._currentAction == GDesktopEnums.PadButtonAction.KEYBINDING) {
-            this._keybindingEdit.actor.set_text(this._currentKeybinding);
-            this._keybindingEdit.actor.show();
-            this._keybindingEdit.actor.grab_key_focus();
+            this._keybindingEdit.set_text(this._currentKeybinding);
+            this._keybindingEdit.show();
+            this._keybindingEdit.grab_key_focus();
         } else {
-            this._keybindingEdit.actor.hide();
+            this._keybindingEdit.hide();
         }
     }
 
@@ -232,13 +233,13 @@ var ActionEditor = class {
         this._actionComboBox.setAction(this._currentAction);
         this._updateKeybindingEntryState();
 
-        let isButton = (action == Meta.PadActionType.BUTTON);
+        let isButton = action == Meta.PadActionType.BUTTON;
         this._actionComboBox.setButtonActionsActive(isButton);
     }
 
     close() {
         this._actionComboBox.popdown();
-        this.actor.hide();
+        this.hide();
     }
 
     _onKeybindingEdited(entry, keybinding) {
@@ -272,8 +273,7 @@ var ActionEditor = class {
         this.close();
         this.emit('done');
     }
-};
-Signals.addSignalMethods(ActionEditor.prototype);
+});
 
 var PadDiagram = GObject.registerClass({
     Properties: {
@@ -291,7 +291,7 @@ var PadDiagram = GObject.registerClass({
                                                  'Editor actor',
                                                  GObject.ParamFlags.READWRITE |
                                                  GObject.ParamFlags.CONSTRUCT_ONLY,
-                                                 Clutter.Actor.$gtype)
+                                                 Clutter.Actor.$gtype),
     },
 }, class PadDiagram extends St.DrawingArea {
     _init(params) {
@@ -344,17 +344,19 @@ var PadDiagram = GObject.registerClass({
     }
 
     _wrappingSvgHeader() {
-        return ('<?xml version="1.0" encoding="UTF-8" standalone="no"?>' +
-                '<svg version="1.1" xmlns="http://www.w3.org/2000/svg" ' +
-                'xmlns:xi="http://www.w3.org/2001/XInclude" ' +
-                `width="${this._imageWidth}" height="${this._imageHeight}"> ` +
-                '<style type="text/css">');
+        return '<?xml version="1.0" encoding="UTF-8" standalone="no"?>' +
+               '<svg version="1.1" xmlns="http://www.w3.org/2000/svg" ' +
+               'xmlns:xi="http://www.w3.org/2001/XInclude" ' +
+               `width="${ // " (give xgettext the paired quotes it expects)
+                   this._imageWidth
+               }" height="${this._imageHeight}"> ` + // "
+               '<style type="text/css">';
     }
 
     _wrappingSvgFooter() {
-        return ('</style>' +
+        return '</style>' +
                 '<xi:include href="' + this._imagePath + '" />' +
-                '</svg>');
+                '</svg>';
     }
 
     _cssString() {
@@ -615,8 +617,21 @@ var PadDiagram = GObject.registerClass({
     }
 });
 
-var PadOsd = class {
-    constructor(padDevice, settings, imagePath, editionMode, monitorIndex) {
+var PadOsd = GObject.registerClass({
+    Signals: {
+        'pad-selected': { param_types: [Clutter.InputDevice.$gtype] },
+        'closed': {},
+    },
+}, class PadOsd extends St.BoxLayout {
+    _init(padDevice, settings, imagePath, editionMode, monitorIndex) {
+        super._init({
+            style_class: 'pad-osd-window',
+            vertical: true,
+            x_expand: true,
+            y_expand: true,
+            reactive: true,
+        });
+
         this.padDevice = padDevice;
         this._groupPads = [padDevice];
         this._settings = settings;
@@ -653,23 +668,18 @@ var PadOsd = class {
                 this._groupPads.push(device);
         });
 
-        this.actor = new St.BoxLayout({ style_class: 'pad-osd-window',
-                                        x_expand: true,
-                                        y_expand: true,
-                                        vertical: true,
-                                        reactive: true });
-        this.actor.connect('destroy', this._onDestroy.bind(this));
-        Main.uiGroup.add_actor(this.actor);
+        this.connect('destroy', this._onDestroy.bind(this));
+        Main.uiGroup.add_actor(this);
 
         this._monitorIndex = monitorIndex;
         let constraint = new Layout.MonitorConstraint({ index: monitorIndex });
-        this.actor.add_constraint(constraint);
+        this.add_constraint(constraint);
 
         this._titleBox = new St.BoxLayout({ style_class: 'pad-osd-title-box',
                                             vertical: false,
                                             x_expand: false,
                                             x_align: Clutter.ActorAlign.CENTER });
-        this.actor.add_actor(this._titleBox);
+        this.add_actor(this._titleBox);
 
         let labelBox = new St.BoxLayout({ style_class: 'pad-osd-title-menu-box',
                                           vertical: true });
@@ -690,10 +700,10 @@ var PadOsd = class {
 
         this._padDiagram = new PadDiagram({ image: this._imagePath,
                                             left_handed: settings.get_boolean('left-handed'),
-                                            editor_actor: this._actionEditor.actor,
+                                            editor_actor: this._actionEditor,
                                             x_expand: true,
                                             y_expand: true });
-        this.actor.add_actor(this._padDiagram);
+        this.add_actor(this._padDiagram);
 
         // FIXME: Fix num buttons.
         let i = 0;
@@ -724,18 +734,20 @@ var PadOsd = class {
                                         x_expand: true,
                                         x_align: Clutter.ActorAlign.CENTER,
                                         y_align: Clutter.ActorAlign.CENTER });
-        this.actor.add_actor(buttonBox);
-        this._editButton = new St.Button({ label: _("Edit…"),
-                                           style_class: 'button',
-                                           x_align: Clutter.ActorAlign.CENTER,
-                                           can_focus: true });
+        this.add_actor(buttonBox);
+        this._editButton = new St.Button({
+            label: _('Edit…'),
+            style_class: 'button',
+            can_focus: true,
+            x_align: Clutter.ActorAlign.CENTER,
+        });
         this._editButton.connect('clicked', () => {
             this.setEditionMode(true);
         });
         buttonBox.add_actor(this._editButton);
 
         this._syncEditionMode();
-        Main.pushModal(this.actor);
+        Main.pushModal(this);
     }
 
     _updatePadChooser() {
@@ -745,7 +757,7 @@ var PadOsd = class {
                 this._padChooser.connect('pad-selected', (chooser, pad) => {
                     this._requestForOtherPad(pad);
                 });
-                this._titleBox.add_child(this._padChooser.actor);
+                this._titleBox.add_child(this._padChooser);
             } else {
                 this._padChooser.update(this._groupPads);
             }
@@ -785,7 +797,7 @@ var PadOsd = class {
             this._padDiagram.deactivateButton(event.get_button());
             return Clutter.EVENT_STOP;
         } else if (event.type() == Clutter.EventType.KEY_PRESS &&
-                   (!this._editionMode || event.get_key_symbol() == Clutter.Escape)) {
+                   (!this._editionMode || event.get_key_symbol() === Clutter.KEY_Escape)) {
             if (this._editedAction != null)
                 this._endActionEdition();
             else
@@ -832,22 +844,23 @@ var PadOsd = class {
             this._tipLabel.set_text(_("Press any key to exit"));
         }
 
-        this._titleLabel.clutter_text.set_markup('<span size="larger"><b>' + title + '</b></span>');
+        this._titleLabel.clutter_text.set_markup(
+            `<span size="larger"><b>${title}</b></span>`);
     }
 
     _isEditedAction(type, number, dir) {
         if (!this._editedAction)
             return false;
 
-        return (this._editedAction.type == type &&
+        return this._editedAction.type == type &&
                 this._editedAction.number == number &&
-                this._editedAction.dir == dir);
+                this._editedAction.dir == dir;
     }
 
     _followUpActionEdition(str) {
         let { type, dir, number, mode } = this._editedAction;
-        let hasNextAction = (type == Meta.PadActionType.RING && dir == CCW ||
-                             type == Meta.PadActionType.STRIP && dir == UP);
+        let hasNextAction = type == Meta.PadActionType.RING && dir == CCW ||
+                             type == Meta.PadActionType.STRIP && dir == UP;
         if (!hasNextAction)
             return false;
 
@@ -918,12 +931,8 @@ var PadOsd = class {
         this._syncEditionMode();
     }
 
-    destroy() {
-        this.actor.destroy();
-    }
-
     _onDestroy() {
-        Main.popModal(this.actor);
+        Main.popModal(this);
         this._actionEditor.close();
 
         let deviceManager = Clutter.DeviceManager.get_default();
@@ -941,11 +950,9 @@ var PadOsd = class {
             this._capturedEventId = 0;
         }
 
-        this.actor = null;
         this.emit('closed');
     }
-};
-Signals.addSignalMethods(PadOsd.prototype);
+});
 
 const PadOsdIface = loadInterfaceXML('org.gnome.Shell.Wacom.PadOsd');
 

js/ui/pageIndicators.js

@@ -1,10 +1,15 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
 /* exported PageIndicators, AnimatedPageIndicators */
 
-const { Clutter, GLib, GObject, Meta, St } = imports.gi;
+const { Clutter, GLib, Graphene, GObject, Meta, St } = imports.gi;
 
 const { ANIMATION_TIME_OUT, ANIMATION_MAX_DELAY_OUT_FOR_ITEM, AnimationDirection } = imports.ui.iconGrid;
 
+const INDICATOR_INACTIVE_OPACITY = 128;
+const INDICATOR_INACTIVE_OPACITY_HOVER = 255;
+const INDICATOR_INACTIVE_SCALE = 2 / 3;
+const INDICATOR_INACTIVE_SCALE_PRESSED = 0.5;
+
 var INDICATORS_BASE_TIME = 250;
 var INDICATORS_BASE_TIME_OUT = 125;
 var INDICATORS_ANIMATION_DELAY = 125;
@@ -12,24 +17,27 @@ var INDICATORS_ANIMATION_DELAY_OUT = 62.5;
 var INDICATORS_ANIMATION_MAX_TIME = 750;
 var SWITCH_TIME = 400;
 var INDICATORS_ANIMATION_MAX_TIME_OUT =
-    Math.min (SWITCH_TIME,
-              ANIMATION_TIME_OUT + ANIMATION_MAX_DELAY_OUT_FOR_ITEM);
+    Math.min(SWITCH_TIME,
+             ANIMATION_TIME_OUT + ANIMATION_MAX_DELAY_OUT_FOR_ITEM);
 
 var ANIMATION_DELAY = 100;
 
 var PageIndicators = GObject.registerClass({
-    Signals: { 'page-activated': { param_types: [GObject.TYPE_INT] } }
+    Signals: { 'page-activated': { param_types: [GObject.TYPE_INT] } },
 }, class PageIndicators extends St.BoxLayout {
-    _init(vertical = true) {
-        super._init({ style_class: 'page-indicators',
-                      vertical,
-                      x_expand: true, y_expand: true,
-                      x_align: vertical ? Clutter.ActorAlign.END : Clutter.ActorAlign.CENTER,
-                      y_align: vertical ? Clutter.ActorAlign.CENTER : Clutter.ActorAlign.END,
-                      reactive: true,
-                      clip_to_allocation: true });
+    _init(orientation = Clutter.Orientation.VERTICAL) {
+        let vertical = orientation == Clutter.Orientation.VERTICAL;
+        super._init({
+            style_class: 'page-indicators',
+            vertical,
+            x_expand: true, y_expand: true,
+            x_align: vertical ? Clutter.ActorAlign.END : Clutter.ActorAlign.CENTER,
+            y_align: vertical ? Clutter.ActorAlign.CENTER : Clutter.ActorAlign.END,
+            reactive: true,
+            clip_to_allocation: true,
+        });
         this._nPages = 0;
-        this._currentPage = undefined;
+        this._currentPosition = 0;
         this._reactive = true;
         this._reactive = true;
     }
@@ -63,13 +71,21 @@ var PageIndicators = GObject.registerClass({
                                                 button_mask: St.ButtonMask.ONE |
                                                              St.ButtonMask.TWO |
                                                              St.ButtonMask.THREE,
-                                                toggle_mode: true,
-                                                reactive: this._reactive,
-                                                checked: pageIndex == this._currentPage });
-                indicator.child = new St.Widget({ style_class: 'page-indicator-icon' });
+                                                reactive: this._reactive });
+                indicator.child = new St.Widget({
+                    style_class: 'page-indicator-icon',
+                    pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }),
+                });
                 indicator.connect('clicked', () => {
                     this.emit('page-activated', pageIndex);
                 });
+                indicator.connect('notify::hover', () => {
+                    this._updateIndicator(indicator, pageIndex);
+                });
+                indicator.connect('notify::pressed', () => {
+                    this._updateIndicator(indicator, pageIndex);
+                });
+                this._updateIndicator(indicator, pageIndex);
                 this.add_actor(indicator);
             }
         } else {
@@ -78,33 +94,57 @@ var PageIndicators = GObject.registerClass({
                 children[i].destroy();
         }
         this._nPages = nPages;
-        this.visible = (this._nPages > 1);
+        this.visible = this._nPages > 1;
     }
 
-    setCurrentPage(currentPage) {
-        this._currentPage = currentPage;
+    _updateIndicator(indicator, pageIndex) {
+        let progress =
+            Math.max(1 - Math.abs(this._currentPosition - pageIndex), 0);
+
+        let inactiveScale = indicator.pressed
+            ? INDICATOR_INACTIVE_SCALE_PRESSED : INDICATOR_INACTIVE_SCALE;
+        let inactiveOpacity = indicator.hover
+            ? INDICATOR_INACTIVE_OPACITY_HOVER : INDICATOR_INACTIVE_OPACITY;
+
+        let scale = inactiveScale + (1 - inactiveScale) * progress;
+        let opacity = inactiveOpacity + (255 - inactiveOpacity) * progress;
+
+        indicator.child.set_scale(scale, scale);
+        indicator.child.opacity = opacity;
+    }
+
+    setCurrentPosition(currentPosition) {
+        this._currentPosition = currentPosition;
 
         let children = this.get_children();
         for (let i = 0; i < children.length; i++)
-            children[i].set_checked(i == this._currentPage);
+            this._updateIndicator(children[i], i);
     }
 });
 
 var AnimatedPageIndicators = GObject.registerClass(
 class AnimatedPageIndicators extends PageIndicators {
     _init() {
-        super._init(true);
+        super._init();
+        this.connect('destroy', this._onDestroy.bind(this));
+    }
 
-        this.connect('notify::mapped', () => {
-            if (!this.mapped)
-                return;
+    _onDestroy() {
+        if (this.animateLater) {
+            Meta.later_remove(this.animateLater);
+            this.animateLater = 0;
+        }
+    }
 
-            // Implicit animations are skipped for unmapped actors, and our
-            // children aren't mapped yet, so defer to a later handler
-            Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
-                this.animateIndicators(AnimationDirection.IN);
-                return GLib.SOURCE_REMOVE;
-            });
+    vfunc_map() {
+        super.vfunc_map();
+
+        // Implicit animations are skipped for unmapped actors, and our
+        // children aren't mapped yet, so defer to a later handler
+        this.animateLater = Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
+            this.animateLater = 0;
+            this.animateIndicators(AnimationDirection.IN);
+            return GLib.SOURCE_REMOVE;
         });
     }
 
@@ -126,12 +166,14 @@ class AnimatedPageIndicators extends PageIndicators {
             offset = children[0].width;
 
         let isAnimationIn = animationDirection == AnimationDirection.IN;
-        let delay = isAnimationIn ? INDICATORS_ANIMATION_DELAY :
-                                    INDICATORS_ANIMATION_DELAY_OUT;
+        let delay = isAnimationIn
+            ? INDICATORS_ANIMATION_DELAY
+            : INDICATORS_ANIMATION_DELAY_OUT;
         let baseTime = isAnimationIn ? INDICATORS_BASE_TIME : INDICATORS_BASE_TIME_OUT;
         let totalAnimationTime = baseTime + delay * this._nPages;
-        let maxTime = isAnimationIn ? INDICATORS_ANIMATION_MAX_TIME :
-                                      INDICATORS_ANIMATION_MAX_TIME_OUT;
+        let maxTime = isAnimationIn
+            ? INDICATORS_ANIMATION_MAX_TIME
+            : INDICATORS_ANIMATION_MAX_TIME_OUT;
         if (totalAnimationTime > maxTime)
             delay -= (totalAnimationTime - maxTime) / this._nPages;
 
@@ -141,7 +183,7 @@ class AnimatedPageIndicators extends PageIndicators {
                 translation_x: isAnimationIn ? 0 : offset,
                 duration: baseTime + delay * i,
                 mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                delay: isAnimationIn ? ANIMATION_DELAY : 0
+                delay: isAnimationIn ? ANIMATION_DELAY : 0,
             });
         }
     }

js/ui/panel.js

@@ -3,7 +3,6 @@
 
 const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Cairo = imports.cairo;
-const Mainloop = imports.mainloop;
 
 const Animation = imports.ui.animation;
 const Config = imports.misc.config;
@@ -58,8 +57,7 @@ function _unpremultiply(color) {
     let red = Math.min((color.red * 255 + 127) / color.alpha, 255);
     let green = Math.min((color.green * 255 + 127) / color.alpha, 255);
     let blue = Math.min((color.blue * 255 + 127) / color.alpha, 255);
-    return new Clutter.Color({ red: red, green: green,
-                               blue: blue, alpha: color.alpha });
+    return new Clutter.Color({ red, green, blue, alpha: color.alpha });
 }
 
 class AppMenu extends PopupMenu.PopupMenu {
@@ -120,7 +118,7 @@ class AppMenu extends PopupMenu.PopupMenu {
 
     _updateDetailsVisibility() {
         let sw = this._appSystem.lookup_app('org.gnome.Software.desktop');
-        this._detailsItem.visible = (sw != null);
+        this._detailsItem.visible = sw != null;
     }
 
     isEmpty() {
@@ -171,9 +169,13 @@ class AppMenu extends PopupMenu.PopupMenu {
         let windows = this._app.get_windows();
         windows.forEach(window => {
             let title = window.title || this._app.get_name();
-            this._windowSection.addAction(title, event => {
+            let item = this._windowSection.addAction(title, event => {
                 Main.activateWindow(window, event.get_time());
             });
+            let id = window.connect('notify::title', () => {
+                item.label.text = window.title || this._app.get_name();
+            });
+            item.connect('destroy', () => window.disconnect(id));
         });
     }
 }
@@ -235,8 +237,11 @@ var AppMenuButton = GObject.registerClass({
         this._overviewHidingId = Main.overview.connect('hiding', this._sync.bind(this));
         this._overviewShowingId = Main.overview.connect('showing', this._sync.bind(this));
 
-        this._spinner = new Animation.Spinner(PANEL_ICON_SIZE, true);
-        this._container.add_actor(this._spinner.actor);
+        this._spinner = new Animation.Spinner(PANEL_ICON_SIZE, {
+            animate: true,
+            hideOnStop: true,
+        });
+        this._container.add_actor(this._spinner);
 
         let menu = new AppMenu(this);
         this.setMenu(menu);
@@ -265,7 +270,7 @@ var AppMenuButton = GObject.registerClass({
         this.ease({
             opacity: 255,
             duration: Overview.ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
+            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
         });
     }
 
@@ -280,7 +285,7 @@ var AppMenuButton = GObject.registerClass({
             opacity: 0,
             mode: Clutter.Animation.EASE_OUT_QUAD,
             duration: Overview.ANIMATION_TIME,
-            onComplete: () => this.hide()
+            onComplete: () => this.hide(),
         });
     }
 
@@ -341,9 +346,10 @@ var AppMenuButton = GObject.registerClass({
         if (focusedApp && focusedApp.is_on_workspace(workspace))
             return focusedApp;
 
-        for (let i = 0; i < this._startingApps.length; i++)
+        for (let i = 0; i < this._startingApps.length; i++) {
             if (this._startingApps[i].is_on_workspace(workspace))
                 return this._startingApps[i];
+        }
 
         return null;
     }
@@ -366,21 +372,21 @@ var AppMenuButton = GObject.registerClass({
             }
         }
 
-        let visible = (this._targetApp != null && !Main.overview.visibleTarget);
+        let visible = this._targetApp != null && !Main.overview.visibleTarget;
         if (visible)
             this.fadeIn();
         else
             this.fadeOut();
 
-        let isBusy = (this._targetApp != null &&
+        let isBusy = this._targetApp != null &&
                       (this._targetApp.get_state() == Shell.AppState.STARTING ||
-                       this._targetApp.get_busy()));
+                       this._targetApp.get_busy());
         if (isBusy)
             this.startAnimation();
         else
             this.stopAnimation();
 
-        this.reactive = (visible && !isBusy);
+        this.reactive = visible && !isBusy;
 
         this._syncIcon();
         this.menu.setApp(this._targetApp);
@@ -431,16 +437,13 @@ class ActivitiesButton extends PanelMenu.Button {
 
         this.label_actor = this._label;
 
-        this.connect('captured-event', this._onCapturedEvent.bind(this));
-        this.connect_after('key-release-event', this._onKeyRelease.bind(this));
-
         Main.overview.connect('showing', () => {
             this.add_style_pseudo_class('overview');
-            this.add_accessible_state (Atk.StateType.CHECKED);
+            this.add_accessible_state(Atk.StateType.CHECKED);
         });
         Main.overview.connect('hiding', () => {
             this.remove_style_pseudo_class('overview');
-            this.remove_accessible_state (Atk.StateType.CHECKED);
+            this.remove_accessible_state(Atk.StateType.CHECKED);
         });
 
         this._xdndTimeOut = 0;
@@ -451,8 +454,8 @@ class ActivitiesButton extends PanelMenu.Button {
             return DND.DragMotionResult.CONTINUE;
 
         if (this._xdndTimeOut != 0)
-            Mainloop.source_remove(this._xdndTimeOut);
-        this._xdndTimeOut = Mainloop.timeout_add(BUTTON_DND_ACTIVATION_TIMEOUT, () => {
+            GLib.source_remove(this._xdndTimeOut);
+        this._xdndTimeOut = GLib.timeout_add(GLib.PRIORITY_DEFAULT, BUTTON_DND_ACTIVATION_TIMEOUT, () => {
             this._xdndToggleOverview();
         });
         GLib.Source.set_name_by_id(this._xdndTimeOut, '[gnome-shell] this._xdndToggleOverview');
@@ -460,7 +463,7 @@ class ActivitiesButton extends PanelMenu.Button {
         return DND.DragMotionResult.CONTINUE;
     }
 
-    _onCapturedEvent(actor, event) {
+    vfunc_captured_event(event) {
         if (event.type() == Clutter.EventType.BUTTON_PRESS ||
             event.type() == Clutter.EventType.TOUCH_BEGIN) {
             if (!Main.overview.shouldToggleByCornerOrButton())
@@ -469,23 +472,25 @@ class ActivitiesButton extends PanelMenu.Button {
         return Clutter.EVENT_PROPAGATE;
     }
 
-    _onEvent(actor, event) {
-        super._onEvent(actor, event);
-
+    vfunc_event(event) {
         if (event.type() == Clutter.EventType.TOUCH_END ||
-            event.type() == Clutter.EventType.BUTTON_RELEASE)
+            event.type() == Clutter.EventType.BUTTON_RELEASE) {
             if (Main.overview.shouldToggleByCornerOrButton())
                 Main.overview.toggle();
+        }
 
         return Clutter.EVENT_PROPAGATE;
     }
 
-    _onKeyRelease(actor, event) {
-        let symbol = event.get_key_symbol();
+    vfunc_key_release_event(keyEvent) {
+        let symbol = keyEvent.keyval;
         if (symbol == Clutter.KEY_Return || symbol == Clutter.KEY_space) {
-            if (Main.overview.shouldToggleByCornerOrButton())
+            if (Main.overview.shouldToggleByCornerOrButton()) {
                 Main.overview.toggle();
+                return Clutter.EVENT_STOP;
+            }
         }
+
         return Clutter.EVENT_PROPAGATE;
     }
 
@@ -496,19 +501,18 @@ class ActivitiesButton extends PanelMenu.Button {
         if (pickedActor == this && Main.overview.shouldToggleByCornerOrButton())
             Main.overview.toggle();
 
-        Mainloop.source_remove(this._xdndTimeOut);
+        GLib.source_remove(this._xdndTimeOut);
         this._xdndTimeOut = 0;
         return GLib.SOURCE_REMOVE;
     }
 });
 
-var PanelCorner = class {
-    constructor(side) {
+var PanelCorner = GObject.registerClass(
+class PanelCorner extends St.DrawingArea {
+    _init(side) {
         this._side = side;
 
-        this.actor = new St.DrawingArea({ style_class: 'panel-corner' });
-        this.actor.connect('style-changed', this._styleChanged.bind(this));
-        this.actor.connect('repaint', this._repaint.bind(this));
+        super._init({ style_class: 'panel-corner' });
     }
 
     _findRightmostButton(container) {
@@ -529,8 +533,8 @@ var PanelCorner = class {
         if (index < 0)
             return null;
 
-        if (!(children[index].has_style_class_name('panel-menu')) &&
-            !(children[index].has_style_class_name('panel-button')))
+        if (!children[index].has_style_class_name('panel-menu') &&
+            !children[index].has_style_class_name('panel-button'))
             return this._findRightmostButton(children[index]);
 
         return children[index];
@@ -554,8 +558,8 @@ var PanelCorner = class {
         if (index == children.length)
             return null;
 
-        if (!(children[index].has_style_class_name('panel-menu')) &&
-            !(children[index].has_style_class_name('panel-button')))
+        if (!children[index].has_style_class_name('panel-menu') &&
+            !children[index].has_style_class_name('panel-button'))
             return this._findLeftmostButton(children[index]);
 
         return children[index];
@@ -598,7 +602,7 @@ var PanelCorner = class {
             this._buttonStyleChangedSignalId = button.connect('style-changed',
                 () => {
                     let pseudoClass = button.get_style_pseudo_class();
-                    this.actor.set_style_pseudo_class(pseudoClass);
+                    this.set_style_pseudo_class(pseudoClass);
                 });
 
             // The corner doesn't support theme transitions, so override
@@ -607,8 +611,8 @@ var PanelCorner = class {
         }
     }
 
-    _repaint() {
-        let node = this.actor.get_theme_node();
+    vfunc_repaint() {
+        let node = this.get_theme_node();
 
         let cornerRadius = node.get_length("-panel-corner-radius");
         let borderWidth = node.get_length('-panel-corner-border-width');
@@ -619,18 +623,19 @@ var PanelCorner = class {
         let overlap = borderColor.alpha != 0;
         let offsetY = overlap ? 0 : borderWidth;
 
-        let cr = this.actor.get_context();
+        let cr = this.get_context();
         cr.setOperator(Cairo.Operator.SOURCE);
 
         cr.moveTo(0, offsetY);
-        if (this._side == St.Side.LEFT)
+        if (this._side == St.Side.LEFT) {
             cr.arc(cornerRadius,
                    borderWidth + cornerRadius,
                    cornerRadius, Math.PI, 3 * Math.PI / 2);
-        else
+        } else {
             cr.arc(0,
                    borderWidth + cornerRadius,
                    cornerRadius, 3 * Math.PI / 2, 2 * Math.PI);
+        }
         cr.lineTo(cornerRadius, offsetY);
         cr.closePath();
 
@@ -646,7 +651,7 @@ var PanelCorner = class {
             Clutter.cairo_set_source_color(cr, backgroundColor);
 
             cr.save();
-            cr.translate(xOffsetDirection * offset, - offset);
+            cr.translate(xOffsetDirection * offset, -offset);
             cr.appendPath(savedPath);
             cr.fill();
             cr.restore();
@@ -655,16 +660,17 @@ var PanelCorner = class {
         cr.$dispose();
     }
 
-    _styleChanged() {
-        let node = this.actor.get_theme_node();
+    vfunc_style_changed() {
+        super.vfunc_style_changed();
+        let node = this.get_theme_node();
 
         let cornerRadius = node.get_length("-panel-corner-radius");
         let borderWidth = node.get_length('-panel-corner-border-width');
 
-        this.actor.set_size(cornerRadius, borderWidth + cornerRadius);
-        this.actor.set_anchor_point(0, borderWidth);
+        this.set_size(cornerRadius, borderWidth + cornerRadius);
+        this.set_anchor_point(0, borderWidth);
     }
-};
+});
 
 var AggregateLayout = GObject.registerClass(
 class AggregateLayout extends Clutter.BoxLayout {
@@ -707,16 +713,15 @@ class AggregateMenu extends PanelMenu.Button {
         this._indicators = new St.BoxLayout({ style_class: 'panel-status-indicators-box' });
         this.add_child(this._indicators);
 
-        if (Config.HAVE_NETWORKMANAGER) {
+        if (Config.HAVE_NETWORKMANAGER)
             this._network = new imports.ui.status.network.NMApplet();
-        } else {
+        else
             this._network = null;
-        }
-        if (Config.HAVE_BLUETOOTH) {
+
+        if (Config.HAVE_BLUETOOTH)
             this._bluetooth = new imports.ui.status.bluetooth.Indicator();
-        } else {
+        else
             this._bluetooth = null;
-        }
 
         this._remoteAccess = new imports.ui.status.remoteAccess.RemoteAccessApplet();
         this._power = new imports.ui.status.power.Indicator();
@@ -729,42 +734,41 @@ class AggregateMenu extends PanelMenu.Button {
         this._nightLight = new imports.ui.status.nightLight.Indicator();
         this._thunderbolt = new imports.ui.status.thunderbolt.Indicator();
 
-        this._indicators.add_child(this._thunderbolt.indicators);
-        this._indicators.add_child(this._screencast.indicators);
-        this._indicators.add_child(this._location.indicators);
-        this._indicators.add_child(this._nightLight.indicators);
-        if (this._network) {
-            this._indicators.add_child(this._network.indicators);
-        }
-        if (this._bluetooth) {
-            this._indicators.add_child(this._bluetooth.indicators);
-        }
-        this._indicators.add_child(this._remoteAccess.indicators);
-        this._indicators.add_child(this._rfkill.indicators);
-        this._indicators.add_child(this._volume.indicators);
-        this._indicators.add_child(this._power.indicators);
+        this._indicators.add_child(this._thunderbolt);
+        this._indicators.add_child(this._screencast);
+        this._indicators.add_child(this._location);
+        this._indicators.add_child(this._nightLight);
+        if (this._network)
+            this._indicators.add_child(this._network);
+        if (this._bluetooth)
+            this._indicators.add_child(this._bluetooth);
+        this._indicators.add_child(this._remoteAccess);
+        this._indicators.add_child(this._rfkill);
+        this._indicators.add_child(this._volume);
+        this._indicators.add_child(this._power);
         this._indicators.add_child(PopupMenu.arrowIcon(St.Side.BOTTOM));
 
         this.menu.addMenuItem(this._volume.menu);
         this.menu.addMenuItem(this._brightness.menu);
         this.menu.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
-        if (this._network) {
+        if (this._network)
             this.menu.addMenuItem(this._network.menu);
-        }
-        if (this._bluetooth) {
+
+        if (this._bluetooth)
             this.menu.addMenuItem(this._bluetooth.menu);
-        }
+
         this.menu.addMenuItem(this._remoteAccess.menu);
         this.menu.addMenuItem(this._location.menu);
         this.menu.addMenuItem(this._rfkill.menu);
         this.menu.addMenuItem(this._power.menu);
         this.menu.addMenuItem(this._nightLight.menu);
+        this.menu.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
         this.menu.addMenuItem(this._system.menu);
 
         menuLayout.addSizeChild(this._location.menu.actor);
         menuLayout.addSizeChild(this._rfkill.menu.actor);
         menuLayout.addSizeChild(this._power.menu.actor);
-        menuLayout.addSizeChild(this._system.buttonGroup);
+        menuLayout.addSizeChild(this._system.menu.actor);
     }
 });
 
@@ -800,14 +804,10 @@ class Panel extends St.Widget {
         this.add_child(this._rightBox);
 
         this._leftCorner = new PanelCorner(St.Side.LEFT);
-        this.add_child(this._leftCorner.actor);
+        this.add_child(this._leftCorner);
 
         this._rightCorner = new PanelCorner(St.Side.RIGHT);
-        this.add_child(this._rightCorner.actor);
-
-        this.connect('button-press-event', this._onButtonPress.bind(this));
-        this.connect('touch-event', this._onButtonPress.bind(this));
-        this.connect('key-press-event', this._onKeyPress.bind(this));
+        this.add_child(this._rightCorner);
 
         Main.overview.connect('showing', () => {
             this.add_style_pseudo_class('overview');
@@ -896,62 +896,65 @@ class Panel extends St.Widget {
 
         let cornerWidth, cornerHeight;
 
-        [, cornerWidth] = this._leftCorner.actor.get_preferred_width(-1);
-        [, cornerHeight] = this._leftCorner.actor.get_preferred_height(-1);
+        [, cornerWidth] = this._leftCorner.get_preferred_width(-1);
+        [, cornerHeight] = this._leftCorner.get_preferred_height(-1);
         childBox.x1 = 0;
         childBox.x2 = cornerWidth;
         childBox.y1 = allocHeight;
         childBox.y2 = allocHeight + cornerHeight;
-        this._leftCorner.actor.allocate(childBox, flags);
+        this._leftCorner.allocate(childBox, flags);
 
-        [, cornerWidth] = this._rightCorner.actor.get_preferred_width(-1);
-        [, cornerHeight] = this._rightCorner.actor.get_preferred_height(-1);
+        [, cornerWidth] = this._rightCorner.get_preferred_width(-1);
+        [, cornerHeight] = this._rightCorner.get_preferred_height(-1);
         childBox.x1 = allocWidth - cornerWidth;
         childBox.x2 = allocWidth;
         childBox.y1 = allocHeight;
         childBox.y2 = allocHeight + cornerHeight;
-        this._rightCorner.actor.allocate(childBox, flags);
+        this._rightCorner.allocate(childBox, flags);
     }
 
-    _onButtonPress(actor, event) {
+    _tryDragWindow(event) {
         if (Main.modalCount > 0)
             return Clutter.EVENT_PROPAGATE;
 
-        if (event.get_source() != actor)
+        if (event.source != this)
             return Clutter.EVENT_PROPAGATE;
 
-        let type = event.type();
-        let isPress = type == Clutter.EventType.BUTTON_PRESS;
-        if (!isPress && type != Clutter.EventType.TOUCH_BEGIN)
-            return Clutter.EVENT_PROPAGATE;
-
-        let button = isPress ? event.get_button() : -1;
-        if (isPress && button != 1)
-            return Clutter.EVENT_PROPAGATE;
-
-        let [stageX, stageY] = event.get_coords();
-
-        let dragWindow = this._getDraggableWindowForPosition(stageX);
+        let { x, y } = event;
+        let dragWindow = this._getDraggableWindowForPosition(x);
 
         if (!dragWindow)
             return Clutter.EVENT_PROPAGATE;
 
-        global.display.begin_grab_op(dragWindow,
-                                     Meta.GrabOp.MOVING,
-                                     false, /* pointer grab */
-                                     true, /* frame action */
-                                     button,
-                                     event.get_state(),
-                                     event.get_time(),
-                                     stageX, stageY);
-
-        return Clutter.EVENT_STOP;
+        return global.display.begin_grab_op(
+            dragWindow,
+            Meta.GrabOp.MOVING,
+            false, /* pointer grab */
+            true, /* frame action */
+            event.button || -1,
+            event.modifier_state,
+            event.time,
+            x, y) ? Clutter.EVENT_STOP : Clutter.EVENT_PROPAGATE;
     }
 
-    _onKeyPress(actor, event) {
-        let symbol = event.get_key_symbol();
+    vfunc_button_press_event(buttonEvent) {
+        if (buttonEvent.button != 1)
+            return Clutter.EVENT_PROPAGATE;
+
+        return this._tryDragWindow(buttonEvent);
+    }
+
+    vfunc_touch_event(touchEvent) {
+        if (touchEvent.type != Clutter.EventType.TOUCH_BEGIN)
+            return Clutter.EVENT_PROPAGATE;
+
+        return this._tryDragWindow(touchEvent);
+    }
+
+    vfunc_key_press_event(keyEvent) {
+        let symbol = keyEvent.keyval;
         if (symbol == Clutter.KEY_Escape) {
-            global.display.focus_default_window(event.get_time());
+            global.display.focus_default_window(keyEvent.time);
             return Clutter.EVENT_STOP;
         }
 
@@ -1105,7 +1108,7 @@ class Panel extends St.Widget {
         let boxes = {
             left: this._leftBox,
             center: this._centerBox,
-            right: this._rightBox
+            right: this._rightBox,
         };
         let boxContainer = boxes[box] || this._rightBox;
         this.statusArea[role] = indicator;
@@ -1115,14 +1118,14 @@ class Panel extends St.Widget {
 
     _addStyleClassName(className) {
         this.add_style_class_name(className);
-        this._rightCorner.actor.add_style_class_name(className);
-        this._leftCorner.actor.add_style_class_name(className);
+        this._rightCorner.add_style_class_name(className);
+        this._leftCorner.add_style_class_name(className);
     }
 
     _removeStyleClassName(className) {
         this.remove_style_class_name(className);
-        this._rightCorner.actor.remove_style_class_name(className);
-        this._leftCorner.actor.remove_style_class_name(className);
+        this._rightCorner.remove_style_class_name(className);
+        this._leftCorner.remove_style_class_name(className);
     }
 
     _onMenuSet(indicator) {

js/ui/panelMenu.js

@@ -2,7 +2,6 @@
 /* exported Button, SystemIndicator */
 
 const { Atk, Clutter, GObject, St } = imports.gi;
-const Signals = imports.signals;
 
 const Main = imports.ui.main;
 const Params = imports.misc.params;
@@ -11,15 +10,17 @@ const PopupMenu = imports.ui.popupMenu;
 var ButtonBox = GObject.registerClass(
 class ButtonBox extends St.Widget {
     _init(params) {
-        params = Params.parse(params, { style_class: 'panel-button' }, true);
+        params = Params.parse(params, {
+            style_class: 'panel-button',
+            x_expand: true,
+            y_expand: true,
+        }, true);
 
         super._init(params);
 
         this._delegate = this;
 
-        this.container = new St.Bin({ y_fill: true,
-                                      x_fill: true,
-                                      child: this });
+        this.container = new St.Bin({ child: this });
 
         this.connect('style-changed', this._onStyleChanged.bind(this));
         this.connect('destroy', this._onDestroy.bind(this));
@@ -101,9 +102,6 @@ var Button = GObject.registerClass({
                       accessible_name: nameText ? nameText : "",
                       accessible_role: Atk.Role.MENU });
 
-        this.connect('event', this._onEvent.bind(this));
-        this.connect('notify::visible', this._onVisibilityChanged.bind(this));
-
         if (dontCreateMenu)
             this.menu = new PopupMenu.PopupDummyMenu(this);
         else
@@ -132,7 +130,7 @@ var Button = GObject.registerClass({
         this.emit('menu-set');
     }
 
-    _onEvent(actor, event) {
+    vfunc_event(event) {
         if (this.menu &&
             (event.type() == Clutter.EventType.TOUCH_BEGIN ||
              event.type() == Clutter.EventType.BUTTON_PRESS))
@@ -141,11 +139,10 @@ var Button = GObject.registerClass({
         return Clutter.EVENT_PROPAGATE;
     }
 
-    _onVisibilityChanged() {
-        if (!this.menu)
-            return;
+    vfunc_hide() {
+        super.vfunc_hide();
 
-        if (!this.visible)
+        if (this.menu)
             this.menu.close();
     }
 
@@ -157,7 +154,7 @@ var Button = GObject.registerClass({
         if (symbol == Clutter.KEY_Left || symbol == Clutter.KEY_Right) {
             let group = global.focus_manager.get_group(this);
             if (group) {
-                let direction = (symbol == Clutter.KEY_Left) ? St.DirectionType.LEFT : St.DirectionType.RIGHT;
+                let direction = symbol == Clutter.KEY_Left ? St.DirectionType.LEFT : St.DirectionType.RIGHT;
                 group.navigate_focus(this, direction, false);
                 return Clutter.EVENT_STOP;
             }
@@ -182,7 +179,7 @@ var Button = GObject.registerClass({
         // measures are in logical pixels, so make sure to consider the scale
         // factor when computing max-height
         let maxHeight = Math.round((workArea.height - verticalMargins) / scaleFactor);
-        this.menu.actor.style = ('max-height: %spx;').format(maxHeight);
+        this.menu.actor.style = 'max-height: %spx;'.format(maxHeight);
     }
 
     _onDestroy() {
@@ -200,24 +197,33 @@ var Button = GObject.registerClass({
  * of an icon and a menu section, which will be composed into the
  * aggregate menu.
  */
-var SystemIndicator = class {
-    constructor() {
-        this.indicators = new St.BoxLayout({ style_class: 'panel-status-indicators-box',
-                                             reactive: true });
-        this.indicators.hide();
+var SystemIndicator = GObject.registerClass(
+class SystemIndicator extends St.BoxLayout {
+    _init() {
+        super._init({
+            style_class: 'panel-status-indicators-box',
+            reactive: true,
+            visible: false,
+        });
         this.menu = new PopupMenu.PopupMenuSection();
     }
 
+    get indicators() {
+        let klass = this.constructor.name;
+        let { stack } = new Error();
+        log(`Usage of indicator.indicators is deprecated for ${klass}\n${stack}`);
+        return this;
+    }
+
     _syncIndicatorsVisible() {
-        this.indicators.visible = this.indicators.get_children().some(a => a.visible);
+        this.visible = this.get_children().some(a => a.visible);
     }
 
     _addIndicator() {
         let icon = new St.Icon({ style_class: 'system-status-icon' });
-        this.indicators.add_actor(icon);
+        this.add_actor(icon);
         icon.connect('notify::visible', this._syncIndicatorsVisible.bind(this));
         this._syncIndicatorsVisible();
         return icon;
     }
-};
-Signals.addSignalMethods(SystemIndicator.prototype);
+});

js/ui/pointerA11yTimeout.js

@@ -1,5 +1,5 @@
 /* exported PointerA11yTimeout */
-const { Clutter, GLib, GObject, Meta, St } = imports.gi;
+const { Clutter, GObject, Meta, St } = imports.gi;
 const Main = imports.ui.main;
 const Cairo = imports.cairo;
 
@@ -10,8 +10,8 @@ var PieTimer = GObject.registerClass({
         'angle': GObject.ParamSpec.double(
             'angle', 'angle', 'angle',
             GObject.ParamFlags.READWRITE,
-            0, 2 * Math.PI, 0)
-    }
+            0, 2 * Math.PI, 0),
+    },
 }, class PieTimer extends St.DrawingArea {
     _init() {
         this._angle = 0;
@@ -20,7 +20,7 @@ var PieTimer = GObject.registerClass({
             opacity: 0,
             visible: false,
             can_focus: false,
-            reactive: false
+            reactive: false,
         });
 
         this.set_pivot_point(0.5, 0.5);
@@ -84,13 +84,13 @@ var PieTimer = GObject.registerClass({
         this.ease({
             opacity: 255,
             duration: duration / 4,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD
+            mode: Clutter.AnimationMode.EASE_IN_QUAD,
         });
 
         this.ease_property('angle', 2 * Math.PI, {
             duration,
             mode: Clutter.AnimationMode.LINEAR,
-            onComplete: this._onTransitionComplete.bind(this)
+            onComplete: this._onTransitionComplete.bind(this),
         });
     }
 
@@ -101,7 +101,7 @@ var PieTimer = GObject.registerClass({
             opacity: 0,
             duration: SUCCESS_ZOOM_OUT_DURATION,
             mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onStopped: () => this.destroy()
+            onStopped: () => this.destroy(),
         });
     }
 });
@@ -110,7 +110,7 @@ var PointerA11yTimeout = class PointerA11yTimeout {
     constructor() {
         let manager = Clutter.DeviceManager.get_default();
 
-        manager.connect('ptr-a11y-timeout-started', (manager, device, type, timeout) => {
+        manager.connect('ptr-a11y-timeout-started', (o, device, type, timeout) => {
             let [x, y] = global.get_pointer();
 
             this._pieTimer = new PieTimer();
@@ -123,7 +123,7 @@ var PointerA11yTimeout = class PointerA11yTimeout {
                 global.display.set_cursor(Meta.Cursor.CROSSHAIR);
         });
 
-        manager.connect('ptr-a11y-timeout-stopped', (manager, device, type, clicked) => {
+        manager.connect('ptr-a11y-timeout-stopped', (o, device, type, clicked) => {
             if (!clicked)
                 this._pieTimer.destroy();
 

js/ui/pointerWatcher.js

@@ -2,7 +2,6 @@
 /* exported getPointerWatcher */
 
 const { GLib, Meta } = imports.gi;
-const Mainloop = imports.mainloop;
 
 // We stop polling if the user is idle for more than this amount of time
 var IDLE_TIME = 1000;
@@ -87,7 +86,7 @@ var PointerWatcher = class {
 
     _updateTimeout() {
         if (this._timeoutId) {
-            Mainloop.source_remove(this._timeoutId);
+            GLib.source_remove(this._timeoutId);
             this._timeoutId = 0;
         }
 
@@ -98,8 +97,8 @@ var PointerWatcher = class {
         for (let i = 1; i < this._watches.length; i++)
             minInterval = Math.min(this._watches[i].interval, minInterval);
 
-        this._timeoutId = Mainloop.timeout_add(minInterval,
-                                               this._onTimeout.bind(this));
+        this._timeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, minInterval,
+            this._onTimeout.bind(this));
         GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] this._onTimeout');
     }
 

js/ui/popupMenu.js

@@ -3,7 +3,7 @@
             PopupImageMenuItem, PopupMenu, PopupDummyMenu, PopupSubMenu,
             PopupMenuSection, PopupSubMenuMenuItem, PopupMenuManager */
 
-const { Atk, Clutter, Gio, GObject, Shell, St } = imports.gi;
+const { Atk, Clutter, Gio, GObject, Graphene, Shell, St } = imports.gi;
 const Signals = imports.signals;
 
 const BoxPointer = imports.ui.boxpointer;
@@ -15,17 +15,21 @@ var Ornament = {
     NONE: 0,
     DOT: 1,
     CHECK: 2,
+    HIDDEN: 3,
 };
 
 function isPopupMenuItemVisible(child) {
-    if (child._delegate instanceof PopupMenuSection)
+    if (child._delegate instanceof PopupMenuSection) {
         if (child._delegate.isEmpty())
             return false;
+    }
     return child.visible;
 }
 
 /**
- * @side Side to which the arrow points.
+ * arrowIcon
+ * @param {St.Side} side - Side to which the arrow points.
+ * @returns {St.Icon} a new arrow icon
  */
 function arrowIcon(side) {
     let iconName;
@@ -57,24 +61,23 @@ var PopupBaseMenuItem = GObject.registerClass({
     Properties: {
         'active': GObject.ParamSpec.boolean('active', 'active', 'active',
                                             GObject.ParamFlags.READWRITE,
-                                            GObject.TYPE_BOOLEAN,
                                             false),
         'sensitive': GObject.ParamSpec.boolean('sensitive', 'sensitive', 'sensitive',
                                                GObject.ParamFlags.READWRITE,
-                                               GObject.TYPE_BOOLEAN,
                                                true),
     },
     Signals: {
         'activate': { param_types: [Clutter.Event.$gtype] },
-    }
+    },
 }, class PopupBaseMenuItem extends St.BoxLayout {
     _init(params) {
-        params = Params.parse (params, { reactive: true,
-                                         activate: true,
-                                         hover: true,
-                                         style_class: null,
-                                         can_focus: true
-                                       });
+        params = Params.parse(params, {
+            reactive: true,
+            activate: true,
+            hover: true,
+            style_class: null,
+            can_focus: true,
+        });
         super._init({ style_class: 'popup-menu-item',
                       reactive: params.reactive,
                       track_hover: params.reactive,
@@ -97,12 +100,6 @@ var PopupBaseMenuItem = GObject.registerClass({
         if (params.style_class)
             this.add_style_class_name(params.style_class);
 
-        if (this._activatable) {
-            this.connect('button-press-event', this._onButtonPressEvent.bind(this));
-            this.connect('button-release-event', this._onButtonReleaseEvent.bind(this));
-            this.connect('touch-event', this._onTouchEvent.bind(this));
-            this.connect('key-press-event', this._onKeyPressEvent.bind(this));
-        }
         if (params.reactive && params.hover)
             this.bind_property('hover', this, 'active', GObject.BindingFlags.SYNC_CREATE);
     }
@@ -124,32 +121,44 @@ var PopupBaseMenuItem = GObject.registerClass({
         this._parent = parent;
     }
 
-    _onButtonPressEvent() {
+    vfunc_button_press_event() {
+        if (!this._activatable)
+            return Clutter.EVENT_PROPAGATE;
+
         // This is the CSS active state
         this.add_style_pseudo_class('active');
         return Clutter.EVENT_PROPAGATE;
     }
 
-    _onButtonReleaseEvent(actor, event) {
+    vfunc_button_release_event() {
+        if (!this._activatable)
+            return Clutter.EVENT_PROPAGATE;
+
         this.remove_style_pseudo_class('active');
-        this.activate(event);
+        this.activate(Clutter.get_current_event());
         return Clutter.EVENT_STOP;
     }
 
-    _onTouchEvent(actor, event) {
-        if (event.type() == Clutter.EventType.TOUCH_END) {
+    vfunc_touch_event(touchEvent) {
+        if (!this._activatable)
+            return Clutter.EVENT_PROPAGATE;
+
+        if (touchEvent.type == Clutter.EventType.TOUCH_END) {
             this.remove_style_pseudo_class('active');
-            this.activate(event);
+            this.activate(Clutter.get_current_event());
             return Clutter.EVENT_STOP;
-        } else if (event.type() == Clutter.EventType.TOUCH_BEGIN) {
+        } else if (touchEvent.type == Clutter.EventType.TOUCH_BEGIN) {
             // This is the CSS active state
             this.add_style_pseudo_class('active');
         }
         return Clutter.EVENT_PROPAGATE;
     }
 
-    _onKeyPressEvent(actor, event) {
-        let state = event.get_state();
+    vfunc_key_press_event(keyEvent) {
+        if (!this._activatable)
+            return super.vfunc_key_press_event(keyEvent);
+
+        let state = keyEvent.modifier_state;
 
         // if user has a modifier down (except capslock and numlock)
         // then don't handle the key press here
@@ -160,9 +169,9 @@ var PopupBaseMenuItem = GObject.registerClass({
         if (state)
             return Clutter.EVENT_PROPAGATE;
 
-        let symbol = event.get_key_symbol();
+        let symbol = keyEvent.keyval;
         if (symbol == Clutter.KEY_space || symbol == Clutter.KEY_Return) {
-            this.activate(event);
+            this.activate(Clutter.get_current_event());
             return Clutter.EVENT_STOP;
         }
         return Clutter.EVENT_PROPAGATE;
@@ -249,10 +258,12 @@ var PopupBaseMenuItem = GObject.registerClass({
         } else if (ornament == Ornament.CHECK) {
             this._ornamentLabel.text = '\u2713';
             this.add_accessible_state(Atk.StateType.CHECKED);
-        } else if (ornament == Ornament.NONE) {
+        } else if (ornament == Ornament.NONE || ornament == Ornament.HIDDEN) {
             this._ornamentLabel.text = '';
             this.remove_accessible_state(Atk.StateType.CHECKED);
         }
+
+        this._ornamentLabel.visible = ornament != Ornament.HIDDEN;
     }
 });
 
@@ -261,7 +272,7 @@ class PopupMenuItem extends PopupBaseMenuItem {
     _init(text, params) {
         super._init(params);
 
-        this.label = new St.Label({ text: text });
+        this.label = new St.Label({ text });
         this.add_child(this.label);
         this.label_actor = this.label;
     }
@@ -283,9 +294,10 @@ class PopupSeparatorMenuItem extends PopupBaseMenuItem {
         this._syncVisibility();
 
         this._separator = new St.Widget({ style_class: 'popup-separator-menu-item',
+                                          x_expand: true,
                                           y_expand: true,
                                           y_align: Clutter.ActorAlign.CENTER });
-        this.add(this._separator, { expand: true });
+        this.add_child(this._separator);
     }
 
     _syncVisibility() {
@@ -316,12 +328,12 @@ class Switch extends St.Bin {
 });
 
 var PopupSwitchMenuItem = GObject.registerClass({
-    Signals: { 'toggled': { param_types: [GObject.TYPE_BOOLEAN] }, },
+    Signals: { 'toggled': { param_types: [GObject.TYPE_BOOLEAN] } },
 }, class PopupSwitchMenuItem extends PopupBaseMenuItem {
     _init(text, active, params) {
         super._init(params);
 
-        this.label = new St.Label({ text: text });
+        this.label = new St.Label({ text });
         this._switch = new Switch(active);
 
         this.accessible_role = Atk.Role.CHECK_MENU_ITEM;
@@ -330,12 +342,16 @@ var PopupSwitchMenuItem = GObject.registerClass({
 
         this.add_child(this.label);
 
-        this._statusBin = new St.Bin({ x_align: St.Align.END });
-        this.add(this._statusBin, { expand: true, x_align: St.Align.END });
+        this._statusBin = new St.Bin({
+            x_align: Clutter.ActorAlign.END,
+            x_expand: true,
+        });
+        this.add_child(this._statusBin);
 
-        this._statusLabel = new St.Label({ text: '',
-                                           style_class: 'popup-status-menu-item'
-                                         });
+        this._statusLabel = new St.Label({
+            text: '',
+            style_class: 'popup-status-menu-item',
+        });
         this._statusBin.child = this._switch;
     }
 
@@ -403,7 +419,7 @@ class PopupImageMenuItem extends PopupBaseMenuItem {
         this._icon = new St.Icon({ style_class: 'popup-menu-icon',
                                    x_align: Clutter.ActorAlign.END });
         this.add_child(this._icon);
-        this.label = new St.Label({ text: text });
+        this.label = new St.Label({ text });
         this.add_child(this.label);
         this.label_actor = this.label;
 
@@ -425,14 +441,17 @@ var PopupMenuBase = class {
             throw new TypeError(`Cannot instantiate abstract class ${this.constructor.name}`);
 
         this.sourceActor = sourceActor;
+        this.focusActor = sourceActor;
         this._parent = null;
 
-        if (styleClass !== undefined) {
-            this.box = new St.BoxLayout({ style_class: styleClass,
-                                          vertical: true });
-        } else {
-            this.box = new St.BoxLayout({ vertical: true });
-        }
+        this.box = new St.BoxLayout({
+            vertical: true,
+            x_expand: true,
+            y_expand: true,
+        });
+
+        if (styleClass !== undefined)
+            this.box.style_class = styleClass;
         this.length = 0;
 
         this.isOpen = false;
@@ -491,7 +510,7 @@ var PopupMenuBase = class {
             menuItem = new PopupMenuItem(title);
 
         this.addMenuItem(menuItem);
-        menuItem.connect('activate', (menuItem, event) => {
+        menuItem.connect('activate', (o, event) => {
             callback(event);
         });
 
@@ -549,7 +568,7 @@ var PopupMenuBase = class {
     }
 
     _connectItemSignals(menuItem) {
-        menuItem._activeChangeId = menuItem.connect('notify::active', (menuItem) => {
+        menuItem._activeChangeId = menuItem.connect('notify::active', () => {
             let active = menuItem.active;
             if (active && this._activeMenuItem != menuItem) {
                 if (this._activeMenuItem)
@@ -573,7 +592,7 @@ var PopupMenuBase = class {
                     menuItem.actor.grab_key_focus();
             }
         });
-        menuItem._activateId = menuItem.connect_after('activate', (menuItem, _event) => {
+        menuItem._activateId = menuItem.connect_after('activate', () => {
             this.emit('activate', menuItem);
             this.itemActivated(BoxPointer.PopupAnimation.FULL);
         });
@@ -586,7 +605,7 @@ var PopupMenuBase = class {
         // the menuItem may have, called destroyId
         // (FIXME: in the future it may make sense to have container objects
         // like PopupMenuManager does)
-        menuItem._popupMenuDestroyId = menuItem.connect('destroy', menuItem => {
+        menuItem._popupMenuDestroyId = menuItem.connect('destroy', () => {
             menuItem.disconnect(menuItem._popupMenuDestroyId);
             menuItem.disconnect(menuItem._activateId);
             menuItem.disconnect(menuItem._activeChangeId);
@@ -613,8 +632,8 @@ var PopupMenuBase = class {
         while (childBeforeIndex >= 0 && !isPopupMenuItemVisible(children[childBeforeIndex]))
             childBeforeIndex--;
 
-        if (childBeforeIndex < 0
-            || children[childBeforeIndex]._delegate instanceof PopupSeparatorMenuItem) {
+        if (childBeforeIndex < 0 ||
+            children[childBeforeIndex]._delegate instanceof PopupSeparatorMenuItem) {
             menuItem.actor.hide();
             return;
         }
@@ -624,8 +643,8 @@ var PopupMenuBase = class {
         while (childAfterIndex < children.length && !isPopupMenuItemVisible(children[childAfterIndex]))
             childAfterIndex++;
 
-        if (childAfterIndex >= children.length
-            || children[childAfterIndex]._delegate instanceof PopupSeparatorMenuItem) {
+        if (childAfterIndex >= children.length ||
+            children[childAfterIndex]._delegate instanceof PopupSeparatorMenuItem) {
             menuItem.actor.hide();
             return;
         }
@@ -718,10 +737,11 @@ var PopupMenuBase = class {
                 this.disconnect(openStateChangeId);
                 menuItem.disconnect(destroyId);
             });
-        } else if (menuItem instanceof PopupBaseMenuItem)
+        } else if (menuItem instanceof PopupBaseMenuItem) {
             this._connectItemSignals(menuItem);
-        else
+        } else {
             throw TypeError("Invalid argument to PopupMenuBase.addMenuItem()");
+        }
 
         menuItem._setParent(this);
 
@@ -781,10 +801,7 @@ var PopupMenu = class extends PopupMenuBase {
         this._arrowAlignment = arrowAlignment;
         this._arrowSide = arrowSide;
 
-        this._boxPointer = new BoxPointer.BoxPointer(arrowSide,
-                                                     { x_fill: true,
-                                                       y_fill: true,
-                                                       x_align: St.Align.START });
+        this._boxPointer = new BoxPointer.BoxPointer(arrowSide);
         this.actor = this._boxPointer;
         this.actor._delegate = this;
         this.actor.style_class = 'popup-menu-boxpointer';
@@ -795,10 +812,12 @@ var PopupMenu = class extends PopupMenuBase {
         global.focus_manager.add_group(this.actor);
         this.actor.reactive = true;
 
-        if (this.sourceActor)
+        if (this.sourceActor) {
             this._keyPressId = this.sourceActor.connect('key-press-event',
                                                         this._onKeyPress.bind(this));
+        }
 
+        this._systemModalOpenedId = 0;
         this._openedSubMenu = null;
     }
 
@@ -873,12 +892,17 @@ var PopupMenu = class extends PopupMenuBase {
         if (this.isEmpty())
             return;
 
+        if (!this._systemModalOpenedId) {
+            this._systemModalOpenedId =
+                Main.layoutManager.connect('system-modal-opened', () => this.close());
+        }
+
         this.isOpen = true;
 
         this._boxPointer.setPosition(this.sourceActor, this._arrowAlignment);
         this._boxPointer.open(animate);
 
-        this.actor.raise_top();
+        this.actor.get_parent().set_child_above_sibling(this.actor, null);
 
         this.emit('open-state-changed', true);
     }
@@ -903,6 +927,11 @@ var PopupMenu = class extends PopupMenuBase {
     destroy() {
         if (this._keyPressId)
             this.sourceActor.disconnect(this._keyPressId);
+
+        if (this._systemModalOpenedId)
+            Main.layoutManager.disconnect(this._systemModalOpenedId);
+        this._systemModalOpenedId = 0;
+
         super.destroy();
     }
 };
@@ -1016,12 +1045,12 @@ var PopupSubMenu = class extends PopupMenuBase {
                 height: naturalHeight,
                 duration: 250,
                 mode: Clutter.AnimationMode.EASE_OUT_EXPO,
-                onComplete: () => this.actor.set_height(-1)
+                onComplete: () => this.actor.set_height(-1),
             });
             this._arrow.ease({
                 rotation_angle_z: targetAngle,
                 duration: 250,
-                mode: Clutter.AnimationMode.EASE_OUT_EXPO
+                mode: Clutter.AnimationMode.EASE_OUT_EXPO,
             });
         } else {
             this._arrow.rotation_angle_z = targetAngle;
@@ -1049,12 +1078,12 @@ var PopupSubMenu = class extends PopupMenuBase {
                 onComplete: () => {
                     this.actor.hide();
                     this.actor.set_height(-1);
-                }
+                },
             });
             this._arrow.ease({
                 rotation_angle_z: 0,
                 duration: 250,
-                mode: Clutter.AnimationMode.EASE_OUT_EXPO
+                mode: Clutter.AnimationMode.EASE_OUT_EXPO,
             });
         } else {
             this._arrow.rotation_angle_z = 0;
@@ -1115,17 +1144,20 @@ class PopupSubMenuMenuItem extends PopupBaseMenuItem {
             this.add_child(this.icon);
         }
 
-        this.label = new St.Label({ text: text,
+        this.label = new St.Label({ text,
                                     y_expand: true,
                                     y_align: Clutter.ActorAlign.CENTER });
         this.add_child(this.label);
         this.label_actor = this.label;
 
-        let expander = new St.Bin({ style_class: 'popup-menu-item-expander' });
-        this.add(expander, { expand: true });
+        let expander = new St.Bin({
+            style_class: 'popup-menu-item-expander',
+            x_expand: true,
+        });
+        this.add_child(expander);
 
         this._triangle = arrowIcon(St.Side.RIGHT);
-        this._triangle.pivot_point = new Clutter.Point({ x: 0.5, y: 0.6 });
+        this._triangle.pivot_point = new Graphene.Point({ x: 0.5, y: 0.6 });
 
         this._triangleBin = new St.Widget({ y_expand: true,
                                             y_align: Clutter.ActorAlign.CENTER });
@@ -1160,7 +1192,7 @@ class PopupSubMenuMenuItem extends PopupBaseMenuItem {
         } else {
             this.remove_style_pseudo_class('open');
             this._getTopMenu()._setOpenedSubMenu(null);
-            this.remove_accessible_state (Atk.StateType.EXPANDED);
+            this.remove_accessible_state(Atk.StateType.EXPANDED);
             this.remove_style_pseudo_class('checked');
         }
     }
@@ -1180,8 +1212,8 @@ class PopupSubMenuMenuItem extends PopupBaseMenuItem {
         return this.menu.isOpen;
     }
 
-    _onKeyPressEvent(actor, event) {
-        let symbol = event.get_key_symbol();
+    vfunc_key_press_event(keyPressEvent) {
+        let symbol = keyPressEvent.keyval;
 
         if (symbol == Clutter.KEY_Right) {
             this._setOpenState(true);
@@ -1192,14 +1224,14 @@ class PopupSubMenuMenuItem extends PopupBaseMenuItem {
             return Clutter.EVENT_STOP;
         }
 
-        return super._onKeyPressEvent(actor, event);
+        return super.vfunc_key_press_event(keyPressEvent);
     }
 
     activate(_event) {
         this._setOpenState(true);
     }
 
-    _onButtonReleaseEvent() {
+    vfunc_button_release_event() {
         // Since we override the parent, we need to manage what the parent does
         // with the active style class
         this.remove_style_pseudo_class('active');
@@ -1207,8 +1239,8 @@ class PopupSubMenuMenuItem extends PopupBaseMenuItem {
         return Clutter.EVENT_PROPAGATE;
     }
 
-    _onTouchEvent(actor, event) {
-        if (event.type() == Clutter.EventType.TOUCH_END) {
+    vfunc_touch_event(touchEvent) {
+        if (touchEvent.type == Clutter.EventType.TOUCH_END) {
             // Since we override the parent, we need to manage what the parent does
             // with the active style class
             this.remove_style_pseudo_class('active');
@@ -1234,11 +1266,11 @@ var PopupMenuManager = class {
             return;
 
         let menudata = {
-            menu:              menu,
+            menu,
             openStateChangeId: menu.connect('open-state-changed', this._onMenuOpenState.bind(this)),
             destroyId:         menu.connect('destroy', this._onMenuDestroy.bind(this)),
             enterId:           0,
-            focusInId:         0
+            focusInId:         0,
         };
 
         let source = menu.sourceActor;
@@ -1296,18 +1328,20 @@ var PopupMenuManager = class {
         if (open) {
             if (this.activeMenu)
                 this.activeMenu.close(BoxPointer.PopupAnimation.FADE);
-            this._grabHelper.grab({ actor: menu.actor, focus: menu.sourceActor,
-                                    onUngrab: isUser => {
-                                        this._closeMenu(isUser, menu);
-                                    } });
+            this._grabHelper.grab({
+                actor: menu.actor,
+                focus: menu.focusActor,
+                onUngrab: isUser => this._closeMenu(isUser, menu),
+            });
         } else {
             this._grabHelper.ungrab({ actor: menu.actor });
         }
     }
 
     _changeMenu(newMenu) {
-        newMenu.open(this.activeMenu ? BoxPointer.PopupAnimation.FADE
-                                     : BoxPointer.PopupAnimation.FULL);
+        newMenu.open(this.activeMenu
+            ? BoxPointer.PopupAnimation.FADE
+            : BoxPointer.PopupAnimation.FULL);
     }
 
     _onMenuSourceEnter(menu) {

js/ui/remoteSearch.js

@@ -181,7 +181,7 @@ function loadRemoteSearchProviders(searchSettings, callback) {
             return -1;
 
         // finally, if both providers are found, return their order in the list
-        return (idxA - idxB);
+        return idxA - idxB;
     });
 
     callback(loadedProviders);
@@ -228,8 +228,7 @@ var RemoteSearchProvider = class {
         }
 
         if (gicon)
-            icon = new St.Icon({ gicon: gicon,
-                                 icon_size: size });
+            icon = new St.Icon({ gicon, icon_size: size });
         return icon;
     }