Compare commits

..

1 Commits

Author SHA1 Message Date
Allan Day
1b4062c931 theme: Standardise text styles
Initial attempt to use standard text styles, in line with what's
being done for GTK (https://gitlab.gnome.org/GNOME/gtk/issues/1808).

This is just changing the sizes and weights for now. Spacing
adjustments will be required further down the line.

https://gitlab.gnome.org/GNOME/gnome-shell/merge_requests/594
2019-06-25 14:28:49 +02:00
288 changed files with 27314 additions and 51337 deletions

View File

@@ -1,6 +0,0 @@
{
"extends": [
"./lint/eslintrc-gjs.json",
"./lint/eslintrc-shell.json"
]
}

View File

@@ -1,5 +1,6 @@
stages: stages:
- review - review
- source_check
- build - build
- test - test
@@ -25,27 +26,19 @@ check_commit_log:
js_check: js_check:
image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1 image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
stage: review stage: source_check
script: script:
- find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG - find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG
- (! grep -q . $JS_LOG) - (! grep -q . $JS_LOG)
<<: *only_default <<: *only_default
only:
changes:
- js/**/*
artifacts: artifacts:
paths: paths:
- ${JS_LOG} - ${JS_LOG}
when: on_failure when: on_failure
eslint:
image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
stage: review
script:
- ./.gitlab-ci/run-eslint.sh
<<: *only_default
artifacts:
paths:
- reports
when: always
build: build:
image: registry.gitlab.gnome.org/gnome/mutter/master:v2 image: registry.gitlab.gnome.org/gnome/mutter/master:v2
stage: build stage: build
@@ -54,7 +47,7 @@ build:
- meson mutter mutter/build --prefix=/usr -Dtests=false - meson mutter mutter/build --prefix=/usr -Dtests=false
- ninja -C mutter/build install - ninja -C mutter/build install
script: script:
- meson . build -Dbuiltype=debugoptimized -Dman=false --werror - meson . build -Dbuiltype=debugoptimized
- ninja -C build - ninja -C build
- ninja -C build install - ninja -C build install
<<: *only_default <<: *only_default
@@ -67,8 +60,6 @@ build:
test: test:
image: registry.gitlab.gnome.org/gnome/mutter/master:v2 image: registry.gitlab.gnome.org/gnome/mutter/master:v2
stage: test stage: test
variables:
XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
before_script: before_script:
- ninja -C mutter/build install - ninja -C mutter/build install
script: script:

View File

@@ -1,7 +1,7 @@
FROM registry.fedoraproject.org/fedora:latest FROM registry.fedoraproject.org/fedora:latest
RUN dnf -y update && dnf -y upgrade && \ RUN dnf -y update && dnf -y upgrade && \
dnf install -y 'dnf-command(copr)' git && \ dnf install -y 'dnf-command(copr)' && \
# For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'` # For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'`
dnf install -y findutils mozjs60-devel && \ dnf install -y findutils mozjs60-devel && \

View File

@@ -1,5 +1,6 @@
#!/usr/bin/bash #!/usr/bin/bash
shell_branch=$(git describe --contains --all HEAD)
mutter_target= mutter_target=
git clone https://gitlab.gnome.org/GNOME/mutter.git git clone https://gitlab.gnome.org/GNOME/mutter.git
@@ -25,7 +26,8 @@ if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
fi fi
if [ -z "$mutter_target" ]; then if [ -z "$mutter_target" ]; then
mutter_target=$(git branch -r -l origin/$CI_COMMIT_REF_NAME) mutter_target=$(git branch -r -l origin/$shell_branch)
mutter_target=${mutter_target:-$(git branch -r -l ${shell_branch#remotes/})}
mutter_target=${mutter_target:-origin/master} mutter_target=${mutter_target:-origin/master}
echo Using $mutter_target instead echo Using $mutter_target instead
fi fi

View File

@@ -1,105 +0,0 @@
#!/usr/bin/env bash
OUTPUT_REGULAR=reports/lint-regular-report.txt
OUTPUT_LEGACY=reports/lint-legacy-report.txt
OUTPUT_FINAL=reports/lint-common-report.txt
OUTPUT_MR=reports/lint-mr-report.txt
LINE_CHANGES=changed-lines.txt
is_empty() {
(! grep -q . $1)
}
run_eslint() {
ARGS_LEGACY='--config lint/eslintrc-legacy.json'
local extra_args=ARGS_$1
local output=OUTPUT_$1
eslint -f unix ${!extra_args} -o ${!output} js
}
list_commit_range_additions() {
# Turn raw context-less git-diff into a list of
# filename:lineno pairs of new (+) lines
git diff -U0 "$@" -- js |
awk '
BEGIN { file=""; }
/^+++ b/ { file=substr($0,7); }
/^@@ / {
len = split($3,a,",")
start=a[1]
count=(len > 1) ? a[2] : 1
for (line=start; line<start+count; line++)
printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line;
}'
}
copy_matched_lines() {
local source=$1
local matches=$2
local target=$3
echo -n > $target
for l in $(<$matches); do
grep $l $source >> $target
done
}
create_common() {
# comm requires sorted input;
# we also strip the error message to make the following a "common" error:
# regular:
# file.js:42:23 Indentation of 55, expected 42
# legacy:
# file.js:42:23 Indentation of 55, extected 24
prepare() {
sed 's: .*::' $1 | sort
}
comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp
# Now add back the stripped error messages
copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL
rm $OUTPUT_FINAL.tmp
}
# Disable MR handling for now. We aren't ready to enforce
# non-legacy style just yet ...
unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME
if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME
branch_point=$(git merge-base HEAD FETCH_HEAD)
commit_range=$branch_point...$CI_COMMIT_SHA
list_commit_range_additions $commit_range > $LINE_CHANGES
# Don't bother with running lint when no JS changed
if is_empty $LINE_CHANGES; then
exit 0
fi
fi
echo Generating lint report using regular configuration
run_eslint REGULAR
echo Generating lint report using legacy configuration
run_eslint LEGACY
echo Done.
create_common
if ! is_empty $OUTPUT_FINAL; then
cat $OUTPUT_FINAL
exit 1
fi
# Just show the report and succeed when not testing a MR
if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
exit 0
fi
copy_matched_lines $OUTPUT_REGULAR $LINE_CHANGES $OUTPUT_MR
cat $OUTPUT_MR
is_empty $OUTPUT_MR

View File

@@ -84,6 +84,7 @@ don't use.
const Main = imports.ui.main; const Main = imports.ui.main;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
const Util = imports.misc.util; const Util = imports.misc.util;
``` ```
The alphabetical ordering should be done independently of the location of the The alphabetical ordering should be done independently of the location of the
@@ -276,49 +277,34 @@ If your usage of an object is like a hash table (and thus conceptually the keys
can have special chars in them), don't use quotes, but use brackets: `{ bar: 42 can have special chars in them), don't use quotes, but use brackets: `{ bar: 42
}`, `foo['bar']`. }`, `foo['bar']`.
## Animations ## Getters, setters, and Tweener
Most objects that are animated are actors, and most properties used in animations
are animatable, which means they can use implicit animations:
Getters and setters should be used when you are dealing with an API that is
designed around setting properties, like Tweener. If you want to animate an
arbitrary property, create a getter and setter, and use Tweener to animate the
property.
```javascript ```javascript
moveActor(actor, x, y) { var ANIMATION_TIME = 2000;
actor.ease({
x, var MyClass = class {
y, constructor() {
duration: 500, // ms this.actor = new St.BoxLayout();
mode: Clutter.AnimationMode.EASE_OUT_QUAD this._position = 0;
}); }
}
``` get position() {
return this._position;
The above is a convenience wrapper around the actual Clutter API, and should generally }
be preferred over the more verbose:
set position(value) {
```javascript this._position = value;
moveActor(actor, x, y) { this.actor.set_position(value, value);
actor.save_easing_state(); }
};
actor.set_easing_duration(500);
actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD); let myThing = new MyClass();
actor.set({ Tweener.addTween(myThing,
x, { position: 100,
y time: ANIMATION_TIME,
}); transition: 'easeOutQuad' });
actor.restore_easing_state();
}
```
There is a similar convenience API around Clutter.PropertyTransition to animate
actor (or actor meta) properties that cannot use implicit animations:
```javascript
desaturateActor(actor, desaturate) {
let factor = desaturate ? 1.0 : 0.0;
actor.ease_property('@effects.desaturate.factor', factor, {
duration: 500, // ms
mode: Clutter.AnimationMode.EASE_OUT_QUAD
});
}
``` ```

194
NEWS
View File

@@ -1,197 +1,3 @@
3.34.3
======
* polkitAgent: Fix confirming via keyboard when password-less [Jonas; #2066]
* Misc. bug fixes and cleanups [Florian; !906]
Contributors:
Jonas Dreßler, Florian Müllner
3.34.2
======
* Fix unredirection after cancelled animations [Florian; #1788]
* Use cached coordinates for window sorting in overview [Andrew; !763]
* Include shadow in window screenshots [Robert; !762]
* Use correct timezones for events [Milan, Florian; !806, #1895]
* Adjust style of system menu action buttons [monday; !802]
* Fix windows getting stuck on screen if closed while animating [Florian; !815]
* Hide stopped spinner in top bar [Joonas; !834]
* Reuse existing icons when updating the app picker grid [Georges; !841]
* Fix not-responding dialog size when using geometry scaling [Jonas; !783]
* Fix battery icon glitch in "100% but charging" case [Philip; !814]
* Update window titles in app menu [Florian; #1830]
* Improve modifier-less keyboard navigation of switcher popups [Florian; #1883]
* Use better OSK layout fallback for unsupported variants [Florian; #1907]
* Fix creating app folders with no pre-existing folders [Jonas; #1652]
* Improve DND page switching in app picker [Florian, Jonas; #1693]
* Show polkit confirmation dialog for users with no password [Joaquim; !829]
* Fix interacting with applications when magnifier is enabled [Jonas; !754]
* Tweak styling of notifications/media constrols [Joonas; !855, !865]
* Fix disable command of gnome-extensions tool [Florian; #1946]
* Enable clean session shutdown after gnome-shell failure [Benjamin; !858]
* Also remove scaled keys when texture cache is cleared [Daniel; !567]
* Don't show overflow indicator in switchers that fit screen [Florian; #1834]
* Place launched applications into a systemd scope [Benjamin; !863]
* Fix weather forecasts for automatic location when Weather is not sandboxed
[Florian; #1823]
* Dismiss switcher popups when a system modal dialogs opens [Florian; #1536]
* Misc. bug fixes and cleanups [Marco, Philip, Florian, cunidev, Jonas, Joonas;
!758, !749, !777, !811, #1884, !823, !840, !782, !847, #1836, !852, !851,
!788, #1916, !866, !884]
Contributors:
Marco Trevisan (Treviño), Benjamin Berg, Philip Chimento, Milan Crha,
Jonas Dreßler, Joonas Henriksson, Robert Mader, Daniel García Moreno,
Florian Müllner, Georges Basile Stavracas Neto, Joaquim Rocha, Andrew Watson,
cunidev, monday
Translators:
Stas Solovey [ru], Ricardo Silva Veloso [pt_BR], Yi-Jyun Pan [zh_TW],
Umarzuki Bin Mochlis Moktar [ms]
3.34.1
======
* Fix "Frequent" view icons disappearing on hover [Jonas D.; #1502]
* Allow editing app folder names [Georges, Marco; !675, !720]
* Skip property transitions while hidden [Florian; !708]
* Make menu animations more consistent [Florian, GB_2; #1595, !717]
* Improve performance when enabling/disabling all extensions [Jonas D.; !96]
* Fix extra icons appearing in "Frequent" view animation [Georges; !696]
* Fix fading out desktop icons [Harshula; #1616]
* Fix box-shadow glitch with prerendered resources [Daniel; #1186]
* Fix accidentally skipped animations [Florian; #1572]
* Fix screenshots and window animations when scaled [Robert; !728]
* Don't leak NOTIFY_SOCKET environment variable to applications [Benjamin; !741]
* Fix lock-up on X11 when ibus is already running on startup [Marco; #1712]
* Fix screen dimming on idle [Marco; #1683]
* Do not notify systemd before initialization is complete [Iain; !750]
* Support SAE secrets in network agent [Lubomir; !751]
* Fix various regressions with dynamic workspaces [Florian; #1497]
* Fixed crashes [Florian, Marco; #1678, !746]
* Misc. bug fixes and cleanups [Marco, Jonas D., Florian, Iain, Georges,
Jonas Å., Martin, Takao, Carlos; !700, !705, !709, !711, !707, #1538, !710,
!713, !699, !715, !718, !716, !719, !721, #1243, !725, !731, #1614, !683,
!732, !121, !735, !736, !740, #573, #1641, #1571]
Contributors:
Marco Trevisan (Treviño), Benjamin Berg, Jonas Dreßler, Takao Fujiwara, GB_2,
Carlos Garnacho, Harshula Jayasuriya, Iain Lane, Robert Mader,
Daniel García Moreno, Florian Müllner, Georges Basile Stavracas Neto,
Lubomir Rintel, Martin Zurowietz, Jonas Ådahl
Translators:
Rafael Fontenelle [pt_BR], Fran Dieguez [gl], Balázs Úr [hu],
Milo Casagrande [it], Daniel Șerbănescu [ro], Kukuh Syafaat [id],
Jiri Grönroos [fi], Daniel Mustieles [es], Piotr Drąg [pl],
Anders Jonsson [sv], Marek Černocký [cs], Jordi Mas [ca],
Aurimas Černius [lt], Christian Kirbach [de], Emin Tufan Çetin [tr],
Enrico Nicoletto [pt_BR], Danial Behzadi [fa], Марко Костић [sr],
Alexandre Franke [fr], Charles Monzat [fr], Kjartan Maraas [nb],
Ryuta Fujii [ja], Nathan Follens [nl], Dušan Kazik [sk], Fabio Tomat [fur],
Matej Urbančič [sl], Ask Hjorth Larsen [da], Alan Mortensen [da]
3.34.0
======
* Handle startup/shutdown of misc X11 services [Carlos; !680]
* Fix sound volume mute/unmute [Iain; #1557]
* Correctly terminate pasted text [Carlos; #1570]
Contributors:
Carlos Garnacho, Iain Lane
Translators:
Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
3.33.92
=======
* Animate pointer a11y pie timer [Jonas D.; !688]
* Fix restarting shell in systemd user session [Benjamin; !690]
* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
!691, !689, !692, #1552, !698]
Contributors:
Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
Will Thompson
Translators:
Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
3.33.91
=======
* Fix regression when adjusting brightness [Florian; #1500]
* Fix pointer a11y timeout animation [Jonas D.; #1533]
* Add new extensions CLI tool [Florian; #1234]
* Only track top-level windows [Carlos; #556]
* Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian;
!678, !682, !686]
Contributors:
Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner
Translators:
Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv],
Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi],
Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl],
Danial Behzadi [fa]
3.33.90
=======
* Implement DND app picker folder management [Georges; !643, !645, !664, !671]
* Make Clocks/Weather integration work with sandboxed apps [Florian; #1158]
* Support startup via systemd user instance [Benjamin; !507]
* Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669]
* Minimize travel distance in overview animation [Sergey; !267]
* Rescan icon theme when installed apps changed [Georges; !661]
* Consistently animate new window actions [Jonas; !662, !673]
* Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels,
Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647,
!385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665,
!667, !670, #1357, !672, !657, #1507, !674, !677]
Contributors:
Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner,
Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode,
Marco Trevisan (Treviño), verdre, Daniel van Vugt
Translators:
Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR],
Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es],
Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro],
Anders Jonsson [sv]
3.33.4
======
* Fix unintentional interference between gestures [Jonas; !598]
* Fix unintentional loop while polkit dialog is active [Ray; !602]
* Fix alt-tab icon size on HiDPI [Jonas; !587]
* Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449]
* Fix style updates for non-background CSS properties [Florian; #1212]
* Fix cursor visibility in screen recordings [Illya; #1208]
* Add option for disabling the hot corner [Florian; #688320]
* Use more fine-grained levels in battery indicator [Florian; !561, #1442]
* Fix the calculation of the maximum number of app search results [Jonas; !110]
* Handle horizontal workspace layout with gestures/animations [Florian; !575]
* Improve handling of session mode extensions [Florian, Didier; #789852]
* Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin,
Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611,
!614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626,
!491, !631, !632, !633, #1457]
Contributors:
Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho,
Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada,
Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño)
Translators:
Jordi Mas [ca], Jor Teron [mjw]
3.33.3 3.33.3
====== ======
* Prepare for optional X11 [Carlos; !378] * Prepare for optional X11 [Carlos; !378]

View File

@@ -30,6 +30,3 @@
/* Define if fdwalk is available in libc */ /* Define if fdwalk is available in libc */
#mesondefine HAVE_FDWALK #mesondefine HAVE_FDWALK
/* Define if we have gnome-desktop systemd utils */
#mesondefine HAVE_GNOME_SYSTEMD

View File

@@ -1,15 +0,0 @@
<node>
<!--
org.gnome.Shell.ClocksIntegration:
@short_description: Clocks integration interface
The interface used for exporting location settings to GNOME Shell's
world clocks integration.
-->
<interface name="org.gnome.Shell.ClocksIntegration">
<property name="Locations" type="av" access="read"/>
</interface>
</node>

View File

@@ -173,30 +173,6 @@
<arg type="s" direction="in" name="uuid"/> <arg type="s" direction="in" name="uuid"/>
</method> </method>
<!--
EnableExtension:
@uuid: The UUID of the extension
@success: Whether the operation was successful
Enable an extension.
-->
<method name="EnableExtension"> \
<arg type="s" direction="in" name="uuid"/> \
<arg type="b" direction="out" name="success"/> \
</method> \
<!--
DisableExtension:
@uuid: The UUID of the extension
@success: Whether the operation was successful
Disable an extension.
-->
<method name="DisableExtension"> \
<arg type="s" direction="in" name="uuid"/> \
<arg type="b" direction="out" name="success"/> \
</method> \
<!-- <!--
LaunchExtensionPrefs: LaunchExtensionPrefs:
@uuid: The UUID of the extension @uuid: The UUID of the extension
@@ -213,15 +189,6 @@
--> -->
<method name="CheckForUpdates"/> <method name="CheckForUpdates"/>
<signal name="ExtensionStateChanged">
<arg type="s" name="uuid"/>
<arg type="a{sv}" name="state"/>
</signal>
<!--
ExtensionStatusChanged:
Deprecated for ExtensionStateChanged
-->
<signal name="ExtensionStatusChanged"> <signal name="ExtensionStatusChanged">
<arg type="s" name="uuid"/> <arg type="s" name="uuid"/>
<arg type="i" name="state"/> <arg type="i" name="state"/>

View File

@@ -1,16 +0,0 @@
<node>
<!--
org.gnome.Shell.WeatherIntegration:
@short_description: Weather integration interface
The interface used for exporting location settings to GNOME Shell's
weather integration.
-->
<interface name="org.gnome.Shell.WeatherIntegration">
<property name="AutomaticLocation" type="b" access="read"/>
<property name="Locations" type="av" access="read"/>
</interface>
</node>

View File

@@ -9,7 +9,7 @@
<method name="ShowOSD"> <method name="ShowOSD">
<arg type="a{sv}" direction="in" name="params"/> <arg type="a{sv}" direction="in" name="params"/>
</method> </method>
<method name="ShowMonitorLabels"> <method name="ShowMonitorLabels2">
<arg type="a{sv}" direction="in" name="params"/> <arg type="a{sv}" direction="in" name="params"/>
</method> </method>
<method name="HideMonitorLabels"/> <method name="HideMonitorLabels"/>

View File

@@ -40,7 +40,6 @@
<file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file> <file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file>
@@ -49,7 +48,6 @@
<file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file>
<file preprocess="xml-stripblanks">org.gnome.Shell.xml</file> <file preprocess="xml-stripblanks">org.gnome.Shell.xml</file>
<file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file> <file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file>
<file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file> <file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file>

View File

@@ -1,15 +0,0 @@
[Unit]
Description=Disable GNOME Shell extensions after failure
# Note that this unit must not conflict with anything, and must
# be able to run in parallel with the gnome-session-shutdown.target.
DefaultDependencies=no
# We want to disable extensions only if gnome-shell has flagged the extensions
# to be a likely cause of trouble.
ConditionPathExists=%t/gnome-shell-disable-extensions
[Service]
Type=simple
# Disable extensions
ExecStart=gsettings set org.gnome.shell disable-user-extensions true
Restart=no

View File

@@ -1,27 +0,0 @@
[Unit]
Description=GNOME Shell on Wayland
# On wayland, force a session shutdown
OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target
OnFailureJobMode=replace-irreversibly
CollectMode=inactive-or-failed
RefuseManualStart=on
RefuseManualStop=on
After=gnome-session-manager.target
Requisite=gnome-session-initialized.target
PartOf=gnome-session-initialized.target
Before=gnome-session-initialized.target
# The units already conflict because they use the same BusName
#Conflicts=gnome-shell-x11.service
[Service]
Type=notify
ExecStart=@bindir@/gnome-shell
# Exit code 1 means we are probably *not* dealing with an extension failure
SuccessExitStatus=1
# On wayland we cannot restart
Restart=no
# Kill any stubborn child processes after this long
TimeoutStopSec=5

View File

@@ -1,10 +1,5 @@
[Unit] [Unit]
Description=GNOME Shell on Wayland Description=GNOME Shell (wayland sync point)
DefaultDependencies=no After=gnome-shell.service
BindsTo=gnome-shell.service
Requisite=gnome-session-initialized.target Conflicts=gnome-shell-x11.target
PartOf=gnome-session-initialized.target
Before=gnome-session-initialized.target
Requires=gnome-shell-wayland.service
After=gnome-shell-wayland.service

View File

@@ -1,33 +0,0 @@
[Unit]
Description=GNOME Shell on X11
# On X11, try to show the GNOME Session Failed screen
OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target
OnFailureJobMode=replace
CollectMode=inactive-or-failed
RefuseManualStart=on
RefuseManualStop=on
After=gnome-session-manager.target
Requisite=gnome-session-initialized.target
PartOf=gnome-session-initialized.target
Before=gnome-session-initialized.target
# The units already conflict because they use the same BusName
#Conflicts=gnome-shell-wayland.service
# Limit startup frequency more than the default
StartLimitIntervalSec=15s
StartLimitBurst=3
[Service]
Type=notify
ExecStart=@bindir@/gnome-shell
# Exit code 1 means we are probably *not* dealing with an extension failure
SuccessExitStatus=1
# On X11 we want to restart on-success (Alt+F2 + r) and on-failure.
Restart=always
# Do not wait before restarting the shell
RestartSec=0ms
# Kill any stubborn child processes after this long
TimeoutStopSec=5

View File

@@ -1,10 +1,5 @@
[Unit] [Unit]
Description=GNOME Shell on X11 Description=GNOME Shell (x11 sync point)
DefaultDependencies=no After=gnome-shell.service
BindsTo=gnome-shell.service
Requisite=gnome-session-initialized.target Conflicts=gnome-shell-wayland.target
PartOf=gnome-session-initialized.target
Before=gnome-session-initialized.target
Requires=gnome-shell-x11.service
After=gnome-shell-x11.service

View File

@@ -0,0 +1,11 @@
[Unit]
Description=GNOME Shell
Wants=gnome-session.service
After=graphical-session-pre.target gnome-session-bus.target
PartOf=graphical-session.target
[Service]
Type=dbus
ExecStart=@bindir@/gnome-shell
Restart=on-failure
BusName=org.gnome.Shell

View File

@@ -14,8 +14,6 @@ desktopconf = configuration_data()
# file when built in a non-system prefix # file when built in a non-system prefix
desktopconf.set('bindir', bindir) desktopconf.set('bindir', bindir)
desktopconf.set('VERSION', meson.project_version()) desktopconf.set('VERSION', meson.project_version())
desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false')
foreach desktop_file : desktop_files foreach desktop_file : desktop_files
i18n.merge_file('desktop', i18n.merge_file('desktop',
input: configure_file( input: configure_file(
@@ -24,7 +22,7 @@ foreach desktop_file : desktop_files
configuration: desktopconf configuration: desktopconf
), ),
output: desktop_file, output: desktop_file,
po_dir: po_dir, po_dir: '../po',
install: true, install: true,
install_dir: desktopdir, install_dir: desktopdir,
type: 'desktop' type: 'desktop'
@@ -100,23 +98,15 @@ if have_systemd
unitconf = configuration_data() unitconf = configuration_data()
unitconf.set('bindir', bindir) unitconf.set('bindir', bindir)
configure_file( unit = configure_file(
input: 'gnome-shell-x11.service.in', input: 'gnome-shell.service.in',
output: 'gnome-shell-x11.service', output: 'gnome-shell.service',
configuration: unitconf, configuration: unitconf,
install_dir: systemduserunitdir install_dir: systemduserunitdir
) )
configure_file( units = files('gnome-shell-wayland.target',
input: 'gnome-shell-wayland.service.in', 'gnome-shell-x11.target')
output: 'gnome-shell-wayland.service',
configuration: unitconf,
install_dir: systemduserunitdir
)
units = files('gnome-shell-x11.target',
'gnome-shell-wayland.target',
'gnome-shell-disable-extensions.service')
install_data(units, install_dir: systemduserunitdir) install_data(units, install_dir: systemduserunitdir)
endif endif

View File

@@ -14,4 +14,3 @@ X-GNOME-Autostart-Phase=DisplayServer
X-GNOME-Provides=panel;windowmanager; X-GNOME-Provides=panel;windowmanager;
X-GNOME-Autostart-Notify=true X-GNOME-Autostart-Notify=true
X-GNOME-AutoRestart=false X-GNOME-AutoRestart=false
X-GNOME-HiddenUnderSystemd=@systemd_hidden@

View File

@@ -21,17 +21,6 @@
EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell. EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell.
</description> </description>
</key> </key>
<key name="disabled-extensions" type="as">
<default>[]</default>
<summary>UUIDs of extensions to force disabling</summary>
<description>
GNOME Shell extensions have a UUID property; this key lists extensions
which should be disabled, even if loaded as part of the current mode.
You can also manipulate this list with the EnableExtension and
DisableExtension D-Bus methods on org.gnome.Shell.
This key takes precedence over the “enabled-extensions” setting.
</description>
</key>
<key name="disable-user-extensions" type="b"> <key name="disable-user-extensions" type="b">
<default>false</default> <default>false</default>
<summary>Disable user extensions</summary> <summary>Disable user extensions</summary>
@@ -110,6 +99,7 @@
</description> </description>
</key> </key>
<child name="keybindings" schema="org.gnome.shell.keybindings"/> <child name="keybindings" schema="org.gnome.shell.keybindings"/>
<child name="keyboard" schema="org.gnome.shell.keyboard"/>
</schema> </schema>
<schema id="org.gnome.shell.keybindings" path="/org/gnome/shell/keybindings/" <schema id="org.gnome.shell.keybindings" path="/org/gnome/shell/keybindings/"
@@ -150,6 +140,11 @@
Keybinding to focus the active notification. Keybinding to focus the active notification.
</description> </description>
</key> </key>
<key name="pause-resume-tweens" type="as">
<default>[]</default>
<summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary>
<description></description>
</key>
<key name="switch-to-application-1" type="as"> <key name="switch-to-application-1" type="as">
<default>["&lt;Super&gt;1"]</default> <default>["&lt;Super&gt;1"]</default>
<summary>Switch to application 1</summary> <summary>Switch to application 1</summary>
@@ -188,6 +183,17 @@
</key> </key>
</schema> </schema>
<schema id="org.gnome.shell.keyboard" path="/org/gnome/shell/keyboard/"
gettext-domain="@GETTEXT_PACKAGE@">
<key name="keyboard-type" type="s">
<default>'touch'</default>
<summary>Which keyboard to use</summary>
<description>
The type of keyboard to use.
</description>
</key>
</schema>
<schema id="org.gnome.shell.app-switcher" <schema id="org.gnome.shell.app-switcher"
path="/org/gnome/shell/app-switcher/" path="/org/gnome/shell/app-switcher/"
gettext-domain="@GETTEXT_PACKAGE@"> gettext-domain="@GETTEXT_PACKAGE@">
@@ -228,36 +234,6 @@
</key> </key>
</schema> </schema>
<schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/"
gettext-domain="@GETTEXT_PACKAGE@">
<key name="locations" type="av">
<summary>Locations</summary>
<description>
The locations to show in world clocks
</description>
<default>[]</default>
</key>
</schema>
<schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/"
gettext-domain="@GETTEXT_PACKAGE@">
<key name="automatic-location" type="b">
<summary>Automatic location</summary>
<description>
Whether to fetch the current location or not
</description>
<default>false</default>
</key>
<key name="locations" type="av">
<summary>Location</summary>
<description>
The location for which to show a forecast
</description>
<default>[]</default>
</key>
</schema>
<!-- unused, change 00_org.gnome.shell.gschema.override instead --> <!-- unused, change 00_org.gnome.shell.gschema.override instead -->
<schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/" <schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/"
gettext-domain="@GETTEXT_PACKAGE@"> gettext-domain="@GETTEXT_PACKAGE@">

View File

@@ -25,10 +25,8 @@ $cakeisalie: "This stylesheet is generated, DO NOT EDIT";
/* GLOBALS */ /* GLOBALS */
$panel-corner-radius: 6px;
$modal_radius: 9px; $medium_radius: 9px;
$button_radius: 5px;
$panel-corner-radius: $button_radius + 1;
$_trough_color: transparentize($fg_color, 0.9); $_trough_color: transparentize($fg_color, 0.9);
$_bubble_borders_color: lighten($borders_color, if($variant=='light', 0%, 5%)); $_bubble_borders_color: lighten($borders_color, if($variant=='light', 0%, 5%));
@@ -48,7 +46,7 @@ stage {
/* Buttons */ /* Buttons */
.button, %button { .button, %button {
border-radius: $button_radius; border-radius: 5px;
border-width: 1px; border-width: 1px;
min-height: 22px; min-height: 22px;
padding: 4px 32px; padding: 4px 32px;
@@ -70,21 +68,21 @@ stage {
border-top: 1px solid $_bubble_borders_color; border-top: 1px solid $_bubble_borders_color;
&:first-child { &:first-child {
border-radius: 0px 0px 0px $modal_radius; border-radius: 0px 0px 0px $medium_radius;
} }
&:last-child { &:last-child {
border-right-width: 0px; border-right-width: 0px;
border-radius: 0px 0px $modal_radius 0px; border-radius: 0px 0px $medium_radius 0px;
} }
&:first-child:last-child { &:first-child:last-child {
border-right-width: 0px; border-right-width: 0px;
border-radius: 0px 0px $modal_radius $modal_radius; border-radius: 0px 0px $medium_radius $medium_radius;
} }
} }
/* Entries */ /* Entries */
StEntry { StEntry {
border-radius: $button_radius; border-radius: 5px;
padding: 4px; padding: 4px;
border-width: 1px; border-width: 1px;
color: $fg_color; color: $fg_color;
@@ -148,7 +146,8 @@ StScrollBar {
-slider-handle-radius: 8px; -slider-handle-radius: 8px;
-slider-handle-border-width: 1px; -slider-handle-border-width: 1px;
-slider-handle-border-color: $borders_color; -slider-handle-border-color: $borders_color;
color: if($variant == 'light', lighten($bg_color, 10%), darken($bg_color,4%)); color: $bg_color; /* FIXME to match gtk, we'd need to style the border of the slider, not
the whole widget */
&:hover { color: $_hover_bg_color; } &:hover { color: $_hover_bg_color; }
&:active { color: $_active_bg_color; } &:active { color: $_active_bg_color; }
} }
@@ -189,12 +188,12 @@ StScrollBar {
/* Modal Dialogs */ /* Modal Dialogs */
.headline { font-size: 110%; } .headline { @extend %heading; }
.lightbox { background-color: black; } .lightbox { background-color: black; }
.flashspot { background-color: white; } .flashspot { background-color: white; }
.modal-dialog { .modal-dialog {
border-radius: $modal_radius; border-radius: 9px;
@extend %bubble-panel; @extend %bubble-panel;
.modal-dialog-content-box { .modal-dialog-content-box {
padding: 24px; padding: 24px;
@@ -206,8 +205,7 @@ StScrollBar {
} }
.run-dialog-button-box { padding-top: 1em; } .run-dialog-button-box { padding-top: 1em; }
.run-dialog-label { .run-dialog-label {
@include fontsize($font-size + 1.1); @extend %title-4;
font-weight: normal;
color: $fg_color; color: $fg_color;
padding-bottom: .4em; padding-bottom: .4em;
} }
@@ -215,8 +213,8 @@ StScrollBar {
} }
.mount-dialog-subject, .mount-dialog-subject,
.end-session-dialog-subject { //this should be a generic header class .end-session-dialog-subject {
@include fontsize($font-size * 1.3); @extend %title-2;
} }
/* Message Dialog */ /* Message Dialog */
@@ -236,12 +234,12 @@ StScrollBar {
} }
.message-dialog-title { .message-dialog-title {
font-weight: bold; @extend %title-2;
} }
.message-dialog-subtitle { .message-dialog-subtitle {
@extend %heading;
color: $fg_color; color: $fg_color;
font-weight: bold;
} }
/* End Session Dialog */ /* End Session Dialog */
@@ -302,7 +300,7 @@ StScrollBar {
} }
.end-session-dialog-list-header { .end-session-dialog-list-header {
font-weight: bold; @extend %heading;
&:rtl { text-align: right; } &:rtl { text-align: right; }
} }
@@ -313,12 +311,11 @@ StScrollBar {
.end-session-dialog-app-list-item-name, .end-session-dialog-app-list-item-name,
.end-session-dialog-session-list-item-name { .end-session-dialog-session-list-item-name {
font-weight: bold; @extend %heading;
} }
.end-session-dialog-app-list-item-description { .end-session-dialog-app-list-item-description {
color: darken($fg_color,5%); color: darken($fg_color,5%);
font-size: 10pt;
} }
/* ShellMountOperation Dialogs */ /* ShellMountOperation Dialogs */
@@ -374,11 +371,6 @@ StScrollBar {
&:rtl { padding-left: 17px; } &:rtl { padding-left: 17px; }
} }
.mount-dialog-app-list-item-name {
font-size: 10pt;
}
/* Password or Authentication Dialog */ /* Password or Authentication Dialog */
.prompt-dialog { .prompt-dialog {
@@ -401,13 +393,11 @@ StScrollBar {
} }
.prompt-dialog-error-label { .prompt-dialog-error-label {
font-size: 10pt;
color: $warning_color; color: $warning_color;
padding-bottom: 8px; padding-bottom: 8px;
} }
.prompt-dialog-info-label { .prompt-dialog-info-label {
font-size: 10pt;
padding-bottom: 8px; padding-bottom: 8px;
} }
@@ -416,7 +406,6 @@ StScrollBar {
} }
.prompt-dialog-null-label { .prompt-dialog-null-label {
font-size: 10pt;
padding-bottom: 8px; padding-bottom: 8px;
} }
@@ -472,7 +461,7 @@ StScrollBar {
} }
.audio-selection-title { .audio-selection-title {
font-weight: bold; @extend %heading;
text-align: center; text-align: center;
} }
@@ -556,9 +545,9 @@ StScrollBar {
&:ltr { padding: .4em 1.75em .4em 0em; } &:ltr { padding: .4em 1.75em .4em 0em; }
&:rtl { padding: .4em 0em .4em 1.75em; } &:rtl { padding: .4em 0em .4em 1.75em; }
&:checked { &:checked {
@extend %heading;
background-color: $bg_color; background-color: $bg_color;
box-shadow: inset 0 -1px 0px $_bubble_borders_color; box-shadow: inset 0 -1px 0px $_bubble_borders_color;
font-weight: bold;
} }
&.selected { &.selected {
background-color: transparentize(white, if($variant=='light', 0.2, 0.9)); background-color: transparentize(white, if($variant=='light', 0.2, 0.9));
@@ -591,7 +580,7 @@ StScrollBar {
} }
.popup-menu-boxpointer, .popup-menu-boxpointer,
.candidate-popup-boxpointer { .candidate-popup-boxpointer {
-arrow-border-radius: $button_radius+4; -arrow-border-radius: $medium_radius;
-arrow-background-color: $bg_color; -arrow-background-color: $bg_color;
-arrow-border-width: 1px; -arrow-border-width: 1px;
-arrow-border-color: if($variant=='light', transparentize(black, 0.6), $borders_color); -arrow-border-color: if($variant=='light', transparentize(black, 0.6), $borders_color);
@@ -610,13 +599,6 @@ StScrollBar {
border-bottom-style: solid; border-bottom-style: solid;
} }
// Rename popup
.rename-folder-popup {
.rename-folder-popup-item {
spacing: 6px;
&:ltr, &:rtl { padding: 0, 12px; }
}
}
// Background menu // Background menu
.background-menu { -boxpointer-gap: 4px; -arrow-rise: 0px; } .background-menu { -boxpointer-gap: 4px; -arrow-rise: 0px; }
@@ -626,18 +608,6 @@ StScrollBar {
app menu inside the main app window itself rather than the top bar app menu inside the main app window itself rather than the top bar
*/ */
/*************
* App Icons *
*************/
/* Outline for low res icons */
.lowres-icon {
icon-shadow: 0 1px 2px rgba(0,0,0,0.3);
}
/* Drapshadow for large icons */
.icon-dropshadow {
icon-shadow: 0 1px 2px rgba(0,0,0,0.4);
}
/* OSD */ /* OSD */
.osd-window { .osd-window {
@@ -648,7 +618,7 @@ StScrollBar {
min-width: 64px; min-width: 64px;
min-height: 64px; min-height: 64px;
.osd-monitor-label { font-size: 3em; } .osd-monitor-label { @extend %title-1; }
.level { .level {
height: 0.6em; height: 0.6em;
-barlevel-height: 0.6em; -barlevel-height: 0.6em;
@@ -747,9 +717,8 @@ StScrollBar {
spacing: 8px; spacing: 8px;
} }
.ws-switcher-active-up, .ws-switcher-active-down, .ws-switcher-active-up, .ws-switcher-active-down {
.ws-switcher-active-left, .ws-switcher-active-right { height: 50px;
height: 52px;
background-color: $selected_bg_color; background-color: $selected_bg_color;
color: $selected_fg_color; color: $selected_fg_color;
background-size: 32px; background-size: 32px;
@@ -822,8 +791,8 @@ StScrollBar {
/* TOP BAR */ /* TOP BAR */
#panel { #panel {
@extend %heading;
background-color: black; background-color: black;
font-weight: bold;
height: 1.86em; height: 1.86em;
font-feature-settings: "tnum"; font-feature-settings: "tnum";
@@ -855,9 +824,9 @@ StScrollBar {
} }
.panel-button { .panel-button {
@extend %heading;
-natural-hpadding: 12px; -natural-hpadding: 12px;
-minimum-hpadding: 6px; -minimum-hpadding: 6px;
font-weight: bold;
color: #ccc; color: #ccc;
.app-menu-icon { .app-menu-icon {
@@ -949,33 +918,33 @@ StScrollBar {
.world-clocks-button, .world-clocks-button,
.weather-button, .weather-button,
.events-section-title { .events-section-title {
&:hover, &:focus { background-color: $_hover_bg_color } &:hover, focus { background-color: $_hover_bg_color }
&:active { background-color: $_active_bg_color } &:active { background-color: $_active_bg_color }
} }
.datemenu-today-button .day-label { .datemenu-today-button .day-label {
@extend %heading;
} }
.datemenu-today-button .date-label { .datemenu-today-button .date-label {
font-size: 1.5em; @extend %large-title;
font-weight: 300;
} }
.world-clocks-header, .world-clocks-header,
.weather-header, .weather-header,
.events-section-title { .events-section-title,
.calendar-month-label {
@extend %heading;
color: darken($fg_color,40%); color: darken($fg_color,40%);
font-weight: bold;
} }
.weather-header.location { .weather-header.location {
font-weight: normal; @extend %caption;
font-size: 0.9em;
} }
.world-clocks-grid, .world-clocks-grid,
.weather-grid { .weather-grid {
spacing-rows: 0.4em; spacing-rows: 0.8em;
spacing-columns: 0.8em; spacing-columns: 0.8em;
} }
@@ -983,35 +952,26 @@ StScrollBar {
spacing: 0.4em; spacing: 0.4em;
} }
.world-clocks-city {
font-weight: bold;
font-size: 0.9em;
}
.world-clocks-time { .world-clocks-time {
color: darken($fg_color,20%); font-feature-settings: "tnum";
font-feature-settings: "tnum";
font-size: 1.2em;
} }
.world-clocks-timezone { .world-clocks-timezone {
color: $fg_color; color: darken($fg_color,40%);
font-feature-settings: "tnum"; font-feature-settings: "tnum";
font-size: 0.9em; @extend %caption;
} }
.weather-forecast-icon { .weather-forecast-icon {
icon-size: 2.18em; icon-size: 32px;
} }
.weather-forecast-time { .weather-forecast-time {
@extend %caption;
color: darken($fg_color,40%); color: darken($fg_color,40%);
font-size: 0.8em;
} }
.calendar-month-label { .calendar-month-label {
color: lighten($fg_color,5%);
font-weight: bold;
padding: 8px 0; padding: 8px 0;
&:focus {} &:focus {}
} }
@@ -1020,7 +980,7 @@ StScrollBar {
background-color: transparent; background-color: transparent;
width: 32px; width: 32px;
border-radius: 4px; border-radius: 4px;
&:hover, &:focus { background-color: $_hover_bg_color; } &:hover, focus { background-color: $_hover_bg_color; }
&:active { background-color: transparentize($fg_color, 0.84); } &:active { background-color: transparentize($fg_color, 0.84); }
} }
@@ -1029,23 +989,22 @@ StScrollBar {
} }
.calendar-day-base { .calendar-day-base {
font-size: 80%; @extend %caption;
text-align: center; text-align: center;
width: 2.4em; height: 2.4em; width: 2.4em; height: 2.4em;
padding: 0.1em; padding: 0.1em;
margin: 2px; margin: 2px;
border-radius: 1.4em; border-radius: 1.4em;
font-feature-settings: "tnum"; font-feature-settings: "tnum";
&:hover, &:focus { background-color: $_hover_bg_color; } &:hover, focus { background-color: $_hover_bg_color; }
&:active,&:selected { &:active,&:selected {
color: lighten($selected_fg_color,5%); color: lighten($selected_fg_color,5%);
background-color: $selected_bg_color; background-color: $selected_bg_color;
border-color: transparent; //avoid jumparound due to today border-color: transparent; //avoid jumparound due to today
} }
&.calendar-day-heading { //day of week heading &.calendar-day-heading { //day of week heading
color: lighten($fg_color,5%); color: darken($fg_color,40%);
margin-top: 1em; // margin-top: 1em;
font-size: 70%;
} }
} }
.calendar-day { //border collapse hack - see calendar.js .calendar-day { //border collapse hack - see calendar.js
@@ -1060,14 +1019,15 @@ StScrollBar {
color: $insensitive_fg_color; color: $insensitive_fg_color;
} }
.calendar-today { .calendar-today {
font-weight: bold; @extend %caption-heading;
color: lighten($fg_color,5%); //color: lighten($fg_color,10%);
background-color: darken($bg_color,5%); //background-color: darken($bg_color,5%);
// border: 1px solid lighten($_bubble_borders_color,20%); border: 1px solid $_bubble_borders_color;
} }
.calendar-day-with-events { .calendar-day-with-events {
@extend %caption-heading;
color: lighten($fg_color,10%); color: lighten($fg_color,10%);
font-weight: bold;
background-image: url("resource:///org/gnome/shell/theme/calendar-today.svg"); background-image: url("resource:///org/gnome/shell/theme/calendar-today.svg");
} }
.calendar-other-month-day { .calendar-other-month-day {
@@ -1075,8 +1035,7 @@ StScrollBar {
opacity: 0.5; opacity: 0.5;
} }
.calendar-week-number { .calendar-week-number {
font-size: 70%; @extend %caption-heading;
font-weight: bold;
width: 2.3em; height: 1.8em; width: 2.3em; height: 1.8em;
border-radius: 2px; border-radius: 2px;
padding: 0.5em 0 0; padding: 0.5em 0 0;
@@ -1133,8 +1092,8 @@ StScrollBar {
} }
.message-secondary-bin > .event-time { .message-secondary-bin > .event-time {
@extend %caption;
color: $fg_color; color: $fg_color;
font-size: 0.7em;
/* HACK: the label should be baseline-aligned with a 1em label, /* HACK: the label should be baseline-aligned with a 1em label,
fake this with some bottom padding */ fake this with some bottom padding */
padding-bottom: 0.13em; padding-bottom: 0.13em;
@@ -1153,21 +1112,14 @@ StScrollBar {
padding: 10px; padding: 10px;
} }
.message-close-button {
color: lighten($fg_color, 15%);
&:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); }
&:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); }
}
.message-media-control { .message-media-control {
padding: 12px; padding: 12px;
color: lighten($fg_color, 15%); color: lighten($fg_color, 15%);
&:last-child:ltr { padding-right: 18px; } &:last-child:ltr { padding-right: 18px; }
&:last-child:rtl { padding-left: 18px; } &:last-child:rtl { padding-left: 18px; }
&:hover { color: if($variant=='light', lighten($fg_color, 30%), darken($fg_color, 10%)); } &:hover { color: $fg_color; }
&:active { color: if($variant=='light', lighten($fg_color, 40%), darken($fg_color, 20%)); } &:insensitive { color: darken($fg_color,40%); }
&:insensitive { color: if($variant=='light', lighten($fg_color, 50%), darken($fg_color, 40%)); }
} }
.media-message-cover-icon { .media-message-cover-icon {
@@ -1184,7 +1136,13 @@ StScrollBar {
// a little unstructured mess: // a little unstructured mess:
.system-switch-user-submenu-icon {
icon-size: 16px;
padding: 0 4px;
}
#appMenu { #appMenu {
spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg");
spacing: 4px; spacing: 4px;
.label-shadow { color: transparent; } .label-shadow { color: transparent; }
@@ -1216,11 +1174,12 @@ StScrollBar {
&:hover, &:focus { &:hover, &:focus {
background-color: $_hover_bg_color; background-color: $_hover_bg_color;
color: $fg_color; color: $fg_color;
border: none;
padding: 14px;
} }
&:active { &:active {
background-color: $selected_bg_color; background-color: $selected_bg_color;
color: $selected_fg_color; color: $selected_fg_color;
border-color: $selected_borders_color;
} }
& > StIcon { icon-size: 16px; } & > StIcon { icon-size: 16px; }
@@ -1305,17 +1264,16 @@ StScrollBar {
.nm-dialog-airplane-box { spacing: 12px; } .nm-dialog-airplane-box { spacing: 12px; }
.nm-dialog-airplane-headline { .nm-dialog-airplane-headline {
font-weight: bold; @extend %heading;
text-align: center; text-align: center;
} }
.nm-dialog-airplane-text { color: $fg_color; } .nm-dialog-airplane-text { color: $fg_color; }
.nm-dialog-header-icon { icon-size: 32px; } .nm-dialog-header-icon { icon-size: 32px; }
.nm-dialog-scroll-view { border: 2px solid $borders_color; } .nm-dialog-scroll-view { border: 2px solid $borders_color; }
.nm-dialog-header { font-weight: bold; } .nm-dialog-header { @extend %title-2; }
.nm-dialog-item { .nm-dialog-item {
font-size: 110%;
border-bottom: 1px solid $borders_color; border-bottom: 1px solid $borders_color;
padding: 12px; padding: 12px;
spacing: 20px; spacing: 20px;
@@ -1351,8 +1309,8 @@ StScrollBar {
.window-clone-border { .window-clone-border {
$_bg: transparentize(white, 0.65); $_bg: transparentize(white, 0.65);
border: 7px solid $_bg; border: 5px solid $_bg;
border-radius: $modal_radius; border-radius: 6px;
// For window decorations with round corners we can't match // For window decorations with round corners we can't match
// the exact shape when the window is scaled. So apply a shadow // the exact shape when the window is scaled. So apply a shadow
// to fix that case // to fix that case
@@ -1389,8 +1347,11 @@ StScrollBar {
//search results //search results
#searchResultsContent { #searchResultsBin {
max-width: 1000px; max-width: 1000px;
}
#searchResultsContent {
padding-left: 20px; padding-left: 20px;
padding-right: 20px; padding-right: 20px;
spacing: 16px; spacing: 16px;
@@ -1419,7 +1380,7 @@ StScrollBar {
#dash { #dash {
@extend %overview-panel; @extend %overview-panel;
font-size: 9pt; @extend %caption;
padding: 4px 0; padding: 4px 0;
border-radius: 0px 9px 9px 0px; border-radius: 0px 9px 9px 0px;
@@ -1506,11 +1467,11 @@ StScrollBar {
.search-provider-icon, .search-provider-icon,
.list-search-result { .list-search-result {
@extend %icon_tile; @extend %icon_tile;
&:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
&:focus, &:selected, &:hover { &:focus, &:selected, &:hover {
background-color: transparentize($osd_fg_color,.9); background-color: transparentize($osd_fg_color,.9);
transition-duration: 200ms; transition-duration: 200ms;
} }
&:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
} }
.app-well-app, .app-well-app,
.app-well-app.app-folder, .app-well-app.app-folder,
@@ -1519,6 +1480,10 @@ StScrollBar {
& .overview-icon { & .overview-icon {
@extend %icon_tile; @extend %icon_tile;
} }
&:active .overview-icon,
&:checked .overview-icon {
background-color: transparentize(darken($osd_bg_color,10%), 0.5);
}
&:hover .overview-icon, &:hover .overview-icon,
&:focus .overview-icon, &:focus .overview-icon,
&:selected .overview-icon { &:selected .overview-icon {
@@ -1527,13 +1492,7 @@ StScrollBar {
border-image: none; border-image: none;
background-image: none; background-image: none;
} }
&:drop .overview-icon {
background-color: transparentize($selected_bg_color,.15);
}
&:active .overview-icon,
&:checked .overview-icon {
background-color: transparentize(darken($osd_bg_color,10%), 0.5);
}
} }
.app-well-app-running-dot { //running apps indicator .app-well-app-running-dot { //running apps indicator
@@ -1544,7 +1503,7 @@ StScrollBar {
%icon_tile { %icon_tile {
color: $osd_fg_color; color: $osd_fg_color;
border-radius: $button_radius+4; border-radius: $medium_radius;
padding: 6px; padding: 6px;
border: 1px solid transparent; border: 1px solid transparent;
transition-duration: 100ms; transition-duration: 100ms;
@@ -1623,6 +1582,7 @@ StScrollBar {
} }
//Some hacks I don't even //Some hacks I don't even
.search-display > StBoxLayout,
.all-apps, .all-apps,
.frequent-apps > StBoxLayout { .frequent-apps > StBoxLayout {
// horizontal padding to make sure scrollbars or dash don't overlap content // horizontal padding to make sure scrollbars or dash don't overlap content
@@ -1635,9 +1595,9 @@ StScrollBar {
border: none; border: none;
} }
// Search status, like "Searching..." and "No results"
%status_text { %status_text {
font-size: 2em; @extend %large-title;
font-weight: bold;
color: $osd_fg_color; color: $osd_fg_color;
} }
@@ -1647,17 +1607,16 @@ StScrollBar {
// Banners // Banners
.notification-banner { .notification-banner {
font-size: 11pt;
width: 34em; width: 34em;
margin: 5px; margin: 5px;
border-radius: $modal_radius; border-radius: $medium-radius;
border: if($variant == 'light', none, $_bubble_borders_color); border: if($variant == 'light', none, $_bubble_borders_color);
min-height: 64px; min-height: 64px;
box-shadow: 0 1px 2px transparentize(black, 0.7); box-shadow: 0 1px 2px transparentize(black, 0.7);
&:hover { background: $bg_color; } &:hover { background: $bg_color; }
&, &:focus, &:active { &, &:focus, &:active {
background-color: $bg_color; background-color: $bg_color;
.message-title { color: $fg_color } .message-title { color: $fg_color; }
.message-content { color: $fg_color; } .message-content { color: $fg_color; }
} }
@@ -1684,18 +1643,6 @@ StScrollBar {
border: none; border: none;
} }
} }
.summary-source-counter {
font-size: 10pt;
font-weight: bold;
height: 1.6em; width: 1.6em;
-shell-counter-overlap-x: 3px;
-shell-counter-overlap-y: 3px;
background-color: $selected_bg_color;
color: $selected_fg_color;
border: 2px solid $fg_color;
box-shadow: 0 2px 2px rgba(0,0,0,0.5);
border-radius: 0.9em; // should be 0.8 but whatever; wish I could do 50%;
}
.secondary-icon { icon-size: 1.09em; } .secondary-icon { icon-size: 1.09em; }
@@ -1714,9 +1661,8 @@ StScrollBar {
&:rtl { padding-left: 0; padding-right: 18pt; } &:rtl { padding-left: 0; padding-right: 18pt; }
} }
.chat-meta-message { .chat-meta-message {
@extend %caption-heading;
padding-left: 4px; padding-left: 4px;
font-size: 9pt;
font-weight: bold;
color: lighten($fg_color,18%); color: lighten($fg_color,18%);
&:rtl { padding-left: 0; padding-right: 4px; } &:rtl { padding-left: 0; padding-right: 4px; }
} }
@@ -1802,36 +1748,30 @@ StScrollBar {
} }
.keyboard-key { .keyboard-key {
$_key_bg: opacify(lighten($osd_bg_color, 9%), 1); background-color: #393f3f;
background-color: $_key_bg;
min-height: 1.2em; min-height: 1.2em;
min-width: 1.2em; min-width: 1.2em;
font-size: 16pt; font-size: 16pt;
border-radius: $button_radius; border-radius: 3px;
border: 1px solid $osd_outer_borders_color; border: 1px solid #464d4d;
color: $osd_fg_color; color: #e5e5e5;
&:focus { @include button(focus); } &:focus { @include button(focus); }
&:hover, &:checked { background-color: lighten($_key_bg, 3%); } &:hover,&:checked { @include button(hover); }
&:active { background-color: darken($_key_bg, 2%); } &:active { @include button(active);}
&:grayed { //FIXME &:grayed { //FIXME
background-color: $osd_bg_color; background-color: $osd_bg_color;
color: $osd_fg_color; color: $osd_fg_color;
border-color: $osd_borders_color; border-color: $osd_borders_color;
} }
&.default-key { &.default-key {
$_default_key_bg: opacify($osd_bg_color, 1); border-color: #2d3232;
border-color: $osd_outer_borders_color; background-color: #1d2020;
background-color: $_default_key_bg;
background-size: 20px; background-size: 20px;
&:hover, &:checked { background-color: lighten($_default_key_bg, 3%); }
&:active { background-color: darken($_default_key_bg, 2%); }
} }
&.enter-key { &.enter-key {
border-color: lighten($selected_bg_color, 5%); border-color: #005684;
background-color: $selected_bg_color; background-color: #006098;
background-image: url("resource:///org/gnome/shell/theme/key-enter.svg"); background-image: url("resource:///org/gnome/shell/theme/key-enter.svg");
&:hover, &:checked { background-color: lighten($selected_bg_color, 3%); }
&:active { background-color: darken($selected_bg_color, 2%); }
} }
&.shift-key-lowercase { &.shift-key-lowercase {
background-image: url("resource:///org/gnome/shell/theme/key-shift.svg"); background-image: url("resource:///org/gnome/shell/theme/key-shift.svg");
@@ -1870,8 +1810,8 @@ StScrollBar {
.emoji-panel { .emoji-panel {
.keyboard-key:latched { .keyboard-key:latched {
border-color: lighten($selected_bg_color, 5%); border-color: #005684;
background-color: $selected_bg_color; background-color: #006098;
} }
} }
@@ -1935,7 +1875,7 @@ StScrollBar {
StEntry { StEntry {
@extend %search_entry; @extend %search_entry;
border-radius: $button_radius; border-radius: 5px;
@if $variant=='dark' { @if $variant=='dark' {
$_gdm_entry_bg: transparentize(lighten(desaturate(#241f31, 20%), 2%), 0.5); $_gdm_entry_bg: transparentize(lighten(desaturate(#241f31, 20%), 2%), 0.5);
background-color: $_gdm_entry_bg; background-color: $_gdm_entry_bg;
@@ -2008,8 +1948,7 @@ StScrollBar {
} }
} }
.login-dialog-not-listed-label { .login-dialog-not-listed-label {
font-size: 90%; @extend %heading;
font-weight: bold;
color: darken($osd_fg_color,30%); color: darken($osd_fg_color,30%);
padding-top: 1em; padding-top: 1em;
} }
@@ -2038,8 +1977,7 @@ StScrollBar {
.login-dialog-username, .login-dialog-username,
.user-widget-label { .user-widget-label {
color: $osd_fg_color; color: $osd_fg_color;
font-size: 120%; @extend %title-3;
font-weight: bold;
text-align: left; text-align: left;
padding-left: 15px; padding-left: 15px;
} }
@@ -2057,7 +1995,6 @@ StScrollBar {
.login-dialog-prompt-label { .login-dialog-prompt-label {
color: darken($osd_fg_color, 20%); color: darken($osd_fg_color, 20%);
font-size: 110%;
padding-top: 1em; padding-top: 1em;
} }
@@ -2129,7 +2066,7 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
.screen-shield-notification-label { .screen-shield-notification-label {
font-weight: bold; @extend %heading;
padding: 0px 0px 0px 12px; padding: 0px 0px 0px 12px;
} }
@@ -2169,9 +2106,9 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
} }
.labels { spacing: 4px; } .labels { spacing: 4px; }
.notebook-tab { .notebook-tab {
@extend %heading;
-natural-hpadding: 12px; -natural-hpadding: 12px;
-minimum-hpadding: 6px; -minimum-hpadding: 6px;
font-weight: bold;
color: #ccc; color: #ccc;
transition-duration: 100ms; transition-duration: 100ms;
padding-left: .3em; padding-left: .3em;
@@ -2232,7 +2169,7 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
} }
.lg-extension-name { .lg-extension-name {
font-weight: bold; @extend %heading;
} }
.lg-extension-meta { .lg-extension-meta {
@@ -2245,3 +2182,39 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
border-radius: 4px; border-radius: 4px;
padding: 6px; padding: 6px;
} }
// text styles
%large-title {
font-weight: 300;
font-size: 24pt;
// letter-spacing: 0.2rem; This breaks the style
}
%title-1 {
font-weight: 800;
font-size: 20pt;
}
%title-2 {
font-weight: 800;
font-size: 15pt;
}
%title-3 {
font-weight: 700;
font-size: 15pt;
}
%title-4 {
font-weight: 700;
font-size: 13pt;
}
%heading {
font-weight: 700;
font-size: 11pt;
}
%caption-heading {
font-weight: 700;
font-size: 9pt;
}
%caption {
font-weight: 400;
font-size: 9pt;
}

View File

@@ -28,7 +28,7 @@ foreach iface : ifaces
output: 'doc-gen-' + iface[1], output: 'doc-gen-' + iface[1],
command: [ command: [
'gdbus-codegen', 'gdbus-codegen',
'--interface-prefix=@0@.'.format(iface[0]), '--interface-prefix=@0@.'.format(iface),
'--generate-docbook', 'doc-gen', '--generate-docbook', 'doc-gen',
'--output-directory', '@OUTDIR@', '--output-directory', '@OUTDIR@',
'@INPUT@' '@INPUT@'

View File

@@ -1,7 +1,3 @@
/* exported main */
imports.gi.versions.Gdk = '3.0';
imports.gi.versions.Gtk = '3.0';
const Gettext = imports.gettext; const Gettext = imports.gettext;
const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi; const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi;
const Format = imports.format; const Format = imports.format;
@@ -12,8 +8,6 @@ const Config = imports.misc.config;
const ExtensionUtils = imports.misc.extensionUtils; const ExtensionUtils = imports.misc.extensionUtils;
const { loadInterfaceXML } = imports.misc.fileUtils; const { loadInterfaceXML } = imports.misc.fileUtils;
const { ExtensionState } = ExtensionUtils;
const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions'); const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions');
const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface); const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface);
@@ -23,54 +17,74 @@ function stripPrefix(string, prefix) {
return string; return string;
} }
var Application = GObject.registerClass({ var Application = class {
GTypeName: 'ExtensionPrefs_Application' constructor() {
}, class Application extends Gtk.Application {
_init() {
GLib.set_prgname('gnome-shell-extension-prefs'); GLib.set_prgname('gnome-shell-extension-prefs');
super._init({ this.application = new Gtk.Application({
application_id: 'org.gnome.shell.ExtensionPrefs', application_id: 'org.gnome.shell.ExtensionPrefs',
flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
}); });
this.application.connect('activate', this._onActivate.bind(this));
this.application.connect('command-line', this._onCommandLine.bind(this));
this.application.connect('startup', this._onStartup.bind(this));
this._extensionPrefsModules = {};
this._startupUuid = null; this._startupUuid = null;
this._loaded = false; this._loaded = false;
this._skipMainWindow = false; this._skipMainWindow = false;
this._shellProxy = null;
} }
get shellProxy() { _extensionAvailable(uuid) {
return this._shellProxy; let extension = ExtensionUtils.extensions[uuid];
}
_showPrefs(uuid) { if (!extension)
let row = this._extensionSelector.get_children().find(c => {
return c.uuid === uuid && c.hasPrefs;
});
if (!row)
return false; return false;
if (!extension.dir.get_child('prefs.js').query_exists(null))
return false;
return true;
}
_getExtensionPrefsModule(extension) {
let uuid = extension.metadata.uuid;
if (this._extensionPrefsModules.hasOwnProperty(uuid))
return this._extensionPrefsModules[uuid];
ExtensionUtils.installImporter(extension);
let prefsModule = extension.imports.prefs;
prefsModule.init(extension.metadata);
this._extensionPrefsModules[uuid] = prefsModule;
return prefsModule;
}
_selectExtension(uuid) {
if (!this._extensionAvailable(uuid))
return;
let extension = ExtensionUtils.extensions[uuid];
let widget; let widget;
try { try {
widget = row.prefsModule.buildPrefsWidget(); let prefsModule = this._getExtensionPrefsModule(extension);
widget = prefsModule.buildPrefsWidget();
} catch (e) { } catch (e) {
widget = this._buildErrorUI(row, e); widget = this._buildErrorUI(extension, e);
} }
let dialog = new Gtk.Window({ let dialog = new Gtk.Window({ modal: !this._skipMainWindow,
modal: !this._skipMainWindow, type_hint: Gdk.WindowTypeHint.DIALOG });
type_hint: Gdk.WindowTypeHint.DIALOG dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true,
}); title: extension.metadata.name,
dialog.set_titlebar(new Gtk.HeaderBar({ visible: true }));
show_close_button: true,
title: row.name,
visible: true
}));
if (this._skipMainWindow) { if (this._skipMainWindow) {
this.add_window(dialog); this.application.add_window(dialog);
if (this._window) if (this._window)
this._window.destroy(); this._window.destroy();
this._window = dialog; this._window = dialog;
@@ -82,11 +96,9 @@ var Application = GObject.registerClass({
dialog.set_default_size(600, 400); dialog.set_default_size(600, 400);
dialog.add(widget); dialog.add(widget);
dialog.show(); dialog.show();
return true;
} }
_buildErrorUI(row, exc) { _buildErrorUI(extension, exc) {
let scroll = new Gtk.ScrolledWindow({ let scroll = new Gtk.ScrolledWindow({
hscrollbar_policy: Gtk.PolicyType.NEVER, hscrollbar_policy: Gtk.PolicyType.NEVER,
propagate_natural_height: true propagate_natural_height: true
@@ -156,20 +168,13 @@ var Application = GObject.registerClass({
copyButton.connect('clicked', w => { copyButton.connect('clicked', w => {
let clipboard = Gtk.Clipboard.get_default(w.get_display()); let clipboard = Gtk.Clipboard.get_default(w.get_display());
// markdown for pasting in gitlab issues let backticks = '```';
let lines = [ clipboard.set_text(
`The settings of extension ${row.uuid} had an error:`, // markdown for pasting in gitlab issues
'```', `The settings of extension ${extension.uuid} had an error:\n${
`${exc}`, backticks}\n${exc}\n${backticks}\n\nStack trace:\n${
'```', backticks}\n${exc.stack}${backticks}\n`, -1
'', );
'Stack trace:',
'```',
exc.stack.replace(/\n$/, ''), // stack without trailing newline
'```',
''
];
clipboard.set_text(lines.join('\n'), -1);
}); });
let spacing = new Gtk.SeparatorToolItem({ draw: false }); let spacing = new Gtk.SeparatorToolItem({ draw: false });
@@ -180,13 +185,13 @@ var Application = GObject.registerClass({
label: _("Homepage"), label: _("Homepage"),
tooltip_text: _("Visit extension homepage"), tooltip_text: _("Visit extension homepage"),
no_show_all: true, no_show_all: true,
visible: row.url != null visible: extension.metadata.url != null
}); });
toolbar.add(urlButton); toolbar.add(urlButton);
urlButton.connect('clicked', w => { urlButton.connect('clicked', w => {
let context = w.get_display().get_app_launch_context(); let context = w.get_display().get_app_launch_context();
Gio.AppInfo.launch_default_for_uri(row.url, context); Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context);
}); });
let expandedBox = new Gtk.Box({ let expandedBox = new Gtk.Box({
@@ -201,8 +206,8 @@ var Application = GObject.registerClass({
return scroll; return scroll;
} }
_buildUI() { _buildUI(app) {
this._window = new Gtk.ApplicationWindow({ application: this, this._window = new Gtk.ApplicationWindow({ application: app,
window_position: Gtk.WindowPosition.CENTER }); window_position: Gtk.WindowPosition.CENTER });
this._window.set_default_size(800, 500); this._window.set_default_size(800, 500);
@@ -236,14 +241,18 @@ var Application = GObject.registerClass({
this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder'); this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder');
this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell'); this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell');
this._shellProxy.connectSignal('ExtensionStateChanged', this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => {
this._onExtensionStateChanged.bind(this)); if (ExtensionUtils.extensions[uuid] !== undefined)
this._scanExtensions();
});
this._window.show_all(); this._window.show_all();
} }
_sortList(row1, row2) { _sortList(row1, row2) {
return row1.name.localeCompare(row2.name); let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name;
let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name;
return name1.localeCompare(name2);
} }
_updateHeader(row, before) { _updateHeader(row, before) {
@@ -254,56 +263,19 @@ var Application = GObject.registerClass({
row.set_header(sep); row.set_header(sep);
} }
_findExtensionRow(uuid) {
return this._extensionSelector.get_children().find(c => c.uuid === uuid);
}
_onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
let row = this._findExtensionRow(uuid);
if (row) {
let { state } = ExtensionUtils.deserializeExtension(newState);
if (state == ExtensionState.UNINSTALLED)
row.destroy();
return; // we only deal with new and deleted extensions here
}
this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
let extension = ExtensionUtils.deserializeExtension(serialized);
if (!extension)
return;
// check the extension wasn't added in between
if (this._findExtensionRow(uuid) != null)
return;
this._addExtensionRow(extension);
});
}
_scanExtensions() { _scanExtensions() {
this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => { let finder = new ExtensionUtils.ExtensionFinder();
if (e) { finder.connect('extension-found', this._extensionFound.bind(this));
if (e instanceof Gio.DBusError) { finder.scanExtensions();
log(`Failed to connect to shell proxy: ${e}`); this._extensionsLoaded();
this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
this._mainStack.visible_child_name = 'noshell';
} else {
throw e;
}
return;
}
for (let uuid in extensionsMap) {
let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]);
this._addExtensionRow(extension);
}
this._extensionsLoaded();
});
} }
_addExtensionRow(extension) { _extensionFound(finder, extension) {
let row = new ExtensionRow(extension); let row = new ExtensionRow(extension.uuid);
row.prefsButton.visible = this._extensionAvailable(row.uuid);
row.prefsButton.connect('clicked', () => { row.prefsButton.connect('clicked', () => {
this._showPrefs(row.uuid); this._selectExtension(row.uuid);
}); });
row.show_all(); row.show_all();
@@ -316,26 +288,24 @@ var Application = GObject.registerClass({
else else
this._mainStack.visible_child_name = 'placeholder'; this._mainStack.visible_child_name = 'placeholder';
if (this._startupUuid) if (this._startupUuid && this._extensionAvailable(this._startupUuid))
this._showPrefs(this._startupUuid); this._selectExtension(this._startupUuid);
this._startupUuid = null; this._startupUuid = null;
this._skipMainWindow = false; this._skipMainWindow = false;
this._loaded = true; this._loaded = true;
} }
vfunc_activate() { _onActivate() {
this._window.present(); this._window.present();
} }
vfunc_startup() { _onStartup(app) {
super.vfunc_startup(); this._buildUI(app);
this._buildUI();
this._scanExtensions(); this._scanExtensions();
} }
vfunc_command_line(commandLine) { _onCommandLine(app, commandLine) {
this.activate(); app.activate();
let args = commandLine.get_arguments(); let args = commandLine.get_arguments();
if (args.length) { if (args.length) {
@@ -346,14 +316,16 @@ var Application = GObject.registerClass({
// Strip off "extension:///" prefix which fakes a URI, if it exists // Strip off "extension:///" prefix which fakes a URI, if it exists
uuid = stripPrefix(uuid, "extension:///"); uuid = stripPrefix(uuid, "extension:///");
if (!this._loaded) if (this._extensionAvailable(uuid))
this._selectExtension(uuid);
else if (!this._loaded)
this._startupUuid = uuid; this._startupUuid = uuid;
else if (!this._showPrefs(uuid)) else
this._skipMainWindow = false; this._skipMainWindow = false;
} }
return 0; return 0;
} }
}); };
var Expander = GObject.registerClass({ var Expander = GObject.registerClass({
Properties: { Properties: {
@@ -520,35 +492,6 @@ class EmptyPlaceholder extends Gtk.Box {
} }
}); });
var NoShellPlaceholder = GObject.registerClass(
class NoShellPlaceholder extends Gtk.Box {
_init() {
super._init({
orientation: Gtk.Orientation.VERTICAL,
spacing: 12,
margin: 100,
margin_bottom: 60
});
let label = new Gtk.Label({
label: '<span size="x-large">%s</span>'.format(
_("Somethings gone wrong")),
use_markup: true
});
label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
this.add(label);
label = new Gtk.Label({
label: _("Were very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
justify: Gtk.Justification.CENTER,
wrap: true
});
this.add(label);
this.show_all();
}
});
var DescriptionLabel = GObject.registerClass( var DescriptionLabel = GObject.registerClass(
class DescriptionLabel extends Gtk.Label { class DescriptionLabel extends Gtk.Label {
vfunc_get_preferred_height_for_width(width) { vfunc_get_preferred_height_for_width(width) {
@@ -561,59 +504,30 @@ class DescriptionLabel extends Gtk.Label {
var ExtensionRow = GObject.registerClass( var ExtensionRow = GObject.registerClass(
class ExtensionRow extends Gtk.ListBoxRow { class ExtensionRow extends Gtk.ListBoxRow {
_init(extension) { _init(uuid) {
super._init(); super._init();
this._app = Gio.Application.get_default(); this.uuid = uuid;
this._extension = extension;
this._prefsModule = null;
this.connect('destroy', this._onDestroy.bind(this)); this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' });
this._settings.connect('changed::enabled-extensions', () => {
this._switch.state = this._isEnabled();
});
this._settings.connect('changed::disable-extension-version-validation',
() => {
this._switch.sensitive = this._canEnable();
});
this._settings.connect('changed::disable-user-extensions',
() => {
this._switch.sensitive = this._canEnable();
});
this._buildUI(); this._buildUI();
this._extensionStateChangedId = this._app.shellProxy.connectSignal(
'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
if (this.uuid !== uuid)
return;
this._extension = ExtensionUtils.deserializeExtension(newState);
let state = (this._extension.state == ExtensionState.ENABLED);
GObject.signal_handler_block(this._switch, this._notifyActiveId);
this._switch.state = state;
GObject.signal_handler_unblock(this._switch, this._notifyActiveId);
this._switch.sensitive = this._canToggle();
});
}
get uuid() {
return this._extension.uuid;
}
get name() {
return this._extension.metadata.name;
}
get hasPrefs() {
return this._extension.hasPrefs;
}
get url() {
return this._extension.metadata.url;
}
_onDestroy() {
if (!this._app.shellProxy)
return;
if (this._extensionStateChangedId)
this._app.shellProxy.disconnectSignal(this._extensionStateChangedId);
this._extensionStateChangedId = 0;
} }
_buildUI() { _buildUI() {
let extension = ExtensionUtils.extensions[this.uuid];
let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL, let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL,
hexpand: true, margin_end: 24, spacing: 24, hexpand: true, margin_end: 24, spacing: 24,
margin: 12 }); margin: 12 });
@@ -623,20 +537,19 @@ class ExtensionRow extends Gtk.ListBoxRow {
spacing: 6, hexpand: true }); spacing: 6, hexpand: true });
hbox.add(vbox); hbox.add(vbox);
let name = GLib.markup_escape_text(this.name, -1); let name = GLib.markup_escape_text(extension.metadata.name, -1);
let label = new Gtk.Label({ label: '<b>' + name + '</b>', let label = new Gtk.Label({ label: '<b>' + name + '</b>',
use_markup: true, use_markup: true,
halign: Gtk.Align.START }); halign: Gtk.Align.START });
vbox.add(label); vbox.add(label);
let desc = this._extension.metadata.description.split('\n')[0]; let desc = extension.metadata.description.split('\n')[0];
label = new DescriptionLabel({ label: desc, wrap: true, lines: 2, label = new DescriptionLabel({ label: desc, wrap: true, lines: 2,
ellipsize: Pango.EllipsizeMode.END, ellipsize: Pango.EllipsizeMode.END,
xalign: 0, yalign: 0 }); xalign: 0, yalign: 0 });
vbox.add(label); vbox.add(label);
let button = new Gtk.Button({ valign: Gtk.Align.CENTER, let button = new Gtk.Button({ valign: Gtk.Align.CENTER,
visible: this.hasPrefs,
no_show_all: true }); no_show_all: true });
button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic', button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic',
icon_size: Gtk.IconSize.BUTTON, icon_size: Gtk.IconSize.BUTTON,
@@ -646,37 +559,51 @@ class ExtensionRow extends Gtk.ListBoxRow {
this.prefsButton = button; this.prefsButton = button;
this._switch = new Gtk.Switch({ this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER,
valign: Gtk.Align.CENTER, sensitive: this._canEnable(),
sensitive: this._canToggle(), state: this._isEnabled() });
state: this._extension.state === ExtensionState.ENABLED this._switch.connect('notify::active', () => {
});
this._notifyActiveId = this._switch.connect('notify::active', () => {
if (this._switch.active) if (this._switch.active)
this._app.shellProxy.EnableExtensionRemote(this.uuid); this._enable();
else else
this._app.shellProxy.DisableExtensionRemote(this.uuid); this._disable();
}); });
this._switch.connect('state-set', () => true); this._switch.connect('state-set', () => true);
hbox.add(this._switch); hbox.add(this._switch);
} }
_canToggle() { _canEnable() {
return this._extension.canChange; let extension = ExtensionUtils.extensions[this.uuid];
let checkVersion = !this._settings.get_boolean('disable-extension-version-validation');
return !this._settings.get_boolean('disable-user-extensions') &&
!(checkVersion && ExtensionUtils.isOutOfDate(extension));
} }
get prefsModule() { _isEnabled() {
if (!this._prefsModule) { let extensions = this._settings.get_strv('enabled-extensions');
ExtensionUtils.installImporter(this._extension); return extensions.indexOf(this.uuid) != -1;
}
// give extension prefs access to their own extension object _enable() {
ExtensionUtils.getCurrentExtension = () => this._extension; let extensions = this._settings.get_strv('enabled-extensions');
if (extensions.indexOf(this.uuid) != -1)
return;
this._prefsModule = this._extension.imports.prefs; extensions.push(this.uuid);
this._prefsModule.init(this._extension.metadata); this._settings.set_strv('enabled-extensions', extensions);
} }
return this._prefsModule; _disable() {
let extensions = this._settings.get_strv('enabled-extensions');
let pos = extensions.indexOf(this.uuid);
if (pos == -1)
return;
do {
extensions.splice(pos, 1);
pos = extensions.indexOf(this.uuid);
} while (pos != -1);
this._settings.set_strv('enabled-extensions', extensions);
} }
}); });
@@ -684,12 +611,12 @@ function initEnvironment() {
// Monkey-patch in a "global" object that fakes some Shell utilities // Monkey-patch in a "global" object that fakes some Shell utilities
// that ExtensionUtils depends on. // that ExtensionUtils depends on.
window.global = { window.global = {
log(...args) { log() {
print(args.join(', ')); print([].join.call(arguments, ', '));
}, },
logError(s) { logError(s) {
log(`ERROR: ${s}`); log('ERROR: ' + s);
}, },
userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell']) userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell'])
@@ -704,5 +631,6 @@ function main(argv) {
Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR); Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR);
Gettext.textdomain(Config.GETTEXT_PACKAGE); Gettext.textdomain(Config.GETTEXT_PACKAGE);
new Application().run(argv); let app = new Application();
app.application.run(argv);
} }

View File

@@ -8,13 +8,14 @@ const Batch = imports.gdm.batch;
const GdmUtil = imports.gdm.util; const GdmUtil = imports.gdm.util;
const Params = imports.misc.params; const Params = imports.misc.params;
const ShellEntry = imports.ui.shellEntry; const ShellEntry = imports.ui.shellEntry;
const Tweener = imports.ui.tweener;
const UserWidget = imports.ui.userWidget; const UserWidget = imports.ui.userWidget;
var DEFAULT_BUTTON_WELL_ICON_SIZE = 16; var DEFAULT_BUTTON_WELL_ICON_SIZE = 16;
var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000; var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0;
var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300; var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3;
var MESSAGE_FADE_OUT_ANIMATION_TIME = 500; var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5;
var AuthPromptMode = { var AuthPromptMode = {
UNLOCK_ONLY: 0, UNLOCK_ONLY: 0,
@@ -58,23 +59,23 @@ var AuthPrompt = class {
this.smartcardDetected = this._userVerifier.smartcardDetected; this.smartcardDetected = this._userVerifier.smartcardDetected;
this.connect('next', () => { this.connect('next', () => {
this.updateSensitivity(false); this.updateSensitivity(false);
this.startSpinning(); this.startSpinning();
if (this._queryingService) { if (this._queryingService) {
this._userVerifier.answerQuery(this._queryingService, this._entry.text); this._userVerifier.answerQuery(this._queryingService, this._entry.text);
} else { } else {
this._preemptiveAnswer = this._entry.text; this._preemptiveAnswer = this._entry.text;
} }
}); });
this.actor = new St.BoxLayout({ style_class: 'login-dialog-prompt-layout', this.actor = new St.BoxLayout({ style_class: 'login-dialog-prompt-layout',
vertical: true }); vertical: true });
this.actor.connect('destroy', this._onDestroy.bind(this)); this.actor.connect('destroy', this._onDestroy.bind(this));
this.actor.connect('key-press-event', (actor, event) => { this.actor.connect('key-press-event', (actor, event) => {
if (event.get_key_symbol() == Clutter.KEY_Escape) if (event.get_key_symbol() == Clutter.KEY_Escape)
this.cancel(); this.cancel();
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
}); });
this._userWell = new St.Bin({ x_fill: true, this._userWell = new St.Bin({ x_fill: true,
x_align: St.Align.START }); x_align: St.Align.START });
@@ -111,7 +112,7 @@ var AuthPrompt = class {
this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box', this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box',
vertical: false }); vertical: false });
this.actor.add(this._buttonBox, this.actor.add(this._buttonBox,
{ expand: true, { expand: true,
x_align: St.Align.MIDDLE, x_align: St.Align.MIDDLE,
y_align: St.Align.END }); y_align: St.Align.END });
@@ -137,7 +138,7 @@ var AuthPrompt = class {
reactive: true, reactive: true,
can_focus: true, can_focus: true,
label: _("Cancel") }); label: _("Cancel") });
this.cancelButton.connect('clicked', () => this.cancel()); this.cancelButton.connect('clicked', () => { this.cancel(); });
this._buttonBox.add(this.cancelButton, this._buttonBox.add(this.cancelButton,
{ expand: false, { expand: false,
x_fill: false, x_fill: false,
@@ -156,7 +157,7 @@ var AuthPrompt = class {
reactive: true, reactive: true,
can_focus: true, can_focus: true,
label: _("Next") }); label: _("Next") });
this.nextButton.connect('clicked', () => this.emit('next')); this.nextButton.connect('clicked', () => { this.emit('next'); });
this.nextButton.add_style_pseudo_class('default'); this.nextButton.add_style_pseudo_class('default');
this._buttonBox.add(this.nextButton, this._buttonBox.add(this.nextButton,
{ expand: false, { expand: false,
@@ -266,7 +267,7 @@ var AuthPrompt = class {
let oldActor = this._defaultButtonWellActor; let oldActor = this._defaultButtonWellActor;
if (oldActor) if (oldActor)
oldActor.remove_all_transitions(); Tweener.removeTweens(oldActor);
let wasSpinner; let wasSpinner;
if (oldActor == this._spinner.actor) if (oldActor == this._spinner.actor)
@@ -289,18 +290,19 @@ var AuthPrompt = class {
this._spinner.stop(); this._spinner.stop();
} }
} else { } else {
oldActor.ease({ Tweener.addTween(oldActor,
opacity: 0, { opacity: 0,
duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME, time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY, delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
mode: Clutter.AnimationMode.LINEAR, transition: 'linear',
onComplete: () => { onCompleteScope: this,
if (wasSpinner) { onComplete() {
if (this._spinner) if (wasSpinner) {
this._spinner.stop(); if (this._spinner)
} this._spinner.stop();
} }
}); }
});
} }
} }
@@ -311,12 +313,11 @@ var AuthPrompt = class {
if (!animate) if (!animate)
actor.opacity = 255; actor.opacity = 255;
else else
actor.ease({ Tweener.addTween(actor,
opacity: 255, { opacity: 255,
duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME, time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY, delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
mode: Clutter.AnimationMode.LINEAR transition: 'linear' });
});
} }
this._defaultButtonWellActor = actor; this._defaultButtonWellActor = actor;
@@ -365,12 +366,12 @@ var AuthPrompt = class {
_fadeOutMessage() { _fadeOutMessage() {
if (this._message.opacity == 0) if (this._message.opacity == 0)
return; return;
this._message.remove_all_transitions(); Tweener.removeTweens(this._message);
this._message.ease({ Tweener.addTween(this._message,
opacity: 0, { opacity: 0,
duration: MESSAGE_FADE_OUT_ANIMATION_TIME, time: MESSAGE_FADE_OUT_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad'
}); });
} }
setMessage(message, type) { setMessage(message, type) {
@@ -385,7 +386,7 @@ var AuthPrompt = class {
this._message.remove_style_class_name('login-dialog-message-hint'); this._message.remove_style_class_name('login-dialog-message-hint');
if (message) { if (message) {
this._message.remove_all_transitions(); Tweener.removeTweens(this._message);
this._message.text = message; this._message.text = message;
this._message.opacity = 255; this._message.opacity = 255;
} else { } else {

View File

@@ -20,7 +20,7 @@
* In order for transformation animations to look good, they need to be * In order for transformation animations to look good, they need to be
* incremental and have some order to them (e.g., fade out hidden items, * incremental and have some order to them (e.g., fade out hidden items,
* then shrink to close the void left over). Chaining animations in this way can * then shrink to close the void left over). Chaining animations in this way can
* be error-prone and wordy using just ease() callbacks. * be error-prone and wordy using just Tweener callbacks.
* *
* The classes in this file help with this: * The classes in this file help with this:
* *
@@ -44,7 +44,6 @@
* replaced by something else. * replaced by something else.
*/ */
const { GObject } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
var Task = class { var Task = class {
@@ -177,35 +176,36 @@ Signals.addSignalMethods(Batch.prototype);
var ConcurrentBatch = class extends Batch { var ConcurrentBatch = class extends Batch {
process() { process() {
let hold = this.runTask(); let hold = this.runTask();
if (hold) { if (hold) {
this.hold.acquireUntilAfter(hold); this.hold.acquireUntilAfter(hold);
} }
// Regardless of the state of the just run task, // Regardless of the state of the just run task,
// fire off the next one, so all the tasks can run // fire off the next one, so all the tasks can run
// concurrently. // concurrently.
this.nextTask(); this.nextTask();
} }
}; };
Signals.addSignalMethods(ConcurrentBatch.prototype); Signals.addSignalMethods(ConcurrentBatch.prototype);
var ConsecutiveBatch = class extends Batch { var ConsecutiveBatch = class extends Batch {
process() { process() {
let hold = this.runTask(); let hold = this.runTask();
if (hold && hold.isAcquired()) { if (hold && hold.isAcquired()) {
// This task is inhibiting the batch. Wait on it // This task is inhibiting the batch. Wait on it
// before processing the next one. // before processing the next one.
let signalId = hold.connect('release', () => { let signalId = hold.connect('release', () => {
hold.disconnect(signalId); hold.disconnect(signalId);
this.nextTask(); this.nextTask();
}); });
} else { return;
// This task finished, process the next one } else {
this.nextTask(); // This task finished, process the next one
} this.nextTask();
}
} }
}; };
Signals.addSignalMethods(ConsecutiveBatch.prototype); Signals.addSignalMethods(ConsecutiveBatch.prototype);

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported FprintManager */
const Gio = imports.gi.Gio; const Gio = imports.gi.Gio;
@@ -24,8 +23,8 @@ function FprintManager() {
try { try {
self.init(null); self.init(null);
} catch (e) { } catch(e) {
log(`Failed to connect to Fprint service: ${e.message}`); log('Failed to connect to Fprint service: ' + e.message);
return null; return null;
} }

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported LoginDialog */
/* /*
* Copyright 2011 Red Hat, Inc * Copyright 2011 Red Hat, Inc
* *
@@ -31,10 +30,11 @@ const LoginManager = imports.misc.loginManager;
const Main = imports.ui.main; const Main = imports.ui.main;
const PopupMenu = imports.ui.popupMenu; const PopupMenu = imports.ui.popupMenu;
const Realmd = imports.gdm.realmd; const Realmd = imports.gdm.realmd;
const Tweener = imports.ui.tweener;
const UserWidget = imports.ui.userWidget; const UserWidget = imports.ui.userWidget;
const _FADE_ANIMATION_TIME = 250; const _FADE_ANIMATION_TIME = 0.25;
const _SCROLL_ANIMATION_TIME = 500; const _SCROLL_ANIMATION_TIME = 0.5;
const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0; const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
const _LOGO_ICON_HEIGHT = 48; const _LOGO_ICON_HEIGHT = 48;
const _MAX_BOTTOM_MENU_ITEMS = 5; const _MAX_BOTTOM_MENU_ITEMS = 5;
@@ -43,7 +43,7 @@ var UserListItem = class {
constructor(user) { constructor(user) {
this.user = user; this.user = user;
this._userChangedId = this.user.connect('changed', this._userChangedId = this.user.connect('changed',
this._onUserChanged.bind(this)); this._onUserChanged.bind(this));
let layout = new St.BoxLayout({ vertical: true }); let layout = new St.BoxLayout({ vertical: true });
this.actor = new St.Button({ style_class: 'login-dialog-user-list-item', this.actor = new St.Button({ style_class: 'login-dialog-user-list-item',
@@ -150,7 +150,7 @@ Signals.addSignalMethods(UserListItem.prototype);
var UserList = class { var UserList = class {
constructor() { constructor() {
this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view' }); this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view'});
this.actor.set_policy(St.PolicyType.NEVER, this.actor.set_policy(St.PolicyType.NEVER,
St.PolicyType.AUTOMATIC); St.PolicyType.AUTOMATIC);
@@ -187,6 +187,8 @@ var UserList = class {
} }
updateStyle(isExpanded) { updateStyle(isExpanded) {
let tasks = [];
if (isExpanded) if (isExpanded)
this._box.add_style_pseudo_class('expanded'); this._box.add_style_pseudo_class('expanded');
else else
@@ -204,10 +206,11 @@ var UserList = class {
let adjustment = this.actor.get_vscroll_bar().get_adjustment(); let adjustment = this.actor.get_vscroll_bar().get_adjustment();
let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0); let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
adjustment.ease(value, { Tweener.removeTweens(adjustment);
mode: Clutter.AnimationMode.EASE_OUT_QUAD, Tweener.addTween (adjustment,
duration: _SCROLL_ANIMATION_TIME { value: value,
}); time: _SCROLL_ANIMATION_TIME,
transition: 'easeOutQuad' });
} }
jumpToItem(item) { jumpToItem(item) {
@@ -241,7 +244,7 @@ var UserList = class {
return; return;
if (user.locked) if (user.locked)
return; return;
let userName = user.get_user_name(); let userName = user.get_user_name();
@@ -258,7 +261,7 @@ var UserList = class {
item.connect('activate', this._onItemActivated.bind(this)); item.connect('activate', this._onItemActivated.bind(this));
// Try to keep the focused item front-and-center // Try to keep the focused item front-and-center
item.actor.connect('key-focus-in', () => this.scrollToItem(item)); item.actor.connect('key-focus-in', () => { this.scrollToItem(item); });
this._moveFocusToItems(); this._moveFocusToItems();
@@ -316,17 +319,17 @@ var SessionMenuButton = class {
this._menu.actor.hide(); this._menu.actor.hide();
this._menu.connect('open-state-changed', (menu, isOpen) => { this._menu.connect('open-state-changed', (menu, isOpen) => {
if (isOpen) if (isOpen)
this._button.add_style_pseudo_class('active'); this._button.add_style_pseudo_class('active');
else else
this._button.remove_style_pseudo_class('active'); this._button.remove_style_pseudo_class('active');
}); });
this._manager = new PopupMenu.PopupMenuManager(this._button, this._manager = new PopupMenu.PopupMenuManager(this._button,
{ actionMode: Shell.ActionMode.NONE }); { actionMode: Shell.ActionMode.NONE });
this._manager.addMenu(this._menu); this._manager.addMenu(this._menu);
this._button.connect('clicked', () => this._menu.toggle()); this._button.connect('clicked', () => { this._menu.toggle(); });
this._items = {}; this._items = {};
this._activeSessionId = null; this._activeSessionId = null;
@@ -350,11 +353,11 @@ var SessionMenuButton = class {
} }
setActiveSession(sessionId) { setActiveSession(sessionId) {
if (sessionId == this._activeSessionId) if (sessionId == this._activeSessionId)
return; return;
this._activeSessionId = sessionId; this._activeSessionId = sessionId;
this._updateOrnament(); this._updateOrnament();
} }
close() { close() {
@@ -371,7 +374,7 @@ var SessionMenuButton = class {
} }
for (let i = 0; i < ids.length; i++) { for (let i = 0; i < ids.length; i++) {
let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]); let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]);
let id = ids[i]; let id = ids[i];
let item = new PopupMenu.PopupMenuItem(sessionName); let item = new PopupMenu.PopupMenuItem(sessionName);
@@ -400,18 +403,18 @@ var LoginDialog = GObject.registerClass({
this.connect('destroy', this._onDestroy.bind(this)); this.connect('destroy', this._onDestroy.bind(this));
parentActor.add_child(this); parentActor.add_child(this);
this._userManager = AccountsService.UserManager.get_default(); this._userManager = AccountsService.UserManager.get_default()
this._gdmClient = new Gdm.Client(); this._gdmClient = new Gdm.Client();
this._settings = new Gio.Settings({ schema_id: GdmUtil.LOGIN_SCREEN_SCHEMA }); this._settings = new Gio.Settings({ schema_id: GdmUtil.LOGIN_SCREEN_SCHEMA });
this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_KEY}`, this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_KEY,
this._updateBanner.bind(this)); this._updateBanner.bind(this));
this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_TEXT_KEY}`, this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_TEXT_KEY,
this._updateBanner.bind(this)); this._updateBanner.bind(this));
this._settings.connect(`changed::${GdmUtil.DISABLE_USER_LIST_KEY}`, this._settings.connect('changed::' + GdmUtil.DISABLE_USER_LIST_KEY,
this._updateDisableUserList.bind(this)); this._updateDisableUserList.bind(this));
this._settings.connect(`changed::${GdmUtil.LOGO_KEY}`, this._settings.connect('changed::' + GdmUtil.LOGO_KEY,
this._updateLogo.bind(this)); this._updateLogo.bind(this));
this._textureCache = St.TextureCache.get_default(); this._textureCache = St.TextureCache.get_default();
@@ -517,7 +520,7 @@ var LoginDialog = GObject.registerClass({
_getBannerAllocation(dialogBox) { _getBannerAllocation(dialogBox) {
let actorBox = new Clutter.ActorBox(); let actorBox = new Clutter.ActorBox();
let [, , natWidth, natHeight] = this._bannerView.get_preferred_size(); let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size();
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2; let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
actorBox.x1 = Math.floor(centerX - natWidth / 2); actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -531,7 +534,7 @@ var LoginDialog = GObject.registerClass({
_getLogoBinAllocation(dialogBox) { _getLogoBinAllocation(dialogBox) {
let actorBox = new Clutter.ActorBox(); let actorBox = new Clutter.ActorBox();
let [, , natWidth, natHeight] = this._logoBin.get_preferred_size(); let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size();
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2; let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
actorBox.x1 = Math.floor(centerX - natWidth / 2); actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -545,7 +548,7 @@ var LoginDialog = GObject.registerClass({
_getCenterActorAllocation(dialogBox, actor) { _getCenterActorAllocation(dialogBox, actor) {
let actorBox = new Clutter.ActorBox(); let actorBox = new Clutter.ActorBox();
let [, , natWidth, natHeight] = actor.get_preferred_size(); let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size();
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2; let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2; let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2;
@@ -572,15 +575,19 @@ var LoginDialog = GObject.registerClass({
// First find out what space the children require // First find out what space the children require
let bannerAllocation = null; let bannerAllocation = null;
let bannerHeight = 0; let bannerHeight = 0;
let bannerWidth = 0;
if (this._bannerView.visible) { if (this._bannerView.visible) {
bannerAllocation = this._getBannerAllocation(dialogBox, this._bannerView); bannerAllocation = this._getBannerAllocation(dialogBox, this._bannerView);
bannerHeight = bannerAllocation.y2 - bannerAllocation.y1; bannerHeight = bannerAllocation.y2 - bannerAllocation.y1;
bannerWidth = bannerAllocation.x2 - bannerAllocation.x1;
} }
let authPromptAllocation = null; let authPromptAllocation = null;
let authPromptHeight = 0;
let authPromptWidth = 0; let authPromptWidth = 0;
if (this._authPrompt.actor.visible) { if (this._authPrompt.actor.visible) {
authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt.actor); authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt.actor);
authPromptHeight = authPromptAllocation.y2 - authPromptAllocation.y1;
authPromptWidth = authPromptAllocation.x2 - authPromptAllocation.x1; authPromptWidth = authPromptAllocation.x2 - authPromptAllocation.x1;
} }
@@ -612,64 +619,64 @@ var LoginDialog = GObject.registerClass({
let leftOverYSpace = bannerSpace - bannerHeight; let leftOverYSpace = bannerSpace - bannerHeight;
if (leftOverYSpace > 0) { if (leftOverYSpace > 0) {
// First figure out how much left over space is up top // First figure out how much left over space is up top
let leftOverTopSpace = leftOverYSpace / 2; let leftOverTopSpace = leftOverYSpace / 2;
// Then, shift the banner into the middle of that extra space // Then, shift the banner into the middle of that extra space
let yShift = Math.floor(leftOverTopSpace / 2); let yShift = Math.floor(leftOverTopSpace / 2);
bannerAllocation.y1 += yShift; bannerAllocation.y1 += yShift;
bannerAllocation.y2 += yShift; bannerAllocation.y2 += yShift;
} else { } else {
// Then figure out how much space there would be if we switched to a // Then figure out how much space there would be if we switched to a
// wide layout with banner on one side and authprompt on the other. // wide layout with banner on one side and authprompt on the other.
let leftOverXSpace = dialogWidth - authPromptWidth; let leftOverXSpace = dialogWidth - authPromptWidth;
// In a wide view, half of the available space goes to the banner, // In a wide view, half of the available space goes to the banner,
// and the other half goes to the margins. // and the other half goes to the margins.
let wideBannerWidth = leftOverXSpace / 2; let wideBannerWidth = leftOverXSpace / 2;
let wideSpacing = leftOverXSpace - wideBannerWidth; let wideSpacing = leftOverXSpace - wideBannerWidth;
// If we do go with a wide layout, we need there to be at least enough // If we do go with a wide layout, we need there to be at least enough
// space for the banner and the auth prompt to be the same width, // space for the banner and the auth prompt to be the same width,
// so it doesn't look unbalanced. // so it doesn't look unbalanced.
if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) { if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) {
let centerX = dialogBox.x1 + dialogWidth / 2; let centerX = dialogBox.x1 + dialogWidth / 2;
let centerY = dialogBox.y1 + dialogHeight / 2; let centerY = dialogBox.y1 + dialogHeight / 2;
// A small portion of the spacing goes down the center of the // A small portion of the spacing goes down the center of the
// screen to help delimit the two columns of the wide view // screen to help delimit the two columns of the wide view
let centerGap = wideSpacing / 8; let centerGap = wideSpacing / 8;
// place the banner along the left edge of the center margin // place the banner along the left edge of the center margin
bannerAllocation.x2 = Math.floor(centerX - centerGap / 2); bannerAllocation.x2 = Math.floor(centerX - centerGap / 2);
bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth); bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth);
// figure out how tall it would like to be and try to accommodate // figure out how tall it would like to be and try to accommodate
// but don't let it get too close to the logo // but don't let it get too close to the logo
let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth); let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
let maxWideHeight = dialogHeight - 3 * logoHeight; let maxWideHeight = dialogHeight - 3 * logoHeight;
wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight); wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2); bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2);
bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight; bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight;
// place the auth prompt along the right edge of the center margin // place the auth prompt along the right edge of the center margin
authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2); authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2);
authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth; authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth;
} else { } else {
// If we aren't going to do a wide view, then we need to limit // If we aren't going to do a wide view, then we need to limit
// the height of the banner so it will present scrollbars // the height of the banner so it will present scrollbars
// First figure out how much space there is without the banner // First figure out how much space there is without the banner
leftOverYSpace += bannerHeight; leftOverYSpace += bannerHeight;
// Then figure out how much of that space is up top // Then figure out how much of that space is up top
let availableTopSpace = Math.floor(leftOverYSpace / 2); let availableTopSpace = Math.floor(leftOverYSpace / 2);
// Then give all of that space to the banner // Then give all of that space to the banner
bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace; bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace;
} }
} }
} else if (userSelectionAllocation) { } else if (userSelectionAllocation) {
// Grow the user list to fill the space // Grow the user list to fill the space
@@ -757,15 +764,14 @@ var LoginDialog = GObject.registerClass({
_fadeInBannerView() { _fadeInBannerView() {
this._bannerView.show(); this._bannerView.show();
this._bannerView.ease({ Tweener.addTween(this._bannerView,
opacity: 255, { opacity: 255,
duration: _FADE_ANIMATION_TIME, time: _FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad' });
});
} }
_hideBannerView() { _hideBannerView() {
this._bannerView.remove_all_transitions(); Tweener.removeTweens(this._bannerView);
this._bannerView.opacity = 0; this._bannerView.opacity = 0;
this._bannerView.hide(); this._bannerView.hide();
} }
@@ -845,10 +851,10 @@ var LoginDialog = GObject.registerClass({
_shouldShowSessionMenuButton() { _shouldShowSessionMenuButton() {
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFYING && if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFYING &&
this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFICATION_FAILED) this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFICATION_FAILED)
return false; return false;
if (this._user && this._user.is_loaded && this._user.is_logged_in()) if (this._user && this._user.is_loaded && this._user.is_logged_in())
return false; return false;
return true; return true;
} }
@@ -858,11 +864,10 @@ var LoginDialog = GObject.registerClass({
return; return;
this._authPrompt.actor.opacity = 0; this._authPrompt.actor.opacity = 0;
this._authPrompt.actor.show(); this._authPrompt.actor.show();
this._authPrompt.actor.ease({ Tweener.addTween(this._authPrompt.actor,
opacity: 255, { opacity: 255,
duration: _FADE_ANIMATION_TIME, time: _FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad' });
});
this._fadeInBannerView(); this._fadeInBannerView();
} }
@@ -906,31 +911,28 @@ var LoginDialog = GObject.registerClass({
this._showPrompt(); this._showPrompt();
} }
_bindOpacity() {
this._bindings = Main.layoutManager.uiGroup.get_children()
.filter(c => c != Main.layoutManager.screenShieldGroup)
.map(c => this.bind_property('opacity', c, 'opacity', 0));
}
_unbindOpacity() {
this._bindings.forEach(b => b.unbind());
}
_loginScreenSessionActivated() { _loginScreenSessionActivated() {
if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING) if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
return; return;
this._bindOpacity(); Tweener.addTween(this,
this.ease({ { opacity: 255,
opacity: 255, time: _FADE_ANIMATION_TIME,
duration: _FADE_ANIMATION_TIME, transition: 'easeOutQuad',
mode: Clutter.AnimationMode.EASE_OUT_QUAD, onUpdate() {
onComplete: () => { let children = Main.layoutManager.uiGroup.get_children();
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
this._authPrompt.reset(); for (let i = 0; i < children.length; i++) {
this._unbindOpacity(); if (children[i] != Main.layoutManager.screenShieldGroup)
} children[i].opacity = this.opacity;
}); }
},
onUpdateScope: this,
onComplete() {
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
this._authPrompt.reset();
},
onCompleteScope: this });
} }
_gotGreeterSessionProxy(proxy) { _gotGreeterSessionProxy(proxy) {
@@ -943,27 +945,34 @@ var LoginDialog = GObject.registerClass({
} }
_startSession(serviceName) { _startSession(serviceName) {
this._bindOpacity(); Tweener.addTween(this,
this.ease({ { opacity: 0,
opacity: 0, time: _FADE_ANIMATION_TIME,
duration: _FADE_ANIMATION_TIME, transition: 'easeOutQuad',
mode: Clutter.AnimationMode.EASE_OUT_QUAD, onUpdate() {
onComplete: () => { let children = Main.layoutManager.uiGroup.get_children();
this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
this._unbindOpacity(); for (let i = 0; i < children.length; i++) {
} if (children[i] != Main.layoutManager.screenShieldGroup)
}); children[i].opacity = this.opacity;
}
},
onUpdateScope: this,
onComplete() {
this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
},
onCompleteScope: this });
} }
_onSessionOpened(client, serviceName) { _onSessionOpened(client, serviceName) {
this._authPrompt.finish(() => this._startSession(serviceName)); this._authPrompt.finish(() => { this._startSession(serviceName); });
} }
_waitForItemForUser(userName) { _waitForItemForUser(userName) {
let item = this._userList.getItemFromUserName(userName); let item = this._userList.getItemFromUserName(userName);
if (item) if (item)
return null; return null;
let hold = new Batch.Hold(); let hold = new Batch.Hold();
let signalId = this._userList.connect('item-added', let signalId = this._userList.connect('item-added',
@@ -974,7 +983,7 @@ var LoginDialog = GObject.registerClass({
hold.release(); hold.release();
}); });
hold.connect('release', () => this._userList.disconnect(signalId)); hold.connect('release', () => { this._userList.disconnect(signalId); });
return hold; return hold;
} }
@@ -1038,7 +1047,6 @@ var LoginDialog = GObject.registerClass({
return this._blockTimedLoginUntilIdle(); return this._blockTimedLoginUntilIdle();
} else { } else {
animationTime = delay; animationTime = delay;
return null;
} }
}, },
@@ -1074,12 +1082,12 @@ var LoginDialog = GObject.registerClass({
// Restart timed login on user interaction // Restart timed login on user interaction
global.stage.connect('captured-event', (actor, event) => { global.stage.connect('captured-event', (actor, event) => {
if (event.type() == Clutter.EventType.KEY_PRESS || if (event.type() == Clutter.EventType.KEY_PRESS ||
event.type() == Clutter.EventType.BUTTON_PRESS) { event.type() == Clutter.EventType.BUTTON_PRESS) {
this._startTimedLogin(userName, seconds); this._startTimedLogin(userName, seconds);
} }
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
}); });
} }
@@ -1225,11 +1233,10 @@ var LoginDialog = GObject.registerClass({
Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN }); Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN });
this.ease({ Tweener.addTween(this,
opacity: 255, { opacity: 255,
duration: 1000, time: 1,
mode: Clutter.AnimationMode.EASE_IN_QUAD transition: 'easeInQuad' });
});
return true; return true;
} }
@@ -1243,7 +1250,7 @@ var LoginDialog = GObject.registerClass({
this._authPrompt.cancel(); this._authPrompt.cancel();
} }
addCharacter(_unichar) { addCharacter(unichar) {
// Don't allow type ahead at the login screen // Don't allow type ahead at the login screen
} }

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported getOVirtCredentialsManager */
const Gio = imports.gi.Gio; const Gio = imports.gi.Gio;
const Signals = imports.signals; const Signals = imports.signals;

View File

@@ -15,13 +15,12 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm");
const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface); const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface);
var Manager = class { var Manager = class {
constructor() { constructor(parentActor) {
this._aggregateProvider = Provider(Gio.DBus.system, this._aggregateProvider = Provider(Gio.DBus.system,
'org.freedesktop.realmd', 'org.freedesktop.realmd',
'/org/freedesktop/realmd', '/org/freedesktop/realmd',
this._reloadRealms.bind(this)); this._reloadRealms.bind(this))
this._realms = {}; this._realms = {};
this._loginFormat = null;
this._signalId = this._aggregateProvider.connect('g-properties-changed', this._signalId = this._aggregateProvider.connect('g-properties-changed',
(proxy, properties) => { (proxy, properties) => {
@@ -37,10 +36,10 @@ var Manager = class {
return; return;
for (let i = 0; i < realmPaths.length; i++) { for (let i = 0; i < realmPaths.length; i++) {
Realm(Gio.DBus.system, let realm = Realm(Gio.DBus.system,
'org.freedesktop.realmd', 'org.freedesktop.realmd',
realmPaths[i], realmPaths[i],
this._onRealmLoaded.bind(this)); this._onRealmLoaded.bind(this));
} }
} }
@@ -87,7 +86,7 @@ var Manager = class {
} }
get loginFormat() { get loginFormat() {
if (this._loginFormat) if (this._loginFormat !== undefined)
return this._loginFormat; return this._loginFormat;
this._updateLoginFormat(); this._updateLoginFormat();
@@ -99,10 +98,10 @@ var Manager = class {
Service(Gio.DBus.system, Service(Gio.DBus.system,
'org.freedesktop.realmd', 'org.freedesktop.realmd',
'/org/freedesktop/realmd', '/org/freedesktop/realmd',
service => service.ReleaseRemote()); service => { service.ReleaseRemote(); });
this._aggregateProvider.disconnect(this._signalId); this._aggregateProvider.disconnect(this._signalId);
this._realms = { }; this._realms = { };
this._updateLoginFormat(); this._updateLoginFormat();
} }
}; };
Signals.addSignalMethods(Manager.prototype); Signals.addSignalMethods(Manager.prototype)

View File

@@ -1,6 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY,
DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */
const { Clutter, Gio, GLib } = imports.gi; const { Clutter, Gio, GLib } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
@@ -11,13 +9,14 @@ const OVirt = imports.gdm.oVirt;
const Main = imports.ui.main; const Main = imports.ui.main;
const Params = imports.misc.params; const Params = imports.misc.params;
const SmartcardManager = imports.misc.smartcardManager; const SmartcardManager = imports.misc.smartcardManager;
const Tweener = imports.ui.tweener;
var PASSWORD_SERVICE_NAME = 'gdm-password'; var PASSWORD_SERVICE_NAME = 'gdm-password';
var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint'; var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint';
var SMARTCARD_SERVICE_NAME = 'gdm-smartcard'; var SMARTCARD_SERVICE_NAME = 'gdm-smartcard';
var OVIRT_SERVICE_NAME = 'gdm-ovirtcred'; var OVIRT_SERVICE_NAME = 'gdm-ovirtcred';
var FADE_ANIMATION_TIME = 160; var FADE_ANIMATION_TIME = 0.16;
var CLONE_FADE_ANIMATION_TIME = 250; var CLONE_FADE_ANIMATION_TIME = 0.25;
var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen'; var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen';
var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication'; var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication';
@@ -31,7 +30,7 @@ var LOGO_KEY = 'logo';
var DISABLE_USER_LIST_KEY = 'disable-user-list'; var DISABLE_USER_LIST_KEY = 'disable-user-list';
// Give user 48ms to read each character of a PAM message // Give user 48ms to read each character of a PAM message
var USER_READ_TIME = 48; var USER_READ_TIME = 48
var MessageType = { var MessageType = {
NONE: 0, NONE: 0,
@@ -46,20 +45,20 @@ function fadeInActor(actor) {
let hold = new Batch.Hold(); let hold = new Batch.Hold();
actor.show(); actor.show();
let [, naturalHeight] = actor.get_preferred_height(-1); let [minHeight, naturalHeight] = actor.get_preferred_height(-1);
actor.opacity = 0; actor.opacity = 0;
actor.set_height(0); actor.set_height(0);
actor.ease({ Tweener.addTween(actor,
opacity: 255, { opacity: 255,
height: naturalHeight, height: naturalHeight,
duration: FADE_ANIMATION_TIME, time: FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete() {
this.set_height(-1); this.set_height(-1);
hold.release(); hold.release();
} },
}); });
return hold; return hold;
} }
@@ -72,17 +71,17 @@ function fadeOutActor(actor) {
} }
let hold = new Batch.Hold(); let hold = new Batch.Hold();
actor.ease({ Tweener.addTween(actor,
opacity: 0, { opacity: 0,
height: 0, height: 0,
duration: FADE_ANIMATION_TIME, time: FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete() {
this.hide(); this.hide();
this.set_height(-1); this.set_height(-1);
hold.release(); hold.release();
} },
}); });
return hold; return hold;
} }
@@ -102,15 +101,15 @@ function cloneAndFadeOutActor(actor) {
clone.set_position(x, y); clone.set_position(x, y);
let hold = new Batch.Hold(); let hold = new Batch.Hold();
clone.ease({ Tweener.addTween(clone,
opacity: 0, { opacity: 0,
duration: CLONE_FADE_ANIMATION_TIME, time: CLONE_FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete() {
clone.destroy(); clone.destroy();
hold.release(); hold.release();
} }
}); });
return hold; return hold;
} }
@@ -304,7 +303,7 @@ var ShellUserVerifier = class {
}); });
} }
_oVirtUserAuthenticated(_token) { _oVirtUserAuthenticated(token) {
this._preemptingService = OVIRT_SERVICE_NAME; this._preemptingService = OVIRT_SERVICE_NAME;
this.emit('ovirt-user-authenticated'); this.emit('ovirt-user-authenticated');
} }
@@ -343,7 +342,7 @@ var ShellUserVerifier = class {
try { try {
this._clearUserVerifier(); this._clearUserVerifier();
this._userVerifier = client.open_reauthentication_channel_finish(result); this._userVerifier = client.open_reauthentication_channel_finish(result);
} catch (e) { } catch(e) {
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
return; return;
if (e.matches(Gio.DBusError, Gio.DBusError.ACCESS_DENIED) && if (e.matches(Gio.DBusError, Gio.DBusError.ACCESS_DENIED) &&
@@ -370,7 +369,7 @@ var ShellUserVerifier = class {
try { try {
this._clearUserVerifier(); this._clearUserVerifier();
this._userVerifier = client.get_user_verifier_finish(result); this._userVerifier = client.get_user_verifier_finish(result);
} catch (e) { } catch(e) {
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
return; return;
this._reportInitError('Failed to obtain user verifier', e); this._reportInitError('Failed to obtain user verifier', e);
@@ -424,31 +423,36 @@ var ShellUserVerifier = class {
_startService(serviceName) { _startService(serviceName) {
this._hold.acquire(); this._hold.acquire();
if (this._userName) { if (this._userName) {
this._userVerifier.call_begin_verification_for_user(serviceName, this._userName, this._cancellable, (obj, result) => { this._userVerifier.call_begin_verification_for_user(serviceName,
try { this._userName,
obj.call_begin_verification_for_user_finish(result); this._cancellable,
} catch (e) { (obj, result) => {
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) try {
return; obj.call_begin_verification_for_user_finish(result);
this._reportInitError('Failed to start verification for user', e); } catch(e) {
return; if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
} return;
this._reportInitError('Failed to start verification for user', e);
return;
}
this._hold.release(); this._hold.release();
}); });
} else { } else {
this._userVerifier.call_begin_verification(serviceName, this._cancellable, (obj, result) => { this._userVerifier.call_begin_verification(serviceName,
try { this._cancellable,
obj.call_begin_verification_finish(result); (obj, result) => {
} catch (e) { try {
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) obj.call_begin_verification_finish(result);
return; } catch(e) {
this._reportInitError('Failed to start verification', e); if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
return; return;
} this._reportInitError('Failed to start verification', e);
return;
}
this._hold.release(); this._hold.release();
}); });
} }
} }

View File

@@ -1,37 +1,23 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported ExtensionState, ExtensionType, getCurrentExtension,
getSettings, initTranslations, isOutOfDate, installImporter,
serializeExtension, deserializeExtension */
// Common utils for the extension system and the extension // Common utils for the extension system and the extension
// preferences tool // preferences tool
const { Gio, GLib } = imports.gi;
const Gettext = imports.gettext; const Gettext = imports.gettext;
const Lang = imports.lang; const Signals = imports.signals;
const Gio = imports.gi.Gio;
const Config = imports.misc.config; const Config = imports.misc.config;
const FileUtils = imports.misc.fileUtils;
var ExtensionType = { var ExtensionType = {
SYSTEM: 1, SYSTEM: 1,
PER_USER: 2 PER_USER: 2
}; };
var ExtensionState = { // Maps uuid -> metadata object
ENABLED: 1, var extensions = {};
DISABLED: 2,
ERROR: 3,
OUT_OF_DATE: 4,
DOWNLOADING: 5,
INITIALIZED: 6,
// Used as an error state for operations on unknown extensions,
// should never be in a real extensionMeta object.
UNINSTALLED: 99
};
const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
/** /**
* getCurrentExtension: * getCurrentExtension:
@@ -45,7 +31,7 @@ function getCurrentExtension() {
// Search for an occurrence of an extension stack frame // Search for an occurrence of an extension stack frame
// Start at 1 because 0 is the stack frame of this function // Start at 1 because 0 is the stack frame of this function
for (let i = 1; i < stack.length; i++) { for (let i = 1; i < stack.length; i++) {
if (stack[i].includes('/gnome-shell/extensions/')) { if (stack[i].indexOf('/gnome-shell/extensions/') > -1) {
extensionStackLine = stack[i]; extensionStackLine = stack[i];
break; break;
} }
@@ -63,17 +49,13 @@ function getCurrentExtension() {
if (!match) if (!match)
return null; return null;
// local import, as the module is used from outside the gnome-shell process
// as well (not this function though)
let extensionManager = imports.ui.main.extensionManager;
let path = match[1]; let path = match[1];
let file = Gio.File.new_for_path(path); let file = Gio.File.new_for_path(path);
// Walk up the directory tree, looking for an extension with // Walk up the directory tree, looking for an extension with
// the same UUID as a directory name. // the same UUID as a directory name.
while (file != null) { while (file != null) {
let extension = extensionManager.lookup(file.get_basename()); let extension = extensions[file.get_basename()];
if (extension !== undefined) if (extension !== undefined)
return extension; return extension;
file = file.get_parent(); file = file.get_parent();
@@ -165,8 +147,8 @@ function versionCheck(required, current) {
let requiredArray = required[i].split('.'); let requiredArray = required[i].split('.');
if (requiredArray[0] == major && if (requiredArray[0] == major &&
requiredArray[1] == minor && requiredArray[1] == minor &&
((requiredArray[2] === undefined && parseInt(minor) % 2 == 0) || (requiredArray[2] == point ||
requiredArray[2] == point)) (requiredArray[2] == undefined && parseInt(minor) % 2 == 0)))
return true; return true;
} }
return false; return false;
@@ -179,50 +161,54 @@ function isOutOfDate(extension) {
return false; return false;
} }
function serializeExtension(extension) { function createExtensionObject(uuid, dir, type) {
let obj = {}; let info;
Lang.copyProperties(extension.metadata, obj);
SERIALIZED_PROPERTIES.forEach(prop => { let metadataFile = dir.get_child('metadata.json');
obj[prop] = extension[prop]; if (!metadataFile.query_exists(null)) {
}); throw new Error('Missing metadata.json');
}
let res = {}; let metadataContents, success, tag;
for (let key in obj) { try {
let val = obj[key]; [success, metadataContents, tag] = metadataFile.load_contents(null);
let type; if (metadataContents instanceof Uint8Array)
switch (typeof val) { metadataContents = imports.byteArray.toString(metadataContents);
case 'string': } catch (e) {
type = 's'; throw new Error('Failed to load metadata.json: ' + e);
break; }
case 'number': let meta;
type = 'd'; try {
break; meta = JSON.parse(metadataContents);
case 'boolean': } catch (e) {
type = 'b'; throw new Error('Failed to parse metadata.json: ' + e);
break; }
default:
continue; let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
for (let i = 0; i < requiredProperties.length; i++) {
let prop = requiredProperties[i];
if (!meta[prop]) {
throw new Error('missing "' + prop + '" property in metadata.json');
} }
res[key] = GLib.Variant.new(type, val);
} }
return res; if (uuid != meta.uuid) {
} throw new Error('uuid "' + meta.uuid + '" from metadata.json does not match directory name "' + uuid + '"');
function deserializeExtension(variant) {
let res = { metadata: {} };
for (let prop in variant) {
let val = variant[prop].unpack();
if (SERIALIZED_PROPERTIES.includes(prop))
res[prop] = val;
else
res.metadata[prop] = val;
} }
// add the 2 additional properties to create a valid extension object, as createExtensionObject()
res.uuid = res.metadata.uuid; let extension = {};
res.dir = Gio.File.new_for_path(res.path);
return res; extension.metadata = meta;
extension.uuid = meta.uuid;
extension.type = type;
extension.dir = dir;
extension.path = dir.get_path();
extension.error = '';
extension.hasPrefs = dir.get_child('prefs.js').query_exists(null);
extensions[uuid] = extension;
return extension;
} }
function installImporter(extension) { function installImporter(extension) {
@@ -233,3 +219,36 @@ function installImporter(extension) {
extension.imports = imports[extension.uuid]; extension.imports = imports[extension.uuid];
imports.searchPath = oldSearchPath; imports.searchPath = oldSearchPath;
} }
var ExtensionFinder = class {
_loadExtension(extensionDir, info, perUserDir) {
let fileType = info.get_file_type();
if (fileType != Gio.FileType.DIRECTORY)
return;
let uuid = info.get_name();
let existing = extensions[uuid];
if (existing) {
log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path()));
return;
}
let extension;
let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER
: ExtensionType.SYSTEM;
try {
extension = createExtensionObject(uuid, extensionDir, type);
} catch(e) {
logError(e, 'Could not load extension %s'.format(uuid));
return;
}
this.emit('extension-found', extension);
}
scanExtensions() {
let perUserDir = Gio.File.new_for_path(global.userdatadir);
FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
this._loadExtension(dir, info, perUserDir);
});
}
};
Signals.addSignalMethods(ExtensionFinder.prototype);

View File

@@ -1,6 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
recursivelyMoveDir, loadInterfaceXML */
const { Gio, GLib } = imports.gi; const { Gio, GLib } = imports.gi;
const Config = imports.misc.config; const Config = imports.misc.config;
@@ -38,7 +36,7 @@ function recursivelyDeleteDir(dir, deleteParent) {
let children = dir.enumerate_children('standard::name,standard::type', let children = dir.enumerate_children('standard::name,standard::type',
Gio.FileQueryInfoFlags.NONE, null); Gio.FileQueryInfoFlags.NONE, null);
let info; let info, child;
while ((info = children.next_file(null)) != null) { while ((info = children.next_file(null)) != null) {
let type = info.get_file_type(); let type = info.get_file_type();
let child = dir.get_child(info.get_name()); let child = dir.get_child(info.get_name());
@@ -59,7 +57,7 @@ function recursivelyMoveDir(srcDir, destDir) {
if (!destDir.query_exists(null)) if (!destDir.query_exists(null))
destDir.make_directory_with_parents(null); destDir.make_directory_with_parents(null);
let info; let info, child;
while ((info = children.next_file(null)) != null) { while ((info = children.next_file(null)) != null) {
let type = info.get_file_type(); let type = info.get_file_type();
let srcChild = srcDir.get_child(info.get_name()); let srcChild = srcDir.get_child(info.get_name());
@@ -86,13 +84,13 @@ function loadInterfaceXML(iface) {
let f = Gio.File.new_for_uri(uri); let f = Gio.File.new_for_uri(uri);
try { try {
let [ok_, bytes] = f.load_contents(null); let [ok, bytes] = f.load_contents(null);
if (bytes instanceof Uint8Array) if (bytes instanceof Uint8Array)
xml = imports.byteArray.toString(bytes); xml = imports.byteArray.toString(bytes)
else else
xml = bytes.toString(); xml = bytes.toString();
} catch (e) { } catch (e) {
log(`Failed to load D-Bus interface ${iface}`); log('Failed to load D-Bus interface ' + iface);
} }
return xml; return xml;

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported PresenceStatus, Presence, Inhibitor, SessionManager */
const Gio = imports.gi.Gio; const Gio = imports.gi.Gio;

View File

@@ -18,7 +18,7 @@ var HistoryManager = class {
this._historyIndex = 0; this._historyIndex = 0;
if (this._key) { if (this._key) {
this._history = global.settings.get_strv(this._key); this._history = global.settings.get_strv(this._key);
global.settings.connect(`changed::${this._key}`, global.settings.connect('changed::' + this._key,
this._historyChanged.bind(this)); this._historyChanged.bind(this));
} else { } else {
@@ -66,7 +66,7 @@ var HistoryManager = class {
this._indexChanged(); this._indexChanged();
} }
return this._historyIndex ? this._history[this._historyIndex - 1] : null; return this._historyIndex ? this._history[this._historyIndex -1] : null;
} }
addItem(input) { addItem(input) {

View File

@@ -1,7 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported getIBusManager */
const { Gio, GLib, IBus } = imports.gi; const { Gio, GLib, IBus } = imports.gi;
const Mainloop = imports.mainloop;
const Signals = imports.signals; const Signals = imports.signals;
const IBusCandidatePopup = imports.ui.ibusCandidatePopup; const IBusCandidatePopup = imports.ui.ibusCandidatePopup;
@@ -18,9 +18,9 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) {
IBus.MICRO_VERSION >= requiredMicro)) IBus.MICRO_VERSION >= requiredMicro))
return; return;
throw "Found IBus version %d.%d.%d but required is %d.%d.%d" throw "Found IBus version %d.%d.%d but required is %d.%d.%d".
.format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION, format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
requiredMajor, requiredMinor, requiredMicro); requiredMajor, requiredMinor, requiredMicro);
} }
function getIBusManager() { function getIBusManager() {
@@ -42,7 +42,7 @@ var IBusManager = class {
this._candidatePopup = new IBusCandidatePopup.CandidatePopup(); this._candidatePopup = new IBusCandidatePopup.CandidatePopup();
this._panelService = null; this._panelService = null;
this._engines = new Map(); this._engines = {};
this._ready = false; this._ready = false;
this._registerPropertiesId = 0; this._registerPropertiesId = 0;
this._currentEngineName = null; this._currentEngineName = null;
@@ -58,79 +58,54 @@ var IBusManager = class {
this._spawn(); this._spawn();
} }
_spawn(extraArgs = []) { _spawn() {
try { try {
let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs]; Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE); Gio.SubprocessFlags.NONE);
} catch (e) { } catch(e) {
log(`Failed to launch ibus-daemon: ${e.message}`); log('Failed to launch ibus-daemon: ' + e.message);
} }
} }
restartDaemon(extraArgs = []) {
this._spawn(['-r', ...extraArgs]);
}
_clear() { _clear() {
if (this._cancellable) {
this._cancellable.cancel();
this._cancellable = null;
}
if (this._preloadEnginesId) {
GLib.source_remove(this._preloadEnginesId);
this._preloadEnginesId = 0;
}
if (this._panelService) if (this._panelService)
this._panelService.destroy(); this._panelService.destroy();
this._panelService = null; this._panelService = null;
this._candidatePopup.setPanelService(null); this._candidatePopup.setPanelService(null);
this._engines.clear(); this._engines = {};
this._ready = false; this._ready = false;
this._registerPropertiesId = 0; this._registerPropertiesId = 0;
this._currentEngineName = null; this._currentEngineName = null;
this.emit('ready', false); this.emit('ready', false);
this._spawn();
} }
_onConnected() { _onConnected() {
this._cancellable = new Gio.Cancellable(); this._ibus.list_engines_async(-1, null, this._initEngines.bind(this));
this._ibus.list_engines_async(-1, this._cancellable,
this._initEngines.bind(this));
this._ibus.request_name_async(IBus.SERVICE_PANEL, this._ibus.request_name_async(IBus.SERVICE_PANEL,
IBus.BusNameFlag.REPLACE_EXISTING, -1, this._cancellable, IBus.BusNameFlag.REPLACE_EXISTING,
this._initPanelService.bind(this)); -1, null,
this._initPanelService.bind(this));
} }
_initEngines(ibus, result) { _initEngines(ibus, result) {
try { let enginesList = this._ibus.list_engines_async_finish(result);
let enginesList = this._ibus.list_engines_async_finish(result); if (enginesList) {
for (let i = 0; i < enginesList.length; ++i) { for (let i = 0; i < enginesList.length; ++i) {
let name = enginesList[i].get_name(); let name = enginesList[i].get_name();
this._engines.set(name, enginesList[i]); this._engines[name] = enginesList[i];
} }
this._updateReadiness(); this._updateReadiness();
} catch (e) { } else {
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
return;
logError(e);
this._clear(); this._clear();
} }
} }
_initPanelService(ibus, result) { _initPanelService(ibus, result) {
let success = false; let success = this._ibus.request_name_async_finish(result);
try {
success = !!this._ibus.request_name_async_finish(result);
} catch (e) {
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
return;
logError(e);
}
if (success) { if (success) {
this._panelService = new IBus.PanelService({ connection: this._ibus.get_connection(), this._panelService = new IBus.PanelService({ connection: this._ibus.get_connection(),
object_path: IBus.PATH_PANEL }); object_path: IBus.PATH_PANEL });
@@ -144,7 +119,7 @@ var IBusManager = class {
if (!GLib.str_has_suffix(path, '/InputContext_1')) if (!GLib.str_has_suffix(path, '/InputContext_1'))
this.emit ('focus-in'); this.emit ('focus-in');
}); });
this._panelService.connect('focus-out', () => this.emit('focus-out')); this._panelService.connect('focus-out', () => { this.emit('focus-out'); });
try { try {
// IBus versions older than 1.5.10 have a bug which // IBus versions older than 1.5.10 have a bug which
@@ -157,13 +132,13 @@ var IBusManager = class {
} catch (e) { } catch (e) {
} }
// If an engine is already active we need to get its properties // If an engine is already active we need to get its properties
this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, result) => { this._ibus.get_global_engine_async(-1, null, (i, result) => {
let engine; let engine;
try { try {
engine = this._ibus.get_global_engine_async_finish(result); engine = this._ibus.get_global_engine_async_finish(result);
if (!engine) if (!engine)
return; return;
} catch (e) { } catch(e) {
return; return;
} }
this._engineChanged(this._ibus, engine.get_name()); this._engineChanged(this._ibus, engine.get_name());
@@ -175,7 +150,8 @@ var IBusManager = class {
} }
_updateReadiness() { _updateReadiness() {
this._ready = this._engines.size > 0 && this._panelService != null; this._ready = (Object.keys(this._engines).length > 0 &&
this._panelService != null);
this.emit('ready', this._ready); this.emit('ready', this._ready);
} }
@@ -213,10 +189,10 @@ var IBusManager = class {
} }
getEngineDesc(id) { getEngineDesc(id) {
if (!this._ready || !this._engines.has(id)) if (!this._ready || !this._engines.hasOwnProperty(id))
return null; return null;
return this._engines.get(id); return this._engines[id];
} }
setEngine(id, callback) { setEngine(id, callback) {
@@ -229,18 +205,8 @@ var IBusManager = class {
return; return;
} }
this._ibus.set_global_engine_async(id, this._ibus.set_global_engine_async(id, this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
this._MAX_INPUT_SOURCE_ACTIVATION_TIME, null, callback || null);
this._cancellable, (_bus, res) => {
try {
this._ibus.set_global_engine_async_finish(res);
} catch (e) {
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
logError(e);
}
if (callback)
callback();
});
} }
preloadEngines(ids) { preloadEngines(ids) {
@@ -248,23 +214,21 @@ var IBusManager = class {
return; return;
if (this._preloadEnginesId != 0) { if (this._preloadEnginesId != 0) {
GLib.source_remove(this._preloadEnginesId); Mainloop.source_remove(this._preloadEnginesId);
this._preloadEnginesId = 0; this._preloadEnginesId = 0;
} }
this._preloadEnginesId = this._preloadEnginesId =
GLib.timeout_add_seconds( Mainloop.timeout_add_seconds(this._PRELOAD_ENGINES_DELAY_TIME,
GLib.PRIORITY_DEFAULT, () => {
this._PRELOAD_ENGINES_DELAY_TIME, this._ibus.preload_engines_async(
() => { ids,
this._ibus.preload_engines_async( -1,
ids, null,
-1, null);
this._cancellable, this._preloadEnginesId = 0;
null); return GLib.SOURCE_REMOVE;
this._preloadEnginesId = 0; });
return GLib.SOURCE_REMOVE;
});
} }
}; };
Signals.addSignalMethods(IBusManager.prototype); Signals.addSignalMethods(IBusManager.prototype);

View File

@@ -1,6 +1,5 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported InputMethod */ const { Clutter, GLib, GObject, IBus } = imports.gi;
const { Clutter, GLib, Gio, GObject, IBus } = imports.gi;
const Keyboard = imports.ui.status.keyboard; const Keyboard = imports.ui.status.keyboard;
@@ -36,7 +35,15 @@ class InputMethod extends Clutter.InputMethod {
} }
_updateCapabilities() { _updateCapabilities() {
let caps = IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT; let caps = 0;
if (this.can_show_preedit)
caps |= IBus.Capabilite.PREEDIT_TEXT;
if (this._currentFocus)
caps |= IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
else
caps |= IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.AUXILIARY_TEXT | IBus.Capabilite.LOOKUP_TABLE | IBus.Capabilite.PROPERTY;
if (this._context) if (this._context)
this._context.set_capabilities(caps); this._context.set_capabilities(caps);
@@ -47,22 +54,12 @@ class InputMethod extends Clutter.InputMethod {
} }
_onConnected() { _onConnected() {
this._cancellable = new Gio.Cancellable(); this._ibus.create_input_context_async ('gnome-shell', -1, null,
this._ibus.create_input_context_async ('gnome-shell', -1, this._setContext.bind(this));
this._cancellable, this._setContext.bind(this));
} }
_setContext(bus, res) { _setContext(bus, res) {
try { this._context = this._ibus.create_input_context_async_finish(res);
this._context = this._ibus.create_input_context_async_finish(res);
} catch (e) {
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) {
logError(e);
this._clear();
}
return;
}
this._context.connect('commit-text', this._onCommitText.bind(this)); this._context.connect('commit-text', this._onCommitText.bind(this));
this._context.connect('delete-surrounding-text', this._onDeleteSurroundingText.bind(this)); this._context.connect('delete-surrounding-text', this._onDeleteSurroundingText.bind(this));
this._context.connect('update-preedit-text', this._onUpdatePreeditText.bind(this)); this._context.connect('update-preedit-text', this._onUpdatePreeditText.bind(this));
@@ -74,15 +71,10 @@ class InputMethod extends Clutter.InputMethod {
} }
_clear() { _clear() {
if (this._cancellable) {
this._cancellable.cancel();
this._cancellable = null;
}
this._context = null; this._context = null;
this._hints = 0; this._hints = 0;
this._purpose = 0; this._purpose = 0;
this._preeditStr = ''; this._preeditStr = ''
this._preeditPos = 0; this._preeditPos = 0;
this._preeditVisible = false; this._preeditVisible = false;
} }
@@ -92,15 +84,15 @@ class InputMethod extends Clutter.InputMethod {
this.emit('request-surrounding'); this.emit('request-surrounding');
} }
_onCommitText(_context, text) { _onCommitText(context, text) {
this.commit(text.get_text()); this.commit(text.get_text());
} }
_onDeleteSurroundingText() { _onDeleteSurroundingText(context) {
this.delete_surrounding(); this.delete_surrounding();
} }
_onUpdatePreeditText(_context, text, pos, visible) { _onUpdatePreeditText(context, text, pos, visible) {
if (text == null) if (text == null)
return; return;
@@ -116,17 +108,17 @@ class InputMethod extends Clutter.InputMethod {
this._preeditVisible = visible; this._preeditVisible = visible;
} }
_onShowPreeditText() { _onShowPreeditText(context) {
this._preeditVisible = true; this._preeditVisible = true;
this.set_preedit_text(this._preeditStr, this._preeditPos); this.set_preedit_text(this._preeditStr, this._preeditPos);
} }
_onHidePreeditText() { _onHidePreeditText(context) {
this.set_preedit_text(null, this._preeditPos); this.set_preedit_text(null, this._preeditPos);
this._preeditVisible = false; this._preeditVisible = false;
} }
_onForwardKeyEvent(_context, keyval, keycode, state) { _onForwardKeyEvent(context, keyval, keycode, state) {
let press = (state & IBus.ModifierType.RELEASE_MASK) == 0; let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
state &= ~(IBus.ModifierType.RELEASE_MASK); state &= ~(IBus.ModifierType.RELEASE_MASK);
@@ -144,6 +136,7 @@ class InputMethod extends Clutter.InputMethod {
this._currentFocus = focus; this._currentFocus = focus;
if (this._context) { if (this._context) {
this._context.focus_in(); this._context.focus_in();
this._updateCapabilities();
this._emitRequestSurrounding(); this._emitRequestSurrounding();
} }
@@ -155,8 +148,10 @@ class InputMethod extends Clutter.InputMethod {
vfunc_focus_out() { vfunc_focus_out() {
this._currentFocus = null; this._currentFocus = null;
if (this._context) if (this._context) {
this._context.focus_out(); this._context.focus_out();
this._updateCapabilities();
}
if (this._preeditStr) { if (this._preeditStr) {
// Unset any preedit text // Unset any preedit text
@@ -259,19 +254,17 @@ class InputMethod extends Clutter.InputMethod {
if (event.type() == Clutter.EventType.KEY_RELEASE) if (event.type() == Clutter.EventType.KEY_RELEASE)
state |= IBus.ModifierType.RELEASE_MASK; state |= IBus.ModifierType.RELEASE_MASK;
this._context.process_key_event_async( this._context.process_key_event_async(event.get_key_symbol(),
event.get_key_symbol(), event.get_key_code() - 8, // Convert XKB keycodes to evcodes
event.get_key_code() - 8, // Convert XKB keycodes to evcodes state, -1, null,
state, -1, this._cancellable, (context, res) => {
(context, res) => { try {
try { let retval = context.process_key_event_async_finish(res);
let retval = context.process_key_event_async_finish(res); this.notify_key_event(event, retval);
this.notify_key_event(event, retval); } catch (e) {
} catch (e) { log('Error processing key on IM: ' + e.message);
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) }
log(`Error processing key on IM: ${e.message}`); });
}
});
return true; return true;
} }
}); });

View File

@@ -1,4 +1,3 @@
/* exported IntrospectService */
const { Gio, GLib, Meta, Shell } = imports.gi; const { Gio, GLib, Meta, Shell } = imports.gi;
const INTROSPECT_SCHEMA = 'org.gnome.shell'; const INTROSPECT_SCHEMA = 'org.gnome.shell';
@@ -40,15 +39,6 @@ var IntrospectService = class {
}); });
this._syncRunningApplications(); this._syncRunningApplications();
this._whitelistMap = new Map();
APP_WHITELIST.forEach(appName => {
Gio.DBus.watch_name(Gio.BusType.SESSION,
appName,
Gio.BusNameWatcherFlags.NONE,
(conn, name, owner) => this._whitelistMap.set(name, owner),
(conn, name) => this._whitelistMap.delete(name));
});
} }
_isStandaloneApp(app) { _isStandaloneApp(app) {
@@ -56,11 +46,11 @@ var IntrospectService = class {
} }
_isIntrospectEnabled() { _isIntrospectEnabled() {
return this._settings.get_boolean(INTROSPECT_KEY); return this._settings.get_boolean(INTROSPECT_KEY);
} }
_isSenderWhitelisted(sender) { _isSenderWhitelisted(sender) {
return [...this._whitelistMap.values()].includes(sender); return APP_WHITELIST.includes(sender);
} }
_getSandboxedAppId(app) { _getSandboxedAppId(app) {
@@ -136,8 +126,7 @@ var IntrospectService = class {
let apps = this._appSystem.get_running(); let apps = this._appSystem.get_running();
let windowsList = {}; let windowsList = {};
if (!this._isIntrospectEnabled() && if (!this._isIntrospectEnabled()) {
!this._isSenderWhitelisted(invocation.get_sender())) {
invocation.return_error_literal(Gio.DBusError, invocation.return_error_literal(Gio.DBusError,
Gio.DBusError.ACCESS_DENIED, Gio.DBusError.ACCESS_DENIED,
'App introspection not allowed'); 'App introspection not allowed');

View File

@@ -1,5 +1,4 @@
/* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */ /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
/* exported getCompletions, getCommonPrefix, getDeclaredConstants */
// Returns a list of potential completions for text. Completions either // Returns a list of potential completions for text. Completions either
// follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo) // follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo)
@@ -9,7 +8,7 @@
// This function is likely the one you want to call from external modules // This function is likely the one you want to call from external modules
function getCompletions(text, commandHeader, globalCompletionList) { function getCompletions(text, commandHeader, globalCompletionList) {
let methods = []; let methods = [];
let expr_, base; let expr, base;
let attrHead = ''; let attrHead = '';
if (globalCompletionList == null) { if (globalCompletionList == null) {
globalCompletionList = []; globalCompletionList = [];
@@ -22,7 +21,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
// Look for expressions like "Main.panel.foo" and match Main.panel and foo // Look for expressions like "Main.panel.foo" and match Main.panel and foo
let matches = text.match(/(.*)\.(.*)/); let matches = text.match(/(.*)\.(.*)/);
if (matches) { if (matches) {
[expr_, base, attrHead] = matches; [expr, base, attrHead] = matches;
methods = getPropertyNamesFromExpression(base, commandHeader).filter( methods = getPropertyNamesFromExpression(base, commandHeader).filter(
attr => attr.slice(0, attrHead.length) == attrHead attr => attr.slice(0, attrHead.length) == attrHead
@@ -33,7 +32,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
// not proceeded by a dot and match them against global constants // not proceeded by a dot and match them against global constants
matches = text.match(/^(\w*)$/); matches = text.match(/^(\w*)$/);
if (text == '' || matches) { if (text == '' || matches) {
[expr_, attrHead] = matches; [expr, attrHead] = matches;
methods = globalCompletionList.filter( methods = globalCompletionList.filter(
attr => attr.slice(0, attrHead.length) == attrHead attr => attr.slice(0, attrHead.length) == attrHead
); );
@@ -52,14 +51,14 @@ function getCompletions(text, commandHeader, globalCompletionList) {
// if we encounter anything that isn't a letter, '.', ')', or ']', // if we encounter anything that isn't a letter, '.', ')', or ']',
// we should stop parsing. // we should stop parsing.
function isStopChar(c) { function isStopChar(c) {
return !c.match(/[\w.)\]]/); return !c.match(/[\w\.\)\]]/);
} }
// Given the ending position of a quoted string, find where it starts // Given the ending position of a quoted string, find where it starts
function findMatchingQuote(expr, offset) { function findMatchingQuote(expr, offset) {
let quoteChar = expr.charAt(offset); let quoteChar = expr.charAt(offset);
for (let i = offset - 1; i >= 0; --i) { for (let i = offset - 1; i >= 0; --i) {
if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') { if (expr.charAt(i) == quoteChar && expr.charAt(i-1) != '\\'){
return i; return i;
} }
} }
@@ -69,7 +68,7 @@ function findMatchingQuote(expr, offset) {
// Given the ending position of a regex, find where it starts // Given the ending position of a regex, find where it starts
function findMatchingSlash(expr, offset) { function findMatchingSlash(expr, offset) {
for (let i = offset - 1; i >= 0; --i) { for (let i = offset - 1; i >= 0; --i) {
if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') { if (expr.charAt(i) == '/' && expr.charAt(i-1) != '\\'){
return i; return i;
} }
} }
@@ -82,7 +81,7 @@ function findMatchingSlash(expr, offset) {
// findMatchingBrace("[(])", 3) returns 1. // findMatchingBrace("[(])", 3) returns 1.
function findMatchingBrace(expr, offset) { function findMatchingBrace(expr, offset) {
let closeBrace = expr.charAt(offset); let closeBrace = expr.charAt(offset);
let openBrace = ({ ')': '(', ']': '[' })[closeBrace]; let openBrace = ({')': '(', ']': '['})[closeBrace];
function findTheBrace(expr, offset) { function findTheBrace(expr, offset) {
if (offset < 0) { if (offset < 0) {
@@ -118,11 +117,11 @@ function getExpressionOffset(expr, offset) {
while (offset >= 0) { while (offset >= 0) {
let currChar = expr.charAt(offset); let currChar = expr.charAt(offset);
if (isStopChar(currChar)) { if (isStopChar(currChar)){
return offset + 1; return offset + 1;
} }
if (currChar.match(/[)\]]/)) { if (currChar.match(/[\)\]]/)) {
offset = findMatchingBrace(expr, offset); offset = findMatchingBrace(expr, offset);
} }
@@ -152,11 +151,15 @@ function getAllProps(obj) {
// e.g., expr="({ foo: null, bar: null, 4: null })" will // e.g., expr="({ foo: null, bar: null, 4: null })" will
// return ["foo", "bar", ...] but the list will not include "4", // return ["foo", "bar", ...] but the list will not include "4",
// since methods accessed with '.' notation must star with a letter or _. // since methods accessed with '.' notation must star with a letter or _.
function getPropertyNamesFromExpression(expr, commandHeader = '') { function getPropertyNamesFromExpression(expr, commandHeader) {
if (commandHeader == null) {
commandHeader = '';
}
let obj = {}; let obj = {};
if (!isUnsafeExpression(expr)) { if (!isUnsafeExpression(expr)) {
try { try {
obj = eval(commandHeader + expr); obj = eval(commandHeader + expr);
} catch (e) { } catch (e) {
return []; return [];
} }
@@ -165,14 +168,14 @@ function getPropertyNamesFromExpression(expr, commandHeader = '') {
} }
let propsUnique = {}; let propsUnique = {};
if (typeof obj === 'object') { if (typeof obj === 'object'){
let allProps = getAllProps(obj); let allProps = getAllProps(obj);
// Get only things we are allowed to complete following a '.' // Get only things we are allowed to complete following a '.'
allProps = allProps.filter( isValidPropertyName ); allProps = allProps.filter( isValidPropertyName );
// Make sure propsUnique contains one key for every // Make sure propsUnique contains one key for every
// property so we end up with a unique list of properties // property so we end up with a unique list of properties
allProps.map(p => (propsUnique[p] = null)); allProps.map(p => propsUnique[p] = null);
} }
return Object.keys(propsUnique).sort(); return Object.keys(propsUnique).sort();
} }
@@ -217,7 +220,7 @@ function isUnsafeExpression(str) {
prunedStr = prunedStr.replace(/[=!]==/g, ''); //replace === and !== with nothing prunedStr = prunedStr.replace(/[=!]==/g, ''); //replace === and !== with nothing
prunedStr = prunedStr.replace(/[=<>!]=/g, ''); //replace ==, <=, >=, != with nothing prunedStr = prunedStr.replace(/[=<>!]=/g, ''); //replace ==, <=, >=, != with nothing
if (prunedStr.match(/[=]/)) { if (prunedStr.match(/=/)) {
return true; return true;
} else if (prunedStr.match(/;/)) { } else if (prunedStr.match(/;/)) {
// If we contain a semicolon not inside of a quote/regex, assume we're unsafe as well // If we contain a semicolon not inside of a quote/regex, assume we're unsafe as well
@@ -231,10 +234,10 @@ function isUnsafeExpression(str) {
function getDeclaredConstants(str) { function getDeclaredConstants(str) {
let ret = []; let ret = [];
str.split(';').forEach(s => { str.split(';').forEach(s => {
let base_, keyword; let base, keyword;
let match = s.match(/const\s+(\w+)\s*=/); let match = s.match(/const\s+(\w+)\s*=/);
if (match) { if (match) {
[base_, keyword] = match; [base, keyword] = match;
ret.push(keyword); ret.push(keyword);
} }
}); });

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported getKeyboardManager, holdKeyboard, releaseKeyboard */
const { GLib, GnomeDesktop, Meta } = imports.gi; const { GLib, GnomeDesktop, Meta } = imports.gi;
@@ -61,7 +60,7 @@ var KeyboardManager = class {
this._currentKeymap.options == options) this._currentKeymap.options == options)
return; return;
this._currentKeymap = { layouts, variants, options }; this._currentKeymap = {layouts, variants, options};
Meta.get_backend().set_keymap(layouts, variants, options); Meta.get_backend().set_keymap(layouts, variants, options);
} }
@@ -126,7 +125,7 @@ var KeyboardManager = class {
_getLocaleLayout() { _getLocaleLayout() {
let locale = GLib.get_language_names()[0]; let locale = GLib.get_language_names()[0];
if (!locale.includes('_')) if (locale.indexOf('_') == -1)
locale = DEFAULT_LOCALE; locale = DEFAULT_LOCALE;
let [found, , id] = GnomeDesktop.get_input_source_from_locale(locale); let [found, , id] = GnomeDesktop.get_input_source_from_locale(locale);

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported canLock, getLoginManager, registerSessionWithGDM */
const { GLib, Gio } = imports.gi; const { GLib, Gio } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
@@ -44,7 +43,7 @@ function canLock() {
let version = result.deep_unpack()[0].deep_unpack(); let version = result.deep_unpack()[0].deep_unpack();
return haveSystemd() && versionCompare('3.5.91', version); return haveSystemd() && versionCompare('3.5.91', version);
} catch (e) { } catch(e) {
return false; return false;
} }
} }
@@ -110,7 +109,7 @@ var LoginManagerSystemd = class {
let sessionId = GLib.getenv('XDG_SESSION_ID'); let sessionId = GLib.getenv('XDG_SESSION_ID');
if (!sessionId) { if (!sessionId) {
log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.'); log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
let [session, objectPath_] = this._userProxy.Display; let [session, objectPath] = this._userProxy.Display;
if (session) { if (session) {
log(`Will monitor session ${session}`); log(`Will monitor session ${session}`);
sessionId = session; sessionId = session;
@@ -183,10 +182,10 @@ var LoginManagerSystemd = class {
(proxy, result) => { (proxy, result) => {
let fd = -1; let fd = -1;
try { try {
let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result); let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result);
fd = fdList.steal_fds()[0]; fd = fdList.steal_fds()[0];
callback(new Gio.UnixInputStream({ fd: fd })); callback(new Gio.UnixInputStream({ fd: fd }));
} catch (e) { } catch(e) {
logError(e, "Error getting systemd inhibitor"); logError(e, "Error getting systemd inhibitor");
callback(null); callback(null);
} }
@@ -200,7 +199,7 @@ var LoginManagerSystemd = class {
Signals.addSignalMethods(LoginManagerSystemd.prototype); Signals.addSignalMethods(LoginManagerSystemd.prototype);
var LoginManagerDummy = class { var LoginManagerDummy = class {
getCurrentSessionProxy(_callback) { getCurrentSessionProxy(callback) {
// we could return a DummySession object that fakes whatever callers // we could return a DummySession object that fakes whatever callers
// expect (at the time of writing: connect() and connectSignal() // expect (at the time of writing: connect() and connectSignal()
// methods), but just never calling the callback should be safer // methods), but just never calling the callback should be safer

View File

@@ -26,33 +26,33 @@ function _getMobileProvidersDatabase() {
} }
// _findProviderForMccMnc: // _findProviderForMccMnc:
// @operatorName: operator name // @operator_name: operator name
// @operatorCode: operator code // @operator_code: operator code
// //
// Given an operator name string (which may not be a real operator name) and an // Given an operator name string (which may not be a real operator name) and an
// operator code string, tries to find a proper operator name to display. // operator code string, tries to find a proper operator name to display.
// //
function _findProviderForMccMnc(operatorName, operatorCode) { function _findProviderForMccMnc(operator_name, operator_code) {
if (operatorName) { if (operator_name) {
if (operatorName.length != 0 && if (operator_name.length != 0 &&
(operatorName.length > 6 || operatorName.length < 5)) { (operator_name.length > 6 || operator_name.length < 5)) {
// this looks like a valid name, i.e. not an MCCMNC (that some // this looks like a valid name, i.e. not an MCCMNC (that some
// devices return when not yet connected // devices return when not yet connected
return operatorName; return operator_name;
} }
if (isNaN(parseInt(operatorName))) { if (isNaN(parseInt(operator_name))) {
// name is definitely not a MCCMNC, so it may be a name // name is definitely not a MCCMNC, so it may be a name
// after all; return that // after all; return that
return operatorName; return operator_name;
} }
} }
let needle; let needle;
if ((!operatorName || operatorName.length == 0) && operatorCode) if ((!operator_name || operator_name.length == 0) && operator_code)
needle = operatorCode; needle = operator_code;
else if (operatorName && (operatorName.length == 6 || operatorName.length == 5)) else if (operator_name && (operator_name.length == 6 || operator_name.length == 5))
needle = operatorName; needle = operator_name;
else // nothing to search else // nothing to search
return null; return null;
@@ -84,9 +84,9 @@ function _findProviderForSid(sid) {
} }
// ----------------------------------------------------- // //------------------------------------------------------------------------------
// Support for the old ModemManager interface (MM < 0.7) // // Support for the old ModemManager interface (MM < 0.7)
// ----------------------------------------------------- // //------------------------------------------------------------------------------
// The following are not the complete interfaces, just the methods we need // The following are not the complete interfaces, just the methods we need
@@ -110,7 +110,7 @@ var ModemGsm = class {
this.signal_quality = quality; this.signal_quality = quality;
this.emit('notify::signal-quality'); this.emit('notify::signal-quality');
}); });
this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => { this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => {
this.operator_name = _findProviderForMccMnc(name, code); this.operator_name = _findProviderForMccMnc(name, code);
this.emit('notify::operator-name'); this.emit('notify::operator-name');
}); });
@@ -120,7 +120,7 @@ var ModemGsm = class {
return; return;
} }
let [status_, code, name] = result; let [status, code, name] = result;
this.operator_name = _findProviderForMccMnc(name, code); this.operator_name = _findProviderForMccMnc(name, code);
this.emit('notify::operator-name'); this.emit('notify::operator-name');
}); });
@@ -171,9 +171,9 @@ var ModemCdma = class {
// it will return an error if the device is not connected // it will return an error if the device is not connected
this.operator_name = null; this.operator_name = null;
} else { } else {
let [bandClass_, band_, sid] = result; let [bandClass, band, sid] = result;
this.operator_name = _findProviderForSid(sid); this.operator_name = _findProviderForSid(sid)
} }
this.emit('notify::operator-name'); this.emit('notify::operator-name');
}); });
@@ -182,9 +182,9 @@ var ModemCdma = class {
Signals.addSignalMethods(ModemCdma.prototype); Signals.addSignalMethods(ModemCdma.prototype);
// ------------------------------------------------------- // //------------------------------------------------------------------------------
// Support for the new ModemManager1 interface (MM >= 0.7) // // Support for the new ModemManager1 interface (MM >= 0.7)
// ------------------------------------------------------- // //------------------------------------------------------------------------------
const BroadbandModemInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem'); const BroadbandModemInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem');
const BroadbandModemProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemInterface); const BroadbandModemProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemInterface);
@@ -224,23 +224,23 @@ var BroadbandModem = class {
} }
_reloadSignalQuality() { _reloadSignalQuality() {
let [quality, recent_] = this._proxy.SignalQuality; let [quality, recent] = this._proxy.SignalQuality;
this.signal_quality = quality; this.signal_quality = quality;
this.emit('notify::signal-quality'); this.emit('notify::signal-quality');
} }
_reloadOperatorName() { _reloadOperatorName() {
let newName = ""; let new_name = "";
if (this.operator_name_3gpp && this.operator_name_3gpp.length > 0) if (this.operator_name_3gpp && this.operator_name_3gpp.length > 0)
newName += this.operator_name_3gpp; new_name += this.operator_name_3gpp;
if (this.operator_name_cdma && this.operator_name_cdma.length > 0) { if (this.operator_name_cdma && this.operator_name_cdma.length > 0) {
if (newName != "") if (new_name != "")
newName += ", "; new_name += ", ";
newName += this.operator_name_cdma; new_name += this.operator_name_cdma;
} }
this.operator_name = newName; this.operator_name = new_name;
this.emit('notify::operator-name'); this.emit('notify::operator-name');
} }

View File

@@ -77,51 +77,54 @@ var ObjectManager = class {
let info = this._interfaceInfos[interfaceName]; let info = this._interfaceInfos[interfaceName];
if (!info) { if (!info) {
if (onFinished) if (onFinished)
onFinished(); onFinished();
return; return;
} }
let proxy = new Gio.DBusProxy({ g_connection: this._connection, let proxy = new Gio.DBusProxy({ g_connection: this._connection,
g_name: this._serviceName, g_name: this._serviceName,
g_object_path: objectPath, g_object_path: objectPath,
g_interface_name: interfaceName, g_interface_name: interfaceName,
g_interface_info: info, g_interface_info: info,
g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START }); g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START });
proxy.init_async(GLib.PRIORITY_DEFAULT, this._cancellable, (initable, result) => { proxy.init_async(GLib.PRIORITY_DEFAULT,
try { this._cancellable,
initable.init_finish(result); (initable, result) => {
} catch (e) { let error = null;
logError(e, `could not initialize proxy for interface ${interfaceName}`); try {
initable.init_finish(result);
} catch(e) {
logError(e, 'could not initialize proxy for interface ' + interfaceName);
if (onFinished) if (onFinished)
onFinished(); onFinished();
return; return;
} }
let isNewObject; let isNewObject;
if (!this._objects[objectPath]) { if (!this._objects[objectPath]) {
this._objects[objectPath] = {}; this._objects[objectPath] = {};
isNewObject = true; isNewObject = true;
} else { } else {
isNewObject = false; isNewObject = false;
} }
this._objects[objectPath][interfaceName] = proxy; this._objects[objectPath][interfaceName] = proxy;
if (!this._interfaces[interfaceName]) if (!this._interfaces[interfaceName])
this._interfaces[interfaceName] = []; this._interfaces[interfaceName] = [];
this._interfaces[interfaceName].push(proxy); this._interfaces[interfaceName].push(proxy);
if (isNewObject) if (isNewObject)
this.emit('object-added', objectPath); this.emit('object-added', objectPath);
this.emit('interface-added', interfaceName, proxy); this.emit('interface-added', interfaceName, proxy);
if (onFinished) if (onFinished)
onFinished(); onFinished();
}); });
} }
@@ -152,10 +155,11 @@ var ObjectManager = class {
} }
_onManagerProxyLoaded(initable, result) { _onManagerProxyLoaded(initable, result) {
let error = null;
try { try {
initable.init_finish(result); initable.init_finish(result);
} catch (e) { } catch(e) {
logError(e, `could not initialize object manager for object ${this._serviceName}`); logError(e, 'could not initialize object manager for object ' + this._serviceName);
this._tryToCompleteLoad(); this._tryToCompleteLoad();
return; return;
@@ -193,7 +197,7 @@ var ObjectManager = class {
this._managerProxy.GetManagedObjectsRemote((result, error) => { this._managerProxy.GetManagedObjectsRemote((result, error) => {
if (!result) { if (!result) {
if (error) { if (error) {
logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`); logError(error, 'could not get remote objects for service ' + this._serviceName + ' path ' + this._managerPath);
} }
this._tryToCompleteLoad(); this._tryToCompleteLoad();

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported parse */
// parse: // parse:
// @params: caller-provided parameter object, or %null // @params: caller-provided parameter object, or %null
@@ -15,13 +14,22 @@
// //
// Return value: a new object, containing the merged parameters from // Return value: a new object, containing the merged parameters from
// @params and @defaults // @params and @defaults
function parse(params = {}, defaults, allowExtras) { function parse(params, defaults, allowExtras) {
if (!allowExtras) { let ret = {}, prop;
for (let prop in params)
if (!(prop in defaults)) if (!params)
throw new Error(`Unrecognized parameter "${prop}"`); params = {};
for (prop in params) {
if (!(prop in defaults) && !allowExtras)
throw new Error('Unrecognized parameter "' + prop + '"');
ret[prop] = params[prop];
} }
let defaultsCopy = Object.assign({}, defaults); for (prop in defaults) {
return Object.assign(defaultsCopy, params); if (!(prop in params))
ret[prop] = defaults[prop];
}
return ret;
} }

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported PermissionStore */
const Gio = imports.gi.Gio; const Gio = imports.gi.Gio;
@@ -13,4 +12,4 @@ function PermissionStore(initCallback, cancellable) {
'org.freedesktop.impl.portal.PermissionStore', 'org.freedesktop.impl.portal.PermissionStore',
'/org/freedesktop/impl/portal/PermissionStore', '/org/freedesktop/impl/portal/PermissionStore',
initCallback, cancellable); initCallback, cancellable);
} };

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported getSmartcardManager */
const Gio = imports.gi.Gio; const Gio = imports.gi.Gio;
const Signals = imports.signals; const Signals = imports.signals;
@@ -30,7 +29,7 @@ var SmartcardManager = class {
this._objectManager = new ObjectManager.ObjectManager({ connection: Gio.DBus.session, this._objectManager = new ObjectManager.ObjectManager({ connection: Gio.DBus.session,
name: "org.gnome.SettingsDaemon.Smartcard", name: "org.gnome.SettingsDaemon.Smartcard",
objectPath: '/org/gnome/SettingsDaemon/Smartcard', objectPath: '/org/gnome/SettingsDaemon/Smartcard',
knownInterfaces: [SmartcardTokenIface], knownInterfaces: [ SmartcardTokenIface ],
onLoaded: this._onLoaded.bind(this) }); onLoaded: this._onLoaded.bind(this) });
this._insertedTokens = {}; this._insertedTokens = {};
this._loginToken = null; this._loginToken = null;

View File

@@ -1,4 +1,3 @@
/* exported getDefault */
const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi; const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi;
const GnomeSession = imports.misc.gnomeSession; const GnomeSession = imports.misc.gnomeSession;
@@ -84,54 +83,48 @@ const SystemActions = GObject.registerClass({
this._canHaveSuspend = true; this._canHaveSuspend = true;
this._actions = new Map(); this._actions = new Map();
this._actions.set(POWER_OFF_ACTION_ID, { this._actions.set(POWER_OFF_ACTION_ID,
// Translators: The name of the power-off action in search { // Translators: The name of the power-off action in search
name: C_("search-result", "Power Off"), name: C_("search-result", "Power Off"),
iconName: 'system-shutdown-symbolic', iconName: 'system-shutdown-symbolic',
// Translators: A list of keywords that match the power-off action, separated by semicolons // Translators: A list of keywords that match the power-off action, separated by semicolons
keywords: _("power off;shutdown;reboot;restart").split(/[; ]/), keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
available: false available: false });
}); this._actions.set(LOCK_SCREEN_ACTION_ID,
this._actions.set(LOCK_SCREEN_ACTION_ID, { { // Translators: The name of the lock screen action in search
// Translators: The name of the lock screen action in search name: C_("search-result", "Lock Screen"),
name: C_("search-result", "Lock Screen"), iconName: 'system-lock-screen-symbolic',
iconName: 'system-lock-screen-symbolic', // Translators: A list of keywords that match the lock screen action, separated by semicolons
// Translators: A list of keywords that match the lock screen action, separated by semicolons keywords: _("lock screen").split(/[; ]/),
keywords: _("lock screen").split(/[; ]/), available: false });
available: false this._actions.set(LOGOUT_ACTION_ID,
}); { // Translators: The name of the logout action in search
this._actions.set(LOGOUT_ACTION_ID, { name: C_("search-result", "Log Out"),
// Translators: The name of the logout action in search iconName: 'application-exit-symbolic',
name: C_("search-result", "Log Out"), // Translators: A list of keywords that match the logout action, separated by semicolons
iconName: 'application-exit-symbolic', keywords: _("logout;log out;sign off").split(/[; ]/),
// Translators: A list of keywords that match the logout action, separated by semicolons available: false });
keywords: _("logout;log out;sign off").split(/[; ]/), this._actions.set(SUSPEND_ACTION_ID,
available: false { // Translators: The name of the suspend action in search
}); name: C_("search-result", "Suspend"),
this._actions.set(SUSPEND_ACTION_ID, { iconName: 'media-playback-pause-symbolic',
// Translators: The name of the suspend action in search // Translators: A list of keywords that match the suspend action, separated by semicolons
name: C_("search-result", "Suspend"), keywords: _("suspend;sleep").split(/[; ]/),
iconName: 'media-playback-pause-symbolic', available: false });
// Translators: A list of keywords that match the suspend action, separated by semicolons this._actions.set(SWITCH_USER_ACTION_ID,
keywords: _("suspend;sleep").split(/[; ]/), { // Translators: The name of the switch user action in search
available: false name: C_("search-result", "Switch User"),
}); iconName: 'system-switch-user-symbolic',
this._actions.set(SWITCH_USER_ACTION_ID, { // Translators: A list of keywords that match the switch user action, separated by semicolons
// Translators: The name of the switch user action in search keywords: _("switch user").split(/[; ]/),
name: C_("search-result", "Switch User"), available: false });
iconName: 'system-switch-user-symbolic', this._actions.set(LOCK_ORIENTATION_ACTION_ID,
// Translators: A list of keywords that match the switch user action, separated by semicolons { // Translators: The name of the lock orientation action in search
keywords: _("switch user").split(/[; ]/), name: C_("search-result", "Lock Orientation"),
available: false iconName: '',
}); // Translators: A list of keywords that match the lock orientation action, separated by semicolons
this._actions.set(LOCK_ORIENTATION_ACTION_ID, { keywords: _("lock orientation;screen;rotation").split(/[; ]/),
// Translators: The name of the lock orientation action in search available: false });
name: C_("search-result", "Lock Orientation"),
iconName: '',
// Translators: A list of keywords that match the lock orientation action, separated by semicolons
keywords: _("lock orientation;screen;rotation").split(/[; ]/),
available: false
});
this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA }); this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA });
this._lockdownSettings = new Gio.Settings({ schema_id: LOCKDOWN_SCHEMA }); this._lockdownSettings = new Gio.Settings({ schema_id: LOCKDOWN_SCHEMA });
@@ -144,96 +137,92 @@ const SystemActions = GObject.registerClass({
this._userManager = AccountsService.UserManager.get_default(); this._userManager = AccountsService.UserManager.get_default();
this._userManager.connect('notify::is-loaded', this._userManager.connect('notify::is-loaded',
() => this._updateMultiUser()); () => { this._updateMultiUser(); });
this._userManager.connect('notify::has-multiple-users', this._userManager.connect('notify::has-multiple-users',
() => this._updateMultiUser()); () => { this._updateMultiUser(); });
this._userManager.connect('user-added', this._userManager.connect('user-added',
() => this._updateMultiUser()); () => { this._updateMultiUser(); });
this._userManager.connect('user-removed', this._userManager.connect('user-removed',
() => this._updateMultiUser()); () => { this._updateMultiUser(); });
this._lockdownSettings.connect(`changed::${DISABLE_USER_SWITCH_KEY}`, this._lockdownSettings.connect('changed::' + DISABLE_USER_SWITCH_KEY,
() => this._updateSwitchUser()); () => { this._updateSwitchUser(); });
this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`, this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY,
() => this._updateLogout()); () => { this._updateLogout(); });
global.settings.connect(`changed::${ALWAYS_SHOW_LOG_OUT_KEY}`, global.settings.connect('changed::' + ALWAYS_SHOW_LOG_OUT_KEY,
() => this._updateLogout()); () => { this._updateLogout(); });
this._lockdownSettings.connect(`changed::${DISABLE_LOCK_SCREEN_KEY}`, this._lockdownSettings.connect('changed::' + DISABLE_LOCK_SCREEN_KEY,
() => this._updateLockScreen()); () => { this._updateLockScreen(); });
this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`, this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY,
() => this._updateHaveShutdown()); () => { this._updateHaveShutdown(); });
this.forceUpdate(); this.forceUpdate();
this._orientationSettings.connect('changed::orientation-lock', this._orientationSettings.connect('changed::orientation-lock',
() => { () => { this._updateOrientationLock();
this._updateOrientationLock(); this._updateOrientationLockIcon(); });
this._updateOrientationLockIcon();
});
Main.layoutManager.connect('monitors-changed', Main.layoutManager.connect('monitors-changed',
() => this._updateOrientationLock()); () => { this._updateOrientationLock(); });
this._sensorProxy = new SensorProxy(Gio.DBus.system, Gio.DBus.system.watch_name(SENSOR_BUS_NAME,
SENSOR_BUS_NAME, Gio.BusNameWatcherFlags.NONE,
SENSOR_OBJECT_PATH, () => { this._sensorProxyAppeared(); },
(proxy, error) => { () => {
if (error) this._sensorProxy = null;
log(error.message); this._updateOrientationLock();
}, });
null,
Gio.DBusProxyFlags.DO_NOT_AUTO_START);
this._sensorProxy.connect('g-properties-changed', () => {
this._updateOrientationLock();
});
this._sensorProxy.connect('notify::g-name-owner', () => {
this._updateOrientationLock();
});
this._updateOrientationLock(); this._updateOrientationLock();
this._updateOrientationLockIcon(); this._updateOrientationLockIcon();
Main.sessionMode.connect('updated', () => this._sessionUpdated()); Main.sessionMode.connect('updated', () => { this._sessionUpdated(); });
this._sessionUpdated(); this._sessionUpdated();
} }
// eslint-disable-next-line camelcase
get can_power_off() { get can_power_off() {
return this._actions.get(POWER_OFF_ACTION_ID).available; return this._actions.get(POWER_OFF_ACTION_ID).available;
} }
// eslint-disable-next-line camelcase
get can_suspend() { get can_suspend() {
return this._actions.get(SUSPEND_ACTION_ID).available; return this._actions.get(SUSPEND_ACTION_ID).available;
} }
// eslint-disable-next-line camelcase
get can_lock_screen() { get can_lock_screen() {
return this._actions.get(LOCK_SCREEN_ACTION_ID).available; return this._actions.get(LOCK_SCREEN_ACTION_ID).available;
} }
// eslint-disable-next-line camelcase
get can_switch_user() { get can_switch_user() {
return this._actions.get(SWITCH_USER_ACTION_ID).available; return this._actions.get(SWITCH_USER_ACTION_ID).available;
} }
// eslint-disable-next-line camelcase
get can_logout() { get can_logout() {
return this._actions.get(LOGOUT_ACTION_ID).available; return this._actions.get(LOGOUT_ACTION_ID).available;
} }
// eslint-disable-next-line camelcase
get can_lock_orientation() { get can_lock_orientation() {
return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available; return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available;
} }
// eslint-disable-next-line camelcase
get orientation_lock_icon() { get orientation_lock_icon() {
return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName; return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName;
} }
_sensorProxyAppeared() {
this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH,
(proxy, error) => {
if (error) {
log(error.message);
return;
}
this._sensorProxy.connect('g-properties-changed',
() => { this._updateOrientationLock(); });
this._updateOrientationLock();
});
}
_updateOrientationLock() { _updateOrientationLock() {
let available = false; let available = false;
if (this._sensorProxy.g_name_owner) if (this._sensorProxy)
available = this._sensorProxy.HasAccelerometer && available = this._sensorProxy.HasAccelerometer &&
this._monitorManager.get_is_builtin_display_on(); this._monitorManager.get_is_builtin_display_on();
@@ -244,9 +233,8 @@ const SystemActions = GObject.registerClass({
_updateOrientationLockIcon() { _updateOrientationLockIcon() {
let locked = this._orientationSettings.get_boolean('orientation-lock'); let locked = this._orientationSettings.get_boolean('orientation-lock');
let iconName = locked let iconName = locked ? 'rotation-locked-symbolic'
? 'rotation-locked-symbolic' : 'rotation-allowed-symbolic';
: 'rotation-allowed-symbolic';
this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName = iconName; this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName = iconName;
this.notify('orientation-lock-icon'); this.notify('orientation-lock-icon');
@@ -269,11 +257,11 @@ const SystemActions = GObject.registerClass({
getMatchingActions(terms) { getMatchingActions(terms) {
// terms is a list of strings // terms is a list of strings
terms = terms.map(term => term.toLowerCase()); terms = terms.map((term) => { return term.toLowerCase(); });
let results = []; let results = [];
for (let [key, { available, keywords }] of this._actions) for (let [key, {available, keywords}] of this._actions)
if (available && terms.every(t => keywords.some(k => k.startsWith(t)))) if (available && terms.every(t => keywords.some(k => k.startsWith(t))))
results.push(key); results.push(key);
@@ -290,24 +278,24 @@ const SystemActions = GObject.registerClass({
activateAction(id) { activateAction(id) {
switch (id) { switch (id) {
case POWER_OFF_ACTION_ID: case POWER_OFF_ACTION_ID:
this.activatePowerOff(); this.activatePowerOff();
break; break;
case LOCK_SCREEN_ACTION_ID: case LOCK_SCREEN_ACTION_ID:
this.activateLockScreen(); this.activateLockScreen();
break; break;
case LOGOUT_ACTION_ID: case LOGOUT_ACTION_ID:
this.activateLogout(); this.activateLogout();
break; break;
case SUSPEND_ACTION_ID: case SUSPEND_ACTION_ID:
this.activateSuspend(); this.activateSuspend();
break; break;
case SWITCH_USER_ACTION_ID: case SWITCH_USER_ACTION_ID:
this.activateSwitchUser(); this.activateSwitchUser();
break; break;
case LOCK_ORIENTATION_ACTION_ID: case LOCK_ORIENTATION_ACTION_ID:
this.activateLockOrientation(); this.activateLockOrientation();
break; break;
} }
} }

View File

@@ -1,23 +1,23 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
formatTime, formatTimeSpan, createTimeLabel, insertSorted,
makeCloseButton, ensureActorVisibleInScrollView */
const { Clutter, Gio, GLib, GObject, Shell, St, GnomeDesktop } = imports.gi; const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
const Gettext = imports.gettext; const Gettext = imports.gettext;
const Mainloop = imports.mainloop;
const Signals = imports.signals;
const Main = imports.ui.main; const Main = imports.ui.main;
const Tweener = imports.ui.tweener;
const Params = imports.misc.params; const Params = imports.misc.params;
var SCROLL_TIME = 100; var SCROLL_TIME = 0.1;
// http://daringfireball.net/2010/07/improved_regex_for_matching_urls // http://daringfireball.net/2010/07/improved_regex_for_matching_urls
const _balancedParens = '\\([^\\s()<>]+\\)'; const _balancedParens = '\\([^\\s()<>]+\\)';
const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]'; const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]';
const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u200E\u200F\u201C\u201D\u2018\u2019\u202A\u202C]'; const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u201C\u201D\u2018\u2019]';
const _urlRegexp = new RegExp( const _urlRegexp = new RegExp(
`(^|${_leadingJunk})` + '(^|' + _leadingJunk + ')' +
'(' + '(' +
'(?:' + '(?:' +
'(?:http|https|ftp)://' + // scheme:// '(?:http|https|ftp)://' + // scheme://
@@ -29,12 +29,12 @@ const _urlRegexp = new RegExp(
'(?:' + // one or more: '(?:' + // one or more:
'[^\\s()<>]+' + // run of non-space non-() '[^\\s()<>]+' + // run of non-space non-()
'|' + // or '|' + // or
`${_balancedParens}` + // balanced parens _balancedParens + // balanced parens
')+' + ')+' +
'(?:' + // end with: '(?:' + // end with:
`${_balancedParens}` + // balanced parens _balancedParens + // balanced parens
'|' + // or '|' + // or
`${_notTrailingJunk}` + // last non-junk char _notTrailingJunk + // last non-junk char
')' + ')' +
')', 'gi'); ')', 'gi');
@@ -69,16 +69,16 @@ function spawn(argv) {
} }
// spawnCommandLine: // spawnCommandLine:
// @commandLine: a command line // @command_line: a command line
// //
// Runs @commandLine in the background, handling any errors that // Runs @command_line in the background, handling any errors that
// occur when trying to parse or start the program. // occur when trying to parse or start the program.
function spawnCommandLine(commandLine) { function spawnCommandLine(command_line) {
try { try {
let [success_, argv] = GLib.shell_parse_argv(commandLine); let [success, argv] = GLib.shell_parse_argv(command_line);
trySpawn(argv); trySpawn(argv);
} catch (err) { } catch (err) {
_handleSpawnError(commandLine, err); _handleSpawnError(command_line, err);
} }
} }
@@ -93,7 +93,7 @@ function spawnApp(argv) {
let context = global.create_app_launch_context(0, -1); let context = global.create_app_launch_context(0, -1);
app.launch([], context); app.launch([], context);
} catch (err) { } catch(err) {
_handleSpawnError(argv[0], err); _handleSpawnError(argv[0], err);
} }
} }
@@ -103,12 +103,13 @@ function spawnApp(argv) {
// //
// Runs @argv in the background. If launching @argv fails, // Runs @argv in the background. If launching @argv fails,
// this will throw an error. // this will throw an error.
function trySpawn(argv) { function trySpawn(argv)
var success_, pid; {
var success, pid;
try { try {
[success_, pid] = GLib.spawn_async(null, argv, null, [success, pid] = GLib.spawn_async(null, argv, null,
GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD, GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
null); null);
} catch (err) { } catch (err) {
/* Rewrite the error in case of ENOENT */ /* Rewrite the error in case of ENOENT */
if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) { if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) {
@@ -127,14 +128,6 @@ function trySpawn(argv) {
throw err; throw err;
} }
} }
// Async call, we don't need the reply though
try {
GnomeDesktop.start_systemd_scope(argv[0], pid, null, null, null, () => {});
} catch (err) {
// Ignore error; it likely means GnomeDesktop is too old
}
// Dummy child watch; we don't want to double-fork internally // Dummy child watch; we don't want to double-fork internally
// because then we lose the parent-child relationship, which // because then we lose the parent-child relationship, which
// can break polkit. See https://bugzilla.redhat.com//show_bug.cgi?id=819275 // can break polkit. See https://bugzilla.redhat.com//show_bug.cgi?id=819275
@@ -142,19 +135,19 @@ function trySpawn(argv) {
} }
// trySpawnCommandLine: // trySpawnCommandLine:
// @commandLine: a command line // @command_line: a command line
// //
// Runs @commandLine in the background. If launching @commandLine // Runs @command_line in the background. If launching @command_line
// fails, this will throw an error. // fails, this will throw an error.
function trySpawnCommandLine(commandLine) { function trySpawnCommandLine(command_line) {
let success_, argv; let success, argv;
try { try {
[success_, argv] = GLib.shell_parse_argv(commandLine); [success, argv] = GLib.shell_parse_argv(command_line);
} catch (err) { } catch (err) {
// Replace "Error invoking GLib.shell_parse_argv: " with // Replace "Error invoking GLib.shell_parse_argv: " with
// something nicer // something nicer
err.message = err.message.replace(/[^:]*: /, `${_("Could not parse command:")}\n`); err.message = err.message.replace(/[^:]*: /, _("Could not parse command:") + "\n");
throw err; throw err;
} }
@@ -229,7 +222,7 @@ function formatTime(time, params) {
/* Translators: Time in 24h format */ /* Translators: Time in 24h format */
format = N_("%H\u2236%M"); format = N_("%H\u2236%M");
// Show the word "Yesterday" and time if date is on yesterday // Show the word "Yesterday" and time if date is on yesterday
else if (daysAgo < 2) else if (daysAgo <2)
/* Translators: this is the word "Yesterday" followed by a /* Translators: this is the word "Yesterday" followed by a
time string in 24h format. i.e. "Yesterday, 14:30" */ time string in 24h format. i.e. "Yesterday, 14:30" */
// xgettext:no-c-format // xgettext:no-c-format
@@ -258,7 +251,7 @@ function formatTime(time, params) {
/* Translators: Time in 12h format */ /* Translators: Time in 12h format */
format = N_("%l\u2236%M %p"); format = N_("%l\u2236%M %p");
// Show the word "Yesterday" and time if date is on yesterday // Show the word "Yesterday" and time if date is on yesterday
else if (daysAgo < 2) else if (daysAgo <2)
/* Translators: this is the word "Yesterday" followed by a /* Translators: this is the word "Yesterday" followed by a
time string in 12h format. i.e. "Yesterday, 2:30 pm" */ time string in 12h format. i.e. "Yesterday, 2:30 pm" */
// xgettext:no-c-format // xgettext:no-c-format
@@ -296,7 +289,7 @@ function createTimeLabel(date, params) {
let id = _desktopSettings.connect('changed::clock-format', () => { let id = _desktopSettings.connect('changed::clock-format', () => {
label.text = formatTime(date, params); label.text = formatTime(date, params);
}); });
label.connect('destroy', () => _desktopSettings.disconnect(id)); label.connect('destroy', () => { _desktopSettings.disconnect(id); });
return label; return label;
} }
@@ -321,8 +314,7 @@ function lowerBound(array, val, cmp) {
if (array.length == 0) if (array.length == 0)
return 0; return 0;
min = 0; min = 0; max = array.length;
max = array.length;
while (min < (max - 1)) { while (min < (max - 1)) {
mid = Math.floor((min + max) / 2); mid = Math.floor((min + max) / 2);
v = cmp(array[mid], val); v = cmp(array[mid], val);
@@ -354,7 +346,7 @@ function insertSorted(array, val, cmp) {
var CloseButton = GObject.registerClass( var CloseButton = GObject.registerClass(
class CloseButton extends St.Button { class CloseButton extends St.Button {
_init(boxpointer) { _init(boxpointer) {
super._init({ style_class: 'notification-close' }); super._init({ style_class: 'notification-close'});
// This is a bit tricky. St.Bin has its own x-align/y-align properties // This is a bit tricky. St.Bin has its own x-align/y-align properties
// that compete with Clutter's properties. This should be fixed for // that compete with Clutter's properties. This should be fixed for
@@ -388,7 +380,7 @@ class CloseButton extends St.Button {
let themeNode = this.get_theme_node(); let themeNode = this.get_theme_node();
let offY = this._computeBoxPointerOffset(); let offY = this._computeBoxPointerOffset();
this.translation_x = themeNode.get_length('-shell-close-overlap-x'); this.translation_x = themeNode.get_length('-shell-close-overlap-x')
this.translation_y = themeNode.get_length('-shell-close-overlap-y') + offY; this.translation_y = themeNode.get_length('-shell-close-overlap-y') + offY;
} }
@@ -404,7 +396,7 @@ function makeCloseButton(boxpointer) {
function ensureActorVisibleInScrollView(scrollView, actor) { function ensureActorVisibleInScrollView(scrollView, actor) {
let adjustment = scrollView.vscroll.adjustment; let adjustment = scrollView.vscroll.adjustment;
let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values(); let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values();
let offset = 0; let offset = 0;
let vfade = scrollView.get_effect("fade"); let vfade = scrollView.get_effect("fade");
@@ -432,8 +424,97 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
else else
return; return;
adjustment.ease(value, { Tweener.addTween(adjustment,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, { value: value,
duration: SCROLL_TIME time: SCROLL_TIME,
}); transition: 'easeOutQuad' });
} }
var AppSettingsMonitor = class {
constructor(appId, schemaId) {
this._appId = appId;
this._schemaId = schemaId;
this._app = null;
this._settings = null;
this._handlers = [];
this._schemaSource = Gio.SettingsSchemaSource.get_default();
this._appSystem = Shell.AppSystem.get_default();
this._appSystem.connect('installed-changed',
this._onInstalledChanged.bind(this));
this._onInstalledChanged();
}
get available() {
return this._app != null && this._settings != null;
}
activateApp() {
if (this._app)
this._app.activate();
}
watchSetting(key, callback) {
let handler = { id: 0, key: key, callback: callback };
this._handlers.push(handler);
this._connectHandler(handler);
}
_connectHandler(handler) {
if (!this._settings || handler.id > 0)
return;
handler.id = this._settings.connect('changed::' + handler.key,
handler.callback);
handler.callback(this._settings, handler.key);
}
_disconnectHandler(handler) {
if (this._settings && handler.id > 0)
this._settings.disconnect(handler.id);
handler.id = 0;
}
_onInstalledChanged() {
let hadApp = (this._app != null);
this._app = this._appSystem.lookup_app(this._appId);
let haveApp = (this._app != null);
if (hadApp == haveApp)
return;
if (haveApp)
this._checkSettings();
else
this._setSettings(null);
}
_setSettings(settings) {
this._handlers.forEach((handler) => { this._disconnectHandler(handler); });
let hadSettings = (this._settings != null);
this._settings = settings;
let haveSettings = (this._settings != null);
this._handlers.forEach((handler) => { this._connectHandler(handler); });
if (hadSettings != haveSettings)
this.emit('available-changed');
}
_checkSettings() {
let schema = this._schemaSource.lookup(this._schemaId, true);
if (schema) {
this._setSettings(new Gio.Settings({ settings_schema: schema }));
} else if (this._app) {
Mainloop.timeout_add_seconds(1, () => {
this._checkSettings();
return GLib.SOURCE_REMOVE;
});
}
}
};
Signals.addSignalMethods(AppSettingsMonitor.prototype);

View File

@@ -1,19 +1,10 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi; const { Geoclue, Gio, GLib, GWeather } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
const PermissionStore = imports.misc.permissionStore; const PermissionStore = imports.misc.permissionStore;
const Util = imports.misc.util;
const { loadInterfaceXML } = imports.misc.fileUtils;
const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration');
const WEATHER_BUS_NAME = 'org.gnome.Weather';
const WEATHER_OBJECT_PATH = '/org/gnome/Weather';
const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration';
const WEATHER_APP_ID = 'org.gnome.Weather.desktop';
// Minimum time between updates to show loading indication // Minimum time between updates to show loading indication
var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE; var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE;
@@ -32,11 +23,10 @@ var WeatherClient = class {
this._gclueStarting = false; this._gclueStarting = false;
this._gclueLocationChangedId = 0; this._gclueLocationChangedId = 0;
this._needsAuth = true;
this._weatherAuthorized = false; this._weatherAuthorized = false;
this._permStore = new PermissionStore.PermissionStore((proxy, error) => { this._permStore = new PermissionStore.PermissionStore((proxy, error) => {
if (error) { if (error) {
log(`Failed to connect to permissionStore: ${error.message}`); log('Failed to connect to permissionStore: ' + error.message);
return; return;
} }
@@ -50,7 +40,7 @@ var WeatherClient = class {
this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => { this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => {
if (error) if (error)
log(`Error looking up permission: ${error.message}`); log('Error looking up permission: ' + error.message);
let [perms, data] = error ? [{}, null] : res; let [perms, data] = error ? [{}, null] : res;
let params = ['gnome', 'geolocation', false, data, perms]; let params = ['gnome', 'geolocation', false, data, perms];
@@ -76,38 +66,17 @@ var WeatherClient = class {
this.emit('changed'); this.emit('changed');
}); });
this._weatherApp = null; this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop',
this._weatherProxy = null; 'org.gnome.Weather');
this._weatherAppMon.connect('available-changed', () => { this.emit('changed'); });
let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface); this._weatherAppMon.watchSetting('automatic-location',
Gio.DBusProxy.new( this._onAutomaticLocationChanged.bind(this));
Gio.DBus.session, this._weatherAppMon.watchSetting('locations',
Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES, this._onLocationsChanged.bind(this));
nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE),
WEATHER_BUS_NAME,
WEATHER_OBJECT_PATH,
WEATHER_INTEGRATION_IFACE,
null,
this._onWeatherProxyReady.bind(this));
this._settings = new Gio.Settings({
schema_id: 'org.gnome.shell.weather'
});
this._settings.connect('changed::automatic-location',
this._onAutomaticLocationChanged.bind(this));
this._onAutomaticLocationChanged();
this._settings.connect('changed::locations',
this._onLocationsChanged.bind(this));
this._onLocationsChanged();
this._appSystem = Shell.AppSystem.get_default();
this._appSystem.connect('installed-changed',
this._onInstalledChanged.bind(this));
this._onInstalledChanged();
} }
get available() { get available() {
return this._weatherApp != null; return this._weatherAppMon.available;
} }
get loading() { get loading() {
@@ -123,8 +92,7 @@ var WeatherClient = class {
} }
activateApp() { activateApp() {
if (this._weatherApp) this._weatherAppMon.activateApp();
this._weatherApp.activate();
} }
update() { update() {
@@ -143,46 +111,7 @@ var WeatherClient = class {
get _useAutoLocation() { get _useAutoLocation() {
return this._autoLocationRequested && return this._autoLocationRequested &&
this._locationSettings.get_boolean('enabled') && this._locationSettings.get_boolean('enabled') &&
(!this._needsAuth || this._weatherAuthorized); this._weatherAuthorized;
}
_onWeatherProxyReady(o, res) {
try {
this._weatherProxy = Gio.DBusProxy.new_finish(res);
} catch (e) {
log(`Failed to create GNOME Weather proxy: ${e}`);
return;
}
this._weatherProxy.connect('g-properties-changed',
this._onWeatherPropertiesChanged.bind(this));
this._onWeatherPropertiesChanged();
}
_onWeatherPropertiesChanged() {
if (this._weatherProxy.g_name_owner == null)
return;
this._settings.set_boolean('automatic-location',
this._weatherProxy.AutomaticLocation);
this._settings.set_value('locations',
new GLib.Variant('av', this._weatherProxy.Locations));
}
_onInstalledChanged() {
let hadApp = (this._weatherApp != null);
this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
let haveApp = (this._weatherApp != null);
if (hadApp !== haveApp)
this.emit('changed');
let neededAuth = this._needsAuth;
this._needsAuth = this._weatherApp === null ||
this._weatherApp.app_info.has_key('X-Flatpak');
if (neededAuth !== this._needsAuth)
this._updateAutoLocation();
} }
_loadInfo() { _loadInfo() {
@@ -249,8 +178,8 @@ var WeatherClient = class {
(o, res) => { (o, res) => {
try { try {
this._gclueService = Geoclue.Simple.new_finish(res); this._gclueService = Geoclue.Simple.new_finish(res);
} catch (e) { } catch(e) {
log(`Failed to connect to Geoclue2 service: ${e.message}`); log('Failed to connect to Geoclue2 service: ' + e.message);
this._setLocation(this._mostRecentLocation); this._setLocation(this._mostRecentLocation);
return; return;
} }
@@ -269,8 +198,8 @@ var WeatherClient = class {
this._setLocation(location); this._setLocation(location);
} }
_onAutomaticLocationChanged() { _onAutomaticLocationChanged(settings, key) {
let useAutoLocation = this._settings.get_boolean('automatic-location'); let useAutoLocation = settings.get_boolean(key);
if (this._autoLocationRequested == useAutoLocation) if (this._autoLocationRequested == useAutoLocation)
return; return;
@@ -288,9 +217,8 @@ var WeatherClient = class {
this._setLocation(this._mostRecentLocation); this._setLocation(this._mostRecentLocation);
} }
_onLocationsChanged() { _onLocationsChanged(settings, key) {
let locations = this._settings.get_value('locations').deep_unpack(); let serialized = settings.get_value(key).deep_unpack().shift();
let serialized = locations.shift();
let mostRecentLocation = null; let mostRecentLocation = null;
if (serialized) if (serialized)
@@ -306,7 +234,7 @@ var WeatherClient = class {
} }
_onPermStoreChanged(proxy, sender, params) { _onPermStoreChanged(proxy, sender, params) {
let [table, id, deleted_, data_, perms] = params; let [table, id, deleted, data, perms] = params;
if (table != 'gnome' || id != 'geolocation') if (table != 'gnome' || id != 'geolocation')
return; return;

View File

@@ -1,9 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported run, script_overviewShowStart, script_overviewShowDone,
script_applicationsShowStart, script_applicationsShowDone,
script_afterShowHide, malloc_usedSize, glx_swapComplete,
clutter_stagePaintDone */
/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */
const System = imports.system; const System = imports.system;
@@ -24,7 +19,7 @@ var METRICS = {
units: "frames / s" }, units: "frames / s" },
overviewLatencySubsequent: overviewLatencySubsequent:
{ description: "Time to first frame after triggering overview, second time", { description: "Time to first frame after triggering overview, second time",
units: "us" }, units: "us"},
overviewFpsSubsequent: overviewFpsSubsequent:
{ description: "Frames rate when going to the overview, second time", { description: "Frames rate when going to the overview, second time",
units: "frames / s" }, units: "frames / s" },
@@ -57,7 +52,7 @@ var METRICS = {
units: "us" }, units: "us" },
applicationsShowTimeSubsequent: applicationsShowTimeSubsequent:
{ description: "Time to switch to applications view, second time", { description: "Time to switch to applications view, second time",
units: "us" } units: "us"}
}; };
let WINDOW_CONFIGS = [ let WINDOW_CONFIGS = [
@@ -126,11 +121,9 @@ function *run() {
for (let i = 0; i < 2; i++) { for (let i = 0; i < 2; i++) {
Scripting.scriptEvent('applicationsShowStart'); Scripting.scriptEvent('applicationsShowStart');
// eslint-disable-next-line require-atomic-updates
Main.overview._dash.showAppsButton.checked = true; Main.overview._dash.showAppsButton.checked = true;
yield Scripting.waitLeisure(); yield Scripting.waitLeisure();
Scripting.scriptEvent('applicationsShowDone'); Scripting.scriptEvent('applicationsShowDone');
// eslint-disable-next-line require-atomic-updates
Main.overview._dash.showAppsButton.checked = false; Main.overview._dash.showAppsButton.checked = false;
yield Scripting.waitLeisure(); yield Scripting.waitLeisure();
} }
@@ -143,6 +136,7 @@ let overviewFrames;
let overviewLatency; let overviewLatency;
let mallocUsedSize = 0; let mallocUsedSize = 0;
let overviewShowCount = 0; let overviewShowCount = 0;
let firstOverviewUsedSize;
let haveSwapComplete = false; let haveSwapComplete = false;
let applicationsShowStart; let applicationsShowStart;
let applicationsShowCount = 0; let applicationsShowCount = 0;
@@ -154,7 +148,7 @@ function script_overviewShowStart(time) {
overviewFrames = 0; overviewFrames = 0;
} }
function script_overviewShowDone(_time) { function script_overviewShowDone(time) {
// We've set up the state at the end of the zoom out, but we // We've set up the state at the end of the zoom out, but we
// need to wait for one more frame to paint before we count // need to wait for one more frame to paint before we count
// ourselves as done. // ourselves as done.
@@ -173,7 +167,7 @@ function script_applicationsShowDone(time) {
METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart; METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart;
} }
function script_afterShowHide(_time) { function script_afterShowHide(time) {
if (overviewShowCount == 1) { if (overviewShowCount == 1) {
METRICS.usedAfterOverview.value = mallocUsedSize; METRICS.usedAfterOverview.value = mallocUsedSize;
} else { } else {

View File

@@ -1,12 +1,3 @@
/* exported run, script_desktopShown, script_overviewShowStart,
script_overviewShowDone, script_applicationsShowStart,
script_applicationsShowDone, script_mainViewDrawStart,
script_mainViewDrawDone, script_overviewDrawStart,
script_overviewDrawDone, script_redrawTestStart,
script_redrawTestDone, script_collectTimings,
script_geditLaunch, script_geditFirstFrame,
clutter_stagePaintStart, clutter_paintCompletedTimestamp */
/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */
const { Clutter, Gio, Shell } = imports.gi; const { Clutter, Gio, Shell } = imports.gi;
const Main = imports.ui.main; const Main = imports.ui.main;
const Scripting = imports.ui.scripting; const Scripting = imports.ui.scripting;
@@ -39,7 +30,7 @@ var METRICS = {
geditStartTime: geditStartTime:
{ description: "Time from gedit launch to window drawn", { description: "Time from gedit launch to window drawn",
units: "us" }, units: "us" },
}; }
function waitAndDraw(milliseconds) { function waitAndDraw(milliseconds) {
let cb; let cb;
@@ -47,7 +38,7 @@ function waitAndDraw(milliseconds) {
let timeline = new Clutter.Timeline({ duration: milliseconds }); let timeline = new Clutter.Timeline({ duration: milliseconds });
timeline.start(); timeline.start();
timeline.connect('new-frame', (_timeline, _frame) => { timeline.connect('new-frame', (timeline, frame) => {
global.stage.queue_redraw(); global.stage.queue_redraw();
}); });
@@ -57,7 +48,7 @@ function waitAndDraw(milliseconds) {
cb(); cb();
}); });
return callback => (cb = callback); return callback => { cb = callback; };
} }
function waitSignal(object, signal) { function waitSignal(object, signal) {
@@ -69,7 +60,7 @@ function waitSignal(object, signal) {
cb(); cb();
}); });
return callback => (cb = callback); return callback => { cb = callback; };
} }
function extractBootTimestamp() { function extractBootTimestamp() {
@@ -82,8 +73,8 @@ function extractBootTimestamp() {
let result = null; let result = null;
let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe()); let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe());
while (true) { // eslint-disable-line no-constant-condition while (true) {
let [line, length_] = datastream.read_line_utf8(null); let [line, length] = datastream.read_line_utf8(null);
if (line === null) if (line === null)
break; break;
@@ -126,7 +117,6 @@ function *run() {
yield Scripting.sleep(1000); yield Scripting.sleep(1000);
Scripting.scriptEvent('applicationsShowStart'); Scripting.scriptEvent('applicationsShowStart');
// eslint-disable-next-line require-atomic-updates
Main.overview._dash.showAppsButton.checked = true; Main.overview._dash.showAppsButton.checked = true;
yield Scripting.waitLeisure(); yield Scripting.waitLeisure();
@@ -137,9 +127,9 @@ function *run() {
Main.overview.hide(); Main.overview.hide();
yield Scripting.waitLeisure(); yield Scripting.waitLeisure();
// --------------------- // ////////////////////////////////////////
// Tests of redraw speed // // Tests of redraw speed
// --------------------- // ////////////////////////////////////////
global.frame_timestamps = true; global.frame_timestamps = true;
global.frame_finish_timestamp = true; global.frame_finish_timestamp = true;
@@ -167,7 +157,7 @@ function *run() {
Main.overview.hide(); Main.overview.hide();
yield Scripting.createTestWindow({ maximized: true, yield Scripting.createTestWindow({ maximized: true,
redraws: true }); redraws: true});
yield Scripting.waitTestWindows(); yield Scripting.waitTestWindows();
yield Scripting.sleep(1000); yield Scripting.sleep(1000);
@@ -186,6 +176,8 @@ function *run() {
yield Scripting.sleep(1000); yield Scripting.sleep(1000);
////////////////////////////////////////
let appSys = Shell.AppSystem.get_default(); let appSys = Shell.AppSystem.get_default();
let app = appSys.lookup_app('org.gnome.gedit.desktop'); let app = appSys.lookup_app('org.gnome.gedit.desktop');
@@ -242,31 +234,31 @@ function script_applicationsShowDone(time) {
METRICS.applicationsShowTime.value = time - applicationsShowStart; METRICS.applicationsShowTime.value = time - applicationsShowStart;
} }
function script_mainViewDrawStart(_time) { function script_mainViewDrawStart(time) {
redrawTiming = 'mainView'; redrawTiming = 'mainView';
} }
function script_mainViewDrawDone(_time) { function script_mainViewDrawDone(time) {
redrawTiming = null; redrawTiming = null;
} }
function script_overviewDrawStart(_time) { function script_overviewDrawStart(time) {
redrawTiming = 'overview'; redrawTiming = 'overview';
} }
function script_overviewDrawDone(_time) { function script_overviewDrawDone(time) {
redrawTiming = null; redrawTiming = null;
} }
function script_redrawTestStart(_time) { function script_redrawTestStart(time) {
redrawTiming = 'application'; redrawTiming = 'application';
} }
function script_redrawTestDone(_time) { function script_redrawTestDone(time) {
redrawTiming = null; redrawTiming = null;
} }
function script_collectTimings(_time) { function script_collectTimings(time) {
for (let timing in redrawTimes) { for (let timing in redrawTimes) {
let times = redrawTimes[timing]; let times = redrawTimes[timing];
times.sort((a, b) => a - b); times.sort((a, b) => a - b);
@@ -277,11 +269,11 @@ function script_collectTimings(_time) {
if (len == 0) if (len == 0)
median = -1; median = -1;
else if (len % 2 == 1) else if (len % 2 == 1)
median = times[(len - 1) / 2]; median = times[(len - 1)/ 2];
else else
median = Math.round((times[len / 2 - 1] + times[len / 2]) / 2); median = Math.round((times[len / 2 - 1] + times[len / 2]) / 2);
METRICS[`${timing}RedrawTime`].value = median; METRICS[timing + 'RedrawTime'].value = median;
} }
} }

View File

@@ -1,4 +1,3 @@
/* exported main */
const Format = imports.format; const Format = imports.format;
const Gettext = imports.gettext; const Gettext = imports.gettext;
const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi; const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi;
@@ -20,6 +19,7 @@ const PortalHelperSecurityLevel = {
INSECURE: 2 INSECURE: 2
}; };
const INACTIVITY_TIMEOUT = 30000; //ms
const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org'; const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org';
const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST; const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST;
const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC; const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC;
@@ -59,7 +59,7 @@ class PortalHeaderBar extends Gtk.HeaderBar {
single_line_mode: true, single_line_mode: true,
ellipsize: Pango.EllipsizeMode.END, ellipsize: Pango.EllipsizeMode.END,
valign: Gtk.Align.BASELINE, valign: Gtk.Align.BASELINE,
selectable: true }); selectable: true});
this.subtitleLabel.get_style_context().add_class('subtitle'); this.subtitleLabel.get_style_context().add_class('subtitle');
hbox.add(this.subtitleLabel); hbox.add(this.subtitleLabel);
@@ -152,7 +152,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
this._webView.load_uri(this._originalUrl); this._webView.load_uri(this._originalUrl);
} }
vfunc_delete_event(_event) { vfunc_delete_event(event) {
if (this._recheckAtExit) if (this._recheckAtExit)
this._doneCallback(PortalHelperResult.RECHECK); this._doneCallback(PortalHelperResult.RECHECK);
else else
@@ -178,7 +178,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE); this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
} }
_onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) { _onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) {
this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE); this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
let uri = new Soup.URI(failingURI); let uri = new Soup.URI(failingURI);
this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host()); this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host());
@@ -265,7 +265,7 @@ class WebPortalHelper extends Gtk.Application {
this._queue = []; this._queue = [];
let action = new Gio.SimpleAction({ name: 'quit' }); let action = new Gio.SimpleAction({ name: 'quit' });
action.connect('activate', () => this.active_window.destroyWindow()); action.connect('activate', () => { this.active_window.destroyWindow(); });
this.add_action(action); this.add_action(action);
} }

View File

@@ -1,4 +1,3 @@
/* exported AccessDialogDBus */
const { Clutter, Gio, GLib, GObject, Shell } = imports.gi; const { Clutter, Gio, GLib, GObject, Shell } = imports.gi;
const CheckBox = imports.ui.checkBox; const CheckBox = imports.ui.checkBox;
@@ -70,7 +69,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
this.addButton({ label: grantLabel, this.addButton({ label: grantLabel,
action: () => { action: () => {
this._sendResponse(DialogResponse.OK); this._sendResponse(DialogResponse.OK);
} }); }});
} }
open() { open() {
@@ -80,7 +79,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
this._requestExported = this._request.export(connection, this._handle); this._requestExported = this._request.export(connection, this._handle);
} }
CloseAsync(invocation, _params) { CloseAsync(invocation, params) {
if (this._invocation.get_sender() != invocation.get_sender()) { if (this._invocation.get_sender() != invocation.get_sender()) {
invocation.return_error_literal(Gio.DBusError, invocation.return_error_literal(Gio.DBusError,
Gio.DBusError.ACCESS_DENIED, Gio.DBusError.ACCESS_DENIED,
@@ -133,10 +132,10 @@ var AccessDialogDBus = class {
return; return;
} }
let [handle, appId, parentWindow_, title, subtitle, body, options] = params; let [handle, appId, parentWindow, title, subtitle, body, options] = params;
// We probably want to use parentWindow and global.display.focus_window // We probably want to use parentWindow and global.display.focus_window
// for this check in the future // for this check in the future
if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) { if (appId && appId + '.desktop' != this._windowTracker.focus_app.id) {
invocation.return_error_literal(Gio.DBusError, invocation.return_error_literal(Gio.DBusError,
Gio.DBusError.ACCESS_DENIED, Gio.DBusError.ACCESS_DENIED,
'Only the focused app is allowed to show a system access dialog'); 'Only the focused app is allowed to show a system access dialog');
@@ -147,7 +146,7 @@ var AccessDialogDBus = class {
subtitle, body, options); subtitle, body, options);
dialog.open(); dialog.open();
dialog.connect('closed', () => (this._accessDialog = null)); dialog.connect('closed', () => { this._accessDialog = null; });
this._accessDialog = dialog; this._accessDialog = dialog;
} }

View File

@@ -1,17 +1,17 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup,
WindowCyclerPopup */
const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
const Mainloop = imports.mainloop;
const Main = imports.ui.main; const Main = imports.ui.main;
const SwitcherPopup = imports.ui.switcherPopup; const SwitcherPopup = imports.ui.switcherPopup;
const Tweener = imports.ui.tweener;
var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds
var THUMBNAIL_DEFAULT_SIZE = 256; var THUMBNAIL_DEFAULT_SIZE = 256;
var THUMBNAIL_POPUP_TIME = 500; // milliseconds var THUMBNAIL_POPUP_TIME = 500; // milliseconds
var THUMBNAIL_FADE_TIME = 100; // milliseconds var THUMBNAIL_FADE_TIME = 0.1; // seconds
var WINDOW_PREVIEW_SIZE = 128; var WINDOW_PREVIEW_SIZE = 128;
var APP_ICON_SIZE = 96; var APP_ICON_SIZE = 96;
@@ -36,7 +36,7 @@ function _createWindowClone(window, size) {
// usual hack for the usual bug in ClutterBinLayout... // usual hack for the usual bug in ClutterBinLayout...
x_expand: true, x_expand: true,
y_expand: true }); y_expand: true });
} };
function getWindows(workspace) { function getWindows(workspace) {
// We ignore skip-taskbar windows in switchers, but if they are attached // We ignore skip-taskbar windows in switchers, but if they are attached
@@ -87,9 +87,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
let hPadding = leftPadding + rightPadding; let hPadding = leftPadding + rightPadding;
let icon = this._items[this._selectedIndex]; let icon = this._items[this._selectedIndex];
let [posX] = icon.get_transformed_position(); let [posX, posY] = icon.get_transformed_position();
let thumbnailCenter = posX + icon.width / 2; let thumbnailCenter = posX + icon.width / 2;
let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1); let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2)); childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2));
if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) { if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) {
let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding; let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding;
@@ -103,7 +103,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
childBox.x2 = primary.x + primary.width - rightPadding; childBox.x2 = primary.x + primary.width - rightPadding;
childBox.y1 = this._switcherList.allocation.y2 + spacing; childBox.y1 = this._switcherList.allocation.y2 + spacing;
this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1); this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1);
let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1); let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
childBox.y2 = childBox.y1 + childNaturalHeight; childBox.y2 = childBox.y1 + childNaturalHeight;
this._thumbnails.allocate(childBox, flags); this._thumbnails.allocate(childBox, flags);
} }
@@ -291,7 +291,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
if (this._thumbnails) if (this._thumbnails)
this._destroyThumbnails(); this._destroyThumbnails();
if (this._thumbnailTimeoutId != 0) if (this._thumbnailTimeoutId != 0)
GLib.source_remove(this._thumbnailTimeoutId); Mainloop.source_remove(this._thumbnailTimeoutId);
} }
/** /**
@@ -326,7 +326,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
} }
if (this._thumbnailTimeoutId != 0) { if (this._thumbnailTimeoutId != 0) {
GLib.source_remove(this._thumbnailTimeoutId); Mainloop.source_remove(this._thumbnailTimeoutId);
this._thumbnailTimeoutId = 0; this._thumbnailTimeoutId = 0;
} }
@@ -343,8 +343,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
this._thumbnails.highlight(window, forceAppFocus); this._thumbnails.highlight(window, forceAppFocus);
} else if (this._items[this._selectedIndex].cachedWindows.length > 1 && } else if (this._items[this._selectedIndex].cachedWindows.length > 1 &&
!forceAppFocus) { !forceAppFocus) {
this._thumbnailTimeoutId = GLib.timeout_add( this._thumbnailTimeoutId = Mainloop.timeout_add (
GLib.PRIORITY_DEFAULT,
THUMBNAIL_POPUP_TIME, THUMBNAIL_POPUP_TIME,
this._timeoutPopupThumbnails.bind(this)); this._timeoutPopupThumbnails.bind(this));
GLib.Source.set_name_by_id(this._thumbnailTimeoutId, '[gnome-shell] this._timeoutPopupThumbnails'); GLib.Source.set_name_by_id(this._thumbnailTimeoutId, '[gnome-shell] this._timeoutPopupThumbnails');
@@ -361,15 +360,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
_destroyThumbnails() { _destroyThumbnails() {
let thumbnailsActor = this._thumbnails; let thumbnailsActor = this._thumbnails;
this._thumbnails.ease({ Tweener.addTween(thumbnailsActor,
opacity: 0, { opacity: 0,
duration: THUMBNAIL_FADE_TIME, time: THUMBNAIL_FADE_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete: () => {
thumbnailsActor.destroy(); thumbnailsActor.destroy();
this.thumbnailsVisible = false; this.thumbnailsVisible = false;
} }
}); });
this._thumbnails = null; this._thumbnails = null;
if (this._switcherList._items[this._selectedIndex]) if (this._switcherList._items[this._selectedIndex])
this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED); this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
@@ -392,14 +391,12 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
this._thumbnails.get_allocation_box(); this._thumbnails.get_allocation_box();
this._thumbnails.opacity = 0; this._thumbnails.opacity = 0;
this._thumbnails.ease({ Tweener.addTween(this._thumbnails,
opacity: 255, { opacity: 255,
duration: THUMBNAIL_FADE_TIME, time: THUMBNAIL_FADE_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete: () => { this.thumbnailsVisible = true; }
this.thumbnailsVisible = true; });
}
});
this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED); this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
} }
@@ -437,8 +434,8 @@ class CyclerHighlight {
if (this._clone.source) if (this._clone.source)
this._clone.source.sync_visibility(); this._clone.source.sync_visibility();
let windowActor = this._window let windowActor = this._window ? this._window.get_compositor_private()
? this._window.get_compositor_private() : null; : null;
if (windowActor) if (windowActor)
windowActor.hide(); windowActor.hide();
@@ -462,7 +459,7 @@ class CyclerHighlight {
_onDestroy() { _onDestroy() {
this.window = null; this.window = null;
} }
} };
// We don't show an actual popup, so just provide what SwitcherPopup // We don't show an actual popup, so just provide what SwitcherPopup
// expects instead of inheriting from SwitcherList // expects instead of inheriting from SwitcherList
@@ -472,7 +469,7 @@ var CyclerList = GObject.registerClass({
'item-removed': { param_types: [GObject.TYPE_INT] }, 'item-removed': { param_types: [GObject.TYPE_INT] },
'item-highlighted': { param_types: [GObject.TYPE_INT] } }, 'item-highlighted': { param_types: [GObject.TYPE_INT] } },
}, class CyclerList extends St.Widget { }, class CyclerList extends St.Widget {
highlight(index, _justOutline) { highlight(index, justOutline) {
this.emit('item-highlighted', index); this.emit('item-highlighted', index);
} }
}); });
@@ -497,7 +494,7 @@ var CyclerPopup = GObject.registerClass({
}); });
} }
_highlightItem(index, _justOutline) { _highlightItem(index, justOutline) {
this._highlight.window = this._items[index]; this._highlight.window = this._items[index];
global.window_group.set_child_above_sibling(this._highlight.actor, null); global.window_group.set_child_above_sibling(this._highlight.actor, null);
} }
@@ -648,9 +645,8 @@ class WindowCyclerPopup extends CyclerPopup {
} }
}); });
var AppIcon = GObject.registerClass({ var AppIcon = GObject.registerClass(
GTypeName: 'AltTab_AppIcon' class AppIcon extends St.BoxLayout {
}, class AppIcon extends St.BoxLayout {
_init(app) { _init(app) {
super._init({ style_class: 'alt-tab-app', super._init({ style_class: 'alt-tab-app',
vertical: true }); vertical: true });
@@ -664,10 +660,17 @@ var AppIcon = GObject.registerClass({
this.add(this.label, { x_fill: false }); this.add(this.label, { x_fill: false });
} }
// eslint-disable-next-line camelcase
set_size(size) { set_size(size) {
this.icon = this.app.create_icon_texture(size); this.icon = this.app.create_icon_texture(size);
this._iconBin.child = this.icon; this._iconBin.child = this.icon;
this._iconBin.set_size(size, size);
}
vfunc_get_preferred_width(forHeight) {
let [minWidth, ] = super.vfunc_get_preferred_width(forHeight);
minWidth = Math.max(minWidth, forHeight);
return [minWidth, minWidth];
} }
}); });
@@ -712,7 +715,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
_onDestroy() { _onDestroy() {
if (this._mouseTimeOutId != 0) if (this._mouseTimeOutId != 0)
GLib.source_remove(this._mouseTimeOutId); Mainloop.source_remove(this._mouseTimeOutId);
this.icons.forEach(icon => { this.icons.forEach(icon => {
icon.app.disconnect(icon._stateChangedId); icon.app.disconnect(icon._stateChangedId);
@@ -721,16 +724,15 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
_setIconSize() { _setIconSize() {
let j = 0; let j = 0;
while (this._items.length > 1 && this._items[j].style_class != 'item-box') { while(this._items.length > 1 && this._items[j].style_class != 'item-box') {
j++; j++;
} }
let themeNode = this._items[j].get_theme_node(); let themeNode = this._items[j].get_theme_node();
this._list.ensure_style();
let iconPadding = themeNode.get_horizontal_padding(); let iconPadding = themeNode.get_horizontal_padding();
let iconBorder = themeNode.get_border_width(St.Side.LEFT) + themeNode.get_border_width(St.Side.RIGHT); let iconBorder = themeNode.get_border_width(St.Side.LEFT) + themeNode.get_border_width(St.Side.RIGHT);
let [, labelNaturalHeight] = this.icons[j].label.get_preferred_height(-1); let [iconMinHeight, iconNaturalHeight] = this.icons[j].label.get_preferred_height(-1);
let iconSpacing = labelNaturalHeight + iconPadding + iconBorder; let iconSpacing = iconNaturalHeight + iconPadding + iconBorder;
let totalSpacing = this._list.spacing * (this._items.length - 1); let totalSpacing = this._list.spacing * (this._items.length - 1);
// We just assume the whole screen here due to weirdness happing with the passed width // We just assume the whole screen here due to weirdness happing with the passed width
@@ -743,7 +745,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
let iconSize = baseIconSizes[0]; let iconSize = baseIconSizes[0];
if (this._items.length > 1) { if (this._items.length > 1) {
for (let i = 0; i < baseIconSizes.length; i++) { for(let i = 0; i < baseIconSizes.length; i++) {
iconSize = baseIconSizes[i]; iconSize = baseIconSizes[i];
let height = iconSizes[i] + iconSpacing; let height = iconSizes[i] + iconSpacing;
let w = height * this._items.length + totalSpacing; let w = height * this._items.length + totalSpacing;
@@ -754,7 +756,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
this._iconSize = iconSize; this._iconSize = iconSize;
for (let i = 0; i < this.icons.length; i++) { for(let i = 0; i < this.icons.length; i++) {
if (this.icons[i].icon != null) if (this.icons[i].icon != null)
break; break;
this.icons[i].set_size(iconSize); this.icons[i].set_size(iconSize);
@@ -791,24 +793,21 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
// activation when the thumbnail list is open // activation when the thumbnail list is open
_onItemEnter(index) { _onItemEnter(index) {
if (this._mouseTimeOutId != 0) if (this._mouseTimeOutId != 0)
GLib.source_remove(this._mouseTimeOutId); Mainloop.source_remove(this._mouseTimeOutId);
if (this._altTabPopup.thumbnailsVisible) { if (this._altTabPopup.thumbnailsVisible) {
this._mouseTimeOutId = GLib.timeout_add( this._mouseTimeOutId = Mainloop.timeout_add(APP_ICON_HOVER_TIMEOUT,
GLib.PRIORITY_DEFAULT, () => {
APP_ICON_HOVER_TIMEOUT, this._enterItem(index);
() => { this._mouseTimeOutId = 0;
this._enterItem(index); return GLib.SOURCE_REMOVE;
this._mouseTimeOutId = 0; });
return GLib.SOURCE_REMOVE;
});
GLib.Source.set_name_by_id(this._mouseTimeOutId, '[gnome-shell] this._enterItem'); GLib.Source.set_name_by_id(this._mouseTimeOutId, '[gnome-shell] this._enterItem');
} else { } else
this._itemEntered(index); this._itemEntered(index);
}
} }
_enterItem(index) { _enterItem(index) {
let [x, y] = global.get_pointer(); let [x, y, mask] = global.get_pointer();
let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y); let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y);
if (this._items[index].contains(pickedActor)) if (this._items[index].contains(pickedActor))
this._itemEntered(index); this._itemEntered(index);
@@ -849,8 +848,9 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
this._removeIcon(app); this._removeIcon(app);
}); });
let n = this._arrows.length;
let arrow = new St.DrawingArea({ style_class: 'switcher-arrow' }); let arrow = new St.DrawingArea({ style_class: 'switcher-arrow' });
arrow.connect('repaint', () => SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM)); arrow.connect('repaint', () => { SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM); });
this.add_actor(arrow); this.add_actor(arrow);
this._arrows.push(arrow); this._arrows.push(arrow);
@@ -877,9 +877,9 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
_init(windows) { _init(windows) {
super._init(false); super._init(false);
this._labels = []; this._labels = new Array();
this._thumbnailBins = []; this._thumbnailBins = new Array();
this._clones = []; this._clones = new Array();
this._windows = windows; this._windows = windows;
for (let i = 0; i < windows.length; i++) { for (let i = 0; i < windows.length; i++) {
@@ -915,7 +915,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
return; return;
let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding(); let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding();
totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding(); totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding();
let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1); let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
let spacing = this._items[0].child.get_theme_node().get_length('spacing'); let spacing = this._items[0].child.get_theme_node().get_length('spacing');
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor; let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor;
@@ -940,7 +940,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
} }
// Make sure we only do this once // Make sure we only do this once
this._thumbnailBins = []; this._thumbnailBins = new Array();
} }
_removeThumbnail(source, clone) { _removeThumbnail(source, clone) {
@@ -991,32 +991,32 @@ class WindowIcon extends St.BoxLayout {
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
switch (mode) { switch (mode) {
case AppIconMode.THUMBNAIL_ONLY: case AppIconMode.THUMBNAIL_ONLY:
size = WINDOW_PREVIEW_SIZE; size = WINDOW_PREVIEW_SIZE;
this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor)); this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
break; break;
case AppIconMode.BOTH: case AppIconMode.BOTH:
size = WINDOW_PREVIEW_SIZE; size = WINDOW_PREVIEW_SIZE;
this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor)); this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
if (this.app) if (this.app)
this._icon.add_actor(this._createAppIcon(this.app, this._icon.add_actor(this._createAppIcon(this.app,
APP_ICON_SIZE_SMALL)); APP_ICON_SIZE_SMALL));
break; break;
case AppIconMode.APP_ICON_ONLY: case AppIconMode.APP_ICON_ONLY:
size = APP_ICON_SIZE; size = APP_ICON_SIZE;
this._icon.add_actor(this._createAppIcon(this.app, size)); this._icon.add_actor(this._createAppIcon(this.app, size));
} }
this._icon.set_size(size * scaleFactor, size * scaleFactor); this._icon.set_size(size * scaleFactor, size * scaleFactor);
} }
_createAppIcon(app, size) { _createAppIcon(app, size) {
let appIcon = app let appIcon = app ? app.create_icon_texture(size)
? app.create_icon_texture(size) : new St.Icon({ icon_name: 'icon-missing',
: new St.Icon({ icon_name: 'icon-missing', icon_size: size }); icon_size: size });
appIcon.x_expand = appIcon.y_expand = true; appIcon.x_expand = appIcon.y_expand = true;
appIcon.x_align = appIcon.y_align = Clutter.ActorAlign.END; appIcon.x_align = appIcon.y_align = Clutter.ActorAlign.END;
@@ -1043,8 +1043,8 @@ class WindowList extends SwitcherPopup.SwitcherList {
this.addItem(icon, icon.label); this.addItem(icon, icon.label);
this.icons.push(icon); this.icons.push(icon);
icon._unmanagedSignalId = icon.window.connect('unmanaged', window => { icon._unmanagedSignalId = icon.window.connect('unmanaged', (window) => {
this._removeWindow(window); this._removeWindow(window)
}); });
} }
@@ -1080,7 +1080,7 @@ class WindowList extends SwitcherPopup.SwitcherList {
childBox.y1 = childBox.y2 - this._label.height; childBox.y1 = childBox.y2 - this._label.height;
this._label.allocate(childBox, flags); this._label.allocate(childBox, flags);
let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM); let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM)
childBox.x1 = box.x1; childBox.x1 = box.x1;
childBox.x2 = box.x2; childBox.x2 = box.x2;
childBox.y1 = box.y1; childBox.y1 = box.y1;

View File

@@ -1,13 +1,13 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Animation, AnimatedIcon, Spinner */
const { Clutter, GLib, Gio, St } = imports.gi; const { GLib, Gio, St } = imports.gi;
const Mainloop = imports.mainloop;
const Params = imports.misc.params; const Tweener = imports.ui.tweener;
var ANIMATED_ICON_UPDATE_TIMEOUT = 16; var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
var SPINNER_ANIMATION_TIME = 300; var SPINNER_ANIMATION_TIME = 0.3;
var SPINNER_ANIMATION_DELAY = 1000; var SPINNER_ANIMATION_DELAY = 1.0;
var Animation = class { var Animation = class {
constructor(file, width, height, speed) { constructor(file, width, height, speed) {
@@ -46,7 +46,7 @@ var Animation = class {
stop() { stop() {
if (this._timeoutId > 0) { if (this._timeoutId > 0) {
GLib.source_remove(this._timeoutId); Mainloop.source_remove(this._timeoutId);
this._timeoutId = 0; this._timeoutId = 0;
} }
@@ -55,29 +55,19 @@ var Animation = class {
_loadFile(file, width, height) { _loadFile(file, width, height) {
let [validResourceScale, resourceScale] = this.actor.get_resource_scale(); let [validResourceScale, resourceScale] = this.actor.get_resource_scale();
let wasPlaying = this._isPlaying;
if (this._isPlaying)
this.stop();
this._isLoaded = false; this._isLoaded = false;
this.actor.destroy_all_children(); this.actor.destroy_all_children();
if (!validResourceScale) { if (!validResourceScale)
if (wasPlaying)
this.play();
return; return;
}
let textureCache = St.TextureCache.get_default(); let texture_cache = St.TextureCache.get_default();
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
this._animations = textureCache.load_sliced_image(file, width, height, this._animations = texture_cache.load_sliced_image(file, width, height,
scaleFactor, resourceScale, scaleFactor, resourceScale,
this._animationsLoaded.bind(this)); this._animationsLoaded.bind(this));
this.actor.set_child(this._animations); this.actor.set_child(this._animations);
if (wasPlaying)
this.play();
} }
_showFrame(frame) { _showFrame(frame) {
@@ -133,22 +123,12 @@ var AnimatedIcon = class extends Animation {
}; };
var Spinner = class extends AnimatedIcon { var Spinner = class extends AnimatedIcon {
constructor(size, params) { constructor(size, animate=false) {
// Compatibility with older callers
if (params === true || params === false)
params = { animate: params };
params = Params.parse(params, {
animate: false,
hideOnStop: false,
});
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg'); let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg');
super(file, size); super(file, size);
this.actor.opacity = 0; this.actor.opacity = 0;
this._animate = params.animate; this._animate = animate;
this._hideOnStop = params.hideOnStop;
this.actor.visible = !this._hideOnStop;
} }
_onDestroy() { _onDestroy() {
@@ -157,16 +137,15 @@ var Spinner = class extends AnimatedIcon {
} }
play() { play() {
this.actor.remove_all_transitions(); Tweener.removeTweens(this.actor);
this.actor.show();
if (this._animate) { if (this._animate) {
super.play(); super.play();
this.actor.ease({ Tweener.addTween(this.actor, {
opacity: 255, opacity: 255,
delay: SPINNER_ANIMATION_DELAY, delay: SPINNER_ANIMATION_DELAY,
duration: SPINNER_ANIMATION_TIME, time: SPINNER_ANIMATION_TIME,
mode: Clutter.AnimationMode.LINEAR transition: 'linear'
}); });
} else { } else {
this.actor.opacity = 255; this.actor.opacity = 255;
@@ -175,25 +154,20 @@ var Spinner = class extends AnimatedIcon {
} }
stop() { stop() {
this.actor.remove_all_transitions(); Tweener.removeTweens(this.actor);
if (this._animate) { if (this._animate) {
this.actor.ease({ Tweener.addTween(this.actor, {
opacity: 0, opacity: 0,
duration: SPINNER_ANIMATION_TIME, time: SPINNER_ANIMATION_TIME,
mode: Clutter.AnimationMode.LINEAR, transition: 'linear',
onComplete: () => { onComplete: () => {
super.stop(); this.stop(false);
if (this._hideOnStop) }
this.actor.hide();
},
}); });
} else { } else {
this.actor.opacity = 0; this.actor.opacity = 0;
super.stop(); super.stop();
if (this._hideOnStop)
this.actor.hide();
} }
} }
}; };

File diff suppressed because it is too large Load Diff

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported getAppFavorites */
const Shell = imports.gi.Shell; const Shell = imports.gi.Shell;
const Signals = imports.signals; const Signals = imports.signals;
@@ -64,7 +63,7 @@ class AppFavorites {
constructor() { constructor() {
this.FAVORITE_APPS_KEY = 'favorite-apps'; this.FAVORITE_APPS_KEY = 'favorite-apps';
this._favorites = {}; this._favorites = {};
global.settings.connect(`changed::${this.FAVORITE_APPS_KEY}`, this._onFavsChanged.bind(this)); global.settings.connect('changed::' + this.FAVORITE_APPS_KEY, this._onFavsChanged.bind(this));
this.reload(); this.reload();
} }
@@ -147,11 +146,12 @@ class AppFavorites {
let app = Shell.AppSystem.get_default().lookup_app(appId); let app = Shell.AppSystem.get_default().lookup_app(appId);
let msg = _("%s has been added to your favorites.").format(app.get_name()); Main.overview.setMessage(_("%s has been added to your favorites.").format(app.get_name()),
Main.overview.setMessage(msg, { { forFeedback: true,
forFeedback: true, undoCallback: () => {
undoCallback: () => this._removeFavorite(appId), this._removeFavorite(appId);
}); }
});
} }
addFavorite(appId) { addFavorite(appId) {
@@ -180,13 +180,14 @@ class AppFavorites {
if (!this._removeFavorite(appId)) if (!this._removeFavorite(appId))
return; return;
let msg = _("%s has been removed from your favorites.").format(app.get_name()); Main.overview.setMessage(_("%s has been removed from your favorites.").format(app.get_name()),
Main.overview.setMessage(msg, { { forFeedback: true,
forFeedback: true, undoCallback: () => {
undoCallback: () => this._addFavorite(appId, pos), this._addFavorite(appId, pos);
}); }
});
} }
} };
Signals.addSignalMethods(AppFavorites.prototype); Signals.addSignalMethods(AppFavorites.prototype);
var appFavoritesInstance = null; var appFavoritesInstance = null;

View File

@@ -1,4 +1,3 @@
/* exported AudioDeviceSelectionDBus */
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
const Main = imports.ui.main; const Main = imports.ui.main;
@@ -35,7 +34,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
throw new Error('Too few devices for a selection'); throw new Error('Too few devices for a selection');
} }
_buildLayout() { _buildLayout(devices) {
let title = new St.Label({ style_class: 'audio-selection-title', let title = new St.Label({ style_class: 'audio-selection-title',
text: _("Select Audio Device"), text: _("Select Audio Device"),
x_align: Clutter.ActorAlign.CENTER }); x_align: Clutter.ActorAlign.CENTER });
@@ -55,28 +54,28 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
} }
_getDeviceLabel(device) { _getDeviceLabel(device) {
switch (device) { switch(device) {
case AudioDevice.HEADPHONES: case AudioDevice.HEADPHONES:
return _("Headphones"); return _("Headphones");
case AudioDevice.HEADSET: case AudioDevice.HEADSET:
return _("Headset"); return _("Headset");
case AudioDevice.MICROPHONE: case AudioDevice.MICROPHONE:
return _("Microphone"); return _("Microphone");
default: default:
return null; return null;
} }
} }
_getDeviceIcon(device) { _getDeviceIcon(device) {
switch (device) { switch(device) {
case AudioDevice.HEADPHONES: case AudioDevice.HEADPHONES:
return 'audio-headphones-symbolic'; return 'audio-headphones-symbolic';
case AudioDevice.HEADSET: case AudioDevice.HEADSET:
return 'audio-headset-symbolic'; return 'audio-headset-symbolic';
case AudioDevice.MICROPHONE: case AudioDevice.MICROPHONE:
return 'audio-input-microphone-symbolic'; return 'audio-input-microphone-symbolic';
default: default:
return null; return null;
} }
} }
@@ -86,7 +85,6 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
box.connect('notify::height', () => { box.connect('notify::height', () => {
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
box.width = box.height; box.width = box.height;
return GLib.SOURCE_REMOVE;
}); });
}); });
@@ -112,11 +110,11 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
} }
_openSettings() { _openSettings() {
let desktopFile = 'gnome-sound-panel.desktop'; let desktopFile = 'gnome-sound-panel.desktop'
let app = Shell.AppSystem.get_default().lookup_app(desktopFile); let app = Shell.AppSystem.get_default().lookup_app(desktopFile);
if (!app) { if (!app) {
log(`Settings panel for desktop file ${desktopFile} could not be loaded!`); log('Settings panel for desktop file ' + desktopFile + ' could not be loaded!');
return; return;
} }
@@ -161,12 +159,12 @@ var AudioDeviceSelectionDBus = class AudioDeviceSelectionDBus {
let [deviceNames] = params; let [deviceNames] = params;
let devices = 0; let devices = 0;
deviceNames.forEach(n => (devices |= AudioDevice[n.toUpperCase()])); deviceNames.forEach(n => { devices |= AudioDevice[n.toUpperCase()]; });
let dialog; let dialog;
try { try {
dialog = new AudioDeviceSelectionDialog(devices); dialog = new AudioDeviceSelectionDialog(devices);
} catch (e) { } catch(e) {
invocation.return_value(null); invocation.return_value(null);
return; return;
} }

View File

@@ -99,6 +99,7 @@ const Signals = imports.signals;
const LoginManager = imports.misc.loginManager; const LoginManager = imports.misc.loginManager;
const Main = imports.ui.main; const Main = imports.ui.main;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff); var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff);
@@ -107,9 +108,10 @@ const PRIMARY_COLOR_KEY = 'primary-color';
const SECONDARY_COLOR_KEY = 'secondary-color'; const SECONDARY_COLOR_KEY = 'secondary-color';
const COLOR_SHADING_TYPE_KEY = 'color-shading-type'; const COLOR_SHADING_TYPE_KEY = 'color-shading-type';
const BACKGROUND_STYLE_KEY = 'picture-options'; const BACKGROUND_STYLE_KEY = 'picture-options';
const PICTURE_OPACITY_KEY = 'picture-opacity';
const PICTURE_URI_KEY = 'picture-uri'; const PICTURE_URI_KEY = 'picture-uri';
var FADE_ANIMATION_TIME = 1000; var FADE_ANIMATION_TIME = 1.0;
// These parameters affect how often we redraw. // These parameters affect how often we redraw.
// The first is how different (percent crossfaded) the slide show // The first is how different (percent crossfaded) the slide show
@@ -332,12 +334,12 @@ var Background = class Background {
} }
_loadPattern() { _loadPattern() {
let colorString, res_, color, secondColor; let colorString, res, color, secondColor;
colorString = this._settings.get_string(PRIMARY_COLOR_KEY); colorString = this._settings.get_string(PRIMARY_COLOR_KEY);
[res_, color] = Clutter.Color.from_string(colorString); [res, color] = Clutter.Color.from_string(colorString);
colorString = this._settings.get_string(SECONDARY_COLOR_KEY); colorString = this._settings.get_string(SECONDARY_COLOR_KEY);
[res_, secondColor] = Clutter.Color.from_string(colorString); [res, secondColor] = Clutter.Color.from_string(colorString);
let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY); let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);
@@ -431,31 +433,30 @@ var Background = class Background {
return; return;
this._updateAnimationTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, this._updateAnimationTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT,
interval, interval,
() => { () => {
this._updateAnimationTimeoutId = 0; this._updateAnimationTimeoutId = 0;
this._updateAnimation(); this._updateAnimation();
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
}); });
GLib.Source.set_name_by_id(this._updateAnimationTimeoutId, '[gnome-shell] this._updateAnimation'); GLib.Source.set_name_by_id(this._updateAnimationTimeoutId, '[gnome-shell] this._updateAnimation');
} }
_loadAnimation(file) { _loadAnimation(file) {
this._cache.getAnimation({ this._cache.getAnimation({ file: file,
file: file, settingsSchema: this._settings.schema_id,
settingsSchema: this._settings.schema_id, onLoaded: animation => {
onLoaded: animation => { this._animation = animation;
this._animation = animation;
if (!this._animation || this._cancellable.is_cancelled()) { if (!this._animation || this._cancellable.is_cancelled()) {
this._setLoaded(); this._setLoaded();
return; return;
} }
this._updateAnimation(); this._updateAnimation();
this._watchFile(file); this._watchFile(file);
} }
}); });
} }
_loadImage(file) { _loadImage(file) {
@@ -464,9 +465,9 @@ var Background = class Background {
let cache = Meta.BackgroundImageCache.get_default(); let cache = Meta.BackgroundImageCache.get_default();
let image = cache.load(file); let image = cache.load(file);
if (image.is_loaded()) { if (image.is_loaded())
this._setLoaded(); this._setLoaded();
} else { else {
let id = image.connect('loaded', () => { let id = image.connect('loaded', () => {
this._setLoaded(); this._setLoaded();
image.disconnect(id); image.disconnect(id);
@@ -633,9 +634,9 @@ var Animation = class Animation {
} }
load(callback) { load(callback) {
this._show = new GnomeDesktop.BGSlideShow({ file: this.file }); this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() });
this._show.load_async(null, () => { this._show.load_async(null, (object, result) => {
this.loaded = true; this.loaded = true;
if (callback) if (callback)
callback(); callback();
@@ -651,7 +652,7 @@ var Animation = class Animation {
if (this._show.get_num_slides() < 1) if (this._show.get_num_slides() < 1)
return; return;
let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height); let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
this.transitionDuration = duration; this.transitionDuration = duration;
this.transitionProgress = progress; this.transitionProgress = progress;
@@ -710,12 +711,14 @@ var BackgroundManager = class BackgroundManager {
this._newBackgroundActor = null; this._newBackgroundActor = null;
this.emit('changed'); this.emit('changed');
oldBackgroundActor.ease({ Tweener.addTween(oldBackgroundActor,
opacity: 0, { opacity: 0,
duration: FADE_ANIMATION_TIME, time: FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => oldBackgroundActor.destroy() onComplete() {
}); oldBackgroundActor.destroy();
}
});
} }
_updateBackgroundActor() { _updateBackgroundActor() {
@@ -749,14 +752,13 @@ var BackgroundManager = class BackgroundManager {
_createBackgroundActor() { _createBackgroundActor() {
let background = this._backgroundSource.getBackground(this._monitorIndex); let background = this._backgroundSource.getBackground(this._monitorIndex);
let backgroundActor = new Meta.BackgroundActor({ let backgroundActor = new Meta.BackgroundActor({ meta_display: global.display,
meta_display: global.display, monitor: this._monitorIndex,
monitor: this._monitorIndex, background: background.background,
background: background.background, vignette: this._vignette,
vignette: this._vignette, vignette_sharpness: 0.5,
vignette_sharpness: 0.5, brightness: 0.5,
brightness: 0.5, });
});
this._container.add_child(backgroundActor); this._container.add_child(backgroundActor);

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported addBackgroundMenu */
const { Clutter, St } = imports.gi; const { Clutter, St } = imports.gi;
@@ -31,7 +30,7 @@ function addBackgroundMenu(actor, layoutManager) {
function openMenu(x, y) { function openMenu(x, y) {
Main.layoutManager.setDummyCursorGeometry(x, y, 0, 0); Main.layoutManager.setDummyCursorGeometry(x, y, 0, 0);
actor._backgroundMenu.open(BoxPointer.PopupAnimation.FULL); actor._backgroundMenu.open(BoxPointer.PopupAnimation.NONE);
} }
let clickAction = new Clutter.ClickAction(); let clickAction = new Clutter.ClickAction();

View File

@@ -1,106 +1,74 @@
/* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */ /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
/* exported BarLevel */
const { Atk, Clutter, GObject, St } = imports.gi; const { Atk, Clutter, St } = imports.gi;
const Signals = imports.signals;
var BarLevel = GObject.registerClass({ var BarLevel = class {
Properties: { constructor(value, params) {
'value': GObject.ParamSpec.double( if (isNaN(value))
'value', 'value', 'value', // Avoid spreading NaNs around
GObject.ParamFlags.READWRITE, throw TypeError('The bar level value must be a number');
0, 2, 0),
'maximum-value': GObject.ParamSpec.double(
'maximum-value', 'maximum-value', 'maximum-value',
GObject.ParamFlags.READWRITE,
1, 2, 1),
'overdrive-start': GObject.ParamSpec.double(
'overdrive-start', 'overdrive-start', 'overdrive-start',
GObject.ParamFlags.READWRITE,
1, 2, 1)
}
}, class BarLevel extends St.DrawingArea {
_init(params) {
this._maxValue = 1; this._maxValue = 1;
this._value = 0; this._value = Math.max(Math.min(value, this._maxValue), 0);
this._overdriveStart = 1; this._overdriveStart = 1;
this._barLevelWidth = 0; this._barLevelWidth = 0;
let defaultParams = { if (params == undefined)
style_class: 'barlevel', params = {}
accessible_role: Atk.Role.LEVEL_BAR
}; this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel',
super._init(Object.assign(defaultParams, params)); can_focus: params['canFocus'] || false,
this.connect('allocation-changed', (actor, box) => { reactive: params['reactive'] || false,
accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR });
this.actor.connect('repaint', this._barLevelRepaint.bind(this));
this.actor.connect('allocation-changed', (actor, box) => {
this._barLevelWidth = box.get_width(); this._barLevelWidth = box.get_width();
}); });
this._customAccessible = St.GenericAccessible.new_for_actor(this); this._customAccessible = St.GenericAccessible.new_for_actor(this.actor);
this.set_accessible(this._customAccessible); this.actor.set_accessible(this._customAccessible);
this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this)); this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this));
this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this)); this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this));
this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this)); this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this));
this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this)); this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this));
this.connect('notify::value', this._valueChanged.bind(this)); this.connect('value-changed', this._valueChanged.bind(this));
} }
get value() { setValue(value) {
return this._value; if (isNaN(value))
throw TypeError('The bar level value must be a number');
this._value = Math.max(Math.min(value, this._maxValue), 0);
this.actor.queue_repaint();
} }
set value(value) { setMaximumValue(value) {
value = Math.max(Math.min(value, this._maxValue), 0); if (isNaN(value))
throw TypeError('The bar level max value must be a number');
if (this._value == value) this._maxValue = Math.max(value, 1);
return;
this._value = value;
this.notify('value');
this.queue_repaint();
}
// eslint-disable-next-line camelcase
get maximum_value() {
return this._maxValue;
}
// eslint-disable-next-line camelcase
set maximum_value(value) {
value = Math.max(value, 1);
if (this._maxValue == value)
return;
this._maxValue = value;
this._overdriveStart = Math.min(this._overdriveStart, this._maxValue); this._overdriveStart = Math.min(this._overdriveStart, this._maxValue);
this.notify('maximum-value'); this.actor.queue_repaint();
this.queue_repaint();
} }
// eslint-disable-next-line camelcase setOverdriveStart(value) {
get overdrive_start() { if (isNaN(value))
return this._overdriveStart; throw TypeError('The overdrive limit value must be a number');
}
// eslint-disable-next-line camelcase
set overdrive_start(value) {
if (this._overdriveStart == value)
return;
if (value > this._maxValue) if (value > this._maxValue)
throw new Error(`Tried to set overdrive value to ${value}, ` + throw new Error(`Tried to set overdrive value to ${value}, ` +
`which is a number greater than the maximum allowed value ${this._maxValue}`); `which is a number greater than the maximum allowed value ${this._maxValue}`);
this._overdriveStart = value; this._overdriveStart = value;
this.notify('overdrive-start'); this._value = Math.max(Math.min(value, this._maxValue), 0);
this.queue_repaint(); this.actor.queue_repaint();
} }
vfunc_repaint() { _barLevelRepaint(area) {
let cr = this.get_context(); let cr = area.get_context();
let themeNode = this.get_theme_node(); let themeNode = area.get_theme_node();
let [width, height] = this.get_surface_size(); let [width, height] = area.get_surface_size();
let barLevelHeight = themeNode.get_length('-barlevel-height'); let barLevelHeight = themeNode.get_length('-barlevel-height');
let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2; let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2;
@@ -137,7 +105,7 @@ var BarLevel = GObject.registerClass({
overdriveSeparatorWidth = themeNode.get_length('-barlevel-overdrive-separator-width'); overdriveSeparatorWidth = themeNode.get_length('-barlevel-overdrive-separator-width');
/* background bar */ /* background bar */
cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4)); cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4);
cr.lineTo(endX, (height + barLevelHeight) / 2); cr.lineTo(endX, (height + barLevelHeight) / 2);
cr.lineTo(endX, (height - barLevelHeight) / 2); cr.lineTo(endX, (height - barLevelHeight) / 2);
cr.lineTo(width - barLevelBorderRadius - barLevelBorderWidth, (height - barLevelHeight) / 2); cr.lineTo(width - barLevelBorderRadius - barLevelBorderWidth, (height - barLevelHeight) / 2);
@@ -149,12 +117,12 @@ var BarLevel = GObject.registerClass({
/* normal progress bar */ /* normal progress bar */
let x = Math.min(endX, overdriveSeparatorX - overdriveSeparatorWidth / 2); let x = Math.min(endX, overdriveSeparatorX - overdriveSeparatorWidth / 2);
cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (1 / 4), TAU * (3 / 4)); cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 1 / 4, TAU * 3 / 4);
cr.lineTo(x, (height - barLevelHeight) / 2); cr.lineTo(x, (height - barLevelHeight) / 2);
cr.lineTo(x, (height + barLevelHeight) / 2); cr.lineTo(x, (height + barLevelHeight) / 2);
cr.lineTo(barLevelBorderRadius + barLevelBorderWidth, (height + barLevelHeight) / 2); cr.lineTo(barLevelBorderRadius + barLevelBorderWidth, (height + barLevelHeight) / 2);
if (this._value > 0) if (this._value > 0)
Clutter.cairo_set_source_color(cr, barLevelActiveColor); Clutter.cairo_set_source_color(cr, barLevelActiveColor);
cr.fillPreserve(); cr.fillPreserve();
Clutter.cairo_set_source_color(cr, barLevelActiveBorderColor); Clutter.cairo_set_source_color(cr, barLevelActiveBorderColor);
cr.setLineWidth(barLevelBorderWidth); cr.setLineWidth(barLevelBorderWidth);
@@ -177,17 +145,17 @@ var BarLevel = GObject.registerClass({
/* end progress bar arc */ /* end progress bar arc */
if (this._value > 0) { if (this._value > 0) {
if (this._value <= this._overdriveStart) if (this._value <= this._overdriveStart)
Clutter.cairo_set_source_color(cr, barLevelActiveColor); Clutter.cairo_set_source_color(cr, barLevelActiveColor);
else else
Clutter.cairo_set_source_color(cr, barLevelOverdriveColor); Clutter.cairo_set_source_color(cr, barLevelOverdriveColor);
cr.arc(endX, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4)); cr.arc(endX, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4);
cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2); cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2);
cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2); cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2);
cr.lineTo(endX, (height - barLevelHeight) / 2); cr.lineTo(endX, (height - barLevelHeight) / 2);
cr.fillPreserve(); cr.fillPreserve();
cr.setLineWidth(barLevelBorderWidth); cr.setLineWidth(barLevelBorderWidth);
cr.stroke(); cr.stroke();
} }
/* draw overdrive separator */ /* draw overdrive separator */
@@ -207,27 +175,32 @@ var BarLevel = GObject.registerClass({
cr.$dispose(); cr.$dispose();
} }
_getCurrentValue() { _getCurrentValue(actor) {
return this._value; return this._value;
} }
_getOverdriveStart() { _getOverdriveStart(actor) {
return this._overdriveStart; return this._overdriveStart;
} }
_getMinimumValue() { _getMinimumValue(actor) {
return 0; return 0;
} }
_getMaximumValue() { _getMaximumValue(actor) {
return this._maxValue; return this._maxValue;
} }
_setCurrentValue(_actor, value) { _setCurrentValue(actor, value) {
this._value = value; this._value = value;
} }
_valueChanged() { _valueChanged(barLevel, value, property) {
this._customAccessible.notify("accessible-value"); this._customAccessible.notify("accessible-value");
} }
});
get value() {
return this._value;
}
};
Signals.addSignalMethods(BarLevel.prototype);

View File

@@ -1,9 +1,9 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported BoxPointer */
const { Clutter, GObject, Shell, St } = imports.gi; const { Clutter, GObject, Meta, Shell, St } = imports.gi;
const Main = imports.ui.main; const Main = imports.ui.main;
const Tweener = imports.ui.tweener;
var PopupAnimation = { var PopupAnimation = {
NONE: 0, NONE: 0,
@@ -12,7 +12,7 @@ var PopupAnimation = {
FULL: ~0, FULL: ~0,
}; };
var POPUP_ANIMATION_TIME = 150; var POPUP_ANIMATION_TIME = 0.15;
/** /**
* BoxPointer: * BoxPointer:
@@ -90,33 +90,31 @@ var BoxPointer = GObject.registerClass({
if (animate & PopupAnimation.SLIDE) { if (animate & PopupAnimation.SLIDE) {
switch (this._arrowSide) { switch (this._arrowSide) {
case St.Side.TOP: case St.Side.TOP:
this.translation_y = -rise; this.translation_y = -rise;
break; break;
case St.Side.BOTTOM: case St.Side.BOTTOM:
this.translation_y = rise; this.translation_y = rise;
break; break;
case St.Side.LEFT: case St.Side.LEFT:
this.translation_x = -rise; this.translation_x = -rise;
break; break;
case St.Side.RIGHT: case St.Side.RIGHT:
this.translation_x = rise; this.translation_x = rise;
break; break;
} }
} }
this.ease({ Tweener.addTween(this, { opacity: 255,
opacity: 255, translation_x: 0,
translation_x: 0, translation_y: 0,
translation_y: 0, transition: 'linear',
duration: animationTime, onComplete: () => {
mode: Clutter.AnimationMode.LINEAR, this._unmuteInput();
onComplete: () => { if (onComplete)
this._unmuteInput(); onComplete();
if (onComplete) },
onComplete(); time: animationTime });
}
});
} }
close(animate, onComplete) { close(animate, onComplete) {
@@ -132,39 +130,38 @@ var BoxPointer = GObject.registerClass({
if (animate & PopupAnimation.SLIDE) { if (animate & PopupAnimation.SLIDE) {
switch (this._arrowSide) { switch (this._arrowSide) {
case St.Side.TOP: case St.Side.TOP:
translationY = rise; translationY = rise;
break; break;
case St.Side.BOTTOM: case St.Side.BOTTOM:
translationY = -rise; translationY = -rise;
break; break;
case St.Side.LEFT: case St.Side.LEFT:
translationX = rise; translationX = rise;
break; break;
case St.Side.RIGHT: case St.Side.RIGHT:
translationX = -rise; translationX = -rise;
break; break;
} }
} }
this._muteInput(); this._muteInput();
this.remove_all_transitions(); Tweener.removeTweens(this);
this.ease({ Tweener.addTween(this, { opacity: fade ? 0 : 255,
opacity: fade ? 0 : 255, translation_x: translationX,
translation_x: translationX, translation_y: translationY,
translation_y: translationY, transition: 'linear',
duration: animationTime, time: animationTime,
mode: Clutter.AnimationMode.LINEAR, onComplete: () => {
onComplete: () => { this.hide();
this.hide(); this.opacity = 0;
this.opacity = 0; this.translation_x = 0;
this.translation_x = 0; this.translation_y = 0;
this.translation_y = 0; if (onComplete)
if (onComplete) onComplete();
onComplete(); }
} });
});
} }
_adjustAllocationForArrow(isWidth, minSize, natSize) { _adjustAllocationForArrow(isWidth, minSize, natSize) {
@@ -172,8 +169,8 @@ var BoxPointer = GObject.registerClass({
let borderWidth = themeNode.get_length('-arrow-border-width'); let borderWidth = themeNode.get_length('-arrow-border-width');
minSize += borderWidth * 2; minSize += borderWidth * 2;
natSize += borderWidth * 2; natSize += borderWidth * 2;
if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)) || if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM))
(isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) { || (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
let rise = themeNode.get_length('-arrow-rise'); let rise = themeNode.get_length('-arrow-rise');
minSize += rise; minSize += rise;
natSize += rise; natSize += rise;
@@ -223,18 +220,18 @@ var BoxPointer = GObject.registerClass({
childBox.x2 = availWidth - borderWidth; childBox.x2 = availWidth - borderWidth;
childBox.y2 = availHeight - borderWidth; childBox.y2 = availHeight - borderWidth;
switch (this._arrowSide) { switch (this._arrowSide) {
case St.Side.TOP: case St.Side.TOP:
childBox.y1 += rise; childBox.y1 += rise;
break; break;
case St.Side.BOTTOM: case St.Side.BOTTOM:
childBox.y2 -= rise; childBox.y2 -= rise;
break; break;
case St.Side.LEFT: case St.Side.LEFT:
childBox.x1 += rise; childBox.x1 += rise;
break; break;
case St.Side.RIGHT: case St.Side.RIGHT:
childBox.x2 -= rise; childBox.x2 -= rise;
break; break;
} }
this.bin.allocate(childBox, flags); this.bin.allocate(childBox, flags);
@@ -267,7 +264,7 @@ var BoxPointer = GObject.registerClass({
let borderRadius = themeNode.get_length('-arrow-border-radius'); let borderRadius = themeNode.get_length('-arrow-border-radius');
let halfBorder = borderWidth / 2; let halfBorder = borderWidth / 2;
let halfBase = Math.floor(base / 2); let halfBase = Math.floor(base/2);
let backgroundColor = themeNode.get_color('-arrow-background-color'); let backgroundColor = themeNode.get_color('-arrow-background-color');
@@ -348,7 +345,7 @@ var BoxPointer = GObject.registerClass({
if (!skipTopRight) { if (!skipTopRight) {
cr.lineTo(x2 - borderRadius, y1); cr.lineTo(x2 - borderRadius, y1);
cr.arc(x2 - borderRadius, y1 + borderRadius, borderRadius, cr.arc(x2 - borderRadius, y1 + borderRadius, borderRadius,
3 * Math.PI / 2, Math.PI * 2); 3*Math.PI/2, Math.PI*2);
} }
if (this._arrowSide == St.Side.RIGHT && rise) { if (this._arrowSide == St.Side.RIGHT && rise) {
@@ -369,7 +366,7 @@ var BoxPointer = GObject.registerClass({
if (!skipBottomRight) { if (!skipBottomRight) {
cr.lineTo(x2, y2 - borderRadius); cr.lineTo(x2, y2 - borderRadius);
cr.arc(x2 - borderRadius, y2 - borderRadius, borderRadius, cr.arc(x2 - borderRadius, y2 - borderRadius, borderRadius,
0, Math.PI / 2); 0, Math.PI/2);
} }
if (this._arrowSide == St.Side.BOTTOM && rise) { if (this._arrowSide == St.Side.BOTTOM && rise) {
@@ -390,7 +387,7 @@ var BoxPointer = GObject.registerClass({
if (!skipBottomLeft) { if (!skipBottomLeft) {
cr.lineTo(x1 + borderRadius, y2); cr.lineTo(x1 + borderRadius, y2);
cr.arc(x1 + borderRadius, y2 - borderRadius, borderRadius, cr.arc(x1 + borderRadius, y2 - borderRadius, borderRadius,
Math.PI / 2, Math.PI); Math.PI/2, Math.PI);
} }
if (this._arrowSide == St.Side.LEFT && rise) { if (this._arrowSide == St.Side.LEFT && rise) {
@@ -399,7 +396,7 @@ var BoxPointer = GObject.registerClass({
cr.lineTo(x1 - rise, y1); cr.lineTo(x1 - rise, y1);
cr.lineTo(x1 + borderRadius, y1); cr.lineTo(x1 + borderRadius, y1);
} else if (skipBottomLeft) { } else if (skipBottomLeft) {
cr.lineTo(x1 - rise, y2); cr.lineTo(x1 - rise, y2)
cr.lineTo(x1 - rise, y2 - halfBase); cr.lineTo(x1 - rise, y2 - halfBase);
} else { } else {
cr.lineTo(x1, this._arrowOrigin + halfBase); cr.lineTo(x1, this._arrowOrigin + halfBase);
@@ -411,7 +408,7 @@ var BoxPointer = GObject.registerClass({
if (!skipTopLeft) { if (!skipTopLeft) {
cr.lineTo(x1, y1 + borderRadius); cr.lineTo(x1, y1 + borderRadius);
cr.arc(x1 + borderRadius, y1 + borderRadius, borderRadius, cr.arc(x1 + borderRadius, y1 + borderRadius, borderRadius,
Math.PI, 3 * Math.PI / 2); Math.PI, 3*Math.PI/2);
} }
Clutter.cairo_set_source_color(cr, backgroundColor); Clutter.cairo_set_source_color(cr, backgroundColor);
@@ -440,7 +437,7 @@ var BoxPointer = GObject.registerClass({
this._sourceActorDestroyId = this._sourceActor.connect('destroy', () => { this._sourceActorDestroyId = this._sourceActor.connect('destroy', () => {
this._sourceActor = null; this._sourceActor = null;
delete this._sourceActorDestroyId; delete this._sourceActorDestroyId;
}); })
} }
} }
@@ -472,7 +469,7 @@ var BoxPointer = GObject.registerClass({
let sourceAllocation = this._sourceAllocation; let sourceAllocation = this._sourceAllocation;
let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment; let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment;
let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment; let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment;
let [, , natWidth, natHeight] = this.get_preferred_size(); let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size();
// We also want to keep it onscreen, and separated from the // We also want to keep it onscreen, and separated from the
// edge by the same distance as the main part of the box is // edge by the same distance as the main part of the box is
@@ -516,7 +513,7 @@ var BoxPointer = GObject.registerClass({
// of the box to maintain the arrow's accuracy. // of the box to maintain the arrow's accuracy.
let arrowOrigin; let arrowOrigin;
let halfBase = Math.floor(arrowBase / 2); let halfBase = Math.floor(arrowBase/2);
let halfBorder = borderWidth / 2; let halfBorder = borderWidth / 2;
let halfMargin = margin / 2; let halfMargin = margin / 2;
let [x1, y1] = [halfBorder, halfBorder]; let [x1, y1] = [halfBorder, halfBorder];
@@ -597,7 +594,7 @@ var BoxPointer = GObject.registerClass({
_calculateArrowSide(arrowSide) { _calculateArrowSide(arrowSide) {
let sourceAllocation = this._sourceAllocation; let sourceAllocation = this._sourceAllocation;
let [, , boxWidth, boxHeight] = this.get_preferred_size(); let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size();
let workarea = this._workArea; let workarea = this._workArea;
switch (arrowSide) { switch (arrowSide) {

View File

@@ -1,7 +1,6 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Calendar, CalendarMessageList */
const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi; const { Clutter, Gio, GLib, Shell, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
const Main = imports.ui.main; const Main = imports.ui.main;
@@ -18,7 +17,7 @@ var ELLIPSIS_CHAR = '\u2026';
var MESSAGE_ICON_SIZE = -1; // pick up from CSS var MESSAGE_ICON_SIZE = -1; // pick up from CSS
var NC_ = (context, str) => `${context}\u0004${str}`; var NC_ = (context, str) => context + '\u0004' + str;
function sameYear(dateA, dateB) { function sameYear(dateA, dateB) {
return (dateA.getYear() == dateB.getYear()); return (dateA.getYear() == dateB.getYear());
@@ -39,7 +38,7 @@ function isToday(date) {
function _isWorkDay(date) { function _isWorkDay(date) {
/* Translators: Enter 0-6 (Sunday-Saturday) for non-work days. Examples: "0" (Sunday) "6" (Saturday) "06" (Sunday and Saturday). */ /* Translators: Enter 0-6 (Sunday-Saturday) for non-work days. Examples: "0" (Sunday) "6" (Saturday) "06" (Sunday and Saturday). */
let days = C_('calendar-no-work', "06"); let days = C_('calendar-no-work', "06");
return !days.includes(date.getDay().toString()); return days.indexOf(date.getDay().toString()) == -1;
} }
function _getBeginningOfDay(date) { function _getBeginningOfDay(date) {
@@ -110,15 +109,15 @@ var EmptyEventSource = class EmptyEventSource {
destroy() { destroy() {
} }
requestRange(_begin, _end) { requestRange(begin, end) {
} }
getEvents(_begin, _end) { getEvents(begin, end) {
let result = []; let result = [];
return result; return result;
} }
hasEvents(_day) { hasEvents(day) {
return false; return false;
} }
}; };
@@ -144,7 +143,8 @@ function _datesEqual(a, b) {
return true; return true;
} }
function _dateIntervalsOverlap(a0, a1, b0, b1) { function _dateIntervalsOverlap(a0, a1, b0, b1)
{
if (a1 <= b0) if (a1 <= b0)
return false; return false;
else if (b1 <= a0) else if (b1 <= a0)
@@ -168,7 +168,7 @@ var DBusEventSource = class DBusEventSource {
try { try {
this._dbusProxy.init_finish(result); this._dbusProxy.init_finish(result);
loaded = true; loaded = true;
} catch (e) { } catch(e) {
if (e.matches(Gio.DBusError, Gio.DBusError.TIMED_OUT)) { if (e.matches(Gio.DBusError, Gio.DBusError.TIMED_OUT)) {
// Ignore timeouts and install signals as normal, because with high // Ignore timeouts and install signals as normal, because with high
// probability the service will appear later on, and we will get a // probability the service will appear later on, and we will get a
@@ -178,7 +178,7 @@ var DBusEventSource = class DBusEventSource {
// about the HasCalendars property and would cause an exception trying // about the HasCalendars property and would cause an exception trying
// to read it) // to read it)
} else { } else {
log(`Error loading calendars: ${e.message}`); log('Error loading calendars: ' + e.message);
return; return;
} }
} }
@@ -221,13 +221,13 @@ var DBusEventSource = class DBusEventSource {
this._lastRequestEnd = null; this._lastRequestEnd = null;
} }
_onNameAppeared() { _onNameAppeared(owner) {
this._initialized = true; this._initialized = true;
this._resetCache(); this._resetCache();
this._loadEvents(true); this._loadEvents(true);
} }
_onNameVanished() { _onNameVanished(oldOwner) {
this._resetCache(); this._resetCache();
this.emit('changed'); this.emit('changed');
} }
@@ -236,20 +236,22 @@ var DBusEventSource = class DBusEventSource {
this._loadEvents(false); this._loadEvents(false);
} }
_onEventsReceived(results, _error) { _onEventsReceived(results, error) {
let newEvents = []; let newEvents = [];
let appointments = results[0] || []; let appointments = results ? results[0] : null;
for (let n = 0; n < appointments.length; n++) { if (appointments != null) {
let a = appointments[n]; for (let n = 0; n < appointments.length; n++) {
let date = new Date(a[4] * 1000); let a = appointments[n];
let end = new Date(a[5] * 1000); let date = new Date(a[4] * 1000);
let id = a[0]; let end = new Date(a[5] * 1000);
let summary = a[1]; let id = a[0];
let allDay = a[3]; let summary = a[1];
let event = new CalendarEvent(id, date, end, summary, allDay); let allDay = a[3];
newEvents.push(event); let event = new CalendarEvent(id, date, end, summary, allDay);
newEvents.push(event);
}
newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
} }
newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
this._events = newEvents; this._events = newEvents;
this.isLoading = false; this.isLoading = false;
@@ -261,7 +263,7 @@ var DBusEventSource = class DBusEventSource {
if (!this._initialized) if (!this._initialized)
return; return;
if (this._curRequestBegin && this._curRequestEnd) { if (this._curRequestBegin && this._curRequestEnd){
this._dbusProxy.GetEventsRemote(this._curRequestBegin.getTime() / 1000, this._dbusProxy.GetEventsRemote(this._curRequestBegin.getTime() / 1000,
this._curRequestEnd.getTime() / 1000, this._curRequestEnd.getTime() / 1000,
forceReload, forceReload,
@@ -283,7 +285,7 @@ var DBusEventSource = class DBusEventSource {
getEvents(begin, end) { getEvents(begin, end) {
let result = []; let result = [];
for (let n = 0; n < this._events.length; n++) { for(let n = 0; n < this._events.length; n++) {
let event = this._events[n]; let event = this._events[n];
if (_dateIntervalsOverlap (event.date, event.end, begin, end)) { if (_dateIntervalsOverlap (event.date, event.end, begin, end)) {
@@ -318,7 +320,7 @@ var Calendar = class Calendar {
this._weekStart = Shell.util_get_week_start(); this._weekStart = Shell.util_get_week_start();
this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.calendar' }); this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.calendar' });
this._settings.connect(`changed::${SHOW_WEEKDATE_KEY}`, this._onSettingsChange.bind(this)); this._settings.connect('changed::' + SHOW_WEEKDATE_KEY, this._onSettingsChange.bind(this));
this._useWeekdate = this._settings.get_boolean(SHOW_WEEKDATE_KEY); this._useWeekdate = this._settings.get_boolean(SHOW_WEEKDATE_KEY);
/** /**
@@ -400,8 +402,8 @@ var Calendar = class Calendar {
this._topBox.add(this._backButton); this._topBox.add(this._backButton);
this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this)); this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this));
this._monthLabel = new St.Label({ style_class: 'calendar-month-label', this._monthLabel = new St.Label({style_class: 'calendar-month-label',
can_focus: true }); can_focus: true });
this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE }); this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE });
this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button', this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button',
@@ -464,7 +466,8 @@ var Calendar = class Calendar {
let day = 32 - new Date(newDate.getFullYear() - 1, 11, 32).getDate(); let day = 32 - new Date(newDate.getFullYear() - 1, 11, 32).getDate();
newDate = new Date(newDate.getFullYear() - 1, 11, day); newDate = new Date(newDate.getFullYear() - 1, 11, day);
} }
} else { }
else {
newDate.setMonth(oldMonth - 1); newDate.setMonth(oldMonth - 1);
if (newDate.getMonth() != oldMonth - 1) { if (newDate.getMonth() != oldMonth - 1) {
let day = 32 - new Date(newDate.getFullYear(), oldMonth - 1, 32).getDate(); let day = 32 - new Date(newDate.getFullYear(), oldMonth - 1, 32).getDate();
@@ -487,7 +490,8 @@ var Calendar = class Calendar {
let day = 32 - new Date(newDate.getFullYear() + 1, 0, 32).getDate(); let day = 32 - new Date(newDate.getFullYear() + 1, 0, 32).getDate();
newDate = new Date(newDate.getFullYear() + 1, 0, day); newDate = new Date(newDate.getFullYear() + 1, 0, day);
} }
} else { }
else {
newDate.setMonth(oldMonth + 1); newDate.setMonth(oldMonth + 1);
if (newDate.getMonth() != oldMonth + 1) { if (newDate.getMonth() != oldMonth + 1) {
let day = 32 - new Date(newDate.getFullYear(), oldMonth + 1, 32).getDate(); let day = 32 - new Date(newDate.getFullYear(), oldMonth + 1, 32).getDate();
@@ -542,6 +546,8 @@ var Calendar = class Calendar {
this._calendarBegin = new Date(beginDate); this._calendarBegin = new Date(beginDate);
this._markedAsToday = now; this._markedAsToday = now;
let year = beginDate.getYear();
let daysToWeekStart = (7 + beginDate.getDay() - this._weekStart) % 7; let daysToWeekStart = (7 + beginDate.getDay() - this._weekStart) % 7;
let startsOnWeekStart = daysToWeekStart == 0; let startsOnWeekStart = daysToWeekStart == 0;
let weekPadding = startsOnWeekStart ? 7 : 0; let weekPadding = startsOnWeekStart ? 7 : 0;
@@ -553,7 +559,7 @@ var Calendar = class Calendar {
let row = 2; let row = 2;
// nRows here means 6 weeks + one header + one navbar // nRows here means 6 weeks + one header + one navbar
let nRows = 8; let nRows = 8;
while (row < nRows) { while (row < 8) {
// xgettext:no-javascript-format // xgettext:no-javascript-format
let button = new St.Button({ label: iter.toLocaleFormat(C_("date day number format", "%d")), let button = new St.Button({ label: iter.toLocaleFormat(C_("date day number format", "%d")),
can_focus: true }); can_focus: true });
@@ -579,13 +585,12 @@ var Calendar = class Calendar {
// Hack used in lieu of border-collapse - see gnome-shell.css // Hack used in lieu of border-collapse - see gnome-shell.css
if (row == 2) if (row == 2)
styleClass = `calendar-day-top ${styleClass}`; styleClass = 'calendar-day-top ' + styleClass;
let leftMost = rtl let leftMost = rtl ? iter.getDay() == (this._weekStart + 6) % 7
? iter.getDay() == (this._weekStart + 6) % 7 : iter.getDay() == this._weekStart;
: iter.getDay() == this._weekStart;
if (leftMost) if (leftMost)
styleClass = `calendar-day-left ${styleClass}`; styleClass = 'calendar-day-left ' + styleClass;
if (sameDay(now, iter)) if (sameDay(now, iter))
styleClass += ' calendar-today'; styleClass += ' calendar-today';
@@ -643,9 +648,9 @@ var Calendar = class Calendar {
button.add_style_pseudo_class('selected'); button.add_style_pseudo_class('selected');
if (this._shouldDateGrabFocus) if (this._shouldDateGrabFocus)
button.grab_key_focus(); button.grab_key_focus();
} else {
button.remove_style_pseudo_class('selected');
} }
else
button.remove_style_pseudo_class('selected');
}); });
} }
}; };
@@ -681,24 +686,23 @@ var EventMessage = class EventMessage extends MessageList.Message {
*/ */
title = C_("event list time", "All Day"); title = C_("event list time", "All Day");
} else { } else {
let date = this._event.date >= periodBegin let date = this._event.date >= periodBegin ? this._event.date
? this._event.date : this._event.end;
: this._event.end;
title = Util.formatTime(date, { timeOnly: true }); title = Util.formatTime(date, { timeOnly: true });
} }
let rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL; let rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL;
if (this._event.date < periodBegin && !this._event.allDay) { if (this._event.date < periodBegin && !this._event.allDay) {
if (rtl) if (rtl)
title = `${title}${ELLIPSIS_CHAR}`; title = title + ELLIPSIS_CHAR;
else else
title = `${ELLIPSIS_CHAR}${title}`; title = ELLIPSIS_CHAR + title;
} }
if (this._event.end > periodEnd && !this._event.allDay) { if (this._event.end > periodEnd && !this._event.allDay) {
if (rtl) if (rtl)
title = `${ELLIPSIS_CHAR}${title}`; title = ELLIPSIS_CHAR + title;
else else
title = `${title}${ELLIPSIS_CHAR}`; title = title + ELLIPSIS_CHAR;
} }
return title; return title;
} }
@@ -737,7 +741,7 @@ class NotificationMessage extends MessageList.Message {
return this.notification.source.createIcon(MESSAGE_ICON_SIZE); return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
} }
_onUpdated(n, _clear) { _onUpdated(n, clear) {
this.setIcon(this._getIcon()); this.setIcon(this._getIcon());
this.setTitle(n.title); this.setTitle(n.title);
this.setBody(n.bannerBodyText); this.setBody(n.bannerBodyText);
@@ -1073,14 +1077,10 @@ var CalendarMessageList = class CalendarMessageList {
this._clearButton.set_x_align(Clutter.ActorAlign.END); this._clearButton.set_x_align(Clutter.ActorAlign.END);
this._clearButton.connect('clicked', () => { this._clearButton.connect('clicked', () => {
let sections = [...this._sections.keys()]; let sections = [...this._sections.keys()];
sections.forEach(s => s.clear()); sections.forEach((s) => { s.clear(); });
}); });
box.add_actor(this._clearButton); box.add_actor(this._clearButton);
this._placeholder.actor.bind_property('visible',
this._clearButton, 'visible',
GObject.BindingFlags.INVERT_BOOLEAN);
this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections', this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections',
vertical: true, vertical: true,
y_expand: true, y_expand: true,
@@ -1103,7 +1103,7 @@ var CalendarMessageList = class CalendarMessageList {
_addSection(section) { _addSection(section) {
let obj = { let obj = {
destroyId: 0, destroyId: 0,
visibleId: 0, visibleId: 0,
emptyChangedId: 0, emptyChangedId: 0,
canClearChangedId: 0, canClearChangedId: 0,
keyFocusId: 0 keyFocusId: 0
@@ -1151,6 +1151,7 @@ var CalendarMessageList = class CalendarMessageList {
let empty = sections.every(s => s.empty || !s.actor.visible); let empty = sections.every(s => s.empty || !s.actor.visible);
this._placeholder.actor.visible = empty; this._placeholder.actor.visible = empty;
this._clearButton.visible = !empty;
let canClear = sections.some(s => s.canClear && s.actor.visible); let canClear = sections.some(s => s.canClear && s.actor.visible);
this._clearButton.reactive = canClear; this._clearButton.reactive = canClear;

View File

@@ -1,4 +1,3 @@
/* exported CheckBox */
const { Clutter, Pango, St } = imports.gi; const { Clutter, Pango, St } = imports.gi;
var CheckBox = class CheckBox { var CheckBox = class CheckBox {

View File

@@ -1,17 +1,17 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported CloseDialog */
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;
const Dialog = imports.ui.dialog; const Dialog = imports.ui.dialog;
const Main = imports.ui.main; const Main = imports.ui.main;
const Tweener = imports.ui.tweener;
var FROZEN_WINDOW_BRIGHTNESS = -0.3; var FROZEN_WINDOW_BRIGHTNESS = -0.3
var DIALOG_TRANSITION_TIME = 150; var DIALOG_TRANSITION_TIME = 0.15
var ALIVE_TIMEOUT = 5000; var ALIVE_TIMEOUT = 5000;
var CloseDialog = GObject.registerClass({ var CloseDialog = GObject.registerClass({
Implements: [Meta.CloseDialog], Implements: [ Meta.CloseDialog ],
Properties: { Properties: {
'window': GObject.ParamSpec.override('window', Meta.CloseDialog) 'window': GObject.ParamSpec.override('window', Meta.CloseDialog)
}, },
@@ -46,18 +46,6 @@ var CloseDialog = GObject.registerClass({
return new Dialog.MessageDialogContent({ icon, title, subtitle }); return new Dialog.MessageDialogContent({ icon, title, subtitle });
} }
_updateScale() {
// Since this is a child of MetaWindowActor (which, for Wayland clients,
// applies the geometry scale factor to its children itself, see
// meta_window_actor_set_geometry_scale()), make sure we don't apply
// the factor twice in the end.
if (this._window.get_client_type() !== Meta.WindowClientType.WAYLAND)
return;
let { scaleFactor } = St.ThemeContext.get_for_stage(global.stage);
this._dialog.set_scale(1 / scaleFactor, 1 / scaleFactor);
}
_initDialog() { _initDialog() {
if (this._dialog) if (this._dialog)
return; return;
@@ -68,19 +56,14 @@ var CloseDialog = GObject.registerClass({
this._dialog.height = windowActor.height; this._dialog.height = windowActor.height;
this._dialog.addContent(this._createDialogContent()); this._dialog.addContent(this._createDialogContent());
this._dialog.addButton({ label: _('Force Quit'), this._dialog.addButton({ label: _('Force Quit'),
action: this._onClose.bind(this), action: this._onClose.bind(this),
default: true }); default: true });
this._dialog.addButton({ label: _('Wait'), this._dialog.addButton({ label: _('Wait'),
action: this._onWait.bind(this), action: this._onWait.bind(this),
key: Clutter.Escape }); key: Clutter.Escape });
global.focus_manager.add_group(this._dialog); global.focus_manager.add_group(this._dialog);
let themeContext = St.ThemeContext.get_for_stage(global.stage);
themeContext.connect('notify::scale-factor', this._updateScale.bind(this));
this._updateScale();
} }
_addWindowEffect() { _addWindowEffect() {
@@ -162,15 +145,15 @@ var CloseDialog = GObject.registerClass({
this._addWindowEffect(); this._addWindowEffect();
this._initDialog(); this._initDialog();
this._dialog._dialog.scale_y = 0; this._dialog.scale_y = 0;
this._dialog._dialog.set_pivot_point(0.5, 0.5); this._dialog.set_pivot_point(0.5, 0.5);
this._dialog._dialog.ease({ Tweener.addTween(this._dialog,
scale_y: 1, { scale_y: 1,
mode: Clutter.AnimationMode.LINEAR, transition: 'linear',
duration: DIALOG_TRANSITION_TIME, time: DIALOG_TRANSITION_TIME,
onComplete: this._onFocusChanged.bind(this) onComplete: this._onFocusChanged.bind(this)
}); });
} }
vfunc_hide() { vfunc_hide() {
@@ -182,7 +165,7 @@ var CloseDialog = GObject.registerClass({
GLib.source_remove(this._timeoutId); GLib.source_remove(this._timeoutId);
this._timeoutId = 0; this._timeoutId = 0;
global.display.disconnect(this._windowFocusChangedId); global.display.disconnect(this._windowFocusChangedId)
this._windowFocusChangedId = 0; this._windowFocusChangedId = 0;
global.stage.disconnect(this._keyFocusChangedId); global.stage.disconnect(this._keyFocusChangedId);
@@ -192,12 +175,14 @@ var CloseDialog = GObject.registerClass({
this._dialog = null; this._dialog = null;
this._removeWindowEffect(); this._removeWindowEffect();
dialog._dialog.ease({ Tweener.addTween(dialog,
scale_y: 0, { scale_y: 0,
mode: Clutter.AnimationMode.LINEAR, transition: 'linear',
duration: DIALOG_TRANSITION_TIME, time: DIALOG_TRANSITION_TIME,
onComplete: () => dialog.destroy() onComplete: () => {
}); dialog.destroy();
}
});
} }
vfunc_focus() { vfunc_focus() {

View File

@@ -1,4 +1,3 @@
/* exported ComponentManager */
const Main = imports.ui.main; const Main = imports.ui.main;
var ComponentManager = class { var ComponentManager = class {
@@ -14,13 +13,13 @@ var ComponentManager = class {
let newEnabledComponents = Main.sessionMode.components; let newEnabledComponents = Main.sessionMode.components;
newEnabledComponents.filter( newEnabledComponents.filter(
name => !this._enabledComponents.includes(name) name => this._enabledComponents.indexOf(name) == -1
).forEach(name => { ).forEach(name => {
this._enableComponent(name); this._enableComponent(name);
}); });
this._enabledComponents.filter( this._enabledComponents.filter(
name => !newEnabledComponents.includes(name) name => newEnabledComponents.indexOf(name) == -1
).forEach(name => { ).forEach(name => {
this._disableComponent(name); this._disableComponent(name);
}); });
@@ -38,8 +37,8 @@ var ComponentManager = class {
if (component) if (component)
return component; return component;
if (Main.sessionMode.isLocked) if (Main.sessionMode.isLocked)
return null; return null;
let constructor = this._importComponent(name); let constructor = this._importComponent(name);
component = new constructor(); component = new constructor();
@@ -49,7 +48,7 @@ var ComponentManager = class {
_enableComponent(name) { _enableComponent(name) {
let component = this._ensureComponent(name); let component = this._ensureComponent(name);
if (component) if (component)
component.enable(); component.enable();
} }

View File

@@ -1,7 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Component */
const { Gio, GLib } = imports.gi; const { Gio, GLib } = imports.gi;
const Mainloop = imports.mainloop;
const Params = imports.misc.params; const Params = imports.misc.params;
const GnomeSession = imports.misc.gnomeSession; const GnomeSession = imports.misc.gnomeSession;
@@ -38,7 +38,7 @@ var AutomountManager = class {
this._driveDisconnectedId = this._volumeMonitor.connect('drive-disconnected', this._onDriveDisconnected.bind(this)); this._driveDisconnectedId = this._volumeMonitor.connect('drive-disconnected', this._onDriveDisconnected.bind(this));
this._driveEjectButtonId = this._volumeMonitor.connect('drive-eject-button', this._onDriveEjectButton.bind(this)); this._driveEjectButtonId = this._volumeMonitor.connect('drive-eject-button', this._onDriveEjectButton.bind(this));
this._mountAllId = GLib.idle_add(GLib.PRIORITY_DEFAULT, this._startupMountAll.bind(this)); this._mountAllId = Mainloop.idle_add(this._startupMountAll.bind(this));
GLib.Source.set_name_by_id(this._mountAllId, '[gnome-shell] this._startupMountAll'); GLib.Source.set_name_by_id(this._mountAllId, '[gnome-shell] this._startupMountAll');
} }
@@ -50,12 +50,12 @@ var AutomountManager = class {
this._volumeMonitor.disconnect(this._driveEjectButtonId); this._volumeMonitor.disconnect(this._driveEjectButtonId);
if (this._mountAllId > 0) { if (this._mountAllId > 0) {
GLib.source_remove(this._mountAllId); Mainloop.source_remove(this._mountAllId);
this._mountAllId = 0; this._mountAllId = 0;
} }
} }
_InhibitorsChanged(_object, _senderName, [_inhibitor]) { _InhibitorsChanged(object, senderName, [inhibtor]) {
this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT, this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
(result, error) => { (result, error) => {
if (!error) { if (!error) {
@@ -109,23 +109,25 @@ var AutomountManager = class {
// we force stop/eject in this case, so we don't have to pass a // we force stop/eject in this case, so we don't have to pass a
// mount operation object // mount operation object
if (drive.can_stop()) { if (drive.can_stop()) {
drive.stop(Gio.MountUnmountFlags.FORCE, null, null, drive.stop
(drive, res) => { (Gio.MountUnmountFlags.FORCE, null, null,
try { (drive, res) => {
drive.stop_finish(res); try {
} catch (e) { drive.stop_finish(res);
log(`Unable to stop the drive after drive-eject-button ${e.toString()}`); } catch (e) {
} log("Unable to stop the drive after drive-eject-button " + e.toString());
}); }
});
} else if (drive.can_eject()) { } else if (drive.can_eject()) {
drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null, drive.eject_with_operation
(drive, res) => { (Gio.MountUnmountFlags.FORCE, null, null,
try { (drive, res) => {
drive.eject_with_operation_finish(res); try {
} catch (e) { drive.eject_with_operation_finish(res);
log(`Unable to eject the drive after drive-eject-button ${e.toString()}`); } catch (e) {
} log("Unable to eject the drive after drive-eject-button " + e.toString());
}); }
});
} }
} }
@@ -211,7 +213,7 @@ var AutomountManager = class {
} }
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.FAILED_HANDLED)) if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.FAILED_HANDLED))
log(`Unable to mount volume ${volume.get_name()}: ${e.toString()}`); log('Unable to mount volume ' + volume.get_name() + ': ' + e.toString());
this._closeOperation(volume); this._closeOperation(volume);
} }
} }
@@ -219,7 +221,7 @@ var AutomountManager = class {
_onVolumeRemoved(monitor, volume) { _onVolumeRemoved(monitor, volume) {
if (volume._allowAutorunExpireId && volume._allowAutorunExpireId > 0) { if (volume._allowAutorunExpireId && volume._allowAutorunExpireId > 0) {
GLib.source_remove(volume._allowAutorunExpireId); Mainloop.source_remove(volume._allowAutorunExpireId);
delete volume._allowAutorunExpireId; delete volume._allowAutorunExpireId;
} }
this._volumeQueue = this._volumeQueue =
@@ -248,7 +250,7 @@ var AutomountManager = class {
} }
_allowAutorunExpire(volume) { _allowAutorunExpire(volume) {
let id = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, AUTORUN_EXPIRE_TIMEOUT_SECS, () => { let id = Mainloop.timeout_add_seconds(AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
volume.allowAutorun = false; volume.allowAutorun = false;
delete volume._allowAutorunExpireId; delete volume._allowAutorunExpireId;
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Component */
const { Gio, St } = imports.gi; const { Gio, St } = imports.gi;
@@ -41,7 +40,7 @@ function isMountRootHidden(root) {
let path = root.get_path(); let path = root.get_path();
// skip any mounts in hidden directory hierarchies // skip any mounts in hidden directory hierarchies
return (path.includes('/.')); return (path.indexOf('/.') != -1);
} }
function isMountNonLocal(mount) { function isMountNonLocal(mount) {
@@ -66,12 +65,15 @@ function startAppForMount(app, mount) {
retval = app.launch(files, retval = app.launch(files,
global.create_app_launch_context(0, -1)); global.create_app_launch_context(0, -1));
} catch (e) { } catch (e) {
log(`Unable to launch the application ${app.get_name()}: ${e}`); log('Unable to launch the application ' + app.get_name()
+ ': ' + e.toString());
} }
return retval; return retval;
} }
/******************************************/
const HotplugSnifferIface = loadInterfaceXML('org.gnome.Shell.HotplugSniffer'); const HotplugSnifferIface = loadInterfaceXML('org.gnome.Shell.HotplugSniffer');
const HotplugSnifferProxy = Gio.DBusProxy.makeProxyWrapper(HotplugSnifferIface); const HotplugSnifferProxy = Gio.DBusProxy.makeProxyWrapper(HotplugSnifferIface);
function HotplugSniffer() { function HotplugSniffer() {
@@ -105,7 +107,8 @@ var ContentTypeDiscoverer = class {
try { try {
contentTypes = mount.guess_content_type_finish(res); contentTypes = mount.guess_content_type_finish(res);
} catch (e) { } catch (e) {
log(`Unable to guess content types on added mount ${mount.get_name()}: ${e}`); log('Unable to guess content types on added mount ' + mount.get_name()
+ ': ' + e.toString());
} }
if (contentTypes.length) { if (contentTypes.length) {
@@ -115,13 +118,16 @@ var ContentTypeDiscoverer = class {
let hotplugSniffer = new HotplugSniffer(); let hotplugSniffer = new HotplugSniffer();
hotplugSniffer.SniffURIRemote(root.get_uri(), hotplugSniffer.SniffURIRemote(root.get_uri(),
([contentTypes]) => { ([contentTypes]) => {
this._emitCallback(mount, contentTypes); this._emitCallback(mount, contentTypes);
}); });
} }
} }
_emitCallback(mount, contentTypes = []) { _emitCallback(mount, contentTypes) {
if (!contentTypes)
contentTypes = [];
// we're not interested in win32 software content types here // we're not interested in win32 software content types here
contentTypes = contentTypes.filter( contentTypes = contentTypes.filter(
type => (type != 'x-content/win32-software') type => (type != 'x-content/win32-software')
@@ -186,15 +192,15 @@ var AutorunDispatcher = class {
_getAutorunSettingForType(contentType) { _getAutorunSettingForType(contentType) {
let runApp = this._settings.get_strv(SETTING_START_APP); let runApp = this._settings.get_strv(SETTING_START_APP);
if (runApp.includes(contentType)) if (runApp.indexOf(contentType) != -1)
return AutorunSetting.RUN; return AutorunSetting.RUN;
let ignore = this._settings.get_strv(SETTING_IGNORE); let ignore = this._settings.get_strv(SETTING_IGNORE);
if (ignore.includes(contentType)) if (ignore.indexOf(contentType) != -1)
return AutorunSetting.IGNORE; return AutorunSetting.IGNORE;
let openFiles = this._settings.get_strv(SETTING_OPEN_FOLDER); let openFiles = this._settings.get_strv(SETTING_OPEN_FOLDER);
if (openFiles.includes(contentType)) if (openFiles.indexOf(contentType) != -1)
return AutorunSetting.FILES; return AutorunSetting.FILES;
return AutorunSetting.ASK; return AutorunSetting.ASK;
@@ -323,10 +329,10 @@ var AutorunNotification = class extends MessageTray.Notification {
style_class: 'hotplug-notification-item-icon' }); style_class: 'hotplug-notification-item-icon' });
box.add(icon); box.add(icon);
let label = new St.Bin({ let label = new St.Bin({ y_align: St.Align.MIDDLE,
y_align: St.Align.MIDDLE, child: new St.Label
child: new St.Label({ text: _("Open with %s").format(app.get_name()) }), ({ text: _("Open with %s").format(app.get_name()) })
}); });
box.add(label); box.add(label);
let button = new St.Button({ child: box, let button = new St.Button({ child: box,

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Component */
const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi; const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi;
@@ -74,9 +73,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true }); ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
this._passwordEntry.clutter_text.connect('activate', this._onPasswordActivate.bind(this)); this._passwordEntry.clutter_text.connect('activate', this._onPasswordActivate.bind(this));
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, { this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
animate: true,
});
if (rtl) { if (rtl) {
layout.attach(this._workSpinner.actor, 0, row, 1, 1); layout.attach(this._workSpinner.actor, 0, row, 1, 1);
@@ -165,7 +162,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
// NOTE: ModalDialog.open() is safe to call if the dialog is // NOTE: ModalDialog.open() is safe to call if the dialog is
// already open - it just returns true without side-effects // already open - it just returns true without side-effects
if (this.open()) if (this.open())
return true; return true;
// The above fail if e.g. unable to get input grab // The above fail if e.g. unable to get input grab
// //
@@ -175,25 +172,25 @@ class KeyringDialog extends ModalDialog.ModalDialog {
log('keyringPrompt: Failed to show modal dialog.' + log('keyringPrompt: Failed to show modal dialog.' +
' Dismissing prompt request'); ' Dismissing prompt request');
this.prompt.cancel(); this.prompt.cancel()
return false; return false;
} }
_onShowPassword() { _onShowPassword(prompt) {
this._buildControlTable(); this._buildControlTable();
this._ensureOpen(); this._ensureOpen();
this._updateSensitivity(true); this._updateSensitivity(true);
this._passwordEntry.grab_key_focus(); this._passwordEntry.grab_key_focus();
} }
_onShowConfirm() { _onShowConfirm(prompt) {
this._buildControlTable(); this._buildControlTable();
this._ensureOpen(); this._ensureOpen();
this._updateSensitivity(true); this._updateSensitivity(true);
this._continueButton.grab_key_focus(); this._continueButton.grab_key_focus();
} }
_onHidePrompt() { _onHidePrompt(prompt) {
this.close(); this.close();
} }
@@ -234,9 +231,8 @@ var KeyringPrompter = class {
constructor() { constructor() {
this._prompter = new Gcr.SystemPrompter(); this._prompter = new Gcr.SystemPrompter();
this._prompter.connect('new-prompt', () => { this._prompter.connect('new-prompt', () => {
let dialog = this._enabled let dialog = this._enabled ? new KeyringDialog()
? new KeyringDialog() : new KeyringDummyDialog();
: new KeyringDummyDialog();
this._currentPrompt = dialog.prompt; this._currentPrompt = dialog.prompt;
return this._currentPrompt; return this._currentPrompt;
}); });

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Component */
const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
@@ -81,9 +80,8 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
secret.valid = secret.value.length > 0; secret.valid = secret.value.length > 0;
this._updateOkButton(); this._updateOkButton();
}); });
} else { } else
secret.valid = true; secret.valid = true;
}
if (rtl) { if (rtl) {
layout.attach(secret.entry, 0, pos, 1, 1); layout.attach(secret.entry, 0, pos, 1, 1);
@@ -107,22 +105,21 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
contentBox.messageBox.add(descriptionLabel, contentBox.messageBox.add(descriptionLabel,
{ y_fill: true, { y_fill: true,
y_align: St.Align.START, y_align: St.Align.START,
expand: true }); expand: true });
} }
this._okButton = { this._okButton = { label: _("Connect"),
label: _("Connect"), action: this._onOk.bind(this),
action: this._onOk.bind(this), default: true
default: true, };
};
this.setButtons([{ this.setButtons([{ label: _("Cancel"),
label: _("Cancel"), action: this.cancel.bind(this),
action: this.cancel.bind(this), key: Clutter.KEY_Escape,
key: Clutter.KEY_Escape, },
}, this._okButton]); this._okButton]);
this._updateOkButton(); this._updateOkButton();
} }
@@ -164,9 +161,9 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
if (value.length == 64) { if (value.length == 64) {
// must be composed of hexadecimal digits only // must be composed of hexadecimal digits only
for (let i = 0; i < 64; i++) { for (let i = 0; i < 64; i++) {
if (!((value[i] >= 'a' && value[i] <= 'f') || if (!((value[i] >= 'a' && value[i] <= 'f')
(value[i] >= 'A' && value[i] <= 'F') || || (value[i] >= 'A' && value[i] <= 'F')
(value[i] >= '0' && value[i] <= '9'))) || (value[i] >= '0' && value[i] <= '9')))
return false; return false;
} }
return true; return true;
@@ -179,29 +176,28 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
let value = secret.value; let value = secret.value;
if (secret.wep_key_type == NM.WepKeyType.KEY) { if (secret.wep_key_type == NM.WepKeyType.KEY) {
if (value.length == 10 || value.length == 26) { if (value.length == 10 || value.length == 26) {
for (let i = 0; i < value.length; i++) { for (let i = 0; i < value.length; i++) {
if (!((value[i] >= 'a' && value[i] <= 'f') || if (!((value[i] >= 'a' && value[i] <= 'f')
(value[i] >= 'A' && value[i] <= 'F') || || (value[i] >= 'A' && value[i] <= 'F')
(value[i] >= '0' && value[i] <= '9'))) || (value[i] >= '0' && value[i] <= '9')))
return false;
}
} else if (value.length == 5 || value.length == 13) {
for (let i = 0; i < value.length; i++) {
if (!((value[i] >= 'a' && value[i] <= 'z')
|| (value[i] >= 'A' && value[i] <= 'Z')))
return false; return false;
} }
} else if (value.length == 5 || value.length == 13) { } else
for (let i = 0; i < value.length; i++) {
if (!((value[i] >= 'a' && value[i] <= 'z') ||
(value[i] >= 'A' && value[i] <= 'Z')))
return false;
}
} else {
return false; return false;
} } else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) {
} else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) { if (value.length < 0 || value.length > 64)
if (value.length < 0 || value.length > 64) return false;
return false; }
}
return true; return true;
} }
_getWirelessSecrets(secrets, _wirelessSetting) { _getWirelessSecrets(secrets, wirelessSetting) {
let wirelessSecuritySetting = this._connection.get_setting_wireless_security(); let wirelessSecuritySetting = this._connection.get_setting_wireless_security();
if (this._settingName == '802-1x') { if (this._settingName == '802-1x') {
@@ -213,13 +209,12 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
// First the easy ones // First the easy ones
case 'wpa-none': case 'wpa-none':
case 'wpa-psk': case 'wpa-psk':
case 'sae':
secrets.push({ label: _("Password: "), key: 'psk', secrets.push({ label: _("Password: "), key: 'psk',
value: wirelessSecuritySetting.psk || '', value: wirelessSecuritySetting.psk || '',
validate: this._validateWpaPsk, password: true }); validate: this._validateWpaPsk, password: true });
break; break;
case 'none': // static WEP case 'none': // static WEP
secrets.push({ label: _("Key: "), key: `wep-key${wirelessSecuritySetting.wep_tx_keyidx}`, secrets.push({ label: _("Key: "), key: 'wep-key' + wirelessSecuritySetting.wep_tx_keyidx,
value: wirelessSecuritySetting.get_wep_key(wirelessSecuritySetting.wep_tx_keyidx) || '', value: wirelessSecuritySetting.get_wep_key(wirelessSecuritySetting.wep_tx_keyidx) || '',
wep_key_type: wirelessSecuritySetting.wep_key_type, wep_key_type: wirelessSecuritySetting.wep_key_type,
validate: this._validateStaticWep, password: true }); validate: this._validateStaticWep, password: true });
@@ -235,12 +230,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
this._get8021xSecrets(secrets); this._get8021xSecrets(secrets);
break; break;
default: default:
log(`Invalid wireless key management: ${wirelessSecuritySetting.key_mgmt}`); log('Invalid wireless key management: ' + wirelessSecuritySetting.key_mgmt);
} }
} }
_get8021xSecrets(secrets) { _get8021xSecrets(secrets) {
let ieee8021xSetting = this._connection.get_setting_802_1x(); let ieee8021xSetting = this._connection.get_setting_802_1x();
let phase2method;
/* If hints were given we know exactly what we need to ask */ /* If hints were given we know exactly what we need to ask */
if (this._settingName == "802-1x" && this._hints.length) { if (this._settingName == "802-1x" && this._hints.length) {
@@ -277,7 +273,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
value: ieee8021xSetting.private_key_password || '', password: true }); value: ieee8021xSetting.private_key_password || '', password: true });
break; break;
default: default:
log(`Invalid EAP/IEEE802.1x method: ${ieee8021xSetting.get_eap_method(0)}`); log('Invalid EAP/IEEE802.1x method: ' + ieee8021xSetting.get_eap_method(0));
} }
} }
@@ -308,7 +304,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
let ssid; let ssid;
let content = { }; let content = { };
content.secrets = []; content.secrets = [ ];
switch (connectionType) { switch (connectionType) {
case '802-11-wireless': case '802-11-wireless':
@@ -331,7 +327,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
this._getPPPoESecrets(content.secrets); this._getPPPoESecrets(content.secrets);
break; break;
case 'gsm': case 'gsm':
if (this._hints.includes('pin')) { if (this._hints.indexOf('pin') != -1) {
let gsmSetting = this._connection.get_setting_gsm(); let gsmSetting = this._connection.get_setting_gsm();
content.title = _("PIN code required"); content.title = _("PIN code required");
content.message = _("PIN code is needed for the mobile broadband device"); content.message = _("PIN code is needed for the mobile broadband device");
@@ -347,8 +343,8 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
this._getMobileSecrets(content.secrets, connectionType); this._getMobileSecrets(content.secrets, connectionType);
break; break;
default: default:
log(`Invalid connection type: ${connectionType}`); log('Invalid connection type: ' + connectionType);
} };
return content; return content;
} }
@@ -363,15 +359,16 @@ var VPNRequestHandler = class {
this._pluginOutBuffer = []; this._pluginOutBuffer = [];
this._title = null; this._title = null;
this._description = null; this._description = null;
this._content = []; this._content = [ ];
this._shellDialog = null; this._shellDialog = null;
let connectionSetting = connection.get_setting_connection(); let connectionSetting = connection.get_setting_connection();
let argv = [authHelper.fileName, let argv = [ authHelper.fileName,
'-u', connectionSetting.uuid, '-u', connectionSetting.uuid,
'-n', connectionSetting.id, '-n', connectionSetting.id,
'-s', serviceType]; '-s', serviceType
];
if (authHelper.externalUIMode) if (authHelper.externalUIMode)
argv.push('--external-ui-mode'); argv.push('--external-ui-mode');
if (flags & NM.SecretAgentGetSecretsFlags.ALLOW_INTERACTION) if (flags & NM.SecretAgentGetSecretsFlags.ALLOW_INTERACTION)
@@ -388,7 +385,7 @@ var VPNRequestHandler = class {
this._newStylePlugin = authHelper.externalUIMode; this._newStylePlugin = authHelper.externalUIMode;
try { try {
let [success_, pid, stdin, stdout, stderr] = let [success, pid, stdin, stdout, stderr] =
GLib.spawn_async_with_pipes(null, /* pwd */ GLib.spawn_async_with_pipes(null, /* pwd */
argv, argv,
null, /* envp */ null, /* envp */
@@ -410,7 +407,7 @@ var VPNRequestHandler = class {
this._vpnChildFinished.bind(this)); this._vpnChildFinished.bind(this));
this._writeConnection(); this._writeConnection();
} catch (e) { } catch(e) {
logError(e, 'error while spawning VPN auth helper'); logError(e, 'error while spawning VPN auth helper');
this._agent.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); this._agent.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
@@ -427,7 +424,7 @@ var VPNRequestHandler = class {
} else { } else {
try { try {
this._stdin.write('QUIT\n\n', null); this._stdin.write('QUIT\n\n', null);
} catch (e) { /* ignore broken pipe errors */ } } catch(e) { /* ignore broken pipe errors */ }
} }
this.destroy(); this.destroy();
@@ -447,7 +444,7 @@ var VPNRequestHandler = class {
this._destroyed = true; this._destroyed = true;
} }
_vpnChildFinished(pid, status, _requestObj) { _vpnChildFinished(pid, status, requestObj) {
this._childWatch = 0; this._childWatch = 0;
if (this._newStylePlugin) { if (this._newStylePlugin) {
// For new style plugin, all work is done in the async reading functions // For new style plugin, all work is done in the async reading functions
@@ -462,9 +459,8 @@ var VPNRequestHandler = class {
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.USER_CANCELED); this._agent.respond(this._requestId, Shell.NetworkAgentResponse.USER_CANCELED);
else else
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.CONFIRMED); this._agent.respond(this._requestId, Shell.NetworkAgentResponse.CONFIRMED);
} else { } else
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
}
this.destroy(); this.destroy();
} }
@@ -477,7 +473,7 @@ var VPNRequestHandler = class {
if (line == '' && this._previousLine == '') { if (line == '' && this._previousLine == '') {
try { try {
this._stdin.write('QUIT\n\n', null); this._stdin.write('QUIT\n\n', null);
} catch (e) { /* ignore broken pipe errors */ } } catch(e) { /* ignore broken pipe errors */ }
} else { } else {
this._agent.set_password(this._requestId, this._previousLine, line); this._agent.set_password(this._requestId, this._previousLine, line);
this._previousLine = undefined; this._previousLine = undefined;
@@ -489,7 +485,7 @@ var VPNRequestHandler = class {
_readStdoutOldStyle() { _readStdoutOldStyle() {
this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => { this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => {
let [line, len_] = this._dataStdout.read_line_finish_utf8(result); let [line, len] = this._dataStdout.read_line_finish_utf8(result);
if (line == null) { if (line == null) {
// end of file // end of file
@@ -544,7 +540,7 @@ var VPNRequestHandler = class {
message: keyfile.get_string(VPN_UI_GROUP, 'Description'), message: keyfile.get_string(VPN_UI_GROUP, 'Description'),
secrets: [] }; secrets: [] };
let [groups, len_] = keyfile.get_groups(); let [groups, len] = keyfile.get_groups();
for (let i = 0; i < groups.length; i++) { for (let i = 0; i < groups.length; i++) {
if (groups[i] == VPN_UI_GROUP) if (groups[i] == VPN_UI_GROUP)
continue; continue;
@@ -553,12 +549,11 @@ var VPNRequestHandler = class {
let shouldAsk = keyfile.get_boolean(groups[i], 'ShouldAsk'); let shouldAsk = keyfile.get_boolean(groups[i], 'ShouldAsk');
if (shouldAsk) { if (shouldAsk) {
contentOverride.secrets.push({ contentOverride.secrets.push({ label: keyfile.get_string(groups[i], 'Label'),
label: keyfile.get_string(groups[i], 'Label'), key: groups[i],
key: groups[i], value: value,
value: value, password: keyfile.get_boolean(groups[i], 'IsSecret')
password: keyfile.get_boolean(groups[i], 'IsSecret'), });
});
} else { } else {
if (!value.length) // Ignore empty secrets if (!value.length) // Ignore empty secrets
continue; continue;
@@ -566,7 +561,7 @@ var VPNRequestHandler = class {
this._agent.set_password(this._requestId, groups[i], value); this._agent.set_password(this._requestId, groups[i], value);
} }
} }
} catch (e) { } catch(e) {
// No output is a valid case it means "both secrets are stored" // No output is a valid case it means "both secrets are stored"
if (data.length > 0) { if (data.length > 0) {
logError(e, 'error while reading VPN plugin output keyfile'); logError(e, 'error while reading VPN plugin output keyfile');
@@ -592,15 +587,15 @@ var VPNRequestHandler = class {
try { try {
vpnSetting.foreach_data_item((key, value) => { vpnSetting.foreach_data_item((key, value) => {
this._stdin.write(`DATA_KEY=${key}\n`, null); this._stdin.write('DATA_KEY=' + key + '\n', null);
this._stdin.write(`DATA_VAL=${value || ''}\n\n`, null); this._stdin.write('DATA_VAL=' + (value || '') + '\n\n', null);
}); });
vpnSetting.foreach_secret((key, value) => { vpnSetting.foreach_secret((key, value) => {
this._stdin.write(`SECRET_KEY=${key}\n`, null); this._stdin.write('SECRET_KEY=' + key + '\n', null);
this._stdin.write(`SECRET_VAL=${value || ''}\n\n`, null); this._stdin.write('SECRET_VAL=' + (value || '') + '\n\n', null);
}); });
this._stdin.write('DONE\n\n', null); this._stdin.write('DONE\n\n', null);
} catch (e) { } catch(e) {
logError(e, 'internal error while writing connection to helper'); logError(e, 'internal error while writing connection to helper');
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
@@ -612,11 +607,10 @@ Signals.addSignalMethods(VPNRequestHandler.prototype);
var NetworkAgent = class { var NetworkAgent = class {
constructor() { constructor() {
this._native = new Shell.NetworkAgent({ this._native = new Shell.NetworkAgent({ identifier: 'org.gnome.Shell.NetworkAgent',
identifier: 'org.gnome.Shell.NetworkAgent', capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
capabilities: NM.SecretAgentCapabilities.VPN_HINTS, auto_register: false
auto_register: false, });
});
this._dialogs = { }; this._dialogs = { };
this._vpnRequests = { }; this._vpnRequests = { };
@@ -625,9 +619,9 @@ var NetworkAgent = class {
this._pluginDir = Gio.file_new_for_path(Config.VPNDIR); this._pluginDir = Gio.file_new_for_path(Config.VPNDIR);
try { try {
let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null); let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null);
monitor.connect('changed', () => (this._vpnCacheBuilt = false)); monitor.connect('changed', () => { this._vpnCacheBuilt = false; });
} catch (e) { } catch(e) {
log(`Failed to create monitor for VPN plugin dir: ${e.message}`); log('Failed to create monitor for VPN plugin dir: ' + e.message);
} }
this._native.connect('new-request', this._newRequest.bind(this)); this._native.connect('new-request', this._newRequest.bind(this));
@@ -638,7 +632,7 @@ var NetworkAgent = class {
try { try {
this._native.init_finish(res); this._native.init_finish(res);
this._initialized = true; this._initialized = true;
} catch (e) { } catch(e) {
this._native = null; this._native = null;
logError(e, 'error initializing the NetworkManager Agent'); logError(e, 'error initializing the NetworkManager Agent');
} }
@@ -686,13 +680,12 @@ var NetworkAgent = class {
let connectionSetting = connection.get_setting_connection(); let connectionSetting = connection.get_setting_connection();
let connectionType = connectionSetting.get_connection_type(); let connectionType = connectionSetting.get_connection_type();
switch (connectionType) { switch (connectionType) {
case '802-11-wireless': { case '802-11-wireless':
let wirelessSetting = connection.get_setting_wireless(); let wirelessSetting = connection.get_setting_wireless();
let ssid = NM.utils_ssid_to_utf8(wirelessSetting.get_ssid().get_data()); let ssid = NM.utils_ssid_to_utf8(wirelessSetting.get_ssid().get_data());
title = _("Authentication required by wireless network"); title = _("Authentication required by wireless network");
body = _("Passwords or encryption keys are required to access the wireless network “%s”.").format(ssid); body = _("Passwords or encryption keys are required to access the wireless network “%s”.").format(ssid);
break; break;
}
case '802-3-ethernet': case '802-3-ethernet':
title = _("Wired 802.1X authentication"); title = _("Wired 802.1X authentication");
body = _("A password is required to connect to “%s”.".format(connection.get_id())); body = _("A password is required to connect to “%s”.".format(connection.get_id()));
@@ -702,7 +695,8 @@ var NetworkAgent = class {
body = _("A password is required to connect to “%s”.".format(connection.get_id())); body = _("A password is required to connect to “%s”.".format(connection.get_id()));
break; break;
case 'gsm': case 'gsm':
if (hints.includes('pin')) { if (hints.indexOf('pin') != -1) {
let gsmSetting = connection.get_setting_gsm();
title = _("PIN code required"); title = _("PIN code required");
body = _("PIN code is needed for the mobile broadband device"); body = _("PIN code is needed for the mobile broadband device");
break; break;
@@ -714,7 +708,7 @@ var NetworkAgent = class {
body = _("A password is required to connect to “%s”.").format(connectionSetting.get_id()); body = _("A password is required to connect to “%s”.").format(connectionSetting.get_id());
break; break;
default: default:
log(`Invalid connection type: ${connectionType}`); log('Invalid connection type: ' + connectionType);
this._native.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR); this._native.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
return; return;
} }

View File

@@ -1,8 +1,8 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Component */
const { AccountsService, Clutter, Gio, GLib, const { AccountsService, Clutter, Gio, GLib,
GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi; GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi;
const Signals = imports.signals;
const Animation = imports.ui.animation; const Animation = imports.ui.animation;
const Dialog = imports.ui.dialog; const Dialog = imports.ui.dialog;
@@ -11,11 +11,6 @@ const ModalDialog = imports.ui.modalDialog;
const ShellEntry = imports.ui.shellEntry; const ShellEntry = imports.ui.shellEntry;
const UserWidget = imports.ui.userWidget; const UserWidget = imports.ui.userWidget;
const DialogMode = {
AUTH: 0,
CONFIRM: 1,
};
var DIALOG_ICON_SIZE = 48; var DIALOG_ICON_SIZE = 48;
var WORK_SPINNER_ICON_SIZE = 16; var WORK_SPINNER_ICON_SIZE = 16;
@@ -44,44 +39,59 @@ var AuthenticationDialog = GObject.registerClass({
this.contentLayout.add_actor(content); this.contentLayout.add_actor(content);
if (userNames.length > 1) { if (userNames.length > 1) {
log(`polkitAuthenticationAgent: Received ${userNames.length} ` + log('polkitAuthenticationAgent: Received ' + userNames.length +
'identities that can be used for authentication. Only ' + ' identities that can be used for authentication. Only ' +
'considering one.'); 'considering one.');
} }
let userName = GLib.get_user_name(); let userName = GLib.get_user_name();
if (!userNames.includes(userName)) if (userNames.indexOf(userName) < 0)
userName = 'root'; userName = 'root';
if (!userNames.includes(userName)) if (userNames.indexOf(userName) < 0)
userName = userNames[0]; userName = userNames[0];
this._user = AccountsService.UserManager.get_default().get_user(userName); this._user = AccountsService.UserManager.get_default().get_user(userName);
let userRealName = this._user.get_real_name()
this._userLoadedId = this._user.connect('notify::is_loaded',
this._onUserChanged.bind(this));
this._userChangedId = this._user.connect('changed',
this._onUserChanged.bind(this));
let userBox = new St.BoxLayout({ // Special case 'root'
style_class: 'polkit-dialog-user-layout', let userIsRoot = false;
vertical: false, if (userName == 'root') {
}); userIsRoot = true;
content.messageBox.add(userBox); userRealName = _("Administrator");
}
this._userAvatar = new UserWidget.Avatar(this._user, { if (userIsRoot) {
iconSize: DIALOG_ICON_SIZE, let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-root-label',
styleClass: 'polkit-dialog-user-icon', text: userRealName }));
}); content.messageBox.add(userLabel, { x_fill: false,
this._userAvatar.actor.hide(); x_align: St.Align.START });
userBox.add_child(this._userAvatar.actor); } else {
let userBox = new St.BoxLayout({ style_class: 'polkit-dialog-user-layout',
vertical: false });
content.messageBox.add(userBox);
this._userAvatar = new UserWidget.Avatar(this._user,
{ iconSize: DIALOG_ICON_SIZE,
styleClass: 'polkit-dialog-user-icon' });
this._userAvatar.actor.hide();
userBox.add(this._userAvatar.actor,
{ x_fill: true,
y_fill: false,
x_align: St.Align.END,
y_align: St.Align.START });
let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label',
text: userRealName }));
userBox.add(userLabel,
{ x_fill: true,
y_fill: false,
x_align: St.Align.END,
y_align: St.Align.MIDDLE });
}
this._userLabel = new St.Label({ this._onUserChanged();
style_class: userName === 'root'
? 'polkit-dialog-user-root-label'
: 'polkit-dialog-user-label',
x_expand: true,
y_align: Clutter.ActorAlign.CENTER,
});
if (userName === 'root')
this._userLabel.text = _('Administrator');
userBox.add_child(this._userLabel);
this._passwordBox = new St.BoxLayout({ vertical: false, style_class: 'prompt-dialog-password-box' }); this._passwordBox = new St.BoxLayout({ vertical: false, style_class: 'prompt-dialog-password-box' });
content.messageBox.add(this._passwordBox); content.messageBox.add(this._passwordBox);
@@ -89,17 +99,16 @@ var AuthenticationDialog = GObject.registerClass({
this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE }); this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE });
this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry', this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
text: "", text: "",
can_focus: true }); can_focus: true});
ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true }); ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this)); this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this));
this._passwordBox.add(this._passwordEntry, this._passwordBox.add(this._passwordEntry,
{ expand: true }); { expand: true });
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, { this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
animate: true,
});
this._passwordBox.add(this._workSpinner.actor); this._passwordBox.add(this._workSpinner.actor);
this.setInitialKeyFocus(this._passwordEntry);
this._passwordBox.hide(); this._passwordBox.hide();
this._errorMessageLabel = new St.Label({ style_class: 'prompt-dialog-error-label' }); this._errorMessageLabel = new St.Label({ style_class: 'prompt-dialog-error-label' });
@@ -119,7 +128,7 @@ var AuthenticationDialog = GObject.registerClass({
* gnome-shell.css sets the color to be transparent * gnome-shell.css sets the color to be transparent
*/ */
this._nullMessageLabel = new St.Label({ style_class: 'prompt-dialog-null-label', this._nullMessageLabel = new St.Label({ style_class: 'prompt-dialog-null-label',
text: 'abc' }); text: 'abc'});
this._nullMessageLabel.add_style_class_name('hidden'); this._nullMessageLabel.add_style_class_name('hidden');
this._nullMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE; this._nullMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
this._nullMessageLabel.clutter_text.line_wrap = true; this._nullMessageLabel.clutter_text.line_wrap = true;
@@ -129,22 +138,14 @@ var AuthenticationDialog = GObject.registerClass({
this._cancelButton = this.addButton({ label: _("Cancel"), this._cancelButton = this.addButton({ label: _("Cancel"),
action: this.cancel.bind(this), action: this.cancel.bind(this),
key: Clutter.Escape }); key: Clutter.Escape });
this._okButton = this.addButton({ label: _("Authenticate"), this._okButton = this.addButton({ label: _("Authenticate"),
action: this._onAuthenticateButtonPressed.bind(this), action: this._onAuthenticateButtonPressed.bind(this),
default: true }); default: true });
this._doneEmitted = false; this._doneEmitted = false;
this._mode = -1;
this._identityToAuth = Polkit.UnixUser.new_for_name(userName); this._identityToAuth = Polkit.UnixUser.new_for_name(userName);
this._cookie = cookie; this._cookie = cookie;
this._userLoadedId = this._user.connect('notify::is-loaded',
this._onUserChanged.bind(this));
this._userChangedId = this._user.connect('changed',
this._onUserChanged.bind(this));
this._onUserChanged();
} }
_setWorking(working) { _setWorking(working) {
@@ -154,9 +155,8 @@ var AuthenticationDialog = GObject.registerClass({
this._workSpinner.stop(); this._workSpinner.stop();
} }
_initiateSession() { performAuthentication() {
this._destroySession(); this._destroySession();
this._session = new PolkitAgent.Session({ identity: this._identityToAuth, this._session = new PolkitAgent.Session({ identity: this._identityToAuth,
cookie: this._cookie }); cookie: this._cookie });
this._sessionCompletedId = this._session.connect('completed', this._onSessionCompleted.bind(this)); this._sessionCompletedId = this._session.connect('completed', this._onSessionCompleted.bind(this));
@@ -181,9 +181,9 @@ var AuthenticationDialog = GObject.registerClass({
// //
// We could add retrying if this turns out to be a problem // We could add retrying if this turns out to be a problem
log('polkitAuthenticationAgent: Failed to show modal dialog. ' + log('polkitAuthenticationAgent: Failed to show modal dialog.' +
`Dismissing authentication request for action-id ${this.actionId} ` + ' Dismissing authentication request for action-id ' + this.actionId +
`cookie ${this._cookie}`); ' cookie ' + this._cookie);
this._emitDone(true); this._emitDone(true);
} }
} }
@@ -216,10 +216,7 @@ var AuthenticationDialog = GObject.registerClass({
} }
_onAuthenticateButtonPressed() { _onAuthenticateButtonPressed() {
if (this._mode === DialogMode.CONFIRM) this._onEntryActivate();
this._initiateSession();
else
this._onEntryActivate();
} }
_onSessionCompleted(session, gainedAuthorization) { _onSessionCompleted(session, gainedAuthorization) {
@@ -250,28 +247,27 @@ var AuthenticationDialog = GObject.registerClass({
} }
/* Try and authenticate again */ /* Try and authenticate again */
this._initiateSession(); this.performAuthentication();
} }
} }
_onSessionRequest(session, request, echoOn) { _onSessionRequest(session, request, echo_on) {
// Cheap localization trick // Cheap localization trick
if (request == 'Password:' || request == 'Password: ') if (request == 'Password:' || request == 'Password: ')
this._passwordLabel.set_text(_("Password:")); this._passwordLabel.set_text(_("Password:"));
else else
this._passwordLabel.set_text(request); this._passwordLabel.set_text(request);
if (echoOn) if (echo_on)
this._passwordEntry.clutter_text.set_password_char(''); this._passwordEntry.clutter_text.set_password_char('');
else else
this._passwordEntry.clutter_text.set_password_char('\u25cf'); // ● U+25CF BLACK CIRCLE this._passwordEntry.clutter_text.set_password_char('\u25cf'); // ● U+25CF BLACK CIRCLE
this._passwordBox.show(); this._passwordBox.show();
this._passwordEntry.set_text(''); this._passwordEntry.set_text('');
this._updateSensitivity(true);
this._ensureOpen();
this._passwordEntry.grab_key_focus(); this._passwordEntry.grab_key_focus();
this._updateSensitivity(true);
this._ensureOpen();
} }
_onSessionShowError(session, text) { _onSessionShowError(session, text) {
@@ -307,40 +303,10 @@ var AuthenticationDialog = GObject.registerClass({
} }
_onUserChanged() { _onUserChanged() {
if (!this._user.is_loaded) if (this._user.is_loaded && this._userAvatar) {
return;
let userName = this._user.get_user_name();
let realName = this._user.get_real_name();
if (userName !== 'root') {
this._userLabel.set_text(realName);
this._userAvatar.update(); this._userAvatar.update();
this._userAvatar.actor.show(); this._userAvatar.actor.show();
} }
if (this._user.get_password_mode() === AccountsService.UserPasswordMode.NONE) {
if (this._mode === DialogMode.CONFIRM)
return;
this._mode = DialogMode.CONFIRM;
this._destroySession();
this._okButton.reactive = true;
/* We normally open the dialog when we get a "request" signal, but
* since in this case initiating a session would perform the
* authentication, only open the dialog and initiate the session
* when the user confirmed. */
this._ensureOpen();
} else {
if (this._mode === DialogMode.AUTH)
return;
this._mode = DialogMode.AUTH;
this._initiateSession();
}
} }
cancel() { cancel() {
@@ -377,7 +343,7 @@ var AuthenticationAgent = class {
enable() { enable() {
try { try {
this._native.register(); this._native.register();
} catch (e) { } catch(e) {
log('Failed to register AuthenticationAgent'); log('Failed to register AuthenticationAgent');
} }
} }
@@ -385,7 +351,7 @@ var AuthenticationAgent = class {
disable() { disable() {
try { try {
this._native.unregister(); this._native.unregister();
} catch (e) { } catch(e) {
log('Failed to unregister AuthenticationAgent'); log('Failed to unregister AuthenticationAgent');
} }
} }
@@ -403,14 +369,26 @@ var AuthenticationAgent = class {
} }
this._currentDialog = new AuthenticationDialog(actionId, message, cookie, userNames); this._currentDialog = new AuthenticationDialog(actionId, message, cookie, userNames);
// We actually don't want to open the dialog until we know for
// sure that we're going to interact with the user. For
// example, if the password for the identity to auth is blank
// (which it will be on a live CD) then there will be no
// conversation at all... of course, we don't *know* that
// until we actually try it.
//
// See https://bugzilla.gnome.org/show_bug.cgi?id=643062 for more
// discussion.
this._currentDialog.connect('done', this._onDialogDone.bind(this)); this._currentDialog.connect('done', this._onDialogDone.bind(this));
this._currentDialog.performAuthentication();
} }
_onCancel(_nativeAgent) { _onCancel(nativeAgent) {
this._completeRequest(false); this._completeRequest(false);
} }
_onDialogDone(_dialog, dismissed) { _onDialogDone(dialog, dismissed) {
this._completeRequest(dismissed); this._completeRequest(dismissed);
} }

View File

@@ -1,14 +1,14 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Component */
const { Clutter, Gio, GLib, GObject, St } = imports.gi; const { Clutter, Gio, GLib, GObject, St } = imports.gi;
const Lang = imports.lang; const Lang = imports.lang;
const Mainloop = imports.mainloop;
var Tpl = null; var Tpl = null;
var Tp = null; var Tp = null;
try { try {
({ TelepathyGLib: Tp, TelepathyLogger: Tpl } = imports.gi); ({ TelepathyGLib: Tp, TelepathyLogger: Tpl } = imports.gi);
} catch (e) { } catch(e) {
log('Telepathy is not available, chat integration will be disabled.'); log('Telepathy is not available, chat integration will be disabled.');
} }
@@ -40,8 +40,10 @@ var NotificationDirection = {
RECEIVED: 'chat-received' RECEIVED: 'chat-received'
}; };
var N_ = s => s;
function makeMessageFromTpMessage(tpMessage, direction) { function makeMessageFromTpMessage(tpMessage, direction) {
let [text, flags_] = tpMessage.to_text(); let [text, flags] = tpMessage.to_text();
let timestamp = tpMessage.get_sent_timestamp(); let timestamp = tpMessage.get_sent_timestamp();
if (timestamp == 0) if (timestamp == 0)
@@ -87,7 +89,7 @@ var TelepathyComponent = class {
try { try {
this._client.register(); this._client.register();
} catch (e) { } catch (e) {
throw new Error(`Could not register Telepathy client. Error: ${e}`); throw new Error('Couldn\'t register Telepathy client. Error: \n' + e);
} }
if (!this._client.account_manager.is_prepared(Tp.AccountManager.get_feature_quark_core())) if (!this._client.account_manager.is_prepared(Tp.AccountManager.get_feature_quark_core()))
@@ -147,20 +149,20 @@ class TelepathyClient extends Tp.BaseClient {
this._delegatedChannelsCb.bind(this)); this._delegatedChannelsCb.bind(this));
} }
vfunc_observe_channels(...args) { vfunc_observe_channels(account, conn, channels,
let [account, conn, channels, dispatchOp_, requests_, context] = args; dispatchOp, requests, context) {
let len = channels.length; let len = channels.length;
for (let i = 0; i < len; i++) { for (let i = 0; i < len; i++) {
let channel = channels[i]; let channel = channels[i];
let [targetHandle_, targetHandleType] = channel.get_handle(); let [targetHandle, targetHandleType] = channel.get_handle();
if (channel.get_invalidated()) if (channel.get_invalidated())
continue; continue;
/* Only observe contact text channels */ /* Only observe contact text channels */
if ((!(channel instanceof Tp.TextChannel)) || if ((!(channel instanceof Tp.TextChannel)) ||
targetHandleType != Tp.HandleType.CONTACT) targetHandleType != Tp.HandleType.CONTACT)
continue; continue;
this._createChatSource(account, conn, channel, channel.get_target_contact()); this._createChatSource(account, conn, channel, channel.get_target_contact());
} }
@@ -180,8 +182,8 @@ class TelepathyClient extends Tp.BaseClient {
}); });
} }
vfunc_handle_channels(...args) { vfunc_handle_channels(account, conn, channels, requests,
let [account, conn, channels, requests_, userActionTime_, context] = args; user_action_time, context) {
this._handlingChannels(account, conn, channels, true); this._handlingChannels(account, conn, channels, true);
context.accept(); context.accept();
} }
@@ -198,7 +200,7 @@ class TelepathyClient extends Tp.BaseClient {
} }
if (channel.get_invalidated()) if (channel.get_invalidated())
continue; continue;
// 'notify' will be true when coming from an actual HandleChannels // 'notify' will be true when coming from an actual HandleChannels
// call, and not when from a successful Claim call. The point is // call, and not when from a successful Claim call. The point is
@@ -220,8 +222,8 @@ class TelepathyClient extends Tp.BaseClient {
} }
} }
vfunc_add_dispatch_operation(...args) { vfunc_add_dispatch_operation(account, conn, channels,
let [account, conn, channels, dispatchOp, context] = args; dispatchOp, context) {
let channel = channels[0]; let channel = channels[0];
let chanType = channel.get_channel_type(); let chanType = channel.get_channel_type();
@@ -239,7 +241,7 @@ class TelepathyClient extends Tp.BaseClient {
} }
_approveTextChannel(account, conn, channel, dispatchOp, context) { _approveTextChannel(account, conn, channel, dispatchOp, context) {
let [targetHandle_, targetHandleType] = channel.get_handle(); let [targetHandle, targetHandleType] = channel.get_handle();
if (targetHandleType != Tp.HandleType.CONTACT) { if (targetHandleType != Tp.HandleType.CONTACT) {
context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT, context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
@@ -253,14 +255,14 @@ class TelepathyClient extends Tp.BaseClient {
dispatchOp.claim_with_finish(result); dispatchOp.claim_with_finish(result);
this._handlingChannels(account, conn, [channel], false); this._handlingChannels(account, conn, [channel], false);
} catch (err) { } catch (err) {
log(`Failed to Claim channel: ${err}`); log('Failed to Claim channel: ' + err);
} }
}); });
context.accept(); context.accept();
} }
_delegatedChannelsCb(_client, _channels) { _delegatedChannelsCb(client, channels) {
// Nothing to do as we don't make a distinction between observed and // Nothing to do as we don't make a distinction between observed and
// handled channels. // handled channels.
} }
@@ -360,28 +362,28 @@ var ChatSource = class extends MessageTray.Source {
let presenceType = this._contact.get_presence_type(); let presenceType = this._contact.get_presence_type();
switch (presenceType) { switch (presenceType) {
case Tp.ConnectionPresenceType.AVAILABLE: case Tp.ConnectionPresenceType.AVAILABLE:
iconName = 'user-available'; iconName = 'user-available';
break; break;
case Tp.ConnectionPresenceType.BUSY: case Tp.ConnectionPresenceType.BUSY:
iconName = 'user-busy'; iconName = 'user-busy';
break; break;
case Tp.ConnectionPresenceType.OFFLINE: case Tp.ConnectionPresenceType.OFFLINE:
iconName = 'user-offline'; iconName = 'user-offline';
break; break;
case Tp.ConnectionPresenceType.HIDDEN: case Tp.ConnectionPresenceType.HIDDEN:
iconName = 'user-invisible'; iconName = 'user-invisible';
break; break;
case Tp.ConnectionPresenceType.AWAY: case Tp.ConnectionPresenceType.AWAY:
iconName = 'user-away'; iconName = 'user-away';
break; break;
case Tp.ConnectionPresenceType.EXTENDED_AWAY: case Tp.ConnectionPresenceType.EXTENDED_AWAY:
iconName = 'user-idle'; iconName = 'user-idle';
break; break;
default: default:
iconName = 'user-offline'; iconName = 'user-offline';
} }
return new Gio.ThemedIcon({ name: iconName }); return new Gio.ThemedIcon({ name: iconName });
} }
_updateAvatarIcon() { _updateAvatarIcon() {
@@ -427,7 +429,7 @@ var ChatSource = class extends MessageTray.Source {
} }
_displayPendingMessages(logManager, result) { _displayPendingMessages(logManager, result) {
let [success_, events] = logManager.get_filtered_events_finish(result); let [success, events] = logManager.get_filtered_events_finish(result);
let logMessages = events.map(makeMessageFromTplEvent); let logMessages = events.map(makeMessageFromTplEvent);
this._ensureNotification(); this._ensureNotification();
@@ -545,8 +547,8 @@ var ChatSource = class extends MessageTray.Source {
// Wait a bit before notifying for the received message, a handler // Wait a bit before notifying for the received message, a handler
// could ack it in the meantime. // could ack it in the meantime.
if (this._notifyTimeoutId != 0) if (this._notifyTimeoutId != 0)
GLib.source_remove(this._notifyTimeoutId); Mainloop.source_remove(this._notifyTimeoutId);
this._notifyTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, this._notifyTimeoutId = Mainloop.timeout_add(500,
this._notifyTimeout.bind(this)); this._notifyTimeout.bind(this));
GLib.Source.set_name_by_id(this._notifyTimeoutId, '[gnome-shell] this._notifyTimeout'); GLib.Source.set_name_by_id(this._notifyTimeoutId, '[gnome-shell] this._notifyTimeout');
} }
@@ -562,7 +564,7 @@ var ChatSource = class extends MessageTray.Source {
// This is called for both messages we send from // This is called for both messages we send from
// our client and other clients as well. // our client and other clients as well.
_messageSent(channel, message, _flags, _token) { _messageSent(channel, message, flags, token) {
this._ensureNotification(); this._ensureNotification();
message = makeMessageFromTpMessage(message, NotificationDirection.SENT); message = makeMessageFromTpMessage(message, NotificationDirection.SENT);
this._notification.appendMessage(message); this._notification.appendMessage(message);
@@ -595,12 +597,12 @@ var ChatSource = class extends MessageTray.Source {
// keep track of it with the ChatStateChanged signal but it is good // keep track of it with the ChatStateChanged signal but it is good
// enough right now. // enough right now.
if (state != this._chatState) { if (state != this._chatState) {
this._chatState = state; this._chatState = state;
this._channel.set_chat_state_async(state, null); this._channel.set_chat_state_async(state, null);
} }
} }
_presenceChanged(_contact, _presence, _status, _message) { _presenceChanged(contact, presence, status, message) {
if (this._notification) if (this._notification)
this._notification.update(this._notification.title, this._notification.update(this._notification.title,
this._notification.bannerBodyText, this._notification.bannerBodyText,
@@ -640,7 +642,7 @@ var ChatNotification = class extends MessageTray.Notification {
destroy(reason) { destroy(reason) {
if (this._timestampTimeoutId) if (this._timestampTimeoutId)
GLib.source_remove(this._timestampTimeoutId); Mainloop.source_remove(this._timestampTimeoutId);
this._timestampTimeoutId = 0; this._timestampTimeoutId = 0;
super.destroy(reason); super.destroy(reason);
} }
@@ -673,8 +675,8 @@ var ChatNotification = class extends MessageTray.Notification {
{ datetime: GLib.DateTime.new_from_unix_local (message.timestamp), { datetime: GLib.DateTime.new_from_unix_local (message.timestamp),
bannerMarkup: true }); bannerMarkup: true });
let group = (message.direction == NotificationDirection.RECEIVED let group = (message.direction == NotificationDirection.RECEIVED ?
? 'received' : 'sent'); 'received' : 'sent');
this._append({ body: messageBody, this._append({ body: messageBody,
group: group, group: group,
@@ -696,8 +698,8 @@ var ChatNotification = class extends MessageTray.Notification {
// SCROLLBACK_RECENT_LENGTH previous messages. Otherwise // SCROLLBACK_RECENT_LENGTH previous messages. Otherwise
// we'll keep SCROLLBACK_IDLE_LENGTH messages. // we'll keep SCROLLBACK_IDLE_LENGTH messages.
let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) ?
? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH; SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
let filteredHistory = this.messages.filter(item => item.realMessage); let filteredHistory = this.messages.filter(item => item.realMessage);
if (filteredHistory.length > maxLength) { if (filteredHistory.length > maxLength) {
@@ -728,7 +730,7 @@ var ChatNotification = class extends MessageTray.Notification {
// Reset the old message timeout // Reset the old message timeout
if (this._timestampTimeoutId) if (this._timestampTimeoutId)
GLib.source_remove(this._timestampTimeoutId); Mainloop.source_remove(this._timestampTimeoutId);
this._timestampTimeoutId = 0; this._timestampTimeoutId = 0;
let message = { realMessage: props.group != 'meta', let message = { realMessage: props.group != 'meta',
@@ -746,8 +748,7 @@ var ChatNotification = class extends MessageTray.Notification {
} else { } else {
// Schedule a new timestamp in SCROLLBACK_IMMEDIATE_TIME // Schedule a new timestamp in SCROLLBACK_IMMEDIATE_TIME
// from the timestamp of the message. // from the timestamp of the message.
this._timestampTimeoutId = GLib.timeout_add_seconds( this._timestampTimeoutId = Mainloop.timeout_add_seconds(
GLib.PRIORITY_DEFAULT,
SCROLLBACK_IMMEDIATE_TIME - (currentTime - timestamp), SCROLLBACK_IMMEDIATE_TIME - (currentTime - timestamp),
this.appendTimestamp.bind(this)); this.appendTimestamp.bind(this));
GLib.Source.set_name_by_id(this._timestampTimeoutId, '[gnome-shell] this.appendTimestamp'); GLib.Source.set_name_by_id(this._timestampTimeoutId, '[gnome-shell] this.appendTimestamp');
@@ -952,15 +953,14 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
// Remove composing timeout. // Remove composing timeout.
if (this._composingTimeoutId > 0) { if (this._composingTimeoutId > 0) {
GLib.source_remove(this._composingTimeoutId); Mainloop.source_remove(this._composingTimeoutId);
this._composingTimeoutId = 0; this._composingTimeoutId = 0;
} }
if (text != '') { if (text != '') {
this.notification.source.setChatState(Tp.ChannelChatState.COMPOSING); this.notification.source.setChatState(Tp.ChannelChatState.COMPOSING);
this._composingTimeoutId = GLib.timeout_add_seconds( this._composingTimeoutId = Mainloop.timeout_add_seconds(
GLib.PRIORITY_DEFAULT,
COMPOSING_STOP_TIMEOUT, COMPOSING_STOP_TIMEOUT,
this._composingStopTimeout.bind(this)); this._composingStopTimeout.bind(this));
GLib.Source.set_name_by_id(this._composingTimeoutId, '[gnome-shell] this._composingStopTimeout'); GLib.Source.set_name_by_id(this._composingTimeoutId, '[gnome-shell] this._composingStopTimeout');

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported CtrlAltTabManager */
const { Clutter, GObject, Meta, Shell, St } = imports.gi; const { Clutter, GObject, Meta, Shell, St } = imports.gi;
@@ -8,6 +7,7 @@ const SwitcherPopup = imports.ui.switcherPopup;
const Params = imports.misc.params; const Params = imports.misc.params;
var POPUP_APPICON_SIZE = 96; var POPUP_APPICON_SIZE = 96;
var POPUP_FADE_TIME = 0.1; // seconds
var SortGroup = { var SortGroup = {
TOP: 0, TOP: 0,
@@ -33,7 +33,7 @@ var CtrlAltTabManager = class CtrlAltTabManager {
item.iconName = icon; item.iconName = icon;
this._items.push(item); this._items.push(item);
root.connect('destroy', () => this.removeGroup(root)); root.connect('destroy', () => { this.removeGroup(root); });
if (root instanceof St.Widget) if (root instanceof St.Widget)
global.focus_manager.add_group(root); global.focus_manager.add_group(root);
} }
@@ -64,8 +64,9 @@ var CtrlAltTabManager = class CtrlAltTabManager {
if (a.sortGroup != b.sortGroup) if (a.sortGroup != b.sortGroup)
return a.sortGroup - b.sortGroup; return a.sortGroup - b.sortGroup;
let [ax] = a.proxy.get_transformed_position(); let ax, bx, y;
let [bx] = b.proxy.get_transformed_position(); [ax, y] = a.proxy.get_transformed_position();
[bx, y] = b.proxy.get_transformed_position();
return ax - bx; return ax - bx;
} }

View File

@@ -1,7 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Dash */
const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
const Mainloop = imports.mainloop;
const Signals = imports.signals; const Signals = imports.signals;
const AppDisplay = imports.ui.appDisplay; const AppDisplay = imports.ui.appDisplay;
@@ -9,10 +9,11 @@ const AppFavorites = imports.ui.appFavorites;
const DND = imports.ui.dnd; const DND = imports.ui.dnd;
const IconGrid = imports.ui.iconGrid; const IconGrid = imports.ui.iconGrid;
const Main = imports.ui.main; const Main = imports.ui.main;
const Tweener = imports.ui.tweener;
var DASH_ANIMATION_TIME = 200; var DASH_ANIMATION_TIME = 0.2;
var DASH_ITEM_LABEL_SHOW_TIME = 150; var DASH_ITEM_LABEL_SHOW_TIME = 0.15;
var DASH_ITEM_LABEL_HIDE_TIME = 100; var DASH_ITEM_LABEL_HIDE_TIME = 0.1;
var DASH_ITEM_HOVER_TIMEOUT = 300; var DASH_ITEM_HOVER_TIMEOUT = 300;
function getAppFromSource(source) { function getAppFromSource(source) {
@@ -23,30 +24,6 @@ function getAppFromSource(source) {
} }
} }
var DashIcon = class DashIcon extends AppDisplay.AppIcon {
constructor(app) {
super(app, {
setSizeManually: true,
showLabel: false
});
}
// Disable all DnD methods
_onDragBegin() {
}
_onDragEnd() {
}
handleDragOver() {
return DND.DragMotionResult.CONTINUE;
}
acceptDrop() {
return false;
}
};
// A container like StBin, but taking the child's scale into account // A container like StBin, but taking the child's scale into account
// when requesting a size // when requesting a size
var DashItemContainer = GObject.registerClass( var DashItemContainer = GObject.registerClass(
@@ -54,24 +31,20 @@ class DashItemContainer extends St.Widget {
_init() { _init() {
super._init({ style_class: 'dash-item-container', super._init({ style_class: 'dash-item-container',
pivot_point: new Clutter.Point({ x: .5, y: .5 }), pivot_point: new Clutter.Point({ x: .5, y: .5 }),
scale_x: 0,
scale_y: 0,
opacity: 0,
x_expand: true, x_expand: true,
x_align: Clutter.ActorAlign.CENTER }); x_align: Clutter.ActorAlign.CENTER });
this._labelText = ""; this._labelText = "";
this.label = new St.Label({ style_class: 'dash-label' }); this.label = new St.Label({ style_class: 'dash-label'});
this.label.hide(); this.label.hide();
Main.layoutManager.addChrome(this.label); Main.layoutManager.addChrome(this.label);
this.label_actor = this.label; this.label_actor = this.label;
this.child = null; this.child = null;
this._childScale = 0;
this._childOpacity = 0;
this.animatingOut = false; this.animatingOut = false;
this.connect('notify::scale-x', () => this.queue_relayout());
this.connect('notify::scale-y', () => this.queue_relayout());
this.connect('destroy', () => { this.connect('destroy', () => {
if (this.child != null) if (this.child != null)
this.child.destroy(); this.child.destroy();
@@ -108,7 +81,7 @@ class DashItemContainer extends St.Widget {
let itemHeight = this.allocation.y2 - this.allocation.y1; let itemHeight = this.allocation.y2 - this.allocation.y1;
let labelHeight = this.label.get_height(); let labelHeight = this.label.get_height();
let yOffset = Math.floor((itemHeight - labelHeight) / 2); let yOffset = Math.floor((itemHeight - labelHeight) / 2)
let y = stageY + yOffset; let y = stageY + yOffset;
@@ -122,11 +95,11 @@ class DashItemContainer extends St.Widget {
x = stageX + this.get_width() + xOffset; x = stageX + this.get_width() + xOffset;
this.label.set_position(x, y); this.label.set_position(x, y);
this.label.ease({ Tweener.addTween(this.label,
opacity: 255, { opacity: 255,
duration: DASH_ITEM_LABEL_SHOW_TIME, time: DASH_ITEM_LABEL_SHOW_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad',
}); });
} }
setLabelText(text) { setLabelText(text) {
@@ -135,12 +108,14 @@ class DashItemContainer extends St.Widget {
} }
hideLabel() { hideLabel() {
this.label.ease({ Tweener.addTween(this.label,
opacity: 0, { opacity: 0,
duration: DASH_ITEM_LABEL_HIDE_TIME, time: DASH_ITEM_LABEL_HIDE_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => this.label.hide() onComplete: () => {
}); this.label.hide();
}
});
} }
setChild(actor) { setChild(actor) {
@@ -151,6 +126,9 @@ class DashItemContainer extends St.Widget {
this.child = actor; this.child = actor;
this.add_actor(this.child); this.add_actor(this.child);
this.set_scale(this._childScale, this._childScale);
this.set_opacity(this._childOpacity);
} }
show(animate) { show(animate) {
@@ -158,13 +136,12 @@ class DashItemContainer extends St.Widget {
return; return;
let time = animate ? DASH_ANIMATION_TIME : 0; let time = animate ? DASH_ANIMATION_TIME : 0;
this.ease({ Tweener.addTween(this,
scale_x: 1, { childScale: 1.0,
scale_y: 1, childOpacity: 255,
opacity: 255, time: time,
duration: time, transition: 'easeOutQuad'
mode: Clutter.AnimationMode.EASE_OUT_QUAD });
});
} }
animateOutAndDestroy() { animateOutAndDestroy() {
@@ -176,14 +153,37 @@ class DashItemContainer extends St.Widget {
} }
this.animatingOut = true; this.animatingOut = true;
this.ease({ Tweener.addTween(this,
scale_x: 0, { childScale: 0.0,
scale_y: 0, childOpacity: 0,
opacity: 0, time: DASH_ANIMATION_TIME,
duration: DASH_ANIMATION_TIME, transition: 'easeOutQuad',
mode: Clutter.AnimationMode.EASE_OUT_QUAD, onComplete: () => {
onComplete: () => this.destroy() this.destroy();
}); }
});
}
set childScale(scale) {
this._childScale = scale;
this.set_scale(scale, scale);
this.queue_relayout();
}
get childScale() {
return this._childScale;
}
set childOpacity(opacity) {
this._childOpacity = opacity;
this.set_opacity(opacity);
this.queue_redraw();
}
get childOpacity() {
return this._childOpacity;
} }
}); });
@@ -198,9 +198,9 @@ class ShowAppsIcon extends DashItemContainer {
toggle_mode: true }); toggle_mode: true });
this._iconActor = null; this._iconActor = null;
this.icon = new IconGrid.BaseIcon(_("Show Applications"), this.icon = new IconGrid.BaseIcon(_("Show Applications"),
{ setSizeManually: true, { setSizeManually: true,
showLabel: false, showLabel: false,
createIcon: this._createIcon.bind(this) }); createIcon: this._createIcon.bind(this) });
this.toggleButton.add_actor(this.icon); this.toggleButton.add_actor(this.icon);
this.toggleButton._delegate = this; this.toggleButton._delegate = this;
@@ -241,14 +241,14 @@ class ShowAppsIcon extends DashItemContainer {
this.setLabelText(_("Show Applications")); this.setLabelText(_("Show Applications"));
} }
handleDragOver(source, _actor, _x, _y, _time) { handleDragOver(source, actor, x, y, time) {
if (!this._canRemoveApp(getAppFromSource(source))) if (!this._canRemoveApp(getAppFromSource(source)))
return DND.DragMotionResult.NO_DROP; return DND.DragMotionResult.NO_DROP;
return DND.DragMotionResult.MOVE_DROP; return DND.DragMotionResult.MOVE_DROP;
} }
acceptDrop(source, _actor, _x, _y, _time) { acceptDrop(source, actor, x, y, time) {
let app = getAppFromSource(source); let app = getAppFromSource(source);
if (!this._canRemoveApp(app)) if (!this._canRemoveApp(app))
return false; return false;
@@ -296,7 +296,7 @@ class DashActor extends St.Widget {
this.set_allocation(box, flags); this.set_allocation(box, flags);
let [appIcons, showAppsButton] = this.get_children(); let [appIcons, showAppsButton] = this.get_children();
let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth); let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
let childBox = new Clutter.ActorBox(); let childBox = new Clutter.ActorBox();
childBox.x1 = contentBox.x1; childBox.x1 = contentBox.x1;
@@ -321,14 +321,14 @@ class DashActor extends St.Widget {
let themeNode = this.get_theme_node(); let themeNode = this.get_theme_node();
let adjustedForWidth = themeNode.adjust_for_width(forWidth); let adjustedForWidth = themeNode.adjust_for_width(forWidth);
let [, showAppsButton] = this.get_children(); let [, showAppsButton] = this.get_children();
let [minHeight] = showAppsButton.get_preferred_height(adjustedForWidth); let [minHeight, ] = showAppsButton.get_preferred_height(adjustedForWidth);
[minHeight] = themeNode.adjust_preferred_height(minHeight, natHeight); [minHeight, ] = themeNode.adjust_preferred_height(minHeight, natHeight);
return [minHeight, natHeight]; return [minHeight, natHeight];
} }
}); });
const baseIconSizes = [16, 22, 24, 32, 48, 64]; const baseIconSizes = [ 16, 22, 24, 32, 48, 64 ];
var Dash = class Dash { var Dash = class Dash {
constructor() { constructor() {
@@ -351,7 +351,8 @@ var Dash = class Dash {
this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS); this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
this._showAppsIcon = new ShowAppsIcon(); this._showAppsIcon = new ShowAppsIcon();
this._showAppsIcon.show(false); this._showAppsIcon.childScale = 1;
this._showAppsIcon.childOpacity = 255;
this._showAppsIcon.icon.setIconSize(this.iconSize); this._showAppsIcon.icon.setIconSize(this.iconSize);
this._hookUpLabel(this._showAppsIcon); this._hookUpLabel(this._showAppsIcon);
@@ -473,7 +474,19 @@ var Dash = class Dash {
} }
_createAppItem(app) { _createAppItem(app) {
let appIcon = new DashIcon(app); let appIcon = new AppDisplay.AppIcon(app,
{ setSizeManually: true,
showLabel: false });
if (appIcon._draggable) {
appIcon._draggable.connect('drag-begin',
() => {
appIcon.actor.opacity = 50;
});
appIcon._draggable.connect('drag-end',
() => {
appIcon.actor.opacity = 255;
});
}
appIcon.connect('menu-state-changed', appIcon.connect('menu-state-changed',
(appIcon, opened) => { (appIcon, opened) => {
@@ -499,7 +512,7 @@ var Dash = class Dash {
// that the notify::hover handler does everything we need to. // that the notify::hover handler does everything we need to.
if (opened) { if (opened) {
if (this._showLabelTimeoutId > 0) { if (this._showLabelTimeoutId > 0) {
GLib.source_remove(this._showLabelTimeoutId); Mainloop.source_remove(this._showLabelTimeoutId);
this._showLabelTimeoutId = 0; this._showLabelTimeoutId = 0;
} }
@@ -513,7 +526,7 @@ var Dash = class Dash {
if (shouldShow) { if (shouldShow) {
if (this._showLabelTimeoutId == 0) { if (this._showLabelTimeoutId == 0) {
let timeout = this._labelShowing ? 0 : DASH_ITEM_HOVER_TIMEOUT; let timeout = this._labelShowing ? 0 : DASH_ITEM_HOVER_TIMEOUT;
this._showLabelTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, this._showLabelTimeoutId = Mainloop.timeout_add(timeout,
() => { () => {
this._labelShowing = true; this._labelShowing = true;
item.showLabel(); item.showLabel();
@@ -522,17 +535,17 @@ var Dash = class Dash {
}); });
GLib.Source.set_name_by_id(this._showLabelTimeoutId, '[gnome-shell] item.showLabel'); GLib.Source.set_name_by_id(this._showLabelTimeoutId, '[gnome-shell] item.showLabel');
if (this._resetHoverTimeoutId > 0) { if (this._resetHoverTimeoutId > 0) {
GLib.source_remove(this._resetHoverTimeoutId); Mainloop.source_remove(this._resetHoverTimeoutId);
this._resetHoverTimeoutId = 0; this._resetHoverTimeoutId = 0;
} }
} }
} else { } else {
if (this._showLabelTimeoutId > 0) if (this._showLabelTimeoutId > 0)
GLib.source_remove(this._showLabelTimeoutId); Mainloop.source_remove(this._showLabelTimeoutId);
this._showLabelTimeoutId = 0; this._showLabelTimeoutId = 0;
item.hideLabel(); item.hideLabel();
if (this._labelShowing) { if (this._labelShowing) {
this._resetHoverTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, DASH_ITEM_HOVER_TIMEOUT, this._resetHoverTimeoutId = Mainloop.timeout_add(DASH_ITEM_HOVER_TIMEOUT,
() => { () => {
this._labelShowing = false; this._labelShowing = false;
this._resetHoverTimeoutId = 0; this._resetHoverTimeoutId = 0;
@@ -620,12 +633,12 @@ var Dash = class Dash {
icon.icon.set_size(icon.icon.width * scale, icon.icon.set_size(icon.icon.width * scale,
icon.icon.height * scale); icon.icon.height * scale);
icon.icon.ease({ Tweener.addTween(icon.icon,
width: targetWidth, { width: targetWidth,
height: targetHeight, height: targetHeight,
duration: DASH_ANIMATION_TIME, time: DASH_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad',
}); });
} }
} }
@@ -635,10 +648,10 @@ var Dash = class Dash {
let running = this._appSystem.get_running(); let running = this._appSystem.get_running();
let children = this._box.get_children().filter(actor => { let children = this._box.get_children().filter(actor => {
return actor.child && return actor.child &&
actor.child._delegate && actor.child._delegate &&
actor.child._delegate.app; actor.child._delegate.app;
}); });
// Apps currently in the dash // Apps currently in the dash
let oldApps = children.map(actor => actor.child._delegate.app); let oldApps = children.map(actor => actor.child._delegate.app);
// Apps supposed to be in the dash // Apps supposed to be in the dash
@@ -687,14 +700,14 @@ var Dash = class Dash {
} }
// App removed at oldIndex // App removed at oldIndex
if (oldApp && !newApps.includes(oldApp)) { if (oldApp && newApps.indexOf(oldApp) == -1) {
removedActors.push(children[oldIndex]); removedActors.push(children[oldIndex]);
oldIndex++; oldIndex++;
continue; continue;
} }
// App added at newIndex // App added at newIndex
if (newApp && !oldApps.includes(newApp)) { if (newApp && oldApps.indexOf(newApp) == -1) {
addedItems.push({ app: newApp, addedItems.push({ app: newApp,
item: this._createAppItem(newApp), item: this._createAppItem(newApp),
pos: newIndex }); pos: newIndex });
@@ -703,8 +716,8 @@ var Dash = class Dash {
} }
// App moved // App moved
let nextApp = newApps.length > newIndex + 1 let nextApp = newApps.length > newIndex + 1 ? newApps[newIndex + 1]
? newApps[newIndex + 1] : null; : null;
let insertHere = nextApp && nextApp == oldApp; let insertHere = nextApp && nextApp == oldApp;
let alreadyRemoved = removedActors.reduce((result, actor) => { let alreadyRemoved = removedActors.reduce((result, actor) => {
let removedApp = actor.child._delegate.app; let removedApp = actor.child._delegate.app;
@@ -777,7 +790,7 @@ var Dash = class Dash {
} }
} }
handleDragOver(source, actor, x, y, _time) { handleDragOver(source, actor, x, y, time) {
let app = getAppFromSource(source); let app = getAppFromSource(source);
// Don't allow favoriting of transient apps // Don't allow favoriting of transient apps
@@ -855,7 +868,7 @@ var Dash = class Dash {
} }
// Draggable target interface // Draggable target interface
acceptDrop(source, _actor, _x, _y, _time) { acceptDrop(source, actor, x, y, time) {
let app = getAppFromSource(source); let app = getAppFromSource(source);
// Don't allow favoriting of transient apps // Don't allow favoriting of transient apps

View File

@@ -1,7 +1,6 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported DateMenuButton */
const { Clutter, Gio, GLib, GnomeDesktop, const { Clutter, GLib, GnomeDesktop,
GObject, GWeather, Shell, St } = imports.gi; GObject, GWeather, Shell, St } = imports.gi;
const Util = imports.misc.util; const Util = imports.misc.util;
@@ -11,13 +10,8 @@ const Calendar = imports.ui.calendar;
const Weather = imports.misc.weather; const Weather = imports.misc.weather;
const System = imports.system; const System = imports.system;
const { loadInterfaceXML } = imports.misc.fileUtils;
const MAX_FORECASTS = 5; const MAX_FORECASTS = 5;
const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration');
const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface);
function _isToday(date) { function _isToday(date) {
let now = new Date(); let now = new Date();
return now.getYear() == date.getYear() && return now.getYear() == date.getYear() &&
@@ -30,13 +24,11 @@ var TodayButton = class TodayButton {
// Having the ability to go to the current date if the user is already // Having the ability to go to the current date if the user is already
// on the current date can be confusing. So don't make the button reactive // on the current date can be confusing. So don't make the button reactive
// until the selected date changes. // until the selected date changes.
this.actor = new St.Button({ this.actor = new St.Button({ style_class: 'datemenu-today-button',
style_class: 'datemenu-today-button', x_expand: true, x_align: St.Align.START,
x_align: St.Align.START, can_focus: true,
x_expand: true, reactive: false
can_focus: true, });
reactive: false,
});
this.actor.connect('clicked', () => { this.actor.connect('clicked', () => {
this._calendar.setDate(new Date(), false); this._calendar.setDate(new Date(), false);
}); });
@@ -55,7 +47,7 @@ var TodayButton = class TodayButton {
this._calendar.connect('selected-date-changed', (calendar, date) => { this._calendar.connect('selected-date-changed', (calendar, date) => {
// Make the button reactive only if the selected date is not the // Make the button reactive only if the selected date is not the
// current date. // current date.
this.actor.reactive = !_isToday(date); this.actor.reactive = !_isToday(date)
}); });
} }
@@ -90,8 +82,7 @@ var WorldClocksSection = class WorldClocksSection {
x_fill: true, x_fill: true,
can_focus: true }); can_focus: true });
this.actor.connect('clicked', () => { this.actor.connect('clicked', () => {
if (this._clocksApp) this._clockAppMon.activateApp();
this._clocksApp.activate();
Main.overview.hide(); Main.overview.hide();
Main.panel.closeCalendar(); Main.panel.closeCalendar();
@@ -104,40 +95,29 @@ var WorldClocksSection = class WorldClocksSection {
this.actor.child = this._grid; this.actor.child = this._grid;
this._clocksApp = null; this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop',
this._clocksProxy = new ClocksProxy( 'org.gnome.clocks');
Gio.DBus.session, this._clockAppMon.connect('available-changed',
'org.gnome.clocks', this._sync.bind(this));
'/org/gnome/clocks', this._clockAppMon.watchSetting('world-clocks',
this._onProxyReady.bind(this), this._clocksChanged.bind(this));
null /* cancellable */,
Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
this._settings = new Gio.Settings({
schema_id: 'org.gnome.shell.world-clocks'
});
this._settings.connect('changed', this._clocksChanged.bind(this));
this._clocksChanged();
this._appSystem = Shell.AppSystem.get_default();
this._appSystem.connect('installed-changed',
this._sync.bind(this));
this._sync(); this._sync();
} }
_sync() { _sync() {
this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop'); this.actor.visible = this._clockAppMon.available;
this.actor.visible = this._clocksApp != null;
} }
_clocksChanged() { _clocksChanged(settings) {
this._grid.destroy_all_children(); this._grid.destroy_all_children();
this._locations = []; this._locations = [];
let world = GWeather.Location.get_world(); let world = GWeather.Location.get_world();
let clocks = this._settings.get_value('locations').deep_unpack(); let clocks = settings.get_value('world-clocks').deep_unpack();
for (let i = 0; i < clocks.length; i++) { for (let i = 0; i < clocks.length; i++) {
let l = world.deserialize(clocks[i]); if (!clocks[i].location)
continue;
let l = world.deserialize(clocks[i].location);
if (l && l.get_timezone() != null) if (l && l.get_timezone() != null)
this._locations.push({ location: l }); this._locations.push({ location: l });
} }
@@ -148,9 +128,8 @@ var WorldClocksSection = class WorldClocksSection {
}); });
let layout = this._grid.layout_manager; let layout = this._grid.layout_manager;
let title = (this._locations.length == 0) let title = (this._locations.length == 0) ? _("Add world clocks…")
? _("Add world clocks") : _("World Clocks");
: _("World Clocks");
let header = new St.Label({ style_class: 'world-clocks-header', let header = new St.Label({ style_class: 'world-clocks-header',
x_align: Clutter.ActorAlign.START, x_align: Clutter.ActorAlign.START,
text: title }); text: title });
@@ -217,25 +196,6 @@ var WorldClocksSection = class WorldClocksSection {
l.actor.text = Util.formatTime(now, { timeOnly: true }); l.actor.text = Util.formatTime(now, { timeOnly: true });
} }
} }
_onProxyReady(proxy, error) {
if (error) {
log(`Failed to create GNOME Clocks proxy: ${error}`);
return;
}
this._clocksProxy.connect('g-properties-changed',
this._onClocksPropertiesChanged.bind(this));
this._onClocksPropertiesChanged();
}
_onClocksPropertiesChanged() {
if (this._clocksProxy.g_name_owner == null)
return;
this._settings.set_value('locations',
new GLib.Variant('av', this._clocksProxy.Locations));
}
}; };
var WeatherSection = class WeatherSection { var WeatherSection = class WeatherSection {
@@ -257,7 +217,7 @@ var WeatherSection = class WeatherSection {
}); });
let box = new St.BoxLayout({ style_class: 'weather-box', let box = new St.BoxLayout({ style_class: 'weather-box',
vertical: true }); vertical: true });
this.actor.child = box; this.actor.child = box;
@@ -289,12 +249,12 @@ var WeatherSection = class WeatherSection {
let current = info; let current = info;
let infos = [info]; let infos = [info];
for (let i = 0; i < forecasts.length; i++) { for (let i = 0; i < forecasts.length; i++) {
let [ok_, timestamp] = forecasts[i].get_value_update(); let [ok, timestamp] = forecasts[i].get_value_update();
let datetime = new Date(timestamp * 1000); let datetime = new Date(timestamp * 1000);
if (!_isToday(datetime)) if (!_isToday(datetime))
continue; // Ignore forecasts from other days continue; // Ignore forecasts from other days
[ok_, timestamp] = current.get_value_update(); [ok, timestamp] = current.get_value_update();
let currenttime = new Date(timestamp * 1000); let currenttime = new Date(timestamp * 1000);
if (currenttime.getHours() == datetime.getHours()) if (currenttime.getHours() == datetime.getHours())
continue; // Enforce a minimum interval of 1h continue; // Enforce a minimum interval of 1h
@@ -315,7 +275,7 @@ var WeatherSection = class WeatherSection {
let col = 0; let col = 0;
infos.forEach(fc => { infos.forEach(fc => {
let [ok_, timestamp] = fc.get_value_update(); let [ok, timestamp] = fc.get_value_update();
let timeStr = Util.formatTime(new Date(timestamp * 1000), { let timeStr = Util.formatTime(new Date(timestamp * 1000), {
timeOnly: true timeOnly: true
}); });
@@ -397,7 +357,7 @@ var MessagesIndicator = class MessagesIndicator {
Main.messageTray.connect('queue-changed', this._updateCount.bind(this)); Main.messageTray.connect('queue-changed', this._updateCount.bind(this));
let sources = Main.messageTray.getSources(); let sources = Main.messageTray.getSources();
sources.forEach(source => this._onSourceAdded(null, source)); sources.forEach(source => { this._onSourceAdded(null, source); });
} }
_onSourceAdded(tray, source) { _onSourceAdded(tray, source) {
@@ -413,7 +373,7 @@ var MessagesIndicator = class MessagesIndicator {
_updateCount() { _updateCount() {
let count = 0; let count = 0;
this._sources.forEach(source => (count += source.unseenCount)); this._sources.forEach(source => { count += source.unseenCount; });
count -= Main.messageTray.queueCount; count -= Main.messageTray.queueCount;
this.actor.visible = (count > 0); this.actor.visible = (count > 0);
@@ -424,8 +384,8 @@ var IndicatorPad = GObject.registerClass(
class IndicatorPad extends St.Widget { class IndicatorPad extends St.Widget {
_init(actor) { _init(actor) {
this._source = actor; this._source = actor;
this._source.connect('notify::visible', () => this.queue_relayout()); this._source.connect('notify::visible', () => { this.queue_relayout(); });
this._source.connect('notify::size', () => this.queue_relayout()); this._source.connect('notify::size', () => { this.queue_relayout(); });
super._init(); super._init();
} }
@@ -499,6 +459,7 @@ class CalendarColumnLayout extends Clutter.BoxLayout {
var DateMenuButton = GObject.registerClass( var DateMenuButton = GObject.registerClass(
class DateMenuButton extends PanelMenu.Button { class DateMenuButton extends PanelMenu.Button {
_init() { _init() {
let item;
let hbox; let hbox;
let vbox; let vbox;

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Dialog, MessageDialogContent */
const { Clutter, Gio, GObject, Pango, St } = imports.gi; const { Clutter, Gio, GObject, Pango, St } = imports.gi;
@@ -26,9 +25,9 @@ class Dialog extends St.Widget {
_createDialog() { _createDialog() {
this._dialog = new St.BoxLayout({ style_class: 'modal-dialog', this._dialog = new St.BoxLayout({ style_class: 'modal-dialog',
x_align: Clutter.ActorAlign.CENTER, x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER, y_align: Clutter.ActorAlign.CENTER,
vertical: true }); vertical: true });
// modal dialogs are fixed width and grow vertically; set the request // modal dialogs are fixed width and grow vertically; set the request
// mode accordingly so wrapped labels are handled correctly during // mode accordingly so wrapped labels are handled correctly during
@@ -39,13 +38,13 @@ class Dialog extends St.Widget {
this.contentLayout = new St.BoxLayout({ vertical: true, this.contentLayout = new St.BoxLayout({ vertical: true,
style_class: "modal-dialog-content-box" }); style_class: "modal-dialog-content-box" });
this._dialog.add(this.contentLayout, this._dialog.add(this.contentLayout,
{ expand: true, { expand: true,
x_fill: true, x_fill: true,
y_fill: true, y_fill: true,
x_align: St.Align.MIDDLE, x_align: St.Align.MIDDLE,
y_align: St.Align.START }); y_align: St.Align.START });
this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) }); this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous:true }) });
this._dialog.add(this.buttonLayout, this._dialog.add(this.buttonLayout,
{ x_align: St.Align.MIDDLE, { x_align: St.Align.MIDDLE,
y_align: St.Align.START }); y_align: St.Align.START });
@@ -117,11 +116,11 @@ class Dialog extends St.Widget {
let button = new St.Button({ style_class: 'modal-dialog-linked-button', let button = new St.Button({ style_class: 'modal-dialog-linked-button',
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE, button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
reactive: true, reactive: true,
can_focus: true, can_focus: true,
x_expand: true, x_expand: true,
y_expand: true, y_expand: true,
label: label }); label: label });
button.connect('clicked', action); button.connect('clicked', action);
buttonInfo['button'] = button; buttonInfo['button'] = button;
@@ -181,8 +180,10 @@ var MessageDialogContent = GObject.registerClass({
this._subtitle.clutter_text.set(textProps); this._subtitle.clutter_text.set(textProps);
this._body.clutter_text.set(textProps); this._body.clutter_text.set(textProps);
let defaultParams = { style_class: 'message-dialog-main-layout' }; if (!params.hasOwnProperty('style_class'))
super._init(Object.assign(defaultParams, params)); params.style_class = 'message-dialog-main-layout';
super._init(params);
this.messageBox = new St.BoxLayout({ style_class: 'message-dialog-content', this.messageBox = new St.BoxLayout({ style_class: 'message-dialog-content',
x_expand: true, x_expand: true,
@@ -213,10 +214,7 @@ var MessageDialogContent = GObject.registerClass({
} }
set icon(icon) { set icon(icon) {
this._icon.set({ Object.assign(this._icon, { gicon: icon, visible: icon != null });
gicon: icon,
visible: icon != null
});
this.notify('icon'); this.notify('icon');
} }
@@ -233,10 +231,7 @@ var MessageDialogContent = GObject.registerClass({
} }
_setLabel(label, prop, value) { _setLabel(label, prop, value) {
label.set({ Object.assign(label, { text: value || '', visible: value != null });
text: value || '',
visible: value != null
});
this.notify(prop); this.notify(prop);
} }

View File

@@ -1,18 +1,18 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported addDragMonitor, removeDragMonitor, makeDraggable */
const { Clutter, GLib, Meta, Shell, St } = imports.gi; const { Clutter, GLib, Meta, Shell, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
const Main = imports.ui.main; const Main = imports.ui.main;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
// Time to scale down to maxDragActorSize // Time to scale down to maxDragActorSize
var SCALE_ANIMATION_TIME = 250; var SCALE_ANIMATION_TIME = 0.25;
// Time to animate to original position on cancel // Time to animate to original position on cancel
var SNAP_BACK_ANIMATION_TIME = 250; var SNAP_BACK_ANIMATION_TIME = 0.25;
// Time to animate to original position on success // Time to animate to original position on success
var REVERT_ANIMATION_TIME = 750; var REVERT_ANIMATION_TIME = 0.75;
var DragMotionResult = { var DragMotionResult = {
NO_DROP: 0, NO_DROP: 0,
@@ -111,6 +111,9 @@ var _Draggable = class _Draggable {
if (event.get_button() != 1) if (event.get_button() != 1)
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
if (Tweener.getTweenCount(actor))
return Clutter.EVENT_PROPAGATE;
this._buttonDown = true; this._buttonDown = true;
this._grabActor(event.get_device()); this._grabActor(event.get_device());
@@ -136,6 +139,9 @@ var _Draggable = class _Draggable {
!global.display.is_pointer_emulating_sequence(event.get_event_sequence())) !global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
if (Tweener.getTweenCount(actor))
return Clutter.EVENT_PROPAGATE;
this._buttonDown = true; this._buttonDown = true;
this._grabActor(event.get_device(), event.get_event_sequence()); this._grabActor(event.get_device(), event.get_event_sequence());
@@ -422,22 +428,20 @@ var _Draggable = class _Draggable {
// to the final position because that tween would // to the final position because that tween would
// fight with updates as the user continues dragging // fight with updates as the user continues dragging
// the mouse; instead we do the position computations in // the mouse; instead we do the position computations in
// a ::new-frame handler. // an onUpdate() function.
this._dragActor.ease({ Tweener.addTween(this._dragActor,
scale_x: scale * origScale, { scale_x: scale * origScale,
scale_y: scale * origScale, scale_y: scale * origScale,
duration: SCALE_ANIMATION_TIME, time: SCALE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad',
}); onUpdate() {
let currentScale = this._dragActor.scale_x / origScale;
this._dragActor.get_transition('scale-x').connect('new-frame', () => { this._dragOffsetX = currentScale * origDragOffsetX;
let currentScale = this._dragActor.scale_x / origScale; this._dragOffsetY = currentScale * origDragOffsetY;
this._dragOffsetX = currentScale * origDragOffsetX; this._dragActor.set_position(this._dragX + this._dragOffsetX,
this._dragOffsetY = currentScale * origDragOffsetY; this._dragY + this._dragOffsetY);
this._dragActor.set_position( },
this._dragX + this._dragOffsetX, onUpdateScope: this });
this._dragY + this._dragOffsetY);
});
} }
} }
} }
@@ -500,7 +504,7 @@ var _Draggable = class _Draggable {
while (target) { while (target) {
if (target._delegate && target._delegate.handleDragOver) { if (target._delegate && target._delegate.handleDragOver) {
let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY); let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
// We currently loop through all parents on drag-over even if one of the children has handled it. // We currently loop through all parents on drag-over even if one of the children has handled it.
// We can check the return value of the function and break the loop if it's true if we don't want // We can check the return value of the function and break the loop if it's true if we don't want
// to continue checking the parents. // to continue checking the parents.
@@ -557,11 +561,11 @@ var _Draggable = class _Draggable {
let dropFunc = dragMonitors[i].dragDrop; let dropFunc = dragMonitors[i].dragDrop;
if (dropFunc) if (dropFunc)
switch (dropFunc(dropEvent)) { switch (dropFunc(dropEvent)) {
case DragDropResult.FAILURE: case DragDropResult.FAILURE:
case DragDropResult.SUCCESS: case DragDropResult.SUCCESS:
return true; return true;
case DragDropResult.CONTINUE: case DragDropResult.CONTINUE:
continue; continue;
} }
} }
@@ -572,25 +576,20 @@ var _Draggable = class _Draggable {
while (target) { while (target) {
if (target._delegate && target._delegate.acceptDrop) { if (target._delegate && target._delegate.acceptDrop) {
let [r_, targX, targY] = target.transform_stage_point(dropX, dropY); let [r, targX, targY] = target.transform_stage_point(dropX, dropY);
let accepted = false; if (target._delegate.acceptDrop(this.actor._delegate,
try { this._dragActor,
accepted = target._delegate.acceptDrop(this.actor._delegate, targX,
this._dragActor, targX, targY, event.get_time()); targY,
} catch (e) { event.get_time())) {
// On error, skip this target
logError(e, "Skipping drag target");
}
if (accepted) {
// If it accepted the drop without taking the actor, // If it accepted the drop without taking the actor,
// handle it ourselves. // handle it ourselves.
if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) { if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) {
if (this._restoreOnSuccess) { if (this._restoreOnSuccess) {
this._restoreDragActor(event.get_time()); this._restoreDragActor(event.get_time());
return true; return true;
} else { } else
this._dragActor.destroy(); this._dragActor.destroy();
}
} }
this._dragState = DragState.INIT; this._dragState = DragState.INIT;
@@ -614,15 +613,15 @@ var _Draggable = class _Draggable {
if (this._dragActorSource && this._dragActorSource.visible) { if (this._dragActorSource && this._dragActorSource.visible) {
// Snap the clone back to its source // Snap the clone back to its source
[x, y] = this._dragActorSource.get_transformed_position(); [x, y] = this._dragActorSource.get_transformed_position();
let [sourceScaledWidth] = this._dragActorSource.get_transformed_size(); let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size();
scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0; scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0;
} else if (this._dragOrigParent) { } else if (this._dragOrigParent) {
// Snap the actor back to its original position within // Snap the actor back to its original position within
// its parent, adjusting for the fact that the parent // its parent, adjusting for the fact that the parent
// may have been moved or scaled // may have been moved or scaled
let [parentX, parentY] = this._dragOrigParent.get_transformed_position(); let [parentX, parentY] = this._dragOrigParent.get_transformed_position();
let [parentWidth] = this._dragOrigParent.get_size(); let [parentWidth, parentHeight] = this._dragOrigParent.get_size();
let [parentScaledWidth] = this._dragOrigParent.get_transformed_size(); let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size();
let parentScale = 1.0; let parentScale = 1.0;
if (parentWidth != 0) if (parentWidth != 0)
parentScale = parentScaledWidth / parentWidth; parentScale = parentScaledWidth / parentWidth;
@@ -658,13 +657,13 @@ var _Draggable = class _Draggable {
let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation(); let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation();
this._animateDragEnd(eventTime, { this._animateDragEnd(eventTime,
x: snapBackX, { x: snapBackX,
y: snapBackY, y: snapBackY,
scale_x: snapBackScale, scale_x: snapBackScale,
scale_y: snapBackScale, scale_y: snapBackScale,
duration: SNAP_BACK_ANIMATION_TIME time: SNAP_BACK_ANIMATION_TIME,
}); });
} }
_restoreDragActor(eventTime) { _restoreDragActor(eventTime) {
@@ -676,27 +675,26 @@ var _Draggable = class _Draggable {
this._dragActor.set_scale(restoreScale, restoreScale); this._dragActor.set_scale(restoreScale, restoreScale);
this._dragActor.opacity = 0; this._dragActor.opacity = 0;
this._animateDragEnd(eventTime, { this._animateDragEnd(eventTime,
duration: REVERT_ANIMATION_TIME { time: REVERT_ANIMATION_TIME });
});
} }
_animateDragEnd(eventTime, params) { _animateDragEnd(eventTime, params) {
this._animationInProgress = true; this._animationInProgress = true;
params['opacity'] = this._dragOrigOpacity;
params['transition'] = 'easeOutQuad';
params['onComplete'] = this._onAnimationComplete;
params['onCompleteScope'] = this;
params['onCompleteParams'] = [this._dragActor, eventTime];
// start the animation // start the animation
this._dragActor.ease(Object.assign(params, { Tweener.addTween(this._dragActor, params)
opacity: this._dragOrigOpacity,
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
onComplete: () => {
this._onAnimationComplete(this._dragActor, eventTime);
}
}));
} }
_finishAnimation() { _finishAnimation() {
if (!this._animationInProgress) if (!this._animationInProgress)
return; return
this._animationInProgress = false; this._animationInProgress = false;
if (!this._buttonDown) if (!this._buttonDown)

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported EdgeDragAction */
const { Clutter, GObject, Meta, St } = imports.gi; const { Clutter, GObject, Meta, St } = imports.gi;
@@ -17,7 +16,7 @@ var EdgeDragAction = GObject.registerClass({
this._allowedModes = allowedModes; this._allowedModes = allowedModes;
this.set_n_touch_points(1); this.set_n_touch_points(1);
global.display.connect('grab-op-begin', () => this.cancel()); global.display.connect('grab-op-begin', () => { this.cancel(); });
} }
_getMonitorRect(x, y) { _getMonitorRect(x, y) {
@@ -27,7 +26,7 @@ var EdgeDragAction = GObject.registerClass({
return global.display.get_monitor_geometry(monitorIndex); return global.display.get_monitor_geometry(monitorIndex);
} }
vfunc_gesture_prepare(_actor) { vfunc_gesture_prepare(actor) {
if (this.get_n_current_points() == 0) if (this.get_n_current_points() == 0)
return false; return false;
@@ -43,7 +42,7 @@ var EdgeDragAction = GObject.registerClass({
(this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD)); (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
} }
vfunc_gesture_progress(_actor) { vfunc_gesture_progress(actor) {
let [startX, startY] = this.get_press_coords(0); let [startX, startY] = this.get_press_coords(0);
let [x, y] = this.get_motion_coords(0); let [x, y] = this.get_motion_coords(0);
let offsetX = Math.abs (x - startX); let offsetX = Math.abs (x - startX);
@@ -63,7 +62,7 @@ var EdgeDragAction = GObject.registerClass({
return true; return true;
} }
vfunc_gesture_end(_actor) { vfunc_gesture_end(actor) {
let [startX, startY] = this.get_press_coords(0); let [startX, startY] = this.get_press_coords(0);
let [x, y] = this.get_motion_coords(0); let [x, y] = this.get_motion_coords(0);
let monitorRect = this._getMonitorRect(startX, startY); let monitorRect = this._getMonitorRect(startX, startY);

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported init, EndSessionDialog */
/* /*
* Copyright 2010-2016 Red Hat, Inc * Copyright 2010-2016 Red Hat, Inc
* *
@@ -17,6 +16,8 @@
* along with this program; if not, see <http://www.gnu.org/licenses/>. * along with this program; if not, see <http://www.gnu.org/licenses/>.
*/ */
const Mainloop = imports.mainloop;
const { AccountsService, Clutter, Gio, const { AccountsService, Clutter, Gio,
GLib, GObject, Pango, Polkit, Shell, St } = imports.gi; GLib, GObject, Pango, Polkit, Shell, St } = imports.gi;
@@ -28,9 +29,13 @@ const UserWidget = imports.ui.userWidget;
const { loadInterfaceXML } = imports.misc.fileUtils; const { loadInterfaceXML } = imports.misc.fileUtils;
let _endSessionDialog = null;
const _ITEM_ICON_SIZE = 48; const _ITEM_ICON_SIZE = 48;
const _DIALOG_ICON_SIZE = 48; const _DIALOG_ICON_SIZE = 48;
var GSM_SESSION_MANAGER_LOGOUT_FORCE = 2;
const EndSessionDialogIface = loadInterfaceXML('org.gnome.SessionManager.EndSessionDialog'); const EndSessionDialogIface = loadInterfaceXML('org.gnome.SessionManager.EndSessionDialog');
const logoutDialogContent = { const logoutDialogContent = {
@@ -48,7 +53,7 @@ const logoutDialogContent = {
}, },
showBatteryWarning: false, showBatteryWarning: false,
confirmButtons: [{ signal: 'ConfirmedLogout', confirmButtons: [{ signal: 'ConfirmedLogout',
label: C_("button", "Log Out") }], label: C_("button", "Log Out") }],
iconStyleClass: 'end-session-dialog-logout-icon', iconStyleClass: 'end-session-dialog-logout-icon',
showOtherSessions: false, showOtherSessions: false,
}; };
@@ -64,9 +69,9 @@ const shutdownDialogContent = {
checkBoxText: C_("checkbox", "Install pending software updates"), checkBoxText: C_("checkbox", "Install pending software updates"),
showBatteryWarning: true, showBatteryWarning: true,
confirmButtons: [{ signal: 'ConfirmedReboot', confirmButtons: [{ signal: 'ConfirmedReboot',
label: C_("button", "Restart") }, label: C_("button", "Restart") },
{ signal: 'ConfirmedShutdown', { signal: 'ConfirmedShutdown',
label: C_("button", "Power Off") }], label: C_("button", "Power Off") }],
iconName: 'system-shutdown-symbolic', iconName: 'system-shutdown-symbolic',
iconStyleClass: 'end-session-dialog-shutdown-icon', iconStyleClass: 'end-session-dialog-shutdown-icon',
showOtherSessions: true, showOtherSessions: true,
@@ -81,7 +86,7 @@ const restartDialogContent = {
}, },
showBatteryWarning: false, showBatteryWarning: false,
confirmButtons: [{ signal: 'ConfirmedReboot', confirmButtons: [{ signal: 'ConfirmedReboot',
label: C_("button", "Restart") }], label: C_("button", "Restart") }],
iconName: 'view-refresh-symbolic', iconName: 'view-refresh-symbolic',
iconStyleClass: 'end-session-dialog-shutdown-icon', iconStyleClass: 'end-session-dialog-shutdown-icon',
showOtherSessions: true, showOtherSessions: true,
@@ -97,7 +102,7 @@ const restartUpdateDialogContent = {
}, },
showBatteryWarning: true, showBatteryWarning: true,
confirmButtons: [{ signal: 'ConfirmedReboot', confirmButtons: [{ signal: 'ConfirmedReboot',
label: C_("button", "Restart &amp; Install") }], label: C_("button", "Restart &amp; Install") }],
unusedFutureButtonForTranslation: C_("button", "Install &amp; Power Off"), unusedFutureButtonForTranslation: C_("button", "Install &amp; Power Off"),
unusedFutureCheckBoxForTranslation: C_("checkbox", "Power off after updates are installed"), unusedFutureCheckBoxForTranslation: C_("checkbox", "Power off after updates are installed"),
iconName: 'view-refresh-symbolic', iconName: 'view-refresh-symbolic',
@@ -117,18 +122,18 @@ const restartUpgradeDialogContent = {
disableTimer: true, disableTimer: true,
showBatteryWarning: false, showBatteryWarning: false,
confirmButtons: [{ signal: 'ConfirmedReboot', confirmButtons: [{ signal: 'ConfirmedReboot',
label: C_("button", "Restart &amp; Install") }], label: C_("button", "Restart &amp; Install") }],
iconName: 'view-refresh-symbolic', iconName: 'view-refresh-symbolic',
iconStyleClass: 'end-session-dialog-shutdown-icon', iconStyleClass: 'end-session-dialog-shutdown-icon',
showOtherSessions: true, showOtherSessions: true,
}; };
const DialogType = { const DialogType = {
LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */, LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */,
SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */, SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */, RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
UPDATE_RESTART: 3, UPDATE_RESTART: 3,
UPGRADE_RESTART: 4 UPGRADE_RESTART: 4
}; };
const DialogContent = { const DialogContent = {
@@ -154,7 +159,7 @@ function findAppFromInhibitor(inhibitor) {
let desktopFile; let desktopFile;
try { try {
[desktopFile] = inhibitor.GetAppIdSync(); [desktopFile] = inhibitor.GetAppIdSync();
} catch (e) { } catch(e) {
// XXX -- sometimes JIT inhibitors generated by gnome-session // XXX -- sometimes JIT inhibitors generated by gnome-session
// get removed too soon. Don't fail in this case. // get removed too soon. Don't fail in this case.
log('gnome-session gave us a dead inhibitor: %s'.format(inhibitor.get_object_path())); log('gnome-session gave us a dead inhibitor: %s'.format(inhibitor.get_object_path()));
@@ -218,7 +223,7 @@ function init() {
// This always returns the same singleton object // This always returns the same singleton object
// By instantiating it initially, we register the // By instantiating it initially, we register the
// bus object, etc. // bus object, etc.
(new EndSessionDialog()); _endSessionDialog = new EndSessionDialog();
} }
var EndSessionDialog = GObject.registerClass( var EndSessionDialog = GObject.registerClass(
@@ -230,13 +235,14 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._loginManager = LoginManager.getLoginManager(); this._loginManager = LoginManager.getLoginManager();
this._userManager = AccountsService.UserManager.get_default(); this._userManager = AccountsService.UserManager.get_default();
this._user = this._userManager.get_user(GLib.get_user_name()); this._user = this._userManager.get_user(GLib.get_user_name());
this._updatesPermission = null;
this._pkOfflineProxy = new PkOfflineProxy(Gio.DBus.system, this._pkOfflineProxy = new PkOfflineProxy(Gio.DBus.system,
'org.freedesktop.PackageKit', 'org.freedesktop.PackageKit',
'/org/freedesktop/PackageKit', '/org/freedesktop/PackageKit',
this._onPkOfflineProxyCreated.bind(this)); (proxy, error) => {
if (error)
log(error.message);
});
this._powerProxy = new UPowerProxy(Gio.DBus.system, this._powerProxy = new UPowerProxy(Gio.DBus.system,
'org.freedesktop.UPower', 'org.freedesktop.UPower',
'/org/freedesktop/UPower', '/org/freedesktop/UPower',
@@ -270,8 +276,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._iconBin = new St.Bin(); this._iconBin = new St.Bin();
mainContentLayout.add(this._iconBin, mainContentLayout.add(this._iconBin,
{ x_fill: true, { x_fill: true,
y_fill: false, y_fill: false,
x_align: St.Align.END, x_align: St.Align.END,
y_align: St.Align.START }); y_align: St.Align.START });
@@ -284,7 +290,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
messageLayout.add(this._subjectLabel, messageLayout.add(this._subjectLabel,
{ x_fill: false, { x_fill: false,
y_fill: false, y_fill: false,
x_align: St.Align.START, x_align: St.Align.START,
y_align: St.Align.START }); y_align: St.Align.START });
@@ -293,7 +299,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._descriptionLabel.clutter_text.line_wrap = true; this._descriptionLabel.clutter_text.line_wrap = true;
messageLayout.add(this._descriptionLabel, messageLayout.add(this._descriptionLabel,
{ y_fill: true, { y_fill: true,
y_align: St.Align.START }); y_align: St.Align.START });
this._checkBox = new CheckBox.CheckBox(); this._checkBox = new CheckBox.CheckBox();
@@ -331,36 +337,16 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._inhibitorSection.add_actor(this._sessionHeader); this._inhibitorSection.add_actor(this._sessionHeader);
this._inhibitorSection.add_actor(this._sessionList); this._inhibitorSection.add_actor(this._sessionList);
try {
this._updatesPermission = Polkit.Permission.new_sync("org.freedesktop.packagekit.trigger-offline-update", null, null);
} catch(e) {
log('No permission to trigger offline updates: %s'.format(e.toString()));
}
this._dbusImpl = Gio.DBusExportedObject.wrapJSObject(EndSessionDialogIface, this); this._dbusImpl = Gio.DBusExportedObject.wrapJSObject(EndSessionDialogIface, this);
this._dbusImpl.export(Gio.DBus.session, '/org/gnome/SessionManager/EndSessionDialog'); this._dbusImpl.export(Gio.DBus.session, '/org/gnome/SessionManager/EndSessionDialog');
} }
_onPkOfflineProxyCreated(proxy, error) {
if (error) {
log(error.message);
return;
}
// Creating a D-Bus proxy won't propagate SERVICE_UNKNOWN or NAME_HAS_NO_OWNER
// errors if PackageKit is not available, but the GIO implementation will make
// sure in that case that the proxy's g-name-owner is set to null, so check that.
if (this._pkOfflineProxy.g_name_owner === null) {
this._pkOfflineProxy = null;
return;
}
// It only makes sense to check for this permission if PackageKit is available.
Polkit.Permission.new(
'org.freedesktop.packagekit.trigger-offline-update', null, null,
(source, res) => {
try {
this._updatesPermission = Polkit.Permission.new_finish(res);
} catch (e) {
log(`No permission to trigger offline updates: ${e}`);
}
});
}
_onDestroy() { _onDestroy() {
this._user.disconnect(this._userLoadedId); this._user.disconnect(this._userLoadedId);
this._user.disconnect(this._userChangedId); this._user.disconnect(this._userChangedId);
@@ -405,8 +391,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
} }
// Use a different description when we are installing a system upgrade // Use a different description when we are installing a system upgrade
// if the PackageKit proxy is available (i.e. PackageKit is available). if (dialogContent.upgradeDescription) {
if (this._pkOfflineProxy && dialogContent.upgradeDescription) {
let name = this._pkOfflineProxy.PreparedUpgrade['name'].deep_unpack(); let name = this._pkOfflineProxy.PreparedUpgrade['name'].deep_unpack();
let version = this._pkOfflineProxy.PreparedUpgrade['version'].deep_unpack(); let version = this._pkOfflineProxy.PreparedUpgrade['version'].deep_unpack();
@@ -443,22 +428,20 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
_updateButtons() { _updateButtons() {
let dialogContent = DialogContent[this._type]; let dialogContent = DialogContent[this._type];
let buttons = [{ action: this.cancel.bind(this), let buttons = [{ action: this.cancel.bind(this),
label: _("Cancel"), label: _("Cancel"),
key: Clutter.Escape }]; key: Clutter.Escape }];
for (let i = 0; i < dialogContent.confirmButtons.length; i++) { for (let i = 0; i < dialogContent.confirmButtons.length; i++) {
let signal = dialogContent.confirmButtons[i].signal; let signal = dialogContent.confirmButtons[i].signal;
let label = dialogContent.confirmButtons[i].label; let label = dialogContent.confirmButtons[i].label;
buttons.push({ buttons.push({ action: () => {
action: () => { this.close(true);
this.close(true); let signalId = this.connect('closed', () => {
let signalId = this.connect('closed', () => { this.disconnect(signalId);
this.disconnect(signalId); this._confirm(signal);
this._confirm(signal); });
}); },
}, label: label });
label: label,
});
} }
this.setButtons(buttons); this.setButtons(buttons);
@@ -493,19 +476,19 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
// Trigger the offline update as requested // Trigger the offline update as requested
if (this._checkBox.actor.checked) { if (this._checkBox.actor.checked) {
switch (signal) { switch (signal) {
case "ConfirmedReboot": case "ConfirmedReboot":
this._triggerOfflineUpdateReboot(callback); this._triggerOfflineUpdateReboot(callback);
break; break;
case "ConfirmedShutdown": case "ConfirmedShutdown":
// To actually trigger the offline update, we need to // To actually trigger the offline update, we need to
// reboot to do the upgrade. When the upgrade is complete, // reboot to do the upgrade. When the upgrade is complete,
// the computer will shut down automatically. // the computer will shut down automatically.
signal = "ConfirmedReboot"; signal = "ConfirmedReboot";
this._triggerOfflineUpdateShutdown(callback); this._triggerOfflineUpdateShutdown(callback);
break; break;
default: default:
callback(); callback();
break; break;
} }
} else { } else {
this._triggerOfflineUpdateCancel(callback); this._triggerOfflineUpdateCancel(callback);
@@ -517,12 +500,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
} }
_triggerOfflineUpdateReboot(callback) { _triggerOfflineUpdateReboot(callback) {
// Handle this gracefully if PackageKit is not available.
if (!this._pkOfflineProxy) {
callback();
return;
}
this._pkOfflineProxy.TriggerRemote('reboot', (result, error) => { this._pkOfflineProxy.TriggerRemote('reboot', (result, error) => {
if (error) if (error)
log(error.message); log(error.message);
@@ -532,12 +509,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
} }
_triggerOfflineUpdateShutdown(callback) { _triggerOfflineUpdateShutdown(callback) {
// Handle this gracefully if PackageKit is not available.
if (!this._pkOfflineProxy) {
callback();
return;
}
this._pkOfflineProxy.TriggerRemote('power-off', (result, error) => { this._pkOfflineProxy.TriggerRemote('power-off', (result, error) => {
if (error) if (error)
log(error.message); log(error.message);
@@ -547,12 +518,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
} }
_triggerOfflineUpdateCancel(callback) { _triggerOfflineUpdateCancel(callback) {
// Handle this gracefully if PackageKit is not available.
if (!this._pkOfflineProxy) {
callback();
return;
}
this._pkOfflineProxy.CancelRemote((result, error) => { this._pkOfflineProxy.CancelRemote((result, error) => {
if (error) if (error)
log(error.message); log(error.message);
@@ -565,7 +530,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
let startTime = GLib.get_monotonic_time(); let startTime = GLib.get_monotonic_time();
this._secondsLeft = this._totalSecondsToStayOpen; this._secondsLeft = this._totalSecondsToStayOpen;
this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => { this._timerId = Mainloop.timeout_add_seconds(1, () => {
let currentTime = GLib.get_monotonic_time(); let currentTime = GLib.get_monotonic_time();
let secondsElapsed = ((currentTime - startTime) / 1000000); let secondsElapsed = ((currentTime - startTime) / 1000000);
@@ -587,7 +552,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
_stopTimer() { _stopTimer() {
if (this._timerId > 0) { if (this._timerId > 0) {
GLib.source_remove(this._timerId); Mainloop.source_remove(this._timerId);
this._timerId = 0; this._timerId = 0;
} }
@@ -620,7 +585,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
} }
_onInhibitorLoaded(inhibitor) { _onInhibitorLoaded(inhibitor) {
if (!this._applications.includes(inhibitor)) { if (this._applications.indexOf(inhibitor) < 0) {
// Stale inhibitor // Stale inhibitor
return; return;
} }
@@ -672,7 +637,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._loginManager.listSessions(result => { this._loginManager.listSessions(result => {
let n = 0; let n = 0;
for (let i = 0; i < result.length; i++) { for (let i = 0; i < result.length; i++) {
let [id_, uid_, userName, seat_, sessionPath] = result[i]; let[id, uid, userName, seat, sessionPath] = result[i];
let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath); let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath);
if (proxy.Class != 'user') if (proxy.Class != 'user')
@@ -715,8 +680,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
this._totalSecondsToStayOpen = totalSecondsToStayOpen; this._totalSecondsToStayOpen = totalSecondsToStayOpen;
this._type = type; this._type = type;
// Only consider updates and upgrades if PackageKit is available. if (this._type == DialogType.RESTART) {
if (this._pkOfflineProxy && this._type == DialogType.RESTART) {
if (this._pkOfflineProxy.UpdateTriggered) if (this._pkOfflineProxy.UpdateTriggered)
this._type = DialogType.UPDATE_RESTART; this._type = DialogType.UPDATE_RESTART;
else if (this._pkOfflineProxy.UpgradeTriggered) else if (this._pkOfflineProxy.UpgradeTriggered)
@@ -738,7 +702,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
let dialogContent = DialogContent[this._type]; let dialogContent = DialogContent[this._type];
for (let i = 0; i < inhibitorObjectPaths.length; i++) { for (let i = 0; i < inhibitorObjectPaths.length; i++) {
let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => { let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => {
this._onInhibitorLoaded(proxy); this._onInhibitorLoaded(proxy);
}); });
@@ -748,9 +712,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
if (dialogContent.showOtherSessions) if (dialogContent.showOtherSessions)
this._loadSessions(); this._loadSessions();
// Only consider updates and upgrades if PackageKit is available. let updateTriggered = this._pkOfflineProxy.UpdateTriggered;
let updateTriggered = this._pkOfflineProxy ? this._pkOfflineProxy.UpdateTriggered : false; let updatePrepared = this._pkOfflineProxy.UpdatePrepared;
let updatePrepared = this._pkOfflineProxy ? this._pkOfflineProxy.UpdatePrepared : false;
let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed; let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed;
_setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || ''); _setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || '');
@@ -782,7 +745,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
}); });
} }
Close(_parameters, _invocation) { Close(parameters, invocation) {
this.close(); this.close();
} }
}); });

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported init */
const Config = imports.misc.config; const Config = imports.misc.config;
@@ -10,7 +9,7 @@ imports.gi.versions.Gtk = '3.0';
imports.gi.versions.TelepathyGLib = '0.12'; imports.gi.versions.TelepathyGLib = '0.12';
imports.gi.versions.TelepathyLogger = '0.2'; imports.gi.versions.TelepathyLogger = '0.2';
const { Clutter, GLib, Meta, Shell, St } = imports.gi; const { Clutter, GLib, Shell, St } = imports.gi;
const Gettext = imports.gettext; const Gettext = imports.gettext;
// We can't import shell JS modules yet, because they may have // We can't import shell JS modules yet, because they may have
@@ -58,132 +57,8 @@ function _patchLayoutClass(layoutClass, styleProps) {
}; };
} }
function _makeEaseCallback(params, cleanup) { function _loggingFunc() {
let onComplete = params.onComplete; let fields = {'MESSAGE': [].join.call(arguments, ', ')};
delete params.onComplete;
let onStopped = params.onStopped;
delete params.onStopped;
return isFinished => {
cleanup();
if (onStopped)
onStopped(isFinished);
if (onComplete && isFinished)
onComplete();
};
}
function _getPropertyTarget(actor, propName) {
if (!propName.startsWith('@'))
return [actor, propName];
let [type, name, prop] = propName.split('.');
switch (type) {
case '@layout':
return [actor.layout_manager, name];
case '@actions':
return [actor.get_action(name), prop];
case '@constraints':
return [actor.get_constraint(name), prop];
case '@effects':
return [actor.get_effect(name), prop];
}
throw new Error(`Invalid property name ${propName}`);
}
function _easeActor(actor, params) {
actor.save_easing_state();
if (params.duration != undefined)
actor.set_easing_duration(params.duration);
delete params.duration;
if (params.delay != undefined)
actor.set_easing_delay(params.delay);
delete params.delay;
if (params.mode != undefined)
actor.set_easing_mode(params.mode);
delete params.mode;
let cleanup = () => Meta.enable_unredirect_for_display(global.display);
let callback = _makeEaseCallback(params, cleanup);
// cancel overwritten transitions
let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
animatedProps.forEach(p => actor.remove_transition(p));
actor.set(params);
actor.restore_easing_state();
let transition = animatedProps.map(p => actor.get_transition(p))
.find(t => t !== null);
if (transition && transition.delay)
transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
else
Meta.disable_unredirect_for_display(global.display);
if (transition)
transition.connect('stopped', (t, finished) => callback(finished));
else
callback(true);
}
function _easeActorProperty(actor, propName, target, params) {
// Avoid pointless difference with ease()
if (params.mode)
params.progress_mode = params.mode;
delete params.mode;
if (params.duration)
params.duration = adjustAnimationTime(params.duration);
let duration = Math.floor(params.duration || 0);
// Copy Clutter's behavior for implicit animations, see
// should_skip_implicit_transition()
if (actor instanceof Clutter.Actor && !actor.mapped)
duration = 0;
let cleanup = () => Meta.enable_unredirect_for_display(global.display);
let callback = _makeEaseCallback(params, cleanup);
// cancel overwritten transition
actor.remove_transition(propName);
if (duration == 0) {
let [obj, prop] = _getPropertyTarget(actor, propName);
obj[prop] = target;
Meta.disable_unredirect_for_display(global.display);
callback(true);
return;
}
let pspec = actor.find_property(propName);
let transition = new Clutter.PropertyTransition(Object.assign({
property_name: propName,
interval: new Clutter.Interval({ value_type: pspec.value_type }),
remove_on_complete: true
}, params));
actor.add_transition(propName, transition);
transition.set_to(target);
if (transition.delay)
transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
else
Meta.disable_unredirect_for_display(global.display);
transition.connect('stopped', (t, finished) => callback(finished));
}
function _loggingFunc(...args) {
let fields = { 'MESSAGE': args.join(', ') };
let domain = "GNOME Shell"; let domain = "GNOME Shell";
// If the caller is an extension, add it as metadata // If the caller is an extension, add it as metadata
@@ -218,27 +93,6 @@ function init() {
column_spacing: 'spacing-columns' }); column_spacing: 'spacing-columns' });
_patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' }); _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });
let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
Clutter.Actor.prototype.set_easing_duration = function(msecs) {
origSetEasingDuration.call(this, adjustAnimationTime(msecs));
};
let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
Clutter.Actor.prototype.set_easing_delay = function(msecs) {
origSetEasingDelay.call(this, adjustAnimationTime(msecs));
};
Clutter.Actor.prototype.ease = function(props, easingParams) {
_easeActor(this, props, easingParams);
};
Clutter.Actor.prototype.ease_property = function(propName, target, params) {
_easeActorProperty(this, propName, target, params);
};
St.Adjustment.prototype.ease = function(target, params) {
// we're not an actor of course, but we implement the same
// transition API as Clutter.Actor, so this works anyway
_easeActorProperty(this, 'value', target, params);
};
Clutter.Actor.prototype.toString = function() { Clutter.Actor.prototype.toString = function() {
return St.describe_actor(this); return St.describe_actor(this);
}; };
@@ -252,21 +106,15 @@ function init() {
} }
}); });
St.set_slow_down_factor = function(factor) {
let { stack } = new Error();
log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
St.Settings.get().slow_down_factor = factor;
};
let origToString = Object.prototype.toString; let origToString = Object.prototype.toString;
Object.prototype.toString = function() { Object.prototype.toString = function() {
let base = origToString.call(this); let base = origToString.call(this);
try { try {
if ('actor' in this && this.actor instanceof Clutter.Actor) if ('actor' in this && this.actor instanceof Clutter.Actor)
return base.replace(/\]$/, ` delegate for ${this.actor.toString().substring(1)}`); return base.replace(/\]$/, ' delegate for ' + this.actor.toString().substring(1));
else else
return base; return base;
} catch (e) { } catch(e) {
return base; return base;
} }
}; };
@@ -280,7 +128,7 @@ function init() {
if (slowdownEnv) { if (slowdownEnv) {
let factor = parseFloat(slowdownEnv); let factor = parseFloat(slowdownEnv);
if (!isNaN(factor) && factor > 0.0) if (!isNaN(factor) && factor > 0.0)
St.Settings.get().slow_down_factor = factor; St.set_slow_down_factor(factor);
} }
// OK, now things are initialized enough that we can import shell JS // OK, now things are initialized enough that we can import shell JS
@@ -290,17 +138,3 @@ function init() {
Tweener.init(); Tweener.init();
String.prototype.format = Format.format; String.prototype.format = Format.format;
} }
// adjustAnimationTime:
// @msecs: time in milliseconds
//
// Adjust @msecs to account for St's enable-animations
// and slow-down-factor settings
function adjustAnimationTime(msecs) {
let settings = St.Settings.get();
if (!settings.enable_animations)
return 1;
return settings.slow_down_factor * msecs;
}

View File

@@ -1,20 +1,19 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported init, installExtension, uninstallExtension,
checkForUpdates, updateExtension */
const { Clutter, Gio, GLib, GObject, Soup } = imports.gi; const { Clutter, Gio, GLib, GObject, Soup, St } = imports.gi;
const Config = imports.misc.config; const Config = imports.misc.config;
const Dialog = imports.ui.dialog;
const ExtensionUtils = imports.misc.extensionUtils; const ExtensionUtils = imports.misc.extensionUtils;
const ExtensionSystem = imports.ui.extensionSystem;
const FileUtils = imports.misc.fileUtils; const FileUtils = imports.misc.fileUtils;
const Main = imports.ui.main;
const ModalDialog = imports.ui.modalDialog; const ModalDialog = imports.ui.modalDialog;
const _signals = ExtensionSystem._signals;
var REPOSITORY_URL_BASE = 'https://extensions.gnome.org'; var REPOSITORY_URL_BASE = 'https://extensions.gnome.org';
var REPOSITORY_URL_DOWNLOAD = `${REPOSITORY_URL_BASE}/download-extension/%s.shell-extension.zip`; var REPOSITORY_URL_DOWNLOAD = REPOSITORY_URL_BASE + '/download-extension/%s.shell-extension.zip';
var REPOSITORY_URL_INFO = `${REPOSITORY_URL_BASE}/extension-info/`; var REPOSITORY_URL_INFO = REPOSITORY_URL_BASE + '/extension-info/';
var REPOSITORY_URL_UPDATE = `${REPOSITORY_URL_BASE}/update-info/`; var REPOSITORY_URL_UPDATE = REPOSITORY_URL_BASE + '/update-info/';
let _httpSession; let _httpSession;
@@ -26,7 +25,7 @@ function installExtension(uuid, invocation) {
_httpSession.queue_message(message, (session, message) => { _httpSession.queue_message(message, (session, message) => {
if (message.status_code != Soup.KnownStatusCode.OK) { if (message.status_code != Soup.KnownStatusCode.OK) {
Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`); ExtensionSystem.logExtensionError(uuid, 'downloading info: ' + message.status_code);
invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString()); invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
return; return;
} }
@@ -35,7 +34,7 @@ function installExtension(uuid, invocation) {
try { try {
info = JSON.parse(message.response_body.data); info = JSON.parse(message.response_body.data);
} catch (e) { } catch (e) {
Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`); ExtensionSystem.logExtensionError(uuid, 'parsing info: ' + e);
invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString()); invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString());
return; return;
} }
@@ -46,7 +45,7 @@ function installExtension(uuid, invocation) {
} }
function uninstallExtension(uuid) { function uninstallExtension(uuid) {
let extension = Main.extensionManager.lookup(uuid); let extension = ExtensionUtils.extensions[uuid];
if (!extension) if (!extension)
return false; return false;
@@ -54,7 +53,7 @@ function uninstallExtension(uuid) {
if (extension.type != ExtensionUtils.ExtensionType.PER_USER) if (extension.type != ExtensionUtils.ExtensionType.PER_USER)
return false; return false;
if (!Main.extensionManager.unloadExtension(extension)) if (!ExtensionSystem.unloadExtension(extension))
return false; return false;
FileUtils.recursivelyDeleteDir(extension.dir, true); FileUtils.recursivelyDeleteDir(extension.dir, true);
@@ -115,10 +114,10 @@ function updateExtension(uuid) {
_httpSession.queue_message(message, (session, message) => { _httpSession.queue_message(message, (session, message) => {
gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => { gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
let oldExtension = Main.extensionManager.lookup(uuid); let oldExtension = ExtensionUtils.extensions[uuid];
let extensionDir = oldExtension.dir; let extensionDir = oldExtension.dir;
if (!Main.extensionManager.unloadExtension(oldExtension)) if (!ExtensionSystem.unloadExtension(oldExtension))
return; return;
FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir); FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir);
@@ -127,11 +126,11 @@ function updateExtension(uuid) {
let extension = null; let extension = null;
try { try {
extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER); extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
Main.extensionManager.loadExtension(extension); ExtensionSystem.loadExtension(extension);
} catch (e) { } catch(e) {
if (extension) if (extension)
Main.extensionManager.unloadExtension(extension); ExtensionSystem.unloadExtension(extension);
logError(e, 'Error loading extension %s'.format(uuid)); logError(e, 'Error loading extension %s'.format(uuid));
@@ -140,7 +139,7 @@ function updateExtension(uuid) {
// Restore what was there before. We can't do much if we // Restore what was there before. We can't do much if we
// fail here. // fail here.
Main.extensionManager.loadExtension(oldExtension); ExtensionSystem.loadExtension(oldExtension);
return; return;
} }
@@ -153,9 +152,9 @@ function updateExtension(uuid) {
function checkForUpdates() { function checkForUpdates() {
let metadatas = {}; let metadatas = {};
Main.extensionManager.getUuids().forEach(uuid => { for (let uuid in ExtensionUtils.extensions) {
metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata; metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata;
}); }
let params = { shell_version: Config.PACKAGE_VERSION, let params = { shell_version: Config.PACKAGE_VERSION,
installed: JSON.stringify(metadatas) }; installed: JSON.stringify(metadatas) };
@@ -186,32 +185,36 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
this._info = info; this._info = info;
this._invocation = invocation; this._invocation = invocation;
this.setButtons([{ this.setButtons([{ label: _("Cancel"),
label: _("Cancel"), action: this._onCancelButtonPressed.bind(this),
action: this._onCancelButtonPressed.bind(this), key: Clutter.Escape
key: Clutter.Escape, },
}, { { label: _("Install"),
label: _("Install"), action: this._onInstallButtonPressed.bind(this),
action: this._onInstallButtonPressed.bind(this), default: true
default: true, }]);
}]);
let content = new Dialog.MessageDialogContent({ let message = _("Download and install “%s” from extensions.gnome.org?").format(info.name);
title: _("Download and install “%s” from extensions.gnome.org?").format(info.name),
icon: new Gio.FileIcon({
file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`)
})
});
this.contentLayout.add(content); let box = new St.BoxLayout({ style_class: 'message-dialog-main-layout',
vertical: false });
this.contentLayout.add(box);
let gicon = new Gio.FileIcon({ file: Gio.File.new_for_uri(REPOSITORY_URL_BASE + info.icon) })
let icon = new St.Icon({ gicon: gicon });
box.add(icon);
let label = new St.Label({ style_class: 'message-dialog-title headline',
text: message });
box.add(label);
} }
_onCancelButtonPressed() { _onCancelButtonPressed(button, event) {
this.close(); this.close();
this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled'])); this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled']));
} }
_onInstallButtonPressed() { _onInstallButtonPressed(button, event) {
let params = { shell_version: Config.PACKAGE_VERSION }; let params = { shell_version: Config.PACKAGE_VERSION };
let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid); let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid);
@@ -223,16 +226,21 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
function errback(code, message) { function errback(code, message) {
let msg = message ? message.toString() : ''; let msg = message ? message.toString() : '';
log('Error while installing %s: %s (%s)'.format(uuid, code, msg)); log('Error while installing %s: %s (%s)'.format(uuid, code, msg));
invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg); invocation.return_dbus_error('org.gnome.Shell.' + code, msg);
} }
function callback() { function callback() {
// Add extension to 'enabled-extensions' for the user, always...
let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY);
if (enabledExtensions.indexOf(uuid) == -1) {
enabledExtensions.push(uuid);
global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions);
}
try { try {
let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER); let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
Main.extensionManager.loadExtension(extension); ExtensionSystem.loadExtension(extension);
if (!Main.extensionManager.enableExtension(uuid)) } catch(e) {
throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`);
} catch (e) {
uninstallExtension(uuid); uninstallExtension(uuid);
errback('LoadExtensionError', e); errback('LoadExtensionError', e);
return; return;

View File

@@ -1,536 +1,374 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported init connect disconnect */
const { GLib, Gio, St } = imports.gi; const { Gio, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
const ExtensionUtils = imports.misc.extensionUtils; const ExtensionUtils = imports.misc.extensionUtils;
const FileUtils = imports.misc.fileUtils;
const Main = imports.ui.main; const Main = imports.ui.main;
const { ExtensionState, ExtensionType } = ExtensionUtils; var ExtensionState = {
ENABLED: 1,
DISABLED: 2,
ERROR: 3,
OUT_OF_DATE: 4,
DOWNLOADING: 5,
INITIALIZED: 6,
// Used as an error state for operations on unknown extensions,
// should never be in a real extensionMeta object.
UNINSTALLED: 99
};
// Arrays of uuids
var enabledExtensions;
// Contains the order that extensions were enabled in.
var extensionOrder = [];
// We don't really have a class to add signals on. So, create
// a simple dummy object, add the signal methods, and export those
// publically.
var _signals = {};
Signals.addSignalMethods(_signals);
var connect = _signals.connect.bind(_signals);
var disconnect = _signals.disconnect.bind(_signals);
const ENABLED_EXTENSIONS_KEY = 'enabled-extensions'; const ENABLED_EXTENSIONS_KEY = 'enabled-extensions';
const DISABLED_EXTENSIONS_KEY = 'disabled-extensions';
const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions'; const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions';
const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation'; const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation';
var ExtensionManager = class { var initted = false;
constructor() { var enabled;
this._initialized = false;
this._enabled = false;
this._extensions = new Map(); function disableExtension(uuid) {
this._enabledExtensions = []; let extension = ExtensionUtils.extensions[uuid];
this._extensionOrder = []; if (!extension)
return;
Main.sessionMode.connect('updated', this._sessionUpdated.bind(this)); if (extension.state != ExtensionState.ENABLED)
} return;
init() { // "Rebase" the extension order by disabling and then enabling extensions
// The following file should exist for a period of time when extensions // in order to help prevent conflicts.
// are enabled after start. If it exists, then the systemd unit will
// disable extensions should gnome-shell crash. // Example:
// Should the file already exist from a previous login, then this is OK. // order = [A, B, C, D, E]
let disableFilename = GLib.build_filenamev([GLib.get_user_runtime_dir(), 'gnome-shell-disable-extensions']); // user disables C
let disableFile = Gio.File.new_for_path(disableFilename); // this should: disable E, disable D, disable C, enable D, enable E
let orderIdx = extensionOrder.indexOf(uuid);
let order = extensionOrder.slice(orderIdx + 1);
let orderReversed = order.slice().reverse();
for (let i = 0; i < orderReversed.length; i++) {
let uuid = orderReversed[i];
try { try {
disableFile.create(Gio.FileCreateFlags.REPLACE_DESTINATION, null); ExtensionUtils.extensions[uuid].stateObj.disable();
} catch(e) {
logExtensionError(uuid, e);
}
}
if (extension.stylesheet) {
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
theme.unload_stylesheet(extension.stylesheet);
delete extension.stylesheet;
}
try {
extension.stateObj.disable();
} catch(e) {
logExtensionError(uuid, e);
}
for (let i = 0; i < order.length; i++) {
let uuid = order[i];
try {
ExtensionUtils.extensions[uuid].stateObj.enable();
} catch(e) {
logExtensionError(uuid, e);
}
}
extensionOrder.splice(orderIdx, 1);
if ( extension.state != ExtensionState.ERROR ) {
extension.state = ExtensionState.DISABLED;
_signals.emit('extension-state-changed', extension);
}
}
function enableExtension(uuid) {
let extension = ExtensionUtils.extensions[uuid];
if (!extension)
return;
if (extension.state == ExtensionState.INITIALIZED)
initExtension(uuid);
if (extension.state != ExtensionState.DISABLED)
return;
extensionOrder.push(uuid);
let stylesheetNames = [global.session_mode + '.css', 'stylesheet.css'];
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
for (let i = 0; i < stylesheetNames.length; i++) {
try {
let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
theme.load_stylesheet(stylesheetFile);
extension.stylesheet = stylesheetFile;
break;
} catch (e) { } catch (e) {
log(`Failed to create file ${disableFilename}: ${e.message}`); if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
} continue; // not an error
log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 60, () => {
FileUtils.deleteGFile(disableFile);
return GLib.SOURCE_REMOVE;
});
this._sessionUpdated();
}
lookup(uuid) {
return this._extensions.get(uuid);
}
getUuids() {
return [...this._extensions.keys()];
}
_callExtensionDisable(uuid) {
let extension = this.lookup(uuid);
if (!extension)
return; return;
if (extension.state != ExtensionState.ENABLED)
return;
// "Rebase" the extension order by disabling and then enabling extensions
// in order to help prevent conflicts.
// Example:
// order = [A, B, C, D, E]
// user disables C
// this should: disable E, disable D, disable C, enable D, enable E
let orderIdx = this._extensionOrder.indexOf(uuid);
let order = this._extensionOrder.slice(orderIdx + 1);
let orderReversed = order.slice().reverse();
for (let i = 0; i < orderReversed.length; i++) {
let uuid = orderReversed[i];
try {
this.lookup(uuid).stateObj.disable();
} catch (e) {
this.logExtensionError(uuid, e);
}
} }
}
try {
extension.stateObj.enable();
extension.state = ExtensionState.ENABLED;
_signals.emit('extension-state-changed', extension);
return;
} catch(e) {
if (extension.stylesheet) { if (extension.stylesheet) {
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
theme.unload_stylesheet(extension.stylesheet); theme.unload_stylesheet(extension.stylesheet);
delete extension.stylesheet; delete extension.stylesheet;
} }
logExtensionError(uuid, e);
try { return;
extension.stateObj.disable();
} catch (e) {
this.logExtensionError(uuid, e);
}
for (let i = 0; i < order.length; i++) {
let uuid = order[i];
try {
this.lookup(uuid).stateObj.enable();
} catch (e) {
this.logExtensionError(uuid, e);
}
}
this._extensionOrder.splice(orderIdx, 1);
if (extension.state != ExtensionState.ERROR) {
extension.state = ExtensionState.DISABLED;
this.emit('extension-state-changed', extension);
}
} }
}
_callExtensionEnable(uuid) { function logExtensionError(uuid, error) {
if (!Main.sessionMode.allowExtensions) let extension = ExtensionUtils.extensions[uuid];
return; if (!extension)
return;
let extension = this.lookup(uuid); let message = '' + error;
if (!extension)
return;
if (extension.state == ExtensionState.INITIALIZED) extension.state = ExtensionState.ERROR;
this._callExtensionInit(uuid); if (!extension.errors)
extension.errors = [];
extension.errors.push(message);
if (extension.state != ExtensionState.DISABLED) log('Extension "%s" had error: %s'.format(uuid, message));
return; _signals.emit('extension-state-changed', { uuid: uuid,
error: message,
state: extension.state });
}
let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css']; function loadExtension(extension) {
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme(); // Default to error, we set success as the last step
for (let i = 0; i < stylesheetNames.length; i++) { extension.state = ExtensionState.ERROR;
try {
let stylesheetFile = extension.dir.get_child(stylesheetNames[i]); let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
theme.load_stylesheet(stylesheetFile);
extension.stylesheet = stylesheetFile; if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
break; extension.state = ExtensionState.OUT_OF_DATE;
} catch (e) { } else {
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND)) let enabled = enabledExtensions.indexOf(extension.uuid) != -1;
continue; // not an error if (enabled) {
this.logExtensionError(uuid, e); if (!initExtension(extension.uuid))
return; return;
} if (extension.state == ExtensionState.DISABLED)
} enableExtension(extension.uuid);
try {
extension.stateObj.enable();
extension.state = ExtensionState.ENABLED;
this._extensionOrder.push(uuid);
this.emit('extension-state-changed', extension);
} catch (e) {
if (extension.stylesheet) {
theme.unload_stylesheet(extension.stylesheet);
delete extension.stylesheet;
}
this.logExtensionError(uuid, e);
}
}
enableExtension(uuid) {
if (!this._extensions.has(uuid))
return false;
let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
if (disabledExtensions.includes(uuid)) {
disabledExtensions = disabledExtensions.filter(item => item !== uuid);
global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
}
if (!enabledExtensions.includes(uuid)) {
enabledExtensions.push(uuid);
global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
}
return true;
}
disableExtension(uuid) {
if (!this._extensions.has(uuid))
return false;
let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
if (enabledExtensions.includes(uuid)) {
enabledExtensions = enabledExtensions.filter(item => item !== uuid);
global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
}
if (!disabledExtensions.includes(uuid)) {
disabledExtensions.push(uuid);
global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
}
return true;
}
logExtensionError(uuid, error) {
let extension = this.lookup(uuid);
if (!extension)
return;
let message = `${error}`;
extension.error = message;
extension.state = ExtensionState.ERROR;
if (!extension.errors)
extension.errors = [];
extension.errors.push(message);
logError(error, `Extension ${uuid}`);
this.emit('extension-state-changed', extension);
}
createExtensionObject(uuid, dir, type) {
let metadataFile = dir.get_child('metadata.json');
if (!metadataFile.query_exists(null)) {
throw new Error('Missing metadata.json');
}
let metadataContents, success_;
try {
[success_, metadataContents] = metadataFile.load_contents(null);
if (metadataContents instanceof Uint8Array)
metadataContents = imports.byteArray.toString(metadataContents);
} catch (e) {
throw new Error(`Failed to load metadata.json: ${e}`);
}
let meta;
try {
meta = JSON.parse(metadataContents);
} catch (e) {
throw new Error(`Failed to parse metadata.json: ${e}`);
}
let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
for (let i = 0; i < requiredProperties.length; i++) {
let prop = requiredProperties[i];
if (!meta[prop]) {
throw new Error(`missing "${prop}" property in metadata.json`);
}
}
if (uuid != meta.uuid) {
throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
}
let extension = {
metadata: meta,
uuid: meta.uuid,
type,
dir,
path: dir.get_path(),
error: '',
hasPrefs: dir.get_child('prefs.js').query_exists(null),
canChange: false
};
this._extensions.set(uuid, extension);
return extension;
}
loadExtension(extension) {
// Default to error, we set success as the last step
extension.state = ExtensionState.ERROR;
let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
extension.state = ExtensionState.OUT_OF_DATE;
} else { } else {
let enabled = this._enabledExtensions.includes(extension.uuid); extension.state = ExtensionState.INITIALIZED;
if (enabled) {
if (!this._callExtensionInit(extension.uuid))
return;
if (extension.state == ExtensionState.DISABLED)
this._callExtensionEnable(extension.uuid);
} else {
extension.state = ExtensionState.INITIALIZED;
}
} }
this._updateCanChange(extension);
this.emit('extension-state-changed', extension);
} }
unloadExtension(extension) { _signals.emit('extension-state-changed', extension);
// Try to disable it -- if it's ERROR'd, we can't guarantee that, }
// but it will be removed on next reboot, and hopefully nothing
// broke too much.
this._callExtensionDisable(extension.uuid);
extension.state = ExtensionState.UNINSTALLED; function unloadExtension(extension) {
this.emit('extension-state-changed', extension); // Try to disable it -- if it's ERROR'd, we can't guarantee that,
// but it will be removed on next reboot, and hopefully nothing
// broke too much.
disableExtension(extension.uuid);
this._extensions.delete(extension.uuid); extension.state = ExtensionState.UNINSTALLED;
return true; _signals.emit('extension-state-changed', extension);
delete ExtensionUtils.extensions[extension.uuid];
return true;
}
function reloadExtension(oldExtension) {
// Grab the things we'll need to pass to createExtensionObject
// to reload it.
let { uuid: uuid, dir: dir, type: type } = oldExtension;
// Then unload the old extension.
unloadExtension(oldExtension);
// Now, recreate the extension and load it.
let newExtension;
try {
newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type);
} catch(e) {
logExtensionError(uuid, e);
return;
} }
reloadExtension(oldExtension) { loadExtension(newExtension);
// Grab the things we'll need to pass to createExtensionObject }
// to reload it.
let { uuid, dir, type } = oldExtension;
// Then unload the old extension. function initExtension(uuid) {
this.unloadExtension(oldExtension); let extension = ExtensionUtils.extensions[uuid];
let dir = extension.dir;
// Now, recreate the extension and load it. if (!extension)
let newExtension; throw new Error("Extension was not properly created. Call loadExtension first");
let extensionJs = dir.get_child('extension.js');
if (!extensionJs.query_exists(null)) {
logExtensionError(uuid, new Error('Missing extension.js'));
return false;
}
let extensionModule;
let extensionState = null;
ExtensionUtils.installImporter(extension);
try {
extensionModule = extension.imports.extension;
} catch(e) {
logExtensionError(uuid, e);
return false;
}
if (extensionModule.init) {
try { try {
newExtension = this.createExtensionObject(uuid, dir, type); extensionState = extensionModule.init(extension);
} catch (e) { } catch(e) {
this.logExtensionError(uuid, e); logExtensionError(uuid, e);
return;
}
this.loadExtension(newExtension);
}
_callExtensionInit(uuid) {
if (!Main.sessionMode.allowExtensions)
return false;
let extension = this.lookup(uuid);
if (!extension)
throw new Error("Extension was not properly created. Call createExtensionObject first");
let dir = extension.dir;
let extensionJs = dir.get_child('extension.js');
if (!extensionJs.query_exists(null)) {
this.logExtensionError(uuid, new Error('Missing extension.js'));
return false; return false;
} }
let extensionModule;
let extensionState = null;
ExtensionUtils.installImporter(extension);
try {
extensionModule = extension.imports.extension;
} catch (e) {
this.logExtensionError(uuid, e);
return false;
}
if (extensionModule.init) {
try {
extensionState = extensionModule.init(extension);
} catch (e) {
this.logExtensionError(uuid, e);
return false;
}
}
if (!extensionState)
extensionState = extensionModule;
extension.stateObj = extensionState;
extension.state = ExtensionState.DISABLED;
this.emit('extension-loaded', uuid);
return true;
} }
_getModeExtensions() { if (!extensionState)
if (Array.isArray(Main.sessionMode.enabledExtensions)) extensionState = extensionModule;
return Main.sessionMode.enabledExtensions; extension.stateObj = extensionState;
return [];
}
_updateCanChange(extension) { extension.state = ExtensionState.DISABLED;
let hasError = _signals.emit('extension-loaded', uuid);
extension.state == ExtensionState.ERROR || return true;
extension.state == ExtensionState.OUT_OF_DATE; }
let isMode = this._getModeExtensions().includes(extension.uuid); function getEnabledExtensions() {
let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY); let extensions;
if (Array.isArray(Main.sessionMode.enabledExtensions))
extensions = Main.sessionMode.enabledExtensions;
else
extensions = [];
let changeKey = isMode if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
? DISABLE_USER_EXTENSIONS_KEY return extensions;
: ENABLED_EXTENSIONS_KEY;
extension.canChange = return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
!hasError && }
global.settings.is_writable(changeKey) &&
(isMode || !modeOnly);
}
_getEnabledExtensions() { function onEnabledExtensionsChanged() {
let extensions = this._getModeExtensions(); let newEnabledExtensions = getEnabledExtensions();
if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY)) if (!enabled)
extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY)); return;
// filter out 'disabled-extensions' which takes precedence // Find and enable all the newly enabled extensions: UUIDs found in the
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY); // new setting, but not in the old one.
return extensions.filter(item => !disabledExtensions.includes(item)); newEnabledExtensions.filter(
} uuid => !enabledExtensions.includes(uuid)
).forEach(uuid => {
enableExtension(uuid);
});
_onUserExtensionsEnabledChanged() { // Find and disable all the newly disabled extensions: UUIDs found in the
this._onEnabledExtensionsChanged(); // old setting, but not in the new one.
this._onSettingsWritableChanged(); enabledExtensions.filter(
} item => !newEnabledExtensions.includes(item)
).forEach(uuid => {
disableExtension(uuid);
});
_onEnabledExtensionsChanged() { enabledExtensions = newEnabledExtensions;
let newEnabledExtensions = this._getEnabledExtensions(); }
// Find and enable all the newly enabled extensions: UUIDs found in the function _onVersionValidationChanged() {
// new setting, but not in the old one. // we want to reload all extensions, but only enable
newEnabledExtensions.filter( // extensions when allowed by the sessionMode, so
uuid => !this._enabledExtensions.includes(uuid) // temporarily disable them all
).forEach(uuid => { enabledExtensions = [];
this._callExtensionEnable(uuid); for (let uuid in ExtensionUtils.extensions)
reloadExtension(ExtensionUtils.extensions[uuid]);
enabledExtensions = getEnabledExtensions();
if (Main.sessionMode.allowExtensions) {
enabledExtensions.forEach(uuid => {
enableExtension(uuid);
}); });
}
}
// Find and disable all the newly disabled extensions: UUIDs found in the function _loadExtensions() {
// old setting, but not in the new one. global.settings.connect('changed::' + ENABLED_EXTENSIONS_KEY, onEnabledExtensionsChanged);
this._extensionOrder.filter( global.settings.connect('changed::' + DISABLE_USER_EXTENSIONS_KEY, onEnabledExtensionsChanged);
uuid => !newEnabledExtensions.includes(uuid) global.settings.connect('changed::' + EXTENSION_DISABLE_VERSION_CHECK_KEY, _onVersionValidationChanged);
).reverse().forEach(uuid => {
this._callExtensionDisable(uuid); enabledExtensions = getEnabledExtensions();
let finder = new ExtensionUtils.ExtensionFinder();
finder.connect('extension-found', (finder, extension) => {
loadExtension(extension);
});
finder.scanExtensions();
}
function enableAllExtensions() {
if (enabled)
return;
if (!initted) {
_loadExtensions();
initted = true;
} else {
enabledExtensions.forEach(uuid => {
enableExtension(uuid);
}); });
this._enabledExtensions = newEnabledExtensions;
} }
enabled = true;
}
_onSettingsWritableChanged() { function disableAllExtensions() {
for (let extension of this._extensions.values()) { if (!enabled)
this._updateCanChange(extension); return;
this.emit('extension-state-changed', extension);
}
}
_onVersionValidationChanged() { if (initted) {
// Disabling extensions modifies the order array, so use a copy
let extensionOrder = this._extensionOrder.slice();
// Disable enabled extensions in the reverse order first to avoid
// the "rebasing" done in _callExtensionDisable...
extensionOrder.slice().reverse().forEach(uuid => { extensionOrder.slice().reverse().forEach(uuid => {
this._callExtensionDisable(uuid); disableExtension(uuid);
});
// ...and then reload and enable extensions in the correct order again.
[...this._extensions.values()].sort((a, b) => {
return extensionOrder.indexOf(a.uuid) - extensionOrder.indexOf(b.uuid);
}).forEach(extension => this.reloadExtension(extension));
}
_loadExtensions() {
global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`,
this._onEnabledExtensionsChanged.bind(this));
global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`,
this._onEnabledExtensionsChanged.bind(this));
global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`,
this._onUserExtensionsEnabledChanged.bind(this));
global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`,
this._onVersionValidationChanged.bind(this));
global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`,
this._onSettingsWritableChanged.bind(this));
global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`,
this._onSettingsWritableChanged.bind(this));
this._enabledExtensions = this._getEnabledExtensions();
let perUserDir = Gio.File.new_for_path(global.userdatadir);
FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
let fileType = info.get_file_type();
if (fileType != Gio.FileType.DIRECTORY)
return;
let uuid = info.get_name();
let existing = this.lookup(uuid);
if (existing) {
log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`);
return;
}
let extension;
let type = dir.has_prefix(perUserDir)
? ExtensionType.PER_USER
: ExtensionType.SYSTEM;
try {
extension = this.createExtensionObject(uuid, dir, type);
} catch (e) {
logError(e, `Could not load extension ${uuid}`);
return;
}
this.loadExtension(extension);
}); });
} }
_enableAllExtensions() { enabled = false;
if (this._enabled) }
return;
if (!this._initialized) { function _sessionUpdated() {
this._loadExtensions(); // For now sessionMode.allowExtensions controls extensions from both the
this._initialized = true; // 'enabled-extensions' preference and the sessionMode.enabledExtensions
} else { // property; it might make sense to make enabledExtensions independent
this._enabledExtensions.forEach(uuid => { // from allowExtensions in the future
this._callExtensionEnable(uuid); if (Main.sessionMode.allowExtensions) {
}); if (initted)
} enabledExtensions = getEnabledExtensions();
this._enabled = true; enableAllExtensions();
} else {
disableAllExtensions();
} }
}
_disableAllExtensions() { function init() {
if (!this._enabled) Main.sessionMode.connect('updated', _sessionUpdated);
return; _sessionUpdated();
}
if (this._initialized) {
this._extensionOrder.slice().reverse().forEach(uuid => {
this._callExtensionDisable(uuid);
});
}
this._enabled = false;
}
_sessionUpdated() {
// For now sessionMode.allowExtensions controls extensions from both the
// 'enabled-extensions' preference and the sessionMode.enabledExtensions
// property; it might make sense to make enabledExtensions independent
// from allowExtensions in the future
if (Main.sessionMode.allowExtensions) {
// Take care of added or removed sessionMode extensions
this._onEnabledExtensionsChanged();
this._enableAllExtensions();
} else {
this._disableAllExtensions();
}
}
};
Signals.addSignalMethods(ExtensionManager.prototype);

View File

@@ -49,15 +49,15 @@ var FocusCaretTracker = class FocusCaretTracker {
this._atspiInited = true; this._atspiInited = true;
} }
return this._atspiInited; return this._atspiInited;
} }
registerFocusListener() { registerFocusListener() {
if (!this._initAtspi() || this._focusListenerRegistered) if (!this._initAtspi() || this._focusListenerRegistered)
return; return;
this._atspiListener.register(`${STATECHANGED}:focused`); this._atspiListener.register(STATECHANGED + ':focused');
this._atspiListener.register(`${STATECHANGED}:selected`); this._atspiListener.register(STATECHANGED + ':selected');
this._focusListenerRegistered = true; this._focusListenerRegistered = true;
} }
@@ -73,8 +73,8 @@ var FocusCaretTracker = class FocusCaretTracker {
if (!this._focusListenerRegistered) if (!this._focusListenerRegistered)
return; return;
this._atspiListener.deregister(`${STATECHANGED}:focused`); this._atspiListener.deregister(STATECHANGED + ':focused');
this._atspiListener.deregister(`${STATECHANGED}:selected`); this._atspiListener.deregister(STATECHANGED + ':selected');
this._focusListenerRegistered = false; this._focusListenerRegistered = false;
} }

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported GrabHelper */
const { Clutter, St } = imports.gi; const { Clutter, St } = imports.gi;
@@ -88,7 +87,7 @@ var GrabHelper = class GrabHelper {
_isWithinGrabbedActor(actor) { _isWithinGrabbedActor(actor) {
let currentActor = this.currentGrab.actor; let currentActor = this.currentGrab.actor;
while (actor) { while (actor) {
if (this._actors.includes(actor)) if (this._actors.indexOf(actor) != -1)
return true; return true;
if (actor == currentActor) if (actor == currentActor)
return true; return true;

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported CandidatePopup */
const { Clutter, IBus, St } = imports.gi; const { Clutter, IBus, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
@@ -9,8 +8,8 @@ const Main = imports.ui.main;
var MAX_CANDIDATES_PER_PAGE = 16; var MAX_CANDIDATES_PER_PAGE = 16;
var DEFAULT_INDEX_LABELS = ['1', '2', '3', '4', '5', '6', '7', '8', var DEFAULT_INDEX_LABELS = [ '1', '2', '3', '4', '5', '6', '7', '8',
'9', '0', 'a', 'b', 'c', 'd', 'e', 'f']; '9', '0', 'a', 'b', 'c', 'd', 'e', 'f' ];
var CandidateArea = class CandidateArea { var CandidateArea = class CandidateArea {
constructor() { constructor() {
@@ -38,14 +37,14 @@ var CandidateArea = class CandidateArea {
this.actor.connect('scroll-event', (actor, event) => { this.actor.connect('scroll-event', (actor, event) => {
let direction = event.get_scroll_direction(); let direction = event.get_scroll_direction();
switch (direction) { switch(direction) {
case Clutter.ScrollDirection.UP: case Clutter.ScrollDirection.UP:
this.emit('cursor-up'); this.emit('cursor-up');
break; break;
case Clutter.ScrollDirection.DOWN: case Clutter.ScrollDirection.DOWN:
this.emit('cursor-down'); this.emit('cursor-down');
break; break;
} };
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
}); });
@@ -126,9 +125,6 @@ Signals.addSignalMethods(CandidateArea.prototype);
var CandidatePopup = class CandidatePopup { var CandidatePopup = class CandidatePopup {
constructor() { constructor() {
this._dummyCursor = new St.Widget({ opacity: 0 });
Main.layoutManager.uiGroup.add_actor(this._dummyCursor);
this._boxPointer = new BoxPointer.BoxPointer(St.Side.TOP); this._boxPointer = new BoxPointer.BoxPointer(St.Side.TOP);
this._boxPointer.visible = false; this._boxPointer.visible = false;
this._boxPointer.style_class = 'candidate-popup-boxpointer'; this._boxPointer.style_class = 'candidate-popup-boxpointer';
@@ -185,7 +181,7 @@ var CandidatePopup = class CandidatePopup {
let window = global.display.focus_window.get_compositor_private(); let window = global.display.focus_window.get_compositor_private();
this._setDummyCursorGeometry(window.x + x, window.y + y, w, h); this._setDummyCursorGeometry(window.x + x, window.y + y, w, h);
}); });
} catch (e) { } catch(e) {
// Only recent IBus versions have support for this signal // Only recent IBus versions have support for this signal
// which is used for wayland clients. In order to work // which is used for wayland clients. In order to work
// with older IBus versions we can silently ignore the // with older IBus versions we can silently ignore the
@@ -202,29 +198,29 @@ var CandidatePopup = class CandidatePopup {
this._setTextAttributes(this._preeditText.clutter_text, this._setTextAttributes(this._preeditText.clutter_text,
attrs); attrs);
}); });
panelService.connect('show-preedit-text', () => { panelService.connect('show-preedit-text', ps => {
this._preeditText.show(); this._preeditText.show();
this._updateVisibility(); this._updateVisibility();
}); });
panelService.connect('hide-preedit-text', () => { panelService.connect('hide-preedit-text', ps => {
this._preeditText.hide(); this._preeditText.hide();
this._updateVisibility(); this._updateVisibility();
}); });
panelService.connect('update-auxiliary-text', (_ps, text, visible) => { panelService.connect('update-auxiliary-text', (ps, text, visible) => {
this._auxText.visible = visible; this._auxText.visible = visible;
this._updateVisibility(); this._updateVisibility();
this._auxText.text = text.get_text(); this._auxText.text = text.get_text();
}); });
panelService.connect('show-auxiliary-text', () => { panelService.connect('show-auxiliary-text', ps => {
this._auxText.show(); this._auxText.show();
this._updateVisibility(); this._updateVisibility();
}); });
panelService.connect('hide-auxiliary-text', () => { panelService.connect('hide-auxiliary-text', ps => {
this._auxText.hide(); this._auxText.hide();
this._updateVisibility(); this._updateVisibility();
}); });
panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => { panelService.connect('update-lookup-table', (ps, lookupTable, visible) => {
this._candidateArea.actor.visible = visible; this._candidateArea.actor.visible = visible;
this._updateVisibility(); this._updateVisibility();
@@ -239,7 +235,7 @@ var CandidatePopup = class CandidatePopup {
let indexes = []; let indexes = [];
let indexLabel; let indexLabel;
for (let i = 0; (indexLabel = lookupTable.get_label(i)); ++i) for (let i = 0; (indexLabel = lookupTable.get_label(i)); ++i)
indexes.push(indexLabel.get_text()); indexes.push(indexLabel.get_text());
Main.keyboard.resetSuggestions(); Main.keyboard.resetSuggestions();
@@ -260,26 +256,24 @@ var CandidatePopup = class CandidatePopup {
this._candidateArea.setOrientation(lookupTable.get_orientation()); this._candidateArea.setOrientation(lookupTable.get_orientation());
this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages); this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
}); });
panelService.connect('show-lookup-table', () => { panelService.connect('show-lookup-table', ps => {
this._candidateArea.actor.show(); this._candidateArea.actor.show();
this._updateVisibility(); this._updateVisibility();
}); });
panelService.connect('hide-lookup-table', () => { panelService.connect('hide-lookup-table', ps => {
this._candidateArea.actor.hide(); this._candidateArea.actor.hide();
this._updateVisibility(); this._updateVisibility();
}); });
panelService.connect('focus-out', () => { panelService.connect('focus-out', ps => {
this._boxPointer.close(BoxPointer.PopupAnimation.NONE); this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
Main.keyboard.resetSuggestions(); Main.keyboard.resetSuggestions();
}); });
} }
_setDummyCursorGeometry(x, y, w, h) { _setDummyCursorGeometry(x, y, w, h) {
this._dummyCursor.set_position(Math.round(x), Math.round(y)); Main.layoutManager.setDummyCursorGeometry(x, y, w, h);
this._dummyCursor.set_size(Math.round(w), Math.round(h));
if (this._boxPointer.visible) if (this._boxPointer.visible)
this._boxPointer.setPosition(this._dummyCursor, 0); this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
} }
_updateVisibility() { _updateVisibility() {
@@ -289,7 +283,7 @@ var CandidatePopup = class CandidatePopup {
this._candidateArea.actor.visible)); this._candidateArea.actor.visible));
if (isVisible) { if (isVisible) {
this._boxPointer.setPosition(this._dummyCursor, 0); this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
this._boxPointer.open(BoxPointer.PopupAnimation.NONE); this._boxPointer.open(BoxPointer.PopupAnimation.NONE);
this._boxPointer.raise_top(); this._boxPointer.raise_top();
} else { } else {

View File

@@ -1,22 +1,22 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported BaseIcon, IconGrid, PaginatedIconGrid */
const { Clutter, GLib, GObject, Meta, St } = imports.gi; const { Clutter, GObject, Meta, St } = imports.gi;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
const Main = imports.ui.main; const Main = imports.ui.main;
var ICON_SIZE = 96; var ICON_SIZE = 96;
var MIN_ICON_SIZE = 16; var MIN_ICON_SIZE = 16;
var EXTRA_SPACE_ANIMATION_TIME = 250; var EXTRA_SPACE_ANIMATION_TIME = 0.25;
var ANIMATION_TIME_IN = 350; var ANIMATION_TIME_IN = 0.350;
var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN; var ANIMATION_TIME_OUT = 1/2 * ANIMATION_TIME_IN;
var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN; var ANIMATION_MAX_DELAY_FOR_ITEM = 2/3 * ANIMATION_TIME_IN;
var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM; var ANIMATION_BASE_DELAY_FOR_ITEM = 1/4 * ANIMATION_MAX_DELAY_FOR_ITEM;
var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2 / 3 * ANIMATION_TIME_OUT; var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2/3 * ANIMATION_TIME_OUT;
var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1 / 4 * ANIMATION_TIME_IN; var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1/4 * ANIMATION_TIME_IN;
var ANIMATION_BOUNCE_ICON_SCALE = 1.1; var ANIMATION_BOUNCE_ICON_SCALE = 1.1;
@@ -26,7 +26,7 @@ var AnimationDirection = {
}; };
var APPICON_ANIMATION_OUT_SCALE = 3; var APPICON_ANIMATION_OUT_SCALE = 3;
var APPICON_ANIMATION_OUT_TIME = 250; var APPICON_ANIMATION_OUT_TIME = 0.25;
var BaseIcon = GObject.registerClass( var BaseIcon = GObject.registerClass(
class BaseIcon extends St.Bin { class BaseIcon extends St.Bin {
@@ -56,10 +56,6 @@ class BaseIcon extends St.Bin {
if (params.showLabel) { if (params.showLabel) {
this.label = new St.Label({ text: label }); this.label = new St.Label({ text: label });
this.label.clutter_text.set({
x_align: Clutter.ActorAlign.CENTER,
y_align: Clutter.ActorAlign.CENTER
});
this._box.add_actor(this.label); this._box.add_actor(this.label);
} else { } else {
this.label = null; this.label = null;
@@ -75,14 +71,14 @@ class BaseIcon extends St.Bin {
this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this)); this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this));
} }
vfunc_get_preferred_width(_forHeight) { vfunc_get_preferred_width(forHeight) {
// Return the actual height to keep the squared aspect // Return the actual height to keep the squared aspect
return this.get_preferred_height(-1); return this.get_preferred_height(-1);
} }
// This can be overridden by a subclass, or by the createIcon // This can be overridden by a subclass, or by the createIcon
// parameter to _init() // parameter to _init()
createIcon(_size) { createIcon(size) {
throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`); throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`);
} }
@@ -141,30 +137,17 @@ class BaseIcon extends St.Bin {
// animating. // animating.
zoomOutActor(this.child); zoomOutActor(this.child);
} }
animateZoomOutAtPos(x, y) {
zoomOutActorAtPos(this.child, x, y);
}
update() {
this._createIconTexture(this.iconSize);
}
}); });
function clamp(value, min, max) { function clamp(value, min, max) {
return Math.max(Math.min(value, max), min); return Math.max(Math.min(value, max), min);
} };
function zoomOutActor(actor) { function zoomOutActor(actor) {
let [x, y] = actor.get_transformed_position();
zoomOutActorAtPos(actor, x, y);
}
function zoomOutActorAtPos(actor, x, y) {
let actorClone = new Clutter.Clone({ source: actor, let actorClone = new Clutter.Clone({ source: actor,
reactive: false }); reactive: false });
let [width, height] = actor.get_transformed_size(); let [width, height] = actor.get_transformed_size();
let [x, y] = actor.get_transformed_position();
actorClone.set_size(width, height); actorClone.set_size(width, height);
actorClone.set_position(x, y); actorClone.set_position(x, y);
actorClone.opacity = 255; actorClone.opacity = 255;
@@ -181,21 +164,23 @@ function zoomOutActorAtPos(actor, x, y) {
let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth); let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth);
let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight); let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight);
actorClone.ease({ Tweener.addTween(actorClone,
scale_x: APPICON_ANIMATION_OUT_SCALE, { time: APPICON_ANIMATION_OUT_TIME,
scale_y: APPICON_ANIMATION_OUT_SCALE, scale_x: APPICON_ANIMATION_OUT_SCALE,
translation_x: containedX - scaledX, scale_y: APPICON_ANIMATION_OUT_SCALE,
translation_y: containedY - scaledY, translation_x: containedX - scaledX,
opacity: 0, translation_y: containedY - scaledY,
duration: APPICON_ANIMATION_OUT_TIME, opacity: 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => actorClone.destroy() onComplete() {
}); actorClone.destroy();
}
});
} }
var IconGrid = GObject.registerClass({ var IconGrid = GObject.registerClass({
Signals: { 'animation-done': {}, Signals: {'animation-done': {},
'child-focused': { param_types: [Clutter.Actor.$gtype] } }, 'child-focused': { param_types: [Clutter.Actor.$gtype]} },
}, class IconGrid extends St.Widget { }, class IconGrid extends St.Widget {
_init(params) { _init(params) {
super._init({ style_class: 'icon-grid', super._init({ style_class: 'icon-grid',
@@ -221,8 +206,6 @@ var IconGrid = GObject.registerClass({
this.rightPadding = 0; this.rightPadding = 0;
this.leftPadding = 0; this.leftPadding = 0;
this._updateIconSizesLaterId = 0;
this._items = []; this._items = [];
this._clonesAnimating = []; this._clonesAnimating = [];
// Pulled from CSS, but hardcode some defaults here // Pulled from CSS, but hardcode some defaults here
@@ -235,19 +218,11 @@ var IconGrid = GObject.registerClass({
// swarming into the void ... // swarming into the void ...
this.connect('notify::mapped', () => { this.connect('notify::mapped', () => {
if (!this.mapped) if (!this.mapped)
this._resetAnimationActors(); this._cancelAnimation();
}); });
this.connect('actor-added', this._childAdded.bind(this)); this.connect('actor-added', this._childAdded.bind(this));
this.connect('actor-removed', this._childRemoved.bind(this)); this.connect('actor-removed', this._childRemoved.bind(this));
this.connect('destroy', this._onDestroy.bind(this));
}
_onDestroy() {
if (this._updateIconSizesLaterId) {
Meta.later_remove (this._updateIconSizesLaterId);
this._updateIconSizesLaterId = 0;
}
} }
_keyFocusIn(actor) { _keyFocusIn(actor) {
@@ -256,35 +231,22 @@ var IconGrid = GObject.registerClass({
_childAdded(grid, child) { _childAdded(grid, child) {
child._iconGridKeyFocusInId = child.connect('key-focus-in', this._keyFocusIn.bind(this)); child._iconGridKeyFocusInId = child.connect('key-focus-in', this._keyFocusIn.bind(this));
child._paintVisible = child.opacity > 0;
child._opacityChangedId = child.connect('notify::opacity', () => {
let paintVisible = child._paintVisible;
child._paintVisible = child.opacity > 0;
if (paintVisible !== child._paintVisible)
this.queue_relayout();
});
} }
_childRemoved(grid, child) { _childRemoved(grid, child) {
child.disconnect(child._iconGridKeyFocusInId); child.disconnect(child._iconGridKeyFocusInId);
delete child._iconGridKeyFocusInId;
child.disconnect(child._opacityChangedId);
delete child._opacityChangedId;
delete child._paintVisible;
} }
vfunc_get_preferred_width(_forHeight) { vfunc_get_preferred_width(forHeight) {
if (this._fillParent) if (this._fillParent)
// Ignore all size requests of children and request a size of 0; // Ignore all size requests of children and request a size of 0;
// later we'll allocate as many children as fit the parent // later we'll allocate as many children as fit the parent
return [0, 0]; return [0, 0];
let nChildren = this.get_n_children(); let nChildren = this.get_n_children();
let nColumns = this._colLimit let nColumns = this._colLimit ? Math.min(this._colLimit,
? Math.min(this._colLimit, nChildren) nChildren)
: nChildren; : nChildren;
let totalSpacing = Math.max(0, nColumns - 1) * this._getSpacing(); let totalSpacing = Math.max(0, nColumns - 1) * this._getSpacing();
// Kind of a lie, but not really an issue right now. If // Kind of a lie, but not really an issue right now. If
// we wanted to support some sort of hidden/overflow that would // we wanted to support some sort of hidden/overflow that would
@@ -314,7 +276,7 @@ var IconGrid = GObject.registerClass({
if (forWidth < 0) if (forWidth < 0)
nColumns = children.length; nColumns = children.length;
else else
[nColumns] = this._computeLayout(forWidth); [nColumns, ] = this._computeLayout(forWidth);
let nRows; let nRows;
if (nColumns > 0) if (nColumns > 0)
@@ -349,15 +311,15 @@ var IconGrid = GObject.registerClass({
let [nColumns, usedWidth] = this._computeLayout(availWidth); let [nColumns, usedWidth] = this._computeLayout(availWidth);
let leftEmptySpace; let leftEmptySpace;
switch (this._xAlign) { switch(this._xAlign) {
case St.Align.START: case St.Align.START:
leftEmptySpace = 0; leftEmptySpace = 0;
break; break;
case St.Align.MIDDLE: case St.Align.MIDDLE:
leftEmptySpace = Math.floor((availWidth - usedWidth) / 2); leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
break; break;
case St.Align.END: case St.Align.END:
leftEmptySpace = availWidth - usedWidth; leftEmptySpace = availWidth - usedWidth;
} }
let animating = this._clonesAnimating.length > 0; let animating = this._clonesAnimating.length > 0;
@@ -415,15 +377,15 @@ var IconGrid = GObject.registerClass({
return true; return true;
for (let child = this.get_first_child(); for (let child = this.get_first_child();
child != null; child != null;
child = child.get_next_sibling()) { child = child.get_next_sibling()) {
if (!child.visible || !child.opacity) if (!child.visible || !child.opacity)
continue; continue;
let childVolume = child.get_transformed_paint_volume(this); let childVolume = child.get_transformed_paint_volume(this);
if (!childVolume) if (!childVolume)
return false; return false
paintVolume.union(childVolume); paintVolume.union(childVolume);
} }
@@ -436,20 +398,21 @@ var IconGrid = GObject.registerClass({
* set of items to be animated. * set of items to be animated.
*/ */
_getChildrenToAnimate() { _getChildrenToAnimate() {
return this._getVisibleChildren().filter(child => child.opacity > 0); return this._getVisibleChildren();
} }
_resetAnimationActors() { _cancelAnimation() {
this._clonesAnimating.forEach(clone => { clone.destroy(); });
this._clonesAnimating = [];
}
_animationDone() {
this._clonesAnimating.forEach(clone => { this._clonesAnimating.forEach(clone => {
clone.source.reactive = true; clone.source.reactive = true;
clone.source.opacity = 255; clone.source.opacity = 255;
clone.destroy(); clone.destroy();
}); });
this._clonesAnimating = []; this._clonesAnimating = [];
}
_animationDone() {
this._resetAnimationActors();
this.emit('animation-done'); this.emit('animation-done');
} }
@@ -458,7 +421,7 @@ var IconGrid = GObject.registerClass({
throw new GObject.NotImplementedError("Pulse animation only implements " + throw new GObject.NotImplementedError("Pulse animation only implements " +
"'in' animation direction"); "'in' animation direction");
this._resetAnimationActors(); this._cancelAnimation();
let actors = this._getChildrenToAnimate(); let actors = this._getChildrenToAnimate();
if (actors.length == 0) { if (actors.length == 0) {
@@ -481,32 +444,30 @@ var IconGrid = GObject.registerClass({
let delay = index / actors.length * maxDelay; let delay = index / actors.length * maxDelay;
let bounceUpTime = ANIMATION_TIME_IN / 4; let bounceUpTime = ANIMATION_TIME_IN / 4;
let isLastItem = index == actors.length - 1; let isLastItem = index == actors.length - 1;
actor.ease({ Tweener.addTween(actor,
scale_x: ANIMATION_BOUNCE_ICON_SCALE, { time: bounceUpTime,
scale_y: ANIMATION_BOUNCE_ICON_SCALE, transition: 'easeInOutQuad',
duration: bounceUpTime, delay: delay,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, scale_x: ANIMATION_BOUNCE_ICON_SCALE,
delay: delay, scale_y: ANIMATION_BOUNCE_ICON_SCALE,
onComplete: () => { onComplete: () => {
let duration = ANIMATION_TIME_IN - bounceUpTime; Tweener.addTween(actor,
actor.ease({ { time: ANIMATION_TIME_IN - bounceUpTime,
scale_x: 1, transition: 'easeInOutQuad',
scale_y: 1, scale_x: 1,
duration, scale_y: 1,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, onComplete: () => {
onComplete: () => { if (isLastItem)
if (isLastItem) this._animationDone();
this._animationDone(); }
actor.reactive = true; });
} }
}); });
}
});
} }
} }
animateSpring(animationDirection, sourceActor) { animateSpring(animationDirection, sourceActor) {
this._resetAnimationActors(); this._cancelAnimation();
let actors = this._getChildrenToAnimate(); let actors = this._getChildrenToAnimate();
if (actors.length == 0) { if (actors.length == 0) {
@@ -543,7 +504,7 @@ var IconGrid = GObject.registerClass({
this._clonesAnimating.push(actorClone); this._clonesAnimating.push(actorClone);
Main.uiGroup.add_actor(actorClone); Main.uiGroup.add_actor(actorClone);
let [width, height] = this._getAllocatedChildSizeAndSpacing(actor); let [width, height,,] = this._getAllocatedChildSizeAndSpacing(actor);
actorClone.set_size(width, height); actorClone.set_size(width, height);
let scaleX = sourceScaledWidth / width; let scaleX = sourceScaledWidth / width;
let scaleY = sourceScaledHeight / height; let scaleY = sourceScaledHeight / height;
@@ -560,25 +521,21 @@ var IconGrid = GObject.registerClass({
let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM; let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM;
let [finalX, finalY] = actor._transformedPosition; let [finalX, finalY] = actor._transformedPosition;
movementParams = { movementParams = { time: ANIMATION_TIME_IN,
x: finalX, transition: 'easeInOutQuad',
y: finalY, delay: delay,
scale_x: 1, x: finalX,
scale_y: 1, y: finalY,
duration: ANIMATION_TIME_IN, scale_x: 1,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, scale_y: 1,
delay onComplete: () => {
}; if (isLastItem)
this._animationDone();
if (isLastItem) }};
movementParams.onComplete = this._animationDone.bind(this); fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
transition: 'easeInOutQuad',
fadeParams = { delay: delay,
opacity: 255, opacity: 255 };
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay
};
} else { } else {
let isLastItem = actor._distance == maxDist; let isLastItem = actor._distance == maxDist;
@@ -586,29 +543,26 @@ var IconGrid = GObject.registerClass({
actorClone.set_position(startX, startY); actorClone.set_position(startX, startY);
let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM; let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM;
movementParams = { movementParams = { time: ANIMATION_TIME_OUT,
x: adjustedSourcePositionX, transition: 'easeInOutQuad',
y: adjustedSourcePositionY, delay: delay,
scale_x: scaleX, x: adjustedSourcePositionX,
scale_y: scaleY, y: adjustedSourcePositionY,
duration: ANIMATION_TIME_OUT, scale_x: scaleX,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, scale_y: scaleY,
delay onComplete: () => {
}; if (isLastItem)
this._animationDone();
if (isLastItem) }};
movementParams.onComplete = this._animationDone.bind(this); fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
transition: 'easeInOutQuad',
fadeParams = { delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
opacity: 0, opacity: 0 };
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
};
} }
actorClone.ease(movementParams);
actorClone.ease(fadeParams); Tweener.addTween(actorClone, movementParams);
Tweener.addTween(actorClone, fadeParams);
} }
} }
@@ -648,8 +602,6 @@ var IconGrid = GObject.registerClass({
} }
_computeLayout(forWidth) { _computeLayout(forWidth) {
this.ensure_style();
let nColumns = 0; let nColumns = 0;
let usedWidth = this.leftPadding + this.rightPadding; let usedWidth = this.leftPadding + this.rightPadding;
let spacing = this._getSpacing(); let spacing = this._getSpacing();
@@ -758,8 +710,8 @@ var IconGrid = GObject.registerClass({
if (this._padWithSpacing) { if (this._padWithSpacing) {
// minRows + 1 because we want to put spacing before the first row, so it is like we have one more row // minRows + 1 because we want to put spacing before the first row, so it is like we have one more row
// to divide the empty space // to divide the empty space
maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows + 1)); maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows +1));
maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns + 1)); maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns +1));
} else { } else {
if (this._minRows <= 1) if (this._minRows <= 1)
maxVSpacing = maxEmptyVArea; maxVSpacing = maxEmptyVArea;
@@ -791,39 +743,36 @@ var IconGrid = GObject.registerClass({
this._fixedHItemSize = this._hItemSize; this._fixedHItemSize = this._hItemSize;
this._fixedVItemSize = this._vItemSize; this._fixedVItemSize = this._vItemSize;
this._updateSpacingForSize(availWidth, availHeight); this._updateSpacingForSize(availWidth, availHeight);
let spacing = this._getSpacing();
if (this.columnsForWidth(availWidth) < this._minColumns || this.rowsForHeight(availHeight) < this._minRows) { if (this.columnsForWidth(availWidth) < this._minColumns || this.rowsForHeight(availHeight) < this._minRows) {
let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth; let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth ;
let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight; let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight ;
let neededSpacePerItem = (neededWidth > neededHeight) let neededSpacePerItem = (neededWidth > neededHeight) ? Math.ceil(neededWidth / this._minColumns)
? Math.ceil(neededWidth / this._minColumns) : Math.ceil(neededHeight / this._minRows);
: Math.ceil(neededHeight / this._minRows);
this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE); this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE);
this._fixedVItemSize = Math.max(this._vItemSize - neededSpacePerItem, MIN_ICON_SIZE); this._fixedVItemSize = Math.max(this._vItemSize - neededSpacePerItem, MIN_ICON_SIZE);
this._updateSpacingForSize(availWidth, availHeight); this._updateSpacingForSize(availWidth, availHeight);
} }
if (!this._updateIconSizesLaterId) Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW, this._updateIconSizes.bind(this));
this._updateIconSizes.bind(this));
} }
// Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
_updateIconSizes() { _updateIconSizes() {
this._updateIconSizesLaterId = 0;
let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize); let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
let newIconSize = Math.floor(ICON_SIZE * scale); let newIconSize = Math.floor(ICON_SIZE * scale);
for (let i in this._items) { for (let i in this._items) {
this._items[i].icon.setIconSize(newIconSize); this._items[i].icon.setIconSize(newIconSize);
} }
return GLib.SOURCE_REMOVE;
} }
}); });
var PaginatedIconGrid = GObject.registerClass({ var PaginatedIconGrid = GObject.registerClass({
Signals: { 'space-opened': {}, Signals: {'space-opened': {},
'space-closed': {} }, 'space-closed': {} },
}, class PaginatedIconGrid extends IconGrid { }, class PaginatedIconGrid extends IconGrid {
_init(params) { _init(params) {
super._init(params); super._init(params);
@@ -834,13 +783,13 @@ var PaginatedIconGrid = GObject.registerClass({
this._childrenPerPage = 0; this._childrenPerPage = 0;
} }
vfunc_get_preferred_height(_forWidth) { vfunc_get_preferred_height(forWidth) {
let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages; let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages;
return [height, height]; return [height, height];
} }
vfunc_allocate(box, flags) { vfunc_allocate(box, flags) {
if (this._childrenPerPage == 0) if (this._childrenPerPage == 0)
log('computePages() must be called before allocate(); pagination will not work.'); log('computePages() must be called before allocate(); pagination will not work.');
this.set_allocation(box, flags); this.set_allocation(box, flags);
@@ -853,24 +802,26 @@ var PaginatedIconGrid = GObject.registerClass({
} }
let children = this._getVisibleChildren(); let children = this._getVisibleChildren();
let availWidth = box.x2 - box.x1; let availWidth = box.x2 - box.x1;
let availHeight = box.y2 - box.y1;
let spacing = this._getSpacing(); let spacing = this._getSpacing();
let [nColumns, usedWidth] = this._computeLayout(availWidth); let [nColumns, usedWidth] = this._computeLayout(availWidth);
let leftEmptySpace; let leftEmptySpace;
switch (this._xAlign) { switch(this._xAlign) {
case St.Align.START: case St.Align.START:
leftEmptySpace = 0; leftEmptySpace = 0;
break; break;
case St.Align.MIDDLE: case St.Align.MIDDLE:
leftEmptySpace = Math.floor((availWidth - usedWidth) / 2); leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
break; break;
case St.Align.END: case St.Align.END:
leftEmptySpace = availWidth - usedWidth; leftEmptySpace = availWidth - usedWidth;
} }
let x = box.x1 + leftEmptySpace + this.leftPadding; let x = box.x1 + leftEmptySpace + this.leftPadding;
let y = box.y1 + this.topPadding; let y = box.y1 + this.topPadding;
let columnIndex = 0; let columnIndex = 0;
let rowIndex = 0;
for (let i = 0; i < children.length; i++) { for (let i = 0; i < children.length; i++) {
let childBox = this._calculateChildBox(children[i], x, y, box); let childBox = this._calculateChildBox(children[i], x, y, box);
@@ -880,21 +831,21 @@ var PaginatedIconGrid = GObject.registerClass({
columnIndex++; columnIndex++;
if (columnIndex == nColumns) { if (columnIndex == nColumns) {
columnIndex = 0; columnIndex = 0;
rowIndex++;
} }
if (columnIndex == 0) { if (columnIndex == 0) {
y += this._getVItemSize() + spacing; y += this._getVItemSize() + spacing;
if ((i + 1) % this._childrenPerPage == 0) if ((i + 1) % this._childrenPerPage == 0)
y += this._spaceBetweenPages - spacing + this.bottomPadding + this.topPadding; y += this._spaceBetweenPages - spacing + this.bottomPadding + this.topPadding;
x = box.x1 + leftEmptySpace + this.leftPadding; x = box.x1 + leftEmptySpace + this.leftPadding;
} else { } else
x += this._getHItemSize() + spacing; x += this._getHItemSize() + spacing;
}
} }
} }
// Overridden from IconGrid // Overridden from IconGrid
_getChildrenToAnimate() { _getChildrenToAnimate() {
let children = super._getChildrenToAnimate(); let children = this._getVisibleChildren();
let firstIndex = this._childrenPerPage * this.currentPage; let firstIndex = this._childrenPerPage * this.currentPage;
let lastIndex = firstIndex + this._childrenPerPage; let lastIndex = firstIndex + this._childrenPerPage;
@@ -902,7 +853,7 @@ var PaginatedIconGrid = GObject.registerClass({
} }
_computePages(availWidthPerPage, availHeightPerPage) { _computePages(availWidthPerPage, availHeightPerPage) {
let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage); let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage);
let nRows; let nRows;
let children = this._getVisibleChildren(); let children = this._getVisibleChildren();
if (nColumns > 0) if (nColumns > 0)
@@ -912,6 +863,7 @@ var PaginatedIconGrid = GObject.registerClass({
if (this._rowLimit) if (this._rowLimit)
nRows = Math.min(nRows, this._rowLimit); nRows = Math.min(nRows, this._rowLimit);
let spacing = this._getSpacing();
// We want to contain the grid inside the parent box with padding // We want to contain the grid inside the parent box with padding
this._rowsPerPage = this.rowsForHeight(availHeightPerPage); this._rowsPerPage = this.rowsForHeight(availHeightPerPage);
this._nPages = Math.ceil(nRows / this._rowsPerPage); this._nPages = Math.ceil(nRows / this._rowsPerPage);
@@ -940,7 +892,7 @@ var PaginatedIconGrid = GObject.registerClass({
if (!this._nPages) if (!this._nPages)
return 0; return 0;
let firstPageItem = pageNumber * this._childrenPerPage; let firstPageItem = pageNumber * this._childrenPerPage
let childBox = this._getVisibleChildren()[firstPageItem].get_allocation_box(); let childBox = this._getVisibleChildren()[firstPageItem].get_allocation_box();
return childBox.y1 - this.topPadding; return childBox.y1 - this.topPadding;
} }
@@ -973,7 +925,8 @@ var PaginatedIconGrid = GObject.registerClass({
let childrenPerRow = this._childrenPerPage / this._rowsPerPage; let childrenPerRow = this._childrenPerPage / this._rowsPerPage;
let sourceRow = Math.floor((index - pageOffset) / childrenPerRow); let sourceRow = Math.floor((index - pageOffset) / childrenPerRow);
let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1 : sourceRow; let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1
: sourceRow;
let nRowsBelow = this._rowsPerPage - nRowsAbove; let nRowsBelow = this._rowsPerPage - nRowsAbove;
let nRowsUp, nRowsDown; let nRowsUp, nRowsDown;
@@ -1013,14 +966,13 @@ var PaginatedIconGrid = GObject.registerClass({
for (let i = 0; i < children.length; i++) { for (let i = 0; i < children.length; i++) {
children[i].translation_y = 0; children[i].translation_y = 0;
let params = { let params = { translation_y: translationY,
translation_y: translationY, time: EXTRA_SPACE_ANIMATION_TIME,
duration: EXTRA_SPACE_ANIMATION_TIME, transition: 'easeInOutQuad'
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD };
};
if (i == (children.length - 1)) if (i == (children.length - 1))
params.onComplete = () => this.emit('space-opened'); params.onComplete = () => { this.emit('space-opened'); };
children[i].ease(params); Tweener.addTween(children[i], params);
} }
} }
@@ -1033,12 +985,12 @@ var PaginatedIconGrid = GObject.registerClass({
for (let i = 0; i < this._translatedChildren.length; i++) { for (let i = 0; i < this._translatedChildren.length; i++) {
if (!this._translatedChildren[i].translation_y) if (!this._translatedChildren[i].translation_y)
continue; continue;
this._translatedChildren[i].ease({ Tweener.addTween(this._translatedChildren[i],
translation_y: 0, { translation_y: 0,
duration: EXTRA_SPACE_ANIMATION_TIME, time: EXTRA_SPACE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD, transition: 'easeInOutQuad',
onComplete: () => this.emit('space-closed') onComplete: () => { this.emit('space-closed'); }
}); });
} }
} }
}); });

View File

@@ -1,4 +1,3 @@
/* exported InhibitShortcutsDialog */
const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi; const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi;
const Dialog = imports.ui.dialog; const Dialog = imports.ui.dialog;
@@ -76,9 +75,8 @@ var InhibitShortcutsDialog = GObject.registerClass({
let name = this._app ? this._app.get_name() : this._window.title; let name = this._app ? this._app.get_name() : this._window.title;
/* Translators: %s is an application name like "Settings" */ /* Translators: %s is an application name like "Settings" */
let title = name let title = name ? _("%s wants to inhibit shortcuts").format(name)
? _("%s wants to inhibit shortcuts").format(name) : _("Application wants to inhibit shortcuts");
: _("Application wants to inhibit shortcuts");
let icon = new Gio.ThemedIcon({ name: 'dialog-warning-symbolic' }); let icon = new Gio.ThemedIcon({ name: 'dialog-warning-symbolic' });
let contentParams = { icon, title }; let contentParams = { icon, title };
@@ -113,7 +111,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
} }
vfunc_show() { vfunc_show() {
if (this._app && APP_WHITELIST.includes(this._app.get_id())) { if (this._app && APP_WHITELIST.indexOf(this._app.get_id()) != -1) {
this._emitResponse(DialogResponse.ALLOW); this._emitResponse(DialogResponse.ALLOW);
return; return;
} }
@@ -141,7 +139,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
return; return;
} }
let [permissions] = res; let [permissions, data] = res;
if (permissions[appId] === undefined) // Not found if (permissions[appId] === undefined) // Not found
this._dialog.open(); this._dialog.open();
else if (permissions[appId] == GRANTED) else if (permissions[appId] == GRANTED)

View File

@@ -1,4 +1,3 @@
/* exported KbdA11yDialog */
const { Clutter, Gio, GObject } = imports.gi; const { Clutter, Gio, GObject } = imports.gi;
const Dialog = imports.ui.dialog; const Dialog = imports.ui.dialog;
@@ -27,24 +26,24 @@ class KbdA11yDialog extends GObject.Object {
if (whatChanged & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) { if (whatChanged & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) {
key = KEY_SLOW_KEYS_ENABLED; key = KEY_SLOW_KEYS_ENABLED;
enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) > 0; enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) ? true : false;
title = enabled title = enabled ?
? _("Slow Keys Turned On") _("Slow Keys Turned On") :
: _("Slow Keys Turned Off"); _("Slow Keys Turned Off");
body = _("You just held down the Shift key for 8 seconds. This is the shortcut " + body = _("You just held down the Shift key for 8 seconds. This is the shortcut " +
"for the Slow Keys feature, which affects the way your keyboard works."); "for the Slow Keys feature, which affects the way your keyboard works.");
} else if (whatChanged & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) { } else if (whatChanged & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) {
key = KEY_STICKY_KEYS_ENABLED; key = KEY_STICKY_KEYS_ENABLED;
enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) > 0; enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) ? true : false;
title = enabled title = enabled ?
? _("Sticky Keys Turned On") _("Sticky Keys Turned On") :
: _("Sticky Keys Turned Off"); _("Sticky Keys Turned Off");
body = enabled body = enabled ?
? _("You just pressed the Shift key 5 times in a row. This is the shortcut " + _("You just pressed the Shift key 5 times in a row. This is the shortcut " +
"for the Sticky Keys feature, which affects the way your keyboard works.") "for the Sticky Keys feature, which affects the way your keyboard works.") :
: _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " + _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
"This turns off the Sticky Keys feature, which affects the way your keyboard works."); "This turns off the Sticky Keys feature, which affects the way your keyboard works.");
} else { } else {
return; return;
} }

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Keyboard */
const { Clutter, Gio, GLib, GObject, Meta, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Meta, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
@@ -11,10 +10,11 @@ const Layout = imports.ui.layout;
const Main = imports.ui.main; const Main = imports.ui.main;
const PageIndicators = imports.ui.pageIndicators; const PageIndicators = imports.ui.pageIndicators;
const PopupMenu = imports.ui.popupMenu; const PopupMenu = imports.ui.popupMenu;
const Tweener = imports.ui.tweener;
var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2; var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2 * 1000;
var KEY_LONG_PRESS_TIME = 250; var KEY_LONG_PRESS_TIME = 250;
var PANEL_SWITCH_ANIMATION_TIME = 500; var PANEL_SWITCH_ANIMATION_TIME = 0.5;
var PANEL_SWITCH_RELATIVE_DISTANCE = 1 / 3; /* A third of the actor width */ var PANEL_SWITCH_RELATIVE_DISTANCE = 1 / 3; /* A third of the actor width */
const A11Y_APPLICATIONS_SCHEMA = 'org.gnome.desktop.a11y.applications'; const A11Y_APPLICATIONS_SCHEMA = 'org.gnome.desktop.a11y.applications';
@@ -24,29 +24,29 @@ const SHOW_KEYBOARD = 'screen-keyboard-enabled';
const KEY_SIZE = 2; const KEY_SIZE = 2;
const defaultKeysPre = [ const defaultKeysPre = [
[[], [], [{ width: 1.5, level: 1, extraClassName: 'shift-key-lowercase' }], [{ label: '?123', width: 1.5, level: 2 }]], [ [], [], [{ width: 1.5, level: 1, extraClassName: 'shift-key-lowercase' }], [{ label: '?123', width: 1.5, level: 2 }] ],
[[], [], [{ width: 1.5, level: 0, extraClassName: 'shift-key-uppercase' }], [{ label: '?123', width: 1.5, level: 2 }]], [ [], [], [{ width: 1.5, level: 0, extraClassName: 'shift-key-uppercase' }], [{ label: '?123', width: 1.5, level: 2 }] ],
[[], [], [{ label: '=/<', width: 1.5, level: 3 }], [{ label: 'ABC', width: 1.5, level: 0 }]], [ [], [], [{ label: '=/<', width: 1.5, level: 3 }], [{ label: 'ABC', width: 1.5, level: 0 }] ],
[[], [], [{ label: '?123', width: 1.5, level: 2 }], [{ label: 'ABC', width: 1.5, level: 0 }]], [ [], [], [{ label: '?123', width: 1.5, level: 2 }], [{ label: 'ABC', width: 1.5, level: 0 }] ],
]; ];
const defaultKeysPost = [ const defaultKeysPost = [
[[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }], [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
[{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }], [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
[{ width: 3, level: 1, right: true, extraClassName: 'shift-key-lowercase' }], [{ width: 3, level: 1, right: true, extraClassName: 'shift-key-lowercase' }],
[{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]], [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
[[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }], [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
[{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }], [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
[{ width: 3, level: 0, right: true, extraClassName: 'shift-key-uppercase' }], [{ width: 3, level: 0, right: true, extraClassName: 'shift-key-uppercase' }],
[{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]], [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
[[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }], [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
[{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }], [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
[{ label: '=/<', width: 3, level: 3, right: true }], [{ label: '=/<', width: 3, level: 3, right: true }],
[{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]], [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
[[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }], [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
[{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }], [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
[{ label: '?123', width: 3, level: 2, right: true }], [{ label: '?123', width: 3, level: 2, right: true }],
[{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]], [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
]; ];
var AspectContainer = GObject.registerClass( var AspectContainer = GObject.registerClass(
@@ -100,14 +100,13 @@ class KeyContainer extends St.Widget {
this._rows = []; this._rows = [];
} }
appendRow() { appendRow(length) {
this._currentRow++; this._currentRow++;
this._currentCol = 0; this._currentCol = 0;
let row = { let row = new Object();
keys: [], row.keys = [];
width: 0, row.width = 0;
};
this._rows.push(row); this._rows.push(row);
} }
@@ -194,12 +193,12 @@ var LanguageSelectionPopup = class extends PopupMenu.PopupMenu {
item = this.addAction(is.displayName, () => { item = this.addAction(is.displayName, () => {
inputSourceManager.activateInputSource(is, true); inputSourceManager.activateInputSource(is, true);
}); });
item.can_focus = false; item.actor.can_focus = false;
} }
this.addMenuItem(new PopupMenu.PopupSeparatorMenuItem()); this.addMenuItem(new PopupMenu.PopupSeparatorMenuItem());
item = this.addSettingsAction(_("Region & Language Settings"), 'gnome-region-panel.desktop'); item = this.addSettingsAction(_("Region & Language Settings"), 'gnome-region-panel.desktop');
item.can_focus = false; item.actor.can_focus = false;
this._capturedEventId = 0; this._capturedEventId = 0;
@@ -298,7 +297,7 @@ var Key = class Key {
} }
_press(key) { _press(key) {
this.emit('activated'); this.emit('activated')
if (key != this.key || this._extended_keys.length == 0) { if (key != this.key || this._extended_keys.length == 0) {
this.emit('pressed', this._getKeyval(key), key); this.emit('pressed', this._getKeyval(key), key);
@@ -406,6 +405,9 @@ var Key = class Key {
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
}); });
button.connect('touch-event', (actor, event) => { button.connect('touch-event', (actor, event) => {
let device = event.get_device();
let sequence = event.get_event_sequence();
// We only handle touch events here on wayland. On X11 // We only handle touch events here on wayland. On X11
// we do get emulated pointer events, which already works // we do get emulated pointer events, which already works
// for single-touch cases. Besides, the X11 passive touch grab // for single-touch cases. Besides, the X11 passive touch grab
@@ -466,23 +468,16 @@ Signals.addSignalMethods(Key.prototype);
var KeyboardModel = class { var KeyboardModel = class {
constructor(groupName) { constructor(groupName) {
let names = [groupName]; try {
if (names.includes('+')) this._model = this._loadModel(groupName);
names.push(groupName.replace(/\+.*/, '')); } catch (e) {
names.push('us'); this._model = this._loadModel('us');
for (let i = 0; i < names.length; i++) {
try {
this._model = this._loadModel(names[i]);
break;
} catch (e) {
}
} }
} }
_loadModel(groupName) { _loadModel(groupName) {
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/%s.json'.format(groupName)); let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/%s.json'.format(groupName));
let [success_, contents] = file.load_contents(null); let [success, contents] = file.load_contents(null);
if (contents instanceof Uint8Array) if (contents instanceof Uint8Array)
contents = imports.byteArray.toString(contents); contents = imports.byteArray.toString(contents);
@@ -577,27 +572,11 @@ var FocusTracker = class {
}; };
Signals.addSignalMethods(FocusTracker.prototype); Signals.addSignalMethods(FocusTracker.prototype);
var EmojiPager = GObject.registerClass({ var EmojiPager = class EmojiPager {
Properties: { constructor(sections, nCols, nRows) {
'delta': GObject.ParamSpec.int( this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout(),
'delta', 'delta', 'delta', reactive: true,
GObject.ParamFlags.READWRITE, clip_to_allocation: true });
GLib.MININT32, GLib.MAXINT32, 0)
},
Signals: {
'emoji': { param_types: [GObject.TYPE_STRING] },
'page-changed': {
param_types: [GObject.TYPE_INT, GObject.TYPE_INT, GObject.TYPE_INT]
}
}
}, class EmojiPager extends St.Widget {
_init(sections, nCols, nRows) {
super._init({
layout_manager: new Clutter.BinLayout(),
reactive: true,
clip_to_allocation: true
});
this._sections = sections; this._sections = sections;
this._nCols = nCols; this._nCols = nCols;
this._nRows = nRows; this._nRows = nRows;
@@ -619,7 +598,7 @@ var EmojiPager = GObject.registerClass({
panAction.connect('gesture-cancel', this._onPanCancel.bind(this)); panAction.connect('gesture-cancel', this._onPanCancel.bind(this));
panAction.connect('gesture-end', this._onPanEnd.bind(this)); panAction.connect('gesture-end', this._onPanEnd.bind(this));
this._panAction = panAction; this._panAction = panAction;
this.add_action(panAction); this.actor.add_action(panAction);
} }
get delta() { get delta() {
@@ -632,11 +611,7 @@ var EmojiPager = GObject.registerClass({
else if (value < -this._width) else if (value < -this._width)
value = -this._width; value = -this._width;
if (this._delta == value)
return;
this._delta = value; this._delta = value;
this.notify('delta');
if (value == 0) if (value == 0)
return; return;
@@ -653,8 +628,8 @@ var EmojiPager = GObject.registerClass({
if (followingPage != null) { if (followingPage != null) {
this._followingPanel = this._generatePanel(followingPage); this._followingPanel = this._generatePanel(followingPage);
this._followingPanel.set_pivot_point(0.5, 0.5); this._followingPanel.set_pivot_point(0.5, 0.5);
this.add_child(this._followingPanel); this.actor.add_child(this._followingPanel);
this.set_child_below_sibling(this._followingPanel, this._panel); this.actor.set_child_below_sibling(this._followingPanel, this._panel);
} }
this._followingPage = followingPage; this._followingPage = followingPage;
@@ -690,7 +665,7 @@ var EmojiPager = GObject.registerClass({
} }
_onPan(action) { _onPan(action) {
let [dist_, dx, dy_] = action.get_motion_delta(0); let [dist, dx, dy] = action.get_motion_delta(0);
this.delta = this.delta + dx; this.delta = this.delta + dx;
if (this._currentKey != null) { if (this._currentKey != null) {
@@ -702,13 +677,13 @@ var EmojiPager = GObject.registerClass({
} }
_onPanBegin() { _onPanBegin() {
this._width = this.width; this._width = this.actor.width;
return true; return true;
} }
_onPanEnd() { _onPanEnd() {
if (Math.abs(this._delta) < this.width * PANEL_SWITCH_RELATIVE_DISTANCE) { if (Math.abs(this._delta) < this.actor.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
this._onPanCancel(); this._onPanCancel()
} else { } else {
let value; let value;
if (this._delta > 0) if (this._delta > 0)
@@ -719,24 +694,28 @@ var EmojiPager = GObject.registerClass({
let relDelta = Math.abs(this._delta - value) / this._width; let relDelta = Math.abs(this._delta - value) / this._width;
let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta); let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);
this.remove_all_transitions(); Tweener.removeTweens(this);
this.ease_property('delta', value, { Tweener.addTween(this,
duration: time, { delta: value,
onComplete: () => { time: time,
this.setCurrentPage(this.getFollowingPage()); transition: 'easeInOutQuad',
} onComplete() {
}); this.setCurrentPage(this.getFollowingPage());
}
});
} }
} }
_onPanCancel() { _onPanCancel() {
let relDelta = Math.abs(this._delta) / this.width; let relDelta = Math.abs(this._delta) / this.actor.width;
let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta); let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);
this.remove_all_transitions(); Tweener.removeTweens(this);
this.ease_property('delta', 0, { Tweener.addTween(this,
duration: time, { delta: 0,
}); time: time,
transition: 'easeInOutQuad',
});
} }
_initPagingInfo() { _initPagingInfo() {
@@ -846,7 +825,7 @@ var EmojiPager = GObject.registerClass({
if (!this._panel) { if (!this._panel) {
this._panel = this._generatePanel(nPage); this._panel = this._generatePanel(nPage);
this.add_child(this._panel); this.actor.add_child(this._panel);
} }
let page = this._pages[nPage]; let page = this._pages[nPage];
@@ -863,7 +842,8 @@ var EmojiPager = GObject.registerClass({
} }
} }
} }
}); };
Signals.addSignalMethods(EmojiPager.prototype);
var EmojiSelection = class EmojiSelection { var EmojiSelection = class EmojiSelection {
constructor() { constructor() {
@@ -885,7 +865,7 @@ var EmojiSelection = class EmojiSelection {
x_expand: true, x_expand: true,
y_expand: true, y_expand: true,
vertical: true }); vertical: true });
this.actor.connect('notify::mapped', () => this._emojiPager.setCurrentPage(0)); this.actor.connect('notify::mapped', () => { this._emojiPager.setCurrentPage(0); });
this._emojiPager = new EmojiPager(this._sections, 11, 3); this._emojiPager = new EmojiPager(this._sections, 11, 3);
this._emojiPager.connect('page-changed', (pager, section, page, nPages) => { this._emojiPager.connect('page-changed', (pager, section, page, nPages) => {
@@ -894,7 +874,7 @@ var EmojiSelection = class EmojiSelection {
this._emojiPager.connect('emoji', (pager, str) => { this._emojiPager.connect('emoji', (pager, str) => {
this.emit('emoji-selected', str); this.emit('emoji-selected', str);
}); });
this.actor.add(this._emojiPager, { expand: true }); this.actor.add(this._emojiPager.actor, { expand: true });
this._pageIndicator = new PageIndicators.PageIndicators(false); this._pageIndicator = new PageIndicators.PageIndicators(false);
this.actor.add(this._pageIndicator, { expand: true, x_fill: false, y_fill: false }); this.actor.add(this._pageIndicator, { expand: true, x_fill: false, y_fill: false });
@@ -927,12 +907,13 @@ var EmojiSelection = class EmojiSelection {
_populateSections() { _populateSections() {
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/emoji.json'); let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/emoji.json');
let [success_, contents] = file.load_contents(null); let [success, contents] = file.load_contents(null);
if (contents instanceof Uint8Array) if (contents instanceof Uint8Array)
contents = imports.byteArray.toString(contents); contents = imports.byteArray.toString(contents);
let emoji = JSON.parse(contents); let emoji = JSON.parse(contents);
let pages = [];
let variants = []; let variants = [];
let currentKey = 0; let currentKey = 0;
let currentSection = null; let currentSection = null;
@@ -967,14 +948,14 @@ var EmojiSelection = class EmojiSelection {
key = new Key('ABC', []); key = new Key('ABC', []);
key.keyButton.add_style_class_name('default-key'); key.keyButton.add_style_class_name('default-key');
key.connect('released', () => this.emit('toggle')); key.connect('released', () => { this.emit('toggle'); });
row.appendKey(key.actor, 1.5); row.appendKey(key.actor, 1.5);
for (let i = 0; i < this._sections.length; i++) { for (let i = 0; i < this._sections.length; i++) {
let section = this._sections[i]; let section = this._sections[i];
key = new Key(section.label, []); key = new Key(section.label, []);
key.connect('released', () => this._emojiPager.setCurrentSection(section, 0)); key.connect('released', () => { this._emojiPager.setCurrentSection(section, 0) });
row.appendKey(key.actor); row.appendKey(key.actor);
section.button = key; section.button = key;
@@ -1093,7 +1074,7 @@ var Keyboard = class Keyboard {
let manager = Clutter.DeviceManager.get_default(); let manager = Clutter.DeviceManager.get_default();
let device = manager.get_device(deviceId); let device = manager.get_device(deviceId);
if (!device.get_device_name().includes('XTEST')) { if (device.get_device_name().indexOf('XTEST') < 0) {
this._lastDeviceId = deviceId; this._lastDeviceId = deviceId;
this._syncEnabled(); this._syncEnabled();
} }
@@ -1194,7 +1175,7 @@ var Keyboard = class Keyboard {
this._emojiSelection = new EmojiSelection(); this._emojiSelection = new EmojiSelection();
this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this)); this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this));
this._emojiSelection.connect('hide', () => this.hide()); this._emojiSelection.connect('hide', (selection) => { this.hide(); });
this._emojiSelection.connect('emoji-selected', (selection, emoji) => { this._emojiSelection.connect('emoji-selected', (selection, emoji) => {
this._keyboardController.commitString(emoji); this._keyboardController.commitString(emoji);
}); });
@@ -1247,12 +1228,12 @@ var Keyboard = class Keyboard {
} }
if (!this._showIdleId) { if (!this._showIdleId) {
this._showIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT_IDLE, () => { this._showIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT_IDLE, () => {
this.show(Main.layoutManager.focusIndex); this.show(Main.layoutManager.focusIndex);
this._showIdleId = 0; this._showIdleId = 0;
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
}); });
GLib.Source.set_name_by_id(this._showIdleId, '[gnome-shell] this.show'); GLib.Source.set_name_by_id(this._showIdleId, '[gnome-shell] this.show');
} }
} }
@@ -1305,7 +1286,7 @@ var Keyboard = class Keyboard {
} }
} }
}); });
button.connect('released', (actor, keyval, _str) => { button.connect('released', (actor, keyval, str) => {
if (keyval != 0) { if (keyval != 0) {
if (button._keyvalPress) if (button._keyvalPress)
this._keyboardController.keyvalRelease(keyval); this._keyboardController.keyvalRelease(keyval);
@@ -1425,6 +1406,8 @@ var Keyboard = class Keyboard {
} }
_getDefaultKeysForRow(row, numRows, level) { _getDefaultKeysForRow(row, numRows, level) {
let pre, post;
/* The first 2 rows in defaultKeysPre/Post belong together with /* The first 2 rows in defaultKeysPre/Post belong together with
* the first 2 rows on each keymap. On keymaps that have more than * the first 2 rows on each keymap. On keymaps that have more than
* 4 rows, the last 2 default key rows must be respectively * 4 rows, the last 2 default key rows must be respectively
@@ -1465,8 +1448,8 @@ var Keyboard = class Keyboard {
numOfVertSlots = rows.length; numOfVertSlots = rows.length;
for (let i = 0; i < rows.length; ++i) { for (let i = 0; i < rows.length; ++i) {
let keyboardRow = rows[i]; let keyboard_row = rows[i];
let keys = keyboardRow.get_children(); let keys = keyboard_row.get_children();
numOfHorizSlots = Math.max(numOfHorizSlots, keys.length); numOfHorizSlots = Math.max(numOfHorizSlots, keys.length);
} }
@@ -1490,7 +1473,7 @@ var Keyboard = class Keyboard {
this._setActiveLayer(0); this._setActiveLayer(0);
} }
_onKeyboardGroupsChanged() { _onKeyboardGroupsChanged(keyboard) {
let nonGroupActors = [this._emojiSelection.actor, this._keypad.actor]; let nonGroupActors = [this._emojiSelection.actor, this._keypad.actor];
this._aspectContainer.get_children().filter(c => !nonGroupActors.includes(c)).forEach(c => { this._aspectContainer.get_children().filter(c => !nonGroupActors.includes(c)).forEach(c => {
c.destroy(); c.destroy();
@@ -1663,7 +1646,8 @@ var Keyboard = class Keyboard {
} }
_windowSlideAnimationComplete(window, delta) { _windowSlideAnimationComplete(window, delta) {
// Synchronize window positions again. // Synchronize window and actor positions again.
let windowActor = window.get_compositor_private();
let frameRect = window.get_frame_rect(); let frameRect = window.get_frame_rect();
frameRect.y += delta; frameRect.y += delta;
window.move_frame(true, frameRect.x, frameRect.y); window.move_frame(true, frameRect.x, frameRect.y);
@@ -1676,23 +1660,19 @@ var Keyboard = class Keyboard {
return; return;
if (show) { if (show) {
windowActor.ease({ Tweener.addTween(windowActor,
y: windowActor.y - deltaY, { y: windowActor.y - deltaY,
duration: Layout.KEYBOARD_ANIMATION_TIME, time: Layout.KEYBOARD_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete: this._windowSlideAnimationComplete,
this._windowSlideAnimationComplete(window, -deltaY); onCompleteParams: [window, -deltaY] });
}
});
} else { } else {
windowActor.ease({ Tweener.addTween(windowActor,
y: windowActor.y + deltaY, { y: windowActor.y + deltaY,
duration: Layout.KEYBOARD_ANIMATION_TIME, time: Layout.KEYBOARD_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_IN_QUAD, transition: 'easeInQuad',
onComplete: () => { onComplete: this._windowSlideAnimationComplete,
this._windowSlideAnimationComplete(window, deltaY); onCompleteParams: [window, deltaY] });
}
});
} }
} }
@@ -1708,11 +1688,12 @@ var Keyboard = class Keyboard {
this._animFocusedWindow = window; this._animFocusedWindow = window;
} }
setCursorLocation(window, x, y, w, h) { setCursorLocation(window, x, y , w, h) {
let monitor = Main.layoutManager.keyboardMonitor; let monitor = Main.layoutManager.keyboardMonitor;
if (window && monitor) { if (window && monitor) {
let keyboardHeight = Main.layoutManager.keyboardBox.height; let keyboardHeight = Main.layoutManager.keyboardBox.height;
let focusObscured = false;
if (y + h >= monitor.y + monitor.height - keyboardHeight) { if (y + h >= monitor.y + monitor.height - keyboardHeight) {
if (this._keyboardVisible) if (this._keyboardVisible)
@@ -1756,13 +1737,14 @@ var KeyboardController = class {
this.emit('groups-changed'); this.emit('groups-changed');
} }
_onSourceChanged(inputSourceManager, _oldSource) { _onSourceChanged(inputSourceManager, oldSource) {
let source = inputSourceManager.currentSource; let source = inputSourceManager.currentSource;
this._currentSource = source; this._currentSource = source;
this.emit('active-group', source.id); this.emit('active-group', source.id);
} }
_onContentPurposeHintsChanged(method) { _onContentPurposeHintsChanged(method) {
let hints = method.content_hints;
let purpose = method.content_purpose; let purpose = method.content_purpose;
let emojiVisible = false; let emojiVisible = false;
let keypadVisible = false; let keypadVisible = false;
@@ -1777,13 +1759,13 @@ var KeyboardController = class {
purpose == Clutter.InputContentPurpose.PHONE) purpose == Clutter.InputContentPurpose.PHONE)
keypadVisible = true; keypadVisible = true;
this.emit('emoji-visible', emojiVisible); this.emit('emoji-visible', emojiVisible)
this.emit('keypad-visible', keypadVisible); this.emit('keypad-visible', keypadVisible);
} }
getGroups() { getGroups() {
let inputSources = this._inputSourceManager.inputSources; let inputSources = this._inputSourceManager.inputSources;
let groups = []; let groups = []
for (let i in inputSources) { for (let i in inputSources) {
let is = inputSources[i]; let is = inputSources[i];

View File

@@ -1,7 +1,6 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported MonitorConstraint, LayoutManager */
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
const Background = imports.ui.background; const Background = imports.ui.background;
@@ -11,17 +10,18 @@ const LoginManager = imports.misc.loginManager;
const DND = imports.ui.dnd; const DND = imports.ui.dnd;
const Main = imports.ui.main; const Main = imports.ui.main;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
const Ripples = imports.ui.ripples; const Ripples = imports.ui.ripples;
var STARTUP_ANIMATION_TIME = 500; var STARTUP_ANIMATION_TIME = 0.5;
var KEYBOARD_ANIMATION_TIME = 150; var KEYBOARD_ANIMATION_TIME = 0.15;
var BACKGROUND_FADE_ANIMATION_TIME = 1000; var BACKGROUND_FADE_ANIMATION_TIME = 1.0;
var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels
var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms
function isPopupMetaWindow(actor) { function isPopupMetaWindow(actor) {
switch (actor.meta_window.get_window_type()) { switch(actor.meta_window.get_window_type()) {
case Meta.WindowType.DROPDOWN_MENU: case Meta.WindowType.DROPDOWN_MENU:
case Meta.WindowType.POPUP_MENU: case Meta.WindowType.POPUP_MENU:
case Meta.WindowType.COMBO: case Meta.WindowType.COMBO:
@@ -32,20 +32,18 @@ function isPopupMetaWindow(actor) {
} }
var MonitorConstraint = GObject.registerClass({ var MonitorConstraint = GObject.registerClass({
Properties: { Properties: {'primary': GObject.ParamSpec.boolean('primary',
'primary': GObject.ParamSpec.boolean('primary', 'Primary', 'Track primary monitor',
'Primary', 'Track primary monitor', GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, false),
false), 'index': GObject.ParamSpec.int('index',
'index': GObject.ParamSpec.int('index', 'Monitor index', 'Track specific monitor',
'Monitor index', 'Track specific monitor', GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, -1, 64, -1),
-1, 64, -1), 'work-area': GObject.ParamSpec.boolean('work-area',
'work-area': GObject.ParamSpec.boolean('work-area', 'Work-area', 'Track monitor\'s work-area',
'Work-area', 'Track monitor\'s work-area', GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, false)},
false)
},
}, class MonitorConstraint extends Clutter.Constraint { }, class MonitorConstraint extends Clutter.Constraint {
_init(props) { _init(props) {
this._primary = false; this._primary = false;
@@ -80,12 +78,10 @@ var MonitorConstraint = GObject.registerClass({
this.notify('index'); this.notify('index');
} }
// eslint-disable-next-line camelcase
get work_area() { get work_area() {
return this._workArea; return this._workArea;
} }
// eslint-disable-next-line camelcase
set work_area(v) { set work_area(v) {
if (v == this._workArea) if (v == this._workArea)
return; return;
@@ -151,13 +147,13 @@ var MonitorConstraint = GObject.registerClass({
}); });
var Monitor = class Monitor { var Monitor = class Monitor {
constructor(index, geometry, geometryScale) { constructor(index, geometry, geometry_scale) {
this.index = index; this.index = index;
this.x = geometry.x; this.x = geometry.x;
this.y = geometry.y; this.y = geometry.y;
this.width = geometry.width; this.width = geometry.width;
this.height = geometry.height; this.height = geometry.height;
this.geometry_scale = geometryScale; this.geometry_scale = geometry_scale;
} }
get inFullscreen() { get inFullscreen() {
@@ -167,12 +163,12 @@ var Monitor = class Monitor {
const UiActor = GObject.registerClass( const UiActor = GObject.registerClass(
class UiActor extends St.Widget { class UiActor extends St.Widget {
vfunc_get_preferred_width (_forHeight) { vfunc_get_preferred_width (forHeight) {
let width = global.stage.width; let width = global.stage.width;
return [width, width]; return [width, width];
} }
vfunc_get_preferred_height (_forWidth) { vfunc_get_preferred_height (forWidth) {
let height = global.stage.height; let height = global.stage.height;
return [height, height]; return [height, height];
} }
@@ -189,7 +185,6 @@ var LayoutManager = GObject.registerClass({
'startup-complete': {}, 'startup-complete': {},
'startup-prepared': {}, 'startup-prepared': {},
'monitors-changed': {}, 'monitors-changed': {},
'system-modal-opened': {},
'keyboard-visible-changed': { param_types: [GObject.TYPE_BOOLEAN] } }, 'keyboard-visible-changed': { param_types: [GObject.TYPE_BOOLEAN] } },
}, class LayoutManager extends GObject.Object { }, class LayoutManager extends GObject.Object {
_init() { _init() {
@@ -239,12 +234,11 @@ var LayoutManager = GObject.registerClass({
reactive: true }); reactive: true });
this.addChrome(this.overviewGroup); this.addChrome(this.overviewGroup);
this.screenShieldGroup = new St.Widget({ this.screenShieldGroup = new St.Widget({ name: 'screenShieldGroup',
name: 'screenShieldGroup', visible: false,
visible: false, clip_to_allocation: true,
clip_to_allocation: true, layout_manager: new Clutter.BinLayout(),
layout_manager: new Clutter.BinLayout(), });
});
this.addChrome(this.screenShieldGroup); this.addChrome(this.screenShieldGroup);
this.panelBox = new St.BoxLayout({ name: 'panelBox', this.panelBox = new St.BoxLayout({ name: 'panelBox',
@@ -278,13 +272,6 @@ var LayoutManager = GObject.registerClass({
this._backgroundGroup.lower_bottom(); this._backgroundGroup.lower_bottom();
this._bgManagers = []; this._bgManagers = [];
this._interfaceSettings = new Gio.Settings({
schema_id: 'org.gnome.desktop.interface'
});
this._interfaceSettings.connect('changed::enable-hot-corners',
this._updateHotCorners.bind(this));
// Need to update struts on new workspaces when they are added // Need to update struts on new workspaces when they are added
let workspaceManager = global.workspace_manager; let workspaceManager = global.workspace_manager;
workspaceManager.connect('notify::n-workspaces', workspaceManager.connect('notify::n-workspaces',
@@ -388,11 +375,6 @@ var LayoutManager = GObject.registerClass({
}); });
this.hotCorners = []; this.hotCorners = [];
if (!this._interfaceSettings.get_boolean('enable-hot-corners')) {
this.emit('hot-corners-changed');
return;
}
let size = this.panelBox.height; let size = this.panelBox.height;
// build new hot corners // build new hot corners
@@ -465,11 +447,10 @@ var LayoutManager = GObject.registerClass({
let backgroundActor = this._bgManagers[i].backgroundActor; let backgroundActor = this._bgManagers[i].backgroundActor;
backgroundActor.show(); backgroundActor.show();
backgroundActor.opacity = 0; backgroundActor.opacity = 0;
backgroundActor.ease({ Tweener.addTween(backgroundActor,
opacity: 255, { opacity: 255,
duration: BACKGROUND_FADE_ANIMATION_TIME, time: BACKGROUND_FADE_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad' });
});
} }
} }
} }
@@ -700,23 +681,23 @@ var LayoutManager = GObject.registerClass({
} }
_startupAnimationGreeter() { _startupAnimationGreeter() {
this.panelBox.ease({ Tweener.addTween(this.panelBox,
translation_y: 0, { translation_y: 0,
duration: STARTUP_ANIMATION_TIME, time: STARTUP_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => this._startupAnimationComplete() onComplete: this._startupAnimationComplete,
}); onCompleteScope: this });
} }
_startupAnimationSession() { _startupAnimationSession() {
this.uiGroup.ease({ Tweener.addTween(this.uiGroup,
scale_x: 1, { scale_x: 1,
scale_y: 1, scale_y: 1,
opacity: 255, opacity: 255,
duration: STARTUP_ANIMATION_TIME, time: STARTUP_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => this._startupAnimationComplete() onComplete: this._startupAnimationComplete,
}); onCompleteScope: this });
} }
_startupAnimationComplete() { _startupAnimationComplete() {
@@ -742,15 +723,14 @@ var LayoutManager = GObject.registerClass({
showKeyboard() { showKeyboard() {
this.keyboardBox.show(); this.keyboardBox.show();
this.keyboardBox.ease({ Tweener.addTween(this.keyboardBox,
anchor_y: this.keyboardBox.height, { anchor_y: this.keyboardBox.height,
opacity: 255, opacity: 255,
duration: KEYBOARD_ANIMATION_TIME, time: KEYBOARD_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete: this._showKeyboardComplete,
this._showKeyboardComplete(); onCompleteScope: this
} });
});
this.emit('keyboard-visible-changed', true); this.emit('keyboard-visible-changed', true);
} }
@@ -769,15 +749,14 @@ var LayoutManager = GObject.registerClass({
this.keyboardBox.disconnect(this._keyboardHeightNotifyId); this.keyboardBox.disconnect(this._keyboardHeightNotifyId);
this._keyboardHeightNotifyId = 0; this._keyboardHeightNotifyId = 0;
} }
this.keyboardBox.ease({ Tweener.addTween(this.keyboardBox,
anchor_y: 0, { anchor_y: 0,
opacity: 0, opacity: 0,
duration: immediate ? 0 : KEYBOARD_ANIMATION_TIME, time: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_IN_QUAD, transition: 'easeInQuad',
onComplete: () => { onComplete: this._hideKeyboardComplete,
this._hideKeyboardComplete(); onCompleteScope: this
} });
});
this.emit('keyboard-visible-changed', false); this.emit('keyboard-visible-changed', false);
} }
@@ -848,7 +827,7 @@ var LayoutManager = GObject.registerClass({
// @params can have any of the same values as in addChrome(), // @params can have any of the same values as in addChrome(),
// though some possibilities don't make sense. By default, @actor has // though some possibilities don't make sense. By default, @actor has
// the same params as its chrome ancestor. // the same params as its chrome ancestor.
trackChrome(actor, params = {}) { trackChrome(actor, params) {
let ancestor = actor.get_parent(); let ancestor = actor.get_parent();
let index = this._findActor(ancestor); let index = this._findActor(ancestor);
while (ancestor && index == -1) { while (ancestor && index == -1) {
@@ -856,13 +835,14 @@ var LayoutManager = GObject.registerClass({
index = this._findActor(ancestor); index = this._findActor(ancestor);
} }
let ancestorData = ancestor let ancestorData = ancestor ? this._trackedActors[index]
? this._trackedActors[index] : defaultParams;
: defaultParams; if (!params)
params = {};
// We can't use Params.parse here because we want to drop // We can't use Params.parse here because we want to drop
// the extra values like ancestorData.actor // the extra values like ancestorData.actor
for (let prop in defaultParams) { for (let prop in defaultParams) {
if (!Object.prototype.hasOwnProperty.call(params, prop)) if (!params.hasOwnProperty(prop))
params[prop] = ancestorData[prop]; params[prop] = ancestorData[prop];
} }
@@ -1016,6 +996,11 @@ var LayoutManager = GObject.registerClass({
if (Main.modalCount > 0) if (Main.modalCount > 0)
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
// Bug workaround - get_transformed_position()/get_transformed_size() don't work after
// a change in stage size until the first pick or paint.
// https://bugzilla.gnome.org/show_bug.cgi?id=761565
global.stage.get_actor_at_pos(Clutter.PickMode.ALL, 0, 0);
let rects = [], struts = [], i; let rects = [], struts = [], i;
let isPopupMenuVisible = global.top_window_group.get_children().some(isPopupMetaWindow); let isPopupMenuVisible = global.top_window_group.get_children().some(isPopupMetaWindow);
let wantsInputRegion = !isPopupMenuVisible; let wantsInputRegion = !isPopupMenuVisible;
@@ -1071,19 +1056,18 @@ var LayoutManager = GObject.registerClass({
side = Meta.Side.RIGHT; side = Meta.Side.RIGHT;
else else
continue; continue;
} else if (x1 <= monitor.x) { } else if (x1 <= monitor.x)
side = Meta.Side.LEFT; side = Meta.Side.LEFT;
} else if (y1 <= monitor.y) { else if (y1 <= monitor.y)
side = Meta.Side.TOP; side = Meta.Side.TOP;
} else if (x2 >= monitor.x + monitor.width) { else if (x2 >= monitor.x + monitor.width)
side = Meta.Side.RIGHT; side = Meta.Side.RIGHT;
} else if (y2 >= monitor.y + monitor.height) { else if (y2 >= monitor.y + monitor.height)
side = Meta.Side.BOTTOM; side = Meta.Side.BOTTOM;
} else { else
continue; continue;
}
let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 }); let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1});
let strut = new Meta.Strut({ rect: strutRect, side: side }); let strut = new Meta.Strut({ rect: strutRect, side: side });
struts.push(strut); struts.push(strut);
} }
@@ -1222,8 +1206,6 @@ var HotCorner = class HotCorner {
if (this.actor) if (this.actor)
this.actor.destroy(); this.actor.destroy();
this._ripples.destroy();
} }
_toggleOverview() { _toggleOverview() {
@@ -1236,7 +1218,7 @@ var HotCorner = class HotCorner {
} }
} }
handleDragOver(source, _actor, _x, _y, _time) { handleDragOver(source, actor, x, y, time) {
if (source != Main.xdndHandler) if (source != Main.xdndHandler)
return DND.DragMotionResult.CONTINUE; return DND.DragMotionResult.CONTINUE;
@@ -1337,7 +1319,7 @@ var PressureBarrier = class PressureBarrier {
let threshold = this._lastTime - this._timeout; let threshold = this._lastTime - this._timeout;
while (i < this._barrierEvents.length) { while (i < this._barrierEvents.length) {
let [time, distance_] = this._barrierEvents[i]; let [time, distance] = this._barrierEvents[i];
if (time >= threshold) if (time >= threshold)
break; break;
i++; i++;
@@ -1346,14 +1328,14 @@ var PressureBarrier = class PressureBarrier {
let firstNewEvent = i; let firstNewEvent = i;
for (i = 0; i < firstNewEvent; i++) { for (i = 0; i < firstNewEvent; i++) {
let [time_, distance] = this._barrierEvents[i]; let [time, distance] = this._barrierEvents[i];
this._currentPressure -= distance; this._currentPressure -= distance;
} }
this._barrierEvents = this._barrierEvents.slice(firstNewEvent); this._barrierEvents = this._barrierEvents.slice(firstNewEvent);
} }
_onBarrierLeft(barrier, _event) { _onBarrierLeft(barrier, event) {
barrier._isHit = false; barrier._isHit = false;
if (this._barriers.every(b => !b._isHit)) { if (this._barriers.every(b => !b._isHit)) {
this._reset(); this._reset();

View File

@@ -1,10 +1,10 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported Lightbox */
const { Clutter, GObject, Shell, St } = imports.gi; const { Clutter, GObject, Shell, St } = imports.gi;
const Signals = imports.signals; const Signals = imports.signals;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
var DEFAULT_FADE_FACTOR = 0.4; var DEFAULT_FADE_FACTOR = 0.4;
var VIGNETTE_BRIGHTNESS = 0.2; var VIGNETTE_BRIGHTNESS = 0.2;
@@ -23,31 +23,16 @@ t = clamp(t, 0.0, 1.0);\n\
float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\ float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\
cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);'; cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);';
var RadialShaderEffect = GObject.registerClass({ var RadialShaderQuad = GObject.registerClass(
Properties: { class RadialShaderQuad extends Shell.GLSLQuad {
'brightness': GObject.ParamSpec.float(
'brightness', 'brightness', 'brightness',
GObject.ParamFlags.READWRITE,
0, 1, 1
),
'sharpness': GObject.ParamSpec.float(
'sharpness', 'sharpness', 'sharpness',
GObject.ParamFlags.READWRITE,
0, 1, 0
)
}
}, class RadialShaderEffect extends Shell.GLSLEffect {
_init(params) { _init(params) {
this._brightness = undefined;
this._sharpness = undefined;
super._init(params); super._init(params);
this._brightnessLocation = this.get_uniform_location('brightness'); this._brightnessLocation = this.get_uniform_location('brightness');
this._sharpnessLocation = this.get_uniform_location('vignette_sharpness'); this._sharpnessLocation = this.get_uniform_location('vignette_sharpness');
this.brightness = 1.0; this.brightness = 1.0;
this.sharpness = 0.0; this.vignetteSharpness = 0.0;
} }
vfunc_build_pipeline() { vfunc_build_pipeline() {
@@ -60,25 +45,19 @@ var RadialShaderEffect = GObject.registerClass({
} }
set brightness(v) { set brightness(v) {
if (this._brightness == v)
return;
this._brightness = v; this._brightness = v;
this.set_uniform_float(this._brightnessLocation, this.set_uniform_float(this._brightnessLocation,
1, [this._brightness]); 1, [this._brightness]);
this.notify('brightness');
} }
get sharpness() { get vignetteSharpness() {
return this._sharpness; return this._sharpness;
} }
set sharpness(v) { set vignetteSharpness(v) {
if (this._sharpness == v)
return;
this._sharpness = v; this._sharpness = v;
this.set_uniform_float(this._sharpnessLocation, this.set_uniform_float(this._sharpnessLocation,
1, [this._sharpness]); 1, [this._sharpness]);
this.notify('sharpness');
} }
}); });
@@ -89,8 +68,8 @@ var RadialShaderEffect = GObject.registerClass({
* - inhibitEvents: whether to inhibit events for @container * - inhibitEvents: whether to inhibit events for @container
* - width: shade actor width * - width: shade actor width
* - height: shade actor height * - height: shade actor height
* - fadeInTime: milliseconds used to fade in * - fadeInTime: seconds used to fade in
* - fadeOutTime: milliseconds used to fade out * - fadeOutTime: seconds used to fade out
* *
* Lightbox creates a dark translucent "shade" actor to hide the * Lightbox creates a dark translucent "shade" actor to hide the
* contents of @container, and allows you to specify particular actors * contents of @container, and allows you to specify particular actors
@@ -108,25 +87,27 @@ var RadialShaderEffect = GObject.registerClass({
*/ */
var Lightbox = class Lightbox { var Lightbox = class Lightbox {
constructor(container, params) { constructor(container, params) {
params = Params.parse(params, { params = Params.parse(params, { inhibitEvents: false,
inhibitEvents: false, width: null,
width: null, height: null,
height: null, fadeFactor: DEFAULT_FADE_FACTOR,
fadeFactor: DEFAULT_FADE_FACTOR, radialEffect: false,
radialEffect: false, });
});
this._container = container; this._container = container;
this._children = container.get_children(); this._children = container.get_children();
this._fadeFactor = params.fadeFactor; this._fadeFactor = params.fadeFactor;
this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect; this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
this.actor = new St.Bin({ reactive: params.inhibitEvents });
if (this._radialEffect) if (this._radialEffect)
this.actor.add_effect(new RadialShaderEffect({ name: 'radial' })); this.actor = new RadialShaderQuad({ x: 0,
y: 0,
reactive: params.inhibitEvents });
else else
this.actor.set({ opacity: 0, style_class: 'lightbox' }); this.actor = new St.Bin({ x: 0,
y: 0,
opacity: 0,
style_class: 'lightbox',
reactive: params.inhibitEvents });
container.add_actor(this.actor); container.add_actor(this.actor);
this.actor.raise_top(); this.actor.raise_top();
@@ -173,52 +154,60 @@ var Lightbox = class Lightbox {
} }
show(fadeInTime) { show(fadeInTime) {
this.actor.remove_all_transitions(); fadeInTime = fadeInTime || 0;
let easeProps = { Tweener.removeTweens(this.actor);
duration: fadeInTime || 0, if (this._radialEffect) {
mode: Clutter.AnimationMode.EASE_OUT_QUAD Tweener.addTween(this.actor,
}; { brightness: VIGNETTE_BRIGHTNESS,
vignetteSharpness: VIGNETTE_SHARPNESS,
let onComplete = () => { time: fadeInTime,
this.shown = true; transition: 'easeOutQuad',
this.emit('shown'); onComplete: () => {
}; this.shown = true;
this.emit('shown');
}
});
} else {
Tweener.addTween(this.actor,
{ opacity: 255 * this._fadeFactor,
time: fadeInTime,
transition: 'easeOutQuad',
onComplete: () => {
this.shown = true;
this.emit('shown');
}
});
}
this.actor.show(); this.actor.show();
if (this._radialEffect) {
this.actor.ease_property(
'@effects.radial.brightness', VIGNETTE_BRIGHTNESS, easeProps);
this.actor.ease_property(
'@effects.radial.sharpness', VIGNETTE_SHARPNESS,
Object.assign({ onComplete }, easeProps));
} else {
this.actor.ease(Object.assign(easeProps, {
opacity: 255 * this._fadeFactor,
onComplete
}));
}
} }
hide(fadeOutTime) { hide(fadeOutTime) {
fadeOutTime = fadeOutTime || 0;
this.shown = false; this.shown = false;
this.actor.remove_all_transitions(); Tweener.removeTweens(this.actor);
let easeProps = {
duration: fadeOutTime || 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD
};
let onComplete = () => this.actor.hide();
if (this._radialEffect) { if (this._radialEffect) {
this.actor.ease_property( Tweener.addTween(this.actor,
'@effects.radial.brightness', 1.0, easeProps); { brightness: 1.0,
this.actor.ease_property( vignetteSharpness: 0.0,
'@effects.radial.sharpness', 0.0, Object.assign({ onComplete }, easeProps)); opacity: 0,
time: fadeOutTime,
transition: 'easeOutQuad',
onComplete: () => {
this.actor.hide();
}
});
} else { } else {
this.actor.ease(Object.assign(easeProps, { opacity: 0, onComplete })); Tweener.addTween(this.actor,
{ opacity: 0,
time: fadeOutTime,
transition: 'easeOutQuad',
onComplete: () => {
this.actor.hide();
}
});
} }
} }

View File

@@ -1,39 +1,24 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported LocatePointer */
const { Gio } = imports.gi; const { Clutter, Gio, GLib, St } = imports.gi;
const Ripples = imports.ui.ripples; const Ripples = imports.ui.ripples;
const Main = imports.ui.main; const Main = imports.ui.main;
const LOCATE_POINTER_KEY = "locate-pointer"; const LOCATE_POINTER_KEY = "locate-pointer";
const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface"; const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface"
var LocatePointer = class { var locatePointer = class {
constructor() { constructor() {
this._settings = new Gio.Settings({ schema_id: LOCATE_POINTER_SCHEMA }); this._settings = new Gio.Settings({schema_id: LOCATE_POINTER_SCHEMA});
this._settings.connect(`changed::${LOCATE_POINTER_KEY}`, () => this._syncEnabled()); this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
this._syncEnabled(); this._ripples.addTo(Main.uiGroup);
}
_syncEnabled() {
let enabled = this._settings.get_boolean(LOCATE_POINTER_KEY);
if (enabled == !!this._ripples)
return;
if (enabled) {
this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
this._ripples.addTo(Main.uiGroup);
} else {
this._ripples.destroy();
this._ripples = null;
}
} }
show() { show() {
if (!this._ripples) if (!this._settings.get_boolean("locate-pointer"))
return; return;
let [x, y] = global.get_pointer(); let [x, y, mods] = global.get_pointer();
this._ripples.playAnimation(x, y); this._ripples.playAnimation(x, y);
} }
}; };

View File

@@ -1,24 +1,26 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported LookingGlass */
const { Clutter, Cogl, Gio, GLib, const { Clutter, Cogl, Gio, GLib,
GObject, Meta, Pango, Shell, St } = imports.gi; GObject, Meta, Pango, Shell, St } = imports.gi;
const Mainloop = imports.mainloop;
const Signals = imports.signals; const Signals = imports.signals;
const System = imports.system; const System = imports.system;
const History = imports.misc.history; const History = imports.misc.history;
const ExtensionSystem = imports.ui.extensionSystem;
const ExtensionUtils = imports.misc.extensionUtils; const ExtensionUtils = imports.misc.extensionUtils;
const ShellEntry = imports.ui.shellEntry; const ShellEntry = imports.ui.shellEntry;
const Tweener = imports.ui.tweener;
const Main = imports.ui.main; const Main = imports.ui.main;
const JsParse = imports.misc.jsParse; const JsParse = imports.misc.jsParse;
const { ExtensionState } = ExtensionUtils;
const CHEVRON = '>>> '; const CHEVRON = '>>> ';
/* Imports...feel free to add here as needed */ /* Imports...feel free to add here as needed */
var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' + var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
'const Main = imports.ui.main; ' + 'const Main = imports.ui.main; ' +
'const Mainloop = imports.mainloop; ' +
'const Tweener = imports.ui.tweener; ' +
/* Utility functions...we should probably be able to use these /* Utility functions...we should probably be able to use these
* in the shell core code too. */ * in the shell core code too. */
'const stage = global.stage; ' + 'const stage = global.stage; ' +
@@ -30,11 +32,9 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im
const HISTORY_KEY = 'looking-glass-history'; const HISTORY_KEY = 'looking-glass-history';
// Time between tabs for them to count as a double-tab event // Time between tabs for them to count as a double-tab event
var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500; var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500;
var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200; var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2;
var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords(); var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords();
const LG_ANIMATION_TIME = 500;
function _getAutoCompleteGlobalKeywords() { function _getAutoCompleteGlobalKeywords() {
const keywords = ['true', 'false', 'null', 'new']; const keywords = ['true', 'false', 'null', 'new'];
// Don't add the private properties of window (i.e., ones starting with '_') // Don't add the private properties of window (i.e., ones starting with '_')
@@ -68,10 +68,10 @@ var AutoComplete = class AutoComplete {
if (commonPrefix.length > 0) { if (commonPrefix.length > 0) {
this.additionalCompletionText(commonPrefix, event.attrHead); this.additionalCompletionText(commonPrefix, event.attrHead);
this.emit('completion', { completion: commonPrefix, type: 'prefix' }); this.emit('completion', { completion: commonPrefix, type: 'prefix' });
this.emit('suggest', { completions: event.completions }); this.emit('suggest', { completions: event.completions});
} }
} else if (event.completions.length > 1 && event.tabType === 'double') { } else if (event.completions.length > 1 && event.tabType === 'double') {
this.emit('suggest', { completions: event.completions }); this.emit('suggest', { completions: event.completions});
} }
} }
@@ -146,8 +146,8 @@ var Notebook = class Notebook {
this.actor.add(scrollview, { expand: true }); this.actor.add(scrollview, { expand: true });
let vAdjust = scrollview.vscroll.adjustment; let vAdjust = scrollview.vscroll.adjustment;
vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData)); vAdjust.connect('changed', () => { this._onAdjustScopeChanged(tabData); });
vAdjust.connect('notify::value', () => this._onAdjustValueChanged(tabData)); vAdjust.connect('notify::value', () => { this._onAdjustValueChanged(tabData); });
if (this._selectedIndex == -1) if (this._selectedIndex == -1)
this.selectIndex(0); this.selectIndex(0);
@@ -185,9 +185,9 @@ var Notebook = class Notebook {
} }
selectChild(child) { selectChild(child) {
if (child == null) { if (child == null)
this.selectIndex(-1); this.selectIndex(-1);
} else { else {
for (let i = 0; i < this._tabs.length; i++) { for (let i = 0; i < this._tabs.length; i++) {
let tabData = this._tabs[i]; let tabData = this._tabs[i];
if (tabData.child == child) { if (tabData.child == child) {
@@ -238,11 +238,11 @@ var Notebook = class Notebook {
Signals.addSignalMethods(Notebook.prototype); Signals.addSignalMethods(Notebook.prototype);
function objectToString(o) { function objectToString(o) {
if (typeof o == typeof objectToString) { if (typeof(o) == typeof(objectToString)) {
// special case this since the default is way, way too verbose // special case this since the default is way, way too verbose
return '<js function>'; return '<js function>';
} else { } else {
return `${o}`; return '' + o;
} }
} }
@@ -266,7 +266,7 @@ var ObjLink = class ObjLink {
this._lookingGlass = lookingGlass; this._lookingGlass = lookingGlass;
} }
_onClicked() { _onClicked(link) {
this._lookingGlass.inspectObject(this._obj, this.actor); this._lookingGlass.inspectObject(this._obj, this.actor);
} }
}; };
@@ -284,7 +284,7 @@ var Result = class Result {
this.actor.add(cmdTxt); this.actor.add(cmdTxt);
let box = new St.BoxLayout({}); let box = new St.BoxLayout({});
this.actor.add(box); this.actor.add(box);
let resultTxt = new St.Label({ text: `r(${index}) = ` }); let resultTxt = new St.Label({ text: 'r(' + index + ') = ' });
resultTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END; resultTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
box.add(resultTxt); box.add(resultTxt);
let objLink = new ObjLink(this._lookingGlass, o); let objLink = new ObjLink(this._lookingGlass, o);
@@ -304,9 +304,6 @@ var WindowList = class WindowList {
} }
_updateWindowList() { _updateWindowList() {
if (!this._lookingGlass.isOpen)
return;
this.actor.destroy_all_children(); this.actor.destroy_all_children();
let windows = global.get_window_actors(); let windows = global.get_window_actors();
let tracker = Shell.WindowTracker.get_default(); let tracker = Shell.WindowTracker.get_default();
@@ -323,7 +320,7 @@ var WindowList = class WindowList {
box.add(windowLink.actor, { x_align: St.Align.START, x_fill: false }); box.add(windowLink.actor, { x_align: St.Align.START, x_fill: false });
let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' }); let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' });
box.add(propsBox); box.add(propsBox);
propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` })); propsBox.add(new St.Label({ text: 'wmclass: ' + metaWindow.get_wm_class() }));
let app = tracker.get_window_app(metaWindow); let app = tracker.get_window_app(metaWindow);
if (app != null && !app.is_window_backed()) { if (app != null && !app.is_window_backed()) {
let icon = app.create_icon_texture(22); let icon = app.create_icon_texture(22);
@@ -338,10 +335,6 @@ var WindowList = class WindowList {
} }
} }
} }
update() {
this._updateWindowList();
}
}; };
Signals.addSignalMethods(WindowList.prototype); Signals.addSignalMethods(WindowList.prototype);
@@ -374,7 +367,7 @@ var ObjInspector = class ObjInspector {
let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' }); let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' });
this._container.add_actor(hbox); this._container.add_actor(hbox);
let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof obj, let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof(obj),
objectToString(obj)) }); objectToString(obj)) });
label.single_line_mode = true; label.single_line_mode = true;
hbox.add(label, { expand: true, y_fill: false }); hbox.add(label, { expand: true, y_fill: false });
@@ -392,7 +385,7 @@ var ObjInspector = class ObjInspector {
button.add_actor(new St.Icon({ icon_name: 'window-close-symbolic' })); button.add_actor(new St.Icon({ icon_name: 'window-close-symbolic' }));
button.connect('clicked', this.close.bind(this)); button.connect('clicked', this.close.bind(this));
hbox.add(button); hbox.add(button);
if (typeof obj == typeof {}) { if (typeof(obj) == typeof({})) {
let properties = []; let properties = [];
for (let propName in obj) { for (let propName in obj) {
properties.push(propName); properties.push(propName);
@@ -401,6 +394,7 @@ var ObjInspector = class ObjInspector {
for (let i = 0; i < properties.length; i++) { for (let i = 0; i < properties.length; i++) {
let propName = properties[i]; let propName = properties[i];
let valueStr;
let link; let link;
try { try {
let prop = obj[propName]; let prop = obj[propName];
@@ -409,7 +403,8 @@ var ObjInspector = class ObjInspector {
link = new St.Label({ text: '<error>' }); link = new St.Label({ text: '<error>' });
} }
let hbox = new St.BoxLayout(); let hbox = new St.BoxLayout();
hbox.add(new St.Label({ text: `${propName}: ` })); let propText = propName + ': ' + valueStr;
hbox.add(new St.Label({ text: propName + ': ' }));
hbox.add(link); hbox.add(link);
this._container.add_actor(hbox); this._container.add_actor(hbox);
} }
@@ -424,12 +419,9 @@ var ObjInspector = class ObjInspector {
this.actor.show(); this.actor.show();
if (sourceActor) { if (sourceActor) {
this.actor.set_scale(0, 0); this.actor.set_scale(0, 0);
this.actor.ease({ Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1,
scale_x: 1, transition: 'easeOutQuad',
scale_y: 1, time: 0.2 });
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
duration: 200
});
} else { } else {
this.actor.set_scale(1, 1); this.actor.set_scale(1, 1);
} }
@@ -501,13 +493,8 @@ var Inspector = GObject.registerClass({
eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this)); eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this));
eventHandler.connect('scroll-event', this._onScrollEvent.bind(this)); eventHandler.connect('scroll-event', this._onScrollEvent.bind(this));
eventHandler.connect('motion-event', this._onMotionEvent.bind(this)); eventHandler.connect('motion-event', this._onMotionEvent.bind(this));
Clutter.grab_pointer(eventHandler);
let dm = Clutter.DeviceManager.get_default(); Clutter.grab_keyboard(eventHandler);
this._pointerDevice = dm.get_core_device(Clutter.InputDeviceType.POINTER_DEVICE);
this._keyboardDevice = dm.get_core_device(Clutter.InputDeviceType.KEYBOARD_DEVICE);
this._pointerDevice.grab(eventHandler);
this._keyboardDevice.grab(eventHandler);
// this._target is the actor currently shown by the inspector. // this._target is the actor currently shown by the inspector.
// this._pointerTarget is the actor directly under the pointer. // this._pointerTarget is the actor directly under the pointer.
@@ -528,7 +515,7 @@ var Inspector = GObject.registerClass({
let primary = Main.layoutManager.primaryMonitor; let primary = Main.layoutManager.primaryMonitor;
let [, , natWidth, natHeight] = let [minWidth, minHeight, natWidth, natHeight] =
this._eventHandler.get_preferred_size(); this._eventHandler.get_preferred_size();
let childBox = new Clutter.ActorBox(); let childBox = new Clutter.ActorBox();
@@ -540,8 +527,8 @@ var Inspector = GObject.registerClass({
} }
_close() { _close() {
this._pointerDevice.ungrab(); Clutter.ungrab_pointer();
this._keyboardDevice.ungrab(); Clutter.ungrab_keyboard();
this._eventHandler.destroy(); this._eventHandler.destroy();
this._eventHandler = null; this._eventHandler = null;
this.emit('closed'); this.emit('closed');
@@ -564,7 +551,7 @@ var Inspector = GObject.registerClass({
_onScrollEvent(actor, event) { _onScrollEvent(actor, event) {
switch (event.get_scroll_direction()) { switch (event.get_scroll_direction()) {
case Clutter.ScrollDirection.UP: { case Clutter.ScrollDirection.UP:
// select parent // select parent
let parent = this._target.get_parent(); let parent = this._target.get_parent();
if (parent != null) { if (parent != null) {
@@ -572,7 +559,6 @@ var Inspector = GObject.registerClass({
this._update(event); this._update(event);
} }
break; break;
}
case Clutter.ScrollDirection.DOWN: case Clutter.ScrollDirection.DOWN:
// select child // select child
@@ -612,9 +598,9 @@ var Inspector = GObject.registerClass({
this._target = target; this._target = target;
this._pointerTarget = target; this._pointerTarget = target;
let position = `[inspect x: ${stageX} y: ${stageY}]`; let position = '[inspect x: ' + stageX + ' y: ' + stageY + ']';
this._displayText.text = ''; this._displayText.text = '';
this._displayText.text = `${position} ${this._target}`; this._displayText.text = position + ' ' + this._target;
this._lookingGlass.setBorderPaintTarget(this._target); this._lookingGlass.setBorderPaintTarget(this._target);
} }
@@ -626,23 +612,22 @@ var Extensions = class Extensions {
this.actor = new St.BoxLayout({ vertical: true, this.actor = new St.BoxLayout({ vertical: true,
name: 'lookingGlassExtensions' }); name: 'lookingGlassExtensions' });
this._noExtensions = new St.Label({ style_class: 'lg-extensions-none', this._noExtensions = new St.Label({ style_class: 'lg-extensions-none',
text: _("No extensions installed") }); text: _("No extensions installed") });
this._numExtensions = 0; this._numExtensions = 0;
this._extensionsList = new St.BoxLayout({ vertical: true, this._extensionsList = new St.BoxLayout({ vertical: true,
style_class: 'lg-extensions-list' }); style_class: 'lg-extensions-list' });
this._extensionsList.add(this._noExtensions); this._extensionsList.add(this._noExtensions);
this.actor.add(this._extensionsList); this.actor.add(this._extensionsList);
Main.extensionManager.getUuids().forEach(uuid => { for (let uuid in ExtensionUtils.extensions)
this._loadExtension(null, uuid); this._loadExtension(null, uuid);
});
Main.extensionManager.connect('extension-loaded', ExtensionSystem.connect('extension-loaded',
this._loadExtension.bind(this)); this._loadExtension.bind(this));
} }
_loadExtension(o, uuid) { _loadExtension(o, uuid) {
let extension = Main.extensionManager.lookup(uuid); let extension = ExtensionUtils.extensions[uuid];
// There can be cases where we create dummy extension metadata // There can be cases where we create dummy extension metadata
// that's not really a proper extension. Don't bother with these. // that's not really a proper extension. Don't bother with these.
if (!extension.metadata.name) if (!extension.metadata.name)
@@ -699,17 +684,17 @@ var Extensions = class Extensions {
_stateToString(extensionState) { _stateToString(extensionState) {
switch (extensionState) { switch (extensionState) {
case ExtensionState.ENABLED: case ExtensionSystem.ExtensionState.ENABLED:
return _("Enabled"); return _("Enabled");
case ExtensionState.DISABLED: case ExtensionSystem.ExtensionState.DISABLED:
case ExtensionState.INITIALIZED: case ExtensionSystem.ExtensionState.INITIALIZED:
return _("Disabled"); return _("Disabled");
case ExtensionState.ERROR: case ExtensionSystem.ExtensionState.ERROR:
return _("Error"); return _("Error");
case ExtensionState.OUT_OF_DATE: case ExtensionSystem.ExtensionState.OUT_OF_DATE:
return _("Out of date"); return _("Out of date");
case ExtensionState.DOWNLOADING: case ExtensionSystem.ExtensionState.DOWNLOADING:
return _("Downloading"); return _("Downloading");
} }
return 'Unknown'; // Not translated, shouldn't appear return 'Unknown'; // Not translated, shouldn't appear
} }
@@ -717,7 +702,7 @@ var Extensions = class Extensions {
_createExtensionDisplay(extension) { _createExtensionDisplay(extension) {
let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true }); let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true });
let name = new St.Label({ style_class: 'lg-extension-name', let name = new St.Label({ style_class: 'lg-extension-name',
text: extension.metadata.name }); text: extension.metadata.name });
box.add(name, { expand: true }); box.add(name, { expand: true });
let description = new St.Label({ style_class: 'lg-extension-description', let description = new St.Label({ style_class: 'lg-extension-description',
text: extension.metadata.description || 'No description' }); text: extension.metadata.description || 'No description' });
@@ -725,6 +710,7 @@ var Extensions = class Extensions {
let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' }); let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' });
box.add(metaBox); box.add(metaBox);
let stateString = this._stateToString(extension.state);
let state = new St.Label({ style_class: 'lg-extension-state', let state = new St.Label({ style_class: 'lg-extension-state',
text: this._stateToString(extension.state) }); text: this._stateToString(extension.state) });
metaBox.add(state); metaBox.add(state);
@@ -809,7 +795,7 @@ var LookingGlass = class LookingGlass {
inspectIcon.connect('button-press-event', () => { inspectIcon.connect('button-press-event', () => {
let inspector = new Inspector(this); let inspector = new Inspector(this);
inspector.connect('target', (i, target, stageX, stageY) => { inspector.connect('target', (i, target, stageX, stageY) => {
this._pushResult(`inspect(${Math.round(stageX)}, ${Math.round(stageY)})`, target); this._pushResult('inspect(' + Math.round(stageX) + ', ' + Math.round(stageY) + ')', target);
}); });
inspector.connect('closed', () => { inspector.connect('closed', () => {
this.actor.show(); this.actor.show();
@@ -824,15 +810,15 @@ var LookingGlass = class LookingGlass {
toolbar.add_actor(gcIcon); toolbar.add_actor(gcIcon);
gcIcon.reactive = true; gcIcon.reactive = true;
gcIcon.connect('button-press-event', () => { gcIcon.connect('button-press-event', () => {
gcIcon.icon_name = 'user-trash'; gcIcon.icon_name = 'user-trash';
System.gc(); System.gc();
this._timeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, () => { this._timeoutId = Mainloop.timeout_add(500, () => {
gcIcon.icon_name = 'user-trash-full'; gcIcon.icon_name = 'user-trash-full';
this._timeoutId = 0; this._timeoutId = 0;
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
}); });
GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\''); GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\'');
return Clutter.EVENT_PROPAGATE; return Clutter.EVENT_PROPAGATE;
}); });
let notebook = new Notebook(); let notebook = new Notebook();
@@ -865,7 +851,7 @@ var LookingGlass = class LookingGlass {
this._extensions = new Extensions(this); this._extensions = new Extensions(this);
notebook.appendPage('Extensions', this._extensions.actor); notebook.appendPage('Extensions', this._extensions.actor);
this._entry.clutter_text.connect('activate', (o, _e) => { this._entry.clutter_text.connect('activate', (o, e) => {
// Hide any completions we are currently showing // Hide any completions we are currently showing
this._hideCompletions(); this._hideCompletions();
@@ -903,11 +889,9 @@ var LookingGlass = class LookingGlass {
let fontDesc = Pango.FontDescription.from_string(fontName); let fontDesc = Pango.FontDescription.from_string(fontName);
// We ignore everything but size and style; you'd be crazy to set your system-wide // We ignore everything but size and style; you'd be crazy to set your system-wide
// monospace font to be bold/oblique/etc. Could easily be added here. // monospace font to be bold/oblique/etc. Could easily be added here.
let size = fontDesc.get_size() / 1024.; this.actor.style =
let unit = fontDesc.get_size_is_absolute() ? 'px' : 'pt'; 'font-size: ' + fontDesc.get_size() / 1024. + (fontDesc.get_size_is_absolute() ? 'px' : 'pt') + ';'
this.actor.style = ` + 'font-family: "' + fontDesc.get_family() + '";';
font-size: ${size}${unit};
font-family: "${fontDesc.get_family()}";`;
} }
setBorderPaintTarget(obj) { setBorderPaintTarget(obj) {
@@ -949,41 +933,35 @@ var LookingGlass = class LookingGlass {
this._completionActor.set_text(completions.join(', ')); this._completionActor.set_text(completions.join(', '));
// Setting the height to -1 allows us to get its actual preferred height rather than // Setting the height to -1 allows us to get its actual preferred height rather than
// whatever was last set when animating // whatever was last given in set_height by Tweener.
this._completionActor.set_height(-1); this._completionActor.set_height(-1);
let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width()); let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
// Don't reanimate if we are already visible // Don't reanimate if we are already visible
if (this._completionActor.visible) { if (this._completionActor.visible) {
this._completionActor.height = naturalHeight; this._completionActor.height = naturalHeight;
} else { } else {
let settings = St.Settings.get();
let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
this._completionActor.show(); this._completionActor.show();
this._completionActor.remove_all_transitions(); Tweener.removeTweens(this._completionActor);
this._completionActor.ease({ Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
height: naturalHeight, transition: 'easeOutQuad',
opacity: 255, height: naturalHeight,
duration, opacity: 255
mode: Clutter.AnimationMode.EASE_OUT_QUAD });
});
} }
} }
_hideCompletions() { _hideCompletions() {
if (this._completionActor) { if (this._completionActor) {
let settings = St.Settings.get(); Tweener.removeTweens(this._completionActor);
let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor; Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
this._completionActor.remove_all_transitions(); transition: 'easeOutQuad',
this._completionActor.ease({ height: 0,
height: 0, opacity: 0,
opacity: 0, onComplete: () => {
duration, this._completionActor.hide();
mode: Clutter.AnimationMode.EASE_OUT_QUAD, }
onComplete: () => { });
this._completionActor.hide();
}
});
} }
} }
@@ -999,7 +977,7 @@ var LookingGlass = class LookingGlass {
try { try {
resultObj = Function(fullCmd)(); resultObj = Function(fullCmd)();
} catch (e) { } catch (e) {
resultObj = `<exception ${e}>`; resultObj = '<exception ' + e + '>';
} }
this._pushResult(command, resultObj); this._pushResult(command, resultObj);
@@ -1015,11 +993,7 @@ var LookingGlass = class LookingGlass {
} }
getResult(idx) { getResult(idx) {
try { return this._results[idx - this._offset].o;
return this._results[idx - this._offset].o;
} catch (e) {
throw new Error(`Unknown result at index ${idx}`);
}
} }
toggle() { toggle() {
@@ -1030,10 +1004,7 @@ var LookingGlass = class LookingGlass {
} }
_queueResize() { _queueResize() {
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { this._resize(); });
this._resize();
return GLib.SOURCE_REMOVE;
});
} }
_resize() { _resize() {
@@ -1096,18 +1067,14 @@ var LookingGlass = class LookingGlass {
this._open = true; this._open = true;
this._history.lastItem(); this._history.lastItem();
this.actor.remove_all_transitions(); Tweener.removeTweens(this.actor);
// We inverse compensate for the slow-down so you can change the factor // We inverse compensate for the slow-down so you can change the factor
// through LookingGlass without long waits. // through LookingGlass without long waits.
let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor; Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(),
this.actor.ease({ transition: 'easeOutQuad',
y: this._targetY, y: this._targetY
duration, });
mode: Clutter.AnimationMode.EASE_OUT_QUAD
});
this._windowList.update();
} }
close() { close() {
@@ -1117,25 +1084,19 @@ var LookingGlass = class LookingGlass {
this._objInspector.actor.hide(); this._objInspector.actor.hide();
this._open = false; this._open = false;
this.actor.remove_all_transitions(); Tweener.removeTweens(this.actor);
this.setBorderPaintTarget(null); this.setBorderPaintTarget(null);
Main.popModal(this._entry); Main.popModal(this._entry);
let settings = St.Settings.get(); Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5),
let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor, transition: 'easeOutQuad',
LG_ANIMATION_TIME); y: this._hiddenY,
this.actor.ease({ onComplete: () => {
y: this._hiddenY, this.actor.hide();
duration, }
mode: Clutter.AnimationMode.EASE_OUT_QUAD, });
onComplete: () => this.actor.hide()
});
}
get isOpen() {
return this._open;
} }
}; };
Signals.addSignalMethods(LookingGlass.prototype); Signals.addSignalMethods(LookingGlass.prototype);

View File

@@ -2,6 +2,7 @@
const { Atspi, Clutter, GDesktopEnums, const { Atspi, Clutter, GDesktopEnums,
Gio, GLib, GObject, Meta, Shell, St } = imports.gi; Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
const Mainloop = imports.mainloop;
const Signals = imports.signals; const Signals = imports.signals;
const Background = imports.ui.background; const Background = imports.ui.background;
@@ -40,8 +41,10 @@ const CROSS_HAIRS_OPACITY_KEY = 'cross-hairs-opacity';
const CROSS_HAIRS_LENGTH_KEY = 'cross-hairs-length'; const CROSS_HAIRS_LENGTH_KEY = 'cross-hairs-length';
const CROSS_HAIRS_CLIP_KEY = 'cross-hairs-clip'; const CROSS_HAIRS_CLIP_KEY = 'cross-hairs-clip';
let magDBusService = null;
var MouseSpriteContent = GObject.registerClass({ var MouseSpriteContent = GObject.registerClass({
Implements: [Clutter.Content], Implements: [ Clutter.Content ],
}, class MouseSpriteContent extends GObject.Object { }, class MouseSpriteContent extends GObject.Object {
_init() { _init() {
super._init(); super._init();
@@ -106,7 +109,8 @@ var Magnifier = class Magnifier {
// Create the first ZoomRegion and initialize it according to the // Create the first ZoomRegion and initialize it according to the
// magnification settings. // magnification settings.
[this.xMouse, this.yMouse] = global.get_pointer(); let mask;
[this.xMouse, this.yMouse, mask] = global.get_pointer();
let aZoomRegion = new ZoomRegion(this, this._cursorRoot); let aZoomRegion = new ZoomRegion(this, this._cursorRoot);
this._zoomRegions.push(aZoomRegion); this._zoomRegions.push(aZoomRegion);
@@ -118,7 +122,7 @@ var Magnifier = class Magnifier {
}); });
// Export to dbus. // Export to dbus.
(new MagnifierDBus.ShellMagnifier()); magDBusService = new MagnifierDBus.ShellMagnifier();
this.setActive(St.Settings.get().magnifier_active); this.setActive(St.Settings.get().magnifier_active);
} }
@@ -127,8 +131,6 @@ var Magnifier = class Magnifier {
* Show the system mouse pointer. * Show the system mouse pointer.
*/ */
showSystemCursor() { showSystemCursor() {
if (this._cursorTracker.set_keep_focus_while_hidden)
this._cursorTracker.set_keep_focus_while_hidden(false);
this._cursorTracker.set_pointer_visible(true); this._cursorTracker.set_pointer_visible(true);
} }
@@ -137,8 +139,6 @@ var Magnifier = class Magnifier {
* Hide the system mouse pointer. * Hide the system mouse pointer.
*/ */
hideSystemCursor() { hideSystemCursor() {
if (this._cursorTracker.set_keep_focus_while_hidden)
this._cursorTracker.set_keep_focus_while_hidden(true);
this._cursorTracker.set_pointer_visible(false); this._cursorTracker.set_pointer_visible(false);
} }
@@ -150,7 +150,7 @@ var Magnifier = class Magnifier {
setActive(activate) { setActive(activate) {
let isActive = this.isActive(); let isActive = this.isActive();
this._zoomRegions.forEach(zoomRegion => { this._zoomRegions.forEach ((zoomRegion, index, array) => {
zoomRegion.setActive(activate); zoomRegion.setActive(activate);
}); });
@@ -173,7 +173,7 @@ var Magnifier = class Magnifier {
// Make sure system mouse pointer is shown when all zoom regions are // Make sure system mouse pointer is shown when all zoom regions are
// invisible. // invisible.
if (!activate) if (!activate)
this.showSystemCursor(); this._cursorTracker.set_pointer_visible(true);
// Notify interested parties of this change // Notify interested parties of this change
this.emit('active-changed', activate); this.emit('active-changed', activate);
@@ -229,14 +229,14 @@ var Magnifier = class Magnifier {
* @return true. * @return true.
*/ */
scrollToMousePos() { scrollToMousePos() {
let [xMouse, yMouse] = global.get_pointer(); let [xMouse, yMouse, mask] = global.get_pointer();
if (xMouse != this.xMouse || yMouse != this.yMouse) { if (xMouse != this.xMouse || yMouse != this.yMouse) {
this.xMouse = xMouse; this.xMouse = xMouse;
this.yMouse = yMouse; this.yMouse = yMouse;
let sysMouseOverAny = false; let sysMouseOverAny = false;
this._zoomRegions.forEach(zoomRegion => { this._zoomRegions.forEach((zoomRegion, index, array) => {
if (zoomRegion.scrollToMousePos()) if (zoomRegion.scrollToMousePos())
sysMouseOverAny = true; sysMouseOverAny = true;
}); });
@@ -268,7 +268,7 @@ var Magnifier = class Magnifier {
zoomRegion.setViewPort(viewPort); zoomRegion.setViewPort(viewPort);
// We ignore the redundant width/height on the ROI // We ignore the redundant width/height on the ROI
let fixedROI = Object.create(roi); let fixedROI = new Object(roi);
fixedROI.width = viewPort.width / xMagFactor; fixedROI.width = viewPort.width / xMagFactor;
fixedROI.height = viewPort.height / yMagFactor; fixedROI.height = viewPort.height / yMagFactor;
zoomRegion.setROI(fixedROI); zoomRegion.setROI(fixedROI);
@@ -284,7 +284,7 @@ var Magnifier = class Magnifier {
* @zoomRegion: The zoomRegion to add. * @zoomRegion: The zoomRegion to add.
*/ */
addZoomRegion(zoomRegion) { addZoomRegion(zoomRegion) {
if (zoomRegion) { if(zoomRegion) {
this._zoomRegions.push(zoomRegion); this._zoomRegions.push(zoomRegion);
if (!this.isTrackingMouse()) if (!this.isTrackingMouse())
this.startTrackingMouse(); this.startTrackingMouse();
@@ -334,7 +334,7 @@ var Magnifier = class Magnifier {
this.setCrosshairsClip(clip); this.setCrosshairsClip(clip);
let theCrossHairs = this._crossHairs; let theCrossHairs = this._crossHairs;
this._zoomRegions.forEach (zoomRegion => { this._zoomRegions.forEach ((zoomRegion, index, array) => {
zoomRegion.addCrosshairs(theCrossHairs); zoomRegion.addCrosshairs(theCrossHairs);
}); });
} }
@@ -349,7 +349,8 @@ var Magnifier = class Magnifier {
if (!this._crossHairs) if (!this._crossHairs)
this.addCrosshairs(); this.addCrosshairs();
this._crossHairs.show(); this._crossHairs.show();
} else { }
else {
if (this._crossHairs) if (this._crossHairs)
this._crossHairs.hide(); this._crossHairs.hide();
} }
@@ -362,7 +363,7 @@ var Magnifier = class Magnifier {
*/ */
setCrosshairsColor(color) { setCrosshairsColor(color) {
if (this._crossHairs) { if (this._crossHairs) {
let [res_, clutterColor] = Clutter.Color.from_string(color); let [res, clutterColor] = Clutter.Color.from_string(color);
this._crossHairs.setColor(clutterColor); this._crossHairs.setColor(clutterColor);
} }
} }
@@ -376,9 +377,9 @@ var Magnifier = class Magnifier {
if (this._crossHairs) { if (this._crossHairs) {
let clutterColor = this._crossHairs.getColor(); let clutterColor = this._crossHairs.getColor();
return clutterColor.to_string(); return clutterColor.to_string();
} else {
return '#00000000';
} }
else
return '#00000000';
} }
/** /**
@@ -455,11 +456,16 @@ var Magnifier = class Magnifier {
* @clip: Flag to indicate whether to clip the crosshairs. * @clip: Flag to indicate whether to clip the crosshairs.
*/ */
setCrosshairsClip(clip) { setCrosshairsClip(clip) {
if (!this._crossHairs) if (clip) {
return; if (this._crossHairs)
this._crossHairs.setClip(CROSSHAIRS_CLIP_SIZE);
// Setting no clipping on crosshairs means a zero sized clip rectangle. }
this._crossHairs.setClip(clip ? CROSSHAIRS_CLIP_SIZE : [0, 0]); else {
// Setting no clipping on crosshairs means a zero sized clip
// rectangle.
if (this._crossHairs)
this._crossHairs.setClip([0, 0]);
}
} }
/** /**
@@ -467,14 +473,14 @@ var Magnifier = class Magnifier {
* Get whether the crosshairs are clipped by the mouse image. * Get whether the crosshairs are clipped by the mouse image.
* @return: Whether the crosshairs are clipped. * @return: Whether the crosshairs are clipped.
*/ */
getCrosshairsClip() { getCrosshairsClip() {
if (this._crossHairs) { if (this._crossHairs) {
let [clipWidth, clipHeight] = this._crossHairs.getClip(); let [clipWidth, clipHeight] = this._crossHairs.getClip();
return (clipWidth > 0 && clipHeight > 0); return (clipWidth > 0 && clipHeight > 0);
} else {
return false;
} }
} else
return false;
}
//// Private methods //// //// Private methods ////
@@ -498,61 +504,61 @@ var Magnifier = class Magnifier {
_settingsInit(zoomRegion) { _settingsInit(zoomRegion) {
this._settings = new Gio.Settings({ schema_id: MAGNIFIER_SCHEMA }); this._settings = new Gio.Settings({ schema_id: MAGNIFIER_SCHEMA });
this._settings.connect(`changed::${SCREEN_POSITION_KEY}`, this._settings.connect('changed::' + SCREEN_POSITION_KEY,
this._updateScreenPosition.bind(this)); this._updateScreenPosition.bind(this));
this._settings.connect(`changed::${MAG_FACTOR_KEY}`, this._settings.connect('changed::' + MAG_FACTOR_KEY,
this._updateMagFactor.bind(this)); this._updateMagFactor.bind(this));
this._settings.connect(`changed::${LENS_MODE_KEY}`, this._settings.connect('changed::' + LENS_MODE_KEY,
this._updateLensMode.bind(this)); this._updateLensMode.bind(this));
this._settings.connect(`changed::${CLAMP_MODE_KEY}`, this._settings.connect('changed::' + CLAMP_MODE_KEY,
this._updateClampMode.bind(this)); this._updateClampMode.bind(this));
this._settings.connect(`changed::${MOUSE_TRACKING_KEY}`, this._settings.connect('changed::' + MOUSE_TRACKING_KEY,
this._updateMouseTrackingMode.bind(this)); this._updateMouseTrackingMode.bind(this));
this._settings.connect(`changed::${FOCUS_TRACKING_KEY}`, this._settings.connect('changed::' + FOCUS_TRACKING_KEY,
this._updateFocusTrackingMode.bind(this)); this._updateFocusTrackingMode.bind(this));
this._settings.connect(`changed::${CARET_TRACKING_KEY}`, this._settings.connect('changed::' + CARET_TRACKING_KEY,
this._updateCaretTrackingMode.bind(this)); this._updateCaretTrackingMode.bind(this));
this._settings.connect(`changed::${INVERT_LIGHTNESS_KEY}`, this._settings.connect('changed::' + INVERT_LIGHTNESS_KEY,
this._updateInvertLightness.bind(this)); this._updateInvertLightness.bind(this));
this._settings.connect(`changed::${COLOR_SATURATION_KEY}`, this._settings.connect('changed::' + COLOR_SATURATION_KEY,
this._updateColorSaturation.bind(this)); this._updateColorSaturation.bind(this));
this._settings.connect(`changed::${BRIGHT_RED_KEY}`, this._settings.connect('changed::' + BRIGHT_RED_KEY,
this._updateBrightness.bind(this)); this._updateBrightness.bind(this));
this._settings.connect(`changed::${BRIGHT_GREEN_KEY}`, this._settings.connect('changed::' + BRIGHT_GREEN_KEY,
this._updateBrightness.bind(this)); this._updateBrightness.bind(this));
this._settings.connect(`changed::${BRIGHT_BLUE_KEY}`, this._settings.connect('changed::' + BRIGHT_BLUE_KEY,
this._updateBrightness.bind(this)); this._updateBrightness.bind(this));
this._settings.connect(`changed::${CONTRAST_RED_KEY}`, this._settings.connect('changed::' + CONTRAST_RED_KEY,
this._updateContrast.bind(this)); this._updateContrast.bind(this));
this._settings.connect(`changed::${CONTRAST_GREEN_KEY}`, this._settings.connect('changed::' + CONTRAST_GREEN_KEY,
this._updateContrast.bind(this)); this._updateContrast.bind(this));
this._settings.connect(`changed::${CONTRAST_BLUE_KEY}`, this._settings.connect('changed::' + CONTRAST_BLUE_KEY,
this._updateContrast.bind(this)); this._updateContrast.bind(this));
this._settings.connect(`changed::${SHOW_CROSS_HAIRS_KEY}`, () => { this._settings.connect('changed::' + SHOW_CROSS_HAIRS_KEY, () => {
this.setCrosshairsVisible(this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY)); this.setCrosshairsVisible(this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY));
}); });
this._settings.connect(`changed::${CROSS_HAIRS_THICKNESS_KEY}`, () => { this._settings.connect('changed::' + CROSS_HAIRS_THICKNESS_KEY, () => {
this.setCrosshairsThickness(this._settings.get_int(CROSS_HAIRS_THICKNESS_KEY)); this.setCrosshairsThickness(this._settings.get_int(CROSS_HAIRS_THICKNESS_KEY));
}); });
this._settings.connect(`changed::${CROSS_HAIRS_COLOR_KEY}`, () => { this._settings.connect('changed::' + CROSS_HAIRS_COLOR_KEY, () => {
this.setCrosshairsColor(this._settings.get_string(CROSS_HAIRS_COLOR_KEY)); this.setCrosshairsColor(this._settings.get_string(CROSS_HAIRS_COLOR_KEY));
}); });
this._settings.connect(`changed::${CROSS_HAIRS_OPACITY_KEY}`, () => { this._settings.connect('changed::' + CROSS_HAIRS_OPACITY_KEY, () => {
this.setCrosshairsOpacity(this._settings.get_double(CROSS_HAIRS_OPACITY_KEY)); this.setCrosshairsOpacity(this._settings.get_double(CROSS_HAIRS_OPACITY_KEY));
}); });
this._settings.connect(`changed::${CROSS_HAIRS_LENGTH_KEY}`, () => { this._settings.connect('changed::' + CROSS_HAIRS_LENGTH_KEY, () => {
this.setCrosshairsLength(this._settings.get_int(CROSS_HAIRS_LENGTH_KEY)); this.setCrosshairsLength(this._settings.get_int(CROSS_HAIRS_LENGTH_KEY));
}); });
this._settings.connect(`changed::${CROSS_HAIRS_CLIP_KEY}`, () => { this._settings.connect('changed::' + CROSS_HAIRS_CLIP_KEY, () => {
this.setCrosshairsClip(this._settings.get_boolean(CROSS_HAIRS_CLIP_KEY)); this.setCrosshairsClip(this._settings.get_boolean(CROSS_HAIRS_CLIP_KEY));
}); });
@@ -604,7 +610,7 @@ var Magnifier = class Magnifier {
let showCrosshairs = this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY); let showCrosshairs = this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY);
this.addCrosshairs(); this.addCrosshairs();
this.setCrosshairsVisible(showCrosshairs); this.setCrosshairsVisible(showCrosshairs);
} }
_updateScreenPosition() { _updateScreenPosition() {
// Applies only to the first zoom region. // Applies only to the first zoom region.
@@ -794,8 +800,8 @@ var ZoomRegion = class ZoomRegion {
let extents; let extents;
try { try {
extents = component.get_extents(Atspi.CoordType.SCREEN); extents = component.get_extents(Atspi.CoordType.SCREEN);
} catch (e) { } catch(e) {
log(`Failed to read extents of focused component: ${e.message}`); log('Failed to read extents of focused component: ' + e.message);
return; return;
} }
@@ -811,8 +817,8 @@ var ZoomRegion = class ZoomRegion {
let extents; let extents;
try { try {
extents = text.get_character_extents(text.get_caret_offset(), 0); extents = text.get_character_extents(text.get_caret_offset(), 0);
} catch (e) { } catch(e) {
log(`Failed to read extents of text caret: ${e.message}`); log('Failed to read extents of text caret: ' + e.message);
return; return;
} }
@@ -1024,7 +1030,7 @@ var ZoomRegion = class ZoomRegion {
viewPort.x = 0; viewPort.x = 0;
viewPort.y = 0; viewPort.y = 0;
viewPort.width = global.screen_width; viewPort.width = global.screen_width;
viewPort.height = global.screen_height / 2; viewPort.height = global.screen_height/2;
this._setViewPort(viewPort); this._setViewPort(viewPort);
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.TOP_HALF; this._screenPosition = GDesktopEnums.MagnifierScreenPosition.TOP_HALF;
} }
@@ -1036,9 +1042,9 @@ var ZoomRegion = class ZoomRegion {
setBottomHalf() { setBottomHalf() {
let viewPort = {}; let viewPort = {};
viewPort.x = 0; viewPort.x = 0;
viewPort.y = global.screen_height / 2; viewPort.y = global.screen_height/2;
viewPort.width = global.screen_width; viewPort.width = global.screen_width;
viewPort.height = global.screen_height / 2; viewPort.height = global.screen_height/2;
this._setViewPort(viewPort); this._setViewPort(viewPort);
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF; this._screenPosition = GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF;
} }
@@ -1051,7 +1057,7 @@ var ZoomRegion = class ZoomRegion {
let viewPort = {}; let viewPort = {};
viewPort.x = 0; viewPort.x = 0;
viewPort.y = 0; viewPort.y = 0;
viewPort.width = global.screen_width / 2; viewPort.width = global.screen_width/2;
viewPort.height = global.screen_height; viewPort.height = global.screen_height;
this._setViewPort(viewPort); this._setViewPort(viewPort);
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.LEFT_HALF; this._screenPosition = GDesktopEnums.MagnifierScreenPosition.LEFT_HALF;
@@ -1063,9 +1069,9 @@ var ZoomRegion = class ZoomRegion {
*/ */
setRightHalf() { setRightHalf() {
let viewPort = {}; let viewPort = {};
viewPort.x = global.screen_width / 2; viewPort.x = global.screen_width/2;
viewPort.y = 0; viewPort.y = 0;
viewPort.width = global.screen_width / 2; viewPort.width = global.screen_width/2;
viewPort.height = global.screen_height; viewPort.height = global.screen_height;
this._setViewPort(viewPort); this._setViewPort(viewPort);
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF; this._screenPosition = GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF;
@@ -1097,21 +1103,21 @@ var ZoomRegion = class ZoomRegion {
*/ */
setScreenPosition(inPosition) { setScreenPosition(inPosition) {
switch (inPosition) { switch (inPosition) {
case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN: case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN:
this.setFullScreenMode(); this.setFullScreenMode();
break; break;
case GDesktopEnums.MagnifierScreenPosition.TOP_HALF: case GDesktopEnums.MagnifierScreenPosition.TOP_HALF:
this.setTopHalf(); this.setTopHalf();
break; break;
case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF: case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF:
this.setBottomHalf(); this.setBottomHalf();
break; break;
case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF: case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF:
this.setLeftHalf(); this.setLeftHalf();
break; break;
case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF: case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF:
this.setRightHalf(); this.setRightHalf();
break; break;
} }
} }
@@ -1143,7 +1149,7 @@ var ZoomRegion = class ZoomRegion {
_clearScrollContentsTimer() { _clearScrollContentsTimer() {
if (this._scrollContentsTimerId != 0) { if (this._scrollContentsTimerId != 0) {
GLib.source_remove(this._scrollContentsTimerId); Mainloop.source_remove(this._scrollContentsTimerId);
this._scrollContentsTimerId = 0; this._scrollContentsTimerId = 0;
} }
} }
@@ -1155,7 +1161,7 @@ var ZoomRegion = class ZoomRegion {
} }
this._clearScrollContentsTimer(); this._clearScrollContentsTimer();
this._scrollContentsTimerId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, POINTER_REST_TIME, () => { this._scrollContentsTimerId = Mainloop.timeout_add(POINTER_REST_TIME, () => {
this._scrollContentsToDelayed(x, y); this._scrollContentsToDelayed(x, y);
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;
}); });
@@ -1454,9 +1460,11 @@ var ZoomRegion = class ZoomRegion {
if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) { if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) {
return this._centerFromPointProportional(xMouse, yMouse); return this._centerFromPointProportional(xMouse, yMouse);
} else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) { }
else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
return this._centerFromPointPush(xMouse, yMouse); return this._centerFromPointPush(xMouse, yMouse);
} else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) { }
else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
return this._centerFromPointCentered(xMouse, yMouse); return this._centerFromPointCentered(xMouse, yMouse);
} }
@@ -1513,7 +1521,7 @@ var ZoomRegion = class ZoomRegion {
} }
_centerFromPointProportional(xPoint, yPoint) { _centerFromPointProportional(xPoint, yPoint) {
let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI(); let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI();
let halfScreenWidth = global.screen_width / 2; let halfScreenWidth = global.screen_width / 2;
let halfScreenHeight = global.screen_height / 2; let halfScreenHeight = global.screen_height / 2;
// We want to pad with a constant distance after zooming, so divide // We want to pad with a constant distance after zooming, so divide
@@ -1524,7 +1532,7 @@ var ZoomRegion = class ZoomRegion {
let xProportion = (xPoint - halfScreenWidth) / halfScreenWidth; // -1 ... 1 let xProportion = (xPoint - halfScreenWidth) / halfScreenWidth; // -1 ... 1
let yProportion = (yPoint - halfScreenHeight) / halfScreenHeight; // -1 ... 1 let yProportion = (yPoint - halfScreenHeight) / halfScreenHeight; // -1 ... 1
let xPos = xPoint - xProportion * (widthRoi / 2 - xPadding); let xPos = xPoint - xProportion * (widthRoi / 2 - xPadding);
let yPos = yPoint - yProportion * (heightRoi / 2 - yPadding); let yPos = yPoint - yProportion * (heightRoi /2 - yPadding);
return [xPos, yPos]; return [xPos, yPos];
} }
@@ -1626,7 +1634,7 @@ var Crosshairs = class Crosshairs {
this.reCenter(); this.reCenter();
} }
/** /**
* addToZoomRegion * addToZoomRegion
* Either add the crosshairs actor to the given ZoomRegion, or, if it is * Either add the crosshairs actor to the given ZoomRegion, or, if it is
* already part of some other ZoomRegion, create a clone of the crosshairs * already part of some other ZoomRegion, create a clone of the crosshairs
@@ -1654,7 +1662,7 @@ var Crosshairs = class Crosshairs {
container.raise_child(magnifiedMouse, crosshairsActor); container.raise_child(magnifiedMouse, crosshairsActor);
let [xMouse, yMouse] = magnifiedMouse.get_position(); let [xMouse, yMouse] = magnifiedMouse.get_position();
let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size(); let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size();
crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2); crosshairsActor.set_position(xMouse - crosshairsWidth / 2 , yMouse - crosshairsHeight / 2);
} }
} }
return crosshairsActor; return crosshairsActor;
@@ -1770,12 +1778,13 @@ var Crosshairs = class Crosshairs {
// mouse. // mouse.
this._clipSize = size; this._clipSize = size;
this.reCenter(); this.reCenter();
} else { }
else {
// Restore the missing chunk. // Restore the missing chunk.
this._clipSize = [0, 0]; this._clipSize = [0, 0];
this.reCenter(); this.reCenter();
} }
} }
/** /**
* show: * show:
@@ -1809,7 +1818,9 @@ var Crosshairs = class Crosshairs {
reCenter(clipSize) { reCenter(clipSize) {
let [groupWidth, groupHeight] = this._actor.get_size(); let [groupWidth, groupHeight] = this._actor.get_size();
let leftLength = this._horizLeftHair.get_width(); let leftLength = this._horizLeftHair.get_width();
let rightLength = this._horizRightHair.get_width();
let topLength = this._vertTopHair.get_height(); let topLength = this._vertTopHair.get_height();
let bottomLength = this._vertBottomHair.get_height();
let thickness = this._horizLeftHair.get_height(); let thickness = this._horizLeftHair.get_height();
// Deal with clip rectangle. // Deal with clip rectangle.
@@ -1916,8 +1927,8 @@ var MagShaderEffects = class MagShaderEffects {
// a null first argument. // a null first argument.
let [bRed, bGreen, bBlue] = this._brightnessContrast.get_brightness(); let [bRed, bGreen, bBlue] = this._brightnessContrast.get_brightness();
this._brightnessContrast.set_enabled( this._brightnessContrast.set_enabled(
cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE || cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE ||
bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE
); );
} }
}; };

View File

@@ -1,5 +1,4 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported ShellMagnifier */
const Gio = imports.gi.Gio; const Gio = imports.gi.Gio;
const Main = imports.ui.main; const Main = imports.ui.main;
@@ -86,7 +85,7 @@ var ShellMagnifier = class ShellMagnifier {
let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] }; let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
let viewBox = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] }; let viewBox = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] };
let realZoomRegion = Main.magnifier.createZoomRegion(xMagFactor, yMagFactor, ROI, viewBox); let realZoomRegion = Main.magnifier.createZoomRegion(xMagFactor, yMagFactor, ROI, viewBox);
let objectPath = `${ZOOM_SERVICE_PATH}/zoomer${_zoomRegionInstanceCount}`; let objectPath = ZOOM_SERVICE_PATH + '/zoomer' + _zoomRegionInstanceCount;
_zoomRegionInstanceCount++; _zoomRegionInstanceCount++;
let zoomRegionProxy = new ShellMagnifierZoomRegion(objectPath, realZoomRegion); let zoomRegionProxy = new ShellMagnifierZoomRegion(objectPath, realZoomRegion);
@@ -107,9 +106,9 @@ var ShellMagnifier = class ShellMagnifier {
if (proxyAndZoomRegion && proxyAndZoomRegion.zoomRegion) { if (proxyAndZoomRegion && proxyAndZoomRegion.zoomRegion) {
Main.magnifier.addZoomRegion(proxyAndZoomRegion.zoomRegion); Main.magnifier.addZoomRegion(proxyAndZoomRegion.zoomRegion);
return true; return true;
} else {
return false;
} }
else
return false;
} }
/** /**
@@ -125,7 +124,7 @@ var ShellMagnifier = class ShellMagnifier {
let zoomRegions = Main.magnifier.getZoomRegions(); let zoomRegions = Main.magnifier.getZoomRegions();
let objectPaths = []; let objectPaths = [];
let thoseZoomers = this._zoomers; let thoseZoomers = this._zoomers;
zoomRegions.forEach (aZoomRegion => { zoomRegions.forEach ((aZoomRegion, index, array) => {
let found = false; let found = false;
for (let objectPath in thoseZoomers) { for (let objectPath in thoseZoomers) {
let proxyAndZoomRegion = thoseZoomers[objectPath]; let proxyAndZoomRegion = thoseZoomers[objectPath];
@@ -180,74 +179,74 @@ var ShellMagnifier = class ShellMagnifier {
* Set the crosswire size of all ZoomRegions. * Set the crosswire size of all ZoomRegions.
* @size: The thickness of each line in the cross wire. * @size: The thickness of each line in the cross wire.
*/ */
setCrosswireSize(size) { setCrosswireSize(size) {
Main.magnifier.setCrosshairsThickness(size); Main.magnifier.setCrosshairsThickness(size);
} }
/** /**
* getCrosswireSize: * getCrosswireSize:
* Get the crosswire size of all ZoomRegions. * Get the crosswire size of all ZoomRegions.
* @return: The thickness of each line in the cross wire. * @return: The thickness of each line in the cross wire.
*/ */
getCrosswireSize() { getCrosswireSize() {
return Main.magnifier.getCrosshairsThickness(); return Main.magnifier.getCrosshairsThickness();
} }
/** /**
* setCrosswireLength: * setCrosswireLength:
* Set the crosswire length of all zoom-regions.. * Set the crosswire length of all zoom-regions..
* @size: The length of each line in the cross wire. * @size: The length of each line in the cross wire.
*/ */
setCrosswireLength(length) { setCrosswireLength(length) {
Main.magnifier.setCrosshairsLength(length); Main.magnifier.setCrosshairsLength(length);
} }
/** /**
* setCrosswireSize: * setCrosswireSize:
* Set the crosswire size of all zoom-regions. * Set the crosswire size of all zoom-regions.
* @size: The thickness of each line in the cross wire. * @size: The thickness of each line in the cross wire.
*/ */
getCrosswireLength() { getCrosswireLength() {
return Main.magnifier.getCrosshairsLength(); return Main.magnifier.getCrosshairsLength();
} }
/** /**
* setCrosswireClip: * setCrosswireClip:
* Set if the crosswire will be clipped by the cursor image.. * Set if the crosswire will be clipped by the cursor image..
* @clip: Flag to indicate whether to clip the crosswire. * @clip: Flag to indicate whether to clip the crosswire.
*/ */
setCrosswireClip(clip) { setCrosswireClip(clip) {
Main.magnifier.setCrosshairsClip(clip); Main.magnifier.setCrosshairsClip(clip);
} }
/** /**
* getCrosswireClip: * getCrosswireClip:
* Get the crosswire clip value. * Get the crosswire clip value.
* @return: Whether the crosswire is clipped by the cursor image. * @return: Whether the crosswire is clipped by the cursor image.
*/ */
getCrosswireClip() { getCrosswireClip() {
return Main.magnifier.getCrosshairsClip(); return Main.magnifier.getCrosshairsClip();
} }
/** /**
* setCrosswireColor: * setCrosswireColor:
* Set the crosswire color of all ZoomRegions. * Set the crosswire color of all ZoomRegions.
* @color: Unsigned int of the form rrggbbaa. * @color: Unsigned int of the form rrggbbaa.
*/ */
setCrosswireColor(color) { setCrosswireColor(color) {
Main.magnifier.setCrosshairsColor('#%08x'.format(color)); Main.magnifier.setCrosshairsColor('#%08x'.format(color));
} }
/** /**
* getCrosswireClip: * getCrosswireClip:
* Get the crosswire color of all ZoomRegions. * Get the crosswire color of all ZoomRegions.
* @return: The crosswire color as an unsigned int in the form rrggbbaa. * @return: The crosswire color as an unsigned int in the form rrggbbaa.
*/ */
getCrosswireColor() { getCrosswireColor() {
let colorString = Main.magnifier.getCrosshairsColor(); let colorString = Main.magnifier.getCrosshairsColor();
// Drop the leading '#'. // Drop the leading '#'.
return parseInt(colorString.slice(1), 16); return parseInt(colorString.slice(1), 16);
} }
}; };
/** /**

View File

@@ -1,14 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported componentManager, notificationDaemon, windowAttentionHandler,
ctrlAltTabManager, padOsdService, osdWindowManager,
osdMonitorLabeler, shellMountOpDBusService, shellDBusService,
shellAccessDialogDBusService, shellAudioSelectionDBusService,
screenSaverDBus, screencastService, uiGroup, magnifier,
xdndHandler, keyboard, kbdA11yDialog, introspectService,
start, pushModal, popModal, activateWindow, createLookingGlass,
initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
const Mainloop = imports.mainloop;
const AccessDialog = imports.ui.accessDialog; const AccessDialog = imports.ui.accessDialog;
const AudioDeviceSelection = imports.ui.audioDeviceSelection; const AudioDeviceSelection = imports.ui.audioDeviceSelection;
@@ -53,7 +46,6 @@ const LOG_DOMAIN = 'GNOME Shell';
const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a'; const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a';
var componentManager = null; var componentManager = null;
var extensionManager = null;
var panel = null; var panel = null;
var overview = null; var overview = null;
var runDialog = null; var runDialog = null;
@@ -92,6 +84,7 @@ let _cssStylesheet = null;
let _a11ySettings = null; let _a11ySettings = null;
let _themeResource = null; let _themeResource = null;
let _oskResource = null; let _oskResource = null;
let pointerA11yTimeout = null;
function _sessionUpdated() { function _sessionUpdated() {
if (sessionMode.isPrimary) if (sessionMode.isPrimary)
@@ -147,12 +140,12 @@ function start() {
function _initializeUI() { function _initializeUI() {
// Ensure ShellWindowTracker and ShellAppUsage are initialized; this will // Ensure ShellWindowTracker and ShellAppUsage are initialized; this will
// also initialize ShellAppSystem first. ShellAppSystem // also initialize ShellAppSystem first. ShellAppSystem
// needs to load all the .desktop files, and ShellWindowTracker // needs to load all the .desktop files, and ShellWindowTracker
// will use those to associate with windows. Right now // will use those to associate with windows. Right now
// the Monitor doesn't listen for installed app changes // the Monitor doesn't listen for installed app changes
// and recalculate application associations, so to avoid // and recalculate application associations, so to avoid
// races for now we initialize it here. It's better to // races for now we initialize it here. It's better to
// be predictable anyways. // be predictable anyways.
Shell.WindowTracker.get_default(); Shell.WindowTracker.get_default();
Shell.AppUsage.get_default(); Shell.AppUsage.get_default();
@@ -164,8 +157,8 @@ function _initializeUI() {
// Setup the stage hierarchy early // Setup the stage hierarchy early
layoutManager = new Layout.LayoutManager(); layoutManager = new Layout.LayoutManager();
// Various parts of the codebase still refer to Main.uiGroup // Various parts of the codebase still refers to Main.uiGroup
// instead of using the layoutManager. This keeps that code // instead using the layoutManager. This keeps that code
// working until it's updated. // working until it's updated.
uiGroup = layoutManager.uiGroup; uiGroup = layoutManager.uiGroup;
@@ -179,7 +172,7 @@ function _initializeUI() {
kbdA11yDialog = new KbdA11yDialog.KbdA11yDialog(); kbdA11yDialog = new KbdA11yDialog.KbdA11yDialog();
wm = new WindowManager.WindowManager(); wm = new WindowManager.WindowManager();
magnifier = new Magnifier.Magnifier(); magnifier = new Magnifier.Magnifier();
locatePointer = new LocatePointer.LocatePointer(); locatePointer = new LocatePointer.locatePointer();
if (LoginManager.canLock()) if (LoginManager.canLock())
screenShield = new ScreenShield.ScreenShield(); screenShield = new ScreenShield.ScreenShield();
@@ -199,7 +192,7 @@ function _initializeUI() {
layoutManager.init(); layoutManager.init();
overview.init(); overview.init();
(new PointerA11yTimeout.PointerA11yTimeout()); pointerA11yTimeout = new PointerA11yTimeout.PointerA11yTimeout();
_a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA }); _a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA });
@@ -229,17 +222,12 @@ function _initializeUI() {
EndSessionDialog.init(); EndSessionDialog.init();
// We're ready for the session manager to move to the next phase // We're ready for the session manager to move to the next phase
GLib.idle_add(GLib.PRIORITY_DEFAULT, () => { Meta.register_with_session();
Shell.util_sd_notify();
Meta.register_with_session();
return GLib.SOURCE_REMOVE;
});
_startDate = new Date(); _startDate = new Date();
ExtensionDownloader.init(); ExtensionDownloader.init();
extensionManager = new ExtensionSystem.ExtensionManager(); ExtensionSystem.init();
extensionManager.init();
if (sessionMode.isGreeter && screenShield) { if (sessionMode.isGreeter && screenShield) {
layoutManager.connect('startup-prepared', () => { layoutManager.connect('startup-prepared', () => {
@@ -267,7 +255,7 @@ function _initializeUI() {
let perfModuleName = GLib.getenv("SHELL_PERF_MODULE"); let perfModuleName = GLib.getenv("SHELL_PERF_MODULE");
if (perfModuleName) { if (perfModuleName) {
let perfOutput = GLib.getenv("SHELL_PERF_OUTPUT"); let perfOutput = GLib.getenv("SHELL_PERF_OUTPUT");
let module = eval(`imports.perf.${perfModuleName};`); let module = eval('imports.perf.' + perfModuleName + ';');
Scripting.runPerfScript(module, perfOutput); Scripting.runPerfScript(module, perfOutput);
} }
}); });
@@ -334,7 +322,7 @@ function getThemeStylesheet() {
/** /**
* setThemeStylesheet: * setThemeStylesheet:
* @cssStylesheet: A file path that contains the theme CSS, * @cssStylesheet: A file path that contains the theme CSS,
* set it to null to use the default * set it to null to use the default
* *
* Set the theme CSS file that the shell will load * Set the theme CSS file that the shell will load
*/ */
@@ -403,9 +391,9 @@ function notify(msg, details) {
function notifyError(msg, details) { function notifyError(msg, details) {
// Also print to stderr so it's logged somewhere // Also print to stderr so it's logged somewhere
if (details) if (details)
log(`error: ${msg}: ${details}`); log('error: ' + msg + ': ' + details);
else else
log(`error: ${msg}`); log('error: ' + msg);
notify(msg, details); notify(msg, details);
} }
@@ -434,15 +422,15 @@ function _findModal(actor) {
* *
* @params may be used to provide the following parameters: * @params may be used to provide the following parameters:
* - timestamp: used to associate the call with a specific user initiated * - timestamp: used to associate the call with a specific user initiated
* event. If not provided then the value of * event. If not provided then the value of
* global.get_current_time() is assumed. * global.get_current_time() is assumed.
* *
* - options: Meta.ModalOptions flags to indicate that the pointer is * - options: Meta.ModalOptions flags to indicate that the pointer is
* already grabbed * already grabbed
* *
* - actionMode: used to set the current Shell.ActionMode to filter * - actionMode: used to set the current Shell.ActionMode to filter
* global keybindings; the default of NONE will filter * global keybindings; the default of NONE will filter
* out all keybindings * out all keybindings
* *
* Returns: true iff we successfully acquired a grab or already had one * Returns: true iff we successfully acquired a grab or already had one
*/ */
@@ -488,15 +476,15 @@ function pushModal(actor, params) {
/** /**
* popModal: * popModal:
* @actor: #ClutterActor passed to original invocation of pushModal() * @actor: #ClutterActor passed to original invocation of pushModal().
* @timestamp: optional timestamp * @timestamp: optional timestamp
* *
* Reverse the effect of pushModal(). If this invocation is undoing * Reverse the effect of pushModal(). If this invocation is undoing
* the topmost invocation, then the focus will be restored to the * the topmost invocation, then the focus will be restored to the
* previous focus at the time when pushModal() was invoked. * previous focus at the time when pushModal() was invoked.
* *
* @timestamp is optionally used to associate the call with a specific user * @timestamp is optionally used to associate the call with a specific user
* initiated event. If not provided then the value of * initiated event. If not provided then the value of
* global.get_current_time() is assumed. * global.get_current_time() is assumed.
*/ */
function popModal(actor, timestamp) { function popModal(actor, timestamp) {
@@ -623,7 +611,7 @@ function _runDeferredWork(workId) {
_deferredWorkQueue.splice(index, 1); _deferredWorkQueue.splice(index, 1);
_deferredWorkData[workId].callback(); _deferredWorkData[workId].callback();
if (_deferredWorkQueue.length == 0 && _deferredTimeoutId > 0) { if (_deferredWorkQueue.length == 0 && _deferredTimeoutId > 0) {
GLib.source_remove(_deferredTimeoutId); Mainloop.source_remove(_deferredTimeoutId);
_deferredTimeoutId = 0; _deferredTimeoutId = 0;
} }
} }
@@ -658,7 +646,7 @@ function _queueBeforeRedraw(workId) {
* *
* This function sets up a callback to be invoked when either the * This function sets up a callback to be invoked when either the
* given actor is mapped, or after some period of time when the machine * given actor is mapped, or after some period of time when the machine
* is idle. This is useful if your actor isn't always visible on the * is idle. This is useful if your actor isn't always visible on the
* screen (for example, all actors in the overview), and you don't want * screen (for example, all actors in the overview), and you don't want
* to consume resources updating if the actor isn't actually going to be * to consume resources updating if the actor isn't actually going to be
* displaying to the user. * displaying to the user.
@@ -669,13 +657,13 @@ function _queueBeforeRedraw(workId) {
* *
* Returns: A string work identifier * Returns: A string work identifier
*/ */
function initializeDeferredWork(actor, callback) { function initializeDeferredWork(actor, callback, props) {
// Turn into a string so we can use as an object property // Turn into a string so we can use as an object property
let workId = `${(++_deferredWorkSequence)}`; let workId = '' + (++_deferredWorkSequence);
_deferredWorkData[workId] = { 'actor': actor, _deferredWorkData[workId] = { 'actor': actor,
'callback': callback }; 'callback': callback };
actor.connect('notify::mapped', () => { actor.connect('notify::mapped', () => {
if (!(actor.mapped && _deferredWorkQueue.includes(workId))) if (!(actor.mapped && _deferredWorkQueue.indexOf(workId) >= 0))
return; return;
_queueBeforeRedraw(workId); _queueBeforeRedraw(workId);
}); });
@@ -694,7 +682,7 @@ function initializeDeferredWork(actor, callback) {
* @workId: work identifier * @workId: work identifier
* *
* Ensure that the work identified by @workId will be * Ensure that the work identified by @workId will be
* run on map or timeout. You should call this function * run on map or timeout. You should call this function
* for example when data being displayed by the actor has * for example when data being displayed by the actor has
* changed. * changed.
*/ */
@@ -705,12 +693,13 @@ function queueDeferredWork(workId) {
logError(new Error(message), message); logError(new Error(message), message);
return; return;
} }
if (!_deferredWorkQueue.includes(workId)) if (_deferredWorkQueue.indexOf(workId) < 0)
_deferredWorkQueue.push(workId); _deferredWorkQueue.push(workId);
if (data.actor.mapped) { if (data.actor.mapped) {
_queueBeforeRedraw(workId); _queueBeforeRedraw(workId);
return;
} else if (_deferredTimeoutId == 0) { } else if (_deferredTimeoutId == 0) {
_deferredTimeoutId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, DEFERRED_TIMEOUT_SECONDS, () => { _deferredTimeoutId = Mainloop.timeout_add_seconds(DEFERRED_TIMEOUT_SECONDS, () => {
_runAllDeferredWork(); _runAllDeferredWork();
_deferredTimeoutId = 0; _deferredTimeoutId = 0;
return GLib.SOURCE_REMOVE; return GLib.SOURCE_REMOVE;

View File

@@ -4,9 +4,10 @@ const MessageTray = imports.ui.messageTray;
const Signals = imports.signals; const Signals = imports.signals;
const Calendar = imports.ui.calendar; const Calendar = imports.ui.calendar;
const Tweener = imports.ui.tweener;
const Util = imports.misc.util; const Util = imports.misc.util;
var MESSAGE_ANIMATION_TIME = 100; var MESSAGE_ANIMATION_TIME = 0.1;
var DEFAULT_EXPAND_LINES = 6; var DEFAULT_EXPAND_LINES = 6;
@@ -32,7 +33,9 @@ function _fixMarkup(text, allowMarkup) {
} }
var URLHighlighter = class URLHighlighter { var URLHighlighter = class URLHighlighter {
constructor(text = '', lineWrap, allowMarkup) { constructor(text, lineWrap, allowMarkup) {
if (!text)
text = '';
this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter', this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter',
x_expand: true, x_align: Clutter.ActorAlign.START }); x_expand: true, x_align: Clutter.ActorAlign.START });
this._linkColor = '#ccccff'; this._linkColor = '#ccccff';
@@ -69,7 +72,7 @@ var URLHighlighter = class URLHighlighter {
let urlId = this._findUrlAtPos(event); let urlId = this._findUrlAtPos(event);
if (urlId != -1) { if (urlId != -1) {
let url = this._urls[urlId].url; let url = this._urls[urlId].url;
if (!url.includes(':')) if (url.indexOf(':') == -1)
url = 'http://' + url; url = 'http://' + url;
Gio.app_info_launch_default_for_uri(url, global.create_app_launch_context(0, -1)); Gio.app_info_launch_default_for_uri(url, global.create_app_launch_context(0, -1));
@@ -129,21 +132,21 @@ var URLHighlighter = class URLHighlighter {
} }
_findUrlAtPos(event) { _findUrlAtPos(event) {
let success_; let success;
let [x, y] = event.get_coords(); let [x, y] = event.get_coords();
[success_, x, y] = this.actor.transform_stage_point(x, y); [success, x, y] = this.actor.transform_stage_point(x, y);
let findPos = -1; let find_pos = -1;
for (let i = 0; i < this.actor.clutter_text.text.length; i++) { for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
let [success_, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i); let [success, px, py, line_height] = this.actor.clutter_text.position_to_coords(i);
if (py > y || py + lineHeight < y || x < px) if (py > y || py + line_height < y || x < px)
continue; continue;
findPos = i; find_pos = i;
} }
if (findPos != -1) { if (find_pos != -1) {
for (let i = 0; i < this._urls.length; i++) for (let i = 0; i < this._urls.length; i++)
if (findPos >= this._urls[i].pos && if (find_pos >= this._urls[i].pos &&
this._urls[i].pos + this._urls[i].url.length > findPos) this._urls[i].pos + this._urls[i].url.length > find_pos)
return i; return i;
} }
return -1; return -1;
} }
@@ -194,14 +197,12 @@ class ScaleLayout extends Clutter.BinLayout {
}); });
var LabelExpanderLayout = GObject.registerClass({ var LabelExpanderLayout = GObject.registerClass({
Properties: { Properties: { 'expansion': GObject.ParamSpec.double('expansion',
'expansion': GObject.ParamSpec.double('expansion', 'Expansion',
'Expansion', 'Expansion of the layout, between 0 (collapsed) ' +
'Expansion of the layout, between 0 (collapsed) ' + 'and 1 (fully expanded',
'and 1 (fully expanded', GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE, 0, 1, 0)},
0, 1, 0)
},
}, class LabelExpanderLayout extends Clutter.LayoutManager { }, class LabelExpanderLayout extends Clutter.LayoutManager {
_init(params) { _init(params) {
this._expansion = 0; this._expansion = 0;
@@ -333,10 +334,7 @@ var Message = class Message {
let closeIcon = new St.Icon({ icon_name: 'window-close-symbolic', let closeIcon = new St.Icon({ icon_name: 'window-close-symbolic',
icon_size: 16 }); icon_size: 16 });
this._closeButton = new St.Button({ this._closeButton = new St.Button({ child: closeIcon, opacity: 0 });
style_class: 'message-close-button',
child: closeIcon, opacity: 0,
});
titleBox.add_actor(this._closeButton); titleBox.add_actor(this._closeButton);
this._bodyStack = new St.Widget({ x_expand: true }); this._bodyStack = new St.Widget({ x_expand: true });
@@ -442,17 +440,15 @@ var Message = class Message {
} }
if (animate) { if (animate) {
this._bodyStack.ease_property('@layout.expansion', 1, { Tweener.addTween(this._bodyStack.layout_manager,
progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD, { expansion: 1,
duration: MessageTray.ANIMATION_TIME, time: MessageTray.ANIMATION_TIME,
}); transition: 'easeOutQuad' });
this._actionBin.scale_y = 0; this._actionBin.scale_y = 0;
this._actionBin.ease({ Tweener.addTween(this._actionBin,
scale_y: 1, { scale_y: 1,
duration: MessageTray.ANIMATION_TIME, time: MessageTray.ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD transition: 'easeOutQuad' });
});
} else { } else {
this._bodyStack.layout_manager.expansion = 1; this._bodyStack.layout_manager.expansion = 1;
this._actionBin.scale_y = 1; this._actionBin.scale_y = 1;
@@ -463,20 +459,19 @@ var Message = class Message {
unexpand(animate) { unexpand(animate) {
if (animate) { if (animate) {
this._bodyStack.ease_property('@layout.expansion', 0, { Tweener.addTween(this._bodyStack.layout_manager,
progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD, { expansion: 0,
duration: MessageTray.ANIMATION_TIME, time: MessageTray.ANIMATION_TIME,
}); transition: 'easeOutQuad' });
Tweener.addTween(this._actionBin,
this._actionBin.ease({ { scale_y: 0,
scale_y: 0, time: MessageTray.ANIMATION_TIME,
duration: MessageTray.ANIMATION_TIME, transition: 'easeOutQuad',
mode: Clutter.AnimationMode.EASE_OUT_QUAD, onCompleteScope: this,
onComplete: () => { onComplete() {
this._actionBin.hide(); this._actionBin.hide();
this.expanded = false; this.expanded = false;
} }});
});
} else { } else {
this._bodyStack.layout_manager.expansion = 0; this._bodyStack.layout_manager.expansion = 0;
this._actionBin.scale_y = 0; this._actionBin.scale_y = 0;
@@ -587,12 +582,10 @@ var MessageListSection = class MessageListSection {
this._list.insert_child_at_index(obj.container, index); this._list.insert_child_at_index(obj.container, index);
if (animate) if (animate)
obj.container.ease({ Tweener.addTween(obj.container, { scale_x: 1,
scale_x: 1, scale_y: 1,
scale_y: 1, time: MESSAGE_ANIMATION_TIME,
duration: MESSAGE_ANIMATION_TIME, transition: 'easeOutQuad' });
mode: Clutter.AnimationMode.EASE_OUT_QUAD
});
} }
moveMessage(message, index, animate) { moveMessage(message, index, animate) {
@@ -605,20 +598,16 @@ var MessageListSection = class MessageListSection {
let onComplete = () => { let onComplete = () => {
this._list.set_child_at_index(obj.container, index); this._list.set_child_at_index(obj.container, index);
obj.container.ease({ Tweener.addTween(obj.container, { scale_x: 1,
scale_x: 1, scale_y: 1,
scale_y: 1, time: MESSAGE_ANIMATION_TIME,
duration: MESSAGE_ANIMATION_TIME, transition: 'easeOutQuad' });
mode: Clutter.AnimationMode.EASE_OUT_QUAD
});
}; };
obj.container.ease({ Tweener.addTween(obj.container, { scale_x: 0,
scale_x: 0, scale_y: 0,
scale_y: 0, time: MESSAGE_ANIMATION_TIME,
duration: MESSAGE_ANIMATION_TIME, transition: 'easeOutQuad',
mode: Clutter.AnimationMode.EASE_OUT_QUAD, onComplete: onComplete });
onComplete
});
} }
removeMessage(message, animate) { removeMessage(message, animate) {
@@ -631,16 +620,13 @@ var MessageListSection = class MessageListSection {
this._messages.delete(message); this._messages.delete(message);
if (animate) { if (animate) {
obj.container.ease({ Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0,
scale_x: 0, time: MESSAGE_ANIMATION_TIME,
scale_y: 0, transition: 'easeOutQuad',
duration: MESSAGE_ANIMATION_TIME, onComplete() {
mode: Clutter.AnimationMode.EASE_OUT_QUAD, obj.container.destroy();
onComplete: () => { global.sync_pointer();
obj.container.destroy(); }});
global.sync_pointer();
}
});
} else { } else {
obj.container.destroy(); obj.container.destroy();
global.sync_pointer(); global.sync_pointer();
@@ -662,14 +648,15 @@ var MessageListSection = class MessageListSection {
for (let i = 0; i < messages.length; i++) { for (let i = 0; i < messages.length; i++) {
let message = messages[i]; let message = messages[i];
let obj = this._messages.get(message); let obj = this._messages.get(message);
obj.container.ease({ Tweener.addTween(obj.container,
anchor_x: this._list.width, { anchor_x: this._list.width,
opacity: 0, opacity: 0,
duration: MESSAGE_ANIMATION_TIME, time: MESSAGE_ANIMATION_TIME,
delay: i * delay, delay: i * delay,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => message.close() onComplete() {
}); message.close();
}});
} }
} }
} }

View File

@@ -1,9 +1,7 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported NotificationPolicy, NotificationGenericPolicy,
NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel,
SystemNotificationSource, MessageTray */
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
const Mainloop = imports.mainloop;
const Signals = imports.signals; const Signals = imports.signals;
const Calendar = imports.ui.calendar; const Calendar = imports.ui.calendar;
@@ -11,14 +9,15 @@ const GnomeSession = imports.misc.gnomeSession;
const Layout = imports.ui.layout; const Layout = imports.ui.layout;
const Main = imports.ui.main; const Main = imports.ui.main;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings'; const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings';
var ANIMATION_TIME = 200; var ANIMATION_TIME = 0.2;
var NOTIFICATION_TIMEOUT = 4000; var NOTIFICATION_TIMEOUT = 4;
var HIDE_TIMEOUT = 200; var HIDE_TIMEOUT = 0.2;
var LONGER_HIDE_TIMEOUT = 600; var LONGER_HIDE_TIMEOUT = 0.6;
var MAX_NOTIFICATIONS_IN_QUEUE = 3; var MAX_NOTIFICATIONS_IN_QUEUE = 3;
var MAX_NOTIFICATIONS_PER_SOURCE = 3; var MAX_NOTIFICATIONS_PER_SOURCE = 3;
@@ -136,14 +135,13 @@ var FocusGrabber = class FocusGrabber {
// A notification without a policy object will inherit the default one. // A notification without a policy object will inherit the default one.
var NotificationPolicy = class NotificationPolicy { var NotificationPolicy = class NotificationPolicy {
constructor(params) { constructor(params) {
params = Params.parse(params, { params = Params.parse(params, { enable: true,
enable: true, enableSound: true,
enableSound: true, showBanners: true,
showBanners: true, forceExpanded: false,
forceExpanded: false, showInLockScreen: true,
showInLockScreen: true, detailsInLockScreen: false
detailsInLockScreen: false, });
});
Object.getOwnPropertyNames(params).forEach(key => { Object.getOwnPropertyNames(params).forEach(key => {
let desc = Object.getOwnPropertyDescriptor(params, key); let desc = Object.getOwnPropertyDescriptor(params, key);
Object.defineProperty(this, `_${key}`, desc); Object.defineProperty(this, `_${key}`, desc);
@@ -153,7 +151,6 @@ var NotificationPolicy = class NotificationPolicy {
// Do nothing for the default policy. These methods are only useful for the // Do nothing for the default policy. These methods are only useful for the
// GSettings policy. // GSettings policy.
store() { } store() { }
destroy() { } destroy() { }
get enable() { get enable() {
@@ -221,17 +218,17 @@ class NotificationApplicationPolicy extends NotificationPolicy {
this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' }); this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' });
this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications.application', this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications.application',
path: `/org/gnome/desktop/notifications/application/${this._canonicalId}/` }); path: '/org/gnome/desktop/notifications/application/' + this._canonicalId + '/' });
this._masterSettings.connect('changed', this._changed.bind(this)); this._masterSettings.connect('changed', this._changed.bind(this));
this._settings.connect('changed', this._changed.bind(this)); this._settings.connect('changed', this._changed.bind(this));
} }
store() { store() {
this._settings.set_string('application-id', `${this.id}.desktop`); this._settings.set_string('application-id', this.id + '.desktop');
let apps = this._masterSettings.get_strv('application-children'); let apps = this._masterSettings.get_strv('application-children');
if (!apps.includes(this._canonicalId)) { if (apps.indexOf(this._canonicalId) < 0) {
apps.push(this._canonicalId); apps.push(this._canonicalId);
this._masterSettings.set_strv('application-children', apps); this._masterSettings.set_strv('application-children', apps);
} }
@@ -251,7 +248,7 @@ class NotificationApplicationPolicy extends NotificationPolicy {
_canonicalizeId(id) { _canonicalizeId(id) {
// Keys are restricted to lowercase alphanumeric characters and dash, // Keys are restricted to lowercase alphanumeric characters and dash,
// and two dashes cannot be in succession // and two dashes cannot be in succession
return id.toLowerCase().replace(/[^a-z0-9-]/g, '-').replace(/--+/g, '-'); return id.toLowerCase().replace(/[^a-z0-9\-]/g, '-').replace(/--+/g, '-');
} }
get enable() { get enable() {
@@ -476,7 +473,9 @@ var Notification = class Notification {
this.destroy(); this.destroy();
} }
destroy(reason = NotificationDestroyedReason.DISMISSED) { destroy(reason) {
if (!reason)
reason = NotificationDestroyedReason.DISMISSED;
this.emit('destroy', reason); this.emit('destroy', reason);
} }
}; };
@@ -591,11 +590,11 @@ class SourceActor extends St.Widget {
}); });
this._actorDestroyed = false; this._actorDestroyed = false;
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor; let scale_factor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
this._iconBin = new St.Bin({ x_fill: true, this._iconBin = new St.Bin({ x_fill: true,
x_expand: true, x_expand: true,
height: size * scaleFactor, height: size * scale_factor,
width: size * scaleFactor }); width: size * scale_factor });
this.add_actor(this._iconBin); this.add_actor(this._iconBin);
@@ -653,7 +652,7 @@ class SourceActorWithLabel extends SourceActor {
let childBox = new Clutter.ActorBox(); let childBox = new Clutter.ActorBox();
let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size(); let [minWidth, minHeight, naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
let direction = this.get_text_direction(); let direction = this.get_text_direction();
if (direction == Clutter.TextDirection.LTR) { if (direction == Clutter.TextDirection.LTR) {
@@ -735,9 +734,8 @@ var Source = class Source {
} }
get narrowestPrivacyScope() { get narrowestPrivacyScope() {
return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) ? PrivacyScope.SYSTEM
? PrivacyScope.SYSTEM : PrivacyScope.USER;
: PrivacyScope.USER;
} }
setTitle(newTitle) { setTitle(newTitle) {
@@ -774,7 +772,7 @@ var Source = class Source {
} }
pushNotification(notification) { pushNotification(notification) {
if (this.notifications.includes(notification)) if (this.notifications.indexOf(notification) >= 0)
return; return;
while (this.notifications.length >= MAX_NOTIFICATIONS_PER_SOURCE) while (this.notifications.length >= MAX_NOTIFICATIONS_PER_SOURCE)
@@ -831,7 +829,7 @@ Signals.addSignalMethods(Source.prototype);
var MessageTray = class MessageTray { var MessageTray = class MessageTray {
constructor() { constructor() {
this._presence = new GnomeSession.Presence((proxy, _error) => { this._presence = new GnomeSession.Presence((proxy, error) => {
this._onStatusChanged(proxy.status); this._onStatusChanged(proxy.status);
}); });
this._busy = false; this._busy = false;
@@ -990,7 +988,7 @@ var MessageTray = class MessageTray {
add(source) { add(source) {
if (this.contains(source)) { if (this.contains(source)) {
log(`Trying to re-add source ${source.title}`); log('Trying to re-add source ' + source.title);
return; return;
} }
@@ -1006,6 +1004,7 @@ var MessageTray = class MessageTray {
_addSource(source) { _addSource(source) {
let obj = { let obj = {
source: source,
notifyId: 0, notifyId: 0,
destroyId: 0, destroyId: 0,
}; };
@@ -1070,7 +1069,7 @@ var MessageTray = class MessageTray {
// If a new notification is updated while it is being hidden, // If a new notification is updated while it is being hidden,
// we stop hiding it and show it again. // we stop hiding it and show it again.
this._updateShowingNotification(); this._updateShowingNotification();
} else if (!this._notificationQueue.includes(notification)) { } else if (this._notificationQueue.indexOf(notification) < 0) {
// If the queue is "full", we skip banner mode and just show a small // If the queue is "full", we skip banner mode and just show a small
// indicator in the panel; however do make an exception for CRITICAL // indicator in the panel; however do make an exception for CRITICAL
// notifications, as only banner mode allows expansion. // notifications, as only banner mode allows expansion.
@@ -1092,7 +1091,7 @@ var MessageTray = class MessageTray {
_resetNotificationLeftTimeout() { _resetNotificationLeftTimeout() {
this._useLongerNotificationLeftTimeout = false; this._useLongerNotificationLeftTimeout = false;
if (this._notificationLeftTimeoutId) { if (this._notificationLeftTimeoutId) {
GLib.source_remove(this._notificationLeftTimeoutId); Mainloop.source_remove(this._notificationLeftTimeoutId);
this._notificationLeftTimeoutId = 0; this._notificationLeftTimeoutId = 0;
this._notificationLeftMouseX = -1; this._notificationLeftMouseX = -1;
this._notificationLeftMouseY = -1; this._notificationLeftMouseY = -1;
@@ -1130,15 +1129,15 @@ var MessageTray = class MessageTray {
// this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us // this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us
// to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still // to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still
// close to its previous position, we extend the timeout once. // close to its previous position, we extend the timeout once.
let [x, y] = global.get_pointer(); let [x, y, mods] = global.get_pointer();
this._notificationLeftMouseX = x; this._notificationLeftMouseX = x;
this._notificationLeftMouseY = y; this._notificationLeftMouseY = y;
// We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it. // We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it.
// We wait for a longer period if the notification popped up where the mouse pointer was already positioned. // We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
// That gives the user more time to mouse away from the notification and mouse back in in order to expand it. // That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT; let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000;
this._notificationLeftTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, this._onNotificationLeftTimeout.bind(this)); this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout'); GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
} }
} }
@@ -1159,7 +1158,7 @@ var MessageTray = class MessageTray {
} }
_onNotificationLeftTimeout() { _onNotificationLeftTimeout() {
let [x, y] = global.get_pointer(); let [x, y, mods] = global.get_pointer();
// We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side. // We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side.
if (this._notificationLeftMouseX > -1 && if (this._notificationLeftMouseX > -1 &&
y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD && y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD &&
@@ -1167,10 +1166,8 @@ var MessageTray = class MessageTray {
x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD && x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) { x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
this._notificationLeftMouseX = -1; this._notificationLeftMouseX = -1;
this._notificationLeftTimeoutId = GLib.timeout_add( this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000,
GLib.PRIORITY_DEFAULT, this._onNotificationLeftTimeout.bind(this));
LONGER_HIDE_TIMEOUT,
this._onNotificationLeftTimeout.bind(this));
GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout'); GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
} else { } else {
this._notificationLeftTimeoutId = 0; this._notificationLeftTimeoutId = 0;
@@ -1251,6 +1248,34 @@ var MessageTray = class MessageTray {
this._notificationExpired = false; this._notificationExpired = false;
} }
_tween(actor, statevar, value, params) {
let onComplete = params.onComplete;
let onCompleteScope = params.onCompleteScope;
let onCompleteParams = params.onCompleteParams;
params.onComplete = this._tweenComplete;
params.onCompleteScope = this;
params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams];
// Remove other tweens that could mess with the state machine
Tweener.removeTweens(actor);
Tweener.addTween(actor, params);
let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING;
this[statevar] = valuing;
}
_tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) {
this[statevar] = value;
if (onComplete)
onComplete.apply(onCompleteScope, onCompleteParams);
this._updateState();
}
_clampOpacity() {
this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255));
}
_onIdleMonitorBecameActive() { _onIdleMonitorBecameActive() {
this._userActiveWhileNotificationShown = true; this._userActiveWhileNotificationShown = true;
this._updateNotificationTimeout(2000); this._updateNotificationTimeout(2000);
@@ -1277,6 +1302,7 @@ var MessageTray = class MessageTray {
this._bannerBin.add_actor(this._banner.actor); this._bannerBin.add_actor(this._banner.actor);
this._bannerBin._opacity = 0;
this._bannerBin.opacity = 0; this._bannerBin.opacity = 0;
this._bannerBin.y = -this._banner.actor.height; this._bannerBin.y = -this._banner.actor.height;
this.actor.show(); this.actor.show();
@@ -1284,7 +1310,7 @@ var MessageTray = class MessageTray {
Meta.disable_unredirect_for_display(global.display); Meta.disable_unredirect_for_display(global.display);
this._updateShowingNotification(); this._updateShowingNotification();
let [x, y] = global.get_pointer(); let [x, y, mods] = global.get_pointer();
// We save the position of the mouse at the time when we started showing the notification // We save the position of the mouse at the time when we started showing the notification
// in order to determine if the notification popped up under it. We make that check if // in order to determine if the notification popped up under it. We make that check if
// the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't // the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't
@@ -1322,45 +1348,39 @@ var MessageTray = class MessageTray {
// We use this._showNotificationCompleted() onComplete callback to extend the time the updated // We use this._showNotificationCompleted() onComplete callback to extend the time the updated
// notification is being shown. // notification is being shown.
this._notificationState = State.SHOWING; let tweenParams = { y: 0,
this._bannerBin.remove_all_transitions(); _opacity: 255,
this._bannerBin.ease({ time: ANIMATION_TIME,
opacity: 255, transition: 'easeOutBack',
duration: ANIMATION_TIME, onUpdate: this._clampOpacity,
mode: Clutter.AnimationMode.LINEAR onUpdateScope: this,
}); onComplete: this._showNotificationCompleted,
this._bannerBin.ease({ onCompleteScope: this
y: 0, };
duration: ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_BACK, this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams);
onComplete: () => {
this._notificationState = State.SHOWN;
this._showNotificationCompleted();
this._updateState();
}
});
} }
_showNotificationCompleted() { _showNotificationCompleted() {
if (this._notification.urgency != Urgency.CRITICAL) if (this._notification.urgency != Urgency.CRITICAL)
this._updateNotificationTimeout(NOTIFICATION_TIMEOUT); this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000);
} }
_updateNotificationTimeout(timeout) { _updateNotificationTimeout(timeout) {
if (this._notificationTimeoutId) { if (this._notificationTimeoutId) {
GLib.source_remove(this._notificationTimeoutId); Mainloop.source_remove(this._notificationTimeoutId);
this._notificationTimeoutId = 0; this._notificationTimeoutId = 0;
} }
if (timeout > 0) { if (timeout > 0) {
this._notificationTimeoutId = this._notificationTimeoutId =
GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, Mainloop.timeout_add(timeout,
this._notificationTimeout.bind(this)); this._notificationTimeout.bind(this));
GLib.Source.set_name_by_id(this._notificationTimeoutId, '[gnome-shell] this._notificationTimeout'); GLib.Source.set_name_by_id(this._notificationTimeoutId, '[gnome-shell] this._notificationTimeout');
} }
} }
_notificationTimeout() { _notificationTimeout() {
let [x, y] = global.get_pointer(); let [x, y, mods] = global.get_pointer();
if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) { if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) {
// The mouse is moving towards the notification, so don't // The mouse is moving towards the notification, so don't
// hide it yet. (We just create a new timeout (and destroy // hide it yet. (We just create a new timeout (and destroy
@@ -1396,26 +1416,20 @@ var MessageTray = class MessageTray {
} }
this._resetNotificationLeftTimeout(); this._resetNotificationLeftTimeout();
this._bannerBin.remove_all_transitions();
if (animate) { if (animate) {
this._notificationState = State.HIDING; this._tween(this._bannerBin, '_notificationState', State.HIDDEN,
this._bannerBin.ease({ { y: -this._bannerBin.height,
opacity: 0, _opacity: 0,
duration: ANIMATION_TIME, time: ANIMATION_TIME,
mode: Clutter.AnimationMode.EASE_OUT_BACK transition: 'easeOutBack',
}); onUpdate: this._clampOpacity,
this._bannerBin.ease({ onUpdateScope: this,
y: -this._bannerBin.height, onComplete: this._hideNotificationCompleted,
duration: ANIMATION_TIME, onCompleteScope: this
mode: Clutter.AnimationMode.EASE_OUT_BACK, });
onComplete: () => {
this._notificationState = State.HIDDEN;
this._hideNotificationCompleted();
this._updateState();
}
});
} else { } else {
Tweener.removeTweens(this._bannerBin);
this._bannerBin.y = -this._bannerBin.height; this._bannerBin.y = -this._bannerBin.height;
this._bannerBin.opacity = 0; this._bannerBin.opacity = 0;
this._notificationState = State.HIDDEN; this._notificationState = State.HIDDEN;

View File

@@ -1,16 +1,17 @@
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*- // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
/* exported ModalDialog */
const { Atk, Clutter, GObject, Shell, St } = imports.gi; const { Atk, Clutter, GObject, Shell, St } = imports.gi;
const Signals = imports.signals;
const Dialog = imports.ui.dialog; const Dialog = imports.ui.dialog;
const Layout = imports.ui.layout; const Layout = imports.ui.layout;
const Lightbox = imports.ui.lightbox; const Lightbox = imports.ui.lightbox;
const Main = imports.ui.main; const Main = imports.ui.main;
const Params = imports.misc.params; const Params = imports.misc.params;
const Tweener = imports.ui.tweener;
var OPEN_AND_CLOSE_TIME = 100; var OPEN_AND_CLOSE_TIME = 0.1;
var FADE_OUT_DIALOG_TIME = 1000; var FADE_OUT_DIALOG_TIME = 1.0;
var State = { var State = {
OPENED: 0, OPENED: 0,
@@ -21,13 +22,11 @@ var State = {
}; };
var ModalDialog = GObject.registerClass({ var ModalDialog = GObject.registerClass({
Properties: { Properties: { 'state': GObject.ParamSpec.int('state', 'Dialog state', 'state',
'state': GObject.ParamSpec.int('state', 'Dialog state', 'state', GObject.ParamFlags.READABLE,
GObject.ParamFlags.READABLE, Math.min(...Object.values(State)),
Math.min(...Object.values(State)), Math.max(...Object.values(State)),
Math.max(...Object.values(State)), State.CLOSED) },
State.CLOSED)
},
Signals: { 'opened': {}, 'closed': {} } Signals: { 'opened': {}, 'closed': {} }
}, class ModalDialog extends St.Widget { }, class ModalDialog extends St.Widget {
_init(params) { _init(params) {
@@ -124,15 +123,15 @@ var ModalDialog = GObject.registerClass({
this._lightbox.show(); this._lightbox.show();
this.opacity = 0; this.opacity = 0;
this.show(); this.show();
this.ease({ Tweener.addTween(this,
opacity: 255, { opacity: 255,
duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0, time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => { onComplete: () => {
this._setState(State.OPENED); this._setState(State.OPENED);
this.emit('opened'); this.emit('opened');
} }
}); });
} }
setInitialKeyFocus(actor) { setInitialKeyFocus(actor) {
@@ -175,16 +174,15 @@ var ModalDialog = GObject.registerClass({
this.popModal(timestamp); this.popModal(timestamp);
this._savedKeyFocus = null; this._savedKeyFocus = null;
if (this._shouldFadeOut) { if (this._shouldFadeOut)
this.ease({ Tweener.addTween(this,
opacity: 0, { opacity: 0,
duration: OPEN_AND_CLOSE_TIME, time: OPEN_AND_CLOSE_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => this._closeComplete() onComplete: this._closeComplete.bind(this)
}); })
} else { else
this._closeComplete(); this._closeComplete();
}
} }
// Drop modal status without closing the dialog; this makes the // Drop modal status without closing the dialog; this makes the
@@ -216,8 +214,6 @@ var ModalDialog = GObject.registerClass({
if (!Main.pushModal(this, params)) if (!Main.pushModal(this, params))
return false; return false;
Main.layoutManager.emit('system-modal-opened');
this._hasModal = true; this._hasModal = true;
if (this._savedKeyFocus) { if (this._savedKeyFocus) {
this._savedKeyFocus.grab_key_focus(); this._savedKeyFocus.grab_key_focus();
@@ -251,11 +247,13 @@ var ModalDialog = GObject.registerClass({
return; return;
this.popModal(timestamp); this.popModal(timestamp);
this.dialogLayout.ease({ Tweener.addTween(this.dialogLayout,
opacity: 0, { opacity: 0,
duration: FADE_OUT_DIALOG_TIME, time: FADE_OUT_DIALOG_TIME,
mode: Clutter.AnimationMode.EASE_OUT_QUAD, transition: 'easeOutQuad',
onComplete: () => (this.state = State.FADED_OUT) onComplete: () => {
}); this._setState(State.FADED_OUT);
}
});
} }
}); });

Some files were not shown because too many files have changed in this diff Show More