Compare commits
632 Commits
wip/jimmac
...
wip/hadess
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
752b1df659 | ||
|
|
366b06716d | ||
|
|
4d47b16d33 | ||
|
|
6526e9edf6 | ||
|
|
055c007ac2 | ||
|
|
43cf466d09 | ||
|
|
6965781d59 | ||
|
|
80680803aa | ||
|
|
51601f3ead | ||
|
|
b25a73c243 | ||
|
|
d0690c3952 | ||
|
|
f2466caef3 | ||
|
|
b1d22d2058 | ||
|
|
6f7e5976e2 | ||
|
|
29543f369f | ||
|
|
a144a1c76d | ||
|
|
d91927674d | ||
|
|
d12cd12e1b | ||
|
|
caa50dc1a3 | ||
|
|
55b57421dc | ||
|
|
320df13b65 | ||
|
|
e4920b2f80 | ||
|
|
c9fbae3408 | ||
|
|
a3c6217875 | ||
|
|
db7726c5bf | ||
|
|
0b91dee5a9 | ||
|
|
3838220961 | ||
|
|
9bb12f6f87 | ||
|
|
4dea1f801a | ||
|
|
91a5133116 | ||
|
|
c4c5c4fd5c | ||
|
|
f67b409fc1 | ||
|
|
22fe4e92c7 | ||
|
|
91eb84fa4e | ||
|
|
4e1492c926 | ||
|
|
ed97f61750 | ||
|
|
b5676a2a5c | ||
|
|
7059dcced3 | ||
|
|
c7e0c7eb79 | ||
|
|
ff775213a5 | ||
|
|
7f9c709c85 | ||
|
|
74d7d3e259 | ||
|
|
0353a5bf2c | ||
|
|
ab6a629955 | ||
|
|
6cad251187 | ||
|
|
d7c569c692 | ||
|
|
0615370930 | ||
|
|
7a92a9ba21 | ||
|
|
0199857c5b | ||
|
|
59e3a1a816 | ||
|
|
6533690fff | ||
|
|
d0d1845bb6 | ||
|
|
20f4fc7c87 | ||
|
|
b4128967a1 | ||
|
|
38ad1d7c13 | ||
|
|
f78136182f | ||
|
|
11d46cf5b3 | ||
|
|
7326e7a9fa | ||
|
|
a65164e540 | ||
|
|
279024afc2 | ||
|
|
ef8000d2e6 | ||
|
|
986600ab31 | ||
|
|
3d39b32a0b | ||
|
|
6205d5eb27 | ||
|
|
a722b4c51d | ||
|
|
31fe517007 | ||
|
|
31d915a38a | ||
|
|
e00878ab75 | ||
|
|
3b5675b79a | ||
|
|
ee97512bcc | ||
|
|
085531b43d | ||
|
|
9e8b97d474 | ||
|
|
a3a7953704 | ||
|
|
92c0171aeb | ||
|
|
6a6d66486d | ||
|
|
1cc766d636 | ||
|
|
60cad01880 | ||
|
|
63c9a6efd0 | ||
|
|
1d1b42756f | ||
|
|
a95601afdb | ||
|
|
2dbdf792db | ||
|
|
e23ce37e62 | ||
|
|
a05cb76e0d | ||
|
|
60cab56f86 | ||
|
|
70a5c3875c | ||
|
|
0fdbde9101 | ||
|
|
2156577333 | ||
|
|
f3e09b2b2f | ||
|
|
6180f59c13 | ||
|
|
506b75fc7f | ||
|
|
a0d0a17d68 | ||
|
|
92e5713e29 | ||
|
|
856c32db91 | ||
|
|
7b45ffa511 | ||
|
|
b6754d7db7 | ||
|
|
2a9977a5b3 | ||
|
|
dab60d5580 | ||
|
|
8e3aac8ed7 | ||
|
|
147cb53140 | ||
|
|
54f369404a | ||
|
|
af1aabff75 | ||
|
|
d6ba6dc554 | ||
|
|
42188b7698 | ||
|
|
48adb2ef4b | ||
|
|
f8e648b7e3 | ||
|
|
daa5452af2 | ||
|
|
259874d731 | ||
|
|
23344701de | ||
|
|
00e95de114 | ||
|
|
942758bb30 | ||
|
|
e0947b01bd | ||
|
|
cf00231aa8 | ||
|
|
5c3f4f5f8b | ||
|
|
5f10047b58 | ||
|
|
3094f86334 | ||
|
|
8ffea9d5c5 | ||
|
|
4f3c8b8d69 | ||
|
|
edf6bd6909 | ||
|
|
3e58af10ca | ||
|
|
9e55d262f9 | ||
|
|
252e694979 | ||
|
|
efed695eca | ||
|
|
b446667df6 | ||
|
|
133a1e7bef | ||
|
|
5b3935fa43 | ||
|
|
471165ca9b | ||
|
|
111f87a1b2 | ||
|
|
93525539c2 | ||
|
|
a77377efe7 | ||
|
|
81ab2865f7 | ||
|
|
e585f7d97b | ||
|
|
1a32e3e74a | ||
|
|
8d6820c4df | ||
|
|
2546445884 | ||
|
|
e44b7df078 | ||
|
|
3a9eaa39ea | ||
|
|
af87bd8c87 | ||
|
|
4bfb4a0e3d | ||
|
|
d1a6601e60 | ||
|
|
817aec5466 | ||
|
|
314a89a837 | ||
|
|
57ed68541a | ||
|
|
413c677fcf | ||
|
|
3d86e6e791 | ||
|
|
3fbd61cbf0 | ||
|
|
43b4f2c7d5 | ||
|
|
7eb4088f45 | ||
|
|
f00201fa6c | ||
|
|
1aca2ba6bb | ||
|
|
e9131465dd | ||
|
|
0ee7f02f8e | ||
|
|
451f4e3636 | ||
|
|
2fc4987c73 | ||
|
|
4525ad346d | ||
|
|
e4b8a4b432 | ||
|
|
62e594af6d | ||
|
|
ce92270626 | ||
|
|
bdcf3037ca | ||
|
|
9698ff491a | ||
|
|
2a9e065cfb | ||
|
|
4c93ef39fa | ||
|
|
22107c183b | ||
|
|
c06eb5d0a7 | ||
|
|
e76877c4b8 | ||
|
|
2a32fb2e72 | ||
|
|
de86920e0e | ||
|
|
8754736fda | ||
|
|
d2ead59d74 | ||
|
|
2f4fcc59a1 | ||
|
|
ba6dbb228d | ||
|
|
60e386048b | ||
|
|
c2904fa14d | ||
|
|
dfdb139d9c | ||
|
|
ce63d21dcc | ||
|
|
1da9937453 | ||
|
|
9f11fbad16 | ||
|
|
f54e7804c5 | ||
|
|
7db5f8b28e | ||
|
|
743ce23fbc | ||
|
|
a3267be192 | ||
|
|
4ad2523877 | ||
|
|
4bfee3a8ca | ||
|
|
fc964f975a | ||
|
|
52f85c9465 | ||
|
|
691610f23c | ||
|
|
b6a2b2b8a5 | ||
|
|
1ad8a2fcf6 | ||
|
|
7ce08845f1 | ||
|
|
d469250130 | ||
|
|
7fd5c47e06 | ||
|
|
8704b1004e | ||
|
|
65a9fb8c01 | ||
|
|
25a7a8006a | ||
|
|
6fe1d3248a | ||
|
|
13f97532bf | ||
|
|
1acee3d702 | ||
|
|
1d17404471 | ||
|
|
48b860b69f | ||
|
|
a030c54661 | ||
|
|
dcf7bae6c7 | ||
|
|
d0ace108e5 | ||
|
|
32d5744014 | ||
|
|
d16094774b | ||
|
|
ac664ba321 | ||
|
|
0888a9bffd | ||
|
|
5e82d72424 | ||
|
|
2513835e89 | ||
|
|
98b70ef00f | ||
|
|
ae11381b88 | ||
|
|
e9596f2775 | ||
|
|
8adbc8010a | ||
|
|
76fb559964 | ||
|
|
1bc1b4d9d8 | ||
|
|
dfc0ef56f6 | ||
|
|
1e68e78d8e | ||
|
|
17fa5a2db4 | ||
|
|
004a5e1042 | ||
|
|
4915a9e8e4 | ||
|
|
8a7e44ccf0 | ||
|
|
a497afe695 | ||
|
|
15c252c11d | ||
|
|
27da3ed1fe | ||
|
|
8656102182 | ||
|
|
24d3744cb9 | ||
|
|
031913b9df | ||
|
|
e53443daf9 | ||
|
|
06317f4f6a | ||
|
|
c69e195441 | ||
|
|
a53b48de4c | ||
|
|
eca98aee42 | ||
|
|
ea5aaa8ab2 | ||
|
|
72566eda43 | ||
|
|
7a4f9a5ff3 | ||
|
|
ba23fd9989 | ||
|
|
c101196f5b | ||
|
|
1687a5451e | ||
|
|
ea4d5f89eb | ||
|
|
9e388ebcfd | ||
|
|
8d9cae45f9 | ||
|
|
406d0900a7 | ||
|
|
cf611d2be8 | ||
|
|
7875fc831b | ||
|
|
44bca36385 | ||
|
|
e2c3198627 | ||
|
|
8b549f3d5b | ||
|
|
a0e3c342a6 | ||
|
|
a80331dbcf | ||
|
|
0068dab001 | ||
|
|
7d42990462 | ||
|
|
e6dec7a9dd | ||
|
|
8adfc5b106 | ||
|
|
8be95b5785 | ||
|
|
9194de8460 | ||
|
|
6dccbc5a90 | ||
|
|
efba1e83c7 | ||
|
|
d1442765a6 | ||
|
|
72e5caf6e1 | ||
|
|
3768b6b701 | ||
|
|
e5cde4700f | ||
|
|
a207f67f73 | ||
|
|
b73aace476 | ||
|
|
346d37ecbb | ||
|
|
7bb29817f7 | ||
|
|
92b92a2e0a | ||
|
|
8e79f9f2dc | ||
|
|
05b345cc92 | ||
|
|
89f9925208 | ||
|
|
fcc1d7beff | ||
|
|
f226398c7c | ||
|
|
890ac9ff38 | ||
|
|
6a027cd566 | ||
|
|
1dc971d760 | ||
|
|
dcf0bf0bb1 | ||
|
|
cf156b469c | ||
|
|
da6c154ceb | ||
|
|
957fa910b3 | ||
|
|
8ac5be95d3 | ||
|
|
c27bd62106 | ||
|
|
480e8b8842 | ||
|
|
c6580421b3 | ||
|
|
c2f5331187 | ||
|
|
5d0c403f1d | ||
|
|
20fc4b4490 | ||
|
|
ea3f906f38 | ||
|
|
2c4df6abcf | ||
|
|
67a0b3b98e | ||
|
|
c366e9f3ca | ||
|
|
812a8552e5 | ||
|
|
069d7d6cac | ||
|
|
785a8b78b1 | ||
|
|
2d927639fe | ||
|
|
d5cad10181 | ||
|
|
441a56b916 | ||
|
|
c2a6a6c939 | ||
|
|
15d1aee21a | ||
|
|
f1bc2d56f4 | ||
|
|
6f62965305 | ||
|
|
a6aa0ac74a | ||
|
|
32ed4ee12e | ||
|
|
33a48aecb7 | ||
|
|
3b63062a30 | ||
|
|
b680952197 | ||
|
|
a4ec460f96 | ||
|
|
5bd295842b | ||
|
|
db9a7ea7a9 | ||
|
|
490a62e781 | ||
|
|
d4b8912c0e | ||
|
|
532acf4c4a | ||
|
|
7141c5be6d | ||
|
|
2df7757905 | ||
|
|
9d5c743a98 | ||
|
|
653e6c85bb | ||
|
|
d9fa389079 | ||
|
|
a429fdbd08 | ||
|
|
f9357457bf | ||
|
|
369e400e32 | ||
|
|
07ad4d8911 | ||
|
|
803a096b7e | ||
|
|
1b40abe37a | ||
|
|
0de5209cf1 | ||
|
|
07fad38a50 | ||
|
|
ac4b88f25d | ||
|
|
23a7aa5740 | ||
|
|
0b1e29e5e3 | ||
|
|
c8c93b2a70 | ||
|
|
d8c7cac536 | ||
|
|
5cb02c1cb5 | ||
|
|
10c1df61cd | ||
|
|
387e5ef0f1 | ||
|
|
f8f40f247f | ||
|
|
16cb918e0d | ||
|
|
638b315e40 | ||
|
|
a20b8dc1ad | ||
|
|
4370aee81e | ||
|
|
779e37fbd9 | ||
|
|
6f4c5022eb | ||
|
|
b499ca47a3 | ||
|
|
dc38e48202 | ||
|
|
7efdb97641 | ||
|
|
14fd7c7532 | ||
|
|
21e14bd46f | ||
|
|
f0e1dc5715 | ||
|
|
6b7af407e1 | ||
|
|
d67c64af83 | ||
|
|
5d2e5fe85a | ||
|
|
308da6ae53 | ||
|
|
76eceec1f5 | ||
|
|
209d332a30 | ||
|
|
35dbc3fcc9 | ||
|
|
ada01507a4 | ||
|
|
826ac95726 | ||
|
|
9b7f228f8e | ||
|
|
5d8ea4f9a3 | ||
|
|
4c89eac9a4 | ||
|
|
f76f30fd6a | ||
|
|
488d98289c | ||
|
|
ff3d32dd18 | ||
|
|
be6ce3c5b4 | ||
|
|
21966afbc6 | ||
|
|
68e3f74ffd | ||
|
|
87f5aa7a13 | ||
|
|
1dadbd0cbb | ||
|
|
481490fdc7 | ||
|
|
3114a24d1f | ||
|
|
73850fee02 | ||
|
|
c0047cd11d | ||
|
|
dd9a452594 | ||
|
|
e45c917811 | ||
|
|
fd19906c64 | ||
|
|
54a2773046 | ||
|
|
ec8b7bc7b2 | ||
|
|
ea71172d44 | ||
|
|
5dfa620f86 | ||
|
|
09d5f0779d | ||
|
|
d1880dc987 | ||
|
|
928b49705f | ||
|
|
f50cac3005 | ||
|
|
ec6e1315a5 | ||
|
|
ad55cb6d5d | ||
|
|
0ce0376725 | ||
|
|
015ca2c507 | ||
|
|
21e752e5e4 | ||
|
|
1e20a1249a | ||
|
|
b67c300484 | ||
|
|
8ac2086ed1 | ||
|
|
72defaa97e | ||
|
|
9097c5e9c0 | ||
|
|
79b54f65b4 | ||
|
|
52c2417685 | ||
|
|
9073debe60 | ||
|
|
8b368d010f | ||
|
|
8b97a06961 | ||
|
|
fffe7bdf9c | ||
|
|
ef18f621ac | ||
|
|
dfa41f6926 | ||
|
|
3d3dca4aa2 | ||
|
|
928595fe21 | ||
|
|
fc958f4215 | ||
|
|
0846238f69 | ||
|
|
007b6ca2e8 | ||
|
|
0b4a4487a0 | ||
|
|
99b4e047dd | ||
|
|
ae2af34453 | ||
|
|
fdf24ceecc | ||
|
|
870dd84a50 | ||
|
|
5d6db923b7 | ||
|
|
8eb88d17fe | ||
|
|
abe012b9fc | ||
|
|
749f52fc8b | ||
|
|
1e6cb43815 | ||
|
|
213d10bf4e | ||
|
|
1abfbb82c5 | ||
|
|
bf36d99a33 | ||
|
|
3ee525833e | ||
|
|
bf497ed643 | ||
|
|
9b8c0f7519 | ||
|
|
12ec5d1cbe | ||
|
|
0f178c3b3d | ||
|
|
9aa06e3001 | ||
|
|
00ec8ca989 | ||
|
|
9c6f558c9e | ||
|
|
1c172955ee | ||
|
|
1d44bf7ce6 | ||
|
|
036e41621d | ||
|
|
3003e9091d | ||
|
|
8d9da10710 | ||
|
|
4d23c12028 | ||
|
|
476816732f | ||
|
|
31968ea53c | ||
|
|
7e00d22bfa | ||
|
|
50055004f5 | ||
|
|
abe2f07779 | ||
|
|
277f0d77f3 | ||
|
|
01d2ad760a | ||
|
|
25f118bf2c | ||
|
|
12b8fb15b1 | ||
|
|
5295866eff | ||
|
|
02b47f4640 | ||
|
|
108ac7cf20 | ||
|
|
933c037c6e | ||
|
|
8f3554ff3e | ||
|
|
668128f8c9 | ||
|
|
28ab1f4af4 | ||
|
|
d360114226 | ||
|
|
5fc456d9d9 | ||
|
|
007d305736 | ||
|
|
ae7ec648b2 | ||
|
|
99a2fad311 | ||
|
|
82d466598c | ||
|
|
3a748fe737 | ||
|
|
89ce53e3ff | ||
|
|
2f29081667 | ||
|
|
cb0d28770f | ||
|
|
86c3909908 | ||
|
|
b970ee7293 | ||
|
|
5545e84430 | ||
|
|
85d9f39417 | ||
|
|
a81450df17 | ||
|
|
a7c94b2cd2 | ||
|
|
9d65c8b2ec | ||
|
|
1b7ff76092 | ||
|
|
17e32bf16d | ||
|
|
74905f3edc | ||
|
|
8e1b13ca96 | ||
|
|
c0e90807e0 | ||
|
|
3db1058c2c | ||
|
|
a57c4c580e | ||
|
|
33bbbdc322 | ||
|
|
5826336a77 | ||
|
|
3b5d13a0b2 | ||
|
|
ed37ba1d9b | ||
|
|
8ea6fd1925 | ||
|
|
93a461f3f7 | ||
|
|
fda7c9b06e | ||
|
|
1e13f32cea | ||
|
|
e357559582 | ||
|
|
71759a0769 | ||
|
|
11b116cb9d | ||
|
|
2f97a1a55d | ||
|
|
79cf3a6dd0 | ||
|
|
0257de1b7e | ||
|
|
466dc8da8f | ||
|
|
2c61badc02 | ||
|
|
3f8d3a7ee2 | ||
|
|
a455860978 | ||
|
|
0ecf135a4b | ||
|
|
cebb6d40df | ||
|
|
0ee13672ee | ||
|
|
49260a85ad | ||
|
|
da9f37e629 | ||
|
|
164f3fa3fd | ||
|
|
8e75d81a44 | ||
|
|
1d60c4d9d4 | ||
|
|
eaa32090b9 | ||
|
|
32ddb6f739 | ||
|
|
2653402c5c | ||
|
|
2743f18af4 | ||
|
|
dd1fdf88ff | ||
|
|
2a041e9d8d | ||
|
|
1117f4760c | ||
|
|
7dda7abf5e | ||
|
|
7ca3cca306 | ||
|
|
d471e3a23b | ||
|
|
ce1bee727a | ||
|
|
43cb3754d9 | ||
|
|
1d6ddf060b | ||
|
|
9928125e7d | ||
|
|
1c63893c4b | ||
|
|
a7ec7583aa | ||
|
|
4a3476266f | ||
|
|
32e0b895a4 | ||
|
|
58806359ee | ||
|
|
4589da957b | ||
|
|
6a4c55b852 | ||
|
|
ea17740719 | ||
|
|
d82810240f | ||
|
|
2768b73015 | ||
|
|
f9a7718dda | ||
|
|
d9d9778a98 | ||
|
|
bd5162105e | ||
|
|
208c5e9562 | ||
|
|
305e63750e | ||
|
|
ab0f74aa15 | ||
|
|
43443d08ae | ||
|
|
b82b553b9e | ||
|
|
08464eadff | ||
|
|
49e56776e8 | ||
|
|
043667dde5 | ||
|
|
f583a7c6d8 | ||
|
|
2d908e80fc | ||
|
|
8f0e9abe47 | ||
|
|
1a27ff6130 | ||
|
|
3f2cffc2e6 | ||
|
|
a78527050a | ||
|
|
a823a213ba | ||
|
|
2c8d380e67 | ||
|
|
3996309f8a | ||
|
|
bd18313d12 | ||
|
|
2ff7a78b56 | ||
|
|
c765082f72 | ||
|
|
7d2c5c1ac9 | ||
|
|
404bc34089 | ||
|
|
16ca7a21a7 | ||
|
|
1b31fd5afe | ||
|
|
e0457b6dc4 | ||
|
|
42b77e7ba5 | ||
|
|
f6bed08993 | ||
|
|
5f77cdb0b9 | ||
|
|
109b8e8f38 | ||
|
|
4c0bd88a2c | ||
|
|
3731be9947 | ||
|
|
6cc19ee6f0 | ||
|
|
1570f838f3 | ||
|
|
74feb110b5 | ||
|
|
6ba03ac2a6 | ||
|
|
55c717c2dc | ||
|
|
355b5eebec | ||
|
|
51938c398a | ||
|
|
dbb71f0dfc | ||
|
|
1cac7b2218 | ||
|
|
ff9bb5399b | ||
|
|
68e45eb051 | ||
|
|
d0da96ad29 | ||
|
|
55b036170b | ||
|
|
5473637736 | ||
|
|
bb6d9734e4 | ||
|
|
53be76c9e2 | ||
|
|
be40de5a9b | ||
|
|
7359e431d3 | ||
|
|
8a5de327bb | ||
|
|
1778adae0d | ||
|
|
0d035a4e53 | ||
|
|
46874eed05 | ||
|
|
e95f3febd6 | ||
|
|
0bdd1b6fc4 | ||
|
|
8a22092632 | ||
|
|
915415d919 | ||
|
|
14d7897a93 | ||
|
|
1398aa6562 | ||
|
|
8fcd6c7153 | ||
|
|
6ed5bc2f6c | ||
|
|
5ec4c2e43e | ||
|
|
6f8dd065a4 | ||
|
|
02db21fc55 | ||
|
|
8c28f9a77d | ||
|
|
95b80eec01 | ||
|
|
02c76695e5 | ||
|
|
d5a1a888d9 | ||
|
|
6c33aff6d1 | ||
|
|
61f86cbc54 | ||
|
|
4c5206954a | ||
|
|
8fda3116f0 | ||
|
|
7ac35c644e | ||
|
|
29b04fcbf2 | ||
|
|
55235c2552 | ||
|
|
f250643385 | ||
|
|
d008c6c5c5 | ||
|
|
e2e02c9a2f | ||
|
|
e56d7f5021 | ||
|
|
e7d44bb349 | ||
|
|
321730fcb9 | ||
|
|
fe83cd91bb | ||
|
|
0b08ee54bb | ||
|
|
f6b4b96737 | ||
|
|
b87455c089 | ||
|
|
2c1a81f448 | ||
|
|
b3736f45e6 | ||
|
|
3c382c4bbe | ||
|
|
5f3bad9c94 | ||
|
|
6970f43e66 | ||
|
|
9476aa598a | ||
|
|
69725e5d41 | ||
|
|
42dabef8c7 | ||
|
|
e10a768ddb | ||
|
|
a8f0787c91 | ||
|
|
074129682b | ||
|
|
c67460a1e3 | ||
|
|
eab320dab5 | ||
|
|
04c7cb6fbe | ||
|
|
d4582491f5 | ||
|
|
0641b1e279 | ||
|
|
ae0450b68e | ||
|
|
cb0a5de83b | ||
|
|
2f5086efaf | ||
|
|
68e580e394 | ||
|
|
b143869d5d | ||
|
|
6a477be874 | ||
|
|
03bb8cdcbd | ||
|
|
8864816b94 | ||
|
|
751cd2f1c1 | ||
|
|
6f6b6fb9d6 | ||
|
|
44e1a6ce06 |
6
.eslintrc.json
Normal file
6
.eslintrc.json
Normal file
@@ -0,0 +1,6 @@
|
||||
{
|
||||
"extends": [
|
||||
"./lint/eslintrc-gjs.json",
|
||||
"./lint/eslintrc-shell.json"
|
||||
]
|
||||
}
|
||||
@@ -1,6 +1,5 @@
|
||||
stages:
|
||||
- review
|
||||
- source_check
|
||||
- build
|
||||
- test
|
||||
|
||||
@@ -26,19 +25,27 @@ check_commit_log:
|
||||
|
||||
js_check:
|
||||
image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
|
||||
stage: source_check
|
||||
stage: review
|
||||
script:
|
||||
- find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG
|
||||
- (! grep -q . $JS_LOG)
|
||||
<<: *only_default
|
||||
only:
|
||||
changes:
|
||||
- js/**/*
|
||||
artifacts:
|
||||
paths:
|
||||
- ${JS_LOG}
|
||||
when: on_failure
|
||||
|
||||
eslint:
|
||||
image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
|
||||
stage: review
|
||||
script:
|
||||
- ./.gitlab-ci/run-eslint.sh
|
||||
<<: *only_default
|
||||
artifacts:
|
||||
paths:
|
||||
- reports
|
||||
when: always
|
||||
|
||||
build:
|
||||
image: registry.gitlab.gnome.org/gnome/mutter/master:v2
|
||||
stage: build
|
||||
@@ -47,7 +54,7 @@ build:
|
||||
- meson mutter mutter/build --prefix=/usr -Dtests=false
|
||||
- ninja -C mutter/build install
|
||||
script:
|
||||
- meson . build -Dbuiltype=debugoptimized
|
||||
- meson . build -Dbuiltype=debugoptimized -Dman=false --werror
|
||||
- ninja -C build
|
||||
- ninja -C build install
|
||||
<<: *only_default
|
||||
@@ -60,6 +67,8 @@ build:
|
||||
test:
|
||||
image: registry.gitlab.gnome.org/gnome/mutter/master:v2
|
||||
stage: test
|
||||
variables:
|
||||
XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
|
||||
before_script:
|
||||
- ninja -C mutter/build install
|
||||
script:
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
FROM registry.fedoraproject.org/fedora:latest
|
||||
|
||||
RUN dnf -y update && dnf -y upgrade && \
|
||||
dnf install -y 'dnf-command(copr)' && \
|
||||
dnf install -y 'dnf-command(copr)' git && \
|
||||
|
||||
# For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'`
|
||||
dnf install -y findutils mozjs60-devel && \
|
||||
|
||||
114
.gitlab-ci/run-eslint.sh
Executable file
114
.gitlab-ci/run-eslint.sh
Executable file
@@ -0,0 +1,114 @@
|
||||
#!/usr/bin/env bash
|
||||
|
||||
OUTPUT_REGULAR=reports/lint-regular-report.txt
|
||||
OUTPUT_LEGACY=reports/lint-legacy-report.txt
|
||||
OUTPUT_FINAL=reports/lint-common-report.txt
|
||||
|
||||
OUTPUT_MR=reports/lint-mr-report.txt
|
||||
|
||||
LINE_CHANGES=changed-lines.txt
|
||||
|
||||
is_empty() {
|
||||
(! grep -q . $1)
|
||||
}
|
||||
|
||||
run_eslint() {
|
||||
ARGS_LEGACY='--config lint/eslintrc-legacy.json'
|
||||
|
||||
local extra_args=ARGS_$1
|
||||
local output_var=OUTPUT_$1
|
||||
local output=${!output_var}
|
||||
|
||||
# ensure output exists even if eslint doesn't report any errors
|
||||
mkdir -p $(dirname $output)
|
||||
touch $output
|
||||
|
||||
eslint -f unix ${!extra_args} -o $output js
|
||||
}
|
||||
|
||||
list_commit_range_additions() {
|
||||
# Turn raw context-less git-diff into a list of
|
||||
# filename:lineno pairs of new (+) lines
|
||||
git diff -U0 "$@" -- js |
|
||||
awk '
|
||||
BEGIN { file=""; }
|
||||
/^+++ b/ { file=substr($0,7); }
|
||||
/^@@ / {
|
||||
len = split($3,a,",")
|
||||
start=a[1]
|
||||
count=(len > 1) ? a[2] : 1
|
||||
|
||||
for (line=start; line<start+count; line++)
|
||||
printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line;
|
||||
}'
|
||||
}
|
||||
|
||||
copy_matched_lines() {
|
||||
local source=$1
|
||||
local matches=$2
|
||||
local target=$3
|
||||
|
||||
echo -n > $target
|
||||
for l in $(<$matches); do
|
||||
grep $l $source >> $target
|
||||
done
|
||||
}
|
||||
|
||||
create_common() {
|
||||
# comm requires sorted input;
|
||||
# we also strip the error message to make the following a "common" error:
|
||||
# regular:
|
||||
# file.js:42:23 Indentation of 55, expected 42
|
||||
# legacy:
|
||||
# file.js:42:23 Indentation of 55, extected 24
|
||||
prepare() {
|
||||
sed 's: .*::' $1 | sort
|
||||
}
|
||||
|
||||
comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp
|
||||
|
||||
# Now add back the stripped error messages
|
||||
copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL
|
||||
rm $OUTPUT_FINAL.tmp
|
||||
}
|
||||
|
||||
# Disable MR handling for now. We aren't ready to enforce
|
||||
# non-legacy style just yet ...
|
||||
unset CI_MERGE_REQUEST_TARGET_BRANCH_NAME
|
||||
|
||||
REMOTE=${1:-$CI_MERGE_REQUEST_PROJECT_URL.git}
|
||||
BRANCH_NAME=${2:-$CI_MERGE_REQUEST_TARGET_BRANCH_NAME}
|
||||
|
||||
if [ "$BRANCH_NAME" ]; then
|
||||
git fetch $REMOTE $BRANCH_NAME
|
||||
branch_point=$(git merge-base HEAD FETCH_HEAD)
|
||||
commit_range=$branch_point...HEAD
|
||||
|
||||
list_commit_range_additions $commit_range > $LINE_CHANGES
|
||||
|
||||
# Don't bother with running lint when no JS changed
|
||||
if is_empty $LINE_CHANGES; then
|
||||
exit 0
|
||||
fi
|
||||
fi
|
||||
|
||||
echo Generating lint report using regular configuration
|
||||
run_eslint REGULAR
|
||||
echo Generating lint report using legacy configuration
|
||||
run_eslint LEGACY
|
||||
echo Done.
|
||||
create_common
|
||||
|
||||
if ! is_empty $OUTPUT_FINAL; then
|
||||
cat $OUTPUT_FINAL
|
||||
exit 1
|
||||
fi
|
||||
|
||||
# Just show the report and succeed when not testing a MR
|
||||
if [ -z "$BRANCH_NAME" ]; then
|
||||
exit 0
|
||||
fi
|
||||
|
||||
copy_matched_lines $OUTPUT_REGULAR $LINE_CHANGES $OUTPUT_MR
|
||||
cat $OUTPUT_MR
|
||||
is_empty $OUTPUT_MR
|
||||
91
HACKING.md
91
HACKING.md
@@ -84,7 +84,6 @@ don't use.
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Util = imports.misc.util;
|
||||
```
|
||||
The alphabetical ordering should be done independently of the location of the
|
||||
@@ -187,15 +186,27 @@ and "double quotes" for strings that the user may see. This allows us to
|
||||
quickly find untranslated or mistranslated strings by grepping through the
|
||||
sources for double quotes without a gettext call around them.
|
||||
|
||||
## `actor` and `_delegate`
|
||||
## `actor` (deprecated) and `_delegate`
|
||||
|
||||
gjs allows us to set so-called "expando properties" on introspected objects,
|
||||
allowing us to treat them like any other. Because the Shell was built before
|
||||
you could inherit from GTypes natively in JS, we usually have a wrapper class
|
||||
that has a property called `actor`. We call this wrapper class the "delegate".
|
||||
you could inherit from GTypes natively in JS, in some cases we have a wrapper
|
||||
class that has a property called `actor` (now deprecated). We call this
|
||||
wrapper class the "delegate".
|
||||
|
||||
We sometimes use expando properties to set a property called `_delegate` on
|
||||
the actor itself:
|
||||
```javascript
|
||||
var MyActor = GObject.registerClass(
|
||||
class MyActor extends Clutter.Actor {
|
||||
_init(params) {
|
||||
super._init(params);
|
||||
this._delegate = this;
|
||||
}
|
||||
});
|
||||
```
|
||||
|
||||
Or using the deprecated `actor`:
|
||||
```javascript
|
||||
var MyClass = class {
|
||||
constructor() {
|
||||
@@ -216,6 +227,7 @@ delegate object from an associated actor. For instance, the drag and drop
|
||||
system calls the `handleDragOver` function on the delegate of a "drop target"
|
||||
when the user drags an item over it. If you do not set the `_delegate`
|
||||
property, your actor will not be able to be dropped onto.
|
||||
In case the class is an actor itself, the `_delegate` can be just set to `this`.
|
||||
|
||||
## Functional style
|
||||
|
||||
@@ -277,34 +289,49 @@ If your usage of an object is like a hash table (and thus conceptually the keys
|
||||
can have special chars in them), don't use quotes, but use brackets: `{ bar: 42
|
||||
}`, `foo['bar']`.
|
||||
|
||||
## Getters, setters, and Tweener
|
||||
## Animations
|
||||
|
||||
Most objects that are animated are actors, and most properties used in animations
|
||||
are animatable, which means they can use implicit animations:
|
||||
|
||||
Getters and setters should be used when you are dealing with an API that is
|
||||
designed around setting properties, like Tweener. If you want to animate an
|
||||
arbitrary property, create a getter and setter, and use Tweener to animate the
|
||||
property.
|
||||
```javascript
|
||||
var ANIMATION_TIME = 2000;
|
||||
|
||||
var MyClass = class {
|
||||
constructor() {
|
||||
this.actor = new St.BoxLayout();
|
||||
this._position = 0;
|
||||
}
|
||||
|
||||
get position() {
|
||||
return this._position;
|
||||
}
|
||||
|
||||
set position(value) {
|
||||
this._position = value;
|
||||
this.actor.set_position(value, value);
|
||||
}
|
||||
};
|
||||
|
||||
let myThing = new MyClass();
|
||||
Tweener.addTween(myThing,
|
||||
{ position: 100,
|
||||
time: ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
moveActor(actor, x, y) {
|
||||
actor.ease({
|
||||
x,
|
||||
y,
|
||||
duration: 500, // ms
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
```
|
||||
|
||||
The above is a convenience wrapper around the actual Clutter API, and should generally
|
||||
be preferred over the more verbose:
|
||||
|
||||
```javascript
|
||||
moveActor(actor, x, y) {
|
||||
actor.save_easing_state();
|
||||
|
||||
actor.set_easing_duration(500);
|
||||
actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD);
|
||||
actor.set({
|
||||
x,
|
||||
y
|
||||
});
|
||||
|
||||
actor.restore_easing_state();
|
||||
}
|
||||
```
|
||||
|
||||
There is a similar convenience API around Clutter.PropertyTransition to animate
|
||||
actor (or actor meta) properties that cannot use implicit animations:
|
||||
|
||||
```javascript
|
||||
desaturateActor(actor, desaturate) {
|
||||
let factor = desaturate ? 1.0 : 0.0;
|
||||
actor.ease_property('@effects.desaturate.factor', factor, {
|
||||
duration: 500, // ms
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
```
|
||||
|
||||
178
NEWS
178
NEWS
@@ -1,3 +1,181 @@
|
||||
3.35.1
|
||||
======
|
||||
* Misc. bug fixes and cleanups [Marco; Matthias; !758, #701212]
|
||||
|
||||
Contributors:
|
||||
Marco Trevisan (Treviño)
|
||||
|
||||
3.34.1
|
||||
======
|
||||
* Fix "Frequent" view icons disappearing on hover [Jonas D.; #1502]
|
||||
* Allow editing app folder names [Georges, Marco; !675, !720]
|
||||
* Skip property transitions while hidden [Florian; !708]
|
||||
* Make menu animations more consistent [Florian, GB_2; #1595, !717]
|
||||
* Improve performance when enabling/disabling all extensions [Jonas D.; !96]
|
||||
* Fix extra icons appearing in "Frequent" view animation [Georges; !696]
|
||||
* Fix fading out desktop icons [Harshula; #1616]
|
||||
* Fix box-shadow glitch with prerendered resources [Daniel; #1186]
|
||||
* Fix accidentally skipped animations [Florian; #1572]
|
||||
* Fix screenshots and window animations when scaled [Robert; !728]
|
||||
* Don't leak NOTIFY_SOCKET environment variable to applications [Benjamin; !741]
|
||||
* Fix lock-up on X11 when ibus is already running on startup [Marco; #1712]
|
||||
* Fix screen dimming on idle [Marco; #1683]
|
||||
* Do not notify systemd before initialization is complete [Iain; !750]
|
||||
* Support SAE secrets in network agent [Lubomir; !751]
|
||||
* Fix various regressions with dynamic workspaces [Florian; #1497]
|
||||
* Fixed crashes [Florian, Marco; #1678, !746]
|
||||
* Misc. bug fixes and cleanups [Marco, Jonas D., Florian, Iain, Georges,
|
||||
Jonas Å., Martin, Takao, Carlos; !700, !705, !709, !711, !707, #1538, !710,
|
||||
!713, !699, !715, !718, !716, !719, !721, #1243, !725, !731, #1614, !683,
|
||||
!732, !121, !735, !736, !740, #573, #1641, #1571]
|
||||
|
||||
Contributors:
|
||||
Marco Trevisan (Treviño), Benjamin Berg, Jonas Dreßler, Takao Fujiwara, GB_2,
|
||||
Carlos Garnacho, Harshula Jayasuriya, Iain Lane, Robert Mader,
|
||||
Daniel García Moreno, Florian Müllner, Georges Basile Stavracas Neto,
|
||||
Lubomir Rintel, Martin Zurowietz, Jonas Ådahl
|
||||
|
||||
Translators:
|
||||
Rafael Fontenelle [pt_BR], Fran Dieguez [gl], Balázs Úr [hu],
|
||||
Milo Casagrande [it], Daniel Șerbănescu [ro], Kukuh Syafaat [id],
|
||||
Jiri Grönroos [fi], Daniel Mustieles [es], Piotr Drąg [pl],
|
||||
Anders Jonsson [sv], Marek Černocký [cs], Jordi Mas [ca],
|
||||
Aurimas Černius [lt], Christian Kirbach [de], Emin Tufan Çetin [tr],
|
||||
Enrico Nicoletto [pt_BR], Danial Behzadi [fa], Марко Костић [sr],
|
||||
Alexandre Franke [fr], Charles Monzat [fr], Kjartan Maraas [nb],
|
||||
Ryuta Fujii [ja], Nathan Follens [nl], Dušan Kazik [sk], Fabio Tomat [fur],
|
||||
Matej Urbančič [sl], Ask Hjorth Larsen [da], Alan Mortensen [da]
|
||||
|
||||
3.34.0
|
||||
======
|
||||
* Handle startup/shutdown of misc X11 services [Carlos; !680]
|
||||
* Fix sound volume mute/unmute [Iain; #1557]
|
||||
* Correctly terminate pasted text [Carlos; #1570]
|
||||
|
||||
Contributors:
|
||||
Carlos Garnacho, Iain Lane
|
||||
|
||||
Translators:
|
||||
Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
|
||||
Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
|
||||
Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
|
||||
|
||||
3.33.92
|
||||
=======
|
||||
* Animate pointer a11y pie timer [Jonas D.; !688]
|
||||
* Fix restarting shell in systemd user session [Benjamin; !690]
|
||||
* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
|
||||
!691, !689, !692, #1552, !698]
|
||||
|
||||
Contributors:
|
||||
Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
|
||||
Will Thompson
|
||||
|
||||
Translators:
|
||||
Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
|
||||
Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
|
||||
Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
|
||||
Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
|
||||
Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
|
||||
Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
|
||||
Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
|
||||
|
||||
3.33.91
|
||||
=======
|
||||
* Fix regression when adjusting brightness [Florian; #1500]
|
||||
* Fix pointer a11y timeout animation [Jonas D.; #1533]
|
||||
* Add new extensions CLI tool [Florian; #1234]
|
||||
* Only track top-level windows [Carlos; #556]
|
||||
* Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian;
|
||||
!678, !682, !686]
|
||||
|
||||
Contributors:
|
||||
Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner
|
||||
|
||||
Translators:
|
||||
Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv],
|
||||
Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi],
|
||||
Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl],
|
||||
Danial Behzadi [fa]
|
||||
|
||||
3.33.90
|
||||
=======
|
||||
* Implement DND app picker folder management [Georges; !643, !645, !664, !671]
|
||||
* Make Clocks/Weather integration work with sandboxed apps [Florian; #1158]
|
||||
* Support startup via systemd user instance [Benjamin; !507]
|
||||
* Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669]
|
||||
* Minimize travel distance in overview animation [Sergey; !267]
|
||||
* Rescan icon theme when installed apps changed [Georges; !661]
|
||||
* Consistently animate new window actions [Jonas; !662, !673]
|
||||
* Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels,
|
||||
Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647,
|
||||
!385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665,
|
||||
!667, !670, #1357, !672, !657, #1507, !674, !677]
|
||||
|
||||
Contributors:
|
||||
Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner,
|
||||
Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode,
|
||||
Marco Trevisan (Treviño), verdre, Daniel van Vugt
|
||||
|
||||
Translators:
|
||||
Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR],
|
||||
Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es],
|
||||
Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro],
|
||||
Anders Jonsson [sv]
|
||||
|
||||
3.33.4
|
||||
======
|
||||
* Fix unintentional interference between gestures [Jonas; !598]
|
||||
* Fix unintentional loop while polkit dialog is active [Ray; !602]
|
||||
* Fix alt-tab icon size on HiDPI [Jonas; !587]
|
||||
* Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449]
|
||||
* Fix style updates for non-background CSS properties [Florian; #1212]
|
||||
* Fix cursor visibility in screen recordings [Illya; #1208]
|
||||
* Add option for disabling the hot corner [Florian; #688320]
|
||||
* Use more fine-grained levels in battery indicator [Florian; !561, #1442]
|
||||
* Fix the calculation of the maximum number of app search results [Jonas; !110]
|
||||
* Handle horizontal workspace layout with gestures/animations [Florian; !575]
|
||||
* Improve handling of session mode extensions [Florian, Didier; #789852]
|
||||
* Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin,
|
||||
Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611,
|
||||
!614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626,
|
||||
!491, !631, !632, !633, #1457]
|
||||
|
||||
Contributors:
|
||||
Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho,
|
||||
Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada,
|
||||
Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño)
|
||||
|
||||
Translators:
|
||||
Jordi Mas [ca], Jor Teron [mjw]
|
||||
|
||||
3.33.3
|
||||
======
|
||||
* Prepare for optional X11 [Carlos; !378]
|
||||
* Fix opening window menu [Marco; !557]
|
||||
* Reload search providers when installed applications change [Cosimo; !562]
|
||||
* Implement locate-pointer accessibility feature [Olivier; #981]
|
||||
* Allow to disable window menus via session mode [Cosimo; !569]
|
||||
* Implement mouse accessibility [Olivier; !474]
|
||||
* Call GDM's RegisterSession() after startup [Iain; !570]
|
||||
* Fix extended keys popups being hidden by on-screen keyboard [Marco; !583]
|
||||
* Fix top bar being hidden by lock screen [Jonas; !571]
|
||||
* Update theme to better match GTK's Adwaita [Frederik; #841]
|
||||
* Set up GJS profiler when GJS_TRACE_FD is set [Christian; !573]
|
||||
* Misc. bug fixes and cleanups [Jonas, Cosimo, Robert, Florian, Marco, Simon,
|
||||
Laurent, Niels, Will; !551, !555, !464, #1333, !565, !572, !568, !558, #1205,
|
||||
#1336, !579, !576, #1392, !582, !586, #1406, #1351]
|
||||
|
||||
Contributors:
|
||||
Laurent Bigonville, Cosimo Cecchi, Piotr Drąg, Jonas Dreßler,
|
||||
Frederik Feichtmeier, Olivier Fourdan, Carlos Garnacho, Niels De Graef,
|
||||
Christian Hergert, Iain Lane, Robert Mader, Florian Müllner, Simon Schampijer,
|
||||
Jakub Steiner, Will Thompson, Marco Trevisan (Treviño)
|
||||
|
||||
Translators:
|
||||
Kukuh Syafaat [id], Balázs Meskó [hu], Daniel Mustieles [es],
|
||||
Fabio Tomat [fur], Nathan Follens [nl], Goran Vidović [hr], Jordi Mas [ca]
|
||||
|
||||
3.33.2
|
||||
======
|
||||
* Fix keeping actors visible in scrollviews [Marco; #1061]
|
||||
|
||||
15
data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
Normal file
15
data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
Normal file
@@ -0,0 +1,15 @@
|
||||
<node>
|
||||
|
||||
<!--
|
||||
org.gnome.Shell.ClocksIntegration:
|
||||
@short_description: Clocks integration interface
|
||||
|
||||
The interface used for exporting location settings to GNOME Shell's
|
||||
world clocks integration.
|
||||
-->
|
||||
<interface name="org.gnome.Shell.ClocksIntegration">
|
||||
|
||||
<property name="Locations" type="av" access="read"/>
|
||||
|
||||
</interface>
|
||||
</node>
|
||||
@@ -173,6 +173,30 @@
|
||||
<arg type="s" direction="in" name="uuid"/>
|
||||
</method>
|
||||
|
||||
<!--
|
||||
EnableExtension:
|
||||
@uuid: The UUID of the extension
|
||||
@success: Whether the operation was successful
|
||||
|
||||
Enable an extension.
|
||||
-->
|
||||
<method name="EnableExtension"> \
|
||||
<arg type="s" direction="in" name="uuid"/> \
|
||||
<arg type="b" direction="out" name="success"/> \
|
||||
</method> \
|
||||
|
||||
<!--
|
||||
DisableExtension:
|
||||
@uuid: The UUID of the extension
|
||||
@success: Whether the operation was successful
|
||||
|
||||
Disable an extension.
|
||||
-->
|
||||
<method name="DisableExtension"> \
|
||||
<arg type="s" direction="in" name="uuid"/> \
|
||||
<arg type="b" direction="out" name="success"/> \
|
||||
</method> \
|
||||
|
||||
<!--
|
||||
LaunchExtensionPrefs:
|
||||
@uuid: The UUID of the extension
|
||||
@@ -189,6 +213,15 @@
|
||||
-->
|
||||
<method name="CheckForUpdates"/>
|
||||
|
||||
<signal name="ExtensionStateChanged">
|
||||
<arg type="s" name="uuid"/>
|
||||
<arg type="a{sv}" name="state"/>
|
||||
</signal>
|
||||
|
||||
<!--
|
||||
ExtensionStatusChanged:
|
||||
Deprecated for ExtensionStateChanged
|
||||
-->
|
||||
<signal name="ExtensionStatusChanged">
|
||||
<arg type="s" name="uuid"/>
|
||||
<arg type="i" name="state"/>
|
||||
|
||||
16
data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
Normal file
16
data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
Normal file
@@ -0,0 +1,16 @@
|
||||
<node>
|
||||
|
||||
<!--
|
||||
org.gnome.Shell.WeatherIntegration:
|
||||
@short_description: Weather integration interface
|
||||
|
||||
The interface used for exporting location settings to GNOME Shell's
|
||||
weather integration.
|
||||
-->
|
||||
<interface name="org.gnome.Shell.WeatherIntegration">
|
||||
|
||||
<property name="AutomaticLocation" type="b" access="read"/>
|
||||
<property name="Locations" type="av" access="read"/>
|
||||
|
||||
</interface>
|
||||
</node>
|
||||
@@ -9,7 +9,7 @@
|
||||
<method name="ShowOSD">
|
||||
<arg type="a{sv}" direction="in" name="params"/>
|
||||
</method>
|
||||
<method name="ShowMonitorLabels2">
|
||||
<method name="ShowMonitorLabels">
|
||||
<arg type="a{sv}" direction="in" name="params"/>
|
||||
</method>
|
||||
<method name="HideMonitorLabels"/>
|
||||
|
||||
@@ -40,6 +40,7 @@
|
||||
<file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file>
|
||||
@@ -48,6 +49,7 @@
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gnome.Shell.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file>
|
||||
<file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file>
|
||||
|
||||
14
data/gnome-shell-disable-extensions.service
Normal file
14
data/gnome-shell-disable-extensions.service
Normal file
@@ -0,0 +1,14 @@
|
||||
[Unit]
|
||||
Description=Disable GNOME Shell extensions after failure
|
||||
DefaultDependencies=no
|
||||
|
||||
# Only disable extensions for a short period of time after login.
|
||||
# This means we err on the side of failing the first login after a broken
|
||||
# extension was installed.
|
||||
Requisite=gnome-session-stable.timer
|
||||
|
||||
[Service]
|
||||
Type=simple
|
||||
# Disable extensions
|
||||
ExecStart=gsettings set org.gnome.shell disable-user-extensions true
|
||||
Restart=no
|
||||
27
data/gnome-shell-wayland.service.in
Normal file
27
data/gnome-shell-wayland.service.in
Normal file
@@ -0,0 +1,27 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell on Wayland
|
||||
# On wayland, force a session shutdown
|
||||
OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target
|
||||
OnFailureJobMode=replace-irreversibly
|
||||
CollectMode=inactive-or-failed
|
||||
RefuseManualStart=on
|
||||
RefuseManualStop=on
|
||||
|
||||
After=gnome-session-manager.target
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
# The units already conflict because they use the same BusName
|
||||
#Conflicts=gnome-shell-x11.service
|
||||
|
||||
[Service]
|
||||
Type=notify
|
||||
ExecStart=@bindir@/gnome-shell
|
||||
# Exit code 1 means we are probably *not* dealing with an extension failure
|
||||
SuccessExitStatus=1
|
||||
# On wayland we cannot restart
|
||||
Restart=no
|
||||
# Kill any stubborn child processes after this long
|
||||
TimeoutStopSec=5
|
||||
@@ -1,5 +1,10 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell (wayland sync point)
|
||||
After=gnome-shell.service
|
||||
BindsTo=gnome-shell.service
|
||||
Conflicts=gnome-shell-x11.target
|
||||
Description=GNOME Shell on Wayland
|
||||
DefaultDependencies=no
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
Requires=gnome-shell-wayland.service
|
||||
After=gnome-shell-wayland.service
|
||||
|
||||
33
data/gnome-shell-x11.service.in
Normal file
33
data/gnome-shell-x11.service.in
Normal file
@@ -0,0 +1,33 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell on X11
|
||||
# On X11, try to show the GNOME Session Failed screen
|
||||
OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target
|
||||
OnFailureJobMode=replace
|
||||
CollectMode=inactive-or-failed
|
||||
RefuseManualStart=on
|
||||
RefuseManualStop=on
|
||||
|
||||
After=gnome-session-manager.target
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
# The units already conflict because they use the same BusName
|
||||
#Conflicts=gnome-shell-wayland.service
|
||||
|
||||
# Limit startup frequency more than the default
|
||||
StartLimitIntervalSec=15s
|
||||
StartLimitBurst=3
|
||||
|
||||
[Service]
|
||||
Type=notify
|
||||
ExecStart=@bindir@/gnome-shell
|
||||
# Exit code 1 means we are probably *not* dealing with an extension failure
|
||||
SuccessExitStatus=1
|
||||
# On X11 we want to restart on-success (Alt+F2 + r) and on-failure.
|
||||
Restart=always
|
||||
# Do not wait before restarting the shell
|
||||
RestartSec=0ms
|
||||
# Kill any stubborn child processes after this long
|
||||
TimeoutStopSec=5
|
||||
@@ -1,5 +1,10 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell (x11 sync point)
|
||||
After=gnome-shell.service
|
||||
BindsTo=gnome-shell.service
|
||||
Conflicts=gnome-shell-wayland.target
|
||||
Description=GNOME Shell on X11
|
||||
DefaultDependencies=no
|
||||
|
||||
Requisite=gnome-session-initialized.target
|
||||
PartOf=gnome-session-initialized.target
|
||||
Before=gnome-session-initialized.target
|
||||
|
||||
Requires=gnome-shell-x11.service
|
||||
After=gnome-shell-x11.service
|
||||
|
||||
@@ -1,11 +0,0 @@
|
||||
[Unit]
|
||||
Description=GNOME Shell
|
||||
Wants=gnome-session.service
|
||||
After=graphical-session-pre.target gnome-session-bus.target
|
||||
PartOf=graphical-session.target
|
||||
|
||||
[Service]
|
||||
Type=dbus
|
||||
ExecStart=@bindir@/gnome-shell
|
||||
Restart=on-failure
|
||||
BusName=org.gnome.Shell
|
||||
@@ -14,6 +14,8 @@ desktopconf = configuration_data()
|
||||
# file when built in a non-system prefix
|
||||
desktopconf.set('bindir', bindir)
|
||||
desktopconf.set('VERSION', meson.project_version())
|
||||
desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false')
|
||||
|
||||
foreach desktop_file : desktop_files
|
||||
i18n.merge_file('desktop',
|
||||
input: configure_file(
|
||||
@@ -22,7 +24,7 @@ foreach desktop_file : desktop_files
|
||||
configuration: desktopconf
|
||||
),
|
||||
output: desktop_file,
|
||||
po_dir: '../po',
|
||||
po_dir: po_dir,
|
||||
install: true,
|
||||
install_dir: desktopdir,
|
||||
type: 'desktop'
|
||||
@@ -98,15 +100,23 @@ if have_systemd
|
||||
unitconf = configuration_data()
|
||||
unitconf.set('bindir', bindir)
|
||||
|
||||
unit = configure_file(
|
||||
input: 'gnome-shell.service.in',
|
||||
output: 'gnome-shell.service',
|
||||
configure_file(
|
||||
input: 'gnome-shell-x11.service.in',
|
||||
output: 'gnome-shell-x11.service',
|
||||
configuration: unitconf,
|
||||
install_dir: systemduserunitdir
|
||||
)
|
||||
|
||||
units = files('gnome-shell-wayland.target',
|
||||
'gnome-shell-x11.target')
|
||||
configure_file(
|
||||
input: 'gnome-shell-wayland.service.in',
|
||||
output: 'gnome-shell-wayland.service',
|
||||
configuration: unitconf,
|
||||
install_dir: systemduserunitdir
|
||||
)
|
||||
|
||||
units = files('gnome-shell-x11.target',
|
||||
'gnome-shell-wayland.target',
|
||||
'gnome-shell-disable-extensions.service')
|
||||
|
||||
install_data(units, install_dir: systemduserunitdir)
|
||||
endif
|
||||
|
||||
@@ -14,3 +14,4 @@ X-GNOME-Autostart-Phase=DisplayServer
|
||||
X-GNOME-Provides=panel;windowmanager;
|
||||
X-GNOME-Autostart-Notify=true
|
||||
X-GNOME-AutoRestart=false
|
||||
X-GNOME-HiddenUnderSystemd=@systemd_hidden@
|
||||
|
||||
@@ -21,6 +21,17 @@
|
||||
EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell.
|
||||
</description>
|
||||
</key>
|
||||
<key name="disabled-extensions" type="as">
|
||||
<default>[]</default>
|
||||
<summary>UUIDs of extensions to force disabling</summary>
|
||||
<description>
|
||||
GNOME Shell extensions have a UUID property; this key lists extensions
|
||||
which should be disabled, even if loaded as part of the current mode.
|
||||
You can also manipulate this list with the EnableExtension and
|
||||
DisableExtension D-Bus methods on org.gnome.Shell.
|
||||
This key takes precedence over the “enabled-extensions” setting.
|
||||
</description>
|
||||
</key>
|
||||
<key name="disable-user-extensions" type="b">
|
||||
<default>false</default>
|
||||
<summary>Disable user extensions</summary>
|
||||
@@ -39,7 +50,7 @@
|
||||
</description>
|
||||
</key>
|
||||
<key name="favorite-apps" type="as">
|
||||
<default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default>
|
||||
<default>[ 'epiphany.desktop', 'evolution.desktop', 'rhythmbox.desktop', 'org.gnome.Shotwell.desktop', 'org.gnome.Nautilus.desktop', 'org.gnome.Software.desktop' ]</default>
|
||||
<summary>List of desktop file IDs for favorite applications</summary>
|
||||
<description>
|
||||
The applications corresponding to these identifiers
|
||||
@@ -99,7 +110,6 @@
|
||||
</description>
|
||||
</key>
|
||||
<child name="keybindings" schema="org.gnome.shell.keybindings"/>
|
||||
<child name="keyboard" schema="org.gnome.shell.keyboard"/>
|
||||
</schema>
|
||||
|
||||
<schema id="org.gnome.shell.keybindings" path="/org/gnome/shell/keybindings/"
|
||||
@@ -140,11 +150,6 @@
|
||||
Keybinding to focus the active notification.
|
||||
</description>
|
||||
</key>
|
||||
<key name="pause-resume-tweens" type="as">
|
||||
<default>[]</default>
|
||||
<summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary>
|
||||
<description></description>
|
||||
</key>
|
||||
<key name="switch-to-application-1" type="as">
|
||||
<default>["<Super>1"]</default>
|
||||
<summary>Switch to application 1</summary>
|
||||
@@ -183,17 +188,6 @@
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<schema id="org.gnome.shell.keyboard" path="/org/gnome/shell/keyboard/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
<key name="keyboard-type" type="s">
|
||||
<default>'touch'</default>
|
||||
<summary>Which keyboard to use</summary>
|
||||
<description>
|
||||
The type of keyboard to use.
|
||||
</description>
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<schema id="org.gnome.shell.app-switcher"
|
||||
path="/org/gnome/shell/app-switcher/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
@@ -234,6 +228,36 @@
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
<key name="locations" type="av">
|
||||
<summary>Locations</summary>
|
||||
<description>
|
||||
The locations to show in world clocks
|
||||
</description>
|
||||
<default>[]</default>
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
<key name="automatic-location" type="b">
|
||||
<summary>Automatic location</summary>
|
||||
<description>
|
||||
Whether to fetch the current location or not
|
||||
</description>
|
||||
<default>false</default>
|
||||
</key>
|
||||
|
||||
<key name="locations" type="av">
|
||||
<summary>Location</summary>
|
||||
<description>
|
||||
The location for which to show a forecast
|
||||
</description>
|
||||
<default>[]</default>
|
||||
</key>
|
||||
</schema>
|
||||
|
||||
<!-- unused, change 00_org.gnome.shell.gschema.override instead -->
|
||||
<schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/"
|
||||
gettext-domain="@GETTEXT_PACKAGE@">
|
||||
|
||||
@@ -25,8 +25,10 @@ $cakeisalie: "This stylesheet is generated, DO NOT EDIT";
|
||||
|
||||
/* GLOBALS */
|
||||
|
||||
$panel-corner-radius: 6px;
|
||||
$medium_radius: 9px;
|
||||
|
||||
$modal_radius: 9px;
|
||||
$button_radius: 5px;
|
||||
$panel-corner-radius: $button_radius + 1;
|
||||
|
||||
$_trough_color: transparentize($fg_color, 0.9);
|
||||
$_bubble_borders_color: lighten($borders_color, if($variant=='light', 0%, 5%));
|
||||
@@ -46,7 +48,7 @@ stage {
|
||||
|
||||
/* Buttons */
|
||||
.button, %button {
|
||||
border-radius: 5px;
|
||||
border-radius: $button_radius;
|
||||
border-width: 1px;
|
||||
min-height: 22px;
|
||||
padding: 4px 32px;
|
||||
@@ -68,21 +70,21 @@ stage {
|
||||
border-top: 1px solid $_bubble_borders_color;
|
||||
|
||||
&:first-child {
|
||||
border-radius: 0px 0px 0px $medium_radius;
|
||||
border-radius: 0px 0px 0px $modal_radius;
|
||||
}
|
||||
&:last-child {
|
||||
border-right-width: 0px;
|
||||
border-radius: 0px 0px $medium_radius 0px;
|
||||
border-radius: 0px 0px $modal_radius 0px;
|
||||
}
|
||||
&:first-child:last-child {
|
||||
border-right-width: 0px;
|
||||
border-radius: 0px 0px $medium_radius $medium_radius;
|
||||
border-radius: 0px 0px $modal_radius $modal_radius;
|
||||
}
|
||||
}
|
||||
|
||||
/* Entries */
|
||||
StEntry {
|
||||
border-radius: 5px;
|
||||
border-radius: $button_radius;
|
||||
padding: 4px;
|
||||
border-width: 1px;
|
||||
color: $fg_color;
|
||||
@@ -146,8 +148,7 @@ StScrollBar {
|
||||
-slider-handle-radius: 8px;
|
||||
-slider-handle-border-width: 1px;
|
||||
-slider-handle-border-color: $borders_color;
|
||||
color: $bg_color; /* FIXME to match gtk, we'd need to style the border of the slider, not
|
||||
the whole widget */
|
||||
color: if($variant == 'light', lighten($bg_color, 10%), darken($bg_color,4%));
|
||||
&:hover { color: $_hover_bg_color; }
|
||||
&:active { color: $_active_bg_color; }
|
||||
}
|
||||
@@ -193,7 +194,7 @@ StScrollBar {
|
||||
.flashspot { background-color: white; }
|
||||
|
||||
.modal-dialog {
|
||||
border-radius: 9px;
|
||||
border-radius: $modal_radius;
|
||||
@extend %bubble-panel;
|
||||
.modal-dialog-content-box {
|
||||
padding: 24px;
|
||||
@@ -590,7 +591,7 @@ StScrollBar {
|
||||
}
|
||||
.popup-menu-boxpointer,
|
||||
.candidate-popup-boxpointer {
|
||||
-arrow-border-radius: $medium_radius;
|
||||
-arrow-border-radius: $button_radius+4;
|
||||
-arrow-background-color: $bg_color;
|
||||
-arrow-border-width: 1px;
|
||||
-arrow-border-color: if($variant=='light', transparentize(black, 0.6), $borders_color);
|
||||
@@ -609,6 +610,13 @@ StScrollBar {
|
||||
border-bottom-style: solid;
|
||||
}
|
||||
|
||||
// Rename popup
|
||||
.rename-folder-popup {
|
||||
.rename-folder-popup-item {
|
||||
spacing: 6px;
|
||||
&:ltr, &:rtl { padding: 0, 12px; }
|
||||
}
|
||||
}
|
||||
|
||||
// Background menu
|
||||
.background-menu { -boxpointer-gap: 4px; -arrow-rise: 0px; }
|
||||
@@ -618,6 +626,18 @@ StScrollBar {
|
||||
app menu inside the main app window itself rather than the top bar
|
||||
*/
|
||||
|
||||
/*************
|
||||
* App Icons *
|
||||
*************/
|
||||
/* Outline for low res icons */
|
||||
.lowres-icon {
|
||||
icon-shadow: 0 1px 2px rgba(0,0,0,0.3);
|
||||
}
|
||||
|
||||
/* Drapshadow for large icons */
|
||||
.icon-dropshadow {
|
||||
icon-shadow: 0 1px 2px rgba(0,0,0,0.4);
|
||||
}
|
||||
|
||||
/* OSD */
|
||||
.osd-window {
|
||||
@@ -727,8 +747,9 @@ StScrollBar {
|
||||
spacing: 8px;
|
||||
}
|
||||
|
||||
.ws-switcher-active-up, .ws-switcher-active-down {
|
||||
height: 50px;
|
||||
.ws-switcher-active-up, .ws-switcher-active-down,
|
||||
.ws-switcher-active-left, .ws-switcher-active-right {
|
||||
height: 52px;
|
||||
background-color: $selected_bg_color;
|
||||
color: $selected_fg_color;
|
||||
background-size: 32px;
|
||||
@@ -928,7 +949,7 @@ StScrollBar {
|
||||
.world-clocks-button,
|
||||
.weather-button,
|
||||
.events-section-title {
|
||||
&:hover, focus { background-color: $_hover_bg_color }
|
||||
&:hover, &:focus { background-color: $_hover_bg_color }
|
||||
&:active { background-color: $_active_bg_color }
|
||||
}
|
||||
|
||||
@@ -999,7 +1020,7 @@ StScrollBar {
|
||||
background-color: transparent;
|
||||
width: 32px;
|
||||
border-radius: 4px;
|
||||
&:hover, focus { background-color: $_hover_bg_color; }
|
||||
&:hover, &:focus { background-color: $_hover_bg_color; }
|
||||
&:active { background-color: transparentize($fg_color, 0.84); }
|
||||
}
|
||||
|
||||
@@ -1015,7 +1036,7 @@ StScrollBar {
|
||||
margin: 2px;
|
||||
border-radius: 1.4em;
|
||||
font-feature-settings: "tnum";
|
||||
&:hover, focus { background-color: $_hover_bg_color; }
|
||||
&:hover, &:focus { background-color: $_hover_bg_color; }
|
||||
&:active,&:selected {
|
||||
color: lighten($selected_fg_color,5%);
|
||||
background-color: $selected_bg_color;
|
||||
@@ -1156,13 +1177,7 @@ StScrollBar {
|
||||
|
||||
// a little unstructured mess:
|
||||
|
||||
.system-switch-user-submenu-icon {
|
||||
icon-size: 16px;
|
||||
padding: 0 4px;
|
||||
}
|
||||
|
||||
#appMenu {
|
||||
spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg");
|
||||
spacing: 4px;
|
||||
|
||||
.label-shadow { color: transparent; }
|
||||
@@ -1330,8 +1345,8 @@ StScrollBar {
|
||||
|
||||
.window-clone-border {
|
||||
$_bg: transparentize(white, 0.65);
|
||||
border: 5px solid $_bg;
|
||||
border-radius: 6px;
|
||||
border: 7px solid $_bg;
|
||||
border-radius: $modal_radius;
|
||||
// For window decorations with round corners we can't match
|
||||
// the exact shape when the window is scaled. So apply a shadow
|
||||
// to fix that case
|
||||
@@ -1368,11 +1383,8 @@ StScrollBar {
|
||||
|
||||
//search results
|
||||
|
||||
#searchResultsBin {
|
||||
max-width: 1000px;
|
||||
}
|
||||
|
||||
#searchResultsContent {
|
||||
max-width: 1000px;
|
||||
padding-left: 20px;
|
||||
padding-right: 20px;
|
||||
spacing: 16px;
|
||||
@@ -1488,11 +1500,11 @@ StScrollBar {
|
||||
.search-provider-icon,
|
||||
.list-search-result {
|
||||
@extend %icon_tile;
|
||||
&:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
|
||||
&:focus, &:selected, &:hover {
|
||||
background-color: transparentize($osd_fg_color,.9);
|
||||
transition-duration: 200ms;
|
||||
}
|
||||
&:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
|
||||
}
|
||||
.app-well-app,
|
||||
.app-well-app.app-folder,
|
||||
@@ -1501,10 +1513,6 @@ StScrollBar {
|
||||
& .overview-icon {
|
||||
@extend %icon_tile;
|
||||
}
|
||||
&:active .overview-icon,
|
||||
&:checked .overview-icon {
|
||||
background-color: transparentize(darken($osd_bg_color,10%), 0.5);
|
||||
}
|
||||
&:hover .overview-icon,
|
||||
&:focus .overview-icon,
|
||||
&:selected .overview-icon {
|
||||
@@ -1513,7 +1521,13 @@ StScrollBar {
|
||||
border-image: none;
|
||||
background-image: none;
|
||||
}
|
||||
|
||||
&:drop .overview-icon {
|
||||
background-color: transparentize($selected_bg_color,.15);
|
||||
}
|
||||
&:active .overview-icon,
|
||||
&:checked .overview-icon {
|
||||
background-color: transparentize(darken($osd_bg_color,10%), 0.5);
|
||||
}
|
||||
}
|
||||
|
||||
.app-well-app-running-dot { //running apps indicator
|
||||
@@ -1524,7 +1538,7 @@ StScrollBar {
|
||||
|
||||
%icon_tile {
|
||||
color: $osd_fg_color;
|
||||
border-radius: $medium_radius;
|
||||
border-radius: $button_radius+4;
|
||||
padding: 6px;
|
||||
border: 1px solid transparent;
|
||||
transition-duration: 100ms;
|
||||
@@ -1603,7 +1617,6 @@ StScrollBar {
|
||||
}
|
||||
|
||||
//Some hacks I don't even
|
||||
.search-display > StBoxLayout,
|
||||
.all-apps,
|
||||
.frequent-apps > StBoxLayout {
|
||||
// horizontal padding to make sure scrollbars or dash don't overlap content
|
||||
@@ -1631,7 +1644,7 @@ StScrollBar {
|
||||
font-size: 11pt;
|
||||
width: 34em;
|
||||
margin: 5px;
|
||||
border-radius: $medium-radius;
|
||||
border-radius: $modal_radius;
|
||||
border: if($variant == 'light', none, $_bubble_borders_color);
|
||||
min-height: 64px;
|
||||
box-shadow: 0 1px 2px transparentize(black, 0.7);
|
||||
@@ -1783,30 +1796,36 @@ StScrollBar {
|
||||
}
|
||||
|
||||
.keyboard-key {
|
||||
background-color: #393f3f;
|
||||
$_key_bg: opacify(lighten($osd_bg_color, 9%), 1);
|
||||
background-color: $_key_bg;
|
||||
min-height: 1.2em;
|
||||
min-width: 1.2em;
|
||||
font-size: 16pt;
|
||||
border-radius: 3px;
|
||||
border: 1px solid #464d4d;
|
||||
color: #e5e5e5;
|
||||
border-radius: $button_radius;
|
||||
border: 1px solid $osd_outer_borders_color;
|
||||
color: $osd_fg_color;
|
||||
&:focus { @include button(focus); }
|
||||
&:hover,&:checked { @include button(hover); }
|
||||
&:active { @include button(active);}
|
||||
&:hover, &:checked { background-color: lighten($_key_bg, 3%); }
|
||||
&:active { background-color: darken($_key_bg, 2%); }
|
||||
&:grayed { //FIXME
|
||||
background-color: $osd_bg_color;
|
||||
color: $osd_fg_color;
|
||||
border-color: $osd_borders_color;
|
||||
}
|
||||
&.default-key {
|
||||
border-color: #2d3232;
|
||||
background-color: #1d2020;
|
||||
$_default_key_bg: opacify($osd_bg_color, 1);
|
||||
border-color: $osd_outer_borders_color;
|
||||
background-color: $_default_key_bg;
|
||||
background-size: 20px;
|
||||
&:hover, &:checked { background-color: lighten($_default_key_bg, 3%); }
|
||||
&:active { background-color: darken($_default_key_bg, 2%); }
|
||||
}
|
||||
&.enter-key {
|
||||
border-color: #005684;
|
||||
background-color: #006098;
|
||||
border-color: lighten($selected_bg_color, 5%);
|
||||
background-color: $selected_bg_color;
|
||||
background-image: url("resource:///org/gnome/shell/theme/key-enter.svg");
|
||||
&:hover, &:checked { background-color: lighten($selected_bg_color, 3%); }
|
||||
&:active { background-color: darken($selected_bg_color, 2%); }
|
||||
}
|
||||
&.shift-key-lowercase {
|
||||
background-image: url("resource:///org/gnome/shell/theme/key-shift.svg");
|
||||
@@ -1845,8 +1864,8 @@ StScrollBar {
|
||||
|
||||
.emoji-panel {
|
||||
.keyboard-key:latched {
|
||||
border-color: #005684;
|
||||
background-color: #006098;
|
||||
border-color: lighten($selected_bg_color, 5%);
|
||||
background-color: $selected_bg_color;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1910,7 +1929,7 @@ StScrollBar {
|
||||
|
||||
StEntry {
|
||||
@extend %search_entry;
|
||||
border-radius: 5px;
|
||||
border-radius: $button_radius;
|
||||
@if $variant=='dark' {
|
||||
$_gdm_entry_bg: transparentize(lighten(desaturate(#241f31, 20%), 2%), 0.5);
|
||||
background-color: $_gdm_entry_bg;
|
||||
|
||||
@@ -28,7 +28,7 @@ foreach iface : ifaces
|
||||
output: 'doc-gen-' + iface[1],
|
||||
command: [
|
||||
'gdbus-codegen',
|
||||
'--interface-prefix=@0@.'.format(iface),
|
||||
'--interface-prefix=@0@.'.format(iface[0]),
|
||||
'--generate-docbook', 'doc-gen',
|
||||
'--output-directory', '@OUTDIR@',
|
||||
'@INPUT@'
|
||||
|
||||
@@ -31,34 +31,34 @@ its dependencies to build from tarballs.</description>
|
||||
<programming-language>JavaScript</programming-language>
|
||||
<programming-language>C</programming-language>
|
||||
|
||||
<maintainer>
|
||||
<author>
|
||||
<foaf:Person>
|
||||
<foaf:name>William Jon McCann</foaf:name>
|
||||
<foaf:mbox rdf:resource="mailto:jmccann@redhat.com" />
|
||||
<gnome:userid>mccann</gnome:userid>
|
||||
</foaf:Person>
|
||||
</maintainer>
|
||||
<maintainer>
|
||||
</author>
|
||||
<author>
|
||||
<foaf:Person>
|
||||
<foaf:name>Owen Taylor</foaf:name>
|
||||
<foaf:mbox rdf:resource="mailto:otaylor@redhat.com" />
|
||||
<gnome:userid>otaylor</gnome:userid>
|
||||
</foaf:Person>
|
||||
</maintainer>
|
||||
<maintainer>
|
||||
</author>
|
||||
<author>
|
||||
<foaf:Person>
|
||||
<foaf:name>Colin Walters</foaf:name>
|
||||
<foaf:mbox rdf:resource="mailto:walters@verbum.org" />
|
||||
<gnome:userid>walters</gnome:userid>
|
||||
</foaf:Person>
|
||||
</maintainer>
|
||||
<maintainer>
|
||||
</author>
|
||||
<author>
|
||||
<foaf:Person>
|
||||
<foaf:name>Marina Zhurakhinskaya</foaf:name>
|
||||
<foaf:mbox rdf:resource="mailto:marinaz@redhat.com" />
|
||||
<gnome:userid>marinaz</gnome:userid>
|
||||
</foaf:Person>
|
||||
</maintainer>
|
||||
</author>
|
||||
<maintainer>
|
||||
<foaf:Person>
|
||||
<foaf:name>Florian Müllner</foaf:name>
|
||||
|
||||
@@ -1,3 +1,7 @@
|
||||
/* exported main */
|
||||
imports.gi.versions.Gdk = '3.0';
|
||||
imports.gi.versions.Gtk = '3.0';
|
||||
|
||||
const Gettext = imports.gettext;
|
||||
const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi;
|
||||
const Format = imports.format;
|
||||
@@ -8,6 +12,8 @@ const Config = imports.misc.config;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const { ExtensionState } = ExtensionUtils;
|
||||
|
||||
const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions');
|
||||
const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface);
|
||||
|
||||
@@ -17,74 +23,54 @@ function stripPrefix(string, prefix) {
|
||||
return string;
|
||||
}
|
||||
|
||||
var Application = class {
|
||||
constructor() {
|
||||
var Application = GObject.registerClass({
|
||||
GTypeName: 'ExtensionPrefs_Application'
|
||||
}, class Application extends Gtk.Application {
|
||||
_init() {
|
||||
GLib.set_prgname('gnome-shell-extension-prefs');
|
||||
this.application = new Gtk.Application({
|
||||
super._init({
|
||||
application_id: 'org.gnome.shell.ExtensionPrefs',
|
||||
flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
|
||||
});
|
||||
|
||||
this.application.connect('activate', this._onActivate.bind(this));
|
||||
this.application.connect('command-line', this._onCommandLine.bind(this));
|
||||
this.application.connect('startup', this._onStartup.bind(this));
|
||||
|
||||
this._extensionPrefsModules = {};
|
||||
|
||||
this._startupUuid = null;
|
||||
this._loaded = false;
|
||||
this._skipMainWindow = false;
|
||||
this._shellProxy = null;
|
||||
}
|
||||
|
||||
_extensionAvailable(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
get shellProxy() {
|
||||
return this._shellProxy;
|
||||
}
|
||||
|
||||
if (!extension)
|
||||
_showPrefs(uuid) {
|
||||
let row = this._extensionSelector.get_children().find(c => {
|
||||
return c.uuid === uuid && c.hasPrefs;
|
||||
});
|
||||
|
||||
if (!row)
|
||||
return false;
|
||||
|
||||
if (!extension.dir.get_child('prefs.js').query_exists(null))
|
||||
return false;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
_getExtensionPrefsModule(extension) {
|
||||
let uuid = extension.metadata.uuid;
|
||||
|
||||
if (this._extensionPrefsModules.hasOwnProperty(uuid))
|
||||
return this._extensionPrefsModules[uuid];
|
||||
|
||||
ExtensionUtils.installImporter(extension);
|
||||
|
||||
let prefsModule = extension.imports.prefs;
|
||||
prefsModule.init(extension.metadata);
|
||||
|
||||
this._extensionPrefsModules[uuid] = prefsModule;
|
||||
return prefsModule;
|
||||
}
|
||||
|
||||
_selectExtension(uuid) {
|
||||
if (!this._extensionAvailable(uuid))
|
||||
return;
|
||||
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
let widget;
|
||||
|
||||
try {
|
||||
let prefsModule = this._getExtensionPrefsModule(extension);
|
||||
widget = prefsModule.buildPrefsWidget();
|
||||
widget = row.prefsModule.buildPrefsWidget();
|
||||
} catch (e) {
|
||||
widget = this._buildErrorUI(extension, e);
|
||||
widget = this._buildErrorUI(row, e);
|
||||
}
|
||||
|
||||
let dialog = new Gtk.Window({ modal: !this._skipMainWindow,
|
||||
type_hint: Gdk.WindowTypeHint.DIALOG });
|
||||
dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true,
|
||||
title: extension.metadata.name,
|
||||
visible: true }));
|
||||
let dialog = new Gtk.Window({
|
||||
modal: !this._skipMainWindow,
|
||||
type_hint: Gdk.WindowTypeHint.DIALOG
|
||||
});
|
||||
dialog.set_titlebar(new Gtk.HeaderBar({
|
||||
show_close_button: true,
|
||||
title: row.name,
|
||||
visible: true
|
||||
}));
|
||||
|
||||
if (this._skipMainWindow) {
|
||||
this.application.add_window(dialog);
|
||||
this.add_window(dialog);
|
||||
if (this._window)
|
||||
this._window.destroy();
|
||||
this._window = dialog;
|
||||
@@ -96,9 +82,11 @@ var Application = class {
|
||||
dialog.set_default_size(600, 400);
|
||||
dialog.add(widget);
|
||||
dialog.show();
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
_buildErrorUI(extension, exc) {
|
||||
_buildErrorUI(row, exc) {
|
||||
let scroll = new Gtk.ScrolledWindow({
|
||||
hscrollbar_policy: Gtk.PolicyType.NEVER,
|
||||
propagate_natural_height: true
|
||||
@@ -168,13 +156,20 @@ var Application = class {
|
||||
|
||||
copyButton.connect('clicked', w => {
|
||||
let clipboard = Gtk.Clipboard.get_default(w.get_display());
|
||||
let backticks = '```';
|
||||
clipboard.set_text(
|
||||
// markdown for pasting in gitlab issues
|
||||
`The settings of extension ${extension.uuid} had an error:\n${
|
||||
backticks}\n${exc}\n${backticks}\n\nStack trace:\n${
|
||||
backticks}\n${exc.stack}${backticks}\n`, -1
|
||||
);
|
||||
// markdown for pasting in gitlab issues
|
||||
let lines = [
|
||||
`The settings of extension ${row.uuid} had an error:`,
|
||||
'```',
|
||||
`${exc}`,
|
||||
'```',
|
||||
'',
|
||||
'Stack trace:',
|
||||
'```',
|
||||
exc.stack.replace(/\n$/, ''), // stack without trailing newline
|
||||
'```',
|
||||
''
|
||||
];
|
||||
clipboard.set_text(lines.join('\n'), -1);
|
||||
});
|
||||
|
||||
let spacing = new Gtk.SeparatorToolItem({ draw: false });
|
||||
@@ -185,13 +180,13 @@ var Application = class {
|
||||
label: _("Homepage"),
|
||||
tooltip_text: _("Visit extension homepage"),
|
||||
no_show_all: true,
|
||||
visible: extension.metadata.url != null
|
||||
visible: row.url != null
|
||||
});
|
||||
toolbar.add(urlButton);
|
||||
|
||||
urlButton.connect('clicked', w => {
|
||||
let context = w.get_display().get_app_launch_context();
|
||||
Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context);
|
||||
Gio.AppInfo.launch_default_for_uri(row.url, context);
|
||||
});
|
||||
|
||||
let expandedBox = new Gtk.Box({
|
||||
@@ -206,8 +201,8 @@ var Application = class {
|
||||
return scroll;
|
||||
}
|
||||
|
||||
_buildUI(app) {
|
||||
this._window = new Gtk.ApplicationWindow({ application: app,
|
||||
_buildUI() {
|
||||
this._window = new Gtk.ApplicationWindow({ application: this,
|
||||
window_position: Gtk.WindowPosition.CENTER });
|
||||
|
||||
this._window.set_default_size(800, 500);
|
||||
@@ -241,18 +236,14 @@ var Application = class {
|
||||
this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder');
|
||||
|
||||
this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell');
|
||||
this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => {
|
||||
if (ExtensionUtils.extensions[uuid] !== undefined)
|
||||
this._scanExtensions();
|
||||
});
|
||||
this._shellProxy.connectSignal('ExtensionStateChanged',
|
||||
this._onExtensionStateChanged.bind(this));
|
||||
|
||||
this._window.show_all();
|
||||
}
|
||||
|
||||
_sortList(row1, row2) {
|
||||
let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name;
|
||||
let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name;
|
||||
return name1.localeCompare(name2);
|
||||
return row1.name.localeCompare(row2.name);
|
||||
}
|
||||
|
||||
_updateHeader(row, before) {
|
||||
@@ -263,19 +254,56 @@ var Application = class {
|
||||
row.set_header(sep);
|
||||
}
|
||||
|
||||
_scanExtensions() {
|
||||
let finder = new ExtensionUtils.ExtensionFinder();
|
||||
finder.connect('extension-found', this._extensionFound.bind(this));
|
||||
finder.scanExtensions();
|
||||
this._extensionsLoaded();
|
||||
_findExtensionRow(uuid) {
|
||||
return this._extensionSelector.get_children().find(c => c.uuid === uuid);
|
||||
}
|
||||
|
||||
_extensionFound(finder, extension) {
|
||||
let row = new ExtensionRow(extension.uuid);
|
||||
_onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
|
||||
let row = this._findExtensionRow(uuid);
|
||||
if (row) {
|
||||
let { state } = ExtensionUtils.deserializeExtension(newState);
|
||||
if (state == ExtensionState.UNINSTALLED)
|
||||
row.destroy();
|
||||
return; // we only deal with new and deleted extensions here
|
||||
}
|
||||
|
||||
this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
|
||||
let extension = ExtensionUtils.deserializeExtension(serialized);
|
||||
if (!extension)
|
||||
return;
|
||||
// check the extension wasn't added in between
|
||||
if (this._findExtensionRow(uuid) != null)
|
||||
return;
|
||||
this._addExtensionRow(extension);
|
||||
});
|
||||
}
|
||||
|
||||
_scanExtensions() {
|
||||
this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => {
|
||||
if (e) {
|
||||
if (e instanceof Gio.DBusError) {
|
||||
log(`Failed to connect to shell proxy: ${e}`);
|
||||
this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
|
||||
this._mainStack.visible_child_name = 'noshell';
|
||||
} else {
|
||||
throw e;
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
for (let uuid in extensionsMap) {
|
||||
let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]);
|
||||
this._addExtensionRow(extension);
|
||||
}
|
||||
this._extensionsLoaded();
|
||||
});
|
||||
}
|
||||
|
||||
_addExtensionRow(extension) {
|
||||
let row = new ExtensionRow(extension);
|
||||
|
||||
row.prefsButton.visible = this._extensionAvailable(row.uuid);
|
||||
row.prefsButton.connect('clicked', () => {
|
||||
this._selectExtension(row.uuid);
|
||||
this._showPrefs(row.uuid);
|
||||
});
|
||||
|
||||
row.show_all();
|
||||
@@ -288,24 +316,26 @@ var Application = class {
|
||||
else
|
||||
this._mainStack.visible_child_name = 'placeholder';
|
||||
|
||||
if (this._startupUuid && this._extensionAvailable(this._startupUuid))
|
||||
this._selectExtension(this._startupUuid);
|
||||
if (this._startupUuid)
|
||||
this._showPrefs(this._startupUuid);
|
||||
this._startupUuid = null;
|
||||
this._skipMainWindow = false;
|
||||
this._loaded = true;
|
||||
}
|
||||
|
||||
_onActivate() {
|
||||
vfunc_activate() {
|
||||
this._window.present();
|
||||
}
|
||||
|
||||
_onStartup(app) {
|
||||
this._buildUI(app);
|
||||
vfunc_startup() {
|
||||
super.vfunc_startup();
|
||||
|
||||
this._buildUI();
|
||||
this._scanExtensions();
|
||||
}
|
||||
|
||||
_onCommandLine(app, commandLine) {
|
||||
app.activate();
|
||||
vfunc_command_line(commandLine) {
|
||||
this.activate();
|
||||
let args = commandLine.get_arguments();
|
||||
|
||||
if (args.length) {
|
||||
@@ -316,16 +346,14 @@ var Application = class {
|
||||
// Strip off "extension:///" prefix which fakes a URI, if it exists
|
||||
uuid = stripPrefix(uuid, "extension:///");
|
||||
|
||||
if (this._extensionAvailable(uuid))
|
||||
this._selectExtension(uuid);
|
||||
else if (!this._loaded)
|
||||
if (!this._loaded)
|
||||
this._startupUuid = uuid;
|
||||
else
|
||||
else if (!this._showPrefs(uuid))
|
||||
this._skipMainWindow = false;
|
||||
}
|
||||
return 0;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var Expander = GObject.registerClass({
|
||||
Properties: {
|
||||
@@ -492,6 +520,35 @@ class EmptyPlaceholder extends Gtk.Box {
|
||||
}
|
||||
});
|
||||
|
||||
var NoShellPlaceholder = GObject.registerClass(
|
||||
class NoShellPlaceholder extends Gtk.Box {
|
||||
_init() {
|
||||
super._init({
|
||||
orientation: Gtk.Orientation.VERTICAL,
|
||||
spacing: 12,
|
||||
margin: 100,
|
||||
margin_bottom: 60
|
||||
});
|
||||
|
||||
let label = new Gtk.Label({
|
||||
label: '<span size="x-large">%s</span>'.format(
|
||||
_("Something’s gone wrong")),
|
||||
use_markup: true
|
||||
});
|
||||
label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
|
||||
this.add(label);
|
||||
|
||||
label = new Gtk.Label({
|
||||
label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
|
||||
justify: Gtk.Justification.CENTER,
|
||||
wrap: true
|
||||
});
|
||||
this.add(label);
|
||||
|
||||
this.show_all();
|
||||
}
|
||||
});
|
||||
|
||||
var DescriptionLabel = GObject.registerClass(
|
||||
class DescriptionLabel extends Gtk.Label {
|
||||
vfunc_get_preferred_height_for_width(width) {
|
||||
@@ -504,30 +561,59 @@ class DescriptionLabel extends Gtk.Label {
|
||||
|
||||
var ExtensionRow = GObject.registerClass(
|
||||
class ExtensionRow extends Gtk.ListBoxRow {
|
||||
_init(uuid) {
|
||||
_init(extension) {
|
||||
super._init();
|
||||
|
||||
this.uuid = uuid;
|
||||
this._app = Gio.Application.get_default();
|
||||
this._extension = extension;
|
||||
this._prefsModule = null;
|
||||
|
||||
this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' });
|
||||
this._settings.connect('changed::enabled-extensions', () => {
|
||||
this._switch.state = this._isEnabled();
|
||||
});
|
||||
this._settings.connect('changed::disable-extension-version-validation',
|
||||
() => {
|
||||
this._switch.sensitive = this._canEnable();
|
||||
});
|
||||
this._settings.connect('changed::disable-user-extensions',
|
||||
() => {
|
||||
this._switch.sensitive = this._canEnable();
|
||||
});
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
|
||||
this._buildUI();
|
||||
|
||||
this._extensionStateChangedId = this._app.shellProxy.connectSignal(
|
||||
'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
|
||||
if (this.uuid !== uuid)
|
||||
return;
|
||||
|
||||
this._extension = ExtensionUtils.deserializeExtension(newState);
|
||||
let state = (this._extension.state == ExtensionState.ENABLED);
|
||||
|
||||
GObject.signal_handler_block(this._switch, this._notifyActiveId);
|
||||
this._switch.state = state;
|
||||
GObject.signal_handler_unblock(this._switch, this._notifyActiveId);
|
||||
|
||||
this._switch.sensitive = this._canToggle();
|
||||
});
|
||||
}
|
||||
|
||||
get uuid() {
|
||||
return this._extension.uuid;
|
||||
}
|
||||
|
||||
get name() {
|
||||
return this._extension.metadata.name;
|
||||
}
|
||||
|
||||
get hasPrefs() {
|
||||
return this._extension.hasPrefs;
|
||||
}
|
||||
|
||||
get url() {
|
||||
return this._extension.metadata.url;
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
if (!this._app.shellProxy)
|
||||
return;
|
||||
|
||||
if (this._extensionStateChangedId)
|
||||
this._app.shellProxy.disconnectSignal(this._extensionStateChangedId);
|
||||
this._extensionStateChangedId = 0;
|
||||
}
|
||||
|
||||
_buildUI() {
|
||||
let extension = ExtensionUtils.extensions[this.uuid];
|
||||
|
||||
let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL,
|
||||
hexpand: true, margin_end: 24, spacing: 24,
|
||||
margin: 12 });
|
||||
@@ -537,19 +623,20 @@ class ExtensionRow extends Gtk.ListBoxRow {
|
||||
spacing: 6, hexpand: true });
|
||||
hbox.add(vbox);
|
||||
|
||||
let name = GLib.markup_escape_text(extension.metadata.name, -1);
|
||||
let name = GLib.markup_escape_text(this.name, -1);
|
||||
let label = new Gtk.Label({ label: '<b>' + name + '</b>',
|
||||
use_markup: true,
|
||||
halign: Gtk.Align.START });
|
||||
vbox.add(label);
|
||||
|
||||
let desc = extension.metadata.description.split('\n')[0];
|
||||
let desc = this._extension.metadata.description.split('\n')[0];
|
||||
label = new DescriptionLabel({ label: desc, wrap: true, lines: 2,
|
||||
ellipsize: Pango.EllipsizeMode.END,
|
||||
xalign: 0, yalign: 0 });
|
||||
vbox.add(label);
|
||||
|
||||
let button = new Gtk.Button({ valign: Gtk.Align.CENTER,
|
||||
visible: this.hasPrefs,
|
||||
no_show_all: true });
|
||||
button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic',
|
||||
icon_size: Gtk.IconSize.BUTTON,
|
||||
@@ -559,51 +646,37 @@ class ExtensionRow extends Gtk.ListBoxRow {
|
||||
|
||||
this.prefsButton = button;
|
||||
|
||||
this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER,
|
||||
sensitive: this._canEnable(),
|
||||
state: this._isEnabled() });
|
||||
this._switch.connect('notify::active', () => {
|
||||
this._switch = new Gtk.Switch({
|
||||
valign: Gtk.Align.CENTER,
|
||||
sensitive: this._canToggle(),
|
||||
state: this._extension.state === ExtensionState.ENABLED
|
||||
});
|
||||
this._notifyActiveId = this._switch.connect('notify::active', () => {
|
||||
if (this._switch.active)
|
||||
this._enable();
|
||||
this._app.shellProxy.EnableExtensionRemote(this.uuid);
|
||||
else
|
||||
this._disable();
|
||||
this._app.shellProxy.DisableExtensionRemote(this.uuid);
|
||||
});
|
||||
this._switch.connect('state-set', () => true);
|
||||
hbox.add(this._switch);
|
||||
}
|
||||
|
||||
_canEnable() {
|
||||
let extension = ExtensionUtils.extensions[this.uuid];
|
||||
let checkVersion = !this._settings.get_boolean('disable-extension-version-validation');
|
||||
|
||||
return !this._settings.get_boolean('disable-user-extensions') &&
|
||||
!(checkVersion && ExtensionUtils.isOutOfDate(extension));
|
||||
_canToggle() {
|
||||
return this._extension.canChange;
|
||||
}
|
||||
|
||||
_isEnabled() {
|
||||
let extensions = this._settings.get_strv('enabled-extensions');
|
||||
return extensions.indexOf(this.uuid) != -1;
|
||||
}
|
||||
get prefsModule() {
|
||||
if (!this._prefsModule) {
|
||||
ExtensionUtils.installImporter(this._extension);
|
||||
|
||||
_enable() {
|
||||
let extensions = this._settings.get_strv('enabled-extensions');
|
||||
if (extensions.indexOf(this.uuid) != -1)
|
||||
return;
|
||||
// give extension prefs access to their own extension object
|
||||
ExtensionUtils.getCurrentExtension = () => this._extension;
|
||||
|
||||
extensions.push(this.uuid);
|
||||
this._settings.set_strv('enabled-extensions', extensions);
|
||||
}
|
||||
this._prefsModule = this._extension.imports.prefs;
|
||||
this._prefsModule.init(this._extension.metadata);
|
||||
}
|
||||
|
||||
_disable() {
|
||||
let extensions = this._settings.get_strv('enabled-extensions');
|
||||
let pos = extensions.indexOf(this.uuid);
|
||||
if (pos == -1)
|
||||
return;
|
||||
do {
|
||||
extensions.splice(pos, 1);
|
||||
pos = extensions.indexOf(this.uuid);
|
||||
} while (pos != -1);
|
||||
this._settings.set_strv('enabled-extensions', extensions);
|
||||
return this._prefsModule;
|
||||
}
|
||||
});
|
||||
|
||||
@@ -611,12 +684,12 @@ function initEnvironment() {
|
||||
// Monkey-patch in a "global" object that fakes some Shell utilities
|
||||
// that ExtensionUtils depends on.
|
||||
window.global = {
|
||||
log() {
|
||||
print([].join.call(arguments, ', '));
|
||||
log(...args) {
|
||||
print(args.join(', '));
|
||||
},
|
||||
|
||||
logError(s) {
|
||||
log('ERROR: ' + s);
|
||||
log(`ERROR: ${s}`);
|
||||
},
|
||||
|
||||
userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell'])
|
||||
@@ -631,6 +704,5 @@ function main(argv) {
|
||||
Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR);
|
||||
Gettext.textdomain(Config.GETTEXT_PACKAGE);
|
||||
|
||||
let app = new Application();
|
||||
app.application.run(argv);
|
||||
new Application().run(argv);
|
||||
}
|
||||
|
||||
@@ -1,21 +1,25 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported AuthPrompt */
|
||||
|
||||
const { Clutter, Pango, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
const { Clutter, GObject, Pango, Shell, St } = imports.gi;
|
||||
|
||||
const Animation = imports.ui.animation;
|
||||
const Batch = imports.gdm.batch;
|
||||
const GdmUtil = imports.gdm.util;
|
||||
const Util = imports.misc.util;
|
||||
const Params = imports.misc.params;
|
||||
const ShellEntry = imports.ui.shellEntry;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const UserWidget = imports.ui.userWidget;
|
||||
|
||||
var DEFAULT_BUTTON_WELL_ICON_SIZE = 16;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000;
|
||||
var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
|
||||
|
||||
var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5;
|
||||
var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
|
||||
|
||||
const WIGGLE_OFFSET = 6;
|
||||
const WIGGLE_DURATION = 65;
|
||||
const N_WIGGLES = 3;
|
||||
|
||||
var AuthPromptMode = {
|
||||
UNLOCK_ONLY: 0,
|
||||
@@ -34,8 +38,21 @@ var BeginRequestType = {
|
||||
DONT_PROVIDE_USERNAME: 1
|
||||
};
|
||||
|
||||
var AuthPrompt = class {
|
||||
constructor(gdmClient, mode) {
|
||||
var AuthPrompt = GObject.registerClass({
|
||||
Signals: {
|
||||
'cancelled': {},
|
||||
'failed': {},
|
||||
'next': {},
|
||||
'prompted': {},
|
||||
'reset': { param_types: [GObject.TYPE_UINT] },
|
||||
}
|
||||
}, class AuthPrompt extends St.BoxLayout {
|
||||
_init(gdmClient, mode) {
|
||||
super._init({
|
||||
style_class: 'login-dialog-prompt-layout',
|
||||
vertical: true
|
||||
});
|
||||
|
||||
this.verificationStatus = AuthPromptStatus.NOT_VERIFYING;
|
||||
|
||||
this._gdmClient = gdmClient;
|
||||
@@ -59,47 +76,42 @@ var AuthPrompt = class {
|
||||
this.smartcardDetected = this._userVerifier.smartcardDetected;
|
||||
|
||||
this.connect('next', () => {
|
||||
this.updateSensitivity(false);
|
||||
this.startSpinning();
|
||||
if (this._queryingService) {
|
||||
this._userVerifier.answerQuery(this._queryingService, this._entry.text);
|
||||
} else {
|
||||
this._preemptiveAnswer = this._entry.text;
|
||||
}
|
||||
});
|
||||
this.updateSensitivity(false);
|
||||
this.startSpinning();
|
||||
if (this._queryingService) {
|
||||
this._userVerifier.answerQuery(this._queryingService, this._entry.text);
|
||||
} else {
|
||||
this._preemptiveAnswer = this._entry.text;
|
||||
}
|
||||
});
|
||||
|
||||
this.actor = new St.BoxLayout({ style_class: 'login-dialog-prompt-layout',
|
||||
vertical: true });
|
||||
this.actor.connect('destroy', this._onDestroy.bind(this));
|
||||
this.actor.connect('key-press-event', (actor, event) => {
|
||||
if (event.get_key_symbol() == Clutter.KEY_Escape)
|
||||
this.cancel();
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
|
||||
this._userWell = new St.Bin({ x_fill: true,
|
||||
x_align: St.Align.START });
|
||||
this.actor.add(this._userWell,
|
||||
{ x_align: St.Align.START,
|
||||
x_fill: true,
|
||||
y_fill: true,
|
||||
expand: true });
|
||||
this._userWell = new St.Bin({ x_fill: true, x_align: St.Align.START });
|
||||
this.add(this._userWell, {
|
||||
x_align: St.Align.START,
|
||||
x_fill: true,
|
||||
y_fill: true,
|
||||
expand: true
|
||||
});
|
||||
this._label = new St.Label({ style_class: 'login-dialog-prompt-label' });
|
||||
|
||||
this.actor.add(this._label,
|
||||
{ expand: true,
|
||||
x_fill: false,
|
||||
y_fill: true,
|
||||
x_align: St.Align.START });
|
||||
this.add(this._label, {
|
||||
expand: true,
|
||||
x_fill: false,
|
||||
y_fill: true,
|
||||
x_align: St.Align.START
|
||||
});
|
||||
this._entry = new St.Entry({ style_class: 'login-dialog-prompt-entry',
|
||||
can_focus: true });
|
||||
ShellEntry.addContextMenu(this._entry, { isPassword: true, actionMode: Shell.ActionMode.NONE });
|
||||
|
||||
this.actor.add(this._entry,
|
||||
{ expand: true,
|
||||
x_fill: true,
|
||||
y_fill: false,
|
||||
x_align: St.Align.START });
|
||||
this.add(this._entry, {
|
||||
expand: true,
|
||||
x_fill: true,
|
||||
y_fill: false,
|
||||
x_align: St.Align.START
|
||||
});
|
||||
|
||||
this._entry.grab_key_focus();
|
||||
|
||||
@@ -107,14 +119,15 @@ var AuthPrompt = class {
|
||||
styleClass: 'login-dialog-message' });
|
||||
this._message.clutter_text.line_wrap = true;
|
||||
this._message.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
|
||||
this.actor.add(this._message, { x_fill: false, x_align: St.Align.START, y_align: St.Align.START });
|
||||
this.add(this._message, { x_fill: false, x_align: St.Align.START, y_align: St.Align.START });
|
||||
|
||||
this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box',
|
||||
vertical: false });
|
||||
this.actor.add(this._buttonBox,
|
||||
{ expand: true,
|
||||
x_align: St.Align.MIDDLE,
|
||||
y_align: St.Align.END });
|
||||
this.add(this._buttonBox, {
|
||||
expand: true,
|
||||
x_align: St.Align.MIDDLE,
|
||||
y_align: St.Align.END
|
||||
});
|
||||
|
||||
this._defaultButtonWell = new St.Widget({ layout_manager: new Clutter.BinLayout() });
|
||||
this._defaultButtonWellActor = null;
|
||||
@@ -122,9 +135,9 @@ var AuthPrompt = class {
|
||||
this._initButtons();
|
||||
|
||||
this._spinner = new Animation.Spinner(DEFAULT_BUTTON_WELL_ICON_SIZE);
|
||||
this._spinner.actor.opacity = 0;
|
||||
this._spinner.actor.show();
|
||||
this._defaultButtonWell.add_child(this._spinner.actor);
|
||||
this._spinner.opacity = 0;
|
||||
this._spinner.show();
|
||||
this._defaultButtonWell.add_child(this._spinner);
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
@@ -132,13 +145,19 @@ var AuthPrompt = class {
|
||||
this._userVerifier = null;
|
||||
}
|
||||
|
||||
vfunc_key_press_event(keyPressEvent) {
|
||||
if (keyPressEvent.keyval == Clutter.KEY_Escape)
|
||||
this.cancel();
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
|
||||
_initButtons() {
|
||||
this.cancelButton = new St.Button({ style_class: 'modal-dialog-button button',
|
||||
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
|
||||
reactive: true,
|
||||
can_focus: true,
|
||||
label: _("Cancel") });
|
||||
this.cancelButton.connect('clicked', () => { this.cancel(); });
|
||||
this.cancelButton.connect('clicked', () => this.cancel());
|
||||
this._buttonBox.add(this.cancelButton,
|
||||
{ expand: false,
|
||||
x_fill: false,
|
||||
@@ -157,7 +176,7 @@ var AuthPrompt = class {
|
||||
reactive: true,
|
||||
can_focus: true,
|
||||
label: _("Next") });
|
||||
this.nextButton.connect('clicked', () => { this.emit('next'); });
|
||||
this.nextButton.connect('clicked', () => this.emit('next'));
|
||||
this.nextButton.add_style_pseudo_class('default');
|
||||
this._buttonBox.add(this.nextButton,
|
||||
{ expand: false,
|
||||
@@ -242,6 +261,12 @@ var AuthPrompt = class {
|
||||
this.updateSensitivity(canRetry);
|
||||
this.setActorInDefaultButtonWell(null);
|
||||
this.verificationStatus = AuthPromptStatus.VERIFICATION_FAILED;
|
||||
|
||||
Util.wiggle(this._entry, {
|
||||
offset: WIGGLE_OFFSET,
|
||||
duration: WIGGLE_DURATION,
|
||||
wiggleCount: N_WIGGLES,
|
||||
});
|
||||
}
|
||||
|
||||
_onVerificationComplete() {
|
||||
@@ -267,16 +292,16 @@ var AuthPrompt = class {
|
||||
let oldActor = this._defaultButtonWellActor;
|
||||
|
||||
if (oldActor)
|
||||
Tweener.removeTweens(oldActor);
|
||||
oldActor.remove_all_transitions();
|
||||
|
||||
let wasSpinner;
|
||||
if (oldActor == this._spinner.actor)
|
||||
if (oldActor == this._spinner)
|
||||
wasSpinner = true;
|
||||
else
|
||||
wasSpinner = false;
|
||||
|
||||
let isSpinner;
|
||||
if (actor == this._spinner.actor)
|
||||
if (actor == this._spinner)
|
||||
isSpinner = true;
|
||||
else
|
||||
isSpinner = false;
|
||||
@@ -290,19 +315,18 @@ var AuthPrompt = class {
|
||||
this._spinner.stop();
|
||||
}
|
||||
} else {
|
||||
Tweener.addTween(oldActor,
|
||||
{ opacity: 0,
|
||||
time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
|
||||
transition: 'linear',
|
||||
onCompleteScope: this,
|
||||
onComplete() {
|
||||
if (wasSpinner) {
|
||||
if (this._spinner)
|
||||
this._spinner.stop();
|
||||
}
|
||||
}
|
||||
});
|
||||
oldActor.ease({
|
||||
opacity: 0,
|
||||
duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
onComplete: () => {
|
||||
if (wasSpinner) {
|
||||
if (this._spinner)
|
||||
this._spinner.stop();
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -313,18 +337,19 @@ var AuthPrompt = class {
|
||||
if (!animate)
|
||||
actor.opacity = 255;
|
||||
else
|
||||
Tweener.addTween(actor,
|
||||
{ opacity: 255,
|
||||
time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
|
||||
transition: 'linear' });
|
||||
actor.ease({
|
||||
opacity: 255,
|
||||
duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
|
||||
delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
|
||||
mode: Clutter.AnimationMode.LINEAR
|
||||
});
|
||||
}
|
||||
|
||||
this._defaultButtonWellActor = actor;
|
||||
}
|
||||
|
||||
startSpinning() {
|
||||
this.setActorInDefaultButtonWell(this._spinner.actor, true);
|
||||
this.setActorInDefaultButtonWell(this._spinner, true);
|
||||
}
|
||||
|
||||
stopSpinning() {
|
||||
@@ -366,12 +391,12 @@ var AuthPrompt = class {
|
||||
_fadeOutMessage() {
|
||||
if (this._message.opacity == 0)
|
||||
return;
|
||||
Tweener.removeTweens(this._message);
|
||||
Tweener.addTween(this._message,
|
||||
{ opacity: 0,
|
||||
time: MESSAGE_FADE_OUT_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad'
|
||||
});
|
||||
this._message.remove_all_transitions();
|
||||
this._message.ease({
|
||||
opacity: 0,
|
||||
duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
|
||||
setMessage(message, type) {
|
||||
@@ -386,7 +411,7 @@ var AuthPrompt = class {
|
||||
this._message.remove_style_class_name('login-dialog-message-hint');
|
||||
|
||||
if (message) {
|
||||
Tweener.removeTweens(this._message);
|
||||
this._message.remove_all_transitions();
|
||||
this._message.text = message;
|
||||
this._message.opacity = 255;
|
||||
} else {
|
||||
@@ -405,9 +430,9 @@ var AuthPrompt = class {
|
||||
this._entry.clutter_text.editable = sensitive;
|
||||
}
|
||||
|
||||
hide() {
|
||||
vfunc_hide() {
|
||||
this.setActorInDefaultButtonWell(null, true);
|
||||
this.actor.hide();
|
||||
super.vfunc_hide();
|
||||
this._message.opacity = 0;
|
||||
|
||||
this.setUser(null);
|
||||
@@ -423,7 +448,7 @@ var AuthPrompt = class {
|
||||
|
||||
if (user) {
|
||||
let userWidget = new UserWidget.UserWidget(user);
|
||||
this._userWell.set_child(userWidget.actor);
|
||||
this._userWell.set_child(userWidget);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -508,5 +533,4 @@ var AuthPrompt = class {
|
||||
this.reset();
|
||||
this.emit('cancelled');
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(AuthPrompt.prototype);
|
||||
});
|
||||
|
||||
@@ -20,7 +20,7 @@
|
||||
* In order for transformation animations to look good, they need to be
|
||||
* incremental and have some order to them (e.g., fade out hidden items,
|
||||
* then shrink to close the void left over). Chaining animations in this way can
|
||||
* be error-prone and wordy using just Tweener callbacks.
|
||||
* be error-prone and wordy using just ease() callbacks.
|
||||
*
|
||||
* The classes in this file help with this:
|
||||
*
|
||||
@@ -44,6 +44,7 @@
|
||||
* replaced by something else.
|
||||
*/
|
||||
|
||||
const { GObject } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
var Task = class {
|
||||
@@ -176,36 +177,35 @@ Signals.addSignalMethods(Batch.prototype);
|
||||
|
||||
var ConcurrentBatch = class extends Batch {
|
||||
process() {
|
||||
let hold = this.runTask();
|
||||
let hold = this.runTask();
|
||||
|
||||
if (hold) {
|
||||
this.hold.acquireUntilAfter(hold);
|
||||
}
|
||||
if (hold) {
|
||||
this.hold.acquireUntilAfter(hold);
|
||||
}
|
||||
|
||||
// Regardless of the state of the just run task,
|
||||
// fire off the next one, so all the tasks can run
|
||||
// concurrently.
|
||||
this.nextTask();
|
||||
// Regardless of the state of the just run task,
|
||||
// fire off the next one, so all the tasks can run
|
||||
// concurrently.
|
||||
this.nextTask();
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(ConcurrentBatch.prototype);
|
||||
|
||||
var ConsecutiveBatch = class extends Batch {
|
||||
process() {
|
||||
let hold = this.runTask();
|
||||
let hold = this.runTask();
|
||||
|
||||
if (hold && hold.isAcquired()) {
|
||||
// This task is inhibiting the batch. Wait on it
|
||||
// before processing the next one.
|
||||
let signalId = hold.connect('release', () => {
|
||||
hold.disconnect(signalId);
|
||||
this.nextTask();
|
||||
});
|
||||
return;
|
||||
} else {
|
||||
// This task finished, process the next one
|
||||
this.nextTask();
|
||||
}
|
||||
if (hold && hold.isAcquired()) {
|
||||
// This task is inhibiting the batch. Wait on it
|
||||
// before processing the next one.
|
||||
let signalId = hold.connect('release', () => {
|
||||
hold.disconnect(signalId);
|
||||
this.nextTask();
|
||||
});
|
||||
} else {
|
||||
// This task finished, process the next one
|
||||
this.nextTask();
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(ConsecutiveBatch.prototype);
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported FprintManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
|
||||
@@ -23,8 +24,8 @@ function FprintManager() {
|
||||
|
||||
try {
|
||||
self.init(null);
|
||||
} catch(e) {
|
||||
log('Failed to connect to Fprint service: ' + e.message);
|
||||
} catch (e) {
|
||||
log(`Failed to connect to Fprint service: ${e.message}`);
|
||||
return null;
|
||||
}
|
||||
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported LoginDialog */
|
||||
/*
|
||||
* Copyright 2011 Red Hat, Inc
|
||||
*
|
||||
@@ -18,7 +19,6 @@
|
||||
|
||||
const { AccountsService, Atk, Clutter, Gdm, Gio,
|
||||
GLib, GObject, Meta, Pango, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const AuthPrompt = imports.gdm.authPrompt;
|
||||
const Batch = imports.gdm.batch;
|
||||
@@ -30,81 +30,88 @@ const LoginManager = imports.misc.loginManager;
|
||||
const Main = imports.ui.main;
|
||||
const PopupMenu = imports.ui.popupMenu;
|
||||
const Realmd = imports.gdm.realmd;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const UserWidget = imports.ui.userWidget;
|
||||
|
||||
const _FADE_ANIMATION_TIME = 0.25;
|
||||
const _SCROLL_ANIMATION_TIME = 0.5;
|
||||
const _FADE_ANIMATION_TIME = 250;
|
||||
const _SCROLL_ANIMATION_TIME = 500;
|
||||
const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
|
||||
const _LOGO_ICON_HEIGHT = 48;
|
||||
const _MAX_BOTTOM_MENU_ITEMS = 5;
|
||||
|
||||
var UserListItem = class {
|
||||
constructor(user) {
|
||||
var UserListItem = GObject.registerClass({
|
||||
GTypeName: 'LoginDialog_UserListItem',
|
||||
Signals: { 'activate': {} }
|
||||
}, class UserListItem extends St.Button {
|
||||
_init(user) {
|
||||
let layout = new St.BoxLayout({ vertical: true });
|
||||
super._init({
|
||||
style_class: 'login-dialog-user-list-item',
|
||||
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
|
||||
can_focus: true,
|
||||
child: layout,
|
||||
reactive: true,
|
||||
x_align: St.Align.START,
|
||||
x_fill: true
|
||||
});
|
||||
|
||||
this.user = user;
|
||||
this._userChangedId = this.user.connect('changed',
|
||||
this._onUserChanged.bind(this));
|
||||
this._onUserChanged.bind(this));
|
||||
|
||||
let layout = new St.BoxLayout({ vertical: true });
|
||||
this.actor = new St.Button({ style_class: 'login-dialog-user-list-item',
|
||||
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
|
||||
can_focus: true,
|
||||
child: layout,
|
||||
reactive: true,
|
||||
x_align: St.Align.START,
|
||||
x_fill: true });
|
||||
this.actor.connect('destroy', this._onDestroy.bind(this));
|
||||
|
||||
this.actor.connect('key-focus-in', () => {
|
||||
this._setSelected(true);
|
||||
});
|
||||
this.actor.connect('key-focus-out', () => {
|
||||
this._setSelected(false);
|
||||
});
|
||||
this.actor.connect('notify::hover', () => {
|
||||
this._setSelected(this.actor.hover);
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
this.connect('notify::hover', () => {
|
||||
this._setSelected(this.hover);
|
||||
});
|
||||
|
||||
this._userWidget = new UserWidget.UserWidget(this.user);
|
||||
layout.add(this._userWidget.actor);
|
||||
layout.add(this._userWidget);
|
||||
|
||||
this._userWidget.actor.bind_property('label-actor', this.actor, 'label-actor',
|
||||
GObject.BindingFlags.SYNC_CREATE);
|
||||
this._userWidget.bind_property('label-actor', this, 'label-actor',
|
||||
GObject.BindingFlags.SYNC_CREATE);
|
||||
|
||||
this._timedLoginIndicator = new St.Bin({ style_class: 'login-dialog-timed-login-indicator',
|
||||
scale_x: 0,
|
||||
visible: false });
|
||||
layout.add(this._timedLoginIndicator);
|
||||
|
||||
this.actor.connect('clicked', this._onClicked.bind(this));
|
||||
this._onUserChanged();
|
||||
}
|
||||
|
||||
vfunc_key_focus_in() {
|
||||
super.vfunc_key_focus_in();
|
||||
this._setSelected(true);
|
||||
}
|
||||
|
||||
vfunc_key_focus_out() {
|
||||
super.vfunc_key_focus_out();
|
||||
this._setSelected(false);
|
||||
}
|
||||
|
||||
_onUserChanged() {
|
||||
this._updateLoggedIn();
|
||||
}
|
||||
|
||||
_updateLoggedIn() {
|
||||
if (this.user.is_logged_in())
|
||||
this.actor.add_style_pseudo_class('logged-in');
|
||||
this.add_style_pseudo_class('logged-in');
|
||||
else
|
||||
this.actor.remove_style_pseudo_class('logged-in');
|
||||
this.remove_style_pseudo_class('logged-in');
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
this.user.disconnect(this._userChangedId);
|
||||
}
|
||||
|
||||
_onClicked() {
|
||||
vfunc_clicked() {
|
||||
this.emit('activate');
|
||||
}
|
||||
|
||||
_setSelected(selected) {
|
||||
if (selected) {
|
||||
this.actor.add_style_pseudo_class('selected');
|
||||
this.actor.grab_key_focus();
|
||||
this.add_style_pseudo_class('selected');
|
||||
this.grab_key_focus();
|
||||
} else {
|
||||
this.actor.remove_style_pseudo_class('selected');
|
||||
this.remove_style_pseudo_class('selected');
|
||||
}
|
||||
}
|
||||
|
||||
@@ -145,23 +152,30 @@ var UserListItem = class {
|
||||
this._timedLoginIndicator.visible = false;
|
||||
this._timedLoginIndicator.scale_x = 0.;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(UserListItem.prototype);
|
||||
});
|
||||
|
||||
var UserList = class {
|
||||
constructor() {
|
||||
this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view'});
|
||||
this.actor.set_policy(St.PolicyType.NEVER,
|
||||
St.PolicyType.AUTOMATIC);
|
||||
var UserList = GObject.registerClass({
|
||||
GTypeName: 'LoginDialog_UserList',
|
||||
Signals: {
|
||||
'activate': { param_types: [UserListItem.$gtype] },
|
||||
'item-added': { param_types: [UserListItem.$gtype] },
|
||||
}
|
||||
}, class UserList extends St.ScrollView {
|
||||
_init() {
|
||||
super._init({ style_class: 'login-dialog-user-list-view' });
|
||||
this.set_policy(St.PolicyType.NEVER,
|
||||
St.PolicyType.AUTOMATIC);
|
||||
|
||||
this._box = new St.BoxLayout({ vertical: true,
|
||||
style_class: 'login-dialog-user-list',
|
||||
pseudo_class: 'expanded' });
|
||||
|
||||
this.actor.add_actor(this._box);
|
||||
this.add_actor(this._box);
|
||||
this._items = {};
|
||||
}
|
||||
|
||||
this.actor.connect('key-focus-in', this._moveFocusToItems.bind(this));
|
||||
vfunc_key_focus_in() {
|
||||
this._moveFocusToItems();
|
||||
}
|
||||
|
||||
_moveFocusToItems() {
|
||||
@@ -170,10 +184,10 @@ var UserList = class {
|
||||
if (!hasItems)
|
||||
return;
|
||||
|
||||
if (global.stage.get_key_focus() != this.actor)
|
||||
if (global.stage.get_key_focus() != this)
|
||||
return;
|
||||
|
||||
let focusSet = this.actor.navigate_focus(null, St.DirectionType.TAB_FORWARD, false);
|
||||
let focusSet = this.navigate_focus(null, St.DirectionType.TAB_FORWARD, false);
|
||||
if (!focusSet) {
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
|
||||
this._moveFocusToItems();
|
||||
@@ -187,8 +201,6 @@ var UserList = class {
|
||||
}
|
||||
|
||||
updateStyle(isExpanded) {
|
||||
let tasks = [];
|
||||
|
||||
if (isExpanded)
|
||||
this._box.add_style_pseudo_class('expanded');
|
||||
else
|
||||
@@ -196,27 +208,26 @@ var UserList = class {
|
||||
|
||||
for (let userName in this._items) {
|
||||
let item = this._items[userName];
|
||||
item.actor.sync_hover();
|
||||
item.sync_hover();
|
||||
}
|
||||
}
|
||||
|
||||
scrollToItem(item) {
|
||||
let box = item.actor.get_allocation_box();
|
||||
let box = item.get_allocation_box();
|
||||
|
||||
let adjustment = this.actor.get_vscroll_bar().get_adjustment();
|
||||
let adjustment = this.get_vscroll_bar().get_adjustment();
|
||||
|
||||
let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
|
||||
Tweener.removeTweens(adjustment);
|
||||
Tweener.addTween (adjustment,
|
||||
{ value: value,
|
||||
time: _SCROLL_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
adjustment.ease(value, {
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: _SCROLL_ANIMATION_TIME
|
||||
});
|
||||
}
|
||||
|
||||
jumpToItem(item) {
|
||||
let box = item.actor.get_allocation_box();
|
||||
let box = item.get_allocation_box();
|
||||
|
||||
let adjustment = this.actor.get_vscroll_bar().get_adjustment();
|
||||
let adjustment = this.get_vscroll_bar().get_adjustment();
|
||||
|
||||
let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
|
||||
|
||||
@@ -244,7 +255,7 @@ var UserList = class {
|
||||
return;
|
||||
|
||||
if (user.locked)
|
||||
return;
|
||||
return;
|
||||
|
||||
let userName = user.get_user_name();
|
||||
|
||||
@@ -254,14 +265,14 @@ var UserList = class {
|
||||
this.removeUser(user);
|
||||
|
||||
let item = new UserListItem(user);
|
||||
this._box.add(item.actor, { x_fill: true });
|
||||
this._box.add(item, { x_fill: true });
|
||||
|
||||
this._items[userName] = item;
|
||||
|
||||
item.connect('activate', this._onItemActivated.bind(this));
|
||||
|
||||
// Try to keep the focused item front-and-center
|
||||
item.actor.connect('key-focus-in', () => { this.scrollToItem(item); });
|
||||
item.connect('key-focus-in', () => this.scrollToItem(item));
|
||||
|
||||
this._moveFocusToItems();
|
||||
|
||||
@@ -282,33 +293,38 @@ var UserList = class {
|
||||
if (!item)
|
||||
return;
|
||||
|
||||
item.actor.destroy();
|
||||
item.destroy();
|
||||
delete this._items[userName];
|
||||
}
|
||||
|
||||
numItems() {
|
||||
return Object.keys(this._items).length;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(UserList.prototype);
|
||||
});
|
||||
|
||||
var SessionMenuButton = class {
|
||||
constructor() {
|
||||
var SessionMenuButton = GObject.registerClass({
|
||||
GTypeName: 'LoginDialog_SessionMenuButton',
|
||||
Signals: { 'session-activated': { param_types: [GObject.TYPE_STRING] } }
|
||||
}, class SessionMenuButton extends St.Bin {
|
||||
_init() {
|
||||
let gearIcon = new St.Icon({ icon_name: 'emblem-system-symbolic' });
|
||||
this._button = new St.Button({ style_class: 'login-dialog-session-list-button',
|
||||
reactive: true,
|
||||
track_hover: true,
|
||||
can_focus: true,
|
||||
accessible_name: _("Choose Session"),
|
||||
accessible_role: Atk.Role.MENU,
|
||||
child: gearIcon });
|
||||
let button = new St.Button({
|
||||
style_class: 'login-dialog-session-list-button',
|
||||
reactive: true,
|
||||
track_hover: true,
|
||||
can_focus: true,
|
||||
accessible_name: _("Choose Session"),
|
||||
accessible_role: Atk.Role.MENU,
|
||||
child: gearIcon
|
||||
});
|
||||
|
||||
this.actor = new St.Bin({ child: this._button });
|
||||
super._init({ child: button });
|
||||
this._button = button;
|
||||
|
||||
let side = St.Side.TOP;
|
||||
let align = 0;
|
||||
if (Gdm.get_session_ids().length > _MAX_BOTTOM_MENU_ITEMS) {
|
||||
if (this.actor.text_direction == Clutter.TextDirection.RTL)
|
||||
if (this.text_direction == Clutter.TextDirection.RTL)
|
||||
side = St.Side.RIGHT;
|
||||
else
|
||||
side = St.Side.LEFT;
|
||||
@@ -319,17 +335,17 @@ var SessionMenuButton = class {
|
||||
this._menu.actor.hide();
|
||||
|
||||
this._menu.connect('open-state-changed', (menu, isOpen) => {
|
||||
if (isOpen)
|
||||
this._button.add_style_pseudo_class('active');
|
||||
else
|
||||
this._button.remove_style_pseudo_class('active');
|
||||
if (isOpen)
|
||||
this._button.add_style_pseudo_class('active');
|
||||
else
|
||||
this._button.remove_style_pseudo_class('active');
|
||||
});
|
||||
|
||||
this._manager = new PopupMenu.PopupMenuManager(this._button,
|
||||
{ actionMode: Shell.ActionMode.NONE });
|
||||
this._manager.addMenu(this._menu);
|
||||
|
||||
this._button.connect('clicked', () => { this._menu.toggle(); });
|
||||
this._button.connect('clicked', () => this._menu.toggle());
|
||||
|
||||
this._items = {};
|
||||
this._activeSessionId = null;
|
||||
@@ -353,11 +369,11 @@ var SessionMenuButton = class {
|
||||
}
|
||||
|
||||
setActiveSession(sessionId) {
|
||||
if (sessionId == this._activeSessionId)
|
||||
return;
|
||||
if (sessionId == this._activeSessionId)
|
||||
return;
|
||||
|
||||
this._activeSessionId = sessionId;
|
||||
this._updateOrnament();
|
||||
this._activeSessionId = sessionId;
|
||||
this._updateOrnament();
|
||||
}
|
||||
|
||||
close() {
|
||||
@@ -374,7 +390,7 @@ var SessionMenuButton = class {
|
||||
}
|
||||
|
||||
for (let i = 0; i < ids.length; i++) {
|
||||
let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]);
|
||||
let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]);
|
||||
|
||||
let id = ids[i];
|
||||
let item = new PopupMenu.PopupMenuItem(sessionName);
|
||||
@@ -387,15 +403,13 @@ var SessionMenuButton = class {
|
||||
});
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(SessionMenuButton.prototype);
|
||||
});
|
||||
|
||||
var LoginDialog = GObject.registerClass({
|
||||
Signals: { 'failed': {} },
|
||||
}, class LoginDialog extends St.Widget {
|
||||
_init(parentActor) {
|
||||
super._init({ style_class: 'login-dialog',
|
||||
visible: false });
|
||||
super._init({ style_class: 'login-dialog', visible: false });
|
||||
|
||||
this.get_accessible().set_role(Atk.Role.WINDOW);
|
||||
|
||||
@@ -403,18 +417,18 @@ var LoginDialog = GObject.registerClass({
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
parentActor.add_child(this);
|
||||
|
||||
this._userManager = AccountsService.UserManager.get_default()
|
||||
this._userManager = AccountsService.UserManager.get_default();
|
||||
this._gdmClient = new Gdm.Client();
|
||||
|
||||
this._settings = new Gio.Settings({ schema_id: GdmUtil.LOGIN_SCREEN_SCHEMA });
|
||||
|
||||
this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_KEY,
|
||||
this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_KEY}`,
|
||||
this._updateBanner.bind(this));
|
||||
this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_TEXT_KEY,
|
||||
this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_TEXT_KEY}`,
|
||||
this._updateBanner.bind(this));
|
||||
this._settings.connect('changed::' + GdmUtil.DISABLE_USER_LIST_KEY,
|
||||
this._settings.connect(`changed::${GdmUtil.DISABLE_USER_LIST_KEY}`,
|
||||
this._updateDisableUserList.bind(this));
|
||||
this._settings.connect('changed::' + GdmUtil.LOGO_KEY,
|
||||
this._settings.connect(`changed::${GdmUtil.LOGO_KEY}`,
|
||||
this._updateLogo.bind(this));
|
||||
|
||||
this._textureCache = St.TextureCache.get_default();
|
||||
@@ -429,7 +443,7 @@ var LoginDialog = GObject.registerClass({
|
||||
this.add_child(this._userSelectionBox);
|
||||
|
||||
this._userList = new UserList();
|
||||
this._userSelectionBox.add(this._userList.actor,
|
||||
this._userSelectionBox.add(this._userList,
|
||||
{ expand: true,
|
||||
x_fill: true,
|
||||
y_fill: true });
|
||||
@@ -438,7 +452,7 @@ var LoginDialog = GObject.registerClass({
|
||||
this._authPrompt.connect('prompted', this._onPrompted.bind(this));
|
||||
this._authPrompt.connect('reset', this._onReset.bind(this));
|
||||
this._authPrompt.hide();
|
||||
this.add_child(this._authPrompt.actor);
|
||||
this.add_child(this._authPrompt);
|
||||
|
||||
// translators: this message is shown below the user list on the
|
||||
// login screen. It can be activated to reveal an entry for
|
||||
@@ -497,9 +511,9 @@ var LoginDialog = GObject.registerClass({
|
||||
(list, sessionId) => {
|
||||
this._greeter.call_select_session_sync (sessionId, null);
|
||||
});
|
||||
this._sessionMenuButton.actor.opacity = 0;
|
||||
this._sessionMenuButton.actor.show();
|
||||
this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton.actor);
|
||||
this._sessionMenuButton.opacity = 0;
|
||||
this._sessionMenuButton.show();
|
||||
this._authPrompt.addActorToDefaultButtonWell(this._sessionMenuButton);
|
||||
|
||||
this._disableUserList = undefined;
|
||||
this._userListLoaded = false;
|
||||
@@ -520,7 +534,7 @@ var LoginDialog = GObject.registerClass({
|
||||
_getBannerAllocation(dialogBox) {
|
||||
let actorBox = new Clutter.ActorBox();
|
||||
|
||||
let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size();
|
||||
let [, , natWidth, natHeight] = this._bannerView.get_preferred_size();
|
||||
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
|
||||
|
||||
actorBox.x1 = Math.floor(centerX - natWidth / 2);
|
||||
@@ -534,7 +548,7 @@ var LoginDialog = GObject.registerClass({
|
||||
_getLogoBinAllocation(dialogBox) {
|
||||
let actorBox = new Clutter.ActorBox();
|
||||
|
||||
let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size();
|
||||
let [, , natWidth, natHeight] = this._logoBin.get_preferred_size();
|
||||
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
|
||||
|
||||
actorBox.x1 = Math.floor(centerX - natWidth / 2);
|
||||
@@ -548,7 +562,7 @@ var LoginDialog = GObject.registerClass({
|
||||
_getCenterActorAllocation(dialogBox, actor) {
|
||||
let actorBox = new Clutter.ActorBox();
|
||||
|
||||
let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size();
|
||||
let [, , natWidth, natHeight] = actor.get_preferred_size();
|
||||
let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
|
||||
let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2;
|
||||
|
||||
@@ -575,19 +589,15 @@ var LoginDialog = GObject.registerClass({
|
||||
// First find out what space the children require
|
||||
let bannerAllocation = null;
|
||||
let bannerHeight = 0;
|
||||
let bannerWidth = 0;
|
||||
if (this._bannerView.visible) {
|
||||
bannerAllocation = this._getBannerAllocation(dialogBox, this._bannerView);
|
||||
bannerHeight = bannerAllocation.y2 - bannerAllocation.y1;
|
||||
bannerWidth = bannerAllocation.x2 - bannerAllocation.x1;
|
||||
}
|
||||
|
||||
let authPromptAllocation = null;
|
||||
let authPromptHeight = 0;
|
||||
let authPromptWidth = 0;
|
||||
if (this._authPrompt.actor.visible) {
|
||||
authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt.actor);
|
||||
authPromptHeight = authPromptAllocation.y2 - authPromptAllocation.y1;
|
||||
if (this._authPrompt.visible) {
|
||||
authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt);
|
||||
authPromptWidth = authPromptAllocation.x2 - authPromptAllocation.x1;
|
||||
}
|
||||
|
||||
@@ -619,64 +629,64 @@ var LoginDialog = GObject.registerClass({
|
||||
let leftOverYSpace = bannerSpace - bannerHeight;
|
||||
|
||||
if (leftOverYSpace > 0) {
|
||||
// First figure out how much left over space is up top
|
||||
let leftOverTopSpace = leftOverYSpace / 2;
|
||||
// First figure out how much left over space is up top
|
||||
let leftOverTopSpace = leftOverYSpace / 2;
|
||||
|
||||
// Then, shift the banner into the middle of that extra space
|
||||
let yShift = Math.floor(leftOverTopSpace / 2);
|
||||
// Then, shift the banner into the middle of that extra space
|
||||
let yShift = Math.floor(leftOverTopSpace / 2);
|
||||
|
||||
bannerAllocation.y1 += yShift;
|
||||
bannerAllocation.y2 += yShift;
|
||||
bannerAllocation.y1 += yShift;
|
||||
bannerAllocation.y2 += yShift;
|
||||
} else {
|
||||
// Then figure out how much space there would be if we switched to a
|
||||
// wide layout with banner on one side and authprompt on the other.
|
||||
let leftOverXSpace = dialogWidth - authPromptWidth;
|
||||
// Then figure out how much space there would be if we switched to a
|
||||
// wide layout with banner on one side and authprompt on the other.
|
||||
let leftOverXSpace = dialogWidth - authPromptWidth;
|
||||
|
||||
// In a wide view, half of the available space goes to the banner,
|
||||
// and the other half goes to the margins.
|
||||
let wideBannerWidth = leftOverXSpace / 2;
|
||||
let wideSpacing = leftOverXSpace - wideBannerWidth;
|
||||
// In a wide view, half of the available space goes to the banner,
|
||||
// and the other half goes to the margins.
|
||||
let wideBannerWidth = leftOverXSpace / 2;
|
||||
let wideSpacing = leftOverXSpace - wideBannerWidth;
|
||||
|
||||
// If we do go with a wide layout, we need there to be at least enough
|
||||
// space for the banner and the auth prompt to be the same width,
|
||||
// so it doesn't look unbalanced.
|
||||
if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) {
|
||||
let centerX = dialogBox.x1 + dialogWidth / 2;
|
||||
let centerY = dialogBox.y1 + dialogHeight / 2;
|
||||
// If we do go with a wide layout, we need there to be at least enough
|
||||
// space for the banner and the auth prompt to be the same width,
|
||||
// so it doesn't look unbalanced.
|
||||
if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) {
|
||||
let centerX = dialogBox.x1 + dialogWidth / 2;
|
||||
let centerY = dialogBox.y1 + dialogHeight / 2;
|
||||
|
||||
// A small portion of the spacing goes down the center of the
|
||||
// screen to help delimit the two columns of the wide view
|
||||
let centerGap = wideSpacing / 8;
|
||||
// A small portion of the spacing goes down the center of the
|
||||
// screen to help delimit the two columns of the wide view
|
||||
let centerGap = wideSpacing / 8;
|
||||
|
||||
// place the banner along the left edge of the center margin
|
||||
bannerAllocation.x2 = Math.floor(centerX - centerGap / 2);
|
||||
bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth);
|
||||
// place the banner along the left edge of the center margin
|
||||
bannerAllocation.x2 = Math.floor(centerX - centerGap / 2);
|
||||
bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth);
|
||||
|
||||
// figure out how tall it would like to be and try to accommodate
|
||||
// but don't let it get too close to the logo
|
||||
let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
|
||||
// figure out how tall it would like to be and try to accommodate
|
||||
// but don't let it get too close to the logo
|
||||
let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
|
||||
|
||||
let maxWideHeight = dialogHeight - 3 * logoHeight;
|
||||
wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
|
||||
bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2);
|
||||
bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight;
|
||||
let maxWideHeight = dialogHeight - 3 * logoHeight;
|
||||
wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
|
||||
bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2);
|
||||
bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight;
|
||||
|
||||
// place the auth prompt along the right edge of the center margin
|
||||
authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2);
|
||||
authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth;
|
||||
} else {
|
||||
// If we aren't going to do a wide view, then we need to limit
|
||||
// the height of the banner so it will present scrollbars
|
||||
// place the auth prompt along the right edge of the center margin
|
||||
authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2);
|
||||
authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth;
|
||||
} else {
|
||||
// If we aren't going to do a wide view, then we need to limit
|
||||
// the height of the banner so it will present scrollbars
|
||||
|
||||
// First figure out how much space there is without the banner
|
||||
leftOverYSpace += bannerHeight;
|
||||
// First figure out how much space there is without the banner
|
||||
leftOverYSpace += bannerHeight;
|
||||
|
||||
// Then figure out how much of that space is up top
|
||||
let availableTopSpace = Math.floor(leftOverYSpace / 2);
|
||||
// Then figure out how much of that space is up top
|
||||
let availableTopSpace = Math.floor(leftOverYSpace / 2);
|
||||
|
||||
// Then give all of that space to the banner
|
||||
bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace;
|
||||
}
|
||||
// Then give all of that space to the banner
|
||||
bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace;
|
||||
}
|
||||
}
|
||||
} else if (userSelectionAllocation) {
|
||||
// Grow the user list to fill the space
|
||||
@@ -697,7 +707,7 @@ var LoginDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
if (authPromptAllocation)
|
||||
this._authPrompt.actor.allocate(authPromptAllocation, flags);
|
||||
this._authPrompt.allocate(authPromptAllocation, flags);
|
||||
|
||||
if (userSelectionAllocation)
|
||||
this._userSelectionBox.allocate(userSelectionAllocation, flags);
|
||||
@@ -764,14 +774,15 @@ var LoginDialog = GObject.registerClass({
|
||||
|
||||
_fadeInBannerView() {
|
||||
this._bannerView.show();
|
||||
Tweener.addTween(this._bannerView,
|
||||
{ opacity: 255,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
this._bannerView.ease({
|
||||
opacity: 255,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
|
||||
_hideBannerView() {
|
||||
Tweener.removeTweens(this._bannerView);
|
||||
this._bannerView.remove_all_transitions();
|
||||
this._bannerView.opacity = 0;
|
||||
this._bannerView.hide();
|
||||
}
|
||||
@@ -800,7 +811,7 @@ var LoginDialog = GObject.registerClass({
|
||||
_onPrompted() {
|
||||
if (this._shouldShowSessionMenuButton()) {
|
||||
this._sessionMenuButton.updateSensitivity(true);
|
||||
this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton.actor);
|
||||
this._authPrompt.setActorInDefaultButtonWell(this._sessionMenuButton);
|
||||
} else {
|
||||
this._sessionMenuButton.updateSensitivity(false);
|
||||
}
|
||||
@@ -851,23 +862,24 @@ var LoginDialog = GObject.registerClass({
|
||||
_shouldShowSessionMenuButton() {
|
||||
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFYING &&
|
||||
this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFICATION_FAILED)
|
||||
return false;
|
||||
return false;
|
||||
|
||||
if (this._user && this._user.is_loaded && this._user.is_logged_in())
|
||||
return false;
|
||||
return false;
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
_showPrompt() {
|
||||
if (this._authPrompt.actor.visible)
|
||||
if (this._authPrompt.visible)
|
||||
return;
|
||||
this._authPrompt.actor.opacity = 0;
|
||||
this._authPrompt.actor.show();
|
||||
Tweener.addTween(this._authPrompt.actor,
|
||||
{ opacity: 255,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
this._authPrompt.opacity = 0;
|
||||
this._authPrompt.show();
|
||||
this._authPrompt.ease({
|
||||
opacity: 255,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
this._fadeInBannerView();
|
||||
}
|
||||
|
||||
@@ -911,28 +923,31 @@ var LoginDialog = GObject.registerClass({
|
||||
this._showPrompt();
|
||||
}
|
||||
|
||||
_bindOpacity() {
|
||||
this._bindings = Main.layoutManager.uiGroup.get_children()
|
||||
.filter(c => c != Main.layoutManager.screenShieldGroup)
|
||||
.map(c => this.bind_property('opacity', c, 'opacity', 0));
|
||||
}
|
||||
|
||||
_unbindOpacity() {
|
||||
this._bindings.forEach(b => b.unbind());
|
||||
}
|
||||
|
||||
_loginScreenSessionActivated() {
|
||||
if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
|
||||
return;
|
||||
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 255,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onUpdate() {
|
||||
let children = Main.layoutManager.uiGroup.get_children();
|
||||
|
||||
for (let i = 0; i < children.length; i++) {
|
||||
if (children[i] != Main.layoutManager.screenShieldGroup)
|
||||
children[i].opacity = this.opacity;
|
||||
}
|
||||
},
|
||||
onUpdateScope: this,
|
||||
onComplete() {
|
||||
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
|
||||
this._authPrompt.reset();
|
||||
},
|
||||
onCompleteScope: this });
|
||||
this._bindOpacity();
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
|
||||
this._authPrompt.reset();
|
||||
this._unbindOpacity();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
_gotGreeterSessionProxy(proxy) {
|
||||
@@ -945,34 +960,27 @@ var LoginDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
_startSession(serviceName) {
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 0,
|
||||
time: _FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onUpdate() {
|
||||
let children = Main.layoutManager.uiGroup.get_children();
|
||||
|
||||
for (let i = 0; i < children.length; i++) {
|
||||
if (children[i] != Main.layoutManager.screenShieldGroup)
|
||||
children[i].opacity = this.opacity;
|
||||
}
|
||||
},
|
||||
onUpdateScope: this,
|
||||
onComplete() {
|
||||
this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
|
||||
},
|
||||
onCompleteScope: this });
|
||||
this._bindOpacity();
|
||||
this.ease({
|
||||
opacity: 0,
|
||||
duration: _FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
|
||||
this._unbindOpacity();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
_onSessionOpened(client, serviceName) {
|
||||
this._authPrompt.finish(() => { this._startSession(serviceName); });
|
||||
this._authPrompt.finish(() => this._startSession(serviceName));
|
||||
}
|
||||
|
||||
_waitForItemForUser(userName) {
|
||||
let item = this._userList.getItemFromUserName(userName);
|
||||
|
||||
if (item)
|
||||
return null;
|
||||
return null;
|
||||
|
||||
let hold = new Batch.Hold();
|
||||
let signalId = this._userList.connect('item-added',
|
||||
@@ -983,7 +991,7 @@ var LoginDialog = GObject.registerClass({
|
||||
hold.release();
|
||||
});
|
||||
|
||||
hold.connect('release', () => { this._userList.disconnect(signalId); });
|
||||
hold.connect('release', () => this._userList.disconnect(signalId));
|
||||
|
||||
return hold;
|
||||
}
|
||||
@@ -1047,18 +1055,19 @@ var LoginDialog = GObject.registerClass({
|
||||
return this._blockTimedLoginUntilIdle();
|
||||
} else {
|
||||
animationTime = delay;
|
||||
return null;
|
||||
}
|
||||
},
|
||||
|
||||
() => {
|
||||
// If idle timeout is done, make sure the timed login indicator is shown
|
||||
if (delay > _TIMED_LOGIN_IDLE_THRESHOLD &&
|
||||
this._authPrompt.actor.visible)
|
||||
this._authPrompt.visible)
|
||||
this._authPrompt.cancel();
|
||||
|
||||
if (delay > _TIMED_LOGIN_IDLE_THRESHOLD || firstRun) {
|
||||
this._userList.scrollToItem(loginItem);
|
||||
loginItem.actor.grab_key_focus();
|
||||
loginItem.grab_key_focus();
|
||||
}
|
||||
},
|
||||
|
||||
@@ -1082,12 +1091,12 @@ var LoginDialog = GObject.registerClass({
|
||||
|
||||
// Restart timed login on user interaction
|
||||
global.stage.connect('captured-event', (actor, event) => {
|
||||
if (event.type() == Clutter.EventType.KEY_PRESS ||
|
||||
if (event.type() == Clutter.EventType.KEY_PRESS ||
|
||||
event.type() == Clutter.EventType.BUTTON_PRESS) {
|
||||
this._startTimedLogin(userName, seconds);
|
||||
}
|
||||
this._startTimedLogin(userName, seconds);
|
||||
}
|
||||
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
}
|
||||
|
||||
@@ -1119,7 +1128,7 @@ var LoginDialog = GObject.registerClass({
|
||||
this._sessionMenuButton.close();
|
||||
this._setUserListExpanded(true);
|
||||
this._notListedButton.show();
|
||||
this._userList.actor.grab_key_focus();
|
||||
this._userList.grab_key_focus();
|
||||
}
|
||||
|
||||
_beginVerificationForItem(item) {
|
||||
@@ -1227,16 +1236,17 @@ var LoginDialog = GObject.registerClass({
|
||||
_("Login Window"),
|
||||
'dialog-password-symbolic',
|
||||
{ sortGroup: CtrlAltTab.SortGroup.MIDDLE });
|
||||
this._userList.actor.grab_key_focus();
|
||||
this._userList.grab_key_focus();
|
||||
this.show();
|
||||
this.opacity = 0;
|
||||
|
||||
Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN });
|
||||
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 255,
|
||||
time: 1,
|
||||
transition: 'easeInQuad' });
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
duration: 1000,
|
||||
mode: Clutter.AnimationMode.EASE_IN_QUAD
|
||||
});
|
||||
|
||||
return true;
|
||||
}
|
||||
@@ -1250,7 +1260,7 @@ var LoginDialog = GObject.registerClass({
|
||||
this._authPrompt.cancel();
|
||||
}
|
||||
|
||||
addCharacter(unichar) {
|
||||
addCharacter(_unichar) {
|
||||
// Don't allow type ahead at the login screen
|
||||
}
|
||||
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getOVirtCredentialsManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
const Signals = imports.signals;
|
||||
|
||||
@@ -15,12 +15,13 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm");
|
||||
const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface);
|
||||
|
||||
var Manager = class {
|
||||
constructor(parentActor) {
|
||||
constructor() {
|
||||
this._aggregateProvider = Provider(Gio.DBus.system,
|
||||
'org.freedesktop.realmd',
|
||||
'/org/freedesktop/realmd',
|
||||
this._reloadRealms.bind(this))
|
||||
this._reloadRealms.bind(this));
|
||||
this._realms = {};
|
||||
this._loginFormat = null;
|
||||
|
||||
this._signalId = this._aggregateProvider.connect('g-properties-changed',
|
||||
(proxy, properties) => {
|
||||
@@ -36,10 +37,10 @@ var Manager = class {
|
||||
return;
|
||||
|
||||
for (let i = 0; i < realmPaths.length; i++) {
|
||||
let realm = Realm(Gio.DBus.system,
|
||||
'org.freedesktop.realmd',
|
||||
realmPaths[i],
|
||||
this._onRealmLoaded.bind(this));
|
||||
Realm(Gio.DBus.system,
|
||||
'org.freedesktop.realmd',
|
||||
realmPaths[i],
|
||||
this._onRealmLoaded.bind(this));
|
||||
}
|
||||
}
|
||||
|
||||
@@ -86,7 +87,7 @@ var Manager = class {
|
||||
}
|
||||
|
||||
get loginFormat() {
|
||||
if (this._loginFormat !== undefined)
|
||||
if (this._loginFormat)
|
||||
return this._loginFormat;
|
||||
|
||||
this._updateLoginFormat();
|
||||
@@ -98,10 +99,10 @@ var Manager = class {
|
||||
Service(Gio.DBus.system,
|
||||
'org.freedesktop.realmd',
|
||||
'/org/freedesktop/realmd',
|
||||
service => { service.ReleaseRemote(); });
|
||||
service => service.ReleaseRemote());
|
||||
this._aggregateProvider.disconnect(this._signalId);
|
||||
this._realms = { };
|
||||
this._updateLoginFormat();
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Manager.prototype)
|
||||
Signals.addSignalMethods(Manager.prototype);
|
||||
|
||||
126
js/gdm/util.js
126
js/gdm/util.js
@@ -1,4 +1,6 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY,
|
||||
DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */
|
||||
|
||||
const { Clutter, Gio, GLib } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -9,14 +11,13 @@ const OVirt = imports.gdm.oVirt;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const SmartcardManager = imports.misc.smartcardManager;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var PASSWORD_SERVICE_NAME = 'gdm-password';
|
||||
var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint';
|
||||
var SMARTCARD_SERVICE_NAME = 'gdm-smartcard';
|
||||
var OVIRT_SERVICE_NAME = 'gdm-ovirtcred';
|
||||
var FADE_ANIMATION_TIME = 0.16;
|
||||
var CLONE_FADE_ANIMATION_TIME = 0.25;
|
||||
var FADE_ANIMATION_TIME = 160;
|
||||
var CLONE_FADE_ANIMATION_TIME = 250;
|
||||
|
||||
var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen';
|
||||
var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication';
|
||||
@@ -30,7 +31,7 @@ var LOGO_KEY = 'logo';
|
||||
var DISABLE_USER_LIST_KEY = 'disable-user-list';
|
||||
|
||||
// Give user 48ms to read each character of a PAM message
|
||||
var USER_READ_TIME = 48
|
||||
var USER_READ_TIME = 48;
|
||||
|
||||
var MessageType = {
|
||||
NONE: 0,
|
||||
@@ -45,20 +46,20 @@ function fadeInActor(actor) {
|
||||
|
||||
let hold = new Batch.Hold();
|
||||
actor.show();
|
||||
let [minHeight, naturalHeight] = actor.get_preferred_height(-1);
|
||||
let [, naturalHeight] = actor.get_preferred_height(-1);
|
||||
|
||||
actor.opacity = 0;
|
||||
actor.set_height(0);
|
||||
Tweener.addTween(actor,
|
||||
{ opacity: 255,
|
||||
height: naturalHeight,
|
||||
time: FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
this.set_height(-1);
|
||||
hold.release();
|
||||
},
|
||||
});
|
||||
actor.ease({
|
||||
opacity: 255,
|
||||
height: naturalHeight,
|
||||
duration: FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this.set_height(-1);
|
||||
hold.release();
|
||||
}
|
||||
});
|
||||
|
||||
return hold;
|
||||
}
|
||||
@@ -71,17 +72,17 @@ function fadeOutActor(actor) {
|
||||
}
|
||||
|
||||
let hold = new Batch.Hold();
|
||||
Tweener.addTween(actor,
|
||||
{ opacity: 0,
|
||||
height: 0,
|
||||
time: FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
this.hide();
|
||||
this.set_height(-1);
|
||||
hold.release();
|
||||
},
|
||||
});
|
||||
actor.ease({
|
||||
opacity: 0,
|
||||
height: 0,
|
||||
duration: FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this.hide();
|
||||
this.set_height(-1);
|
||||
hold.release();
|
||||
}
|
||||
});
|
||||
return hold;
|
||||
}
|
||||
|
||||
@@ -101,15 +102,15 @@ function cloneAndFadeOutActor(actor) {
|
||||
clone.set_position(x, y);
|
||||
|
||||
let hold = new Batch.Hold();
|
||||
Tweener.addTween(clone,
|
||||
{ opacity: 0,
|
||||
time: CLONE_FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
clone.destroy();
|
||||
hold.release();
|
||||
}
|
||||
});
|
||||
clone.ease({
|
||||
opacity: 0,
|
||||
duration: CLONE_FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
clone.destroy();
|
||||
hold.release();
|
||||
}
|
||||
});
|
||||
return hold;
|
||||
}
|
||||
|
||||
@@ -303,7 +304,7 @@ var ShellUserVerifier = class {
|
||||
});
|
||||
}
|
||||
|
||||
_oVirtUserAuthenticated(token) {
|
||||
_oVirtUserAuthenticated(_token) {
|
||||
this._preemptingService = OVIRT_SERVICE_NAME;
|
||||
this.emit('ovirt-user-authenticated');
|
||||
}
|
||||
@@ -342,7 +343,7 @@ var ShellUserVerifier = class {
|
||||
try {
|
||||
this._clearUserVerifier();
|
||||
this._userVerifier = client.open_reauthentication_channel_finish(result);
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
if (e.matches(Gio.DBusError, Gio.DBusError.ACCESS_DENIED) &&
|
||||
@@ -369,7 +370,7 @@ var ShellUserVerifier = class {
|
||||
try {
|
||||
this._clearUserVerifier();
|
||||
this._userVerifier = client.get_user_verifier_finish(result);
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
this._reportInitError('Failed to obtain user verifier', e);
|
||||
@@ -423,36 +424,31 @@ var ShellUserVerifier = class {
|
||||
_startService(serviceName) {
|
||||
this._hold.acquire();
|
||||
if (this._userName) {
|
||||
this._userVerifier.call_begin_verification_for_user(serviceName,
|
||||
this._userName,
|
||||
this._cancellable,
|
||||
(obj, result) => {
|
||||
try {
|
||||
obj.call_begin_verification_for_user_finish(result);
|
||||
} catch(e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
this._reportInitError('Failed to start verification for user', e);
|
||||
return;
|
||||
}
|
||||
this._userVerifier.call_begin_verification_for_user(serviceName, this._userName, this._cancellable, (obj, result) => {
|
||||
try {
|
||||
obj.call_begin_verification_for_user_finish(result);
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
this._reportInitError('Failed to start verification for user', e);
|
||||
return;
|
||||
}
|
||||
|
||||
this._hold.release();
|
||||
});
|
||||
this._hold.release();
|
||||
});
|
||||
} else {
|
||||
this._userVerifier.call_begin_verification(serviceName,
|
||||
this._cancellable,
|
||||
(obj, result) => {
|
||||
try {
|
||||
obj.call_begin_verification_finish(result);
|
||||
} catch(e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
this._reportInitError('Failed to start verification', e);
|
||||
return;
|
||||
}
|
||||
this._userVerifier.call_begin_verification(serviceName, this._cancellable, (obj, result) => {
|
||||
try {
|
||||
obj.call_begin_verification_finish(result);
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
this._reportInitError('Failed to start verification', e);
|
||||
return;
|
||||
}
|
||||
|
||||
this._hold.release();
|
||||
});
|
||||
this._hold.release();
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -1,23 +1,37 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported ExtensionState, ExtensionType, getCurrentExtension,
|
||||
getSettings, initTranslations, isOutOfDate, installImporter,
|
||||
serializeExtension, deserializeExtension */
|
||||
|
||||
// Common utils for the extension system and the extension
|
||||
// preferences tool
|
||||
|
||||
const Gettext = imports.gettext;
|
||||
const Signals = imports.signals;
|
||||
const { Gio, GLib } = imports.gi;
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
const Gettext = imports.gettext;
|
||||
const Lang = imports.lang;
|
||||
|
||||
const Config = imports.misc.config;
|
||||
const FileUtils = imports.misc.fileUtils;
|
||||
|
||||
var ExtensionType = {
|
||||
SYSTEM: 1,
|
||||
PER_USER: 2
|
||||
};
|
||||
|
||||
// Maps uuid -> metadata object
|
||||
var extensions = {};
|
||||
var ExtensionState = {
|
||||
ENABLED: 1,
|
||||
DISABLED: 2,
|
||||
ERROR: 3,
|
||||
OUT_OF_DATE: 4,
|
||||
DOWNLOADING: 5,
|
||||
INITIALIZED: 6,
|
||||
|
||||
// Used as an error state for operations on unknown extensions,
|
||||
// should never be in a real extensionMeta object.
|
||||
UNINSTALLED: 99
|
||||
};
|
||||
|
||||
const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
|
||||
|
||||
/**
|
||||
* getCurrentExtension:
|
||||
@@ -31,7 +45,7 @@ function getCurrentExtension() {
|
||||
// Search for an occurrence of an extension stack frame
|
||||
// Start at 1 because 0 is the stack frame of this function
|
||||
for (let i = 1; i < stack.length; i++) {
|
||||
if (stack[i].indexOf('/gnome-shell/extensions/') > -1) {
|
||||
if (stack[i].includes('/gnome-shell/extensions/')) {
|
||||
extensionStackLine = stack[i];
|
||||
break;
|
||||
}
|
||||
@@ -49,13 +63,17 @@ function getCurrentExtension() {
|
||||
if (!match)
|
||||
return null;
|
||||
|
||||
// local import, as the module is used from outside the gnome-shell process
|
||||
// as well (not this function though)
|
||||
let extensionManager = imports.ui.main.extensionManager;
|
||||
|
||||
let path = match[1];
|
||||
let file = Gio.File.new_for_path(path);
|
||||
|
||||
// Walk up the directory tree, looking for an extension with
|
||||
// the same UUID as a directory name.
|
||||
while (file != null) {
|
||||
let extension = extensions[file.get_basename()];
|
||||
let extension = extensionManager.lookup(file.get_basename());
|
||||
if (extension !== undefined)
|
||||
return extension;
|
||||
file = file.get_parent();
|
||||
@@ -147,8 +165,8 @@ function versionCheck(required, current) {
|
||||
let requiredArray = required[i].split('.');
|
||||
if (requiredArray[0] == major &&
|
||||
requiredArray[1] == minor &&
|
||||
(requiredArray[2] == point ||
|
||||
(requiredArray[2] == undefined && parseInt(minor) % 2 == 0)))
|
||||
((requiredArray[2] === undefined && parseInt(minor) % 2 == 0) ||
|
||||
requiredArray[2] == point))
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
@@ -161,54 +179,50 @@ function isOutOfDate(extension) {
|
||||
return false;
|
||||
}
|
||||
|
||||
function createExtensionObject(uuid, dir, type) {
|
||||
let info;
|
||||
function serializeExtension(extension) {
|
||||
let obj = {};
|
||||
Lang.copyProperties(extension.metadata, obj);
|
||||
|
||||
let metadataFile = dir.get_child('metadata.json');
|
||||
if (!metadataFile.query_exists(null)) {
|
||||
throw new Error('Missing metadata.json');
|
||||
}
|
||||
SERIALIZED_PROPERTIES.forEach(prop => {
|
||||
obj[prop] = extension[prop];
|
||||
});
|
||||
|
||||
let metadataContents, success, tag;
|
||||
try {
|
||||
[success, metadataContents, tag] = metadataFile.load_contents(null);
|
||||
if (metadataContents instanceof Uint8Array)
|
||||
metadataContents = imports.byteArray.toString(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error('Failed to load metadata.json: ' + e);
|
||||
}
|
||||
let meta;
|
||||
try {
|
||||
meta = JSON.parse(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error('Failed to parse metadata.json: ' + e);
|
||||
}
|
||||
|
||||
let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
|
||||
for (let i = 0; i < requiredProperties.length; i++) {
|
||||
let prop = requiredProperties[i];
|
||||
if (!meta[prop]) {
|
||||
throw new Error('missing "' + prop + '" property in metadata.json');
|
||||
let res = {};
|
||||
for (let key in obj) {
|
||||
let val = obj[key];
|
||||
let type;
|
||||
switch (typeof val) {
|
||||
case 'string':
|
||||
type = 's';
|
||||
break;
|
||||
case 'number':
|
||||
type = 'd';
|
||||
break;
|
||||
case 'boolean':
|
||||
type = 'b';
|
||||
break;
|
||||
default:
|
||||
continue;
|
||||
}
|
||||
res[key] = GLib.Variant.new(type, val);
|
||||
}
|
||||
|
||||
if (uuid != meta.uuid) {
|
||||
throw new Error('uuid "' + meta.uuid + '" from metadata.json does not match directory name "' + uuid + '"');
|
||||
return res;
|
||||
}
|
||||
|
||||
function deserializeExtension(variant) {
|
||||
let res = { metadata: {} };
|
||||
for (let prop in variant) {
|
||||
let val = variant[prop].unpack();
|
||||
if (SERIALIZED_PROPERTIES.includes(prop))
|
||||
res[prop] = val;
|
||||
else
|
||||
res.metadata[prop] = val;
|
||||
}
|
||||
|
||||
let extension = {};
|
||||
|
||||
extension.metadata = meta;
|
||||
extension.uuid = meta.uuid;
|
||||
extension.type = type;
|
||||
extension.dir = dir;
|
||||
extension.path = dir.get_path();
|
||||
extension.error = '';
|
||||
extension.hasPrefs = dir.get_child('prefs.js').query_exists(null);
|
||||
|
||||
extensions[uuid] = extension;
|
||||
|
||||
return extension;
|
||||
// add the 2 additional properties to create a valid extension object, as createExtensionObject()
|
||||
res.uuid = res.metadata.uuid;
|
||||
res.dir = Gio.File.new_for_path(res.path);
|
||||
return res;
|
||||
}
|
||||
|
||||
function installImporter(extension) {
|
||||
@@ -219,36 +233,3 @@ function installImporter(extension) {
|
||||
extension.imports = imports[extension.uuid];
|
||||
imports.searchPath = oldSearchPath;
|
||||
}
|
||||
|
||||
var ExtensionFinder = class {
|
||||
_loadExtension(extensionDir, info, perUserDir) {
|
||||
let fileType = info.get_file_type();
|
||||
if (fileType != Gio.FileType.DIRECTORY)
|
||||
return;
|
||||
let uuid = info.get_name();
|
||||
let existing = extensions[uuid];
|
||||
if (existing) {
|
||||
log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path()));
|
||||
return;
|
||||
}
|
||||
|
||||
let extension;
|
||||
let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER
|
||||
: ExtensionType.SYSTEM;
|
||||
try {
|
||||
extension = createExtensionObject(uuid, extensionDir, type);
|
||||
} catch(e) {
|
||||
logError(e, 'Could not load extension %s'.format(uuid));
|
||||
return;
|
||||
}
|
||||
this.emit('extension-found', extension);
|
||||
}
|
||||
|
||||
scanExtensions() {
|
||||
let perUserDir = Gio.File.new_for_path(global.userdatadir);
|
||||
FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
|
||||
this._loadExtension(dir, info, perUserDir);
|
||||
});
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(ExtensionFinder.prototype);
|
||||
|
||||
@@ -1,4 +1,6 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
|
||||
recursivelyMoveDir, loadInterfaceXML */
|
||||
|
||||
const { Gio, GLib } = imports.gi;
|
||||
const Config = imports.misc.config;
|
||||
@@ -36,7 +38,7 @@ function recursivelyDeleteDir(dir, deleteParent) {
|
||||
let children = dir.enumerate_children('standard::name,standard::type',
|
||||
Gio.FileQueryInfoFlags.NONE, null);
|
||||
|
||||
let info, child;
|
||||
let info;
|
||||
while ((info = children.next_file(null)) != null) {
|
||||
let type = info.get_file_type();
|
||||
let child = dir.get_child(info.get_name());
|
||||
@@ -57,7 +59,7 @@ function recursivelyMoveDir(srcDir, destDir) {
|
||||
if (!destDir.query_exists(null))
|
||||
destDir.make_directory_with_parents(null);
|
||||
|
||||
let info, child;
|
||||
let info;
|
||||
while ((info = children.next_file(null)) != null) {
|
||||
let type = info.get_file_type();
|
||||
let srcChild = srcDir.get_child(info.get_name());
|
||||
@@ -84,13 +86,13 @@ function loadInterfaceXML(iface) {
|
||||
let f = Gio.File.new_for_uri(uri);
|
||||
|
||||
try {
|
||||
let [ok, bytes] = f.load_contents(null);
|
||||
let [ok_, bytes] = f.load_contents(null);
|
||||
if (bytes instanceof Uint8Array)
|
||||
xml = imports.byteArray.toString(bytes)
|
||||
xml = imports.byteArray.toString(bytes);
|
||||
else
|
||||
xml = bytes.toString();
|
||||
} catch (e) {
|
||||
log('Failed to load D-Bus interface ' + iface);
|
||||
log(`Failed to load D-Bus interface ${iface}`);
|
||||
}
|
||||
|
||||
return xml;
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported PresenceStatus, Presence, Inhibitor, SessionManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
|
||||
|
||||
@@ -18,7 +18,7 @@ var HistoryManager = class {
|
||||
this._historyIndex = 0;
|
||||
if (this._key) {
|
||||
this._history = global.settings.get_strv(this._key);
|
||||
global.settings.connect('changed::' + this._key,
|
||||
global.settings.connect(`changed::${this._key}`,
|
||||
this._historyChanged.bind(this));
|
||||
|
||||
} else {
|
||||
@@ -28,7 +28,7 @@ var HistoryManager = class {
|
||||
this._entry = params.entry;
|
||||
|
||||
if (this._entry) {
|
||||
this._entry.connect('key-press-event',
|
||||
this._entry.connect('key-press-event',
|
||||
this._onEntryKeyPress.bind(this));
|
||||
}
|
||||
}
|
||||
@@ -66,7 +66,7 @@ var HistoryManager = class {
|
||||
this._indexChanged();
|
||||
}
|
||||
|
||||
return this._historyIndex ? this._history[this._historyIndex -1] : null;
|
||||
return this._historyIndex ? this._history[this._historyIndex - 1] : null;
|
||||
}
|
||||
|
||||
addItem(input) {
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getIBusManager */
|
||||
|
||||
const { Gio, GLib, IBus } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const IBusCandidatePopup = imports.ui.ibusCandidatePopup;
|
||||
@@ -18,9 +18,9 @@ function _checkIBusVersion(requiredMajor, requiredMinor, requiredMicro) {
|
||||
IBus.MICRO_VERSION >= requiredMicro))
|
||||
return;
|
||||
|
||||
throw "Found IBus version %d.%d.%d but required is %d.%d.%d".
|
||||
format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
|
||||
requiredMajor, requiredMinor, requiredMicro);
|
||||
throw "Found IBus version %d.%d.%d but required is %d.%d.%d"
|
||||
.format(IBus.MAJOR_VERSION, IBus.MINOR_VERSION, IBus.MINOR_VERSION,
|
||||
requiredMajor, requiredMinor, requiredMicro);
|
||||
}
|
||||
|
||||
function getIBusManager() {
|
||||
@@ -42,7 +42,7 @@ var IBusManager = class {
|
||||
this._candidatePopup = new IBusCandidatePopup.CandidatePopup();
|
||||
|
||||
this._panelService = null;
|
||||
this._engines = {};
|
||||
this._engines = new Map();
|
||||
this._ready = false;
|
||||
this._registerPropertiesId = 0;
|
||||
this._currentEngineName = null;
|
||||
@@ -58,54 +58,79 @@ var IBusManager = class {
|
||||
this._spawn();
|
||||
}
|
||||
|
||||
_spawn() {
|
||||
_spawn(extraArgs = []) {
|
||||
try {
|
||||
Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
|
||||
Gio.SubprocessFlags.NONE);
|
||||
} catch(e) {
|
||||
log('Failed to launch ibus-daemon: ' + e.message);
|
||||
let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs];
|
||||
Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE);
|
||||
} catch (e) {
|
||||
log(`Failed to launch ibus-daemon: ${e.message}`);
|
||||
}
|
||||
}
|
||||
|
||||
restartDaemon(extraArgs = []) {
|
||||
this._spawn(['-r', ...extraArgs]);
|
||||
}
|
||||
|
||||
_clear() {
|
||||
if (this._cancellable) {
|
||||
this._cancellable.cancel();
|
||||
this._cancellable = null;
|
||||
}
|
||||
|
||||
if (this._preloadEnginesId) {
|
||||
GLib.source_remove(this._preloadEnginesId);
|
||||
this._preloadEnginesId = 0;
|
||||
}
|
||||
|
||||
if (this._panelService)
|
||||
this._panelService.destroy();
|
||||
|
||||
this._panelService = null;
|
||||
this._candidatePopup.setPanelService(null);
|
||||
this._engines = {};
|
||||
this._engines.clear();
|
||||
this._ready = false;
|
||||
this._registerPropertiesId = 0;
|
||||
this._currentEngineName = null;
|
||||
|
||||
this.emit('ready', false);
|
||||
|
||||
this._spawn();
|
||||
}
|
||||
|
||||
_onConnected() {
|
||||
this._ibus.list_engines_async(-1, null, this._initEngines.bind(this));
|
||||
this._cancellable = new Gio.Cancellable();
|
||||
this._ibus.list_engines_async(-1, this._cancellable,
|
||||
this._initEngines.bind(this));
|
||||
this._ibus.request_name_async(IBus.SERVICE_PANEL,
|
||||
IBus.BusNameFlag.REPLACE_EXISTING,
|
||||
-1, null,
|
||||
this._initPanelService.bind(this));
|
||||
IBus.BusNameFlag.REPLACE_EXISTING, -1, this._cancellable,
|
||||
this._initPanelService.bind(this));
|
||||
}
|
||||
|
||||
_initEngines(ibus, result) {
|
||||
let enginesList = this._ibus.list_engines_async_finish(result);
|
||||
if (enginesList) {
|
||||
try {
|
||||
let enginesList = this._ibus.list_engines_async_finish(result);
|
||||
for (let i = 0; i < enginesList.length; ++i) {
|
||||
let name = enginesList[i].get_name();
|
||||
this._engines[name] = enginesList[i];
|
||||
this._engines.set(name, enginesList[i]);
|
||||
}
|
||||
this._updateReadiness();
|
||||
} else {
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
|
||||
logError(e);
|
||||
this._clear();
|
||||
}
|
||||
}
|
||||
|
||||
_initPanelService(ibus, result) {
|
||||
let success = this._ibus.request_name_async_finish(result);
|
||||
let success = false;
|
||||
try {
|
||||
success = !!this._ibus.request_name_async_finish(result);
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
return;
|
||||
logError(e);
|
||||
}
|
||||
|
||||
if (success) {
|
||||
this._panelService = new IBus.PanelService({ connection: this._ibus.get_connection(),
|
||||
object_path: IBus.PATH_PANEL });
|
||||
@@ -119,7 +144,7 @@ var IBusManager = class {
|
||||
if (!GLib.str_has_suffix(path, '/InputContext_1'))
|
||||
this.emit ('focus-in');
|
||||
});
|
||||
this._panelService.connect('focus-out', () => { this.emit('focus-out'); });
|
||||
this._panelService.connect('focus-out', () => this.emit('focus-out'));
|
||||
|
||||
try {
|
||||
// IBus versions older than 1.5.10 have a bug which
|
||||
@@ -132,13 +157,13 @@ var IBusManager = class {
|
||||
} catch (e) {
|
||||
}
|
||||
// If an engine is already active we need to get its properties
|
||||
this._ibus.get_global_engine_async(-1, null, (i, result) => {
|
||||
this._ibus.get_global_engine_async(-1, this._cancellable, (_bus, result) => {
|
||||
let engine;
|
||||
try {
|
||||
engine = this._ibus.get_global_engine_async_finish(result);
|
||||
if (!engine)
|
||||
return;
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
return;
|
||||
}
|
||||
this._engineChanged(this._ibus, engine.get_name());
|
||||
@@ -150,8 +175,7 @@ var IBusManager = class {
|
||||
}
|
||||
|
||||
_updateReadiness() {
|
||||
this._ready = (Object.keys(this._engines).length > 0 &&
|
||||
this._panelService != null);
|
||||
this._ready = this._engines.size > 0 && this._panelService != null;
|
||||
this.emit('ready', this._ready);
|
||||
}
|
||||
|
||||
@@ -189,10 +213,10 @@ var IBusManager = class {
|
||||
}
|
||||
|
||||
getEngineDesc(id) {
|
||||
if (!this._ready || !this._engines.hasOwnProperty(id))
|
||||
if (!this._ready || !this._engines.has(id))
|
||||
return null;
|
||||
|
||||
return this._engines[id];
|
||||
return this._engines.get(id);
|
||||
}
|
||||
|
||||
setEngine(id, callback) {
|
||||
@@ -205,8 +229,18 @@ var IBusManager = class {
|
||||
return;
|
||||
}
|
||||
|
||||
this._ibus.set_global_engine_async(id, this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
|
||||
null, callback || null);
|
||||
this._ibus.set_global_engine_async(id,
|
||||
this._MAX_INPUT_SOURCE_ACTIVATION_TIME,
|
||||
this._cancellable, (_bus, res) => {
|
||||
try {
|
||||
this._ibus.set_global_engine_async_finish(res);
|
||||
} catch (e) {
|
||||
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
logError(e);
|
||||
}
|
||||
if (callback)
|
||||
callback();
|
||||
});
|
||||
}
|
||||
|
||||
preloadEngines(ids) {
|
||||
@@ -214,21 +248,23 @@ var IBusManager = class {
|
||||
return;
|
||||
|
||||
if (this._preloadEnginesId != 0) {
|
||||
Mainloop.source_remove(this._preloadEnginesId);
|
||||
GLib.source_remove(this._preloadEnginesId);
|
||||
this._preloadEnginesId = 0;
|
||||
}
|
||||
|
||||
this._preloadEnginesId =
|
||||
Mainloop.timeout_add_seconds(this._PRELOAD_ENGINES_DELAY_TIME,
|
||||
() => {
|
||||
this._ibus.preload_engines_async(
|
||||
ids,
|
||||
-1,
|
||||
null,
|
||||
null);
|
||||
this._preloadEnginesId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
GLib.timeout_add_seconds(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
this._PRELOAD_ENGINES_DELAY_TIME,
|
||||
() => {
|
||||
this._ibus.preload_engines_async(
|
||||
ids,
|
||||
-1,
|
||||
this._cancellable,
|
||||
null);
|
||||
this._preloadEnginesId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(IBusManager.prototype);
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
const { Clutter, GLib, GObject, IBus } = imports.gi;
|
||||
/* exported InputMethod */
|
||||
const { Clutter, GLib, Gio, GObject, IBus } = imports.gi;
|
||||
|
||||
const Keyboard = imports.ui.status.keyboard;
|
||||
|
||||
@@ -35,15 +36,7 @@ class InputMethod extends Clutter.InputMethod {
|
||||
}
|
||||
|
||||
_updateCapabilities() {
|
||||
let caps = 0;
|
||||
|
||||
if (this.can_show_preedit)
|
||||
caps |= IBus.Capabilite.PREEDIT_TEXT;
|
||||
|
||||
if (this._currentFocus)
|
||||
caps |= IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
|
||||
else
|
||||
caps |= IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.AUXILIARY_TEXT | IBus.Capabilite.LOOKUP_TABLE | IBus.Capabilite.PROPERTY;
|
||||
let caps = IBus.Capabilite.PREEDIT_TEXT | IBus.Capabilite.FOCUS | IBus.Capabilite.SURROUNDING_TEXT;
|
||||
|
||||
if (this._context)
|
||||
this._context.set_capabilities(caps);
|
||||
@@ -54,12 +47,22 @@ class InputMethod extends Clutter.InputMethod {
|
||||
}
|
||||
|
||||
_onConnected() {
|
||||
this._ibus.create_input_context_async ('gnome-shell', -1, null,
|
||||
this._setContext.bind(this));
|
||||
this._cancellable = new Gio.Cancellable();
|
||||
this._ibus.create_input_context_async ('gnome-shell', -1,
|
||||
this._cancellable, this._setContext.bind(this));
|
||||
}
|
||||
|
||||
_setContext(bus, res) {
|
||||
this._context = this._ibus.create_input_context_async_finish(res);
|
||||
try {
|
||||
this._context = this._ibus.create_input_context_async_finish(res);
|
||||
} catch (e) {
|
||||
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED)) {
|
||||
logError(e);
|
||||
this._clear();
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
this._context.connect('commit-text', this._onCommitText.bind(this));
|
||||
this._context.connect('delete-surrounding-text', this._onDeleteSurroundingText.bind(this));
|
||||
this._context.connect('update-preedit-text', this._onUpdatePreeditText.bind(this));
|
||||
@@ -71,10 +74,15 @@ class InputMethod extends Clutter.InputMethod {
|
||||
}
|
||||
|
||||
_clear() {
|
||||
if (this._cancellable) {
|
||||
this._cancellable.cancel();
|
||||
this._cancellable = null;
|
||||
}
|
||||
|
||||
this._context = null;
|
||||
this._hints = 0;
|
||||
this._purpose = 0;
|
||||
this._preeditStr = ''
|
||||
this._preeditStr = '';
|
||||
this._preeditPos = 0;
|
||||
this._preeditVisible = false;
|
||||
}
|
||||
@@ -84,15 +92,15 @@ class InputMethod extends Clutter.InputMethod {
|
||||
this.emit('request-surrounding');
|
||||
}
|
||||
|
||||
_onCommitText(context, text) {
|
||||
_onCommitText(_context, text) {
|
||||
this.commit(text.get_text());
|
||||
}
|
||||
|
||||
_onDeleteSurroundingText(context) {
|
||||
_onDeleteSurroundingText() {
|
||||
this.delete_surrounding();
|
||||
}
|
||||
|
||||
_onUpdatePreeditText(context, text, pos, visible) {
|
||||
_onUpdatePreeditText(_context, text, pos, visible) {
|
||||
if (text == null)
|
||||
return;
|
||||
|
||||
@@ -108,17 +116,17 @@ class InputMethod extends Clutter.InputMethod {
|
||||
this._preeditVisible = visible;
|
||||
}
|
||||
|
||||
_onShowPreeditText(context) {
|
||||
_onShowPreeditText() {
|
||||
this._preeditVisible = true;
|
||||
this.set_preedit_text(this._preeditStr, this._preeditPos);
|
||||
}
|
||||
|
||||
_onHidePreeditText(context) {
|
||||
_onHidePreeditText() {
|
||||
this.set_preedit_text(null, this._preeditPos);
|
||||
this._preeditVisible = false;
|
||||
}
|
||||
|
||||
_onForwardKeyEvent(context, keyval, keycode, state) {
|
||||
_onForwardKeyEvent(_context, keyval, keycode, state) {
|
||||
let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
|
||||
state &= ~(IBus.ModifierType.RELEASE_MASK);
|
||||
|
||||
@@ -136,7 +144,6 @@ class InputMethod extends Clutter.InputMethod {
|
||||
this._currentFocus = focus;
|
||||
if (this._context) {
|
||||
this._context.focus_in();
|
||||
this._updateCapabilities();
|
||||
this._emitRequestSurrounding();
|
||||
}
|
||||
|
||||
@@ -148,10 +155,8 @@ class InputMethod extends Clutter.InputMethod {
|
||||
|
||||
vfunc_focus_out() {
|
||||
this._currentFocus = null;
|
||||
if (this._context) {
|
||||
if (this._context)
|
||||
this._context.focus_out();
|
||||
this._updateCapabilities();
|
||||
}
|
||||
|
||||
if (this._preeditStr) {
|
||||
// Unset any preedit text
|
||||
@@ -254,17 +259,19 @@ class InputMethod extends Clutter.InputMethod {
|
||||
if (event.type() == Clutter.EventType.KEY_RELEASE)
|
||||
state |= IBus.ModifierType.RELEASE_MASK;
|
||||
|
||||
this._context.process_key_event_async(event.get_key_symbol(),
|
||||
event.get_key_code() - 8, // Convert XKB keycodes to evcodes
|
||||
state, -1, null,
|
||||
(context, res) => {
|
||||
try {
|
||||
let retval = context.process_key_event_async_finish(res);
|
||||
this.notify_key_event(event, retval);
|
||||
} catch (e) {
|
||||
log('Error processing key on IM: ' + e.message);
|
||||
}
|
||||
});
|
||||
this._context.process_key_event_async(
|
||||
event.get_key_symbol(),
|
||||
event.get_key_code() - 8, // Convert XKB keycodes to evcodes
|
||||
state, -1, this._cancellable,
|
||||
(context, res) => {
|
||||
try {
|
||||
let retval = context.process_key_event_async_finish(res);
|
||||
this.notify_key_event(event, retval);
|
||||
} catch (e) {
|
||||
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
|
||||
log(`Error processing key on IM: ${e.message}`);
|
||||
}
|
||||
});
|
||||
return true;
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported IntrospectService */
|
||||
const { Gio, GLib, Meta, Shell } = imports.gi;
|
||||
|
||||
const INTROSPECT_SCHEMA = 'org.gnome.shell';
|
||||
@@ -46,11 +47,11 @@ var IntrospectService = class {
|
||||
}
|
||||
|
||||
_isIntrospectEnabled() {
|
||||
return this._settings.get_boolean(INTROSPECT_KEY);
|
||||
return this._settings.get_boolean(INTROSPECT_KEY);
|
||||
}
|
||||
|
||||
_isSenderWhitelisted(sender) {
|
||||
return APP_WHITELIST.includes(sender);
|
||||
return APP_WHITELIST.includes(sender);
|
||||
}
|
||||
|
||||
_getSandboxedAppId(app) {
|
||||
@@ -126,7 +127,8 @@ var IntrospectService = class {
|
||||
let apps = this._appSystem.get_running();
|
||||
let windowsList = {};
|
||||
|
||||
if (!this._isIntrospectEnabled()) {
|
||||
if (!this._isIntrospectEnabled() &&
|
||||
!this._isSenderWhitelisted(invocation.get_sender())) {
|
||||
invocation.return_error_literal(Gio.DBusError,
|
||||
Gio.DBusError.ACCESS_DENIED,
|
||||
'App introspection not allowed');
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
/* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
|
||||
/* exported getCompletions, getCommonPrefix, getDeclaredConstants */
|
||||
|
||||
// Returns a list of potential completions for text. Completions either
|
||||
// follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo)
|
||||
@@ -8,7 +9,7 @@
|
||||
// This function is likely the one you want to call from external modules
|
||||
function getCompletions(text, commandHeader, globalCompletionList) {
|
||||
let methods = [];
|
||||
let expr, base;
|
||||
let expr_, base;
|
||||
let attrHead = '';
|
||||
if (globalCompletionList == null) {
|
||||
globalCompletionList = [];
|
||||
@@ -21,7 +22,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
|
||||
// Look for expressions like "Main.panel.foo" and match Main.panel and foo
|
||||
let matches = text.match(/(.*)\.(.*)/);
|
||||
if (matches) {
|
||||
[expr, base, attrHead] = matches;
|
||||
[expr_, base, attrHead] = matches;
|
||||
|
||||
methods = getPropertyNamesFromExpression(base, commandHeader).filter(
|
||||
attr => attr.slice(0, attrHead.length) == attrHead
|
||||
@@ -32,7 +33,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
|
||||
// not proceeded by a dot and match them against global constants
|
||||
matches = text.match(/^(\w*)$/);
|
||||
if (text == '' || matches) {
|
||||
[expr, attrHead] = matches;
|
||||
[expr_, attrHead] = matches;
|
||||
methods = globalCompletionList.filter(
|
||||
attr => attr.slice(0, attrHead.length) == attrHead
|
||||
);
|
||||
@@ -51,14 +52,14 @@ function getCompletions(text, commandHeader, globalCompletionList) {
|
||||
// if we encounter anything that isn't a letter, '.', ')', or ']',
|
||||
// we should stop parsing.
|
||||
function isStopChar(c) {
|
||||
return !c.match(/[\w\.\)\]]/);
|
||||
return !c.match(/[\w.)\]]/);
|
||||
}
|
||||
|
||||
// Given the ending position of a quoted string, find where it starts
|
||||
function findMatchingQuote(expr, offset) {
|
||||
let quoteChar = expr.charAt(offset);
|
||||
for (let i = offset - 1; i >= 0; --i) {
|
||||
if (expr.charAt(i) == quoteChar && expr.charAt(i-1) != '\\'){
|
||||
if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') {
|
||||
return i;
|
||||
}
|
||||
}
|
||||
@@ -68,7 +69,7 @@ function findMatchingQuote(expr, offset) {
|
||||
// Given the ending position of a regex, find where it starts
|
||||
function findMatchingSlash(expr, offset) {
|
||||
for (let i = offset - 1; i >= 0; --i) {
|
||||
if (expr.charAt(i) == '/' && expr.charAt(i-1) != '\\'){
|
||||
if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') {
|
||||
return i;
|
||||
}
|
||||
}
|
||||
@@ -81,7 +82,7 @@ function findMatchingSlash(expr, offset) {
|
||||
// findMatchingBrace("[(])", 3) returns 1.
|
||||
function findMatchingBrace(expr, offset) {
|
||||
let closeBrace = expr.charAt(offset);
|
||||
let openBrace = ({')': '(', ']': '['})[closeBrace];
|
||||
let openBrace = ({ ')': '(', ']': '[' })[closeBrace];
|
||||
|
||||
function findTheBrace(expr, offset) {
|
||||
if (offset < 0) {
|
||||
@@ -117,11 +118,11 @@ function getExpressionOffset(expr, offset) {
|
||||
while (offset >= 0) {
|
||||
let currChar = expr.charAt(offset);
|
||||
|
||||
if (isStopChar(currChar)){
|
||||
if (isStopChar(currChar)) {
|
||||
return offset + 1;
|
||||
}
|
||||
|
||||
if (currChar.match(/[\)\]]/)) {
|
||||
if (currChar.match(/[)\]]/)) {
|
||||
offset = findMatchingBrace(expr, offset);
|
||||
}
|
||||
|
||||
@@ -151,15 +152,11 @@ function getAllProps(obj) {
|
||||
// e.g., expr="({ foo: null, bar: null, 4: null })" will
|
||||
// return ["foo", "bar", ...] but the list will not include "4",
|
||||
// since methods accessed with '.' notation must star with a letter or _.
|
||||
function getPropertyNamesFromExpression(expr, commandHeader) {
|
||||
if (commandHeader == null) {
|
||||
commandHeader = '';
|
||||
}
|
||||
|
||||
function getPropertyNamesFromExpression(expr, commandHeader = '') {
|
||||
let obj = {};
|
||||
if (!isUnsafeExpression(expr)) {
|
||||
try {
|
||||
obj = eval(commandHeader + expr);
|
||||
obj = eval(commandHeader + expr);
|
||||
} catch (e) {
|
||||
return [];
|
||||
}
|
||||
@@ -168,14 +165,14 @@ function getPropertyNamesFromExpression(expr, commandHeader) {
|
||||
}
|
||||
|
||||
let propsUnique = {};
|
||||
if (typeof obj === 'object'){
|
||||
if (typeof obj === 'object') {
|
||||
let allProps = getAllProps(obj);
|
||||
// Get only things we are allowed to complete following a '.'
|
||||
allProps = allProps.filter( isValidPropertyName );
|
||||
|
||||
// Make sure propsUnique contains one key for every
|
||||
// property so we end up with a unique list of properties
|
||||
allProps.map(p => propsUnique[p] = null);
|
||||
allProps.map(p => (propsUnique[p] = null));
|
||||
}
|
||||
return Object.keys(propsUnique).sort();
|
||||
}
|
||||
@@ -220,7 +217,7 @@ function isUnsafeExpression(str) {
|
||||
prunedStr = prunedStr.replace(/[=!]==/g, ''); //replace === and !== with nothing
|
||||
prunedStr = prunedStr.replace(/[=<>!]=/g, ''); //replace ==, <=, >=, != with nothing
|
||||
|
||||
if (prunedStr.match(/=/)) {
|
||||
if (prunedStr.match(/[=]/)) {
|
||||
return true;
|
||||
} else if (prunedStr.match(/;/)) {
|
||||
// If we contain a semicolon not inside of a quote/regex, assume we're unsafe as well
|
||||
@@ -234,10 +231,10 @@ function isUnsafeExpression(str) {
|
||||
function getDeclaredConstants(str) {
|
||||
let ret = [];
|
||||
str.split(';').forEach(s => {
|
||||
let base, keyword;
|
||||
let base_, keyword;
|
||||
let match = s.match(/const\s+(\w+)\s*=/);
|
||||
if (match) {
|
||||
[base, keyword] = match;
|
||||
[base_, keyword] = match;
|
||||
ret.push(keyword);
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getKeyboardManager, holdKeyboard, releaseKeyboard */
|
||||
|
||||
const { GLib, GnomeDesktop, Meta } = imports.gi;
|
||||
|
||||
@@ -60,7 +61,7 @@ var KeyboardManager = class {
|
||||
this._currentKeymap.options == options)
|
||||
return;
|
||||
|
||||
this._currentKeymap = {layouts, variants, options};
|
||||
this._currentKeymap = { layouts, variants, options };
|
||||
Meta.get_backend().set_keymap(layouts, variants, options);
|
||||
}
|
||||
|
||||
@@ -125,7 +126,7 @@ var KeyboardManager = class {
|
||||
|
||||
_getLocaleLayout() {
|
||||
let locale = GLib.get_language_names()[0];
|
||||
if (locale.indexOf('_') == -1)
|
||||
if (!locale.includes('_'))
|
||||
locale = DEFAULT_LOCALE;
|
||||
|
||||
let [found, , id] = GnomeDesktop.get_input_source_from_locale(locale);
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported canLock, getLoginManager, registerSessionWithGDM */
|
||||
|
||||
const { GLib, Gio } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -43,7 +44,7 @@ function canLock() {
|
||||
|
||||
let version = result.deep_unpack()[0].deep_unpack();
|
||||
return haveSystemd() && versionCompare('3.5.91', version);
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
@@ -109,7 +110,7 @@ var LoginManagerSystemd = class {
|
||||
let sessionId = GLib.getenv('XDG_SESSION_ID');
|
||||
if (!sessionId) {
|
||||
log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
|
||||
let [session, objectPath] = this._userProxy.Display;
|
||||
let [session, objectPath_] = this._userProxy.Display;
|
||||
if (session) {
|
||||
log(`Will monitor session ${session}`);
|
||||
sessionId = session;
|
||||
@@ -182,10 +183,10 @@ var LoginManagerSystemd = class {
|
||||
(proxy, result) => {
|
||||
let fd = -1;
|
||||
try {
|
||||
let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result);
|
||||
let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
|
||||
fd = fdList.steal_fds()[0];
|
||||
callback(new Gio.UnixInputStream({ fd: fd }));
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
logError(e, "Error getting systemd inhibitor");
|
||||
callback(null);
|
||||
}
|
||||
@@ -199,7 +200,7 @@ var LoginManagerSystemd = class {
|
||||
Signals.addSignalMethods(LoginManagerSystemd.prototype);
|
||||
|
||||
var LoginManagerDummy = class {
|
||||
getCurrentSessionProxy(callback) {
|
||||
getCurrentSessionProxy(_callback) {
|
||||
// we could return a DummySession object that fakes whatever callers
|
||||
// expect (at the time of writing: connect() and connectSignal()
|
||||
// methods), but just never calling the callback should be safer
|
||||
|
||||
@@ -26,33 +26,33 @@ function _getMobileProvidersDatabase() {
|
||||
}
|
||||
|
||||
// _findProviderForMccMnc:
|
||||
// @operator_name: operator name
|
||||
// @operator_code: operator code
|
||||
// @operatorName: operator name
|
||||
// @operatorCode: operator code
|
||||
//
|
||||
// Given an operator name string (which may not be a real operator name) and an
|
||||
// operator code string, tries to find a proper operator name to display.
|
||||
//
|
||||
function _findProviderForMccMnc(operator_name, operator_code) {
|
||||
if (operator_name) {
|
||||
if (operator_name.length != 0 &&
|
||||
(operator_name.length > 6 || operator_name.length < 5)) {
|
||||
function _findProviderForMccMnc(operatorName, operatorCode) {
|
||||
if (operatorName) {
|
||||
if (operatorName.length != 0 &&
|
||||
(operatorName.length > 6 || operatorName.length < 5)) {
|
||||
// this looks like a valid name, i.e. not an MCCMNC (that some
|
||||
// devices return when not yet connected
|
||||
return operator_name;
|
||||
return operatorName;
|
||||
}
|
||||
|
||||
if (isNaN(parseInt(operator_name))) {
|
||||
if (isNaN(parseInt(operatorName))) {
|
||||
// name is definitely not a MCCMNC, so it may be a name
|
||||
// after all; return that
|
||||
return operator_name;
|
||||
return operatorName;
|
||||
}
|
||||
}
|
||||
|
||||
let needle;
|
||||
if ((!operator_name || operator_name.length == 0) && operator_code)
|
||||
needle = operator_code;
|
||||
else if (operator_name && (operator_name.length == 6 || operator_name.length == 5))
|
||||
needle = operator_name;
|
||||
if ((!operatorName || operatorName.length == 0) && operatorCode)
|
||||
needle = operatorCode;
|
||||
else if (operatorName && (operatorName.length == 6 || operatorName.length == 5))
|
||||
needle = operatorName;
|
||||
else // nothing to search
|
||||
return null;
|
||||
|
||||
@@ -84,9 +84,9 @@ function _findProviderForSid(sid) {
|
||||
}
|
||||
|
||||
|
||||
//------------------------------------------------------------------------------
|
||||
// Support for the old ModemManager interface (MM < 0.7)
|
||||
//------------------------------------------------------------------------------
|
||||
// ----------------------------------------------------- //
|
||||
// Support for the old ModemManager interface (MM < 0.7) //
|
||||
// ----------------------------------------------------- //
|
||||
|
||||
|
||||
// The following are not the complete interfaces, just the methods we need
|
||||
@@ -110,7 +110,7 @@ var ModemGsm = class {
|
||||
this.signal_quality = quality;
|
||||
this.emit('notify::signal-quality');
|
||||
});
|
||||
this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => {
|
||||
this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
|
||||
this.operator_name = _findProviderForMccMnc(name, code);
|
||||
this.emit('notify::operator-name');
|
||||
});
|
||||
@@ -120,7 +120,7 @@ var ModemGsm = class {
|
||||
return;
|
||||
}
|
||||
|
||||
let [status, code, name] = result;
|
||||
let [status_, code, name] = result;
|
||||
this.operator_name = _findProviderForMccMnc(name, code);
|
||||
this.emit('notify::operator-name');
|
||||
});
|
||||
@@ -171,9 +171,9 @@ var ModemCdma = class {
|
||||
// it will return an error if the device is not connected
|
||||
this.operator_name = null;
|
||||
} else {
|
||||
let [bandClass, band, sid] = result;
|
||||
let [bandClass_, band_, sid] = result;
|
||||
|
||||
this.operator_name = _findProviderForSid(sid)
|
||||
this.operator_name = _findProviderForSid(sid);
|
||||
}
|
||||
this.emit('notify::operator-name');
|
||||
});
|
||||
@@ -182,9 +182,9 @@ var ModemCdma = class {
|
||||
Signals.addSignalMethods(ModemCdma.prototype);
|
||||
|
||||
|
||||
//------------------------------------------------------------------------------
|
||||
// Support for the new ModemManager1 interface (MM >= 0.7)
|
||||
//------------------------------------------------------------------------------
|
||||
// ------------------------------------------------------- //
|
||||
// Support for the new ModemManager1 interface (MM >= 0.7) //
|
||||
// ------------------------------------------------------- //
|
||||
|
||||
const BroadbandModemInterface = loadInterfaceXML('org.freedesktop.ModemManager1.Modem');
|
||||
const BroadbandModemProxy = Gio.DBusProxy.makeProxyWrapper(BroadbandModemInterface);
|
||||
@@ -224,23 +224,23 @@ var BroadbandModem = class {
|
||||
}
|
||||
|
||||
_reloadSignalQuality() {
|
||||
let [quality, recent] = this._proxy.SignalQuality;
|
||||
let [quality, recent_] = this._proxy.SignalQuality;
|
||||
this.signal_quality = quality;
|
||||
this.emit('notify::signal-quality');
|
||||
}
|
||||
|
||||
_reloadOperatorName() {
|
||||
let new_name = "";
|
||||
let newName = "";
|
||||
if (this.operator_name_3gpp && this.operator_name_3gpp.length > 0)
|
||||
new_name += this.operator_name_3gpp;
|
||||
newName += this.operator_name_3gpp;
|
||||
|
||||
if (this.operator_name_cdma && this.operator_name_cdma.length > 0) {
|
||||
if (new_name != "")
|
||||
new_name += ", ";
|
||||
new_name += this.operator_name_cdma;
|
||||
if (newName != "")
|
||||
newName += ", ";
|
||||
newName += this.operator_name_cdma;
|
||||
}
|
||||
|
||||
this.operator_name = new_name;
|
||||
this.operator_name = newName;
|
||||
this.emit('notify::operator-name');
|
||||
}
|
||||
|
||||
|
||||
@@ -77,54 +77,51 @@ var ObjectManager = class {
|
||||
let info = this._interfaceInfos[interfaceName];
|
||||
|
||||
if (!info) {
|
||||
if (onFinished)
|
||||
onFinished();
|
||||
return;
|
||||
if (onFinished)
|
||||
onFinished();
|
||||
return;
|
||||
}
|
||||
|
||||
let proxy = new Gio.DBusProxy({ g_connection: this._connection,
|
||||
g_name: this._serviceName,
|
||||
g_object_path: objectPath,
|
||||
g_interface_name: interfaceName,
|
||||
g_interface_info: info,
|
||||
g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START });
|
||||
g_name: this._serviceName,
|
||||
g_object_path: objectPath,
|
||||
g_interface_name: interfaceName,
|
||||
g_interface_info: info,
|
||||
g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START });
|
||||
|
||||
proxy.init_async(GLib.PRIORITY_DEFAULT,
|
||||
this._cancellable,
|
||||
(initable, result) => {
|
||||
let error = null;
|
||||
try {
|
||||
initable.init_finish(result);
|
||||
} catch(e) {
|
||||
logError(e, 'could not initialize proxy for interface ' + interfaceName);
|
||||
proxy.init_async(GLib.PRIORITY_DEFAULT, this._cancellable, (initable, result) => {
|
||||
try {
|
||||
initable.init_finish(result);
|
||||
} catch (e) {
|
||||
logError(e, `could not initialize proxy for interface ${interfaceName}`);
|
||||
|
||||
if (onFinished)
|
||||
onFinished();
|
||||
return;
|
||||
}
|
||||
if (onFinished)
|
||||
onFinished();
|
||||
return;
|
||||
}
|
||||
|
||||
let isNewObject;
|
||||
if (!this._objects[objectPath]) {
|
||||
this._objects[objectPath] = {};
|
||||
isNewObject = true;
|
||||
} else {
|
||||
isNewObject = false;
|
||||
}
|
||||
let isNewObject;
|
||||
if (!this._objects[objectPath]) {
|
||||
this._objects[objectPath] = {};
|
||||
isNewObject = true;
|
||||
} else {
|
||||
isNewObject = false;
|
||||
}
|
||||
|
||||
this._objects[objectPath][interfaceName] = proxy;
|
||||
this._objects[objectPath][interfaceName] = proxy;
|
||||
|
||||
if (!this._interfaces[interfaceName])
|
||||
this._interfaces[interfaceName] = [];
|
||||
if (!this._interfaces[interfaceName])
|
||||
this._interfaces[interfaceName] = [];
|
||||
|
||||
this._interfaces[interfaceName].push(proxy);
|
||||
this._interfaces[interfaceName].push(proxy);
|
||||
|
||||
if (isNewObject)
|
||||
this.emit('object-added', objectPath);
|
||||
if (isNewObject)
|
||||
this.emit('object-added', objectPath);
|
||||
|
||||
this.emit('interface-added', interfaceName, proxy);
|
||||
this.emit('interface-added', interfaceName, proxy);
|
||||
|
||||
if (onFinished)
|
||||
onFinished();
|
||||
if (onFinished)
|
||||
onFinished();
|
||||
});
|
||||
}
|
||||
|
||||
@@ -155,11 +152,10 @@ var ObjectManager = class {
|
||||
}
|
||||
|
||||
_onManagerProxyLoaded(initable, result) {
|
||||
let error = null;
|
||||
try {
|
||||
initable.init_finish(result);
|
||||
} catch(e) {
|
||||
logError(e, 'could not initialize object manager for object ' + this._serviceName);
|
||||
} catch (e) {
|
||||
logError(e, `could not initialize object manager for object ${this._serviceName}`);
|
||||
|
||||
this._tryToCompleteLoad();
|
||||
return;
|
||||
@@ -197,7 +193,7 @@ var ObjectManager = class {
|
||||
this._managerProxy.GetManagedObjectsRemote((result, error) => {
|
||||
if (!result) {
|
||||
if (error) {
|
||||
logError(error, 'could not get remote objects for service ' + this._serviceName + ' path ' + this._managerPath);
|
||||
logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`);
|
||||
}
|
||||
|
||||
this._tryToCompleteLoad();
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported parse */
|
||||
|
||||
// parse:
|
||||
// @params: caller-provided parameter object, or %null
|
||||
@@ -14,22 +15,13 @@
|
||||
//
|
||||
// Return value: a new object, containing the merged parameters from
|
||||
// @params and @defaults
|
||||
function parse(params, defaults, allowExtras) {
|
||||
let ret = {}, prop;
|
||||
|
||||
if (!params)
|
||||
params = {};
|
||||
|
||||
for (prop in params) {
|
||||
if (!(prop in defaults) && !allowExtras)
|
||||
throw new Error('Unrecognized parameter "' + prop + '"');
|
||||
ret[prop] = params[prop];
|
||||
function parse(params = {}, defaults, allowExtras) {
|
||||
if (!allowExtras) {
|
||||
for (let prop in params)
|
||||
if (!(prop in defaults))
|
||||
throw new Error(`Unrecognized parameter "${prop}"`);
|
||||
}
|
||||
|
||||
for (prop in defaults) {
|
||||
if (!(prop in params))
|
||||
ret[prop] = defaults[prop];
|
||||
}
|
||||
|
||||
return ret;
|
||||
}
|
||||
let defaultsCopy = Object.assign({}, defaults);
|
||||
return Object.assign(defaultsCopy, params);
|
||||
}
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported PermissionStore */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
|
||||
@@ -12,4 +13,4 @@ function PermissionStore(initCallback, cancellable) {
|
||||
'org.freedesktop.impl.portal.PermissionStore',
|
||||
'/org/freedesktop/impl/portal/PermissionStore',
|
||||
initCallback, cancellable);
|
||||
};
|
||||
}
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getSmartcardManager */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
const Signals = imports.signals;
|
||||
@@ -29,7 +30,7 @@ var SmartcardManager = class {
|
||||
this._objectManager = new ObjectManager.ObjectManager({ connection: Gio.DBus.session,
|
||||
name: "org.gnome.SettingsDaemon.Smartcard",
|
||||
objectPath: '/org/gnome/SettingsDaemon/Smartcard',
|
||||
knownInterfaces: [ SmartcardTokenIface ],
|
||||
knownInterfaces: [SmartcardTokenIface],
|
||||
onLoaded: this._onLoaded.bind(this) });
|
||||
this._insertedTokens = {};
|
||||
this._loginToken = null;
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported getDefault */
|
||||
const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi;
|
||||
|
||||
const GnomeSession = imports.misc.gnomeSession;
|
||||
@@ -83,48 +84,54 @@ const SystemActions = GObject.registerClass({
|
||||
this._canHaveSuspend = true;
|
||||
|
||||
this._actions = new Map();
|
||||
this._actions.set(POWER_OFF_ACTION_ID,
|
||||
{ // Translators: The name of the power-off action in search
|
||||
name: C_("search-result", "Power Off"),
|
||||
iconName: 'system-shutdown-symbolic',
|
||||
// Translators: A list of keywords that match the power-off action, separated by semicolons
|
||||
keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
|
||||
available: false });
|
||||
this._actions.set(LOCK_SCREEN_ACTION_ID,
|
||||
{ // Translators: The name of the lock screen action in search
|
||||
name: C_("search-result", "Lock Screen"),
|
||||
iconName: 'system-lock-screen-symbolic',
|
||||
// Translators: A list of keywords that match the lock screen action, separated by semicolons
|
||||
keywords: _("lock screen").split(/[; ]/),
|
||||
available: false });
|
||||
this._actions.set(LOGOUT_ACTION_ID,
|
||||
{ // Translators: The name of the logout action in search
|
||||
name: C_("search-result", "Log Out"),
|
||||
iconName: 'application-exit-symbolic',
|
||||
// Translators: A list of keywords that match the logout action, separated by semicolons
|
||||
keywords: _("logout;log out;sign off").split(/[; ]/),
|
||||
available: false });
|
||||
this._actions.set(SUSPEND_ACTION_ID,
|
||||
{ // Translators: The name of the suspend action in search
|
||||
name: C_("search-result", "Suspend"),
|
||||
iconName: 'media-playback-pause-symbolic',
|
||||
// Translators: A list of keywords that match the suspend action, separated by semicolons
|
||||
keywords: _("suspend;sleep").split(/[; ]/),
|
||||
available: false });
|
||||
this._actions.set(SWITCH_USER_ACTION_ID,
|
||||
{ // Translators: The name of the switch user action in search
|
||||
name: C_("search-result", "Switch User"),
|
||||
iconName: 'system-switch-user-symbolic',
|
||||
// Translators: A list of keywords that match the switch user action, separated by semicolons
|
||||
keywords: _("switch user").split(/[; ]/),
|
||||
available: false });
|
||||
this._actions.set(LOCK_ORIENTATION_ACTION_ID,
|
||||
{ // Translators: The name of the lock orientation action in search
|
||||
name: C_("search-result", "Lock Orientation"),
|
||||
iconName: '',
|
||||
// Translators: A list of keywords that match the lock orientation action, separated by semicolons
|
||||
keywords: _("lock orientation;screen;rotation").split(/[; ]/),
|
||||
available: false });
|
||||
this._actions.set(POWER_OFF_ACTION_ID, {
|
||||
// Translators: The name of the power-off action in search
|
||||
name: C_("search-result", "Power Off"),
|
||||
iconName: 'system-shutdown-symbolic',
|
||||
// Translators: A list of keywords that match the power-off action, separated by semicolons
|
||||
keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
|
||||
available: false
|
||||
});
|
||||
this._actions.set(LOCK_SCREEN_ACTION_ID, {
|
||||
// Translators: The name of the lock screen action in search
|
||||
name: C_("search-result", "Lock Screen"),
|
||||
iconName: 'system-lock-screen-symbolic',
|
||||
// Translators: A list of keywords that match the lock screen action, separated by semicolons
|
||||
keywords: _("lock screen").split(/[; ]/),
|
||||
available: false
|
||||
});
|
||||
this._actions.set(LOGOUT_ACTION_ID, {
|
||||
// Translators: The name of the logout action in search
|
||||
name: C_("search-result", "Log Out"),
|
||||
iconName: 'application-exit-symbolic',
|
||||
// Translators: A list of keywords that match the logout action, separated by semicolons
|
||||
keywords: _("logout;log out;sign off").split(/[; ]/),
|
||||
available: false
|
||||
});
|
||||
this._actions.set(SUSPEND_ACTION_ID, {
|
||||
// Translators: The name of the suspend action in search
|
||||
name: C_("search-result", "Suspend"),
|
||||
iconName: 'media-playback-pause-symbolic',
|
||||
// Translators: A list of keywords that match the suspend action, separated by semicolons
|
||||
keywords: _("suspend;sleep").split(/[; ]/),
|
||||
available: false
|
||||
});
|
||||
this._actions.set(SWITCH_USER_ACTION_ID, {
|
||||
// Translators: The name of the switch user action in search
|
||||
name: C_("search-result", "Switch User"),
|
||||
iconName: 'system-switch-user-symbolic',
|
||||
// Translators: A list of keywords that match the switch user action, separated by semicolons
|
||||
keywords: _("switch user").split(/[; ]/),
|
||||
available: false
|
||||
});
|
||||
this._actions.set(LOCK_ORIENTATION_ACTION_ID, {
|
||||
// Translators: The name of the lock orientation action in search
|
||||
name: C_("search-result", "Lock Orientation"),
|
||||
iconName: '',
|
||||
// Translators: A list of keywords that match the lock orientation action, separated by semicolons
|
||||
keywords: _("lock orientation;screen;rotation").split(/[; ]/),
|
||||
available: false
|
||||
});
|
||||
|
||||
this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA });
|
||||
this._lockdownSettings = new Gio.Settings({ schema_id: LOCKDOWN_SCHEMA });
|
||||
@@ -137,92 +144,96 @@ const SystemActions = GObject.registerClass({
|
||||
this._userManager = AccountsService.UserManager.get_default();
|
||||
|
||||
this._userManager.connect('notify::is-loaded',
|
||||
() => { this._updateMultiUser(); });
|
||||
() => this._updateMultiUser());
|
||||
this._userManager.connect('notify::has-multiple-users',
|
||||
() => { this._updateMultiUser(); });
|
||||
() => this._updateMultiUser());
|
||||
this._userManager.connect('user-added',
|
||||
() => { this._updateMultiUser(); });
|
||||
() => this._updateMultiUser());
|
||||
this._userManager.connect('user-removed',
|
||||
() => { this._updateMultiUser(); });
|
||||
() => this._updateMultiUser());
|
||||
|
||||
this._lockdownSettings.connect('changed::' + DISABLE_USER_SWITCH_KEY,
|
||||
() => { this._updateSwitchUser(); });
|
||||
this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY,
|
||||
() => { this._updateLogout(); });
|
||||
global.settings.connect('changed::' + ALWAYS_SHOW_LOG_OUT_KEY,
|
||||
() => { this._updateLogout(); });
|
||||
this._lockdownSettings.connect(`changed::${DISABLE_USER_SWITCH_KEY}`,
|
||||
() => this._updateSwitchUser());
|
||||
this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`,
|
||||
() => this._updateLogout());
|
||||
global.settings.connect(`changed::${ALWAYS_SHOW_LOG_OUT_KEY}`,
|
||||
() => this._updateLogout());
|
||||
|
||||
this._lockdownSettings.connect('changed::' + DISABLE_LOCK_SCREEN_KEY,
|
||||
() => { this._updateLockScreen(); });
|
||||
this._lockdownSettings.connect(`changed::${DISABLE_LOCK_SCREEN_KEY}`,
|
||||
() => this._updateLockScreen());
|
||||
|
||||
this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY,
|
||||
() => { this._updateHaveShutdown(); });
|
||||
this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`,
|
||||
() => this._updateHaveShutdown());
|
||||
|
||||
this.forceUpdate();
|
||||
|
||||
this._orientationSettings.connect('changed::orientation-lock',
|
||||
() => { this._updateOrientationLock();
|
||||
this._updateOrientationLockIcon(); });
|
||||
() => {
|
||||
this._updateOrientationLock();
|
||||
this._updateOrientationLockIcon();
|
||||
});
|
||||
Main.layoutManager.connect('monitors-changed',
|
||||
() => { this._updateOrientationLock(); });
|
||||
Gio.DBus.system.watch_name(SENSOR_BUS_NAME,
|
||||
Gio.BusNameWatcherFlags.NONE,
|
||||
() => { this._sensorProxyAppeared(); },
|
||||
() => {
|
||||
this._sensorProxy = null;
|
||||
this._updateOrientationLock();
|
||||
});
|
||||
() => this._updateOrientationLock());
|
||||
this._sensorProxy = new SensorProxy(Gio.DBus.system,
|
||||
SENSOR_BUS_NAME,
|
||||
SENSOR_OBJECT_PATH,
|
||||
(proxy, error) => {
|
||||
if (error)
|
||||
log(error.message);
|
||||
},
|
||||
null,
|
||||
Gio.DBusProxyFlags.DO_NOT_AUTO_START);
|
||||
this._sensorProxy.connect('g-properties-changed', () => {
|
||||
this._updateOrientationLock();
|
||||
});
|
||||
this._sensorProxy.connect('notify::g-name-owner', () => {
|
||||
this._updateOrientationLock();
|
||||
});
|
||||
this._updateOrientationLock();
|
||||
this._updateOrientationLockIcon();
|
||||
|
||||
Main.sessionMode.connect('updated', () => { this._sessionUpdated(); });
|
||||
Main.sessionMode.connect('updated', () => this._sessionUpdated());
|
||||
this._sessionUpdated();
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_power_off() {
|
||||
return this._actions.get(POWER_OFF_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_suspend() {
|
||||
return this._actions.get(SUSPEND_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_lock_screen() {
|
||||
return this._actions.get(LOCK_SCREEN_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_switch_user() {
|
||||
return this._actions.get(SWITCH_USER_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_logout() {
|
||||
return this._actions.get(LOGOUT_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get can_lock_orientation() {
|
||||
return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get orientation_lock_icon() {
|
||||
return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName;
|
||||
}
|
||||
|
||||
_sensorProxyAppeared() {
|
||||
this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH,
|
||||
(proxy, error) => {
|
||||
if (error) {
|
||||
log(error.message);
|
||||
return;
|
||||
}
|
||||
this._sensorProxy.connect('g-properties-changed',
|
||||
() => { this._updateOrientationLock(); });
|
||||
this._updateOrientationLock();
|
||||
});
|
||||
}
|
||||
|
||||
_updateOrientationLock() {
|
||||
let available = false;
|
||||
if (this._sensorProxy)
|
||||
if (this._sensorProxy.g_name_owner)
|
||||
available = this._sensorProxy.HasAccelerometer &&
|
||||
this._monitorManager.get_is_builtin_display_on();
|
||||
|
||||
@@ -233,8 +244,9 @@ const SystemActions = GObject.registerClass({
|
||||
|
||||
_updateOrientationLockIcon() {
|
||||
let locked = this._orientationSettings.get_boolean('orientation-lock');
|
||||
let iconName = locked ? 'rotation-locked-symbolic'
|
||||
: 'rotation-allowed-symbolic';
|
||||
let iconName = locked
|
||||
? 'rotation-locked-symbolic'
|
||||
: 'rotation-allowed-symbolic';
|
||||
this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName = iconName;
|
||||
|
||||
this.notify('orientation-lock-icon');
|
||||
@@ -257,11 +269,11 @@ const SystemActions = GObject.registerClass({
|
||||
|
||||
getMatchingActions(terms) {
|
||||
// terms is a list of strings
|
||||
terms = terms.map((term) => { return term.toLowerCase(); });
|
||||
terms = terms.map(term => term.toLowerCase());
|
||||
|
||||
let results = [];
|
||||
|
||||
for (let [key, {available, keywords}] of this._actions)
|
||||
for (let [key, { available, keywords }] of this._actions)
|
||||
if (available && terms.every(t => keywords.some(k => k.startsWith(t))))
|
||||
results.push(key);
|
||||
|
||||
@@ -278,24 +290,24 @@ const SystemActions = GObject.registerClass({
|
||||
|
||||
activateAction(id) {
|
||||
switch (id) {
|
||||
case POWER_OFF_ACTION_ID:
|
||||
this.activatePowerOff();
|
||||
break;
|
||||
case LOCK_SCREEN_ACTION_ID:
|
||||
this.activateLockScreen();
|
||||
break;
|
||||
case LOGOUT_ACTION_ID:
|
||||
this.activateLogout();
|
||||
break;
|
||||
case SUSPEND_ACTION_ID:
|
||||
this.activateSuspend();
|
||||
break;
|
||||
case SWITCH_USER_ACTION_ID:
|
||||
this.activateSwitchUser();
|
||||
break;
|
||||
case LOCK_ORIENTATION_ACTION_ID:
|
||||
this.activateLockOrientation();
|
||||
break;
|
||||
case POWER_OFF_ACTION_ID:
|
||||
this.activatePowerOff();
|
||||
break;
|
||||
case LOCK_SCREEN_ACTION_ID:
|
||||
this.activateLockScreen();
|
||||
break;
|
||||
case LOGOUT_ACTION_ID:
|
||||
this.activateLogout();
|
||||
break;
|
||||
case SUSPEND_ACTION_ID:
|
||||
this.activateSuspend();
|
||||
break;
|
||||
case SWITCH_USER_ACTION_ID:
|
||||
this.activateSwitchUser();
|
||||
break;
|
||||
case LOCK_ORIENTATION_ACTION_ID:
|
||||
this.activateLockOrientation();
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
191
js/misc/util.js
191
js/misc/util.js
@@ -1,23 +1,23 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
|
||||
formatTime, formatTimeSpan, createTimeLabel, insertSorted,
|
||||
makeCloseButton, ensureActorVisibleInScrollView, wiggle */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
|
||||
const Gettext = imports.gettext;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Params = imports.misc.params;
|
||||
|
||||
var SCROLL_TIME = 0.1;
|
||||
var SCROLL_TIME = 100;
|
||||
|
||||
// http://daringfireball.net/2010/07/improved_regex_for_matching_urls
|
||||
const _balancedParens = '\\([^\\s()<>]+\\)';
|
||||
const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]';
|
||||
const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u201C\u201D\u2018\u2019]';
|
||||
const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u200E\u200F\u201C\u201D\u2018\u2019\u202A\u202C]';
|
||||
|
||||
const _urlRegexp = new RegExp(
|
||||
'(^|' + _leadingJunk + ')' +
|
||||
`(^|${_leadingJunk})` +
|
||||
'(' +
|
||||
'(?:' +
|
||||
'(?:http|https|ftp)://' + // scheme://
|
||||
@@ -29,12 +29,12 @@ const _urlRegexp = new RegExp(
|
||||
'(?:' + // one or more:
|
||||
'[^\\s()<>]+' + // run of non-space non-()
|
||||
'|' + // or
|
||||
_balancedParens + // balanced parens
|
||||
`${_balancedParens}` + // balanced parens
|
||||
')+' +
|
||||
'(?:' + // end with:
|
||||
_balancedParens + // balanced parens
|
||||
`${_balancedParens}` + // balanced parens
|
||||
'|' + // or
|
||||
_notTrailingJunk + // last non-junk char
|
||||
`${_notTrailingJunk}` + // last non-junk char
|
||||
')' +
|
||||
')', 'gi');
|
||||
|
||||
@@ -69,16 +69,16 @@ function spawn(argv) {
|
||||
}
|
||||
|
||||
// spawnCommandLine:
|
||||
// @command_line: a command line
|
||||
// @commandLine: a command line
|
||||
//
|
||||
// Runs @command_line in the background, handling any errors that
|
||||
// Runs @commandLine in the background, handling any errors that
|
||||
// occur when trying to parse or start the program.
|
||||
function spawnCommandLine(command_line) {
|
||||
function spawnCommandLine(commandLine) {
|
||||
try {
|
||||
let [success, argv] = GLib.shell_parse_argv(command_line);
|
||||
let [success_, argv] = GLib.shell_parse_argv(commandLine);
|
||||
trySpawn(argv);
|
||||
} catch (err) {
|
||||
_handleSpawnError(command_line, err);
|
||||
_handleSpawnError(commandLine, err);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -93,7 +93,7 @@ function spawnApp(argv) {
|
||||
|
||||
let context = global.create_app_launch_context(0, -1);
|
||||
app.launch([], context);
|
||||
} catch(err) {
|
||||
} catch (err) {
|
||||
_handleSpawnError(argv[0], err);
|
||||
}
|
||||
}
|
||||
@@ -103,13 +103,12 @@ function spawnApp(argv) {
|
||||
//
|
||||
// Runs @argv in the background. If launching @argv fails,
|
||||
// this will throw an error.
|
||||
function trySpawn(argv)
|
||||
{
|
||||
var success, pid;
|
||||
function trySpawn(argv) {
|
||||
var success_, pid;
|
||||
try {
|
||||
[success, pid] = GLib.spawn_async(null, argv, null,
|
||||
GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
|
||||
null);
|
||||
[success_, pid] = GLib.spawn_async(null, argv, null,
|
||||
GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
|
||||
null);
|
||||
} catch (err) {
|
||||
/* Rewrite the error in case of ENOENT */
|
||||
if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) {
|
||||
@@ -135,19 +134,19 @@ function trySpawn(argv)
|
||||
}
|
||||
|
||||
// trySpawnCommandLine:
|
||||
// @command_line: a command line
|
||||
// @commandLine: a command line
|
||||
//
|
||||
// Runs @command_line in the background. If launching @command_line
|
||||
// Runs @commandLine in the background. If launching @commandLine
|
||||
// fails, this will throw an error.
|
||||
function trySpawnCommandLine(command_line) {
|
||||
let success, argv;
|
||||
function trySpawnCommandLine(commandLine) {
|
||||
let success_, argv;
|
||||
|
||||
try {
|
||||
[success, argv] = GLib.shell_parse_argv(command_line);
|
||||
[success_, argv] = GLib.shell_parse_argv(commandLine);
|
||||
} catch (err) {
|
||||
// Replace "Error invoking GLib.shell_parse_argv: " with
|
||||
// something nicer
|
||||
err.message = err.message.replace(/[^:]*: /, _("Could not parse command:") + "\n");
|
||||
err.message = err.message.replace(/[^:]*: /, `${_("Could not parse command:")}\n`);
|
||||
throw err;
|
||||
}
|
||||
|
||||
@@ -222,7 +221,7 @@ function formatTime(time, params) {
|
||||
/* Translators: Time in 24h format */
|
||||
format = N_("%H\u2236%M");
|
||||
// Show the word "Yesterday" and time if date is on yesterday
|
||||
else if (daysAgo <2)
|
||||
else if (daysAgo < 2)
|
||||
/* Translators: this is the word "Yesterday" followed by a
|
||||
time string in 24h format. i.e. "Yesterday, 14:30" */
|
||||
// xgettext:no-c-format
|
||||
@@ -251,7 +250,7 @@ function formatTime(time, params) {
|
||||
/* Translators: Time in 12h format */
|
||||
format = N_("%l\u2236%M %p");
|
||||
// Show the word "Yesterday" and time if date is on yesterday
|
||||
else if (daysAgo <2)
|
||||
else if (daysAgo < 2)
|
||||
/* Translators: this is the word "Yesterday" followed by a
|
||||
time string in 12h format. i.e. "Yesterday, 2:30 pm" */
|
||||
// xgettext:no-c-format
|
||||
@@ -289,7 +288,7 @@ function createTimeLabel(date, params) {
|
||||
let id = _desktopSettings.connect('changed::clock-format', () => {
|
||||
label.text = formatTime(date, params);
|
||||
});
|
||||
label.connect('destroy', () => { _desktopSettings.disconnect(id); });
|
||||
label.connect('destroy', () => _desktopSettings.disconnect(id));
|
||||
return label;
|
||||
}
|
||||
|
||||
@@ -314,7 +313,8 @@ function lowerBound(array, val, cmp) {
|
||||
if (array.length == 0)
|
||||
return 0;
|
||||
|
||||
min = 0; max = array.length;
|
||||
min = 0;
|
||||
max = array.length;
|
||||
while (min < (max - 1)) {
|
||||
mid = Math.floor((min + max) / 2);
|
||||
v = cmp(array[mid], val);
|
||||
@@ -346,7 +346,7 @@ function insertSorted(array, val, cmp) {
|
||||
var CloseButton = GObject.registerClass(
|
||||
class CloseButton extends St.Button {
|
||||
_init(boxpointer) {
|
||||
super._init({ style_class: 'notification-close'});
|
||||
super._init({ style_class: 'notification-close' });
|
||||
|
||||
// This is a bit tricky. St.Bin has its own x-align/y-align properties
|
||||
// that compete with Clutter's properties. This should be fixed for
|
||||
@@ -380,7 +380,7 @@ class CloseButton extends St.Button {
|
||||
let themeNode = this.get_theme_node();
|
||||
|
||||
let offY = this._computeBoxPointerOffset();
|
||||
this.translation_x = themeNode.get_length('-shell-close-overlap-x')
|
||||
this.translation_x = themeNode.get_length('-shell-close-overlap-x');
|
||||
this.translation_y = themeNode.get_length('-shell-close-overlap-y') + offY;
|
||||
}
|
||||
|
||||
@@ -396,7 +396,7 @@ function makeCloseButton(boxpointer) {
|
||||
|
||||
function ensureActorVisibleInScrollView(scrollView, actor) {
|
||||
let adjustment = scrollView.vscroll.adjustment;
|
||||
let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values();
|
||||
let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values();
|
||||
|
||||
let offset = 0;
|
||||
let vfade = scrollView.get_effect("fade");
|
||||
@@ -424,97 +424,42 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
|
||||
else
|
||||
return;
|
||||
|
||||
Tweener.addTween(adjustment,
|
||||
{ value: value,
|
||||
time: SCROLL_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
adjustment.ease(value, {
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: SCROLL_TIME
|
||||
});
|
||||
}
|
||||
|
||||
var AppSettingsMonitor = class {
|
||||
constructor(appId, schemaId) {
|
||||
this._appId = appId;
|
||||
this._schemaId = schemaId;
|
||||
function wiggle(actor, params) {
|
||||
params = Params.parse(params, {
|
||||
offset: 0,
|
||||
duration: 0,
|
||||
wiggleCount: 0,
|
||||
});
|
||||
actor.translation_x = 0;
|
||||
|
||||
this._app = null;
|
||||
this._settings = null;
|
||||
this._handlers = [];
|
||||
|
||||
this._schemaSource = Gio.SettingsSchemaSource.get_default();
|
||||
|
||||
this._appSystem = Shell.AppSystem.get_default();
|
||||
this._appSystem.connect('installed-changed',
|
||||
this._onInstalledChanged.bind(this));
|
||||
this._onInstalledChanged();
|
||||
}
|
||||
|
||||
get available() {
|
||||
return this._app != null && this._settings != null;
|
||||
}
|
||||
|
||||
activateApp() {
|
||||
if (this._app)
|
||||
this._app.activate();
|
||||
}
|
||||
|
||||
watchSetting(key, callback) {
|
||||
let handler = { id: 0, key: key, callback: callback };
|
||||
this._handlers.push(handler);
|
||||
|
||||
this._connectHandler(handler);
|
||||
}
|
||||
|
||||
_connectHandler(handler) {
|
||||
if (!this._settings || handler.id > 0)
|
||||
return;
|
||||
|
||||
handler.id = this._settings.connect('changed::' + handler.key,
|
||||
handler.callback);
|
||||
handler.callback(this._settings, handler.key);
|
||||
}
|
||||
|
||||
_disconnectHandler(handler) {
|
||||
if (this._settings && handler.id > 0)
|
||||
this._settings.disconnect(handler.id);
|
||||
handler.id = 0;
|
||||
}
|
||||
|
||||
_onInstalledChanged() {
|
||||
let hadApp = (this._app != null);
|
||||
this._app = this._appSystem.lookup_app(this._appId);
|
||||
let haveApp = (this._app != null);
|
||||
|
||||
if (hadApp == haveApp)
|
||||
return;
|
||||
|
||||
if (haveApp)
|
||||
this._checkSettings();
|
||||
else
|
||||
this._setSettings(null);
|
||||
}
|
||||
|
||||
_setSettings(settings) {
|
||||
this._handlers.forEach((handler) => { this._disconnectHandler(handler); });
|
||||
|
||||
let hadSettings = (this._settings != null);
|
||||
this._settings = settings;
|
||||
let haveSettings = (this._settings != null);
|
||||
|
||||
this._handlers.forEach((handler) => { this._connectHandler(handler); });
|
||||
|
||||
if (hadSettings != haveSettings)
|
||||
this.emit('available-changed');
|
||||
}
|
||||
|
||||
_checkSettings() {
|
||||
let schema = this._schemaSource.lookup(this._schemaId, true);
|
||||
if (schema) {
|
||||
this._setSettings(new Gio.Settings({ settings_schema: schema }));
|
||||
} else if (this._app) {
|
||||
Mainloop.timeout_add_seconds(1, () => {
|
||||
this._checkSettings();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
// Accelerate before wiggling
|
||||
actor.ease({
|
||||
translation_x: -params.offset,
|
||||
duration: params.duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
// Wiggle
|
||||
actor.ease({
|
||||
translation_x: params.offset,
|
||||
duration: params.duration,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
repeatCount: params.wiggleCount,
|
||||
autoReverse: true,
|
||||
onComplete: () => {
|
||||
// Decelerate and return to the original position
|
||||
actor.ease({
|
||||
translation_x: 0,
|
||||
duration: params.duration,
|
||||
mode: Clutter.AnimationMode.EASE_IN_QUAD,
|
||||
});
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(AppSettingsMonitor.prototype);
|
||||
});
|
||||
}
|
||||
|
||||
@@ -1,10 +1,19 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
|
||||
const { Geoclue, Gio, GLib, GWeather } = imports.gi;
|
||||
const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const PermissionStore = imports.misc.permissionStore;
|
||||
const Util = imports.misc.util;
|
||||
|
||||
const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration');
|
||||
|
||||
const WEATHER_BUS_NAME = 'org.gnome.Weather';
|
||||
const WEATHER_OBJECT_PATH = '/org/gnome/Weather';
|
||||
const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration';
|
||||
|
||||
const WEATHER_APP_ID = 'org.gnome.Weather.desktop';
|
||||
|
||||
// Minimum time between updates to show loading indication
|
||||
var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE;
|
||||
@@ -26,7 +35,7 @@ var WeatherClient = class {
|
||||
this._weatherAuthorized = false;
|
||||
this._permStore = new PermissionStore.PermissionStore((proxy, error) => {
|
||||
if (error) {
|
||||
log('Failed to connect to permissionStore: ' + error.message);
|
||||
log(`Failed to connect to permissionStore: ${error.message}`);
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -40,7 +49,7 @@ var WeatherClient = class {
|
||||
|
||||
this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => {
|
||||
if (error)
|
||||
log('Error looking up permission: ' + error.message);
|
||||
log(`Error looking up permission: ${error.message}`);
|
||||
|
||||
let [perms, data] = error ? [{}, null] : res;
|
||||
let params = ['gnome', 'geolocation', false, data, perms];
|
||||
@@ -66,17 +75,38 @@ var WeatherClient = class {
|
||||
this.emit('changed');
|
||||
});
|
||||
|
||||
this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop',
|
||||
'org.gnome.Weather');
|
||||
this._weatherAppMon.connect('available-changed', () => { this.emit('changed'); });
|
||||
this._weatherAppMon.watchSetting('automatic-location',
|
||||
this._onAutomaticLocationChanged.bind(this));
|
||||
this._weatherAppMon.watchSetting('locations',
|
||||
this._onLocationsChanged.bind(this));
|
||||
this._weatherApp = null;
|
||||
this._weatherProxy = null;
|
||||
|
||||
let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface);
|
||||
Gio.DBusProxy.new(
|
||||
Gio.DBus.session,
|
||||
Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES,
|
||||
nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE),
|
||||
WEATHER_BUS_NAME,
|
||||
WEATHER_OBJECT_PATH,
|
||||
WEATHER_INTEGRATION_IFACE,
|
||||
null,
|
||||
this._onWeatherProxyReady.bind(this));
|
||||
|
||||
this._settings = new Gio.Settings({
|
||||
schema_id: 'org.gnome.shell.weather'
|
||||
});
|
||||
this._settings.connect('changed::automatic-location',
|
||||
this._onAutomaticLocationChanged.bind(this));
|
||||
this._onAutomaticLocationChanged();
|
||||
this._settings.connect('changed::locations',
|
||||
this._onLocationsChanged.bind(this));
|
||||
this._onLocationsChanged();
|
||||
|
||||
this._appSystem = Shell.AppSystem.get_default();
|
||||
this._appSystem.connect('installed-changed',
|
||||
this._onInstalledChanged.bind(this));
|
||||
this._onInstalledChanged();
|
||||
}
|
||||
|
||||
get available() {
|
||||
return this._weatherAppMon.available;
|
||||
return this._weatherApp != null;
|
||||
}
|
||||
|
||||
get loading() {
|
||||
@@ -92,7 +122,8 @@ var WeatherClient = class {
|
||||
}
|
||||
|
||||
activateApp() {
|
||||
this._weatherAppMon.activateApp();
|
||||
if (this._weatherApp)
|
||||
this._weatherApp.activate();
|
||||
}
|
||||
|
||||
update() {
|
||||
@@ -114,6 +145,38 @@ var WeatherClient = class {
|
||||
this._weatherAuthorized;
|
||||
}
|
||||
|
||||
_onWeatherProxyReady(o, res) {
|
||||
try {
|
||||
this._weatherProxy = Gio.DBusProxy.new_finish(res);
|
||||
} catch (e) {
|
||||
log(`Failed to create GNOME Weather proxy: ${e}`);
|
||||
return;
|
||||
}
|
||||
|
||||
this._weatherProxy.connect('g-properties-changed',
|
||||
this._onWeatherPropertiesChanged.bind(this));
|
||||
this._onWeatherPropertiesChanged();
|
||||
}
|
||||
|
||||
_onWeatherPropertiesChanged() {
|
||||
if (this._weatherProxy.g_name_owner == null)
|
||||
return;
|
||||
|
||||
this._settings.set_boolean('automatic-location',
|
||||
this._weatherProxy.AutomaticLocation);
|
||||
this._settings.set_value('locations',
|
||||
new GLib.Variant('av', this._weatherProxy.Locations));
|
||||
}
|
||||
|
||||
_onInstalledChanged() {
|
||||
let hadApp = (this._weatherApp != null);
|
||||
this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
|
||||
let haveApp = (this._weatherApp != null);
|
||||
|
||||
if (hadApp !== haveApp)
|
||||
this.emit('changed');
|
||||
}
|
||||
|
||||
_loadInfo() {
|
||||
let id = this._weatherInfo.connect('updated', () => {
|
||||
this._weatherInfo.disconnect(id);
|
||||
@@ -178,8 +241,8 @@ var WeatherClient = class {
|
||||
(o, res) => {
|
||||
try {
|
||||
this._gclueService = Geoclue.Simple.new_finish(res);
|
||||
} catch(e) {
|
||||
log('Failed to connect to Geoclue2 service: ' + e.message);
|
||||
} catch (e) {
|
||||
log(`Failed to connect to Geoclue2 service: ${e.message}`);
|
||||
this._setLocation(this._mostRecentLocation);
|
||||
return;
|
||||
}
|
||||
@@ -198,8 +261,8 @@ var WeatherClient = class {
|
||||
this._setLocation(location);
|
||||
}
|
||||
|
||||
_onAutomaticLocationChanged(settings, key) {
|
||||
let useAutoLocation = settings.get_boolean(key);
|
||||
_onAutomaticLocationChanged() {
|
||||
let useAutoLocation = this._settings.get_boolean('automatic-location');
|
||||
if (this._autoLocationRequested == useAutoLocation)
|
||||
return;
|
||||
|
||||
@@ -217,8 +280,9 @@ var WeatherClient = class {
|
||||
this._setLocation(this._mostRecentLocation);
|
||||
}
|
||||
|
||||
_onLocationsChanged(settings, key) {
|
||||
let serialized = settings.get_value(key).deep_unpack().shift();
|
||||
_onLocationsChanged() {
|
||||
let locations = this._settings.get_value('locations').deep_unpack();
|
||||
let serialized = locations.shift();
|
||||
let mostRecentLocation = null;
|
||||
|
||||
if (serialized)
|
||||
@@ -234,7 +298,7 @@ var WeatherClient = class {
|
||||
}
|
||||
|
||||
_onPermStoreChanged(proxy, sender, params) {
|
||||
let [table, id, deleted, data, perms] = params;
|
||||
let [table, id, deleted_, data_, perms] = params;
|
||||
|
||||
if (table != 'gnome' || id != 'geolocation')
|
||||
return;
|
||||
|
||||
@@ -1,4 +1,9 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported run, script_overviewShowStart, script_overviewShowDone,
|
||||
script_applicationsShowStart, script_applicationsShowDone,
|
||||
script_afterShowHide, malloc_usedSize, glx_swapComplete,
|
||||
clutter_stagePaintDone */
|
||||
/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */
|
||||
|
||||
const System = imports.system;
|
||||
|
||||
@@ -19,7 +24,7 @@ var METRICS = {
|
||||
units: "frames / s" },
|
||||
overviewLatencySubsequent:
|
||||
{ description: "Time to first frame after triggering overview, second time",
|
||||
units: "us"},
|
||||
units: "us" },
|
||||
overviewFpsSubsequent:
|
||||
{ description: "Frames rate when going to the overview, second time",
|
||||
units: "frames / s" },
|
||||
@@ -52,7 +57,7 @@ var METRICS = {
|
||||
units: "us" },
|
||||
applicationsShowTimeSubsequent:
|
||||
{ description: "Time to switch to applications view, second time",
|
||||
units: "us"}
|
||||
units: "us" }
|
||||
};
|
||||
|
||||
let WINDOW_CONFIGS = [
|
||||
@@ -121,10 +126,12 @@ function *run() {
|
||||
|
||||
for (let i = 0; i < 2; i++) {
|
||||
Scripting.scriptEvent('applicationsShowStart');
|
||||
Main.overview._dash.showAppsButton.checked = true;
|
||||
// eslint-disable-next-line require-atomic-updates
|
||||
Main.overview.dash.showAppsButton.checked = true;
|
||||
yield Scripting.waitLeisure();
|
||||
Scripting.scriptEvent('applicationsShowDone');
|
||||
Main.overview._dash.showAppsButton.checked = false;
|
||||
// eslint-disable-next-line require-atomic-updates
|
||||
Main.overview.dash.showAppsButton.checked = false;
|
||||
yield Scripting.waitLeisure();
|
||||
}
|
||||
}
|
||||
@@ -136,7 +143,6 @@ let overviewFrames;
|
||||
let overviewLatency;
|
||||
let mallocUsedSize = 0;
|
||||
let overviewShowCount = 0;
|
||||
let firstOverviewUsedSize;
|
||||
let haveSwapComplete = false;
|
||||
let applicationsShowStart;
|
||||
let applicationsShowCount = 0;
|
||||
@@ -148,7 +154,7 @@ function script_overviewShowStart(time) {
|
||||
overviewFrames = 0;
|
||||
}
|
||||
|
||||
function script_overviewShowDone(time) {
|
||||
function script_overviewShowDone(_time) {
|
||||
// We've set up the state at the end of the zoom out, but we
|
||||
// need to wait for one more frame to paint before we count
|
||||
// ourselves as done.
|
||||
@@ -167,7 +173,7 @@ function script_applicationsShowDone(time) {
|
||||
METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart;
|
||||
}
|
||||
|
||||
function script_afterShowHide(time) {
|
||||
function script_afterShowHide(_time) {
|
||||
if (overviewShowCount == 1) {
|
||||
METRICS.usedAfterOverview.value = mallocUsedSize;
|
||||
} else {
|
||||
|
||||
@@ -1,3 +1,12 @@
|
||||
/* exported run, script_desktopShown, script_overviewShowStart,
|
||||
script_overviewShowDone, script_applicationsShowStart,
|
||||
script_applicationsShowDone, script_mainViewDrawStart,
|
||||
script_mainViewDrawDone, script_overviewDrawStart,
|
||||
script_overviewDrawDone, script_redrawTestStart,
|
||||
script_redrawTestDone, script_collectTimings,
|
||||
script_geditLaunch, script_geditFirstFrame,
|
||||
clutter_stagePaintStart, clutter_paintCompletedTimestamp */
|
||||
/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */
|
||||
const { Clutter, Gio, Shell } = imports.gi;
|
||||
const Main = imports.ui.main;
|
||||
const Scripting = imports.ui.scripting;
|
||||
@@ -30,7 +39,7 @@ var METRICS = {
|
||||
geditStartTime:
|
||||
{ description: "Time from gedit launch to window drawn",
|
||||
units: "us" },
|
||||
}
|
||||
};
|
||||
|
||||
function waitAndDraw(milliseconds) {
|
||||
let cb;
|
||||
@@ -38,7 +47,7 @@ function waitAndDraw(milliseconds) {
|
||||
let timeline = new Clutter.Timeline({ duration: milliseconds });
|
||||
timeline.start();
|
||||
|
||||
timeline.connect('new-frame', (timeline, frame) => {
|
||||
timeline.connect('new-frame', (_timeline, _frame) => {
|
||||
global.stage.queue_redraw();
|
||||
});
|
||||
|
||||
@@ -48,7 +57,7 @@ function waitAndDraw(milliseconds) {
|
||||
cb();
|
||||
});
|
||||
|
||||
return callback => { cb = callback; };
|
||||
return callback => (cb = callback);
|
||||
}
|
||||
|
||||
function waitSignal(object, signal) {
|
||||
@@ -60,7 +69,7 @@ function waitSignal(object, signal) {
|
||||
cb();
|
||||
});
|
||||
|
||||
return callback => { cb = callback; };
|
||||
return callback => (cb = callback);
|
||||
}
|
||||
|
||||
function extractBootTimestamp() {
|
||||
@@ -73,8 +82,8 @@ function extractBootTimestamp() {
|
||||
let result = null;
|
||||
|
||||
let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe());
|
||||
while (true) {
|
||||
let [line, length] = datastream.read_line_utf8(null);
|
||||
while (true) { // eslint-disable-line no-constant-condition
|
||||
let [line, length_] = datastream.read_line_utf8(null);
|
||||
if (line === null)
|
||||
break;
|
||||
|
||||
@@ -117,7 +126,8 @@ function *run() {
|
||||
yield Scripting.sleep(1000);
|
||||
|
||||
Scripting.scriptEvent('applicationsShowStart');
|
||||
Main.overview._dash.showAppsButton.checked = true;
|
||||
// eslint-disable-next-line require-atomic-updates
|
||||
Main.overview.dash.showAppsButton.checked = true;
|
||||
|
||||
yield Scripting.waitLeisure();
|
||||
Scripting.scriptEvent('applicationsShowDone');
|
||||
@@ -127,9 +137,9 @@ function *run() {
|
||||
Main.overview.hide();
|
||||
yield Scripting.waitLeisure();
|
||||
|
||||
////////////////////////////////////////
|
||||
// Tests of redraw speed
|
||||
////////////////////////////////////////
|
||||
// --------------------- //
|
||||
// Tests of redraw speed //
|
||||
// --------------------- //
|
||||
|
||||
global.frame_timestamps = true;
|
||||
global.frame_finish_timestamp = true;
|
||||
@@ -157,7 +167,7 @@ function *run() {
|
||||
Main.overview.hide();
|
||||
|
||||
yield Scripting.createTestWindow({ maximized: true,
|
||||
redraws: true});
|
||||
redraws: true });
|
||||
yield Scripting.waitTestWindows();
|
||||
|
||||
yield Scripting.sleep(1000);
|
||||
@@ -176,8 +186,6 @@ function *run() {
|
||||
|
||||
yield Scripting.sleep(1000);
|
||||
|
||||
////////////////////////////////////////
|
||||
|
||||
let appSys = Shell.AppSystem.get_default();
|
||||
let app = appSys.lookup_app('org.gnome.gedit.desktop');
|
||||
|
||||
@@ -234,31 +242,31 @@ function script_applicationsShowDone(time) {
|
||||
METRICS.applicationsShowTime.value = time - applicationsShowStart;
|
||||
}
|
||||
|
||||
function script_mainViewDrawStart(time) {
|
||||
function script_mainViewDrawStart(_time) {
|
||||
redrawTiming = 'mainView';
|
||||
}
|
||||
|
||||
function script_mainViewDrawDone(time) {
|
||||
function script_mainViewDrawDone(_time) {
|
||||
redrawTiming = null;
|
||||
}
|
||||
|
||||
function script_overviewDrawStart(time) {
|
||||
function script_overviewDrawStart(_time) {
|
||||
redrawTiming = 'overview';
|
||||
}
|
||||
|
||||
function script_overviewDrawDone(time) {
|
||||
function script_overviewDrawDone(_time) {
|
||||
redrawTiming = null;
|
||||
}
|
||||
|
||||
function script_redrawTestStart(time) {
|
||||
function script_redrawTestStart(_time) {
|
||||
redrawTiming = 'application';
|
||||
}
|
||||
|
||||
function script_redrawTestDone(time) {
|
||||
function script_redrawTestDone(_time) {
|
||||
redrawTiming = null;
|
||||
}
|
||||
|
||||
function script_collectTimings(time) {
|
||||
function script_collectTimings(_time) {
|
||||
for (let timing in redrawTimes) {
|
||||
let times = redrawTimes[timing];
|
||||
times.sort((a, b) => a - b);
|
||||
@@ -269,11 +277,11 @@ function script_collectTimings(time) {
|
||||
if (len == 0)
|
||||
median = -1;
|
||||
else if (len % 2 == 1)
|
||||
median = times[(len - 1)/ 2];
|
||||
median = times[(len - 1) / 2];
|
||||
else
|
||||
median = Math.round((times[len / 2 - 1] + times[len / 2]) / 2);
|
||||
|
||||
METRICS[timing + 'RedrawTime'].value = median;
|
||||
METRICS[`${timing}RedrawTime`].value = median;
|
||||
}
|
||||
}
|
||||
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported main */
|
||||
const Format = imports.format;
|
||||
const Gettext = imports.gettext;
|
||||
const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi;
|
||||
@@ -19,7 +20,6 @@ const PortalHelperSecurityLevel = {
|
||||
INSECURE: 2
|
||||
};
|
||||
|
||||
const INACTIVITY_TIMEOUT = 30000; //ms
|
||||
const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org';
|
||||
const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST;
|
||||
const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC;
|
||||
@@ -59,7 +59,7 @@ class PortalHeaderBar extends Gtk.HeaderBar {
|
||||
single_line_mode: true,
|
||||
ellipsize: Pango.EllipsizeMode.END,
|
||||
valign: Gtk.Align.BASELINE,
|
||||
selectable: true});
|
||||
selectable: true });
|
||||
this.subtitleLabel.get_style_context().add_class('subtitle');
|
||||
hbox.add(this.subtitleLabel);
|
||||
|
||||
@@ -152,7 +152,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
|
||||
this._webView.load_uri(this._originalUrl);
|
||||
}
|
||||
|
||||
vfunc_delete_event(event) {
|
||||
vfunc_delete_event(_event) {
|
||||
if (this._recheckAtExit)
|
||||
this._doneCallback(PortalHelperResult.RECHECK);
|
||||
else
|
||||
@@ -178,7 +178,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
|
||||
this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
|
||||
}
|
||||
|
||||
_onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) {
|
||||
_onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) {
|
||||
this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
|
||||
let uri = new Soup.URI(failingURI);
|
||||
this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host());
|
||||
@@ -265,7 +265,7 @@ class WebPortalHelper extends Gtk.Application {
|
||||
this._queue = [];
|
||||
|
||||
let action = new Gio.SimpleAction({ name: 'quit' });
|
||||
action.connect('activate', () => { this.active_window.destroyWindow(); });
|
||||
action.connect('activate', () => this.active_window.destroyWindow());
|
||||
this.add_action(action);
|
||||
}
|
||||
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported AccessDialogDBus */
|
||||
const { Clutter, Gio, GLib, GObject, Shell } = imports.gi;
|
||||
|
||||
const CheckBox = imports.ui.checkBox;
|
||||
@@ -55,8 +56,8 @@ class AccessDialog extends ModalDialog.ModalDialog {
|
||||
|
||||
let check = new CheckBox.CheckBox();
|
||||
check.getLabelActor().text = name;
|
||||
check.actor.checked = selected == "true";
|
||||
content.insertBeforeBody(check.actor);
|
||||
check.checked = selected == "true";
|
||||
content.insertBeforeBody(check);
|
||||
|
||||
this._choices.set(id, check);
|
||||
}
|
||||
@@ -69,7 +70,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
|
||||
this.addButton({ label: grantLabel,
|
||||
action: () => {
|
||||
this._sendResponse(DialogResponse.OK);
|
||||
}});
|
||||
} });
|
||||
}
|
||||
|
||||
open() {
|
||||
@@ -79,7 +80,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
|
||||
this._requestExported = this._request.export(connection, this._handle);
|
||||
}
|
||||
|
||||
CloseAsync(invocation, params) {
|
||||
CloseAsync(invocation, _params) {
|
||||
if (this._invocation.get_sender() != invocation.get_sender()) {
|
||||
invocation.return_error_literal(Gio.DBusError,
|
||||
Gio.DBusError.ACCESS_DENIED,
|
||||
@@ -98,7 +99,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
|
||||
let results = {};
|
||||
if (response == DialogResponse.OK) {
|
||||
for (let [id, check] of this._choices) {
|
||||
let checked = check.actor.checked ? 'true' : 'false';
|
||||
let checked = check.checked ? 'true' : 'false';
|
||||
results[id] = new GLib.Variant('s', checked);
|
||||
}
|
||||
}
|
||||
@@ -132,10 +133,10 @@ var AccessDialogDBus = class {
|
||||
return;
|
||||
}
|
||||
|
||||
let [handle, appId, parentWindow, title, subtitle, body, options] = params;
|
||||
let [handle, appId, parentWindow_, title, subtitle, body, options] = params;
|
||||
// We probably want to use parentWindow and global.display.focus_window
|
||||
// for this check in the future
|
||||
if (appId && appId + '.desktop' != this._windowTracker.focus_app.id) {
|
||||
if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) {
|
||||
invocation.return_error_literal(Gio.DBusError,
|
||||
Gio.DBusError.ACCESS_DENIED,
|
||||
'Only the focused app is allowed to show a system access dialog');
|
||||
@@ -146,7 +147,7 @@ var AccessDialogDBus = class {
|
||||
subtitle, body, options);
|
||||
dialog.open();
|
||||
|
||||
dialog.connect('closed', () => { this._accessDialog = null; });
|
||||
dialog.connect('closed', () => (this._accessDialog = null));
|
||||
|
||||
this._accessDialog = dialog;
|
||||
}
|
||||
|
||||
195
js/ui/altTab.js
195
js/ui/altTab.js
@@ -1,17 +1,17 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup,
|
||||
WindowCyclerPopup */
|
||||
|
||||
const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const SwitcherPopup = imports.ui.switcherPopup;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds
|
||||
|
||||
var THUMBNAIL_DEFAULT_SIZE = 256;
|
||||
var THUMBNAIL_POPUP_TIME = 500; // milliseconds
|
||||
var THUMBNAIL_FADE_TIME = 0.1; // seconds
|
||||
var THUMBNAIL_FADE_TIME = 100; // milliseconds
|
||||
|
||||
var WINDOW_PREVIEW_SIZE = 128;
|
||||
var APP_ICON_SIZE = 96;
|
||||
@@ -36,7 +36,7 @@ function _createWindowClone(window, size) {
|
||||
// usual hack for the usual bug in ClutterBinLayout...
|
||||
x_expand: true,
|
||||
y_expand: true });
|
||||
};
|
||||
}
|
||||
|
||||
function getWindows(workspace) {
|
||||
// We ignore skip-taskbar windows in switchers, but if they are attached
|
||||
@@ -87,9 +87,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
let hPadding = leftPadding + rightPadding;
|
||||
|
||||
let icon = this._items[this._selectedIndex];
|
||||
let [posX, posY] = icon.get_transformed_position();
|
||||
let [posX] = icon.get_transformed_position();
|
||||
let thumbnailCenter = posX + icon.width / 2;
|
||||
let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
|
||||
let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
|
||||
childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2));
|
||||
if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) {
|
||||
let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding;
|
||||
@@ -103,7 +103,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
childBox.x2 = primary.x + primary.width - rightPadding;
|
||||
childBox.y1 = this._switcherList.allocation.y2 + spacing;
|
||||
this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1);
|
||||
let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
|
||||
let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
|
||||
childBox.y2 = childBox.y1 + childNaturalHeight;
|
||||
this._thumbnails.allocate(childBox, flags);
|
||||
}
|
||||
@@ -291,7 +291,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
if (this._thumbnails)
|
||||
this._destroyThumbnails();
|
||||
if (this._thumbnailTimeoutId != 0)
|
||||
Mainloop.source_remove(this._thumbnailTimeoutId);
|
||||
GLib.source_remove(this._thumbnailTimeoutId);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -326,7 +326,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
}
|
||||
|
||||
if (this._thumbnailTimeoutId != 0) {
|
||||
Mainloop.source_remove(this._thumbnailTimeoutId);
|
||||
GLib.source_remove(this._thumbnailTimeoutId);
|
||||
this._thumbnailTimeoutId = 0;
|
||||
}
|
||||
|
||||
@@ -343,7 +343,8 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
this._thumbnails.highlight(window, forceAppFocus);
|
||||
} else if (this._items[this._selectedIndex].cachedWindows.length > 1 &&
|
||||
!forceAppFocus) {
|
||||
this._thumbnailTimeoutId = Mainloop.timeout_add (
|
||||
this._thumbnailTimeoutId = GLib.timeout_add(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
THUMBNAIL_POPUP_TIME,
|
||||
this._timeoutPopupThumbnails.bind(this));
|
||||
GLib.Source.set_name_by_id(this._thumbnailTimeoutId, '[gnome-shell] this._timeoutPopupThumbnails');
|
||||
@@ -360,15 +361,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
|
||||
_destroyThumbnails() {
|
||||
let thumbnailsActor = this._thumbnails;
|
||||
Tweener.addTween(thumbnailsActor,
|
||||
{ opacity: 0,
|
||||
time: THUMBNAIL_FADE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
thumbnailsActor.destroy();
|
||||
this.thumbnailsVisible = false;
|
||||
}
|
||||
});
|
||||
this._thumbnails.ease({
|
||||
opacity: 0,
|
||||
duration: THUMBNAIL_FADE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
thumbnailsActor.destroy();
|
||||
this.thumbnailsVisible = false;
|
||||
}
|
||||
});
|
||||
this._thumbnails = null;
|
||||
if (this._switcherList._items[this._selectedIndex])
|
||||
this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
|
||||
@@ -391,38 +392,39 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
|
||||
this._thumbnails.get_allocation_box();
|
||||
|
||||
this._thumbnails.opacity = 0;
|
||||
Tweener.addTween(this._thumbnails,
|
||||
{ opacity: 255,
|
||||
time: THUMBNAIL_FADE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => { this.thumbnailsVisible = true; }
|
||||
});
|
||||
this._thumbnails.ease({
|
||||
opacity: 255,
|
||||
duration: THUMBNAIL_FADE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this.thumbnailsVisible = true;
|
||||
}
|
||||
});
|
||||
|
||||
this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
|
||||
}
|
||||
});
|
||||
|
||||
class CyclerHighlight {
|
||||
constructor() {
|
||||
var CyclerHighlight = GObject.registerClass(
|
||||
class CyclerHighlight extends St.Widget {
|
||||
_init() {
|
||||
super._init({ layout_manager: new Clutter.BinLayout() });
|
||||
this._window = null;
|
||||
|
||||
this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout() });
|
||||
|
||||
this._clone = new Clutter.Clone();
|
||||
this.actor.add_actor(this._clone);
|
||||
this.add_actor(this._clone);
|
||||
|
||||
this._highlight = new St.Widget({ style_class: 'cycler-highlight' });
|
||||
this.actor.add_actor(this._highlight);
|
||||
this.add_actor(this._highlight);
|
||||
|
||||
let coordinate = Clutter.BindCoordinate.ALL;
|
||||
let constraint = new Clutter.BindConstraint({ coordinate: coordinate });
|
||||
this._clone.bind_property('source', constraint, 'source', 0);
|
||||
|
||||
this.actor.add_constraint(constraint);
|
||||
this.add_constraint(constraint);
|
||||
|
||||
this.actor.connect('notify::allocation',
|
||||
this._onAllocationChanged.bind(this));
|
||||
this.actor.connect('destroy', this._onDestroy.bind(this));
|
||||
this.connect('notify::allocation', this._onAllocationChanged.bind(this));
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
}
|
||||
|
||||
set window(w) {
|
||||
@@ -434,8 +436,8 @@ class CyclerHighlight {
|
||||
if (this._clone.source)
|
||||
this._clone.source.sync_visibility();
|
||||
|
||||
let windowActor = this._window ? this._window.get_compositor_private()
|
||||
: null;
|
||||
let windowActor = this._window
|
||||
? this._window.get_compositor_private() : null;
|
||||
|
||||
if (windowActor)
|
||||
windowActor.hide();
|
||||
@@ -448,7 +450,7 @@ class CyclerHighlight {
|
||||
this._highlight.set_size(0, 0);
|
||||
this._highlight.hide();
|
||||
} else {
|
||||
let [x, y] = this.actor.allocation.get_origin();
|
||||
let [x, y] = this.allocation.get_origin();
|
||||
let rect = this._window.get_frame_rect();
|
||||
this._highlight.set_size(rect.width, rect.height);
|
||||
this._highlight.set_position(rect.x - x, rect.y - y);
|
||||
@@ -459,7 +461,7 @@ class CyclerHighlight {
|
||||
_onDestroy() {
|
||||
this.window = null;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
// We don't show an actual popup, so just provide what SwitcherPopup
|
||||
// expects instead of inheriting from SwitcherList
|
||||
@@ -469,7 +471,7 @@ var CyclerList = GObject.registerClass({
|
||||
'item-removed': { param_types: [GObject.TYPE_INT] },
|
||||
'item-highlighted': { param_types: [GObject.TYPE_INT] } },
|
||||
}, class CyclerList extends St.Widget {
|
||||
highlight(index, justOutline) {
|
||||
highlight(index, _justOutline) {
|
||||
this.emit('item-highlighted', index);
|
||||
}
|
||||
});
|
||||
@@ -486,7 +488,7 @@ var CyclerPopup = GObject.registerClass({
|
||||
return;
|
||||
|
||||
this._highlight = new CyclerHighlight();
|
||||
global.window_group.add_actor(this._highlight.actor);
|
||||
global.window_group.add_actor(this._highlight);
|
||||
|
||||
this._switcherList = new CyclerList();
|
||||
this._switcherList.connect('item-highlighted', (list, index) => {
|
||||
@@ -494,9 +496,9 @@ var CyclerPopup = GObject.registerClass({
|
||||
});
|
||||
}
|
||||
|
||||
_highlightItem(index, justOutline) {
|
||||
_highlightItem(index, _justOutline) {
|
||||
this._highlight.window = this._items[index];
|
||||
global.window_group.set_child_above_sibling(this._highlight.actor, null);
|
||||
global.window_group.set_child_above_sibling(this._highlight, null);
|
||||
}
|
||||
|
||||
_finish() {
|
||||
@@ -526,7 +528,7 @@ var CyclerPopup = GObject.registerClass({
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
this._highlight.actor.destroy();
|
||||
this._highlight.destroy();
|
||||
|
||||
super._onDestroy();
|
||||
}
|
||||
@@ -645,8 +647,9 @@ class WindowCyclerPopup extends CyclerPopup {
|
||||
}
|
||||
});
|
||||
|
||||
var AppIcon = GObject.registerClass(
|
||||
class AppIcon extends St.BoxLayout {
|
||||
var AppIcon = GObject.registerClass({
|
||||
GTypeName: 'AltTab_AppIcon'
|
||||
}, class AppIcon extends St.BoxLayout {
|
||||
_init(app) {
|
||||
super._init({ style_class: 'alt-tab-app',
|
||||
vertical: true });
|
||||
@@ -660,17 +663,10 @@ class AppIcon extends St.BoxLayout {
|
||||
this.add(this.label, { x_fill: false });
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set_size(size) {
|
||||
this.icon = this.app.create_icon_texture(size);
|
||||
this._iconBin.child = this.icon;
|
||||
this._iconBin.set_size(size, size);
|
||||
}
|
||||
|
||||
vfunc_get_preferred_width(forHeight) {
|
||||
let [minWidth, ] = super.vfunc_get_preferred_width(forHeight);
|
||||
|
||||
minWidth = Math.max(minWidth, forHeight);
|
||||
return [minWidth, minWidth];
|
||||
}
|
||||
});
|
||||
|
||||
@@ -715,7 +711,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
|
||||
_onDestroy() {
|
||||
if (this._mouseTimeOutId != 0)
|
||||
Mainloop.source_remove(this._mouseTimeOutId);
|
||||
GLib.source_remove(this._mouseTimeOutId);
|
||||
|
||||
this.icons.forEach(icon => {
|
||||
icon.app.disconnect(icon._stateChangedId);
|
||||
@@ -724,15 +720,16 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
|
||||
_setIconSize() {
|
||||
let j = 0;
|
||||
while(this._items.length > 1 && this._items[j].style_class != 'item-box') {
|
||||
j++;
|
||||
while (this._items.length > 1 && this._items[j].style_class != 'item-box') {
|
||||
j++;
|
||||
}
|
||||
let themeNode = this._items[j].get_theme_node();
|
||||
this._list.ensure_style();
|
||||
|
||||
let iconPadding = themeNode.get_horizontal_padding();
|
||||
let iconBorder = themeNode.get_border_width(St.Side.LEFT) + themeNode.get_border_width(St.Side.RIGHT);
|
||||
let [iconMinHeight, iconNaturalHeight] = this.icons[j].label.get_preferred_height(-1);
|
||||
let iconSpacing = iconNaturalHeight + iconPadding + iconBorder;
|
||||
let [, labelNaturalHeight] = this.icons[j].label.get_preferred_height(-1);
|
||||
let iconSpacing = labelNaturalHeight + iconPadding + iconBorder;
|
||||
let totalSpacing = this._list.spacing * (this._items.length - 1);
|
||||
|
||||
// We just assume the whole screen here due to weirdness happing with the passed width
|
||||
@@ -745,7 +742,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
let iconSize = baseIconSizes[0];
|
||||
|
||||
if (this._items.length > 1) {
|
||||
for(let i = 0; i < baseIconSizes.length; i++) {
|
||||
for (let i = 0; i < baseIconSizes.length; i++) {
|
||||
iconSize = baseIconSizes[i];
|
||||
let height = iconSizes[i] + iconSpacing;
|
||||
let w = height * this._items.length + totalSpacing;
|
||||
@@ -756,7 +753,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
|
||||
this._iconSize = iconSize;
|
||||
|
||||
for(let i = 0; i < this.icons.length; i++) {
|
||||
for (let i = 0; i < this.icons.length; i++) {
|
||||
if (this.icons[i].icon != null)
|
||||
break;
|
||||
this.icons[i].set_size(iconSize);
|
||||
@@ -793,21 +790,24 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
// activation when the thumbnail list is open
|
||||
_onItemEnter(index) {
|
||||
if (this._mouseTimeOutId != 0)
|
||||
Mainloop.source_remove(this._mouseTimeOutId);
|
||||
GLib.source_remove(this._mouseTimeOutId);
|
||||
if (this._altTabPopup.thumbnailsVisible) {
|
||||
this._mouseTimeOutId = Mainloop.timeout_add(APP_ICON_HOVER_TIMEOUT,
|
||||
() => {
|
||||
this._enterItem(index);
|
||||
this._mouseTimeOutId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
this._mouseTimeOutId = GLib.timeout_add(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
APP_ICON_HOVER_TIMEOUT,
|
||||
() => {
|
||||
this._enterItem(index);
|
||||
this._mouseTimeOutId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
GLib.Source.set_name_by_id(this._mouseTimeOutId, '[gnome-shell] this._enterItem');
|
||||
} else
|
||||
this._itemEntered(index);
|
||||
} else {
|
||||
this._itemEntered(index);
|
||||
}
|
||||
}
|
||||
|
||||
_enterItem(index) {
|
||||
let [x, y, mask] = global.get_pointer();
|
||||
let [x, y] = global.get_pointer();
|
||||
let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y);
|
||||
if (this._items[index].contains(pickedActor))
|
||||
this._itemEntered(index);
|
||||
@@ -848,9 +848,8 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
|
||||
this._removeIcon(app);
|
||||
});
|
||||
|
||||
let n = this._arrows.length;
|
||||
let arrow = new St.DrawingArea({ style_class: 'switcher-arrow' });
|
||||
arrow.connect('repaint', () => { SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM); });
|
||||
arrow.connect('repaint', () => SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM));
|
||||
this.add_actor(arrow);
|
||||
this._arrows.push(arrow);
|
||||
|
||||
@@ -877,9 +876,9 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
|
||||
_init(windows) {
|
||||
super._init(false);
|
||||
|
||||
this._labels = new Array();
|
||||
this._thumbnailBins = new Array();
|
||||
this._clones = new Array();
|
||||
this._labels = [];
|
||||
this._thumbnailBins = [];
|
||||
this._clones = [];
|
||||
this._windows = windows;
|
||||
|
||||
for (let i = 0; i < windows.length; i++) {
|
||||
@@ -915,7 +914,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
|
||||
return;
|
||||
let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding();
|
||||
totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding();
|
||||
let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
|
||||
let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
|
||||
let spacing = this._items[0].child.get_theme_node().get_length('spacing');
|
||||
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
|
||||
let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor;
|
||||
@@ -940,7 +939,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
|
||||
}
|
||||
|
||||
// Make sure we only do this once
|
||||
this._thumbnailBins = new Array();
|
||||
this._thumbnailBins = [];
|
||||
}
|
||||
|
||||
_removeThumbnail(source, clone) {
|
||||
@@ -991,32 +990,32 @@ class WindowIcon extends St.BoxLayout {
|
||||
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
|
||||
|
||||
switch (mode) {
|
||||
case AppIconMode.THUMBNAIL_ONLY:
|
||||
size = WINDOW_PREVIEW_SIZE;
|
||||
this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
|
||||
break;
|
||||
case AppIconMode.THUMBNAIL_ONLY:
|
||||
size = WINDOW_PREVIEW_SIZE;
|
||||
this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
|
||||
break;
|
||||
|
||||
case AppIconMode.BOTH:
|
||||
size = WINDOW_PREVIEW_SIZE;
|
||||
this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
|
||||
case AppIconMode.BOTH:
|
||||
size = WINDOW_PREVIEW_SIZE;
|
||||
this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
|
||||
|
||||
if (this.app)
|
||||
this._icon.add_actor(this._createAppIcon(this.app,
|
||||
APP_ICON_SIZE_SMALL));
|
||||
break;
|
||||
if (this.app)
|
||||
this._icon.add_actor(this._createAppIcon(this.app,
|
||||
APP_ICON_SIZE_SMALL));
|
||||
break;
|
||||
|
||||
case AppIconMode.APP_ICON_ONLY:
|
||||
size = APP_ICON_SIZE;
|
||||
this._icon.add_actor(this._createAppIcon(this.app, size));
|
||||
case AppIconMode.APP_ICON_ONLY:
|
||||
size = APP_ICON_SIZE;
|
||||
this._icon.add_actor(this._createAppIcon(this.app, size));
|
||||
}
|
||||
|
||||
this._icon.set_size(size * scaleFactor, size * scaleFactor);
|
||||
}
|
||||
|
||||
_createAppIcon(app, size) {
|
||||
let appIcon = app ? app.create_icon_texture(size)
|
||||
: new St.Icon({ icon_name: 'icon-missing',
|
||||
icon_size: size });
|
||||
let appIcon = app
|
||||
? app.create_icon_texture(size)
|
||||
: new St.Icon({ icon_name: 'icon-missing', icon_size: size });
|
||||
appIcon.x_expand = appIcon.y_expand = true;
|
||||
appIcon.x_align = appIcon.y_align = Clutter.ActorAlign.END;
|
||||
|
||||
@@ -1043,8 +1042,8 @@ class WindowList extends SwitcherPopup.SwitcherList {
|
||||
this.addItem(icon, icon.label);
|
||||
this.icons.push(icon);
|
||||
|
||||
icon._unmanagedSignalId = icon.window.connect('unmanaged', (window) => {
|
||||
this._removeWindow(window)
|
||||
icon._unmanagedSignalId = icon.window.connect('unmanaged', window => {
|
||||
this._removeWindow(window);
|
||||
});
|
||||
}
|
||||
|
||||
@@ -1080,7 +1079,7 @@ class WindowList extends SwitcherPopup.SwitcherList {
|
||||
childBox.y1 = childBox.y2 - this._label.height;
|
||||
this._label.allocate(childBox, flags);
|
||||
|
||||
let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM)
|
||||
let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM);
|
||||
childBox.x1 = box.x1;
|
||||
childBox.x2 = box.x2;
|
||||
childBox.y1 = box.y1;
|
||||
|
||||
@@ -1,21 +1,18 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Animation, AnimatedIcon, Spinner */
|
||||
|
||||
const { GLib, Gio, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const Tweener = imports.ui.tweener;
|
||||
const { Clutter, GLib, GObject, Gio, St } = imports.gi;
|
||||
|
||||
var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
|
||||
var SPINNER_ANIMATION_TIME = 0.3;
|
||||
var SPINNER_ANIMATION_DELAY = 1.0;
|
||||
var SPINNER_ANIMATION_TIME = 300;
|
||||
var SPINNER_ANIMATION_DELAY = 1000;
|
||||
|
||||
var Animation = class {
|
||||
constructor(file, width, height, speed) {
|
||||
this.actor = new St.Bin();
|
||||
this.actor.set_size(width, height);
|
||||
this.actor.connect('destroy', this._onDestroy.bind(this));
|
||||
this.actor.connect('notify::size', this._syncAnimationSize.bind(this));
|
||||
this.actor.connect('resource-scale-changed',
|
||||
var Animation = GObject.registerClass(
|
||||
class Animation extends St.Bin {
|
||||
_init(file, width, height, speed) {
|
||||
super._init({ width: width, height: height });
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
this.connect('resource-scale-changed',
|
||||
this._loadFile.bind(this, file, width, height));
|
||||
|
||||
let themeContext = St.ThemeContext.get_for_stage(global.stage);
|
||||
@@ -46,7 +43,7 @@ var Animation = class {
|
||||
|
||||
stop() {
|
||||
if (this._timeoutId > 0) {
|
||||
Mainloop.source_remove(this._timeoutId);
|
||||
GLib.source_remove(this._timeoutId);
|
||||
this._timeoutId = 0;
|
||||
}
|
||||
|
||||
@@ -54,20 +51,30 @@ var Animation = class {
|
||||
}
|
||||
|
||||
_loadFile(file, width, height) {
|
||||
let [validResourceScale, resourceScale] = this.actor.get_resource_scale();
|
||||
let [validResourceScale, resourceScale] = this.get_resource_scale();
|
||||
let wasPlaying = this._isPlaying;
|
||||
|
||||
if (this._isPlaying)
|
||||
this.stop();
|
||||
|
||||
this._isLoaded = false;
|
||||
this.actor.destroy_all_children();
|
||||
this.destroy_all_children();
|
||||
|
||||
if (!validResourceScale)
|
||||
if (!validResourceScale) {
|
||||
if (wasPlaying)
|
||||
this.play();
|
||||
return;
|
||||
}
|
||||
|
||||
let texture_cache = St.TextureCache.get_default();
|
||||
let textureCache = St.TextureCache.get_default();
|
||||
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
|
||||
this._animations = texture_cache.load_sliced_image(file, width, height,
|
||||
scaleFactor, resourceScale,
|
||||
this._animationsLoaded.bind(this));
|
||||
this.actor.set_child(this._animations);
|
||||
this._animations = textureCache.load_sliced_image(file, width, height,
|
||||
scaleFactor, resourceScale,
|
||||
this._animationsLoaded.bind(this));
|
||||
this.set_child(this._animations);
|
||||
|
||||
if (wasPlaying)
|
||||
this.play();
|
||||
}
|
||||
|
||||
_showFrame(frame) {
|
||||
@@ -91,7 +98,7 @@ var Animation = class {
|
||||
if (!this._isLoaded)
|
||||
return;
|
||||
|
||||
let [width, height] = this.actor.get_size();
|
||||
let [width, height] = this.get_size();
|
||||
|
||||
for (let i = 0; i < this._animations.get_n_children(); ++i)
|
||||
this._animations.get_child_at_index(i).set_size(width, height);
|
||||
@@ -114,20 +121,22 @@ var Animation = class {
|
||||
themeContext.disconnect(this._scaleChangedId);
|
||||
this._scaleChangedId = 0;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var AnimatedIcon = class extends Animation {
|
||||
constructor(file, size) {
|
||||
super(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT);
|
||||
var AnimatedIcon = GObject.registerClass(
|
||||
class AnimatedIcon extends Animation {
|
||||
_init(file, size) {
|
||||
super._init(file, size, size, ANIMATED_ICON_UPDATE_TIMEOUT);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var Spinner = class extends AnimatedIcon {
|
||||
constructor(size, animate=false) {
|
||||
var Spinner = GObject.registerClass(
|
||||
class Spinner extends AnimatedIcon {
|
||||
_init(size, animate = false) {
|
||||
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg');
|
||||
super(file, size);
|
||||
super._init(file, size);
|
||||
|
||||
this.actor.opacity = 0;
|
||||
this.opacity = 0;
|
||||
this._animate = animate;
|
||||
}
|
||||
|
||||
@@ -137,37 +146,35 @@ var Spinner = class extends AnimatedIcon {
|
||||
}
|
||||
|
||||
play() {
|
||||
Tweener.removeTweens(this.actor);
|
||||
this.remove_all_transitions();
|
||||
|
||||
if (this._animate) {
|
||||
super.play();
|
||||
Tweener.addTween(this.actor, {
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
delay: SPINNER_ANIMATION_DELAY,
|
||||
time: SPINNER_ANIMATION_TIME,
|
||||
transition: 'linear'
|
||||
duration: SPINNER_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.LINEAR
|
||||
});
|
||||
} else {
|
||||
this.actor.opacity = 255;
|
||||
this.opacity = 255;
|
||||
super.play();
|
||||
}
|
||||
}
|
||||
|
||||
stop() {
|
||||
Tweener.removeTweens(this.actor);
|
||||
this.remove_all_transitions();
|
||||
|
||||
if (this._animate) {
|
||||
Tweener.addTween(this.actor, {
|
||||
this.ease({
|
||||
opacity: 0,
|
||||
time: SPINNER_ANIMATION_TIME,
|
||||
transition: 'linear',
|
||||
onComplete: () => {
|
||||
this.stop(false);
|
||||
}
|
||||
duration: SPINNER_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
onComplete: () => super.stop()
|
||||
});
|
||||
} else {
|
||||
this.actor.opacity = 0;
|
||||
this.opacity = 0;
|
||||
super.stop();
|
||||
}
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
1553
js/ui/appDisplay.js
1553
js/ui/appDisplay.js
File diff suppressed because it is too large
Load Diff
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported getAppFavorites */
|
||||
|
||||
const Shell = imports.gi.Shell;
|
||||
const Signals = imports.signals;
|
||||
@@ -54,6 +55,7 @@ const RENAMED_DESKTOP_IDS = {
|
||||
'org.gnome.taquin.desktop': 'org.gnome.Taquin.desktop',
|
||||
'org.gnome.Weather.Application.desktop': 'org.gnome.Weather.desktop',
|
||||
'polari.desktop': 'org.gnome.Polari.desktop',
|
||||
'shotwell.desktop': 'org.gnome.Shotwell.desktop',
|
||||
'tali.desktop': 'org.gnome.Tali.desktop',
|
||||
'totem.desktop': 'org.gnome.Totem.desktop',
|
||||
'evince.desktop': 'org.gnome.Evince.desktop',
|
||||
@@ -63,7 +65,7 @@ class AppFavorites {
|
||||
constructor() {
|
||||
this.FAVORITE_APPS_KEY = 'favorite-apps';
|
||||
this._favorites = {};
|
||||
global.settings.connect('changed::' + this.FAVORITE_APPS_KEY, this._onFavsChanged.bind(this));
|
||||
global.settings.connect(`changed::${this.FAVORITE_APPS_KEY}`, this._onFavsChanged.bind(this));
|
||||
this.reload();
|
||||
}
|
||||
|
||||
@@ -146,12 +148,11 @@ class AppFavorites {
|
||||
|
||||
let app = Shell.AppSystem.get_default().lookup_app(appId);
|
||||
|
||||
Main.overview.setMessage(_("%s has been added to your favorites.").format(app.get_name()),
|
||||
{ forFeedback: true,
|
||||
undoCallback: () => {
|
||||
this._removeFavorite(appId);
|
||||
}
|
||||
});
|
||||
let msg = _("%s has been added to your favorites.").format(app.get_name());
|
||||
Main.overview.setMessage(msg, {
|
||||
forFeedback: true,
|
||||
undoCallback: () => this._removeFavorite(appId),
|
||||
});
|
||||
}
|
||||
|
||||
addFavorite(appId) {
|
||||
@@ -180,14 +181,13 @@ class AppFavorites {
|
||||
if (!this._removeFavorite(appId))
|
||||
return;
|
||||
|
||||
Main.overview.setMessage(_("%s has been removed from your favorites.").format(app.get_name()),
|
||||
{ forFeedback: true,
|
||||
undoCallback: () => {
|
||||
this._addFavorite(appId, pos);
|
||||
}
|
||||
});
|
||||
let msg = _("%s has been removed from your favorites.").format(app.get_name());
|
||||
Main.overview.setMessage(msg, {
|
||||
forFeedback: true,
|
||||
undoCallback: () => this._addFavorite(appId, pos),
|
||||
});
|
||||
}
|
||||
};
|
||||
}
|
||||
Signals.addSignalMethods(AppFavorites.prototype);
|
||||
|
||||
var appFavoritesInstance = null;
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported AudioDeviceSelectionDBus */
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
@@ -34,7 +35,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
|
||||
throw new Error('Too few devices for a selection');
|
||||
}
|
||||
|
||||
_buildLayout(devices) {
|
||||
_buildLayout() {
|
||||
let title = new St.Label({ style_class: 'audio-selection-title',
|
||||
text: _("Select Audio Device"),
|
||||
x_align: Clutter.ActorAlign.CENTER });
|
||||
@@ -54,28 +55,28 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
_getDeviceLabel(device) {
|
||||
switch(device) {
|
||||
case AudioDevice.HEADPHONES:
|
||||
return _("Headphones");
|
||||
case AudioDevice.HEADSET:
|
||||
return _("Headset");
|
||||
case AudioDevice.MICROPHONE:
|
||||
return _("Microphone");
|
||||
default:
|
||||
return null;
|
||||
switch (device) {
|
||||
case AudioDevice.HEADPHONES:
|
||||
return _("Headphones");
|
||||
case AudioDevice.HEADSET:
|
||||
return _("Headset");
|
||||
case AudioDevice.MICROPHONE:
|
||||
return _("Microphone");
|
||||
default:
|
||||
return null;
|
||||
}
|
||||
}
|
||||
|
||||
_getDeviceIcon(device) {
|
||||
switch(device) {
|
||||
case AudioDevice.HEADPHONES:
|
||||
return 'audio-headphones-symbolic';
|
||||
case AudioDevice.HEADSET:
|
||||
return 'audio-headset-symbolic';
|
||||
case AudioDevice.MICROPHONE:
|
||||
return 'audio-input-microphone-symbolic';
|
||||
default:
|
||||
return null;
|
||||
switch (device) {
|
||||
case AudioDevice.HEADPHONES:
|
||||
return 'audio-headphones-symbolic';
|
||||
case AudioDevice.HEADSET:
|
||||
return 'audio-headset-symbolic';
|
||||
case AudioDevice.MICROPHONE:
|
||||
return 'audio-input-microphone-symbolic';
|
||||
default:
|
||||
return null;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -85,6 +86,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
|
||||
box.connect('notify::height', () => {
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
|
||||
box.width = box.height;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
});
|
||||
|
||||
@@ -110,11 +112,11 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
_openSettings() {
|
||||
let desktopFile = 'gnome-sound-panel.desktop'
|
||||
let desktopFile = 'gnome-sound-panel.desktop';
|
||||
let app = Shell.AppSystem.get_default().lookup_app(desktopFile);
|
||||
|
||||
if (!app) {
|
||||
log('Settings panel for desktop file ' + desktopFile + ' could not be loaded!');
|
||||
log(`Settings panel for desktop file ${desktopFile} could not be loaded!`);
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -159,12 +161,12 @@ var AudioDeviceSelectionDBus = class AudioDeviceSelectionDBus {
|
||||
|
||||
let [deviceNames] = params;
|
||||
let devices = 0;
|
||||
deviceNames.forEach(n => { devices |= AudioDevice[n.toUpperCase()]; });
|
||||
deviceNames.forEach(n => (devices |= AudioDevice[n.toUpperCase()]));
|
||||
|
||||
let dialog;
|
||||
try {
|
||||
dialog = new AudioDeviceSelectionDialog(devices);
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
invocation.return_value(null);
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported SystemBackground */
|
||||
|
||||
// READ THIS FIRST
|
||||
// Background handling is a maze of objects, both objects in this file, and
|
||||
@@ -93,13 +94,12 @@
|
||||
// MetaBackgroundImage MetaBackgroundImage
|
||||
// MetaBackgroundImage MetaBackgroundImage
|
||||
|
||||
const { Clutter, GDesktopEnums, Gio, GLib, GnomeDesktop, Meta } = imports.gi;
|
||||
const { Clutter, GDesktopEnums, Gio, GLib, GObject, GnomeDesktop, Meta } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const LoginManager = imports.misc.loginManager;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff);
|
||||
|
||||
@@ -108,10 +108,9 @@ const PRIMARY_COLOR_KEY = 'primary-color';
|
||||
const SECONDARY_COLOR_KEY = 'secondary-color';
|
||||
const COLOR_SHADING_TYPE_KEY = 'color-shading-type';
|
||||
const BACKGROUND_STYLE_KEY = 'picture-options';
|
||||
const PICTURE_OPACITY_KEY = 'picture-opacity';
|
||||
const PICTURE_URI_KEY = 'picture-uri';
|
||||
|
||||
var FADE_ANIMATION_TIME = 1.0;
|
||||
var FADE_ANIMATION_TIME = 1000;
|
||||
|
||||
// These parameters affect how often we redraw.
|
||||
// The first is how different (percent crossfaded) the slide show
|
||||
@@ -222,16 +221,17 @@ function getBackgroundCache() {
|
||||
return _backgroundCache;
|
||||
}
|
||||
|
||||
var Background = class Background {
|
||||
constructor(params) {
|
||||
var Background = GObject.registerClass({
|
||||
Signals: { 'loaded': {}, 'bg-changed': {} }
|
||||
}, class Background extends Meta.Background {
|
||||
_init(params) {
|
||||
params = Params.parse(params, { monitorIndex: 0,
|
||||
layoutManager: Main.layoutManager,
|
||||
settings: null,
|
||||
file: null,
|
||||
style: null });
|
||||
|
||||
this.background = new Meta.Background({ meta_display: global.display });
|
||||
this.background._delegate = this;
|
||||
super._init({ meta_display: global.display });
|
||||
|
||||
this._settings = params.settings;
|
||||
this._file = params.file;
|
||||
@@ -264,8 +264,6 @@ var Background = class Background {
|
||||
}
|
||||
|
||||
destroy() {
|
||||
this.background = null;
|
||||
|
||||
this._cancellable.cancel();
|
||||
this._removeAnimationTimeout();
|
||||
|
||||
@@ -302,9 +300,11 @@ var Background = class Background {
|
||||
|
||||
this._changedIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
|
||||
this._changedIdleId = 0;
|
||||
this.emit('changed');
|
||||
this.emit('bg-changed');
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
GLib.Source.set_name_by_id(this._changedIdleId,
|
||||
'[gnome-shell] Background._emitChangedSignal');
|
||||
}
|
||||
|
||||
updateResolution() {
|
||||
@@ -330,23 +330,23 @@ var Background = class Background {
|
||||
this.emit('loaded');
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
GLib.Source.set_name_by_id(id, '[gnome-shell] this.emit');
|
||||
GLib.Source.set_name_by_id(id, '[gnome-shell] Background._setLoaded Idle');
|
||||
}
|
||||
|
||||
_loadPattern() {
|
||||
let colorString, res, color, secondColor;
|
||||
let colorString, res_, color, secondColor;
|
||||
|
||||
colorString = this._settings.get_string(PRIMARY_COLOR_KEY);
|
||||
[res, color] = Clutter.Color.from_string(colorString);
|
||||
[res_, color] = Clutter.Color.from_string(colorString);
|
||||
colorString = this._settings.get_string(SECONDARY_COLOR_KEY);
|
||||
[res, secondColor] = Clutter.Color.from_string(colorString);
|
||||
[res_, secondColor] = Clutter.Color.from_string(colorString);
|
||||
|
||||
let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);
|
||||
|
||||
if (shadingType == GDesktopEnums.BackgroundShading.SOLID)
|
||||
this.background.set_color(color);
|
||||
this.set_color(color);
|
||||
else
|
||||
this.background.set_gradient(shadingType, color, secondColor);
|
||||
this.set_gradient(shadingType, color, secondColor);
|
||||
}
|
||||
|
||||
_watchFile(file) {
|
||||
@@ -382,13 +382,13 @@ var Background = class Background {
|
||||
let finish = () => {
|
||||
this._setLoaded();
|
||||
if (files.length > 1) {
|
||||
this.background.set_blend(files[0], files[1],
|
||||
this._animation.transitionProgress,
|
||||
this._style);
|
||||
this.set_blend(files[0], files[1],
|
||||
this._animation.transitionProgress,
|
||||
this._style);
|
||||
} else if (files.length > 0) {
|
||||
this.background.set_file(files[0], this._style);
|
||||
this.set_file(files[0], this._style);
|
||||
} else {
|
||||
this.background.set_file(null, this._style);
|
||||
this.set_file(null, this._style);
|
||||
}
|
||||
this._queueUpdateAnimation();
|
||||
};
|
||||
@@ -433,41 +433,42 @@ var Background = class Background {
|
||||
return;
|
||||
|
||||
this._updateAnimationTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT,
|
||||
interval,
|
||||
() => {
|
||||
this._updateAnimationTimeoutId = 0;
|
||||
this._updateAnimation();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
interval,
|
||||
() => {
|
||||
this._updateAnimationTimeoutId = 0;
|
||||
this._updateAnimation();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
GLib.Source.set_name_by_id(this._updateAnimationTimeoutId, '[gnome-shell] this._updateAnimation');
|
||||
}
|
||||
|
||||
_loadAnimation(file) {
|
||||
this._cache.getAnimation({ file: file,
|
||||
settingsSchema: this._settings.schema_id,
|
||||
onLoaded: animation => {
|
||||
this._animation = animation;
|
||||
this._cache.getAnimation({
|
||||
file: file,
|
||||
settingsSchema: this._settings.schema_id,
|
||||
onLoaded: animation => {
|
||||
this._animation = animation;
|
||||
|
||||
if (!this._animation || this._cancellable.is_cancelled()) {
|
||||
this._setLoaded();
|
||||
return;
|
||||
}
|
||||
if (!this._animation || this._cancellable.is_cancelled()) {
|
||||
this._setLoaded();
|
||||
return;
|
||||
}
|
||||
|
||||
this._updateAnimation();
|
||||
this._watchFile(file);
|
||||
}
|
||||
});
|
||||
this._updateAnimation();
|
||||
this._watchFile(file);
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
_loadImage(file) {
|
||||
this.background.set_file(file, this._style);
|
||||
this.set_file(file, this._style);
|
||||
this._watchFile(file);
|
||||
|
||||
let cache = Meta.BackgroundImageCache.get_default();
|
||||
let image = cache.load(file);
|
||||
if (image.is_loaded())
|
||||
if (image.is_loaded()) {
|
||||
this._setLoaded();
|
||||
else {
|
||||
} else {
|
||||
let id = image.connect('loaded', () => {
|
||||
this._setLoaded();
|
||||
image.disconnect(id);
|
||||
@@ -494,13 +495,14 @@ var Background = class Background {
|
||||
|
||||
this._loadFile(this._file);
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Background.prototype);
|
||||
});
|
||||
|
||||
let _systemBackground;
|
||||
|
||||
var SystemBackground = class SystemBackground {
|
||||
constructor() {
|
||||
var SystemBackground = GObject.registerClass({
|
||||
Signals: { 'loaded': {} }
|
||||
}, class SystemBackground extends Meta.BackgroundActor {
|
||||
_init() {
|
||||
let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/noise-texture.png');
|
||||
|
||||
if (_systemBackground == null) {
|
||||
@@ -509,9 +511,11 @@ var SystemBackground = class SystemBackground {
|
||||
_systemBackground.set_file(file, GDesktopEnums.BackgroundStyle.WALLPAPER);
|
||||
}
|
||||
|
||||
this.actor = new Meta.BackgroundActor({ meta_display: global.display,
|
||||
monitor: 0,
|
||||
background: _systemBackground });
|
||||
super._init({
|
||||
meta_display: global.display,
|
||||
monitor: 0,
|
||||
background: _systemBackground
|
||||
});
|
||||
|
||||
let cache = Meta.BackgroundImageCache.get_default();
|
||||
let image = cache.load(file);
|
||||
@@ -530,8 +534,7 @@ var SystemBackground = class SystemBackground {
|
||||
});
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(SystemBackground.prototype);
|
||||
});
|
||||
|
||||
var BackgroundSource = class BackgroundSource {
|
||||
constructor(layoutManager, settingsSchema) {
|
||||
@@ -567,7 +570,7 @@ var BackgroundSource = class BackgroundSource {
|
||||
|
||||
// We don't watch changes to settings here,
|
||||
// instead we rely on Background to watch those
|
||||
// and emit 'changed' at the right time
|
||||
// and emit 'bg-changed' at the right time
|
||||
|
||||
if (this._overrideImage != null) {
|
||||
file = Gio.File.new_for_path(this._overrideImage);
|
||||
@@ -596,7 +599,7 @@ var BackgroundSource = class BackgroundSource {
|
||||
style: style
|
||||
});
|
||||
|
||||
background._changedId = background.connect('changed', () => {
|
||||
background._changedId = background.connect('bg-changed', () => {
|
||||
background.disconnect(background._changedId);
|
||||
background.destroy();
|
||||
delete this._backgrounds[monitorIndex];
|
||||
@@ -634,9 +637,9 @@ var Animation = class Animation {
|
||||
}
|
||||
|
||||
load(callback) {
|
||||
this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() });
|
||||
this._show = new GnomeDesktop.BGSlideShow({ file: this.file });
|
||||
|
||||
this._show.load_async(null, (object, result) => {
|
||||
this._show.load_async(null, () => {
|
||||
this.loaded = true;
|
||||
if (callback)
|
||||
callback();
|
||||
@@ -652,7 +655,7 @@ var Animation = class Animation {
|
||||
if (this._show.get_num_slides() < 1)
|
||||
return;
|
||||
|
||||
let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
|
||||
let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
|
||||
|
||||
this.transitionDuration = duration;
|
||||
this.transitionProgress = progress;
|
||||
@@ -711,14 +714,12 @@ var BackgroundManager = class BackgroundManager {
|
||||
this._newBackgroundActor = null;
|
||||
this.emit('changed');
|
||||
|
||||
Tweener.addTween(oldBackgroundActor,
|
||||
{ opacity: 0,
|
||||
time: FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
oldBackgroundActor.destroy();
|
||||
}
|
||||
});
|
||||
oldBackgroundActor.ease({
|
||||
opacity: 0,
|
||||
duration: FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => oldBackgroundActor.destroy()
|
||||
});
|
||||
}
|
||||
|
||||
_updateBackgroundActor() {
|
||||
@@ -735,7 +736,7 @@ var BackgroundManager = class BackgroundManager {
|
||||
|
||||
this._newBackgroundActor = newBackgroundActor;
|
||||
|
||||
let background = newBackgroundActor.background._delegate;
|
||||
let background = newBackgroundActor.background;
|
||||
|
||||
if (background.isLoaded) {
|
||||
this._swapBackgroundActor();
|
||||
@@ -752,13 +753,14 @@ var BackgroundManager = class BackgroundManager {
|
||||
|
||||
_createBackgroundActor() {
|
||||
let background = this._backgroundSource.getBackground(this._monitorIndex);
|
||||
let backgroundActor = new Meta.BackgroundActor({ meta_display: global.display,
|
||||
monitor: this._monitorIndex,
|
||||
background: background.background,
|
||||
vignette: this._vignette,
|
||||
vignette_sharpness: 0.5,
|
||||
brightness: 0.5,
|
||||
});
|
||||
let backgroundActor = new Meta.BackgroundActor({
|
||||
meta_display: global.display,
|
||||
monitor: this._monitorIndex,
|
||||
background,
|
||||
vignette: this._vignette,
|
||||
vignette_sharpness: 0.5,
|
||||
brightness: 0.5,
|
||||
});
|
||||
|
||||
this._container.add_child(backgroundActor);
|
||||
|
||||
@@ -768,7 +770,7 @@ var BackgroundManager = class BackgroundManager {
|
||||
backgroundActor.lower_bottom();
|
||||
}
|
||||
|
||||
let changeSignalId = background.connect('changed', () => {
|
||||
let changeSignalId = background.connect('bg-changed', () => {
|
||||
background.disconnect(changeSignalId);
|
||||
changeSignalId = null;
|
||||
this._updateBackgroundActor();
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported addBackgroundMenu */
|
||||
|
||||
const { Clutter, St } = imports.gi;
|
||||
|
||||
@@ -30,7 +31,7 @@ function addBackgroundMenu(actor, layoutManager) {
|
||||
|
||||
function openMenu(x, y) {
|
||||
Main.layoutManager.setDummyCursorGeometry(x, y, 0, 0);
|
||||
actor._backgroundMenu.open(BoxPointer.PopupAnimation.NONE);
|
||||
actor._backgroundMenu.open(BoxPointer.PopupAnimation.FULL);
|
||||
}
|
||||
|
||||
let clickAction = new Clutter.ClickAction();
|
||||
|
||||
@@ -1,74 +1,106 @@
|
||||
/* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
|
||||
/* exported BarLevel */
|
||||
|
||||
const { Atk, Clutter, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
const { Atk, Clutter, GObject, St } = imports.gi;
|
||||
|
||||
var BarLevel = class {
|
||||
constructor(value, params) {
|
||||
if (isNaN(value))
|
||||
// Avoid spreading NaNs around
|
||||
throw TypeError('The bar level value must be a number');
|
||||
var BarLevel = GObject.registerClass({
|
||||
Properties: {
|
||||
'value': GObject.ParamSpec.double(
|
||||
'value', 'value', 'value',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
0, 2, 0),
|
||||
'maximum-value': GObject.ParamSpec.double(
|
||||
'maximum-value', 'maximum-value', 'maximum-value',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
1, 2, 1),
|
||||
'overdrive-start': GObject.ParamSpec.double(
|
||||
'overdrive-start', 'overdrive-start', 'overdrive-start',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
1, 2, 1)
|
||||
}
|
||||
}, class BarLevel extends St.DrawingArea {
|
||||
_init(params) {
|
||||
this._maxValue = 1;
|
||||
this._value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
this._value = 0;
|
||||
this._overdriveStart = 1;
|
||||
this._barLevelWidth = 0;
|
||||
|
||||
if (params == undefined)
|
||||
params = {}
|
||||
|
||||
this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel',
|
||||
can_focus: params['canFocus'] || false,
|
||||
reactive: params['reactive'] || false,
|
||||
accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR });
|
||||
this.actor.connect('repaint', this._barLevelRepaint.bind(this));
|
||||
this.actor.connect('allocation-changed', (actor, box) => {
|
||||
let defaultParams = {
|
||||
style_class: 'barlevel',
|
||||
accessible_role: Atk.Role.LEVEL_BAR
|
||||
};
|
||||
super._init(Object.assign(defaultParams, params));
|
||||
this.connect('allocation-changed', (actor, box) => {
|
||||
this._barLevelWidth = box.get_width();
|
||||
});
|
||||
|
||||
this._customAccessible = St.GenericAccessible.new_for_actor(this.actor);
|
||||
this.actor.set_accessible(this._customAccessible);
|
||||
this._customAccessible = St.GenericAccessible.new_for_actor(this);
|
||||
this.set_accessible(this._customAccessible);
|
||||
|
||||
this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this));
|
||||
this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this));
|
||||
this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this));
|
||||
this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this));
|
||||
|
||||
this.connect('value-changed', this._valueChanged.bind(this));
|
||||
this.connect('notify::value', this._valueChanged.bind(this));
|
||||
}
|
||||
|
||||
setValue(value) {
|
||||
if (isNaN(value))
|
||||
throw TypeError('The bar level value must be a number');
|
||||
|
||||
this._value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
this.actor.queue_repaint();
|
||||
get value() {
|
||||
return this._value;
|
||||
}
|
||||
|
||||
setMaximumValue(value) {
|
||||
if (isNaN(value))
|
||||
throw TypeError('The bar level max value must be a number');
|
||||
set value(value) {
|
||||
value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
|
||||
this._maxValue = Math.max(value, 1);
|
||||
if (this._value == value)
|
||||
return;
|
||||
|
||||
this._value = value;
|
||||
this.notify('value');
|
||||
this.queue_repaint();
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get maximum_value() {
|
||||
return this._maxValue;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set maximum_value(value) {
|
||||
value = Math.max(value, 1);
|
||||
|
||||
if (this._maxValue == value)
|
||||
return;
|
||||
|
||||
this._maxValue = value;
|
||||
this._overdriveStart = Math.min(this._overdriveStart, this._maxValue);
|
||||
this.actor.queue_repaint();
|
||||
this.notify('maximum-value');
|
||||
this.queue_repaint();
|
||||
}
|
||||
|
||||
setOverdriveStart(value) {
|
||||
if (isNaN(value))
|
||||
throw TypeError('The overdrive limit value must be a number');
|
||||
// eslint-disable-next-line camelcase
|
||||
get overdrive_start() {
|
||||
return this._overdriveStart;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set overdrive_start(value) {
|
||||
if (this._overdriveStart == value)
|
||||
return;
|
||||
|
||||
if (value > this._maxValue)
|
||||
throw new Error(`Tried to set overdrive value to ${value}, ` +
|
||||
`which is a number greater than the maximum allowed value ${this._maxValue}`);
|
||||
|
||||
this._overdriveStart = value;
|
||||
this._value = Math.max(Math.min(value, this._maxValue), 0);
|
||||
this.actor.queue_repaint();
|
||||
this.notify('overdrive-start');
|
||||
this.queue_repaint();
|
||||
}
|
||||
|
||||
_barLevelRepaint(area) {
|
||||
let cr = area.get_context();
|
||||
let themeNode = area.get_theme_node();
|
||||
let [width, height] = area.get_surface_size();
|
||||
vfunc_repaint() {
|
||||
let cr = this.get_context();
|
||||
let themeNode = this.get_theme_node();
|
||||
let [width, height] = this.get_surface_size();
|
||||
|
||||
let barLevelHeight = themeNode.get_length('-barlevel-height');
|
||||
let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2;
|
||||
@@ -105,7 +137,7 @@ var BarLevel = class {
|
||||
overdriveSeparatorWidth = themeNode.get_length('-barlevel-overdrive-separator-width');
|
||||
|
||||
/* background bar */
|
||||
cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4);
|
||||
cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4));
|
||||
cr.lineTo(endX, (height + barLevelHeight) / 2);
|
||||
cr.lineTo(endX, (height - barLevelHeight) / 2);
|
||||
cr.lineTo(width - barLevelBorderRadius - barLevelBorderWidth, (height - barLevelHeight) / 2);
|
||||
@@ -117,12 +149,12 @@ var BarLevel = class {
|
||||
|
||||
/* normal progress bar */
|
||||
let x = Math.min(endX, overdriveSeparatorX - overdriveSeparatorWidth / 2);
|
||||
cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 1 / 4, TAU * 3 / 4);
|
||||
cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (1 / 4), TAU * (3 / 4));
|
||||
cr.lineTo(x, (height - barLevelHeight) / 2);
|
||||
cr.lineTo(x, (height + barLevelHeight) / 2);
|
||||
cr.lineTo(barLevelBorderRadius + barLevelBorderWidth, (height + barLevelHeight) / 2);
|
||||
if (this._value > 0)
|
||||
Clutter.cairo_set_source_color(cr, barLevelActiveColor);
|
||||
Clutter.cairo_set_source_color(cr, barLevelActiveColor);
|
||||
cr.fillPreserve();
|
||||
Clutter.cairo_set_source_color(cr, barLevelActiveBorderColor);
|
||||
cr.setLineWidth(barLevelBorderWidth);
|
||||
@@ -145,17 +177,17 @@ var BarLevel = class {
|
||||
|
||||
/* end progress bar arc */
|
||||
if (this._value > 0) {
|
||||
if (this._value <= this._overdriveStart)
|
||||
Clutter.cairo_set_source_color(cr, barLevelActiveColor);
|
||||
else
|
||||
Clutter.cairo_set_source_color(cr, barLevelOverdriveColor);
|
||||
cr.arc(endX, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4);
|
||||
cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2);
|
||||
cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2);
|
||||
cr.lineTo(endX, (height - barLevelHeight) / 2);
|
||||
cr.fillPreserve();
|
||||
cr.setLineWidth(barLevelBorderWidth);
|
||||
cr.stroke();
|
||||
if (this._value <= this._overdriveStart)
|
||||
Clutter.cairo_set_source_color(cr, barLevelActiveColor);
|
||||
else
|
||||
Clutter.cairo_set_source_color(cr, barLevelOverdriveColor);
|
||||
cr.arc(endX, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4));
|
||||
cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2);
|
||||
cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2);
|
||||
cr.lineTo(endX, (height - barLevelHeight) / 2);
|
||||
cr.fillPreserve();
|
||||
cr.setLineWidth(barLevelBorderWidth);
|
||||
cr.stroke();
|
||||
}
|
||||
|
||||
/* draw overdrive separator */
|
||||
@@ -175,32 +207,27 @@ var BarLevel = class {
|
||||
cr.$dispose();
|
||||
}
|
||||
|
||||
_getCurrentValue(actor) {
|
||||
_getCurrentValue() {
|
||||
return this._value;
|
||||
}
|
||||
|
||||
_getOverdriveStart(actor) {
|
||||
_getOverdriveStart() {
|
||||
return this._overdriveStart;
|
||||
}
|
||||
|
||||
_getMinimumValue(actor) {
|
||||
_getMinimumValue() {
|
||||
return 0;
|
||||
}
|
||||
|
||||
_getMaximumValue(actor) {
|
||||
_getMaximumValue() {
|
||||
return this._maxValue;
|
||||
}
|
||||
|
||||
_setCurrentValue(actor, value) {
|
||||
_setCurrentValue(_actor, value) {
|
||||
this._value = value;
|
||||
}
|
||||
|
||||
_valueChanged(barLevel, value, property) {
|
||||
_valueChanged() {
|
||||
this._customAccessible.notify("accessible-value");
|
||||
}
|
||||
|
||||
get value() {
|
||||
return this._value;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(BarLevel.prototype);
|
||||
});
|
||||
|
||||
@@ -1,9 +1,9 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported BoxPointer */
|
||||
|
||||
const { Clutter, GObject, Meta, Shell, St } = imports.gi;
|
||||
const { Clutter, GObject, Shell, St } = imports.gi;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var PopupAnimation = {
|
||||
NONE: 0,
|
||||
@@ -12,7 +12,7 @@ var PopupAnimation = {
|
||||
FULL: ~0,
|
||||
};
|
||||
|
||||
var POPUP_ANIMATION_TIME = 0.15;
|
||||
var POPUP_ANIMATION_TIME = 150;
|
||||
|
||||
/**
|
||||
* BoxPointer:
|
||||
@@ -46,12 +46,18 @@ var BoxPointer = GObject.registerClass({
|
||||
this.add_actor(this._border);
|
||||
this.bin.raise(this._border);
|
||||
this._sourceAlignment = 0.5;
|
||||
this._capturedEventId = 0;
|
||||
this._muteInput();
|
||||
this._muteInput = true;
|
||||
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
}
|
||||
|
||||
vfunc_captured_event() {
|
||||
if (this._muteInput)
|
||||
return Clutter.EVENT_STOP;
|
||||
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
if (this._sourceActorDestroyId) {
|
||||
this._sourceActor.disconnect(this._sourceActorDestroyId);
|
||||
@@ -63,19 +69,6 @@ var BoxPointer = GObject.registerClass({
|
||||
return this._arrowSide;
|
||||
}
|
||||
|
||||
_muteInput() {
|
||||
if (this._capturedEventId == 0)
|
||||
this._capturedEventId = this.connect('captured-event',
|
||||
() => Clutter.EVENT_STOP);
|
||||
}
|
||||
|
||||
_unmuteInput() {
|
||||
if (this._capturedEventId != 0) {
|
||||
this.disconnect(this._capturedEventId);
|
||||
this._capturedEventId = 0;
|
||||
}
|
||||
}
|
||||
|
||||
open(animate, onComplete) {
|
||||
let themeNode = this.get_theme_node();
|
||||
let rise = themeNode.get_length('-arrow-rise');
|
||||
@@ -90,31 +83,33 @@ var BoxPointer = GObject.registerClass({
|
||||
|
||||
if (animate & PopupAnimation.SLIDE) {
|
||||
switch (this._arrowSide) {
|
||||
case St.Side.TOP:
|
||||
this.translation_y = -rise;
|
||||
break;
|
||||
case St.Side.BOTTOM:
|
||||
this.translation_y = rise;
|
||||
break;
|
||||
case St.Side.LEFT:
|
||||
this.translation_x = -rise;
|
||||
break;
|
||||
case St.Side.RIGHT:
|
||||
this.translation_x = rise;
|
||||
break;
|
||||
case St.Side.TOP:
|
||||
this.translation_y = -rise;
|
||||
break;
|
||||
case St.Side.BOTTOM:
|
||||
this.translation_y = rise;
|
||||
break;
|
||||
case St.Side.LEFT:
|
||||
this.translation_x = -rise;
|
||||
break;
|
||||
case St.Side.RIGHT:
|
||||
this.translation_x = rise;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
Tweener.addTween(this, { opacity: 255,
|
||||
translation_x: 0,
|
||||
translation_y: 0,
|
||||
transition: 'linear',
|
||||
onComplete: () => {
|
||||
this._unmuteInput();
|
||||
if (onComplete)
|
||||
onComplete();
|
||||
},
|
||||
time: animationTime });
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
translation_x: 0,
|
||||
translation_y: 0,
|
||||
duration: animationTime,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
onComplete: () => {
|
||||
this._muteInput = false;
|
||||
if (onComplete)
|
||||
onComplete();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
close(animate, onComplete) {
|
||||
@@ -130,38 +125,39 @@ var BoxPointer = GObject.registerClass({
|
||||
|
||||
if (animate & PopupAnimation.SLIDE) {
|
||||
switch (this._arrowSide) {
|
||||
case St.Side.TOP:
|
||||
translationY = rise;
|
||||
break;
|
||||
case St.Side.BOTTOM:
|
||||
translationY = -rise;
|
||||
break;
|
||||
case St.Side.LEFT:
|
||||
translationX = rise;
|
||||
break;
|
||||
case St.Side.RIGHT:
|
||||
translationX = -rise;
|
||||
break;
|
||||
case St.Side.TOP:
|
||||
translationY = rise;
|
||||
break;
|
||||
case St.Side.BOTTOM:
|
||||
translationY = -rise;
|
||||
break;
|
||||
case St.Side.LEFT:
|
||||
translationX = rise;
|
||||
break;
|
||||
case St.Side.RIGHT:
|
||||
translationX = -rise;
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
this._muteInput();
|
||||
this._muteInput = true;
|
||||
|
||||
Tweener.removeTweens(this);
|
||||
Tweener.addTween(this, { opacity: fade ? 0 : 255,
|
||||
translation_x: translationX,
|
||||
translation_y: translationY,
|
||||
transition: 'linear',
|
||||
time: animationTime,
|
||||
onComplete: () => {
|
||||
this.hide();
|
||||
this.opacity = 0;
|
||||
this.translation_x = 0;
|
||||
this.translation_y = 0;
|
||||
if (onComplete)
|
||||
onComplete();
|
||||
}
|
||||
});
|
||||
this.remove_all_transitions();
|
||||
this.ease({
|
||||
opacity: fade ? 0 : 255,
|
||||
translation_x: translationX,
|
||||
translation_y: translationY,
|
||||
duration: animationTime,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
onComplete: () => {
|
||||
this.hide();
|
||||
this.opacity = 0;
|
||||
this.translation_x = 0;
|
||||
this.translation_y = 0;
|
||||
if (onComplete)
|
||||
onComplete();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
_adjustAllocationForArrow(isWidth, minSize, natSize) {
|
||||
@@ -169,8 +165,8 @@ var BoxPointer = GObject.registerClass({
|
||||
let borderWidth = themeNode.get_length('-arrow-border-width');
|
||||
minSize += borderWidth * 2;
|
||||
natSize += borderWidth * 2;
|
||||
if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM))
|
||||
|| (isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
|
||||
if ((!isWidth && (this._arrowSide == St.Side.TOP || this._arrowSide == St.Side.BOTTOM)) ||
|
||||
(isWidth && (this._arrowSide == St.Side.LEFT || this._arrowSide == St.Side.RIGHT))) {
|
||||
let rise = themeNode.get_length('-arrow-rise');
|
||||
minSize += rise;
|
||||
natSize += rise;
|
||||
@@ -220,18 +216,18 @@ var BoxPointer = GObject.registerClass({
|
||||
childBox.x2 = availWidth - borderWidth;
|
||||
childBox.y2 = availHeight - borderWidth;
|
||||
switch (this._arrowSide) {
|
||||
case St.Side.TOP:
|
||||
childBox.y1 += rise;
|
||||
break;
|
||||
case St.Side.BOTTOM:
|
||||
childBox.y2 -= rise;
|
||||
break;
|
||||
case St.Side.LEFT:
|
||||
childBox.x1 += rise;
|
||||
break;
|
||||
case St.Side.RIGHT:
|
||||
childBox.x2 -= rise;
|
||||
break;
|
||||
case St.Side.TOP:
|
||||
childBox.y1 += rise;
|
||||
break;
|
||||
case St.Side.BOTTOM:
|
||||
childBox.y2 -= rise;
|
||||
break;
|
||||
case St.Side.LEFT:
|
||||
childBox.x1 += rise;
|
||||
break;
|
||||
case St.Side.RIGHT:
|
||||
childBox.x2 -= rise;
|
||||
break;
|
||||
}
|
||||
this.bin.allocate(childBox, flags);
|
||||
|
||||
@@ -264,7 +260,7 @@ var BoxPointer = GObject.registerClass({
|
||||
let borderRadius = themeNode.get_length('-arrow-border-radius');
|
||||
|
||||
let halfBorder = borderWidth / 2;
|
||||
let halfBase = Math.floor(base/2);
|
||||
let halfBase = Math.floor(base / 2);
|
||||
|
||||
let backgroundColor = themeNode.get_color('-arrow-background-color');
|
||||
|
||||
@@ -345,7 +341,7 @@ var BoxPointer = GObject.registerClass({
|
||||
if (!skipTopRight) {
|
||||
cr.lineTo(x2 - borderRadius, y1);
|
||||
cr.arc(x2 - borderRadius, y1 + borderRadius, borderRadius,
|
||||
3*Math.PI/2, Math.PI*2);
|
||||
3 * Math.PI / 2, Math.PI * 2);
|
||||
}
|
||||
|
||||
if (this._arrowSide == St.Side.RIGHT && rise) {
|
||||
@@ -366,7 +362,7 @@ var BoxPointer = GObject.registerClass({
|
||||
if (!skipBottomRight) {
|
||||
cr.lineTo(x2, y2 - borderRadius);
|
||||
cr.arc(x2 - borderRadius, y2 - borderRadius, borderRadius,
|
||||
0, Math.PI/2);
|
||||
0, Math.PI / 2);
|
||||
}
|
||||
|
||||
if (this._arrowSide == St.Side.BOTTOM && rise) {
|
||||
@@ -387,7 +383,7 @@ var BoxPointer = GObject.registerClass({
|
||||
if (!skipBottomLeft) {
|
||||
cr.lineTo(x1 + borderRadius, y2);
|
||||
cr.arc(x1 + borderRadius, y2 - borderRadius, borderRadius,
|
||||
Math.PI/2, Math.PI);
|
||||
Math.PI / 2, Math.PI);
|
||||
}
|
||||
|
||||
if (this._arrowSide == St.Side.LEFT && rise) {
|
||||
@@ -396,7 +392,7 @@ var BoxPointer = GObject.registerClass({
|
||||
cr.lineTo(x1 - rise, y1);
|
||||
cr.lineTo(x1 + borderRadius, y1);
|
||||
} else if (skipBottomLeft) {
|
||||
cr.lineTo(x1 - rise, y2)
|
||||
cr.lineTo(x1 - rise, y2);
|
||||
cr.lineTo(x1 - rise, y2 - halfBase);
|
||||
} else {
|
||||
cr.lineTo(x1, this._arrowOrigin + halfBase);
|
||||
@@ -408,7 +404,7 @@ var BoxPointer = GObject.registerClass({
|
||||
if (!skipTopLeft) {
|
||||
cr.lineTo(x1, y1 + borderRadius);
|
||||
cr.arc(x1 + borderRadius, y1 + borderRadius, borderRadius,
|
||||
Math.PI, 3*Math.PI/2);
|
||||
Math.PI, 3 * Math.PI / 2);
|
||||
}
|
||||
|
||||
Clutter.cairo_set_source_color(cr, backgroundColor);
|
||||
@@ -437,7 +433,7 @@ var BoxPointer = GObject.registerClass({
|
||||
this._sourceActorDestroyId = this._sourceActor.connect('destroy', () => {
|
||||
this._sourceActor = null;
|
||||
delete this._sourceActorDestroyId;
|
||||
})
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -469,7 +465,7 @@ var BoxPointer = GObject.registerClass({
|
||||
let sourceAllocation = this._sourceAllocation;
|
||||
let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment;
|
||||
let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment;
|
||||
let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size();
|
||||
let [, , natWidth, natHeight] = this.get_preferred_size();
|
||||
|
||||
// We also want to keep it onscreen, and separated from the
|
||||
// edge by the same distance as the main part of the box is
|
||||
@@ -513,7 +509,7 @@ var BoxPointer = GObject.registerClass({
|
||||
// of the box to maintain the arrow's accuracy.
|
||||
|
||||
let arrowOrigin;
|
||||
let halfBase = Math.floor(arrowBase/2);
|
||||
let halfBase = Math.floor(arrowBase / 2);
|
||||
let halfBorder = borderWidth / 2;
|
||||
let halfMargin = margin / 2;
|
||||
let [x1, y1] = [halfBorder, halfBorder];
|
||||
@@ -594,7 +590,7 @@ var BoxPointer = GObject.registerClass({
|
||||
|
||||
_calculateArrowSide(arrowSide) {
|
||||
let sourceAllocation = this._sourceAllocation;
|
||||
let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size();
|
||||
let [, , boxWidth, boxHeight] = this.get_preferred_size();
|
||||
let workarea = this._workArea;
|
||||
|
||||
switch (arrowSide) {
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Calendar, CalendarMessageList */
|
||||
|
||||
const { Clutter, Gio, GLib, Shell, St } = imports.gi;
|
||||
const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
@@ -17,7 +18,7 @@ var ELLIPSIS_CHAR = '\u2026';
|
||||
|
||||
var MESSAGE_ICON_SIZE = -1; // pick up from CSS
|
||||
|
||||
var NC_ = (context, str) => context + '\u0004' + str;
|
||||
var NC_ = (context, str) => `${context}\u0004${str}`;
|
||||
|
||||
function sameYear(dateA, dateB) {
|
||||
return (dateA.getYear() == dateB.getYear());
|
||||
@@ -38,7 +39,7 @@ function isToday(date) {
|
||||
function _isWorkDay(date) {
|
||||
/* Translators: Enter 0-6 (Sunday-Saturday) for non-work days. Examples: "0" (Sunday) "6" (Saturday) "06" (Sunday and Saturday). */
|
||||
let days = C_('calendar-no-work', "06");
|
||||
return days.indexOf(date.getDay().toString()) == -1;
|
||||
return !days.includes(date.getDay().toString());
|
||||
}
|
||||
|
||||
function _getBeginningOfDay(date) {
|
||||
@@ -109,15 +110,15 @@ var EmptyEventSource = class EmptyEventSource {
|
||||
destroy() {
|
||||
}
|
||||
|
||||
requestRange(begin, end) {
|
||||
requestRange(_begin, _end) {
|
||||
}
|
||||
|
||||
getEvents(begin, end) {
|
||||
getEvents(_begin, _end) {
|
||||
let result = [];
|
||||
return result;
|
||||
}
|
||||
|
||||
hasEvents(day) {
|
||||
hasEvents(_day) {
|
||||
return false;
|
||||
}
|
||||
};
|
||||
@@ -143,8 +144,7 @@ function _datesEqual(a, b) {
|
||||
return true;
|
||||
}
|
||||
|
||||
function _dateIntervalsOverlap(a0, a1, b0, b1)
|
||||
{
|
||||
function _dateIntervalsOverlap(a0, a1, b0, b1) {
|
||||
if (a1 <= b0)
|
||||
return false;
|
||||
else if (b1 <= a0)
|
||||
@@ -168,7 +168,7 @@ var DBusEventSource = class DBusEventSource {
|
||||
try {
|
||||
this._dbusProxy.init_finish(result);
|
||||
loaded = true;
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.DBusError, Gio.DBusError.TIMED_OUT)) {
|
||||
// Ignore timeouts and install signals as normal, because with high
|
||||
// probability the service will appear later on, and we will get a
|
||||
@@ -178,7 +178,7 @@ var DBusEventSource = class DBusEventSource {
|
||||
// about the HasCalendars property and would cause an exception trying
|
||||
// to read it)
|
||||
} else {
|
||||
log('Error loading calendars: ' + e.message);
|
||||
log(`Error loading calendars: ${e.message}`);
|
||||
return;
|
||||
}
|
||||
}
|
||||
@@ -221,13 +221,13 @@ var DBusEventSource = class DBusEventSource {
|
||||
this._lastRequestEnd = null;
|
||||
}
|
||||
|
||||
_onNameAppeared(owner) {
|
||||
_onNameAppeared() {
|
||||
this._initialized = true;
|
||||
this._resetCache();
|
||||
this._loadEvents(true);
|
||||
}
|
||||
|
||||
_onNameVanished(oldOwner) {
|
||||
_onNameVanished() {
|
||||
this._resetCache();
|
||||
this.emit('changed');
|
||||
}
|
||||
@@ -236,22 +236,20 @@ var DBusEventSource = class DBusEventSource {
|
||||
this._loadEvents(false);
|
||||
}
|
||||
|
||||
_onEventsReceived(results, error) {
|
||||
_onEventsReceived(results, _error) {
|
||||
let newEvents = [];
|
||||
let appointments = results ? results[0] : null;
|
||||
if (appointments != null) {
|
||||
for (let n = 0; n < appointments.length; n++) {
|
||||
let a = appointments[n];
|
||||
let date = new Date(a[4] * 1000);
|
||||
let end = new Date(a[5] * 1000);
|
||||
let id = a[0];
|
||||
let summary = a[1];
|
||||
let allDay = a[3];
|
||||
let event = new CalendarEvent(id, date, end, summary, allDay);
|
||||
newEvents.push(event);
|
||||
}
|
||||
newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
|
||||
let appointments = results[0] || [];
|
||||
for (let n = 0; n < appointments.length; n++) {
|
||||
let a = appointments[n];
|
||||
let date = new Date(a[4] * 1000);
|
||||
let end = new Date(a[5] * 1000);
|
||||
let id = a[0];
|
||||
let summary = a[1];
|
||||
let allDay = a[3];
|
||||
let event = new CalendarEvent(id, date, end, summary, allDay);
|
||||
newEvents.push(event);
|
||||
}
|
||||
newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
|
||||
|
||||
this._events = newEvents;
|
||||
this.isLoading = false;
|
||||
@@ -263,7 +261,7 @@ var DBusEventSource = class DBusEventSource {
|
||||
if (!this._initialized)
|
||||
return;
|
||||
|
||||
if (this._curRequestBegin && this._curRequestEnd){
|
||||
if (this._curRequestBegin && this._curRequestEnd) {
|
||||
this._dbusProxy.GetEventsRemote(this._curRequestBegin.getTime() / 1000,
|
||||
this._curRequestEnd.getTime() / 1000,
|
||||
forceReload,
|
||||
@@ -285,7 +283,7 @@ var DBusEventSource = class DBusEventSource {
|
||||
|
||||
getEvents(begin, end) {
|
||||
let result = [];
|
||||
for(let n = 0; n < this._events.length; n++) {
|
||||
for (let n = 0; n < this._events.length; n++) {
|
||||
let event = this._events[n];
|
||||
|
||||
if (_dateIntervalsOverlap (event.date, event.end, begin, end)) {
|
||||
@@ -315,12 +313,14 @@ var DBusEventSource = class DBusEventSource {
|
||||
};
|
||||
Signals.addSignalMethods(DBusEventSource.prototype);
|
||||
|
||||
var Calendar = class Calendar {
|
||||
constructor() {
|
||||
var Calendar = GObject.registerClass({
|
||||
Signals: { 'selected-date-changed': { param_types: [GLib.DateTime.$gtype] } }
|
||||
}, class Calendar extends St.Widget {
|
||||
_init() {
|
||||
this._weekStart = Shell.util_get_week_start();
|
||||
this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.calendar' });
|
||||
|
||||
this._settings.connect('changed::' + SHOW_WEEKDATE_KEY, this._onSettingsChange.bind(this));
|
||||
this._settings.connect(`changed::${SHOW_WEEKDATE_KEY}`, this._onSettingsChange.bind(this));
|
||||
this._useWeekdate = this._settings.get_boolean(SHOW_WEEKDATE_KEY);
|
||||
|
||||
/**
|
||||
@@ -346,12 +346,11 @@ var Calendar = class Calendar {
|
||||
|
||||
this._shouldDateGrabFocus = false;
|
||||
|
||||
this.actor = new St.Widget({ style_class: 'calendar',
|
||||
layout_manager: new Clutter.TableLayout(),
|
||||
reactive: true });
|
||||
|
||||
this.actor.connect('scroll-event',
|
||||
this._onScroll.bind(this));
|
||||
super._init({
|
||||
style_class: 'calendar',
|
||||
layout_manager: new Clutter.TableLayout(),
|
||||
reactive: true
|
||||
});
|
||||
|
||||
this._buildHeader ();
|
||||
}
|
||||
@@ -375,7 +374,10 @@ var Calendar = class Calendar {
|
||||
|
||||
this._selectedDate = date;
|
||||
this._update();
|
||||
this.emit('selected-date-changed', new Date(this._selectedDate));
|
||||
|
||||
let datetime = GLib.DateTime.new_from_unix_local(
|
||||
this._selectedDate.getTime() / 1000);
|
||||
this.emit('selected-date-changed', datetime);
|
||||
}
|
||||
|
||||
updateTimeZone() {
|
||||
@@ -386,9 +388,9 @@ var Calendar = class Calendar {
|
||||
}
|
||||
|
||||
_buildHeader() {
|
||||
let layout = this.actor.layout_manager;
|
||||
let layout = this.layout_manager;
|
||||
let offsetCols = this._useWeekdate ? 1 : 0;
|
||||
this.actor.destroy_all_children();
|
||||
this.destroy_all_children();
|
||||
|
||||
// Top line of the calendar '<| September 2009 |>'
|
||||
this._topBox = new St.BoxLayout();
|
||||
@@ -402,8 +404,8 @@ var Calendar = class Calendar {
|
||||
this._topBox.add(this._backButton);
|
||||
this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this));
|
||||
|
||||
this._monthLabel = new St.Label({style_class: 'calendar-month-label',
|
||||
can_focus: true });
|
||||
this._monthLabel = new St.Label({ style_class: 'calendar-month-label',
|
||||
can_focus: true });
|
||||
this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE });
|
||||
|
||||
this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button',
|
||||
@@ -430,7 +432,7 @@ var Calendar = class Calendar {
|
||||
can_focus: true });
|
||||
label.accessible_name = iter.toLocaleFormat('%A');
|
||||
let col;
|
||||
if (this.actor.get_text_direction() == Clutter.TextDirection.RTL)
|
||||
if (this.get_text_direction() == Clutter.TextDirection.RTL)
|
||||
col = 6 - (7 + iter.getDay() - this._weekStart) % 7;
|
||||
else
|
||||
col = offsetCols + (7 + iter.getDay() - this._weekStart) % 7;
|
||||
@@ -439,11 +441,11 @@ var Calendar = class Calendar {
|
||||
}
|
||||
|
||||
// All the children after this are days, and get removed when we update the calendar
|
||||
this._firstDayIndex = this.actor.get_n_children();
|
||||
this._firstDayIndex = this.get_n_children();
|
||||
}
|
||||
|
||||
_onScroll(actor, event) {
|
||||
switch (event.get_scroll_direction()) {
|
||||
vfunc_scroll_event(scrollEvent) {
|
||||
switch (scrollEvent.direction) {
|
||||
case Clutter.ScrollDirection.UP:
|
||||
case Clutter.ScrollDirection.LEFT:
|
||||
this._onPrevMonthButtonClicked();
|
||||
@@ -466,8 +468,7 @@ var Calendar = class Calendar {
|
||||
let day = 32 - new Date(newDate.getFullYear() - 1, 11, 32).getDate();
|
||||
newDate = new Date(newDate.getFullYear() - 1, 11, day);
|
||||
}
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
newDate.setMonth(oldMonth - 1);
|
||||
if (newDate.getMonth() != oldMonth - 1) {
|
||||
let day = 32 - new Date(newDate.getFullYear(), oldMonth - 1, 32).getDate();
|
||||
@@ -490,8 +491,7 @@ var Calendar = class Calendar {
|
||||
let day = 32 - new Date(newDate.getFullYear() + 1, 0, 32).getDate();
|
||||
newDate = new Date(newDate.getFullYear() + 1, 0, day);
|
||||
}
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
newDate.setMonth(oldMonth + 1);
|
||||
if (newDate.getMonth() != oldMonth + 1) {
|
||||
let day = 32 - new Date(newDate.getFullYear(), oldMonth + 1, 32).getDate();
|
||||
@@ -515,7 +515,7 @@ var Calendar = class Calendar {
|
||||
let now = new Date();
|
||||
|
||||
// Remove everything but the topBox and the weekday labels
|
||||
let children = this.actor.get_children();
|
||||
let children = this.get_children();
|
||||
for (let i = this._firstDayIndex; i < children.length; i++)
|
||||
children[i].destroy();
|
||||
|
||||
@@ -546,20 +546,18 @@ var Calendar = class Calendar {
|
||||
this._calendarBegin = new Date(beginDate);
|
||||
this._markedAsToday = now;
|
||||
|
||||
let year = beginDate.getYear();
|
||||
|
||||
let daysToWeekStart = (7 + beginDate.getDay() - this._weekStart) % 7;
|
||||
let startsOnWeekStart = daysToWeekStart == 0;
|
||||
let weekPadding = startsOnWeekStart ? 7 : 0;
|
||||
|
||||
beginDate.setTime(beginDate.getTime() - (weekPadding + daysToWeekStart) * MSECS_IN_DAY);
|
||||
|
||||
let layout = this.actor.layout_manager;
|
||||
let layout = this.layout_manager;
|
||||
let iter = new Date(beginDate);
|
||||
let row = 2;
|
||||
// nRows here means 6 weeks + one header + one navbar
|
||||
let nRows = 8;
|
||||
while (row < 8) {
|
||||
while (row < nRows) {
|
||||
// xgettext:no-javascript-format
|
||||
let button = new St.Button({ label: iter.toLocaleFormat(C_("date day number format", "%d")),
|
||||
can_focus: true });
|
||||
@@ -585,12 +583,13 @@ var Calendar = class Calendar {
|
||||
|
||||
// Hack used in lieu of border-collapse - see gnome-shell.css
|
||||
if (row == 2)
|
||||
styleClass = 'calendar-day-top ' + styleClass;
|
||||
styleClass = `calendar-day-top ${styleClass}`;
|
||||
|
||||
let leftMost = rtl ? iter.getDay() == (this._weekStart + 6) % 7
|
||||
: iter.getDay() == this._weekStart;
|
||||
let leftMost = rtl
|
||||
? iter.getDay() == (this._weekStart + 6) % 7
|
||||
: iter.getDay() == this._weekStart;
|
||||
if (leftMost)
|
||||
styleClass = 'calendar-day-left ' + styleClass;
|
||||
styleClass = `calendar-day-left ${styleClass}`;
|
||||
|
||||
if (sameDay(now, iter))
|
||||
styleClass += ' calendar-today';
|
||||
@@ -648,17 +647,17 @@ var Calendar = class Calendar {
|
||||
button.add_style_pseudo_class('selected');
|
||||
if (this._shouldDateGrabFocus)
|
||||
button.grab_key_focus();
|
||||
}
|
||||
else
|
||||
} else {
|
||||
button.remove_style_pseudo_class('selected');
|
||||
}
|
||||
});
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Calendar.prototype);
|
||||
});
|
||||
|
||||
var EventMessage = class EventMessage extends MessageList.Message {
|
||||
constructor(event, date) {
|
||||
super('', event.summary);
|
||||
var EventMessage = GObject.registerClass(
|
||||
class EventMessage extends MessageList.Message {
|
||||
_init(event, date) {
|
||||
super._init('', event.summary);
|
||||
|
||||
this._event = event;
|
||||
this._date = date;
|
||||
@@ -667,11 +666,12 @@ var EventMessage = class EventMessage extends MessageList.Message {
|
||||
|
||||
this._icon = new St.Icon({ icon_name: 'x-office-calendar-symbolic' });
|
||||
this.setIcon(this._icon);
|
||||
}
|
||||
|
||||
this.actor.connect('style-changed', () => {
|
||||
let iconVisible = this.actor.get_parent().has_style_pseudo_class('first-child');
|
||||
this._icon.opacity = (iconVisible ? 255 : 0);
|
||||
});
|
||||
vfunc_style_changed() {
|
||||
let iconVisible = this.get_parent().has_style_pseudo_class('first-child');
|
||||
this._icon.opacity = (iconVisible ? 255 : 0);
|
||||
super.vfunc_style_changed();
|
||||
}
|
||||
|
||||
_formatEventTime() {
|
||||
@@ -686,32 +686,33 @@ var EventMessage = class EventMessage extends MessageList.Message {
|
||||
*/
|
||||
title = C_("event list time", "All Day");
|
||||
} else {
|
||||
let date = this._event.date >= periodBegin ? this._event.date
|
||||
: this._event.end;
|
||||
let date = this._event.date >= periodBegin
|
||||
? this._event.date
|
||||
: this._event.end;
|
||||
title = Util.formatTime(date, { timeOnly: true });
|
||||
}
|
||||
|
||||
let rtl = Clutter.get_default_text_direction() == Clutter.TextDirection.RTL;
|
||||
if (this._event.date < periodBegin && !this._event.allDay) {
|
||||
if (rtl)
|
||||
title = title + ELLIPSIS_CHAR;
|
||||
title = `${title}${ELLIPSIS_CHAR}`;
|
||||
else
|
||||
title = ELLIPSIS_CHAR + title;
|
||||
title = `${ELLIPSIS_CHAR}${title}`;
|
||||
}
|
||||
if (this._event.end > periodEnd && !this._event.allDay) {
|
||||
if (rtl)
|
||||
title = ELLIPSIS_CHAR + title;
|
||||
title = `${ELLIPSIS_CHAR}${title}`;
|
||||
else
|
||||
title = title + ELLIPSIS_CHAR;
|
||||
title = `${title}${ELLIPSIS_CHAR}`;
|
||||
}
|
||||
return title;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var NotificationMessage =
|
||||
var NotificationMessage = GObject.registerClass(
|
||||
class NotificationMessage extends MessageList.Message {
|
||||
constructor(notification) {
|
||||
super(notification.title, notification.bannerBodyText);
|
||||
_init(notification) {
|
||||
super._init(notification.title, notification.bannerBodyText);
|
||||
this.setUseBodyMarkup(notification.bannerBodyMarkup);
|
||||
|
||||
this.notification = notification;
|
||||
@@ -741,14 +742,14 @@ class NotificationMessage extends MessageList.Message {
|
||||
return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
|
||||
}
|
||||
|
||||
_onUpdated(n, clear) {
|
||||
_onUpdated(n, _clear) {
|
||||
this.setIcon(this._getIcon());
|
||||
this.setTitle(n.title);
|
||||
this.setBody(n.bannerBodyText);
|
||||
this.setUseBodyMarkup(n.bannerBodyMarkup);
|
||||
}
|
||||
|
||||
_onClicked() {
|
||||
vfunc_clicked() {
|
||||
this.notification.activate();
|
||||
}
|
||||
|
||||
@@ -770,11 +771,12 @@ class NotificationMessage extends MessageList.Message {
|
||||
canClose() {
|
||||
return true;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var EventsSection = class EventsSection extends MessageList.MessageListSection {
|
||||
constructor() {
|
||||
super();
|
||||
var EventsSection = GObject.registerClass(
|
||||
class EventsSection extends MessageList.MessageListSection {
|
||||
_init() {
|
||||
super._init();
|
||||
|
||||
this._desktopSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
|
||||
this._desktopSettings.connect('changed', this._reloadEvents.bind(this));
|
||||
@@ -786,7 +788,7 @@ var EventsSection = class EventsSection extends MessageList.MessageListSection {
|
||||
label: '',
|
||||
x_align: St.Align.START,
|
||||
can_focus: true });
|
||||
this.actor.insert_child_below(this._title, null);
|
||||
this.insert_child_below(this._title, null);
|
||||
|
||||
this._title.connect('clicked', this._onTitleClicked.bind(this));
|
||||
this._title.connect('key-focus-in', this._onKeyFocusIn.bind(this));
|
||||
@@ -905,12 +907,29 @@ var EventsSection = class EventsSection extends MessageList.MessageListSection {
|
||||
|
||||
super._sync();
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var NotificationSection =
|
||||
var TimeLabel = GObject.registerClass(
|
||||
class NotificationTimeLabel extends St.Label {
|
||||
_init(datetime) {
|
||||
super._init({
|
||||
style_class: 'event-time',
|
||||
x_align: Clutter.ActorAlign.START,
|
||||
y_align: Clutter.ActorAlign.END
|
||||
});
|
||||
this._datetime = datetime;
|
||||
}
|
||||
|
||||
vfunc_map() {
|
||||
this.text = Util.formatTimeSpan(this._datetime);
|
||||
super.vfunc_map();
|
||||
}
|
||||
});
|
||||
|
||||
var NotificationSection = GObject.registerClass(
|
||||
class NotificationSection extends MessageList.MessageListSection {
|
||||
constructor() {
|
||||
super();
|
||||
_init() {
|
||||
super._init();
|
||||
|
||||
this._sources = new Map();
|
||||
this._nUrgent = 0;
|
||||
@@ -919,8 +938,6 @@ class NotificationSection extends MessageList.MessageListSection {
|
||||
Main.messageTray.getSources().forEach(source => {
|
||||
this._sourceAdded(Main.messageTray, source);
|
||||
});
|
||||
|
||||
this.actor.connect('notify::mapped', this._onMapped.bind(this));
|
||||
}
|
||||
|
||||
get allowed() {
|
||||
@@ -928,17 +945,6 @@ class NotificationSection extends MessageList.MessageListSection {
|
||||
!Main.sessionMode.isGreeter;
|
||||
}
|
||||
|
||||
_createTimeLabel(datetime) {
|
||||
let label = new St.Label({ style_class: 'event-time',
|
||||
x_align: Clutter.ActorAlign.START,
|
||||
y_align: Clutter.ActorAlign.END });
|
||||
label.connect('notify::mapped', () => {
|
||||
if (label.mapped)
|
||||
label.text = Util.formatTimeSpan(datetime);
|
||||
});
|
||||
return label;
|
||||
}
|
||||
|
||||
_sourceAdded(tray, source) {
|
||||
let obj = {
|
||||
destroyId: 0,
|
||||
@@ -956,13 +962,13 @@ class NotificationSection extends MessageList.MessageListSection {
|
||||
|
||||
_onNotificationAdded(source, notification) {
|
||||
let message = new NotificationMessage(notification);
|
||||
message.setSecondaryActor(this._createTimeLabel(notification.datetime));
|
||||
message.setSecondaryActor(new TimeLabel(notification.datetime));
|
||||
|
||||
let isUrgent = notification.urgency == MessageTray.Urgency.CRITICAL;
|
||||
|
||||
let updatedId = notification.connect('updated', () => {
|
||||
message.setSecondaryActor(this._createTimeLabel(notification.datetime));
|
||||
this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.actor.mapped);
|
||||
message.setSecondaryActor(new TimeLabel(notification.datetime));
|
||||
this.moveMessage(message, isUrgent ? 0 : this._nUrgent, this.mapped);
|
||||
});
|
||||
let destroyId = notification.connect('destroy', () => {
|
||||
notification.disconnect(destroyId);
|
||||
@@ -982,7 +988,7 @@ class NotificationSection extends MessageList.MessageListSection {
|
||||
}
|
||||
|
||||
let index = isUrgent ? 0 : this._nUrgent;
|
||||
this.addMessageAtIndex(message, index, this.actor.mapped);
|
||||
this.addMessageAtIndex(message, index, this.mapped);
|
||||
}
|
||||
|
||||
_onSourceDestroy(source, obj) {
|
||||
@@ -992,25 +998,23 @@ class NotificationSection extends MessageList.MessageListSection {
|
||||
this._sources.delete(source);
|
||||
}
|
||||
|
||||
_onMapped() {
|
||||
if (!this.actor.mapped)
|
||||
return;
|
||||
|
||||
for (let message of this._messages.keys())
|
||||
vfunc_map() {
|
||||
this._messages.forEach(message => {
|
||||
if (message.notification.urgency != MessageTray.Urgency.CRITICAL)
|
||||
message.notification.acknowledged = true;
|
||||
});
|
||||
super.vfunc_map();
|
||||
}
|
||||
|
||||
_shouldShow() {
|
||||
return !this.empty && isToday(this._date);
|
||||
}
|
||||
};
|
||||
|
||||
var Placeholder = class Placeholder {
|
||||
constructor() {
|
||||
this.actor = new St.BoxLayout({ style_class: 'message-list-placeholder',
|
||||
vertical: true });
|
||||
});
|
||||
|
||||
var Placeholder = GObject.registerClass(
|
||||
class Placeholder extends St.BoxLayout {
|
||||
_init() {
|
||||
super._init({ style_class: 'message-list-placeholder', vertical: true });
|
||||
this._date = new Date();
|
||||
|
||||
let todayFile = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/no-notifications.svg');
|
||||
@@ -1019,10 +1023,10 @@ var Placeholder = class Placeholder {
|
||||
this._otherIcon = new Gio.FileIcon({ file: otherFile });
|
||||
|
||||
this._icon = new St.Icon();
|
||||
this.actor.add_actor(this._icon);
|
||||
this.add_actor(this._icon);
|
||||
|
||||
this._label = new St.Label();
|
||||
this.actor.add_actor(this._label);
|
||||
this.add_actor(this._label);
|
||||
|
||||
this._sync();
|
||||
}
|
||||
@@ -1049,20 +1053,24 @@ var Placeholder = class Placeholder {
|
||||
this._label.text = _("No Events");
|
||||
}
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var CalendarMessageList = class CalendarMessageList {
|
||||
constructor() {
|
||||
this.actor = new St.Widget({ style_class: 'message-list',
|
||||
layout_manager: new Clutter.BinLayout(),
|
||||
x_expand: true, y_expand: true });
|
||||
var CalendarMessageList = GObject.registerClass(
|
||||
class CalendarMessageList extends St.Widget {
|
||||
_init() {
|
||||
super._init({
|
||||
style_class: 'message-list',
|
||||
layout_manager: new Clutter.BinLayout(),
|
||||
x_expand: true,
|
||||
y_expand: true
|
||||
});
|
||||
|
||||
this._placeholder = new Placeholder();
|
||||
this.actor.add_actor(this._placeholder.actor);
|
||||
this.add_actor(this._placeholder);
|
||||
|
||||
let box = new St.BoxLayout({ vertical: true,
|
||||
x_expand: true, y_expand: true });
|
||||
this.actor.add_actor(box);
|
||||
this.add_actor(box);
|
||||
|
||||
this._scrollView = new St.ScrollView({ style_class: 'vfade',
|
||||
overlay_scrollbars: true,
|
||||
@@ -1076,17 +1084,21 @@ var CalendarMessageList = class CalendarMessageList {
|
||||
can_focus: true });
|
||||
this._clearButton.set_x_align(Clutter.ActorAlign.END);
|
||||
this._clearButton.connect('clicked', () => {
|
||||
let sections = [...this._sections.keys()];
|
||||
sections.forEach((s) => { s.clear(); });
|
||||
this._sectionList.get_children().forEach(s => s.clear());
|
||||
});
|
||||
box.add_actor(this._clearButton);
|
||||
|
||||
this._placeholder.bind_property('visible',
|
||||
this._clearButton, 'visible',
|
||||
GObject.BindingFlags.INVERT_BOOLEAN);
|
||||
|
||||
this._sectionList = new St.BoxLayout({ style_class: 'message-list-sections',
|
||||
vertical: true,
|
||||
y_expand: true,
|
||||
y_align: Clutter.ActorAlign.START });
|
||||
this._sectionList.connect('actor-added', this._sync.bind(this));
|
||||
this._sectionList.connect('actor-removed', this._sync.bind(this));
|
||||
this._scrollView.add_actor(this._sectionList);
|
||||
this._sections = new Map();
|
||||
|
||||
this._mediaSection = new Mpris.MediaSection();
|
||||
this._addSection(this._mediaSection);
|
||||
@@ -1101,59 +1113,35 @@ var CalendarMessageList = class CalendarMessageList {
|
||||
}
|
||||
|
||||
_addSection(section) {
|
||||
let obj = {
|
||||
destroyId: 0,
|
||||
visibleId: 0,
|
||||
emptyChangedId: 0,
|
||||
canClearChangedId: 0,
|
||||
keyFocusId: 0
|
||||
};
|
||||
obj.destroyId = section.actor.connect('destroy', () => {
|
||||
this._removeSection(section);
|
||||
});
|
||||
obj.visibleId = section.actor.connect('notify::visible',
|
||||
this._sync.bind(this));
|
||||
obj.emptyChangedId = section.connect('empty-changed',
|
||||
this._sync.bind(this));
|
||||
obj.canClearChangedId = section.connect('can-clear-changed',
|
||||
this._sync.bind(this));
|
||||
obj.keyFocusId = section.connect('key-focus-in',
|
||||
this._onKeyFocusIn.bind(this));
|
||||
let connectionsIds = [];
|
||||
|
||||
this._sections.set(section, obj);
|
||||
this._sectionList.add_actor(section.actor);
|
||||
this._sync();
|
||||
}
|
||||
for (let prop of ['visible', 'empty', 'can-clear']) {
|
||||
connectionsIds.push(
|
||||
section.connect(`notify::${prop}`, this._sync.bind(this)));
|
||||
}
|
||||
connectionsIds.push(section.connect('message-focused', (_s, messageActor) => {
|
||||
Util.ensureActorVisibleInScrollView(this._scrollView, messageActor);
|
||||
}));
|
||||
|
||||
_removeSection(section) {
|
||||
let obj = this._sections.get(section);
|
||||
section.actor.disconnect(obj.destroyId);
|
||||
section.actor.disconnect(obj.visibleId);
|
||||
section.disconnect(obj.emptyChangedId);
|
||||
section.disconnect(obj.canClearChangedId);
|
||||
section.disconnect(obj.keyFocusId);
|
||||
connectionsIds.push(section.connect('destroy', (section) => {
|
||||
connectionsIds.forEach(id => section.disconnect(id));
|
||||
this._sectionList.remove_actor(section);
|
||||
}));
|
||||
|
||||
this._sections.delete(section);
|
||||
this._sectionList.remove_actor(section.actor);
|
||||
this._sync();
|
||||
}
|
||||
|
||||
_onKeyFocusIn(section, actor) {
|
||||
Util.ensureActorVisibleInScrollView(this._scrollView, actor);
|
||||
this._sectionList.add_actor(section);
|
||||
}
|
||||
|
||||
_sync() {
|
||||
let sections = [...this._sections.keys()];
|
||||
let sections = this._sectionList.get_children();
|
||||
let visible = sections.some(s => s.allowed);
|
||||
this.actor.visible = visible;
|
||||
this.visible = visible;
|
||||
if (!visible)
|
||||
return;
|
||||
|
||||
let empty = sections.every(s => s.empty || !s.actor.visible);
|
||||
this._placeholder.actor.visible = empty;
|
||||
this._clearButton.visible = !empty;
|
||||
let empty = sections.every(s => s.empty || !s.visible);
|
||||
this._placeholder.visible = empty;
|
||||
|
||||
let canClear = sections.some(s => s.canClear && s.actor.visible);
|
||||
let canClear = sections.some(s => s.canClear && s.visible);
|
||||
this._clearButton.reactive = canClear;
|
||||
}
|
||||
|
||||
@@ -1162,8 +1150,7 @@ var CalendarMessageList = class CalendarMessageList {
|
||||
}
|
||||
|
||||
setDate(date) {
|
||||
for (let section of this._sections.keys())
|
||||
section.setDate(date);
|
||||
this._sectionList.get_children().forEach(s => s.setDate(date));
|
||||
this._placeholder.setDate(date);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
@@ -1,15 +1,19 @@
|
||||
const { Clutter, Pango, St } = imports.gi;
|
||||
/* exported CheckBox */
|
||||
const { Clutter, GObject, Pango, St } = imports.gi;
|
||||
|
||||
var CheckBox = class CheckBox {
|
||||
constructor(label) {
|
||||
var CheckBox = GObject.registerClass(
|
||||
class CheckBox extends St.Button {
|
||||
_init(label) {
|
||||
let container = new St.BoxLayout();
|
||||
this.actor = new St.Button({ style_class: 'check-box',
|
||||
child: container,
|
||||
button_mask: St.ButtonMask.ONE,
|
||||
toggle_mode: true,
|
||||
can_focus: true,
|
||||
x_fill: true,
|
||||
y_fill: true });
|
||||
super._init({
|
||||
style_class: 'check-box',
|
||||
child: container,
|
||||
button_mask: St.ButtonMask.ONE,
|
||||
toggle_mode: true,
|
||||
can_focus: true,
|
||||
x_fill: true,
|
||||
y_fill: true
|
||||
});
|
||||
|
||||
this._box = new St.Bin();
|
||||
this._box.set_y_align(Clutter.ActorAlign.START);
|
||||
@@ -31,4 +35,4 @@ var CheckBox = class CheckBox {
|
||||
getLabelActor() {
|
||||
return this._label;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
@@ -1,17 +1,17 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported CloseDialog */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;
|
||||
|
||||
const Dialog = imports.ui.dialog;
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var FROZEN_WINDOW_BRIGHTNESS = -0.3
|
||||
var DIALOG_TRANSITION_TIME = 0.15
|
||||
var FROZEN_WINDOW_BRIGHTNESS = -0.3;
|
||||
var DIALOG_TRANSITION_TIME = 150;
|
||||
var ALIVE_TIMEOUT = 5000;
|
||||
|
||||
var CloseDialog = GObject.registerClass({
|
||||
Implements: [ Meta.CloseDialog ],
|
||||
Implements: [Meta.CloseDialog],
|
||||
Properties: {
|
||||
'window': GObject.ParamSpec.override('window', Meta.CloseDialog)
|
||||
},
|
||||
@@ -56,12 +56,12 @@ var CloseDialog = GObject.registerClass({
|
||||
this._dialog.height = windowActor.height;
|
||||
|
||||
this._dialog.addContent(this._createDialogContent());
|
||||
this._dialog.addButton({ label: _('Force Quit'),
|
||||
action: this._onClose.bind(this),
|
||||
this._dialog.addButton({ label: _('Force Quit'),
|
||||
action: this._onClose.bind(this),
|
||||
default: true });
|
||||
this._dialog.addButton({ label: _('Wait'),
|
||||
this._dialog.addButton({ label: _('Wait'),
|
||||
action: this._onWait.bind(this),
|
||||
key: Clutter.Escape });
|
||||
key: Clutter.Escape });
|
||||
|
||||
global.focus_manager.add_group(this._dialog);
|
||||
}
|
||||
@@ -148,12 +148,12 @@ var CloseDialog = GObject.registerClass({
|
||||
this._dialog.scale_y = 0;
|
||||
this._dialog.set_pivot_point(0.5, 0.5);
|
||||
|
||||
Tweener.addTween(this._dialog,
|
||||
{ scale_y: 1,
|
||||
transition: 'linear',
|
||||
time: DIALOG_TRANSITION_TIME,
|
||||
onComplete: this._onFocusChanged.bind(this)
|
||||
});
|
||||
this._dialog.ease({
|
||||
scale_y: 1,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
duration: DIALOG_TRANSITION_TIME,
|
||||
onComplete: this._onFocusChanged.bind(this)
|
||||
});
|
||||
}
|
||||
|
||||
vfunc_hide() {
|
||||
@@ -165,7 +165,7 @@ var CloseDialog = GObject.registerClass({
|
||||
GLib.source_remove(this._timeoutId);
|
||||
this._timeoutId = 0;
|
||||
|
||||
global.display.disconnect(this._windowFocusChangedId)
|
||||
global.display.disconnect(this._windowFocusChangedId);
|
||||
this._windowFocusChangedId = 0;
|
||||
|
||||
global.stage.disconnect(this._keyFocusChangedId);
|
||||
@@ -175,14 +175,12 @@ var CloseDialog = GObject.registerClass({
|
||||
this._dialog = null;
|
||||
this._removeWindowEffect();
|
||||
|
||||
Tweener.addTween(dialog,
|
||||
{ scale_y: 0,
|
||||
transition: 'linear',
|
||||
time: DIALOG_TRANSITION_TIME,
|
||||
onComplete: () => {
|
||||
dialog.destroy();
|
||||
}
|
||||
});
|
||||
dialog.ease({
|
||||
scale_y: 0,
|
||||
mode: Clutter.AnimationMode.LINEAR,
|
||||
duration: DIALOG_TRANSITION_TIME,
|
||||
onComplete: () => dialog.destroy()
|
||||
});
|
||||
}
|
||||
|
||||
vfunc_focus() {
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported ComponentManager */
|
||||
const Main = imports.ui.main;
|
||||
|
||||
var ComponentManager = class {
|
||||
@@ -13,13 +14,13 @@ var ComponentManager = class {
|
||||
let newEnabledComponents = Main.sessionMode.components;
|
||||
|
||||
newEnabledComponents.filter(
|
||||
name => this._enabledComponents.indexOf(name) == -1
|
||||
name => !this._enabledComponents.includes(name)
|
||||
).forEach(name => {
|
||||
this._enableComponent(name);
|
||||
});
|
||||
|
||||
this._enabledComponents.filter(
|
||||
name => newEnabledComponents.indexOf(name) == -1
|
||||
name => !newEnabledComponents.includes(name)
|
||||
).forEach(name => {
|
||||
this._disableComponent(name);
|
||||
});
|
||||
@@ -37,8 +38,8 @@ var ComponentManager = class {
|
||||
if (component)
|
||||
return component;
|
||||
|
||||
if (Main.sessionMode.isLocked)
|
||||
return null;
|
||||
if (Main.sessionMode.isLocked)
|
||||
return null;
|
||||
|
||||
let constructor = this._importComponent(name);
|
||||
component = new constructor();
|
||||
@@ -48,7 +49,7 @@ var ComponentManager = class {
|
||||
|
||||
_enableComponent(name) {
|
||||
let component = this._ensureComponent(name);
|
||||
if (component)
|
||||
if (component)
|
||||
component.enable();
|
||||
}
|
||||
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Gio, GLib } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Params = imports.misc.params;
|
||||
|
||||
const GnomeSession = imports.misc.gnomeSession;
|
||||
@@ -38,7 +38,7 @@ var AutomountManager = class {
|
||||
this._driveDisconnectedId = this._volumeMonitor.connect('drive-disconnected', this._onDriveDisconnected.bind(this));
|
||||
this._driveEjectButtonId = this._volumeMonitor.connect('drive-eject-button', this._onDriveEjectButton.bind(this));
|
||||
|
||||
this._mountAllId = Mainloop.idle_add(this._startupMountAll.bind(this));
|
||||
this._mountAllId = GLib.idle_add(GLib.PRIORITY_DEFAULT, this._startupMountAll.bind(this));
|
||||
GLib.Source.set_name_by_id(this._mountAllId, '[gnome-shell] this._startupMountAll');
|
||||
}
|
||||
|
||||
@@ -50,12 +50,12 @@ var AutomountManager = class {
|
||||
this._volumeMonitor.disconnect(this._driveEjectButtonId);
|
||||
|
||||
if (this._mountAllId > 0) {
|
||||
Mainloop.source_remove(this._mountAllId);
|
||||
GLib.source_remove(this._mountAllId);
|
||||
this._mountAllId = 0;
|
||||
}
|
||||
}
|
||||
|
||||
_InhibitorsChanged(object, senderName, [inhibtor]) {
|
||||
_InhibitorsChanged(_object, _senderName, [_inhibitor]) {
|
||||
this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
|
||||
(result, error) => {
|
||||
if (!error) {
|
||||
@@ -109,25 +109,23 @@ var AutomountManager = class {
|
||||
// we force stop/eject in this case, so we don't have to pass a
|
||||
// mount operation object
|
||||
if (drive.can_stop()) {
|
||||
drive.stop
|
||||
(Gio.MountUnmountFlags.FORCE, null, null,
|
||||
(drive, res) => {
|
||||
try {
|
||||
drive.stop_finish(res);
|
||||
} catch (e) {
|
||||
log("Unable to stop the drive after drive-eject-button " + e.toString());
|
||||
}
|
||||
});
|
||||
drive.stop(Gio.MountUnmountFlags.FORCE, null, null,
|
||||
(drive, res) => {
|
||||
try {
|
||||
drive.stop_finish(res);
|
||||
} catch (e) {
|
||||
log(`Unable to stop the drive after drive-eject-button ${e.toString()}`);
|
||||
}
|
||||
});
|
||||
} else if (drive.can_eject()) {
|
||||
drive.eject_with_operation
|
||||
(Gio.MountUnmountFlags.FORCE, null, null,
|
||||
(drive, res) => {
|
||||
try {
|
||||
drive.eject_with_operation_finish(res);
|
||||
} catch (e) {
|
||||
log("Unable to eject the drive after drive-eject-button " + e.toString());
|
||||
}
|
||||
});
|
||||
drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null,
|
||||
(drive, res) => {
|
||||
try {
|
||||
drive.eject_with_operation_finish(res);
|
||||
} catch (e) {
|
||||
log(`Unable to eject the drive after drive-eject-button ${e.toString()}`);
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -158,7 +156,7 @@ var AutomountManager = class {
|
||||
!volume.should_automount() ||
|
||||
!volume.can_mount()) {
|
||||
// allow the autorun to run anyway; this can happen if the
|
||||
// mount gets added programmatically later, even if
|
||||
// mount gets added programmatically later, even if
|
||||
// should_automount() or can_mount() are false, like for
|
||||
// blank optical media.
|
||||
this._allowAutorun(volume);
|
||||
@@ -213,7 +211,7 @@ var AutomountManager = class {
|
||||
}
|
||||
|
||||
if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.FAILED_HANDLED))
|
||||
log('Unable to mount volume ' + volume.get_name() + ': ' + e.toString());
|
||||
log(`Unable to mount volume ${volume.get_name()}: ${e.toString()}`);
|
||||
this._closeOperation(volume);
|
||||
}
|
||||
}
|
||||
@@ -221,17 +219,17 @@ var AutomountManager = class {
|
||||
|
||||
_onVolumeRemoved(monitor, volume) {
|
||||
if (volume._allowAutorunExpireId && volume._allowAutorunExpireId > 0) {
|
||||
Mainloop.source_remove(volume._allowAutorunExpireId);
|
||||
GLib.source_remove(volume._allowAutorunExpireId);
|
||||
delete volume._allowAutorunExpireId;
|
||||
}
|
||||
this._volumeQueue =
|
||||
this._volumeQueue =
|
||||
this._volumeQueue.filter(element => (element != volume));
|
||||
}
|
||||
|
||||
_reaskPassword(volume) {
|
||||
let prevOperation = this._activeOperations.get(volume);
|
||||
let existingDialog = prevOperation ? prevOperation.borrowDialog() : null;
|
||||
let operation =
|
||||
let operation =
|
||||
new ShellMountOperation.ShellMountOperation(volume,
|
||||
{ existingDialog: existingDialog });
|
||||
this._mountVolume(volume, operation);
|
||||
@@ -250,7 +248,7 @@ var AutomountManager = class {
|
||||
}
|
||||
|
||||
_allowAutorunExpire(volume) {
|
||||
let id = Mainloop.timeout_add_seconds(AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
|
||||
let id = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, AUTORUN_EXPIRE_TIMEOUT_SECS, () => {
|
||||
volume.allowAutorun = false;
|
||||
delete volume._allowAutorunExpireId;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Gio, St } = imports.gi;
|
||||
const { Gio, GObject, St } = imports.gi;
|
||||
|
||||
const GnomeSession = imports.misc.gnomeSession;
|
||||
const Main = imports.ui.main;
|
||||
@@ -40,7 +41,7 @@ function isMountRootHidden(root) {
|
||||
let path = root.get_path();
|
||||
|
||||
// skip any mounts in hidden directory hierarchies
|
||||
return (path.indexOf('/.') != -1);
|
||||
return (path.includes('/.'));
|
||||
}
|
||||
|
||||
function isMountNonLocal(mount) {
|
||||
@@ -62,18 +63,15 @@ function startAppForMount(app, mount) {
|
||||
files.push(root);
|
||||
|
||||
try {
|
||||
retval = app.launch(files,
|
||||
retval = app.launch(files,
|
||||
global.create_app_launch_context(0, -1));
|
||||
} catch (e) {
|
||||
log('Unable to launch the application ' + app.get_name()
|
||||
+ ': ' + e.toString());
|
||||
log(`Unable to launch the application ${app.get_name()}: ${e}`);
|
||||
}
|
||||
|
||||
return retval;
|
||||
}
|
||||
|
||||
/******************************************/
|
||||
|
||||
const HotplugSnifferIface = loadInterfaceXML('org.gnome.Shell.HotplugSniffer');
|
||||
const HotplugSnifferProxy = Gio.DBusProxy.makeProxyWrapper(HotplugSnifferIface);
|
||||
function HotplugSniffer() {
|
||||
@@ -107,8 +105,7 @@ var ContentTypeDiscoverer = class {
|
||||
try {
|
||||
contentTypes = mount.guess_content_type_finish(res);
|
||||
} catch (e) {
|
||||
log('Unable to guess content types on added mount ' + mount.get_name()
|
||||
+ ': ' + e.toString());
|
||||
log(`Unable to guess content types on added mount ${mount.get_name()}: ${e}`);
|
||||
}
|
||||
|
||||
if (contentTypes.length) {
|
||||
@@ -118,16 +115,13 @@ var ContentTypeDiscoverer = class {
|
||||
|
||||
let hotplugSniffer = new HotplugSniffer();
|
||||
hotplugSniffer.SniffURIRemote(root.get_uri(),
|
||||
([contentTypes]) => {
|
||||
this._emitCallback(mount, contentTypes);
|
||||
});
|
||||
([contentTypes]) => {
|
||||
this._emitCallback(mount, contentTypes);
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
_emitCallback(mount, contentTypes) {
|
||||
if (!contentTypes)
|
||||
contentTypes = [];
|
||||
|
||||
_emitCallback(mount, contentTypes = []) {
|
||||
// we're not interested in win32 software content types here
|
||||
contentTypes = contentTypes.filter(
|
||||
type => (type != 'x-content/win32-software')
|
||||
@@ -192,15 +186,15 @@ var AutorunDispatcher = class {
|
||||
|
||||
_getAutorunSettingForType(contentType) {
|
||||
let runApp = this._settings.get_strv(SETTING_START_APP);
|
||||
if (runApp.indexOf(contentType) != -1)
|
||||
if (runApp.includes(contentType))
|
||||
return AutorunSetting.RUN;
|
||||
|
||||
let ignore = this._settings.get_strv(SETTING_IGNORE);
|
||||
if (ignore.indexOf(contentType) != -1)
|
||||
if (ignore.includes(contentType))
|
||||
return AutorunSetting.IGNORE;
|
||||
|
||||
let openFiles = this._settings.get_strv(SETTING_OPEN_FOLDER);
|
||||
if (openFiles.indexOf(contentType) != -1)
|
||||
if (openFiles.includes(contentType))
|
||||
return AutorunSetting.FILES;
|
||||
|
||||
return AutorunSetting.ASK;
|
||||
@@ -219,11 +213,11 @@ var AutorunDispatcher = class {
|
||||
}
|
||||
|
||||
_addSource(mount, apps) {
|
||||
// if we already have a source showing for this
|
||||
// if we already have a source showing for this
|
||||
// mount, return
|
||||
if (this._getSourceForMount(mount))
|
||||
return;
|
||||
|
||||
|
||||
// add a new source
|
||||
this._sources.push(new AutorunSource(this._manager, mount, apps));
|
||||
}
|
||||
@@ -268,7 +262,7 @@ var AutorunDispatcher = class {
|
||||
|
||||
removeMount(mount) {
|
||||
let source = this._getSourceForMount(mount);
|
||||
|
||||
|
||||
// if we aren't tracking this mount, don't do anything
|
||||
if (!source)
|
||||
return;
|
||||
@@ -278,9 +272,10 @@ var AutorunDispatcher = class {
|
||||
}
|
||||
};
|
||||
|
||||
var AutorunSource = class extends MessageTray.Source {
|
||||
constructor(manager, mount, apps) {
|
||||
super(mount.get_name());
|
||||
var AutorunSource = GObject.registerClass(
|
||||
class AutorunSource extends MessageTray.Source {
|
||||
_init(manager, mount, apps) {
|
||||
super._init(mount.get_name());
|
||||
|
||||
this._manager = manager;
|
||||
this.mount = mount;
|
||||
@@ -290,7 +285,7 @@ var AutorunSource = class extends MessageTray.Source {
|
||||
|
||||
// add ourselves as a source, and popup the notification
|
||||
Main.messageTray.add(this);
|
||||
this.notify(this._notification);
|
||||
this.showNotification(this._notification);
|
||||
}
|
||||
|
||||
getIcon() {
|
||||
@@ -300,11 +295,12 @@ var AutorunSource = class extends MessageTray.Source {
|
||||
_createPolicy() {
|
||||
return new MessageTray.NotificationApplicationPolicy('org.gnome.Nautilus');
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var AutorunNotification = class extends MessageTray.Notification {
|
||||
constructor(manager, source) {
|
||||
super(source, source.title);
|
||||
var AutorunNotification = GObject.registerClass(
|
||||
class AutorunNotification extends MessageTray.Notification {
|
||||
_init(manager, source) {
|
||||
super._init(source, source.title);
|
||||
|
||||
this._manager = manager;
|
||||
this._mount = source.mount;
|
||||
@@ -329,10 +325,10 @@ var AutorunNotification = class extends MessageTray.Notification {
|
||||
style_class: 'hotplug-notification-item-icon' });
|
||||
box.add(icon);
|
||||
|
||||
let label = new St.Bin({ y_align: St.Align.MIDDLE,
|
||||
child: new St.Label
|
||||
({ text: _("Open with %s").format(app.get_name()) })
|
||||
});
|
||||
let label = new St.Bin({
|
||||
y_align: St.Align.MIDDLE,
|
||||
child: new St.Label({ text: _("Open with %s").format(app.get_name()) }),
|
||||
});
|
||||
box.add(label);
|
||||
|
||||
let button = new St.Button({ child: box,
|
||||
@@ -356,6 +352,6 @@ var AutorunNotification = class extends MessageTray.Notification {
|
||||
let app = Gio.app_info_get_default_for_type('inode/directory', false);
|
||||
startAppForMount(app, this._mount);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var Component = AutorunManager;
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi;
|
||||
|
||||
@@ -76,13 +77,13 @@ class KeyringDialog extends ModalDialog.ModalDialog {
|
||||
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
|
||||
|
||||
if (rtl) {
|
||||
layout.attach(this._workSpinner.actor, 0, row, 1, 1);
|
||||
layout.attach(this._workSpinner, 0, row, 1, 1);
|
||||
layout.attach(this._passwordEntry, 1, row, 1, 1);
|
||||
layout.attach(label, 2, row, 1, 1);
|
||||
} else {
|
||||
layout.attach(label, 0, row, 1, 1);
|
||||
layout.attach(this._passwordEntry, 1, row, 1, 1);
|
||||
layout.attach(this._workSpinner.actor, 2, row, 1, 1);
|
||||
layout.attach(this._workSpinner, 2, row, 1, 1);
|
||||
}
|
||||
row++;
|
||||
} else {
|
||||
@@ -120,8 +121,8 @@ class KeyringDialog extends ModalDialog.ModalDialog {
|
||||
if (this.prompt.choice_visible) {
|
||||
let choice = new CheckBox.CheckBox();
|
||||
this.prompt.bind_property('choice-label', choice.getLabelActor(), 'text', GObject.BindingFlags.SYNC_CREATE);
|
||||
this.prompt.bind_property('choice-chosen', choice.actor, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL);
|
||||
layout.attach(choice.actor, rtl ? 0 : 1, row, 1, 1);
|
||||
this.prompt.bind_property('choice-chosen', choice, 'checked', GObject.BindingFlags.SYNC_CREATE | GObject.BindingFlags.BIDIRECTIONAL);
|
||||
layout.attach(choice, rtl ? 0 : 1, row, 1, 1);
|
||||
row++;
|
||||
}
|
||||
|
||||
@@ -162,7 +163,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
|
||||
// NOTE: ModalDialog.open() is safe to call if the dialog is
|
||||
// already open - it just returns true without side-effects
|
||||
if (this.open())
|
||||
return true;
|
||||
return true;
|
||||
|
||||
// The above fail if e.g. unable to get input grab
|
||||
//
|
||||
@@ -172,25 +173,25 @@ class KeyringDialog extends ModalDialog.ModalDialog {
|
||||
|
||||
log('keyringPrompt: Failed to show modal dialog.' +
|
||||
' Dismissing prompt request');
|
||||
this.prompt.cancel()
|
||||
this.prompt.cancel();
|
||||
return false;
|
||||
}
|
||||
|
||||
_onShowPassword(prompt) {
|
||||
_onShowPassword() {
|
||||
this._buildControlTable();
|
||||
this._ensureOpen();
|
||||
this._updateSensitivity(true);
|
||||
this._passwordEntry.grab_key_focus();
|
||||
}
|
||||
|
||||
_onShowConfirm(prompt) {
|
||||
_onShowConfirm() {
|
||||
this._buildControlTable();
|
||||
this._ensureOpen();
|
||||
this._updateSensitivity(true);
|
||||
this._continueButton.grab_key_focus();
|
||||
}
|
||||
|
||||
_onHidePrompt(prompt) {
|
||||
_onHidePrompt() {
|
||||
this.close();
|
||||
}
|
||||
|
||||
@@ -231,8 +232,9 @@ var KeyringPrompter = class {
|
||||
constructor() {
|
||||
this._prompter = new Gcr.SystemPrompter();
|
||||
this._prompter.connect('new-prompt', () => {
|
||||
let dialog = this._enabled ? new KeyringDialog()
|
||||
: new KeyringDummyDialog();
|
||||
let dialog = this._enabled
|
||||
? new KeyringDialog()
|
||||
: new KeyringDummyDialog();
|
||||
this._currentPrompt = dialog.prompt;
|
||||
return this._currentPrompt;
|
||||
});
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
@@ -80,8 +81,9 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
secret.valid = secret.value.length > 0;
|
||||
this._updateOkButton();
|
||||
});
|
||||
} else
|
||||
} else {
|
||||
secret.valid = true;
|
||||
}
|
||||
|
||||
if (rtl) {
|
||||
layout.attach(secret.entry, 0, pos, 1, 1);
|
||||
@@ -105,21 +107,22 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
|
||||
|
||||
contentBox.messageBox.add(descriptionLabel,
|
||||
{ y_fill: true,
|
||||
{ y_fill: true,
|
||||
y_align: St.Align.START,
|
||||
expand: true });
|
||||
}
|
||||
|
||||
this._okButton = { label: _("Connect"),
|
||||
action: this._onOk.bind(this),
|
||||
default: true
|
||||
};
|
||||
this._okButton = {
|
||||
label: _("Connect"),
|
||||
action: this._onOk.bind(this),
|
||||
default: true,
|
||||
};
|
||||
|
||||
this.setButtons([{ label: _("Cancel"),
|
||||
action: this.cancel.bind(this),
|
||||
key: Clutter.KEY_Escape,
|
||||
},
|
||||
this._okButton]);
|
||||
this.setButtons([{
|
||||
label: _("Cancel"),
|
||||
action: this.cancel.bind(this),
|
||||
key: Clutter.KEY_Escape,
|
||||
}, this._okButton]);
|
||||
|
||||
this._updateOkButton();
|
||||
}
|
||||
@@ -161,9 +164,9 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
if (value.length == 64) {
|
||||
// must be composed of hexadecimal digits only
|
||||
for (let i = 0; i < 64; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f')
|
||||
|| (value[i] >= 'A' && value[i] <= 'F')
|
||||
|| (value[i] >= '0' && value[i] <= '9')))
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f') ||
|
||||
(value[i] >= 'A' && value[i] <= 'F') ||
|
||||
(value[i] >= '0' && value[i] <= '9')))
|
||||
return false;
|
||||
}
|
||||
return true;
|
||||
@@ -176,28 +179,29 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
let value = secret.value;
|
||||
if (secret.wep_key_type == NM.WepKeyType.KEY) {
|
||||
if (value.length == 10 || value.length == 26) {
|
||||
for (let i = 0; i < value.length; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f')
|
||||
|| (value[i] >= 'A' && value[i] <= 'F')
|
||||
|| (value[i] >= '0' && value[i] <= '9')))
|
||||
return false;
|
||||
}
|
||||
} else if (value.length == 5 || value.length == 13) {
|
||||
for (let i = 0; i < value.length; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'z')
|
||||
|| (value[i] >= 'A' && value[i] <= 'Z')))
|
||||
for (let i = 0; i < value.length; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'f') ||
|
||||
(value[i] >= 'A' && value[i] <= 'F') ||
|
||||
(value[i] >= '0' && value[i] <= '9')))
|
||||
return false;
|
||||
}
|
||||
} else
|
||||
} else if (value.length == 5 || value.length == 13) {
|
||||
for (let i = 0; i < value.length; i++) {
|
||||
if (!((value[i] >= 'a' && value[i] <= 'z') ||
|
||||
(value[i] >= 'A' && value[i] <= 'Z')))
|
||||
return false;
|
||||
}
|
||||
} else {
|
||||
return false;
|
||||
} else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) {
|
||||
if (value.length < 0 || value.length > 64)
|
||||
return false;
|
||||
}
|
||||
}
|
||||
} else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) {
|
||||
if (value.length < 0 || value.length > 64)
|
||||
return false;
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
_getWirelessSecrets(secrets, wirelessSetting) {
|
||||
_getWirelessSecrets(secrets, _wirelessSetting) {
|
||||
let wirelessSecuritySetting = this._connection.get_setting_wireless_security();
|
||||
|
||||
if (this._settingName == '802-1x') {
|
||||
@@ -209,12 +213,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
// First the easy ones
|
||||
case 'wpa-none':
|
||||
case 'wpa-psk':
|
||||
case 'sae':
|
||||
secrets.push({ label: _("Password: "), key: 'psk',
|
||||
value: wirelessSecuritySetting.psk || '',
|
||||
validate: this._validateWpaPsk, password: true });
|
||||
break;
|
||||
case 'none': // static WEP
|
||||
secrets.push({ label: _("Key: "), key: 'wep-key' + wirelessSecuritySetting.wep_tx_keyidx,
|
||||
secrets.push({ label: _("Key: "), key: `wep-key${wirelessSecuritySetting.wep_tx_keyidx}`,
|
||||
value: wirelessSecuritySetting.get_wep_key(wirelessSecuritySetting.wep_tx_keyidx) || '',
|
||||
wep_key_type: wirelessSecuritySetting.wep_key_type,
|
||||
validate: this._validateStaticWep, password: true });
|
||||
@@ -230,13 +235,12 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
this._get8021xSecrets(secrets);
|
||||
break;
|
||||
default:
|
||||
log('Invalid wireless key management: ' + wirelessSecuritySetting.key_mgmt);
|
||||
log(`Invalid wireless key management: ${wirelessSecuritySetting.key_mgmt}`);
|
||||
}
|
||||
}
|
||||
|
||||
_get8021xSecrets(secrets) {
|
||||
let ieee8021xSetting = this._connection.get_setting_802_1x();
|
||||
let phase2method;
|
||||
|
||||
/* If hints were given we know exactly what we need to ask */
|
||||
if (this._settingName == "802-1x" && this._hints.length) {
|
||||
@@ -273,7 +277,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
value: ieee8021xSetting.private_key_password || '', password: true });
|
||||
break;
|
||||
default:
|
||||
log('Invalid EAP/IEEE802.1x method: ' + ieee8021xSetting.get_eap_method(0));
|
||||
log(`Invalid EAP/IEEE802.1x method: ${ieee8021xSetting.get_eap_method(0)}`);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -304,7 +308,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
let ssid;
|
||||
|
||||
let content = { };
|
||||
content.secrets = [ ];
|
||||
content.secrets = [];
|
||||
|
||||
switch (connectionType) {
|
||||
case '802-11-wireless':
|
||||
@@ -327,7 +331,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
this._getPPPoESecrets(content.secrets);
|
||||
break;
|
||||
case 'gsm':
|
||||
if (this._hints.indexOf('pin') != -1) {
|
||||
if (this._hints.includes('pin')) {
|
||||
let gsmSetting = this._connection.get_setting_gsm();
|
||||
content.title = _("PIN code required");
|
||||
content.message = _("PIN code is needed for the mobile broadband device");
|
||||
@@ -343,8 +347,8 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
|
||||
this._getMobileSecrets(content.secrets, connectionType);
|
||||
break;
|
||||
default:
|
||||
log('Invalid connection type: ' + connectionType);
|
||||
};
|
||||
log(`Invalid connection type: ${connectionType}`);
|
||||
}
|
||||
|
||||
return content;
|
||||
}
|
||||
@@ -359,16 +363,15 @@ var VPNRequestHandler = class {
|
||||
this._pluginOutBuffer = [];
|
||||
this._title = null;
|
||||
this._description = null;
|
||||
this._content = [ ];
|
||||
this._content = [];
|
||||
this._shellDialog = null;
|
||||
|
||||
let connectionSetting = connection.get_setting_connection();
|
||||
|
||||
let argv = [ authHelper.fileName,
|
||||
'-u', connectionSetting.uuid,
|
||||
'-n', connectionSetting.id,
|
||||
'-s', serviceType
|
||||
];
|
||||
let argv = [authHelper.fileName,
|
||||
'-u', connectionSetting.uuid,
|
||||
'-n', connectionSetting.id,
|
||||
'-s', serviceType];
|
||||
if (authHelper.externalUIMode)
|
||||
argv.push('--external-ui-mode');
|
||||
if (flags & NM.SecretAgentGetSecretsFlags.ALLOW_INTERACTION)
|
||||
@@ -385,7 +388,7 @@ var VPNRequestHandler = class {
|
||||
this._newStylePlugin = authHelper.externalUIMode;
|
||||
|
||||
try {
|
||||
let [success, pid, stdin, stdout, stderr] =
|
||||
let [success_, pid, stdin, stdout, stderr] =
|
||||
GLib.spawn_async_with_pipes(null, /* pwd */
|
||||
argv,
|
||||
null, /* envp */
|
||||
@@ -407,7 +410,7 @@ var VPNRequestHandler = class {
|
||||
this._vpnChildFinished.bind(this));
|
||||
|
||||
this._writeConnection();
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
logError(e, 'error while spawning VPN auth helper');
|
||||
|
||||
this._agent.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
|
||||
@@ -424,7 +427,7 @@ var VPNRequestHandler = class {
|
||||
} else {
|
||||
try {
|
||||
this._stdin.write('QUIT\n\n', null);
|
||||
} catch(e) { /* ignore broken pipe errors */ }
|
||||
} catch (e) { /* ignore broken pipe errors */ }
|
||||
}
|
||||
|
||||
this.destroy();
|
||||
@@ -444,7 +447,7 @@ var VPNRequestHandler = class {
|
||||
this._destroyed = true;
|
||||
}
|
||||
|
||||
_vpnChildFinished(pid, status, requestObj) {
|
||||
_vpnChildFinished(pid, status, _requestObj) {
|
||||
this._childWatch = 0;
|
||||
if (this._newStylePlugin) {
|
||||
// For new style plugin, all work is done in the async reading functions
|
||||
@@ -459,8 +462,9 @@ var VPNRequestHandler = class {
|
||||
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.USER_CANCELED);
|
||||
else
|
||||
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.CONFIRMED);
|
||||
} else
|
||||
} else {
|
||||
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
|
||||
}
|
||||
|
||||
this.destroy();
|
||||
}
|
||||
@@ -473,7 +477,7 @@ var VPNRequestHandler = class {
|
||||
if (line == '' && this._previousLine == '') {
|
||||
try {
|
||||
this._stdin.write('QUIT\n\n', null);
|
||||
} catch(e) { /* ignore broken pipe errors */ }
|
||||
} catch (e) { /* ignore broken pipe errors */ }
|
||||
} else {
|
||||
this._agent.set_password(this._requestId, this._previousLine, line);
|
||||
this._previousLine = undefined;
|
||||
@@ -485,7 +489,7 @@ var VPNRequestHandler = class {
|
||||
|
||||
_readStdoutOldStyle() {
|
||||
this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => {
|
||||
let [line, len] = this._dataStdout.read_line_finish_utf8(result);
|
||||
let [line, len_] = this._dataStdout.read_line_finish_utf8(result);
|
||||
|
||||
if (line == null) {
|
||||
// end of file
|
||||
@@ -540,7 +544,7 @@ var VPNRequestHandler = class {
|
||||
message: keyfile.get_string(VPN_UI_GROUP, 'Description'),
|
||||
secrets: [] };
|
||||
|
||||
let [groups, len] = keyfile.get_groups();
|
||||
let [groups, len_] = keyfile.get_groups();
|
||||
for (let i = 0; i < groups.length; i++) {
|
||||
if (groups[i] == VPN_UI_GROUP)
|
||||
continue;
|
||||
@@ -549,11 +553,12 @@ var VPNRequestHandler = class {
|
||||
let shouldAsk = keyfile.get_boolean(groups[i], 'ShouldAsk');
|
||||
|
||||
if (shouldAsk) {
|
||||
contentOverride.secrets.push({ label: keyfile.get_string(groups[i], 'Label'),
|
||||
key: groups[i],
|
||||
value: value,
|
||||
password: keyfile.get_boolean(groups[i], 'IsSecret')
|
||||
});
|
||||
contentOverride.secrets.push({
|
||||
label: keyfile.get_string(groups[i], 'Label'),
|
||||
key: groups[i],
|
||||
value: value,
|
||||
password: keyfile.get_boolean(groups[i], 'IsSecret'),
|
||||
});
|
||||
} else {
|
||||
if (!value.length) // Ignore empty secrets
|
||||
continue;
|
||||
@@ -561,7 +566,7 @@ var VPNRequestHandler = class {
|
||||
this._agent.set_password(this._requestId, groups[i], value);
|
||||
}
|
||||
}
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
// No output is a valid case it means "both secrets are stored"
|
||||
if (data.length > 0) {
|
||||
logError(e, 'error while reading VPN plugin output keyfile');
|
||||
@@ -587,15 +592,15 @@ var VPNRequestHandler = class {
|
||||
|
||||
try {
|
||||
vpnSetting.foreach_data_item((key, value) => {
|
||||
this._stdin.write('DATA_KEY=' + key + '\n', null);
|
||||
this._stdin.write('DATA_VAL=' + (value || '') + '\n\n', null);
|
||||
this._stdin.write(`DATA_KEY=${key}\n`, null);
|
||||
this._stdin.write(`DATA_VAL=${value || ''}\n\n`, null);
|
||||
});
|
||||
vpnSetting.foreach_secret((key, value) => {
|
||||
this._stdin.write('SECRET_KEY=' + key + '\n', null);
|
||||
this._stdin.write('SECRET_VAL=' + (value || '') + '\n\n', null);
|
||||
this._stdin.write(`SECRET_KEY=${key}\n`, null);
|
||||
this._stdin.write(`SECRET_VAL=${value || ''}\n\n`, null);
|
||||
});
|
||||
this._stdin.write('DONE\n\n', null);
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
logError(e, 'internal error while writing connection to helper');
|
||||
|
||||
this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
|
||||
@@ -607,10 +612,11 @@ Signals.addSignalMethods(VPNRequestHandler.prototype);
|
||||
|
||||
var NetworkAgent = class {
|
||||
constructor() {
|
||||
this._native = new Shell.NetworkAgent({ identifier: 'org.gnome.Shell.NetworkAgent',
|
||||
capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
|
||||
auto_register: false
|
||||
});
|
||||
this._native = new Shell.NetworkAgent({
|
||||
identifier: 'org.gnome.Shell.NetworkAgent',
|
||||
capabilities: NM.SecretAgentCapabilities.VPN_HINTS,
|
||||
auto_register: false,
|
||||
});
|
||||
|
||||
this._dialogs = { };
|
||||
this._vpnRequests = { };
|
||||
@@ -619,9 +625,9 @@ var NetworkAgent = class {
|
||||
this._pluginDir = Gio.file_new_for_path(Config.VPNDIR);
|
||||
try {
|
||||
let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null);
|
||||
monitor.connect('changed', () => { this._vpnCacheBuilt = false; });
|
||||
} catch(e) {
|
||||
log('Failed to create monitor for VPN plugin dir: ' + e.message);
|
||||
monitor.connect('changed', () => (this._vpnCacheBuilt = false));
|
||||
} catch (e) {
|
||||
log(`Failed to create monitor for VPN plugin dir: ${e.message}`);
|
||||
}
|
||||
|
||||
this._native.connect('new-request', this._newRequest.bind(this));
|
||||
@@ -632,7 +638,7 @@ var NetworkAgent = class {
|
||||
try {
|
||||
this._native.init_finish(res);
|
||||
this._initialized = true;
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
this._native = null;
|
||||
logError(e, 'error initializing the NetworkManager Agent');
|
||||
}
|
||||
@@ -680,12 +686,13 @@ var NetworkAgent = class {
|
||||
let connectionSetting = connection.get_setting_connection();
|
||||
let connectionType = connectionSetting.get_connection_type();
|
||||
switch (connectionType) {
|
||||
case '802-11-wireless':
|
||||
case '802-11-wireless': {
|
||||
let wirelessSetting = connection.get_setting_wireless();
|
||||
let ssid = NM.utils_ssid_to_utf8(wirelessSetting.get_ssid().get_data());
|
||||
title = _("Authentication required by wireless network");
|
||||
body = _("Passwords or encryption keys are required to access the wireless network “%s”.").format(ssid);
|
||||
break;
|
||||
}
|
||||
case '802-3-ethernet':
|
||||
title = _("Wired 802.1X authentication");
|
||||
body = _("A password is required to connect to “%s”.".format(connection.get_id()));
|
||||
@@ -695,8 +702,7 @@ var NetworkAgent = class {
|
||||
body = _("A password is required to connect to “%s”.".format(connection.get_id()));
|
||||
break;
|
||||
case 'gsm':
|
||||
if (hints.indexOf('pin') != -1) {
|
||||
let gsmSetting = connection.get_setting_gsm();
|
||||
if (hints.includes('pin')) {
|
||||
title = _("PIN code required");
|
||||
body = _("PIN code is needed for the mobile broadband device");
|
||||
break;
|
||||
@@ -708,7 +714,7 @@ var NetworkAgent = class {
|
||||
body = _("A password is required to connect to “%s”.").format(connectionSetting.get_id());
|
||||
break;
|
||||
default:
|
||||
log('Invalid connection type: ' + connectionType);
|
||||
log(`Invalid connection type: ${connectionType}`);
|
||||
this._native.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
|
||||
return;
|
||||
}
|
||||
@@ -728,7 +734,7 @@ var NetworkAgent = class {
|
||||
});
|
||||
|
||||
Main.messageTray.add(source);
|
||||
source.notify(notification);
|
||||
source.showNotification(notification);
|
||||
}
|
||||
|
||||
_newRequest(agent, requestId, connection, settingName, hints, flags) {
|
||||
|
||||
@@ -1,8 +1,8 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { AccountsService, Clutter, Gio, GLib,
|
||||
GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Animation = imports.ui.animation;
|
||||
const Dialog = imports.ui.dialog;
|
||||
@@ -39,19 +39,19 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
this.contentLayout.add_actor(content);
|
||||
|
||||
if (userNames.length > 1) {
|
||||
log('polkitAuthenticationAgent: Received ' + userNames.length +
|
||||
' identities that can be used for authentication. Only ' +
|
||||
log(`polkitAuthenticationAgent: Received ${userNames.length} ` +
|
||||
'identities that can be used for authentication. Only ' +
|
||||
'considering one.');
|
||||
}
|
||||
|
||||
let userName = GLib.get_user_name();
|
||||
if (userNames.indexOf(userName) < 0)
|
||||
if (!userNames.includes(userName))
|
||||
userName = 'root';
|
||||
if (userNames.indexOf(userName) < 0)
|
||||
if (!userNames.includes(userName))
|
||||
userName = userNames[0];
|
||||
|
||||
this._user = AccountsService.UserManager.get_default().get_user(userName);
|
||||
let userRealName = this._user.get_real_name()
|
||||
let userRealName = this._user.get_real_name();
|
||||
this._userLoadedId = this._user.connect('notify::is_loaded',
|
||||
this._onUserChanged.bind(this));
|
||||
this._userChangedId = this._user.connect('changed',
|
||||
@@ -76,17 +76,17 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
this._userAvatar = new UserWidget.Avatar(this._user,
|
||||
{ iconSize: DIALOG_ICON_SIZE,
|
||||
styleClass: 'polkit-dialog-user-icon' });
|
||||
this._userAvatar.actor.hide();
|
||||
userBox.add(this._userAvatar.actor,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
this._userAvatar.hide();
|
||||
userBox.add(this._userAvatar,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
x_align: St.Align.END,
|
||||
y_align: St.Align.START });
|
||||
let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label',
|
||||
text: userRealName }));
|
||||
userBox.add(userLabel,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
x_align: St.Align.END,
|
||||
y_align: St.Align.MIDDLE });
|
||||
}
|
||||
@@ -99,14 +99,14 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE });
|
||||
this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
|
||||
text: "",
|
||||
can_focus: true});
|
||||
can_focus: true });
|
||||
ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
|
||||
this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this));
|
||||
this._passwordBox.add(this._passwordEntry,
|
||||
{ expand: true });
|
||||
|
||||
this._workSpinner = new Animation.Spinner(WORK_SPINNER_ICON_SIZE, true);
|
||||
this._passwordBox.add(this._workSpinner.actor);
|
||||
this._passwordBox.add(this._workSpinner);
|
||||
|
||||
this.setInitialKeyFocus(this._passwordEntry);
|
||||
this._passwordBox.hide();
|
||||
@@ -128,7 +128,7 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
* gnome-shell.css sets the color to be transparent
|
||||
*/
|
||||
this._nullMessageLabel = new St.Label({ style_class: 'prompt-dialog-null-label',
|
||||
text: 'abc'});
|
||||
text: 'abc' });
|
||||
this._nullMessageLabel.add_style_class_name('hidden');
|
||||
this._nullMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
|
||||
this._nullMessageLabel.clutter_text.line_wrap = true;
|
||||
@@ -138,7 +138,7 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
this._cancelButton = this.addButton({ label: _("Cancel"),
|
||||
action: this.cancel.bind(this),
|
||||
key: Clutter.Escape });
|
||||
this._okButton = this.addButton({ label: _("Authenticate"),
|
||||
this._okButton = this.addButton({ label: _("Authenticate"),
|
||||
action: this._onAuthenticateButtonPressed.bind(this),
|
||||
default: true });
|
||||
|
||||
@@ -181,9 +181,9 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
//
|
||||
// We could add retrying if this turns out to be a problem
|
||||
|
||||
log('polkitAuthenticationAgent: Failed to show modal dialog.' +
|
||||
' Dismissing authentication request for action-id ' + this.actionId +
|
||||
' cookie ' + this._cookie);
|
||||
log('polkitAuthenticationAgent: Failed to show modal dialog. ' +
|
||||
`Dismissing authentication request for action-id ${this.actionId} ` +
|
||||
`cookie ${this._cookie}`);
|
||||
this._emitDone(true);
|
||||
}
|
||||
}
|
||||
@@ -251,14 +251,14 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
}
|
||||
}
|
||||
|
||||
_onSessionRequest(session, request, echo_on) {
|
||||
_onSessionRequest(session, request, echoOn) {
|
||||
// Cheap localization trick
|
||||
if (request == 'Password:' || request == 'Password: ')
|
||||
this._passwordLabel.set_text(_("Password:"));
|
||||
else
|
||||
this._passwordLabel.set_text(request);
|
||||
|
||||
if (echo_on)
|
||||
if (echoOn)
|
||||
this._passwordEntry.clutter_text.set_password_char('');
|
||||
else
|
||||
this._passwordEntry.clutter_text.set_password_char('\u25cf'); // ● U+25CF BLACK CIRCLE
|
||||
@@ -305,7 +305,7 @@ var AuthenticationDialog = GObject.registerClass({
|
||||
_onUserChanged() {
|
||||
if (this._user.is_loaded && this._userAvatar) {
|
||||
this._userAvatar.update();
|
||||
this._userAvatar.actor.show();
|
||||
this._userAvatar.show();
|
||||
}
|
||||
}
|
||||
|
||||
@@ -343,7 +343,7 @@ var AuthenticationAgent = class {
|
||||
enable() {
|
||||
try {
|
||||
this._native.register();
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
log('Failed to register AuthenticationAgent');
|
||||
}
|
||||
}
|
||||
@@ -351,7 +351,7 @@ var AuthenticationAgent = class {
|
||||
disable() {
|
||||
try {
|
||||
this._native.unregister();
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
log('Failed to unregister AuthenticationAgent');
|
||||
}
|
||||
}
|
||||
@@ -384,11 +384,11 @@ var AuthenticationAgent = class {
|
||||
this._currentDialog.performAuthentication();
|
||||
}
|
||||
|
||||
_onCancel(nativeAgent) {
|
||||
_onCancel(_nativeAgent) {
|
||||
this._completeRequest(false);
|
||||
}
|
||||
|
||||
_onDialogDone(dialog, dismissed) {
|
||||
_onDialogDone(_dialog, dismissed) {
|
||||
this._completeRequest(dismissed);
|
||||
}
|
||||
|
||||
|
||||
@@ -1,14 +1,14 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Component */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, St } = imports.gi;
|
||||
const Lang = imports.lang;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
var Tpl = null;
|
||||
var Tp = null;
|
||||
try {
|
||||
({ TelepathyGLib: Tp, TelepathyLogger: Tpl } = imports.gi);
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
log('Telepathy is not available, chat integration will be disabled.');
|
||||
}
|
||||
|
||||
@@ -40,10 +40,8 @@ var NotificationDirection = {
|
||||
RECEIVED: 'chat-received'
|
||||
};
|
||||
|
||||
var N_ = s => s;
|
||||
|
||||
function makeMessageFromTpMessage(tpMessage, direction) {
|
||||
let [text, flags] = tpMessage.to_text();
|
||||
let [text, flags_] = tpMessage.to_text();
|
||||
|
||||
let timestamp = tpMessage.get_sent_timestamp();
|
||||
if (timestamp == 0)
|
||||
@@ -89,7 +87,7 @@ var TelepathyComponent = class {
|
||||
try {
|
||||
this._client.register();
|
||||
} catch (e) {
|
||||
throw new Error('Couldn\'t register Telepathy client. Error: \n' + e);
|
||||
throw new Error(`Could not register Telepathy client. Error: ${e}`);
|
||||
}
|
||||
|
||||
if (!this._client.account_manager.is_prepared(Tp.AccountManager.get_feature_quark_core()))
|
||||
@@ -149,20 +147,20 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
this._delegatedChannelsCb.bind(this));
|
||||
}
|
||||
|
||||
vfunc_observe_channels(account, conn, channels,
|
||||
dispatchOp, requests, context) {
|
||||
vfunc_observe_channels(...args) {
|
||||
let [account, conn, channels, dispatchOp_, requests_, context] = args;
|
||||
let len = channels.length;
|
||||
for (let i = 0; i < len; i++) {
|
||||
let channel = channels[i];
|
||||
let [targetHandle, targetHandleType] = channel.get_handle();
|
||||
let [targetHandle_, targetHandleType] = channel.get_handle();
|
||||
|
||||
if (channel.get_invalidated())
|
||||
continue;
|
||||
continue;
|
||||
|
||||
/* Only observe contact text channels */
|
||||
if ((!(channel instanceof Tp.TextChannel)) ||
|
||||
targetHandleType != Tp.HandleType.CONTACT)
|
||||
continue;
|
||||
continue;
|
||||
|
||||
this._createChatSource(account, conn, channel, channel.get_target_contact());
|
||||
}
|
||||
@@ -182,8 +180,8 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
});
|
||||
}
|
||||
|
||||
vfunc_handle_channels(account, conn, channels, requests,
|
||||
user_action_time, context) {
|
||||
vfunc_handle_channels(...args) {
|
||||
let [account, conn, channels, requests_, userActionTime_, context] = args;
|
||||
this._handlingChannels(account, conn, channels, true);
|
||||
context.accept();
|
||||
}
|
||||
@@ -200,7 +198,7 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
}
|
||||
|
||||
if (channel.get_invalidated())
|
||||
continue;
|
||||
continue;
|
||||
|
||||
// 'notify' will be true when coming from an actual HandleChannels
|
||||
// call, and not when from a successful Claim call. The point is
|
||||
@@ -217,13 +215,13 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
// We are already handling the channel, display the source
|
||||
let source = this._chatSources[channel.get_object_path()];
|
||||
if (source)
|
||||
source.notify();
|
||||
source.showNotification();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
vfunc_add_dispatch_operation(account, conn, channels,
|
||||
dispatchOp, context) {
|
||||
vfunc_add_dispatch_operation(...args) {
|
||||
let [account, conn, channels, dispatchOp, context] = args;
|
||||
let channel = channels[0];
|
||||
let chanType = channel.get_channel_type();
|
||||
|
||||
@@ -241,7 +239,7 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
}
|
||||
|
||||
_approveTextChannel(account, conn, channel, dispatchOp, context) {
|
||||
let [targetHandle, targetHandleType] = channel.get_handle();
|
||||
let [targetHandle_, targetHandleType] = channel.get_handle();
|
||||
|
||||
if (targetHandleType != Tp.HandleType.CONTACT) {
|
||||
context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
|
||||
@@ -255,22 +253,23 @@ class TelepathyClient extends Tp.BaseClient {
|
||||
dispatchOp.claim_with_finish(result);
|
||||
this._handlingChannels(account, conn, [channel], false);
|
||||
} catch (err) {
|
||||
log('Failed to Claim channel: ' + err);
|
||||
log(`Failed to Claim channel: ${err}`);
|
||||
}
|
||||
});
|
||||
|
||||
context.accept();
|
||||
}
|
||||
|
||||
_delegatedChannelsCb(client, channels) {
|
||||
_delegatedChannelsCb(_client, _channels) {
|
||||
// Nothing to do as we don't make a distinction between observed and
|
||||
// handled channels.
|
||||
}
|
||||
}) : null;
|
||||
|
||||
var ChatSource = class extends MessageTray.Source {
|
||||
constructor(account, conn, channel, contact, client) {
|
||||
super(contact.get_alias());
|
||||
var ChatSource = HAVE_TP ? GObject.registerClass(
|
||||
class ChatSource extends MessageTray.Source {
|
||||
_init(account, conn, channel, contact, client) {
|
||||
super._init(contact.get_alias());
|
||||
|
||||
this._account = account;
|
||||
this._contact = contact;
|
||||
@@ -328,7 +327,7 @@ var ChatSource = class extends MessageTray.Source {
|
||||
|
||||
// We ack messages when the user expands the new notification
|
||||
let id = this._banner.connect('expanded', this._ackMessages.bind(this));
|
||||
this._banner.actor.connect('destroy', () => {
|
||||
this._banner.connect('destroy', () => {
|
||||
this._banner.disconnect(id);
|
||||
this._banner = null;
|
||||
});
|
||||
@@ -362,28 +361,28 @@ var ChatSource = class extends MessageTray.Source {
|
||||
let presenceType = this._contact.get_presence_type();
|
||||
|
||||
switch (presenceType) {
|
||||
case Tp.ConnectionPresenceType.AVAILABLE:
|
||||
iconName = 'user-available';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.BUSY:
|
||||
iconName = 'user-busy';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.OFFLINE:
|
||||
iconName = 'user-offline';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.HIDDEN:
|
||||
iconName = 'user-invisible';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.AWAY:
|
||||
iconName = 'user-away';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.EXTENDED_AWAY:
|
||||
iconName = 'user-idle';
|
||||
break;
|
||||
default:
|
||||
iconName = 'user-offline';
|
||||
}
|
||||
return new Gio.ThemedIcon({ name: iconName });
|
||||
case Tp.ConnectionPresenceType.AVAILABLE:
|
||||
iconName = 'user-available';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.BUSY:
|
||||
iconName = 'user-busy';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.OFFLINE:
|
||||
iconName = 'user-offline';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.HIDDEN:
|
||||
iconName = 'user-invisible';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.AWAY:
|
||||
iconName = 'user-away';
|
||||
break;
|
||||
case Tp.ConnectionPresenceType.EXTENDED_AWAY:
|
||||
iconName = 'user-idle';
|
||||
break;
|
||||
default:
|
||||
iconName = 'user-offline';
|
||||
}
|
||||
return new Gio.ThemedIcon({ name: iconName });
|
||||
}
|
||||
|
||||
_updateAvatarIcon() {
|
||||
@@ -429,7 +428,7 @@ var ChatSource = class extends MessageTray.Source {
|
||||
}
|
||||
|
||||
_displayPendingMessages(logManager, result) {
|
||||
let [success, events] = logManager.get_filtered_events_finish(result);
|
||||
let [success_, events] = logManager.get_filtered_events_finish(result);
|
||||
|
||||
let logMessages = events.map(makeMessageFromTplEvent);
|
||||
this._ensureNotification();
|
||||
@@ -478,7 +477,7 @@ var ChatSource = class extends MessageTray.Source {
|
||||
this._notification.appendMessage(pendingMessages[i], true);
|
||||
|
||||
if (pendingMessages.length > 0)
|
||||
this.notify();
|
||||
this.showNotification();
|
||||
}
|
||||
|
||||
destroy(reason) {
|
||||
@@ -547,15 +546,15 @@ var ChatSource = class extends MessageTray.Source {
|
||||
// Wait a bit before notifying for the received message, a handler
|
||||
// could ack it in the meantime.
|
||||
if (this._notifyTimeoutId != 0)
|
||||
Mainloop.source_remove(this._notifyTimeoutId);
|
||||
this._notifyTimeoutId = Mainloop.timeout_add(500,
|
||||
GLib.source_remove(this._notifyTimeoutId);
|
||||
this._notifyTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500,
|
||||
this._notifyTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notifyTimeoutId, '[gnome-shell] this._notifyTimeout');
|
||||
}
|
||||
|
||||
_notifyTimeout() {
|
||||
if (this._pendingMessages.length != 0)
|
||||
this.notify();
|
||||
this.showNotification();
|
||||
|
||||
this._notifyTimeoutId = 0;
|
||||
|
||||
@@ -564,14 +563,14 @@ var ChatSource = class extends MessageTray.Source {
|
||||
|
||||
// This is called for both messages we send from
|
||||
// our client and other clients as well.
|
||||
_messageSent(channel, message, flags, token) {
|
||||
_messageSent(channel, message, _flags, _token) {
|
||||
this._ensureNotification();
|
||||
message = makeMessageFromTpMessage(message, NotificationDirection.SENT);
|
||||
this._notification.appendMessage(message);
|
||||
}
|
||||
|
||||
notify() {
|
||||
super.notify(this._notification);
|
||||
showNotification() {
|
||||
super.showNotification(this._notification);
|
||||
}
|
||||
|
||||
respond(text) {
|
||||
@@ -585,7 +584,7 @@ var ChatSource = class extends MessageTray.Source {
|
||||
|
||||
let msg = Tp.ClientMessage.new_text(type, text);
|
||||
this._channel.send_message_async(msg, 0, (src, result) => {
|
||||
this._channel.send_message_finish(result);
|
||||
this._channel.send_message_finish(result);
|
||||
});
|
||||
}
|
||||
|
||||
@@ -597,12 +596,12 @@ var ChatSource = class extends MessageTray.Source {
|
||||
// keep track of it with the ChatStateChanged signal but it is good
|
||||
// enough right now.
|
||||
if (state != this._chatState) {
|
||||
this._chatState = state;
|
||||
this._channel.set_chat_state_async(state, null);
|
||||
this._chatState = state;
|
||||
this._channel.set_chat_state_async(state, null);
|
||||
}
|
||||
}
|
||||
|
||||
_presenceChanged(contact, presence, status, message) {
|
||||
_presenceChanged(_contact, _presence, _status, _message) {
|
||||
if (this._notification)
|
||||
this._notification.update(this._notification.title,
|
||||
this._notification.bannerBodyText,
|
||||
@@ -627,12 +626,18 @@ var ChatSource = class extends MessageTray.Source {
|
||||
// 'pending-message-removed' for each one.
|
||||
this._channel.ack_all_pending_messages_async(null);
|
||||
}
|
||||
};
|
||||
}) : null;
|
||||
|
||||
var ChatNotification = class extends MessageTray.Notification {
|
||||
constructor(source) {
|
||||
super(source, source.title, null,
|
||||
{ secondaryGIcon: source.getSecondaryIcon() });
|
||||
var ChatNotification = HAVE_TP ? GObject.registerClass({
|
||||
Signals: {
|
||||
'message-removed': { param_types: [Tp.Message.$gtype] },
|
||||
'message-added': { param_types: [Tp.Message.$gtype] },
|
||||
'timestamp-changed': { param_types: [Tp.Message.$gtype] },
|
||||
}
|
||||
}, class ChatNotification extends MessageTray.Notification {
|
||||
_init(source) {
|
||||
super._init(source, source.title, null,
|
||||
{ secondaryGIcon: source.getSecondaryIcon() });
|
||||
this.setUrgency(MessageTray.Urgency.HIGH);
|
||||
this.setResident(true);
|
||||
|
||||
@@ -642,7 +647,7 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
|
||||
destroy(reason) {
|
||||
if (this._timestampTimeoutId)
|
||||
Mainloop.source_remove(this._timestampTimeoutId);
|
||||
GLib.source_remove(this._timestampTimeoutId);
|
||||
this._timestampTimeoutId = 0;
|
||||
super.destroy(reason);
|
||||
}
|
||||
@@ -655,7 +660,7 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
* sender: the name of the sender,
|
||||
* timestamp: the time the message was sent
|
||||
* direction: a #NotificationDirection
|
||||
*
|
||||
*
|
||||
* @noTimestamp: Whether to add a timestamp. If %true, no timestamp
|
||||
* will be added, regardless of the difference since the
|
||||
* last timestamp
|
||||
@@ -675,8 +680,8 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
{ datetime: GLib.DateTime.new_from_unix_local (message.timestamp),
|
||||
bannerMarkup: true });
|
||||
|
||||
let group = (message.direction == NotificationDirection.RECEIVED ?
|
||||
'received' : 'sent');
|
||||
let group = (message.direction == NotificationDirection.RECEIVED
|
||||
? 'received' : 'sent');
|
||||
|
||||
this._append({ body: messageBody,
|
||||
group: group,
|
||||
@@ -698,8 +703,8 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
// SCROLLBACK_RECENT_LENGTH previous messages. Otherwise
|
||||
// we'll keep SCROLLBACK_IDLE_LENGTH messages.
|
||||
|
||||
let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME) ?
|
||||
SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
|
||||
let maxLength = (lastMessageTime < currentTime - SCROLLBACK_RECENT_TIME)
|
||||
? SCROLLBACK_IDLE_LENGTH : SCROLLBACK_RECENT_LENGTH;
|
||||
|
||||
let filteredHistory = this.messages.filter(item => item.realMessage);
|
||||
if (filteredHistory.length > maxLength) {
|
||||
@@ -730,7 +735,7 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
|
||||
// Reset the old message timeout
|
||||
if (this._timestampTimeoutId)
|
||||
Mainloop.source_remove(this._timestampTimeoutId);
|
||||
GLib.source_remove(this._timestampTimeoutId);
|
||||
this._timestampTimeoutId = 0;
|
||||
|
||||
let message = { realMessage: props.group != 'meta',
|
||||
@@ -748,7 +753,8 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
} else {
|
||||
// Schedule a new timestamp in SCROLLBACK_IMMEDIATE_TIME
|
||||
// from the timestamp of the message.
|
||||
this._timestampTimeoutId = Mainloop.timeout_add_seconds(
|
||||
this._timestampTimeoutId = GLib.timeout_add_seconds(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
SCROLLBACK_IMMEDIATE_TIME - (currentTime - timestamp),
|
||||
this.appendTimestamp.bind(this));
|
||||
GLib.Source.set_name_by_id(this._timestampTimeoutId, '[gnome-shell] this.appendTimestamp');
|
||||
@@ -783,7 +789,7 @@ var ChatNotification = class extends MessageTray.Notification {
|
||||
|
||||
this._filterMessages();
|
||||
}
|
||||
};
|
||||
}) : null;
|
||||
|
||||
var ChatLineBox = GObject.registerClass(
|
||||
class ChatLineBox extends St.BoxLayout {
|
||||
@@ -793,9 +799,10 @@ class ChatLineBox extends St.BoxLayout {
|
||||
}
|
||||
});
|
||||
|
||||
var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
|
||||
constructor(notification) {
|
||||
super(notification);
|
||||
var ChatNotificationBanner = GObject.registerClass(
|
||||
class ChatNotificationBanner extends MessageTray.NotificationBanner {
|
||||
_init(notification) {
|
||||
super._init(notification);
|
||||
|
||||
this._responseEntry = new St.Entry({ style_class: 'chat-response',
|
||||
x_expand: true,
|
||||
@@ -880,8 +887,7 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
|
||||
}
|
||||
|
||||
_addMessage(message) {
|
||||
let highlighter = new MessageList.URLHighlighter(message.body, true, true);
|
||||
let body = highlighter.actor;
|
||||
let body = new MessageList.URLHighlighter(message.body, true, true);
|
||||
|
||||
let styles = message.styles;
|
||||
for (let i = 0; i < styles.length; i++)
|
||||
@@ -953,14 +959,15 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
|
||||
|
||||
// Remove composing timeout.
|
||||
if (this._composingTimeoutId > 0) {
|
||||
Mainloop.source_remove(this._composingTimeoutId);
|
||||
GLib.source_remove(this._composingTimeoutId);
|
||||
this._composingTimeoutId = 0;
|
||||
}
|
||||
|
||||
if (text != '') {
|
||||
this.notification.source.setChatState(Tp.ChannelChatState.COMPOSING);
|
||||
|
||||
this._composingTimeoutId = Mainloop.timeout_add_seconds(
|
||||
this._composingTimeoutId = GLib.timeout_add_seconds(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
COMPOSING_STOP_TIMEOUT,
|
||||
this._composingStopTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._composingTimeoutId, '[gnome-shell] this._composingStopTimeout');
|
||||
@@ -968,6 +975,6 @@ var ChatNotificationBanner = class extends MessageTray.NotificationBanner {
|
||||
this.notification.source.setChatState(Tp.ChannelChatState.ACTIVE);
|
||||
}
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var Component = TelepathyComponent;
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported CtrlAltTabManager */
|
||||
|
||||
const { Clutter, GObject, Meta, Shell, St } = imports.gi;
|
||||
|
||||
@@ -7,7 +8,6 @@ const SwitcherPopup = imports.ui.switcherPopup;
|
||||
const Params = imports.misc.params;
|
||||
|
||||
var POPUP_APPICON_SIZE = 96;
|
||||
var POPUP_FADE_TIME = 0.1; // seconds
|
||||
|
||||
var SortGroup = {
|
||||
TOP: 0,
|
||||
@@ -33,7 +33,7 @@ var CtrlAltTabManager = class CtrlAltTabManager {
|
||||
item.iconName = icon;
|
||||
|
||||
this._items.push(item);
|
||||
root.connect('destroy', () => { this.removeGroup(root); });
|
||||
root.connect('destroy', () => this.removeGroup(root));
|
||||
if (root instanceof St.Widget)
|
||||
global.focus_manager.add_group(root);
|
||||
}
|
||||
@@ -64,9 +64,8 @@ var CtrlAltTabManager = class CtrlAltTabManager {
|
||||
if (a.sortGroup != b.sortGroup)
|
||||
return a.sortGroup - b.sortGroup;
|
||||
|
||||
let ax, bx, y;
|
||||
[ax, y] = a.proxy.get_transformed_position();
|
||||
[bx, y] = b.proxy.get_transformed_position();
|
||||
let [ax] = a.proxy.get_transformed_position();
|
||||
let [bx] = b.proxy.get_transformed_position();
|
||||
|
||||
return ax - bx;
|
||||
}
|
||||
|
||||
231
js/ui/dash.js
231
js/ui/dash.js
@@ -1,19 +1,18 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Dash */
|
||||
|
||||
const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
const { Clutter, GLib, GObject,
|
||||
Graphene, Meta, Shell, St } = imports.gi;
|
||||
|
||||
const AppDisplay = imports.ui.appDisplay;
|
||||
const AppFavorites = imports.ui.appFavorites;
|
||||
const DND = imports.ui.dnd;
|
||||
const IconGrid = imports.ui.iconGrid;
|
||||
const Main = imports.ui.main;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var DASH_ANIMATION_TIME = 0.2;
|
||||
var DASH_ITEM_LABEL_SHOW_TIME = 0.15;
|
||||
var DASH_ITEM_LABEL_HIDE_TIME = 0.1;
|
||||
var DASH_ANIMATION_TIME = 200;
|
||||
var DASH_ITEM_LABEL_SHOW_TIME = 150;
|
||||
var DASH_ITEM_LABEL_HIDE_TIME = 100;
|
||||
var DASH_ITEM_HOVER_TIMEOUT = 300;
|
||||
|
||||
function getAppFromSource(source) {
|
||||
@@ -24,27 +23,56 @@ function getAppFromSource(source) {
|
||||
}
|
||||
}
|
||||
|
||||
var DashIcon = GObject.registerClass(
|
||||
class DashIcon extends AppDisplay.AppIcon {
|
||||
_init(app) {
|
||||
super._init(app, {
|
||||
setSizeManually: true,
|
||||
showLabel: false
|
||||
});
|
||||
}
|
||||
|
||||
// Disable all DnD methods
|
||||
_onDragBegin() {
|
||||
}
|
||||
|
||||
_onDragEnd() {
|
||||
}
|
||||
|
||||
handleDragOver() {
|
||||
return DND.DragMotionResult.CONTINUE;
|
||||
}
|
||||
|
||||
acceptDrop() {
|
||||
return false;
|
||||
}
|
||||
});
|
||||
|
||||
// A container like StBin, but taking the child's scale into account
|
||||
// when requesting a size
|
||||
var DashItemContainer = GObject.registerClass(
|
||||
class DashItemContainer extends St.Widget {
|
||||
_init() {
|
||||
super._init({ style_class: 'dash-item-container',
|
||||
pivot_point: new Clutter.Point({ x: .5, y: .5 }),
|
||||
pivot_point: new Graphene.Point({ x: .5, y: .5 }),
|
||||
scale_x: 0,
|
||||
scale_y: 0,
|
||||
opacity: 0,
|
||||
x_expand: true,
|
||||
x_align: Clutter.ActorAlign.CENTER });
|
||||
|
||||
this._labelText = "";
|
||||
this.label = new St.Label({ style_class: 'dash-label'});
|
||||
this.label = new St.Label({ style_class: 'dash-label' });
|
||||
this.label.hide();
|
||||
Main.layoutManager.addChrome(this.label);
|
||||
this.label_actor = this.label;
|
||||
|
||||
this.child = null;
|
||||
this._childScale = 0;
|
||||
this._childOpacity = 0;
|
||||
this.animatingOut = false;
|
||||
|
||||
this.connect('notify::scale-x', () => this.queue_relayout());
|
||||
this.connect('notify::scale-y', () => this.queue_relayout());
|
||||
|
||||
this.connect('destroy', () => {
|
||||
if (this.child != null)
|
||||
this.child.destroy();
|
||||
@@ -81,7 +109,7 @@ class DashItemContainer extends St.Widget {
|
||||
let itemHeight = this.allocation.y2 - this.allocation.y1;
|
||||
|
||||
let labelHeight = this.label.get_height();
|
||||
let yOffset = Math.floor((itemHeight - labelHeight) / 2)
|
||||
let yOffset = Math.floor((itemHeight - labelHeight) / 2);
|
||||
|
||||
let y = stageY + yOffset;
|
||||
|
||||
@@ -95,11 +123,11 @@ class DashItemContainer extends St.Widget {
|
||||
x = stageX + this.get_width() + xOffset;
|
||||
|
||||
this.label.set_position(x, y);
|
||||
Tweener.addTween(this.label,
|
||||
{ opacity: 255,
|
||||
time: DASH_ITEM_LABEL_SHOW_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
});
|
||||
this.label.ease({
|
||||
opacity: 255,
|
||||
duration: DASH_ITEM_LABEL_SHOW_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
|
||||
setLabelText(text) {
|
||||
@@ -108,14 +136,12 @@ class DashItemContainer extends St.Widget {
|
||||
}
|
||||
|
||||
hideLabel() {
|
||||
Tweener.addTween(this.label,
|
||||
{ opacity: 0,
|
||||
time: DASH_ITEM_LABEL_HIDE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.label.hide();
|
||||
}
|
||||
});
|
||||
this.label.ease({
|
||||
opacity: 0,
|
||||
duration: DASH_ITEM_LABEL_HIDE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this.label.hide()
|
||||
});
|
||||
}
|
||||
|
||||
setChild(actor) {
|
||||
@@ -126,9 +152,6 @@ class DashItemContainer extends St.Widget {
|
||||
|
||||
this.child = actor;
|
||||
this.add_actor(this.child);
|
||||
|
||||
this.set_scale(this._childScale, this._childScale);
|
||||
this.set_opacity(this._childOpacity);
|
||||
}
|
||||
|
||||
show(animate) {
|
||||
@@ -136,12 +159,13 @@ class DashItemContainer extends St.Widget {
|
||||
return;
|
||||
|
||||
let time = animate ? DASH_ANIMATION_TIME : 0;
|
||||
Tweener.addTween(this,
|
||||
{ childScale: 1.0,
|
||||
childOpacity: 255,
|
||||
time: time,
|
||||
transition: 'easeOutQuad'
|
||||
});
|
||||
this.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
opacity: 255,
|
||||
duration: time,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
|
||||
animateOutAndDestroy() {
|
||||
@@ -153,37 +177,14 @@ class DashItemContainer extends St.Widget {
|
||||
}
|
||||
|
||||
this.animatingOut = true;
|
||||
Tweener.addTween(this,
|
||||
{ childScale: 0.0,
|
||||
childOpacity: 0,
|
||||
time: DASH_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.destroy();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
set childScale(scale) {
|
||||
this._childScale = scale;
|
||||
|
||||
this.set_scale(scale, scale);
|
||||
this.queue_relayout();
|
||||
}
|
||||
|
||||
get childScale() {
|
||||
return this._childScale;
|
||||
}
|
||||
|
||||
set childOpacity(opacity) {
|
||||
this._childOpacity = opacity;
|
||||
|
||||
this.set_opacity(opacity);
|
||||
this.queue_redraw();
|
||||
}
|
||||
|
||||
get childOpacity() {
|
||||
return this._childOpacity;
|
||||
this.ease({
|
||||
scale_x: 0,
|
||||
scale_y: 0,
|
||||
opacity: 0,
|
||||
duration: DASH_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this.destroy()
|
||||
});
|
||||
}
|
||||
});
|
||||
|
||||
@@ -198,9 +199,9 @@ class ShowAppsIcon extends DashItemContainer {
|
||||
toggle_mode: true });
|
||||
this._iconActor = null;
|
||||
this.icon = new IconGrid.BaseIcon(_("Show Applications"),
|
||||
{ setSizeManually: true,
|
||||
showLabel: false,
|
||||
createIcon: this._createIcon.bind(this) });
|
||||
{ setSizeManually: true,
|
||||
showLabel: false,
|
||||
createIcon: this._createIcon.bind(this) });
|
||||
this.toggleButton.add_actor(this.icon);
|
||||
this.toggleButton._delegate = this;
|
||||
|
||||
@@ -241,14 +242,14 @@ class ShowAppsIcon extends DashItemContainer {
|
||||
this.setLabelText(_("Show Applications"));
|
||||
}
|
||||
|
||||
handleDragOver(source, actor, x, y, time) {
|
||||
handleDragOver(source, _actor, _x, _y, _time) {
|
||||
if (!this._canRemoveApp(getAppFromSource(source)))
|
||||
return DND.DragMotionResult.NO_DROP;
|
||||
|
||||
return DND.DragMotionResult.MOVE_DROP;
|
||||
}
|
||||
|
||||
acceptDrop(source, actor, x, y, time) {
|
||||
acceptDrop(source, _actor, _x, _y, _time) {
|
||||
let app = getAppFromSource(source);
|
||||
if (!this._canRemoveApp(app))
|
||||
return false;
|
||||
@@ -296,7 +297,7 @@ class DashActor extends St.Widget {
|
||||
this.set_allocation(box, flags);
|
||||
|
||||
let [appIcons, showAppsButton] = this.get_children();
|
||||
let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
|
||||
let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
|
||||
|
||||
let childBox = new Clutter.ActorBox();
|
||||
childBox.x1 = contentBox.x1;
|
||||
@@ -321,17 +322,19 @@ class DashActor extends St.Widget {
|
||||
let themeNode = this.get_theme_node();
|
||||
let adjustedForWidth = themeNode.adjust_for_width(forWidth);
|
||||
let [, showAppsButton] = this.get_children();
|
||||
let [minHeight, ] = showAppsButton.get_preferred_height(adjustedForWidth);
|
||||
[minHeight, ] = themeNode.adjust_preferred_height(minHeight, natHeight);
|
||||
let [minHeight] = showAppsButton.get_preferred_height(adjustedForWidth);
|
||||
[minHeight] = themeNode.adjust_preferred_height(minHeight, natHeight);
|
||||
|
||||
return [minHeight, natHeight];
|
||||
}
|
||||
});
|
||||
|
||||
const baseIconSizes = [ 16, 22, 24, 32, 48, 64 ];
|
||||
const baseIconSizes = [16, 22, 24, 32, 48, 64];
|
||||
|
||||
var Dash = class Dash {
|
||||
constructor() {
|
||||
var Dash = GObject.registerClass({
|
||||
Signals: { 'icon-size-changed': {} }
|
||||
}, class Dash extends St.Bin {
|
||||
_init() {
|
||||
this._maxHeight = -1;
|
||||
this.iconSize = 64;
|
||||
this._shownInitially = false;
|
||||
@@ -351,8 +354,7 @@ var Dash = class Dash {
|
||||
this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);
|
||||
|
||||
this._showAppsIcon = new ShowAppsIcon();
|
||||
this._showAppsIcon.childScale = 1;
|
||||
this._showAppsIcon.childOpacity = 255;
|
||||
this._showAppsIcon.show(false);
|
||||
this._showAppsIcon.icon.setIconSize(this.iconSize);
|
||||
this._hookUpLabel(this._showAppsIcon);
|
||||
|
||||
@@ -360,11 +362,11 @@ var Dash = class Dash {
|
||||
|
||||
this._container.add_actor(this._showAppsIcon);
|
||||
|
||||
this.actor = new St.Bin({ child: this._container });
|
||||
this.actor.connect('notify::height', () => {
|
||||
if (this._maxHeight != this.actor.height)
|
||||
super._init({ child: this._container });
|
||||
this.connect('notify::height', () => {
|
||||
if (this._maxHeight != this.height)
|
||||
this._queueRedisplay();
|
||||
this._maxHeight = this.actor.height;
|
||||
this._maxHeight = this.height;
|
||||
});
|
||||
|
||||
this._workId = Main.initializeDeferredWork(this._box, this._redisplay.bind(this));
|
||||
@@ -387,7 +389,7 @@ var Dash = class Dash {
|
||||
|
||||
// Translators: this is the name of the dock/favorites area on
|
||||
// the left of the overview
|
||||
Main.ctrlAltTabManager.addGroup(this.actor, _("Dash"), 'user-bookmarks-symbolic');
|
||||
Main.ctrlAltTabManager.addGroup(this, _("Dash"), 'user-bookmarks-symbolic');
|
||||
}
|
||||
|
||||
_onDragBegin() {
|
||||
@@ -474,19 +476,7 @@ var Dash = class Dash {
|
||||
}
|
||||
|
||||
_createAppItem(app) {
|
||||
let appIcon = new AppDisplay.AppIcon(app,
|
||||
{ setSizeManually: true,
|
||||
showLabel: false });
|
||||
if (appIcon._draggable) {
|
||||
appIcon._draggable.connect('drag-begin',
|
||||
() => {
|
||||
appIcon.actor.opacity = 50;
|
||||
});
|
||||
appIcon._draggable.connect('drag-end',
|
||||
() => {
|
||||
appIcon.actor.opacity = 255;
|
||||
});
|
||||
}
|
||||
let appIcon = new DashIcon(app);
|
||||
|
||||
appIcon.connect('menu-state-changed',
|
||||
(appIcon, opened) => {
|
||||
@@ -494,11 +484,11 @@ var Dash = class Dash {
|
||||
});
|
||||
|
||||
let item = new DashItemContainer();
|
||||
item.setChild(appIcon.actor);
|
||||
item.setChild(appIcon);
|
||||
|
||||
// Override default AppIcon label_actor, now the
|
||||
// accessible_name is set at DashItemContainer.setLabelText
|
||||
appIcon.actor.label_actor = null;
|
||||
appIcon.label_actor = null;
|
||||
item.setLabelText(app.get_name());
|
||||
|
||||
appIcon.icon.setIconSize(this.iconSize);
|
||||
@@ -512,7 +502,7 @@ var Dash = class Dash {
|
||||
// that the notify::hover handler does everything we need to.
|
||||
if (opened) {
|
||||
if (this._showLabelTimeoutId > 0) {
|
||||
Mainloop.source_remove(this._showLabelTimeoutId);
|
||||
GLib.source_remove(this._showLabelTimeoutId);
|
||||
this._showLabelTimeoutId = 0;
|
||||
}
|
||||
|
||||
@@ -526,7 +516,7 @@ var Dash = class Dash {
|
||||
if (shouldShow) {
|
||||
if (this._showLabelTimeoutId == 0) {
|
||||
let timeout = this._labelShowing ? 0 : DASH_ITEM_HOVER_TIMEOUT;
|
||||
this._showLabelTimeoutId = Mainloop.timeout_add(timeout,
|
||||
this._showLabelTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
|
||||
() => {
|
||||
this._labelShowing = true;
|
||||
item.showLabel();
|
||||
@@ -535,17 +525,17 @@ var Dash = class Dash {
|
||||
});
|
||||
GLib.Source.set_name_by_id(this._showLabelTimeoutId, '[gnome-shell] item.showLabel');
|
||||
if (this._resetHoverTimeoutId > 0) {
|
||||
Mainloop.source_remove(this._resetHoverTimeoutId);
|
||||
GLib.source_remove(this._resetHoverTimeoutId);
|
||||
this._resetHoverTimeoutId = 0;
|
||||
}
|
||||
}
|
||||
} else {
|
||||
if (this._showLabelTimeoutId > 0)
|
||||
Mainloop.source_remove(this._showLabelTimeoutId);
|
||||
GLib.source_remove(this._showLabelTimeoutId);
|
||||
this._showLabelTimeoutId = 0;
|
||||
item.hideLabel();
|
||||
if (this._labelShowing) {
|
||||
this._resetHoverTimeoutId = Mainloop.timeout_add(DASH_ITEM_HOVER_TIMEOUT,
|
||||
this._resetHoverTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, DASH_ITEM_HOVER_TIMEOUT,
|
||||
() => {
|
||||
this._labelShowing = false;
|
||||
this._resetHoverTimeoutId = 0;
|
||||
@@ -633,12 +623,12 @@ var Dash = class Dash {
|
||||
icon.icon.set_size(icon.icon.width * scale,
|
||||
icon.icon.height * scale);
|
||||
|
||||
Tweener.addTween(icon.icon,
|
||||
{ width: targetWidth,
|
||||
height: targetHeight,
|
||||
time: DASH_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
});
|
||||
icon.icon.ease({
|
||||
width: targetWidth,
|
||||
height: targetHeight,
|
||||
duration: DASH_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -648,10 +638,10 @@ var Dash = class Dash {
|
||||
let running = this._appSystem.get_running();
|
||||
|
||||
let children = this._box.get_children().filter(actor => {
|
||||
return actor.child &&
|
||||
actor.child._delegate &&
|
||||
actor.child._delegate.app;
|
||||
});
|
||||
return actor.child &&
|
||||
actor.child._delegate &&
|
||||
actor.child._delegate.app;
|
||||
});
|
||||
// Apps currently in the dash
|
||||
let oldApps = children.map(actor => actor.child._delegate.app);
|
||||
// Apps supposed to be in the dash
|
||||
@@ -700,14 +690,14 @@ var Dash = class Dash {
|
||||
}
|
||||
|
||||
// App removed at oldIndex
|
||||
if (oldApp && newApps.indexOf(oldApp) == -1) {
|
||||
if (oldApp && !newApps.includes(oldApp)) {
|
||||
removedActors.push(children[oldIndex]);
|
||||
oldIndex++;
|
||||
continue;
|
||||
}
|
||||
|
||||
// App added at newIndex
|
||||
if (newApp && oldApps.indexOf(newApp) == -1) {
|
||||
if (newApp && !oldApps.includes(newApp)) {
|
||||
addedItems.push({ app: newApp,
|
||||
item: this._createAppItem(newApp),
|
||||
pos: newIndex });
|
||||
@@ -716,8 +706,8 @@ var Dash = class Dash {
|
||||
}
|
||||
|
||||
// App moved
|
||||
let nextApp = newApps.length > newIndex + 1 ? newApps[newIndex + 1]
|
||||
: null;
|
||||
let nextApp = newApps.length > newIndex + 1
|
||||
? newApps[newIndex + 1] : null;
|
||||
let insertHere = nextApp && nextApp == oldApp;
|
||||
let alreadyRemoved = removedActors.reduce((result, actor) => {
|
||||
let removedApp = actor.child._delegate.app;
|
||||
@@ -790,7 +780,7 @@ var Dash = class Dash {
|
||||
}
|
||||
}
|
||||
|
||||
handleDragOver(source, actor, x, y, time) {
|
||||
handleDragOver(source, actor, x, y, _time) {
|
||||
let app = getAppFromSource(source);
|
||||
|
||||
// Don't allow favoriting of transient apps
|
||||
@@ -868,7 +858,7 @@ var Dash = class Dash {
|
||||
}
|
||||
|
||||
// Draggable target interface
|
||||
acceptDrop(source, actor, x, y, time) {
|
||||
acceptDrop(source, _actor, _x, _y, _time) {
|
||||
let app = getAppFromSource(source);
|
||||
|
||||
// Don't allow favoriting of transient apps
|
||||
@@ -915,5 +905,4 @@ var Dash = class Dash {
|
||||
|
||||
return true;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Dash.prototype);
|
||||
});
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported DateMenuButton */
|
||||
|
||||
const { Clutter, GLib, GnomeDesktop,
|
||||
const { Clutter, Gio, GLib, GnomeDesktop,
|
||||
GObject, GWeather, Shell, St } = imports.gi;
|
||||
|
||||
const Util = imports.misc.util;
|
||||
@@ -10,8 +11,13 @@ const Calendar = imports.ui.calendar;
|
||||
const Weather = imports.misc.weather;
|
||||
const System = imports.system;
|
||||
|
||||
const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
const MAX_FORECASTS = 5;
|
||||
|
||||
const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration');
|
||||
const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface);
|
||||
|
||||
function _isToday(date) {
|
||||
let now = new Date();
|
||||
return now.getYear() == date.getYear() &&
|
||||
@@ -19,22 +25,26 @@ function _isToday(date) {
|
||||
now.getDate() == date.getDate();
|
||||
}
|
||||
|
||||
var TodayButton = class TodayButton {
|
||||
constructor(calendar) {
|
||||
function _gDateTimeToDate(datetime) {
|
||||
return new Date(datetime.to_unix() * 1000 + datetime.get_microsecond() / 1000);
|
||||
}
|
||||
|
||||
var TodayButton = GObject.registerClass(
|
||||
class TodayButton extends St.Button {
|
||||
_init(calendar) {
|
||||
// Having the ability to go to the current date if the user is already
|
||||
// on the current date can be confusing. So don't make the button reactive
|
||||
// until the selected date changes.
|
||||
this.actor = new St.Button({ style_class: 'datemenu-today-button',
|
||||
x_expand: true, x_align: St.Align.START,
|
||||
can_focus: true,
|
||||
reactive: false
|
||||
});
|
||||
this.actor.connect('clicked', () => {
|
||||
this._calendar.setDate(new Date(), false);
|
||||
super._init({
|
||||
style_class: 'datemenu-today-button',
|
||||
x_align: St.Align.START,
|
||||
x_expand: true,
|
||||
can_focus: true,
|
||||
reactive: false
|
||||
});
|
||||
|
||||
let hbox = new St.BoxLayout({ vertical: true });
|
||||
this.actor.add_actor(hbox);
|
||||
this.add_actor(hbox);
|
||||
|
||||
this._dayLabel = new St.Label({ style_class: 'day-label',
|
||||
x_align: Clutter.ActorAlign.START });
|
||||
@@ -44,13 +54,17 @@ var TodayButton = class TodayButton {
|
||||
hbox.add_actor(this._dateLabel);
|
||||
|
||||
this._calendar = calendar;
|
||||
this._calendar.connect('selected-date-changed', (calendar, date) => {
|
||||
this._calendar.connect('selected-date-changed', (_calendar, datetime) => {
|
||||
// Make the button reactive only if the selected date is not the
|
||||
// current date.
|
||||
this.actor.reactive = !_isToday(date)
|
||||
this.reactive = !_isToday(_gDateTimeToDate(datetime));
|
||||
});
|
||||
}
|
||||
|
||||
vfunc_clicked() {
|
||||
this._calendar.setDate(new Date(), false);
|
||||
}
|
||||
|
||||
setDate(date) {
|
||||
this._dayLabel.set_text(date.toLocaleFormat('%A'));
|
||||
|
||||
@@ -67,57 +81,72 @@ var TodayButton = class TodayButton {
|
||||
* date, e.g. "Tuesday February 17 2015".
|
||||
*/
|
||||
dateFormat = Shell.util_translate_time_string (N_("%A %B %e %Y"));
|
||||
this.actor.accessible_name = date.toLocaleFormat(dateFormat);
|
||||
this.accessible_name = date.toLocaleFormat(dateFormat);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var WorldClocksSection = class WorldClocksSection {
|
||||
constructor() {
|
||||
var WorldClocksSection = GObject.registerClass(
|
||||
class WorldClocksSection extends St.Button {
|
||||
_init() {
|
||||
super._init({
|
||||
style_class: 'world-clocks-button',
|
||||
x_fill: true,
|
||||
can_focus: true
|
||||
});
|
||||
this._clock = new GnomeDesktop.WallClock();
|
||||
this._clockNotifyId = 0;
|
||||
|
||||
this._locations = [];
|
||||
|
||||
this.actor = new St.Button({ style_class: 'world-clocks-button',
|
||||
x_fill: true,
|
||||
can_focus: true });
|
||||
this.actor.connect('clicked', () => {
|
||||
this._clockAppMon.activateApp();
|
||||
|
||||
Main.overview.hide();
|
||||
Main.panel.closeCalendar();
|
||||
});
|
||||
|
||||
let layout = new Clutter.GridLayout({ orientation: Clutter.Orientation.VERTICAL });
|
||||
this._grid = new St.Widget({ style_class: 'world-clocks-grid',
|
||||
layout_manager: layout });
|
||||
layout.hookup_style(this._grid);
|
||||
|
||||
this.actor.child = this._grid;
|
||||
this.child = this._grid;
|
||||
|
||||
this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop',
|
||||
'org.gnome.clocks');
|
||||
this._clockAppMon.connect('available-changed',
|
||||
this._sync.bind(this));
|
||||
this._clockAppMon.watchSetting('world-clocks',
|
||||
this._clocksChanged.bind(this));
|
||||
this._clocksApp = null;
|
||||
this._clocksProxy = new ClocksProxy(
|
||||
Gio.DBus.session,
|
||||
'org.gnome.clocks',
|
||||
'/org/gnome/clocks',
|
||||
this._onProxyReady.bind(this),
|
||||
null /* cancellable */,
|
||||
Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
|
||||
|
||||
this._settings = new Gio.Settings({
|
||||
schema_id: 'org.gnome.shell.world-clocks'
|
||||
});
|
||||
this._settings.connect('changed', this._clocksChanged.bind(this));
|
||||
this._clocksChanged();
|
||||
|
||||
this._appSystem = Shell.AppSystem.get_default();
|
||||
this._appSystem.connect('installed-changed',
|
||||
this._sync.bind(this));
|
||||
this._sync();
|
||||
}
|
||||
|
||||
_sync() {
|
||||
this.actor.visible = this._clockAppMon.available;
|
||||
vfunc_clicked() {
|
||||
if (this._clocksApp)
|
||||
this._clocksApp.activate();
|
||||
|
||||
Main.overview.hide();
|
||||
Main.panel.closeCalendar();
|
||||
}
|
||||
|
||||
_clocksChanged(settings) {
|
||||
_sync() {
|
||||
this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop');
|
||||
this.visible = this._clocksApp != null;
|
||||
}
|
||||
|
||||
_clocksChanged() {
|
||||
this._grid.destroy_all_children();
|
||||
this._locations = [];
|
||||
|
||||
let world = GWeather.Location.get_world();
|
||||
let clocks = settings.get_value('world-clocks').deep_unpack();
|
||||
let clocks = this._settings.get_value('locations').deep_unpack();
|
||||
for (let i = 0; i < clocks.length; i++) {
|
||||
if (!clocks[i].location)
|
||||
continue;
|
||||
let l = world.deserialize(clocks[i].location);
|
||||
let l = world.deserialize(clocks[i]);
|
||||
if (l && l.get_timezone() != null)
|
||||
this._locations.push({ location: l });
|
||||
}
|
||||
@@ -128,13 +157,14 @@ var WorldClocksSection = class WorldClocksSection {
|
||||
});
|
||||
|
||||
let layout = this._grid.layout_manager;
|
||||
let title = (this._locations.length == 0) ? _("Add world clocks…")
|
||||
: _("World Clocks");
|
||||
let title = (this._locations.length == 0)
|
||||
? _("Add world clocks…")
|
||||
: _("World Clocks");
|
||||
let header = new St.Label({ style_class: 'world-clocks-header',
|
||||
x_align: Clutter.ActorAlign.START,
|
||||
text: title });
|
||||
layout.attach(header, 0, 0, 2, 1);
|
||||
this.actor.label_actor = header;
|
||||
this.label_actor = header;
|
||||
|
||||
let localOffset = GLib.DateTime.new_now_local().get_utc_offset();
|
||||
|
||||
@@ -196,30 +226,42 @@ var WorldClocksSection = class WorldClocksSection {
|
||||
l.actor.text = Util.formatTime(now, { timeOnly: true });
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
var WeatherSection = class WeatherSection {
|
||||
constructor() {
|
||||
_onProxyReady(proxy, error) {
|
||||
if (error) {
|
||||
log(`Failed to create GNOME Clocks proxy: ${error}`);
|
||||
return;
|
||||
}
|
||||
|
||||
this._clocksProxy.connect('g-properties-changed',
|
||||
this._onClocksPropertiesChanged.bind(this));
|
||||
this._onClocksPropertiesChanged();
|
||||
}
|
||||
|
||||
_onClocksPropertiesChanged() {
|
||||
if (this._clocksProxy.g_name_owner == null)
|
||||
return;
|
||||
|
||||
this._settings.set_value('locations',
|
||||
new GLib.Variant('av', this._clocksProxy.Locations));
|
||||
}
|
||||
});
|
||||
|
||||
var WeatherSection = GObject.registerClass(
|
||||
class WeatherSection extends St.Button {
|
||||
_init() {
|
||||
super._init({
|
||||
style_class: 'weather-button',
|
||||
x_fill: true,
|
||||
can_focus: true
|
||||
});
|
||||
|
||||
this._weatherClient = new Weather.WeatherClient();
|
||||
|
||||
this.actor = new St.Button({ style_class: 'weather-button',
|
||||
x_fill: true,
|
||||
can_focus: true });
|
||||
this.actor.connect('clicked', () => {
|
||||
this._weatherClient.activateApp();
|
||||
|
||||
Main.overview.hide();
|
||||
Main.panel.closeCalendar();
|
||||
});
|
||||
this.actor.connect('notify::mapped', () => {
|
||||
if (this.actor.mapped)
|
||||
this._weatherClient.update();
|
||||
});
|
||||
|
||||
let box = new St.BoxLayout({ style_class: 'weather-box',
|
||||
vertical: true });
|
||||
vertical: true });
|
||||
|
||||
this.actor.child = box;
|
||||
this.child = box;
|
||||
|
||||
let titleBox = new St.BoxLayout();
|
||||
titleBox.add_child(new St.Label({ style_class: 'weather-header',
|
||||
@@ -242,6 +284,18 @@ var WeatherSection = class WeatherSection {
|
||||
this._sync();
|
||||
}
|
||||
|
||||
vfunc_map() {
|
||||
this._weatherClient.update();
|
||||
super.vfunc_map();
|
||||
}
|
||||
|
||||
vfunc_clicked() {
|
||||
this._weatherClient.activateApp();
|
||||
|
||||
Main.overview.hide();
|
||||
Main.panel.closeCalendar();
|
||||
}
|
||||
|
||||
_getInfos() {
|
||||
let info = this._weatherClient.info;
|
||||
let forecasts = info.get_forecast_list();
|
||||
@@ -249,12 +303,12 @@ var WeatherSection = class WeatherSection {
|
||||
let current = info;
|
||||
let infos = [info];
|
||||
for (let i = 0; i < forecasts.length; i++) {
|
||||
let [ok, timestamp] = forecasts[i].get_value_update();
|
||||
let [ok_, timestamp] = forecasts[i].get_value_update();
|
||||
let datetime = new Date(timestamp * 1000);
|
||||
if (!_isToday(datetime))
|
||||
continue; // Ignore forecasts from other days
|
||||
|
||||
[ok, timestamp] = current.get_value_update();
|
||||
[ok_, timestamp] = current.get_value_update();
|
||||
let currenttime = new Date(timestamp * 1000);
|
||||
if (currenttime.getHours() == datetime.getHours())
|
||||
continue; // Enforce a minimum interval of 1h
|
||||
@@ -275,7 +329,7 @@ var WeatherSection = class WeatherSection {
|
||||
|
||||
let col = 0;
|
||||
infos.forEach(fc => {
|
||||
let [ok, timestamp] = fc.get_value_update();
|
||||
let [ok_, timestamp] = fc.get_value_update();
|
||||
let timeStr = Util.formatTime(new Date(timestamp * 1000), {
|
||||
timeOnly: true
|
||||
});
|
||||
@@ -332,23 +386,27 @@ var WeatherSection = class WeatherSection {
|
||||
}
|
||||
|
||||
_sync() {
|
||||
this.actor.visible = this._weatherClient.available;
|
||||
this.visible = this._weatherClient.available;
|
||||
|
||||
if (!this.actor.visible)
|
||||
if (!this.visible)
|
||||
return;
|
||||
|
||||
this._titleLocation.visible = this._weatherClient.hasLocation;
|
||||
|
||||
this._updateForecasts();
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var MessagesIndicator = class MessagesIndicator {
|
||||
constructor() {
|
||||
this.actor = new St.Icon({ icon_name: 'message-indicator-symbolic',
|
||||
icon_size: 16,
|
||||
visible: false, y_expand: true,
|
||||
y_align: Clutter.ActorAlign.CENTER });
|
||||
var MessagesIndicator = GObject.registerClass(
|
||||
class MessagesIndicator extends St.Icon {
|
||||
_init() {
|
||||
super._init({
|
||||
icon_name: 'message-indicator-symbolic',
|
||||
icon_size: 16,
|
||||
visible: false,
|
||||
y_expand: true,
|
||||
y_align: Clutter.ActorAlign.CENTER
|
||||
});
|
||||
|
||||
this._sources = [];
|
||||
|
||||
@@ -357,11 +415,11 @@ var MessagesIndicator = class MessagesIndicator {
|
||||
Main.messageTray.connect('queue-changed', this._updateCount.bind(this));
|
||||
|
||||
let sources = Main.messageTray.getSources();
|
||||
sources.forEach(source => { this._onSourceAdded(null, source); });
|
||||
sources.forEach(source => this._onSourceAdded(null, source));
|
||||
}
|
||||
|
||||
_onSourceAdded(tray, source) {
|
||||
source.connect('count-updated', this._updateCount.bind(this));
|
||||
source.connect('notify::count', this._updateCount.bind(this));
|
||||
this._sources.push(source);
|
||||
this._updateCount();
|
||||
}
|
||||
@@ -373,19 +431,19 @@ var MessagesIndicator = class MessagesIndicator {
|
||||
|
||||
_updateCount() {
|
||||
let count = 0;
|
||||
this._sources.forEach(source => { count += source.unseenCount; });
|
||||
this._sources.forEach(source => (count += source.unseenCount));
|
||||
count -= Main.messageTray.queueCount;
|
||||
|
||||
this.actor.visible = (count > 0);
|
||||
this.visible = (count > 0);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var IndicatorPad = GObject.registerClass(
|
||||
class IndicatorPad extends St.Widget {
|
||||
_init(actor) {
|
||||
this._source = actor;
|
||||
this._source.connect('notify::visible', () => { this.queue_relayout(); });
|
||||
this._source.connect('notify::size', () => { this.queue_relayout(); });
|
||||
this._source.connect('notify::visible', () => this.queue_relayout());
|
||||
this._source.connect('notify::size', () => this.queue_relayout());
|
||||
super._init();
|
||||
}
|
||||
|
||||
@@ -459,7 +517,6 @@ class CalendarColumnLayout extends Clutter.BoxLayout {
|
||||
var DateMenuButton = GObject.registerClass(
|
||||
class DateMenuButton extends PanelMenu.Button {
|
||||
_init() {
|
||||
let item;
|
||||
let hbox;
|
||||
let vbox;
|
||||
|
||||
@@ -472,9 +529,9 @@ class DateMenuButton extends PanelMenu.Button {
|
||||
this._indicator = new MessagesIndicator();
|
||||
|
||||
let box = new St.BoxLayout();
|
||||
box.add_actor(new IndicatorPad(this._indicator.actor));
|
||||
box.add_actor(new IndicatorPad(this._indicator));
|
||||
box.add_actor(this._clockDisplay);
|
||||
box.add_actor(this._indicator.actor);
|
||||
box.add_actor(this._indicator);
|
||||
|
||||
this.label_actor = this._clockDisplay;
|
||||
this.add_actor(box);
|
||||
@@ -490,11 +547,11 @@ class DateMenuButton extends PanelMenu.Button {
|
||||
bin.add_actor(hbox);
|
||||
|
||||
this._calendar = new Calendar.Calendar();
|
||||
this._calendar.connect('selected-date-changed',
|
||||
(calendar, date) => {
|
||||
layout.frozen = !_isToday(date);
|
||||
this._messageList.setDate(date);
|
||||
});
|
||||
this._calendar.connect('selected-date-changed', (_calendar, datetime) => {
|
||||
let date = _gDateTimeToDate(datetime);
|
||||
layout.frozen = !_isToday(date);
|
||||
this._messageList.setDate(date);
|
||||
});
|
||||
|
||||
this.menu.connect('open-state-changed', (menu, isOpen) => {
|
||||
// Whenever the menu is opened, select today
|
||||
@@ -508,19 +565,19 @@ class DateMenuButton extends PanelMenu.Button {
|
||||
|
||||
// Fill up the first column
|
||||
this._messageList = new Calendar.CalendarMessageList();
|
||||
hbox.add(this._messageList.actor, { expand: true, y_fill: false, y_align: St.Align.START });
|
||||
hbox.add(this._messageList, { expand: true, y_fill: false, y_align: St.Align.START });
|
||||
|
||||
// Fill up the second column
|
||||
let boxLayout = new CalendarColumnLayout(this._calendar.actor);
|
||||
let boxLayout = new CalendarColumnLayout(this._calendar);
|
||||
vbox = new St.Widget({ style_class: 'datemenu-calendar-column',
|
||||
layout_manager: boxLayout });
|
||||
boxLayout.hookup_style(vbox);
|
||||
hbox.add(vbox);
|
||||
|
||||
this._date = new TodayButton(this._calendar);
|
||||
vbox.add_actor(this._date.actor);
|
||||
vbox.add_actor(this._date);
|
||||
|
||||
vbox.add_actor(this._calendar.actor);
|
||||
vbox.add_actor(this._calendar);
|
||||
|
||||
this._displaysSection = new St.ScrollView({ style_class: 'datemenu-displays-section vfade',
|
||||
x_expand: true, x_fill: true,
|
||||
@@ -533,10 +590,10 @@ class DateMenuButton extends PanelMenu.Button {
|
||||
this._displaysSection.add_actor(displaysBox);
|
||||
|
||||
this._clocksItem = new WorldClocksSection();
|
||||
displaysBox.add(this._clocksItem.actor, { x_fill: true });
|
||||
displaysBox.add(this._clocksItem, { x_fill: true });
|
||||
|
||||
this._weatherItem = new WeatherSection();
|
||||
displaysBox.add(this._weatherItem.actor, { x_fill: true });
|
||||
displaysBox.add(this._weatherItem, { x_fill: true });
|
||||
|
||||
// Done with hbox for calendar and event list
|
||||
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Dialog, MessageDialogContent */
|
||||
|
||||
const { Clutter, Gio, GObject, Pango, St } = imports.gi;
|
||||
|
||||
@@ -25,9 +26,9 @@ class Dialog extends St.Widget {
|
||||
|
||||
_createDialog() {
|
||||
this._dialog = new St.BoxLayout({ style_class: 'modal-dialog',
|
||||
x_align: Clutter.ActorAlign.CENTER,
|
||||
y_align: Clutter.ActorAlign.CENTER,
|
||||
vertical: true });
|
||||
x_align: Clutter.ActorAlign.CENTER,
|
||||
y_align: Clutter.ActorAlign.CENTER,
|
||||
vertical: true });
|
||||
|
||||
// modal dialogs are fixed width and grow vertically; set the request
|
||||
// mode accordingly so wrapped labels are handled correctly during
|
||||
@@ -38,13 +39,13 @@ class Dialog extends St.Widget {
|
||||
this.contentLayout = new St.BoxLayout({ vertical: true,
|
||||
style_class: "modal-dialog-content-box" });
|
||||
this._dialog.add(this.contentLayout,
|
||||
{ expand: true,
|
||||
x_fill: true,
|
||||
y_fill: true,
|
||||
{ expand: true,
|
||||
x_fill: true,
|
||||
y_fill: true,
|
||||
x_align: St.Align.MIDDLE,
|
||||
y_align: St.Align.START });
|
||||
|
||||
this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous:true }) });
|
||||
this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) });
|
||||
this._dialog.add(this.buttonLayout,
|
||||
{ x_align: St.Align.MIDDLE,
|
||||
y_align: St.Align.START });
|
||||
@@ -116,11 +117,11 @@ class Dialog extends St.Widget {
|
||||
|
||||
let button = new St.Button({ style_class: 'modal-dialog-linked-button',
|
||||
button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
|
||||
reactive: true,
|
||||
can_focus: true,
|
||||
x_expand: true,
|
||||
y_expand: true,
|
||||
label: label });
|
||||
reactive: true,
|
||||
can_focus: true,
|
||||
x_expand: true,
|
||||
y_expand: true,
|
||||
label: label });
|
||||
button.connect('clicked', action);
|
||||
|
||||
buttonInfo['button'] = button;
|
||||
@@ -180,10 +181,8 @@ var MessageDialogContent = GObject.registerClass({
|
||||
this._subtitle.clutter_text.set(textProps);
|
||||
this._body.clutter_text.set(textProps);
|
||||
|
||||
if (!params.hasOwnProperty('style_class'))
|
||||
params.style_class = 'message-dialog-main-layout';
|
||||
|
||||
super._init(params);
|
||||
let defaultParams = { style_class: 'message-dialog-main-layout' };
|
||||
super._init(Object.assign(defaultParams, params));
|
||||
|
||||
this.messageBox = new St.BoxLayout({ style_class: 'message-dialog-content',
|
||||
x_expand: true,
|
||||
@@ -214,7 +213,10 @@ var MessageDialogContent = GObject.registerClass({
|
||||
}
|
||||
|
||||
set icon(icon) {
|
||||
Object.assign(this._icon, { gicon: icon, visible: icon != null });
|
||||
this._icon.set({
|
||||
gicon: icon,
|
||||
visible: icon != null
|
||||
});
|
||||
this.notify('icon');
|
||||
}
|
||||
|
||||
@@ -231,7 +233,10 @@ var MessageDialogContent = GObject.registerClass({
|
||||
}
|
||||
|
||||
_setLabel(label, prop, value) {
|
||||
Object.assign(label, { text: value || '', visible: value != null });
|
||||
label.set({
|
||||
text: value || '',
|
||||
visible: value != null
|
||||
});
|
||||
this.notify(prop);
|
||||
}
|
||||
|
||||
|
||||
118
js/ui/dnd.js
118
js/ui/dnd.js
@@ -1,18 +1,18 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported addDragMonitor, removeDragMonitor, makeDraggable */
|
||||
|
||||
const { Clutter, GLib, Meta, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
// Time to scale down to maxDragActorSize
|
||||
var SCALE_ANIMATION_TIME = 0.25;
|
||||
var SCALE_ANIMATION_TIME = 250;
|
||||
// Time to animate to original position on cancel
|
||||
var SNAP_BACK_ANIMATION_TIME = 0.25;
|
||||
var SNAP_BACK_ANIMATION_TIME = 250;
|
||||
// Time to animate to original position on success
|
||||
var REVERT_ANIMATION_TIME = 0.75;
|
||||
var REVERT_ANIMATION_TIME = 750;
|
||||
|
||||
var DragMotionResult = {
|
||||
NO_DROP: 0,
|
||||
@@ -111,9 +111,6 @@ var _Draggable = class _Draggable {
|
||||
if (event.get_button() != 1)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
if (Tweener.getTweenCount(actor))
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
this._buttonDown = true;
|
||||
this._grabActor(event.get_device());
|
||||
|
||||
@@ -139,9 +136,6 @@ var _Draggable = class _Draggable {
|
||||
!global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
if (Tweener.getTweenCount(actor))
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
this._buttonDown = true;
|
||||
this._grabActor(event.get_device(), event.get_event_sequence());
|
||||
|
||||
@@ -428,20 +422,22 @@ var _Draggable = class _Draggable {
|
||||
// to the final position because that tween would
|
||||
// fight with updates as the user continues dragging
|
||||
// the mouse; instead we do the position computations in
|
||||
// an onUpdate() function.
|
||||
Tweener.addTween(this._dragActor,
|
||||
{ scale_x: scale * origScale,
|
||||
scale_y: scale * origScale,
|
||||
time: SCALE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onUpdate() {
|
||||
let currentScale = this._dragActor.scale_x / origScale;
|
||||
this._dragOffsetX = currentScale * origDragOffsetX;
|
||||
this._dragOffsetY = currentScale * origDragOffsetY;
|
||||
this._dragActor.set_position(this._dragX + this._dragOffsetX,
|
||||
this._dragY + this._dragOffsetY);
|
||||
},
|
||||
onUpdateScope: this });
|
||||
// a ::new-frame handler.
|
||||
this._dragActor.ease({
|
||||
scale_x: scale * origScale,
|
||||
scale_y: scale * origScale,
|
||||
duration: SCALE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
|
||||
this._dragActor.get_transition('scale-x').connect('new-frame', () => {
|
||||
let currentScale = this._dragActor.scale_x / origScale;
|
||||
this._dragOffsetX = currentScale * origDragOffsetX;
|
||||
this._dragOffsetY = currentScale * origDragOffsetY;
|
||||
this._dragActor.set_position(
|
||||
this._dragX + this._dragOffsetX,
|
||||
this._dragY + this._dragOffsetY);
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -504,7 +500,7 @@ var _Draggable = class _Draggable {
|
||||
|
||||
while (target) {
|
||||
if (target._delegate && target._delegate.handleDragOver) {
|
||||
let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
|
||||
let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
|
||||
// We currently loop through all parents on drag-over even if one of the children has handled it.
|
||||
// We can check the return value of the function and break the loop if it's true if we don't want
|
||||
// to continue checking the parents.
|
||||
@@ -561,11 +557,11 @@ var _Draggable = class _Draggable {
|
||||
let dropFunc = dragMonitors[i].dragDrop;
|
||||
if (dropFunc)
|
||||
switch (dropFunc(dropEvent)) {
|
||||
case DragDropResult.FAILURE:
|
||||
case DragDropResult.SUCCESS:
|
||||
return true;
|
||||
case DragDropResult.CONTINUE:
|
||||
continue;
|
||||
case DragDropResult.FAILURE:
|
||||
case DragDropResult.SUCCESS:
|
||||
return true;
|
||||
case DragDropResult.CONTINUE:
|
||||
continue;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -576,20 +572,25 @@ var _Draggable = class _Draggable {
|
||||
|
||||
while (target) {
|
||||
if (target._delegate && target._delegate.acceptDrop) {
|
||||
let [r, targX, targY] = target.transform_stage_point(dropX, dropY);
|
||||
if (target._delegate.acceptDrop(this.actor._delegate,
|
||||
this._dragActor,
|
||||
targX,
|
||||
targY,
|
||||
event.get_time())) {
|
||||
let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
|
||||
let accepted = false;
|
||||
try {
|
||||
accepted = target._delegate.acceptDrop(this.actor._delegate,
|
||||
this._dragActor, targX, targY, event.get_time());
|
||||
} catch (e) {
|
||||
// On error, skip this target
|
||||
logError(e, "Skipping drag target");
|
||||
}
|
||||
if (accepted) {
|
||||
// If it accepted the drop without taking the actor,
|
||||
// handle it ourselves.
|
||||
if (this._dragActor && this._dragActor.get_parent() == Main.uiGroup) {
|
||||
if (this._restoreOnSuccess) {
|
||||
this._restoreDragActor(event.get_time());
|
||||
return true;
|
||||
} else
|
||||
} else {
|
||||
this._dragActor.destroy();
|
||||
}
|
||||
}
|
||||
|
||||
this._dragState = DragState.INIT;
|
||||
@@ -613,15 +614,15 @@ var _Draggable = class _Draggable {
|
||||
if (this._dragActorSource && this._dragActorSource.visible) {
|
||||
// Snap the clone back to its source
|
||||
[x, y] = this._dragActorSource.get_transformed_position();
|
||||
let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size();
|
||||
scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0;
|
||||
let [sourceScaledWidth] = this._dragActorSource.get_transformed_size();
|
||||
scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0;
|
||||
} else if (this._dragOrigParent) {
|
||||
// Snap the actor back to its original position within
|
||||
// its parent, adjusting for the fact that the parent
|
||||
// may have been moved or scaled
|
||||
let [parentX, parentY] = this._dragOrigParent.get_transformed_position();
|
||||
let [parentWidth, parentHeight] = this._dragOrigParent.get_size();
|
||||
let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size();
|
||||
let [parentWidth] = this._dragOrigParent.get_size();
|
||||
let [parentScaledWidth] = this._dragOrigParent.get_transformed_size();
|
||||
let parentScale = 1.0;
|
||||
if (parentWidth != 0)
|
||||
parentScale = parentScaledWidth / parentWidth;
|
||||
@@ -657,13 +658,13 @@ var _Draggable = class _Draggable {
|
||||
|
||||
let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation();
|
||||
|
||||
this._animateDragEnd(eventTime,
|
||||
{ x: snapBackX,
|
||||
y: snapBackY,
|
||||
scale_x: snapBackScale,
|
||||
scale_y: snapBackScale,
|
||||
time: SNAP_BACK_ANIMATION_TIME,
|
||||
});
|
||||
this._animateDragEnd(eventTime, {
|
||||
x: snapBackX,
|
||||
y: snapBackY,
|
||||
scale_x: snapBackScale,
|
||||
scale_y: snapBackScale,
|
||||
duration: SNAP_BACK_ANIMATION_TIME
|
||||
});
|
||||
}
|
||||
|
||||
_restoreDragActor(eventTime) {
|
||||
@@ -675,26 +676,27 @@ var _Draggable = class _Draggable {
|
||||
this._dragActor.set_scale(restoreScale, restoreScale);
|
||||
this._dragActor.opacity = 0;
|
||||
|
||||
this._animateDragEnd(eventTime,
|
||||
{ time: REVERT_ANIMATION_TIME });
|
||||
this._animateDragEnd(eventTime, {
|
||||
duration: REVERT_ANIMATION_TIME
|
||||
});
|
||||
}
|
||||
|
||||
_animateDragEnd(eventTime, params) {
|
||||
this._animationInProgress = true;
|
||||
|
||||
params['opacity'] = this._dragOrigOpacity;
|
||||
params['transition'] = 'easeOutQuad';
|
||||
params['onComplete'] = this._onAnimationComplete;
|
||||
params['onCompleteScope'] = this;
|
||||
params['onCompleteParams'] = [this._dragActor, eventTime];
|
||||
|
||||
// start the animation
|
||||
Tweener.addTween(this._dragActor, params)
|
||||
this._dragActor.ease(Object.assign(params, {
|
||||
opacity: this._dragOrigOpacity,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._onAnimationComplete(this._dragActor, eventTime);
|
||||
}
|
||||
}));
|
||||
}
|
||||
|
||||
_finishAnimation() {
|
||||
if (!this._animationInProgress)
|
||||
return
|
||||
return;
|
||||
|
||||
this._animationInProgress = false;
|
||||
if (!this._buttonDown)
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported EdgeDragAction */
|
||||
|
||||
const { Clutter, GObject, Meta, St } = imports.gi;
|
||||
|
||||
@@ -16,7 +17,7 @@ var EdgeDragAction = GObject.registerClass({
|
||||
this._allowedModes = allowedModes;
|
||||
this.set_n_touch_points(1);
|
||||
|
||||
global.display.connect('grab-op-begin', () => { this.cancel(); });
|
||||
global.display.connect('grab-op-begin', () => this.cancel());
|
||||
}
|
||||
|
||||
_getMonitorRect(x, y) {
|
||||
@@ -26,7 +27,7 @@ var EdgeDragAction = GObject.registerClass({
|
||||
return global.display.get_monitor_geometry(monitorIndex);
|
||||
}
|
||||
|
||||
vfunc_gesture_prepare(actor) {
|
||||
vfunc_gesture_prepare(_actor) {
|
||||
if (this.get_n_current_points() == 0)
|
||||
return false;
|
||||
|
||||
@@ -42,7 +43,7 @@ var EdgeDragAction = GObject.registerClass({
|
||||
(this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
|
||||
}
|
||||
|
||||
vfunc_gesture_progress(actor) {
|
||||
vfunc_gesture_progress(_actor) {
|
||||
let [startX, startY] = this.get_press_coords(0);
|
||||
let [x, y] = this.get_motion_coords(0);
|
||||
let offsetX = Math.abs (x - startX);
|
||||
@@ -62,7 +63,7 @@ var EdgeDragAction = GObject.registerClass({
|
||||
return true;
|
||||
}
|
||||
|
||||
vfunc_gesture_end(actor) {
|
||||
vfunc_gesture_end(_actor) {
|
||||
let [startX, startY] = this.get_press_coords(0);
|
||||
let [x, y] = this.get_motion_coords(0);
|
||||
let monitorRect = this._getMonitorRect(startX, startY);
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init, EndSessionDialog */
|
||||
/*
|
||||
* Copyright 2010-2016 Red Hat, Inc
|
||||
*
|
||||
@@ -16,8 +17,6 @@
|
||||
* along with this program; if not, see <http://www.gnu.org/licenses/>.
|
||||
*/
|
||||
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const { AccountsService, Clutter, Gio,
|
||||
GLib, GObject, Pango, Polkit, Shell, St } = imports.gi;
|
||||
|
||||
@@ -29,13 +28,9 @@ const UserWidget = imports.ui.userWidget;
|
||||
|
||||
const { loadInterfaceXML } = imports.misc.fileUtils;
|
||||
|
||||
let _endSessionDialog = null;
|
||||
|
||||
const _ITEM_ICON_SIZE = 48;
|
||||
const _DIALOG_ICON_SIZE = 48;
|
||||
|
||||
var GSM_SESSION_MANAGER_LOGOUT_FORCE = 2;
|
||||
|
||||
const EndSessionDialogIface = loadInterfaceXML('org.gnome.SessionManager.EndSessionDialog');
|
||||
|
||||
const logoutDialogContent = {
|
||||
@@ -53,7 +48,7 @@ const logoutDialogContent = {
|
||||
},
|
||||
showBatteryWarning: false,
|
||||
confirmButtons: [{ signal: 'ConfirmedLogout',
|
||||
label: C_("button", "Log Out") }],
|
||||
label: C_("button", "Log Out") }],
|
||||
iconStyleClass: 'end-session-dialog-logout-icon',
|
||||
showOtherSessions: false,
|
||||
};
|
||||
@@ -69,9 +64,9 @@ const shutdownDialogContent = {
|
||||
checkBoxText: C_("checkbox", "Install pending software updates"),
|
||||
showBatteryWarning: true,
|
||||
confirmButtons: [{ signal: 'ConfirmedReboot',
|
||||
label: C_("button", "Restart") },
|
||||
label: C_("button", "Restart") },
|
||||
{ signal: 'ConfirmedShutdown',
|
||||
label: C_("button", "Power Off") }],
|
||||
label: C_("button", "Power Off") }],
|
||||
iconName: 'system-shutdown-symbolic',
|
||||
iconStyleClass: 'end-session-dialog-shutdown-icon',
|
||||
showOtherSessions: true,
|
||||
@@ -86,7 +81,7 @@ const restartDialogContent = {
|
||||
},
|
||||
showBatteryWarning: false,
|
||||
confirmButtons: [{ signal: 'ConfirmedReboot',
|
||||
label: C_("button", "Restart") }],
|
||||
label: C_("button", "Restart") }],
|
||||
iconName: 'view-refresh-symbolic',
|
||||
iconStyleClass: 'end-session-dialog-shutdown-icon',
|
||||
showOtherSessions: true,
|
||||
@@ -102,7 +97,7 @@ const restartUpdateDialogContent = {
|
||||
},
|
||||
showBatteryWarning: true,
|
||||
confirmButtons: [{ signal: 'ConfirmedReboot',
|
||||
label: C_("button", "Restart & Install") }],
|
||||
label: C_("button", "Restart & Install") }],
|
||||
unusedFutureButtonForTranslation: C_("button", "Install & Power Off"),
|
||||
unusedFutureCheckBoxForTranslation: C_("checkbox", "Power off after updates are installed"),
|
||||
iconName: 'view-refresh-symbolic',
|
||||
@@ -122,18 +117,18 @@ const restartUpgradeDialogContent = {
|
||||
disableTimer: true,
|
||||
showBatteryWarning: false,
|
||||
confirmButtons: [{ signal: 'ConfirmedReboot',
|
||||
label: C_("button", "Restart & Install") }],
|
||||
label: C_("button", "Restart & Install") }],
|
||||
iconName: 'view-refresh-symbolic',
|
||||
iconStyleClass: 'end-session-dialog-shutdown-icon',
|
||||
showOtherSessions: true,
|
||||
};
|
||||
|
||||
const DialogType = {
|
||||
LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */,
|
||||
SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
|
||||
RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
|
||||
UPDATE_RESTART: 3,
|
||||
UPGRADE_RESTART: 4
|
||||
LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */,
|
||||
SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
|
||||
RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
|
||||
UPDATE_RESTART: 3,
|
||||
UPGRADE_RESTART: 4
|
||||
};
|
||||
|
||||
const DialogContent = {
|
||||
@@ -159,7 +154,7 @@ function findAppFromInhibitor(inhibitor) {
|
||||
let desktopFile;
|
||||
try {
|
||||
[desktopFile] = inhibitor.GetAppIdSync();
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
// XXX -- sometimes JIT inhibitors generated by gnome-session
|
||||
// get removed too soon. Don't fail in this case.
|
||||
log('gnome-session gave us a dead inhibitor: %s'.format(inhibitor.get_object_path()));
|
||||
@@ -212,10 +207,10 @@ function _setCheckBoxLabel(checkBox, text) {
|
||||
|
||||
if (text) {
|
||||
label.set_text(text);
|
||||
checkBox.actor.show();
|
||||
checkBox.show();
|
||||
} else {
|
||||
label.set_text('');
|
||||
checkBox.actor.hide();
|
||||
checkBox.hide();
|
||||
}
|
||||
}
|
||||
|
||||
@@ -223,7 +218,7 @@ function init() {
|
||||
// This always returns the same singleton object
|
||||
// By instantiating it initially, we register the
|
||||
// bus object, etc.
|
||||
_endSessionDialog = new EndSessionDialog();
|
||||
(new EndSessionDialog());
|
||||
}
|
||||
|
||||
var EndSessionDialog = GObject.registerClass(
|
||||
@@ -235,14 +230,13 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
this._loginManager = LoginManager.getLoginManager();
|
||||
this._userManager = AccountsService.UserManager.get_default();
|
||||
this._user = this._userManager.get_user(GLib.get_user_name());
|
||||
this._updatesPermission = null;
|
||||
|
||||
this._pkOfflineProxy = new PkOfflineProxy(Gio.DBus.system,
|
||||
'org.freedesktop.PackageKit',
|
||||
'/org/freedesktop/PackageKit',
|
||||
(proxy, error) => {
|
||||
if (error)
|
||||
log(error.message);
|
||||
});
|
||||
this._onPkOfflineProxyCreated.bind(this));
|
||||
|
||||
this._powerProxy = new UPowerProxy(Gio.DBus.system,
|
||||
'org.freedesktop.UPower',
|
||||
'/org/freedesktop/UPower',
|
||||
@@ -276,8 +270,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
|
||||
this._iconBin = new St.Bin();
|
||||
mainContentLayout.add(this._iconBin,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
{ x_fill: true,
|
||||
y_fill: false,
|
||||
x_align: St.Align.END,
|
||||
y_align: St.Align.START });
|
||||
|
||||
@@ -290,7 +284,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
|
||||
messageLayout.add(this._subjectLabel,
|
||||
{ x_fill: false,
|
||||
y_fill: false,
|
||||
y_fill: false,
|
||||
x_align: St.Align.START,
|
||||
y_align: St.Align.START });
|
||||
|
||||
@@ -299,12 +293,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
this._descriptionLabel.clutter_text.line_wrap = true;
|
||||
|
||||
messageLayout.add(this._descriptionLabel,
|
||||
{ y_fill: true,
|
||||
{ y_fill: true,
|
||||
y_align: St.Align.START });
|
||||
|
||||
this._checkBox = new CheckBox.CheckBox();
|
||||
this._checkBox.actor.connect('clicked', this._sync.bind(this));
|
||||
messageLayout.add(this._checkBox.actor);
|
||||
this._checkBox.connect('clicked', this._sync.bind(this));
|
||||
messageLayout.add(this._checkBox);
|
||||
|
||||
this._batteryWarning = new St.Label({ style_class: 'end-session-dialog-warning',
|
||||
text: _("Running on battery power: please plug in before installing updates.") });
|
||||
@@ -337,16 +331,36 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
this._inhibitorSection.add_actor(this._sessionHeader);
|
||||
this._inhibitorSection.add_actor(this._sessionList);
|
||||
|
||||
try {
|
||||
this._updatesPermission = Polkit.Permission.new_sync("org.freedesktop.packagekit.trigger-offline-update", null, null);
|
||||
} catch(e) {
|
||||
log('No permission to trigger offline updates: %s'.format(e.toString()));
|
||||
}
|
||||
|
||||
this._dbusImpl = Gio.DBusExportedObject.wrapJSObject(EndSessionDialogIface, this);
|
||||
this._dbusImpl.export(Gio.DBus.session, '/org/gnome/SessionManager/EndSessionDialog');
|
||||
}
|
||||
|
||||
_onPkOfflineProxyCreated(proxy, error) {
|
||||
if (error) {
|
||||
log(error.message);
|
||||
return;
|
||||
}
|
||||
|
||||
// Creating a D-Bus proxy won't propagate SERVICE_UNKNOWN or NAME_HAS_NO_OWNER
|
||||
// errors if PackageKit is not available, but the GIO implementation will make
|
||||
// sure in that case that the proxy's g-name-owner is set to null, so check that.
|
||||
if (this._pkOfflineProxy.g_name_owner === null) {
|
||||
this._pkOfflineProxy = null;
|
||||
return;
|
||||
}
|
||||
|
||||
// It only makes sense to check for this permission if PackageKit is available.
|
||||
Polkit.Permission.new(
|
||||
'org.freedesktop.packagekit.trigger-offline-update', null, null,
|
||||
(source, res) => {
|
||||
try {
|
||||
this._updatesPermission = Polkit.Permission.new_finish(res);
|
||||
} catch (e) {
|
||||
log(`No permission to trigger offline updates: ${e}`);
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
this._user.disconnect(this._userLoadedId);
|
||||
this._user.disconnect(this._userChangedId);
|
||||
@@ -362,12 +376,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
let subject = dialogContent.subject;
|
||||
|
||||
// Use different title when we are installing updates
|
||||
if (dialogContent.subjectWithUpdates && this._checkBox.actor.checked)
|
||||
if (dialogContent.subjectWithUpdates && this._checkBox.checked)
|
||||
subject = dialogContent.subjectWithUpdates;
|
||||
|
||||
if (dialogContent.showBatteryWarning) {
|
||||
// Warn when running on battery power
|
||||
if (this._powerProxy.OnBattery && this._checkBox.actor.checked)
|
||||
if (this._powerProxy.OnBattery && this._checkBox.checked)
|
||||
this._batteryWarning.opacity = 255;
|
||||
else
|
||||
this._batteryWarning.opacity = 0;
|
||||
@@ -391,7 +405,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
}
|
||||
|
||||
// Use a different description when we are installing a system upgrade
|
||||
if (dialogContent.upgradeDescription) {
|
||||
// if the PackageKit proxy is available (i.e. PackageKit is available).
|
||||
if (this._pkOfflineProxy && dialogContent.upgradeDescription) {
|
||||
let name = this._pkOfflineProxy.PreparedUpgrade['name'].deep_unpack();
|
||||
let version = this._pkOfflineProxy.PreparedUpgrade['version'].deep_unpack();
|
||||
|
||||
@@ -414,7 +429,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
let avatarWidget = new UserWidget.Avatar(this._user,
|
||||
{ iconSize: _DIALOG_ICON_SIZE,
|
||||
styleClass: dialogContent.iconStyleClass });
|
||||
this._iconBin.child = avatarWidget.actor;
|
||||
this._iconBin.child = avatarWidget;
|
||||
avatarWidget.update();
|
||||
}
|
||||
|
||||
@@ -428,20 +443,22 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
_updateButtons() {
|
||||
let dialogContent = DialogContent[this._type];
|
||||
let buttons = [{ action: this.cancel.bind(this),
|
||||
label: _("Cancel"),
|
||||
key: Clutter.Escape }];
|
||||
label: _("Cancel"),
|
||||
key: Clutter.Escape }];
|
||||
|
||||
for (let i = 0; i < dialogContent.confirmButtons.length; i++) {
|
||||
let signal = dialogContent.confirmButtons[i].signal;
|
||||
let label = dialogContent.confirmButtons[i].label;
|
||||
buttons.push({ action: () => {
|
||||
this.close(true);
|
||||
let signalId = this.connect('closed', () => {
|
||||
this.disconnect(signalId);
|
||||
this._confirm(signal);
|
||||
});
|
||||
},
|
||||
label: label });
|
||||
buttons.push({
|
||||
action: () => {
|
||||
this.close(true);
|
||||
let signalId = this.connect('closed', () => {
|
||||
this.disconnect(signalId);
|
||||
this._confirm(signal);
|
||||
});
|
||||
},
|
||||
label: label,
|
||||
});
|
||||
}
|
||||
|
||||
this.setButtons(buttons);
|
||||
@@ -468,27 +485,27 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
};
|
||||
|
||||
// Offline update not available; just emit the signal
|
||||
if (!this._checkBox.actor.visible) {
|
||||
if (!this._checkBox.visible) {
|
||||
callback();
|
||||
return;
|
||||
}
|
||||
|
||||
// Trigger the offline update as requested
|
||||
if (this._checkBox.actor.checked) {
|
||||
if (this._checkBox.checked) {
|
||||
switch (signal) {
|
||||
case "ConfirmedReboot":
|
||||
this._triggerOfflineUpdateReboot(callback);
|
||||
break;
|
||||
case "ConfirmedShutdown":
|
||||
// To actually trigger the offline update, we need to
|
||||
// reboot to do the upgrade. When the upgrade is complete,
|
||||
// the computer will shut down automatically.
|
||||
signal = "ConfirmedReboot";
|
||||
this._triggerOfflineUpdateShutdown(callback);
|
||||
break;
|
||||
default:
|
||||
callback();
|
||||
break;
|
||||
case "ConfirmedReboot":
|
||||
this._triggerOfflineUpdateReboot(callback);
|
||||
break;
|
||||
case "ConfirmedShutdown":
|
||||
// To actually trigger the offline update, we need to
|
||||
// reboot to do the upgrade. When the upgrade is complete,
|
||||
// the computer will shut down automatically.
|
||||
signal = "ConfirmedReboot";
|
||||
this._triggerOfflineUpdateShutdown(callback);
|
||||
break;
|
||||
default:
|
||||
callback();
|
||||
break;
|
||||
}
|
||||
} else {
|
||||
this._triggerOfflineUpdateCancel(callback);
|
||||
@@ -500,6 +517,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
}
|
||||
|
||||
_triggerOfflineUpdateReboot(callback) {
|
||||
// Handle this gracefully if PackageKit is not available.
|
||||
if (!this._pkOfflineProxy) {
|
||||
callback();
|
||||
return;
|
||||
}
|
||||
|
||||
this._pkOfflineProxy.TriggerRemote('reboot', (result, error) => {
|
||||
if (error)
|
||||
log(error.message);
|
||||
@@ -509,6 +532,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
}
|
||||
|
||||
_triggerOfflineUpdateShutdown(callback) {
|
||||
// Handle this gracefully if PackageKit is not available.
|
||||
if (!this._pkOfflineProxy) {
|
||||
callback();
|
||||
return;
|
||||
}
|
||||
|
||||
this._pkOfflineProxy.TriggerRemote('power-off', (result, error) => {
|
||||
if (error)
|
||||
log(error.message);
|
||||
@@ -518,6 +547,12 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
}
|
||||
|
||||
_triggerOfflineUpdateCancel(callback) {
|
||||
// Handle this gracefully if PackageKit is not available.
|
||||
if (!this._pkOfflineProxy) {
|
||||
callback();
|
||||
return;
|
||||
}
|
||||
|
||||
this._pkOfflineProxy.CancelRemote((result, error) => {
|
||||
if (error)
|
||||
log(error.message);
|
||||
@@ -530,7 +565,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
let startTime = GLib.get_monotonic_time();
|
||||
this._secondsLeft = this._totalSecondsToStayOpen;
|
||||
|
||||
this._timerId = Mainloop.timeout_add_seconds(1, () => {
|
||||
this._timerId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, 1, () => {
|
||||
let currentTime = GLib.get_monotonic_time();
|
||||
let secondsElapsed = ((currentTime - startTime) / 1000000);
|
||||
|
||||
@@ -552,7 +587,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
|
||||
_stopTimer() {
|
||||
if (this._timerId > 0) {
|
||||
Mainloop.source_remove(this._timerId);
|
||||
GLib.source_remove(this._timerId);
|
||||
this._timerId = 0;
|
||||
}
|
||||
|
||||
@@ -585,7 +620,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
}
|
||||
|
||||
_onInhibitorLoaded(inhibitor) {
|
||||
if (this._applications.indexOf(inhibitor) < 0) {
|
||||
if (!this._applications.includes(inhibitor)) {
|
||||
// Stale inhibitor
|
||||
return;
|
||||
}
|
||||
@@ -621,7 +656,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
|
||||
let actor = new St.BoxLayout({ style_class: 'end-session-dialog-session-list-item',
|
||||
can_focus: true });
|
||||
actor.add(avatar.actor);
|
||||
actor.add(avatar);
|
||||
|
||||
let nameLabel = new St.Label({ text: userLabelText,
|
||||
style_class: 'end-session-dialog-session-list-item-name',
|
||||
@@ -637,7 +672,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
this._loginManager.listSessions(result => {
|
||||
let n = 0;
|
||||
for (let i = 0; i < result.length; i++) {
|
||||
let[id, uid, userName, seat, sessionPath] = result[i];
|
||||
let [id_, uid_, userName, seat_, sessionPath] = result[i];
|
||||
let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath);
|
||||
|
||||
if (proxy.Class != 'user')
|
||||
@@ -680,7 +715,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
this._totalSecondsToStayOpen = totalSecondsToStayOpen;
|
||||
this._type = type;
|
||||
|
||||
if (this._type == DialogType.RESTART) {
|
||||
// Only consider updates and upgrades if PackageKit is available.
|
||||
if (this._pkOfflineProxy && this._type == DialogType.RESTART) {
|
||||
if (this._pkOfflineProxy.UpdateTriggered)
|
||||
this._type = DialogType.UPDATE_RESTART;
|
||||
else if (this._pkOfflineProxy.UpgradeTriggered)
|
||||
@@ -702,7 +738,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
let dialogContent = DialogContent[this._type];
|
||||
|
||||
for (let i = 0; i < inhibitorObjectPaths.length; i++) {
|
||||
let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => {
|
||||
let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => {
|
||||
this._onInhibitorLoaded(proxy);
|
||||
});
|
||||
|
||||
@@ -712,19 +748,20 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
if (dialogContent.showOtherSessions)
|
||||
this._loadSessions();
|
||||
|
||||
let updateTriggered = this._pkOfflineProxy.UpdateTriggered;
|
||||
let updatePrepared = this._pkOfflineProxy.UpdatePrepared;
|
||||
// Only consider updates and upgrades if PackageKit is available.
|
||||
let updateTriggered = this._pkOfflineProxy ? this._pkOfflineProxy.UpdateTriggered : false;
|
||||
let updatePrepared = this._pkOfflineProxy ? this._pkOfflineProxy.UpdatePrepared : false;
|
||||
let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed;
|
||||
|
||||
_setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || '');
|
||||
this._checkBox.actor.visible = (dialogContent.checkBoxText && updatePrepared && updatesAllowed);
|
||||
this._checkBox.actor.checked = (updatePrepared && updateTriggered);
|
||||
this._checkBox.visible = (dialogContent.checkBoxText && updatePrepared && updatesAllowed);
|
||||
this._checkBox.checked = (updatePrepared && updateTriggered);
|
||||
|
||||
// We show the warning either together with the checkbox, or when
|
||||
// updates have already been triggered, but the user doesn't have
|
||||
// enough permissions to cancel them.
|
||||
this._batteryWarning.visible = (dialogContent.showBatteryWarning &&
|
||||
(this._checkBox.actor.visible || updatePrepared && updateTriggered && !updatesAllowed));
|
||||
(this._checkBox.visible || updatePrepared && updateTriggered && !updatesAllowed));
|
||||
|
||||
this._updateButtons();
|
||||
|
||||
@@ -745,7 +782,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
|
||||
});
|
||||
}
|
||||
|
||||
Close(parameters, invocation) {
|
||||
Close(_parameters, _invocation) {
|
||||
this.close();
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init */
|
||||
|
||||
const Config = imports.misc.config;
|
||||
|
||||
@@ -9,7 +10,7 @@ imports.gi.versions.Gtk = '3.0';
|
||||
imports.gi.versions.TelepathyGLib = '0.12';
|
||||
imports.gi.versions.TelepathyLogger = '0.2';
|
||||
|
||||
const { Clutter, GLib, Shell, St } = imports.gi;
|
||||
const { Clutter, GLib, Meta, Shell, St } = imports.gi;
|
||||
const Gettext = imports.gettext;
|
||||
|
||||
// We can't import shell JS modules yet, because they may have
|
||||
@@ -57,8 +58,156 @@ function _patchLayoutClass(layoutClass, styleProps) {
|
||||
};
|
||||
}
|
||||
|
||||
function _loggingFunc() {
|
||||
let fields = {'MESSAGE': [].join.call(arguments, ', ')};
|
||||
function _makeEaseCallback(params, cleanup) {
|
||||
let onComplete = params.onComplete;
|
||||
delete params.onComplete;
|
||||
|
||||
let onStopped = params.onStopped;
|
||||
delete params.onStopped;
|
||||
|
||||
return isFinished => {
|
||||
cleanup();
|
||||
|
||||
if (onStopped)
|
||||
onStopped(isFinished);
|
||||
if (onComplete && isFinished)
|
||||
onComplete();
|
||||
};
|
||||
}
|
||||
|
||||
function _getPropertyTarget(actor, propName) {
|
||||
if (!propName.startsWith('@'))
|
||||
return [actor, propName];
|
||||
|
||||
let [type, name, prop] = propName.split('.');
|
||||
switch (type) {
|
||||
case '@layout':
|
||||
return [actor.layout_manager, name];
|
||||
case '@actions':
|
||||
return [actor.get_action(name), prop];
|
||||
case '@constraints':
|
||||
return [actor.get_constraint(name), prop];
|
||||
case '@effects':
|
||||
return [actor.get_effect(name), prop];
|
||||
}
|
||||
|
||||
throw new Error(`Invalid property name ${propName}`);
|
||||
}
|
||||
|
||||
function _easeActor(actor, params) {
|
||||
actor.save_easing_state();
|
||||
|
||||
if (params.duration != undefined)
|
||||
actor.set_easing_duration(params.duration);
|
||||
delete params.duration;
|
||||
|
||||
if (params.delay != undefined)
|
||||
actor.set_easing_delay(params.delay);
|
||||
delete params.delay;
|
||||
|
||||
let repeatCount = 0;
|
||||
if (params.repeatCount != undefined)
|
||||
repeatCount = params.repeatCount;
|
||||
delete params.repeatCount;
|
||||
|
||||
let autoReverse = false;
|
||||
if (params.autoReverse != undefined)
|
||||
autoReverse = params.autoReverse;
|
||||
delete params.autoReverse;
|
||||
|
||||
if (params.mode != undefined)
|
||||
actor.set_easing_mode(params.mode);
|
||||
delete params.mode;
|
||||
|
||||
let cleanup = () => Meta.enable_unredirect_for_display(global.display);
|
||||
let callback = _makeEaseCallback(params, cleanup);
|
||||
|
||||
// cancel overwritten transitions
|
||||
let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
|
||||
animatedProps.forEach(p => actor.remove_transition(p));
|
||||
|
||||
actor.set(params);
|
||||
actor.restore_easing_state();
|
||||
|
||||
let transition = animatedProps.map(p => actor.get_transition(p))
|
||||
.find(t => t !== null);
|
||||
|
||||
if (transition && transition.delay)
|
||||
transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
|
||||
else
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
|
||||
if (transition) {
|
||||
transition.set({ repeatCount, autoReverse });
|
||||
transition.connect('stopped', (t, finished) => callback(finished));
|
||||
} else {
|
||||
callback(true);
|
||||
}
|
||||
}
|
||||
|
||||
function _easeActorProperty(actor, propName, target, params) {
|
||||
// Avoid pointless difference with ease()
|
||||
if (params.mode)
|
||||
params.progress_mode = params.mode;
|
||||
delete params.mode;
|
||||
|
||||
if (params.duration)
|
||||
params.duration = adjustAnimationTime(params.duration);
|
||||
let duration = Math.floor(params.duration || 0);
|
||||
|
||||
let repeatCount = 0;
|
||||
if (params.repeatCount != undefined)
|
||||
repeatCount = params.repeatCount;
|
||||
delete params.repeatCount;
|
||||
|
||||
let autoReverse = false;
|
||||
if (params.autoReverse != undefined)
|
||||
autoReverse = params.autoReverse;
|
||||
delete params.autoReverse;
|
||||
|
||||
// Copy Clutter's behavior for implicit animations, see
|
||||
// should_skip_implicit_transition()
|
||||
if (actor instanceof Clutter.Actor && !actor.mapped)
|
||||
duration = 0;
|
||||
|
||||
let cleanup = () => Meta.enable_unredirect_for_display(global.display);
|
||||
let callback = _makeEaseCallback(params, cleanup);
|
||||
|
||||
// cancel overwritten transition
|
||||
actor.remove_transition(propName);
|
||||
|
||||
if (duration == 0) {
|
||||
let [obj, prop] = _getPropertyTarget(actor, propName);
|
||||
obj[prop] = target;
|
||||
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
callback(true);
|
||||
|
||||
return;
|
||||
}
|
||||
|
||||
let pspec = actor.find_property(propName);
|
||||
let transition = new Clutter.PropertyTransition(Object.assign({
|
||||
property_name: propName,
|
||||
interval: new Clutter.Interval({ value_type: pspec.value_type }),
|
||||
remove_on_complete: true,
|
||||
repeat_count: repeatCount,
|
||||
auto_reverse: autoReverse,
|
||||
}, params));
|
||||
actor.add_transition(propName, transition);
|
||||
|
||||
transition.set_to(target);
|
||||
|
||||
if (transition.delay)
|
||||
transition.connect('started', () => Meta.disable_unredirect_for_display(global.display));
|
||||
else
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
|
||||
transition.connect('stopped', (t, finished) => callback(finished));
|
||||
}
|
||||
|
||||
function _loggingFunc(...args) {
|
||||
let fields = { 'MESSAGE': args.join(', ') };
|
||||
let domain = "GNOME Shell";
|
||||
|
||||
// If the caller is an extension, add it as metadata
|
||||
@@ -93,6 +242,27 @@ function init() {
|
||||
column_spacing: 'spacing-columns' });
|
||||
_patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });
|
||||
|
||||
let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
|
||||
Clutter.Actor.prototype.set_easing_duration = function(msecs) {
|
||||
origSetEasingDuration.call(this, adjustAnimationTime(msecs));
|
||||
};
|
||||
let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
|
||||
Clutter.Actor.prototype.set_easing_delay = function(msecs) {
|
||||
origSetEasingDelay.call(this, adjustAnimationTime(msecs));
|
||||
};
|
||||
|
||||
Clutter.Actor.prototype.ease = function(props, easingParams) {
|
||||
_easeActor(this, props, easingParams);
|
||||
};
|
||||
Clutter.Actor.prototype.ease_property = function(propName, target, params) {
|
||||
_easeActorProperty(this, propName, target, params);
|
||||
};
|
||||
St.Adjustment.prototype.ease = function(target, params) {
|
||||
// we're not an actor of course, but we implement the same
|
||||
// transition API as Clutter.Actor, so this works anyway
|
||||
_easeActorProperty(this, 'value', target, params);
|
||||
};
|
||||
|
||||
Clutter.Actor.prototype.toString = function() {
|
||||
return St.describe_actor(this);
|
||||
};
|
||||
@@ -106,15 +276,21 @@ function init() {
|
||||
}
|
||||
});
|
||||
|
||||
St.set_slow_down_factor = function(factor) {
|
||||
let { stack } = new Error();
|
||||
log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
|
||||
St.Settings.get().slow_down_factor = factor;
|
||||
};
|
||||
|
||||
let origToString = Object.prototype.toString;
|
||||
Object.prototype.toString = function() {
|
||||
let base = origToString.call(this);
|
||||
try {
|
||||
if ('actor' in this && this.actor instanceof Clutter.Actor)
|
||||
return base.replace(/\]$/, ' delegate for ' + this.actor.toString().substring(1));
|
||||
return base.replace(/\]$/, ` delegate for ${this.actor.toString().substring(1)}`);
|
||||
else
|
||||
return base;
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
return base;
|
||||
}
|
||||
};
|
||||
@@ -128,7 +304,7 @@ function init() {
|
||||
if (slowdownEnv) {
|
||||
let factor = parseFloat(slowdownEnv);
|
||||
if (!isNaN(factor) && factor > 0.0)
|
||||
St.set_slow_down_factor(factor);
|
||||
St.Settings.get().slow_down_factor = factor;
|
||||
}
|
||||
|
||||
// OK, now things are initialized enough that we can import shell JS
|
||||
@@ -138,3 +314,17 @@ function init() {
|
||||
Tweener.init();
|
||||
String.prototype.format = Format.format;
|
||||
}
|
||||
|
||||
// adjustAnimationTime:
|
||||
// @msecs: time in milliseconds
|
||||
//
|
||||
// Adjust @msecs to account for St's enable-animations
|
||||
// and slow-down-factor settings
|
||||
function adjustAnimationTime(msecs) {
|
||||
let settings = St.Settings.get();
|
||||
|
||||
if (!settings.enable_animations)
|
||||
return 1;
|
||||
return settings.slow_down_factor * msecs;
|
||||
}
|
||||
|
||||
|
||||
@@ -1,19 +1,20 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init, installExtension, uninstallExtension,
|
||||
checkForUpdates, updateExtension */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Soup, St } = imports.gi;
|
||||
const { Clutter, Gio, GLib, GObject, Soup } = imports.gi;
|
||||
|
||||
const Config = imports.misc.config;
|
||||
const Dialog = imports.ui.dialog;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const ExtensionSystem = imports.ui.extensionSystem;
|
||||
const FileUtils = imports.misc.fileUtils;
|
||||
const Main = imports.ui.main;
|
||||
const ModalDialog = imports.ui.modalDialog;
|
||||
|
||||
const _signals = ExtensionSystem._signals;
|
||||
|
||||
var REPOSITORY_URL_BASE = 'https://extensions.gnome.org';
|
||||
var REPOSITORY_URL_DOWNLOAD = REPOSITORY_URL_BASE + '/download-extension/%s.shell-extension.zip';
|
||||
var REPOSITORY_URL_INFO = REPOSITORY_URL_BASE + '/extension-info/';
|
||||
var REPOSITORY_URL_UPDATE = REPOSITORY_URL_BASE + '/update-info/';
|
||||
var REPOSITORY_URL_DOWNLOAD = `${REPOSITORY_URL_BASE}/download-extension/%s.shell-extension.zip`;
|
||||
var REPOSITORY_URL_INFO = `${REPOSITORY_URL_BASE}/extension-info/`;
|
||||
var REPOSITORY_URL_UPDATE = `${REPOSITORY_URL_BASE}/update-info/`;
|
||||
|
||||
let _httpSession;
|
||||
|
||||
@@ -25,7 +26,7 @@ function installExtension(uuid, invocation) {
|
||||
|
||||
_httpSession.queue_message(message, (session, message) => {
|
||||
if (message.status_code != Soup.KnownStatusCode.OK) {
|
||||
ExtensionSystem.logExtensionError(uuid, 'downloading info: ' + message.status_code);
|
||||
Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
|
||||
invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
|
||||
return;
|
||||
}
|
||||
@@ -34,7 +35,7 @@ function installExtension(uuid, invocation) {
|
||||
try {
|
||||
info = JSON.parse(message.response_body.data);
|
||||
} catch (e) {
|
||||
ExtensionSystem.logExtensionError(uuid, 'parsing info: ' + e);
|
||||
Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`);
|
||||
invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString());
|
||||
return;
|
||||
}
|
||||
@@ -45,7 +46,7 @@ function installExtension(uuid, invocation) {
|
||||
}
|
||||
|
||||
function uninstallExtension(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
let extension = Main.extensionManager.lookup(uuid);
|
||||
if (!extension)
|
||||
return false;
|
||||
|
||||
@@ -53,7 +54,7 @@ function uninstallExtension(uuid) {
|
||||
if (extension.type != ExtensionUtils.ExtensionType.PER_USER)
|
||||
return false;
|
||||
|
||||
if (!ExtensionSystem.unloadExtension(extension))
|
||||
if (!Main.extensionManager.unloadExtension(extension))
|
||||
return false;
|
||||
|
||||
FileUtils.recursivelyDeleteDir(extension.dir, true);
|
||||
@@ -114,10 +115,10 @@ function updateExtension(uuid) {
|
||||
|
||||
_httpSession.queue_message(message, (session, message) => {
|
||||
gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
|
||||
let oldExtension = ExtensionUtils.extensions[uuid];
|
||||
let oldExtension = Main.extensionManager.lookup(uuid);
|
||||
let extensionDir = oldExtension.dir;
|
||||
|
||||
if (!ExtensionSystem.unloadExtension(oldExtension))
|
||||
if (!Main.extensionManager.unloadExtension(oldExtension))
|
||||
return;
|
||||
|
||||
FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir);
|
||||
@@ -126,11 +127,11 @@ function updateExtension(uuid) {
|
||||
let extension = null;
|
||||
|
||||
try {
|
||||
extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
ExtensionSystem.loadExtension(extension);
|
||||
} catch(e) {
|
||||
extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
Main.extensionManager.loadExtension(extension);
|
||||
} catch (e) {
|
||||
if (extension)
|
||||
ExtensionSystem.unloadExtension(extension);
|
||||
Main.extensionManager.unloadExtension(extension);
|
||||
|
||||
logError(e, 'Error loading extension %s'.format(uuid));
|
||||
|
||||
@@ -139,7 +140,7 @@ function updateExtension(uuid) {
|
||||
|
||||
// Restore what was there before. We can't do much if we
|
||||
// fail here.
|
||||
ExtensionSystem.loadExtension(oldExtension);
|
||||
Main.extensionManager.loadExtension(oldExtension);
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -152,9 +153,9 @@ function updateExtension(uuid) {
|
||||
|
||||
function checkForUpdates() {
|
||||
let metadatas = {};
|
||||
for (let uuid in ExtensionUtils.extensions) {
|
||||
metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata;
|
||||
}
|
||||
Main.extensionManager.getUuids().forEach(uuid => {
|
||||
metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata;
|
||||
});
|
||||
|
||||
let params = { shell_version: Config.PACKAGE_VERSION,
|
||||
installed: JSON.stringify(metadatas) };
|
||||
@@ -185,36 +186,32 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
|
||||
this._info = info;
|
||||
this._invocation = invocation;
|
||||
|
||||
this.setButtons([{ label: _("Cancel"),
|
||||
action: this._onCancelButtonPressed.bind(this),
|
||||
key: Clutter.Escape
|
||||
},
|
||||
{ label: _("Install"),
|
||||
action: this._onInstallButtonPressed.bind(this),
|
||||
default: true
|
||||
}]);
|
||||
this.setButtons([{
|
||||
label: _("Cancel"),
|
||||
action: this._onCancelButtonPressed.bind(this),
|
||||
key: Clutter.Escape,
|
||||
}, {
|
||||
label: _("Install"),
|
||||
action: this._onInstallButtonPressed.bind(this),
|
||||
default: true,
|
||||
}]);
|
||||
|
||||
let message = _("Download and install “%s” from extensions.gnome.org?").format(info.name);
|
||||
let content = new Dialog.MessageDialogContent({
|
||||
title: _("Download and install “%s” from extensions.gnome.org?").format(info.name),
|
||||
icon: new Gio.FileIcon({
|
||||
file: Gio.File.new_for_uri(`${REPOSITORY_URL_BASE}${info.icon}`)
|
||||
})
|
||||
});
|
||||
|
||||
let box = new St.BoxLayout({ style_class: 'message-dialog-main-layout',
|
||||
vertical: false });
|
||||
this.contentLayout.add(box);
|
||||
|
||||
let gicon = new Gio.FileIcon({ file: Gio.File.new_for_uri(REPOSITORY_URL_BASE + info.icon) })
|
||||
let icon = new St.Icon({ gicon: gicon });
|
||||
box.add(icon);
|
||||
|
||||
let label = new St.Label({ style_class: 'message-dialog-title headline',
|
||||
text: message });
|
||||
box.add(label);
|
||||
this.contentLayout.add(content);
|
||||
}
|
||||
|
||||
_onCancelButtonPressed(button, event) {
|
||||
_onCancelButtonPressed() {
|
||||
this.close();
|
||||
this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled']));
|
||||
}
|
||||
|
||||
_onInstallButtonPressed(button, event) {
|
||||
_onInstallButtonPressed() {
|
||||
let params = { shell_version: Config.PACKAGE_VERSION };
|
||||
|
||||
let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid);
|
||||
@@ -226,21 +223,16 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
|
||||
function errback(code, message) {
|
||||
let msg = message ? message.toString() : '';
|
||||
log('Error while installing %s: %s (%s)'.format(uuid, code, msg));
|
||||
invocation.return_dbus_error('org.gnome.Shell.' + code, msg);
|
||||
invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg);
|
||||
}
|
||||
|
||||
function callback() {
|
||||
// Add extension to 'enabled-extensions' for the user, always...
|
||||
let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY);
|
||||
if (enabledExtensions.indexOf(uuid) == -1) {
|
||||
enabledExtensions.push(uuid);
|
||||
global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions);
|
||||
}
|
||||
|
||||
try {
|
||||
let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
ExtensionSystem.loadExtension(extension);
|
||||
} catch(e) {
|
||||
let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
|
||||
Main.extensionManager.loadExtension(extension);
|
||||
if (!Main.extensionManager.enableExtension(uuid))
|
||||
throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`);
|
||||
} catch (e) {
|
||||
uninstallExtension(uuid);
|
||||
errback('LoadExtensionError', e);
|
||||
return;
|
||||
|
||||
@@ -1,374 +1,519 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported init connect disconnect */
|
||||
|
||||
const { Gio, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const FileUtils = imports.misc.fileUtils;
|
||||
const Main = imports.ui.main;
|
||||
|
||||
var ExtensionState = {
|
||||
ENABLED: 1,
|
||||
DISABLED: 2,
|
||||
ERROR: 3,
|
||||
OUT_OF_DATE: 4,
|
||||
DOWNLOADING: 5,
|
||||
INITIALIZED: 6,
|
||||
|
||||
// Used as an error state for operations on unknown extensions,
|
||||
// should never be in a real extensionMeta object.
|
||||
UNINSTALLED: 99
|
||||
};
|
||||
|
||||
// Arrays of uuids
|
||||
var enabledExtensions;
|
||||
// Contains the order that extensions were enabled in.
|
||||
var extensionOrder = [];
|
||||
|
||||
// We don't really have a class to add signals on. So, create
|
||||
// a simple dummy object, add the signal methods, and export those
|
||||
// publically.
|
||||
var _signals = {};
|
||||
Signals.addSignalMethods(_signals);
|
||||
|
||||
var connect = _signals.connect.bind(_signals);
|
||||
var disconnect = _signals.disconnect.bind(_signals);
|
||||
const { ExtensionState, ExtensionType } = ExtensionUtils;
|
||||
|
||||
const ENABLED_EXTENSIONS_KEY = 'enabled-extensions';
|
||||
const DISABLED_EXTENSIONS_KEY = 'disabled-extensions';
|
||||
const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions';
|
||||
const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation';
|
||||
|
||||
var initted = false;
|
||||
var enabled;
|
||||
var ExtensionManager = class {
|
||||
constructor() {
|
||||
this._initialized = false;
|
||||
this._enabled = false;
|
||||
|
||||
function disableExtension(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
if (!extension)
|
||||
return;
|
||||
this._extensions = new Map();
|
||||
this._enabledExtensions = [];
|
||||
this._extensionOrder = [];
|
||||
|
||||
if (extension.state != ExtensionState.ENABLED)
|
||||
return;
|
||||
|
||||
// "Rebase" the extension order by disabling and then enabling extensions
|
||||
// in order to help prevent conflicts.
|
||||
|
||||
// Example:
|
||||
// order = [A, B, C, D, E]
|
||||
// user disables C
|
||||
// this should: disable E, disable D, disable C, enable D, enable E
|
||||
|
||||
let orderIdx = extensionOrder.indexOf(uuid);
|
||||
let order = extensionOrder.slice(orderIdx + 1);
|
||||
let orderReversed = order.slice().reverse();
|
||||
|
||||
for (let i = 0; i < orderReversed.length; i++) {
|
||||
let uuid = orderReversed[i];
|
||||
try {
|
||||
ExtensionUtils.extensions[uuid].stateObj.disable();
|
||||
} catch(e) {
|
||||
logExtensionError(uuid, e);
|
||||
}
|
||||
Main.sessionMode.connect('updated', this._sessionUpdated.bind(this));
|
||||
}
|
||||
|
||||
if (extension.stylesheet) {
|
||||
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
|
||||
theme.unload_stylesheet(extension.stylesheet);
|
||||
delete extension.stylesheet;
|
||||
init() {
|
||||
this._sessionUpdated();
|
||||
}
|
||||
|
||||
try {
|
||||
extension.stateObj.disable();
|
||||
} catch(e) {
|
||||
logExtensionError(uuid, e);
|
||||
lookup(uuid) {
|
||||
return this._extensions.get(uuid);
|
||||
}
|
||||
|
||||
for (let i = 0; i < order.length; i++) {
|
||||
let uuid = order[i];
|
||||
try {
|
||||
ExtensionUtils.extensions[uuid].stateObj.enable();
|
||||
} catch(e) {
|
||||
logExtensionError(uuid, e);
|
||||
}
|
||||
getUuids() {
|
||||
return [...this._extensions.keys()];
|
||||
}
|
||||
|
||||
extensionOrder.splice(orderIdx, 1);
|
||||
|
||||
if ( extension.state != ExtensionState.ERROR ) {
|
||||
extension.state = ExtensionState.DISABLED;
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
}
|
||||
}
|
||||
|
||||
function enableExtension(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
if (!extension)
|
||||
return;
|
||||
|
||||
if (extension.state == ExtensionState.INITIALIZED)
|
||||
initExtension(uuid);
|
||||
|
||||
if (extension.state != ExtensionState.DISABLED)
|
||||
return;
|
||||
|
||||
extensionOrder.push(uuid);
|
||||
|
||||
let stylesheetNames = [global.session_mode + '.css', 'stylesheet.css'];
|
||||
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
|
||||
for (let i = 0; i < stylesheetNames.length; i++) {
|
||||
try {
|
||||
let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
|
||||
theme.load_stylesheet(stylesheetFile);
|
||||
extension.stylesheet = stylesheetFile;
|
||||
break;
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
|
||||
continue; // not an error
|
||||
log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
|
||||
_callExtensionDisable(uuid) {
|
||||
let extension = this.lookup(uuid);
|
||||
if (!extension)
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
try {
|
||||
extension.stateObj.enable();
|
||||
extension.state = ExtensionState.ENABLED;
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
return;
|
||||
} catch(e) {
|
||||
if (extension.state != ExtensionState.ENABLED)
|
||||
return;
|
||||
|
||||
// "Rebase" the extension order by disabling and then enabling extensions
|
||||
// in order to help prevent conflicts.
|
||||
|
||||
// Example:
|
||||
// order = [A, B, C, D, E]
|
||||
// user disables C
|
||||
// this should: disable E, disable D, disable C, enable D, enable E
|
||||
|
||||
let orderIdx = this._extensionOrder.indexOf(uuid);
|
||||
let order = this._extensionOrder.slice(orderIdx + 1);
|
||||
let orderReversed = order.slice().reverse();
|
||||
|
||||
for (let i = 0; i < orderReversed.length; i++) {
|
||||
let uuid = orderReversed[i];
|
||||
try {
|
||||
this.lookup(uuid).stateObj.disable();
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
}
|
||||
}
|
||||
|
||||
if (extension.stylesheet) {
|
||||
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
|
||||
theme.unload_stylesheet(extension.stylesheet);
|
||||
delete extension.stylesheet;
|
||||
}
|
||||
logExtensionError(uuid, e);
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
function logExtensionError(uuid, error) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
if (!extension)
|
||||
return;
|
||||
try {
|
||||
extension.stateObj.disable();
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
}
|
||||
|
||||
let message = '' + error;
|
||||
for (let i = 0; i < order.length; i++) {
|
||||
let uuid = order[i];
|
||||
try {
|
||||
this.lookup(uuid).stateObj.enable();
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
}
|
||||
}
|
||||
|
||||
extension.state = ExtensionState.ERROR;
|
||||
if (!extension.errors)
|
||||
extension.errors = [];
|
||||
extension.errors.push(message);
|
||||
this._extensionOrder.splice(orderIdx, 1);
|
||||
|
||||
log('Extension "%s" had error: %s'.format(uuid, message));
|
||||
_signals.emit('extension-state-changed', { uuid: uuid,
|
||||
error: message,
|
||||
state: extension.state });
|
||||
}
|
||||
|
||||
function loadExtension(extension) {
|
||||
// Default to error, we set success as the last step
|
||||
extension.state = ExtensionState.ERROR;
|
||||
|
||||
let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
|
||||
|
||||
if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
|
||||
extension.state = ExtensionState.OUT_OF_DATE;
|
||||
} else {
|
||||
let enabled = enabledExtensions.indexOf(extension.uuid) != -1;
|
||||
if (enabled) {
|
||||
if (!initExtension(extension.uuid))
|
||||
return;
|
||||
if (extension.state == ExtensionState.DISABLED)
|
||||
enableExtension(extension.uuid);
|
||||
} else {
|
||||
extension.state = ExtensionState.INITIALIZED;
|
||||
if (extension.state != ExtensionState.ERROR) {
|
||||
extension.state = ExtensionState.DISABLED;
|
||||
this.emit('extension-state-changed', extension);
|
||||
}
|
||||
}
|
||||
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
}
|
||||
_callExtensionEnable(uuid) {
|
||||
if (!Main.sessionMode.allowExtensions)
|
||||
return;
|
||||
|
||||
function unloadExtension(extension) {
|
||||
// Try to disable it -- if it's ERROR'd, we can't guarantee that,
|
||||
// but it will be removed on next reboot, and hopefully nothing
|
||||
// broke too much.
|
||||
disableExtension(extension.uuid);
|
||||
let extension = this.lookup(uuid);
|
||||
if (!extension)
|
||||
return;
|
||||
|
||||
extension.state = ExtensionState.UNINSTALLED;
|
||||
_signals.emit('extension-state-changed', extension);
|
||||
if (extension.state == ExtensionState.INITIALIZED)
|
||||
this._callExtensionInit(uuid);
|
||||
|
||||
delete ExtensionUtils.extensions[extension.uuid];
|
||||
return true;
|
||||
}
|
||||
if (extension.state != ExtensionState.DISABLED)
|
||||
return;
|
||||
|
||||
function reloadExtension(oldExtension) {
|
||||
// Grab the things we'll need to pass to createExtensionObject
|
||||
// to reload it.
|
||||
let { uuid: uuid, dir: dir, type: type } = oldExtension;
|
||||
let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
|
||||
let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
|
||||
for (let i = 0; i < stylesheetNames.length; i++) {
|
||||
try {
|
||||
let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
|
||||
theme.load_stylesheet(stylesheetFile);
|
||||
extension.stylesheet = stylesheetFile;
|
||||
break;
|
||||
} catch (e) {
|
||||
if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
|
||||
continue; // not an error
|
||||
this.logExtensionError(uuid, e);
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
// Then unload the old extension.
|
||||
unloadExtension(oldExtension);
|
||||
|
||||
// Now, recreate the extension and load it.
|
||||
let newExtension;
|
||||
try {
|
||||
newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type);
|
||||
} catch(e) {
|
||||
logExtensionError(uuid, e);
|
||||
return;
|
||||
}
|
||||
|
||||
loadExtension(newExtension);
|
||||
}
|
||||
|
||||
function initExtension(uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
let dir = extension.dir;
|
||||
|
||||
if (!extension)
|
||||
throw new Error("Extension was not properly created. Call loadExtension first");
|
||||
|
||||
let extensionJs = dir.get_child('extension.js');
|
||||
if (!extensionJs.query_exists(null)) {
|
||||
logExtensionError(uuid, new Error('Missing extension.js'));
|
||||
return false;
|
||||
}
|
||||
|
||||
let extensionModule;
|
||||
let extensionState = null;
|
||||
|
||||
ExtensionUtils.installImporter(extension);
|
||||
try {
|
||||
extensionModule = extension.imports.extension;
|
||||
} catch(e) {
|
||||
logExtensionError(uuid, e);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (extensionModule.init) {
|
||||
try {
|
||||
extensionState = extensionModule.init(extension);
|
||||
} catch(e) {
|
||||
logExtensionError(uuid, e);
|
||||
extension.stateObj.enable();
|
||||
extension.state = ExtensionState.ENABLED;
|
||||
this._extensionOrder.push(uuid);
|
||||
this.emit('extension-state-changed', extension);
|
||||
} catch (e) {
|
||||
if (extension.stylesheet) {
|
||||
theme.unload_stylesheet(extension.stylesheet);
|
||||
delete extension.stylesheet;
|
||||
}
|
||||
this.logExtensionError(uuid, e);
|
||||
}
|
||||
}
|
||||
|
||||
enableExtension(uuid) {
|
||||
if (!this._extensions.has(uuid))
|
||||
return false;
|
||||
|
||||
let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
|
||||
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
|
||||
|
||||
if (disabledExtensions.includes(uuid)) {
|
||||
disabledExtensions = disabledExtensions.filter(item => item !== uuid);
|
||||
global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
|
||||
}
|
||||
|
||||
if (!enabledExtensions.includes(uuid)) {
|
||||
enabledExtensions.push(uuid);
|
||||
global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
disableExtension(uuid) {
|
||||
if (!this._extensions.has(uuid))
|
||||
return false;
|
||||
|
||||
let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
|
||||
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
|
||||
|
||||
if (enabledExtensions.includes(uuid)) {
|
||||
enabledExtensions = enabledExtensions.filter(item => item !== uuid);
|
||||
global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
|
||||
}
|
||||
|
||||
if (!disabledExtensions.includes(uuid)) {
|
||||
disabledExtensions.push(uuid);
|
||||
global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
logExtensionError(uuid, error) {
|
||||
let extension = this.lookup(uuid);
|
||||
if (!extension)
|
||||
return;
|
||||
|
||||
let message = `${error}`;
|
||||
|
||||
extension.error = message;
|
||||
extension.state = ExtensionState.ERROR;
|
||||
if (!extension.errors)
|
||||
extension.errors = [];
|
||||
extension.errors.push(message);
|
||||
|
||||
logError(error, `Extension ${uuid}`);
|
||||
this.emit('extension-state-changed', extension);
|
||||
}
|
||||
|
||||
createExtensionObject(uuid, dir, type) {
|
||||
let metadataFile = dir.get_child('metadata.json');
|
||||
if (!metadataFile.query_exists(null)) {
|
||||
throw new Error('Missing metadata.json');
|
||||
}
|
||||
|
||||
let metadataContents, success_;
|
||||
try {
|
||||
[success_, metadataContents] = metadataFile.load_contents(null);
|
||||
if (metadataContents instanceof Uint8Array)
|
||||
metadataContents = imports.byteArray.toString(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error(`Failed to load metadata.json: ${e}`);
|
||||
}
|
||||
let meta;
|
||||
try {
|
||||
meta = JSON.parse(metadataContents);
|
||||
} catch (e) {
|
||||
throw new Error(`Failed to parse metadata.json: ${e}`);
|
||||
}
|
||||
|
||||
let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
|
||||
for (let i = 0; i < requiredProperties.length; i++) {
|
||||
let prop = requiredProperties[i];
|
||||
if (!meta[prop]) {
|
||||
throw new Error(`missing "${prop}" property in metadata.json`);
|
||||
}
|
||||
}
|
||||
|
||||
if (uuid != meta.uuid) {
|
||||
throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
|
||||
}
|
||||
|
||||
let extension = {
|
||||
metadata: meta,
|
||||
uuid: meta.uuid,
|
||||
type,
|
||||
dir,
|
||||
path: dir.get_path(),
|
||||
error: '',
|
||||
hasPrefs: dir.get_child('prefs.js').query_exists(null),
|
||||
canChange: false
|
||||
};
|
||||
this._extensions.set(uuid, extension);
|
||||
|
||||
return extension;
|
||||
}
|
||||
|
||||
loadExtension(extension) {
|
||||
// Default to error, we set success as the last step
|
||||
extension.state = ExtensionState.ERROR;
|
||||
|
||||
let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
|
||||
|
||||
if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
|
||||
extension.state = ExtensionState.OUT_OF_DATE;
|
||||
} else {
|
||||
let enabled = this._enabledExtensions.includes(extension.uuid);
|
||||
if (enabled) {
|
||||
if (!this._callExtensionInit(extension.uuid))
|
||||
return;
|
||||
if (extension.state == ExtensionState.DISABLED)
|
||||
this._callExtensionEnable(extension.uuid);
|
||||
} else {
|
||||
extension.state = ExtensionState.INITIALIZED;
|
||||
}
|
||||
}
|
||||
|
||||
this._updateCanChange(extension);
|
||||
this.emit('extension-state-changed', extension);
|
||||
}
|
||||
|
||||
unloadExtension(extension) {
|
||||
// Try to disable it -- if it's ERROR'd, we can't guarantee that,
|
||||
// but it will be removed on next reboot, and hopefully nothing
|
||||
// broke too much.
|
||||
this._callExtensionDisable(extension.uuid);
|
||||
|
||||
extension.state = ExtensionState.UNINSTALLED;
|
||||
this.emit('extension-state-changed', extension);
|
||||
|
||||
this._extensions.delete(extension.uuid);
|
||||
return true;
|
||||
}
|
||||
|
||||
reloadExtension(oldExtension) {
|
||||
// Grab the things we'll need to pass to createExtensionObject
|
||||
// to reload it.
|
||||
let { uuid, dir, type } = oldExtension;
|
||||
|
||||
// Then unload the old extension.
|
||||
this.unloadExtension(oldExtension);
|
||||
|
||||
// Now, recreate the extension and load it.
|
||||
let newExtension;
|
||||
try {
|
||||
newExtension = this.createExtensionObject(uuid, dir, type);
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
return;
|
||||
}
|
||||
|
||||
this.loadExtension(newExtension);
|
||||
}
|
||||
|
||||
_callExtensionInit(uuid) {
|
||||
if (!Main.sessionMode.allowExtensions)
|
||||
return false;
|
||||
|
||||
let extension = this.lookup(uuid);
|
||||
if (!extension)
|
||||
throw new Error("Extension was not properly created. Call createExtensionObject first");
|
||||
|
||||
let dir = extension.dir;
|
||||
let extensionJs = dir.get_child('extension.js');
|
||||
if (!extensionJs.query_exists(null)) {
|
||||
this.logExtensionError(uuid, new Error('Missing extension.js'));
|
||||
return false;
|
||||
}
|
||||
|
||||
let extensionModule;
|
||||
let extensionState = null;
|
||||
|
||||
ExtensionUtils.installImporter(extension);
|
||||
try {
|
||||
extensionModule = extension.imports.extension;
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (extensionModule.init) {
|
||||
try {
|
||||
extensionState = extensionModule.init(extension);
|
||||
} catch (e) {
|
||||
this.logExtensionError(uuid, e);
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
if (!extensionState)
|
||||
extensionState = extensionModule;
|
||||
extension.stateObj = extensionState;
|
||||
|
||||
extension.state = ExtensionState.DISABLED;
|
||||
this.emit('extension-loaded', uuid);
|
||||
return true;
|
||||
}
|
||||
|
||||
if (!extensionState)
|
||||
extensionState = extensionModule;
|
||||
extension.stateObj = extensionState;
|
||||
_getModeExtensions() {
|
||||
if (Array.isArray(Main.sessionMode.enabledExtensions))
|
||||
return Main.sessionMode.enabledExtensions;
|
||||
return [];
|
||||
}
|
||||
|
||||
extension.state = ExtensionState.DISABLED;
|
||||
_signals.emit('extension-loaded', uuid);
|
||||
return true;
|
||||
}
|
||||
_updateCanChange(extension) {
|
||||
let hasError =
|
||||
extension.state == ExtensionState.ERROR ||
|
||||
extension.state == ExtensionState.OUT_OF_DATE;
|
||||
|
||||
function getEnabledExtensions() {
|
||||
let extensions;
|
||||
if (Array.isArray(Main.sessionMode.enabledExtensions))
|
||||
extensions = Main.sessionMode.enabledExtensions;
|
||||
else
|
||||
extensions = [];
|
||||
let isMode = this._getModeExtensions().includes(extension.uuid);
|
||||
let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY);
|
||||
|
||||
if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
|
||||
return extensions;
|
||||
let changeKey = isMode
|
||||
? DISABLE_USER_EXTENSIONS_KEY
|
||||
: ENABLED_EXTENSIONS_KEY;
|
||||
|
||||
return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
|
||||
}
|
||||
extension.canChange =
|
||||
!hasError &&
|
||||
global.settings.is_writable(changeKey) &&
|
||||
(isMode || !modeOnly);
|
||||
}
|
||||
|
||||
function onEnabledExtensionsChanged() {
|
||||
let newEnabledExtensions = getEnabledExtensions();
|
||||
_getEnabledExtensions() {
|
||||
let extensions = this._getModeExtensions();
|
||||
|
||||
if (!enabled)
|
||||
return;
|
||||
if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
|
||||
extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
|
||||
|
||||
// Find and enable all the newly enabled extensions: UUIDs found in the
|
||||
// new setting, but not in the old one.
|
||||
newEnabledExtensions.filter(
|
||||
uuid => !enabledExtensions.includes(uuid)
|
||||
).forEach(uuid => {
|
||||
enableExtension(uuid);
|
||||
});
|
||||
// filter out 'disabled-extensions' which takes precedence
|
||||
let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
|
||||
return extensions.filter(item => !disabledExtensions.includes(item));
|
||||
}
|
||||
|
||||
// Find and disable all the newly disabled extensions: UUIDs found in the
|
||||
// old setting, but not in the new one.
|
||||
enabledExtensions.filter(
|
||||
item => !newEnabledExtensions.includes(item)
|
||||
).forEach(uuid => {
|
||||
disableExtension(uuid);
|
||||
});
|
||||
_onUserExtensionsEnabledChanged() {
|
||||
this._onEnabledExtensionsChanged();
|
||||
this._onSettingsWritableChanged();
|
||||
}
|
||||
|
||||
enabledExtensions = newEnabledExtensions;
|
||||
}
|
||||
_onEnabledExtensionsChanged() {
|
||||
let newEnabledExtensions = this._getEnabledExtensions();
|
||||
|
||||
function _onVersionValidationChanged() {
|
||||
// we want to reload all extensions, but only enable
|
||||
// extensions when allowed by the sessionMode, so
|
||||
// temporarily disable them all
|
||||
enabledExtensions = [];
|
||||
for (let uuid in ExtensionUtils.extensions)
|
||||
reloadExtension(ExtensionUtils.extensions[uuid]);
|
||||
enabledExtensions = getEnabledExtensions();
|
||||
|
||||
if (Main.sessionMode.allowExtensions) {
|
||||
enabledExtensions.forEach(uuid => {
|
||||
enableExtension(uuid);
|
||||
// Find and enable all the newly enabled extensions: UUIDs found in the
|
||||
// new setting, but not in the old one.
|
||||
newEnabledExtensions.filter(
|
||||
uuid => !this._enabledExtensions.includes(uuid)
|
||||
).forEach(uuid => {
|
||||
this._callExtensionEnable(uuid);
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
function _loadExtensions() {
|
||||
global.settings.connect('changed::' + ENABLED_EXTENSIONS_KEY, onEnabledExtensionsChanged);
|
||||
global.settings.connect('changed::' + DISABLE_USER_EXTENSIONS_KEY, onEnabledExtensionsChanged);
|
||||
global.settings.connect('changed::' + EXTENSION_DISABLE_VERSION_CHECK_KEY, _onVersionValidationChanged);
|
||||
|
||||
enabledExtensions = getEnabledExtensions();
|
||||
|
||||
let finder = new ExtensionUtils.ExtensionFinder();
|
||||
finder.connect('extension-found', (finder, extension) => {
|
||||
loadExtension(extension);
|
||||
});
|
||||
finder.scanExtensions();
|
||||
}
|
||||
|
||||
function enableAllExtensions() {
|
||||
if (enabled)
|
||||
return;
|
||||
|
||||
if (!initted) {
|
||||
_loadExtensions();
|
||||
initted = true;
|
||||
} else {
|
||||
enabledExtensions.forEach(uuid => {
|
||||
enableExtension(uuid);
|
||||
// Find and disable all the newly disabled extensions: UUIDs found in the
|
||||
// old setting, but not in the new one.
|
||||
this._extensionOrder.filter(
|
||||
uuid => !newEnabledExtensions.includes(uuid)
|
||||
).reverse().forEach(uuid => {
|
||||
this._callExtensionDisable(uuid);
|
||||
});
|
||||
|
||||
this._enabledExtensions = newEnabledExtensions;
|
||||
}
|
||||
enabled = true;
|
||||
}
|
||||
|
||||
function disableAllExtensions() {
|
||||
if (!enabled)
|
||||
return;
|
||||
_onSettingsWritableChanged() {
|
||||
for (let extension of this._extensions.values()) {
|
||||
this._updateCanChange(extension);
|
||||
this.emit('extension-state-changed', extension);
|
||||
}
|
||||
}
|
||||
|
||||
if (initted) {
|
||||
_onVersionValidationChanged() {
|
||||
// Disabling extensions modifies the order array, so use a copy
|
||||
let extensionOrder = this._extensionOrder.slice();
|
||||
|
||||
// Disable enabled extensions in the reverse order first to avoid
|
||||
// the "rebasing" done in _callExtensionDisable...
|
||||
extensionOrder.slice().reverse().forEach(uuid => {
|
||||
disableExtension(uuid);
|
||||
this._callExtensionDisable(uuid);
|
||||
});
|
||||
|
||||
// ...and then reload and enable extensions in the correct order again.
|
||||
[...this._extensions.values()].sort((a, b) => {
|
||||
return extensionOrder.indexOf(a.uuid) - extensionOrder.indexOf(b.uuid);
|
||||
}).forEach(extension => this.reloadExtension(extension));
|
||||
}
|
||||
|
||||
_loadExtensions() {
|
||||
global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`,
|
||||
this._onEnabledExtensionsChanged.bind(this));
|
||||
global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`,
|
||||
this._onEnabledExtensionsChanged.bind(this));
|
||||
global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`,
|
||||
this._onUserExtensionsEnabledChanged.bind(this));
|
||||
global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`,
|
||||
this._onVersionValidationChanged.bind(this));
|
||||
global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`,
|
||||
this._onSettingsWritableChanged.bind(this));
|
||||
global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`,
|
||||
this._onSettingsWritableChanged.bind(this));
|
||||
|
||||
this._enabledExtensions = this._getEnabledExtensions();
|
||||
|
||||
let perUserDir = Gio.File.new_for_path(global.userdatadir);
|
||||
FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
|
||||
let fileType = info.get_file_type();
|
||||
if (fileType != Gio.FileType.DIRECTORY)
|
||||
return;
|
||||
let uuid = info.get_name();
|
||||
let existing = this.lookup(uuid);
|
||||
if (existing) {
|
||||
log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`);
|
||||
return;
|
||||
}
|
||||
|
||||
let extension;
|
||||
let type = dir.has_prefix(perUserDir)
|
||||
? ExtensionType.PER_USER
|
||||
: ExtensionType.SYSTEM;
|
||||
try {
|
||||
extension = this.createExtensionObject(uuid, dir, type);
|
||||
} catch (e) {
|
||||
logError(e, `Could not load extension ${uuid}`);
|
||||
return;
|
||||
}
|
||||
this.loadExtension(extension);
|
||||
});
|
||||
}
|
||||
|
||||
enabled = false;
|
||||
}
|
||||
_enableAllExtensions() {
|
||||
if (this._enabled)
|
||||
return;
|
||||
|
||||
function _sessionUpdated() {
|
||||
// For now sessionMode.allowExtensions controls extensions from both the
|
||||
// 'enabled-extensions' preference and the sessionMode.enabledExtensions
|
||||
// property; it might make sense to make enabledExtensions independent
|
||||
// from allowExtensions in the future
|
||||
if (Main.sessionMode.allowExtensions) {
|
||||
if (initted)
|
||||
enabledExtensions = getEnabledExtensions();
|
||||
enableAllExtensions();
|
||||
} else {
|
||||
disableAllExtensions();
|
||||
if (!this._initialized) {
|
||||
this._loadExtensions();
|
||||
this._initialized = true;
|
||||
} else {
|
||||
this._enabledExtensions.forEach(uuid => {
|
||||
this._callExtensionEnable(uuid);
|
||||
});
|
||||
}
|
||||
this._enabled = true;
|
||||
}
|
||||
}
|
||||
|
||||
function init() {
|
||||
Main.sessionMode.connect('updated', _sessionUpdated);
|
||||
_sessionUpdated();
|
||||
}
|
||||
_disableAllExtensions() {
|
||||
if (!this._enabled)
|
||||
return;
|
||||
|
||||
if (this._initialized) {
|
||||
this._extensionOrder.slice().reverse().forEach(uuid => {
|
||||
this._callExtensionDisable(uuid);
|
||||
});
|
||||
}
|
||||
|
||||
this._enabled = false;
|
||||
}
|
||||
|
||||
_sessionUpdated() {
|
||||
// For now sessionMode.allowExtensions controls extensions from both the
|
||||
// 'enabled-extensions' preference and the sessionMode.enabledExtensions
|
||||
// property; it might make sense to make enabledExtensions independent
|
||||
// from allowExtensions in the future
|
||||
if (Main.sessionMode.allowExtensions) {
|
||||
// Take care of added or removed sessionMode extensions
|
||||
this._onEnabledExtensionsChanged();
|
||||
this._enableAllExtensions();
|
||||
} else {
|
||||
this._disableAllExtensions();
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(ExtensionManager.prototype);
|
||||
|
||||
@@ -49,15 +49,15 @@ var FocusCaretTracker = class FocusCaretTracker {
|
||||
this._atspiInited = true;
|
||||
}
|
||||
|
||||
return this._atspiInited;
|
||||
return this._atspiInited;
|
||||
}
|
||||
|
||||
registerFocusListener() {
|
||||
if (!this._initAtspi() || this._focusListenerRegistered)
|
||||
return;
|
||||
|
||||
this._atspiListener.register(STATECHANGED + ':focused');
|
||||
this._atspiListener.register(STATECHANGED + ':selected');
|
||||
this._atspiListener.register(`${STATECHANGED}:focused`);
|
||||
this._atspiListener.register(`${STATECHANGED}:selected`);
|
||||
this._focusListenerRegistered = true;
|
||||
}
|
||||
|
||||
@@ -73,8 +73,8 @@ var FocusCaretTracker = class FocusCaretTracker {
|
||||
if (!this._focusListenerRegistered)
|
||||
return;
|
||||
|
||||
this._atspiListener.deregister(STATECHANGED + ':focused');
|
||||
this._atspiListener.deregister(STATECHANGED + ':selected');
|
||||
this._atspiListener.deregister(`${STATECHANGED}:focused`);
|
||||
this._atspiListener.deregister(`${STATECHANGED}:selected`);
|
||||
this._focusListenerRegistered = false;
|
||||
}
|
||||
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported GrabHelper */
|
||||
|
||||
const { Clutter, St } = imports.gi;
|
||||
|
||||
@@ -87,7 +88,7 @@ var GrabHelper = class GrabHelper {
|
||||
_isWithinGrabbedActor(actor) {
|
||||
let currentActor = this.currentGrab.actor;
|
||||
while (actor) {
|
||||
if (this._actors.indexOf(actor) != -1)
|
||||
if (this._actors.includes(actor))
|
||||
return true;
|
||||
if (actor == currentActor)
|
||||
return true;
|
||||
|
||||
@@ -1,21 +1,33 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported CandidatePopup */
|
||||
|
||||
const { Clutter, IBus, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
const { Clutter, GObject, IBus, St } = imports.gi;
|
||||
|
||||
const BoxPointer = imports.ui.boxpointer;
|
||||
const Main = imports.ui.main;
|
||||
|
||||
var MAX_CANDIDATES_PER_PAGE = 16;
|
||||
|
||||
var DEFAULT_INDEX_LABELS = [ '1', '2', '3', '4', '5', '6', '7', '8',
|
||||
'9', '0', 'a', 'b', 'c', 'd', 'e', 'f' ];
|
||||
var DEFAULT_INDEX_LABELS = ['1', '2', '3', '4', '5', '6', '7', '8',
|
||||
'9', '0', 'a', 'b', 'c', 'd', 'e', 'f'];
|
||||
|
||||
var CandidateArea = class CandidateArea {
|
||||
constructor() {
|
||||
this.actor = new St.BoxLayout({ vertical: true,
|
||||
reactive: true,
|
||||
visible: false });
|
||||
var CandidateArea = GObject.registerClass({
|
||||
Signals: {
|
||||
'candidate-clicked': { param_types: [GObject.TYPE_UINT,
|
||||
GObject.TYPE_UINT,
|
||||
Clutter.ModifierType.$gtype] },
|
||||
'cursor-down': {},
|
||||
'cursor-up': {},
|
||||
'next-page': {},
|
||||
'previous-page': {},
|
||||
}
|
||||
}, class CandidateArea extends St.BoxLayout {
|
||||
_init() {
|
||||
super._init({
|
||||
vertical: true,
|
||||
reactive: true,
|
||||
visible: false
|
||||
});
|
||||
this._candidateBoxes = [];
|
||||
for (let i = 0; i < MAX_CANDIDATES_PER_PAGE; ++i) {
|
||||
let box = new St.BoxLayout({ style_class: 'candidate-box',
|
||||
@@ -26,7 +38,7 @@ var CandidateArea = class CandidateArea {
|
||||
box.add(box._indexLabel, { y_fill: false });
|
||||
box.add(box._candidateLabel, { y_fill: false });
|
||||
this._candidateBoxes.push(box);
|
||||
this.actor.add(box);
|
||||
this.add(box);
|
||||
|
||||
let j = i;
|
||||
box.connect('button-release-event', (actor, event) => {
|
||||
@@ -35,19 +47,6 @@ var CandidateArea = class CandidateArea {
|
||||
});
|
||||
}
|
||||
|
||||
this.actor.connect('scroll-event', (actor, event) => {
|
||||
let direction = event.get_scroll_direction();
|
||||
switch(direction) {
|
||||
case Clutter.ScrollDirection.UP:
|
||||
this.emit('cursor-up');
|
||||
break;
|
||||
case Clutter.ScrollDirection.DOWN:
|
||||
this.emit('cursor-down');
|
||||
break;
|
||||
};
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
|
||||
this._buttonBox = new St.BoxLayout({ style_class: 'candidate-page-button-box' });
|
||||
|
||||
this._previousButton = new St.Button({ style_class: 'candidate-page-button candidate-page-button-previous button' });
|
||||
@@ -58,7 +57,7 @@ var CandidateArea = class CandidateArea {
|
||||
this._nextButton.child = new St.Icon({ style_class: 'candidate-page-button-icon' });
|
||||
this._buttonBox.add(this._nextButton, { expand: true });
|
||||
|
||||
this.actor.add(this._buttonBox);
|
||||
this.add(this._buttonBox);
|
||||
|
||||
this._previousButton.connect('clicked', () => {
|
||||
this.emit('previous-page');
|
||||
@@ -71,6 +70,18 @@ var CandidateArea = class CandidateArea {
|
||||
this._cursorPosition = 0;
|
||||
}
|
||||
|
||||
vfunc_scroll_event(scrollEvent) {
|
||||
switch (scrollEvent.direction) {
|
||||
case Clutter.ScrollDirection.UP:
|
||||
this.emit('cursor-up');
|
||||
break;
|
||||
case Clutter.ScrollDirection.DOWN:
|
||||
this.emit('cursor-down');
|
||||
break;
|
||||
}
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
|
||||
setOrientation(orientation) {
|
||||
if (this._orientation == orientation)
|
||||
return;
|
||||
@@ -78,15 +89,15 @@ var CandidateArea = class CandidateArea {
|
||||
this._orientation = orientation;
|
||||
|
||||
if (this._orientation == IBus.Orientation.HORIZONTAL) {
|
||||
this.actor.vertical = false;
|
||||
this.actor.remove_style_class_name('vertical');
|
||||
this.actor.add_style_class_name('horizontal');
|
||||
this.vertical = false;
|
||||
this.remove_style_class_name('vertical');
|
||||
this.add_style_class_name('horizontal');
|
||||
this._previousButton.child.icon_name = 'go-previous-symbolic';
|
||||
this._nextButton.child.icon_name = 'go-next-symbolic';
|
||||
} else { // VERTICAL || SYSTEM
|
||||
this.actor.vertical = true;
|
||||
this.actor.add_style_class_name('vertical');
|
||||
this.actor.remove_style_class_name('horizontal');
|
||||
this.vertical = true;
|
||||
this.add_style_class_name('vertical');
|
||||
this.remove_style_class_name('horizontal');
|
||||
this._previousButton.child.icon_name = 'go-up-symbolic';
|
||||
this._nextButton.child.icon_name = 'go-down-symbolic';
|
||||
}
|
||||
@@ -120,19 +131,23 @@ var CandidateArea = class CandidateArea {
|
||||
this._previousButton.reactive = wrapsAround || page > 0;
|
||||
this._nextButton.reactive = wrapsAround || page < nPages - 1;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(CandidateArea.prototype);
|
||||
});
|
||||
|
||||
var CandidatePopup = class CandidatePopup {
|
||||
constructor() {
|
||||
this._boxPointer = new BoxPointer.BoxPointer(St.Side.TOP);
|
||||
this._boxPointer.visible = false;
|
||||
this._boxPointer.style_class = 'candidate-popup-boxpointer';
|
||||
Main.layoutManager.addChrome(this._boxPointer);
|
||||
var CandidatePopup = GObject.registerClass(
|
||||
class IbusCandidatePopup extends BoxPointer.BoxPointer {
|
||||
_init() {
|
||||
super._init(St.Side.TOP);
|
||||
this.visible = false;
|
||||
this.style_class = 'candidate-popup-boxpointer';
|
||||
|
||||
this._dummyCursor = new St.Widget({ opacity: 0 });
|
||||
Main.layoutManager.uiGroup.add_actor(this._dummyCursor);
|
||||
|
||||
Main.layoutManager.addChrome(this);
|
||||
|
||||
let box = new St.BoxLayout({ style_class: 'candidate-popup-content',
|
||||
vertical: true });
|
||||
this._boxPointer.bin.set_child(box);
|
||||
this.bin.set_child(box);
|
||||
|
||||
this._preeditText = new St.Label({ style_class: 'candidate-popup-text',
|
||||
visible: false });
|
||||
@@ -143,7 +158,7 @@ var CandidatePopup = class CandidatePopup {
|
||||
box.add(this._auxText);
|
||||
|
||||
this._candidateArea = new CandidateArea();
|
||||
box.add(this._candidateArea.actor);
|
||||
box.add(this._candidateArea);
|
||||
|
||||
this._candidateArea.connect('previous-page', () => {
|
||||
this._panelService.page_up();
|
||||
@@ -181,7 +196,7 @@ var CandidatePopup = class CandidatePopup {
|
||||
let window = global.display.focus_window.get_compositor_private();
|
||||
this._setDummyCursorGeometry(window.x + x, window.y + y, w, h);
|
||||
});
|
||||
} catch(e) {
|
||||
} catch (e) {
|
||||
// Only recent IBus versions have support for this signal
|
||||
// which is used for wayland clients. In order to work
|
||||
// with older IBus versions we can silently ignore the
|
||||
@@ -198,30 +213,30 @@ var CandidatePopup = class CandidatePopup {
|
||||
this._setTextAttributes(this._preeditText.clutter_text,
|
||||
attrs);
|
||||
});
|
||||
panelService.connect('show-preedit-text', ps => {
|
||||
panelService.connect('show-preedit-text', () => {
|
||||
this._preeditText.show();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('hide-preedit-text', ps => {
|
||||
panelService.connect('hide-preedit-text', () => {
|
||||
this._preeditText.hide();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('update-auxiliary-text', (ps, text, visible) => {
|
||||
panelService.connect('update-auxiliary-text', (_ps, text, visible) => {
|
||||
this._auxText.visible = visible;
|
||||
this._updateVisibility();
|
||||
|
||||
this._auxText.text = text.get_text();
|
||||
});
|
||||
panelService.connect('show-auxiliary-text', ps => {
|
||||
panelService.connect('show-auxiliary-text', () => {
|
||||
this._auxText.show();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('hide-auxiliary-text', ps => {
|
||||
panelService.connect('hide-auxiliary-text', () => {
|
||||
this._auxText.hide();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('update-lookup-table', (ps, lookupTable, visible) => {
|
||||
this._candidateArea.actor.visible = visible;
|
||||
panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => {
|
||||
this._candidateArea.visible = visible;
|
||||
this._updateVisibility();
|
||||
|
||||
let nCandidates = lookupTable.get_number_of_candidates();
|
||||
@@ -235,7 +250,7 @@ var CandidatePopup = class CandidatePopup {
|
||||
let indexes = [];
|
||||
let indexLabel;
|
||||
for (let i = 0; (indexLabel = lookupTable.get_label(i)); ++i)
|
||||
indexes.push(indexLabel.get_text());
|
||||
indexes.push(indexLabel.get_text());
|
||||
|
||||
Main.keyboard.resetSuggestions();
|
||||
|
||||
@@ -256,38 +271,40 @@ var CandidatePopup = class CandidatePopup {
|
||||
this._candidateArea.setOrientation(lookupTable.get_orientation());
|
||||
this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
|
||||
});
|
||||
panelService.connect('show-lookup-table', ps => {
|
||||
this._candidateArea.actor.show();
|
||||
panelService.connect('show-lookup-table', () => {
|
||||
this._candidateArea.show();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('hide-lookup-table', ps => {
|
||||
this._candidateArea.actor.hide();
|
||||
panelService.connect('hide-lookup-table', () => {
|
||||
this._candidateArea.hide();
|
||||
this._updateVisibility();
|
||||
});
|
||||
panelService.connect('focus-out', ps => {
|
||||
this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
|
||||
panelService.connect('focus-out', () => {
|
||||
this.close(BoxPointer.PopupAnimation.NONE);
|
||||
Main.keyboard.resetSuggestions();
|
||||
});
|
||||
}
|
||||
|
||||
_setDummyCursorGeometry(x, y, w, h) {
|
||||
Main.layoutManager.setDummyCursorGeometry(x, y, w, h);
|
||||
if (this._boxPointer.visible)
|
||||
this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
|
||||
this._dummyCursor.set_position(Math.round(x), Math.round(y));
|
||||
this._dummyCursor.set_size(Math.round(w), Math.round(h));
|
||||
|
||||
if (this.visible)
|
||||
this.setPosition(this._dummyCursor, 0);
|
||||
}
|
||||
|
||||
_updateVisibility() {
|
||||
let isVisible = (!Main.keyboard.visible &&
|
||||
(this._preeditText.visible ||
|
||||
this._auxText.visible ||
|
||||
this._candidateArea.actor.visible));
|
||||
this._candidateArea.visible));
|
||||
|
||||
if (isVisible) {
|
||||
this._boxPointer.setPosition(Main.layoutManager.dummyCursor, 0);
|
||||
this._boxPointer.open(BoxPointer.PopupAnimation.NONE);
|
||||
this._boxPointer.raise_top();
|
||||
this.setPosition(this._dummyCursor, 0);
|
||||
this.open(BoxPointer.PopupAnimation.NONE);
|
||||
this.raise_top();
|
||||
} else {
|
||||
this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
|
||||
this.close(BoxPointer.PopupAnimation.NONE);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -297,4 +314,4 @@ var CandidatePopup = class CandidatePopup {
|
||||
if (attr.get_attr_type() == IBus.AttrType.BACKGROUND)
|
||||
clutterText.set_selection(attr.get_start_index(), attr.get_end_index());
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
@@ -1,22 +1,22 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported BaseIcon, IconGrid, PaginatedIconGrid */
|
||||
|
||||
const { Clutter, GObject, Meta, St } = imports.gi;
|
||||
const { Clutter, GLib, GObject, Graphene, Meta, St } = imports.gi;
|
||||
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Main = imports.ui.main;
|
||||
|
||||
var ICON_SIZE = 96;
|
||||
var MIN_ICON_SIZE = 16;
|
||||
|
||||
var EXTRA_SPACE_ANIMATION_TIME = 0.25;
|
||||
var EXTRA_SPACE_ANIMATION_TIME = 250;
|
||||
|
||||
var ANIMATION_TIME_IN = 0.350;
|
||||
var ANIMATION_TIME_OUT = 1/2 * ANIMATION_TIME_IN;
|
||||
var ANIMATION_MAX_DELAY_FOR_ITEM = 2/3 * ANIMATION_TIME_IN;
|
||||
var ANIMATION_BASE_DELAY_FOR_ITEM = 1/4 * ANIMATION_MAX_DELAY_FOR_ITEM;
|
||||
var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2/3 * ANIMATION_TIME_OUT;
|
||||
var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1/4 * ANIMATION_TIME_IN;
|
||||
var ANIMATION_TIME_IN = 350;
|
||||
var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN;
|
||||
var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN;
|
||||
var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM;
|
||||
var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2 / 3 * ANIMATION_TIME_OUT;
|
||||
var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1 / 4 * ANIMATION_TIME_IN;
|
||||
|
||||
var ANIMATION_BOUNCE_ICON_SCALE = 1.1;
|
||||
|
||||
@@ -26,7 +26,7 @@ var AnimationDirection = {
|
||||
};
|
||||
|
||||
var APPICON_ANIMATION_OUT_SCALE = 3;
|
||||
var APPICON_ANIMATION_OUT_TIME = 0.25;
|
||||
var APPICON_ANIMATION_OUT_TIME = 250;
|
||||
|
||||
var BaseIcon = GObject.registerClass(
|
||||
class BaseIcon extends St.Bin {
|
||||
@@ -56,6 +56,10 @@ class BaseIcon extends St.Bin {
|
||||
|
||||
if (params.showLabel) {
|
||||
this.label = new St.Label({ text: label });
|
||||
this.label.clutter_text.set({
|
||||
x_align: Clutter.ActorAlign.CENTER,
|
||||
y_align: Clutter.ActorAlign.CENTER
|
||||
});
|
||||
this._box.add_actor(this.label);
|
||||
} else {
|
||||
this.label = null;
|
||||
@@ -71,14 +75,14 @@ class BaseIcon extends St.Bin {
|
||||
this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this));
|
||||
}
|
||||
|
||||
vfunc_get_preferred_width(forHeight) {
|
||||
vfunc_get_preferred_width(_forHeight) {
|
||||
// Return the actual height to keep the squared aspect
|
||||
return this.get_preferred_height(-1);
|
||||
}
|
||||
|
||||
// This can be overridden by a subclass, or by the createIcon
|
||||
// parameter to _init()
|
||||
createIcon(size) {
|
||||
createIcon(_size) {
|
||||
throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`);
|
||||
}
|
||||
|
||||
@@ -137,17 +141,30 @@ class BaseIcon extends St.Bin {
|
||||
// animating.
|
||||
zoomOutActor(this.child);
|
||||
}
|
||||
|
||||
animateZoomOutAtPos(x, y) {
|
||||
zoomOutActorAtPos(this.child, x, y);
|
||||
}
|
||||
|
||||
update() {
|
||||
this._createIconTexture(this.iconSize);
|
||||
}
|
||||
});
|
||||
|
||||
function clamp(value, min, max) {
|
||||
return Math.max(Math.min(value, max), min);
|
||||
};
|
||||
}
|
||||
|
||||
function zoomOutActor(actor) {
|
||||
let [x, y] = actor.get_transformed_position();
|
||||
zoomOutActorAtPos(actor, x, y);
|
||||
}
|
||||
|
||||
function zoomOutActorAtPos(actor, x, y) {
|
||||
let actorClone = new Clutter.Clone({ source: actor,
|
||||
reactive: false });
|
||||
let [width, height] = actor.get_transformed_size();
|
||||
let [x, y] = actor.get_transformed_position();
|
||||
|
||||
actorClone.set_size(width, height);
|
||||
actorClone.set_position(x, y);
|
||||
actorClone.opacity = 255;
|
||||
@@ -164,23 +181,21 @@ function zoomOutActor(actor) {
|
||||
let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth);
|
||||
let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight);
|
||||
|
||||
Tweener.addTween(actorClone,
|
||||
{ time: APPICON_ANIMATION_OUT_TIME,
|
||||
scale_x: APPICON_ANIMATION_OUT_SCALE,
|
||||
scale_y: APPICON_ANIMATION_OUT_SCALE,
|
||||
translation_x: containedX - scaledX,
|
||||
translation_y: containedY - scaledY,
|
||||
opacity: 0,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
actorClone.destroy();
|
||||
}
|
||||
});
|
||||
actorClone.ease({
|
||||
scale_x: APPICON_ANIMATION_OUT_SCALE,
|
||||
scale_y: APPICON_ANIMATION_OUT_SCALE,
|
||||
translation_x: containedX - scaledX,
|
||||
translation_y: containedY - scaledY,
|
||||
opacity: 0,
|
||||
duration: APPICON_ANIMATION_OUT_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => actorClone.destroy()
|
||||
});
|
||||
}
|
||||
|
||||
var IconGrid = GObject.registerClass({
|
||||
Signals: {'animation-done': {},
|
||||
'child-focused': { param_types: [Clutter.Actor.$gtype]} },
|
||||
Signals: { 'animation-done': {},
|
||||
'child-focused': { param_types: [Clutter.Actor.$gtype] } },
|
||||
}, class IconGrid extends St.Widget {
|
||||
_init(params) {
|
||||
super._init({ style_class: 'icon-grid',
|
||||
@@ -206,6 +221,8 @@ var IconGrid = GObject.registerClass({
|
||||
this.rightPadding = 0;
|
||||
this.leftPadding = 0;
|
||||
|
||||
this._updateIconSizesLaterId = 0;
|
||||
|
||||
this._items = [];
|
||||
this._clonesAnimating = [];
|
||||
// Pulled from CSS, but hardcode some defaults here
|
||||
@@ -214,15 +231,23 @@ var IconGrid = GObject.registerClass({
|
||||
this._fixedHItemSize = this._fixedVItemSize = undefined;
|
||||
this.connect('style-changed', this._onStyleChanged.bind(this));
|
||||
|
||||
// Cancel animations when hiding the overview, to avoid icons
|
||||
// swarming into the void ...
|
||||
this.connect('notify::mapped', () => {
|
||||
if (!this.mapped)
|
||||
this._cancelAnimation();
|
||||
});
|
||||
|
||||
this.connect('actor-added', this._childAdded.bind(this));
|
||||
this.connect('actor-removed', this._childRemoved.bind(this));
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
}
|
||||
|
||||
vfunc_unmap() {
|
||||
// Cancel animations when hiding the overview, to avoid icons
|
||||
// swarming into the void ...
|
||||
this._resetAnimationActors();
|
||||
super.vfunc_unmap();
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
if (this._updateIconSizesLaterId) {
|
||||
Meta.later_remove (this._updateIconSizesLaterId);
|
||||
this._updateIconSizesLaterId = 0;
|
||||
}
|
||||
}
|
||||
|
||||
_keyFocusIn(actor) {
|
||||
@@ -231,22 +256,35 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
_childAdded(grid, child) {
|
||||
child._iconGridKeyFocusInId = child.connect('key-focus-in', this._keyFocusIn.bind(this));
|
||||
|
||||
child._paintVisible = child.opacity > 0;
|
||||
child._opacityChangedId = child.connect('notify::opacity', () => {
|
||||
let paintVisible = child._paintVisible;
|
||||
child._paintVisible = child.opacity > 0;
|
||||
if (paintVisible !== child._paintVisible)
|
||||
this.queue_relayout();
|
||||
});
|
||||
}
|
||||
|
||||
_childRemoved(grid, child) {
|
||||
child.disconnect(child._iconGridKeyFocusInId);
|
||||
delete child._iconGridKeyFocusInId;
|
||||
|
||||
child.disconnect(child._opacityChangedId);
|
||||
delete child._opacityChangedId;
|
||||
delete child._paintVisible;
|
||||
}
|
||||
|
||||
vfunc_get_preferred_width(forHeight) {
|
||||
vfunc_get_preferred_width(_forHeight) {
|
||||
if (this._fillParent)
|
||||
// Ignore all size requests of children and request a size of 0;
|
||||
// later we'll allocate as many children as fit the parent
|
||||
return [0, 0];
|
||||
|
||||
let nChildren = this.get_n_children();
|
||||
let nColumns = this._colLimit ? Math.min(this._colLimit,
|
||||
nChildren)
|
||||
: nChildren;
|
||||
let nColumns = this._colLimit
|
||||
? Math.min(this._colLimit, nChildren)
|
||||
: nChildren;
|
||||
let totalSpacing = Math.max(0, nColumns - 1) * this._getSpacing();
|
||||
// Kind of a lie, but not really an issue right now. If
|
||||
// we wanted to support some sort of hidden/overflow that would
|
||||
@@ -276,7 +314,7 @@ var IconGrid = GObject.registerClass({
|
||||
if (forWidth < 0)
|
||||
nColumns = children.length;
|
||||
else
|
||||
[nColumns, ] = this._computeLayout(forWidth);
|
||||
[nColumns] = this._computeLayout(forWidth);
|
||||
|
||||
let nRows;
|
||||
if (nColumns > 0)
|
||||
@@ -311,15 +349,15 @@ var IconGrid = GObject.registerClass({
|
||||
let [nColumns, usedWidth] = this._computeLayout(availWidth);
|
||||
|
||||
let leftEmptySpace;
|
||||
switch(this._xAlign) {
|
||||
case St.Align.START:
|
||||
leftEmptySpace = 0;
|
||||
break;
|
||||
case St.Align.MIDDLE:
|
||||
leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
|
||||
break;
|
||||
case St.Align.END:
|
||||
leftEmptySpace = availWidth - usedWidth;
|
||||
switch (this._xAlign) {
|
||||
case St.Align.START:
|
||||
leftEmptySpace = 0;
|
||||
break;
|
||||
case St.Align.MIDDLE:
|
||||
leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
|
||||
break;
|
||||
case St.Align.END:
|
||||
leftEmptySpace = availWidth - usedWidth;
|
||||
}
|
||||
|
||||
let animating = this._clonesAnimating.length > 0;
|
||||
@@ -364,7 +402,7 @@ var IconGrid = GObject.registerClass({
|
||||
let allocationBox = this.get_allocation_box();
|
||||
let paintBox = themeNode.get_paint_box(allocationBox);
|
||||
|
||||
let origin = new Clutter.Vertex();
|
||||
let origin = new Graphene.Point3D();
|
||||
origin.x = paintBox.x1 - allocationBox.x1;
|
||||
origin.y = paintBox.y1 - allocationBox.y1;
|
||||
origin.z = 0.0;
|
||||
@@ -377,15 +415,15 @@ var IconGrid = GObject.registerClass({
|
||||
return true;
|
||||
|
||||
for (let child = this.get_first_child();
|
||||
child != null;
|
||||
child = child.get_next_sibling()) {
|
||||
child != null;
|
||||
child = child.get_next_sibling()) {
|
||||
|
||||
if (!child.visible || !child.opacity)
|
||||
continue;
|
||||
|
||||
let childVolume = child.get_transformed_paint_volume(this);
|
||||
if (!childVolume)
|
||||
return false
|
||||
return false;
|
||||
|
||||
paintVolume.union(childVolume);
|
||||
}
|
||||
@@ -398,21 +436,20 @@ var IconGrid = GObject.registerClass({
|
||||
* set of items to be animated.
|
||||
*/
|
||||
_getChildrenToAnimate() {
|
||||
return this._getVisibleChildren();
|
||||
return this._getVisibleChildren().filter(child => child.opacity > 0);
|
||||
}
|
||||
|
||||
_cancelAnimation() {
|
||||
this._clonesAnimating.forEach(clone => { clone.destroy(); });
|
||||
this._clonesAnimating = [];
|
||||
}
|
||||
|
||||
_animationDone() {
|
||||
_resetAnimationActors() {
|
||||
this._clonesAnimating.forEach(clone => {
|
||||
clone.source.reactive = true;
|
||||
clone.source.opacity = 255;
|
||||
clone.destroy();
|
||||
});
|
||||
this._clonesAnimating = [];
|
||||
}
|
||||
|
||||
_animationDone() {
|
||||
this._resetAnimationActors();
|
||||
this.emit('animation-done');
|
||||
}
|
||||
|
||||
@@ -421,7 +458,7 @@ var IconGrid = GObject.registerClass({
|
||||
throw new GObject.NotImplementedError("Pulse animation only implements " +
|
||||
"'in' animation direction");
|
||||
|
||||
this._cancelAnimation();
|
||||
this._resetAnimationActors();
|
||||
|
||||
let actors = this._getChildrenToAnimate();
|
||||
if (actors.length == 0) {
|
||||
@@ -444,30 +481,32 @@ var IconGrid = GObject.registerClass({
|
||||
let delay = index / actors.length * maxDelay;
|
||||
let bounceUpTime = ANIMATION_TIME_IN / 4;
|
||||
let isLastItem = index == actors.length - 1;
|
||||
Tweener.addTween(actor,
|
||||
{ time: bounceUpTime,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
scale_x: ANIMATION_BOUNCE_ICON_SCALE,
|
||||
scale_y: ANIMATION_BOUNCE_ICON_SCALE,
|
||||
onComplete: () => {
|
||||
Tweener.addTween(actor,
|
||||
{ time: ANIMATION_TIME_IN - bounceUpTime,
|
||||
transition: 'easeInOutQuad',
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
onComplete: () => {
|
||||
if (isLastItem)
|
||||
this._animationDone();
|
||||
}
|
||||
});
|
||||
}
|
||||
});
|
||||
actor.ease({
|
||||
scale_x: ANIMATION_BOUNCE_ICON_SCALE,
|
||||
scale_y: ANIMATION_BOUNCE_ICON_SCALE,
|
||||
duration: bounceUpTime,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay: delay,
|
||||
onComplete: () => {
|
||||
let duration = ANIMATION_TIME_IN - bounceUpTime;
|
||||
actor.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
if (isLastItem)
|
||||
this._animationDone();
|
||||
actor.reactive = true;
|
||||
}
|
||||
});
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
animateSpring(animationDirection, sourceActor) {
|
||||
this._cancelAnimation();
|
||||
this._resetAnimationActors();
|
||||
|
||||
let actors = this._getChildrenToAnimate();
|
||||
if (actors.length == 0) {
|
||||
@@ -504,7 +543,7 @@ var IconGrid = GObject.registerClass({
|
||||
this._clonesAnimating.push(actorClone);
|
||||
Main.uiGroup.add_actor(actorClone);
|
||||
|
||||
let [width, height,,] = this._getAllocatedChildSizeAndSpacing(actor);
|
||||
let [width, height] = this._getAllocatedChildSizeAndSpacing(actor);
|
||||
actorClone.set_size(width, height);
|
||||
let scaleX = sourceScaledWidth / width;
|
||||
let scaleY = sourceScaledHeight / height;
|
||||
@@ -521,21 +560,25 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM;
|
||||
let [finalX, finalY] = actor._transformedPosition;
|
||||
movementParams = { time: ANIMATION_TIME_IN,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
x: finalX,
|
||||
y: finalY,
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
onComplete: () => {
|
||||
if (isLastItem)
|
||||
this._animationDone();
|
||||
}};
|
||||
fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
opacity: 255 };
|
||||
movementParams = {
|
||||
x: finalX,
|
||||
y: finalY,
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration: ANIMATION_TIME_IN,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay
|
||||
};
|
||||
|
||||
if (isLastItem)
|
||||
movementParams.onComplete = this._animationDone.bind(this);
|
||||
|
||||
fadeParams = {
|
||||
opacity: 255,
|
||||
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay
|
||||
};
|
||||
} else {
|
||||
let isLastItem = actor._distance == maxDist;
|
||||
|
||||
@@ -543,26 +586,29 @@ var IconGrid = GObject.registerClass({
|
||||
actorClone.set_position(startX, startY);
|
||||
|
||||
let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM;
|
||||
movementParams = { time: ANIMATION_TIME_OUT,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: delay,
|
||||
x: adjustedSourcePositionX,
|
||||
y: adjustedSourcePositionY,
|
||||
scale_x: scaleX,
|
||||
scale_y: scaleY,
|
||||
onComplete: () => {
|
||||
if (isLastItem)
|
||||
this._animationDone();
|
||||
}};
|
||||
fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
transition: 'easeInOutQuad',
|
||||
delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
opacity: 0 };
|
||||
movementParams = {
|
||||
x: adjustedSourcePositionX,
|
||||
y: adjustedSourcePositionY,
|
||||
scale_x: scaleX,
|
||||
scale_y: scaleY,
|
||||
duration: ANIMATION_TIME_OUT,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay
|
||||
};
|
||||
|
||||
if (isLastItem)
|
||||
movementParams.onComplete = this._animationDone.bind(this);
|
||||
|
||||
fadeParams = {
|
||||
opacity: 0,
|
||||
duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
|
||||
};
|
||||
}
|
||||
|
||||
|
||||
Tweener.addTween(actorClone, movementParams);
|
||||
Tweener.addTween(actorClone, fadeParams);
|
||||
actorClone.ease(movementParams);
|
||||
actorClone.ease(fadeParams);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -602,6 +648,8 @@ var IconGrid = GObject.registerClass({
|
||||
}
|
||||
|
||||
_computeLayout(forWidth) {
|
||||
this.ensure_style();
|
||||
|
||||
let nColumns = 0;
|
||||
let usedWidth = this.leftPadding + this.rightPadding;
|
||||
let spacing = this._getSpacing();
|
||||
@@ -669,13 +717,13 @@ var IconGrid = GObject.registerClass({
|
||||
|
||||
this._items.push(item);
|
||||
if (index !== undefined)
|
||||
this.insert_child_at_index(item.actor, index);
|
||||
this.insert_child_at_index(item, index);
|
||||
else
|
||||
this.add_actor(item.actor);
|
||||
this.add_actor(item);
|
||||
}
|
||||
|
||||
removeItem(item) {
|
||||
this.remove_child(item.actor);
|
||||
this.remove_child(item);
|
||||
}
|
||||
|
||||
getItemAtIndex(index) {
|
||||
@@ -710,8 +758,8 @@ var IconGrid = GObject.registerClass({
|
||||
if (this._padWithSpacing) {
|
||||
// minRows + 1 because we want to put spacing before the first row, so it is like we have one more row
|
||||
// to divide the empty space
|
||||
maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows +1));
|
||||
maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns +1));
|
||||
maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows + 1));
|
||||
maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns + 1));
|
||||
} else {
|
||||
if (this._minRows <= 1)
|
||||
maxVSpacing = maxEmptyVArea;
|
||||
@@ -743,36 +791,39 @@ var IconGrid = GObject.registerClass({
|
||||
this._fixedHItemSize = this._hItemSize;
|
||||
this._fixedVItemSize = this._vItemSize;
|
||||
this._updateSpacingForSize(availWidth, availHeight);
|
||||
let spacing = this._getSpacing();
|
||||
|
||||
if (this.columnsForWidth(availWidth) < this._minColumns || this.rowsForHeight(availHeight) < this._minRows) {
|
||||
let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth ;
|
||||
let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight ;
|
||||
let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth;
|
||||
let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight;
|
||||
|
||||
let neededSpacePerItem = (neededWidth > neededHeight) ? Math.ceil(neededWidth / this._minColumns)
|
||||
: Math.ceil(neededHeight / this._minRows);
|
||||
let neededSpacePerItem = (neededWidth > neededHeight)
|
||||
? Math.ceil(neededWidth / this._minColumns)
|
||||
: Math.ceil(neededHeight / this._minRows);
|
||||
this._fixedHItemSize = Math.max(this._hItemSize - neededSpacePerItem, MIN_ICON_SIZE);
|
||||
this._fixedVItemSize = Math.max(this._vItemSize - neededSpacePerItem, MIN_ICON_SIZE);
|
||||
|
||||
this._updateSpacingForSize(availWidth, availHeight);
|
||||
}
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
|
||||
this._updateIconSizes.bind(this));
|
||||
if (!this._updateIconSizesLaterId)
|
||||
this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
|
||||
this._updateIconSizes.bind(this));
|
||||
}
|
||||
|
||||
// Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
|
||||
_updateIconSizes() {
|
||||
this._updateIconSizesLaterId = 0;
|
||||
let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
|
||||
let newIconSize = Math.floor(ICON_SIZE * scale);
|
||||
for (let i in this._items) {
|
||||
this._items[i].icon.setIconSize(newIconSize);
|
||||
}
|
||||
return GLib.SOURCE_REMOVE;
|
||||
}
|
||||
});
|
||||
|
||||
var PaginatedIconGrid = GObject.registerClass({
|
||||
Signals: {'space-opened': {},
|
||||
'space-closed': {} },
|
||||
Signals: { 'space-opened': {},
|
||||
'space-closed': {} },
|
||||
}, class PaginatedIconGrid extends IconGrid {
|
||||
_init(params) {
|
||||
super._init(params);
|
||||
@@ -783,13 +834,13 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
this._childrenPerPage = 0;
|
||||
}
|
||||
|
||||
vfunc_get_preferred_height(forWidth) {
|
||||
vfunc_get_preferred_height(_forWidth) {
|
||||
let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages;
|
||||
return [height, height];
|
||||
}
|
||||
|
||||
vfunc_allocate(box, flags) {
|
||||
if (this._childrenPerPage == 0)
|
||||
if (this._childrenPerPage == 0)
|
||||
log('computePages() must be called before allocate(); pagination will not work.');
|
||||
|
||||
this.set_allocation(box, flags);
|
||||
@@ -802,26 +853,24 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
}
|
||||
let children = this._getVisibleChildren();
|
||||
let availWidth = box.x2 - box.x1;
|
||||
let availHeight = box.y2 - box.y1;
|
||||
let spacing = this._getSpacing();
|
||||
let [nColumns, usedWidth] = this._computeLayout(availWidth);
|
||||
|
||||
let leftEmptySpace;
|
||||
switch(this._xAlign) {
|
||||
case St.Align.START:
|
||||
leftEmptySpace = 0;
|
||||
break;
|
||||
case St.Align.MIDDLE:
|
||||
leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
|
||||
break;
|
||||
case St.Align.END:
|
||||
leftEmptySpace = availWidth - usedWidth;
|
||||
switch (this._xAlign) {
|
||||
case St.Align.START:
|
||||
leftEmptySpace = 0;
|
||||
break;
|
||||
case St.Align.MIDDLE:
|
||||
leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
|
||||
break;
|
||||
case St.Align.END:
|
||||
leftEmptySpace = availWidth - usedWidth;
|
||||
}
|
||||
|
||||
let x = box.x1 + leftEmptySpace + this.leftPadding;
|
||||
let y = box.y1 + this.topPadding;
|
||||
let columnIndex = 0;
|
||||
let rowIndex = 0;
|
||||
|
||||
for (let i = 0; i < children.length; i++) {
|
||||
let childBox = this._calculateChildBox(children[i], x, y, box);
|
||||
@@ -831,21 +880,21 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
columnIndex++;
|
||||
if (columnIndex == nColumns) {
|
||||
columnIndex = 0;
|
||||
rowIndex++;
|
||||
}
|
||||
if (columnIndex == 0) {
|
||||
y += this._getVItemSize() + spacing;
|
||||
if ((i + 1) % this._childrenPerPage == 0)
|
||||
y += this._spaceBetweenPages - spacing + this.bottomPadding + this.topPadding;
|
||||
x = box.x1 + leftEmptySpace + this.leftPadding;
|
||||
} else
|
||||
} else {
|
||||
x += this._getHItemSize() + spacing;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// Overridden from IconGrid
|
||||
_getChildrenToAnimate() {
|
||||
let children = this._getVisibleChildren();
|
||||
let children = super._getChildrenToAnimate();
|
||||
let firstIndex = this._childrenPerPage * this.currentPage;
|
||||
let lastIndex = firstIndex + this._childrenPerPage;
|
||||
|
||||
@@ -853,7 +902,7 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
}
|
||||
|
||||
_computePages(availWidthPerPage, availHeightPerPage) {
|
||||
let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage);
|
||||
let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage);
|
||||
let nRows;
|
||||
let children = this._getVisibleChildren();
|
||||
if (nColumns > 0)
|
||||
@@ -863,7 +912,6 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
if (this._rowLimit)
|
||||
nRows = Math.min(nRows, this._rowLimit);
|
||||
|
||||
let spacing = this._getSpacing();
|
||||
// We want to contain the grid inside the parent box with padding
|
||||
this._rowsPerPage = this.rowsForHeight(availHeightPerPage);
|
||||
this._nPages = Math.ceil(nRows / this._rowsPerPage);
|
||||
@@ -892,7 +940,7 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
if (!this._nPages)
|
||||
return 0;
|
||||
|
||||
let firstPageItem = pageNumber * this._childrenPerPage
|
||||
let firstPageItem = pageNumber * this._childrenPerPage;
|
||||
let childBox = this._getVisibleChildren()[firstPageItem].get_allocation_box();
|
||||
return childBox.y1 - this.topPadding;
|
||||
}
|
||||
@@ -915,7 +963,7 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
*/
|
||||
openExtraSpace(sourceItem, side, nRows) {
|
||||
let children = this._getVisibleChildren();
|
||||
let index = children.indexOf(sourceItem.actor);
|
||||
let index = children.indexOf(sourceItem);
|
||||
if (index == -1)
|
||||
throw new Error('Item not found.');
|
||||
|
||||
@@ -925,8 +973,7 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
let childrenPerRow = this._childrenPerPage / this._rowsPerPage;
|
||||
let sourceRow = Math.floor((index - pageOffset) / childrenPerRow);
|
||||
|
||||
let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1
|
||||
: sourceRow;
|
||||
let nRowsAbove = (side == St.Side.TOP) ? sourceRow + 1 : sourceRow;
|
||||
let nRowsBelow = this._rowsPerPage - nRowsAbove;
|
||||
|
||||
let nRowsUp, nRowsDown;
|
||||
@@ -966,13 +1013,14 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
|
||||
for (let i = 0; i < children.length; i++) {
|
||||
children[i].translation_y = 0;
|
||||
let params = { translation_y: translationY,
|
||||
time: EXTRA_SPACE_ANIMATION_TIME,
|
||||
transition: 'easeInOutQuad'
|
||||
};
|
||||
let params = {
|
||||
translation_y: translationY,
|
||||
duration: EXTRA_SPACE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD
|
||||
};
|
||||
if (i == (children.length - 1))
|
||||
params.onComplete = () => { this.emit('space-opened'); };
|
||||
Tweener.addTween(children[i], params);
|
||||
params.onComplete = () => this.emit('space-opened');
|
||||
children[i].ease(params);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -985,12 +1033,12 @@ var PaginatedIconGrid = GObject.registerClass({
|
||||
for (let i = 0; i < this._translatedChildren.length; i++) {
|
||||
if (!this._translatedChildren[i].translation_y)
|
||||
continue;
|
||||
Tweener.addTween(this._translatedChildren[i],
|
||||
{ translation_y: 0,
|
||||
time: EXTRA_SPACE_ANIMATION_TIME,
|
||||
transition: 'easeInOutQuad',
|
||||
onComplete: () => { this.emit('space-closed'); }
|
||||
});
|
||||
this._translatedChildren[i].ease({
|
||||
translation_y: 0,
|
||||
duration: EXTRA_SPACE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
|
||||
onComplete: () => this.emit('space-closed')
|
||||
});
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported InhibitShortcutsDialog */
|
||||
const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi;
|
||||
|
||||
const Dialog = imports.ui.dialog;
|
||||
@@ -75,8 +76,9 @@ var InhibitShortcutsDialog = GObject.registerClass({
|
||||
let name = this._app ? this._app.get_name() : this._window.title;
|
||||
|
||||
/* Translators: %s is an application name like "Settings" */
|
||||
let title = name ? _("%s wants to inhibit shortcuts").format(name)
|
||||
: _("Application wants to inhibit shortcuts");
|
||||
let title = name
|
||||
? _("%s wants to inhibit shortcuts").format(name)
|
||||
: _("Application wants to inhibit shortcuts");
|
||||
let icon = new Gio.ThemedIcon({ name: 'dialog-warning-symbolic' });
|
||||
|
||||
let contentParams = { icon, title };
|
||||
@@ -111,7 +113,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
|
||||
}
|
||||
|
||||
vfunc_show() {
|
||||
if (this._app && APP_WHITELIST.indexOf(this._app.get_id()) != -1) {
|
||||
if (this._app && APP_WHITELIST.includes(this._app.get_id())) {
|
||||
this._emitResponse(DialogResponse.ALLOW);
|
||||
return;
|
||||
}
|
||||
@@ -139,7 +141,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
|
||||
return;
|
||||
}
|
||||
|
||||
let [permissions, data] = res;
|
||||
let [permissions] = res;
|
||||
if (permissions[appId] === undefined) // Not found
|
||||
this._dialog.open();
|
||||
else if (permissions[appId] == GRANTED)
|
||||
|
||||
@@ -1,3 +1,4 @@
|
||||
/* exported KbdA11yDialog */
|
||||
const { Clutter, Gio, GObject } = imports.gi;
|
||||
|
||||
const Dialog = imports.ui.dialog;
|
||||
@@ -26,24 +27,24 @@ class KbdA11yDialog extends GObject.Object {
|
||||
|
||||
if (whatChanged & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) {
|
||||
key = KEY_SLOW_KEYS_ENABLED;
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) ? true : false;
|
||||
title = enabled ?
|
||||
_("Slow Keys Turned On") :
|
||||
_("Slow Keys Turned Off");
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.SLOW_KEYS_ENABLED) > 0;
|
||||
title = enabled
|
||||
? _("Slow Keys Turned On")
|
||||
: _("Slow Keys Turned Off");
|
||||
body = _("You just held down the Shift key for 8 seconds. This is the shortcut " +
|
||||
"for the Slow Keys feature, which affects the way your keyboard works.");
|
||||
|
||||
} else if (whatChanged & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) {
|
||||
key = KEY_STICKY_KEYS_ENABLED;
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) ? true : false;
|
||||
title = enabled ?
|
||||
_("Sticky Keys Turned On") :
|
||||
_("Sticky Keys Turned Off");
|
||||
body = enabled ?
|
||||
_("You just pressed the Shift key 5 times in a row. This is the shortcut " +
|
||||
"for the Sticky Keys feature, which affects the way your keyboard works.") :
|
||||
_("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
|
||||
"This turns off the Sticky Keys feature, which affects the way your keyboard works.");
|
||||
enabled = (newFlags & Clutter.KeyboardA11yFlags.STICKY_KEYS_ENABLED) > 0;
|
||||
title = enabled
|
||||
? _("Sticky Keys Turned On")
|
||||
: _("Sticky Keys Turned Off");
|
||||
body = enabled
|
||||
? _("You just pressed the Shift key 5 times in a row. This is the shortcut " +
|
||||
"for the Sticky Keys feature, which affects the way your keyboard works.")
|
||||
: _("You just pressed two keys at once, or pressed the Shift key 5 times in a row. " +
|
||||
"This turns off the Sticky Keys feature, which affects the way your keyboard works.");
|
||||
} else {
|
||||
return;
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
235
js/ui/layout.js
235
js/ui/layout.js
@@ -1,6 +1,7 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported MonitorConstraint, LayoutManager */
|
||||
|
||||
const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Background = imports.ui.background;
|
||||
@@ -10,18 +11,17 @@ const LoginManager = imports.misc.loginManager;
|
||||
const DND = imports.ui.dnd;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Ripples = imports.ui.ripples;
|
||||
|
||||
var STARTUP_ANIMATION_TIME = 0.5;
|
||||
var KEYBOARD_ANIMATION_TIME = 0.15;
|
||||
var BACKGROUND_FADE_ANIMATION_TIME = 1.0;
|
||||
var STARTUP_ANIMATION_TIME = 500;
|
||||
var KEYBOARD_ANIMATION_TIME = 150;
|
||||
var BACKGROUND_FADE_ANIMATION_TIME = 1000;
|
||||
|
||||
var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels
|
||||
var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms
|
||||
|
||||
function isPopupMetaWindow(actor) {
|
||||
switch(actor.meta_window.get_window_type()) {
|
||||
switch (actor.meta_window.get_window_type()) {
|
||||
case Meta.WindowType.DROPDOWN_MENU:
|
||||
case Meta.WindowType.POPUP_MENU:
|
||||
case Meta.WindowType.COMBO:
|
||||
@@ -32,18 +32,20 @@ function isPopupMetaWindow(actor) {
|
||||
}
|
||||
|
||||
var MonitorConstraint = GObject.registerClass({
|
||||
Properties: {'primary': GObject.ParamSpec.boolean('primary',
|
||||
'Primary', 'Track primary monitor',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
false),
|
||||
'index': GObject.ParamSpec.int('index',
|
||||
'Monitor index', 'Track specific monitor',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
-1, 64, -1),
|
||||
'work-area': GObject.ParamSpec.boolean('work-area',
|
||||
'Work-area', 'Track monitor\'s work-area',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
false)},
|
||||
Properties: {
|
||||
'primary': GObject.ParamSpec.boolean('primary',
|
||||
'Primary', 'Track primary monitor',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
false),
|
||||
'index': GObject.ParamSpec.int('index',
|
||||
'Monitor index', 'Track specific monitor',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
-1, 64, -1),
|
||||
'work-area': GObject.ParamSpec.boolean('work-area',
|
||||
'Work-area', 'Track monitor\'s work-area',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
false)
|
||||
},
|
||||
}, class MonitorConstraint extends Clutter.Constraint {
|
||||
_init(props) {
|
||||
this._primary = false;
|
||||
@@ -78,10 +80,12 @@ var MonitorConstraint = GObject.registerClass({
|
||||
this.notify('index');
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
get work_area() {
|
||||
return this._workArea;
|
||||
}
|
||||
|
||||
// eslint-disable-next-line camelcase
|
||||
set work_area(v) {
|
||||
if (v == this._workArea)
|
||||
return;
|
||||
@@ -147,13 +151,13 @@ var MonitorConstraint = GObject.registerClass({
|
||||
});
|
||||
|
||||
var Monitor = class Monitor {
|
||||
constructor(index, geometry, geometry_scale) {
|
||||
constructor(index, geometry, geometryScale) {
|
||||
this.index = index;
|
||||
this.x = geometry.x;
|
||||
this.y = geometry.y;
|
||||
this.width = geometry.width;
|
||||
this.height = geometry.height;
|
||||
this.geometry_scale = geometry_scale;
|
||||
this.geometry_scale = geometryScale;
|
||||
}
|
||||
|
||||
get inFullscreen() {
|
||||
@@ -163,12 +167,12 @@ var Monitor = class Monitor {
|
||||
|
||||
const UiActor = GObject.registerClass(
|
||||
class UiActor extends St.Widget {
|
||||
vfunc_get_preferred_width (forHeight) {
|
||||
vfunc_get_preferred_width (_forHeight) {
|
||||
let width = global.stage.width;
|
||||
return [width, width];
|
||||
}
|
||||
|
||||
vfunc_get_preferred_height (forWidth) {
|
||||
vfunc_get_preferred_height (_forWidth) {
|
||||
let height = global.stage.height;
|
||||
return [height, height];
|
||||
}
|
||||
@@ -234,11 +238,12 @@ var LayoutManager = GObject.registerClass({
|
||||
reactive: true });
|
||||
this.addChrome(this.overviewGroup);
|
||||
|
||||
this.screenShieldGroup = new St.Widget({ name: 'screenShieldGroup',
|
||||
visible: false,
|
||||
clip_to_allocation: true,
|
||||
layout_manager: new Clutter.BinLayout(),
|
||||
});
|
||||
this.screenShieldGroup = new St.Widget({
|
||||
name: 'screenShieldGroup',
|
||||
visible: false,
|
||||
clip_to_allocation: true,
|
||||
layout_manager: new Clutter.BinLayout(),
|
||||
});
|
||||
this.addChrome(this.screenShieldGroup);
|
||||
|
||||
this.panelBox = new St.BoxLayout({ name: 'panelBox',
|
||||
@@ -272,6 +277,13 @@ var LayoutManager = GObject.registerClass({
|
||||
this._backgroundGroup.lower_bottom();
|
||||
this._bgManagers = [];
|
||||
|
||||
this._interfaceSettings = new Gio.Settings({
|
||||
schema_id: 'org.gnome.desktop.interface'
|
||||
});
|
||||
|
||||
this._interfaceSettings.connect('changed::enable-hot-corners',
|
||||
this._updateHotCorners.bind(this));
|
||||
|
||||
// Need to update struts on new workspaces when they are added
|
||||
let workspaceManager = global.workspace_manager;
|
||||
workspaceManager.connect('notify::n-workspaces',
|
||||
@@ -375,6 +387,11 @@ var LayoutManager = GObject.registerClass({
|
||||
});
|
||||
this.hotCorners = [];
|
||||
|
||||
if (!this._interfaceSettings.get_boolean('enable-hot-corners')) {
|
||||
this.emit('hot-corners-changed');
|
||||
return;
|
||||
}
|
||||
|
||||
let size = this.panelBox.height;
|
||||
|
||||
// build new hot corners
|
||||
@@ -447,10 +464,11 @@ var LayoutManager = GObject.registerClass({
|
||||
let backgroundActor = this._bgManagers[i].backgroundActor;
|
||||
backgroundActor.show();
|
||||
backgroundActor.opacity = 0;
|
||||
Tweener.addTween(backgroundActor,
|
||||
{ opacity: 255,
|
||||
time: BACKGROUND_FADE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
backgroundActor.ease({
|
||||
opacity: 255,
|
||||
duration: BACKGROUND_FADE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -588,17 +606,17 @@ var LayoutManager = GObject.registerClass({
|
||||
return;
|
||||
}
|
||||
this._systemBackground = new Background.SystemBackground();
|
||||
this._systemBackground.actor.hide();
|
||||
this._systemBackground.hide();
|
||||
|
||||
global.stage.insert_child_below(this._systemBackground.actor, null);
|
||||
global.stage.insert_child_below(this._systemBackground, null);
|
||||
|
||||
let constraint = new Clutter.BindConstraint({ source: global.stage,
|
||||
coordinate: Clutter.BindCoordinate.ALL });
|
||||
this._systemBackground.actor.add_constraint(constraint);
|
||||
this._systemBackground.add_constraint(constraint);
|
||||
|
||||
let signalId = this._systemBackground.connect('loaded', () => {
|
||||
this._systemBackground.disconnect(signalId);
|
||||
this._systemBackground.actor.show();
|
||||
this._systemBackground.show();
|
||||
global.stage.show();
|
||||
|
||||
this._prepareStartupAnimation();
|
||||
@@ -681,30 +699,30 @@ var LayoutManager = GObject.registerClass({
|
||||
}
|
||||
|
||||
_startupAnimationGreeter() {
|
||||
Tweener.addTween(this.panelBox,
|
||||
{ translation_y: 0,
|
||||
time: STARTUP_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._startupAnimationComplete,
|
||||
onCompleteScope: this });
|
||||
this.panelBox.ease({
|
||||
translation_y: 0,
|
||||
duration: STARTUP_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this._startupAnimationComplete()
|
||||
});
|
||||
}
|
||||
|
||||
_startupAnimationSession() {
|
||||
Tweener.addTween(this.uiGroup,
|
||||
{ scale_x: 1,
|
||||
scale_y: 1,
|
||||
opacity: 255,
|
||||
time: STARTUP_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._startupAnimationComplete,
|
||||
onCompleteScope: this });
|
||||
this.uiGroup.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
opacity: 255,
|
||||
duration: STARTUP_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this._startupAnimationComplete()
|
||||
});
|
||||
}
|
||||
|
||||
_startupAnimationComplete() {
|
||||
this._coverPane.destroy();
|
||||
this._coverPane = null;
|
||||
|
||||
this._systemBackground.actor.destroy();
|
||||
this._systemBackground.destroy();
|
||||
this._systemBackground = null;
|
||||
|
||||
this._startingUp = false;
|
||||
@@ -723,14 +741,15 @@ var LayoutManager = GObject.registerClass({
|
||||
|
||||
showKeyboard() {
|
||||
this.keyboardBox.show();
|
||||
Tweener.addTween(this.keyboardBox,
|
||||
{ anchor_y: this.keyboardBox.height,
|
||||
opacity: 255,
|
||||
time: KEYBOARD_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._showKeyboardComplete,
|
||||
onCompleteScope: this
|
||||
});
|
||||
this.keyboardBox.ease({
|
||||
anchor_y: this.keyboardBox.height,
|
||||
opacity: 255,
|
||||
duration: KEYBOARD_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._showKeyboardComplete();
|
||||
}
|
||||
});
|
||||
this.emit('keyboard-visible-changed', true);
|
||||
}
|
||||
|
||||
@@ -749,14 +768,15 @@ var LayoutManager = GObject.registerClass({
|
||||
this.keyboardBox.disconnect(this._keyboardHeightNotifyId);
|
||||
this._keyboardHeightNotifyId = 0;
|
||||
}
|
||||
Tweener.addTween(this.keyboardBox,
|
||||
{ anchor_y: 0,
|
||||
opacity: 0,
|
||||
time: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
|
||||
transition: 'easeInQuad',
|
||||
onComplete: this._hideKeyboardComplete,
|
||||
onCompleteScope: this
|
||||
});
|
||||
this.keyboardBox.ease({
|
||||
anchor_y: 0,
|
||||
opacity: 0,
|
||||
duration: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_IN_QUAD,
|
||||
onComplete: () => {
|
||||
this._hideKeyboardComplete();
|
||||
}
|
||||
});
|
||||
|
||||
this.emit('keyboard-visible-changed', false);
|
||||
}
|
||||
@@ -827,7 +847,7 @@ var LayoutManager = GObject.registerClass({
|
||||
// @params can have any of the same values as in addChrome(),
|
||||
// though some possibilities don't make sense. By default, @actor has
|
||||
// the same params as its chrome ancestor.
|
||||
trackChrome(actor, params) {
|
||||
trackChrome(actor, params = {}) {
|
||||
let ancestor = actor.get_parent();
|
||||
let index = this._findActor(ancestor);
|
||||
while (ancestor && index == -1) {
|
||||
@@ -835,14 +855,13 @@ var LayoutManager = GObject.registerClass({
|
||||
index = this._findActor(ancestor);
|
||||
}
|
||||
|
||||
let ancestorData = ancestor ? this._trackedActors[index]
|
||||
: defaultParams;
|
||||
if (!params)
|
||||
params = {};
|
||||
let ancestorData = ancestor
|
||||
? this._trackedActors[index]
|
||||
: defaultParams;
|
||||
// We can't use Params.parse here because we want to drop
|
||||
// the extra values like ancestorData.actor
|
||||
for (let prop in defaultParams) {
|
||||
if (!params.hasOwnProperty(prop))
|
||||
if (!Object.prototype.hasOwnProperty.call(params, prop))
|
||||
params[prop] = ancestorData[prop];
|
||||
}
|
||||
|
||||
@@ -996,11 +1015,6 @@ var LayoutManager = GObject.registerClass({
|
||||
if (Main.modalCount > 0)
|
||||
return GLib.SOURCE_REMOVE;
|
||||
|
||||
// Bug workaround - get_transformed_position()/get_transformed_size() don't work after
|
||||
// a change in stage size until the first pick or paint.
|
||||
// https://bugzilla.gnome.org/show_bug.cgi?id=761565
|
||||
global.stage.get_actor_at_pos(Clutter.PickMode.ALL, 0, 0);
|
||||
|
||||
let rects = [], struts = [], i;
|
||||
let isPopupMenuVisible = global.top_window_group.get_children().some(isPopupMetaWindow);
|
||||
let wantsInputRegion = !isPopupMenuVisible;
|
||||
@@ -1056,18 +1070,19 @@ var LayoutManager = GObject.registerClass({
|
||||
side = Meta.Side.RIGHT;
|
||||
else
|
||||
continue;
|
||||
} else if (x1 <= monitor.x)
|
||||
} else if (x1 <= monitor.x) {
|
||||
side = Meta.Side.LEFT;
|
||||
else if (y1 <= monitor.y)
|
||||
} else if (y1 <= monitor.y) {
|
||||
side = Meta.Side.TOP;
|
||||
else if (x2 >= monitor.x + monitor.width)
|
||||
} else if (x2 >= monitor.x + monitor.width) {
|
||||
side = Meta.Side.RIGHT;
|
||||
else if (y2 >= monitor.y + monitor.height)
|
||||
} else if (y2 >= monitor.y + monitor.height) {
|
||||
side = Meta.Side.BOTTOM;
|
||||
else
|
||||
} else {
|
||||
continue;
|
||||
}
|
||||
|
||||
let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1});
|
||||
let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 });
|
||||
let strut = new Meta.Strut({ rect: strutRect, side: side });
|
||||
struts.push(strut);
|
||||
}
|
||||
@@ -1097,8 +1112,11 @@ var LayoutManager = GObject.registerClass({
|
||||
//
|
||||
// This class manages a "hot corner" that can toggle switching to
|
||||
// overview.
|
||||
var HotCorner = class HotCorner {
|
||||
constructor(layoutManager, monitor, x, y) {
|
||||
var HotCorner = GObject.registerClass(
|
||||
class HotCorner extends Clutter.Actor {
|
||||
_init(layoutManager, monitor, x, y) {
|
||||
super._init();
|
||||
|
||||
// We use this flag to mark the case where the user has entered the
|
||||
// hot corner and has not left both the hot corner and a surrounding
|
||||
// guard area (the "environs"). This avoids triggering the hot corner
|
||||
@@ -1127,6 +1145,8 @@ var HotCorner = class HotCorner {
|
||||
|
||||
this._ripples = new Ripples.Ripples(px, py, 'ripple-box');
|
||||
this._ripples.addTo(layoutManager.uiGroup);
|
||||
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
}
|
||||
|
||||
setBarrierSize(size) {
|
||||
@@ -1166,11 +1186,14 @@ var HotCorner = class HotCorner {
|
||||
|
||||
_setupFallbackCornerIfNeeded(layoutManager) {
|
||||
if (!global.display.supports_extended_barriers()) {
|
||||
this.actor = new Clutter.Actor({ name: 'hot-corner-environs',
|
||||
x: this._x, y: this._y,
|
||||
width: 3,
|
||||
height: 3,
|
||||
reactive: true });
|
||||
this.set({
|
||||
name: 'hot-corner-environs',
|
||||
x: this._x,
|
||||
y: this._y,
|
||||
width: 3,
|
||||
height: 3,
|
||||
reactive: true
|
||||
});
|
||||
|
||||
this._corner = new Clutter.Actor({ name: 'hot-corner',
|
||||
width: 1,
|
||||
@@ -1179,19 +1202,16 @@ var HotCorner = class HotCorner {
|
||||
reactive: true });
|
||||
this._corner._delegate = this;
|
||||
|
||||
this.actor.add_child(this._corner);
|
||||
layoutManager.addChrome(this.actor);
|
||||
this.add_child(this._corner);
|
||||
layoutManager.addChrome(this);
|
||||
|
||||
if (Clutter.get_default_text_direction() == Clutter.TextDirection.RTL) {
|
||||
this._corner.set_position(this.actor.width - this._corner.width, 0);
|
||||
this.actor.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST);
|
||||
this._corner.set_position(this.width - this._corner.width, 0);
|
||||
this.set_anchor_point_from_gravity(Clutter.Gravity.NORTH_EAST);
|
||||
} else {
|
||||
this._corner.set_position(0, 0);
|
||||
}
|
||||
|
||||
this.actor.connect('leave-event',
|
||||
this._onEnvironsLeft.bind(this));
|
||||
|
||||
this._corner.connect('enter-event',
|
||||
this._onCornerEntered.bind(this));
|
||||
this._corner.connect('leave-event',
|
||||
@@ -1199,13 +1219,12 @@ var HotCorner = class HotCorner {
|
||||
}
|
||||
}
|
||||
|
||||
destroy() {
|
||||
_onDestroy() {
|
||||
this.setBarrierSize(0);
|
||||
this._pressureBarrier.destroy();
|
||||
this._pressureBarrier = null;
|
||||
|
||||
if (this.actor)
|
||||
this.actor.destroy();
|
||||
this._ripples.destroy();
|
||||
}
|
||||
|
||||
_toggleOverview() {
|
||||
@@ -1218,7 +1237,7 @@ var HotCorner = class HotCorner {
|
||||
}
|
||||
}
|
||||
|
||||
handleDragOver(source, actor, x, y, time) {
|
||||
handleDragOver(source, _actor, _x, _y, _time) {
|
||||
if (source != Main.xdndHandler)
|
||||
return DND.DragMotionResult.CONTINUE;
|
||||
|
||||
@@ -1236,18 +1255,18 @@ var HotCorner = class HotCorner {
|
||||
}
|
||||
|
||||
_onCornerLeft(actor, event) {
|
||||
if (event.get_related() != this.actor)
|
||||
if (event.get_related() != this)
|
||||
this._entered = false;
|
||||
// Consume event, otherwise this will confuse onEnvironsLeft
|
||||
return Clutter.EVENT_STOP;
|
||||
}
|
||||
|
||||
_onEnvironsLeft(actor, event) {
|
||||
if (event.get_related() != this._corner)
|
||||
vfunc_leave_event(crossingEvent) {
|
||||
if (crossingEvent.related != this._corner)
|
||||
this._entered = false;
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var PressureBarrier = class PressureBarrier {
|
||||
constructor(threshold, timeout, actionMode) {
|
||||
@@ -1319,7 +1338,7 @@ var PressureBarrier = class PressureBarrier {
|
||||
let threshold = this._lastTime - this._timeout;
|
||||
|
||||
while (i < this._barrierEvents.length) {
|
||||
let [time, distance] = this._barrierEvents[i];
|
||||
let [time, distance_] = this._barrierEvents[i];
|
||||
if (time >= threshold)
|
||||
break;
|
||||
i++;
|
||||
@@ -1328,14 +1347,14 @@ var PressureBarrier = class PressureBarrier {
|
||||
let firstNewEvent = i;
|
||||
|
||||
for (i = 0; i < firstNewEvent; i++) {
|
||||
let [time, distance] = this._barrierEvents[i];
|
||||
let [time_, distance] = this._barrierEvents[i];
|
||||
this._currentPressure -= distance;
|
||||
}
|
||||
|
||||
this._barrierEvents = this._barrierEvents.slice(firstNewEvent);
|
||||
}
|
||||
|
||||
_onBarrierLeft(barrier, event) {
|
||||
_onBarrierLeft(barrier, _event) {
|
||||
barrier._isHit = false;
|
||||
if (this._barriers.every(b => !b._isHit)) {
|
||||
this._reset();
|
||||
|
||||
@@ -1,10 +1,9 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported Lightbox */
|
||||
|
||||
const { Clutter, GObject, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var DEFAULT_FADE_FACTOR = 0.4;
|
||||
var VIGNETTE_BRIGHTNESS = 0.2;
|
||||
@@ -23,16 +22,31 @@ t = clamp(t, 0.0, 1.0);\n\
|
||||
float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\
|
||||
cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);';
|
||||
|
||||
var RadialShaderQuad = GObject.registerClass(
|
||||
class RadialShaderQuad extends Shell.GLSLQuad {
|
||||
var RadialShaderEffect = GObject.registerClass({
|
||||
Properties: {
|
||||
'brightness': GObject.ParamSpec.float(
|
||||
'brightness', 'brightness', 'brightness',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
0, 1, 1
|
||||
),
|
||||
'sharpness': GObject.ParamSpec.float(
|
||||
'sharpness', 'sharpness', 'sharpness',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
0, 1, 0
|
||||
)
|
||||
}
|
||||
}, class RadialShaderEffect extends Shell.GLSLEffect {
|
||||
_init(params) {
|
||||
this._brightness = undefined;
|
||||
this._sharpness = undefined;
|
||||
|
||||
super._init(params);
|
||||
|
||||
this._brightnessLocation = this.get_uniform_location('brightness');
|
||||
this._sharpnessLocation = this.get_uniform_location('vignette_sharpness');
|
||||
|
||||
this.brightness = 1.0;
|
||||
this.vignetteSharpness = 0.0;
|
||||
this.sharpness = 0.0;
|
||||
}
|
||||
|
||||
vfunc_build_pipeline() {
|
||||
@@ -45,19 +59,25 @@ class RadialShaderQuad extends Shell.GLSLQuad {
|
||||
}
|
||||
|
||||
set brightness(v) {
|
||||
if (this._brightness == v)
|
||||
return;
|
||||
this._brightness = v;
|
||||
this.set_uniform_float(this._brightnessLocation,
|
||||
1, [this._brightness]);
|
||||
this.notify('brightness');
|
||||
}
|
||||
|
||||
get vignetteSharpness() {
|
||||
get sharpness() {
|
||||
return this._sharpness;
|
||||
}
|
||||
|
||||
set vignetteSharpness(v) {
|
||||
set sharpness(v) {
|
||||
if (this._sharpness == v)
|
||||
return;
|
||||
this._sharpness = v;
|
||||
this.set_uniform_float(this._sharpnessLocation,
|
||||
1, [this._sharpness]);
|
||||
this.notify('sharpness');
|
||||
}
|
||||
});
|
||||
|
||||
@@ -68,8 +88,8 @@ class RadialShaderQuad extends Shell.GLSLQuad {
|
||||
* - inhibitEvents: whether to inhibit events for @container
|
||||
* - width: shade actor width
|
||||
* - height: shade actor height
|
||||
* - fadeInTime: seconds used to fade in
|
||||
* - fadeOutTime: seconds used to fade out
|
||||
* - fadeFactor: fading opacity factor
|
||||
* - radialEffect: whether to enable the GLSL radial effect
|
||||
*
|
||||
* Lightbox creates a dark translucent "shade" actor to hide the
|
||||
* contents of @container, and allows you to specify particular actors
|
||||
@@ -85,44 +105,49 @@ class RadialShaderQuad extends Shell.GLSLQuad {
|
||||
* @container and will track any changes in its size. You can override
|
||||
* this by passing an explicit width and height in @params.
|
||||
*/
|
||||
var Lightbox = class Lightbox {
|
||||
constructor(container, params) {
|
||||
params = Params.parse(params, { inhibitEvents: false,
|
||||
width: null,
|
||||
height: null,
|
||||
fadeFactor: DEFAULT_FADE_FACTOR,
|
||||
radialEffect: false,
|
||||
});
|
||||
var Lightbox = GObject.registerClass({
|
||||
Properties: {
|
||||
'active': GObject.ParamSpec.boolean(
|
||||
'active', 'active', 'active', GObject.ParamFlags.READABLE, false),
|
||||
}
|
||||
}, class Lightbox extends St.Bin {
|
||||
_init(container, params) {
|
||||
params = Params.parse(params, {
|
||||
inhibitEvents: false,
|
||||
width: null,
|
||||
height: null,
|
||||
fadeFactor: DEFAULT_FADE_FACTOR,
|
||||
radialEffect: false,
|
||||
});
|
||||
|
||||
super._init({
|
||||
reactive: params.inhibitEvents,
|
||||
width: params.width,
|
||||
height: params.height,
|
||||
visible: false
|
||||
});
|
||||
|
||||
this._active = false;
|
||||
this._container = container;
|
||||
this._children = container.get_children();
|
||||
this._fadeFactor = params.fadeFactor;
|
||||
this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
|
||||
|
||||
if (this._radialEffect)
|
||||
this.actor = new RadialShaderQuad({ x: 0,
|
||||
y: 0,
|
||||
reactive: params.inhibitEvents });
|
||||
this.add_effect(new RadialShaderEffect({ name: 'radial' }));
|
||||
else
|
||||
this.actor = new St.Bin({ x: 0,
|
||||
y: 0,
|
||||
opacity: 0,
|
||||
style_class: 'lightbox',
|
||||
reactive: params.inhibitEvents });
|
||||
this.set({ opacity: 0, style_class: 'lightbox' });
|
||||
|
||||
container.add_actor(this.actor);
|
||||
this.actor.raise_top();
|
||||
this.actor.hide();
|
||||
this.shown = false;
|
||||
container.add_actor(this);
|
||||
this.raise_top();
|
||||
|
||||
this.actor.connect('destroy', this._onDestroy.bind(this));
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
|
||||
if (params.width && params.height) {
|
||||
this.actor.width = params.width;
|
||||
this.actor.height = params.height;
|
||||
} else {
|
||||
let constraint = new Clutter.BindConstraint({ source: container,
|
||||
coordinate: Clutter.BindCoordinate.ALL });
|
||||
this.actor.add_constraint(constraint);
|
||||
if (!params.width || !params.height) {
|
||||
this.add_constraint(new Clutter.BindConstraint({
|
||||
source: container,
|
||||
coordinate: Clutter.BindCoordinate.ALL
|
||||
}));
|
||||
}
|
||||
|
||||
this._actorAddedSignalId = container.connect('actor-added', this._actorAdded.bind(this));
|
||||
@@ -131,16 +156,20 @@ var Lightbox = class Lightbox {
|
||||
this._highlighted = null;
|
||||
}
|
||||
|
||||
get active() {
|
||||
return this._active;
|
||||
}
|
||||
|
||||
_actorAdded(container, newChild) {
|
||||
let children = this._container.get_children();
|
||||
let myIndex = children.indexOf(this.actor);
|
||||
let myIndex = children.indexOf(this);
|
||||
let newChildIndex = children.indexOf(newChild);
|
||||
|
||||
if (newChildIndex > myIndex) {
|
||||
// The child was added above the shade (presumably it was
|
||||
// made the new top-most child). Move it below the shade,
|
||||
// and add it to this._children as the new topmost actor.
|
||||
newChild.lower(this.actor);
|
||||
this._container.set_child_above_sibling(this, newChild);
|
||||
this._children.push(newChild);
|
||||
} else if (newChildIndex == 0) {
|
||||
// Bottom of stack
|
||||
@@ -153,61 +182,55 @@ var Lightbox = class Lightbox {
|
||||
}
|
||||
}
|
||||
|
||||
show(fadeInTime) {
|
||||
fadeInTime = fadeInTime || 0;
|
||||
lightOn(fadeInTime) {
|
||||
this.remove_all_transitions();
|
||||
|
||||
let easeProps = {
|
||||
duration: fadeInTime || 0,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
};
|
||||
|
||||
let onComplete = () => {
|
||||
this._active = true;
|
||||
this.notify('active');
|
||||
};
|
||||
|
||||
this.show();
|
||||
|
||||
Tweener.removeTweens(this.actor);
|
||||
if (this._radialEffect) {
|
||||
Tweener.addTween(this.actor,
|
||||
{ brightness: VIGNETTE_BRIGHTNESS,
|
||||
vignetteSharpness: VIGNETTE_SHARPNESS,
|
||||
time: fadeInTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.shown = true;
|
||||
this.emit('shown');
|
||||
}
|
||||
});
|
||||
this.ease_property(
|
||||
'@effects.radial.brightness', VIGNETTE_BRIGHTNESS, easeProps);
|
||||
this.ease_property(
|
||||
'@effects.radial.sharpness', VIGNETTE_SHARPNESS,
|
||||
Object.assign({ onComplete }, easeProps));
|
||||
} else {
|
||||
Tweener.addTween(this.actor,
|
||||
{ opacity: 255 * this._fadeFactor,
|
||||
time: fadeInTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.shown = true;
|
||||
this.emit('shown');
|
||||
}
|
||||
});
|
||||
this.ease(Object.assign(easeProps, {
|
||||
opacity: 255 * this._fadeFactor,
|
||||
onComplete
|
||||
}));
|
||||
}
|
||||
|
||||
this.actor.show();
|
||||
}
|
||||
|
||||
hide(fadeOutTime) {
|
||||
fadeOutTime = fadeOutTime || 0;
|
||||
lightOff(fadeOutTime) {
|
||||
this.remove_all_transitions();
|
||||
|
||||
this._active = false;
|
||||
this.notify('active');
|
||||
|
||||
let easeProps = {
|
||||
duration: fadeOutTime || 0,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
};
|
||||
|
||||
let onComplete = () => this.hide();
|
||||
|
||||
this.shown = false;
|
||||
Tweener.removeTweens(this.actor);
|
||||
if (this._radialEffect) {
|
||||
Tweener.addTween(this.actor,
|
||||
{ brightness: 1.0,
|
||||
vignetteSharpness: 0.0,
|
||||
opacity: 0,
|
||||
time: fadeOutTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.actor.hide();
|
||||
}
|
||||
});
|
||||
this.ease_property(
|
||||
'@effects.radial.brightness', 1.0, easeProps);
|
||||
this.ease_property(
|
||||
'@effects.radial.sharpness', 0.0, Object.assign({ onComplete }, easeProps));
|
||||
} else {
|
||||
Tweener.addTween(this.actor,
|
||||
{ opacity: 0,
|
||||
time: fadeOutTime,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this.actor.hide();
|
||||
}
|
||||
});
|
||||
this.ease(Object.assign(easeProps, { opacity: 0, onComplete }));
|
||||
}
|
||||
}
|
||||
|
||||
@@ -238,7 +261,7 @@ var Lightbox = class Lightbox {
|
||||
// case we may need to indicate some *other* actor as the new
|
||||
// sibling of the to-be-lowered one.
|
||||
|
||||
let below = this.actor;
|
||||
let below = this;
|
||||
for (let i = this._children.length - 1; i >= 0; i--) {
|
||||
if (this._children[i] == window)
|
||||
this._children[i].raise_top();
|
||||
@@ -251,15 +274,6 @@ var Lightbox = class Lightbox {
|
||||
this._highlighted = window;
|
||||
}
|
||||
|
||||
/**
|
||||
* destroy:
|
||||
*
|
||||
* Destroys the lightbox.
|
||||
*/
|
||||
destroy() {
|
||||
this.actor.destroy();
|
||||
}
|
||||
|
||||
/**
|
||||
* _onDestroy:
|
||||
*
|
||||
@@ -267,10 +281,15 @@ var Lightbox = class Lightbox {
|
||||
* by destroying its container or by explicitly calling this.destroy().
|
||||
*/
|
||||
_onDestroy() {
|
||||
this._container.disconnect(this._actorAddedSignalId);
|
||||
this._container.disconnect(this._actorRemovedSignalId);
|
||||
if (this._actorAddedSignalId) {
|
||||
this._container.disconnect(this._actorAddedSignalId);
|
||||
this._actorAddedSignalId = 0;
|
||||
}
|
||||
if (this._actorRemovedSignalId) {
|
||||
this._container.disconnect(this._actorRemovedSignalId);
|
||||
this._actorRemovedSignalId = 0;
|
||||
}
|
||||
|
||||
this.highlight(null);
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Lightbox.prototype);
|
||||
});
|
||||
|
||||
@@ -1,24 +1,39 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported LocatePointer */
|
||||
|
||||
const { Clutter, Gio, GLib, St } = imports.gi;
|
||||
const { Gio } = imports.gi;
|
||||
const Ripples = imports.ui.ripples;
|
||||
const Main = imports.ui.main;
|
||||
|
||||
const LOCATE_POINTER_KEY = "locate-pointer";
|
||||
const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface"
|
||||
const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface";
|
||||
|
||||
var locatePointer = class {
|
||||
var LocatePointer = class {
|
||||
constructor() {
|
||||
this._settings = new Gio.Settings({schema_id: LOCATE_POINTER_SCHEMA});
|
||||
this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
|
||||
this._ripples.addTo(Main.uiGroup);
|
||||
this._settings = new Gio.Settings({ schema_id: LOCATE_POINTER_SCHEMA });
|
||||
this._settings.connect(`changed::${LOCATE_POINTER_KEY}`, () => this._syncEnabled());
|
||||
this._syncEnabled();
|
||||
}
|
||||
|
||||
_syncEnabled() {
|
||||
let enabled = this._settings.get_boolean(LOCATE_POINTER_KEY);
|
||||
if (enabled == !!this._ripples)
|
||||
return;
|
||||
|
||||
if (enabled) {
|
||||
this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
|
||||
this._ripples.addTo(Main.uiGroup);
|
||||
} else {
|
||||
this._ripples.destroy();
|
||||
this._ripples = null;
|
||||
}
|
||||
}
|
||||
|
||||
show() {
|
||||
if (!this._settings.get_boolean("locate-pointer"))
|
||||
if (!this._ripples)
|
||||
return;
|
||||
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
let [x, y] = global.get_pointer();
|
||||
this._ripples.playAnimation(x, y);
|
||||
}
|
||||
};
|
||||
|
||||
@@ -1,26 +1,24 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported LookingGlass */
|
||||
|
||||
const { Clutter, Cogl, Gio, GLib,
|
||||
GObject, Meta, Pango, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const { Clutter, Cogl, Gio, GLib, GObject,
|
||||
Graphene, Meta, Pango, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
const System = imports.system;
|
||||
|
||||
const History = imports.misc.history;
|
||||
const ExtensionSystem = imports.ui.extensionSystem;
|
||||
const ExtensionUtils = imports.misc.extensionUtils;
|
||||
const ShellEntry = imports.ui.shellEntry;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Main = imports.ui.main;
|
||||
const JsParse = imports.misc.jsParse;
|
||||
|
||||
const { ExtensionState } = ExtensionUtils;
|
||||
|
||||
const CHEVRON = '>>> ';
|
||||
|
||||
/* Imports...feel free to add here as needed */
|
||||
var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
|
||||
'const Main = imports.ui.main; ' +
|
||||
'const Mainloop = imports.mainloop; ' +
|
||||
'const Tweener = imports.ui.tweener; ' +
|
||||
/* Utility functions...we should probably be able to use these
|
||||
* in the shell core code too. */
|
||||
'const stage = global.stage; ' +
|
||||
@@ -32,9 +30,11 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im
|
||||
const HISTORY_KEY = 'looking-glass-history';
|
||||
// Time between tabs for them to count as a double-tab event
|
||||
var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500;
|
||||
var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2;
|
||||
var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200;
|
||||
var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords();
|
||||
|
||||
const LG_ANIMATION_TIME = 500;
|
||||
|
||||
function _getAutoCompleteGlobalKeywords() {
|
||||
const keywords = ['true', 'false', 'null', 'new'];
|
||||
// Don't add the private properties of window (i.e., ones starting with '_')
|
||||
@@ -68,10 +68,10 @@ var AutoComplete = class AutoComplete {
|
||||
if (commonPrefix.length > 0) {
|
||||
this.additionalCompletionText(commonPrefix, event.attrHead);
|
||||
this.emit('completion', { completion: commonPrefix, type: 'prefix' });
|
||||
this.emit('suggest', { completions: event.completions});
|
||||
this.emit('suggest', { completions: event.completions });
|
||||
}
|
||||
} else if (event.completions.length > 1 && event.tabType === 'double') {
|
||||
this.emit('suggest', { completions: event.completions});
|
||||
this.emit('suggest', { completions: event.completions });
|
||||
}
|
||||
}
|
||||
|
||||
@@ -110,9 +110,11 @@ var AutoComplete = class AutoComplete {
|
||||
Signals.addSignalMethods(AutoComplete.prototype);
|
||||
|
||||
|
||||
var Notebook = class Notebook {
|
||||
constructor() {
|
||||
this.actor = new St.BoxLayout({ vertical: true });
|
||||
var Notebook = GObject.registerClass({
|
||||
Signals: { 'selection': { param_types: [Clutter.Actor.$gtype] } },
|
||||
}, class Notebook extends St.BoxLayout {
|
||||
_init() {
|
||||
super._init({ vertical: true });
|
||||
|
||||
this.tabControls = new St.BoxLayout({ style_class: 'labels' });
|
||||
|
||||
@@ -143,11 +145,11 @@ var Notebook = class Notebook {
|
||||
_scrollToBottom: false };
|
||||
this._tabs.push(tabData);
|
||||
scrollview.hide();
|
||||
this.actor.add(scrollview, { expand: true });
|
||||
this.add(scrollview, { expand: true });
|
||||
|
||||
let vAdjust = scrollview.vscroll.adjustment;
|
||||
vAdjust.connect('changed', () => { this._onAdjustScopeChanged(tabData); });
|
||||
vAdjust.connect('notify::value', () => { this._onAdjustValueChanged(tabData); });
|
||||
vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData));
|
||||
vAdjust.connect('notify::value', () => this._onAdjustValueChanged(tabData));
|
||||
|
||||
if (this._selectedIndex == -1)
|
||||
this.selectIndex(0);
|
||||
@@ -174,7 +176,7 @@ var Notebook = class Notebook {
|
||||
// Focus the new tab before unmapping the old one
|
||||
let tabData = this._tabs[index];
|
||||
if (!tabData.scrollView.navigate_focus(null, St.DirectionType.TAB_FORWARD, false))
|
||||
this.actor.grab_key_focus();
|
||||
this.grab_key_focus();
|
||||
|
||||
this._unselect();
|
||||
|
||||
@@ -185,9 +187,9 @@ var Notebook = class Notebook {
|
||||
}
|
||||
|
||||
selectChild(child) {
|
||||
if (child == null)
|
||||
if (child == null) {
|
||||
this.selectIndex(-1);
|
||||
else {
|
||||
} else {
|
||||
for (let i = 0; i < this._tabs.length; i++) {
|
||||
let tabData = this._tabs[i];
|
||||
if (tabData.child == child) {
|
||||
@@ -234,69 +236,75 @@ var Notebook = class Notebook {
|
||||
|
||||
this.selectIndex(prevIndex);
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Notebook.prototype);
|
||||
});
|
||||
|
||||
function objectToString(o) {
|
||||
if (typeof(o) == typeof(objectToString)) {
|
||||
if (typeof o == typeof objectToString) {
|
||||
// special case this since the default is way, way too verbose
|
||||
return '<js function>';
|
||||
} else {
|
||||
return '' + o;
|
||||
return `${o}`;
|
||||
}
|
||||
}
|
||||
|
||||
var ObjLink = class ObjLink {
|
||||
constructor(lookingGlass, o, title) {
|
||||
var ObjLink = GObject.registerClass(
|
||||
class ObjLink extends St.Button {
|
||||
_init(lookingGlass, o, title) {
|
||||
let text;
|
||||
if (title)
|
||||
text = title;
|
||||
else
|
||||
text = objectToString(o);
|
||||
text = GLib.markup_escape_text(text, -1);
|
||||
|
||||
super._init({
|
||||
reactive: true,
|
||||
track_hover: true,
|
||||
style_class: 'shell-link',
|
||||
label: text
|
||||
});
|
||||
this.get_child().single_line_mode = true;
|
||||
|
||||
this._obj = o;
|
||||
|
||||
this.actor = new St.Button({ reactive: true,
|
||||
track_hover: true,
|
||||
style_class: 'shell-link',
|
||||
label: text });
|
||||
this.actor.get_child().single_line_mode = true;
|
||||
this.actor.connect('clicked', this._onClicked.bind(this));
|
||||
|
||||
this._lookingGlass = lookingGlass;
|
||||
}
|
||||
|
||||
_onClicked(link) {
|
||||
this._lookingGlass.inspectObject(this._obj, this.actor);
|
||||
vfunc_clicked() {
|
||||
this._lookingGlass.inspectObject(this._obj, this);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var Result = GObject.registerClass({
|
||||
GTypeName: 'LookingClass_Result'
|
||||
}, class Result extends St.BoxLayout {
|
||||
_init(lookingGlass, command, o, index) {
|
||||
super._init({ vertical: true });
|
||||
|
||||
var Result = class Result {
|
||||
constructor(lookingGlass, command, o, index) {
|
||||
this.index = index;
|
||||
this.o = o;
|
||||
|
||||
this.actor = new St.BoxLayout({ vertical: true });
|
||||
this._lookingGlass = lookingGlass;
|
||||
|
||||
let cmdTxt = new St.Label({ text: command });
|
||||
cmdTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
|
||||
this.actor.add(cmdTxt);
|
||||
this.add(cmdTxt);
|
||||
let box = new St.BoxLayout({});
|
||||
this.actor.add(box);
|
||||
let resultTxt = new St.Label({ text: 'r(' + index + ') = ' });
|
||||
this.add(box);
|
||||
let resultTxt = new St.Label({ text: `r(${index}) = ` });
|
||||
resultTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
|
||||
box.add(resultTxt);
|
||||
let objLink = new ObjLink(this._lookingGlass, o);
|
||||
box.add(objLink.actor);
|
||||
box.add(objLink);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var WindowList = class WindowList {
|
||||
constructor(lookingGlass) {
|
||||
this.actor = new St.BoxLayout({ name: 'Windows', vertical: true, style: 'spacing: 8px' });
|
||||
var WindowList = GObject.registerClass({
|
||||
GTypeName: 'LookingClass_WindowList'
|
||||
}, class WindowList extends St.BoxLayout {
|
||||
_init(lookingGlass) {
|
||||
super._init({ name: 'Windows', vertical: true, style: 'spacing: 8px' });
|
||||
let tracker = Shell.WindowTracker.get_default();
|
||||
this._updateId = Main.initializeDeferredWork(this.actor, this._updateWindowList.bind(this));
|
||||
this._updateId = Main.initializeDeferredWork(this, this._updateWindowList.bind(this));
|
||||
global.display.connect('window-created', this._updateWindowList.bind(this));
|
||||
tracker.connect('tracked-windows-changed', this._updateWindowList.bind(this));
|
||||
|
||||
@@ -304,7 +312,10 @@ var WindowList = class WindowList {
|
||||
}
|
||||
|
||||
_updateWindowList() {
|
||||
this.actor.destroy_all_children();
|
||||
if (!this._lookingGlass.isOpen)
|
||||
return;
|
||||
|
||||
this.destroy_all_children();
|
||||
let windows = global.get_window_actors();
|
||||
let tracker = Shell.WindowTracker.get_default();
|
||||
for (let i = 0; i < windows.length; i++) {
|
||||
@@ -315,12 +326,12 @@ var WindowList = class WindowList {
|
||||
metaWindow._lookingGlassManaged = true;
|
||||
}
|
||||
let box = new St.BoxLayout({ vertical: true });
|
||||
this.actor.add(box);
|
||||
this.add(box);
|
||||
let windowLink = new ObjLink(this._lookingGlass, metaWindow, metaWindow.title);
|
||||
box.add(windowLink.actor, { x_align: St.Align.START, x_fill: false });
|
||||
box.add(windowLink, { x_align: St.Align.START, x_fill: false });
|
||||
let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' });
|
||||
box.add(propsBox);
|
||||
propsBox.add(new St.Label({ text: 'wmclass: ' + metaWindow.get_wm_class() }));
|
||||
propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` }));
|
||||
let app = tracker.get_window_app(metaWindow);
|
||||
if (app != null && !app.is_window_backed()) {
|
||||
let icon = app.create_icon_texture(22);
|
||||
@@ -328,30 +339,38 @@ var WindowList = class WindowList {
|
||||
propsBox.add(propBox);
|
||||
propBox.add(new St.Label({ text: 'app: ' }), { y_fill: false });
|
||||
let appLink = new ObjLink(this._lookingGlass, app, app.get_id());
|
||||
propBox.add(appLink.actor, { y_fill: false });
|
||||
propBox.add(appLink, { y_fill: false });
|
||||
propBox.add(icon, { y_fill: false });
|
||||
} else {
|
||||
propsBox.add(new St.Label({ text: '<untracked>' }));
|
||||
}
|
||||
}
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(WindowList.prototype);
|
||||
|
||||
var ObjInspector = class ObjInspector {
|
||||
constructor(lookingGlass) {
|
||||
update() {
|
||||
this._updateWindowList();
|
||||
}
|
||||
});
|
||||
|
||||
var ObjInspector = GObject.registerClass(
|
||||
class ObjInspector extends St.ScrollView {
|
||||
_init(lookingGlass) {
|
||||
super._init({
|
||||
pivot_point: new Graphene.Point({ x: 0.5, y: 0.5 }),
|
||||
x_fill: true,
|
||||
y_fill: true
|
||||
});
|
||||
|
||||
this._obj = null;
|
||||
this._previousObj = null;
|
||||
|
||||
this._parentList = [];
|
||||
|
||||
this.actor = new St.ScrollView({ pivot_point: new Clutter.Point({ x: 0.5, y: 0.5 }),
|
||||
x_fill: true, y_fill: true });
|
||||
this.actor.get_hscroll_bar().hide();
|
||||
this.get_hscroll_bar().hide();
|
||||
this._container = new St.BoxLayout({ name: 'LookingGlassPropertyInspector',
|
||||
style_class: 'lg-dialog',
|
||||
vertical: true });
|
||||
this.actor.add_actor(this._container);
|
||||
this.add_actor(this._container);
|
||||
|
||||
this._lookingGlass = lookingGlass;
|
||||
}
|
||||
@@ -367,7 +386,7 @@ var ObjInspector = class ObjInspector {
|
||||
|
||||
let hbox = new St.BoxLayout({ style_class: 'lg-obj-inspector-title' });
|
||||
this._container.add_actor(hbox);
|
||||
let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof(obj),
|
||||
let label = new St.Label({ text: 'Inspecting: %s: %s'.format(typeof obj,
|
||||
objectToString(obj)) });
|
||||
label.single_line_mode = true;
|
||||
hbox.add(label, { expand: true, y_fill: false });
|
||||
@@ -385,7 +404,7 @@ var ObjInspector = class ObjInspector {
|
||||
button.add_actor(new St.Icon({ icon_name: 'window-close-symbolic' }));
|
||||
button.connect('clicked', this.close.bind(this));
|
||||
hbox.add(button);
|
||||
if (typeof(obj) == typeof({})) {
|
||||
if (typeof obj == typeof {}) {
|
||||
let properties = [];
|
||||
for (let propName in obj) {
|
||||
properties.push(propName);
|
||||
@@ -394,17 +413,15 @@ var ObjInspector = class ObjInspector {
|
||||
|
||||
for (let i = 0; i < properties.length; i++) {
|
||||
let propName = properties[i];
|
||||
let valueStr;
|
||||
let link;
|
||||
try {
|
||||
let prop = obj[propName];
|
||||
link = new ObjLink(this._lookingGlass, prop).actor;
|
||||
link = new ObjLink(this._lookingGlass, prop);
|
||||
} catch (e) {
|
||||
link = new St.Label({ text: '<error>' });
|
||||
}
|
||||
let hbox = new St.BoxLayout();
|
||||
let propText = propName + ': ' + valueStr;
|
||||
hbox.add(new St.Label({ text: propName + ': ' }));
|
||||
hbox.add(new St.Label({ text: `${propName}: ` }));
|
||||
hbox.add(link);
|
||||
this._container.add_actor(hbox);
|
||||
}
|
||||
@@ -416,14 +433,17 @@ var ObjInspector = class ObjInspector {
|
||||
return;
|
||||
this._previousObj = null;
|
||||
this._open = true;
|
||||
this.actor.show();
|
||||
this.show();
|
||||
if (sourceActor) {
|
||||
this.actor.set_scale(0, 0);
|
||||
Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1,
|
||||
transition: 'easeOutQuad',
|
||||
time: 0.2 });
|
||||
this.set_scale(0, 0);
|
||||
this.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: 200
|
||||
});
|
||||
} else {
|
||||
this.actor.set_scale(1, 1);
|
||||
this.set_scale(1, 1);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -431,7 +451,7 @@ var ObjInspector = class ObjInspector {
|
||||
if (!this._open)
|
||||
return;
|
||||
this._open = false;
|
||||
this.actor.hide();
|
||||
this.hide();
|
||||
this._previousObj = null;
|
||||
this._obj = null;
|
||||
}
|
||||
@@ -445,7 +465,7 @@ var ObjInspector = class ObjInspector {
|
||||
_onBack() {
|
||||
this.selectObject(this._previousObj, true);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var RedBorderEffect = GObject.registerClass(
|
||||
class RedBorderEffect extends Clutter.Effect {
|
||||
@@ -457,16 +477,16 @@ class RedBorderEffect extends Clutter.Effect {
|
||||
color.init_from_4ub(0xff, 0, 0, 0xc4);
|
||||
Cogl.set_source_color(color);
|
||||
|
||||
let geom = actor.get_allocation_geometry();
|
||||
let alloc = actor.get_allocation_box();
|
||||
let width = 2;
|
||||
|
||||
// clockwise order
|
||||
Cogl.rectangle(0, 0, geom.width, width);
|
||||
Cogl.rectangle(geom.width - width, width,
|
||||
geom.width, geom.height);
|
||||
Cogl.rectangle(0, geom.height,
|
||||
geom.width - width, geom.height - width);
|
||||
Cogl.rectangle(0, geom.height - width,
|
||||
Cogl.rectangle(0, 0, alloc.get_width(), width);
|
||||
Cogl.rectangle(alloc.get_width() - width, width,
|
||||
alloc.get_width(), alloc.get_height());
|
||||
Cogl.rectangle(0, alloc.get_height(),
|
||||
alloc.get_width() - width, alloc.get_height() - width);
|
||||
Cogl.rectangle(0, alloc.get_height() - width,
|
||||
width, width);
|
||||
}
|
||||
});
|
||||
@@ -476,8 +496,7 @@ var Inspector = GObject.registerClass({
|
||||
'target': { param_types: [Clutter.Actor.$gtype, GObject.TYPE_DOUBLE, GObject.TYPE_DOUBLE] } },
|
||||
}, class Inspector extends Clutter.Actor {
|
||||
_init(lookingGlass) {
|
||||
super._init({ width: 0,
|
||||
height: 0 });
|
||||
super._init({ width: 0, height: 0 });
|
||||
|
||||
Main.uiGroup.add_actor(this);
|
||||
|
||||
@@ -493,8 +512,13 @@ var Inspector = GObject.registerClass({
|
||||
eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this));
|
||||
eventHandler.connect('scroll-event', this._onScrollEvent.bind(this));
|
||||
eventHandler.connect('motion-event', this._onMotionEvent.bind(this));
|
||||
Clutter.grab_pointer(eventHandler);
|
||||
Clutter.grab_keyboard(eventHandler);
|
||||
|
||||
let dm = Clutter.DeviceManager.get_default();
|
||||
this._pointerDevice = dm.get_core_device(Clutter.InputDeviceType.POINTER_DEVICE);
|
||||
this._keyboardDevice = dm.get_core_device(Clutter.InputDeviceType.KEYBOARD_DEVICE);
|
||||
|
||||
this._pointerDevice.grab(eventHandler);
|
||||
this._keyboardDevice.grab(eventHandler);
|
||||
|
||||
// this._target is the actor currently shown by the inspector.
|
||||
// this._pointerTarget is the actor directly under the pointer.
|
||||
@@ -515,7 +539,7 @@ var Inspector = GObject.registerClass({
|
||||
|
||||
let primary = Main.layoutManager.primaryMonitor;
|
||||
|
||||
let [minWidth, minHeight, natWidth, natHeight] =
|
||||
let [, , natWidth, natHeight] =
|
||||
this._eventHandler.get_preferred_size();
|
||||
|
||||
let childBox = new Clutter.ActorBox();
|
||||
@@ -527,8 +551,8 @@ var Inspector = GObject.registerClass({
|
||||
}
|
||||
|
||||
_close() {
|
||||
Clutter.ungrab_pointer();
|
||||
Clutter.ungrab_keyboard();
|
||||
this._pointerDevice.ungrab();
|
||||
this._keyboardDevice.ungrab();
|
||||
this._eventHandler.destroy();
|
||||
this._eventHandler = null;
|
||||
this.emit('closed');
|
||||
@@ -551,7 +575,7 @@ var Inspector = GObject.registerClass({
|
||||
|
||||
_onScrollEvent(actor, event) {
|
||||
switch (event.get_scroll_direction()) {
|
||||
case Clutter.ScrollDirection.UP:
|
||||
case Clutter.ScrollDirection.UP: {
|
||||
// select parent
|
||||
let parent = this._target.get_parent();
|
||||
if (parent != null) {
|
||||
@@ -559,6 +583,7 @@ var Inspector = GObject.registerClass({
|
||||
this._update(event);
|
||||
}
|
||||
break;
|
||||
}
|
||||
|
||||
case Clutter.ScrollDirection.DOWN:
|
||||
// select child
|
||||
@@ -598,36 +623,39 @@ var Inspector = GObject.registerClass({
|
||||
this._target = target;
|
||||
this._pointerTarget = target;
|
||||
|
||||
let position = '[inspect x: ' + stageX + ' y: ' + stageY + ']';
|
||||
let position = `[inspect x: ${stageX} y: ${stageY}]`;
|
||||
this._displayText.text = '';
|
||||
this._displayText.text = position + ' ' + this._target;
|
||||
this._displayText.text = `${position} ${this._target}`;
|
||||
|
||||
this._lookingGlass.setBorderPaintTarget(this._target);
|
||||
}
|
||||
});
|
||||
|
||||
var Extensions = class Extensions {
|
||||
constructor(lookingGlass) {
|
||||
var Extensions = GObject.registerClass({
|
||||
GTypeName: 'LookingClass_Extensions'
|
||||
}, class Extensions extends St.BoxLayout {
|
||||
_init(lookingGlass) {
|
||||
super._init({ vertical: true, name: 'lookingGlassExtensions' });
|
||||
|
||||
this._lookingGlass = lookingGlass;
|
||||
this.actor = new St.BoxLayout({ vertical: true,
|
||||
name: 'lookingGlassExtensions' });
|
||||
this._noExtensions = new St.Label({ style_class: 'lg-extensions-none',
|
||||
text: _("No extensions installed") });
|
||||
text: _("No extensions installed") });
|
||||
this._numExtensions = 0;
|
||||
this._extensionsList = new St.BoxLayout({ vertical: true,
|
||||
style_class: 'lg-extensions-list' });
|
||||
this._extensionsList.add(this._noExtensions);
|
||||
this.actor.add(this._extensionsList);
|
||||
this.add(this._extensionsList);
|
||||
|
||||
for (let uuid in ExtensionUtils.extensions)
|
||||
Main.extensionManager.getUuids().forEach(uuid => {
|
||||
this._loadExtension(null, uuid);
|
||||
});
|
||||
|
||||
ExtensionSystem.connect('extension-loaded',
|
||||
this._loadExtension.bind(this));
|
||||
Main.extensionManager.connect('extension-loaded',
|
||||
this._loadExtension.bind(this));
|
||||
}
|
||||
|
||||
_loadExtension(o, uuid) {
|
||||
let extension = ExtensionUtils.extensions[uuid];
|
||||
let extension = Main.extensionManager.lookup(uuid);
|
||||
// There can be cases where we create dummy extension metadata
|
||||
// that's not really a proper extension. Don't bother with these.
|
||||
if (!extension.metadata.name)
|
||||
@@ -684,17 +712,17 @@ var Extensions = class Extensions {
|
||||
|
||||
_stateToString(extensionState) {
|
||||
switch (extensionState) {
|
||||
case ExtensionSystem.ExtensionState.ENABLED:
|
||||
return _("Enabled");
|
||||
case ExtensionSystem.ExtensionState.DISABLED:
|
||||
case ExtensionSystem.ExtensionState.INITIALIZED:
|
||||
return _("Disabled");
|
||||
case ExtensionSystem.ExtensionState.ERROR:
|
||||
return _("Error");
|
||||
case ExtensionSystem.ExtensionState.OUT_OF_DATE:
|
||||
return _("Out of date");
|
||||
case ExtensionSystem.ExtensionState.DOWNLOADING:
|
||||
return _("Downloading");
|
||||
case ExtensionState.ENABLED:
|
||||
return _("Enabled");
|
||||
case ExtensionState.DISABLED:
|
||||
case ExtensionState.INITIALIZED:
|
||||
return _("Disabled");
|
||||
case ExtensionState.ERROR:
|
||||
return _("Error");
|
||||
case ExtensionState.OUT_OF_DATE:
|
||||
return _("Out of date");
|
||||
case ExtensionState.DOWNLOADING:
|
||||
return _("Downloading");
|
||||
}
|
||||
return 'Unknown'; // Not translated, shouldn't appear
|
||||
}
|
||||
@@ -702,7 +730,7 @@ var Extensions = class Extensions {
|
||||
_createExtensionDisplay(extension) {
|
||||
let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true });
|
||||
let name = new St.Label({ style_class: 'lg-extension-name',
|
||||
text: extension.metadata.name });
|
||||
text: extension.metadata.name });
|
||||
box.add(name, { expand: true });
|
||||
let description = new St.Label({ style_class: 'lg-extension-description',
|
||||
text: extension.metadata.description || 'No description' });
|
||||
@@ -710,7 +738,6 @@ var Extensions = class Extensions {
|
||||
|
||||
let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' });
|
||||
box.add(metaBox);
|
||||
let stateString = this._stateToString(extension.state);
|
||||
let state = new St.Label({ style_class: 'lg-extension-state',
|
||||
text: this._stateToString(extension.state) });
|
||||
metaBox.add(state);
|
||||
@@ -745,10 +772,19 @@ var Extensions = class Extensions {
|
||||
|
||||
return box;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var LookingGlass = GObject.registerClass(
|
||||
class LookingGlass extends St.BoxLayout {
|
||||
_init() {
|
||||
super._init({
|
||||
name: 'LookingGlassDialog',
|
||||
style_class: 'lg-dialog',
|
||||
vertical: true,
|
||||
visible: false,
|
||||
reactive: true
|
||||
});
|
||||
|
||||
var LookingGlass = class LookingGlass {
|
||||
constructor() {
|
||||
this._borderPaintTarget = null;
|
||||
this._redBorderEffect = new RedBorderEffect();
|
||||
|
||||
@@ -756,26 +792,18 @@ var LookingGlass = class LookingGlass {
|
||||
|
||||
this._it = null;
|
||||
this._offset = 0;
|
||||
this._results = [];
|
||||
|
||||
// Sort of magic, but...eh.
|
||||
this._maxItems = 150;
|
||||
|
||||
this.actor = new St.BoxLayout({ name: 'LookingGlassDialog',
|
||||
style_class: 'lg-dialog',
|
||||
vertical: true,
|
||||
visible: false,
|
||||
reactive: true });
|
||||
this.actor.connect('key-press-event', this._globalKeyPressEvent.bind(this));
|
||||
|
||||
this._interfaceSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.interface' });
|
||||
this._interfaceSettings.connect('changed::monospace-font-name',
|
||||
this._updateFont.bind(this));
|
||||
this._updateFont();
|
||||
|
||||
// We want it to appear to slide out from underneath the panel
|
||||
Main.uiGroup.add_actor(this.actor);
|
||||
Main.uiGroup.set_child_below_sibling(this.actor,
|
||||
Main.uiGroup.add_actor(this);
|
||||
Main.uiGroup.set_child_below_sibling(this,
|
||||
Main.layoutManager.panelBox);
|
||||
Main.layoutManager.panelBox.connect('allocation-changed',
|
||||
this._queueResize.bind(this));
|
||||
@@ -783,11 +811,11 @@ var LookingGlass = class LookingGlass {
|
||||
this._queueResize.bind(this));
|
||||
|
||||
this._objInspector = new ObjInspector(this);
|
||||
Main.uiGroup.add_actor(this._objInspector.actor);
|
||||
this._objInspector.actor.hide();
|
||||
Main.uiGroup.add_actor(this._objInspector);
|
||||
this._objInspector.hide();
|
||||
|
||||
let toolbar = new St.BoxLayout({ name: 'Toolbar' });
|
||||
this.actor.add_actor(toolbar);
|
||||
this.add_actor(toolbar);
|
||||
let inspectIcon = new St.Icon({ icon_name: 'gtk-color-picker',
|
||||
icon_size: 24 });
|
||||
toolbar.add_actor(inspectIcon);
|
||||
@@ -795,13 +823,13 @@ var LookingGlass = class LookingGlass {
|
||||
inspectIcon.connect('button-press-event', () => {
|
||||
let inspector = new Inspector(this);
|
||||
inspector.connect('target', (i, target, stageX, stageY) => {
|
||||
this._pushResult('inspect(' + Math.round(stageX) + ', ' + Math.round(stageY) + ')', target);
|
||||
this._pushResult(`inspect(${Math.round(stageX)}, ${Math.round(stageY)})`, target);
|
||||
});
|
||||
inspector.connect('closed', () => {
|
||||
this.actor.show();
|
||||
this.show();
|
||||
global.stage.set_key_focus(this._entry);
|
||||
});
|
||||
this.actor.hide();
|
||||
this.hide();
|
||||
return Clutter.EVENT_STOP;
|
||||
});
|
||||
|
||||
@@ -810,20 +838,20 @@ var LookingGlass = class LookingGlass {
|
||||
toolbar.add_actor(gcIcon);
|
||||
gcIcon.reactive = true;
|
||||
gcIcon.connect('button-press-event', () => {
|
||||
gcIcon.icon_name = 'user-trash';
|
||||
System.gc();
|
||||
this._timeoutId = Mainloop.timeout_add(500, () => {
|
||||
gcIcon.icon_name = 'user-trash';
|
||||
System.gc();
|
||||
this._timeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, 500, () => {
|
||||
gcIcon.icon_name = 'user-trash-full';
|
||||
this._timeoutId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\'');
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\'');
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
|
||||
let notebook = new Notebook();
|
||||
this._notebook = notebook;
|
||||
this.actor.add(notebook.actor, { expand: true });
|
||||
this.add(notebook, { expand: true });
|
||||
|
||||
let emptyBox = new St.Bin();
|
||||
toolbar.add(emptyBox, { expand: true });
|
||||
@@ -846,12 +874,12 @@ var LookingGlass = class LookingGlass {
|
||||
this._entryArea.add(this._entry, { expand: true });
|
||||
|
||||
this._windowList = new WindowList(this);
|
||||
notebook.appendPage('Windows', this._windowList.actor);
|
||||
notebook.appendPage('Windows', this._windowList);
|
||||
|
||||
this._extensions = new Extensions(this);
|
||||
notebook.appendPage('Extensions', this._extensions.actor);
|
||||
notebook.appendPage('Extensions', this._extensions);
|
||||
|
||||
this._entry.clutter_text.connect('activate', (o, e) => {
|
||||
this._entry.clutter_text.connect('activate', (o, _e) => {
|
||||
// Hide any completions we are currently showing
|
||||
this._hideCompletions();
|
||||
|
||||
@@ -867,7 +895,7 @@ var LookingGlass = class LookingGlass {
|
||||
return true;
|
||||
});
|
||||
|
||||
this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY,
|
||||
this._history = new History.HistoryManager({ gsettingsKey: HISTORY_KEY,
|
||||
entry: this._entry.clutter_text });
|
||||
|
||||
this._autoComplete = new AutoComplete(this._entry);
|
||||
@@ -889,9 +917,11 @@ var LookingGlass = class LookingGlass {
|
||||
let fontDesc = Pango.FontDescription.from_string(fontName);
|
||||
// We ignore everything but size and style; you'd be crazy to set your system-wide
|
||||
// monospace font to be bold/oblique/etc. Could easily be added here.
|
||||
this.actor.style =
|
||||
'font-size: ' + fontDesc.get_size() / 1024. + (fontDesc.get_size_is_absolute() ? 'px' : 'pt') + ';'
|
||||
+ 'font-family: "' + fontDesc.get_family() + '";';
|
||||
let size = fontDesc.get_size() / 1024.;
|
||||
let unit = fontDesc.get_size_is_absolute() ? 'px' : 'pt';
|
||||
this.style = `
|
||||
font-size: ${size}${unit};
|
||||
font-family: "${fontDesc.get_family()}";`;
|
||||
}
|
||||
|
||||
setBorderPaintTarget(obj) {
|
||||
@@ -903,17 +933,14 @@ var LookingGlass = class LookingGlass {
|
||||
}
|
||||
|
||||
_pushResult(command, obj) {
|
||||
let index = this._results.length + this._offset;
|
||||
let index = this._resultsArea.get_n_children() + this._offset;
|
||||
let result = new Result(this, CHEVRON + command, obj, index);
|
||||
this._results.push(result);
|
||||
this._resultsArea.add(result.actor);
|
||||
this._resultsArea.add(result);
|
||||
if (obj instanceof Clutter.Actor)
|
||||
this.setBorderPaintTarget(obj);
|
||||
|
||||
let children = this._resultsArea.get_children();
|
||||
if (children.length > this._maxItems) {
|
||||
this._results.shift();
|
||||
children[0].destroy();
|
||||
if (this._resultsArea.get_n_children() > this._maxItems) {
|
||||
this._resultsArea.get_first_child().destroy();
|
||||
this._offset++;
|
||||
}
|
||||
this._it = obj;
|
||||
@@ -933,35 +960,41 @@ var LookingGlass = class LookingGlass {
|
||||
this._completionActor.set_text(completions.join(', '));
|
||||
|
||||
// Setting the height to -1 allows us to get its actual preferred height rather than
|
||||
// whatever was last given in set_height by Tweener.
|
||||
// whatever was last set when animating
|
||||
this._completionActor.set_height(-1);
|
||||
let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
|
||||
let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
|
||||
|
||||
// Don't reanimate if we are already visible
|
||||
if (this._completionActor.visible) {
|
||||
this._completionActor.height = naturalHeight;
|
||||
} else {
|
||||
let settings = St.Settings.get();
|
||||
let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
|
||||
this._completionActor.show();
|
||||
Tweener.removeTweens(this._completionActor);
|
||||
Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
|
||||
transition: 'easeOutQuad',
|
||||
height: naturalHeight,
|
||||
opacity: 255
|
||||
});
|
||||
this._completionActor.remove_all_transitions();
|
||||
this._completionActor.ease({
|
||||
height: naturalHeight,
|
||||
opacity: 255,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
_hideCompletions() {
|
||||
if (this._completionActor) {
|
||||
Tweener.removeTweens(this._completionActor);
|
||||
Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
|
||||
transition: 'easeOutQuad',
|
||||
height: 0,
|
||||
opacity: 0,
|
||||
onComplete: () => {
|
||||
this._completionActor.hide();
|
||||
}
|
||||
});
|
||||
let settings = St.Settings.get();
|
||||
let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
|
||||
this._completionActor.remove_all_transitions();
|
||||
this._completionActor.ease({
|
||||
height: 0,
|
||||
opacity: 0,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._completionActor.hide();
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -977,7 +1010,7 @@ var LookingGlass = class LookingGlass {
|
||||
try {
|
||||
resultObj = Function(fullCmd)();
|
||||
} catch (e) {
|
||||
resultObj = '<exception ' + e + '>';
|
||||
resultObj = `<exception ${e}>`;
|
||||
}
|
||||
|
||||
this._pushResult(command, resultObj);
|
||||
@@ -993,7 +1026,11 @@ var LookingGlass = class LookingGlass {
|
||||
}
|
||||
|
||||
getResult(idx) {
|
||||
return this._results[idx - this._offset].o;
|
||||
try {
|
||||
return this._resultsArea.get_child_at_index(idx - this._offset).o;
|
||||
} catch (e) {
|
||||
throw new Error(`Unknown result at index ${idx}`);
|
||||
}
|
||||
}
|
||||
|
||||
toggle() {
|
||||
@@ -1004,7 +1041,10 @@ var LookingGlass = class LookingGlass {
|
||||
}
|
||||
|
||||
_queueResize() {
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { this._resize(); });
|
||||
Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
|
||||
this._resize();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
}
|
||||
|
||||
_resize() {
|
||||
@@ -1012,15 +1052,15 @@ var LookingGlass = class LookingGlass {
|
||||
let myWidth = primary.width * 0.7;
|
||||
let availableHeight = primary.height - Main.layoutManager.keyboardBox.height;
|
||||
let myHeight = Math.min(primary.height * 0.7, availableHeight * 0.9);
|
||||
this.actor.x = primary.x + (primary.width - myWidth) / 2;
|
||||
this.x = primary.x + (primary.width - myWidth) / 2;
|
||||
this._hiddenY = primary.y + Main.layoutManager.panelBox.height - myHeight;
|
||||
this._targetY = this._hiddenY + myHeight;
|
||||
this.actor.y = this._hiddenY;
|
||||
this.actor.width = myWidth;
|
||||
this.actor.height = myHeight;
|
||||
this._objInspector.actor.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8));
|
||||
this._objInspector.actor.set_position(this.actor.x + Math.floor(myWidth * 0.1),
|
||||
this._targetY + Math.floor(myHeight * 0.1));
|
||||
this.y = this._hiddenY;
|
||||
this.width = myWidth;
|
||||
this.height = myHeight;
|
||||
this._objInspector.set_size(Math.floor(myWidth * 0.8), Math.floor(myHeight * 0.8));
|
||||
this._objInspector.set_position(this.x + Math.floor(myWidth * 0.1),
|
||||
this._targetY + Math.floor(myHeight * 0.1));
|
||||
}
|
||||
|
||||
insertObject(obj) {
|
||||
@@ -1033,11 +1073,10 @@ var LookingGlass = class LookingGlass {
|
||||
}
|
||||
|
||||
// Handle key events which are relevant for all tabs of the LookingGlass
|
||||
_globalKeyPressEvent(actor, event) {
|
||||
let symbol = event.get_key_symbol();
|
||||
let modifierState = event.get_state();
|
||||
vfunc_key_press_event(keyPressEvent) {
|
||||
let symbol = keyPressEvent.keyval;
|
||||
if (symbol == Clutter.Escape) {
|
||||
if (this._objInspector.actor.visible) {
|
||||
if (this._objInspector.visible) {
|
||||
this._objInspector.close();
|
||||
} else {
|
||||
this.close();
|
||||
@@ -1045,7 +1084,7 @@ var LookingGlass = class LookingGlass {
|
||||
return Clutter.EVENT_STOP;
|
||||
}
|
||||
// Ctrl+PgUp and Ctrl+PgDown switches tabs in the notebook view
|
||||
if (modifierState & Clutter.ModifierType.CONTROL_MASK) {
|
||||
if (keyPressEvent.modifier_state & Clutter.ModifierType.CONTROL_MASK) {
|
||||
if (symbol == Clutter.KEY_Page_Up) {
|
||||
this._notebook.prevTab();
|
||||
} else if (symbol == Clutter.KEY_Page_Down) {
|
||||
@@ -1063,40 +1102,49 @@ var LookingGlass = class LookingGlass {
|
||||
return;
|
||||
|
||||
this._notebook.selectIndex(0);
|
||||
this.actor.show();
|
||||
this.show();
|
||||
this._open = true;
|
||||
this._history.lastItem();
|
||||
|
||||
Tweener.removeTweens(this.actor);
|
||||
this.remove_all_transitions();
|
||||
|
||||
// We inverse compensate for the slow-down so you can change the factor
|
||||
// through LookingGlass without long waits.
|
||||
Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(),
|
||||
transition: 'easeOutQuad',
|
||||
y: this._targetY
|
||||
});
|
||||
let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor;
|
||||
this.ease({
|
||||
y: this._targetY,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
|
||||
this._windowList.update();
|
||||
}
|
||||
|
||||
close() {
|
||||
if (!this._open)
|
||||
return;
|
||||
|
||||
this._objInspector.actor.hide();
|
||||
this._objInspector.hide();
|
||||
|
||||
this._open = false;
|
||||
Tweener.removeTweens(this.actor);
|
||||
this.remove_all_transitions();
|
||||
|
||||
this.setBorderPaintTarget(null);
|
||||
|
||||
Main.popModal(this._entry);
|
||||
|
||||
Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5),
|
||||
transition: 'easeOutQuad',
|
||||
y: this._hiddenY,
|
||||
onComplete: () => {
|
||||
this.actor.hide();
|
||||
}
|
||||
});
|
||||
let settings = St.Settings.get();
|
||||
let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor,
|
||||
LG_ANIMATION_TIME);
|
||||
this.ease({
|
||||
y: this._hiddenY,
|
||||
duration,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this.hide()
|
||||
});
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(LookingGlass.prototype);
|
||||
|
||||
get isOpen() {
|
||||
return this._open;
|
||||
}
|
||||
});
|
||||
|
||||
@@ -2,7 +2,6 @@
|
||||
|
||||
const { Atspi, Clutter, GDesktopEnums,
|
||||
Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Background = imports.ui.background;
|
||||
@@ -41,10 +40,8 @@ const CROSS_HAIRS_OPACITY_KEY = 'cross-hairs-opacity';
|
||||
const CROSS_HAIRS_LENGTH_KEY = 'cross-hairs-length';
|
||||
const CROSS_HAIRS_CLIP_KEY = 'cross-hairs-clip';
|
||||
|
||||
let magDBusService = null;
|
||||
|
||||
var MouseSpriteContent = GObject.registerClass({
|
||||
Implements: [ Clutter.Content ],
|
||||
Implements: [Clutter.Content],
|
||||
}, class MouseSpriteContent extends GObject.Object {
|
||||
_init() {
|
||||
super._init();
|
||||
@@ -109,8 +106,7 @@ var Magnifier = class Magnifier {
|
||||
// Create the first ZoomRegion and initialize it according to the
|
||||
// magnification settings.
|
||||
|
||||
let mask;
|
||||
[this.xMouse, this.yMouse, mask] = global.get_pointer();
|
||||
[this.xMouse, this.yMouse] = global.get_pointer();
|
||||
|
||||
let aZoomRegion = new ZoomRegion(this, this._cursorRoot);
|
||||
this._zoomRegions.push(aZoomRegion);
|
||||
@@ -122,7 +118,7 @@ var Magnifier = class Magnifier {
|
||||
});
|
||||
|
||||
// Export to dbus.
|
||||
magDBusService = new MagnifierDBus.ShellMagnifier();
|
||||
(new MagnifierDBus.ShellMagnifier());
|
||||
this.setActive(St.Settings.get().magnifier_active);
|
||||
}
|
||||
|
||||
@@ -150,7 +146,7 @@ var Magnifier = class Magnifier {
|
||||
setActive(activate) {
|
||||
let isActive = this.isActive();
|
||||
|
||||
this._zoomRegions.forEach ((zoomRegion, index, array) => {
|
||||
this._zoomRegions.forEach(zoomRegion => {
|
||||
zoomRegion.setActive(activate);
|
||||
});
|
||||
|
||||
@@ -229,14 +225,14 @@ var Magnifier = class Magnifier {
|
||||
* @return true.
|
||||
*/
|
||||
scrollToMousePos() {
|
||||
let [xMouse, yMouse, mask] = global.get_pointer();
|
||||
let [xMouse, yMouse] = global.get_pointer();
|
||||
|
||||
if (xMouse != this.xMouse || yMouse != this.yMouse) {
|
||||
this.xMouse = xMouse;
|
||||
this.yMouse = yMouse;
|
||||
|
||||
let sysMouseOverAny = false;
|
||||
this._zoomRegions.forEach((zoomRegion, index, array) => {
|
||||
this._zoomRegions.forEach(zoomRegion => {
|
||||
if (zoomRegion.scrollToMousePos())
|
||||
sysMouseOverAny = true;
|
||||
});
|
||||
@@ -268,7 +264,7 @@ var Magnifier = class Magnifier {
|
||||
zoomRegion.setViewPort(viewPort);
|
||||
|
||||
// We ignore the redundant width/height on the ROI
|
||||
let fixedROI = new Object(roi);
|
||||
let fixedROI = Object.create(roi);
|
||||
fixedROI.width = viewPort.width / xMagFactor;
|
||||
fixedROI.height = viewPort.height / yMagFactor;
|
||||
zoomRegion.setROI(fixedROI);
|
||||
@@ -284,7 +280,7 @@ var Magnifier = class Magnifier {
|
||||
* @zoomRegion: The zoomRegion to add.
|
||||
*/
|
||||
addZoomRegion(zoomRegion) {
|
||||
if(zoomRegion) {
|
||||
if (zoomRegion) {
|
||||
this._zoomRegions.push(zoomRegion);
|
||||
if (!this.isTrackingMouse())
|
||||
this.startTrackingMouse();
|
||||
@@ -334,7 +330,7 @@ var Magnifier = class Magnifier {
|
||||
this.setCrosshairsClip(clip);
|
||||
|
||||
let theCrossHairs = this._crossHairs;
|
||||
this._zoomRegions.forEach ((zoomRegion, index, array) => {
|
||||
this._zoomRegions.forEach (zoomRegion => {
|
||||
zoomRegion.addCrosshairs(theCrossHairs);
|
||||
});
|
||||
}
|
||||
@@ -349,8 +345,7 @@ var Magnifier = class Magnifier {
|
||||
if (!this._crossHairs)
|
||||
this.addCrosshairs();
|
||||
this._crossHairs.show();
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
if (this._crossHairs)
|
||||
this._crossHairs.hide();
|
||||
}
|
||||
@@ -363,7 +358,7 @@ var Magnifier = class Magnifier {
|
||||
*/
|
||||
setCrosshairsColor(color) {
|
||||
if (this._crossHairs) {
|
||||
let [res, clutterColor] = Clutter.Color.from_string(color);
|
||||
let [res_, clutterColor] = Clutter.Color.from_string(color);
|
||||
this._crossHairs.setColor(clutterColor);
|
||||
}
|
||||
}
|
||||
@@ -377,9 +372,9 @@ var Magnifier = class Magnifier {
|
||||
if (this._crossHairs) {
|
||||
let clutterColor = this._crossHairs.getColor();
|
||||
return clutterColor.to_string();
|
||||
}
|
||||
else
|
||||
} else {
|
||||
return '#00000000';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -456,16 +451,11 @@ var Magnifier = class Magnifier {
|
||||
* @clip: Flag to indicate whether to clip the crosshairs.
|
||||
*/
|
||||
setCrosshairsClip(clip) {
|
||||
if (clip) {
|
||||
if (this._crossHairs)
|
||||
this._crossHairs.setClip(CROSSHAIRS_CLIP_SIZE);
|
||||
}
|
||||
else {
|
||||
// Setting no clipping on crosshairs means a zero sized clip
|
||||
// rectangle.
|
||||
if (this._crossHairs)
|
||||
this._crossHairs.setClip([0, 0]);
|
||||
}
|
||||
if (!this._crossHairs)
|
||||
return;
|
||||
|
||||
// Setting no clipping on crosshairs means a zero sized clip rectangle.
|
||||
this._crossHairs.setClip(clip ? CROSSHAIRS_CLIP_SIZE : [0, 0]);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -473,14 +463,14 @@ var Magnifier = class Magnifier {
|
||||
* Get whether the crosshairs are clipped by the mouse image.
|
||||
* @return: Whether the crosshairs are clipped.
|
||||
*/
|
||||
getCrosshairsClip() {
|
||||
getCrosshairsClip() {
|
||||
if (this._crossHairs) {
|
||||
let [clipWidth, clipHeight] = this._crossHairs.getClip();
|
||||
return (clipWidth > 0 && clipHeight > 0);
|
||||
}
|
||||
else
|
||||
} else {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
//// Private methods ////
|
||||
|
||||
@@ -504,61 +494,61 @@ var Magnifier = class Magnifier {
|
||||
_settingsInit(zoomRegion) {
|
||||
this._settings = new Gio.Settings({ schema_id: MAGNIFIER_SCHEMA });
|
||||
|
||||
this._settings.connect('changed::' + SCREEN_POSITION_KEY,
|
||||
this._settings.connect(`changed::${SCREEN_POSITION_KEY}`,
|
||||
this._updateScreenPosition.bind(this));
|
||||
this._settings.connect('changed::' + MAG_FACTOR_KEY,
|
||||
this._settings.connect(`changed::${MAG_FACTOR_KEY}`,
|
||||
this._updateMagFactor.bind(this));
|
||||
this._settings.connect('changed::' + LENS_MODE_KEY,
|
||||
this._settings.connect(`changed::${LENS_MODE_KEY}`,
|
||||
this._updateLensMode.bind(this));
|
||||
this._settings.connect('changed::' + CLAMP_MODE_KEY,
|
||||
this._settings.connect(`changed::${CLAMP_MODE_KEY}`,
|
||||
this._updateClampMode.bind(this));
|
||||
this._settings.connect('changed::' + MOUSE_TRACKING_KEY,
|
||||
this._settings.connect(`changed::${MOUSE_TRACKING_KEY}`,
|
||||
this._updateMouseTrackingMode.bind(this));
|
||||
this._settings.connect('changed::' + FOCUS_TRACKING_KEY,
|
||||
this._settings.connect(`changed::${FOCUS_TRACKING_KEY}`,
|
||||
this._updateFocusTrackingMode.bind(this));
|
||||
this._settings.connect('changed::' + CARET_TRACKING_KEY,
|
||||
this._settings.connect(`changed::${CARET_TRACKING_KEY}`,
|
||||
this._updateCaretTrackingMode.bind(this));
|
||||
|
||||
this._settings.connect('changed::' + INVERT_LIGHTNESS_KEY,
|
||||
this._settings.connect(`changed::${INVERT_LIGHTNESS_KEY}`,
|
||||
this._updateInvertLightness.bind(this));
|
||||
this._settings.connect('changed::' + COLOR_SATURATION_KEY,
|
||||
this._settings.connect(`changed::${COLOR_SATURATION_KEY}`,
|
||||
this._updateColorSaturation.bind(this));
|
||||
|
||||
this._settings.connect('changed::' + BRIGHT_RED_KEY,
|
||||
this._settings.connect(`changed::${BRIGHT_RED_KEY}`,
|
||||
this._updateBrightness.bind(this));
|
||||
this._settings.connect('changed::' + BRIGHT_GREEN_KEY,
|
||||
this._settings.connect(`changed::${BRIGHT_GREEN_KEY}`,
|
||||
this._updateBrightness.bind(this));
|
||||
this._settings.connect('changed::' + BRIGHT_BLUE_KEY,
|
||||
this._settings.connect(`changed::${BRIGHT_BLUE_KEY}`,
|
||||
this._updateBrightness.bind(this));
|
||||
|
||||
this._settings.connect('changed::' + CONTRAST_RED_KEY,
|
||||
this._settings.connect(`changed::${CONTRAST_RED_KEY}`,
|
||||
this._updateContrast.bind(this));
|
||||
this._settings.connect('changed::' + CONTRAST_GREEN_KEY,
|
||||
this._settings.connect(`changed::${CONTRAST_GREEN_KEY}`,
|
||||
this._updateContrast.bind(this));
|
||||
this._settings.connect('changed::' + CONTRAST_BLUE_KEY,
|
||||
this._settings.connect(`changed::${CONTRAST_BLUE_KEY}`,
|
||||
this._updateContrast.bind(this));
|
||||
|
||||
this._settings.connect('changed::' + SHOW_CROSS_HAIRS_KEY, () => {
|
||||
this._settings.connect(`changed::${SHOW_CROSS_HAIRS_KEY}`, () => {
|
||||
this.setCrosshairsVisible(this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY));
|
||||
});
|
||||
|
||||
this._settings.connect('changed::' + CROSS_HAIRS_THICKNESS_KEY, () => {
|
||||
this._settings.connect(`changed::${CROSS_HAIRS_THICKNESS_KEY}`, () => {
|
||||
this.setCrosshairsThickness(this._settings.get_int(CROSS_HAIRS_THICKNESS_KEY));
|
||||
});
|
||||
|
||||
this._settings.connect('changed::' + CROSS_HAIRS_COLOR_KEY, () => {
|
||||
this._settings.connect(`changed::${CROSS_HAIRS_COLOR_KEY}`, () => {
|
||||
this.setCrosshairsColor(this._settings.get_string(CROSS_HAIRS_COLOR_KEY));
|
||||
});
|
||||
|
||||
this._settings.connect('changed::' + CROSS_HAIRS_OPACITY_KEY, () => {
|
||||
this._settings.connect(`changed::${CROSS_HAIRS_OPACITY_KEY}`, () => {
|
||||
this.setCrosshairsOpacity(this._settings.get_double(CROSS_HAIRS_OPACITY_KEY));
|
||||
});
|
||||
|
||||
this._settings.connect('changed::' + CROSS_HAIRS_LENGTH_KEY, () => {
|
||||
this._settings.connect(`changed::${CROSS_HAIRS_LENGTH_KEY}`, () => {
|
||||
this.setCrosshairsLength(this._settings.get_int(CROSS_HAIRS_LENGTH_KEY));
|
||||
});
|
||||
|
||||
this._settings.connect('changed::' + CROSS_HAIRS_CLIP_KEY, () => {
|
||||
this._settings.connect(`changed::${CROSS_HAIRS_CLIP_KEY}`, () => {
|
||||
this.setCrosshairsClip(this._settings.get_boolean(CROSS_HAIRS_CLIP_KEY));
|
||||
});
|
||||
|
||||
@@ -610,7 +600,7 @@ var Magnifier = class Magnifier {
|
||||
let showCrosshairs = this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY);
|
||||
this.addCrosshairs();
|
||||
this.setCrosshairsVisible(showCrosshairs);
|
||||
}
|
||||
}
|
||||
|
||||
_updateScreenPosition() {
|
||||
// Applies only to the first zoom region.
|
||||
@@ -800,8 +790,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
let extents;
|
||||
try {
|
||||
extents = component.get_extents(Atspi.CoordType.SCREEN);
|
||||
} catch(e) {
|
||||
log('Failed to read extents of focused component: ' + e.message);
|
||||
} catch (e) {
|
||||
log(`Failed to read extents of focused component: ${e.message}`);
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -817,8 +807,8 @@ var ZoomRegion = class ZoomRegion {
|
||||
let extents;
|
||||
try {
|
||||
extents = text.get_character_extents(text.get_caret_offset(), 0);
|
||||
} catch(e) {
|
||||
log('Failed to read extents of text caret: ' + e.message);
|
||||
} catch (e) {
|
||||
log(`Failed to read extents of text caret: ${e.message}`);
|
||||
return;
|
||||
}
|
||||
|
||||
@@ -1030,7 +1020,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
viewPort.x = 0;
|
||||
viewPort.y = 0;
|
||||
viewPort.width = global.screen_width;
|
||||
viewPort.height = global.screen_height/2;
|
||||
viewPort.height = global.screen_height / 2;
|
||||
this._setViewPort(viewPort);
|
||||
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.TOP_HALF;
|
||||
}
|
||||
@@ -1042,9 +1032,9 @@ var ZoomRegion = class ZoomRegion {
|
||||
setBottomHalf() {
|
||||
let viewPort = {};
|
||||
viewPort.x = 0;
|
||||
viewPort.y = global.screen_height/2;
|
||||
viewPort.y = global.screen_height / 2;
|
||||
viewPort.width = global.screen_width;
|
||||
viewPort.height = global.screen_height/2;
|
||||
viewPort.height = global.screen_height / 2;
|
||||
this._setViewPort(viewPort);
|
||||
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF;
|
||||
}
|
||||
@@ -1057,7 +1047,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
let viewPort = {};
|
||||
viewPort.x = 0;
|
||||
viewPort.y = 0;
|
||||
viewPort.width = global.screen_width/2;
|
||||
viewPort.width = global.screen_width / 2;
|
||||
viewPort.height = global.screen_height;
|
||||
this._setViewPort(viewPort);
|
||||
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.LEFT_HALF;
|
||||
@@ -1069,9 +1059,9 @@ var ZoomRegion = class ZoomRegion {
|
||||
*/
|
||||
setRightHalf() {
|
||||
let viewPort = {};
|
||||
viewPort.x = global.screen_width/2;
|
||||
viewPort.x = global.screen_width / 2;
|
||||
viewPort.y = 0;
|
||||
viewPort.width = global.screen_width/2;
|
||||
viewPort.width = global.screen_width / 2;
|
||||
viewPort.height = global.screen_height;
|
||||
this._setViewPort(viewPort);
|
||||
this._screenPosition = GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF;
|
||||
@@ -1103,21 +1093,21 @@ var ZoomRegion = class ZoomRegion {
|
||||
*/
|
||||
setScreenPosition(inPosition) {
|
||||
switch (inPosition) {
|
||||
case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN:
|
||||
this.setFullScreenMode();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.TOP_HALF:
|
||||
this.setTopHalf();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF:
|
||||
this.setBottomHalf();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF:
|
||||
this.setLeftHalf();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF:
|
||||
this.setRightHalf();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN:
|
||||
this.setFullScreenMode();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.TOP_HALF:
|
||||
this.setTopHalf();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF:
|
||||
this.setBottomHalf();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF:
|
||||
this.setLeftHalf();
|
||||
break;
|
||||
case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF:
|
||||
this.setRightHalf();
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1149,7 +1139,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
_clearScrollContentsTimer() {
|
||||
if (this._scrollContentsTimerId != 0) {
|
||||
Mainloop.source_remove(this._scrollContentsTimerId);
|
||||
GLib.source_remove(this._scrollContentsTimerId);
|
||||
this._scrollContentsTimerId = 0;
|
||||
}
|
||||
}
|
||||
@@ -1161,7 +1151,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
}
|
||||
|
||||
this._clearScrollContentsTimer();
|
||||
this._scrollContentsTimerId = Mainloop.timeout_add(POINTER_REST_TIME, () => {
|
||||
this._scrollContentsTimerId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, POINTER_REST_TIME, () => {
|
||||
this._scrollContentsToDelayed(x, y);
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
@@ -1300,7 +1290,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
// Add a background for when the magnified uiGroup is scrolled
|
||||
// out of view (don't want to see desktop showing through).
|
||||
this._background = (new Background.SystemBackground()).actor;
|
||||
this._background = new Background.SystemBackground();
|
||||
mainGroup.add_actor(this._background);
|
||||
|
||||
// Clone the group that contains all of UI on the screen. This is the
|
||||
@@ -1460,11 +1450,9 @@ var ZoomRegion = class ZoomRegion {
|
||||
|
||||
if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) {
|
||||
return this._centerFromPointProportional(xMouse, yMouse);
|
||||
}
|
||||
else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
|
||||
} else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
|
||||
return this._centerFromPointPush(xMouse, yMouse);
|
||||
}
|
||||
else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
|
||||
} else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
|
||||
return this._centerFromPointCentered(xMouse, yMouse);
|
||||
}
|
||||
|
||||
@@ -1521,7 +1509,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
}
|
||||
|
||||
_centerFromPointProportional(xPoint, yPoint) {
|
||||
let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI();
|
||||
let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI();
|
||||
let halfScreenWidth = global.screen_width / 2;
|
||||
let halfScreenHeight = global.screen_height / 2;
|
||||
// We want to pad with a constant distance after zooming, so divide
|
||||
@@ -1532,7 +1520,7 @@ var ZoomRegion = class ZoomRegion {
|
||||
let xProportion = (xPoint - halfScreenWidth) / halfScreenWidth; // -1 ... 1
|
||||
let yProportion = (yPoint - halfScreenHeight) / halfScreenHeight; // -1 ... 1
|
||||
let xPos = xPoint - xProportion * (widthRoi / 2 - xPadding);
|
||||
let yPos = yPoint - yProportion * (heightRoi /2 - yPadding);
|
||||
let yPos = yPoint - yProportion * (heightRoi / 2 - yPadding);
|
||||
|
||||
return [xPos, yPos];
|
||||
}
|
||||
@@ -1599,8 +1587,9 @@ var ZoomRegion = class ZoomRegion {
|
||||
}
|
||||
};
|
||||
|
||||
var Crosshairs = class Crosshairs {
|
||||
constructor() {
|
||||
var Crosshairs = GObject.registerClass(
|
||||
class Crosshairs extends Clutter.Actor {
|
||||
_init() {
|
||||
|
||||
// Set the group containing the crosshairs to three times the desktop
|
||||
// size in case the crosshairs need to appear to be infinite in
|
||||
@@ -1608,7 +1597,7 @@ var Crosshairs = class Crosshairs {
|
||||
let groupWidth = global.screen_width * 3;
|
||||
let groupHeight = global.screen_height * 3;
|
||||
|
||||
this._actor = new Clutter.Actor({
|
||||
super._init({
|
||||
clip_to_allocation: false,
|
||||
width: groupWidth,
|
||||
height: groupHeight
|
||||
@@ -1617,10 +1606,10 @@ var Crosshairs = class Crosshairs {
|
||||
this._horizRightHair = new Clutter.Actor();
|
||||
this._vertTopHair = new Clutter.Actor();
|
||||
this._vertBottomHair = new Clutter.Actor();
|
||||
this._actor.add_actor(this._horizLeftHair);
|
||||
this._actor.add_actor(this._horizRightHair);
|
||||
this._actor.add_actor(this._vertTopHair);
|
||||
this._actor.add_actor(this._vertBottomHair);
|
||||
this.add_actor(this._horizLeftHair);
|
||||
this.add_actor(this._horizRightHair);
|
||||
this.add_actor(this._vertTopHair);
|
||||
this.add_actor(this._vertBottomHair);
|
||||
this._clipSize = [0, 0];
|
||||
this._clones = [];
|
||||
this.reCenter();
|
||||
@@ -1630,11 +1619,11 @@ var Crosshairs = class Crosshairs {
|
||||
}
|
||||
|
||||
_monitorsChanged() {
|
||||
this._actor.set_size(global.screen_width * 3, global.screen_height * 3);
|
||||
this.set_size(global.screen_width * 3, global.screen_height * 3);
|
||||
this.reCenter();
|
||||
}
|
||||
|
||||
/**
|
||||
/**
|
||||
* addToZoomRegion
|
||||
* Either add the crosshairs actor to the given ZoomRegion, or, if it is
|
||||
* already part of some other ZoomRegion, create a clone of the crosshairs
|
||||
@@ -1651,18 +1640,21 @@ var Crosshairs = class Crosshairs {
|
||||
if (zoomRegion && magnifiedMouse) {
|
||||
let container = magnifiedMouse.get_parent();
|
||||
if (container) {
|
||||
crosshairsActor = this._actor;
|
||||
if (this._actor.get_parent() != null) {
|
||||
crosshairsActor = new Clutter.Clone({ source: this._actor });
|
||||
crosshairsActor = this;
|
||||
if (this.get_parent() != null) {
|
||||
crosshairsActor = new Clutter.Clone({ source: this });
|
||||
this._clones.push(crosshairsActor);
|
||||
|
||||
// Clones don't share visibility.
|
||||
this.bind_property('visible', crosshairsActor, 'visible',
|
||||
GObject.BindingFlags.SYNC_CREATE);
|
||||
}
|
||||
crosshairsActor.visible = this._actor.visible;
|
||||
|
||||
container.add_actor(crosshairsActor);
|
||||
container.raise_child(magnifiedMouse, crosshairsActor);
|
||||
let [xMouse, yMouse] = magnifiedMouse.get_position();
|
||||
let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size();
|
||||
crosshairsActor.set_position(xMouse - crosshairsWidth / 2 , yMouse - crosshairsHeight / 2);
|
||||
crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2);
|
||||
}
|
||||
}
|
||||
return crosshairsActor;
|
||||
@@ -1675,7 +1667,7 @@ var Crosshairs = class Crosshairs {
|
||||
* child actor if it was just a clone of the crosshairs actor.
|
||||
*/
|
||||
removeFromParent(childActor) {
|
||||
if (childActor == this._actor)
|
||||
if (childActor == this)
|
||||
childActor.get_parent().remove_actor(childActor);
|
||||
else
|
||||
childActor.destroy();
|
||||
@@ -1778,34 +1770,11 @@ var Crosshairs = class Crosshairs {
|
||||
// mouse.
|
||||
this._clipSize = size;
|
||||
this.reCenter();
|
||||
}
|
||||
else {
|
||||
} else {
|
||||
// Restore the missing chunk.
|
||||
this._clipSize = [0, 0];
|
||||
this.reCenter();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* show:
|
||||
* Show the crosshairs.
|
||||
*/
|
||||
show() {
|
||||
this._actor.show();
|
||||
// Clones don't share visibility.
|
||||
for (let i = 0; i < this._clones.length; i++)
|
||||
this._clones[i].show();
|
||||
}
|
||||
|
||||
/**
|
||||
* hide:
|
||||
* Hide the crosshairs.
|
||||
*/
|
||||
hide() {
|
||||
this._actor.hide();
|
||||
// Clones don't share visibility.
|
||||
for (let i = 0; i < this._clones.length; i++)
|
||||
this._clones[i].hide();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1816,11 +1785,9 @@ var Crosshairs = class Crosshairs {
|
||||
* @clipSize: Optional. If present, an array of the form [width, height].
|
||||
*/
|
||||
reCenter(clipSize) {
|
||||
let [groupWidth, groupHeight] = this._actor.get_size();
|
||||
let [groupWidth, groupHeight] = this.get_size();
|
||||
let leftLength = this._horizLeftHair.get_width();
|
||||
let rightLength = this._horizRightHair.get_width();
|
||||
let topLength = this._vertTopHair.get_height();
|
||||
let bottomLength = this._vertBottomHair.get_height();
|
||||
let thickness = this._horizLeftHair.get_height();
|
||||
|
||||
// Deal with clip rectangle.
|
||||
@@ -1840,7 +1807,7 @@ var Crosshairs = class Crosshairs {
|
||||
this._vertTopHair.set_position((groupWidth - thickness) / 2, top);
|
||||
this._vertBottomHair.set_position((groupWidth - thickness) / 2, bottom);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var MagShaderEffects = class MagShaderEffects {
|
||||
constructor(uiGroupClone) {
|
||||
@@ -1927,8 +1894,8 @@ var MagShaderEffects = class MagShaderEffects {
|
||||
// a null first argument.
|
||||
let [bRed, bGreen, bBlue] = this._brightnessContrast.get_brightness();
|
||||
this._brightnessContrast.set_enabled(
|
||||
cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE ||
|
||||
bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE
|
||||
cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE ||
|
||||
bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE
|
||||
);
|
||||
}
|
||||
};
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported ShellMagnifier */
|
||||
|
||||
const Gio = imports.gi.Gio;
|
||||
const Main = imports.ui.main;
|
||||
@@ -85,7 +86,7 @@ var ShellMagnifier = class ShellMagnifier {
|
||||
let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
|
||||
let viewBox = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] };
|
||||
let realZoomRegion = Main.magnifier.createZoomRegion(xMagFactor, yMagFactor, ROI, viewBox);
|
||||
let objectPath = ZOOM_SERVICE_PATH + '/zoomer' + _zoomRegionInstanceCount;
|
||||
let objectPath = `${ZOOM_SERVICE_PATH}/zoomer${_zoomRegionInstanceCount}`;
|
||||
_zoomRegionInstanceCount++;
|
||||
|
||||
let zoomRegionProxy = new ShellMagnifierZoomRegion(objectPath, realZoomRegion);
|
||||
@@ -106,9 +107,9 @@ var ShellMagnifier = class ShellMagnifier {
|
||||
if (proxyAndZoomRegion && proxyAndZoomRegion.zoomRegion) {
|
||||
Main.magnifier.addZoomRegion(proxyAndZoomRegion.zoomRegion);
|
||||
return true;
|
||||
}
|
||||
else
|
||||
} else {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -124,7 +125,7 @@ var ShellMagnifier = class ShellMagnifier {
|
||||
let zoomRegions = Main.magnifier.getZoomRegions();
|
||||
let objectPaths = [];
|
||||
let thoseZoomers = this._zoomers;
|
||||
zoomRegions.forEach ((aZoomRegion, index, array) => {
|
||||
zoomRegions.forEach (aZoomRegion => {
|
||||
let found = false;
|
||||
for (let objectPath in thoseZoomers) {
|
||||
let proxyAndZoomRegion = thoseZoomers[objectPath];
|
||||
@@ -179,74 +180,74 @@ var ShellMagnifier = class ShellMagnifier {
|
||||
* Set the crosswire size of all ZoomRegions.
|
||||
* @size: The thickness of each line in the cross wire.
|
||||
*/
|
||||
setCrosswireSize(size) {
|
||||
setCrosswireSize(size) {
|
||||
Main.magnifier.setCrosshairsThickness(size);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* getCrosswireSize:
|
||||
* Get the crosswire size of all ZoomRegions.
|
||||
* @return: The thickness of each line in the cross wire.
|
||||
*/
|
||||
getCrosswireSize() {
|
||||
getCrosswireSize() {
|
||||
return Main.magnifier.getCrosshairsThickness();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* setCrosswireLength:
|
||||
* Set the crosswire length of all zoom-regions..
|
||||
* @size: The length of each line in the cross wire.
|
||||
*/
|
||||
setCrosswireLength(length) {
|
||||
setCrosswireLength(length) {
|
||||
Main.magnifier.setCrosshairsLength(length);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* setCrosswireSize:
|
||||
* Set the crosswire size of all zoom-regions.
|
||||
* @size: The thickness of each line in the cross wire.
|
||||
*/
|
||||
getCrosswireLength() {
|
||||
getCrosswireLength() {
|
||||
return Main.magnifier.getCrosshairsLength();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* setCrosswireClip:
|
||||
* Set if the crosswire will be clipped by the cursor image..
|
||||
* @clip: Flag to indicate whether to clip the crosswire.
|
||||
*/
|
||||
setCrosswireClip(clip) {
|
||||
setCrosswireClip(clip) {
|
||||
Main.magnifier.setCrosshairsClip(clip);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* getCrosswireClip:
|
||||
* Get the crosswire clip value.
|
||||
* @return: Whether the crosswire is clipped by the cursor image.
|
||||
*/
|
||||
getCrosswireClip() {
|
||||
getCrosswireClip() {
|
||||
return Main.magnifier.getCrosshairsClip();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* setCrosswireColor:
|
||||
* Set the crosswire color of all ZoomRegions.
|
||||
* @color: Unsigned int of the form rrggbbaa.
|
||||
*/
|
||||
setCrosswireColor(color) {
|
||||
setCrosswireColor(color) {
|
||||
Main.magnifier.setCrosshairsColor('#%08x'.format(color));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* getCrosswireClip:
|
||||
* Get the crosswire color of all ZoomRegions.
|
||||
* @return: The crosswire color as an unsigned int in the form rrggbbaa.
|
||||
*/
|
||||
getCrosswireColor() {
|
||||
getCrosswireColor() {
|
||||
let colorString = Main.magnifier.getCrosshairsColor();
|
||||
// Drop the leading '#'.
|
||||
return parseInt(colorString.slice(1), 16);
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,7 +1,14 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported componentManager, notificationDaemon, windowAttentionHandler,
|
||||
ctrlAltTabManager, padOsdService, osdWindowManager,
|
||||
osdMonitorLabeler, shellMountOpDBusService, shellDBusService,
|
||||
shellAccessDialogDBusService, shellAudioSelectionDBusService,
|
||||
screenSaverDBus, screencastService, uiGroup, magnifier,
|
||||
xdndHandler, keyboard, kbdA11yDialog, introspectService,
|
||||
start, pushModal, popModal, activateWindow, createLookingGlass,
|
||||
initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
|
||||
const AccessDialog = imports.ui.accessDialog;
|
||||
const AudioDeviceSelection = imports.ui.audioDeviceSelection;
|
||||
@@ -46,6 +53,7 @@ const LOG_DOMAIN = 'GNOME Shell';
|
||||
const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a';
|
||||
|
||||
var componentManager = null;
|
||||
var extensionManager = null;
|
||||
var panel = null;
|
||||
var overview = null;
|
||||
var runDialog = null;
|
||||
@@ -84,7 +92,6 @@ let _cssStylesheet = null;
|
||||
let _a11ySettings = null;
|
||||
let _themeResource = null;
|
||||
let _oskResource = null;
|
||||
let pointerA11yTimeout = null;
|
||||
|
||||
function _sessionUpdated() {
|
||||
if (sessionMode.isPrimary)
|
||||
@@ -140,12 +147,12 @@ function start() {
|
||||
|
||||
function _initializeUI() {
|
||||
// Ensure ShellWindowTracker and ShellAppUsage are initialized; this will
|
||||
// also initialize ShellAppSystem first. ShellAppSystem
|
||||
// also initialize ShellAppSystem first. ShellAppSystem
|
||||
// needs to load all the .desktop files, and ShellWindowTracker
|
||||
// will use those to associate with windows. Right now
|
||||
// will use those to associate with windows. Right now
|
||||
// the Monitor doesn't listen for installed app changes
|
||||
// and recalculate application associations, so to avoid
|
||||
// races for now we initialize it here. It's better to
|
||||
// races for now we initialize it here. It's better to
|
||||
// be predictable anyways.
|
||||
Shell.WindowTracker.get_default();
|
||||
Shell.AppUsage.get_default();
|
||||
@@ -157,8 +164,8 @@ function _initializeUI() {
|
||||
// Setup the stage hierarchy early
|
||||
layoutManager = new Layout.LayoutManager();
|
||||
|
||||
// Various parts of the codebase still refers to Main.uiGroup
|
||||
// instead using the layoutManager. This keeps that code
|
||||
// Various parts of the codebase still refer to Main.uiGroup
|
||||
// instead of using the layoutManager. This keeps that code
|
||||
// working until it's updated.
|
||||
uiGroup = layoutManager.uiGroup;
|
||||
|
||||
@@ -172,7 +179,7 @@ function _initializeUI() {
|
||||
kbdA11yDialog = new KbdA11yDialog.KbdA11yDialog();
|
||||
wm = new WindowManager.WindowManager();
|
||||
magnifier = new Magnifier.Magnifier();
|
||||
locatePointer = new LocatePointer.locatePointer();
|
||||
locatePointer = new LocatePointer.LocatePointer();
|
||||
|
||||
if (LoginManager.canLock())
|
||||
screenShield = new ScreenShield.ScreenShield();
|
||||
@@ -182,7 +189,7 @@ function _initializeUI() {
|
||||
|
||||
messageTray = new MessageTray.MessageTray();
|
||||
panel = new Panel.Panel();
|
||||
keyboard = new Keyboard.Keyboard();
|
||||
keyboard = new Keyboard.KeyboardManager();
|
||||
notificationDaemon = new NotificationDaemon.NotificationDaemon();
|
||||
windowAttentionHandler = new WindowAttentionHandler.WindowAttentionHandler();
|
||||
componentManager = new Components.ComponentManager();
|
||||
@@ -192,7 +199,7 @@ function _initializeUI() {
|
||||
layoutManager.init();
|
||||
overview.init();
|
||||
|
||||
pointerA11yTimeout = new PointerA11yTimeout.PointerA11yTimeout();
|
||||
(new PointerA11yTimeout.PointerA11yTimeout());
|
||||
|
||||
_a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA });
|
||||
|
||||
@@ -222,12 +229,17 @@ function _initializeUI() {
|
||||
EndSessionDialog.init();
|
||||
|
||||
// We're ready for the session manager to move to the next phase
|
||||
Meta.register_with_session();
|
||||
GLib.idle_add(GLib.PRIORITY_DEFAULT, () => {
|
||||
Shell.util_sd_notify();
|
||||
Meta.register_with_session();
|
||||
return GLib.SOURCE_REMOVE;
|
||||
});
|
||||
|
||||
_startDate = new Date();
|
||||
|
||||
ExtensionDownloader.init();
|
||||
ExtensionSystem.init();
|
||||
extensionManager = new ExtensionSystem.ExtensionManager();
|
||||
extensionManager.init();
|
||||
|
||||
if (sessionMode.isGreeter && screenShield) {
|
||||
layoutManager.connect('startup-prepared', () => {
|
||||
@@ -250,12 +262,25 @@ function _initializeUI() {
|
||||
});
|
||||
}
|
||||
|
||||
let credentials = new Gio.Credentials();
|
||||
if (credentials.get_unix_user() === 0) {
|
||||
notify(_('Logged in as a privileged user'),
|
||||
_('Running a session as a privileged user should be avoided for security reasons. If possible, you should log in as a normal user.'));
|
||||
}
|
||||
|
||||
if (sessionMode.currentMode !== 'gdm' &&
|
||||
sessionMode.currentMode !== 'initial-setup' &&
|
||||
screenShield === null) {
|
||||
notify(_('Screen Lock disabled'),
|
||||
_('Screen Locking requires the GNOME display manager.'));
|
||||
}
|
||||
|
||||
LoginManager.registerSessionWithGDM();
|
||||
|
||||
let perfModuleName = GLib.getenv("SHELL_PERF_MODULE");
|
||||
if (perfModuleName) {
|
||||
let perfOutput = GLib.getenv("SHELL_PERF_OUTPUT");
|
||||
let module = eval('imports.perf.' + perfModuleName + ';');
|
||||
let module = eval(`imports.perf.${perfModuleName};`);
|
||||
Scripting.runPerfScript(module, perfOutput);
|
||||
}
|
||||
});
|
||||
@@ -322,7 +347,7 @@ function getThemeStylesheet() {
|
||||
/**
|
||||
* setThemeStylesheet:
|
||||
* @cssStylesheet: A file path that contains the theme CSS,
|
||||
* set it to null to use the default
|
||||
* set it to null to use the default
|
||||
*
|
||||
* Set the theme CSS file that the shell will load
|
||||
*/
|
||||
@@ -378,7 +403,7 @@ function notify(msg, details) {
|
||||
messageTray.add(source);
|
||||
let notification = new MessageTray.Notification(source, msg, details);
|
||||
notification.setTransient(true);
|
||||
source.notify(notification);
|
||||
source.showNotification(notification);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -391,9 +416,9 @@ function notify(msg, details) {
|
||||
function notifyError(msg, details) {
|
||||
// Also print to stderr so it's logged somewhere
|
||||
if (details)
|
||||
log('error: ' + msg + ': ' + details);
|
||||
log(`error: ${msg}: ${details}`);
|
||||
else
|
||||
log('error: ' + msg);
|
||||
log(`error: ${msg}`);
|
||||
|
||||
notify(msg, details);
|
||||
}
|
||||
@@ -422,15 +447,15 @@ function _findModal(actor) {
|
||||
*
|
||||
* @params may be used to provide the following parameters:
|
||||
* - timestamp: used to associate the call with a specific user initiated
|
||||
* event. If not provided then the value of
|
||||
* event. If not provided then the value of
|
||||
* global.get_current_time() is assumed.
|
||||
*
|
||||
* - options: Meta.ModalOptions flags to indicate that the pointer is
|
||||
* already grabbed
|
||||
*
|
||||
* - actionMode: used to set the current Shell.ActionMode to filter
|
||||
* global keybindings; the default of NONE will filter
|
||||
* out all keybindings
|
||||
* global keybindings; the default of NONE will filter
|
||||
* out all keybindings
|
||||
*
|
||||
* Returns: true iff we successfully acquired a grab or already had one
|
||||
*/
|
||||
@@ -476,15 +501,15 @@ function pushModal(actor, params) {
|
||||
|
||||
/**
|
||||
* popModal:
|
||||
* @actor: #ClutterActor passed to original invocation of pushModal().
|
||||
* @actor: #ClutterActor passed to original invocation of pushModal()
|
||||
* @timestamp: optional timestamp
|
||||
*
|
||||
* Reverse the effect of pushModal(). If this invocation is undoing
|
||||
* Reverse the effect of pushModal(). If this invocation is undoing
|
||||
* the topmost invocation, then the focus will be restored to the
|
||||
* previous focus at the time when pushModal() was invoked.
|
||||
*
|
||||
* @timestamp is optionally used to associate the call with a specific user
|
||||
* initiated event. If not provided then the value of
|
||||
* initiated event. If not provided then the value of
|
||||
* global.get_current_time() is assumed.
|
||||
*/
|
||||
function popModal(actor, timestamp) {
|
||||
@@ -611,7 +636,7 @@ function _runDeferredWork(workId) {
|
||||
_deferredWorkQueue.splice(index, 1);
|
||||
_deferredWorkData[workId].callback();
|
||||
if (_deferredWorkQueue.length == 0 && _deferredTimeoutId > 0) {
|
||||
Mainloop.source_remove(_deferredTimeoutId);
|
||||
GLib.source_remove(_deferredTimeoutId);
|
||||
_deferredTimeoutId = 0;
|
||||
}
|
||||
}
|
||||
@@ -646,7 +671,7 @@ function _queueBeforeRedraw(workId) {
|
||||
*
|
||||
* This function sets up a callback to be invoked when either the
|
||||
* given actor is mapped, or after some period of time when the machine
|
||||
* is idle. This is useful if your actor isn't always visible on the
|
||||
* is idle. This is useful if your actor isn't always visible on the
|
||||
* screen (for example, all actors in the overview), and you don't want
|
||||
* to consume resources updating if the actor isn't actually going to be
|
||||
* displaying to the user.
|
||||
@@ -657,13 +682,13 @@ function _queueBeforeRedraw(workId) {
|
||||
*
|
||||
* Returns: A string work identifier
|
||||
*/
|
||||
function initializeDeferredWork(actor, callback, props) {
|
||||
function initializeDeferredWork(actor, callback) {
|
||||
// Turn into a string so we can use as an object property
|
||||
let workId = '' + (++_deferredWorkSequence);
|
||||
let workId = `${(++_deferredWorkSequence)}`;
|
||||
_deferredWorkData[workId] = { 'actor': actor,
|
||||
'callback': callback };
|
||||
actor.connect('notify::mapped', () => {
|
||||
if (!(actor.mapped && _deferredWorkQueue.indexOf(workId) >= 0))
|
||||
if (!(actor.mapped && _deferredWorkQueue.includes(workId)))
|
||||
return;
|
||||
_queueBeforeRedraw(workId);
|
||||
});
|
||||
@@ -682,7 +707,7 @@ function initializeDeferredWork(actor, callback, props) {
|
||||
* @workId: work identifier
|
||||
*
|
||||
* Ensure that the work identified by @workId will be
|
||||
* run on map or timeout. You should call this function
|
||||
* run on map or timeout. You should call this function
|
||||
* for example when data being displayed by the actor has
|
||||
* changed.
|
||||
*/
|
||||
@@ -693,13 +718,12 @@ function queueDeferredWork(workId) {
|
||||
logError(new Error(message), message);
|
||||
return;
|
||||
}
|
||||
if (_deferredWorkQueue.indexOf(workId) < 0)
|
||||
if (!_deferredWorkQueue.includes(workId))
|
||||
_deferredWorkQueue.push(workId);
|
||||
if (data.actor.mapped) {
|
||||
_queueBeforeRedraw(workId);
|
||||
return;
|
||||
} else if (_deferredTimeoutId == 0) {
|
||||
_deferredTimeoutId = Mainloop.timeout_add_seconds(DEFERRED_TIMEOUT_SECONDS, () => {
|
||||
_deferredTimeoutId = GLib.timeout_add_seconds(GLib.PRIORITY_DEFAULT, DEFERRED_TIMEOUT_SECONDS, () => {
|
||||
_runAllDeferredWork();
|
||||
_deferredTimeoutId = 0;
|
||||
return GLib.SOURCE_REMOVE;
|
||||
|
||||
@@ -1,13 +1,13 @@
|
||||
const { Atk, Clutter, Gio, GLib, GObject, Meta, Pango, St } = imports.gi;
|
||||
/* exported MessageListSection */
|
||||
const { Atk, Clutter, Gio, GLib,
|
||||
GObject, Graphene, Meta, Pango, St } = imports.gi;
|
||||
const Main = imports.ui.main;
|
||||
const MessageTray = imports.ui.messageTray;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Calendar = imports.ui.calendar;
|
||||
const Tweener = imports.ui.tweener;
|
||||
const Util = imports.misc.util;
|
||||
|
||||
var MESSAGE_ANIMATION_TIME = 0.1;
|
||||
var MESSAGE_ANIMATION_TIME = 100;
|
||||
|
||||
var DEFAULT_EXPAND_LINES = 6;
|
||||
|
||||
@@ -32,15 +32,18 @@ function _fixMarkup(text, allowMarkup) {
|
||||
return GLib.markup_escape_text(text, -1);
|
||||
}
|
||||
|
||||
var URLHighlighter = class URLHighlighter {
|
||||
constructor(text, lineWrap, allowMarkup) {
|
||||
if (!text)
|
||||
text = '';
|
||||
this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter',
|
||||
x_expand: true, x_align: Clutter.ActorAlign.START });
|
||||
var URLHighlighter = GObject.registerClass(
|
||||
class URLHighlighter extends St.Label {
|
||||
_init(text = '', lineWrap, allowMarkup) {
|
||||
super._init({
|
||||
reactive: true,
|
||||
style_class: 'url-highlighter',
|
||||
x_expand: true,
|
||||
x_align: Clutter.ActorAlign.START
|
||||
});
|
||||
this._linkColor = '#ccccff';
|
||||
this.actor.connect('style-changed', () => {
|
||||
let [hasColor, color] = this.actor.get_theme_node().lookup_color('link-color', false);
|
||||
this.connect('style-changed', () => {
|
||||
let [hasColor, color] = this.get_theme_node().lookup_color('link-color', false);
|
||||
if (hasColor) {
|
||||
let linkColor = color.to_string().substr(0, 7);
|
||||
if (linkColor != this._linkColor) {
|
||||
@@ -49,70 +52,75 @@ var URLHighlighter = class URLHighlighter {
|
||||
}
|
||||
}
|
||||
});
|
||||
this.actor.clutter_text.line_wrap = lineWrap;
|
||||
this.actor.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR;
|
||||
this.clutter_text.line_wrap = lineWrap;
|
||||
this.clutter_text.line_wrap_mode = Pango.WrapMode.WORD_CHAR;
|
||||
|
||||
this.setMarkup(text, allowMarkup);
|
||||
this.actor.connect('button-press-event', (actor, event) => {
|
||||
// Don't try to URL highlight when invisible.
|
||||
// The MessageTray doesn't actually hide us, so
|
||||
// we need to check for paint opacities as well.
|
||||
if (!actor.visible || actor.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
|
||||
// Keep Notification.actor from seeing this and taking
|
||||
// a pointer grab, which would block our button-release-event
|
||||
// handler, if an URL is clicked
|
||||
return this._findUrlAtPos(event) != -1;
|
||||
});
|
||||
this.actor.connect('button-release-event', (actor, event) => {
|
||||
if (!actor.visible || actor.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
let urlId = this._findUrlAtPos(event);
|
||||
if (urlId != -1) {
|
||||
let url = this._urls[urlId].url;
|
||||
if (url.indexOf(':') == -1)
|
||||
url = 'http://' + url;
|
||||
|
||||
Gio.app_info_launch_default_for_uri(url, global.create_app_launch_context(0, -1));
|
||||
return Clutter.EVENT_STOP;
|
||||
}
|
||||
vfunc_button_press_event(buttonEvent) {
|
||||
// Don't try to URL highlight when invisible.
|
||||
// The MessageTray doesn't actually hide us, so
|
||||
// we need to check for paint opacities as well.
|
||||
if (!this.visible || this.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
this.actor.connect('motion-event', (actor, event) => {
|
||||
if (!actor.visible || actor.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
let urlId = this._findUrlAtPos(event);
|
||||
if (urlId != -1 && !this._cursorChanged) {
|
||||
global.display.set_cursor(Meta.Cursor.POINTING_HAND);
|
||||
this._cursorChanged = true;
|
||||
} else if (urlId == -1) {
|
||||
global.display.set_cursor(Meta.Cursor.DEFAULT);
|
||||
this._cursorChanged = false;
|
||||
}
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
this.actor.connect('leave-event', () => {
|
||||
if (!this.actor.visible || this.actor.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
// Keep Notification from seeing this and taking
|
||||
// a pointer grab, which would block our button-release-event
|
||||
// handler, if an URL is clicked
|
||||
return this._findUrlAtPos(buttonEvent) != -1;
|
||||
}
|
||||
|
||||
if (this._cursorChanged) {
|
||||
this._cursorChanged = false;
|
||||
global.display.set_cursor(Meta.Cursor.DEFAULT);
|
||||
}
|
||||
vfunc_button_release_event(buttonEvent) {
|
||||
if (!this.visible || this.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
});
|
||||
|
||||
let urlId = this._findUrlAtPos(buttonEvent);
|
||||
if (urlId != -1) {
|
||||
let url = this._urls[urlId].url;
|
||||
if (!url.includes(':'))
|
||||
url = 'http://' + url;
|
||||
|
||||
Gio.app_info_launch_default_for_uri(
|
||||
url, global.create_app_launch_context(0, -1));
|
||||
return Clutter.EVENT_STOP;
|
||||
}
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
|
||||
vfunc_motion_event(motionEvent) {
|
||||
if (!this.visible || this.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
let urlId = this._findUrlAtPos(motionEvent);
|
||||
if (urlId != -1 && !this._cursorChanged) {
|
||||
global.display.set_cursor(Meta.Cursor.POINTING_HAND);
|
||||
this._cursorChanged = true;
|
||||
} else if (urlId == -1) {
|
||||
global.display.set_cursor(Meta.Cursor.DEFAULT);
|
||||
this._cursorChanged = false;
|
||||
}
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
|
||||
vfunc_leave_event(crossingEvent) {
|
||||
if (!this.visible || this.get_paint_opacity() == 0)
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
|
||||
if (this._cursorChanged) {
|
||||
this._cursorChanged = false;
|
||||
global.display.set_cursor(Meta.Cursor.DEFAULT);
|
||||
}
|
||||
return super.vfunc_leave_event(crossingEvent);
|
||||
}
|
||||
|
||||
setMarkup(text, allowMarkup) {
|
||||
text = text ? _fixMarkup(text, allowMarkup) : '';
|
||||
this._text = text;
|
||||
|
||||
this.actor.clutter_text.set_markup(text);
|
||||
this.clutter_text.set_markup(text);
|
||||
/* clutter_text.text contain text without markup */
|
||||
this._urls = Util.findUrls(this.actor.clutter_text.text);
|
||||
this._urls = Util.findUrls(this.clutter_text.text);
|
||||
this._highlightUrls();
|
||||
}
|
||||
|
||||
@@ -128,29 +136,28 @@ var URLHighlighter = class URLHighlighter {
|
||||
pos = url.pos + url.url.length;
|
||||
}
|
||||
markup += this._text.substr(pos);
|
||||
this.actor.clutter_text.set_markup(markup);
|
||||
this.clutter_text.set_markup(markup);
|
||||
}
|
||||
|
||||
_findUrlAtPos(event) {
|
||||
let success;
|
||||
let [x, y] = event.get_coords();
|
||||
[success, x, y] = this.actor.transform_stage_point(x, y);
|
||||
let find_pos = -1;
|
||||
for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
|
||||
let [success, px, py, line_height] = this.actor.clutter_text.position_to_coords(i);
|
||||
if (py > y || py + line_height < y || x < px)
|
||||
let { x, y } = event;
|
||||
[, x, y] = this.transform_stage_point(x, y);
|
||||
let findPos = -1;
|
||||
for (let i = 0; i < this.clutter_text.text.length; i++) {
|
||||
let [, px, py, lineHeight] = this.clutter_text.position_to_coords(i);
|
||||
if (py > y || py + lineHeight < y || x < px)
|
||||
continue;
|
||||
find_pos = i;
|
||||
findPos = i;
|
||||
}
|
||||
if (find_pos != -1) {
|
||||
if (findPos != -1) {
|
||||
for (let i = 0; i < this._urls.length; i++)
|
||||
if (find_pos >= this._urls[i].pos &&
|
||||
this._urls[i].pos + this._urls[i].url.length > find_pos)
|
||||
return i;
|
||||
if (findPos >= this._urls[i].pos &&
|
||||
this._urls[i].pos + this._urls[i].url.length > findPos)
|
||||
return i;
|
||||
}
|
||||
return -1;
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var ScaleLayout = GObject.registerClass(
|
||||
class ScaleLayout extends Clutter.BinLayout {
|
||||
@@ -197,12 +204,14 @@ class ScaleLayout extends Clutter.BinLayout {
|
||||
});
|
||||
|
||||
var LabelExpanderLayout = GObject.registerClass({
|
||||
Properties: { 'expansion': GObject.ParamSpec.double('expansion',
|
||||
'Expansion',
|
||||
'Expansion of the layout, between 0 (collapsed) ' +
|
||||
'and 1 (fully expanded',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
0, 1, 0)},
|
||||
Properties: {
|
||||
'expansion': GObject.ParamSpec.double('expansion',
|
||||
'Expansion',
|
||||
'Expansion of the layout, between 0 (collapsed) ' +
|
||||
'and 1 (fully expanded',
|
||||
GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
|
||||
0, 1, 0)
|
||||
},
|
||||
}, class LabelExpanderLayout extends Clutter.LayoutManager {
|
||||
_init(params) {
|
||||
this._expansion = 0;
|
||||
@@ -284,21 +293,29 @@ var LabelExpanderLayout = GObject.registerClass({
|
||||
}
|
||||
});
|
||||
|
||||
var Message = class Message {
|
||||
constructor(title, body) {
|
||||
this.expanded = false;
|
||||
|
||||
var Message = GObject.registerClass({
|
||||
GTypeName: 'MessageList_Message',
|
||||
Signals: {
|
||||
'close': {},
|
||||
'expanded': {},
|
||||
'unexpanded': {},
|
||||
}
|
||||
}, class Message extends St.Button {
|
||||
_init(title, body) {
|
||||
super._init({
|
||||
style_class: 'message',
|
||||
accessible_role: Atk.Role.NOTIFICATION,
|
||||
can_focus: true,
|
||||
x_expand: true,
|
||||
x_fill: true
|
||||
});
|
||||
|
||||
this.expanded = false;
|
||||
this._useBodyMarkup = false;
|
||||
|
||||
this.actor = new St.Button({ style_class: 'message',
|
||||
accessible_role: Atk.Role.NOTIFICATION,
|
||||
can_focus: true,
|
||||
x_expand: true, x_fill: true });
|
||||
this.actor.connect('key-press-event',
|
||||
this._onKeyPressed.bind(this));
|
||||
|
||||
let vbox = new St.BoxLayout({ vertical: true });
|
||||
this.actor.set_child(vbox);
|
||||
this.set_child(vbox);
|
||||
|
||||
let hbox = new St.BoxLayout();
|
||||
vbox.add_actor(hbox);
|
||||
@@ -342,15 +359,14 @@ var Message = class Message {
|
||||
contentBox.add_actor(this._bodyStack);
|
||||
|
||||
this.bodyLabel = new URLHighlighter('', false, this._useBodyMarkup);
|
||||
this.bodyLabel.actor.add_style_class_name('message-body');
|
||||
this._bodyStack.add_actor(this.bodyLabel.actor);
|
||||
this.bodyLabel.add_style_class_name('message-body');
|
||||
this._bodyStack.add_actor(this.bodyLabel);
|
||||
this.setBody(body);
|
||||
|
||||
this._closeButton.connect('clicked', this.close.bind(this));
|
||||
let actorHoverId = this.actor.connect('notify::hover', this._sync.bind(this));
|
||||
this._closeButton.connect('destroy', this.actor.disconnect.bind(this.actor, actorHoverId));
|
||||
this.actor.connect('clicked', this._onClicked.bind(this));
|
||||
this.actor.connect('destroy', this._onDestroy.bind(this));
|
||||
let actorHoverId = this.connect('notify::hover', this._sync.bind(this));
|
||||
this._closeButton.connect('destroy', this.disconnect.bind(this, actorHoverId));
|
||||
this.connect('destroy', this._onDestroy.bind(this));
|
||||
this._sync();
|
||||
}
|
||||
|
||||
@@ -436,19 +452,21 @@ var Message = class Message {
|
||||
if (this._bodyStack.get_n_children() < 2) {
|
||||
this._expandedLabel = new URLHighlighter(this._bodyText,
|
||||
true, this._useBodyMarkup);
|
||||
this.setExpandedBody(this._expandedLabel.actor);
|
||||
this.setExpandedBody(this._expandedLabel);
|
||||
}
|
||||
|
||||
if (animate) {
|
||||
Tweener.addTween(this._bodyStack.layout_manager,
|
||||
{ expansion: 1,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
this._bodyStack.ease_property('@layout.expansion', 1, {
|
||||
progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
});
|
||||
|
||||
this._actionBin.scale_y = 0;
|
||||
Tweener.addTween(this._actionBin,
|
||||
{ scale_y: 1,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
this._actionBin.ease({
|
||||
scale_y: 1,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
} else {
|
||||
this._bodyStack.layout_manager.expansion = 1;
|
||||
this._actionBin.scale_y = 1;
|
||||
@@ -459,19 +477,20 @@ var Message = class Message {
|
||||
|
||||
unexpand(animate) {
|
||||
if (animate) {
|
||||
Tweener.addTween(this._bodyStack.layout_manager,
|
||||
{ expansion: 0,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
Tweener.addTween(this._actionBin,
|
||||
{ scale_y: 0,
|
||||
time: MessageTray.ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onCompleteScope: this,
|
||||
onComplete() {
|
||||
this._actionBin.hide();
|
||||
this.expanded = false;
|
||||
}});
|
||||
this._bodyStack.ease_property('@layout.expansion', 0, {
|
||||
progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
});
|
||||
|
||||
this._actionBin.ease({
|
||||
scale_y: 0,
|
||||
duration: MessageTray.ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._actionBin.hide();
|
||||
this.expanded = false;
|
||||
}
|
||||
});
|
||||
} else {
|
||||
this._bodyStack.layout_manager.expansion = 0;
|
||||
this._actionBin.scale_y = 0;
|
||||
@@ -486,19 +505,16 @@ var Message = class Message {
|
||||
}
|
||||
|
||||
_sync() {
|
||||
let visible = this.actor.hover && this.canClose();
|
||||
let visible = this.hover && this.canClose();
|
||||
this._closeButton.opacity = visible ? 255 : 0;
|
||||
this._closeButton.reactive = visible;
|
||||
}
|
||||
|
||||
_onClicked() {
|
||||
}
|
||||
|
||||
_onDestroy() {
|
||||
}
|
||||
|
||||
_onKeyPressed(a, event) {
|
||||
let keysym = event.get_key_symbol();
|
||||
vfunc_key_press_event(keyEvent) {
|
||||
let keysym = keyEvent.keyval;
|
||||
|
||||
if (keysym == Clutter.KEY_Delete ||
|
||||
keysym == Clutter.KEY_KP_Delete) {
|
||||
@@ -507,37 +523,66 @@ var Message = class Message {
|
||||
}
|
||||
return Clutter.EVENT_PROPAGATE;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Message.prototype);
|
||||
});
|
||||
|
||||
var MessageListSection = class MessageListSection {
|
||||
constructor() {
|
||||
this.actor = new St.BoxLayout({ style_class: 'message-list-section',
|
||||
clip_to_allocation: true,
|
||||
x_expand: true, vertical: true });
|
||||
var MessageListSection = GObject.registerClass({
|
||||
Properties: {
|
||||
'can-clear': GObject.ParamSpec.boolean(
|
||||
'can-clear', 'can-clear', 'can-clear',
|
||||
GObject.ParamFlags.READABLE,
|
||||
false),
|
||||
'empty': GObject.ParamSpec.boolean(
|
||||
'empty', 'empty', 'empty',
|
||||
GObject.ParamFlags.READABLE,
|
||||
true),
|
||||
},
|
||||
Signals: {
|
||||
'can-clear-changed': {},
|
||||
'empty-changed': {},
|
||||
'message-focused': { param_types: [Message.$gtype] },
|
||||
}
|
||||
}, class MessageListSection extends St.BoxLayout {
|
||||
_init() {
|
||||
super._init({
|
||||
style_class: 'message-list-section',
|
||||
clip_to_allocation: true,
|
||||
vertical: true,
|
||||
x_expand: true
|
||||
});
|
||||
|
||||
this._list = new St.BoxLayout({ style_class: 'message-list-section-list',
|
||||
vertical: true });
|
||||
this.actor.add_actor(this._list);
|
||||
this.add_actor(this._list);
|
||||
|
||||
this._list.connect('actor-added', this._sync.bind(this));
|
||||
this._list.connect('actor-removed', this._sync.bind(this));
|
||||
|
||||
let id = Main.sessionMode.connect('updated',
|
||||
this._sync.bind(this));
|
||||
this.actor.connect('destroy', () => {
|
||||
this.connect('destroy', () => {
|
||||
Main.sessionMode.disconnect(id);
|
||||
});
|
||||
|
||||
this._messages = new Map();
|
||||
this._date = new Date();
|
||||
this.empty = true;
|
||||
this.canClear = false;
|
||||
this._empty = true;
|
||||
this._canClear = false;
|
||||
this._sync();
|
||||
}
|
||||
|
||||
_onKeyFocusIn(actor) {
|
||||
this.emit('key-focus-in', actor);
|
||||
get empty() {
|
||||
return this._empty;
|
||||
}
|
||||
|
||||
get canClear() {
|
||||
return this._canClear;
|
||||
}
|
||||
|
||||
get _messages() {
|
||||
return this._list.get_children().map(i => i.child);
|
||||
}
|
||||
|
||||
_onKeyFocusIn(messageActor) {
|
||||
this.emit('message-focused', messageActor);
|
||||
}
|
||||
|
||||
get allowed() {
|
||||
@@ -556,85 +601,96 @@ var MessageListSection = class MessageListSection {
|
||||
}
|
||||
|
||||
addMessageAtIndex(message, index, animate) {
|
||||
let obj = {
|
||||
container: null,
|
||||
destroyId: 0,
|
||||
keyFocusId: 0,
|
||||
closeId: 0
|
||||
};
|
||||
let pivot = new Clutter.Point({ x: .5, y: .5 });
|
||||
let scale = animate ? 0 : 1;
|
||||
obj.container = new St.Widget({ layout_manager: new ScaleLayout(),
|
||||
pivot_point: pivot,
|
||||
scale_x: scale, scale_y: scale });
|
||||
obj.keyFocusId = message.actor.connect('key-focus-in',
|
||||
this._onKeyFocusIn.bind(this));
|
||||
obj.destroyId = message.actor.connect('destroy', () => {
|
||||
this.removeMessage(message, false);
|
||||
if (this._messages.includes(message))
|
||||
throw new Error('Message was already added previously');
|
||||
|
||||
let listItem = new St.Bin({
|
||||
child: message,
|
||||
x_fill: true,
|
||||
y_fill: true,
|
||||
layout_manager: new ScaleLayout(),
|
||||
pivot_point: new Graphene.Point({ x: .5, y: .5 }),
|
||||
});
|
||||
obj.closeId = message.connect('close', () => {
|
||||
listItem._connectionsIds = [];
|
||||
|
||||
listItem._connectionsIds.push(message.connect('key-focus-in',
|
||||
this._onKeyFocusIn.bind(this)));
|
||||
listItem._connectionsIds.push(message.connect('close', () => {
|
||||
this.removeMessage(message, true);
|
||||
});
|
||||
}));
|
||||
listItem._connectionsIds.push(message.connect('destroy', () => {
|
||||
listItem._connectionsIds.forEach(id => message.disconnect(id));
|
||||
listItem.destroy();
|
||||
}));
|
||||
|
||||
this._messages.set(message, obj);
|
||||
obj.container.add_actor(message.actor);
|
||||
this._list.insert_child_at_index(listItem, index);
|
||||
|
||||
this._list.insert_child_at_index(obj.container, index);
|
||||
|
||||
if (animate)
|
||||
Tweener.addTween(obj.container, { scale_x: 1,
|
||||
scale_y: 1,
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
if (animate) {
|
||||
listItem.set({ scale_x: 0, scale_y: 0 });
|
||||
listItem.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
moveMessage(message, index, animate) {
|
||||
let obj = this._messages.get(message);
|
||||
if (!this._messages.includes(message))
|
||||
throw new Error(`Impossible to move the untracked message ${message}`);
|
||||
|
||||
let listItem = message.get_parent();
|
||||
|
||||
if (!animate) {
|
||||
this._list.set_child_at_index(obj.container, index);
|
||||
this._list.set_child_at_index(listItem, index);
|
||||
return;
|
||||
}
|
||||
|
||||
let onComplete = () => {
|
||||
this._list.set_child_at_index(obj.container, index);
|
||||
Tweener.addTween(obj.container, { scale_x: 1,
|
||||
scale_y: 1,
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad' });
|
||||
this._list.set_child_at_index(listItem, index);
|
||||
listItem.ease({
|
||||
scale_x: 1,
|
||||
scale_y: 1,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD
|
||||
});
|
||||
};
|
||||
Tweener.addTween(obj.container, { scale_x: 0,
|
||||
scale_y: 0,
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: onComplete });
|
||||
listItem.ease({
|
||||
scale_x: 0,
|
||||
scale_y: 0,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete
|
||||
});
|
||||
}
|
||||
|
||||
removeMessage(message, animate) {
|
||||
let obj = this._messages.get(message);
|
||||
if (!this._messages.includes(message))
|
||||
throw new Error(`Impossible to remove the untracked message ${message}`);
|
||||
|
||||
message.actor.disconnect(obj.destroyId);
|
||||
message.actor.disconnect(obj.keyFocusId);
|
||||
message.disconnect(obj.closeId);
|
||||
|
||||
this._messages.delete(message);
|
||||
let listItem = message.get_parent();
|
||||
listItem._connectionsIds.forEach(id => message.disconnect(id));
|
||||
|
||||
if (animate) {
|
||||
Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0,
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
obj.container.destroy();
|
||||
global.sync_pointer();
|
||||
}});
|
||||
listItem.ease({
|
||||
scale_x: 0,
|
||||
scale_y: 0,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
listItem.destroy();
|
||||
global.sync_pointer();
|
||||
}
|
||||
});
|
||||
} else {
|
||||
obj.container.destroy();
|
||||
listItem.destroy();
|
||||
global.sync_pointer();
|
||||
}
|
||||
}
|
||||
|
||||
clear() {
|
||||
let messages = [...this._messages.keys()].filter(msg => msg.canClose());
|
||||
let messages = this._messages.filter(msg => msg.canClose());
|
||||
|
||||
// If there are few messages, letting them all zoom out looks OK
|
||||
if (messages.length < 2) {
|
||||
@@ -647,47 +703,37 @@ var MessageListSection = class MessageListSection {
|
||||
let delay = MESSAGE_ANIMATION_TIME / Math.max(messages.length, 5);
|
||||
for (let i = 0; i < messages.length; i++) {
|
||||
let message = messages[i];
|
||||
let obj = this._messages.get(message);
|
||||
Tweener.addTween(obj.container,
|
||||
{ anchor_x: this._list.width,
|
||||
opacity: 0,
|
||||
time: MESSAGE_ANIMATION_TIME,
|
||||
delay: i * delay,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete() {
|
||||
message.close();
|
||||
}});
|
||||
message.get_parent().ease({
|
||||
translation_x: this._list.width,
|
||||
opacity: 0,
|
||||
duration: MESSAGE_ANIMATION_TIME,
|
||||
delay: i * delay,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => message.close()
|
||||
});
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
_canClear() {
|
||||
for (let message of this._messages.keys())
|
||||
if (message.canClose())
|
||||
return true;
|
||||
return false;
|
||||
}
|
||||
|
||||
_shouldShow() {
|
||||
return !this.empty;
|
||||
}
|
||||
|
||||
_sync() {
|
||||
let empty = this._list.get_n_children() == 0;
|
||||
let changed = this.empty !== empty;
|
||||
this.empty = empty;
|
||||
let messages = this._messages;
|
||||
let empty = messages.length == 0;
|
||||
|
||||
if (changed)
|
||||
this.emit('empty-changed');
|
||||
if (this._empty != empty) {
|
||||
this._empty = empty;
|
||||
this.notify('empty');
|
||||
}
|
||||
|
||||
let canClear = this._canClear();
|
||||
changed = this.canClear !== canClear;
|
||||
this.canClear = canClear;
|
||||
let canClear = messages.some(m => m.canClose());
|
||||
if (this._canClear != canClear) {
|
||||
this._canClear = canClear;
|
||||
this.notify('can-clear');
|
||||
}
|
||||
|
||||
if (changed)
|
||||
this.emit('can-clear-changed');
|
||||
|
||||
this.actor.visible = this.allowed && this._shouldShow();
|
||||
this.visible = this.allowed && this._shouldShow();
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(MessageListSection.prototype);
|
||||
});
|
||||
|
||||
@@ -1,23 +1,23 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported NotificationPolicy, NotificationGenericPolicy,
|
||||
NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel,
|
||||
SystemNotificationSource, MessageTray */
|
||||
|
||||
const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
|
||||
const Mainloop = imports.mainloop;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Calendar = imports.ui.calendar;
|
||||
const GnomeSession = imports.misc.gnomeSession;
|
||||
const Layout = imports.ui.layout;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings';
|
||||
|
||||
var ANIMATION_TIME = 0.2;
|
||||
var NOTIFICATION_TIMEOUT = 4;
|
||||
var ANIMATION_TIME = 200;
|
||||
var NOTIFICATION_TIMEOUT = 4000;
|
||||
|
||||
var HIDE_TIMEOUT = 0.2;
|
||||
var LONGER_HIDE_TIMEOUT = 0.6;
|
||||
var HIDE_TIMEOUT = 200;
|
||||
var LONGER_HIDE_TIMEOUT = 600;
|
||||
|
||||
var MAX_NOTIFICATIONS_IN_QUEUE = 3;
|
||||
var MAX_NOTIFICATIONS_PER_SOURCE = 3;
|
||||
@@ -133,70 +133,84 @@ var FocusGrabber = class FocusGrabber {
|
||||
// source, such as whether to play sound or honour the critical bit.
|
||||
//
|
||||
// A notification without a policy object will inherit the default one.
|
||||
var NotificationPolicy = class NotificationPolicy {
|
||||
constructor(params) {
|
||||
params = Params.parse(params, { enable: true,
|
||||
enableSound: true,
|
||||
showBanners: true,
|
||||
forceExpanded: false,
|
||||
showInLockScreen: true,
|
||||
detailsInLockScreen: false
|
||||
});
|
||||
Object.getOwnPropertyNames(params).forEach(key => {
|
||||
let desc = Object.getOwnPropertyDescriptor(params, key);
|
||||
Object.defineProperty(this, `_${key}`, desc);
|
||||
});
|
||||
var NotificationPolicy = GObject.registerClass({
|
||||
GTypeName: 'MessageTray_NotificationPolicy',
|
||||
Properties: {
|
||||
'enable': GObject.ParamSpec.boolean(
|
||||
'enable', 'enable', 'enable',
|
||||
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
|
||||
true),
|
||||
'enable-sound': GObject.ParamSpec.boolean(
|
||||
'enable-sound', 'enable-sound', 'enable-sound',
|
||||
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
|
||||
true),
|
||||
'show-banners': GObject.ParamSpec.boolean(
|
||||
'show-banners', 'show-banners', 'show-banners',
|
||||
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
|
||||
true),
|
||||
'force-expanded': GObject.ParamSpec.boolean(
|
||||
'force-expanded', 'force-expanded', 'force-expanded',
|
||||
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
|
||||
false),
|
||||
'show-in-lock-screen': GObject.ParamSpec.boolean(
|
||||
'show-in-lock-screen', 'show-in-lock-screen', 'show-in-lock-screen',
|
||||
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
|
||||
false),
|
||||
'details-in-lock-screen': GObject.ParamSpec.boolean(
|
||||
'details-in-lock-screen', 'details-in-lock-screen', 'details-in-lock-screen',
|
||||
GObject.ParamFlags.READWRITE | GObject.ParamFlags.CONSTRUCT_ONLY,
|
||||
false),
|
||||
}
|
||||
|
||||
}, class NotificationPolicy extends GObject.Object {
|
||||
// Do nothing for the default policy. These methods are only useful for the
|
||||
// GSettings policy.
|
||||
store() { }
|
||||
destroy() { }
|
||||
|
||||
get enable() {
|
||||
return this._enable;
|
||||
destroy() {
|
||||
this.run_dispose();
|
||||
}
|
||||
|
||||
get enableSound() {
|
||||
return this._enableSound;
|
||||
return this.enable_sound;
|
||||
}
|
||||
|
||||
get showBanners() {
|
||||
return this._showBanners;
|
||||
return this.show_banners;
|
||||
}
|
||||
|
||||
get forceExpanded() {
|
||||
return this._forceExpanded;
|
||||
return this.force_expanded;
|
||||
}
|
||||
|
||||
get showInLockScreen() {
|
||||
return this._showInLockScreen;
|
||||
return this.show_in_lock_screen;
|
||||
}
|
||||
|
||||
get detailsInLockScreen() {
|
||||
return this._detailsInLockScreen;
|
||||
return this.details_in_lock_screen;
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(NotificationPolicy.prototype);
|
||||
});
|
||||
|
||||
var NotificationGenericPolicy =
|
||||
class NotificationGenericPolicy extends NotificationPolicy {
|
||||
constructor() {
|
||||
super();
|
||||
var NotificationGenericPolicy = GObject.registerClass({
|
||||
GTypeName: 'MessageTray_NotificationGenericPolicy'
|
||||
}, class NotificationGenericPolicy extends NotificationPolicy {
|
||||
_init() {
|
||||
super._init();
|
||||
this.id = 'generic';
|
||||
|
||||
this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' });
|
||||
this._masterSettings.connect('changed', this._changed.bind(this));
|
||||
}
|
||||
|
||||
store() { }
|
||||
|
||||
destroy() {
|
||||
this._masterSettings.run_dispose();
|
||||
|
||||
super.destroy();
|
||||
}
|
||||
|
||||
_changed(settings, key) {
|
||||
this.emit('policy-changed', key);
|
||||
if (this.constructor.find_property(key))
|
||||
this.notify(key);
|
||||
}
|
||||
|
||||
get showBanners() {
|
||||
@@ -206,29 +220,30 @@ class NotificationGenericPolicy extends NotificationPolicy {
|
||||
get showInLockScreen() {
|
||||
return this._masterSettings.get_boolean('show-in-lock-screen');
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var NotificationApplicationPolicy =
|
||||
class NotificationApplicationPolicy extends NotificationPolicy {
|
||||
constructor(id) {
|
||||
super();
|
||||
var NotificationApplicationPolicy = GObject.registerClass({
|
||||
GTypeName: 'MessageTray_NotificationApplicationPolicy'
|
||||
}, class NotificationApplicationPolicy extends NotificationPolicy {
|
||||
_init(id) {
|
||||
super._init();
|
||||
|
||||
this.id = id;
|
||||
this._canonicalId = this._canonicalizeId(id);
|
||||
|
||||
this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' });
|
||||
this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications.application',
|
||||
path: '/org/gnome/desktop/notifications/application/' + this._canonicalId + '/' });
|
||||
path: `/org/gnome/desktop/notifications/application/${this._canonicalId}/` });
|
||||
|
||||
this._masterSettings.connect('changed', this._changed.bind(this));
|
||||
this._settings.connect('changed', this._changed.bind(this));
|
||||
}
|
||||
|
||||
store() {
|
||||
this._settings.set_string('application-id', this.id + '.desktop');
|
||||
this._settings.set_string('application-id', `${this.id}.desktop`);
|
||||
|
||||
let apps = this._masterSettings.get_strv('application-children');
|
||||
if (apps.indexOf(this._canonicalId) < 0) {
|
||||
if (!apps.includes(this._canonicalId)) {
|
||||
apps.push(this._canonicalId);
|
||||
this._masterSettings.set_strv('application-children', apps);
|
||||
}
|
||||
@@ -237,18 +252,19 @@ class NotificationApplicationPolicy extends NotificationPolicy {
|
||||
destroy() {
|
||||
this._masterSettings.run_dispose();
|
||||
this._settings.run_dispose();
|
||||
|
||||
super.destroy();
|
||||
}
|
||||
|
||||
_changed(settings, key) {
|
||||
this.emit('policy-changed', key);
|
||||
if (key == 'enable')
|
||||
this.emit('enable-changed');
|
||||
if (this.constructor.find_property(key))
|
||||
this.notify(key);
|
||||
}
|
||||
|
||||
_canonicalizeId(id) {
|
||||
// Keys are restricted to lowercase alphanumeric characters and dash,
|
||||
// and two dashes cannot be in succession
|
||||
return id.toLowerCase().replace(/[^a-z0-9\-]/g, '-').replace(/--+/g, '-');
|
||||
return id.toLowerCase().replace(/[^a-z0-9-]/g, '-').replace(/--+/g, '-');
|
||||
}
|
||||
|
||||
get enable() {
|
||||
@@ -276,7 +292,7 @@ class NotificationApplicationPolicy extends NotificationPolicy {
|
||||
get detailsInLockScreen() {
|
||||
return this._settings.get_boolean('details-in-lock-screen');
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
// Notification:
|
||||
// @source: the notification's Source
|
||||
@@ -332,13 +348,27 @@ class NotificationApplicationPolicy extends NotificationPolicy {
|
||||
// event sound is played when the notification is shown (if the policy for
|
||||
// @source allows playing sounds).
|
||||
//
|
||||
// [1] https://developer.gnome.org/notification-spec/#markup
|
||||
var Notification = class Notification {
|
||||
constructor(source, title, banner, params) {
|
||||
// [1] https://developer.gnome.org/notification-spec/#markup
|
||||
var Notification = GObject.registerClass({
|
||||
GTypeName: 'MessageTray_Notification',
|
||||
Properties: {
|
||||
'acknowledged': GObject.ParamSpec.boolean(
|
||||
'acknowledged', 'acknowledged', 'acknowledged',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
false),
|
||||
},
|
||||
Signals: {
|
||||
'activated': {},
|
||||
'destroy': { param_types: [GObject.TYPE_UINT] },
|
||||
'updated': { param_types: [GObject.TYPE_BOOLEAN] },
|
||||
}
|
||||
}, class Notification extends GObject.Object {
|
||||
_init(source, title, banner, params) {
|
||||
super._init();
|
||||
|
||||
this.source = source;
|
||||
this.title = title;
|
||||
this.urgency = Urgency.NORMAL;
|
||||
this.resident = false;
|
||||
// 'transient' is a reserved keyword in JS, so we have to use an alternate variable name
|
||||
this.isTransient = false;
|
||||
this.privacyScope = PrivacyScope.USER;
|
||||
@@ -350,6 +380,7 @@ var Notification = class Notification {
|
||||
this._soundFile = null;
|
||||
this._soundPlayed = false;
|
||||
this.actions = [];
|
||||
this.setResident(false);
|
||||
|
||||
// If called with only one argument we assume the caller
|
||||
// will call .update() later on. This is the case of
|
||||
@@ -419,7 +450,7 @@ var Notification = class Notification {
|
||||
if (this._acknowledged == v)
|
||||
return;
|
||||
this._acknowledged = v;
|
||||
this.emit('acknowledged-changed');
|
||||
this.notify('acknowledged');
|
||||
}
|
||||
|
||||
setUrgency(urgency) {
|
||||
@@ -428,6 +459,15 @@ var Notification = class Notification {
|
||||
|
||||
setResident(resident) {
|
||||
this.resident = resident;
|
||||
|
||||
if (this.resident) {
|
||||
if (this._activatedId) {
|
||||
this.disconnect(this._activatedId);
|
||||
this._activatedId = 0;
|
||||
}
|
||||
} else if (!this._activatedId) {
|
||||
this._activatedId = this.connect_after('activated', () => this.destroy());
|
||||
}
|
||||
}
|
||||
|
||||
setTransient(isTransient) {
|
||||
@@ -469,25 +509,30 @@ var Notification = class Notification {
|
||||
|
||||
activate() {
|
||||
this.emit('activated');
|
||||
if (!this.resident)
|
||||
this.destroy();
|
||||
}
|
||||
|
||||
destroy(reason) {
|
||||
if (!reason)
|
||||
reason = NotificationDestroyedReason.DISMISSED;
|
||||
destroy(reason = NotificationDestroyedReason.DISMISSED) {
|
||||
if (this._activatedId) {
|
||||
this.disconnect(this._activatedId);
|
||||
delete this._activatedId;
|
||||
}
|
||||
|
||||
this.emit('destroy', reason);
|
||||
this.run_dispose();
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Notification.prototype);
|
||||
});
|
||||
|
||||
var NotificationBanner =
|
||||
class NotificationBanner extends Calendar.NotificationMessage {
|
||||
constructor(notification) {
|
||||
super(notification);
|
||||
var NotificationBanner = GObject.registerClass({
|
||||
Signals: {
|
||||
'done-displaying': {},
|
||||
'unfocused': {},
|
||||
}
|
||||
}, class NotificationBanner extends Calendar.NotificationMessage {
|
||||
_init(notification) {
|
||||
super._init(notification);
|
||||
|
||||
this.actor.can_focus = false;
|
||||
this.actor.add_style_class_name('notification-banner');
|
||||
this.can_focus = false;
|
||||
this.add_style_class_name('notification-banner');
|
||||
|
||||
this._buttonBox = null;
|
||||
|
||||
@@ -574,7 +619,7 @@ class NotificationBanner extends Calendar.NotificationMessage {
|
||||
|
||||
return this.addButton(button, callback);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var SourceActor = GObject.registerClass(
|
||||
class SourceActor extends St.Widget {
|
||||
@@ -590,11 +635,11 @@ class SourceActor extends St.Widget {
|
||||
});
|
||||
this._actorDestroyed = false;
|
||||
|
||||
let scale_factor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
|
||||
let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
|
||||
this._iconBin = new St.Bin({ x_fill: true,
|
||||
x_expand: true,
|
||||
height: size * scale_factor,
|
||||
width: size * scale_factor });
|
||||
height: size * scaleFactor,
|
||||
width: size * scaleFactor });
|
||||
|
||||
this.add_actor(this._iconBin);
|
||||
|
||||
@@ -639,7 +684,7 @@ class SourceActorWithLabel extends SourceActor {
|
||||
|
||||
this.add_actor(this._counterBin);
|
||||
|
||||
this._countUpdatedId = this._source.connect('count-updated', this._updateCount.bind(this));
|
||||
this._countUpdatedId = this._source.connect('notify::count', this._updateCount.bind(this));
|
||||
this._updateCount();
|
||||
|
||||
this.connect('destroy', () => {
|
||||
@@ -652,7 +697,7 @@ class SourceActorWithLabel extends SourceActor {
|
||||
|
||||
let childBox = new Clutter.ActorBox();
|
||||
|
||||
let [minWidth, minHeight, naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
|
||||
let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
|
||||
let direction = this.get_text_direction();
|
||||
|
||||
if (direction == Clutter.TextDirection.LTR) {
|
||||
@@ -687,11 +732,34 @@ class SourceActorWithLabel extends SourceActor {
|
||||
}
|
||||
});
|
||||
|
||||
var Source = class Source {
|
||||
constructor(title, iconName) {
|
||||
var Source = GObject.registerClass({
|
||||
GTypeName: 'MessageTray_Source',
|
||||
Properties: {
|
||||
'count': GObject.ParamSpec.int(
|
||||
'count', 'count', 'count',
|
||||
GObject.ParamFlags.READABLE,
|
||||
0, GLib.MAXINT32, 0),
|
||||
'policy': GObject.ParamSpec.object(
|
||||
'policy', 'policy', 'policy',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
NotificationPolicy.$gtype),
|
||||
'title': GObject.ParamSpec.string(
|
||||
'title', 'title', 'title',
|
||||
GObject.ParamFlags.READWRITE,
|
||||
null),
|
||||
},
|
||||
Signals: {
|
||||
'destroy': { param_types: [GObject.TYPE_UINT] },
|
||||
'icon-updated': {},
|
||||
'notification-added': { param_types: [Notification.$gtype] },
|
||||
'notification-show': { param_types: [Notification.$gtype] },
|
||||
}
|
||||
}, class Source extends GObject.Object {
|
||||
_init(title, iconName) {
|
||||
super._init({ title: title });
|
||||
|
||||
this.SOURCE_ICON_SIZE = 48;
|
||||
|
||||
this.title = title;
|
||||
this.iconName = iconName;
|
||||
|
||||
this.isChat = false;
|
||||
@@ -726,7 +794,7 @@ var Source = class Source {
|
||||
}
|
||||
|
||||
countUpdated() {
|
||||
this.emit('count-updated');
|
||||
super.notify('count');
|
||||
}
|
||||
|
||||
_createPolicy() {
|
||||
@@ -734,13 +802,17 @@ var Source = class Source {
|
||||
}
|
||||
|
||||
get narrowestPrivacyScope() {
|
||||
return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM) ? PrivacyScope.SYSTEM
|
||||
: PrivacyScope.USER;
|
||||
return this.notifications.every(n => n.privacyScope == PrivacyScope.SYSTEM)
|
||||
? PrivacyScope.SYSTEM
|
||||
: PrivacyScope.USER;
|
||||
}
|
||||
|
||||
setTitle(newTitle) {
|
||||
if (this.title == newTitle)
|
||||
return;
|
||||
|
||||
this.title = newTitle;
|
||||
this.emit('title-changed');
|
||||
this.notify('title');
|
||||
}
|
||||
|
||||
createBanner(notification) {
|
||||
@@ -765,38 +837,53 @@ var Source = class Source {
|
||||
return;
|
||||
|
||||
this.notifications.splice(index, 1);
|
||||
this.countUpdated();
|
||||
|
||||
if (this.notifications.length == 0)
|
||||
this.destroy();
|
||||
|
||||
this.countUpdated();
|
||||
}
|
||||
|
||||
pushNotification(notification) {
|
||||
if (this.notifications.indexOf(notification) >= 0)
|
||||
if (this.notifications.includes(notification))
|
||||
return;
|
||||
|
||||
while (this.notifications.length >= MAX_NOTIFICATIONS_PER_SOURCE)
|
||||
this.notifications.shift().destroy(NotificationDestroyedReason.EXPIRED);
|
||||
|
||||
notification.connect('destroy', this._onNotificationDestroy.bind(this));
|
||||
notification.connect('acknowledged-changed', this.countUpdated.bind(this));
|
||||
notification.connect('notify::acknowledged', this.countUpdated.bind(this));
|
||||
this.notifications.push(notification);
|
||||
this.emit('notification-added', notification);
|
||||
|
||||
this.countUpdated();
|
||||
}
|
||||
|
||||
notify(notification) {
|
||||
showNotification(notification) {
|
||||
notification.acknowledged = false;
|
||||
this.pushNotification(notification);
|
||||
|
||||
if (this.policy.showBanners || notification.urgency == Urgency.CRITICAL) {
|
||||
this.emit('notify', notification);
|
||||
this.emit('notification-show', notification);
|
||||
} else {
|
||||
notification.playSound();
|
||||
}
|
||||
}
|
||||
|
||||
notify(propName) {
|
||||
if (propName instanceof Notification) {
|
||||
try {
|
||||
throw new Error('Source.notify() has been moved to Source.showNotification()' +
|
||||
'this code will break in the future');
|
||||
} catch (e) {
|
||||
logError(e);
|
||||
this.showNotification(propName);
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
super.notify(propName);
|
||||
}
|
||||
|
||||
destroy(reason) {
|
||||
this.policy.destroy();
|
||||
|
||||
@@ -807,6 +894,8 @@ var Source = class Source {
|
||||
notifications[i].destroy(reason);
|
||||
|
||||
this.emit('destroy', reason);
|
||||
|
||||
this.run_dispose();
|
||||
}
|
||||
|
||||
iconUpdated() {
|
||||
@@ -821,15 +910,24 @@ var Source = class Source {
|
||||
for (let i = this.notifications.length - 1; i >= 0; i--)
|
||||
if (!this.notifications[i].resident)
|
||||
this.notifications[i].destroy();
|
||||
|
||||
this.countUpdated();
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(Source.prototype);
|
||||
});
|
||||
|
||||
var MessageTray = class MessageTray {
|
||||
constructor() {
|
||||
this._presence = new GnomeSession.Presence((proxy, error) => {
|
||||
var MessageTray = GObject.registerClass({
|
||||
Signals: {
|
||||
'queue-changed': {},
|
||||
'source-added': { param_types: [Source.$gtype] },
|
||||
'source-removed': { param_types: [Source.$gtype] },
|
||||
}
|
||||
}, class MessageTray extends St.Widget {
|
||||
_init() {
|
||||
super._init({
|
||||
visible: false,
|
||||
clip_to_allocation: true,
|
||||
layout_manager: new Clutter.BinLayout()
|
||||
});
|
||||
|
||||
this._presence = new GnomeSession.Presence((proxy, _error) => {
|
||||
this._onStatusChanged(proxy.status);
|
||||
});
|
||||
this._busy = false;
|
||||
@@ -845,18 +943,15 @@ var MessageTray = class MessageTray {
|
||||
// so fix up Clutter's view of the pointer position in
|
||||
// that case.
|
||||
let related = ev.get_related();
|
||||
if (!related || this.actor.contains(related))
|
||||
if (!related || this.contains(related))
|
||||
global.sync_pointer();
|
||||
});
|
||||
|
||||
this.actor = new St.Widget({ visible: false,
|
||||
clip_to_allocation: true,
|
||||
layout_manager: new Clutter.BinLayout() });
|
||||
let constraint = new Layout.MonitorConstraint({ primary: true });
|
||||
Main.layoutManager.panelBox.bind_property('visible',
|
||||
constraint, 'work-area',
|
||||
GObject.BindingFlags.SYNC_CREATE);
|
||||
this.actor.add_constraint(constraint);
|
||||
this.add_constraint(constraint);
|
||||
|
||||
this._bannerBin = new St.Widget({ name: 'notification-container',
|
||||
reactive: true,
|
||||
@@ -870,7 +965,7 @@ var MessageTray = class MessageTray {
|
||||
this._onNotificationKeyRelease.bind(this));
|
||||
this._bannerBin.connect('notify::hover',
|
||||
this._onNotificationHoverChanged.bind(this));
|
||||
this.actor.add_actor(this._bannerBin);
|
||||
this.add_actor(this._bannerBin);
|
||||
|
||||
this._notificationFocusGrabber = new FocusGrabber(this._bannerBin);
|
||||
this._notificationQueue = [];
|
||||
@@ -899,7 +994,7 @@ var MessageTray = class MessageTray {
|
||||
this._notificationTimeoutId = 0;
|
||||
this._notificationRemoved = false;
|
||||
|
||||
Main.layoutManager.addChrome(this.actor, { affectsInputRegion: false });
|
||||
Main.layoutManager.addChrome(this, { affectsInputRegion: false });
|
||||
Main.layoutManager.trackChrome(this._bannerBin, { affectsInputRegion: true });
|
||||
|
||||
global.display.connect('in-fullscreen-changed', this._updateState.bind(this));
|
||||
@@ -942,11 +1037,11 @@ var MessageTray = class MessageTray {
|
||||
}
|
||||
|
||||
_onDragBegin() {
|
||||
Shell.util_set_hidden_from_pick(this.actor, true);
|
||||
Shell.util_set_hidden_from_pick(this, true);
|
||||
}
|
||||
|
||||
_onDragEnd() {
|
||||
Shell.util_set_hidden_from_pick(this.actor, false);
|
||||
Shell.util_set_hidden_from_pick(this, false);
|
||||
}
|
||||
|
||||
get bannerAlignment() {
|
||||
@@ -988,30 +1083,29 @@ var MessageTray = class MessageTray {
|
||||
|
||||
add(source) {
|
||||
if (this.contains(source)) {
|
||||
log('Trying to re-add source ' + source.title);
|
||||
log(`Trying to re-add source ${source.title}`);
|
||||
return;
|
||||
}
|
||||
|
||||
// Register that we got a notification for this source
|
||||
source.policy.store();
|
||||
|
||||
source.policy.connect('enable-changed', () => {
|
||||
source.policy.connect('notify::enable', () => {
|
||||
this._onSourceEnableChanged(source.policy, source);
|
||||
});
|
||||
source.policy.connect('policy-changed', this._updateState.bind(this));
|
||||
source.policy.connect('notify', this._updateState.bind(this));
|
||||
this._onSourceEnableChanged(source.policy, source);
|
||||
}
|
||||
|
||||
_addSource(source) {
|
||||
let obj = {
|
||||
source: source,
|
||||
notifyId: 0,
|
||||
showId: 0,
|
||||
destroyId: 0,
|
||||
};
|
||||
|
||||
this._sources.set(source, obj);
|
||||
|
||||
obj.notifyId = source.connect('notify', this._onNotify.bind(this));
|
||||
obj.showId = source.connect('notification-show', this._onNotificationShow.bind(this));
|
||||
obj.destroyId = source.connect('destroy', this._onSourceDestroy.bind(this));
|
||||
|
||||
this.emit('source-added', source);
|
||||
@@ -1021,7 +1115,7 @@ var MessageTray = class MessageTray {
|
||||
let obj = this._sources.get(source);
|
||||
this._sources.delete(source);
|
||||
|
||||
source.disconnect(obj.notifyId);
|
||||
source.disconnect(obj.showId);
|
||||
source.disconnect(obj.destroyId);
|
||||
|
||||
this.emit('source-removed', source);
|
||||
@@ -1062,14 +1156,14 @@ var MessageTray = class MessageTray {
|
||||
}
|
||||
}
|
||||
|
||||
_onNotify(source, notification) {
|
||||
_onNotificationShow(_source, notification) {
|
||||
if (this._notification == notification) {
|
||||
// If a notification that is being shown is updated, we update
|
||||
// how it is shown and extend the time until it auto-hides.
|
||||
// If a new notification is updated while it is being hidden,
|
||||
// we stop hiding it and show it again.
|
||||
this._updateShowingNotification();
|
||||
} else if (this._notificationQueue.indexOf(notification) < 0) {
|
||||
} else if (!this._notificationQueue.includes(notification)) {
|
||||
// If the queue is "full", we skip banner mode and just show a small
|
||||
// indicator in the panel; however do make an exception for CRITICAL
|
||||
// notifications, as only banner mode allows expansion.
|
||||
@@ -1091,7 +1185,7 @@ var MessageTray = class MessageTray {
|
||||
_resetNotificationLeftTimeout() {
|
||||
this._useLongerNotificationLeftTimeout = false;
|
||||
if (this._notificationLeftTimeoutId) {
|
||||
Mainloop.source_remove(this._notificationLeftTimeoutId);
|
||||
GLib.source_remove(this._notificationLeftTimeoutId);
|
||||
this._notificationLeftTimeoutId = 0;
|
||||
this._notificationLeftMouseX = -1;
|
||||
this._notificationLeftMouseY = -1;
|
||||
@@ -1129,15 +1223,15 @@ var MessageTray = class MessageTray {
|
||||
// this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us
|
||||
// to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still
|
||||
// close to its previous position, we extend the timeout once.
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
let [x, y] = global.get_pointer();
|
||||
this._notificationLeftMouseX = x;
|
||||
this._notificationLeftMouseY = y;
|
||||
|
||||
// We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it.
|
||||
// We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
|
||||
// That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
|
||||
let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000;
|
||||
this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
|
||||
let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT;
|
||||
this._notificationLeftTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout, this._onNotificationLeftTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
|
||||
}
|
||||
}
|
||||
@@ -1158,7 +1252,7 @@ var MessageTray = class MessageTray {
|
||||
}
|
||||
|
||||
_onNotificationLeftTimeout() {
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
let [x, y] = global.get_pointer();
|
||||
// We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side.
|
||||
if (this._notificationLeftMouseX > -1 &&
|
||||
y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD &&
|
||||
@@ -1166,8 +1260,10 @@ var MessageTray = class MessageTray {
|
||||
x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
|
||||
x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
|
||||
this._notificationLeftMouseX = -1;
|
||||
this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000,
|
||||
this._onNotificationLeftTimeout.bind(this));
|
||||
this._notificationLeftTimeoutId = GLib.timeout_add(
|
||||
GLib.PRIORITY_DEFAULT,
|
||||
LONGER_HIDE_TIMEOUT,
|
||||
this._onNotificationLeftTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
|
||||
} else {
|
||||
this._notificationLeftTimeoutId = 0;
|
||||
@@ -1192,7 +1288,7 @@ var MessageTray = class MessageTray {
|
||||
// at the present time.
|
||||
_updateState() {
|
||||
let hasMonitor = Main.layoutManager.primaryMonitor != null;
|
||||
this.actor.visible = !this._bannerBlocked && hasMonitor && this._banner != null;
|
||||
this.visible = !this._bannerBlocked && hasMonitor && this._banner != null;
|
||||
if (this._bannerBlocked || !hasMonitor)
|
||||
return;
|
||||
|
||||
@@ -1248,34 +1344,6 @@ var MessageTray = class MessageTray {
|
||||
this._notificationExpired = false;
|
||||
}
|
||||
|
||||
_tween(actor, statevar, value, params) {
|
||||
let onComplete = params.onComplete;
|
||||
let onCompleteScope = params.onCompleteScope;
|
||||
let onCompleteParams = params.onCompleteParams;
|
||||
|
||||
params.onComplete = this._tweenComplete;
|
||||
params.onCompleteScope = this;
|
||||
params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams];
|
||||
|
||||
// Remove other tweens that could mess with the state machine
|
||||
Tweener.removeTweens(actor);
|
||||
Tweener.addTween(actor, params);
|
||||
|
||||
let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING;
|
||||
this[statevar] = valuing;
|
||||
}
|
||||
|
||||
_tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) {
|
||||
this[statevar] = value;
|
||||
if (onComplete)
|
||||
onComplete.apply(onCompleteScope, onCompleteParams);
|
||||
this._updateState();
|
||||
}
|
||||
|
||||
_clampOpacity() {
|
||||
this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255));
|
||||
}
|
||||
|
||||
_onIdleMonitorBecameActive() {
|
||||
this._userActiveWhileNotificationShown = true;
|
||||
this._updateNotificationTimeout(2000);
|
||||
@@ -1300,17 +1368,16 @@ var MessageTray = class MessageTray {
|
||||
this._updateState();
|
||||
});
|
||||
|
||||
this._bannerBin.add_actor(this._banner.actor);
|
||||
this._bannerBin.add_actor(this._banner);
|
||||
|
||||
this._bannerBin._opacity = 0;
|
||||
this._bannerBin.opacity = 0;
|
||||
this._bannerBin.y = -this._banner.actor.height;
|
||||
this.actor.show();
|
||||
this._bannerBin.y = -this._banner.height;
|
||||
this.show();
|
||||
|
||||
Meta.disable_unredirect_for_display(global.display);
|
||||
this._updateShowingNotification();
|
||||
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
let [x, y] = global.get_pointer();
|
||||
// We save the position of the mouse at the time when we started showing the notification
|
||||
// in order to determine if the notification popped up under it. We make that check if
|
||||
// the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't
|
||||
@@ -1348,39 +1415,45 @@ var MessageTray = class MessageTray {
|
||||
// We use this._showNotificationCompleted() onComplete callback to extend the time the updated
|
||||
// notification is being shown.
|
||||
|
||||
let tweenParams = { y: 0,
|
||||
_opacity: 255,
|
||||
time: ANIMATION_TIME,
|
||||
transition: 'easeOutBack',
|
||||
onUpdate: this._clampOpacity,
|
||||
onUpdateScope: this,
|
||||
onComplete: this._showNotificationCompleted,
|
||||
onCompleteScope: this
|
||||
};
|
||||
|
||||
this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams);
|
||||
this._notificationState = State.SHOWING;
|
||||
this._bannerBin.remove_all_transitions();
|
||||
this._bannerBin.ease({
|
||||
opacity: 255,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.LINEAR
|
||||
});
|
||||
this._bannerBin.ease({
|
||||
y: 0,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_BACK,
|
||||
onComplete: () => {
|
||||
this._notificationState = State.SHOWN;
|
||||
this._showNotificationCompleted();
|
||||
this._updateState();
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
_showNotificationCompleted() {
|
||||
if (this._notification.urgency != Urgency.CRITICAL)
|
||||
this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000);
|
||||
this._updateNotificationTimeout(NOTIFICATION_TIMEOUT);
|
||||
}
|
||||
|
||||
_updateNotificationTimeout(timeout) {
|
||||
if (this._notificationTimeoutId) {
|
||||
Mainloop.source_remove(this._notificationTimeoutId);
|
||||
GLib.source_remove(this._notificationTimeoutId);
|
||||
this._notificationTimeoutId = 0;
|
||||
}
|
||||
if (timeout > 0) {
|
||||
this._notificationTimeoutId =
|
||||
Mainloop.timeout_add(timeout,
|
||||
this._notificationTimeout.bind(this));
|
||||
GLib.timeout_add(GLib.PRIORITY_DEFAULT, timeout,
|
||||
this._notificationTimeout.bind(this));
|
||||
GLib.Source.set_name_by_id(this._notificationTimeoutId, '[gnome-shell] this._notificationTimeout');
|
||||
}
|
||||
}
|
||||
|
||||
_notificationTimeout() {
|
||||
let [x, y, mods] = global.get_pointer();
|
||||
let [x, y] = global.get_pointer();
|
||||
if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) {
|
||||
// The mouse is moving towards the notification, so don't
|
||||
// hide it yet. (We just create a new timeout (and destroy
|
||||
@@ -1416,20 +1489,26 @@ var MessageTray = class MessageTray {
|
||||
}
|
||||
|
||||
this._resetNotificationLeftTimeout();
|
||||
this._bannerBin.remove_all_transitions();
|
||||
|
||||
if (animate) {
|
||||
this._tween(this._bannerBin, '_notificationState', State.HIDDEN,
|
||||
{ y: -this._bannerBin.height,
|
||||
_opacity: 0,
|
||||
time: ANIMATION_TIME,
|
||||
transition: 'easeOutBack',
|
||||
onUpdate: this._clampOpacity,
|
||||
onUpdateScope: this,
|
||||
onComplete: this._hideNotificationCompleted,
|
||||
onCompleteScope: this
|
||||
});
|
||||
this._notificationState = State.HIDING;
|
||||
this._bannerBin.ease({
|
||||
opacity: 0,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_BACK
|
||||
});
|
||||
this._bannerBin.ease({
|
||||
y: -this._bannerBin.height,
|
||||
duration: ANIMATION_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_BACK,
|
||||
onComplete: () => {
|
||||
this._notificationState = State.HIDDEN;
|
||||
this._hideNotificationCompleted();
|
||||
this._updateState();
|
||||
}
|
||||
});
|
||||
} else {
|
||||
Tweener.removeTweens(this._bannerBin);
|
||||
this._bannerBin.y = -this._bannerBin.height;
|
||||
this._bannerBin.opacity = 0;
|
||||
this._notificationState = State.HIDDEN;
|
||||
@@ -1440,16 +1519,16 @@ var MessageTray = class MessageTray {
|
||||
_hideNotificationCompleted() {
|
||||
let notification = this._notification;
|
||||
this._notification = null;
|
||||
if (notification.isTransient)
|
||||
if (!this._notificationRemoved && notification.isTransient)
|
||||
notification.destroy(NotificationDestroyedReason.EXPIRED);
|
||||
|
||||
this._pointerInNotification = false;
|
||||
this._notificationRemoved = false;
|
||||
Meta.enable_unredirect_for_display(global.display);
|
||||
|
||||
this._banner.actor.destroy();
|
||||
this._banner.destroy();
|
||||
this._banner = null;
|
||||
this.actor.hide();
|
||||
this.hide();
|
||||
}
|
||||
|
||||
_expandActiveNotification() {
|
||||
@@ -1471,15 +1550,15 @@ var MessageTray = class MessageTray {
|
||||
_ensureBannerFocused() {
|
||||
this._notificationFocusGrabber.grabFocus();
|
||||
}
|
||||
};
|
||||
Signals.addSignalMethods(MessageTray.prototype);
|
||||
});
|
||||
|
||||
var SystemNotificationSource = class SystemNotificationSource extends Source {
|
||||
constructor() {
|
||||
super(_("System Information"), 'dialog-information-symbolic');
|
||||
var SystemNotificationSource = GObject.registerClass(
|
||||
class SystemNotificationSource extends Source {
|
||||
_init() {
|
||||
super._init(_("System Information"), 'dialog-information-symbolic');
|
||||
}
|
||||
|
||||
open() {
|
||||
this.destroy();
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
@@ -1,17 +1,16 @@
|
||||
// -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
|
||||
/* exported ModalDialog */
|
||||
|
||||
const { Atk, Clutter, GObject, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Dialog = imports.ui.dialog;
|
||||
const Layout = imports.ui.layout;
|
||||
const Lightbox = imports.ui.lightbox;
|
||||
const Main = imports.ui.main;
|
||||
const Params = imports.misc.params;
|
||||
const Tweener = imports.ui.tweener;
|
||||
|
||||
var OPEN_AND_CLOSE_TIME = 0.1;
|
||||
var FADE_OUT_DIALOG_TIME = 1.0;
|
||||
var OPEN_AND_CLOSE_TIME = 100;
|
||||
var FADE_OUT_DIALOG_TIME = 1000;
|
||||
|
||||
var State = {
|
||||
OPENED: 0,
|
||||
@@ -22,11 +21,13 @@ var State = {
|
||||
};
|
||||
|
||||
var ModalDialog = GObject.registerClass({
|
||||
Properties: { 'state': GObject.ParamSpec.int('state', 'Dialog state', 'state',
|
||||
GObject.ParamFlags.READABLE,
|
||||
Math.min(...Object.values(State)),
|
||||
Math.max(...Object.values(State)),
|
||||
State.CLOSED) },
|
||||
Properties: {
|
||||
'state': GObject.ParamSpec.int('state', 'Dialog state', 'state',
|
||||
GObject.ParamFlags.READABLE,
|
||||
Math.min(...Object.values(State)),
|
||||
Math.max(...Object.values(State)),
|
||||
State.CLOSED)
|
||||
},
|
||||
Signals: { 'opened': {}, 'closed': {} }
|
||||
}, class ModalDialog extends St.Widget {
|
||||
_init(params) {
|
||||
@@ -120,18 +121,18 @@ var ModalDialog = GObject.registerClass({
|
||||
|
||||
this.dialogLayout.opacity = 255;
|
||||
if (this._lightbox)
|
||||
this._lightbox.show();
|
||||
this._lightbox.lightOn();
|
||||
this.opacity = 0;
|
||||
this.show();
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 255,
|
||||
time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this._setState(State.OPENED);
|
||||
this.emit('opened');
|
||||
}
|
||||
});
|
||||
this.ease({
|
||||
opacity: 255,
|
||||
duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => {
|
||||
this._setState(State.OPENED);
|
||||
this.emit('opened');
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
setInitialKeyFocus(actor) {
|
||||
@@ -174,15 +175,16 @@ var ModalDialog = GObject.registerClass({
|
||||
this.popModal(timestamp);
|
||||
this._savedKeyFocus = null;
|
||||
|
||||
if (this._shouldFadeOut)
|
||||
Tweener.addTween(this,
|
||||
{ opacity: 0,
|
||||
time: OPEN_AND_CLOSE_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: this._closeComplete.bind(this)
|
||||
})
|
||||
else
|
||||
if (this._shouldFadeOut) {
|
||||
this.ease({
|
||||
opacity: 0,
|
||||
duration: OPEN_AND_CLOSE_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => this._closeComplete()
|
||||
});
|
||||
} else {
|
||||
this._closeComplete();
|
||||
}
|
||||
}
|
||||
|
||||
// Drop modal status without closing the dialog; this makes the
|
||||
@@ -247,13 +249,11 @@ var ModalDialog = GObject.registerClass({
|
||||
return;
|
||||
|
||||
this.popModal(timestamp);
|
||||
Tweener.addTween(this.dialogLayout,
|
||||
{ opacity: 0,
|
||||
time: FADE_OUT_DIALOG_TIME,
|
||||
transition: 'easeOutQuad',
|
||||
onComplete: () => {
|
||||
this._setState(State.FADED_OUT);
|
||||
}
|
||||
});
|
||||
this.dialogLayout.ease({
|
||||
opacity: 0,
|
||||
duration: FADE_OUT_DIALOG_TIME,
|
||||
mode: Clutter.AnimationMode.EASE_OUT_QUAD,
|
||||
onComplete: () => (this.state = State.FADED_OUT)
|
||||
});
|
||||
}
|
||||
});
|
||||
|
||||
@@ -1,4 +1,5 @@
|
||||
const { Gio, Shell, St } = imports.gi;
|
||||
/* exported MediaSection */
|
||||
const { Gio, GObject, Shell, St } = imports.gi;
|
||||
const Signals = imports.signals;
|
||||
|
||||
const Calendar = imports.ui.calendar;
|
||||
@@ -18,9 +19,10 @@ const MprisPlayerProxy = Gio.DBusProxy.makeProxyWrapper(MprisPlayerIface);
|
||||
|
||||
const MPRIS_PLAYER_PREFIX = 'org.mpris.MediaPlayer2.';
|
||||
|
||||
var MediaMessage = class MediaMessage extends MessageList.Message {
|
||||
constructor(player) {
|
||||
super('', '');
|
||||
var MediaMessage = GObject.registerClass(
|
||||
class MediaMessage extends MessageList.Message {
|
||||
_init(player) {
|
||||
super._init('', '');
|
||||
|
||||
this._player = player;
|
||||
|
||||
@@ -47,7 +49,7 @@ var MediaMessage = class MediaMessage extends MessageList.Message {
|
||||
this._update();
|
||||
}
|
||||
|
||||
_onClicked() {
|
||||
vfunc_clicked() {
|
||||
this._player.raise();
|
||||
Main.panel.closeCalendar();
|
||||
}
|
||||
@@ -70,14 +72,15 @@ var MediaMessage = class MediaMessage extends MessageList.Message {
|
||||
}
|
||||
|
||||
let isPlaying = this._player.status == 'Playing';
|
||||
let iconName = isPlaying ? 'media-playback-pause-symbolic'
|
||||
: 'media-playback-start-symbolic';
|
||||
let iconName = isPlaying
|
||||
? 'media-playback-pause-symbolic'
|
||||
: 'media-playback-start-symbolic';
|
||||
this._playPauseButton.child.icon_name = iconName;
|
||||
|
||||
this._updateNavButton(this._prevButton, this._player.canGoPrevious);
|
||||
this._updateNavButton(this._nextButton, this._player.canGoNext);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
var MprisPlayer = class MprisPlayer {
|
||||
constructor(busName) {
|
||||
@@ -135,7 +138,7 @@ var MprisPlayer = class MprisPlayer {
|
||||
// so prefer activating the app via .desktop file if possible
|
||||
let app = null;
|
||||
if (this._mprisProxy.DesktopEntry) {
|
||||
let desktopId = this._mprisProxy.DesktopEntry + '.desktop';
|
||||
let desktopId = `${this._mprisProxy.DesktopEntry}.desktop`;
|
||||
app = Shell.AppSystem.get_default().lookup_app(desktopId);
|
||||
}
|
||||
|
||||
@@ -192,9 +195,10 @@ var MprisPlayer = class MprisPlayer {
|
||||
};
|
||||
Signals.addSignalMethods(MprisPlayer.prototype);
|
||||
|
||||
var MediaSection = class MediaSection extends MessageList.MessageListSection {
|
||||
constructor() {
|
||||
super();
|
||||
var MediaSection = GObject.registerClass(
|
||||
class MediaSection extends MessageList.MessageListSection {
|
||||
_init() {
|
||||
super._init();
|
||||
|
||||
this._players = new Map();
|
||||
|
||||
@@ -245,4 +249,4 @@ var MediaSection = class MediaSection extends MessageList.MessageListSection {
|
||||
if (newOwner && !oldOwner)
|
||||
this._addPlayer(name);
|
||||
}
|
||||
};
|
||||
});
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user