adjust UI to new text styles

With the new text styles, some UI needs to adjusted, primarily to accommodate larger heading text.
theme: Standardise text styles
2019-06-27 13:52:40 +01:00 · 2019-06-27 13:51:14 +01:00 · 2019-06-27 13:51:14 +01:00
272 changed files with 22082 additions and 41685 deletions
--- a/.eslintrc.json
+++ b/.eslintrc.json
@@ -1,6 +0,0 @@
-{
-    "extends": [
-        "./lint/eslintrc-gjs.json",
-        "./lint/eslintrc-shell.json"
-    ]
-}
--- a/.gitlab-ci.yml
+++ b/.gitlab-ci.yml
@@ -1,5 +1,6 @@
 stages:
 - review
+ - source_check
 - build
 - test

@@ -25,27 +26,19 @@ check_commit_log:

 js_check:
    image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
-    stage: review
+    stage: source_check
    script:
        - find js -name '*.js' -exec js60 -c -s '{}' ';' 2>&1 | tee $JS_LOG
        - (! grep -q . $JS_LOG)
    <<: *only_default
+    only:
+        changes:
+            - js/**/*
    artifacts:
        paths:
            - ${JS_LOG}
        when: on_failure

-eslint:
-    image: registry.gitlab.gnome.org/gnome/gnome-shell/extension-ci:v1
-    stage: review
-    script:
-        - ./.gitlab-ci/run-eslint.sh
-    <<: *only_default
-    artifacts:
-        paths:
-            - reports
-        when: always
-
 build:
    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: build
@@ -54,7 +47,7 @@ build:
        - meson mutter mutter/build --prefix=/usr -Dtests=false
        - ninja -C mutter/build install
    script:
-        - meson . build -Dbuiltype=debugoptimized -Dman=false
+        - meson . build -Dbuiltype=debugoptimized
        - ninja -C build
        - ninja -C build install
    <<: *only_default
@@ -67,8 +60,6 @@ build:
 test:
    image: registry.gitlab.gnome.org/gnome/mutter/master:v2
    stage: test
-    variables:
-        XDG_RUNTIME_DIR: "$CI_PROJECT_DIR/runtime-dir"
    before_script:
        - ninja -C mutter/build install
    script:
--- a/.gitlab-ci/Dockerfile.extension-ci
+++ b/.gitlab-ci/Dockerfile.extension-ci
@@ -1,7 +1,7 @@
 FROM registry.fedoraproject.org/fedora:latest

 RUN dnf -y update && dnf -y upgrade && \
-    dnf install -y 'dnf-command(copr)' git && \
+    dnf install -y 'dnf-command(copr)' && \

    # For syntax checks with `find . -name '*.js' -exec js60 -c -s '{}' ';'`
    dnf install -y findutils mozjs60-devel && \
--- a/.gitlab-ci/run-eslint.sh
+++ b/.gitlab-ci/run-eslint.sh
@@ -1,97 +0,0 @@
-#!/usr/bin/env bash
-
-OUTPUT_REGULAR=reports/lint-regular-report.txt
-OUTPUT_LEGACY=reports/lint-legacy-report.txt
-OUTPUT_FINAL=reports/lint-common-report.txt
-
-OUTPUT_MR=reports/lint-mr-report.txt
-
-LINE_CHANGES=changed-lines.txt
-
-is_empty() {
-  (! grep -q . $1)
-}
-
-run_eslint() {
-  ARGS_LEGACY='--config lint/eslintrc-legacy.json'
-
-  local extra_args=ARGS_$1
-  local output=OUTPUT_$1
-  eslint -f unix ${!extra_args} -o ${!output} js
-}
-
-list_commit_range_additions() {
-  # Turn raw context-less git-diff into a list of
-  # filename:lineno pairs of new (+) lines
-  git diff -U0 "$@" -- js |
-  awk '
-    BEGIN { file=""; }
-    /^+++ b/ { file=substr($0,7); }
-    /^@@ / {
-        len = split($3,a,",")
-        start=a[1]
-        count=(len > 1) ? a[2] : 1
-
-        for (line=start; line<start+count; line++)
-            printf "%s/%s:%d:\n",ENVIRON["PWD"],file,line;
-    }'
-}
-
-copy_matched_lines() {
-  local source=$1
-  local matches=$2
-  local target=$3
-
-  echo -n > $target
-  for l in $(<$matches); do
-    grep $l $source >> $target
-  done
-}
-
-create_common() {
-  # comm requires sorted input;
-  # we also strip the error message to make the following a "common" error:
-  # regular:
-  #  file.js:42:23 Indentation of 55, expected 42
-  # legacy:
-  #  file.js:42:23 Indentation of 55, extected 24
-  prepare() {
-    sed 's: .*::' $1 | sort
-  }
-
-  comm -12 <(prepare $OUTPUT_REGULAR) <(prepare $OUTPUT_LEGACY) >$OUTPUT_FINAL.tmp
-
-  # Now add back the stripped error messages
-  copy_matched_lines $OUTPUT_REGULAR $OUTPUT_FINAL.tmp $OUTPUT_FINAL
-  rm $OUTPUT_FINAL.tmp
-}
-
-if [ "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
-  git fetch $CI_MERGE_REQUEST_PROJECT_URL.git $CI_MERGE_REQUEST_TARGET_BRANCH_NAME
-  branch_point=$(git merge-base HEAD FETCH_HEAD)
-  commit_range=$branch_point...$CI_COMMIT_SHA
-
-  list_commit_range_additions $commit_range > $LINE_CHANGES
-
-  # Don't bother with running lint when no JS changed
-  if is_empty $LINE_CHANGES; then
-    exit 0
-  fi
-fi
-
-echo Generating lint report using regular configuration
-run_eslint REGULAR
-echo Generating lint report using legacy configuration
-run_eslint LEGACY
-echo Done.
-create_common
-
-# Just show the report and succeed when not testing a MR
-if [ -z "$CI_MERGE_REQUEST_TARGET_BRANCH_NAME" ]; then
-  cat $OUTPUT_FINAL
-  exit 0
-fi
-
-copy_matched_lines $OUTPUT_FINAL $LINE_CHANGES $OUTPUT_MR
-cat $OUTPUT_MR
-is_empty $OUTPUT_MR
--- a/HACKING.md
+++ b/HACKING.md
@@ -84,6 +84,7 @@ don't use.

    const Main = imports.ui.main;
    const Params = imports.misc.params;
+    const Tweener = imports.ui.tweener;
    const Util = imports.misc.util;
 ```
 The alphabetical ordering should be done independently of the location of the
@@ -276,49 +277,34 @@ If your usage of an object is like a hash table (and thus conceptually the keys
 can have special chars in them), don't use quotes, but use brackets: `{ bar: 42
 }`, `foo['bar']`.

-## Animations
-
-Most objects that are animated are actors, and most properties used in animations
-are animatable, which means they can use implicit animations:
+## Getters, setters, and Tweener

+Getters and setters should be used when you are dealing with an API that is
+designed around setting properties, like Tweener. If you want to animate an
+arbitrary property, create a getter and setter, and use Tweener to animate the
+property.
 ```javascript
-    moveActor(actor, x, y) {
-        actor.ease({
-            x,
-            y,
-            duration: 500, // ms
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
-    }
-```
-
-The above is a convenience wrapper around the actual Clutter API, and should generally
-be preferred over the more verbose:
-
-```javascript
-    moveActor(actor, x, y) {
-        actor.save_easing_state();
-
-        actor.set_easing_duration(500);
-        actor.set_easing_mode(Clutter.AnimationMode.EASE_OUT_QUAD);
-        actor.set({
-            x,
-            y
-        });
-
-        actor.restore_easing_state();
-    }
-```
-
-There is a similar convenience API around Clutter.PropertyTransition to animate
-actor (or actor meta) properties that cannot use implicit animations:
-
-```javascript
-    desaturateActor(actor, desaturate) {
-        let factor = desaturate ? 1.0 : 0.0;
-        actor.ease_property('@effects.desaturate.factor', factor, {
-            duration: 500, // ms
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
-    }
+    var ANIMATION_TIME = 2000;
+
+    var MyClass = class {
+        constructor() {
+            this.actor = new St.BoxLayout();
+            this._position = 0;
+        }
+
+        get position() {
+            return this._position;
+        }
+
+        set position(value) {
+            this._position = value;
+            this.actor.set_position(value, value);
+        }
+    };
+
+    let myThing = new MyClass();
+    Tweener.addTween(myThing,
+                     { position: 100,
+                       time: ANIMATION_TIME,
+                       transition: 'easeOutQuad' });
 ```
--- a/103
+++ b/103
@@ -1,106 +1,3 @@
-3.34.0
-======
-* Handle startup/shutdown of misc X11 services [Carlos; !680]
-* Fix sound volume mute/unmute [Iain; #1557]
-* Correctly terminate pasted text [Carlos; #1570]
-
-Contributors:
-  Carlos Garnacho, Iain Lane
-
-Translators:
-  Tom Tryfonidis [el], Milo Casagrande [it], Ryuta Fujii [ja],
-  Efstathios Iosifidis [el], Carmen Bianca BAKKER [eo], Sabri Ünal [tr],
-  Dušan Kazik [sk], Balázs Meskó [hu], Claude Paroz [fr]
-
-3.33.92
-=======
-* Animate pointer a11y pie timer [Jonas D.; !688]
-* Fix restarting shell in systemd user session [Benjamin; !690]
-* Misc. bug fixes and cleanups [Florian, Jonas D., Jonas Å., Will;
-  !691, !689, !692, #1552, !698]
-
-Contributors:
-  Jonas Ådahl, Benjamin Berg, Piotr Drąg, Jonas Dreßler, Florian Müllner,
-  Will Thompson
-
-Translators:
-  Daniel Șerbănescu [ro], Danial Behzadi [fa], Daniel Mustieles [es],
-  Jiri Grönroos [fi], Asier Sarasua Garmendia [eu], Piotr Drąg [pl],
-  Rūdolfs Mazurs [lv], Anders Jonsson [sv], Fran Dieguez [gl], Jordi Mas [ca],
-  Matej Urbančič [sl], Zander Brown [en_GB], Ryuta Fujii [ja], Tim Sabsch [de],
-  Fabio Tomat [fur], Pawan Chitrakar [ne], A S Alam [pa], Changwoo Ryu [ko],
-  Aurimas Černius [lt], Daniel Rusek [cs], Marek Černocký [cs],
-  Kukuh Syafaat [id], Goran Vidović [hr], Rafael Fontenelle [pt_BR]
-
-3.33.91
-=======
-* Fix regression when adjusting brightness [Florian; #1500]
-* Fix pointer a11y timeout animation [Jonas D.; #1533]
-* Add new extensions CLI tool [Florian; #1234]
-* Only track top-level windows [Carlos; #556]
-* Misc. bug fixes and cleanups [Jonas D., Jonas Å., Piotr, Florian;
-  !678, !682, !686]
-
-Contributors:
-  Jonas Ådahl, Jonas Dreßler, Carlos Garnacho, Florian Müllner
-
-Translators:
-  Asier Sarasua Garmendia [eu], Sveinn í Felli [is], Anders Jonsson [sv],
-  Jordi Mas [ca], Kukuh Syafaat [id], Florentina Mușat [ro], Jiri Grönroos [fi],
-  Aurimas Černius [lt], Daniel Mustieles [es], Piotr Drąg [pl],
-  Danial Behzadi [fa]
-
-3.33.90
-=======
-* Implement DND app picker folder management [Georges; !643, !645, !664, !671]
-* Make Clocks/Weather integration work with sandboxed apps [Florian; #1158]
-* Support startup via systemd user instance [Benjamin; !507]
-* Replace Tweener with Clutter animations [Florian; !663, !22, !666, !668, !669]
-* Minimize travel distance in overview animation [Sergey; !267]
-* Rescan icon theme when installed apps changed [Georges; !661]
-* Consistently animate new window actions [Jonas; !662, !673]
-* Misc. bug fixes and cleanups [Florian, Daniel, Ray, Bastien, Jonas, Niels,
-  Marco, Georges; !635, !636, !637, #1462, !628, !640, !641, !627, !644, !647,
-  !385, #1474, !651, #1144, !646, !653, !652, !655, #1482, !656, $654, !665,
-  !667, !670, #1357, !672, !657, #1507, !674, !677]
-
-Contributors:
-  Benjamin Berg, Sergey Bugaev, Jonas Dreßler, Niels De Graef, Florian Müllner,
-  Georges Basile Stavracas Neto, Bastien Nocera, Ray Strode,
-  Marco Trevisan (Treviño), verdre, Daniel van Vugt
-
-Translators:
-  Asier Sarasua Garmendia [eu], Rafael Fontenelle [pt_BR],
-  Kristjan SCHMIDT [eo], Jor Teron [mjw], Daniel Mustieles [es],
-  Kukuh Syafaat [id], Jordi Mas [ca], Fabio Tomat [fur], Daniel Șerbănescu [ro],
-  Anders Jonsson [sv]
-
-3.33.4
-======
-* Fix unintentional interference between gestures [Jonas; !598]
-* Fix unintentional loop while polkit dialog is active [Ray; !602]
-* Fix alt-tab icon size on HiDPI [Jonas; !587]
-* Style fixes and improvements [Frederik, Jakub; !610, #1446, #1449]
-* Fix style updates for non-background CSS properties [Florian; #1212]
-* Fix cursor visibility in screen recordings [Illya; #1208]
-* Add option for disabling the hot corner [Florian; #688320]
-* Use more fine-grained levels in battery indicator [Florian; !561, #1442]
-* Fix the calculation of the maximum number of app search results [Jonas; !110]
-* Handle horizontal workspace layout with gestures/animations [Florian; !575]
-* Improve handling of session mode extensions [Florian, Didier; #789852]
-* Misc. bug fixes and cleanups [Jonas, Florian, Sonny, Carlos, Mario, Benjamin,
-  Marco, Ting-Wei; !599, !600, !591, !606, !152, !607, !604, !495, !608, !611,
-  !614, !612, !615, !618, #369, !620, #774, !621, !616, #1065, !609, !626,
-  !491, !631, !632, !633, #1457]
-
-Contributors:
-  Benjamin Berg, Jonas Dreßler, Frederik Feichtmeier, Carlos Garnacho,
-  Illya Klymov, Ting-Wei Lan, Florian Müllner, Sonny Piers, Mario Sanchez Prada,
-  Didier Roche, Jakub Steiner, Ray Strode, Jor Teron, Marco Trevisan (Treviño)
-
-Translators:
-  Jordi Mas [ca], Jor Teron [mjw]
-
 3.33.3
 ======
 * Prepare for optional X11 [Carlos; !378]
--- a/data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.ClocksIntegration.xml
@@ -1,15 +0,0 @@
-<node>
-
-  <!--
-      org.gnome.Shell.ClocksIntegration:
-      @short_description: Clocks integration interface
-
-      The interface used for exporting location settings to GNOME Shell's
-      world clocks integration.
-  -->
-  <interface name="org.gnome.Shell.ClocksIntegration">
-
-  <property name="Locations" type="av" access="read"/>
-
-  </interface>
-</node>
--- a/data/dbus-interfaces/org.gnome.Shell.Extensions.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.Extensions.xml
@@ -173,30 +173,6 @@
      <arg type="s" direction="in" name="uuid"/>
    </method>

-    <!--
-        EnableExtension:
-        @uuid: The UUID of the extension
-        @success: Whether the operation was successful
-
-        Enable an extension.
-    -->
-    <method name="EnableExtension"> \
-      <arg type="s" direction="in" name="uuid"/> \
-      <arg type="b" direction="out" name="success"/> \
-    </method> \
-
-    <!--
-        DisableExtension:
-        @uuid: The UUID of the extension
-        @success: Whether the operation was successful
-
-        Disable an extension.
-    -->
-    <method name="DisableExtension"> \
-      <arg type="s" direction="in" name="uuid"/> \
-      <arg type="b" direction="out" name="success"/> \
-    </method> \
-
    <!--
        LaunchExtensionPrefs:
        @uuid: The UUID of the extension
@@ -213,15 +189,6 @@
    -->
    <method name="CheckForUpdates"/>

-    <signal name="ExtensionStateChanged">
-      <arg type="s" name="uuid"/>
-      <arg type="a{sv}" name="state"/>
-    </signal>
-
-    <!--
-        ExtensionStatusChanged:
-        Deprecated for ExtensionStateChanged
-    -->
    <signal name="ExtensionStatusChanged">
      <arg type="s" name="uuid"/>
      <arg type="i" name="state"/>
--- a/data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.WeatherIntegration.xml
@@ -1,16 +0,0 @@
-<node>
-
-  <!--
-      org.gnome.Shell.WeatherIntegration:
-      @short_description: Weather integration interface
-
-      The interface used for exporting location settings to GNOME Shell's
-      weather integration.
-  -->
-  <interface name="org.gnome.Shell.WeatherIntegration">
-
-  <property name="AutomaticLocation" type="b" access="read"/>
-  <property name="Locations" type="av" access="read"/>
-
-  </interface>
-</node>
--- a/data/dbus-interfaces/org.gnome.Shell.xml
+++ b/data/dbus-interfaces/org.gnome.Shell.xml
@@ -9,7 +9,7 @@
    <method name="ShowOSD">
      <arg type="a{sv}" direction="in" name="params"/>
    </method>
-    <method name="ShowMonitorLabels">
+    <method name="ShowMonitorLabels2">
      <arg type="a{sv}" direction="in" name="params"/>
    </method>
    <method name="HideMonitorLabels"/>
--- a/data/gnome-shell-dbus-interfaces.gresource.xml
+++ b/data/gnome-shell-dbus-interfaces.gresource.xml
@@ -40,7 +40,6 @@
    <file preprocess="xml-stripblanks">org.gnome.SettingsDaemon.Wacom.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.AudioDeviceSelection.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.CalendarServer.xml</file>
-    <file preprocess="xml-stripblanks">org.gnome.Shell.ClocksIntegration.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Extensions.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Introspect.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.HotplugSniffer.xml</file>
@@ -49,7 +48,6 @@
    <file preprocess="xml-stripblanks">org.gnome.Shell.Screencast.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Screenshot.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.Wacom.PadOsd.xml</file>
-    <file preprocess="xml-stripblanks">org.gnome.Shell.WeatherIntegration.xml</file>
    <file preprocess="xml-stripblanks">org.gnome.Shell.xml</file>
    <file preprocess="xml-stripblanks">org.Gtk.MountOperationHandler.xml</file>
    <file preprocess="xml-stripblanks">org.gtk.Notifications.xml</file>
--- a/data/gnome-shell-disable-extensions.service
+++ b/data/gnome-shell-disable-extensions.service
@@ -1,14 +0,0 @@
-[Unit]
-Description=Disable GNOME Shell extensions after failure
-DefaultDependencies=no
-
-# Only disable extensions for a short period of time after login.
-# This means we err on the side of failing the first login after a broken
-# extension was installed.
-Requisite=gnome-session-stable.timer
-
-[Service]
-Type=simple
-# Disable extensions
-ExecStart=gsettings set org.gnome.shell disable-user-extensions true
-Restart=no
--- a/data/gnome-shell-wayland.service.in
+++ b/data/gnome-shell-wayland.service.in
@@ -1,25 +0,0 @@
-[Unit]
-Description=GNOME Shell on Wayland
-# On wayland, force a session shutdown
-OnFailure=gnome-shell-disable-extensions.service gnome-session-shutdown.target
-OnFailureJobMode=replace-irreversibly
-CollectMode=inactive-or-failed
-RefuseManualStart=on
-RefuseManualStop=on
-
-After=gnome-session-manager.target
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-# The units already conflict because they use the same BusName
-#Conflicts=gnome-shell-x11.service
-
-[Service]
-Type=notify
-ExecStart=@bindir@/gnome-shell
-# Exit code 1 means we are probably *not* dealing with an extension failure
-SuccessExitStatus=1
-# On wayland we cannot restart
-Restart=no
--- a/data/gnome-shell-wayland.target
+++ b/data/gnome-shell-wayland.target
@@ -1,10 +1,5 @@
 [Unit]
-Description=GNOME Shell on Wayland
-DefaultDependencies=no
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-Requires=gnome-shell-wayland.service
-After=gnome-shell-wayland.service
+Description=GNOME Shell (wayland sync point)
+After=gnome-shell.service
+BindsTo=gnome-shell.service
+Conflicts=gnome-shell-x11.target
--- a/data/gnome-shell-x11.service.in
+++ b/data/gnome-shell-x11.service.in
@@ -1,31 +0,0 @@
-[Unit]
-Description=GNOME Shell on X11
-# On X11, try to show the GNOME Session Failed screen
-OnFailure=gnome-shell-disable-extensions.service gnome-session-failed.target
-OnFailureJobMode=replace
-CollectMode=inactive-or-failed
-RefuseManualStart=on
-RefuseManualStop=on
-
-After=gnome-session-manager.target
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-# The units already conflict because they use the same BusName
-#Conflicts=gnome-shell-wayland.service
-
-# Limit startup frequency more than the default
-StartLimitIntervalSec=15s
-StartLimitBurst=3
-
-[Service]
-Type=notify
-ExecStart=@bindir@/gnome-shell
-# Exit code 1 means we are probably *not* dealing with an extension failure
-SuccessExitStatus=1
-# On X11 we want to restart on-success (Alt+F2 + r) and on-failure.
-Restart=always
-# Do not wait before restarting the shell
-RestartSec=0ms
--- a/data/gnome-shell-x11.target
+++ b/data/gnome-shell-x11.target
@@ -1,10 +1,5 @@
 [Unit]
-Description=GNOME Shell on X11
-DefaultDependencies=no
-
-Requisite=gnome-session-initialized.target
-PartOf=gnome-session-initialized.target
-Before=gnome-session-initialized.target
-
-Requires=gnome-shell-x11.service
-After=gnome-shell-x11.service
+Description=GNOME Shell (x11 sync point)
+After=gnome-shell.service
+BindsTo=gnome-shell.service
+Conflicts=gnome-shell-wayland.target
--- a/data/gnome-shell.service.in
+++ b/data/gnome-shell.service.in
@@ -0,0 +1,11 @@
+[Unit]
+Description=GNOME Shell
+Wants=gnome-session.service
+After=graphical-session-pre.target gnome-session-bus.target
+PartOf=graphical-session.target
+
+[Service]
+Type=dbus
+ExecStart=@bindir@/gnome-shell
+Restart=on-failure
+BusName=org.gnome.Shell
--- a/data/meson.build
+++ b/data/meson.build
@@ -14,8 +14,6 @@ desktopconf = configuration_data()
 # file when built in a non-system prefix
 desktopconf.set('bindir', bindir)
 desktopconf.set('VERSION', meson.project_version())
-desktopconf.set('systemd_hidden', have_systemd ? 'true' : 'false')
-
 foreach desktop_file : desktop_files
  i18n.merge_file('desktop',
    input: configure_file(
@@ -24,7 +22,7 @@ foreach desktop_file : desktop_files
      configuration: desktopconf
    ),
    output: desktop_file,
-    po_dir: po_dir,
+    po_dir: '../po',
    install: true,
    install_dir: desktopdir,
    type: 'desktop'
@@ -100,23 +98,15 @@ if have_systemd
  unitconf = configuration_data()
  unitconf.set('bindir', bindir)

-  configure_file(
-    input: 'gnome-shell-x11.service.in',
-    output: 'gnome-shell-x11.service',
+  unit = configure_file(
+    input: 'gnome-shell.service.in',
+    output: 'gnome-shell.service',
    configuration: unitconf,
    install_dir: systemduserunitdir
  )

-  configure_file(
-    input: 'gnome-shell-wayland.service.in',
-    output: 'gnome-shell-wayland.service',
-    configuration: unitconf,
-    install_dir: systemduserunitdir
-  )
-
-  units = files('gnome-shell-x11.target',
-                'gnome-shell-wayland.target',
-                'gnome-shell-disable-extensions.service')
+  units = files('gnome-shell-wayland.target',
+                'gnome-shell-x11.target')

  install_data(units, install_dir: systemduserunitdir)
 endif
--- a/data/org.gnome.Shell.desktop.in.in
+++ b/data/org.gnome.Shell.desktop.in.in
@@ -14,4 +14,3 @@ X-GNOME-Autostart-Phase=DisplayServer
 X-GNOME-Provides=panel;windowmanager;
 X-GNOME-Autostart-Notify=true
 X-GNOME-AutoRestart=false
-X-GNOME-HiddenUnderSystemd=@systemd_hidden@
--- a/data/org.gnome.shell.gschema.xml.in
+++ b/data/org.gnome.shell.gschema.xml.in
@@ -21,17 +21,6 @@
        EnableExtension and DisableExtension D-Bus methods on org.gnome.Shell.
      </description>
    </key>
-    <key name="disabled-extensions" type="as">
-      <default>[]</default>
-      <summary>UUIDs of extensions to force disabling</summary>
-      <description>
-        GNOME Shell extensions have a UUID property; this key lists extensions
-        which should be disabled, even if loaded as part of the current mode.
-        You can also manipulate this list with the EnableExtension and
-        DisableExtension D-Bus methods on org.gnome.Shell.
-        This key takes precedence over the “enabled-extensions” setting.
-      </description>
-    </key>
    <key name="disable-user-extensions" type="b">
      <default>false</default>
      <summary>Disable user extensions</summary>
@@ -110,6 +99,7 @@
      </description>
    </key>
    <child name="keybindings" schema="org.gnome.shell.keybindings"/>
+    <child name="keyboard" schema="org.gnome.shell.keyboard"/>
  </schema>

  <schema id="org.gnome.shell.keybindings" path="/org/gnome/shell/keybindings/"
@@ -150,6 +140,11 @@
        Keybinding to focus the active notification.
      </description>
    </key>
+    <key name="pause-resume-tweens" type="as">
+      <default>[]</default>
+      <summary>Keybinding that pauses and resumes all running tweens, for debugging purposes</summary>
+      <description></description>
+    </key>
    <key name="switch-to-application-1" type="as">
      <default>["&lt;Super&gt;1"]</default>
      <summary>Switch to application 1</summary>
@@ -188,6 +183,17 @@
    </key>
  </schema>

+  <schema id="org.gnome.shell.keyboard" path="/org/gnome/shell/keyboard/"
+          gettext-domain="@GETTEXT_PACKAGE@">
+    <key name="keyboard-type" type="s">
+      <default>'touch'</default>
+      <summary>Which keyboard to use</summary>
+      <description>
+        The type of keyboard to use.
+      </description>
+    </key>
+  </schema>
+
  <schema id="org.gnome.shell.app-switcher"
          path="/org/gnome/shell/app-switcher/"
          gettext-domain="@GETTEXT_PACKAGE@">
@@ -228,36 +234,6 @@
    </key>
  </schema>

-  <schema id="org.gnome.shell.world-clocks" path="/org/gnome/shell/world-clocks/"
-          gettext-domain="@GETTEXT_PACKAGE@">
-    <key name="locations" type="av">
-      <summary>Locations</summary>
-      <description>
-        The locations to show in world clocks
-      </description>
-      <default>[]</default>
-    </key>
-  </schema>
-
-  <schema id="org.gnome.shell.weather" path="/org/gnome/shell/weather/"
-          gettext-domain="@GETTEXT_PACKAGE@">
-    <key name="automatic-location" type="b">
-      <summary>Automatic location</summary>
-      <description>
-        Whether to fetch the current location or not
-      </description>
-      <default>false</default>
-    </key>
-
-    <key name="locations" type="av">
-      <summary>Location</summary>
-      <description>
-        The location for which to show a forecast
-      </description>
-      <default>[]</default>
-    </key>
-  </schema>
-
  <!-- unused, change 00_org.gnome.shell.gschema.override instead -->
  <schema id="org.gnome.shell.overrides" path="/org/gnome/shell/overrides/"
 	  gettext-domain="@GETTEXT_PACKAGE@">
--- a/data/theme/gnome-shell-sass/_common.scss
+++ b/data/theme/gnome-shell-sass/_common.scss
@@ -25,10 +25,8 @@ $cakeisalie: "This stylesheet is generated, DO NOT EDIT";

 /* GLOBALS */

-
-$modal_radius: 9px;
-$button_radius: 5px;
-$panel-corner-radius: $button_radius + 1;
+$panel-corner-radius: 6px;
+$medium_radius: 9px;

 $_trough_color: transparentize($fg_color, 0.9);
 $_bubble_borders_color: lighten($borders_color, if($variant=='light', 0%, 5%));
@@ -48,7 +46,7 @@ stage {

 /* Buttons */
 .button, %button {
-  border-radius: $button_radius;
+  border-radius: 5px;
  border-width: 1px;
  min-height: 22px;
  padding: 4px 32px;
@@ -70,21 +68,21 @@ stage {
  border-top: 1px solid $_bubble_borders_color;

  &:first-child {
-    border-radius: 0px 0px 0px $modal_radius;
+    border-radius: 0px 0px 0px $medium_radius;
  }
  &:last-child {
    border-right-width: 0px;
-    border-radius: 0px 0px $modal_radius 0px;
+    border-radius: 0px 0px $medium_radius 0px;
  }
  &:first-child:last-child {
    border-right-width: 0px;
-    border-radius: 0px 0px $modal_radius $modal_radius;
+    border-radius: 0px 0px $medium_radius $medium_radius;
  }
 }

 /* Entries */
 StEntry {
-  border-radius: $button_radius;
+  border-radius: 5px;
  padding: 4px;
  border-width: 1px;
  color: $fg_color;
@@ -189,12 +187,12 @@ StScrollBar {

 /* Modal Dialogs */

-.headline { font-size: 110%; }
+.headline { @extend %heading; }
 .lightbox { background-color: black; }
 .flashspot { background-color: white; }

 .modal-dialog {
-  border-radius: $modal_radius;
+  border-radius: 9px;
  @extend %bubble-panel;
  .modal-dialog-content-box {
    padding: 24px;
@@ -206,8 +204,7 @@ StScrollBar {
  }
  .run-dialog-button-box { padding-top: 1em; }
  .run-dialog-label {
-    @include fontsize($font-size + 1.1);
-    font-weight: normal;
+    @extend %title-4;
    color: $fg_color;
    padding-bottom: .4em;
  }
@@ -215,8 +212,8 @@ StScrollBar {
 }

  .mount-dialog-subject,
-  .end-session-dialog-subject { //this should be a generic header class
-    @include fontsize($font-size * 1.3);
+  .end-session-dialog-subject {
+    @extend %title-2;
  }

 /* Message Dialog */
@@ -236,12 +233,12 @@ StScrollBar {
  }

  .message-dialog-title {
-    font-weight: bold;
+    @extend %title-2;
  }

  .message-dialog-subtitle {
+    @extend %heading;
    color: $fg_color;
-    font-weight: bold;
  }

 /* End Session Dialog */
@@ -255,6 +252,7 @@ StScrollBar {
  }

  .end-session-dialog-layout {
+    spacing: 12px;
    padding-left: 17px;
    &:rtl { padding-right: 17px; }
  }
@@ -302,7 +300,7 @@ StScrollBar {
  }

  .end-session-dialog-list-header {
-    font-weight: bold;
+    @extend %heading;
    &:rtl { text-align: right; }
  }

@@ -313,12 +311,11 @@ StScrollBar {

  .end-session-dialog-app-list-item-name,
  .end-session-dialog-session-list-item-name {
-    font-weight: bold;
+    @extend %heading;
  }

  .end-session-dialog-app-list-item-description {
    color: darken($fg_color,5%);
-    font-size: 10pt;
  }

 /* ShellMountOperation Dialogs */
@@ -374,11 +371,6 @@ StScrollBar {
    &:rtl { padding-left: 17px; }
  }

-  .mount-dialog-app-list-item-name {
-    font-size: 10pt;
-  }
-
-
 /* Password or Authentication Dialog */

 .prompt-dialog {
@@ -388,7 +380,7 @@ StScrollBar {

  .message-dialog-main-layout { spacing: 24px; padding: 10px; }
  .message-dialog-content { spacing: 16px; }
-  .message-dialog-title { color: lighten($fg_color,15%); }
+  .message-dialog-title { @extend %title-2; color: lighten($fg_color,15%); }
 }

  .prompt-dialog-description:rtl {
@@ -401,13 +393,11 @@ StScrollBar {
  }

  .prompt-dialog-error-label {
-    font-size: 10pt;
    color: $warning_color;
    padding-bottom: 8px;
  }

  .prompt-dialog-info-label {
-    font-size: 10pt;
    padding-bottom: 8px;
  }

@@ -416,7 +406,6 @@ StScrollBar {
  }

  .prompt-dialog-null-label {
-    font-size: 10pt;
    padding-bottom: 8px;
  }

@@ -472,7 +461,7 @@ StScrollBar {
  }

  .audio-selection-title {
-    font-weight: bold;
+    @extend %title-2;
    text-align: center;
  }

@@ -515,7 +504,7 @@ StScrollBar {
 .extension-dialog {
  @extend %bubble-panel;
  .message-dialog-main-layout { spacing: 24px; padding: 10px; }
-  .message-dialog-title { font-weight: normal; color: $fg_color; }
+  .message-dialog-title { @extend %title-2; }
 }

 /* Inhibit-Shortcuts Dialog */
@@ -556,9 +545,9 @@ StScrollBar {
    &:ltr { padding: .4em 1.75em .4em 0em; }
    &:rtl { padding: .4em 0em .4em 1.75em; }
    &:checked {
+      @extend %heading;
      background-color: $bg_color;
      box-shadow: inset 0 -1px 0px $_bubble_borders_color;
-      font-weight: bold;
    }
    &.selected {
      background-color: transparentize(white, if($variant=='light', 0.2, 0.9));
@@ -591,7 +580,7 @@ StScrollBar {
  }
  .popup-menu-boxpointer,
  .candidate-popup-boxpointer {
-    -arrow-border-radius: $button_radius+4;
+    -arrow-border-radius: $medium_radius;
    -arrow-background-color: $bg_color;
    -arrow-border-width: 1px;
    -arrow-border-color: if($variant=='light', transparentize(black, 0.6), $borders_color);
@@ -619,18 +608,6 @@ StScrollBar {
  app menu inside the main app window itself rather than the top bar
 */

-/*************
- * App Icons *
- *************/
-/* Outline for low res icons */
-.lowres-icon {
-    icon-shadow: 0 1px 2px rgba(0,0,0,0.3);
-}
-
-/* Drapshadow for large icons */
-.icon-dropshadow {
-  icon-shadow: 0 1px 2px rgba(0,0,0,0.4);
-}

 /* OSD */
 .osd-window {
@@ -641,7 +618,7 @@ StScrollBar {
  min-width: 64px;
  min-height: 64px;

-  .osd-monitor-label { font-size: 3em; }
+  .osd-monitor-label { @extend %title-1; }
  .level {
    height: 0.6em;
    -barlevel-height: 0.6em;
@@ -740,8 +717,7 @@ StScrollBar {
    spacing: 8px;
  }

-  .ws-switcher-active-up, .ws-switcher-active-down,
-  .ws-switcher-active-left, .ws-switcher-active-right {
+  .ws-switcher-active-up, .ws-switcher-active-down {
    height: 50px;
    background-color: $selected_bg_color;
    color: $selected_fg_color;
@@ -815,8 +791,8 @@ StScrollBar {
 /* TOP BAR */

 #panel {
+  @extend %heading;
  background-color: black;
-  font-weight: bold;
  height: 1.86em;
  font-feature-settings: "tnum";

@@ -848,9 +824,9 @@ StScrollBar {
  }

  .panel-button {
+    @extend %heading;
    -natural-hpadding: 12px;
    -minimum-hpadding: 6px;
-    font-weight: bold;
    color: #ccc;

    .app-menu-icon {
@@ -942,33 +918,33 @@ StScrollBar {
    .world-clocks-button,
    .weather-button,
    .events-section-title {
-      &:hover, &:focus { background-color: $_hover_bg_color }
+      &:hover, focus { background-color: $_hover_bg_color }
      &:active { background-color: $_active_bg_color }
    }

    .datemenu-today-button .day-label {
+      @extend %heading;
    }

    .datemenu-today-button .date-label {
-      font-size: 1.5em;
-      font-weight: 300;
+      @extend %large-title;
    }

    .world-clocks-header,
    .weather-header,
-    .events-section-title {
+    .events-section-title,
+    .calendar-month-label {
+      @extend %heading;
      color: darken($fg_color,40%);
-      font-weight: bold;
    }

    .weather-header.location {
-      font-weight: normal;
-      font-size: 0.9em;
+      @extend %caption;
    }

    .world-clocks-grid,
    .weather-grid {
-      spacing-rows: 0.4em;
+      spacing-rows: 0.8em;
      spacing-columns: 0.8em;
    }

@@ -976,35 +952,26 @@ StScrollBar {
      spacing: 0.4em;
    }

-    .world-clocks-city {
-      font-weight: bold;
-      font-size: 0.9em;
-    }
-
    .world-clocks-time {
-      color: darken($fg_color,20%);
-      font-feature-settings: "tnum";
-      font-size: 1.2em;
+        font-feature-settings: "tnum";
    }

    .world-clocks-timezone {
-      color: $fg_color;
+      color: darken($fg_color,40%);
      font-feature-settings: "tnum";
-      font-size: 0.9em;
+      @extend %caption;
    }

    .weather-forecast-icon {
-      icon-size: 2.18em;
+      icon-size: 32px;
    }

    .weather-forecast-time {
+      @extend %caption;
      color: darken($fg_color,40%);
-      font-size: 0.8em;
    }

    .calendar-month-label {
-      color: lighten($fg_color,5%);
-      font-weight: bold;
      padding: 8px 0;
      &:focus {}
    }
@@ -1013,7 +980,7 @@ StScrollBar {
      background-color: transparent;
      width: 32px;
      border-radius: 4px;
-      &:hover, &:focus { background-color: $_hover_bg_color; }
+      &:hover, focus { background-color: $_hover_bg_color; }
      &:active { background-color: transparentize($fg_color, 0.84); }
    }

@@ -1022,23 +989,22 @@ StScrollBar {
      }

    .calendar-day-base {
-      font-size: 80%;
+      @extend %caption;
      text-align: center;
      width: 2.4em; height: 2.4em;
      padding: 0.1em;
      margin: 2px;
      border-radius: 1.4em;
      font-feature-settings: "tnum";
-      &:hover, &:focus { background-color: $_hover_bg_color; }
+      &:hover, focus { background-color: $_hover_bg_color; }
      &:active,&:selected {
        color: lighten($selected_fg_color,5%);
        background-color: $selected_bg_color;
        border-color: transparent; //avoid jumparound due to today
      }
      &.calendar-day-heading {  //day of week heading
-        color: lighten($fg_color,5%);
-        margin-top: 1em;
-        font-size: 70%;
+        color: darken($fg_color,40%);
+//        margin-top: 1em;
      }
    }
      .calendar-day { //border collapse hack - see calendar.js
@@ -1053,14 +1019,15 @@ StScrollBar {
        color: $insensitive_fg_color;
      }
      .calendar-today {
-        font-weight: bold;
+        @extend %caption-heading;
        //color: lighten($fg_color,10%);
        //background-color: darken($bg_color,5%);
        border: 1px solid $_bubble_borders_color;
      }
      .calendar-day-with-events {
+        @extend %caption-heading;
        color: lighten($fg_color,10%);
-        font-weight: bold;
+
        background-image: url("resource:///org/gnome/shell/theme/calendar-today.svg");
      }
      .calendar-other-month-day {
@@ -1068,8 +1035,7 @@ StScrollBar {
        opacity: 0.5;
      }
      .calendar-week-number {
-        font-size: 70%;
-        font-weight: bold;
+        @extend %caption-heading;
        width: 2.3em; height: 1.8em;
        border-radius: 2px;
        padding: 0.5em 0 0;
@@ -1126,11 +1092,11 @@ StScrollBar {
          }

          .message-secondary-bin > .event-time {
-            color: $fg_color;
-            font-size: 0.7em;
+            @extend %caption;
+            color: darken($fg_color,40%);
            /* HACK: the label should be baseline-aligned with a 1em label,
                     fake this with some bottom padding */
-            padding-bottom: 0.13em;
+           padding-bottom: 1px;
          }

          .message-secondary-bin > StIcon {
@@ -1170,7 +1136,13 @@ StScrollBar {

  // a little unstructured mess:

+  .system-switch-user-submenu-icon {
+    icon-size: 16px;
+    padding: 0 4px;
+  }
+
  #appMenu {
+    spinner-image: url("resource:///org/gnome/shell/theme/process-working.svg");
    spacing: 4px;

    .label-shadow { color: transparent; }
@@ -1292,17 +1264,16 @@ StScrollBar {
  .nm-dialog-airplane-box { spacing: 12px; }

  .nm-dialog-airplane-headline {
-    font-weight: bold;
+    @extend %heading;
    text-align: center;
  }

  .nm-dialog-airplane-text { color: $fg_color; }
  .nm-dialog-header-icon { icon-size: 32px; }
  .nm-dialog-scroll-view { border: 2px solid $borders_color; }
-  .nm-dialog-header { font-weight: bold; }
+  .nm-dialog-header { @extend %title-2; }

  .nm-dialog-item {
-    font-size: 110%;
    border-bottom: 1px solid $borders_color;
    padding: 12px;
    spacing: 20px;
@@ -1338,8 +1309,8 @@ StScrollBar {

  .window-clone-border {
    $_bg: transparentize(white, 0.65);
-    border: 7px solid $_bg;
-    border-radius: $modal_radius;
+    border: 5px solid $_bg;
+    border-radius: 6px;
    // For window decorations with round corners we can't match
    // the exact shape when the window is scaled. So apply a shadow
    // to fix that case
@@ -1376,8 +1347,11 @@ StScrollBar {

  //search results

-  #searchResultsContent {
+  #searchResultsBin {
    max-width: 1000px;
+  }
+
+  #searchResultsContent {
    padding-left: 20px;
    padding-right: 20px;
    spacing: 16px;
@@ -1406,7 +1380,7 @@ StScrollBar {

  #dash {
    @extend %overview-panel;
-    font-size: 9pt;
+    @extend %caption;
    padding: 4px 0;
    border-radius: 0px 9px 9px 0px;

@@ -1493,11 +1467,11 @@ StScrollBar {
  .search-provider-icon,
  .list-search-result {
    @extend %icon_tile;
+    &:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
    &:focus, &:selected, &:hover {
      background-color: transparentize($osd_fg_color,.9);
      transition-duration: 200ms;
    }
-    &:active, &:checked { background-color: transparentize(darken($osd_bg_color,10%),.1); }
  }
  .app-well-app,
  .app-well-app.app-folder,
@@ -1506,6 +1480,10 @@ StScrollBar {
    & .overview-icon {
      @extend %icon_tile;
    }
+    &:active .overview-icon,
+    &:checked .overview-icon {
+      background-color: transparentize(darken($osd_bg_color,10%), 0.5);
+    }
    &:hover .overview-icon,
    &:focus .overview-icon,
    &:selected .overview-icon {
@@ -1514,13 +1492,7 @@ StScrollBar {
      border-image: none;
      background-image: none;
    }
-    &:drop .overview-icon {
-      background-color: transparentize($selected_bg_color,.15);
-    }
-    &:active .overview-icon,
-    &:checked .overview-icon {
-      background-color: transparentize(darken($osd_bg_color,10%), 0.5);
-    }
+
  }

  .app-well-app-running-dot { //running apps indicator
@@ -1531,7 +1503,7 @@ StScrollBar {

  %icon_tile {
    color: $osd_fg_color;
-    border-radius: $button_radius+4;
+    border-radius: $medium_radius;
    padding: 6px;
    border: 1px solid transparent;
    transition-duration: 100ms;
@@ -1610,6 +1582,7 @@ StScrollBar {
  }

  //Some hacks I don't even
+  .search-display > StBoxLayout,
  .all-apps,
  .frequent-apps > StBoxLayout {
    // horizontal padding to make sure scrollbars or dash don't overlap content
@@ -1622,9 +1595,9 @@ StScrollBar {
  border: none;
 }

+// Search status, like "Searching..." and "No results"
 %status_text {
-  font-size: 2em;
-  font-weight: bold;
+  @extend %large-title;
  color: $osd_fg_color;
 }

@@ -1633,18 +1606,22 @@ StScrollBar {
  .url-highlighter { link-color: lighten($selected_bg_color,10%); }

  // Banners
+  .message-body {
+    @extend %caption;
+    padding-top: 2px;
+  }
+
  .notification-banner {
-    font-size: 11pt;
    width: 34em;
    margin: 5px;
-    border-radius: $modal_radius;
+    border-radius: $medium-radius;
    border: if($variant == 'light', none, $_bubble_borders_color);
    min-height: 64px;
    box-shadow: 0 1px 2px transparentize(black, 0.7);
    &:hover { background: $bg_color; }
    &, &:focus, &:active {
      background-color: $bg_color;
-      .message-title { color: $fg_color }
+      .message-title { color: $fg_color; }
      .message-content { color: $fg_color; }
    }

@@ -1671,20 +1648,6 @@ StScrollBar {
      border: none;
    }
  }
-  .summary-source-counter {
-    font-size: 10pt;
-    font-weight: bold;
-    height: 1.6em; width: 1.6em;
-    -shell-counter-overlap-x: 3px;
-    -shell-counter-overlap-y: 3px;
-    background-color: $selected_bg_color;
-    color: $selected_fg_color;
-    border: 2px solid $fg_color;
-    box-shadow: 0 2px 2px rgba(0,0,0,0.5);
-    border-radius: 0.9em; // should be 0.8 but whatever; wish I could do 50%;
-  }
-
-  .secondary-icon { icon-size: 1.09em; }

  //chat bubbles
  .chat-body { spacing: 5px; }
@@ -1701,9 +1664,8 @@ StScrollBar {
    &:rtl { padding-left: 0; padding-right: 18pt; }
  }
  .chat-meta-message {
+    @extend %caption-heading;
    padding-left: 4px;
-    font-size: 9pt;
-    font-weight: bold;
    color: lighten($fg_color,18%);
    &:rtl { padding-left: 0; padding-right: 4px; }
  }
@@ -1789,36 +1751,30 @@ StScrollBar {
  }

  .keyboard-key {
-    $_key_bg: opacify(lighten($osd_bg_color, 9%), 1);
-    background-color: $_key_bg;
+    background-color: #393f3f;
    min-height: 1.2em;
    min-width: 1.2em;
    font-size: 16pt;
-    border-radius: $button_radius;
-    border: 1px solid $osd_outer_borders_color;
-    color: $osd_fg_color;
+    border-radius: 3px;
+    border: 1px solid #464d4d;
+    color: #e5e5e5;
    &:focus { @include button(focus); }
-    &:hover, &:checked { background-color: lighten($_key_bg, 3%); }
-    &:active { background-color: darken($_key_bg, 2%); }
+    &:hover,&:checked { @include button(hover); }
+    &:active { @include button(active);}
    &:grayed { //FIXME
      background-color: $osd_bg_color;
      color: $osd_fg_color;
      border-color: $osd_borders_color;
    }
    &.default-key {
-      $_default_key_bg: opacify($osd_bg_color, 1);
-      border-color: $osd_outer_borders_color;
-      background-color: $_default_key_bg;
+      border-color: #2d3232;
+      background-color: #1d2020;
      background-size: 20px;
-      &:hover, &:checked { background-color: lighten($_default_key_bg, 3%); }
-      &:active { background-color: darken($_default_key_bg, 2%); }
    }
    &.enter-key {
-      border-color: lighten($selected_bg_color, 5%);
-      background-color: $selected_bg_color;
+      border-color: #005684;
+      background-color: #006098;
      background-image: url("resource:///org/gnome/shell/theme/key-enter.svg");
-      &:hover, &:checked { background-color: lighten($selected_bg_color, 3%); }
-      &:active { background-color: darken($selected_bg_color, 2%); }
    }
    &.shift-key-lowercase {
      background-image: url("resource:///org/gnome/shell/theme/key-shift.svg");
@@ -1857,8 +1813,8 @@ StScrollBar {

 .emoji-panel {
  .keyboard-key:latched {
-    border-color: lighten($selected_bg_color, 5%);
-    background-color: $selected_bg_color;
+    border-color: #005684;
+    background-color: #006098;
  }
 }

@@ -1922,7 +1878,7 @@ StScrollBar {

  StEntry {
    @extend %search_entry;
-    border-radius: $button_radius;
+    border-radius: 5px;
    @if $variant=='dark' {
      $_gdm_entry_bg: transparentize(lighten(desaturate(#241f31, 20%), 2%), 0.5);
      background-color: $_gdm_entry_bg;
@@ -1995,8 +1951,7 @@ StScrollBar {
    }
  }
  .login-dialog-not-listed-label {
-    font-size: 90%;
-    font-weight: bold;
+    @extend %heading;
    color: darken($osd_fg_color,30%);
    padding-top: 1em;
  }
@@ -2025,8 +1980,7 @@ StScrollBar {
  .login-dialog-username,
  .user-widget-label {
    color: $osd_fg_color;
-    font-size: 120%;
-    font-weight: bold;
+    @extend %title-3;
    text-align: left;
    padding-left: 15px;
  }
@@ -2044,7 +1998,6 @@ StScrollBar {

  .login-dialog-prompt-label {
      color: darken($osd_fg_color, 20%);
-      font-size: 110%;
      padding-top: 1em;
  }

@@ -2116,7 +2069,7 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);


 .screen-shield-notification-label {
-  font-weight: bold;
+  @extend %heading;
  padding: 0px 0px 0px 12px;
 }

@@ -2156,9 +2109,9 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
  }
  .labels { spacing: 4px; }
  .notebook-tab {
+    @extend %heading;
    -natural-hpadding: 12px;
    -minimum-hpadding: 6px;
-    font-weight: bold;
    color: #ccc;
    transition-duration: 100ms;
    padding-left: .3em;
@@ -2219,7 +2172,7 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
  }

  .lg-extension-name {
-      font-weight: bold;
+      @extend %heading;
  }

  .lg-extension-meta {
@@ -2232,3 +2185,39 @@ $_screenshield_shadow: 0px 0px 6px rgba(0, 0, 0, 0.726);
    border-radius: 4px;
    padding: 6px;
  }
+
+// text styles
+
+%large-title {
+  font-weight: 300;
+  font-size: 24pt;
+// letter-spacing: 0.2rem; this breaks the style
+}
+%title-1 {
+  font-weight: 800;
+  font-size: 20pt;
+}
+%title-2 {
+  font-weight: 800;
+  font-size: 15pt;
+}
+%title-3 {
+  font-weight: 700;
+  font-size: 15pt;
+}
+%title-4 {
+  font-weight: 700;
+  font-size: 13pt;
+}
+%heading {
+  font-weight: 700;
+  font-size: 11pt;
+}
+%caption-heading {
+  font-weight: 700;
+  font-size: 9pt;
+}
+%caption {
+  font-weight: 400;
+  font-size: 9pt;
+}
--- a/docs/reference/shell/meson.build
+++ b/docs/reference/shell/meson.build
@@ -28,7 +28,7 @@ foreach iface : ifaces
    output: 'doc-gen-' + iface[1],
    command: [
      'gdbus-codegen',
-      '--interface-prefix=@0@.'.format(iface[0]),
+      '--interface-prefix=@0@.'.format(iface),
      '--generate-docbook', 'doc-gen',
      '--output-directory', '@OUTDIR@',
      '@INPUT@'
--- a/js/extensionPrefs/main.js
+++ b/js/extensionPrefs/main.js
@@ -1,7 +1,3 @@
-/* exported main */
-imports.gi.versions.Gdk = '3.0';
-imports.gi.versions.Gtk = '3.0';
-
 const Gettext = imports.gettext;
 const { Gdk, GLib, Gio, GObject, Gtk, Pango } = imports.gi;
 const Format = imports.format;
@@ -12,8 +8,6 @@ const Config = imports.misc.config;
 const ExtensionUtils = imports.misc.extensionUtils;
 const { loadInterfaceXML } = imports.misc.fileUtils;

-const { ExtensionState } = ExtensionUtils;
-
 const GnomeShellIface = loadInterfaceXML('org.gnome.Shell.Extensions');
 const GnomeShellProxy = Gio.DBusProxy.makeProxyWrapper(GnomeShellIface);

@@ -23,54 +17,74 @@ function stripPrefix(string, prefix) {
    return string;
 }

-var Application = GObject.registerClass({
-    GTypeName: 'ExtensionPrefs_Application'
-}, class Application extends Gtk.Application {
-    _init() {
+var Application = class {
+    constructor() {
        GLib.set_prgname('gnome-shell-extension-prefs');
-        super._init({
+        this.application = new Gtk.Application({
            application_id: 'org.gnome.shell.ExtensionPrefs',
            flags: Gio.ApplicationFlags.HANDLES_COMMAND_LINE
        });

+        this.application.connect('activate', this._onActivate.bind(this));
+        this.application.connect('command-line', this._onCommandLine.bind(this));
+        this.application.connect('startup', this._onStartup.bind(this));
+
+        this._extensionPrefsModules = {};
+
        this._startupUuid = null;
        this._loaded = false;
        this._skipMainWindow = false;
-        this._shellProxy = null;
    }

-    get shellProxy() {
-        return this._shellProxy;
-    }
+    _extensionAvailable(uuid) {
+        let extension = ExtensionUtils.extensions[uuid];

-    _showPrefs(uuid) {
-        let row = this._extensionSelector.get_children().find(c => {
-            return c.uuid === uuid && c.hasPrefs;
-        });
-
-        if (!row)
+        if (!extension)
            return false;

+        if (!extension.dir.get_child('prefs.js').query_exists(null))
+            return false;
+
+        return true;
+    }
+
+    _getExtensionPrefsModule(extension) {
+        let uuid = extension.metadata.uuid;
+
+        if (this._extensionPrefsModules.hasOwnProperty(uuid))
+            return this._extensionPrefsModules[uuid];
+
+        ExtensionUtils.installImporter(extension);
+
+        let prefsModule = extension.imports.prefs;
+        prefsModule.init(extension.metadata);
+
+        this._extensionPrefsModules[uuid] = prefsModule;
+        return prefsModule;
+    }
+
+    _selectExtension(uuid) {
+        if (!this._extensionAvailable(uuid))
+            return;
+
+        let extension = ExtensionUtils.extensions[uuid];
        let widget;

        try {
-            widget = row.prefsModule.buildPrefsWidget();
+            let prefsModule = this._getExtensionPrefsModule(extension);
+            widget = prefsModule.buildPrefsWidget();
        } catch (e) {
-            widget = this._buildErrorUI(row, e);
+            widget = this._buildErrorUI(extension, e);
        }

-        let dialog = new Gtk.Window({
-            modal: !this._skipMainWindow,
-            type_hint: Gdk.WindowTypeHint.DIALOG
-        });
-        dialog.set_titlebar(new Gtk.HeaderBar({
-            show_close_button: true,
-            title: row.name,
-            visible: true
-        }));
+        let dialog = new Gtk.Window({ modal: !this._skipMainWindow,
+                                      type_hint: Gdk.WindowTypeHint.DIALOG });
+        dialog.set_titlebar(new Gtk.HeaderBar({ show_close_button: true,
+                                                title: extension.metadata.name,
+                                                visible: true }));

        if (this._skipMainWindow) {
-            this.add_window(dialog);
+            this.application.add_window(dialog);
            if (this._window)
                this._window.destroy();
            this._window = dialog;
@@ -82,11 +96,9 @@ var Application = GObject.registerClass({
        dialog.set_default_size(600, 400);
        dialog.add(widget);
        dialog.show();
-
-        return true;
    }

-    _buildErrorUI(row, exc) {
+    _buildErrorUI(extension, exc) {
        let scroll = new Gtk.ScrolledWindow({
            hscrollbar_policy: Gtk.PolicyType.NEVER,
            propagate_natural_height: true
@@ -156,20 +168,13 @@ var Application = GObject.registerClass({

        copyButton.connect('clicked', w => {
            let clipboard = Gtk.Clipboard.get_default(w.get_display());
-            // markdown for pasting in gitlab issues
-            let lines = [
-                `The settings of extension ${row.uuid} had an error:`,
-                '```',
-                `${exc}`,
-                '```',
-                '',
-                'Stack trace:',
-                '```',
-                exc.stack.replace(/\n$/, ''), // stack without trailing newline
-                '```',
-                ''
-            ];
-            clipboard.set_text(lines.join('\n'), -1);
+            let backticks = '```';
+            clipboard.set_text(
+                // markdown for pasting in gitlab issues
+                `The settings of extension ${extension.uuid} had an error:\n${
+                backticks}\n${exc}\n${backticks}\n\nStack trace:\n${
+                backticks}\n${exc.stack}${backticks}\n`, -1
+            );
        });

        let spacing = new Gtk.SeparatorToolItem({ draw: false });
@@ -180,13 +185,13 @@ var Application = GObject.registerClass({
            label: _("Homepage"),
            tooltip_text: _("Visit extension homepage"),
            no_show_all: true,
-            visible: row.url != null
+            visible: extension.metadata.url != null
        });
        toolbar.add(urlButton);

        urlButton.connect('clicked', w => {
            let context = w.get_display().get_app_launch_context();
-            Gio.AppInfo.launch_default_for_uri(row.url, context);
+            Gio.AppInfo.launch_default_for_uri(extension.metadata.url, context);
        });

        let expandedBox = new Gtk.Box({
@@ -201,8 +206,8 @@ var Application = GObject.registerClass({
        return scroll;
    }

-    _buildUI() {
-        this._window = new Gtk.ApplicationWindow({ application: this,
+    _buildUI(app) {
+        this._window = new Gtk.ApplicationWindow({ application: app,
                                                   window_position: Gtk.WindowPosition.CENTER });

        this._window.set_default_size(800, 500);
@@ -236,14 +241,18 @@ var Application = GObject.registerClass({
        this._mainStack.add_named(new EmptyPlaceholder(), 'placeholder');

        this._shellProxy = new GnomeShellProxy(Gio.DBus.session, 'org.gnome.Shell', '/org/gnome/Shell');
-        this._shellProxy.connectSignal('ExtensionStateChanged',
-            this._onExtensionStateChanged.bind(this));
+        this._shellProxy.connectSignal('ExtensionStatusChanged', (proxy, senderName, [uuid, state, error]) => {
+            if (ExtensionUtils.extensions[uuid] !== undefined)
+                this._scanExtensions();
+        });

        this._window.show_all();
    }

    _sortList(row1, row2) {
-        return row1.name.localeCompare(row2.name);
+        let name1 = ExtensionUtils.extensions[row1.uuid].metadata.name;
+        let name2 = ExtensionUtils.extensions[row2.uuid].metadata.name;
+        return name1.localeCompare(name2);
    }

    _updateHeader(row, before) {
@@ -254,55 +263,19 @@ var Application = GObject.registerClass({
        row.set_header(sep);
    }

-    _findExtensionRow(uuid) {
-        return this._extensionSelector.get_children().find(c => c.uuid === uuid);
-    }
-
-    _onExtensionStateChanged(proxy, senderName, [uuid, newState]) {
-        let row = this._findExtensionRow(uuid);
-        if (row) {
-            let { state } = ExtensionUtils.deserializeExtension(newState);
-            if (state == ExtensionState.UNINSTALLED)
-                row.destroy();
-            return; // we only deal with new and deleted extensions here
-        }
-
-        this._shellProxy.GetExtensionInfoRemote(uuid, ([serialized]) => {
-            let extension = ExtensionUtils.deserializeExtension(serialized);
-            if (!extension)
-                return;
-            // check the extension wasn't added in between
-            if (this._findExtensionRow(uuid) != null)
-                return;
-            this._addExtensionRow(extension);
-        });
-    }
-
    _scanExtensions() {
-        this._shellProxy.ListExtensionsRemote(([extensionsMap], e) => {
-            if (e) {
-                if (e instanceof Gio.DBusError) {
-                    log(`Failed to connect to shell proxy: ${e}`);
-                    this._mainStack.add_named(new NoShellPlaceholder(), 'noshell');
-                    this._mainStack.visible_child_name = 'noshell';
-                } else
-                    throw e;
-                return;
-            }
-
-            for (let uuid in extensionsMap) {
-                let extension = ExtensionUtils.deserializeExtension(extensionsMap[uuid]);
-                this._addExtensionRow(extension);
-            }
-            this._extensionsLoaded();
-        });
+        let finder = new ExtensionUtils.ExtensionFinder();
+        finder.connect('extension-found', this._extensionFound.bind(this));
+        finder.scanExtensions();
+        this._extensionsLoaded();
    }

-    _addExtensionRow(extension) {
-        let row = new ExtensionRow(extension);
+    _extensionFound(finder, extension) {
+        let row = new ExtensionRow(extension.uuid);

+        row.prefsButton.visible = this._extensionAvailable(row.uuid);
        row.prefsButton.connect('clicked', () => {
-            this._showPrefs(row.uuid);
+            this._selectExtension(row.uuid);
        });

        row.show_all();
@@ -315,26 +288,24 @@ var Application = GObject.registerClass({
        else
            this._mainStack.visible_child_name = 'placeholder';

-        if (this._startupUuid)
-            this._showPrefs(this._startupUuid);
+        if (this._startupUuid && this._extensionAvailable(this._startupUuid))
+            this._selectExtension(this._startupUuid);
        this._startupUuid = null;
        this._skipMainWindow = false;
        this._loaded = true;
    }

-    vfunc_activate() {
+    _onActivate() {
        this._window.present();
    }

-    vfunc_startup() {
-        super.vfunc_startup();
-
-        this._buildUI();
+    _onStartup(app) {
+        this._buildUI(app);
        this._scanExtensions();
    }

-    vfunc_command_line(commandLine) {
-        this.activate();
+    _onCommandLine(app, commandLine) {
+        app.activate();
        let args = commandLine.get_arguments();

        if (args.length) {
@@ -345,14 +316,16 @@ var Application = GObject.registerClass({
            // Strip off "extension:///" prefix which fakes a URI, if it exists
            uuid = stripPrefix(uuid, "extension:///");

-            if (!this._loaded)
+            if (this._extensionAvailable(uuid))
+                this._selectExtension(uuid);
+            else if (!this._loaded)
                this._startupUuid = uuid;
-            else if (!this._showPrefs(uuid))
+            else
                this._skipMainWindow = false;
        }
        return 0;
    }
-});
+};

 var Expander = GObject.registerClass({
    Properties: {
@@ -519,35 +492,6 @@ class EmptyPlaceholder extends Gtk.Box {
    }
 });

-var NoShellPlaceholder = GObject.registerClass(
-class NoShellPlaceholder extends Gtk.Box {
-    _init() {
-        super._init({
-            orientation: Gtk.Orientation.VERTICAL,
-            spacing: 12,
-            margin: 100,
-            margin_bottom: 60
-        });
-
-        let label = new Gtk.Label({
-            label: '<span size="x-large">%s</span>'.format(
-                _("Something’s gone wrong")),
-            use_markup: true
-        });
-        label.get_style_context().add_class(Gtk.STYLE_CLASS_DIM_LABEL);
-        this.add(label);
-
-        label = new Gtk.Label({
-            label: _("We’re very sorry, but it was not possible to get the list of installed extensions. Make sure you are logged into GNOME and try again."),
-            justify: Gtk.Justification.CENTER,
-            wrap: true
-        });
-        this.add(label);
-
-        this.show_all();
-    }
-});
-
 var DescriptionLabel = GObject.registerClass(
 class DescriptionLabel extends Gtk.Label {
    vfunc_get_preferred_height_for_width(width) {
@@ -560,55 +504,30 @@ class DescriptionLabel extends Gtk.Label {

 var ExtensionRow = GObject.registerClass(
 class ExtensionRow extends Gtk.ListBoxRow {
-    _init(extension) {
+    _init(uuid) {
        super._init();

-        this._app = Gio.Application.get_default();
-        this._extension = extension;
-        this._prefsModule = null;
+        this.uuid = uuid;

-        this._extensionStateChangedId = this._app.shellProxy.connectSignal(
-            'ExtensionStateChanged', (p, sender, [uuid, newState]) => {
-                if (this.uuid !== uuid)
-                    return;
-
-                this._extension = ExtensionUtils.deserializeExtension(newState);
-                let state = (this._extension.state == ExtensionState.ENABLED);
-                this._switch.state = state;
-                this._switch.sensitive = this._canToggle();
+        this._settings = new Gio.Settings({ schema_id: 'org.gnome.shell' });
+        this._settings.connect('changed::enabled-extensions', () => {
+            this._switch.state = this._isEnabled();
+        });
+        this._settings.connect('changed::disable-extension-version-validation',
+            () => {
+                this._switch.sensitive = this._canEnable();
+            });
+        this._settings.connect('changed::disable-user-extensions',
+            () => {
+                this._switch.sensitive = this._canEnable();
            });
-
-        this.connect('destroy', this._onDestroy.bind(this));

        this._buildUI();
    }

-    get uuid() {
-        return this._extension.uuid;
-    }
-
-    get name() {
-        return this._extension.metadata.name;
-    }
-
-    get hasPrefs() {
-        return this._extension.hasPrefs;
-    }
-
-    get url() {
-        return this._extension.metadata.url;
-    }
-
-    _onDestroy() {
-        if (!this._app.shellProxy)
-            return;
-
-        if (this._extensionStateChangedId)
-            this._app.shellProxy.disconnectSignal(this._extensionStateChangedId);
-        this._extensionStateChangedId = 0;
-    }
-
    _buildUI() {
+        let extension = ExtensionUtils.extensions[this.uuid];
+
        let hbox = new Gtk.Box({ orientation: Gtk.Orientation.HORIZONTAL,
                                 hexpand: true, margin_end: 24, spacing: 24,
                                 margin: 12 });
@@ -618,20 +537,19 @@ class ExtensionRow extends Gtk.ListBoxRow {
                                 spacing: 6, hexpand: true });
        hbox.add(vbox);

-        let name = GLib.markup_escape_text(this.name, -1);
+        let name = GLib.markup_escape_text(extension.metadata.name, -1);
        let label = new Gtk.Label({ label: '<b>' + name + '</b>',
                                    use_markup: true,
                                    halign: Gtk.Align.START });
        vbox.add(label);

-        let desc = this._extension.metadata.description.split('\n')[0];
+        let desc = extension.metadata.description.split('\n')[0];
        label = new DescriptionLabel({ label: desc, wrap: true, lines: 2,
                                       ellipsize: Pango.EllipsizeMode.END,
                                       xalign: 0, yalign: 0 });
        vbox.add(label);

        let button = new Gtk.Button({ valign: Gtk.Align.CENTER,
-                                      visible: this.hasPrefs,
                                      no_show_all: true });
        button.set_image(new Gtk.Image({ icon_name: 'emblem-system-symbolic',
                                         icon_size: Gtk.IconSize.BUTTON,
@@ -641,37 +559,51 @@ class ExtensionRow extends Gtk.ListBoxRow {

        this.prefsButton = button;

-        this._switch = new Gtk.Switch({
-            valign: Gtk.Align.CENTER,
-            sensitive: this._canToggle(),
-            state: this._extension.state === ExtensionState.ENABLED
-        });
+        this._switch = new Gtk.Switch({ valign: Gtk.Align.CENTER,
+                                        sensitive: this._canEnable(),
+                                        state: this._isEnabled() });
        this._switch.connect('notify::active', () => {
            if (this._switch.active)
-                this._app.shellProxy.EnableExtensionRemote(this.uuid);
+                this._enable();
            else
-                this._app.shellProxy.DisableExtensionRemote(this.uuid);
+                this._disable();
        });
        this._switch.connect('state-set', () => true);
        hbox.add(this._switch);
    }

-    _canToggle() {
-        return this._extension.canChange;
+    _canEnable() {
+        let extension = ExtensionUtils.extensions[this.uuid];
+        let checkVersion = !this._settings.get_boolean('disable-extension-version-validation');
+
+        return !this._settings.get_boolean('disable-user-extensions') &&
+               !(checkVersion && ExtensionUtils.isOutOfDate(extension));
    }

-    get prefsModule() {
-        if (!this._prefsModule) {
-            ExtensionUtils.installImporter(this._extension);
+    _isEnabled() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        return extensions.indexOf(this.uuid) != -1;
+    }

-            // give extension prefs access to their own extension object
-            ExtensionUtils.getCurrentExtension = () => this._extension;
+    _enable() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        if (extensions.indexOf(this.uuid) != -1)
+            return;

-            this._prefsModule = this._extension.imports.prefs;
-            this._prefsModule.init(this._extension.metadata);
-        }
+        extensions.push(this.uuid);
+        this._settings.set_strv('enabled-extensions', extensions);
+    }

-        return this._prefsModule;
+    _disable() {
+        let extensions = this._settings.get_strv('enabled-extensions');
+        let pos = extensions.indexOf(this.uuid);
+        if (pos == -1)
+            return;
+        do {
+            extensions.splice(pos, 1);
+            pos = extensions.indexOf(this.uuid);
+        } while (pos != -1);
+        this._settings.set_strv('enabled-extensions', extensions);
    }
 });

@@ -679,12 +611,12 @@ function initEnvironment() {
    // Monkey-patch in a "global" object that fakes some Shell utilities
    // that ExtensionUtils depends on.
    window.global = {
-        log(...args) {
-            print(args.join(', '));
+        log() {
+            print([].join.call(arguments, ', '));
        },

        logError(s) {
-            log(`ERROR: ${s}`);
+            log('ERROR: ' + s);
        },

        userdatadir: GLib.build_filenamev([GLib.get_user_data_dir(), 'gnome-shell'])
@@ -699,5 +631,6 @@ function main(argv) {
    Gettext.bindtextdomain(Config.GETTEXT_PACKAGE, Config.LOCALEDIR);
    Gettext.textdomain(Config.GETTEXT_PACKAGE);

-    new Application().run(argv);
+    let app = new Application();
+    app.application.run(argv);
 }
--- a/js/gdm/authPrompt.js
+++ b/js/gdm/authPrompt.js
@@ -8,13 +8,14 @@ const Batch = imports.gdm.batch;
 const GdmUtil = imports.gdm.util;
 const Params = imports.misc.params;
 const ShellEntry = imports.ui.shellEntry;
+const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;

 var DEFAULT_BUTTON_WELL_ICON_SIZE = 16;
-var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1000;
-var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 300;
+var DEFAULT_BUTTON_WELL_ANIMATION_DELAY = 1.0;
+var DEFAULT_BUTTON_WELL_ANIMATION_TIME = 0.3;

-var MESSAGE_FADE_OUT_ANIMATION_TIME = 500;
+var MESSAGE_FADE_OUT_ANIMATION_TIME = 0.5;

 var AuthPromptMode = {
    UNLOCK_ONLY: 0,
@@ -58,23 +59,23 @@ var AuthPrompt = class {
        this.smartcardDetected = this._userVerifier.smartcardDetected;

        this.connect('next', () => {
-            this.updateSensitivity(false);
-            this.startSpinning();
-            if (this._queryingService) {
-                this._userVerifier.answerQuery(this._queryingService, this._entry.text);
-            } else {
-                this._preemptiveAnswer = this._entry.text;
-            }
-        });
+                this.updateSensitivity(false);
+                this.startSpinning();
+                if (this._queryingService) {
+                    this._userVerifier.answerQuery(this._queryingService, this._entry.text);
+                } else {
+                    this._preemptiveAnswer = this._entry.text;
+                }
+            });

        this.actor = new St.BoxLayout({ style_class: 'login-dialog-prompt-layout',
                                        vertical: true });
        this.actor.connect('destroy', this._onDestroy.bind(this));
        this.actor.connect('key-press-event', (actor, event) => {
-            if (event.get_key_symbol() == Clutter.KEY_Escape)
-                this.cancel();
-            return Clutter.EVENT_PROPAGATE;
-        });
+                if (event.get_key_symbol() == Clutter.KEY_Escape)
+                    this.cancel();
+                return Clutter.EVENT_PROPAGATE;
+            });

        this._userWell = new St.Bin({ x_fill: true,
                                      x_align: St.Align.START });
@@ -111,7 +112,7 @@ var AuthPrompt = class {
        this._buttonBox = new St.BoxLayout({ style_class: 'login-dialog-button-box',
                                             vertical: false });
        this.actor.add(this._buttonBox,
-                       { expand: true,
+                       { expand:  true,
                         x_align: St.Align.MIDDLE,
                         y_align: St.Align.END });

@@ -137,7 +138,7 @@ var AuthPrompt = class {
                                            reactive: true,
                                            can_focus: true,
                                            label: _("Cancel") });
-        this.cancelButton.connect('clicked', () => this.cancel());
+        this.cancelButton.connect('clicked', () => { this.cancel(); });
        this._buttonBox.add(this.cancelButton,
                            { expand: false,
                              x_fill: false,
@@ -156,7 +157,7 @@ var AuthPrompt = class {
                                          reactive: true,
                                          can_focus: true,
                                          label: _("Next") });
-        this.nextButton.connect('clicked', () => this.emit('next'));
+        this.nextButton.connect('clicked', () => { this.emit('next'); });
        this.nextButton.add_style_pseudo_class('default');
        this._buttonBox.add(this.nextButton,
                            { expand: false,
@@ -266,7 +267,7 @@ var AuthPrompt = class {
        let oldActor = this._defaultButtonWellActor;

        if (oldActor)
-            oldActor.remove_all_transitions();
+            Tweener.removeTweens(oldActor);

        let wasSpinner;
        if (oldActor == this._spinner.actor)
@@ -289,18 +290,19 @@ var AuthPrompt = class {
                        this._spinner.stop();
                }
            } else {
-                oldActor.ease({
-                    opacity: 0,
-                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                    mode: Clutter.AnimationMode.LINEAR,
-                    onComplete: () => {
-                        if (wasSpinner) {
-                            if (this._spinner)
-                                this._spinner.stop();
-                        }
-                    }
-                });
+                Tweener.addTween(oldActor,
+                                 { opacity: 0,
+                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                                   transition: 'linear',
+                                   onCompleteScope: this,
+                                   onComplete() {
+                                      if (wasSpinner) {
+                                          if (this._spinner)
+                                              this._spinner.stop();
+                                      }
+                                   }
+                                 });
            }
        }

@@ -311,12 +313,11 @@ var AuthPrompt = class {
            if (!animate)
                actor.opacity = 255;
            else
-                actor.ease({
-                    opacity: 255,
-                    duration: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
-                    delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
-                    mode: Clutter.AnimationMode.LINEAR
-                });
+                Tweener.addTween(actor,
+                                 { opacity: 255,
+                                   time: DEFAULT_BUTTON_WELL_ANIMATION_TIME,
+                                   delay: DEFAULT_BUTTON_WELL_ANIMATION_DELAY,
+                                   transition: 'linear' });
        }

        this._defaultButtonWellActor = actor;
@@ -365,12 +366,12 @@ var AuthPrompt = class {
    _fadeOutMessage() {
        if (this._message.opacity == 0)
            return;
-        this._message.remove_all_transitions();
-        this._message.ease({
-            opacity: 0,
-            duration: MESSAGE_FADE_OUT_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.removeTweens(this._message);
+        Tweener.addTween(this._message,
+                         { opacity: 0,
+                           time: MESSAGE_FADE_OUT_ANIMATION_TIME,
+                           transition: 'easeOutQuad'
+                         });
    }

    setMessage(message, type) {
@@ -385,7 +386,7 @@ var AuthPrompt = class {
            this._message.remove_style_class_name('login-dialog-message-hint');

        if (message) {
-            this._message.remove_all_transitions();
+            Tweener.removeTweens(this._message);
            this._message.text = message;
            this._message.opacity = 255;
        } else {
--- a/js/gdm/batch.js
+++ b/js/gdm/batch.js
@@ -20,7 +20,7 @@
 * In order for transformation animations to look good, they need to be
 * incremental and have some order to them (e.g., fade out hidden items,
 * then shrink to close the void left over). Chaining animations in this way can
- * be error-prone and wordy using just ease() callbacks.
+ * be error-prone and wordy using just Tweener callbacks.
 *
 * The classes in this file help with this:
 *
@@ -44,7 +44,6 @@
 * replaced by something else.
 */

-const { GObject } = imports.gi;
 const Signals = imports.signals;

 var Task = class {
@@ -177,36 +176,36 @@ Signals.addSignalMethods(Batch.prototype);

 var ConcurrentBatch = class extends Batch {
    process() {
-        let hold = this.runTask();
+       let hold = this.runTask();

-        if (hold) {
-            this.hold.acquireUntilAfter(hold);
-        }
+       if (hold) {
+           this.hold.acquireUntilAfter(hold);
+       }

-        // Regardless of the state of the just run task,
-        // fire off the next one, so all the tasks can run
-        // concurrently.
-        this.nextTask();
+       // Regardless of the state of the just run task,
+       // fire off the next one, so all the tasks can run
+       // concurrently.
+       this.nextTask();
    }
 };
 Signals.addSignalMethods(ConcurrentBatch.prototype);

 var ConsecutiveBatch = class extends Batch {
    process() {
-        let hold = this.runTask();
+       let hold = this.runTask();

-        if (hold && hold.isAcquired()) {
-            // This task is inhibiting the batch. Wait on it
-            // before processing the next one.
-            let signalId = hold.connect('release', () => {
-                hold.disconnect(signalId);
-                this.nextTask();
-            });
-            return;
-        } else {
-            // This task finished, process the next one
-            this.nextTask();
-        }
+       if (hold && hold.isAcquired()) {
+           // This task is inhibiting the batch. Wait on it
+           // before processing the next one.
+           let signalId = hold.connect('release', () => {
+               hold.disconnect(signalId);
+               this.nextTask();
+           });
+           return;
+       } else {
+           // This task finished, process the next one
+           this.nextTask();
+       }
    }
 };
 Signals.addSignalMethods(ConsecutiveBatch.prototype);
--- a/js/gdm/fingerprint.js
+++ b/js/gdm/fingerprint.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported FprintManager */

 const Gio = imports.gi.Gio;

@@ -24,8 +23,8 @@ function FprintManager() {

    try {
        self.init(null);
-    } catch (e) {
-        log(`Failed to connect to Fprint service: ${e.message}`);
+    } catch(e) {
+        log('Failed to connect to Fprint service: ' + e.message);
        return null;
    }

--- a/js/gdm/loginDialog.js
+++ b/js/gdm/loginDialog.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LoginDialog */
 /*
 * Copyright 2011 Red Hat, Inc
 *
@@ -31,10 +30,11 @@ const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const PopupMenu = imports.ui.popupMenu;
 const Realmd = imports.gdm.realmd;
+const Tweener = imports.ui.tweener;
 const UserWidget = imports.ui.userWidget;

-const _FADE_ANIMATION_TIME = 250;
-const _SCROLL_ANIMATION_TIME = 500;
+const _FADE_ANIMATION_TIME = 0.25;
+const _SCROLL_ANIMATION_TIME = 0.5;
 const _TIMED_LOGIN_IDLE_THRESHOLD = 5.0;
 const _LOGO_ICON_HEIGHT = 48;
 const _MAX_BOTTOM_MENU_ITEMS = 5;
@@ -43,7 +43,7 @@ var UserListItem = class {
    constructor(user) {
        this.user = user;
        this._userChangedId = this.user.connect('changed',
-                                                this._onUserChanged.bind(this));
+                                                 this._onUserChanged.bind(this));

        let layout = new St.BoxLayout({ vertical: true });
        this.actor = new St.Button({ style_class: 'login-dialog-user-list-item',
@@ -150,7 +150,7 @@ Signals.addSignalMethods(UserListItem.prototype);

 var UserList = class {
    constructor() {
-        this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view' });
+        this.actor = new St.ScrollView({ style_class: 'login-dialog-user-list-view'});
        this.actor.set_policy(St.PolicyType.NEVER,
                              St.PolicyType.AUTOMATIC);

@@ -187,6 +187,8 @@ var UserList = class {
    }

    updateStyle(isExpanded) {
+        let tasks = [];
+
        if (isExpanded)
            this._box.add_style_pseudo_class('expanded');
        else
@@ -204,10 +206,11 @@ var UserList = class {
        let adjustment = this.actor.get_vscroll_bar().get_adjustment();

        let value = (box.y1 + adjustment.step_increment / 2.0) - (adjustment.page_size / 2.0);
-        adjustment.ease(value, {
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            duration: _SCROLL_ANIMATION_TIME
-        });
+        Tweener.removeTweens(adjustment);
+        Tweener.addTween (adjustment,
+                          { value: value,
+                            time: _SCROLL_ANIMATION_TIME,
+                            transition: 'easeOutQuad' });
    }

    jumpToItem(item) {
@@ -241,7 +244,7 @@ var UserList = class {
            return;

        if (user.locked)
-            return;
+           return;

        let userName = user.get_user_name();

@@ -258,7 +261,7 @@ var UserList = class {
        item.connect('activate', this._onItemActivated.bind(this));

        // Try to keep the focused item front-and-center
-        item.actor.connect('key-focus-in', () => this.scrollToItem(item));
+        item.actor.connect('key-focus-in', () => { this.scrollToItem(item); });

        this._moveFocusToItems();

@@ -316,17 +319,17 @@ var SessionMenuButton = class {
        this._menu.actor.hide();

        this._menu.connect('open-state-changed', (menu, isOpen) => {
-            if (isOpen)
-                this._button.add_style_pseudo_class('active');
-            else
-                this._button.remove_style_pseudo_class('active');
+             if (isOpen)
+                 this._button.add_style_pseudo_class('active');
+             else
+                 this._button.remove_style_pseudo_class('active');
        });

        this._manager = new PopupMenu.PopupMenuManager(this._button,
                                                       { actionMode: Shell.ActionMode.NONE });
        this._manager.addMenu(this._menu);

-        this._button.connect('clicked', () => this._menu.toggle());
+        this._button.connect('clicked', () => { this._menu.toggle(); });

        this._items = {};
        this._activeSessionId = null;
@@ -350,11 +353,11 @@ var SessionMenuButton = class {
    }

    setActiveSession(sessionId) {
-        if (sessionId == this._activeSessionId)
-            return;
+         if (sessionId == this._activeSessionId)
+             return;

-        this._activeSessionId = sessionId;
-        this._updateOrnament();
+         this._activeSessionId = sessionId;
+         this._updateOrnament();
    }

    close() {
@@ -371,7 +374,7 @@ var SessionMenuButton = class {
        }

        for (let i = 0; i < ids.length; i++) {
-            let [sessionName, sessionDescription_] = Gdm.get_session_name_and_description(ids[i]);
+            let [sessionName, sessionDescription] = Gdm.get_session_name_and_description(ids[i]);

            let id = ids[i];
            let item = new PopupMenu.PopupMenuItem(sessionName);
@@ -400,18 +403,18 @@ var LoginDialog = GObject.registerClass({
        this.connect('destroy', this._onDestroy.bind(this));
        parentActor.add_child(this);

-        this._userManager = AccountsService.UserManager.get_default();
+        this._userManager = AccountsService.UserManager.get_default()
        this._gdmClient = new Gdm.Client();

        this._settings = new Gio.Settings({ schema_id: GdmUtil.LOGIN_SCREEN_SCHEMA });

-        this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_KEY}`,
+        this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_KEY,
                               this._updateBanner.bind(this));
-        this._settings.connect(`changed::${GdmUtil.BANNER_MESSAGE_TEXT_KEY}`,
+        this._settings.connect('changed::' + GdmUtil.BANNER_MESSAGE_TEXT_KEY,
                               this._updateBanner.bind(this));
-        this._settings.connect(`changed::${GdmUtil.DISABLE_USER_LIST_KEY}`,
+        this._settings.connect('changed::' + GdmUtil.DISABLE_USER_LIST_KEY,
                               this._updateDisableUserList.bind(this));
-        this._settings.connect(`changed::${GdmUtil.LOGO_KEY}`,
+        this._settings.connect('changed::' + GdmUtil.LOGO_KEY,
                               this._updateLogo.bind(this));

        this._textureCache = St.TextureCache.get_default();
@@ -517,7 +520,7 @@ var LoginDialog = GObject.registerClass({
    _getBannerAllocation(dialogBox) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = this._bannerView.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this._bannerView.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;

        actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -531,7 +534,7 @@ var LoginDialog = GObject.registerClass({
    _getLogoBinAllocation(dialogBox) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = this._logoBin.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this._logoBin.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;

        actorBox.x1 = Math.floor(centerX - natWidth / 2);
@@ -545,7 +548,7 @@ var LoginDialog = GObject.registerClass({
    _getCenterActorAllocation(dialogBox, actor) {
        let actorBox = new Clutter.ActorBox();

-        let [, , natWidth, natHeight] = actor.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = actor.get_preferred_size();
        let centerX = dialogBox.x1 + (dialogBox.x2 - dialogBox.x1) / 2;
        let centerY = dialogBox.y1 + (dialogBox.y2 - dialogBox.y1) / 2;

@@ -572,15 +575,19 @@ var LoginDialog = GObject.registerClass({
        // First find out what space the children require
        let bannerAllocation = null;
        let bannerHeight = 0;
+        let bannerWidth = 0;
        if (this._bannerView.visible) {
            bannerAllocation = this._getBannerAllocation(dialogBox, this._bannerView);
            bannerHeight = bannerAllocation.y2 - bannerAllocation.y1;
+            bannerWidth = bannerAllocation.x2 - bannerAllocation.x1;
        }

        let authPromptAllocation = null;
+        let authPromptHeight = 0;
        let authPromptWidth = 0;
        if (this._authPrompt.actor.visible) {
            authPromptAllocation = this._getCenterActorAllocation(dialogBox, this._authPrompt.actor);
+            authPromptHeight = authPromptAllocation.y2 - authPromptAllocation.y1;
            authPromptWidth = authPromptAllocation.x2 - authPromptAllocation.x1;
        }

@@ -612,64 +619,64 @@ var LoginDialog = GObject.registerClass({
            let leftOverYSpace = bannerSpace - bannerHeight;

            if (leftOverYSpace > 0) {
-                // First figure out how much left over space is up top
-                let leftOverTopSpace = leftOverYSpace / 2;
+                 // First figure out how much left over space is up top
+                 let leftOverTopSpace = leftOverYSpace / 2;

-                // Then, shift the banner into the middle of that extra space
-                let yShift = Math.floor(leftOverTopSpace / 2);
+                 // Then, shift the banner into the middle of that extra space
+                 let yShift = Math.floor(leftOverTopSpace / 2);

-                bannerAllocation.y1 += yShift;
-                bannerAllocation.y2 += yShift;
+                 bannerAllocation.y1 += yShift;
+                 bannerAllocation.y2 += yShift;
            } else {
-                // Then figure out how much space there would be if we switched to a
-                // wide layout with banner on one side and authprompt on the other.
-                let leftOverXSpace = dialogWidth - authPromptWidth;
+                 // Then figure out how much space there would be if we switched to a
+                 // wide layout with banner on one side and authprompt on the other.
+                 let leftOverXSpace = dialogWidth - authPromptWidth;

-                // In a wide view, half of the available space goes to the banner,
-                // and the other half goes to the margins.
-                let wideBannerWidth = leftOverXSpace / 2;
-                let wideSpacing  = leftOverXSpace - wideBannerWidth;
+                 // In a wide view, half of the available space goes to the banner,
+                 // and the other half goes to the margins.
+                 let wideBannerWidth = leftOverXSpace / 2;
+                 let wideSpacing  = leftOverXSpace - wideBannerWidth;

-                // If we do go with a wide layout, we need there to be at least enough
-                // space for the banner and the auth prompt to be the same width,
-                // so it doesn't look unbalanced.
-                if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) {
-                    let centerX = dialogBox.x1 + dialogWidth / 2;
-                    let centerY = dialogBox.y1 + dialogHeight / 2;
+                 // If we do go with a wide layout, we need there to be at least enough
+                 // space for the banner and the auth prompt to be the same width,
+                 // so it doesn't look unbalanced.
+                 if (authPromptWidth > 0 && wideBannerWidth > authPromptWidth) {
+                     let centerX = dialogBox.x1 + dialogWidth / 2;
+                     let centerY = dialogBox.y1 + dialogHeight / 2;

-                    // A small portion of the spacing goes down the center of the
-                    // screen to help delimit the two columns of the wide view
-                    let centerGap = wideSpacing / 8;
+                     // A small portion of the spacing goes down the center of the
+                     // screen to help delimit the two columns of the wide view
+                     let centerGap = wideSpacing / 8;

-                    // place the banner along the left edge of the center margin
-                    bannerAllocation.x2 = Math.floor(centerX - centerGap / 2);
-                    bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth);
+                     // place the banner along the left edge of the center margin
+                     bannerAllocation.x2 = Math.floor(centerX - centerGap / 2);
+                     bannerAllocation.x1 = Math.floor(bannerAllocation.x2 - wideBannerWidth);

-                    // figure out how tall it would like to be and try to accommodate
-                    // but don't let it get too close to the logo
-                    let [, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);
+                     // figure out how tall it would like to be and try to accommodate
+                     // but don't let it get too close to the logo
+                     let [wideMinHeight, wideBannerHeight] = this._bannerView.get_preferred_height(wideBannerWidth);

-                    let maxWideHeight = dialogHeight - 3 * logoHeight;
-                    wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
-                    bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2);
-                    bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight;
+                     let maxWideHeight = dialogHeight - 3 * logoHeight;
+                     wideBannerHeight = Math.min(maxWideHeight, wideBannerHeight);
+                     bannerAllocation.y1 = Math.floor(centerY - wideBannerHeight / 2);
+                     bannerAllocation.y2 = bannerAllocation.y1 + wideBannerHeight;

-                    // place the auth prompt along the right edge of the center margin
-                    authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2);
-                    authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth;
-                } else {
-                    // If we aren't going to do a wide view, then we need to limit
-                    // the height of the banner so it will present scrollbars
+                     // place the auth prompt along the right edge of the center margin
+                     authPromptAllocation.x1 = Math.floor(centerX + centerGap / 2);
+                     authPromptAllocation.x2 = authPromptAllocation.x1 + authPromptWidth;
+                 } else {
+                     // If we aren't going to do a wide view, then we need to limit
+                     // the height of the banner so it will present scrollbars

-                    // First figure out how much space there is without the banner
-                    leftOverYSpace += bannerHeight;
+                     // First figure out how much space there is without the banner
+                     leftOverYSpace += bannerHeight;

-                    // Then figure out how much of that space is up top
-                    let availableTopSpace = Math.floor(leftOverYSpace / 2);
+                     // Then figure out how much of that space is up top
+                     let availableTopSpace = Math.floor(leftOverYSpace / 2);

-                    // Then give all of that space to the banner
-                    bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace;
-                }
+                     // Then give all of that space to the banner
+                     bannerAllocation.y2 = bannerAllocation.y1 + availableTopSpace;
+                 }
            }
        } else if (userSelectionAllocation) {
            // Grow the user list to fill the space
@@ -757,15 +764,14 @@ var LoginDialog = GObject.registerClass({

    _fadeInBannerView() {
        this._bannerView.show();
-        this._bannerView.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this._bannerView,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad' });
    }

    _hideBannerView() {
-        this._bannerView.remove_all_transitions();
+        Tweener.removeTweens(this._bannerView);
        this._bannerView.opacity = 0;
        this._bannerView.hide();
    }
@@ -845,10 +851,10 @@ var LoginDialog = GObject.registerClass({
    _shouldShowSessionMenuButton() {
        if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFYING &&
            this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.VERIFICATION_FAILED)
-            return false;
+          return false;

        if (this._user && this._user.is_loaded && this._user.is_logged_in())
-            return false;
+          return false;

        return true;
    }
@@ -858,11 +864,10 @@ var LoginDialog = GObject.registerClass({
            return;
        this._authPrompt.actor.opacity = 0;
        this._authPrompt.actor.show();
-        this._authPrompt.actor.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this._authPrompt.actor,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad' });
        this._fadeInBannerView();
    }

@@ -906,31 +911,28 @@ var LoginDialog = GObject.registerClass({
        this._showPrompt();
    }

-    _bindOpacity() {
-        this._bindings = Main.layoutManager.uiGroup.get_children()
-            .filter(c => c != Main.layoutManager.screenShieldGroup)
-            .map(c => this.bind_property('opacity', c, 'opacity', 0));
-    }
-
-    _unbindOpacity() {
-        this._bindings.forEach(b => b.unbind());
-    }
-
    _loginScreenSessionActivated() {
        if (this.opacity == 255 && this._authPrompt.verificationStatus == AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
            return;

-        this._bindOpacity();
-        this.actor.ease({
-            opacity: 255,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
-                    this._authPrompt.reset();
-                this._unbindOpacity();
-            }
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onUpdate() {
+                               let children = Main.layoutManager.uiGroup.get_children();
+
+                               for (let i = 0; i < children.length; i++) {
+                                   if (children[i] != Main.layoutManager.screenShieldGroup)
+                                       children[i].opacity = this.opacity;
+                               }
+                           },
+                           onUpdateScope: this,
+                           onComplete() {
+                               if (this._authPrompt.verificationStatus != AuthPrompt.AuthPromptStatus.NOT_VERIFYING)
+                                   this._authPrompt.reset();
+                           },
+                           onCompleteScope: this });
    }

    _gotGreeterSessionProxy(proxy) {
@@ -943,27 +945,34 @@ var LoginDialog = GObject.registerClass({
    }

    _startSession(serviceName) {
-        this._bindOpacity();
-        this.actor.ease({
-            opacity: 0,
-            duration: _FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
-                this._unbindOpacity();
-            }
-        });
+        Tweener.addTween(this,
+                         { opacity: 0,
+                           time: _FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onUpdate() {
+                               let children = Main.layoutManager.uiGroup.get_children();
+
+                               for (let i = 0; i < children.length; i++) {
+                                   if (children[i] != Main.layoutManager.screenShieldGroup)
+                                       children[i].opacity = this.opacity;
+                               }
+                           },
+                           onUpdateScope: this,
+                           onComplete() {
+                               this._greeter.call_start_session_when_ready_sync(serviceName, true, null);
+                           },
+                           onCompleteScope: this });
    }

    _onSessionOpened(client, serviceName) {
-        this._authPrompt.finish(() => this._startSession(serviceName));
+        this._authPrompt.finish(() => { this._startSession(serviceName); });
    }

    _waitForItemForUser(userName) {
        let item = this._userList.getItemFromUserName(userName);

        if (item)
-            return null;
+          return null;

        let hold = new Batch.Hold();
        let signalId = this._userList.connect('item-added',
@@ -974,7 +983,7 @@ var LoginDialog = GObject.registerClass({
                    hold.release();
            });

-        hold.connect('release', () => this._userList.disconnect(signalId));
+        hold.connect('release', () => { this._userList.disconnect(signalId); });

        return hold;
    }
@@ -1038,7 +1047,6 @@ var LoginDialog = GObject.registerClass({
                             return this._blockTimedLoginUntilIdle();
                         } else {
                             animationTime = delay;
-                             return null;
                         }
                     },

@@ -1074,12 +1082,12 @@ var LoginDialog = GObject.registerClass({

        // Restart timed login on user interaction
        global.stage.connect('captured-event', (actor, event) => {
-            if (event.type() == Clutter.EventType.KEY_PRESS ||
+           if (event.type() == Clutter.EventType.KEY_PRESS ||
               event.type() == Clutter.EventType.BUTTON_PRESS) {
-                this._startTimedLogin(userName, seconds);
-            }
+               this._startTimedLogin(userName, seconds);
+           }

-            return Clutter.EVENT_PROPAGATE;
+           return Clutter.EVENT_PROPAGATE;
        });
    }

@@ -1225,11 +1233,10 @@ var LoginDialog = GObject.registerClass({

        Main.pushModal(this, { actionMode: Shell.ActionMode.LOGIN_SCREEN });

-        this.ease({
-            opacity: 255,
-            duration: 1000,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: 1,
+                           transition: 'easeInQuad' });

        return true;
    }
@@ -1243,7 +1250,7 @@ var LoginDialog = GObject.registerClass({
        this._authPrompt.cancel();
    }

-    addCharacter(_unichar) {
+    addCharacter(unichar) {
        // Don't allow type ahead at the login screen
    }

--- a/js/gdm/oVirt.js
+++ b/js/gdm/oVirt.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getOVirtCredentialsManager */

 const Gio = imports.gi.Gio;
 const Signals = imports.signals;
--- a/js/gdm/realmd.js
+++ b/js/gdm/realmd.js
@@ -15,11 +15,11 @@ const RealmIface = loadInterfaceXML("org.freedesktop.realmd.Realm");
 const Realm = Gio.DBusProxy.makeProxyWrapper(RealmIface);

 var Manager = class {
-    constructor() {
+    constructor(parentActor) {
        this._aggregateProvider = Provider(Gio.DBus.system,
                                           'org.freedesktop.realmd',
                                           '/org/freedesktop/realmd',
-                                           this._reloadRealms.bind(this));
+                                           this._reloadRealms.bind(this))
        this._realms = {};

        this._signalId = this._aggregateProvider.connect('g-properties-changed',
@@ -36,10 +36,10 @@ var Manager = class {
            return;

        for (let i = 0; i < realmPaths.length; i++) {
-            Realm(Gio.DBus.system,
-                  'org.freedesktop.realmd',
-                  realmPaths[i],
-                  this._onRealmLoaded.bind(this));
+            let realm = Realm(Gio.DBus.system,
+                              'org.freedesktop.realmd',
+                              realmPaths[i],
+                              this._onRealmLoaded.bind(this));
        }
    }

@@ -98,10 +98,10 @@ var Manager = class {
        Service(Gio.DBus.system,
                'org.freedesktop.realmd',
                '/org/freedesktop/realmd',
-                service => service.ReleaseRemote());
+                service => { service.ReleaseRemote(); });
        this._aggregateProvider.disconnect(this._signalId);
        this._realms = { };
        this._updateLoginFormat();
    }
 };
-Signals.addSignalMethods(Manager.prototype);
+Signals.addSignalMethods(Manager.prototype)
--- a/js/gdm/util.js
+++ b/js/gdm/util.js
@@ -1,6 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BANNER_MESSAGE_KEY, BANNER_MESSAGE_TEXT_KEY, LOGO_KEY,
-            DISABLE_USER_LIST_KEY, fadeInActor, fadeOutActor, cloneAndFadeOutActor */

 const { Clutter, Gio, GLib } = imports.gi;
 const Signals = imports.signals;
@@ -11,13 +9,14 @@ const OVirt = imports.gdm.oVirt;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
 const SmartcardManager = imports.misc.smartcardManager;
+const Tweener = imports.ui.tweener;

 var PASSWORD_SERVICE_NAME = 'gdm-password';
 var FINGERPRINT_SERVICE_NAME = 'gdm-fingerprint';
 var SMARTCARD_SERVICE_NAME = 'gdm-smartcard';
 var OVIRT_SERVICE_NAME = 'gdm-ovirtcred';
-var FADE_ANIMATION_TIME = 160;
-var CLONE_FADE_ANIMATION_TIME = 250;
+var FADE_ANIMATION_TIME = 0.16;
+var CLONE_FADE_ANIMATION_TIME = 0.25;

 var LOGIN_SCREEN_SCHEMA = 'org.gnome.login-screen';
 var PASSWORD_AUTHENTICATION_KEY = 'enable-password-authentication';
@@ -31,7 +30,7 @@ var LOGO_KEY = 'logo';
 var DISABLE_USER_LIST_KEY = 'disable-user-list';

 // Give user 48ms to read each character of a PAM message
-var USER_READ_TIME = 48;
+var USER_READ_TIME = 48

 var MessageType = {
    NONE: 0,
@@ -46,20 +45,20 @@ function fadeInActor(actor) {

    let hold = new Batch.Hold();
    actor.show();
-    let [, naturalHeight] = actor.get_preferred_height(-1);
+    let [minHeight, naturalHeight] = actor.get_preferred_height(-1);

    actor.opacity = 0;
    actor.set_height(0);
-    actor.ease({
-        opacity: 255,
-        height: naturalHeight,
-        duration: FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            this.set_height(-1);
-            hold.release();
-        }
-    });
+    Tweener.addTween(actor,
+                     { opacity: 255,
+                       height: naturalHeight,
+                       time: FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           this.set_height(-1);
+                           hold.release();
+                       },
+                     });

    return hold;
 }
@@ -72,17 +71,17 @@ function fadeOutActor(actor) {
    }

    let hold = new Batch.Hold();
-    actor.ease({
-        opacity: 0,
-        height: 0,
-        duration: FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            this.hide();
-            this.set_height(-1);
-            hold.release();
-        }
-    });
+    Tweener.addTween(actor,
+                     { opacity: 0,
+                       height: 0,
+                       time: FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           this.hide();
+                           this.set_height(-1);
+                           hold.release();
+                       },
+                     });
    return hold;
 }

@@ -102,15 +101,15 @@ function cloneAndFadeOutActor(actor) {
    clone.set_position(x, y);

    let hold = new Batch.Hold();
-    clone.ease({
-        opacity: 0,
-        duration: CLONE_FADE_ANIMATION_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => {
-            clone.destroy();
-            hold.release();
-        }
-    });
+    Tweener.addTween(clone,
+                     { opacity: 0,
+                       time: CLONE_FADE_ANIMATION_TIME,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           clone.destroy();
+                           hold.release();
+                       }
+                     });
    return hold;
 }

@@ -304,7 +303,7 @@ var ShellUserVerifier = class {
            });
    }

-    _oVirtUserAuthenticated(_token) {
+    _oVirtUserAuthenticated(token) {
        this._preemptingService = OVIRT_SERVICE_NAME;
        this.emit('ovirt-user-authenticated');
    }
@@ -343,7 +342,7 @@ var ShellUserVerifier = class {
        try {
            this._clearUserVerifier();
            this._userVerifier = client.open_reauthentication_channel_finish(result);
-        } catch (e) {
+        } catch(e) {
            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
                return;
            if (e.matches(Gio.DBusError, Gio.DBusError.ACCESS_DENIED) &&
@@ -370,7 +369,7 @@ var ShellUserVerifier = class {
        try {
            this._clearUserVerifier();
            this._userVerifier = client.get_user_verifier_finish(result);
-        } catch (e) {
+        } catch(e) {
            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
                return;
            this._reportInitError('Failed to obtain user verifier', e);
@@ -424,31 +423,36 @@ var ShellUserVerifier = class {
    _startService(serviceName) {
        this._hold.acquire();
        if (this._userName) {
-            this._userVerifier.call_begin_verification_for_user(serviceName, this._userName, this._cancellable, (obj, result) => {
-                try {
-                    obj.call_begin_verification_for_user_finish(result);
-                } catch (e) {
-                    if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
-                        return;
-                    this._reportInitError('Failed to start verification for user', e);
-                    return;
-                }
+           this._userVerifier.call_begin_verification_for_user(serviceName,
+                                                               this._userName,
+                                                               this._cancellable,
+                                                               (obj, result) => {
+               try {
+                   obj.call_begin_verification_for_user_finish(result);
+               } catch(e) {
+                   if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
+                       return;
+                   this._reportInitError('Failed to start verification for user', e);
+                   return;
+               }

-                this._hold.release();
-            });
+               this._hold.release();
+           });
        } else {
-            this._userVerifier.call_begin_verification(serviceName, this._cancellable, (obj, result) => {
-                try {
-                    obj.call_begin_verification_finish(result);
-                } catch (e) {
-                    if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
-                        return;
-                    this._reportInitError('Failed to start verification', e);
-                    return;
-                }
+           this._userVerifier.call_begin_verification(serviceName,
+                                                      this._cancellable,
+                                                      (obj, result) => {
+               try {
+                   obj.call_begin_verification_finish(result);
+               } catch(e) {
+                   if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.CANCELLED))
+                       return;
+                   this._reportInitError('Failed to start verification', e);
+                   return;
+               }

-                this._hold.release();
-            });
+               this._hold.release();
+           });
        }
    }

--- a/js/misc/extensionUtils.js
+++ b/js/misc/extensionUtils.js
@@ -1,37 +1,23 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ExtensionState, ExtensionType, getCurrentExtension,
-   getSettings, initTranslations, isOutOfDate, installImporter,
-   serializeExtension, deserializeExtension */

 // Common utils for the extension system and the extension
 // preferences tool

-const { Gio, GLib } = imports.gi;
-
 const Gettext = imports.gettext;
-const Lang = imports.lang;
+const Signals = imports.signals;
+
+const Gio = imports.gi.Gio;

 const Config = imports.misc.config;
+const FileUtils = imports.misc.fileUtils;

 var ExtensionType = {
    SYSTEM: 1,
    PER_USER: 2
 };

-var ExtensionState = {
-    ENABLED: 1,
-    DISABLED: 2,
-    ERROR: 3,
-    OUT_OF_DATE: 4,
-    DOWNLOADING: 5,
-    INITIALIZED: 6,
-
-    // Used as an error state for operations on unknown extensions,
-    // should never be in a real extensionMeta object.
-    UNINSTALLED: 99
-};
-
-const SERIALIZED_PROPERTIES = ['type', 'state', 'path', 'error', 'hasPrefs', 'canChange'];
+// Maps uuid -> metadata object
+var extensions = {};

 /**
 * getCurrentExtension:
@@ -45,7 +31,7 @@ function getCurrentExtension() {
    // Search for an occurrence of an extension stack frame
    // Start at 1 because 0 is the stack frame of this function
    for (let i = 1; i < stack.length; i++) {
-        if (stack[i].includes('/gnome-shell/extensions/')) {
+        if (stack[i].indexOf('/gnome-shell/extensions/') > -1) {
            extensionStackLine = stack[i];
            break;
        }
@@ -63,17 +49,13 @@ function getCurrentExtension() {
    if (!match)
        return null;

-    // local import, as the module is used from outside the gnome-shell process
-    // as well (not this function though)
-    let extensionManager = imports.ui.main.extensionManager;
-
    let path = match[1];
    let file = Gio.File.new_for_path(path);

    // Walk up the directory tree, looking for an extension with
    // the same UUID as a directory name.
    while (file != null) {
-        let extension = extensionManager.lookup(file.get_basename());
+        let extension = extensions[file.get_basename()];
        if (extension !== undefined)
            return extension;
        file = file.get_parent();
@@ -179,50 +161,54 @@ function isOutOfDate(extension) {
    return false;
 }

-function serializeExtension(extension) {
-    let obj = {};
-    Lang.copyProperties(extension.metadata, obj);
+function createExtensionObject(uuid, dir, type) {
+    let info;

-    SERIALIZED_PROPERTIES.forEach(prop => {
-        obj[prop] = extension[prop];
-    });
+    let metadataFile = dir.get_child('metadata.json');
+    if (!metadataFile.query_exists(null)) {
+        throw new Error('Missing metadata.json');
+    }

-    let res = {};
-    for (let key in obj) {
-        let val = obj[key];
-        let type;
-        switch (typeof val) {
-        case 'string':
-            type = 's';
-            break;
-        case 'number':
-            type = 'd';
-            break;
-        case 'boolean':
-            type = 'b';
-            break;
-        default:
-            continue;
+    let metadataContents, success, tag;
+    try {
+        [success, metadataContents, tag] = metadataFile.load_contents(null);
+        if (metadataContents instanceof Uint8Array)
+            metadataContents = imports.byteArray.toString(metadataContents);
+    } catch (e) {
+        throw new Error('Failed to load metadata.json: ' + e);
+    }
+    let meta;
+    try {
+        meta = JSON.parse(metadataContents);
+    } catch (e) {
+        throw new Error('Failed to parse metadata.json: ' + e);
+    }
+
+    let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
+    for (let i = 0; i < requiredProperties.length; i++) {
+        let prop = requiredProperties[i];
+        if (!meta[prop]) {
+            throw new Error('missing "' + prop + '" property in metadata.json');
        }
-        res[key] = GLib.Variant.new(type, val);
    }

-    return res;
-}
-
-function deserializeExtension(variant) {
-    let res = { metadata: {} };
-    for (let prop in variant) {
-        let val = variant[prop].unpack();
-        if (SERIALIZED_PROPERTIES.includes(prop))
-            res[prop] = val;
-        else
-            res.metadata[prop] = val;
+    if (uuid != meta.uuid) {
+        throw new Error('uuid "' + meta.uuid + '" from metadata.json does not match directory name "' + uuid + '"');
    }
-    // add the 2 additional properties to create a valid extension object, as createExtensionObject()
-    res.uuid = res.metadata.uuid;
-    res.dir = Gio.File.new_for_path(res.path);
-    return res;
+
+    let extension = {};
+
+    extension.metadata = meta;
+    extension.uuid = meta.uuid;
+    extension.type = type;
+    extension.dir = dir;
+    extension.path = dir.get_path();
+    extension.error = '';
+    extension.hasPrefs = dir.get_child('prefs.js').query_exists(null);
+
+    extensions[uuid] = extension;
+
+    return extension;
 }

 function installImporter(extension) {
@@ -233,3 +219,36 @@ function installImporter(extension) {
    extension.imports = imports[extension.uuid];
    imports.searchPath = oldSearchPath;
 }
+
+var ExtensionFinder = class {
+    _loadExtension(extensionDir, info, perUserDir) {
+        let fileType = info.get_file_type();
+        if (fileType != Gio.FileType.DIRECTORY)
+            return;
+        let uuid = info.get_name();
+        let existing = extensions[uuid];
+        if (existing) {
+            log('Extension %s already installed in %s. %s will not be loaded'.format(uuid, existing.path, extensionDir.get_path()));
+            return;
+        }
+
+        let extension;
+        let type = extensionDir.has_prefix(perUserDir) ? ExtensionType.PER_USER
+                                                       : ExtensionType.SYSTEM;
+        try {
+            extension = createExtensionObject(uuid, extensionDir, type);
+        } catch(e) {
+            logError(e, 'Could not load extension %s'.format(uuid));
+            return;
+        }
+        this.emit('extension-found', extension);
+    }
+
+    scanExtensions() {
+        let perUserDir = Gio.File.new_for_path(global.userdatadir);
+        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
+            this._loadExtension(dir, info, perUserDir);
+        });
+    }
+};
+Signals.addSignalMethods(ExtensionFinder.prototype);
--- a/js/misc/fileUtils.js
+++ b/js/misc/fileUtils.js
@@ -1,6 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported collectFromDatadirs, deleteGFile, recursivelyDeleteDir,
-            recursivelyMoveDir, loadInterfaceXML */

 const { Gio, GLib } = imports.gi;
 const Config = imports.misc.config;
@@ -38,7 +36,7 @@ function recursivelyDeleteDir(dir, deleteParent) {
    let children = dir.enumerate_children('standard::name,standard::type',
                                          Gio.FileQueryInfoFlags.NONE, null);

-    let info;
+    let info, child;
    while ((info = children.next_file(null)) != null) {
        let type = info.get_file_type();
        let child = dir.get_child(info.get_name());
@@ -59,7 +57,7 @@ function recursivelyMoveDir(srcDir, destDir) {
    if (!destDir.query_exists(null))
        destDir.make_directory_with_parents(null);

-    let info;
+    let info, child;
    while ((info = children.next_file(null)) != null) {
        let type = info.get_file_type();
        let srcChild = srcDir.get_child(info.get_name());
@@ -86,13 +84,13 @@ function loadInterfaceXML(iface) {
    let f = Gio.File.new_for_uri(uri);

    try {
-        let [ok_, bytes] = f.load_contents(null);
+        let [ok, bytes] = f.load_contents(null);
        if (bytes instanceof Uint8Array)
-            xml = imports.byteArray.toString(bytes);
+            xml = imports.byteArray.toString(bytes)
        else
            xml = bytes.toString();
    } catch (e) {
-        log(`Failed to load D-Bus interface ${iface}`);
+        log('Failed to load D-Bus interface ' + iface);
    }

    return xml;
--- a/js/misc/gnomeSession.js
+++ b/js/misc/gnomeSession.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PresenceStatus, Presence, Inhibitor, SessionManager */

 const Gio = imports.gi.Gio;

--- a/js/misc/history.js
+++ b/js/misc/history.js
@@ -18,7 +18,7 @@ var HistoryManager = class {
        this._historyIndex = 0;
        if (this._key) {
            this._history = global.settings.get_strv(this._key);
-            global.settings.connect(`changed::${this._key}`,
+            global.settings.connect('changed::' + this._key,
                                    this._historyChanged.bind(this));

        } else {
@@ -66,7 +66,7 @@ var HistoryManager = class {
            this._indexChanged();
        }

-        return this._historyIndex ? this._history[this._historyIndex - 1] : null;
+        return this._historyIndex ? this._history[this._historyIndex -1] : null;
    }

    addItem(input) {
--- a/js/misc/ibusManager.js
+++ b/js/misc/ibusManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getIBusManager */

 const { Gio, GLib, IBus } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -43,7 +42,7 @@ var IBusManager = class {
        this._candidatePopup = new IBusCandidatePopup.CandidatePopup();

        this._panelService = null;
-        this._engines = new Map();
+        this._engines = {};
        this._ready = false;
        this._registerPropertiesId = 0;
        this._currentEngineName = null;
@@ -59,31 +58,29 @@ var IBusManager = class {
        this._spawn();
    }

-    _spawn(extraArgs = []) {
+    _spawn() {
        try {
-            let cmdLine = ['ibus-daemon', '--panel', 'disable', ...extraArgs];
-            Gio.Subprocess.new(cmdLine, Gio.SubprocessFlags.NONE);
-        } catch (e) {
-            log(`Failed to launch ibus-daemon: ${e.message}`);
+            Gio.Subprocess.new(['ibus-daemon', '--xim', '--panel', 'disable'],
+                               Gio.SubprocessFlags.NONE);
+        } catch(e) {
+            log('Failed to launch ibus-daemon: ' + e.message);
        }
    }

-    restartDaemon(extraArgs = []) {
-        this._spawn(['-r', ...extraArgs]);
-    }
-
    _clear() {
        if (this._panelService)
            this._panelService.destroy();

        this._panelService = null;
        this._candidatePopup.setPanelService(null);
-        this._engines.clear();
+        this._engines = {};
        this._ready = false;
        this._registerPropertiesId = 0;
        this._currentEngineName = null;

        this.emit('ready', false);
+
+        this._spawn();
    }

    _onConnected() {
@@ -99,7 +96,7 @@ var IBusManager = class {
        if (enginesList) {
            for (let i = 0; i < enginesList.length; ++i) {
                let name = enginesList[i].get_name();
-                this._engines.set(name, enginesList[i]);
+                this._engines[name] = enginesList[i];
            }
            this._updateReadiness();
        } else {
@@ -122,7 +119,7 @@ var IBusManager = class {
                if (!GLib.str_has_suffix(path, '/InputContext_1'))
                    this.emit ('focus-in');
            });
-            this._panelService.connect('focus-out', () => this.emit('focus-out'));
+            this._panelService.connect('focus-out', () => { this.emit('focus-out'); });

            try {
                // IBus versions older than 1.5.10 have a bug which
@@ -141,7 +138,7 @@ var IBusManager = class {
                    engine = this._ibus.get_global_engine_async_finish(result);
                    if (!engine)
                        return;
-                } catch (e) {
+                } catch(e) {
                    return;
                }
                this._engineChanged(this._ibus, engine.get_name());
@@ -153,7 +150,8 @@ var IBusManager = class {
    }

    _updateReadiness() {
-        this._ready = this._engines.size > 0 && this._panelService != null;
+        this._ready = (Object.keys(this._engines).length > 0 &&
+                       this._panelService != null);
        this.emit('ready', this._ready);
    }

@@ -191,10 +189,10 @@ var IBusManager = class {
    }

    getEngineDesc(id) {
-        if (!this._ready || !this._engines.has(id))
+        if (!this._ready || !this._engines.hasOwnProperty(id))
            return null;

-        return this._engines.get(id);
+        return this._engines[id];
    }

    setEngine(id, callback) {
--- a/js/misc/inputMethod.js
+++ b/js/misc/inputMethod.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported InputMethod */
 const { Clutter, GLib, GObject, IBus } = imports.gi;

 const Keyboard = imports.ui.status.keyboard;
@@ -75,7 +74,7 @@ class InputMethod extends Clutter.InputMethod {
        this._context = null;
        this._hints = 0;
        this._purpose = 0;
-        this._preeditStr = '';
+        this._preeditStr = ''
        this._preeditPos = 0;
        this._preeditVisible = false;
    }
@@ -85,15 +84,15 @@ class InputMethod extends Clutter.InputMethod {
            this.emit('request-surrounding');
    }

-    _onCommitText(_context, text) {
+    _onCommitText(context, text) {
        this.commit(text.get_text());
    }

-    _onDeleteSurroundingText() {
+    _onDeleteSurroundingText(context) {
        this.delete_surrounding();
    }

-    _onUpdatePreeditText(_context, text, pos, visible) {
+    _onUpdatePreeditText(context, text, pos, visible) {
        if (text == null)
            return;

@@ -109,17 +108,17 @@ class InputMethod extends Clutter.InputMethod {
        this._preeditVisible = visible;
    }

-    _onShowPreeditText() {
+    _onShowPreeditText(context) {
        this._preeditVisible = true;
        this.set_preedit_text(this._preeditStr, this._preeditPos);
    }

-    _onHidePreeditText() {
+    _onHidePreeditText(context) {
        this.set_preedit_text(null, this._preeditPos);
        this._preeditVisible = false;
    }

-    _onForwardKeyEvent(_context, keyval, keycode, state) {
+    _onForwardKeyEvent(context, keyval, keycode, state) {
        let press = (state & IBus.ModifierType.RELEASE_MASK) == 0;
        state &= ~(IBus.ModifierType.RELEASE_MASK);

@@ -263,7 +262,7 @@ class InputMethod extends Clutter.InputMethod {
                                                      let retval = context.process_key_event_async_finish(res);
                                                      this.notify_key_event(event, retval);
                                                  } catch (e) {
-                                                      log(`Error processing key on IM: ${e.message}`);
+                                                      log('Error processing key on IM: ' + e.message);
                                                  }
                                              });
        return true;
--- a/js/misc/introspect.js
+++ b/js/misc/introspect.js
@@ -1,4 +1,3 @@
-/* exported IntrospectService */
 const { Gio, GLib, Meta, Shell } = imports.gi;

 const INTROSPECT_SCHEMA = 'org.gnome.shell';
@@ -47,11 +46,11 @@ var IntrospectService = class {
    }

    _isIntrospectEnabled() {
-        return this._settings.get_boolean(INTROSPECT_KEY);
+       return this._settings.get_boolean(INTROSPECT_KEY);
    }

    _isSenderWhitelisted(sender) {
-        return APP_WHITELIST.includes(sender);
+       return APP_WHITELIST.includes(sender);
    }

    _getSandboxedAppId(app) {
--- a/js/misc/jsParse.js
+++ b/js/misc/jsParse.js
@@ -1,5 +1,4 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
-/* exported getCompletions, getCommonPrefix, getDeclaredConstants */

 // Returns a list of potential completions for text. Completions either
 // follow a dot (e.g. foo.ba -> bar) or they are picked from globalCompletionList (e.g. fo -> foo)
@@ -9,7 +8,7 @@
 // This function is likely the one you want to call from external modules
 function getCompletions(text, commandHeader, globalCompletionList) {
    let methods = [];
-    let expr_, base;
+    let expr, base;
    let attrHead = '';
    if (globalCompletionList == null) {
        globalCompletionList = [];
@@ -22,7 +21,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
        // Look for expressions like "Main.panel.foo" and match Main.panel and foo
        let matches = text.match(/(.*)\.(.*)/);
        if (matches) {
-            [expr_, base, attrHead] = matches;
+            [expr, base, attrHead] = matches;

            methods = getPropertyNamesFromExpression(base, commandHeader).filter(
                attr => attr.slice(0, attrHead.length) == attrHead
@@ -33,7 +32,7 @@ function getCompletions(text, commandHeader, globalCompletionList) {
        // not proceeded by a dot and match them against global constants
        matches = text.match(/^(\w*)$/);
        if (text == '' || matches) {
-            [expr_, attrHead] = matches;
+            [expr, attrHead] = matches;
            methods = globalCompletionList.filter(
                attr => attr.slice(0, attrHead.length) == attrHead
            );
@@ -52,14 +51,14 @@ function getCompletions(text, commandHeader, globalCompletionList) {
 // if we encounter anything that isn't a letter, '.', ')', or ']',
 // we should stop parsing.
 function isStopChar(c) {
-    return !c.match(/[\w.)\]]/);
+    return !c.match(/[\w\.\)\]]/);
 }

 // Given the ending position of a quoted string, find where it starts
 function findMatchingQuote(expr, offset) {
    let quoteChar = expr.charAt(offset);
    for (let i = offset - 1; i >= 0; --i) {
-        if (expr.charAt(i) == quoteChar && expr.charAt(i - 1) != '\\') {
+        if (expr.charAt(i) == quoteChar && expr.charAt(i-1) != '\\'){
            return i;
        }
    }
@@ -69,7 +68,7 @@ function findMatchingQuote(expr, offset) {
 // Given the ending position of a regex, find where it starts
 function findMatchingSlash(expr, offset) {
    for (let i = offset - 1; i >= 0; --i) {
-        if (expr.charAt(i) == '/' && expr.charAt(i - 1) != '\\') {
+        if (expr.charAt(i) == '/' && expr.charAt(i-1) != '\\'){
            return i;
        }
    }
@@ -82,7 +81,7 @@ function findMatchingSlash(expr, offset) {
 // findMatchingBrace("[(])", 3) returns 1.
 function findMatchingBrace(expr, offset) {
    let closeBrace = expr.charAt(offset);
-    let openBrace = ({ ')': '(', ']': '[' })[closeBrace];
+    let openBrace = ({')': '(', ']': '['})[closeBrace];

    function findTheBrace(expr, offset) {
        if (offset < 0) {
@@ -118,11 +117,11 @@ function getExpressionOffset(expr, offset) {
    while (offset >= 0) {
        let currChar = expr.charAt(offset);

-        if (isStopChar(currChar)) {
+        if (isStopChar(currChar)){
            return offset + 1;
        }

-        if (currChar.match(/[)\]]/)) {
+        if (currChar.match(/[\)\]]/)) {
            offset = findMatchingBrace(expr, offset);
        }

@@ -152,11 +151,15 @@ function getAllProps(obj) {
 // e.g., expr="({ foo: null, bar: null, 4: null })" will
 // return ["foo", "bar", ...] but the list will not include "4",
 // since methods accessed with '.' notation must star with a letter or _.
-function getPropertyNamesFromExpression(expr, commandHeader = '') {
+function getPropertyNamesFromExpression(expr, commandHeader) {
+    if (commandHeader == null) {
+        commandHeader = '';
+    }
+
    let obj = {};
    if (!isUnsafeExpression(expr)) {
        try {
-            obj = eval(commandHeader + expr);
+                obj = eval(commandHeader + expr);
        } catch (e) {
            return [];
        }
@@ -165,7 +168,7 @@ function getPropertyNamesFromExpression(expr, commandHeader = '') {
    }

    let propsUnique = {};
-    if (typeof obj === 'object') {
+    if (typeof obj === 'object'){
        let allProps = getAllProps(obj);
        // Get only things we are allowed to complete following a '.'
        allProps = allProps.filter( isValidPropertyName );
@@ -231,10 +234,10 @@ function isUnsafeExpression(str) {
 function getDeclaredConstants(str) {
    let ret = [];
    str.split(';').forEach(s => {
-        let base_, keyword;
+        let base, keyword;
        let match = s.match(/const\s+(\w+)\s*=/);
        if (match) {
-            [base_, keyword] = match;
+            [base, keyword] = match;
            ret.push(keyword);
        }
    });
--- a/js/misc/keyboardManager.js
+++ b/js/misc/keyboardManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getKeyboardManager, holdKeyboard, releaseKeyboard */

 const { GLib, GnomeDesktop, Meta } = imports.gi;

@@ -61,7 +60,7 @@ var KeyboardManager = class {
            this._currentKeymap.options == options)
            return;

-        this._currentKeymap = { layouts, variants, options };
+        this._currentKeymap = {layouts, variants, options};
        Meta.get_backend().set_keymap(layouts, variants, options);
    }

@@ -126,7 +125,7 @@ var KeyboardManager = class {

    _getLocaleLayout() {
        let locale = GLib.get_language_names()[0];
-        if (!locale.includes('_'))
+        if (locale.indexOf('_') == -1)
            locale = DEFAULT_LOCALE;

        let [found, , id] = GnomeDesktop.get_input_source_from_locale(locale);
--- a/js/misc/loginManager.js
+++ b/js/misc/loginManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported canLock, getLoginManager, registerSessionWithGDM */

 const { GLib, Gio } = imports.gi;
 const Signals = imports.signals;
@@ -44,7 +43,7 @@ function canLock() {

        let version = result.deep_unpack()[0].deep_unpack();
        return haveSystemd() && versionCompare('3.5.91', version);
-    } catch (e) {
+    } catch(e) {
        return false;
    }
 }
@@ -110,7 +109,7 @@ var LoginManagerSystemd = class {
        let sessionId = GLib.getenv('XDG_SESSION_ID');
        if (!sessionId) {
            log('Unset XDG_SESSION_ID, getCurrentSessionProxy() called outside a user session. Asking logind directly.');
-            let [session, objectPath_] = this._userProxy.Display;
+            let [session, objectPath] = this._userProxy.Display;
            if (session) {
                log(`Will monitor session ${session}`);
                sessionId = session;
@@ -183,10 +182,10 @@ var LoginManagerSystemd = class {
            (proxy, result) => {
                let fd = -1;
                try {
-                    let [outVariant_, fdList] = proxy.call_with_unix_fd_list_finish(result);
+                    let [outVariant, fdList] = proxy.call_with_unix_fd_list_finish(result);
                    fd = fdList.steal_fds()[0];
                    callback(new Gio.UnixInputStream({ fd: fd }));
-                } catch (e) {
+                } catch(e) {
                    logError(e, "Error getting systemd inhibitor");
                    callback(null);
                }
@@ -200,7 +199,7 @@ var LoginManagerSystemd = class {
 Signals.addSignalMethods(LoginManagerSystemd.prototype);

 var LoginManagerDummy = class {
-    getCurrentSessionProxy(_callback) {
+    getCurrentSessionProxy(callback) {
        // we could return a DummySession object that fakes whatever callers
        // expect (at the time of writing: connect() and connectSignal()
        // methods), but just never calling the callback should be safer
--- a/js/misc/modemManager.js
+++ b/js/misc/modemManager.js
@@ -26,33 +26,33 @@ function _getMobileProvidersDatabase() {
 }

 // _findProviderForMccMnc:
-// @operatorName: operator name
-// @operatorCode: operator code
+// @operator_name: operator name
+// @operator_code: operator code
 //
 // Given an operator name string (which may not be a real operator name) and an
 // operator code string, tries to find a proper operator name to display.
 //
-function _findProviderForMccMnc(operatorName, operatorCode) {
-    if (operatorName) {
-        if (operatorName.length != 0 &&
-            (operatorName.length > 6 || operatorName.length < 5)) {
+function _findProviderForMccMnc(operator_name, operator_code) {
+    if (operator_name) {
+        if (operator_name.length != 0 &&
+            (operator_name.length > 6 || operator_name.length < 5)) {
            // this looks like a valid name, i.e. not an MCCMNC (that some
            // devices return when not yet connected
-            return operatorName;
+            return operator_name;
        }

-        if (isNaN(parseInt(operatorName))) {
+        if (isNaN(parseInt(operator_name))) {
            // name is definitely not a MCCMNC, so it may be a name
            // after all; return that
-            return operatorName;
+            return operator_name;
        }
    }

    let needle;
-    if ((!operatorName || operatorName.length == 0) && operatorCode)
-        needle = operatorCode;
-    else if (operatorName && (operatorName.length == 6 || operatorName.length == 5))
-        needle = operatorName;
+    if ((!operator_name || operator_name.length == 0) && operator_code)
+        needle = operator_code;
+    else if (operator_name && (operator_name.length == 6 || operator_name.length == 5))
+        needle = operator_name;
    else // nothing to search
        return null;

@@ -110,7 +110,7 @@ var ModemGsm = class {
            this.signal_quality = quality;
            this.emit('notify::signal-quality');
        });
-        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [_status, code, name]) => {
+        this._proxy.connectSignal('RegistrationInfo', (proxy, sender, [status, code, name]) => {
            this.operator_name = _findProviderForMccMnc(name, code);
            this.emit('notify::operator-name');
        });
@@ -120,7 +120,7 @@ var ModemGsm = class {
                return;
            }

-            let [status_, code, name] = result;
+            let [status, code, name] = result;
            this.operator_name = _findProviderForMccMnc(name, code);
            this.emit('notify::operator-name');
        });
@@ -171,9 +171,9 @@ var ModemCdma = class {
                // it will return an error if the device is not connected
                this.operator_name = null;
            } else {
-                let [bandClass_, band_, sid] = result;
+                let [bandClass, band, sid] = result;

-                this.operator_name = _findProviderForSid(sid);
+                this.operator_name = _findProviderForSid(sid)
            }
            this.emit('notify::operator-name');
        });
@@ -224,23 +224,23 @@ var BroadbandModem = class {
    }

    _reloadSignalQuality() {
-        let [quality, recent_] = this._proxy.SignalQuality;
+        let [quality, recent] = this._proxy.SignalQuality;
        this.signal_quality = quality;
        this.emit('notify::signal-quality');
    }

    _reloadOperatorName() {
-        let newName = "";
+        let new_name = "";
        if (this.operator_name_3gpp && this.operator_name_3gpp.length > 0)
-            newName += this.operator_name_3gpp;
+            new_name += this.operator_name_3gpp;

        if (this.operator_name_cdma && this.operator_name_cdma.length > 0) {
-            if (newName != "")
-                newName += ", ";
-            newName += this.operator_name_cdma;
+            if (new_name != "")
+                new_name += ", ";
+            new_name += this.operator_name_cdma;
        }

-        this.operator_name = newName;
+        this.operator_name = new_name;
        this.emit('notify::operator-name');
    }

--- a/js/misc/objectManager.js
+++ b/js/misc/objectManager.js
@@ -77,51 +77,54 @@ var ObjectManager = class {
        let info = this._interfaceInfos[interfaceName];

        if (!info) {
-            if (onFinished)
-                onFinished();
-            return;
+           if (onFinished)
+               onFinished();
+           return;
        }

        let proxy = new Gio.DBusProxy({ g_connection: this._connection,
-                                        g_name: this._serviceName,
-                                        g_object_path: objectPath,
-                                        g_interface_name: interfaceName,
-                                        g_interface_info: info,
-                                        g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START });
+                                       g_name: this._serviceName,
+                                       g_object_path: objectPath,
+                                       g_interface_name: interfaceName,
+                                       g_interface_info: info,
+                                       g_flags: Gio.DBusProxyFlags.DO_NOT_AUTO_START });

-        proxy.init_async(GLib.PRIORITY_DEFAULT, this._cancellable, (initable, result) => {
-            try {
-                initable.init_finish(result);
-            } catch (e) {
-                logError(e, `could not initialize proxy for interface ${interfaceName}`);
+        proxy.init_async(GLib.PRIORITY_DEFAULT,
+                         this._cancellable,
+                         (initable, result) => {
+               let error = null;
+               try {
+                   initable.init_finish(result);
+               } catch(e) {
+                   logError(e, 'could not initialize proxy for interface ' + interfaceName);

-                if (onFinished)
-                    onFinished();
-                return;
-            }
+                   if (onFinished)
+                       onFinished();
+                   return;
+               }

-            let isNewObject;
-            if (!this._objects[objectPath]) {
-                this._objects[objectPath] = {};
-                isNewObject = true;
-            } else {
-                isNewObject = false;
-            }
+               let isNewObject;
+               if (!this._objects[objectPath]) {
+                   this._objects[objectPath] = {};
+                   isNewObject = true;
+               } else {
+                   isNewObject = false;
+               }

-            this._objects[objectPath][interfaceName] = proxy;
+               this._objects[objectPath][interfaceName] = proxy;

-            if (!this._interfaces[interfaceName])
-                this._interfaces[interfaceName] = [];
+               if (!this._interfaces[interfaceName])
+                   this._interfaces[interfaceName] = [];

-            this._interfaces[interfaceName].push(proxy);
+               this._interfaces[interfaceName].push(proxy);

-            if (isNewObject)
-                this.emit('object-added', objectPath);
+               if (isNewObject)
+                   this.emit('object-added', objectPath);

-            this.emit('interface-added', interfaceName, proxy);
+               this.emit('interface-added', interfaceName, proxy);

-            if (onFinished)
-                onFinished();
+               if (onFinished)
+                   onFinished();
        });
    }

@@ -152,10 +155,11 @@ var ObjectManager = class {
    }

    _onManagerProxyLoaded(initable, result) {
+        let error = null;
        try {
            initable.init_finish(result);
-        } catch (e) {
-            logError(e, `could not initialize object manager for object ${this._serviceName}`);
+        } catch(e) {
+            logError(e, 'could not initialize object manager for object ' + this._serviceName);

            this._tryToCompleteLoad();
            return;
@@ -193,7 +197,7 @@ var ObjectManager = class {
        this._managerProxy.GetManagedObjectsRemote((result, error) => {
            if (!result) {
                if (error) {
-                    logError(error, `could not get remote objects for service ${this._serviceName} path ${this._managerPath}`);
+                   logError(error, 'could not get remote objects for service ' + this._serviceName + ' path ' + this._managerPath);
                }

                this._tryToCompleteLoad();
--- a/js/misc/params.js
+++ b/js/misc/params.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported parse */

 // parse:
 // @params: caller-provided parameter object, or %null
@@ -15,13 +14,22 @@
 //
 // Return value: a new object, containing the merged parameters from
 // @params and @defaults
-function parse(params = {}, defaults, allowExtras) {
-    if (!allowExtras) {
-        for (let prop in params)
-            if (!(prop in defaults))
-                throw new Error(`Unrecognized parameter "${prop}"`);
+function parse(params, defaults, allowExtras) {
+    let ret = {}, prop;
+
+    if (!params)
+        params = {};
+
+    for (prop in params) {
+        if (!(prop in defaults) && !allowExtras)
+            throw new Error('Unrecognized parameter "' + prop + '"');
+        ret[prop] = params[prop];
    }

-    let defaultsCopy = Object.assign({}, defaults);
-    return Object.assign(defaultsCopy, params);
-}
+    for (prop in defaults) {
+        if (!(prop in params))
+            ret[prop] = defaults[prop];
+    }
+
+    return ret;
+}
--- a/js/misc/permissionStore.js
+++ b/js/misc/permissionStore.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported PermissionStore */

 const Gio = imports.gi.Gio;

@@ -13,4 +12,4 @@ function PermissionStore(initCallback, cancellable) {
                                    'org.freedesktop.impl.portal.PermissionStore',
                                    '/org/freedesktop/impl/portal/PermissionStore',
                                    initCallback, cancellable);
-}
+};
--- a/js/misc/smartcardManager.js
+++ b/js/misc/smartcardManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getSmartcardManager */

 const Gio = imports.gi.Gio;
 const Signals = imports.signals;
@@ -30,7 +29,7 @@ var SmartcardManager = class {
        this._objectManager = new ObjectManager.ObjectManager({ connection: Gio.DBus.session,
                                                                name: "org.gnome.SettingsDaemon.Smartcard",
                                                                objectPath: '/org/gnome/SettingsDaemon/Smartcard',
-                                                                knownInterfaces: [SmartcardTokenIface],
+                                                                knownInterfaces: [ SmartcardTokenIface ],
                                                                onLoaded: this._onLoaded.bind(this) });
        this._insertedTokens = {};
        this._loginToken = null;
--- a/js/misc/systemActions.js
+++ b/js/misc/systemActions.js
@@ -1,4 +1,3 @@
-/* exported getDefault */
 const { AccountsService, Clutter, Gdm, Gio, GLib, GObject, Meta } = imports.gi;

 const GnomeSession = imports.misc.gnomeSession;
@@ -84,54 +83,48 @@ const SystemActions = GObject.registerClass({
        this._canHaveSuspend = true;

        this._actions = new Map();
-        this._actions.set(POWER_OFF_ACTION_ID, {
-            // Translators: The name of the power-off action in search
-            name: C_("search-result", "Power Off"),
-            iconName: 'system-shutdown-symbolic',
-            // Translators: A list of keywords that match the power-off action, separated by semicolons
-            keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
-            available: false
-        });
-        this._actions.set(LOCK_SCREEN_ACTION_ID, {
-            // Translators: The name of the lock screen action in search
-            name: C_("search-result", "Lock Screen"),
-            iconName: 'system-lock-screen-symbolic',
-            // Translators: A list of keywords that match the lock screen action, separated by semicolons
-            keywords: _("lock screen").split(/[; ]/),
-            available: false
-        });
-        this._actions.set(LOGOUT_ACTION_ID, {
-            // Translators: The name of the logout action in search
-            name: C_("search-result", "Log Out"),
-            iconName: 'application-exit-symbolic',
-            // Translators: A list of keywords that match the logout action, separated by semicolons
-            keywords: _("logout;log out;sign off").split(/[; ]/),
-            available: false
-        });
-        this._actions.set(SUSPEND_ACTION_ID, {
-            // Translators: The name of the suspend action in search
-            name: C_("search-result", "Suspend"),
-            iconName: 'media-playback-pause-symbolic',
-            // Translators: A list of keywords that match the suspend action, separated by semicolons
-            keywords: _("suspend;sleep").split(/[; ]/),
-            available: false
-        });
-        this._actions.set(SWITCH_USER_ACTION_ID, {
-            // Translators: The name of the switch user action in search
-            name: C_("search-result", "Switch User"),
-            iconName: 'system-switch-user-symbolic',
-            // Translators: A list of keywords that match the switch user action, separated by semicolons
-            keywords: _("switch user").split(/[; ]/),
-            available: false
-        });
-        this._actions.set(LOCK_ORIENTATION_ACTION_ID, {
-            // Translators: The name of the lock orientation action in search
-            name: C_("search-result", "Lock Orientation"),
-            iconName: '',
-            // Translators: A list of keywords that match the lock orientation action, separated by semicolons
-            keywords: _("lock orientation;screen;rotation").split(/[; ]/),
-            available: false
-        });
+        this._actions.set(POWER_OFF_ACTION_ID,
+                          { // Translators: The name of the power-off action in search
+                            name: C_("search-result", "Power Off"),
+                            iconName: 'system-shutdown-symbolic',
+                            // Translators: A list of keywords that match the power-off action, separated by semicolons
+                            keywords: _("power off;shutdown;reboot;restart").split(/[; ]/),
+                            available: false });
+        this._actions.set(LOCK_SCREEN_ACTION_ID,
+                          { // Translators: The name of the lock screen action in search
+                            name: C_("search-result", "Lock Screen"),
+                            iconName: 'system-lock-screen-symbolic',
+                            // Translators: A list of keywords that match the lock screen action, separated by semicolons
+                            keywords: _("lock screen").split(/[; ]/),
+                            available: false });
+        this._actions.set(LOGOUT_ACTION_ID,
+                          { // Translators: The name of the logout action in search
+                            name: C_("search-result", "Log Out"),
+                            iconName: 'application-exit-symbolic',
+                            // Translators: A list of keywords that match the logout action, separated by semicolons
+                            keywords: _("logout;log out;sign off").split(/[; ]/),
+                            available: false });
+        this._actions.set(SUSPEND_ACTION_ID,
+                          { // Translators: The name of the suspend action in search
+                            name: C_("search-result", "Suspend"),
+                            iconName: 'media-playback-pause-symbolic',
+                            // Translators: A list of keywords that match the suspend action, separated by semicolons
+                            keywords: _("suspend;sleep").split(/[; ]/),
+                            available: false });
+        this._actions.set(SWITCH_USER_ACTION_ID,
+                          { // Translators: The name of the switch user action in search
+                            name: C_("search-result", "Switch User"),
+                            iconName: 'system-switch-user-symbolic',
+                            // Translators: A list of keywords that match the switch user action, separated by semicolons
+                            keywords: _("switch user").split(/[; ]/),
+                            available: false });
+        this._actions.set(LOCK_ORIENTATION_ACTION_ID,
+                          { // Translators: The name of the lock orientation action in search
+                            name: C_("search-result", "Lock Orientation"),
+                            iconName: '',
+                            // Translators: A list of keywords that match the lock orientation action, separated by semicolons
+                            keywords: _("lock orientation;screen;rotation").split(/[; ]/),
+                            available: false });

        this._loginScreenSettings = new Gio.Settings({ schema_id: LOGIN_SCREEN_SCHEMA });
        this._lockdownSettings = new Gio.Settings({ schema_id: LOCKDOWN_SCHEMA });
@@ -144,96 +137,92 @@ const SystemActions = GObject.registerClass({
        this._userManager = AccountsService.UserManager.get_default();

        this._userManager.connect('notify::is-loaded',
-                                  () => this._updateMultiUser());
+                                  () => { this._updateMultiUser(); });
        this._userManager.connect('notify::has-multiple-users',
-                                  () => this._updateMultiUser());
+                                  () => { this._updateMultiUser(); });
        this._userManager.connect('user-added',
-                                  () => this._updateMultiUser());
+                                  () => { this._updateMultiUser(); });
        this._userManager.connect('user-removed',
-                                  () => this._updateMultiUser());
+                                  () => { this._updateMultiUser(); });

-        this._lockdownSettings.connect(`changed::${DISABLE_USER_SWITCH_KEY}`,
-                                       () => this._updateSwitchUser());
-        this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`,
-                                       () => this._updateLogout());
-        global.settings.connect(`changed::${ALWAYS_SHOW_LOG_OUT_KEY}`,
-                                () => this._updateLogout());
+        this._lockdownSettings.connect('changed::' + DISABLE_USER_SWITCH_KEY,
+                                       () => { this._updateSwitchUser(); });
+        this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY,
+                                       () => { this._updateLogout(); });
+        global.settings.connect('changed::' + ALWAYS_SHOW_LOG_OUT_KEY,
+                                () => { this._updateLogout(); });

-        this._lockdownSettings.connect(`changed::${DISABLE_LOCK_SCREEN_KEY}`,
-                                       () => this._updateLockScreen());
+        this._lockdownSettings.connect('changed::' + DISABLE_LOCK_SCREEN_KEY,
+                                       () => { this._updateLockScreen(); });

-        this._lockdownSettings.connect(`changed::${DISABLE_LOG_OUT_KEY}`,
-                                       () => this._updateHaveShutdown());
+        this._lockdownSettings.connect('changed::' + DISABLE_LOG_OUT_KEY,
+                                       () => { this._updateHaveShutdown(); });

        this.forceUpdate();

        this._orientationSettings.connect('changed::orientation-lock',
-                                          () => {
-                                              this._updateOrientationLock();
-                                              this._updateOrientationLockIcon();
-                                          });
+                                          () => { this._updateOrientationLock();
+                                                  this._updateOrientationLockIcon(); });
        Main.layoutManager.connect('monitors-changed',
-                                   () => this._updateOrientationLock());
-        this._sensorProxy = new SensorProxy(Gio.DBus.system,
-            SENSOR_BUS_NAME,
-            SENSOR_OBJECT_PATH,
-            (proxy, error)  => {
-                if (error)
-                    log(error.message);
-            },
-            null,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START);
-        this._sensorProxy.connect('g-properties-changed', () => {
-            this._updateOrientationLock();
-        });
-        this._sensorProxy.connect('notify::g-name-owner', () => {
-            this._updateOrientationLock();
-        });
+                                   () => { this._updateOrientationLock(); });
+        Gio.DBus.system.watch_name(SENSOR_BUS_NAME,
+                                   Gio.BusNameWatcherFlags.NONE,
+                                   () => { this._sensorProxyAppeared(); },
+                                   () => {
+                                       this._sensorProxy = null;
+                                       this._updateOrientationLock();
+                                   });
        this._updateOrientationLock();
        this._updateOrientationLockIcon();

-        Main.sessionMode.connect('updated', () => this._sessionUpdated());
+        Main.sessionMode.connect('updated', () => { this._sessionUpdated(); });
        this._sessionUpdated();
    }

-    // eslint-disable-next-line camelcase
    get can_power_off() {
        return this._actions.get(POWER_OFF_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_suspend() {
        return this._actions.get(SUSPEND_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_lock_screen() {
        return this._actions.get(LOCK_SCREEN_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_switch_user() {
        return this._actions.get(SWITCH_USER_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_logout() {
        return this._actions.get(LOGOUT_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get can_lock_orientation() {
        return this._actions.get(LOCK_ORIENTATION_ACTION_ID).available;
    }

-    // eslint-disable-next-line camelcase
    get orientation_lock_icon() {
        return this._actions.get(LOCK_ORIENTATION_ACTION_ID).iconName;
    }

+    _sensorProxyAppeared() {
+        this._sensorProxy = new SensorProxy(Gio.DBus.system, SENSOR_BUS_NAME, SENSOR_OBJECT_PATH,
+            (proxy, error)  => {
+                if (error) {
+                    log(error.message);
+                    return;
+                }
+                this._sensorProxy.connect('g-properties-changed',
+                                          () => { this._updateOrientationLock(); });
+                this._updateOrientationLock();
+            });
+    }
+
    _updateOrientationLock() {
        let available = false;
-        if (this._sensorProxy.g_name_owner)
+        if (this._sensorProxy)
            available = this._sensorProxy.HasAccelerometer &&
                        this._monitorManager.get_is_builtin_display_on();

@@ -268,11 +257,11 @@ const SystemActions = GObject.registerClass({

    getMatchingActions(terms) {
        // terms is a list of strings
-        terms = terms.map((term) => term.toLowerCase());
+        terms = terms.map((term) => { return term.toLowerCase(); });

        let results = [];

-        for (let [key, { available, keywords }] of this._actions)
+        for (let [key, {available, keywords}] of this._actions)
            if (available && terms.every(t => keywords.some(k => k.startsWith(t))))
                results.push(key);

@@ -289,24 +278,24 @@ const SystemActions = GObject.registerClass({

    activateAction(id) {
        switch (id) {
-        case POWER_OFF_ACTION_ID:
-            this.activatePowerOff();
-            break;
-        case LOCK_SCREEN_ACTION_ID:
-            this.activateLockScreen();
-            break;
-        case LOGOUT_ACTION_ID:
-            this.activateLogout();
-            break;
-        case SUSPEND_ACTION_ID:
-            this.activateSuspend();
-            break;
-        case SWITCH_USER_ACTION_ID:
-            this.activateSwitchUser();
-            break;
-        case LOCK_ORIENTATION_ACTION_ID:
-            this.activateLockOrientation();
-            break;
+            case POWER_OFF_ACTION_ID:
+                this.activatePowerOff();
+                break;
+            case LOCK_SCREEN_ACTION_ID:
+                this.activateLockScreen();
+                break;
+            case LOGOUT_ACTION_ID:
+                this.activateLogout();
+                break;
+            case SUSPEND_ACTION_ID:
+                this.activateSuspend();
+                break;
+            case SWITCH_USER_ACTION_ID:
+                this.activateSwitchUser();
+                break;
+            case LOCK_ORIENTATION_ACTION_ID:
+                this.activateLockOrientation();
+                break;
        }
    }

--- a/js/misc/util.js
+++ b/js/misc/util.js
@@ -1,16 +1,15 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported findUrls, spawn, spawnCommandLine, spawnApp, trySpawnCommandLine,
-            formatTime, formatTimeSpan, createTimeLabel, insertSorted,
-            makeCloseButton, ensureActorVisibleInScrollView */

 const { Clutter, Gio, GLib, GObject, Shell, St } = imports.gi;
 const Gettext = imports.gettext;
 const Mainloop = imports.mainloop;
+const Signals = imports.signals;

 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;
 const Params = imports.misc.params;

-var SCROLL_TIME = 100;
+var SCROLL_TIME = 0.1;

 // http://daringfireball.net/2010/07/improved_regex_for_matching_urls
 const _balancedParens = '\\([^\\s()<>]+\\)';
@@ -18,7 +17,7 @@ const _leadingJunk = '[\\s`(\\[{\'\\"<\u00AB\u201C\u2018]';
 const _notTrailingJunk = '[^\\s`!()\\[\\]{};:\'\\".,<>?\u00AB\u00BB\u201C\u201D\u2018\u2019]';

 const _urlRegexp = new RegExp(
-    `(^|${_leadingJunk})` +
+    '(^|' + _leadingJunk + ')' +
    '(' +
        '(?:' +
            '(?:http|https|ftp)://' +             // scheme://
@@ -30,12 +29,12 @@ const _urlRegexp = new RegExp(
        '(?:' +                                   // one or more:
            '[^\\s()<>]+' +                       // run of non-space non-()
            '|' +                                 // or
-            `${_balancedParens}` +                // balanced parens
+            _balancedParens +                     // balanced parens
        ')+' +
        '(?:' +                                   // end with:
-            `${_balancedParens}` +                // balanced parens
+            _balancedParens +                     // balanced parens
            '|' +                                 // or
-            `${_notTrailingJunk}` +               // last non-junk char
+            _notTrailingJunk +                    // last non-junk char
        ')' +
    ')', 'gi');

@@ -70,16 +69,16 @@ function spawn(argv) {
 }

 // spawnCommandLine:
-// @commandLine: a command line
+// @command_line: a command line
 //
-// Runs @commandLine in the background, handling any errors that
+// Runs @command_line in the background, handling any errors that
 // occur when trying to parse or start the program.
-function spawnCommandLine(commandLine) {
+function spawnCommandLine(command_line) {
    try {
-        let [success_, argv] = GLib.shell_parse_argv(commandLine);
+        let [success, argv] = GLib.shell_parse_argv(command_line);
        trySpawn(argv);
    } catch (err) {
-        _handleSpawnError(commandLine, err);
+        _handleSpawnError(command_line, err);
    }
 }

@@ -94,7 +93,7 @@ function spawnApp(argv) {

        let context = global.create_app_launch_context(0, -1);
        app.launch([], context);
-    } catch (err) {
+    } catch(err) {
        _handleSpawnError(argv[0], err);
    }
 }
@@ -104,12 +103,13 @@ function spawnApp(argv) {
 //
 // Runs @argv in the background. If launching @argv fails,
 // this will throw an error.
-function trySpawn(argv) {
-    var success_, pid;
+function trySpawn(argv)
+{
+    var success, pid;
    try {
-        [success_, pid] = GLib.spawn_async(null, argv, null,
-                                           GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
-                                           null);
+        [success, pid] = GLib.spawn_async(null, argv, null,
+                                          GLib.SpawnFlags.SEARCH_PATH | GLib.SpawnFlags.DO_NOT_REAP_CHILD,
+                                          null);
    } catch (err) {
        /* Rewrite the error in case of ENOENT */
        if (err.matches(GLib.SpawnError, GLib.SpawnError.NOENT)) {
@@ -135,19 +135,19 @@ function trySpawn(argv) {
 }

 // trySpawnCommandLine:
-// @commandLine: a command line
+// @command_line: a command line
 //
-// Runs @commandLine in the background. If launching @commandLine
+// Runs @command_line in the background. If launching @command_line
 // fails, this will throw an error.
-function trySpawnCommandLine(commandLine) {
-    let success_, argv;
+function trySpawnCommandLine(command_line) {
+    let success, argv;

    try {
-        [success_, argv] = GLib.shell_parse_argv(commandLine);
+        [success, argv] = GLib.shell_parse_argv(command_line);
    } catch (err) {
        // Replace "Error invoking GLib.shell_parse_argv: " with
        // something nicer
-        err.message = err.message.replace(/[^:]*: /, `${_("Could not parse command:")}\n`);
+        err.message = err.message.replace(/[^:]*: /, _("Could not parse command:") + "\n");
        throw err;
    }

@@ -222,7 +222,7 @@ function formatTime(time, params) {
            /* Translators: Time in 24h format */
            format = N_("%H\u2236%M");
        // Show the word "Yesterday" and time if date is on yesterday
-        else if (daysAgo < 2)
+        else if (daysAgo <2)
            /* Translators: this is the word "Yesterday" followed by a
             time string in 24h format. i.e. "Yesterday, 14:30" */
            // xgettext:no-c-format
@@ -251,7 +251,7 @@ function formatTime(time, params) {
            /* Translators: Time in 12h format */
            format = N_("%l\u2236%M %p");
        // Show the word "Yesterday" and time if date is on yesterday
-        else if (daysAgo < 2)
+        else if (daysAgo <2)
            /* Translators: this is the word "Yesterday" followed by a
             time string in 12h format. i.e. "Yesterday, 2:30 pm" */
            // xgettext:no-c-format
@@ -289,7 +289,7 @@ function createTimeLabel(date, params) {
    let id = _desktopSettings.connect('changed::clock-format', () => {
        label.text = formatTime(date, params);
    });
-    label.connect('destroy', () => _desktopSettings.disconnect(id));
+    label.connect('destroy', () => { _desktopSettings.disconnect(id); });
    return label;
 }

@@ -346,7 +346,7 @@ function insertSorted(array, val, cmp) {
 var CloseButton = GObject.registerClass(
 class CloseButton extends St.Button {
    _init(boxpointer) {
-        super._init({ style_class: 'notification-close' });
+        super._init({ style_class: 'notification-close'});

        // This is a bit tricky. St.Bin has its own x-align/y-align properties
        // that compete with Clutter's properties. This should be fixed for
@@ -380,7 +380,7 @@ class CloseButton extends St.Button {
        let themeNode = this.get_theme_node();

        let offY = this._computeBoxPointerOffset();
-        this.translation_x = themeNode.get_length('-shell-close-overlap-x');
+        this.translation_x = themeNode.get_length('-shell-close-overlap-x')
        this.translation_y = themeNode.get_length('-shell-close-overlap-y') + offY;
    }

@@ -396,7 +396,7 @@ function makeCloseButton(boxpointer) {

 function ensureActorVisibleInScrollView(scrollView, actor) {
    let adjustment = scrollView.vscroll.adjustment;
-    let [value, lower_, upper, stepIncrement_, pageIncrement_, pageSize] = adjustment.get_values();
+    let [value, lower, upper, stepIncrement, pageIncrement, pageSize] = adjustment.get_values();

    let offset = 0;
    let vfade = scrollView.get_effect("fade");
@@ -424,8 +424,97 @@ function ensureActorVisibleInScrollView(scrollView, actor) {
    else
        return;

-    adjustment.ease(value, {
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        duration: SCROLL_TIME
-    });
+    Tweener.addTween(adjustment,
+                     { value: value,
+                       time: SCROLL_TIME,
+                       transition: 'easeOutQuad' });
 }
+
+var AppSettingsMonitor = class {
+    constructor(appId, schemaId) {
+        this._appId = appId;
+        this._schemaId = schemaId;
+
+        this._app = null;
+        this._settings = null;
+        this._handlers = [];
+
+        this._schemaSource = Gio.SettingsSchemaSource.get_default();
+
+        this._appSystem = Shell.AppSystem.get_default();
+        this._appSystem.connect('installed-changed',
+                                this._onInstalledChanged.bind(this));
+        this._onInstalledChanged();
+    }
+
+    get available() {
+        return this._app != null && this._settings != null;
+    }
+
+    activateApp() {
+        if (this._app)
+            this._app.activate();
+    }
+
+    watchSetting(key, callback) {
+        let handler = { id: 0, key: key, callback: callback };
+        this._handlers.push(handler);
+
+        this._connectHandler(handler);
+    }
+
+    _connectHandler(handler) {
+        if (!this._settings || handler.id > 0)
+            return;
+
+        handler.id = this._settings.connect('changed::' + handler.key,
+                                            handler.callback);
+        handler.callback(this._settings, handler.key);
+    }
+
+    _disconnectHandler(handler) {
+        if (this._settings && handler.id > 0)
+            this._settings.disconnect(handler.id);
+        handler.id = 0;
+    }
+
+    _onInstalledChanged() {
+        let hadApp = (this._app != null);
+        this._app = this._appSystem.lookup_app(this._appId);
+        let haveApp = (this._app != null);
+
+        if (hadApp == haveApp)
+            return;
+
+        if (haveApp)
+            this._checkSettings();
+        else
+            this._setSettings(null);
+    }
+
+    _setSettings(settings) {
+        this._handlers.forEach((handler) => { this._disconnectHandler(handler); });
+
+        let hadSettings = (this._settings != null);
+        this._settings = settings;
+        let haveSettings = (this._settings != null);
+
+        this._handlers.forEach((handler) => { this._connectHandler(handler); });
+
+        if (hadSettings != haveSettings)
+            this.emit('available-changed');
+    }
+
+    _checkSettings() {
+        let schema = this._schemaSource.lookup(this._schemaId, true);
+        if (schema) {
+            this._setSettings(new Gio.Settings({ settings_schema: schema }));
+        } else if (this._app) {
+            Mainloop.timeout_add_seconds(1, () => {
+                this._checkSettings();
+                return GLib.SOURCE_REMOVE;
+            });
+        }
+    }
+};
+Signals.addSignalMethods(AppSettingsMonitor.prototype);
--- a/js/misc/weather.js
+++ b/js/misc/weather.js
@@ -1,19 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-

-const { Geoclue, Gio, GLib, GWeather, Shell } = imports.gi;
+const { Geoclue, Gio, GLib, GWeather } = imports.gi;
 const Signals = imports.signals;

 const PermissionStore = imports.misc.permissionStore;
-
-const { loadInterfaceXML } = imports.misc.fileUtils;
-
-const WeatherIntegrationIface = loadInterfaceXML('org.gnome.Shell.WeatherIntegration');
-
-const WEATHER_BUS_NAME = 'org.gnome.Weather';
-const WEATHER_OBJECT_PATH = '/org/gnome/Weather';
-const WEATHER_INTEGRATION_IFACE = 'org.gnome.Shell.WeatherIntegration';
-
-const WEATHER_APP_ID = 'org.gnome.Weather.desktop';
+const Util = imports.misc.util;

 // Minimum time between updates to show loading indication
 var UPDATE_THRESHOLD = 10 * GLib.TIME_SPAN_MINUTE;
@@ -35,7 +26,7 @@ var WeatherClient = class {
        this._weatherAuthorized = false;
        this._permStore = new PermissionStore.PermissionStore((proxy, error) => {
            if (error) {
-                log(`Failed to connect to permissionStore: ${error.message}`);
+                log('Failed to connect to permissionStore: ' + error.message);
                return;
            }

@@ -49,7 +40,7 @@ var WeatherClient = class {

            this._permStore.LookupRemote('gnome', 'geolocation', (res, error) => {
                if (error)
-                    log(`Error looking up permission: ${error.message}`);
+                    log('Error looking up permission: ' + error.message);

                let [perms, data] = error ? [{}, null] : res;
                let  params = ['gnome', 'geolocation', false, data, perms];
@@ -75,38 +66,17 @@ var WeatherClient = class {
            this.emit('changed');
        });

-        this._weatherApp = null;
-        this._weatherProxy = null;
-
-        let nodeInfo = Gio.DBusNodeInfo.new_for_xml(WeatherIntegrationIface);
-        Gio.DBusProxy.new(
-            Gio.DBus.session,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES,
-            nodeInfo.lookup_interface(WEATHER_INTEGRATION_IFACE),
-            WEATHER_BUS_NAME,
-            WEATHER_OBJECT_PATH,
-            WEATHER_INTEGRATION_IFACE,
-            null,
-            this._onWeatherProxyReady.bind(this));
-
-        this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.weather'
-        });
-        this._settings.connect('changed::automatic-location',
-            this._onAutomaticLocationChanged.bind(this));
-        this._onAutomaticLocationChanged();
-        this._settings.connect('changed::locations',
-            this._onLocationsChanged.bind(this));
-        this._onLocationsChanged();
-
-        this._appSystem = Shell.AppSystem.get_default();
-        this._appSystem.connect('installed-changed',
-            this._onInstalledChanged.bind(this));
-        this._onInstalledChanged();
+        this._weatherAppMon = new Util.AppSettingsMonitor('org.gnome.Weather.desktop',
+                                                          'org.gnome.Weather');
+        this._weatherAppMon.connect('available-changed', () => { this.emit('changed'); });
+        this._weatherAppMon.watchSetting('automatic-location',
+                                         this._onAutomaticLocationChanged.bind(this));
+        this._weatherAppMon.watchSetting('locations',
+                                         this._onLocationsChanged.bind(this));
    }

    get available() {
-        return this._weatherApp != null;
+        return this._weatherAppMon.available;
    }

    get loading() {
@@ -122,8 +92,7 @@ var WeatherClient = class {
    }

    activateApp() {
-        if (this._weatherApp)
-            this._weatherApp.activate();
+        this._weatherAppMon.activateApp();
    }

    update() {
@@ -145,38 +114,6 @@ var WeatherClient = class {
               this._weatherAuthorized;
    }

-    _onWeatherProxyReady(o, res) {
-        try {
-            this._weatherProxy = Gio.DBusProxy.new_finish(res);
-        } catch (e) {
-            log(`Failed to create GNOME Weather proxy: ${e}`);
-            return;
-        }
-
-        this._weatherProxy.connect('g-properties-changed',
-            this._onWeatherPropertiesChanged.bind(this));
-        this._onWeatherPropertiesChanged();
-    }
-
-    _onWeatherPropertiesChanged() {
-        if (this._weatherProxy.g_name_owner == null)
-            return;
-
-        this._settings.set_boolean('automatic-location',
-            this._weatherProxy.AutomaticLocation);
-        this._settings.set_value('locations',
-            new GLib.Variant('av', this._weatherProxy.Locations));
-    }
-
-    _onInstalledChanged() {
-        let hadApp = (this._weatherApp != null);
-        this._weatherApp = this._appSystem.lookup_app(WEATHER_APP_ID);
-        let haveApp = (this._weatherApp != null);
-
-        if (hadApp !== haveApp)
-            this.emit('changed');
-    }
-
    _loadInfo() {
        let id = this._weatherInfo.connect('updated', () => {
            this._weatherInfo.disconnect(id);
@@ -241,8 +178,8 @@ var WeatherClient = class {
            (o, res) => {
                try {
                    this._gclueService = Geoclue.Simple.new_finish(res);
-                } catch (e) {
-                    log(`Failed to connect to Geoclue2 service: ${e.message}`);
+                } catch(e) {
+                    log('Failed to connect to Geoclue2 service: ' + e.message);
                    this._setLocation(this._mostRecentLocation);
                    return;
                }
@@ -261,8 +198,8 @@ var WeatherClient = class {
        this._setLocation(location);
    }

-    _onAutomaticLocationChanged() {
-        let useAutoLocation = this._settings.get_boolean('automatic-location');
+    _onAutomaticLocationChanged(settings, key) {
+        let useAutoLocation = settings.get_boolean(key);
        if (this._autoLocationRequested == useAutoLocation)
            return;

@@ -280,9 +217,8 @@ var WeatherClient = class {
            this._setLocation(this._mostRecentLocation);
    }

-    _onLocationsChanged() {
-        let locations = this._settings.get_value('locations').deep_unpack();
-        let serialized = locations.shift();
+    _onLocationsChanged(settings, key) {
+        let serialized = settings.get_value(key).deep_unpack().shift();
        let mostRecentLocation = null;

        if (serialized)
@@ -298,7 +234,7 @@ var WeatherClient = class {
    }

    _onPermStoreChanged(proxy, sender, params) {
-        let [table, id, deleted_, data_, perms] = params;
+        let [table, id, deleted, data, perms] = params;

        if (table != 'gnome' || id != 'geolocation')
            return;
--- a/js/perf/core.js
+++ b/js/perf/core.js
@@ -1,9 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported run, script_overviewShowStart, script_overviewShowDone,
-            script_applicationsShowStart, script_applicationsShowDone,
-            script_afterShowHide, malloc_usedSize, glx_swapComplete,
-            clutter_stagePaintDone */
-/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^malloc", "^glx", "^clutter"] }] */

 const System = imports.system;

@@ -24,7 +19,7 @@ var METRICS = {
      units: "frames / s" },
    overviewLatencySubsequent:
    { description: "Time to first frame after triggering overview, second time",
-      units: "us" },
+      units: "us"},
    overviewFpsSubsequent:
    { description: "Frames rate when going to the overview, second time",
      units: "frames / s" },
@@ -57,7 +52,7 @@ var METRICS = {
      units: "us" },
    applicationsShowTimeSubsequent:
    { description: "Time to switch to applications view, second time",
-      units: "us" }
+      units: "us"}
 };

 let WINDOW_CONFIGS = [
@@ -126,11 +121,9 @@ function *run() {

    for (let i = 0; i < 2; i++) {
        Scripting.scriptEvent('applicationsShowStart');
-        // eslint-disable-next-line require-atomic-updates
        Main.overview._dash.showAppsButton.checked = true;
        yield Scripting.waitLeisure();
        Scripting.scriptEvent('applicationsShowDone');
-        // eslint-disable-next-line require-atomic-updates
        Main.overview._dash.showAppsButton.checked = false;
        yield Scripting.waitLeisure();
    }
@@ -143,6 +136,7 @@ let overviewFrames;
 let overviewLatency;
 let mallocUsedSize = 0;
 let overviewShowCount = 0;
+let firstOverviewUsedSize;
 let haveSwapComplete = false;
 let applicationsShowStart;
 let applicationsShowCount = 0;
@@ -154,7 +148,7 @@ function script_overviewShowStart(time) {
    overviewFrames = 0;
 }

-function script_overviewShowDone(_time) {
+function script_overviewShowDone(time) {
    // We've set up the state at the end of the zoom out, but we
    // need to wait for one more frame to paint before we count
    // ourselves as done.
@@ -173,7 +167,7 @@ function script_applicationsShowDone(time) {
        METRICS.applicationsShowTimeSubsequent.value = time - applicationsShowStart;
 }

-function script_afterShowHide(_time) {
+function script_afterShowHide(time) {
    if (overviewShowCount == 1) {
        METRICS.usedAfterOverview.value = mallocUsedSize;
    } else {
--- a/js/perf/hwtest.js
+++ b/js/perf/hwtest.js
@@ -1,12 +1,3 @@
-/* exported run, script_desktopShown, script_overviewShowStart,
-            script_overviewShowDone, script_applicationsShowStart,
-            script_applicationsShowDone, script_mainViewDrawStart,
-            script_mainViewDrawDone, script_overviewDrawStart,
-            script_overviewDrawDone, script_redrawTestStart,
-            script_redrawTestDone, script_collectTimings,
-            script_geditLaunch, script_geditFirstFrame,
-            clutter_stagePaintStart, clutter_paintCompletedTimestamp */
-/* eslint camelcase: ["error", { properties: "never", allow: ["^script_", "^clutter"] }] */
 const { Clutter, Gio, Shell } = imports.gi;
 const Main = imports.ui.main;
 const Scripting = imports.ui.scripting;
@@ -39,7 +30,7 @@ var METRICS = {
    geditStartTime:
    { description: "Time from gedit launch to window drawn",
      units: "us" },
-};
+}

 function waitAndDraw(milliseconds) {
    let cb;
@@ -47,7 +38,7 @@ function waitAndDraw(milliseconds) {
    let timeline = new Clutter.Timeline({ duration: milliseconds });
    timeline.start();

-    timeline.connect('new-frame', (_timeline, _frame) => {
+    timeline.connect('new-frame', (timeline, frame) => {
        global.stage.queue_redraw();
    });

@@ -57,7 +48,7 @@ function waitAndDraw(milliseconds) {
            cb();
    });

-    return callback => cb = callback;
+    return callback => { cb = callback; };
 }

 function waitSignal(object, signal) {
@@ -69,7 +60,7 @@ function waitSignal(object, signal) {
            cb();
    });

-    return callback => cb = callback;
+    return callback => { cb = callback; };
 }

 function extractBootTimestamp() {
@@ -82,8 +73,8 @@ function extractBootTimestamp() {
    let result = null;

    let datastream = Gio.DataInputStream.new(sp.get_stdout_pipe());
-    while (true) { // eslint-disable-line no-constant-condition
-        let [line, length_] = datastream.read_line_utf8(null);
+    while (true) {
+        let [line, length] = datastream.read_line_utf8(null);
        if (line === null)
            break;

@@ -126,7 +117,6 @@ function *run() {
    yield Scripting.sleep(1000);

    Scripting.scriptEvent('applicationsShowStart');
-    // eslint-disable-next-line require-atomic-updates
    Main.overview._dash.showAppsButton.checked = true;

    yield Scripting.waitLeisure();
@@ -167,7 +157,7 @@ function *run() {
    Main.overview.hide();

    yield Scripting.createTestWindow({ maximized: true,
-                                       redraws: true });
+                                       redraws: true});
    yield Scripting.waitTestWindows();

    yield Scripting.sleep(1000);
@@ -244,31 +234,31 @@ function script_applicationsShowDone(time) {
    METRICS.applicationsShowTime.value = time - applicationsShowStart;
 }

-function script_mainViewDrawStart(_time) {
+function script_mainViewDrawStart(time) {
    redrawTiming = 'mainView';
 }

-function script_mainViewDrawDone(_time) {
+function script_mainViewDrawDone(time) {
    redrawTiming = null;
 }

-function script_overviewDrawStart(_time) {
+function script_overviewDrawStart(time) {
    redrawTiming = 'overview';
 }

-function script_overviewDrawDone(_time) {
+function script_overviewDrawDone(time) {
    redrawTiming = null;
 }

-function script_redrawTestStart(_time) {
+function script_redrawTestStart(time) {
    redrawTiming = 'application';
 }

-function script_redrawTestDone(_time) {
+function script_redrawTestDone(time) {
    redrawTiming = null;
 }

-function script_collectTimings(_time) {
+function script_collectTimings(time) {
    for (let timing in redrawTimes) {
        let times = redrawTimes[timing];
        times.sort((a, b) => a - b);
@@ -279,11 +269,11 @@ function script_collectTimings(_time) {
        if (len == 0)
            median = -1;
        else if (len % 2 == 1)
-            median = times[(len - 1) / 2];
+            median = times[(len - 1)/ 2];
        else
            median = Math.round((times[len / 2 - 1] + times[len / 2]) / 2);

-        METRICS[`${timing}RedrawTime`].value = median;
+        METRICS[timing + 'RedrawTime'].value = median;
    }
 }

--- a/js/portalHelper/main.js
+++ b/js/portalHelper/main.js
@@ -1,4 +1,3 @@
-/* exported main */
 const Format = imports.format;
 const Gettext = imports.gettext;
 const { Gio, GLib, GObject, Gtk, Pango, Soup, WebKit2: WebKit } = imports.gi;
@@ -20,6 +19,7 @@ const PortalHelperSecurityLevel = {
    INSECURE: 2
 };

+const INACTIVITY_TIMEOUT = 30000; //ms
 const CONNECTIVITY_CHECK_HOST = 'nmcheck.gnome.org';
 const CONNECTIVITY_CHECK_URI = 'http://' + CONNECTIVITY_CHECK_HOST;
 const CONNECTIVITY_RECHECK_RATELIMIT_TIMEOUT = 30 * GLib.USEC_PER_SEC;
@@ -59,7 +59,7 @@ class PortalHeaderBar extends Gtk.HeaderBar {
                                             single_line_mode: true,
                                             ellipsize: Pango.EllipsizeMode.END,
                                             valign: Gtk.Align.BASELINE,
-                                             selectable: true });
+                                             selectable: true});
        this.subtitleLabel.get_style_context().add_class('subtitle');
        hbox.add(this.subtitleLabel);

@@ -152,7 +152,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
        this._webView.load_uri(this._originalUrl);
    }

-    vfunc_delete_event(_event) {
+    vfunc_delete_event(event) {
        if (this._recheckAtExit)
            this._doneCallback(PortalHelperResult.RECHECK);
        else
@@ -178,7 +178,7 @@ class PortalWindow extends Gtk.ApplicationWindow {
        this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
    }

-    _onLoadFailedWithTlsErrors(view, failingURI, certificate, _errors) {
+    _onLoadFailedWithTlsErrors(view, failingURI, certificate, errors) {
        this._headerBar.setSecurityIcon(PortalHelperSecurityLevel.INSECURE);
        let uri = new Soup.URI(failingURI);
        this._webContext.allow_tls_certificate_for_host(certificate, uri.get_host());
@@ -265,7 +265,7 @@ class WebPortalHelper extends Gtk.Application {
        this._queue = [];

        let action = new Gio.SimpleAction({ name: 'quit' });
-        action.connect('activate', () => this.active_window.destroyWindow());
+        action.connect('activate', () => { this.active_window.destroyWindow(); });
        this.add_action(action);
    }

--- a/js/ui/accessDialog.js
+++ b/js/ui/accessDialog.js
@@ -1,4 +1,3 @@
-/* exported AccessDialogDBus */
 const { Clutter, Gio, GLib, GObject, Shell } = imports.gi;

 const CheckBox = imports.ui.checkBox;
@@ -70,7 +69,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
        this.addButton({ label: grantLabel,
                         action: () => {
                             this._sendResponse(DialogResponse.OK);
-                         } });
+                         }});
    }

    open() {
@@ -80,7 +79,7 @@ class AccessDialog extends ModalDialog.ModalDialog {
        this._requestExported = this._request.export(connection, this._handle);
    }

-    CloseAsync(invocation, _params) {
+    CloseAsync(invocation, params) {
        if (this._invocation.get_sender() != invocation.get_sender()) {
            invocation.return_error_literal(Gio.DBusError,
                                            Gio.DBusError.ACCESS_DENIED,
@@ -133,10 +132,10 @@ var AccessDialogDBus = class {
            return;
        }

-        let [handle, appId, parentWindow_, title, subtitle, body, options] = params;
+        let [handle, appId, parentWindow, title, subtitle, body, options] = params;
        // We probably want to use parentWindow and global.display.focus_window
        // for this check in the future
-        if (appId && `${appId}.desktop` != this._windowTracker.focus_app.id) {
+        if (appId && appId + '.desktop' != this._windowTracker.focus_app.id) {
            invocation.return_error_literal(Gio.DBusError,
                                            Gio.DBusError.ACCESS_DENIED,
                                            'Only the focused app is allowed to show a system access dialog');
@@ -147,7 +146,7 @@ var AccessDialogDBus = class {
                                      subtitle, body, options);
        dialog.open();

-        dialog.connect('closed', () => this._accessDialog = null);
+        dialog.connect('closed', () => { this._accessDialog = null; });

        this._accessDialog = dialog;
    }
--- a/js/ui/altTab.js
+++ b/js/ui/altTab.js
@@ -1,18 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported AppSwitcherPopup, GroupCyclerPopup, WindowSwitcherPopup,
-            WindowCyclerPopup */

 const { Atk, Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;

 const Main = imports.ui.main;
 const SwitcherPopup = imports.ui.switcherPopup;
+const Tweener = imports.ui.tweener;

 var APP_ICON_HOVER_TIMEOUT = 200; // milliseconds

 var THUMBNAIL_DEFAULT_SIZE = 256;
 var THUMBNAIL_POPUP_TIME = 500; // milliseconds
-var THUMBNAIL_FADE_TIME = 100; // milliseconds
+var THUMBNAIL_FADE_TIME = 0.1; // seconds

 var WINDOW_PREVIEW_SIZE = 128;
 var APP_ICON_SIZE = 96;
@@ -37,7 +36,7 @@ function _createWindowClone(window, size) {
                               // usual hack for the usual bug in ClutterBinLayout...
                               x_expand: true,
                               y_expand: true });
-}
+};

 function getWindows(workspace) {
    // We ignore skip-taskbar windows in switchers, but if they are attached
@@ -88,9 +87,9 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
            let hPadding = leftPadding + rightPadding;

            let icon = this._items[this._selectedIndex];
-            let [posX] = icon.get_transformed_position();
+            let [posX, posY] = icon.get_transformed_position();
            let thumbnailCenter = posX + icon.width / 2;
-            let [, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
+            let [childMinWidth, childNaturalWidth] = this._thumbnails.get_preferred_width(-1);
            childBox.x1 = Math.max(primary.x + leftPadding, Math.floor(thumbnailCenter - childNaturalWidth / 2));
            if (childBox.x1 + childNaturalWidth > primary.x + primary.width - hPadding) {
                let offset = childBox.x1 + childNaturalWidth - primary.width + hPadding;
@@ -104,7 +103,7 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
                childBox.x2 = primary.x + primary.width - rightPadding;
            childBox.y1 = this._switcherList.allocation.y2 + spacing;
            this._thumbnails.addClones(primary.y + primary.height - bottomPadding - childBox.y1);
-            let [, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
+            let [childMinHeight, childNaturalHeight] = this._thumbnails.get_preferred_height(-1);
            childBox.y2 = childBox.y1 + childNaturalHeight;
            this._thumbnails.allocate(childBox, flags);
        }
@@ -361,15 +360,15 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {

    _destroyThumbnails() {
        let thumbnailsActor = this._thumbnails;
-        this._thumbnails.ease({
-            opacity: 0,
-            duration: THUMBNAIL_FADE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                thumbnailsActor.destroy();
-                this.thumbnailsVisible = false;
-            }
-        });
+        Tweener.addTween(thumbnailsActor,
+                         { opacity: 0,
+                           time: THUMBNAIL_FADE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               thumbnailsActor.destroy();
+                               this.thumbnailsVisible = false;
+                           }
+                         });
        this._thumbnails = null;
        if (this._switcherList._items[this._selectedIndex])
            this._switcherList._items[this._selectedIndex].remove_accessible_state (Atk.StateType.EXPANDED);
@@ -392,14 +391,12 @@ class AppSwitcherPopup extends SwitcherPopup.SwitcherPopup {
        this._thumbnails.get_allocation_box();

        this._thumbnails.opacity = 0;
-        this._thumbnails.ease({
-            opacity: 255,
-            duration: THUMBNAIL_FADE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this.thumbnailsVisible = true;
-            }
-        });
+        Tweener.addTween(this._thumbnails,
+                         { opacity: 255,
+                           time: THUMBNAIL_FADE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => { this.thumbnailsVisible = true; }
+                         });

        this._switcherList._items[this._selectedIndex].add_accessible_state (Atk.StateType.EXPANDED);
    }
@@ -462,7 +459,7 @@ class CyclerHighlight {
    _onDestroy() {
        this.window = null;
    }
-}
+};

 // We don't show an actual popup, so just provide what SwitcherPopup
 // expects instead of inheriting from SwitcherList
@@ -472,7 +469,7 @@ var CyclerList = GObject.registerClass({
               'item-removed': { param_types: [GObject.TYPE_INT] },
               'item-highlighted': { param_types: [GObject.TYPE_INT] } },
 }, class CyclerList extends St.Widget {
-    highlight(index, _justOutline) {
+    highlight(index, justOutline) {
        this.emit('item-highlighted', index);
    }
 });
@@ -497,7 +494,7 @@ var CyclerPopup = GObject.registerClass({
        });
    }

-    _highlightItem(index, _justOutline) {
+    _highlightItem(index, justOutline) {
        this._highlight.window = this._items[index];
        global.window_group.set_child_above_sibling(this._highlight.actor, null);
    }
@@ -663,10 +660,17 @@ class AppIcon extends St.BoxLayout {
        this.add(this.label, { x_fill: false });
    }

-    // eslint-disable-next-line camelcase
    set_size(size) {
        this.icon = this.app.create_icon_texture(size);
        this._iconBin.child = this.icon;
+        this._iconBin.set_size(size, size);
+    }
+
+    vfunc_get_preferred_width(forHeight) {
+        let [minWidth, ] = super.vfunc_get_preferred_width(forHeight);
+
+        minWidth = Math.max(minWidth, forHeight);
+        return [minWidth, minWidth];
    }
 });

@@ -720,16 +724,15 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {

    _setIconSize() {
        let j = 0;
-        while (this._items.length > 1 && this._items[j].style_class != 'item-box') {
-            j++;
+        while(this._items.length > 1 && this._items[j].style_class != 'item-box') {
+                j++;
        }
        let themeNode = this._items[j].get_theme_node();
-        this._list.ensure_style();

        let iconPadding = themeNode.get_horizontal_padding();
        let iconBorder = themeNode.get_border_width(St.Side.LEFT) + themeNode.get_border_width(St.Side.RIGHT);
-        let [, labelNaturalHeight] = this.icons[j].label.get_preferred_height(-1);
-        let iconSpacing = labelNaturalHeight + iconPadding + iconBorder;
+        let [iconMinHeight, iconNaturalHeight] = this.icons[j].label.get_preferred_height(-1);
+        let iconSpacing = iconNaturalHeight + iconPadding + iconBorder;
        let totalSpacing = this._list.spacing * (this._items.length - 1);

        // We just assume the whole screen here due to weirdness happing with the passed width
@@ -742,7 +745,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
        let iconSize = baseIconSizes[0];

        if (this._items.length > 1) {
-            for (let i =  0; i < baseIconSizes.length; i++) {
+            for(let i =  0; i < baseIconSizes.length; i++) {
                iconSize = baseIconSizes[i];
                let height = iconSizes[i] + iconSpacing;
                let w = height * this._items.length + totalSpacing;
@@ -753,7 +756,7 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {

        this._iconSize = iconSize;

-        for (let i = 0; i < this.icons.length; i++) {
+        for(let i = 0; i < this.icons.length; i++) {
            if (this.icons[i].icon != null)
                break;
            this.icons[i].set_size(iconSize);
@@ -799,13 +802,12 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
                                                            return GLib.SOURCE_REMOVE;
                                                        });
            GLib.Source.set_name_by_id(this._mouseTimeOutId, '[gnome-shell] this._enterItem');
-        } else {
-            this._itemEntered(index);
-        }
+        } else
+           this._itemEntered(index);
    }

    _enterItem(index) {
-        let [x, y] = global.get_pointer();
+        let [x, y, mask] = global.get_pointer();
        let pickedActor = global.stage.get_actor_at_pos(Clutter.PickMode.ALL, x, y);
        if (this._items[index].contains(pickedActor))
            this._itemEntered(index);
@@ -846,8 +848,9 @@ class AppSwitcher extends SwitcherPopup.SwitcherList {
                this._removeIcon(app);
        });

+        let n = this._arrows.length;
        let arrow = new St.DrawingArea({ style_class: 'switcher-arrow' });
-        arrow.connect('repaint', () => SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM));
+        arrow.connect('repaint', () => { SwitcherPopup.drawArrow(arrow, St.Side.BOTTOM); });
        this.add_actor(arrow);
        this._arrows.push(arrow);

@@ -912,7 +915,7 @@ class ThumbnailList extends SwitcherPopup.SwitcherList {
            return;
        let totalPadding = this._items[0].get_theme_node().get_horizontal_padding() + this._items[0].get_theme_node().get_vertical_padding();
        totalPadding += this.get_theme_node().get_horizontal_padding() + this.get_theme_node().get_vertical_padding();
-        let [, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
+        let [labelMinHeight, labelNaturalHeight] = this._labels[0].get_preferred_height(-1);
        let spacing = this._items[0].child.get_theme_node().get_length('spacing');
        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
        let thumbnailSize = THUMBNAIL_DEFAULT_SIZE * scaleFactor;
@@ -988,23 +991,23 @@ class WindowIcon extends St.BoxLayout {
        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;

        switch (mode) {
-        case AppIconMode.THUMBNAIL_ONLY:
-            size = WINDOW_PREVIEW_SIZE;
-            this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
-            break;
+            case AppIconMode.THUMBNAIL_ONLY:
+                size = WINDOW_PREVIEW_SIZE;
+                this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
+                break;

-        case AppIconMode.BOTH:
-            size = WINDOW_PREVIEW_SIZE;
-            this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));
+            case AppIconMode.BOTH:
+                size = WINDOW_PREVIEW_SIZE;
+                this._icon.add_actor(_createWindowClone(mutterWindow, size * scaleFactor));

-            if (this.app)
-                this._icon.add_actor(this._createAppIcon(this.app,
-                                                         APP_ICON_SIZE_SMALL));
-            break;
+                if (this.app)
+                    this._icon.add_actor(this._createAppIcon(this.app,
+                                                             APP_ICON_SIZE_SMALL));
+                break;

-        case AppIconMode.APP_ICON_ONLY:
-            size = APP_ICON_SIZE;
-            this._icon.add_actor(this._createAppIcon(this.app, size));
+            case AppIconMode.APP_ICON_ONLY:
+                size = APP_ICON_SIZE;
+                this._icon.add_actor(this._createAppIcon(this.app, size));
        }

        this._icon.set_size(size * scaleFactor, size * scaleFactor);
@@ -1041,7 +1044,7 @@ class WindowList extends SwitcherPopup.SwitcherList {
            this.icons.push(icon);

            icon._unmanagedSignalId = icon.window.connect('unmanaged', (window) => {
-                this._removeWindow(window);
+                this._removeWindow(window)
            });
        }

@@ -1077,7 +1080,7 @@ class WindowList extends SwitcherPopup.SwitcherList {
        childBox.y1 = childBox.y2 - this._label.height;
        this._label.allocate(childBox, flags);

-        let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM);
+        let totalLabelHeight = this._label.height + themeNode.get_padding(St.Side.BOTTOM)
        childBox.x1 = box.x1;
        childBox.x2 = box.x2;
        childBox.y1 = box.y1;
--- a/js/ui/animation.js
+++ b/js/ui/animation.js
@@ -1,12 +1,13 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Animation, AnimatedIcon, Spinner */

-const { Clutter, GLib, Gio, St } = imports.gi;
+const { GLib, Gio, St } = imports.gi;
 const Mainloop = imports.mainloop;

+const Tweener = imports.ui.tweener;
+
 var ANIMATED_ICON_UPDATE_TIMEOUT = 16;
-var SPINNER_ANIMATION_TIME = 300;
-var SPINNER_ANIMATION_DELAY = 1000;
+var SPINNER_ANIMATION_TIME = 0.3;
+var SPINNER_ANIMATION_DELAY = 1.0;

 var Animation = class {
    constructor(file, width, height, speed) {
@@ -61,11 +62,11 @@ var Animation = class {
        if (!validResourceScale)
            return;

-        let textureCache = St.TextureCache.get_default();
+        let texture_cache = St.TextureCache.get_default();
        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
-        this._animations = textureCache.load_sliced_image(file, width, height,
-                                                          scaleFactor, resourceScale,
-                                                          this._animationsLoaded.bind(this));
+        this._animations = texture_cache.load_sliced_image(file, width, height,
+                                                           scaleFactor, resourceScale,
+                                                           this._animationsLoaded.bind(this));
        this.actor.set_child(this._animations);
    }

@@ -122,7 +123,7 @@ var AnimatedIcon = class extends Animation {
 };

 var Spinner = class extends AnimatedIcon {
-    constructor(size, animate = false) {
+    constructor(size, animate=false) {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/theme/process-working.svg');
        super(file, size);

@@ -136,15 +137,15 @@ var Spinner = class extends AnimatedIcon {
    }

    play() {
-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        if (this._animate) {
            super.play();
-            this.actor.ease({
+            Tweener.addTween(this.actor, {
                opacity: 255,
                delay: SPINNER_ANIMATION_DELAY,
-                duration: SPINNER_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.LINEAR
+                time: SPINNER_ANIMATION_TIME,
+                transition: 'linear'
            });
        } else {
            this.actor.opacity = 255;
@@ -153,14 +154,16 @@ var Spinner = class extends AnimatedIcon {
    }

    stop() {
-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        if (this._animate) {
-            this.actor.ease({
+            Tweener.addTween(this.actor, {
                opacity: 0,
                time: SPINNER_ANIMATION_TIME,
                transition: 'linear',
-                onComplete: () => super.stop()
+                onComplete: () => {
+                    this.stop(false);
+                }
            });
        } else {
            this.actor.opacity = 0;
--- a/js/ui/appDisplay.js
+++ b/js/ui/appDisplay.js
--- a/js/ui/appFavorites.js
+++ b/js/ui/appFavorites.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported getAppFavorites */

 const Shell = imports.gi.Shell;
 const Signals = imports.signals;
@@ -64,7 +63,7 @@ class AppFavorites {
    constructor() {
        this.FAVORITE_APPS_KEY = 'favorite-apps';
        this._favorites = {};
-        global.settings.connect(`changed::${this.FAVORITE_APPS_KEY}`, this._onFavsChanged.bind(this));
+        global.settings.connect('changed::' + this.FAVORITE_APPS_KEY, this._onFavsChanged.bind(this));
        this.reload();
    }

@@ -188,7 +187,7 @@ class AppFavorites {
                                   }
                                 });
    }
-}
+};
 Signals.addSignalMethods(AppFavorites.prototype);

 var appFavoritesInstance = null;
--- a/js/ui/audioDeviceSelection.js
+++ b/js/ui/audioDeviceSelection.js
@@ -1,4 +1,3 @@
-/* exported AudioDeviceSelectionDBus */
 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;

 const Main = imports.ui.main;
@@ -35,7 +34,7 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
            throw new Error('Too few devices for a selection');
    }

-    _buildLayout() {
+    _buildLayout(devices) {
        let title = new St.Label({ style_class: 'audio-selection-title',
                                   text: _("Select Audio Device"),
                                   x_align: Clutter.ActorAlign.CENTER });
@@ -55,28 +54,28 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
    }

    _getDeviceLabel(device) {
-        switch (device) {
-        case AudioDevice.HEADPHONES:
-            return _("Headphones");
-        case AudioDevice.HEADSET:
-            return _("Headset");
-        case AudioDevice.MICROPHONE:
-            return _("Microphone");
-        default:
-            return null;
+        switch(device) {
+            case AudioDevice.HEADPHONES:
+                return _("Headphones");
+            case AudioDevice.HEADSET:
+                return _("Headset");
+            case AudioDevice.MICROPHONE:
+                return _("Microphone");
+            default:
+                return null;
        }
    }

    _getDeviceIcon(device) {
-        switch (device) {
-        case AudioDevice.HEADPHONES:
-            return 'audio-headphones-symbolic';
-        case AudioDevice.HEADSET:
-            return 'audio-headset-symbolic';
-        case AudioDevice.MICROPHONE:
-            return 'audio-input-microphone-symbolic';
-        default:
-            return null;
+        switch(device) {
+            case AudioDevice.HEADPHONES:
+                return 'audio-headphones-symbolic';
+            case AudioDevice.HEADSET:
+                return 'audio-headset-symbolic';
+            case AudioDevice.MICROPHONE:
+                return 'audio-input-microphone-symbolic';
+            default:
+                return null;
        }
    }

@@ -86,7 +85,6 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
        box.connect('notify::height', () => {
            Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
                box.width = box.height;
-                return GLib.SOURCE_REMOVE;
            });
        });

@@ -112,11 +110,11 @@ var AudioDeviceSelectionDialog = GObject.registerClass({
    }

    _openSettings() {
-        let desktopFile = 'gnome-sound-panel.desktop';
+        let desktopFile = 'gnome-sound-panel.desktop'
        let app = Shell.AppSystem.get_default().lookup_app(desktopFile);

        if (!app) {
-            log(`Settings panel for desktop file ${desktopFile} could not be loaded!`);
+            log('Settings panel for desktop file ' + desktopFile + ' could not be loaded!');
            return;
        }

@@ -161,12 +159,12 @@ var AudioDeviceSelectionDBus = class AudioDeviceSelectionDBus {

        let [deviceNames] = params;
        let devices = 0;
-        deviceNames.forEach(n => devices |= AudioDevice[n.toUpperCase()]);
+        deviceNames.forEach(n => { devices |= AudioDevice[n.toUpperCase()]; });

        let dialog;
        try {
            dialog = new AudioDeviceSelectionDialog(devices);
-        } catch (e) {
+        } catch(e) {
            invocation.return_value(null);
            return;
        }
--- a/js/ui/background.js
+++ b/js/ui/background.js
@@ -99,6 +99,7 @@ const Signals = imports.signals;
 const LoginManager = imports.misc.loginManager;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 var DEFAULT_BACKGROUND_COLOR = Clutter.Color.from_pixel(0x2e3436ff);

@@ -107,9 +108,10 @@ const PRIMARY_COLOR_KEY = 'primary-color';
 const SECONDARY_COLOR_KEY = 'secondary-color';
 const COLOR_SHADING_TYPE_KEY = 'color-shading-type';
 const BACKGROUND_STYLE_KEY = 'picture-options';
+const PICTURE_OPACITY_KEY = 'picture-opacity';
 const PICTURE_URI_KEY = 'picture-uri';

-var FADE_ANIMATION_TIME = 1000;
+var FADE_ANIMATION_TIME = 1.0;

 // These parameters affect how often we redraw.
 // The first is how different (percent crossfaded) the slide show
@@ -332,12 +334,12 @@ var Background = class Background {
    }

    _loadPattern() {
-        let colorString, res_, color, secondColor;
+        let colorString, res, color, secondColor;

        colorString = this._settings.get_string(PRIMARY_COLOR_KEY);
-        [res_, color] = Clutter.Color.from_string(colorString);
+        [res, color] = Clutter.Color.from_string(colorString);
        colorString = this._settings.get_string(SECONDARY_COLOR_KEY);
-        [res_, secondColor] = Clutter.Color.from_string(colorString);
+        [res, secondColor] = Clutter.Color.from_string(colorString);

        let shadingType = this._settings.get_enum(COLOR_SHADING_TYPE_KEY);

@@ -431,12 +433,12 @@ var Background = class Background {
            return;

        this._updateAnimationTimeoutId = GLib.timeout_add(GLib.PRIORITY_DEFAULT,
-                                                          interval,
-                                                          () => {
-                                                              this._updateAnimationTimeoutId = 0;
-                                                              this._updateAnimation();
-                                                              return GLib.SOURCE_REMOVE;
-                                                          });
+                                                      interval,
+                                                      () => {
+                                                          this._updateAnimationTimeoutId = 0;
+                                                          this._updateAnimation();
+                                                          return GLib.SOURCE_REMOVE;
+                                                      });
        GLib.Source.set_name_by_id(this._updateAnimationTimeoutId, '[gnome-shell] this._updateAnimation');
    }

@@ -463,9 +465,9 @@ var Background = class Background {

        let cache = Meta.BackgroundImageCache.get_default();
        let image = cache.load(file);
-        if (image.is_loaded()) {
+        if (image.is_loaded())
            this._setLoaded();
-        } else {
+        else {
            let id = image.connect('loaded', () => {
                this._setLoaded();
                image.disconnect(id);
@@ -632,9 +634,9 @@ var Animation = class Animation {
    }

    load(callback) {
-        this._show = new GnomeDesktop.BGSlideShow({ file: this.file });
+        this._show = new GnomeDesktop.BGSlideShow({ filename: this.file.get_path() });

-        this._show.load_async(null, () => {
+        this._show.load_async(null, (object, result) => {
            this.loaded = true;
            if (callback)
                callback();
@@ -650,7 +652,7 @@ var Animation = class Animation {
        if (this._show.get_num_slides() < 1)
            return;

-        let [progress, duration, isFixed_, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);
+        let [progress, duration, isFixed, filename1, filename2] = this._show.get_current_slide(monitor.width, monitor.height);

        this.transitionDuration = duration;
        this.transitionProgress = progress;
@@ -709,12 +711,14 @@ var BackgroundManager = class BackgroundManager {
        this._newBackgroundActor = null;
        this.emit('changed');

-        oldBackgroundActor.ease({
-            opacity: 0,
-            duration: FADE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => oldBackgroundActor.destroy()
-        });
+        Tweener.addTween(oldBackgroundActor,
+                         { opacity: 0,
+                           time: FADE_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete() {
+                               oldBackgroundActor.destroy();
+                           }
+                         });
    }

    _updateBackgroundActor() {
--- a/js/ui/backgroundMenu.js
+++ b/js/ui/backgroundMenu.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported addBackgroundMenu */

 const { Clutter, St } = imports.gi;

--- a/js/ui/barLevel.js
+++ b/js/ui/barLevel.js
@@ -1,106 +1,74 @@
 /* -*- mode: js2; js2-basic-offset: 4; indent-tabs-mode: nil -*- */
-/* exported BarLevel */

-const { Atk, Clutter, GObject, St } = imports.gi;
+const { Atk, Clutter, St } = imports.gi;
+const Signals = imports.signals;

-var BarLevel = GObject.registerClass({
-    Properties: {
-        'value': GObject.ParamSpec.double(
-            'value', 'value', 'value',
-            GObject.ParamFlags.READWRITE,
-            0, 2, 0),
-        'maximum-value': GObject.ParamSpec.double(
-            'maximum-value', 'maximum-value', 'maximum-value',
-            GObject.ParamFlags.READWRITE,
-            1, 2, 1),
-        'overdrive-start': GObject.ParamSpec.double(
-            'overdrive-start', 'overdrive-start', 'overdrive-start',
-            GObject.ParamFlags.READWRITE,
-            1, 2, 1)
-    }
-}, class BarLevel extends St.DrawingArea {
-    _init(params) {
+var BarLevel = class {
+    constructor(value, params) {
+        if (isNaN(value))
+            // Avoid spreading NaNs around
+            throw TypeError('The bar level value must be a number');
        this._maxValue = 1;
-        this._value = 0;
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
        this._overdriveStart = 1;
        this._barLevelWidth = 0;

-        let defaultParams = {
-            style_class: 'barlevel',
-            accessible_role: Atk.Role.LEVEL_BAR
-        };
-        super._init(Object.assign(defaultParams, params));
-        this.connect('allocation-changed', (actor, box) => {
+        if (params == undefined)
+            params = {}
+
+        this.actor = new St.DrawingArea({ styleClass: params['styleClass'] || 'barlevel',
+                                          can_focus: params['canFocus'] || false,
+                                          reactive: params['reactive'] || false,
+                                          accessible_role: params['accessibleRole'] || Atk.Role.LEVEL_BAR });
+        this.actor.connect('repaint', this._barLevelRepaint.bind(this));
+        this.actor.connect('allocation-changed', (actor, box) => {
            this._barLevelWidth = box.get_width();
        });

-        this._customAccessible = St.GenericAccessible.new_for_actor(this);
-        this.set_accessible(this._customAccessible);
+        this._customAccessible = St.GenericAccessible.new_for_actor(this.actor);
+        this.actor.set_accessible(this._customAccessible);

        this._customAccessible.connect('get-current-value', this._getCurrentValue.bind(this));
        this._customAccessible.connect('get-minimum-value', this._getMinimumValue.bind(this));
        this._customAccessible.connect('get-maximum-value', this._getMaximumValue.bind(this));
        this._customAccessible.connect('set-current-value', this._setCurrentValue.bind(this));

-        this.connect('notify::value', this._valueChanged.bind(this));
+        this.connect('value-changed', this._valueChanged.bind(this));
    }

-    get value() {
-        return this._value;
+    setValue(value) {
+        if (isNaN(value))
+            throw TypeError('The bar level value must be a number');
+
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
+        this.actor.queue_repaint();
    }

-    set value(value) {
-        value = Math.max(Math.min(value, this._maxValue), 0);
+    setMaximumValue(value) {
+        if (isNaN(value))
+            throw TypeError('The bar level max value must be a number');

-        if (this._value == value)
-            return;
-
-        this._value = value;
-        this.notify('value');
-        this.queue_repaint();
-    }
-
-    // eslint-disable-next-line camelcase
-    get maximum_value() {
-        return this._maxValue;
-    }
-
-    // eslint-disable-next-line camelcase
-    set maximum_value(value) {
-        value = Math.max(value, 1);
-
-        if (this._maxValue == value)
-            return;
-
-        this._maxValue = value;
+        this._maxValue = Math.max(value, 1);
        this._overdriveStart = Math.min(this._overdriveStart, this._maxValue);
-        this.notify('maximum-value');
-        this.queue_repaint();
+        this.actor.queue_repaint();
    }

-    // eslint-disable-next-line camelcase
-    get overdrive_start() {
-        return this._overdriveStart;
-    }
-
-    // eslint-disable-next-line camelcase
-    set overdrive_start(value) {
-        if (this._overdriveStart == value)
-            return;
-
+    setOverdriveStart(value) {
+        if (isNaN(value))
+            throw TypeError('The overdrive limit value must be a number');
        if (value > this._maxValue)
            throw new Error(`Tried to set overdrive value to ${value}, ` +
                `which is a number greater than the maximum allowed value ${this._maxValue}`);

        this._overdriveStart = value;
-        this.notify('overdrive-start');
-        this.queue_repaint();
+        this._value = Math.max(Math.min(value, this._maxValue), 0);
+        this.actor.queue_repaint();
    }

-    vfunc_repaint() {
-        let cr = this.get_context();
-        let themeNode = this.get_theme_node();
-        let [width, height] = this.get_surface_size();
+    _barLevelRepaint(area) {
+        let cr = area.get_context();
+        let themeNode = area.get_theme_node();
+        let [width, height] = area.get_surface_size();

        let barLevelHeight = themeNode.get_length('-barlevel-height');
        let barLevelBorderRadius = Math.min(width, barLevelHeight) / 2;
@@ -137,7 +105,7 @@ var BarLevel = GObject.registerClass({
            overdriveSeparatorWidth = themeNode.get_length('-barlevel-overdrive-separator-width');

        /* background bar */
-        cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4));
+        cr.arc(width - barLevelBorderRadius - barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4);
        cr.lineTo(endX, (height + barLevelHeight) / 2);
        cr.lineTo(endX, (height - barLevelHeight) / 2);
        cr.lineTo(width - barLevelBorderRadius - barLevelBorderWidth, (height - barLevelHeight) / 2);
@@ -149,12 +117,12 @@ var BarLevel = GObject.registerClass({

        /* normal progress bar */
        let x = Math.min(endX, overdriveSeparatorX - overdriveSeparatorWidth / 2);
-        cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * (1 / 4), TAU * (3 / 4));
+        cr.arc(barLevelBorderRadius + barLevelBorderWidth, height / 2, barLevelBorderRadius, TAU * 1 / 4, TAU * 3 / 4);
        cr.lineTo(x, (height - barLevelHeight) / 2);
        cr.lineTo(x, (height + barLevelHeight) / 2);
        cr.lineTo(barLevelBorderRadius + barLevelBorderWidth, (height + barLevelHeight) / 2);
        if (this._value > 0)
-            Clutter.cairo_set_source_color(cr, barLevelActiveColor);
+          Clutter.cairo_set_source_color(cr, barLevelActiveColor);
        cr.fillPreserve();
        Clutter.cairo_set_source_color(cr, barLevelActiveBorderColor);
        cr.setLineWidth(barLevelBorderWidth);
@@ -177,17 +145,17 @@ var BarLevel = GObject.registerClass({

        /* end progress bar arc */
        if (this._value > 0) {
-            if (this._value <= this._overdriveStart)
-                Clutter.cairo_set_source_color(cr, barLevelActiveColor);
-            else
-                Clutter.cairo_set_source_color(cr, barLevelOverdriveColor);
-            cr.arc(endX, height / 2, barLevelBorderRadius, TAU * (3 / 4), TAU * (1 / 4));
-            cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2);
-            cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2);
-            cr.lineTo(endX, (height - barLevelHeight) / 2);
-            cr.fillPreserve();
-            cr.setLineWidth(barLevelBorderWidth);
-            cr.stroke();
+          if (this._value <= this._overdriveStart)
+              Clutter.cairo_set_source_color(cr, barLevelActiveColor);
+          else
+              Clutter.cairo_set_source_color(cr, barLevelOverdriveColor);
+          cr.arc(endX, height / 2, barLevelBorderRadius, TAU * 3 / 4, TAU * 1 / 4);
+          cr.lineTo(Math.floor(endX), (height + barLevelHeight) / 2);
+          cr.lineTo(Math.floor(endX), (height - barLevelHeight) / 2);
+          cr.lineTo(endX, (height - barLevelHeight) / 2);
+          cr.fillPreserve();
+          cr.setLineWidth(barLevelBorderWidth);
+          cr.stroke();
        }

        /* draw overdrive separator */
@@ -207,27 +175,32 @@ var BarLevel = GObject.registerClass({
        cr.$dispose();
    }

-    _getCurrentValue() {
+    _getCurrentValue(actor) {
        return this._value;
    }

-    _getOverdriveStart() {
+    _getOverdriveStart(actor) {
        return this._overdriveStart;
    }

-    _getMinimumValue() {
+    _getMinimumValue(actor) {
        return 0;
    }

-    _getMaximumValue() {
+    _getMaximumValue(actor) {
        return this._maxValue;
    }

-    _setCurrentValue(_actor, value) {
+    _setCurrentValue(actor, value) {
        this._value = value;
    }

-    _valueChanged() {
+    _valueChanged(barLevel, value, property) {
        this._customAccessible.notify("accessible-value");
    }
-});
+
+    get value() {
+        return this._value;
+    }
+};
+Signals.addSignalMethods(BarLevel.prototype);
--- a/js/ui/boxpointer.js
+++ b/js/ui/boxpointer.js
@@ -1,9 +1,9 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BoxPointer */

-const { Clutter, GObject, Shell, St } = imports.gi;
+const { Clutter, GObject, Meta, Shell, St } = imports.gi;

 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

 var PopupAnimation = {
    NONE:  0,
@@ -12,7 +12,7 @@ var PopupAnimation = {
    FULL:  ~0,
 };

-var POPUP_ANIMATION_TIME = 150;
+var POPUP_ANIMATION_TIME = 0.15;

 /**
 * BoxPointer:
@@ -90,33 +90,31 @@ var BoxPointer = GObject.registerClass({

        if (animate & PopupAnimation.SLIDE) {
            switch (this._arrowSide) {
-            case St.Side.TOP:
-                this.translation_y = -rise;
-                break;
-            case St.Side.BOTTOM:
-                this.translation_y = rise;
-                break;
-            case St.Side.LEFT:
-                this.translation_x = -rise;
-                break;
-            case St.Side.RIGHT:
-                this.translation_x = rise;
-                break;
+                case St.Side.TOP:
+                    this.translation_y = -rise;
+                    break;
+                case St.Side.BOTTOM:
+                    this.translation_y = rise;
+                    break;
+                case St.Side.LEFT:
+                    this.translation_x = -rise;
+                    break;
+                case St.Side.RIGHT:
+                    this.translation_x = rise;
+                    break;
            }
        }

-        this.ease({
-            opacity: 255,
-            translation_x: 0,
-            translation_y: 0,
-            duration: animationTime,
-            mode: Clutter.AnimationMode.LINEAR,
-            onComplete: () => {
-                this._unmuteInput();
-                if (onComplete)
-                    onComplete();
-            }
-        });
+        Tweener.addTween(this, { opacity: 255,
+                                 translation_x: 0,
+                                 translation_y: 0,
+                                 transition: 'linear',
+                                 onComplete: () => {
+                                     this._unmuteInput();
+                                     if (onComplete)
+                                         onComplete();
+                                 },
+                                 time: animationTime });
    }

    close(animate, onComplete) {
@@ -132,39 +130,38 @@ var BoxPointer = GObject.registerClass({

        if (animate & PopupAnimation.SLIDE) {
            switch (this._arrowSide) {
-            case St.Side.TOP:
-                translationY = rise;
-                break;
-            case St.Side.BOTTOM:
-                translationY = -rise;
-                break;
-            case St.Side.LEFT:
-                translationX = rise;
-                break;
-            case St.Side.RIGHT:
-                translationX = -rise;
-                break;
+                case St.Side.TOP:
+                    translationY = rise;
+                    break;
+                case St.Side.BOTTOM:
+                    translationY = -rise;
+                    break;
+                case St.Side.LEFT:
+                    translationX = rise;
+                    break;
+                case St.Side.RIGHT:
+                    translationX = -rise;
+                    break;
            }
        }

        this._muteInput();

-        this.remove_all_transitions();
-        this.ease({
-            opacity: fade ? 0 : 255,
-            translation_x: translationX,
-            translation_y: translationY,
-            duration: animationTime,
-            mode: Clutter.AnimationMode.LINEAR,
-            onComplete: () => {
-                this.hide();
-                this.opacity = 0;
-                this.translation_x = 0;
-                this.translation_y = 0;
-                if (onComplete)
-                    onComplete();
-            }
-        });
+        Tweener.removeTweens(this);
+        Tweener.addTween(this, { opacity: fade ? 0 : 255,
+                                 translation_x: translationX,
+                                 translation_y: translationY,
+                                 transition: 'linear',
+                                 time: animationTime,
+                                 onComplete: () => {
+                                     this.hide();
+                                     this.opacity = 0;
+                                     this.translation_x = 0;
+                                     this.translation_y = 0;
+                                     if (onComplete)
+                                         onComplete();
+                                 }
+                               });
    }

    _adjustAllocationForArrow(isWidth, minSize, natSize) {
@@ -223,18 +220,18 @@ var BoxPointer = GObject.registerClass({
        childBox.x2 = availWidth - borderWidth;
        childBox.y2 = availHeight - borderWidth;
        switch (this._arrowSide) {
-        case St.Side.TOP:
-            childBox.y1 += rise;
-            break;
-        case St.Side.BOTTOM:
-            childBox.y2 -= rise;
-            break;
-        case St.Side.LEFT:
-            childBox.x1 += rise;
-            break;
-        case St.Side.RIGHT:
-            childBox.x2 -= rise;
-            break;
+            case St.Side.TOP:
+                childBox.y1 += rise;
+                break;
+            case St.Side.BOTTOM:
+                childBox.y2 -= rise;
+                break;
+            case St.Side.LEFT:
+                childBox.x1 += rise;
+                break;
+            case St.Side.RIGHT:
+                childBox.x2 -= rise;
+                break;
        }
        this.bin.allocate(childBox, flags);

@@ -267,7 +264,7 @@ var BoxPointer = GObject.registerClass({
        let borderRadius = themeNode.get_length('-arrow-border-radius');

        let halfBorder = borderWidth / 2;
-        let halfBase = Math.floor(base / 2);
+        let halfBase = Math.floor(base/2);

        let backgroundColor = themeNode.get_color('-arrow-background-color');

@@ -348,7 +345,7 @@ var BoxPointer = GObject.registerClass({
        if (!skipTopRight) {
            cr.lineTo(x2 - borderRadius, y1);
            cr.arc(x2 - borderRadius, y1 + borderRadius, borderRadius,
-                   3 * Math.PI / 2, Math.PI * 2);
+                   3*Math.PI/2, Math.PI*2);
        }

        if (this._arrowSide == St.Side.RIGHT && rise) {
@@ -369,7 +366,7 @@ var BoxPointer = GObject.registerClass({
        if (!skipBottomRight) {
            cr.lineTo(x2, y2 - borderRadius);
            cr.arc(x2 - borderRadius, y2 - borderRadius, borderRadius,
-                   0, Math.PI / 2);
+                   0, Math.PI/2);
        }

        if (this._arrowSide == St.Side.BOTTOM && rise) {
@@ -390,7 +387,7 @@ var BoxPointer = GObject.registerClass({
        if (!skipBottomLeft) {
            cr.lineTo(x1 + borderRadius, y2);
            cr.arc(x1 + borderRadius, y2 - borderRadius, borderRadius,
-                   Math.PI / 2, Math.PI);
+                   Math.PI/2, Math.PI);
        }

        if (this._arrowSide == St.Side.LEFT && rise) {
@@ -399,7 +396,7 @@ var BoxPointer = GObject.registerClass({
                cr.lineTo(x1 - rise, y1);
                cr.lineTo(x1 + borderRadius, y1);
            } else if (skipBottomLeft) {
-                cr.lineTo(x1 - rise, y2);
+                cr.lineTo(x1 - rise, y2)
                cr.lineTo(x1 - rise, y2 - halfBase);
            } else {
                cr.lineTo(x1, this._arrowOrigin + halfBase);
@@ -411,7 +408,7 @@ var BoxPointer = GObject.registerClass({
        if (!skipTopLeft) {
            cr.lineTo(x1, y1 + borderRadius);
            cr.arc(x1 + borderRadius, y1 + borderRadius, borderRadius,
-                   Math.PI, 3 * Math.PI / 2);
+                   Math.PI, 3*Math.PI/2);
        }

        Clutter.cairo_set_source_color(cr, backgroundColor);
@@ -440,7 +437,7 @@ var BoxPointer = GObject.registerClass({
                this._sourceActorDestroyId = this._sourceActor.connect('destroy', () => {
                    this._sourceActor = null;
                    delete this._sourceActorDestroyId;
-                });
+                })
            }
        }

@@ -472,7 +469,7 @@ var BoxPointer = GObject.registerClass({
        let sourceAllocation = this._sourceAllocation;
        let sourceCenterX = sourceAllocation.x1 + sourceContentBox.x1 + (sourceContentBox.x2 - sourceContentBox.x1) * this._sourceAlignment;
        let sourceCenterY = sourceAllocation.y1 + sourceContentBox.y1 + (sourceContentBox.y2 - sourceContentBox.y1) * this._sourceAlignment;
-        let [, , natWidth, natHeight] = this.get_preferred_size();
+        let [minWidth, minHeight, natWidth, natHeight] = this.get_preferred_size();

        // We also want to keep it onscreen, and separated from the
        // edge by the same distance as the main part of the box is
@@ -516,7 +513,7 @@ var BoxPointer = GObject.registerClass({
        //     of the box to maintain the arrow's accuracy.

        let arrowOrigin;
-        let halfBase = Math.floor(arrowBase / 2);
+        let halfBase = Math.floor(arrowBase/2);
        let halfBorder = borderWidth / 2;
        let halfMargin = margin / 2;
        let [x1, y1] = [halfBorder, halfBorder];
@@ -597,7 +594,7 @@ var BoxPointer = GObject.registerClass({

    _calculateArrowSide(arrowSide) {
        let sourceAllocation = this._sourceAllocation;
-        let [, , boxWidth, boxHeight] = this.get_preferred_size();
+        let [minWidth, minHeight, boxWidth, boxHeight] = this.get_preferred_size();
        let workarea = this._workArea;

        switch (arrowSide) {
--- a/js/ui/calendar.js
+++ b/js/ui/calendar.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Calendar, CalendarMessageList */

 const { Clutter, Gio, GLib, Shell, St } = imports.gi;
 const Signals = imports.signals;
@@ -18,7 +17,7 @@ var ELLIPSIS_CHAR = '\u2026';

 var MESSAGE_ICON_SIZE = -1; // pick up from CSS

-var NC_ = (context, str) => `${context}\u0004${str}`;
+var NC_ = (context, str) => context + '\u0004' + str;

 function sameYear(dateA, dateB) {
    return (dateA.getYear() == dateB.getYear());
@@ -39,7 +38,7 @@ function isToday(date) {
 function _isWorkDay(date) {
    /* Translators: Enter 0-6 (Sunday-Saturday) for non-work days. Examples: "0" (Sunday) "6" (Saturday) "06" (Sunday and Saturday). */
    let days = C_('calendar-no-work', "06");
-    return !days.includes(date.getDay().toString());
+    return days.indexOf(date.getDay().toString()) == -1;
 }

 function _getBeginningOfDay(date) {
@@ -110,15 +109,15 @@ var EmptyEventSource = class EmptyEventSource {
    destroy() {
    }

-    requestRange(_begin, _end) {
+    requestRange(begin, end) {
    }

-    getEvents(_begin, _end) {
+    getEvents(begin, end) {
        let result = [];
        return result;
    }

-    hasEvents(_day) {
+    hasEvents(day) {
        return false;
    }
 };
@@ -144,7 +143,8 @@ function _datesEqual(a, b) {
    return true;
 }

-function _dateIntervalsOverlap(a0, a1, b0, b1) {
+function _dateIntervalsOverlap(a0, a1, b0, b1)
+{
    if (a1 <= b0)
        return false;
    else if (b1 <= a0)
@@ -168,7 +168,7 @@ var DBusEventSource = class DBusEventSource {
            try {
                this._dbusProxy.init_finish(result);
                loaded = true;
-            } catch (e) {
+            } catch(e) {
                if (e.matches(Gio.DBusError, Gio.DBusError.TIMED_OUT)) {
                    // Ignore timeouts and install signals as normal, because with high
                    // probability the service will appear later on, and we will get a
@@ -178,7 +178,7 @@ var DBusEventSource = class DBusEventSource {
                    // about the HasCalendars property and would cause an exception trying
                    // to read it)
                } else {
-                    log(`Error loading calendars: ${e.message}`);
+                    log('Error loading calendars: ' + e.message);
                    return;
                }
            }
@@ -221,13 +221,13 @@ var DBusEventSource = class DBusEventSource {
        this._lastRequestEnd = null;
    }

-    _onNameAppeared() {
+    _onNameAppeared(owner) {
        this._initialized = true;
        this._resetCache();
        this._loadEvents(true);
    }

-    _onNameVanished() {
+    _onNameVanished(oldOwner) {
        this._resetCache();
        this.emit('changed');
    }
@@ -236,20 +236,22 @@ var DBusEventSource = class DBusEventSource {
        this._loadEvents(false);
    }

-    _onEventsReceived(results, _error) {
+    _onEventsReceived(results, error) {
        let newEvents = [];
-        let appointments = results[0] || [];
-        for (let n = 0; n < appointments.length; n++) {
-            let a = appointments[n];
-            let date = new Date(a[4] * 1000);
-            let end = new Date(a[5] * 1000);
-            let id = a[0];
-            let summary = a[1];
-            let allDay = a[3];
-            let event = new CalendarEvent(id, date, end, summary, allDay);
-            newEvents.push(event);
+        let appointments = results ? results[0] : null;
+        if (appointments != null) {
+            for (let n = 0; n < appointments.length; n++) {
+                let a = appointments[n];
+                let date = new Date(a[4] * 1000);
+                let end = new Date(a[5] * 1000);
+                let id = a[0];
+                let summary = a[1];
+                let allDay = a[3];
+                let event = new CalendarEvent(id, date, end, summary, allDay);
+                newEvents.push(event);
+            }
+            newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());
        }
-        newEvents.sort((ev1, ev2) => ev1.date.getTime() - ev2.date.getTime());

        this._events = newEvents;
        this.isLoading = false;
@@ -261,7 +263,7 @@ var DBusEventSource = class DBusEventSource {
        if (!this._initialized)
            return;

-        if (this._curRequestBegin && this._curRequestEnd) {
+        if (this._curRequestBegin && this._curRequestEnd){
            this._dbusProxy.GetEventsRemote(this._curRequestBegin.getTime() / 1000,
                                            this._curRequestEnd.getTime() / 1000,
                                            forceReload,
@@ -283,7 +285,7 @@ var DBusEventSource = class DBusEventSource {

    getEvents(begin, end) {
        let result = [];
-        for (let n = 0; n < this._events.length; n++) {
+        for(let n = 0; n < this._events.length; n++) {
            let event = this._events[n];

            if (_dateIntervalsOverlap (event.date, event.end, begin, end)) {
@@ -318,7 +320,7 @@ var Calendar = class Calendar {
        this._weekStart = Shell.util_get_week_start();
        this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.calendar' });

-        this._settings.connect(`changed::${SHOW_WEEKDATE_KEY}`, this._onSettingsChange.bind(this));
+        this._settings.connect('changed::' + SHOW_WEEKDATE_KEY, this._onSettingsChange.bind(this));
        this._useWeekdate = this._settings.get_boolean(SHOW_WEEKDATE_KEY);

        /**
@@ -400,8 +402,8 @@ var Calendar = class Calendar {
        this._topBox.add(this._backButton);
        this._backButton.connect('clicked', this._onPrevMonthButtonClicked.bind(this));

-        this._monthLabel = new St.Label({ style_class: 'calendar-month-label',
-                                          can_focus: true });
+        this._monthLabel = new St.Label({style_class: 'calendar-month-label',
+                                         can_focus: true });
        this._topBox.add(this._monthLabel, { expand: true, x_fill: false, x_align: St.Align.MIDDLE });

        this._forwardButton = new St.Button({ style_class: 'calendar-change-month-forward pager-button',
@@ -464,7 +466,8 @@ var Calendar = class Calendar {
                let day = 32 - new Date(newDate.getFullYear() - 1, 11, 32).getDate();
                newDate = new Date(newDate.getFullYear() - 1, 11, day);
            }
-        } else {
+        }
+        else {
            newDate.setMonth(oldMonth - 1);
            if (newDate.getMonth() != oldMonth - 1) {
                let day = 32 - new Date(newDate.getFullYear(), oldMonth - 1, 32).getDate();
@@ -487,7 +490,8 @@ var Calendar = class Calendar {
                let day = 32 - new Date(newDate.getFullYear() + 1, 0, 32).getDate();
                newDate = new Date(newDate.getFullYear() + 1, 0, day);
            }
-        } else {
+        }
+        else {
            newDate.setMonth(oldMonth + 1);
            if (newDate.getMonth() != oldMonth + 1) {
                let day = 32 - new Date(newDate.getFullYear(), oldMonth + 1, 32).getDate();
@@ -542,6 +546,8 @@ var Calendar = class Calendar {
        this._calendarBegin = new Date(beginDate);
        this._markedAsToday = now;

+        let year = beginDate.getYear();
+
        let daysToWeekStart = (7 + beginDate.getDay() - this._weekStart) % 7;
        let startsOnWeekStart = daysToWeekStart == 0;
        let weekPadding = startsOnWeekStart ? 7 : 0;
@@ -553,7 +559,7 @@ var Calendar = class Calendar {
        let row = 2;
        // nRows here means 6 weeks + one header + one navbar
        let nRows = 8;
-        while (row < nRows) {
+        while (row < 8) {
            // xgettext:no-javascript-format
            let button = new St.Button({ label: iter.toLocaleFormat(C_("date day number format", "%d")),
                                         can_focus: true });
@@ -579,12 +585,12 @@ var Calendar = class Calendar {

            // Hack used in lieu of border-collapse - see gnome-shell.css
            if (row == 2)
-                styleClass = `calendar-day-top ${styleClass}`;
+                styleClass = 'calendar-day-top ' + styleClass;

            let leftMost = rtl ? iter.getDay() == (this._weekStart + 6) % 7
                               : iter.getDay() == this._weekStart;
            if (leftMost)
-                styleClass = `calendar-day-left ${styleClass}`;
+                styleClass = 'calendar-day-left ' + styleClass;

            if (sameDay(now, iter))
                styleClass += ' calendar-today';
@@ -642,9 +648,9 @@ var Calendar = class Calendar {
                button.add_style_pseudo_class('selected');
                if (this._shouldDateGrabFocus)
                    button.grab_key_focus();
-            } else {
-                button.remove_style_pseudo_class('selected');
            }
+            else
+                button.remove_style_pseudo_class('selected');
        });
    }
 };
@@ -735,7 +741,7 @@ class NotificationMessage extends MessageList.Message {
            return this.notification.source.createIcon(MESSAGE_ICON_SIZE);
    }

-    _onUpdated(n, _clear) {
+    _onUpdated(n, clear) {
        this.setIcon(this._getIcon());
        this.setTitle(n.title);
        this.setBody(n.bannerBodyText);
@@ -1071,7 +1077,7 @@ var CalendarMessageList = class CalendarMessageList {
        this._clearButton.set_x_align(Clutter.ActorAlign.END);
        this._clearButton.connect('clicked', () => {
            let sections = [...this._sections.keys()];
-            sections.forEach((s) => s.clear());
+            sections.forEach((s) => { s.clear(); });
        });
        box.add_actor(this._clearButton);

@@ -1097,7 +1103,7 @@ var CalendarMessageList = class CalendarMessageList {
    _addSection(section) {
        let obj = {
            destroyId: 0,
-            visibleId: 0,
+            visibleId:  0,
            emptyChangedId: 0,
            canClearChangedId: 0,
            keyFocusId: 0
--- a/js/ui/checkBox.js
+++ b/js/ui/checkBox.js
@@ -1,4 +1,3 @@
-/* exported CheckBox */
 const { Clutter, Pango, St } = imports.gi;

 var CheckBox = class CheckBox {
--- a/js/ui/closeDialog.js
+++ b/js/ui/closeDialog.js
@@ -1,17 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CloseDialog */

 const { Clutter, Gio, GLib, GObject, Meta, Shell } = imports.gi;

 const Dialog = imports.ui.dialog;
 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

-var FROZEN_WINDOW_BRIGHTNESS = -0.3;
-var DIALOG_TRANSITION_TIME = 150;
+var FROZEN_WINDOW_BRIGHTNESS = -0.3
+var DIALOG_TRANSITION_TIME = 0.15
 var ALIVE_TIMEOUT = 5000;

 var CloseDialog = GObject.registerClass({
-    Implements: [Meta.CloseDialog],
+    Implements: [ Meta.CloseDialog ],
    Properties: {
        'window': GObject.ParamSpec.override('window', Meta.CloseDialog)
    },
@@ -56,12 +56,12 @@ var CloseDialog = GObject.registerClass({
        this._dialog.height = windowActor.height;

        this._dialog.addContent(this._createDialogContent());
-        this._dialog.addButton({ label: _('Force Quit'),
-                                 action: this._onClose.bind(this),
+        this._dialog.addButton({ label:   _('Force Quit'),
+                                 action:  this._onClose.bind(this),
                                 default: true });
-        this._dialog.addButton({ label: _('Wait'),
+        this._dialog.addButton({ label:  _('Wait'),
                                 action: this._onWait.bind(this),
-                                 key: Clutter.Escape });
+                                 key:    Clutter.Escape });

        global.focus_manager.add_group(this._dialog);
    }
@@ -148,12 +148,12 @@ var CloseDialog = GObject.registerClass({
        this._dialog.scale_y = 0;
        this._dialog.set_pivot_point(0.5, 0.5);

-        this._dialog.ease({
-            scale_y: 1,
-            mode: Clutter.AnimationMode.LINEAR,
-            duration: DIALOG_TRANSITION_TIME,
-            onComplete: this._onFocusChanged.bind(this)
-        });
+        Tweener.addTween(this._dialog,
+                         { scale_y: 1,
+                           transition: 'linear',
+                           time: DIALOG_TRANSITION_TIME,
+                           onComplete: this._onFocusChanged.bind(this)
+                         });
    }

    vfunc_hide() {
@@ -165,7 +165,7 @@ var CloseDialog = GObject.registerClass({
        GLib.source_remove(this._timeoutId);
        this._timeoutId = 0;

-        global.display.disconnect(this._windowFocusChangedId);
+        global.display.disconnect(this._windowFocusChangedId)
        this._windowFocusChangedId = 0;

        global.stage.disconnect(this._keyFocusChangedId);
@@ -175,12 +175,14 @@ var CloseDialog = GObject.registerClass({
        this._dialog = null;
        this._removeWindowEffect();

-        dialog.ease({
-            scale_y: 0,
-            mode: Clutter.AnimationMode.LINEAR,
-            duration: DIALOG_TRANSITION_TIME,
-            onComplete: () => dialog.destroy()
-        });
+        Tweener.addTween(dialog,
+                         { scale_y: 0,
+                           transition: 'linear',
+                           time: DIALOG_TRANSITION_TIME,
+                           onComplete: () => {
+                               dialog.destroy();
+                           }
+                         });
    }

    vfunc_focus() {
--- a/js/ui/components/init.js
+++ b/js/ui/components/init.js
@@ -1,4 +1,3 @@
-/* exported ComponentManager */
 const Main = imports.ui.main;

 var ComponentManager = class {
@@ -14,13 +13,13 @@ var ComponentManager = class {
        let newEnabledComponents = Main.sessionMode.components;

        newEnabledComponents.filter(
-            name => !this._enabledComponents.includes(name)
+            name => this._enabledComponents.indexOf(name) == -1
        ).forEach(name => {
            this._enableComponent(name);
        });

        this._enabledComponents.filter(
-            name => !newEnabledComponents.includes(name)
+            name => newEnabledComponents.indexOf(name) == -1
        ).forEach(name => {
            this._disableComponent(name);
        });
@@ -38,8 +37,8 @@ var ComponentManager = class {
        if (component)
            return component;

-        if (Main.sessionMode.isLocked)
-            return null;
+	if (Main.sessionMode.isLocked)
+	    return null;

        let constructor = this._importComponent(name);
        component = new constructor();
@@ -49,7 +48,7 @@ var ComponentManager = class {

    _enableComponent(name) {
        let component = this._ensureComponent(name);
-        if (component)
+	if (component)
            component.enable();
    }

--- a/js/ui/components/automountManager.js
+++ b/js/ui/components/automountManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Gio, GLib } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -56,7 +55,7 @@ var AutomountManager = class {
        }
    }

-    _InhibitorsChanged(_object, _senderName, [_inhibitor]) {
+    _InhibitorsChanged(object, senderName, [inhibtor]) {
        this._session.IsInhibitedRemote(GNOME_SESSION_AUTOMOUNT_INHIBIT,
            (result, error) => {
                if (!error) {
@@ -110,23 +109,25 @@ var AutomountManager = class {
        // we force stop/eject in this case, so we don't have to pass a
        // mount operation object
        if (drive.can_stop()) {
-            drive.stop(Gio.MountUnmountFlags.FORCE, null, null,
-                (drive, res) => {
-                    try {
-                        drive.stop_finish(res);
-                    } catch (e) {
-                        log(`Unable to stop the drive after drive-eject-button ${e.toString()}`);
-                    }
-                });
+            drive.stop
+                (Gio.MountUnmountFlags.FORCE, null, null,
+                 (drive, res) => {
+                     try {
+                         drive.stop_finish(res);
+                     } catch (e) {
+                         log("Unable to stop the drive after drive-eject-button " + e.toString());
+                     }
+                 });
        } else if (drive.can_eject()) {
-            drive.eject_with_operation(Gio.MountUnmountFlags.FORCE, null, null,
-                (drive, res) => {
-                    try {
-                        drive.eject_with_operation_finish(res);
-                    } catch (e) {
-                        log(`Unable to eject the drive after drive-eject-button ${e.toString()}`);
-                    }
-                });
+            drive.eject_with_operation 
+                (Gio.MountUnmountFlags.FORCE, null, null,
+                 (drive, res) => {
+                     try {
+                         drive.eject_with_operation_finish(res);
+                     } catch (e) {
+                         log("Unable to eject the drive after drive-eject-button " + e.toString());
+                     }
+                 });
        }
    }

@@ -212,7 +213,7 @@ var AutomountManager = class {
                }

                if (!e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.FAILED_HANDLED))
-                    log(`Unable to mount volume ${volume.get_name()}: ${e.toString()}`);
+                    log('Unable to mount volume ' + volume.get_name() + ': ' + e.toString());
                this._closeOperation(volume);
            }
        }
--- a/js/ui/components/autorunManager.js
+++ b/js/ui/components/autorunManager.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Gio, St } = imports.gi;

@@ -41,7 +40,7 @@ function isMountRootHidden(root) {
    let path = root.get_path();

    // skip any mounts in hidden directory hierarchies
-    return (path.includes('/.'));
+    return (path.indexOf('/.') != -1);
 }

 function isMountNonLocal(mount) {
@@ -66,7 +65,8 @@ function startAppForMount(app, mount) {
        retval = app.launch(files, 
                            global.create_app_launch_context(0, -1));
    } catch (e) {
-        log(`Unable to launch the application ${app.get_name()}: ${e}`);
+        log('Unable to launch the application ' + app.get_name()
+            + ': ' + e.toString());
    }

    return retval;
@@ -107,7 +107,8 @@ var ContentTypeDiscoverer = class {
        try {
            contentTypes = mount.guess_content_type_finish(res);
        } catch (e) {
-            log(`Unable to guess content types on added mount ${mount.get_name()}: ${e}`);
+            log('Unable to guess content types on added mount ' + mount.get_name()
+                + ': ' + e.toString());
        }

        if (contentTypes.length) {
@@ -123,7 +124,10 @@ var ContentTypeDiscoverer = class {
        }
    }

-    _emitCallback(mount, contentTypes = []) {
+    _emitCallback(mount, contentTypes) {
+        if (!contentTypes)
+            contentTypes = [];
+
        // we're not interested in win32 software content types here
        contentTypes = contentTypes.filter(
            type => (type != 'x-content/win32-software')
@@ -188,15 +192,15 @@ var AutorunDispatcher = class {

    _getAutorunSettingForType(contentType) {
        let runApp = this._settings.get_strv(SETTING_START_APP);
-        if (runApp.includes(contentType))
+        if (runApp.indexOf(contentType) != -1)
            return AutorunSetting.RUN;

        let ignore = this._settings.get_strv(SETTING_IGNORE);
-        if (ignore.includes(contentType))
+        if (ignore.indexOf(contentType) != -1)
            return AutorunSetting.IGNORE;

        let openFiles = this._settings.get_strv(SETTING_OPEN_FOLDER);
-        if (openFiles.includes(contentType))
+        if (openFiles.indexOf(contentType) != -1)
            return AutorunSetting.FILES;

        return AutorunSetting.ASK;
--- a/js/ui/components/keyring.js
+++ b/js/ui/components/keyring.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gcr, Gio, GObject, Pango, Shell, St } = imports.gi;

@@ -163,7 +162,7 @@ class KeyringDialog extends ModalDialog.ModalDialog {
        // NOTE: ModalDialog.open() is safe to call if the dialog is
        // already open - it just returns true without side-effects
        if (this.open())
-            return true;
+          return true;

        // The above fail if e.g. unable to get input grab
        //
@@ -173,25 +172,25 @@ class KeyringDialog extends ModalDialog.ModalDialog {

        log('keyringPrompt: Failed to show modal dialog.' +
            ' Dismissing prompt request');
-        this.prompt.cancel();
+        this.prompt.cancel()
        return false;
    }

-    _onShowPassword() {
+    _onShowPassword(prompt) {
        this._buildControlTable();
        this._ensureOpen();
        this._updateSensitivity(true);
        this._passwordEntry.grab_key_focus();
    }

-    _onShowConfirm() {
+    _onShowConfirm(prompt) {
        this._buildControlTable();
        this._ensureOpen();
        this._updateSensitivity(true);
        this._continueButton.grab_key_focus();
    }

-    _onHidePrompt() {
+    _onHidePrompt(prompt) {
        this.close();
    }

--- a/js/ui/components/networkAgent.js
+++ b/js/ui/components/networkAgent.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gio, GLib, GObject, NM, Pango, Shell, St } = imports.gi;
 const Signals = imports.signals;
@@ -81,9 +80,8 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
                        secret.valid = secret.value.length > 0;
                    this._updateOkButton();
                });
-            } else {
+            } else
                secret.valid = true;
-            }

            if (rtl) {
                layout.attach(secret.entry, 0, pos, 1, 1);
@@ -107,19 +105,19 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
            descriptionLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;

            contentBox.messageBox.add(descriptionLabel,
-                                      { y_fill: true,
+                                      { y_fill:  true,
                                        y_align: St.Align.START,
                                        expand: true });
        }

-        this._okButton = { label: _("Connect"),
+        this._okButton = { label:  _("Connect"),
                           action: this._onOk.bind(this),
                           default: true
                         };

        this.setButtons([{ label: _("Cancel"),
                           action: this.cancel.bind(this),
-                           key: Clutter.KEY_Escape,
+                           key:    Clutter.KEY_Escape,
                         },
                         this._okButton]);

@@ -178,29 +176,28 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
        let value = secret.value;
        if (secret.wep_key_type == NM.WepKeyType.KEY) {
            if (value.length == 10 || value.length == 26) {
-                for (let i = 0; i < value.length; i++) {
+		for (let i = 0; i < value.length; i++) {
                    if (!((value[i] >= 'a' && value[i] <= 'f')
                          || (value[i] >= 'A' && value[i] <= 'F')
                          || (value[i] >= '0' && value[i] <= '9')))
                        return false;
-                }
-            } else if (value.length == 5 || value.length == 13) {
-                for (let i = 0; i < value.length; i++) {
+		}
+	    } else if (value.length == 5 || value.length == 13) {
+		for (let i = 0; i < value.length; i++) {
                    if (!((value[i] >= 'a' && value[i] <= 'z')
                          || (value[i] >= 'A' && value[i] <= 'Z')))
                        return false;
                }
-            } else {
+            } else
                return false;
-            }
-        } else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) {
-            if (value.length < 0 || value.length > 64)
-                return false;
-        }
+	} else if (secret.wep_key_type == NM.WepKeyType.PASSPHRASE) {
+	    if (value.length < 0 || value.length > 64)
+	        return false;
+	}
        return true;
    }

-    _getWirelessSecrets(secrets, _wirelessSetting) {
+    _getWirelessSecrets(secrets, wirelessSetting) {
        let wirelessSecuritySetting = this._connection.get_setting_wireless_security();

        if (this._settingName == '802-1x') {
@@ -217,7 +214,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
                           validate: this._validateWpaPsk, password: true });
            break;
        case 'none': // static WEP
-            secrets.push({ label: _("Key: "), key: `wep-key${wirelessSecuritySetting.wep_tx_keyidx}`,
+            secrets.push({ label: _("Key: "), key: 'wep-key' + wirelessSecuritySetting.wep_tx_keyidx,
                           value: wirelessSecuritySetting.get_wep_key(wirelessSecuritySetting.wep_tx_keyidx) || '',
                           wep_key_type: wirelessSecuritySetting.wep_key_type,
                           validate: this._validateStaticWep, password: true });
@@ -233,12 +230,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
            this._get8021xSecrets(secrets);
            break;
        default:
-            log(`Invalid wireless key management: ${wirelessSecuritySetting.key_mgmt}`);
+            log('Invalid wireless key management: ' + wirelessSecuritySetting.key_mgmt);
        }
    }

    _get8021xSecrets(secrets) {
        let ieee8021xSetting = this._connection.get_setting_802_1x();
+        let phase2method;

        /* If hints were given we know exactly what we need to ask */
        if (this._settingName == "802-1x" && this._hints.length) {
@@ -275,7 +273,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
                           value: ieee8021xSetting.private_key_password || '', password: true });
            break;
        default:
-            log(`Invalid EAP/IEEE802.1x method: ${ieee8021xSetting.get_eap_method(0)}`);
+            log('Invalid EAP/IEEE802.1x method: ' + ieee8021xSetting.get_eap_method(0));
        }
    }

@@ -306,13 +304,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
        let ssid;

        let content = { };
-        content.secrets = [];
+        content.secrets = [ ];

        switch (connectionType) {
        case '802-11-wireless':
            wirelessSetting = this._connection.get_setting_wireless();
            ssid = NM.utils_ssid_to_utf8(wirelessSetting.get_ssid().get_data());
-            content.title = _("Authentication required by wireless network");
+            content.title = _("Authentication required");
            content.message = _("Passwords or encryption keys are required to access the wireless network “%s”.").format(ssid);
            this._getWirelessSecrets(content.secrets, wirelessSetting);
            break;
@@ -329,7 +327,7 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
            this._getPPPoESecrets(content.secrets);
            break;
        case 'gsm':
-            if (this._hints.includes('pin')) {
+            if (this._hints.indexOf('pin') != -1) {
                let gsmSetting = this._connection.get_setting_gsm();
                content.title = _("PIN code required");
                content.message = _("PIN code is needed for the mobile broadband device");
@@ -340,13 +338,13 @@ class NetworkSecretDialog extends ModalDialog.ModalDialog {
            // fall through
        case 'cdma':
        case 'bluetooth':
-            content.title = _("Mobile broadband network password");
+            content.title = _("Mobile broadband password");
            content.message = _("A password is required to connect to “%s”.").format(connectionSetting.get_id());
            this._getMobileSecrets(content.secrets, connectionType);
            break;
        default:
-            log(`Invalid connection type: ${connectionType}`);
-        }
+            log('Invalid connection type: ' + connectionType);
+        };

        return content;
    }
@@ -361,15 +359,16 @@ var VPNRequestHandler = class {
        this._pluginOutBuffer = [];
        this._title = null;
        this._description = null;
-        this._content = [];
+        this._content = [ ];
        this._shellDialog = null;

        let connectionSetting = connection.get_setting_connection();

-        let argv = [authHelper.fileName,
-                    '-u', connectionSetting.uuid,
-                    '-n', connectionSetting.id,
-                    '-s', serviceType];
+        let argv = [ authHelper.fileName,
+                     '-u', connectionSetting.uuid,
+                     '-n', connectionSetting.id,
+                     '-s', serviceType
+                   ];
        if (authHelper.externalUIMode)
            argv.push('--external-ui-mode');
        if (flags & NM.SecretAgentGetSecretsFlags.ALLOW_INTERACTION)
@@ -386,7 +385,7 @@ var VPNRequestHandler = class {
        this._newStylePlugin = authHelper.externalUIMode;

        try {
-            let [success_, pid, stdin, stdout, stderr] =
+            let [success, pid, stdin, stdout, stderr] =
                GLib.spawn_async_with_pipes(null, /* pwd */
                                            argv,
                                            null, /* envp */
@@ -408,7 +407,7 @@ var VPNRequestHandler = class {
                                                    this._vpnChildFinished.bind(this));

            this._writeConnection();
-        } catch (e) {
+        } catch(e) {
            logError(e, 'error while spawning VPN auth helper');

            this._agent.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
@@ -425,7 +424,7 @@ var VPNRequestHandler = class {
        } else {
            try {
                this._stdin.write('QUIT\n\n', null);
-            } catch (e) { /* ignore broken pipe errors */ }
+            } catch(e) { /* ignore broken pipe errors */ }
        }

        this.destroy();
@@ -445,7 +444,7 @@ var VPNRequestHandler = class {
        this._destroyed = true;
    }

-    _vpnChildFinished(pid, status, _requestObj) {
+    _vpnChildFinished(pid, status, requestObj) {
        this._childWatch = 0;
        if (this._newStylePlugin) {
            // For new style plugin, all work is done in the async reading functions
@@ -460,9 +459,8 @@ var VPNRequestHandler = class {
                this._agent.respond(this._requestId, Shell.NetworkAgentResponse.USER_CANCELED);
            else
                this._agent.respond(this._requestId, Shell.NetworkAgentResponse.CONFIRMED);
-        } else {
+        } else
            this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
-        }

        this.destroy();
    }
@@ -475,7 +473,7 @@ var VPNRequestHandler = class {
            if (line == '' && this._previousLine == '') {
                try {
                    this._stdin.write('QUIT\n\n', null);
-                } catch (e) { /* ignore broken pipe errors */ }
+                } catch(e) { /* ignore broken pipe errors */ }
            } else {
                this._agent.set_password(this._requestId, this._previousLine, line);
                this._previousLine = undefined;
@@ -487,7 +485,7 @@ var VPNRequestHandler = class {

    _readStdoutOldStyle() {
        this._dataStdout.read_line_async(GLib.PRIORITY_DEFAULT, null, (stream, result) => {
-            let [line, len_] = this._dataStdout.read_line_finish_utf8(result);
+            let [line, len] = this._dataStdout.read_line_finish_utf8(result);

            if (line == null) {
                // end of file
@@ -542,7 +540,7 @@ var VPNRequestHandler = class {
                                message: keyfile.get_string(VPN_UI_GROUP, 'Description'),
                                secrets: [] };

-            let [groups, len_] = keyfile.get_groups();
+            let [groups, len] = keyfile.get_groups();
            for (let i = 0; i < groups.length; i++) {
                if (groups[i] == VPN_UI_GROUP)
                    continue;
@@ -563,7 +561,7 @@ var VPNRequestHandler = class {
                    this._agent.set_password(this._requestId, groups[i], value);
                }
            }
-        } catch (e) {
+        } catch(e) {
            // No output is a valid case it means "both secrets are stored"
            if (data.length > 0) {
                logError(e, 'error while reading VPN plugin output keyfile');
@@ -589,15 +587,15 @@ var VPNRequestHandler = class {

        try {
            vpnSetting.foreach_data_item((key, value) => {
-                this._stdin.write(`DATA_KEY=${key}\n`, null);
-                this._stdin.write(`DATA_VAL=${value || ''}\n\n`, null);
+                this._stdin.write('DATA_KEY=' + key + '\n', null);
+                this._stdin.write('DATA_VAL=' + (value || '') + '\n\n', null);
            });
            vpnSetting.foreach_secret((key, value) => {
-                this._stdin.write(`SECRET_KEY=${key}\n`, null);
-                this._stdin.write(`SECRET_VAL=${value || ''}\n\n`, null);
+                this._stdin.write('SECRET_KEY=' + key + '\n', null);
+                this._stdin.write('SECRET_VAL=' + (value || '') + '\n\n', null);
            });
            this._stdin.write('DONE\n\n', null);
-        } catch (e) {
+        } catch(e) {
            logError(e, 'internal error while writing connection to helper');

            this._agent.respond(this._requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
@@ -621,9 +619,9 @@ var NetworkAgent = class {
        this._pluginDir = Gio.file_new_for_path(Config.VPNDIR);
        try {
            let monitor = this._pluginDir.monitor(Gio.FileMonitorFlags.NONE, null);
-            monitor.connect('changed', () => this._vpnCacheBuilt = false);
-        } catch (e) {
-            log(`Failed to create monitor for VPN plugin dir: ${e.message}`);
+            monitor.connect('changed', () => { this._vpnCacheBuilt = false; });
+        } catch(e) {
+            log('Failed to create monitor for VPN plugin dir: ' + e.message);
        }

        this._native.connect('new-request', this._newRequest.bind(this));
@@ -634,7 +632,7 @@ var NetworkAgent = class {
            try {
                this._native.init_finish(res);
                this._initialized = true;
-            } catch (e) {
+            } catch(e) {
                this._native = null;
                logError(e, 'error initializing the NetworkManager Agent');
            }
@@ -682,13 +680,12 @@ var NetworkAgent = class {
        let connectionSetting = connection.get_setting_connection();
        let connectionType = connectionSetting.get_connection_type();
        switch (connectionType) {
-        case '802-11-wireless': {
+        case '802-11-wireless':
            let wirelessSetting = connection.get_setting_wireless();
            let ssid = NM.utils_ssid_to_utf8(wirelessSetting.get_ssid().get_data());
-            title = _("Authentication required by wireless network");
+            title = _("Authentication required");
            body = _("Passwords or encryption keys are required to access the wireless network “%s”.").format(ssid);
            break;
-        }
        case '802-3-ethernet':
            title = _("Wired 802.1X authentication");
            body = _("A password is required to connect to “%s”.".format(connection.get_id()));
@@ -698,7 +695,8 @@ var NetworkAgent = class {
            body = _("A password is required to connect to “%s”.".format(connection.get_id()));
            break;
        case 'gsm':
-            if (hints.includes('pin')) {
+            if (hints.indexOf('pin') != -1) {
+                let gsmSetting = connection.get_setting_gsm();
                title = _("PIN code required");
                body = _("PIN code is needed for the mobile broadband device");
                break;
@@ -710,7 +708,7 @@ var NetworkAgent = class {
            body = _("A password is required to connect to “%s”.").format(connectionSetting.get_id());
            break;
        default:
-            log(`Invalid connection type: ${connectionType}`);
+            log('Invalid connection type: ' + connectionType);
            this._native.respond(requestId, Shell.NetworkAgentResponse.INTERNAL_ERROR);
            return;
        }
--- a/js/ui/components/polkitAgent.js
+++ b/js/ui/components/polkitAgent.js
@@ -1,8 +1,8 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { AccountsService, Clutter, Gio, GLib,
        GObject, Pango, PolkitAgent, Polkit, Shell, St } = imports.gi;
+const Signals = imports.signals;

 const Animation = imports.ui.animation;
 const Dialog = imports.ui.dialog;
@@ -39,19 +39,19 @@ var AuthenticationDialog = GObject.registerClass({
        this.contentLayout.add_actor(content);

        if (userNames.length > 1) {
-            log(`polkitAuthenticationAgent: Received ${userNames.length} ` +
-                'identities that can be used for authentication. Only ' +
+            log('polkitAuthenticationAgent: Received ' + userNames.length +
+                ' identities that can be used for authentication. Only ' +
                'considering one.');
        }

        let userName = GLib.get_user_name();
-        if (!userNames.includes(userName))
+        if (userNames.indexOf(userName) < 0)
            userName = 'root';
-        if (!userNames.includes(userName))
+        if (userNames.indexOf(userName) < 0)
            userName = userNames[0];

        this._user = AccountsService.UserManager.get_default().get_user(userName);
-        let userRealName = this._user.get_real_name();
+        let userRealName = this._user.get_real_name()
        this._userLoadedId = this._user.connect('notify::is_loaded',
                                                this._onUserChanged.bind(this));
        this._userChangedId = this._user.connect('changed',
@@ -78,15 +78,15 @@ var AuthenticationDialog = GObject.registerClass({
                                                       styleClass: 'polkit-dialog-user-icon' });
            this._userAvatar.actor.hide();
            userBox.add(this._userAvatar.actor,
-                        { x_fill: true,
-                          y_fill: false,
+                        { x_fill:  true,
+                          y_fill:  false,
                          x_align: St.Align.END,
                          y_align: St.Align.START });
            let userLabel = new St.Label(({ style_class: 'polkit-dialog-user-label',
                                            text: userRealName }));
            userBox.add(userLabel,
-                        { x_fill: true,
-                          y_fill: false,
+                        { x_fill:  true,
+                          y_fill:  false,
                          x_align: St.Align.END,
                          y_align: St.Align.MIDDLE });
        }
@@ -99,7 +99,7 @@ var AuthenticationDialog = GObject.registerClass({
        this._passwordBox.add(this._passwordLabel, { y_fill: false, y_align: St.Align.MIDDLE });
        this._passwordEntry = new St.Entry({ style_class: 'prompt-dialog-password-entry',
                                             text: "",
-                                             can_focus: true });
+                                             can_focus: true});
        ShellEntry.addContextMenu(this._passwordEntry, { isPassword: true });
        this._passwordEntry.clutter_text.connect('activate', this._onEntryActivate.bind(this));
        this._passwordBox.add(this._passwordEntry,
@@ -128,7 +128,7 @@ var AuthenticationDialog = GObject.registerClass({
         * gnome-shell.css sets the color to be transparent
         */
        this._nullMessageLabel = new St.Label({ style_class: 'prompt-dialog-null-label',
-                                                text: 'abc' });
+                                                text: 'abc'});
        this._nullMessageLabel.add_style_class_name('hidden');
        this._nullMessageLabel.clutter_text.ellipsize = Pango.EllipsizeMode.NONE;
        this._nullMessageLabel.clutter_text.line_wrap = true;
@@ -138,7 +138,7 @@ var AuthenticationDialog = GObject.registerClass({
        this._cancelButton = this.addButton({ label: _("Cancel"),
                                              action: this.cancel.bind(this),
                                              key: Clutter.Escape });
-        this._okButton = this.addButton({ label: _("Authenticate"),
+        this._okButton = this.addButton({ label:  _("Authenticate"),
                                          action: this._onAuthenticateButtonPressed.bind(this),
                                          default: true });

@@ -181,9 +181,9 @@ var AuthenticationDialog = GObject.registerClass({
            //
            // We could add retrying if this turns out to be a problem

-            log('polkitAuthenticationAgent: Failed to show modal dialog. ' +
-                `Dismissing authentication request for action-id ${this.actionId} ` +
-                `cookie ${this._cookie}`);
+            log('polkitAuthenticationAgent: Failed to show modal dialog.' +
+                ' Dismissing authentication request for action-id ' + this.actionId +
+                ' cookie ' + this._cookie);
            this._emitDone(true);
        }
    }
@@ -251,14 +251,14 @@ var AuthenticationDialog = GObject.registerClass({
        }
    }

-    _onSessionRequest(session, request, echoOn) {
+    _onSessionRequest(session, request, echo_on) {
        // Cheap localization trick
        if (request == 'Password:' || request == 'Password: ')
            this._passwordLabel.set_text(_("Password:"));
        else
            this._passwordLabel.set_text(request);

-        if (echoOn)
+        if (echo_on)
            this._passwordEntry.clutter_text.set_password_char('');
        else
            this._passwordEntry.clutter_text.set_password_char('\u25cf'); // ● U+25CF BLACK CIRCLE
@@ -343,7 +343,7 @@ var AuthenticationAgent = class {
    enable() {
        try {
            this._native.register();
-        } catch (e) {
+        } catch(e) {
            log('Failed to register AuthenticationAgent');
        }
    }
@@ -351,7 +351,7 @@ var AuthenticationAgent = class {
    disable() {
        try {
            this._native.unregister();
-        } catch (e) {
+        } catch(e) {
            log('Failed to unregister AuthenticationAgent');
        }
    }
@@ -384,11 +384,11 @@ var AuthenticationAgent = class {
        this._currentDialog.performAuthentication();
    }

-    _onCancel(_nativeAgent) {
+    _onCancel(nativeAgent) {
        this._completeRequest(false);
    }

-    _onDialogDone(_dialog, dismissed) {
+    _onDialogDone(dialog, dismissed) {
        this._completeRequest(dismissed);
    }

--- a/js/ui/components/telepathyClient.js
+++ b/js/ui/components/telepathyClient.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Component */

 const { Clutter, Gio, GLib, GObject, St } = imports.gi;
 const Lang = imports.lang;
@@ -9,7 +8,7 @@ var Tpl = null;
 var Tp = null;
 try {
    ({ TelepathyGLib: Tp, TelepathyLogger: Tpl } = imports.gi);
-} catch (e) {
+} catch(e) {
    log('Telepathy is not available, chat integration will be disabled.');
 }

@@ -41,8 +40,10 @@ var NotificationDirection = {
    RECEIVED: 'chat-received'
 };

+var N_ = s => s;
+
 function makeMessageFromTpMessage(tpMessage, direction) {
-    let [text, flags_] = tpMessage.to_text();
+    let [text, flags] = tpMessage.to_text();

    let timestamp = tpMessage.get_sent_timestamp();
    if (timestamp == 0)
@@ -88,7 +89,7 @@ var TelepathyComponent = class {
        try {
            this._client.register();
        } catch (e) {
-            throw new Error(`Could not register Telepathy client. Error: ${e}`);
+            throw new Error('Couldn\'t register Telepathy client. Error: \n' + e);
        }

        if (!this._client.account_manager.is_prepared(Tp.AccountManager.get_feature_quark_core()))
@@ -148,20 +149,20 @@ class TelepathyClient extends Tp.BaseClient {
            this._delegatedChannelsCb.bind(this));
    }

-    vfunc_observe_channels(...args) {
-        let [account, conn, channels, dispatchOp_, requests_, context] = args;
+    vfunc_observe_channels(account, conn, channels,
+                                     dispatchOp, requests, context) {
        let len = channels.length;
        for (let i = 0; i < len; i++) {
            let channel = channels[i];
-            let [targetHandle_, targetHandleType] = channel.get_handle();
+            let [targetHandle, targetHandleType] = channel.get_handle();

            if (channel.get_invalidated())
-                continue;
+              continue;

            /* Only observe contact text channels */
            if ((!(channel instanceof Tp.TextChannel)) ||
               targetHandleType != Tp.HandleType.CONTACT)
-                continue;
+               continue;

            this._createChatSource(account, conn, channel, channel.get_target_contact());
        }
@@ -181,8 +182,8 @@ class TelepathyClient extends Tp.BaseClient {
        });
    }

-    vfunc_handle_channels(...args) {
-        let [account, conn, channels, requests_, userActionTime_, context] = args;
+    vfunc_handle_channels(account, conn, channels, requests,
+                                    user_action_time, context) {
        this._handlingChannels(account, conn, channels, true);
        context.accept();
    }
@@ -199,7 +200,7 @@ class TelepathyClient extends Tp.BaseClient {
            }

            if (channel.get_invalidated())
-                continue;
+              continue;

            // 'notify' will be true when coming from an actual HandleChannels
            // call, and not when from a successful Claim call. The point is
@@ -221,8 +222,8 @@ class TelepathyClient extends Tp.BaseClient {
        }
    }

-    vfunc_add_dispatch_operation(...args) {
-        let [account, conn, channels, dispatchOp, context] = args;
+    vfunc_add_dispatch_operation(account, conn, channels,
+                                           dispatchOp, context) {
        let channel = channels[0];
        let chanType = channel.get_channel_type();

@@ -240,7 +241,7 @@ class TelepathyClient extends Tp.BaseClient {
    }

    _approveTextChannel(account, conn, channel, dispatchOp, context) {
-        let [targetHandle_, targetHandleType] = channel.get_handle();
+        let [targetHandle, targetHandleType] = channel.get_handle();

        if (targetHandleType != Tp.HandleType.CONTACT) {
            context.fail(new Tp.Error({ code: Tp.Error.INVALID_ARGUMENT,
@@ -254,14 +255,14 @@ class TelepathyClient extends Tp.BaseClient {
                dispatchOp.claim_with_finish(result);
                this._handlingChannels(account, conn, [channel], false);
            } catch (err) {
-                log(`Failed to Claim channel: ${err}`);
+                log('Failed to Claim channel: ' + err);
            }
        });

        context.accept();
    }

-    _delegatedChannelsCb(_client, _channels) {
+    _delegatedChannelsCb(client, channels) {
        // Nothing to do as we don't make a distinction between observed and
        // handled channels.
    }
@@ -361,28 +362,28 @@ var ChatSource = class extends MessageTray.Source {
        let presenceType = this._contact.get_presence_type();

        switch (presenceType) {
-        case Tp.ConnectionPresenceType.AVAILABLE:
-            iconName = 'user-available';
-            break;
-        case Tp.ConnectionPresenceType.BUSY:
-            iconName = 'user-busy';
-            break;
-        case Tp.ConnectionPresenceType.OFFLINE:
-            iconName = 'user-offline';
-            break;
-        case Tp.ConnectionPresenceType.HIDDEN:
-            iconName = 'user-invisible';
-            break;
-        case Tp.ConnectionPresenceType.AWAY:
-            iconName = 'user-away';
-            break;
-        case Tp.ConnectionPresenceType.EXTENDED_AWAY:
-            iconName = 'user-idle';
-            break;
-        default:
-            iconName = 'user-offline';
-        }
-        return new Gio.ThemedIcon({ name: iconName });
+            case Tp.ConnectionPresenceType.AVAILABLE:
+                iconName = 'user-available';
+                break;
+            case Tp.ConnectionPresenceType.BUSY:
+                iconName = 'user-busy';
+                break;
+            case Tp.ConnectionPresenceType.OFFLINE:
+                iconName = 'user-offline';
+                break;
+            case Tp.ConnectionPresenceType.HIDDEN:
+                iconName = 'user-invisible';
+                break;
+            case Tp.ConnectionPresenceType.AWAY:
+                iconName = 'user-away';
+                break;
+            case Tp.ConnectionPresenceType.EXTENDED_AWAY:
+                iconName = 'user-idle';
+                break;
+            default:
+                iconName = 'user-offline';
+       }
+       return new Gio.ThemedIcon({ name: iconName });
    }

    _updateAvatarIcon() {
@@ -428,7 +429,7 @@ var ChatSource = class extends MessageTray.Source {
    }

    _displayPendingMessages(logManager, result) {
-        let [success_, events] = logManager.get_filtered_events_finish(result);
+        let [success, events] = logManager.get_filtered_events_finish(result);

        let logMessages = events.map(makeMessageFromTplEvent);
        this._ensureNotification();
@@ -563,7 +564,7 @@ var ChatSource = class extends MessageTray.Source {

    // This is called for both messages we send from
    // our client and other clients as well.
-    _messageSent(channel, message, _flags, _token) {
+    _messageSent(channel, message, flags, token) {
        this._ensureNotification();
        message = makeMessageFromTpMessage(message, NotificationDirection.SENT);
        this._notification.appendMessage(message);
@@ -596,12 +597,12 @@ var ChatSource = class extends MessageTray.Source {
        // keep track of it with the ChatStateChanged signal but it is good
        // enough right now.
        if (state != this._chatState) {
-            this._chatState = state;
-            this._channel.set_chat_state_async(state, null);
+          this._chatState = state;
+          this._channel.set_chat_state_async(state, null);
        }
    }

-    _presenceChanged(_contact, _presence, _status, _message) {
+    _presenceChanged(contact, presence, status, message) {
        if (this._notification)
            this._notification.update(this._notification.title,
                                      this._notification.bannerBodyText,
--- a/js/ui/ctrlAltTab.js
+++ b/js/ui/ctrlAltTab.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CtrlAltTabManager */

 const { Clutter, GObject, Meta, Shell, St } = imports.gi;

@@ -8,6 +7,7 @@ const SwitcherPopup = imports.ui.switcherPopup;
 const Params = imports.misc.params;

 var POPUP_APPICON_SIZE = 96;
+var POPUP_FADE_TIME = 0.1; // seconds

 var SortGroup = {
    TOP:    0,
@@ -33,7 +33,7 @@ var CtrlAltTabManager = class CtrlAltTabManager {
        item.iconName = icon;

        this._items.push(item);
-        root.connect('destroy', () => this.removeGroup(root));
+        root.connect('destroy', () => { this.removeGroup(root); });
        if (root instanceof St.Widget)
            global.focus_manager.add_group(root);
    }
@@ -64,8 +64,9 @@ var CtrlAltTabManager = class CtrlAltTabManager {
        if (a.sortGroup != b.sortGroup)
            return a.sortGroup - b.sortGroup;

-        let [ax] = a.proxy.get_transformed_position();
-        let [bx] = b.proxy.get_transformed_position();
+        let ax, bx, y;
+        [ax, y] = a.proxy.get_transformed_position();
+        [bx, y] = b.proxy.get_transformed_position();

        return ax - bx;
    }
--- a/js/ui/dash.js
+++ b/js/ui/dash.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Dash */

 const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -10,10 +9,11 @@ const AppFavorites = imports.ui.appFavorites;
 const DND = imports.ui.dnd;
 const IconGrid = imports.ui.iconGrid;
 const Main = imports.ui.main;
+const Tweener = imports.ui.tweener;

-var DASH_ANIMATION_TIME = 200;
-var DASH_ITEM_LABEL_SHOW_TIME = 150;
-var DASH_ITEM_LABEL_HIDE_TIME = 100;
+var DASH_ANIMATION_TIME = 0.2;
+var DASH_ITEM_LABEL_SHOW_TIME = 0.15;
+var DASH_ITEM_LABEL_HIDE_TIME = 0.1;
 var DASH_ITEM_HOVER_TIMEOUT = 300;

 function getAppFromSource(source) {
@@ -24,30 +24,6 @@ function getAppFromSource(source) {
    }
 }

-var DashIcon = class DashIcon extends AppDisplay.AppIcon {
-    constructor(app) {
-        super(app, {
-            setSizeManually: true,
-            showLabel: false
-        });
-    }
-
-    // Disable all DnD methods
-    _onDragBegin() {
-    }
-
-    _onDragEnd() {
-    }
-
-    handleDragOver() {
-        return DND.DragMotionResult.CONTINUE;
-    }
-
-    acceptDrop() {
-        return false;
-    }
-};
-
 // A container like StBin, but taking the child's scale into account
 // when requesting a size
 var DashItemContainer = GObject.registerClass(
@@ -55,24 +31,20 @@ class DashItemContainer extends St.Widget {
    _init() {
        super._init({ style_class: 'dash-item-container',
                      pivot_point: new Clutter.Point({ x: .5, y: .5 }),
-                      scale_x: 0,
-                      scale_y: 0,
-                      opacity: 0,
                      x_expand: true,
                      x_align: Clutter.ActorAlign.CENTER });

        this._labelText = "";
-        this.label = new St.Label({ style_class: 'dash-label' });
+        this.label = new St.Label({ style_class: 'dash-label'});
        this.label.hide();
        Main.layoutManager.addChrome(this.label);
        this.label_actor = this.label;

        this.child = null;
+        this._childScale = 0;
+        this._childOpacity = 0;
        this.animatingOut = false;

-        this.connect('notify::scale-x', () => this.queue_relayout());
-        this.connect('notify::scale-y', () => this.queue_relayout());
-
        this.connect('destroy', () => {
            if (this.child != null)
                this.child.destroy();
@@ -109,7 +81,7 @@ class DashItemContainer extends St.Widget {
        let itemHeight = this.allocation.y2 - this.allocation.y1;

        let labelHeight = this.label.get_height();
-        let yOffset = Math.floor((itemHeight - labelHeight) / 2);
+        let yOffset = Math.floor((itemHeight - labelHeight) / 2)

        let y = stageY + yOffset;

@@ -123,11 +95,11 @@ class DashItemContainer extends St.Widget {
            x = stageX + this.get_width() + xOffset;

        this.label.set_position(x, y);
-        this.label.ease({
-            opacity: 255,
-            duration: DASH_ITEM_LABEL_SHOW_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this.label,
+                         { opacity: 255,
+                           time: DASH_ITEM_LABEL_SHOW_TIME,
+                           transition: 'easeOutQuad',
+                         });
    }

    setLabelText(text) {
@@ -136,12 +108,14 @@ class DashItemContainer extends St.Widget {
    }

    hideLabel() {
-        this.label.ease({
-            opacity: 0,
-            duration: DASH_ITEM_LABEL_HIDE_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.label.hide()
-        });
+        Tweener.addTween(this.label,
+                         { opacity: 0,
+                           time: DASH_ITEM_LABEL_HIDE_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this.label.hide();
+                           }
+                         });
    }

    setChild(actor) {
@@ -152,6 +126,9 @@ class DashItemContainer extends St.Widget {

        this.child = actor;
        this.add_actor(this.child);
+
+        this.set_scale(this._childScale, this._childScale);
+        this.set_opacity(this._childOpacity);
    }

    show(animate) {
@@ -159,13 +136,12 @@ class DashItemContainer extends St.Widget {
            return;

        let time = animate ? DASH_ANIMATION_TIME : 0;
-        this.ease({
-            scale_x: 1,
-            scale_y: 1,
-            opacity: 255,
-            duration: time,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this,
+                         { childScale: 1.0,
+                           childOpacity: 255,
+                           time: time,
+                           transition: 'easeOutQuad'
+                         });
    }

    animateOutAndDestroy() {
@@ -177,14 +153,37 @@ class DashItemContainer extends St.Widget {
        }

        this.animatingOut = true;
-        this.ease({
-            scale_x: 0,
-            scale_y: 0,
-            opacity: 0,
-            duration: DASH_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.destroy()
-        });
+        Tweener.addTween(this,
+                         { childScale: 0.0,
+                           childOpacity: 0,
+                           time: DASH_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this.destroy();
+                           }
+                         });
+    }
+
+    set childScale(scale) {
+        this._childScale = scale;
+
+        this.set_scale(scale, scale);
+        this.queue_relayout();
+    }
+
+    get childScale() {
+        return this._childScale;
+    }
+
+    set childOpacity(opacity) {
+        this._childOpacity = opacity;
+
+        this.set_opacity(opacity);
+        this.queue_redraw();
+    }
+
+    get childOpacity() {
+        return this._childOpacity;
    }
 });

@@ -199,9 +198,9 @@ class ShowAppsIcon extends DashItemContainer {
                                            toggle_mode: true });
        this._iconActor = null;
        this.icon = new IconGrid.BaseIcon(_("Show Applications"),
-                                          { setSizeManually: true,
-                                            showLabel: false,
-                                            createIcon: this._createIcon.bind(this) });
+                                           { setSizeManually: true,
+                                             showLabel: false,
+                                             createIcon: this._createIcon.bind(this) });
        this.toggleButton.add_actor(this.icon);
        this.toggleButton._delegate = this;

@@ -242,14 +241,14 @@ class ShowAppsIcon extends DashItemContainer {
            this.setLabelText(_("Show Applications"));
    }

-    handleDragOver(source, _actor, _x, _y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        if (!this._canRemoveApp(getAppFromSource(source)))
            return DND.DragMotionResult.NO_DROP;

        return DND.DragMotionResult.MOVE_DROP;
    }

-    acceptDrop(source, _actor, _x, _y, _time) {
+    acceptDrop(source, actor, x, y, time) {
        let app = getAppFromSource(source);
        if (!this._canRemoveApp(app))
            return false;
@@ -297,7 +296,7 @@ class DashActor extends St.Widget {
        this.set_allocation(box, flags);

        let [appIcons, showAppsButton] = this.get_children();
-        let [, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);
+        let [showAppsMinHeight, showAppsNatHeight] = showAppsButton.get_preferred_height(availWidth);

        let childBox = new Clutter.ActorBox();
        childBox.x1 = contentBox.x1;
@@ -322,14 +321,14 @@ class DashActor extends St.Widget {
        let themeNode = this.get_theme_node();
        let adjustedForWidth = themeNode.adjust_for_width(forWidth);
        let [, showAppsButton] = this.get_children();
-        let [minHeight] = showAppsButton.get_preferred_height(adjustedForWidth);
-        [minHeight] = themeNode.adjust_preferred_height(minHeight, natHeight);
+        let [minHeight, ] = showAppsButton.get_preferred_height(adjustedForWidth);
+        [minHeight, ] = themeNode.adjust_preferred_height(minHeight, natHeight);

        return [minHeight, natHeight];
    }
 });

-const baseIconSizes = [16, 22, 24, 32, 48, 64];
+const baseIconSizes = [ 16, 22, 24, 32, 48, 64 ];

 var Dash = class Dash {
    constructor() {
@@ -352,7 +351,8 @@ var Dash = class Dash {
        this._container.set_offscreen_redirect(Clutter.OffscreenRedirect.ALWAYS);

        this._showAppsIcon = new ShowAppsIcon();
-        this._showAppsIcon.show(false);
+        this._showAppsIcon.childScale = 1;
+        this._showAppsIcon.childOpacity = 255;
        this._showAppsIcon.icon.setIconSize(this.iconSize);
        this._hookUpLabel(this._showAppsIcon);

@@ -474,7 +474,19 @@ var Dash = class Dash {
    }

    _createAppItem(app) {
-        let appIcon = new DashIcon(app);
+        let appIcon = new AppDisplay.AppIcon(app,
+                                             { setSizeManually: true,
+                                               showLabel: false });
+        if (appIcon._draggable) {
+            appIcon._draggable.connect('drag-begin',
+                                       () => {
+                                           appIcon.actor.opacity = 50;
+                                       });
+            appIcon._draggable.connect('drag-end',
+                                       () => {
+                                           appIcon.actor.opacity = 255;
+                                       });
+        }

        appIcon.connect('menu-state-changed',
                        (appIcon, opened) => {
@@ -621,12 +633,12 @@ var Dash = class Dash {
            icon.icon.set_size(icon.icon.width * scale,
                               icon.icon.height * scale);

-            icon.icon.ease({
-                width: targetWidth,
-                height: targetHeight,
-                time: DASH_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(icon.icon,
+                             { width: targetWidth,
+                               height: targetHeight,
+                               time: DASH_ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                             });
        }
    }

@@ -636,10 +648,10 @@ var Dash = class Dash {
        let running = this._appSystem.get_running();

        let children = this._box.get_children().filter(actor => {
-            return actor.child &&
-                   actor.child._delegate &&
-                   actor.child._delegate.app;
-        });
+                return actor.child &&
+                       actor.child._delegate &&
+                       actor.child._delegate.app;
+            });
        // Apps currently in the dash
        let oldApps = children.map(actor => actor.child._delegate.app);
        // Apps supposed to be in the dash
@@ -688,14 +700,14 @@ var Dash = class Dash {
            }

            // App removed at oldIndex
-            if (oldApp && !newApps.includes(oldApp)) {
+            if (oldApp && newApps.indexOf(oldApp) == -1) {
                removedActors.push(children[oldIndex]);
                oldIndex++;
                continue;
            }

            // App added at newIndex
-            if (newApp && !oldApps.includes(newApp)) {
+            if (newApp && oldApps.indexOf(newApp) == -1) {
                addedItems.push({ app: newApp,
                                  item: this._createAppItem(newApp),
                                  pos: newIndex });
@@ -778,7 +790,7 @@ var Dash = class Dash {
        }
    }

-    handleDragOver(source, actor, x, y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        let app = getAppFromSource(source);

        // Don't allow favoriting of transient apps
@@ -856,7 +868,7 @@ var Dash = class Dash {
    }

    // Draggable target interface
-    acceptDrop(source, _actor, _x, _y, _time) {
+    acceptDrop(source, actor, x, y, time) {
        let app = getAppFromSource(source);

        // Don't allow favoriting of transient apps
--- a/js/ui/dateMenu.js
+++ b/js/ui/dateMenu.js
@@ -1,7 +1,6 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported DateMenuButton */

-const { Clutter, Gio, GLib, GnomeDesktop,
+const { Clutter, GLib, GnomeDesktop,
        GObject, GWeather, Shell, St } = imports.gi;

 const Util = imports.misc.util;
@@ -11,13 +10,8 @@ const Calendar = imports.ui.calendar;
 const Weather = imports.misc.weather;
 const System = imports.system;

-const { loadInterfaceXML } = imports.misc.fileUtils;
-
 const MAX_FORECASTS = 5;

-const ClocksIntegrationIface = loadInterfaceXML('org.gnome.Shell.ClocksIntegration');
-const ClocksProxy = Gio.DBusProxy.makeProxyWrapper(ClocksIntegrationIface);
-
 function _isToday(date) {
    let now = new Date();
    return now.getYear() == date.getYear() &&
@@ -53,7 +47,7 @@ var TodayButton = class TodayButton {
        this._calendar.connect('selected-date-changed', (calendar, date) => {
            // Make the button reactive only if the selected date is not the
            // current date.
-            this.actor.reactive = !_isToday(date);
+            this.actor.reactive = !_isToday(date)
        });
    }

@@ -88,8 +82,7 @@ var WorldClocksSection = class WorldClocksSection {
                                     x_fill: true,
                                     can_focus: true });
        this.actor.connect('clicked', () => {
-            if (this._clocksApp)
-                this._clocksApp.activate();
+            this._clockAppMon.activateApp();

            Main.overview.hide();
            Main.panel.closeCalendar();
@@ -102,40 +95,29 @@ var WorldClocksSection = class WorldClocksSection {

        this.actor.child = this._grid;

-        this._clocksApp = null;
-        this._clocksProxy = new ClocksProxy(
-            Gio.DBus.session,
-            'org.gnome.clocks',
-            '/org/gnome/clocks',
-            this._onProxyReady.bind(this),
-            null /* cancellable */,
-            Gio.DBusProxyFlags.DO_NOT_AUTO_START | Gio.DBusProxyFlags.GET_INVALIDATED_PROPERTIES);
-
-        this._settings = new Gio.Settings({
-            schema_id: 'org.gnome.shell.world-clocks'
-        });
-        this._settings.connect('changed', this._clocksChanged.bind(this));
-        this._clocksChanged();
-
-        this._appSystem = Shell.AppSystem.get_default();
-        this._appSystem.connect('installed-changed',
-            this._sync.bind(this));
+        this._clockAppMon = new Util.AppSettingsMonitor('org.gnome.clocks.desktop',
+                                                        'org.gnome.clocks');
+        this._clockAppMon.connect('available-changed',
+                                  this._sync.bind(this));
+        this._clockAppMon.watchSetting('world-clocks',
+                                       this._clocksChanged.bind(this));
        this._sync();
    }

    _sync() {
-        this._clocksApp = this._appSystem.lookup_app('org.gnome.clocks.desktop');
-        this.actor.visible = this._clocksApp != null;
+        this.actor.visible = this._clockAppMon.available;
    }

-    _clocksChanged() {
+    _clocksChanged(settings) {
        this._grid.destroy_all_children();
        this._locations = [];

        let world = GWeather.Location.get_world();
-        let clocks = this._settings.get_value('locations').deep_unpack();
+        let clocks = settings.get_value('world-clocks').deep_unpack();
        for (let i = 0; i < clocks.length; i++) {
-            let l = world.deserialize(clocks[i]);
+            if (!clocks[i].location)
+                continue;
+            let l = world.deserialize(clocks[i].location);
            if (l && l.get_timezone() != null)
                this._locations.push({ location: l });
        }
@@ -214,25 +196,6 @@ var WorldClocksSection = class WorldClocksSection {
            l.actor.text = Util.formatTime(now, { timeOnly: true });
        }
    }
-
-    _onProxyReady(proxy, error) {
-        if (error) {
-            log(`Failed to create GNOME Clocks proxy: ${error}`);
-            return;
-        }
-
-        this._clocksProxy.connect('g-properties-changed',
-            this._onClocksPropertiesChanged.bind(this));
-        this._onClocksPropertiesChanged();
-    }
-
-    _onClocksPropertiesChanged() {
-        if (this._clocksProxy.g_name_owner == null)
-            return;
-
-        this._settings.set_value('locations',
-            new GLib.Variant('av', this._clocksProxy.Locations));
-    }
 };

 var WeatherSection = class WeatherSection {
@@ -254,7 +217,7 @@ var WeatherSection = class WeatherSection {
        });

        let box = new St.BoxLayout({ style_class: 'weather-box',
-                                     vertical: true });
+                                      vertical: true });

        this.actor.child = box;

@@ -286,12 +249,12 @@ var WeatherSection = class WeatherSection {
        let current = info;
        let infos = [info];
        for (let i = 0; i < forecasts.length; i++) {
-            let [ok_, timestamp] = forecasts[i].get_value_update();
+            let [ok, timestamp] = forecasts[i].get_value_update();
            let datetime = new Date(timestamp * 1000);
            if (!_isToday(datetime))
                continue; // Ignore forecasts from other days

-            [ok_, timestamp] = current.get_value_update();
+            [ok, timestamp] = current.get_value_update();
            let currenttime = new Date(timestamp * 1000);
            if (currenttime.getHours() == datetime.getHours())
                continue; // Enforce a minimum interval of 1h
@@ -312,7 +275,7 @@ var WeatherSection = class WeatherSection {

        let col = 0;
        infos.forEach(fc => {
-            let [ok_, timestamp] = fc.get_value_update();
+            let [ok, timestamp] = fc.get_value_update();
            let timeStr = Util.formatTime(new Date(timestamp * 1000), {
                timeOnly: true
            });
@@ -394,7 +357,7 @@ var MessagesIndicator = class MessagesIndicator {
        Main.messageTray.connect('queue-changed', this._updateCount.bind(this));

        let sources = Main.messageTray.getSources();
-        sources.forEach(source => this._onSourceAdded(null, source));
+        sources.forEach(source => { this._onSourceAdded(null, source); });
    }

    _onSourceAdded(tray, source) {
@@ -410,7 +373,7 @@ var MessagesIndicator = class MessagesIndicator {

    _updateCount() {
        let count = 0;
-        this._sources.forEach(source => count += source.unseenCount);
+        this._sources.forEach(source => { count += source.unseenCount; });
        count -= Main.messageTray.queueCount;

        this.actor.visible = (count > 0);
@@ -421,8 +384,8 @@ var IndicatorPad = GObject.registerClass(
 class IndicatorPad extends St.Widget {
    _init(actor) {
        this._source = actor;
-        this._source.connect('notify::visible', () => this.queue_relayout());
-        this._source.connect('notify::size', () => this.queue_relayout());
+        this._source.connect('notify::visible', () => { this.queue_relayout(); });
+        this._source.connect('notify::size', () => { this.queue_relayout(); });
        super._init();
    }

@@ -496,6 +459,7 @@ class CalendarColumnLayout extends Clutter.BoxLayout {
 var DateMenuButton = GObject.registerClass(
 class DateMenuButton extends PanelMenu.Button {
    _init() {
+        let item;
        let hbox;
        let vbox;

--- a/js/ui/dialog.js
+++ b/js/ui/dialog.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Dialog, MessageDialogContent */

 const { Clutter, Gio, GObject, Pango, St } = imports.gi;

@@ -26,9 +25,9 @@ class Dialog extends St.Widget {

    _createDialog() {
        this._dialog = new St.BoxLayout({ style_class: 'modal-dialog',
-                                          x_align: Clutter.ActorAlign.CENTER,
-                                          y_align: Clutter.ActorAlign.CENTER,
-                                          vertical: true });
+                                          x_align:     Clutter.ActorAlign.CENTER,
+                                          y_align:     Clutter.ActorAlign.CENTER,
+                                          vertical:    true });

        // modal dialogs are fixed width and grow vertically; set the request
        // mode accordingly so wrapped labels are handled correctly during
@@ -39,13 +38,13 @@ class Dialog extends St.Widget {
        this.contentLayout = new St.BoxLayout({ vertical: true,
                                                style_class: "modal-dialog-content-box" });
        this._dialog.add(this.contentLayout,
-                         { expand: true,
-                           x_fill: true,
-                           y_fill: true,
+                         { expand:  true,
+                           x_fill:  true,
+                           y_fill:  true,
                           x_align: St.Align.MIDDLE,
                           y_align: St.Align.START });

-        this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous: true }) });
+        this.buttonLayout = new St.Widget ({ layout_manager: new Clutter.BoxLayout({ homogeneous:true }) });
        this._dialog.add(this.buttonLayout,
                         { x_align: St.Align.MIDDLE,
                           y_align: St.Align.START });
@@ -117,11 +116,11 @@ class Dialog extends St.Widget {

        let button = new St.Button({ style_class: 'modal-dialog-linked-button',
                                     button_mask: St.ButtonMask.ONE | St.ButtonMask.THREE,
-                                     reactive: true,
-                                     can_focus: true,
-                                     x_expand: true,
-                                     y_expand: true,
-                                     label: label });
+                                     reactive:    true,
+                                     can_focus:   true,
+                                     x_expand:    true,
+                                     y_expand:    true,
+                                     label:       label });
        button.connect('clicked', action);

        buttonInfo['button'] = button;
@@ -181,8 +180,10 @@ var MessageDialogContent = GObject.registerClass({
        this._subtitle.clutter_text.set(textProps);
        this._body.clutter_text.set(textProps);

-        let defaultParams = { style_class: 'message-dialog-main-layout' };
-        super._init(Object.assign(defaultParams, params));
+        if (!params.hasOwnProperty('style_class'))
+            params.style_class = 'message-dialog-main-layout';
+
+        super._init(params);

        this.messageBox = new St.BoxLayout({ style_class: 'message-dialog-content',
                                             x_expand: true,
--- a/js/ui/dnd.js
+++ b/js/ui/dnd.js
@@ -1,18 +1,18 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported addDragMonitor, removeDragMonitor, makeDraggable */

 const { Clutter, GLib, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;

 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 // Time to scale down to maxDragActorSize
-var SCALE_ANIMATION_TIME = 250;
+var SCALE_ANIMATION_TIME = 0.25;
 // Time to animate to original position on cancel
-var SNAP_BACK_ANIMATION_TIME = 250;
+var SNAP_BACK_ANIMATION_TIME = 0.25;
 // Time to animate to original position on success
-var REVERT_ANIMATION_TIME = 750;
+var REVERT_ANIMATION_TIME = 0.75;

 var DragMotionResult = {
    NO_DROP:   0,
@@ -111,6 +111,9 @@ var _Draggable = class _Draggable {
        if (event.get_button() != 1)
            return Clutter.EVENT_PROPAGATE;

+        if (Tweener.getTweenCount(actor))
+            return Clutter.EVENT_PROPAGATE;
+
        this._buttonDown = true;
        this._grabActor(event.get_device());

@@ -136,6 +139,9 @@ var _Draggable = class _Draggable {
            !global.display.is_pointer_emulating_sequence(event.get_event_sequence()))
            return Clutter.EVENT_PROPAGATE;

+        if (Tweener.getTweenCount(actor))
+            return Clutter.EVENT_PROPAGATE;
+
        this._buttonDown = true;
        this._grabActor(event.get_device(), event.get_event_sequence());

@@ -422,22 +428,20 @@ var _Draggable = class _Draggable {
                // to the final position because that tween would
                // fight with updates as the user continues dragging
                // the mouse; instead we do the position computations in
-                // a ::new-frame handler.
-                this._dragActor.ease({
-                    scale_x: scale * origScale,
-                    scale_y: scale * origScale,
-                    duration: SCALE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-
-                this._dragActor.get_transition('scale-x').connect('new-frame', () => {
-                    let currentScale = this._dragActor.scale_x / origScale;
-                    this._dragOffsetX = currentScale * origDragOffsetX;
-                    this._dragOffsetY = currentScale * origDragOffsetY;
-                    this._dragActor.set_position(
-                        this._dragX + this._dragOffsetX,
-                        this._dragY + this._dragOffsetY);
-                });
+                // an onUpdate() function.
+                Tweener.addTween(this._dragActor,
+                                 { scale_x: scale * origScale,
+                                   scale_y: scale * origScale,
+                                   time: SCALE_ANIMATION_TIME,
+                                   transition: 'easeOutQuad',
+                                   onUpdate() {
+                                       let currentScale = this._dragActor.scale_x / origScale;
+                                       this._dragOffsetX = currentScale * origDragOffsetX;
+                                       this._dragOffsetY = currentScale * origDragOffsetY;
+                                       this._dragActor.set_position(this._dragX + this._dragOffsetX,
+                                                                    this._dragY + this._dragOffsetY);
+                                   },
+                                   onUpdateScope: this });
            }
        }
    }
@@ -500,7 +504,7 @@ var _Draggable = class _Draggable {

        while (target) {
            if (target._delegate && target._delegate.handleDragOver) {
-                let [r_, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
+                let [r, targX, targY] = target.transform_stage_point(this._dragX, this._dragY);
                // We currently loop through all parents on drag-over even if one of the children has handled it.
                // We can check the return value of the function and break the loop if it's true if we don't want
                // to continue checking the parents.
@@ -557,11 +561,11 @@ var _Draggable = class _Draggable {
            let dropFunc = dragMonitors[i].dragDrop;
            if (dropFunc)
                switch (dropFunc(dropEvent)) {
-                case DragDropResult.FAILURE:
-                case DragDropResult.SUCCESS:
-                    return true;
-                case DragDropResult.CONTINUE:
-                    continue;
+                    case DragDropResult.FAILURE:
+                    case DragDropResult.SUCCESS:
+                        return true;
+                    case DragDropResult.CONTINUE:
+                        continue;
                }
        }

@@ -572,7 +576,7 @@ var _Draggable = class _Draggable {

        while (target) {
            if (target._delegate && target._delegate.acceptDrop) {
-                let [r_, targX, targY] = target.transform_stage_point(dropX, dropY);
+                let [r, targX, targY] = target.transform_stage_point(dropX, dropY);
                if (target._delegate.acceptDrop(this.actor._delegate,
                                                this._dragActor,
                                                targX,
@@ -584,9 +588,8 @@ var _Draggable = class _Draggable {
                        if (this._restoreOnSuccess) {
                            this._restoreDragActor(event.get_time());
                            return true;
-                        } else {
+                        } else
                            this._dragActor.destroy();
-                        }
                    }

                    this._dragState = DragState.INIT;
@@ -610,15 +613,15 @@ var _Draggable = class _Draggable {
        if (this._dragActorSource && this._dragActorSource.visible) {
            // Snap the clone back to its source
            [x, y] = this._dragActorSource.get_transformed_position();
-            let [sourceScaledWidth] = this._dragActorSource.get_transformed_size();
-            scale = sourceScaledWidth ? sourceScaledWidth / this._dragActor.width : 0;
+            let [sourceScaledWidth, sourceScaledHeight] = this._dragActorSource.get_transformed_size();
+            scale = sourceScaledWidth ? this._dragActor.width / sourceScaledWidth : 0;
        } else if (this._dragOrigParent) {
            // Snap the actor back to its original position within
            // its parent, adjusting for the fact that the parent
            // may have been moved or scaled
            let [parentX, parentY] = this._dragOrigParent.get_transformed_position();
-            let [parentWidth] = this._dragOrigParent.get_size();
-            let [parentScaledWidth] = this._dragOrigParent.get_transformed_size();
+            let [parentWidth, parentHeight] = this._dragOrigParent.get_size();
+            let [parentScaledWidth, parentScaledHeight] = this._dragOrigParent.get_transformed_size();
            let parentScale = 1.0;
            if (parentWidth != 0)
                parentScale = parentScaledWidth / parentWidth;
@@ -654,13 +657,13 @@ var _Draggable = class _Draggable {

        let [snapBackX, snapBackY, snapBackScale] = this._getRestoreLocation();

-        this._animateDragEnd(eventTime, {
-            x: snapBackX,
-            y: snapBackY,
-            scale_x: snapBackScale,
-            scale_y: snapBackScale,
-            duration: SNAP_BACK_ANIMATION_TIME
-        });
+        this._animateDragEnd(eventTime,
+                             { x: snapBackX,
+                               y: snapBackY,
+                               scale_x: snapBackScale,
+                               scale_y: snapBackScale,
+                               time: SNAP_BACK_ANIMATION_TIME,
+                             });
    }

    _restoreDragActor(eventTime) {
@@ -672,27 +675,26 @@ var _Draggable = class _Draggable {
        this._dragActor.set_scale(restoreScale, restoreScale);
        this._dragActor.opacity = 0;

-        this._animateDragEnd(eventTime, {
-            duration: REVERT_ANIMATION_TIME
-        });
+        this._animateDragEnd(eventTime,
+                             { time: REVERT_ANIMATION_TIME });
    }

    _animateDragEnd(eventTime, params) {
        this._animationInProgress = true;

+        params['opacity']          = this._dragOrigOpacity;
+        params['transition']       = 'easeOutQuad';
+        params['onComplete']       = this._onAnimationComplete;
+        params['onCompleteScope']  = this;
+        params['onCompleteParams'] = [this._dragActor, eventTime];
+
        // start the animation
-        this._dragActor.ease(Object.assign(params, {
-            opacity: this._dragOrigOpacity,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._onAnimationComplete(this._dragActor, eventTime);
-            }
-        }));
+        Tweener.addTween(this._dragActor, params)
    }

    _finishAnimation() {
        if (!this._animationInProgress)
-            return;
+            return

        this._animationInProgress = false;
        if (!this._buttonDown)
--- a/js/ui/edgeDragAction.js
+++ b/js/ui/edgeDragAction.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported EdgeDragAction */

 const { Clutter, GObject, Meta, St } = imports.gi;

@@ -17,7 +16,7 @@ var EdgeDragAction = GObject.registerClass({
        this._allowedModes = allowedModes;
        this.set_n_touch_points(1);

-        global.display.connect('grab-op-begin', () => this.cancel());
+        global.display.connect('grab-op-begin', () => { this.cancel(); });
    }

    _getMonitorRect(x, y) {
@@ -27,7 +26,7 @@ var EdgeDragAction = GObject.registerClass({
        return global.display.get_monitor_geometry(monitorIndex);
    }

-    vfunc_gesture_prepare(_actor) {
+    vfunc_gesture_prepare(actor) {
        if (this.get_n_current_points() == 0)
            return false;

@@ -43,7 +42,7 @@ var EdgeDragAction = GObject.registerClass({
                (this._side == St.Side.BOTTOM && y > monitorRect.y + monitorRect.height - EDGE_THRESHOLD));
    }

-    vfunc_gesture_progress(_actor) {
+    vfunc_gesture_progress(actor) {
        let [startX, startY] = this.get_press_coords(0);
        let [x, y] = this.get_motion_coords(0);
        let offsetX = Math.abs (x - startX);
@@ -63,7 +62,7 @@ var EdgeDragAction = GObject.registerClass({
        return true;
    }

-    vfunc_gesture_end(_actor) {
+    vfunc_gesture_end(actor) {
        let [startX, startY] = this.get_press_coords(0);
        let [x, y] = this.get_motion_coords(0);
        let monitorRect = this._getMonitorRect(startX, startY);
--- a/js/ui/endSessionDialog.js
+++ b/js/ui/endSessionDialog.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init, EndSessionDialog */
 /*
 * Copyright 2010-2016 Red Hat, Inc
 *
@@ -30,9 +29,13 @@ const UserWidget = imports.ui.userWidget;

 const { loadInterfaceXML } = imports.misc.fileUtils;

+let _endSessionDialog = null;
+
 const _ITEM_ICON_SIZE = 48;
 const _DIALOG_ICON_SIZE = 48;

+var GSM_SESSION_MANAGER_LOGOUT_FORCE = 2;
+
 const EndSessionDialogIface = loadInterfaceXML('org.gnome.SessionManager.EndSessionDialog');

 const logoutDialogContent = {
@@ -50,7 +53,7 @@ const logoutDialogContent = {
    },
    showBatteryWarning: false,
    confirmButtons: [{ signal: 'ConfirmedLogout',
-                       label: C_("button", "Log Out") }],
+                       label:  C_("button", "Log Out") }],
    iconStyleClass: 'end-session-dialog-logout-icon',
    showOtherSessions: false,
 };
@@ -66,9 +69,9 @@ const shutdownDialogContent = {
    checkBoxText: C_("checkbox", "Install pending software updates"),
    showBatteryWarning: true,
    confirmButtons: [{ signal: 'ConfirmedReboot',
-                       label: C_("button", "Restart") },
+                       label:  C_("button", "Restart") },
                     { signal: 'ConfirmedShutdown',
-                       label: C_("button", "Power Off") }],
+                       label:  C_("button", "Power Off") }],
    iconName: 'system-shutdown-symbolic',
    iconStyleClass: 'end-session-dialog-shutdown-icon',
    showOtherSessions: true,
@@ -83,7 +86,7 @@ const restartDialogContent = {
    },
    showBatteryWarning: false,
    confirmButtons: [{ signal: 'ConfirmedReboot',
-                       label: C_("button", "Restart") }],
+                       label:  C_("button", "Restart") }],
    iconName: 'view-refresh-symbolic',
    iconStyleClass: 'end-session-dialog-shutdown-icon',
    showOtherSessions: true,
@@ -99,7 +102,7 @@ const restartUpdateDialogContent = {
    },
    showBatteryWarning: true,
    confirmButtons: [{ signal: 'ConfirmedReboot',
-                       label: C_("button", "Restart &amp; Install") }],
+                       label:  C_("button", "Restart &amp; Install") }],
    unusedFutureButtonForTranslation: C_("button", "Install &amp; Power Off"),
    unusedFutureCheckBoxForTranslation: C_("checkbox", "Power off after updates are installed"),
    iconName: 'view-refresh-symbolic',
@@ -119,18 +122,18 @@ const restartUpgradeDialogContent = {
    disableTimer: true,
    showBatteryWarning: false,
    confirmButtons: [{ signal: 'ConfirmedReboot',
-                       label: C_("button", "Restart &amp; Install") }],
+                       label:  C_("button", "Restart &amp; Install") }],
    iconName: 'view-refresh-symbolic',
    iconStyleClass: 'end-session-dialog-shutdown-icon',
    showOtherSessions: true,
 };

 const DialogType = {
-    LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */,
-    SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
-    RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
-    UPDATE_RESTART: 3,
-    UPGRADE_RESTART: 4
+  LOGOUT: 0 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_LOGOUT */,
+  SHUTDOWN: 1 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_SHUTDOWN */,
+  RESTART: 2 /* GSM_SHELL_END_SESSION_DIALOG_TYPE_RESTART */,
+  UPDATE_RESTART: 3,
+  UPGRADE_RESTART: 4
 };

 const DialogContent = {
@@ -156,7 +159,7 @@ function findAppFromInhibitor(inhibitor) {
    let desktopFile;
    try {
        [desktopFile] = inhibitor.GetAppIdSync();
-    } catch (e) {
+    } catch(e) {
        // XXX -- sometimes JIT inhibitors generated by gnome-session
        // get removed too soon. Don't fail in this case.
        log('gnome-session gave us a dead inhibitor: %s'.format(inhibitor.get_object_path()));
@@ -220,7 +223,7 @@ function init() {
    // This always returns the same singleton object
    // By instantiating it initially, we register the
    // bus object, etc.
-    (new EndSessionDialog());
+    _endSessionDialog = new EndSessionDialog();
 }

 var EndSessionDialog = GObject.registerClass(
@@ -232,13 +235,14 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._loginManager = LoginManager.getLoginManager();
        this._userManager = AccountsService.UserManager.get_default();
        this._user = this._userManager.get_user(GLib.get_user_name());
-        this._updatesPermission = null;

        this._pkOfflineProxy = new PkOfflineProxy(Gio.DBus.system,
                                                  'org.freedesktop.PackageKit',
                                                  '/org/freedesktop/PackageKit',
-                                                  this._onPkOfflineProxyCreated.bind(this));
-
+                                                  (proxy, error) => {
+                                                      if (error)
+                                                          log(error.message);
+                                                  });
        this._powerProxy = new UPowerProxy(Gio.DBus.system,
                                           'org.freedesktop.UPower',
                                           '/org/freedesktop/UPower',
@@ -272,8 +276,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {

        this._iconBin = new St.Bin();
        mainContentLayout.add(this._iconBin,
-                              { x_fill: true,
-                                y_fill: false,
+                              { x_fill:  true,
+                                y_fill:  false,
                                x_align: St.Align.END,
                                y_align: St.Align.START });

@@ -286,7 +290,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {

        messageLayout.add(this._subjectLabel,
                          { x_fill: false,
-                            y_fill: false,
+                            y_fill:  false,
                            x_align: St.Align.START,
                            y_align: St.Align.START });

@@ -295,7 +299,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._descriptionLabel.clutter_text.line_wrap = true;

        messageLayout.add(this._descriptionLabel,
-                          { y_fill: true,
+                          { y_fill:  true,
                            y_align: St.Align.START });

        this._checkBox = new CheckBox.CheckBox();
@@ -333,36 +337,16 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._inhibitorSection.add_actor(this._sessionHeader);
        this._inhibitorSection.add_actor(this._sessionList);

+        try {
+            this._updatesPermission = Polkit.Permission.new_sync("org.freedesktop.packagekit.trigger-offline-update", null, null);
+        } catch(e) {
+            log('No permission to trigger offline updates: %s'.format(e.toString()));
+        }
+
        this._dbusImpl = Gio.DBusExportedObject.wrapJSObject(EndSessionDialogIface, this);
        this._dbusImpl.export(Gio.DBus.session, '/org/gnome/SessionManager/EndSessionDialog');
    }

-    _onPkOfflineProxyCreated(proxy, error) {
-        if (error) {
-            log(error.message);
-            return;
-        }
-
-        // Creating a D-Bus proxy won't propagate SERVICE_UNKNOWN or NAME_HAS_NO_OWNER
-        // errors if PackageKit is not available, but the GIO implementation will make
-        // sure in that case that the proxy's g-name-owner is set to null, so check that.
-        if (this._pkOfflineProxy.g_name_owner === null) {
-            this._pkOfflineProxy = null;
-            return;
-        }
-
-        // It only makes sense to check for this permission if PackageKit is available.
-        Polkit.Permission.new(
-            'org.freedesktop.packagekit.trigger-offline-update', null, null,
-            (source, res) => {
-                try {
-                    this._updatesPermission = Polkit.Permission.new_finish(res);
-                } catch (e) {
-                    log(`No permission to trigger offline updates: ${e}`);
-                }
-            });
-    }
-
    _onDestroy() {
        this._user.disconnect(this._userLoadedId);
        this._user.disconnect(this._userChangedId);
@@ -407,8 +391,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        }

        // Use a different description when we are installing a system upgrade
-        // if the PackageKit proxy is available (i.e. PackageKit is available).
-        if (this._pkOfflineProxy && dialogContent.upgradeDescription) {
+        if (dialogContent.upgradeDescription) {
            let name = this._pkOfflineProxy.PreparedUpgrade['name'].deep_unpack();
            let version = this._pkOfflineProxy.PreparedUpgrade['version'].deep_unpack();

@@ -445,8 +428,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
    _updateButtons() {
        let dialogContent = DialogContent[this._type];
        let buttons = [{ action: this.cancel.bind(this),
-                         label: _("Cancel"),
-                         key: Clutter.Escape }];
+                         label:  _("Cancel"),
+                         key:    Clutter.Escape }];

        for (let i = 0; i < dialogContent.confirmButtons.length; i++) {
            let signal = dialogContent.confirmButtons[i].signal;
@@ -493,19 +476,19 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        // Trigger the offline update as requested
        if (this._checkBox.actor.checked) {
            switch (signal) {
-            case "ConfirmedReboot":
-                this._triggerOfflineUpdateReboot(callback);
-                break;
-            case "ConfirmedShutdown":
-                // To actually trigger the offline update, we need to
-                // reboot to do the upgrade. When the upgrade is complete,
-                // the computer will shut down automatically.
-                signal = "ConfirmedReboot";
-                this._triggerOfflineUpdateShutdown(callback);
-                break;
-            default:
-                callback();
-                break;
+                case "ConfirmedReboot":
+                    this._triggerOfflineUpdateReboot(callback);
+                    break;
+                case "ConfirmedShutdown":
+                    // To actually trigger the offline update, we need to
+                    // reboot to do the upgrade. When the upgrade is complete,
+                    // the computer will shut down automatically.
+                    signal = "ConfirmedReboot";
+                    this._triggerOfflineUpdateShutdown(callback);
+                    break;
+                default:
+                    callback();
+                    break;
            }
        } else {
            this._triggerOfflineUpdateCancel(callback);
@@ -517,12 +500,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
    }

    _triggerOfflineUpdateReboot(callback) {
-        // Handle this gracefully if PackageKit is not available.
-        if (!this._pkOfflineProxy) {
-            callback();
-            return;
-        }
-
        this._pkOfflineProxy.TriggerRemote('reboot', (result, error) => {
            if (error)
                log(error.message);
@@ -532,12 +509,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
    }

    _triggerOfflineUpdateShutdown(callback) {
-        // Handle this gracefully if PackageKit is not available.
-        if (!this._pkOfflineProxy) {
-            callback();
-            return;
-        }
-
        this._pkOfflineProxy.TriggerRemote('power-off', (result, error) => {
            if (error)
                log(error.message);
@@ -547,12 +518,6 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
    }

    _triggerOfflineUpdateCancel(callback) {
-        // Handle this gracefully if PackageKit is not available.
-        if (!this._pkOfflineProxy) {
-            callback();
-            return;
-        }
-
        this._pkOfflineProxy.CancelRemote((result, error) => {
            if (error)
                log(error.message);
@@ -620,7 +585,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
    }

    _onInhibitorLoaded(inhibitor) {
-        if (!this._applications.includes(inhibitor)) {
+        if (this._applications.indexOf(inhibitor) < 0) {
            // Stale inhibitor
            return;
        }
@@ -672,7 +637,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._loginManager.listSessions(result => {
            let n = 0;
            for (let i = 0; i < result.length; i++) {
-                let [id_, uid_, userName, seat_, sessionPath] = result[i];
+                let[id, uid, userName, seat, sessionPath] = result[i];
                let proxy = new LogindSession(Gio.DBus.system, 'org.freedesktop.login1', sessionPath);

                if (proxy.Class != 'user')
@@ -715,8 +680,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        this._totalSecondsToStayOpen = totalSecondsToStayOpen;
        this._type = type;

-        // Only consider updates and upgrades if PackageKit is available.
-        if (this._pkOfflineProxy && this._type == DialogType.RESTART) {
+        if (this._type == DialogType.RESTART) {
            if (this._pkOfflineProxy.UpdateTriggered)
                this._type = DialogType.UPDATE_RESTART;
            else if (this._pkOfflineProxy.UpgradeTriggered)
@@ -738,7 +702,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        let dialogContent = DialogContent[this._type];

        for (let i = 0; i < inhibitorObjectPaths.length; i++) {
-            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], proxy => {
+            let inhibitor = new GnomeSession.Inhibitor(inhibitorObjectPaths[i], (proxy, error) => {
                this._onInhibitorLoaded(proxy);
            });

@@ -748,9 +712,8 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        if (dialogContent.showOtherSessions)
            this._loadSessions();

-        // Only consider updates and upgrades if PackageKit is available.
-        let updateTriggered = this._pkOfflineProxy ? this._pkOfflineProxy.UpdateTriggered : false;
-        let updatePrepared = this._pkOfflineProxy ? this._pkOfflineProxy.UpdatePrepared : false;
+        let updateTriggered = this._pkOfflineProxy.UpdateTriggered;
+        let updatePrepared = this._pkOfflineProxy.UpdatePrepared;
        let updatesAllowed = this._updatesPermission && this._updatesPermission.allowed;

        _setCheckBoxLabel(this._checkBox, dialogContent.checkBoxText || '');
@@ -782,7 +745,7 @@ class EndSessionDialog extends ModalDialog.ModalDialog {
        });
    }

-    Close(_parameters, _invocation) {
+    Close(parameters, invocation) {
        this.close();
    }
 });
--- a/js/ui/environment.js
+++ b/js/ui/environment.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init */

 const Config = imports.misc.config;

@@ -58,118 +57,8 @@ function _patchLayoutClass(layoutClass, styleProps) {
    };
 }

-function _makeEaseCallback(params) {
-    let onComplete = params.onComplete;
-    delete params.onComplete;
-
-    let onStopped = params.onStopped;
-    delete params.onStopped;
-
-    if (!onComplete && !onStopped)
-        return null;
-
-    return isFinished => {
-        if (onStopped)
-            onStopped(isFinished);
-        if (onComplete && isFinished)
-            onComplete();
-    };
-}
-
-function _getPropertyTarget(actor, propName) {
-    if (!propName.startsWith('@'))
-        return [actor, propName];
-
-    let [type, name, prop] = propName.split('.');
-    switch (type) {
-    case '@layout':
-        return [actor.layout_manager, name];
-    case '@actions':
-        return [actor.get_action(name), prop];
-    case '@constraints':
-        return [actor.get_constraint(name), prop];
-    case '@effects':
-        return [actor.get_effect(name), prop];
-    }
-
-    throw new Error(`Invalid property name ${propName}`);
-}
-
-function _easeActor(actor, params) {
-    actor.save_easing_state();
-
-    if (params.duration != undefined)
-        actor.set_easing_duration(params.duration);
-    delete params.duration;
-
-    if (params.delay != undefined)
-        actor.set_easing_delay(params.delay);
-    delete params.delay;
-
-    if (params.mode != undefined)
-        actor.set_easing_mode(params.mode);
-    delete params.mode;
-
-    let callback = _makeEaseCallback(params);
-
-    // cancel overwritten transitions
-    let animatedProps = Object.keys(params).map(p => p.replace('_', '-', 'g'));
-    animatedProps.forEach(p => actor.remove_transition(p));
-
-    actor.set(params);
-    actor.restore_easing_state();
-
-    if (callback) {
-        let transition = actor.get_transition(animatedProps[0]);
-
-        if (transition)
-            transition.connect('stopped', (t, finished) => callback(finished));
-        else
-            callback(true);
-    }
-}
-
-function _easeActorProperty(actor, propName, target, params) {
-    // Avoid pointless difference with ease()
-    if (params.mode)
-        params.progress_mode = params.mode;
-    delete params.mode;
-
-    if (params.duration)
-        params.duration = adjustAnimationTime(params.duration);
-    let duration = Math.floor(params.duration || 0);
-
-    let callback = _makeEaseCallback(params);
-
-    // cancel overwritten transition
-    actor.remove_transition(propName);
-
-    if (duration == 0) {
-        let [obj, prop] = _getPropertyTarget(actor, propName);
-        obj[prop] = target;
-
-        if (callback)
-            callback(true);
-
-        return;
-    }
-
-    let pspec = actor.find_property(propName);
-    let transition = new Clutter.PropertyTransition(Object.assign({
-        property_name: propName,
-        interval: new Clutter.Interval({ value_type: pspec.value_type }),
-        remove_on_complete: true
-    }, params));
-    actor.add_transition(propName, transition);
-
-    transition.set_to(target);
-
-    if (callback)
-        transition.connect('stopped', (t, finished) => callback(finished));
-}
-
-function _loggingFunc(...args) {
-    let fields = { 'MESSAGE': args.join(', ') };
+function _loggingFunc() {
+    let fields = {'MESSAGE': [].join.call(arguments, ', ')};
    let domain = "GNOME Shell";

    // If the caller is an extension, add it as metadata
@@ -204,27 +93,6 @@ function init() {
                                            column_spacing: 'spacing-columns' });
    _patchLayoutClass(Clutter.BoxLayout, { spacing: 'spacing' });

-    let origSetEasingDuration = Clutter.Actor.prototype.set_easing_duration;
-    Clutter.Actor.prototype.set_easing_duration = function(msecs) {
-        origSetEasingDuration.call(this, adjustAnimationTime(msecs));
-    };
-    let origSetEasingDelay = Clutter.Actor.prototype.set_easing_delay;
-    Clutter.Actor.prototype.set_easing_delay = function(msecs) {
-        origSetEasingDelay.call(this, adjustAnimationTime(msecs));
-    };
-
-    Clutter.Actor.prototype.ease = function(props, easingParams) {
-        _easeActor(this, props, easingParams);
-    };
-    Clutter.Actor.prototype.ease_property = function(propName, target, params) {
-        _easeActorProperty(this, propName, target, params);
-    };
-    St.Adjustment.prototype.ease = function(target, params) {
-        // we're not an actor of course, but we implement the same
-        // transition API as Clutter.Actor, so this works anyway
-        _easeActorProperty(this, 'value', target, params);
-    };
-
    Clutter.Actor.prototype.toString = function() {
        return St.describe_actor(this);
    };
@@ -238,21 +106,15 @@ function init() {
        }
    });

-    St.set_slow_down_factor = function(factor) {
-        let { stack } = new Error();
-        log(`St.set_slow_down_factor() is deprecated, use St.Settings.slow_down_factor\n${stack}`);
-        St.Settings.get().slow_down_factor = factor;
-    };
-
    let origToString = Object.prototype.toString;
    Object.prototype.toString = function() {
        let base = origToString.call(this);
        try {
            if ('actor' in this && this.actor instanceof Clutter.Actor)
-                return base.replace(/\]$/, ` delegate for ${this.actor.toString().substring(1)}`);
+                return base.replace(/\]$/, ' delegate for ' + this.actor.toString().substring(1));
            else
                return base;
-        } catch (e) {
+        } catch(e) {
            return base;
        }
    };
@@ -266,7 +128,7 @@ function init() {
    if (slowdownEnv) {
        let factor = parseFloat(slowdownEnv);
        if (!isNaN(factor) && factor > 0.0)
-            St.Settings.get().slow_down_factor = factor;
+            St.set_slow_down_factor(factor);
    }

    // OK, now things are initialized enough that we can import shell JS
@@ -276,17 +138,3 @@ function init() {
    Tweener.init();
    String.prototype.format = Format.format;
 }
-
-// adjustAnimationTime:
-// @msecs: time in milliseconds
-//
-// Adjust @msecs to account for St's enable-animations
-// and slow-down-factor settings
-function adjustAnimationTime(msecs) {
-    let settings = St.Settings.get();
-
-    if (!settings.enable_animations)
-        return 1;
-    return settings.slow_down_factor * msecs;
-}
-
--- a/js/ui/extensionDownloader.js
+++ b/js/ui/extensionDownloader.js
@@ -1,20 +1,20 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init, installExtension, uninstallExtension,
-            checkForUpdates, updateExtension */

-const { Clutter, Gio, GLib, GObject, Soup } = imports.gi;
+const { Clutter, Gio, GLib, GObject, Pango, Soup, St } = imports.gi;

 const Config = imports.misc.config;
 const Dialog = imports.ui.dialog;
 const ExtensionUtils = imports.misc.extensionUtils;
+const ExtensionSystem = imports.ui.extensionSystem;
 const FileUtils = imports.misc.fileUtils;
-const Main = imports.ui.main;
 const ModalDialog = imports.ui.modalDialog;

+const _signals = ExtensionSystem._signals;
+
 var REPOSITORY_URL_BASE = 'https://extensions.gnome.org';
-var REPOSITORY_URL_DOWNLOAD = `${REPOSITORY_URL_BASE}/download-extension/%s.shell-extension.zip`;
-var REPOSITORY_URL_INFO     = `${REPOSITORY_URL_BASE}/extension-info/`;
-var REPOSITORY_URL_UPDATE   = `${REPOSITORY_URL_BASE}/update-info/`;
+var REPOSITORY_URL_DOWNLOAD = REPOSITORY_URL_BASE + '/download-extension/%s.shell-extension.zip';
+var REPOSITORY_URL_INFO     = REPOSITORY_URL_BASE + '/extension-info/';
+var REPOSITORY_URL_UPDATE   = REPOSITORY_URL_BASE + '/update-info/';

 let _httpSession;

@@ -26,7 +26,7 @@ function installExtension(uuid, invocation) {

    _httpSession.queue_message(message, (session, message) => {
        if (message.status_code != Soup.KnownStatusCode.OK) {
-            Main.extensionManager.logExtensionError(uuid, `downloading info: ${message.status_code}`);
+            ExtensionSystem.logExtensionError(uuid, 'downloading info: ' + message.status_code);
            invocation.return_dbus_error('org.gnome.Shell.DownloadInfoError', message.status_code.toString());
            return;
        }
@@ -35,7 +35,7 @@ function installExtension(uuid, invocation) {
        try {
            info = JSON.parse(message.response_body.data);
        } catch (e) {
-            Main.extensionManager.logExtensionError(uuid, `parsing info: ${e}`);
+            ExtensionSystem.logExtensionError(uuid, 'parsing info: ' + e);
            invocation.return_dbus_error('org.gnome.Shell.ParseInfoError', e.toString());
            return;
        }
@@ -46,7 +46,7 @@ function installExtension(uuid, invocation) {
 }

 function uninstallExtension(uuid) {
-    let extension = Main.extensionManager.lookup(uuid);
+    let extension = ExtensionUtils.extensions[uuid];
    if (!extension)
        return false;

@@ -54,7 +54,7 @@ function uninstallExtension(uuid) {
    if (extension.type != ExtensionUtils.ExtensionType.PER_USER)
        return false;

-    if (!Main.extensionManager.unloadExtension(extension))
+    if (!ExtensionSystem.unloadExtension(extension))
        return false;

    FileUtils.recursivelyDeleteDir(extension.dir, true);
@@ -115,10 +115,10 @@ function updateExtension(uuid) {

    _httpSession.queue_message(message, (session, message) => {
        gotExtensionZipFile(session, message, uuid, newExtensionTmpDir, () => {
-            let oldExtension = Main.extensionManager.lookup(uuid);
+            let oldExtension = ExtensionUtils.extensions[uuid];
            let extensionDir = oldExtension.dir;

-            if (!Main.extensionManager.unloadExtension(oldExtension))
+            if (!ExtensionSystem.unloadExtension(oldExtension))
                return;

            FileUtils.recursivelyMoveDir(extensionDir, oldExtensionTmpDir);
@@ -127,11 +127,11 @@ function updateExtension(uuid) {
            let extension = null;

            try {
-                extension = Main.extensionManager.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
-                Main.extensionManager.loadExtension(extension);
-            } catch (e) {
+                extension = ExtensionUtils.createExtensionObject(uuid, extensionDir, ExtensionUtils.ExtensionType.PER_USER);
+                ExtensionSystem.loadExtension(extension);
+            } catch(e) {
                if (extension)
-                    Main.extensionManager.unloadExtension(extension);
+                    ExtensionSystem.unloadExtension(extension);

                logError(e, 'Error loading extension %s'.format(uuid));

@@ -140,7 +140,7 @@ function updateExtension(uuid) {

                // Restore what was there before. We can't do much if we
                // fail here.
-                Main.extensionManager.loadExtension(oldExtension);
+                ExtensionSystem.loadExtension(oldExtension);
                return;
            }

@@ -153,9 +153,9 @@ function updateExtension(uuid) {

 function checkForUpdates() {
    let metadatas = {};
-    Main.extensionManager.getUuids().forEach(uuid => {
-        metadatas[uuid] = Main.extensionManager.extensions[uuid].metadata;
-    });
+    for (let uuid in ExtensionUtils.extensions) {
+        metadatas[uuid] = ExtensionUtils.extensions[uuid].metadata;
+    }

    let params = { shell_version: Config.PACKAGE_VERSION,
                   installed: JSON.stringify(metadatas) };
@@ -188,9 +188,9 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {

        this.setButtons([{ label: _("Cancel"),
                           action: this._onCancelButtonPressed.bind(this),
-                           key: Clutter.Escape
+                           key:    Clutter.Escape
                         },
-                         { label: _("Install"),
+                         { label:  _("Install"),
                           action: this._onInstallButtonPressed.bind(this),
                           default: true
                         }]);
@@ -205,12 +205,12 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
        this.contentLayout.add(content);
    }

-    _onCancelButtonPressed() {
+    _onCancelButtonPressed(button, event) {
        this.close();
        this._invocation.return_value(GLib.Variant.new('(s)', ['cancelled']));
    }

-    _onInstallButtonPressed() {
+    _onInstallButtonPressed(button, event) {
        let params = { shell_version: Config.PACKAGE_VERSION };

        let url = REPOSITORY_URL_DOWNLOAD.format(this._uuid);
@@ -222,16 +222,21 @@ class InstallExtensionDialog extends ModalDialog.ModalDialog {
        function errback(code, message) {
            let msg = message ? message.toString() : '';
            log('Error while installing %s: %s (%s)'.format(uuid, code, msg));
-            invocation.return_dbus_error(`org.gnome.Shell.${code}`, msg);
+            invocation.return_dbus_error('org.gnome.Shell.' + code, msg);
        }

        function callback() {
+            // Add extension to 'enabled-extensions' for the user, always...
+            let enabledExtensions = global.settings.get_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY);
+            if (enabledExtensions.indexOf(uuid) == -1) {
+                enabledExtensions.push(uuid);
+                global.settings.set_strv(ExtensionSystem.ENABLED_EXTENSIONS_KEY, enabledExtensions);
+            }
+
            try {
-                let extension = Main.extensionManager.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
-                Main.extensionManager.loadExtension(extension);
-                if (!Main.extensionManager.enableExtension(uuid))
-                    throw new Error(`Cannot add ${uuid} to enabled extensions gsettings key`);
-            } catch (e) {
+                let extension = ExtensionUtils.createExtensionObject(uuid, dir, ExtensionUtils.ExtensionType.PER_USER);
+                ExtensionSystem.loadExtension(extension);
+            } catch(e) {
                uninstallExtension(uuid);
                errback('LoadExtensionError', e);
                return;
--- a/js/ui/extensionSystem.js
+++ b/js/ui/extensionSystem.js
@@ -1,523 +1,374 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported init connect disconnect */

 const { Gio, St } = imports.gi;
 const Signals = imports.signals;

 const ExtensionUtils = imports.misc.extensionUtils;
-const FileUtils = imports.misc.fileUtils;
 const Main = imports.ui.main;

-const { ExtensionState, ExtensionType } = ExtensionUtils;
+var ExtensionState = {
+    ENABLED: 1,
+    DISABLED: 2,
+    ERROR: 3,
+    OUT_OF_DATE: 4,
+    DOWNLOADING: 5,
+    INITIALIZED: 6,
+
+    // Used as an error state for operations on unknown extensions,
+    // should never be in a real extensionMeta object.
+    UNINSTALLED: 99
+};
+
+// Arrays of uuids
+var enabledExtensions;
+// Contains the order that extensions were enabled in.
+var extensionOrder = [];
+
+// We don't really have a class to add signals on. So, create
+// a simple dummy object, add the signal methods, and export those
+// publically.
+var _signals = {};
+Signals.addSignalMethods(_signals);
+
+var connect = _signals.connect.bind(_signals);
+var disconnect = _signals.disconnect.bind(_signals);

 const ENABLED_EXTENSIONS_KEY = 'enabled-extensions';
-const DISABLED_EXTENSIONS_KEY = 'disabled-extensions';
 const DISABLE_USER_EXTENSIONS_KEY = 'disable-user-extensions';
 const EXTENSION_DISABLE_VERSION_CHECK_KEY = 'disable-extension-version-validation';

-var ExtensionManager = class {
-    constructor() {
-        this._initted = false;
-        this._enabled = false;
+var initted = false;
+var enabled;

-        this._extensions = new Map();
-        this._enabledExtensions = [];
-        this._extensionOrder = [];
+function disableExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;

-        Main.sessionMode.connect('updated', this._sessionUpdated.bind(this));
-    }
+    if (extension.state != ExtensionState.ENABLED)
+        return;

-    init() {
-        this._sessionUpdated();
-    }
+    // "Rebase" the extension order by disabling and then enabling extensions
+    // in order to help prevent conflicts.

-    lookup(uuid) {
-        return this._extensions.get(uuid);
-    }
+    // Example:
+    //   order = [A, B, C, D, E]
+    //   user disables C
+    //   this should: disable E, disable D, disable C, enable D, enable E

-    getUuids() {
-        return [...this._extensions.keys()];
-    }
+    let orderIdx = extensionOrder.indexOf(uuid);
+    let order = extensionOrder.slice(orderIdx + 1);
+    let orderReversed = order.slice().reverse();

-    _callExtensionDisable(uuid) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
-
-        if (extension.state != ExtensionState.ENABLED)
-            return;
-
-        // "Rebase" the extension order by disabling and then enabling extensions
-        // in order to help prevent conflicts.
-
-        // Example:
-        //   order = [A, B, C, D, E]
-        //   user disables C
-        //   this should: disable E, disable D, disable C, enable D, enable E
-
-        let orderIdx = this._extensionOrder.indexOf(uuid);
-        let order = this._extensionOrder.slice(orderIdx + 1);
-        let orderReversed = order.slice().reverse();
-
-        for (let i = 0; i < orderReversed.length; i++) {
-            let uuid = orderReversed[i];
-            try {
-                this.lookup(uuid).stateObj.disable();
-            } catch (e) {
-                this.logExtensionError(uuid, e);
-            }
+    for (let i = 0; i < orderReversed.length; i++) {
+        let uuid = orderReversed[i];
+        try {
+            ExtensionUtils.extensions[uuid].stateObj.disable();
+        } catch(e) {
+            logExtensionError(uuid, e);
        }
+    }

+    if (extension.stylesheet) {
+        let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
+        theme.unload_stylesheet(extension.stylesheet);
+        delete extension.stylesheet;
+    }
+
+    try {
+        extension.stateObj.disable();
+    } catch(e) {
+        logExtensionError(uuid, e);
+    }
+
+    for (let i = 0; i < order.length; i++) {
+        let uuid = order[i];
+        try {
+            ExtensionUtils.extensions[uuid].stateObj.enable();
+        } catch(e) {
+            logExtensionError(uuid, e);
+        }
+    }
+
+    extensionOrder.splice(orderIdx, 1);
+
+    if ( extension.state != ExtensionState.ERROR ) {
+        extension.state = ExtensionState.DISABLED;
+        _signals.emit('extension-state-changed', extension);
+    }
+}
+
+function enableExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;
+
+    if (extension.state == ExtensionState.INITIALIZED)
+        initExtension(uuid);
+
+    if (extension.state != ExtensionState.DISABLED)
+        return;
+
+    extensionOrder.push(uuid);
+
+    let stylesheetNames = [global.session_mode + '.css', 'stylesheet.css'];
+    let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
+    for (let i = 0; i < stylesheetNames.length; i++) {
+        try {
+            let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
+            theme.load_stylesheet(stylesheetFile);
+            extension.stylesheet = stylesheetFile;
+            break;
+        } catch (e) {
+            if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
+                continue; // not an error
+            log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+            return;
+        }
+    }
+
+    try {
+        extension.stateObj.enable();
+        extension.state = ExtensionState.ENABLED;
+        _signals.emit('extension-state-changed', extension);
+        return;
+    } catch(e) {
        if (extension.stylesheet) {
-            let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
            theme.unload_stylesheet(extension.stylesheet);
            delete extension.stylesheet;
        }
-
-        try {
-            extension.stateObj.disable();
-        } catch (e) {
-            this.logExtensionError(uuid, e);
-        }
-
-        for (let i = 0; i < order.length; i++) {
-            let uuid = order[i];
-            try {
-                this.lookup(uuid).stateObj.enable();
-            } catch (e) {
-                this.logExtensionError(uuid, e);
-            }
-        }
-
-        this._extensionOrder.splice(orderIdx, 1);
-
-        if (extension.state != ExtensionState.ERROR) {
-            extension.state = ExtensionState.DISABLED;
-            this.emit('extension-state-changed', extension);
-        }
+        logExtensionError(uuid, e);
+        return;
    }
+}

-    _callExtensionEnable(uuid) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
+function logExtensionError(uuid, error) {
+    let extension = ExtensionUtils.extensions[uuid];
+    if (!extension)
+        return;

-        if (extension.state == ExtensionState.INITIALIZED)
-            this._callExtensionInit(uuid);
+    let message = '' + error;

-        if (extension.state != ExtensionState.DISABLED)
-            return;
+    extension.state = ExtensionState.ERROR;
+    if (!extension.errors)
+        extension.errors = [];
+    extension.errors.push(message);

-        this._extensionOrder.push(uuid);
+    log('Extension "%s" had error: %s'.format(uuid, message));
+    _signals.emit('extension-state-changed', { uuid: uuid,
+                                               error: message,
+                                               state: extension.state });
+}

-        let stylesheetNames = [`${global.session_mode}.css`, 'stylesheet.css'];
-        let theme = St.ThemeContext.get_for_stage(global.stage).get_theme();
-        for (let i = 0; i < stylesheetNames.length; i++) {
-            try {
-                let stylesheetFile = extension.dir.get_child(stylesheetNames[i]);
-                theme.load_stylesheet(stylesheetFile);
-                extension.stylesheet = stylesheetFile;
-                break;
-            } catch (e) {
-                if (e.matches(Gio.IOErrorEnum, Gio.IOErrorEnum.NOT_FOUND))
-                    continue; // not an error
-                log(`Failed to load stylesheet for extension ${uuid}: ${e.message}`);
+function loadExtension(extension) {
+    // Default to error, we set success as the last step
+    extension.state = ExtensionState.ERROR;
+
+    let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
+
+    if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
+        extension.state = ExtensionState.OUT_OF_DATE;
+    } else {
+        let enabled = enabledExtensions.indexOf(extension.uuid) != -1;
+        if (enabled) {
+            if (!initExtension(extension.uuid))
                return;
-            }
-        }
-
-        try {
-            extension.stateObj.enable();
-            extension.state = ExtensionState.ENABLED;
-            this.emit('extension-state-changed', extension);
-            return;
-        } catch (e) {
-            if (extension.stylesheet) {
-                theme.unload_stylesheet(extension.stylesheet);
-                delete extension.stylesheet;
-            }
-            this.logExtensionError(uuid, e);
-            return;
-        }
-    }
-
-    enableExtension(uuid) {
-        if (!this._extensions.has(uuid))
-            return false;
-
-        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-
-        if (disabledExtensions.includes(uuid)) {
-            disabledExtensions = disabledExtensions.filter(item => item !== uuid);
-            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
-        }
-
-        if (!enabledExtensions.includes(uuid)) {
-            enabledExtensions.push(uuid);
-            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
-        }
-
-        return true;
-    }
-
-    disableExtension(uuid) {
-        if (!this._extensions.has(uuid))
-            return false;
-
-        let enabledExtensions = global.settings.get_strv(ENABLED_EXTENSIONS_KEY);
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-
-        if (enabledExtensions.includes(uuid)) {
-            enabledExtensions = enabledExtensions.filter(item => item !== uuid);
-            global.settings.set_strv(ENABLED_EXTENSIONS_KEY, enabledExtensions);
-        }
-
-        if (!disabledExtensions.includes(uuid)) {
-            disabledExtensions.push(uuid);
-            global.settings.set_strv(DISABLED_EXTENSIONS_KEY, disabledExtensions);
-        }
-
-        return true;
-    }
-
-    logExtensionError(uuid, error) {
-        let extension = this.lookup(uuid);
-        if (!extension)
-            return;
-
-        let message = `${error}`;
-
-        extension.error = message;
-        extension.state = ExtensionState.ERROR;
-        if (!extension.errors)
-            extension.errors = [];
-        extension.errors.push(message);
-
-        log('Extension "%s" had error: %s'.format(uuid, message));
-        this.emit('extension-state-changed', extension);
-    }
-
-    createExtensionObject(uuid, dir, type) {
-        let metadataFile = dir.get_child('metadata.json');
-        if (!metadataFile.query_exists(null)) {
-            throw new Error('Missing metadata.json');
-        }
-
-        let metadataContents, success_;
-        try {
-            [success_, metadataContents] = metadataFile.load_contents(null);
-            if (metadataContents instanceof Uint8Array)
-                metadataContents = imports.byteArray.toString(metadataContents);
-        } catch (e) {
-            throw new Error(`Failed to load metadata.json: ${e}`);
-        }
-        let meta;
-        try {
-            meta = JSON.parse(metadataContents);
-        } catch (e) {
-            throw new Error(`Failed to parse metadata.json: ${e}`);
-        }
-
-        let requiredProperties = ['uuid', 'name', 'description', 'shell-version'];
-        for (let i = 0; i < requiredProperties.length; i++) {
-            let prop = requiredProperties[i];
-            if (!meta[prop]) {
-                throw new Error(`missing "${prop}" property in metadata.json`);
-            }
-        }
-
-        if (uuid != meta.uuid) {
-            throw new Error(`uuid "${meta.uuid}" from metadata.json does not match directory name "${uuid}"`);
-        }
-
-        let extension = {
-            metadata: meta,
-            uuid: meta.uuid,
-            type,
-            dir,
-            path: dir.get_path(),
-            error: '',
-            hasPrefs: dir.get_child('prefs.js').query_exists(null),
-            canChange: false
-        };
-        this._extensions.set(uuid, extension);
-
-        return extension;
-    }
-
-    loadExtension(extension) {
-        // Default to error, we set success as the last step
-        extension.state = ExtensionState.ERROR;
-
-        let checkVersion = !global.settings.get_boolean(EXTENSION_DISABLE_VERSION_CHECK_KEY);
-
-        if (checkVersion && ExtensionUtils.isOutOfDate(extension)) {
-            extension.state = ExtensionState.OUT_OF_DATE;
+            if (extension.state == ExtensionState.DISABLED)
+                enableExtension(extension.uuid);
        } else {
-            let enabled = this._enabledExtensions.includes(extension.uuid);
-            if (enabled) {
-                if (!this._callExtensionInit(extension.uuid))
-                    return;
-                if (extension.state == ExtensionState.DISABLED)
-                    this._callExtensionEnable(extension.uuid);
-            } else {
-                extension.state = ExtensionState.INITIALIZED;
-            }
+            extension.state = ExtensionState.INITIALIZED;
        }
-
-        this._updateCanChange(extension);
-        this.emit('extension-state-changed', extension);
    }

-    unloadExtension(extension) {
-        // Try to disable it -- if it's ERROR'd, we can't guarantee that,
-        // but it will be removed on next reboot, and hopefully nothing
-        // broke too much.
-        this._callExtensionDisable(extension.uuid);
+    _signals.emit('extension-state-changed', extension);
+}

-        extension.state = ExtensionState.UNINSTALLED;
-        this.emit('extension-state-changed', extension);
+function unloadExtension(extension) {
+    // Try to disable it -- if it's ERROR'd, we can't guarantee that,
+    // but it will be removed on next reboot, and hopefully nothing
+    // broke too much.
+    disableExtension(extension.uuid);

-        this._extensions.delete(extension.uuid);
-        return true;
+    extension.state = ExtensionState.UNINSTALLED;
+    _signals.emit('extension-state-changed', extension);
+
+    delete ExtensionUtils.extensions[extension.uuid];
+    return true;
+}
+
+function reloadExtension(oldExtension) {
+    // Grab the things we'll need to pass to createExtensionObject
+    // to reload it.
+    let { uuid: uuid, dir: dir, type: type } = oldExtension;
+
+    // Then unload the old extension.
+    unloadExtension(oldExtension);
+
+    // Now, recreate the extension and load it.
+    let newExtension;
+    try {
+        newExtension = ExtensionUtils.createExtensionObject(uuid, dir, type);
+    } catch(e) {
+        logExtensionError(uuid, e);
+        return;
    }

-    reloadExtension(oldExtension) {
-        // Grab the things we'll need to pass to createExtensionObject
-        // to reload it.
-        let { uuid: uuid, dir: dir, type: type } = oldExtension;
+    loadExtension(newExtension);
+}

-        // Then unload the old extension.
-        this.unloadExtension(oldExtension);
+function initExtension(uuid) {
+    let extension = ExtensionUtils.extensions[uuid];
+    let dir = extension.dir;

-        // Now, recreate the extension and load it.
-        let newExtension;
+    if (!extension)
+        throw new Error("Extension was not properly created. Call loadExtension first");
+
+    let extensionJs = dir.get_child('extension.js');
+    if (!extensionJs.query_exists(null)) {
+        logExtensionError(uuid, new Error('Missing extension.js'));
+        return false;
+    }
+
+    let extensionModule;
+    let extensionState = null;
+
+    ExtensionUtils.installImporter(extension);
+    try {
+        extensionModule = extension.imports.extension;
+    } catch(e) {
+        logExtensionError(uuid, e);
+        return false;
+    }
+
+    if (extensionModule.init) {
        try {
-            newExtension = this.createExtensionObject(uuid, dir, type);
-        } catch (e) {
-            this.logExtensionError(uuid, e);
-            return;
-        }
-
-        this.loadExtension(newExtension);
-    }
-
-    _callExtensionInit(uuid) {
-        let extension = this.lookup(uuid);
-        let dir = extension.dir;
-
-        if (!extension)
-            throw new Error("Extension was not properly created. Call loadExtension first");
-
-        let extensionJs = dir.get_child('extension.js');
-        if (!extensionJs.query_exists(null)) {
-            this.logExtensionError(uuid, new Error('Missing extension.js'));
+            extensionState = extensionModule.init(extension);
+        } catch(e) {
+            logExtensionError(uuid, e);
            return false;
        }
-
-        let extensionModule;
-        let extensionState = null;
-
-        ExtensionUtils.installImporter(extension);
-        try {
-            extensionModule = extension.imports.extension;
-        } catch (e) {
-            this.logExtensionError(uuid, e);
-            return false;
-        }
-
-        if (extensionModule.init) {
-            try {
-                extensionState = extensionModule.init(extension);
-            } catch (e) {
-                this.logExtensionError(uuid, e);
-                return false;
-            }
-        }
-
-        if (!extensionState)
-            extensionState = extensionModule;
-        extension.stateObj = extensionState;
-
-        extension.state = ExtensionState.DISABLED;
-        this.emit('extension-loaded', uuid);
-        return true;
    }

-    _getModeExtensions() {
-        if (Array.isArray(Main.sessionMode.enabledExtensions))
-            return Main.sessionMode.enabledExtensions;
-        return [];
-    }
+    if (!extensionState)
+        extensionState = extensionModule;
+    extension.stateObj = extensionState;

-    _updateCanChange(extension) {
-        let hasError =
-            extension.state == ExtensionState.ERROR ||
-            extension.state == ExtensionState.OUT_OF_DATE;
+    extension.state = ExtensionState.DISABLED;
+    _signals.emit('extension-loaded', uuid);
+    return true;
+}

-        let isMode = this._getModeExtensions().includes(extension.uuid);
-        let modeOnly = global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY);
+function getEnabledExtensions() {
+    let extensions;
+    if (Array.isArray(Main.sessionMode.enabledExtensions))
+        extensions = Main.sessionMode.enabledExtensions;
+    else
+        extensions = [];

-        let changeKey = isMode
-            ? DISABLE_USER_EXTENSIONS_KEY
-            : ENABLED_EXTENSIONS_KEY;
+    if (global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
+        return extensions;

-        extension.canChange =
-            !hasError &&
-            global.settings.is_writable(changeKey) &&
-            (isMode || !modeOnly);
-    }
+    return extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
+}

-    _getEnabledExtensions() {
-        let extensions = this._getModeExtensions();
+function onEnabledExtensionsChanged() {
+    let newEnabledExtensions = getEnabledExtensions();

-        if (!global.settings.get_boolean(DISABLE_USER_EXTENSIONS_KEY))
-            extensions = extensions.concat(global.settings.get_strv(ENABLED_EXTENSIONS_KEY));
+    if (!enabled)
+        return;

-        // filter out 'disabled-extensions' which takes precedence
-        let disabledExtensions = global.settings.get_strv(DISABLED_EXTENSIONS_KEY);
-        return extensions.filter(item => !disabledExtensions.includes(item));
-    }
+    // Find and enable all the newly enabled extensions: UUIDs found in the
+    // new setting, but not in the old one.
+    newEnabledExtensions.filter(
+        uuid => !enabledExtensions.includes(uuid)
+    ).forEach(uuid => {
+        enableExtension(uuid);
+    });

-    _onUserExtensionsEnabledChanged() {
-        this._onEnabledExtensionsChanged();
-        this._onSettingsWritableChanged();
-    }
+    // Find and disable all the newly disabled extensions: UUIDs found in the
+    // old setting, but not in the new one.
+    enabledExtensions.filter(
+        item => !newEnabledExtensions.includes(item)
+    ).forEach(uuid => {
+        disableExtension(uuid);
+    });

-    _onEnabledExtensionsChanged() {
-        let newEnabledExtensions = this._getEnabledExtensions();
+    enabledExtensions = newEnabledExtensions;
+}

-        if (!this._enabled)
-            return;
+function _onVersionValidationChanged() {
+    // we want to reload all extensions, but only enable
+    // extensions when allowed by the sessionMode, so
+    // temporarily disable them all
+    enabledExtensions = [];
+    for (let uuid in ExtensionUtils.extensions)
+        reloadExtension(ExtensionUtils.extensions[uuid]);
+    enabledExtensions = getEnabledExtensions();

-        // Find and enable all the newly enabled extensions: UUIDs found in the
-        // new setting, but not in the old one.
-        newEnabledExtensions.filter(
-            uuid => !this._enabledExtensions.includes(uuid)
-        ).forEach(uuid => {
-            this._callExtensionEnable(uuid);
+    if (Main.sessionMode.allowExtensions) {
+        enabledExtensions.forEach(uuid => {
+            enableExtension(uuid);
        });
+    }
+}

-        // Find and disable all the newly disabled extensions: UUIDs found in the
-        // old setting, but not in the new one.
-        this._enabledExtensions.filter(
-            item => !newEnabledExtensions.includes(item)
-        ).forEach(uuid => {
-            this._callExtensionDisable(uuid);
+function _loadExtensions() {
+    global.settings.connect('changed::' + ENABLED_EXTENSIONS_KEY, onEnabledExtensionsChanged);
+    global.settings.connect('changed::' + DISABLE_USER_EXTENSIONS_KEY, onEnabledExtensionsChanged);
+    global.settings.connect('changed::' + EXTENSION_DISABLE_VERSION_CHECK_KEY, _onVersionValidationChanged);
+
+    enabledExtensions = getEnabledExtensions();
+
+    let finder = new ExtensionUtils.ExtensionFinder();
+    finder.connect('extension-found', (finder, extension) => {
+        loadExtension(extension);
+    });
+    finder.scanExtensions();
+}
+
+function enableAllExtensions() {
+    if (enabled)
+        return;
+
+    if (!initted) {
+        _loadExtensions();
+        initted = true;
+    } else {
+        enabledExtensions.forEach(uuid => {
+            enableExtension(uuid);
        });
-
-        this._enabledExtensions = newEnabledExtensions;
    }
+    enabled = true;
+}

-    _onSettingsWritableChanged() {
-        for (let extension of this._extensions.values()) {
-            this._updateCanChange(extension);
-            this.emit('extension-state-changed', extension);
-        }
-    }
+function disableAllExtensions() {
+    if (!enabled)
+        return;

-    _onVersionValidationChanged() {
-        // we want to reload all extensions, but only enable
-        // extensions when allowed by the sessionMode, so
-        // temporarily disable them all
-        this._enabledExtensions = [];
-
-        // The loop modifies the extensions map, so iterate over a copy
-        let extensions = [...this._extensions.values()];
-        for (let extension of extensions)
-            this.reloadExtension(extension);
-        this._enabledExtensions = this._getEnabledExtensions();
-
-        if (Main.sessionMode.allowExtensions) {
-            this._enabledExtensions.forEach(uuid => {
-                this._callExtensionEnable(uuid);
-            });
-        }
-    }
-
-    _loadExtensions() {
-        global.settings.connect(`changed::${ENABLED_EXTENSIONS_KEY}`,
-            this._onEnabledExtensionsChanged.bind(this));
-        global.settings.connect(`changed::${DISABLED_EXTENSIONS_KEY}`,
-            this._onEnabledExtensionsChanged.bind(this));
-        global.settings.connect(`changed::${DISABLE_USER_EXTENSIONS_KEY}`,
-            this._onUserExtensionsEnabledChanged.bind(this));
-        global.settings.connect(`changed::${EXTENSION_DISABLE_VERSION_CHECK_KEY}`,
-            this._onVersionValidationChanged.bind(this));
-        global.settings.connect(`writable-changed::${ENABLED_EXTENSIONS_KEY}`,
-            this._onSettingsWritableChanged.bind(this));
-        global.settings.connect(`writable-changed::${DISABLED_EXTENSIONS_KEY}`,
-            this._onSettingsWritableChanged.bind(this));
-
-        this._enabledExtensions = this._getEnabledExtensions();
-
-        let perUserDir = Gio.File.new_for_path(global.userdatadir);
-        FileUtils.collectFromDatadirs('extensions', true, (dir, info) => {
-            let fileType = info.get_file_type();
-            if (fileType != Gio.FileType.DIRECTORY)
-                return;
-            let uuid = info.get_name();
-            let existing = this.lookup(uuid);
-            if (existing) {
-                log(`Extension ${uuid} already installed in ${existing.path}. ${dir.get_path()} will not be loaded`);
-                return;
-            }
-
-            let extension;
-            let type = dir.has_prefix(perUserDir)
-                ? ExtensionType.PER_USER
-                : ExtensionType.SYSTEM;
-            try {
-                extension = this.createExtensionObject(uuid, dir, type);
-            } catch (e) {
-                logError(e, `Could not load extension ${uuid}`);
-                return;
-            }
-            this.loadExtension(extension);
+    if (initted) {
+        extensionOrder.slice().reverse().forEach(uuid => {
+            disableExtension(uuid);
        });
    }

-    _enableAllExtensions() {
-        if (this._enabled)
-            return;
+    enabled = false;
+}

-        if (!this._initted) {
-            this._loadExtensions();
-            this._initted = true;
-        } else {
-            this._enabledExtensions.forEach(uuid => {
-                this._callExtensionEnable(uuid);
-            });
-        }
-        this._enabled = true;
+function _sessionUpdated() {
+    // For now sessionMode.allowExtensions controls extensions from both the
+    // 'enabled-extensions' preference and the sessionMode.enabledExtensions
+    // property; it might make sense to make enabledExtensions independent
+    // from allowExtensions in the future
+    if (Main.sessionMode.allowExtensions) {
+        if (initted)
+            enabledExtensions = getEnabledExtensions();
+        enableAllExtensions();
+    } else {
+        disableAllExtensions();
    }
+}

-    _disableAllExtensions() {
-        if (!this._enabled)
-            return;
-
-        if (this._initted) {
-            this._extensionOrder.slice().reverse().forEach(uuid => {
-                this._callExtensionDisable(uuid);
-            });
-        }
-
-        this._enabled = false;
-    }
-
-    _sessionUpdated() {
-        // For now sessionMode.allowExtensions controls extensions from both the
-        // 'enabled-extensions' preference and the sessionMode.enabledExtensions
-        // property; it might make sense to make enabledExtensions independent
-        // from allowExtensions in the future
-        if (Main.sessionMode.allowExtensions) {
-            if (this._initted)
-                this._enabledExtensions = this._getEnabledExtensions();
-            this._enableAllExtensions();
-        } else {
-            this._disableAllExtensions();
-        }
-    }
-};
-Signals.addSignalMethods(ExtensionManager.prototype);
+function init() {
+    Main.sessionMode.connect('updated', _sessionUpdated);
+    _sessionUpdated();
+}
--- a/js/ui/focusCaretTracker.js
+++ b/js/ui/focusCaretTracker.js
@@ -49,15 +49,15 @@ var FocusCaretTracker = class FocusCaretTracker {
            this._atspiInited = true;
        }

-        return this._atspiInited;
+	return this._atspiInited;
    }

    registerFocusListener() {
        if (!this._initAtspi() || this._focusListenerRegistered)
            return;

-        this._atspiListener.register(`${STATECHANGED}:focused`);
-        this._atspiListener.register(`${STATECHANGED}:selected`);
+        this._atspiListener.register(STATECHANGED + ':focused');
+        this._atspiListener.register(STATECHANGED + ':selected');
        this._focusListenerRegistered = true;
    }

@@ -73,8 +73,8 @@ var FocusCaretTracker = class FocusCaretTracker {
        if (!this._focusListenerRegistered)
            return;

-        this._atspiListener.deregister(`${STATECHANGED}:focused`);
-        this._atspiListener.deregister(`${STATECHANGED}:selected`);
+        this._atspiListener.deregister(STATECHANGED + ':focused');
+        this._atspiListener.deregister(STATECHANGED + ':selected');
        this._focusListenerRegistered = false;
    }

--- a/js/ui/grabHelper.js
+++ b/js/ui/grabHelper.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported GrabHelper */

 const { Clutter, St } = imports.gi;

@@ -88,7 +87,7 @@ var GrabHelper = class GrabHelper {
    _isWithinGrabbedActor(actor) {
        let currentActor = this.currentGrab.actor;
        while (actor) {
-            if (this._actors.includes(actor))
+            if (this._actors.indexOf(actor) != -1)
                return true;
            if (actor == currentActor)
                return true;
--- a/js/ui/ibusCandidatePopup.js
+++ b/js/ui/ibusCandidatePopup.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported CandidatePopup */

 const { Clutter, IBus, St } = imports.gi;
 const Signals = imports.signals;
@@ -9,8 +8,8 @@ const Main = imports.ui.main;

 var MAX_CANDIDATES_PER_PAGE = 16;

-var DEFAULT_INDEX_LABELS = ['1', '2', '3', '4', '5', '6', '7', '8',
-                            '9', '0', 'a', 'b', 'c', 'd', 'e', 'f'];
+var DEFAULT_INDEX_LABELS = [ '1', '2', '3', '4', '5', '6', '7', '8',
+                             '9', '0', 'a', 'b', 'c', 'd', 'e', 'f' ];

 var CandidateArea = class CandidateArea {
    constructor() {
@@ -38,14 +37,14 @@ var CandidateArea = class CandidateArea {

        this.actor.connect('scroll-event', (actor, event) => {
            let direction = event.get_scroll_direction();
-            switch (direction) {
+            switch(direction) {
            case Clutter.ScrollDirection.UP:
                this.emit('cursor-up');
                break;
            case Clutter.ScrollDirection.DOWN:
                this.emit('cursor-down');
                break;
-            }
+            };
            return Clutter.EVENT_PROPAGATE;
        });

@@ -182,7 +181,7 @@ var CandidatePopup = class CandidatePopup {
                let window = global.display.focus_window.get_compositor_private();
                this._setDummyCursorGeometry(window.x + x, window.y + y, w, h);
            });
-        } catch (e) {
+        } catch(e) {
            // Only recent IBus versions have support for this signal
            // which is used for wayland clients. In order to work
            // with older IBus versions we can silently ignore the
@@ -199,29 +198,29 @@ var CandidatePopup = class CandidatePopup {
                this._setTextAttributes(this._preeditText.clutter_text,
                                        attrs);
        });
-        panelService.connect('show-preedit-text', () => {
+        panelService.connect('show-preedit-text', ps => {
            this._preeditText.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-preedit-text', () => {
+        panelService.connect('hide-preedit-text', ps => {
            this._preeditText.hide();
            this._updateVisibility();
        });
-        panelService.connect('update-auxiliary-text', (_ps, text, visible) => {
+        panelService.connect('update-auxiliary-text', (ps, text, visible) => {
            this._auxText.visible = visible;
            this._updateVisibility();

            this._auxText.text = text.get_text();
        });
-        panelService.connect('show-auxiliary-text', () => {
+        panelService.connect('show-auxiliary-text', ps => {
            this._auxText.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-auxiliary-text', () => {
+        panelService.connect('hide-auxiliary-text', ps => {
            this._auxText.hide();
            this._updateVisibility();
        });
-        panelService.connect('update-lookup-table', (_ps, lookupTable, visible) => {
+        panelService.connect('update-lookup-table', (ps, lookupTable, visible) => {
            this._candidateArea.actor.visible = visible;
            this._updateVisibility();

@@ -236,7 +235,7 @@ var CandidatePopup = class CandidatePopup {
            let indexes = [];
            let indexLabel;
            for (let i = 0; (indexLabel = lookupTable.get_label(i)); ++i)
-                indexes.push(indexLabel.get_text());
+                 indexes.push(indexLabel.get_text());

            Main.keyboard.resetSuggestions();

@@ -257,15 +256,15 @@ var CandidatePopup = class CandidatePopup {
            this._candidateArea.setOrientation(lookupTable.get_orientation());
            this._candidateArea.updateButtons(lookupTable.is_round(), page, nPages);
        });
-        panelService.connect('show-lookup-table', () => {
+        panelService.connect('show-lookup-table', ps => {
            this._candidateArea.actor.show();
            this._updateVisibility();
        });
-        panelService.connect('hide-lookup-table', () => {
+        panelService.connect('hide-lookup-table', ps => {
            this._candidateArea.actor.hide();
            this._updateVisibility();
        });
-        panelService.connect('focus-out', () => {
+        panelService.connect('focus-out', ps => {
            this._boxPointer.close(BoxPointer.PopupAnimation.NONE);
            Main.keyboard.resetSuggestions();
        });
--- a/js/ui/iconGrid.js
+++ b/js/ui/iconGrid.js
@@ -1,22 +1,22 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported BaseIcon, IconGrid, PaginatedIconGrid */

-const { Clutter, GLib, GObject, Meta, St } = imports.gi;
+const { Clutter, GObject, Meta, St } = imports.gi;

 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;

 var ICON_SIZE = 96;
 var MIN_ICON_SIZE = 16;

-var EXTRA_SPACE_ANIMATION_TIME = 250;
+var EXTRA_SPACE_ANIMATION_TIME = 0.25;

-var ANIMATION_TIME_IN = 350;
-var ANIMATION_TIME_OUT = 1 / 2 * ANIMATION_TIME_IN;
-var ANIMATION_MAX_DELAY_FOR_ITEM = 2 / 3 * ANIMATION_TIME_IN;
-var ANIMATION_BASE_DELAY_FOR_ITEM = 1 / 4 * ANIMATION_MAX_DELAY_FOR_ITEM;
-var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2 / 3 * ANIMATION_TIME_OUT;
-var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1 / 4 * ANIMATION_TIME_IN;
+var ANIMATION_TIME_IN = 0.350;
+var ANIMATION_TIME_OUT = 1/2 * ANIMATION_TIME_IN;
+var ANIMATION_MAX_DELAY_FOR_ITEM = 2/3 * ANIMATION_TIME_IN;
+var ANIMATION_BASE_DELAY_FOR_ITEM = 1/4 * ANIMATION_MAX_DELAY_FOR_ITEM;
+var ANIMATION_MAX_DELAY_OUT_FOR_ITEM = 2/3 * ANIMATION_TIME_OUT;
+var ANIMATION_FADE_IN_TIME_FOR_ITEM = 1/4 * ANIMATION_TIME_IN;

 var ANIMATION_BOUNCE_ICON_SCALE = 1.1;

@@ -26,7 +26,7 @@ var AnimationDirection = {
 };

 var APPICON_ANIMATION_OUT_SCALE = 3;
-var APPICON_ANIMATION_OUT_TIME = 250;
+var APPICON_ANIMATION_OUT_TIME = 0.25;

 var BaseIcon = GObject.registerClass(
 class BaseIcon extends St.Bin {
@@ -56,10 +56,6 @@ class BaseIcon extends St.Bin {

        if (params.showLabel) {
            this.label = new St.Label({ text: label });
-            this.label.clutter_text.set({
-                x_align: Clutter.ActorAlign.CENTER,
-                y_align: Clutter.ActorAlign.CENTER
-            });
            this._box.add_actor(this.label);
        } else {
            this.label = null;
@@ -75,14 +71,14 @@ class BaseIcon extends St.Bin {
        this._iconThemeChangedId = cache.connect('icon-theme-changed', this._onIconThemeChanged.bind(this));
    }

-    vfunc_get_preferred_width(_forHeight) {
+    vfunc_get_preferred_width(forHeight) {
        // Return the actual height to keep the squared aspect
        return this.get_preferred_height(-1);
    }

    // This can be overridden by a subclass, or by the createIcon
    // parameter to _init()
-    createIcon(_size) {
+    createIcon(size) {
        throw new GObject.NotImplementedError(`createIcon in ${this.constructor.name}`);
    }

@@ -141,15 +137,11 @@ class BaseIcon extends St.Bin {
        // animating.
        zoomOutActor(this.child);
    }
-
-    update() {
-        this._createIconTexture(this.iconSize);
-    }
 });

 function clamp(value, min, max) {
    return Math.max(Math.min(value, max), min);
-}
+};

 function zoomOutActor(actor) {
    let actorClone = new Clutter.Clone({ source: actor,
@@ -172,21 +164,23 @@ function zoomOutActor(actor) {
    let containedX = clamp(scaledX, monitor.x, monitor.x + monitor.width - scaledWidth);
    let containedY = clamp(scaledY, monitor.y, monitor.y + monitor.height - scaledHeight);

-    actorClone.ease({
-        scale_x: APPICON_ANIMATION_OUT_SCALE,
-        scale_y: APPICON_ANIMATION_OUT_SCALE,
-        translation_x: containedX - scaledX,
-        translation_y: containedY - scaledY,
-        opacity: 0,
-        duration: APPICON_ANIMATION_OUT_TIME,
-        mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-        onComplete: () => actorClone.destroy()
-    });
+    Tweener.addTween(actorClone,
+                     { time: APPICON_ANIMATION_OUT_TIME,
+                       scale_x: APPICON_ANIMATION_OUT_SCALE,
+                       scale_y: APPICON_ANIMATION_OUT_SCALE,
+                       translation_x: containedX - scaledX,
+                       translation_y: containedY - scaledY,
+                       opacity: 0,
+                       transition: 'easeOutQuad',
+                       onComplete() {
+                           actorClone.destroy();
+                       }
+                    });
 }

 var IconGrid = GObject.registerClass({
-    Signals: { 'animation-done': {},
-               'child-focused': { param_types: [Clutter.Actor.$gtype] } },
+    Signals: {'animation-done': {},
+              'child-focused': { param_types: [Clutter.Actor.$gtype]} },
 }, class IconGrid extends St.Widget {
    _init(params) {
        super._init({ style_class: 'icon-grid',
@@ -212,8 +206,6 @@ var IconGrid = GObject.registerClass({
        this.rightPadding = 0;
        this.leftPadding = 0;

-        this._updateIconSizesLaterId = 0;
-
        this._items = [];
        this._clonesAnimating = [];
        // Pulled from CSS, but hardcode some defaults here
@@ -226,19 +218,11 @@ var IconGrid = GObject.registerClass({
        // swarming into the void ...
        this.connect('notify::mapped', () => {
            if (!this.mapped)
-                this._resetAnimationActors();
+                this._cancelAnimation();
        });

        this.connect('actor-added', this._childAdded.bind(this));
        this.connect('actor-removed', this._childRemoved.bind(this));
-        this.connect('destroy', this._onDestroy.bind(this));
-    }
-
-    _onDestroy() {
-        if (this._updateIconSizesLaterId) {
-            Meta.later_remove (this._updateIconSizesLaterId);
-            this._updateIconSizesLaterId = 0;
-        }
    }

    _keyFocusIn(actor) {
@@ -253,7 +237,7 @@ var IconGrid = GObject.registerClass({
        child.disconnect(child._iconGridKeyFocusInId);
    }

-    vfunc_get_preferred_width(_forHeight) {
+    vfunc_get_preferred_width(forHeight) {
        if (this._fillParent)
            // Ignore all size requests of children and request a size of 0;
            // later we'll allocate as many children as fit the parent
@@ -292,7 +276,7 @@ var IconGrid = GObject.registerClass({
        if (forWidth < 0)
            nColumns = children.length;
        else
-            [nColumns] = this._computeLayout(forWidth);
+            [nColumns, ] = this._computeLayout(forWidth);

        let nRows;
        if (nColumns > 0)
@@ -327,15 +311,15 @@ var IconGrid = GObject.registerClass({
        let [nColumns, usedWidth] = this._computeLayout(availWidth);

        let leftEmptySpace;
-        switch (this._xAlign) {
-        case St.Align.START:
-            leftEmptySpace = 0;
-            break;
-        case St.Align.MIDDLE:
-            leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
-            break;
-        case St.Align.END:
-            leftEmptySpace = availWidth - usedWidth;
+        switch(this._xAlign) {
+            case St.Align.START:
+                leftEmptySpace = 0;
+                break;
+            case St.Align.MIDDLE:
+                leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
+                break;
+            case St.Align.END:
+                leftEmptySpace = availWidth - usedWidth;
        }

        let animating = this._clonesAnimating.length > 0;
@@ -393,15 +377,15 @@ var IconGrid = GObject.registerClass({
            return true;

        for (let child = this.get_first_child();
-            child != null;
-            child = child.get_next_sibling()) {
+             child != null;
+             child = child.get_next_sibling()) {

            if (!child.visible || !child.opacity)
                continue;

            let childVolume = child.get_transformed_paint_volume(this);
            if (!childVolume)
-                return false;
+                return false

            paintVolume.union(childVolume);
        }
@@ -417,17 +401,18 @@ var IconGrid = GObject.registerClass({
        return this._getVisibleChildren();
    }

-    _resetAnimationActors() {
+    _cancelAnimation() {
+        this._clonesAnimating.forEach(clone => { clone.destroy(); });
+        this._clonesAnimating = [];
+    }
+
+    _animationDone() {
        this._clonesAnimating.forEach(clone => {
            clone.source.reactive = true;
            clone.source.opacity = 255;
            clone.destroy();
        });
        this._clonesAnimating = [];
-    }
-
-    _animationDone() {
-        this._resetAnimationActors();
        this.emit('animation-done');
    }

@@ -436,7 +421,7 @@ var IconGrid = GObject.registerClass({
            throw new GObject.NotImplementedError("Pulse animation only implements " +
                                                  "'in' animation direction");

-        this._resetAnimationActors();
+        this._cancelAnimation();

        let actors = this._getChildrenToAnimate();
        if (actors.length == 0) {
@@ -459,32 +444,30 @@ var IconGrid = GObject.registerClass({
            let delay = index / actors.length * maxDelay;
            let bounceUpTime = ANIMATION_TIME_IN / 4;
            let isLastItem = index == actors.length - 1;
-            actor.ease({
-                scale_x: ANIMATION_BOUNCE_ICON_SCALE,
-                scale_y: ANIMATION_BOUNCE_ICON_SCALE,
-                duration: bounceUpTime,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                delay: delay,
-                onComplete: () => {
-                    let duration = ANIMATION_TIME_IN - bounceUpTime;
-                    actor.ease({
-                        scale_x: 1,
-                        scale_y: 1,
-                        duration,
-                        mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                        onComplete: () => {
-                            if (isLastItem)
-                                this._animationDone();
-                            actor.reactive = true;
-                        }
-                    });
-                }
-            });
+            Tweener.addTween(actor,
+                            { time: bounceUpTime,
+                              transition: 'easeInOutQuad',
+                              delay: delay,
+                              scale_x: ANIMATION_BOUNCE_ICON_SCALE,
+                              scale_y: ANIMATION_BOUNCE_ICON_SCALE,
+                              onComplete: () => {
+                                  Tweener.addTween(actor,
+                                                   { time: ANIMATION_TIME_IN - bounceUpTime,
+                                                     transition: 'easeInOutQuad',
+                                                     scale_x: 1,
+                                                     scale_y: 1,
+                                                     onComplete: () => {
+                                                        if (isLastItem)
+                                                            this._animationDone();
+                                                    }
+                                                   });
+                              }
+                            });
        }
    }

    animateSpring(animationDirection, sourceActor) {
-        this._resetAnimationActors();
+        this._cancelAnimation();

        let actors = this._getChildrenToAnimate();
        if (actors.length == 0) {
@@ -521,7 +504,7 @@ var IconGrid = GObject.registerClass({
            this._clonesAnimating.push(actorClone);
            Main.uiGroup.add_actor(actorClone);

-            let [width, height] = this._getAllocatedChildSizeAndSpacing(actor);
+            let [width, height,,] = this._getAllocatedChildSizeAndSpacing(actor);
            actorClone.set_size(width, height);
            let scaleX = sourceScaledWidth / width;
            let scaleY = sourceScaledHeight / height;
@@ -538,25 +521,21 @@ var IconGrid = GObject.registerClass({

                let delay = (1 - (actor._distance - minDist) / normalization) * ANIMATION_MAX_DELAY_FOR_ITEM;
                let [finalX, finalY]  = actor._transformedPosition;
-                movementParams = {
-                    x: finalX,
-                    y: finalY,
-                    scale_x: 1,
-                    scale_y: 1,
-                    duration: ANIMATION_TIME_IN,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
-                };
-
-                if (isLastItem)
-                    movementParams.onComplete = this._animationDone.bind(this);
-
-                fadeParams = {
-                    opacity: 255,
-                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
-                };
+                movementParams = { time: ANIMATION_TIME_IN,
+                                   transition: 'easeInOutQuad',
+                                   delay: delay,
+                                   x: finalX,
+                                   y: finalY,
+                                   scale_x: 1,
+                                   scale_y: 1,
+                                   onComplete: () => {
+                                       if (isLastItem)
+                                           this._animationDone();
+                                   }};
+                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               transition: 'easeInOutQuad',
+                               delay: delay,
+                               opacity: 255 };
            } else {
                let isLastItem = actor._distance == maxDist;

@@ -564,29 +543,26 @@ var IconGrid = GObject.registerClass({
                actorClone.set_position(startX, startY);

                let delay = (actor._distance - minDist) / normalization * ANIMATION_MAX_DELAY_OUT_FOR_ITEM;
-                movementParams = {
-                    x: adjustedSourcePositionX,
-                    y: adjustedSourcePositionY,
-                    scale_x: scaleX,
-                    scale_y: scaleY,
-                    duration: ANIMATION_TIME_OUT,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay
-                };
-
-                if (isLastItem)
-                    movementParams.onComplete = this._animationDone.bind(this);
-
-                fadeParams = {
-                    opacity: 0,
-                    duration: ANIMATION_FADE_IN_TIME_FOR_ITEM,
-                    mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                    delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM
-                };
+                movementParams = { time: ANIMATION_TIME_OUT,
+                                   transition: 'easeInOutQuad',
+                                   delay: delay,
+                                   x: adjustedSourcePositionX,
+                                   y: adjustedSourcePositionY,
+                                   scale_x: scaleX,
+                                   scale_y: scaleY,
+                                   onComplete: () => {
+                                       if (isLastItem)
+                                           this._animationDone();
+                                   }};
+                fadeParams = { time: ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               transition: 'easeInOutQuad',
+                               delay: ANIMATION_TIME_OUT + delay - ANIMATION_FADE_IN_TIME_FOR_ITEM,
+                               opacity: 0 };
            }

-            actorClone.ease(movementParams);
-            actorClone.ease(fadeParams);
+
+            Tweener.addTween(actorClone, movementParams);
+            Tweener.addTween(actorClone, fadeParams);
        }
    }

@@ -626,8 +602,6 @@ var IconGrid = GObject.registerClass({
    }

    _computeLayout(forWidth) {
-        this.ensure_style();
-
        let nColumns = 0;
        let usedWidth = this.leftPadding + this.rightPadding;
        let spacing = this._getSpacing();
@@ -736,8 +710,8 @@ var IconGrid = GObject.registerClass({
        if (this._padWithSpacing) {
            // minRows + 1 because we want to put spacing before the first row, so it is like we have one more row
            // to divide the empty space
-            maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows + 1));
-            maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns + 1));
+            maxVSpacing = Math.floor(maxEmptyVArea / (this._minRows +1));
+            maxHSpacing = Math.floor(maxEmptyHArea / (this._minColumns +1));
        } else {
            if (this._minRows <=  1)
                maxVSpacing = maxEmptyVArea;
@@ -769,10 +743,11 @@ var IconGrid = GObject.registerClass({
        this._fixedHItemSize = this._hItemSize;
        this._fixedVItemSize = this._vItemSize;
        this._updateSpacingForSize(availWidth, availHeight);
+        let spacing = this._getSpacing();

        if (this.columnsForWidth(availWidth) < this._minColumns || this.rowsForHeight(availHeight) < this._minRows) {
-            let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth;
-            let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight;
+            let neededWidth = this.usedWidthForNColumns(this._minColumns) - availWidth ;
+            let neededHeight = this.usedHeightForNRows(this._minRows) - availHeight ;

            let neededSpacePerItem = (neededWidth > neededHeight) ? Math.ceil(neededWidth / this._minColumns)
                                                                  : Math.ceil(neededHeight / this._minRows);
@@ -781,26 +756,23 @@ var IconGrid = GObject.registerClass({

            this._updateSpacingForSize(availWidth, availHeight);
        }
-        if (!this._updateIconSizesLaterId)
-            this._updateIconSizesLaterId = Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
-                                                          this._updateIconSizes.bind(this));
+        Meta.later_add(Meta.LaterType.BEFORE_REDRAW,
+                       this._updateIconSizes.bind(this));
    }

    // Note that this is ICON_SIZE as used by BaseIcon, not elsewhere in IconGrid; it's a bit messed up
    _updateIconSizes() {
-        this._updateIconSizesLaterId = 0;
        let scale = Math.min(this._fixedHItemSize, this._fixedVItemSize) / Math.max(this._hItemSize, this._vItemSize);
        let newIconSize = Math.floor(ICON_SIZE * scale);
        for (let i in this._items) {
            this._items[i].icon.setIconSize(newIconSize);
        }
-        return GLib.SOURCE_REMOVE;
    }
 });

 var PaginatedIconGrid = GObject.registerClass({
-    Signals: { 'space-opened': {},
-               'space-closed': {} },
+    Signals: {'space-opened': {},
+              'space-closed': {} },
 }, class PaginatedIconGrid extends IconGrid {
    _init(params) {
        super._init(params);
@@ -811,13 +783,13 @@ var PaginatedIconGrid = GObject.registerClass({
        this._childrenPerPage = 0;
    }

-    vfunc_get_preferred_height(_forWidth) {
+    vfunc_get_preferred_height(forWidth) {
        let height = (this._availableHeightPerPageForItems() + this.bottomPadding + this.topPadding) * this._nPages + this._spaceBetweenPages * this._nPages;
        return [height, height];
    }

    vfunc_allocate(box, flags) {
-        if (this._childrenPerPage == 0)
+         if (this._childrenPerPage == 0)
            log('computePages() must be called before allocate(); pagination will not work.');

        this.set_allocation(box, flags);
@@ -830,24 +802,26 @@ var PaginatedIconGrid = GObject.registerClass({
        }
        let children = this._getVisibleChildren();
        let availWidth = box.x2 - box.x1;
+        let availHeight = box.y2 - box.y1;
        let spacing = this._getSpacing();
        let [nColumns, usedWidth] = this._computeLayout(availWidth);

        let leftEmptySpace;
-        switch (this._xAlign) {
-        case St.Align.START:
-            leftEmptySpace = 0;
-            break;
-        case St.Align.MIDDLE:
-            leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
-            break;
-        case St.Align.END:
-            leftEmptySpace = availWidth - usedWidth;
+        switch(this._xAlign) {
+            case St.Align.START:
+                leftEmptySpace = 0;
+                break;
+            case St.Align.MIDDLE:
+                leftEmptySpace = Math.floor((availWidth - usedWidth) / 2);
+                break;
+            case St.Align.END:
+                leftEmptySpace = availWidth - usedWidth;
        }

        let x = box.x1 + leftEmptySpace + this.leftPadding;
        let y = box.y1 + this.topPadding;
        let columnIndex = 0;
+        let rowIndex = 0;

        for (let i = 0; i < children.length; i++) {
            let childBox = this._calculateChildBox(children[i], x, y, box);
@@ -857,15 +831,15 @@ var PaginatedIconGrid = GObject.registerClass({
            columnIndex++;
            if (columnIndex == nColumns) {
                columnIndex = 0;
+                rowIndex++;
            }
            if (columnIndex == 0) {
                y += this._getVItemSize() + spacing;
                if ((i + 1) % this._childrenPerPage == 0)
                    y +=  this._spaceBetweenPages - spacing + this.bottomPadding + this.topPadding;
                x = box.x1 + leftEmptySpace + this.leftPadding;
-            } else {
+            } else
                x += this._getHItemSize() + spacing;
-            }
        }
    }

@@ -879,7 +853,7 @@ var PaginatedIconGrid = GObject.registerClass({
    }

    _computePages(availWidthPerPage, availHeightPerPage) {
-        let [nColumns, usedWidth_] = this._computeLayout(availWidthPerPage);
+        let [nColumns, usedWidth] = this._computeLayout(availWidthPerPage);
        let nRows;
        let children = this._getVisibleChildren();
        if (nColumns > 0)
@@ -889,6 +863,7 @@ var PaginatedIconGrid = GObject.registerClass({
        if (this._rowLimit)
            nRows = Math.min(nRows, this._rowLimit);

+        let spacing = this._getSpacing();
        // We want to contain the grid inside the parent box with padding
        this._rowsPerPage = this.rowsForHeight(availHeightPerPage);
        this._nPages = Math.ceil(nRows / this._rowsPerPage);
@@ -917,7 +892,7 @@ var PaginatedIconGrid = GObject.registerClass({
        if (!this._nPages)
            return 0;

-        let firstPageItem = pageNumber * this._childrenPerPage;
+        let firstPageItem = pageNumber * this._childrenPerPage
        let childBox = this._getVisibleChildren()[firstPageItem].get_allocation_box();
        return childBox.y1 - this.topPadding;
    }
@@ -991,14 +966,13 @@ var PaginatedIconGrid = GObject.registerClass({

        for (let i = 0; i < children.length; i++) {
            children[i].translation_y = 0;
-            let params = {
-                translation_y: translationY,
-                duration: EXTRA_SPACE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD
-            };
+            let params = { translation_y: translationY,
+                           time: EXTRA_SPACE_ANIMATION_TIME,
+                           transition: 'easeInOutQuad'
+                         };
            if (i == (children.length - 1))
-                params.onComplete = () => this.emit('space-opened');
-            children[i].ease(params);
+                params.onComplete = () => { this.emit('space-opened'); };
+            Tweener.addTween(children[i], params);
        }
    }

@@ -1011,12 +985,12 @@ var PaginatedIconGrid = GObject.registerClass({
        for (let i = 0; i < this._translatedChildren.length; i++) {
            if (!this._translatedChildren[i].translation_y)
                continue;
-            this._translatedChildren[i].ease({
-                translation_y: 0,
-                duration: EXTRA_SPACE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_OUT_QUAD,
-                onComplete: () => this.emit('space-closed')
-            });
+            Tweener.addTween(this._translatedChildren[i],
+                             { translation_y: 0,
+                               time: EXTRA_SPACE_ANIMATION_TIME,
+                               transition: 'easeInOutQuad',
+                               onComplete: () => { this.emit('space-closed'); }
+                             });
        }
    }
 });
--- a/js/ui/inhibitShortcutsDialog.js
+++ b/js/ui/inhibitShortcutsDialog.js
@@ -1,4 +1,3 @@
-/* exported InhibitShortcutsDialog */
 const { Clutter, Gio, GLib, GObject, Gtk, Meta, Shell } = imports.gi;

 const Dialog = imports.ui.dialog;
@@ -112,7 +111,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
    }

    vfunc_show() {
-        if (this._app && APP_WHITELIST.includes(this._app.get_id())) {
+        if (this._app && APP_WHITELIST.indexOf(this._app.get_id()) != -1) {
            this._emitResponse(DialogResponse.ALLOW);
            return;
        }
@@ -140,7 +139,7 @@ var InhibitShortcutsDialog = GObject.registerClass({
                        return;
                    }

-                    let [permissions] = res;
+                    let [permissions, data] = res;
                    if (permissions[appId] === undefined) // Not found
                        this._dialog.open();
                    else if (permissions[appId] == GRANTED)
--- a/js/ui/kbdA11yDialog.js
+++ b/js/ui/kbdA11yDialog.js
@@ -1,4 +1,3 @@
-/* exported KbdA11yDialog */
 const { Clutter, Gio, GObject } = imports.gi;

 const Dialog = imports.ui.dialog;
--- a/js/ui/keyboard.js
+++ b/js/ui/keyboard.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Keyboard */

 const { Clutter, Gio, GLib, GObject, Meta, St } = imports.gi;
 const Signals = imports.signals;
@@ -11,10 +10,11 @@ const Layout = imports.ui.layout;
 const Main = imports.ui.main;
 const PageIndicators = imports.ui.pageIndicators;
 const PopupMenu = imports.ui.popupMenu;
+const Tweener = imports.ui.tweener;

-var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2;
+var KEYBOARD_REST_TIME = Layout.KEYBOARD_ANIMATION_TIME * 2 * 1000;
 var KEY_LONG_PRESS_TIME = 250;
-var PANEL_SWITCH_ANIMATION_TIME = 500;
+var PANEL_SWITCH_ANIMATION_TIME = 0.5;
 var PANEL_SWITCH_RELATIVE_DISTANCE = 1 / 3; /* A third of the actor width */

 const A11Y_APPLICATIONS_SCHEMA = 'org.gnome.desktop.a11y.applications';
@@ -24,29 +24,29 @@ const SHOW_KEYBOARD = 'screen-keyboard-enabled';
 const KEY_SIZE = 2;

 const defaultKeysPre = [
-    [[], [], [{ width: 1.5, level: 1, extraClassName: 'shift-key-lowercase' }], [{ label: '?123', width: 1.5, level: 2 }]],
-    [[], [], [{ width: 1.5, level: 0, extraClassName: 'shift-key-uppercase' }], [{ label: '?123', width: 1.5, level: 2 }]],
-    [[], [], [{ label: '=/<', width: 1.5, level: 3 }], [{ label: 'ABC', width: 1.5, level: 0 }]],
-    [[], [], [{ label: '?123', width: 1.5, level: 2 }], [{ label: 'ABC', width: 1.5, level: 0 }]],
+    [ [], [], [{ width: 1.5, level: 1, extraClassName: 'shift-key-lowercase' }], [{ label: '?123', width: 1.5, level: 2 }] ],
+    [ [], [], [{ width: 1.5, level: 0, extraClassName: 'shift-key-uppercase' }], [{ label: '?123', width: 1.5, level: 2 }] ],
+    [ [], [], [{ label: '=/<', width: 1.5, level: 3 }], [{ label: 'ABC', width: 1.5, level: 0 }] ],
+    [ [], [], [{ label: '?123', width: 1.5, level: 2 }], [{ label: 'ABC', width: 1.5, level: 0 }] ],
 ];

 const defaultKeysPost = [
-    [[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
-     [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
-     [{ width: 3, level: 1, right: true, extraClassName: 'shift-key-lowercase' }],
-     [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]],
-    [[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
-     [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
-     [{ width: 3, level: 0, right: true, extraClassName: 'shift-key-uppercase' }],
-     [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]],
-    [[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
-     [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
-     [{ label: '=/<', width: 3, level: 3, right: true }],
-     [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]],
-    [[{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
-     [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
-     [{ label: '?123', width: 3, level: 2, right: true }],
-     [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }]],
+    [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
+      [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
+      [{ width: 3, level: 1, right: true, extraClassName: 'shift-key-lowercase' }],
+      [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
+    [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
+      [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
+      [{ width: 3, level: 0, right: true, extraClassName: 'shift-key-uppercase' }],
+      [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
+    [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
+      [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
+      [{ label: '=/<', width: 3, level: 3, right: true }],
+      [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
+    [ [{ label: '⌫', width: 1.5, keyval: Clutter.KEY_BackSpace }],
+      [{ width: 2, keyval: Clutter.KEY_Return, extraClassName: 'enter-key' }],
+      [{ label: '?123', width: 3, level: 2, right: true }],
+      [{ label: '☻', action: 'emoji' }, { action: 'languageMenu', extraClassName: 'layout-key' }, { action: 'hide', extraClassName: 'hide-key' }] ],
 ];

 var AspectContainer = GObject.registerClass(
@@ -100,7 +100,7 @@ class KeyContainer extends St.Widget {
        this._rows = [];
    }

-    appendRow() {
+    appendRow(length) {
        this._currentRow++;
        this._currentCol = 0;

@@ -297,7 +297,7 @@ var Key = class Key {
    }

    _press(key) {
-        this.emit('activated');
+        this.emit('activated')

        if (key != this.key || this._extended_keys.length == 0) {
            this.emit('pressed', this._getKeyval(key), key);
@@ -405,6 +405,9 @@ var Key = class Key {
            return Clutter.EVENT_PROPAGATE;
        });
        button.connect('touch-event', (actor, event) => {
+            let device = event.get_device();
+            let sequence = event.get_event_sequence();
+
            // We only handle touch events here on wayland. On X11
            // we do get emulated pointer events, which already works
            // for single-touch cases. Besides, the X11 passive touch grab
@@ -474,7 +477,7 @@ var KeyboardModel = class {

    _loadModel(groupName) {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/%s.json'.format(groupName));
-        let [success_, contents] = file.load_contents(null);
+        let [success, contents] = file.load_contents(null);
        if (contents instanceof Uint8Array)
            contents = imports.byteArray.toString(contents);

@@ -569,27 +572,11 @@ var FocusTracker = class {
 };
 Signals.addSignalMethods(FocusTracker.prototype);

-var EmojiPager = GObject.registerClass({
-    Properties: {
-        'delta': GObject.ParamSpec.int(
-            'delta', 'delta', 'delta',
-            GObject.ParamFlags.READWRITE,
-            GLib.MININT32, GLib.MAXINT32, 0)
-    },
-    Signals: {
-        'emoji': { param_types: [GObject.TYPE_STRING] },
-        'page-changed': {
-            param_types: [GObject.TYPE_INT, GObject.TYPE_INT, GObject.TYPE_INT]
-        }
-    }
-}, class EmojiPager extends St.Widget {
-    _init(sections, nCols, nRows) {
-        super._init({
-            layout_manager: new Clutter.BinLayout(),
-            reactive: true,
-            clip_to_allocation: true
-        });
-
+var EmojiPager = class EmojiPager {
+    constructor(sections, nCols, nRows) {
+        this.actor = new St.Widget({ layout_manager: new Clutter.BinLayout(),
+                                     reactive: true,
+                                     clip_to_allocation: true });
        this._sections = sections;
        this._nCols = nCols;
        this._nRows = nRows;
@@ -611,7 +598,7 @@ var EmojiPager = GObject.registerClass({
        panAction.connect('gesture-cancel', this._onPanCancel.bind(this));
        panAction.connect('gesture-end', this._onPanEnd.bind(this));
        this._panAction = panAction;
-        this.add_action(panAction);
+        this.actor.add_action(panAction);
    }

    get delta() {
@@ -624,11 +611,7 @@ var EmojiPager = GObject.registerClass({
        else if (value < -this._width)
            value = -this._width;

-        if (this._delta == value)
-            return;
-
        this._delta = value;
-        this.notify('delta');

        if (value == 0)
            return;
@@ -645,8 +628,8 @@ var EmojiPager = GObject.registerClass({
            if (followingPage != null) {
                this._followingPanel = this._generatePanel(followingPage);
                this._followingPanel.set_pivot_point(0.5, 0.5);
-                this.add_child(this._followingPanel);
-                this.set_child_below_sibling(this._followingPanel, this._panel);
+                this.actor.add_child(this._followingPanel);
+                this.actor.set_child_below_sibling(this._followingPanel, this._panel);
            }

            this._followingPage = followingPage;
@@ -682,7 +665,7 @@ var EmojiPager = GObject.registerClass({
    }

    _onPan(action) {
-        let [dist_, dx, dy_] = action.get_motion_delta(0);
+        let [dist, dx, dy] = action.get_motion_delta(0);
        this.delta = this.delta + dx;

        if (this._currentKey != null) {
@@ -694,13 +677,13 @@ var EmojiPager = GObject.registerClass({
    }

    _onPanBegin() {
-        this._width = this.width;
+        this._width = this.actor.width;
        return true;
    }

    _onPanEnd() {
-        if (Math.abs(this._delta) < this.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
-            this._onPanCancel();
+        if (Math.abs(this._delta) < this.actor.width * PANEL_SWITCH_RELATIVE_DISTANCE) {
+            this._onPanCancel()
        } else {
            let value;
            if (this._delta > 0)
@@ -711,24 +694,28 @@ var EmojiPager = GObject.registerClass({
            let relDelta = Math.abs(this._delta - value) / this._width;
            let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);

-            this.remove_all_transitions();
-            this.ease_property('delta', value, {
-                duration: time,
-                onComplete: () => {
-                    this.setCurrentPage(this.getFollowingPage());
-                }
-            });
+            Tweener.removeTweens(this);
+            Tweener.addTween(this,
+                             { delta: value,
+                               time: time,
+                               transition: 'easeInOutQuad',
+                               onComplete() {
+                                   this.setCurrentPage(this.getFollowingPage());
+                               }
+                             });
        }
    }

    _onPanCancel() {
-        let relDelta = Math.abs(this._delta) / this.width;
+        let relDelta = Math.abs(this._delta) / this.actor.width;
        let time = PANEL_SWITCH_ANIMATION_TIME * Math.abs(relDelta);

-        this.remove_all_transitions();
-        this.ease_property('delta', 0, {
-            duration: time,
-        });
+        Tweener.removeTweens(this);
+        Tweener.addTween(this,
+                         { delta: 0,
+                           time: time,
+                           transition: 'easeInOutQuad',
+                         });
    }

    _initPagingInfo() {
@@ -838,7 +825,7 @@ var EmojiPager = GObject.registerClass({

        if (!this._panel) {
            this._panel = this._generatePanel(nPage);
-            this.add_child(this._panel);
+            this.actor.add_child(this._panel);
        }

        let page = this._pages[nPage];
@@ -855,7 +842,8 @@ var EmojiPager = GObject.registerClass({
            }
        }
    }
-});
+};
+Signals.addSignalMethods(EmojiPager.prototype);

 var EmojiSelection = class EmojiSelection {
    constructor() {
@@ -877,7 +865,7 @@ var EmojiSelection = class EmojiSelection {
                                        x_expand: true,
                                        y_expand: true,
                                        vertical: true });
-        this.actor.connect('notify::mapped', () => this._emojiPager.setCurrentPage(0));
+        this.actor.connect('notify::mapped', () => { this._emojiPager.setCurrentPage(0); });

        this._emojiPager = new EmojiPager(this._sections, 11, 3);
        this._emojiPager.connect('page-changed', (pager, section, page, nPages) => {
@@ -919,12 +907,13 @@ var EmojiSelection = class EmojiSelection {

    _populateSections() {
        let file = Gio.File.new_for_uri('resource:///org/gnome/shell/osk-layouts/emoji.json');
-        let [success_, contents] = file.load_contents(null);
+        let [success, contents] = file.load_contents(null);

        if (contents instanceof Uint8Array)
            contents = imports.byteArray.toString(contents);
        let emoji = JSON.parse(contents);

+        let pages = [];
        let variants = [];
        let currentKey = 0;
        let currentSection = null;
@@ -959,14 +948,14 @@ var EmojiSelection = class EmojiSelection {

        key = new Key('ABC', []);
        key.keyButton.add_style_class_name('default-key');
-        key.connect('released', () => this.emit('toggle'));
+        key.connect('released', () => { this.emit('toggle'); });
        row.appendKey(key.actor, 1.5);

        for (let i = 0; i < this._sections.length; i++) {
            let section = this._sections[i];

            key = new Key(section.label, []);
-            key.connect('released', () => this._emojiPager.setCurrentSection(section, 0));
+            key.connect('released', () => { this._emojiPager.setCurrentSection(section, 0) });
            row.appendKey(key.actor);

            section.button = key;
@@ -1085,7 +1074,7 @@ var Keyboard = class Keyboard {
                let manager = Clutter.DeviceManager.get_default();
                let device = manager.get_device(deviceId);

-                if (!device.get_device_name().includes('XTEST')) {
+                if (device.get_device_name().indexOf('XTEST') < 0) {
                    this._lastDeviceId = deviceId;
                    this._syncEnabled();
                }
@@ -1186,7 +1175,7 @@ var Keyboard = class Keyboard {

        this._emojiSelection = new EmojiSelection();
        this._emojiSelection.connect('toggle', this._toggleEmoji.bind(this));
-        this._emojiSelection.connect('hide', () => this.hide());
+        this._emojiSelection.connect('hide', (selection) => { this.hide(); });
        this._emojiSelection.connect('emoji-selected', (selection, emoji) => {
            this._keyboardController.commitString(emoji);
        });
@@ -1239,12 +1228,12 @@ var Keyboard = class Keyboard {
        }

        if (!this._showIdleId) {
-            this._showIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT_IDLE, () => {
-                this.show(Main.layoutManager.focusIndex);
-                this._showIdleId = 0;
-                return GLib.SOURCE_REMOVE;
-            });
-            GLib.Source.set_name_by_id(this._showIdleId, '[gnome-shell] this.show');
+          this._showIdleId = GLib.idle_add(GLib.PRIORITY_DEFAULT_IDLE, () => {
+              this.show(Main.layoutManager.focusIndex);
+              this._showIdleId = 0;
+              return GLib.SOURCE_REMOVE;
+          });
+          GLib.Source.set_name_by_id(this._showIdleId, '[gnome-shell] this.show');
        }
    }

@@ -1297,7 +1286,7 @@ var Keyboard = class Keyboard {
                    }
                }
            });
-            button.connect('released', (actor, keyval, _str) => {
+            button.connect('released', (actor, keyval, str) => {
                if (keyval != 0) {
                    if (button._keyvalPress)
                        this._keyboardController.keyvalRelease(keyval);
@@ -1417,6 +1406,8 @@ var Keyboard = class Keyboard {
    }

    _getDefaultKeysForRow(row, numRows, level) {
+        let pre, post;
+
        /* The first 2 rows in defaultKeysPre/Post belong together with
         * the first 2 rows on each keymap. On keymaps that have more than
         * 4 rows, the last 2 default key rows must be respectively
@@ -1457,8 +1448,8 @@ var Keyboard = class Keyboard {
        numOfVertSlots = rows.length;

        for (let i = 0; i < rows.length; ++i) {
-            let keyboardRow = rows[i];
-            let keys = keyboardRow.get_children();
+            let keyboard_row = rows[i];
+            let keys = keyboard_row.get_children();

            numOfHorizSlots = Math.max(numOfHorizSlots, keys.length);
        }
@@ -1482,7 +1473,7 @@ var Keyboard = class Keyboard {
        this._setActiveLayer(0);
    }

-    _onKeyboardGroupsChanged() {
+    _onKeyboardGroupsChanged(keyboard) {
        let nonGroupActors = [this._emojiSelection.actor, this._keypad.actor];
        this._aspectContainer.get_children().filter(c => !nonGroupActors.includes(c)).forEach(c => {
            c.destroy();
@@ -1655,7 +1646,8 @@ var Keyboard = class Keyboard {
    }

    _windowSlideAnimationComplete(window, delta) {
-        // Synchronize window positions again.
+        // Synchronize window and actor positions again.
+        let windowActor = window.get_compositor_private();
        let frameRect = window.get_frame_rect();
        frameRect.y += delta;
        window.move_frame(true, frameRect.x, frameRect.y);
@@ -1668,23 +1660,19 @@ var Keyboard = class Keyboard {
            return;

        if (show) {
-            windowActor.ease({
-                y: windowActor.y - deltaY,
-                duration: Layout.KEYBOARD_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._windowSlideAnimationComplete(window, -deltaY);
-                }
-            });
+            Tweener.addTween(windowActor,
+                             { y: windowActor.y - deltaY,
+                               time: Layout.KEYBOARD_ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                               onComplete: this._windowSlideAnimationComplete,
+                               onCompleteParams: [window, -deltaY] });
        } else {
-            windowActor.ease({
-                y: windowActor.y + deltaY,
-                duration: Layout.KEYBOARD_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_IN_QUAD,
-                onComplete: () => {
-                    this._windowSlideAnimationComplete(window, deltaY);
-                }
-            });
+            Tweener.addTween(windowActor,
+                             { y: windowActor.y + deltaY,
+                               time: Layout.KEYBOARD_ANIMATION_TIME,
+                               transition: 'easeInQuad',
+                               onComplete: this._windowSlideAnimationComplete,
+                               onCompleteParams: [window, deltaY] });
        }
    }

@@ -1700,11 +1688,12 @@ var Keyboard = class Keyboard {
        this._animFocusedWindow = window;
    }

-    setCursorLocation(window, x, y, w, h) {
+    setCursorLocation(window, x, y , w, h) {
        let monitor = Main.layoutManager.keyboardMonitor;

        if (window && monitor) {
            let keyboardHeight = Main.layoutManager.keyboardBox.height;
+            let focusObscured = false;

            if (y + h >= monitor.y + monitor.height - keyboardHeight) {
                if (this._keyboardVisible)
@@ -1748,13 +1737,14 @@ var KeyboardController = class {
        this.emit('groups-changed');
    }

-    _onSourceChanged(inputSourceManager, _oldSource) {
+    _onSourceChanged(inputSourceManager, oldSource) {
        let source = inputSourceManager.currentSource;
        this._currentSource = source;
        this.emit('active-group', source.id);
    }

    _onContentPurposeHintsChanged(method) {
+        let hints = method.content_hints;
        let purpose = method.content_purpose;
        let emojiVisible = false;
        let keypadVisible = false;
@@ -1769,13 +1759,13 @@ var KeyboardController = class {
            purpose == Clutter.InputContentPurpose.PHONE)
            keypadVisible = true;

-        this.emit('emoji-visible', emojiVisible);
+        this.emit('emoji-visible', emojiVisible)
        this.emit('keypad-visible', keypadVisible);
    }

    getGroups() {
        let inputSources = this._inputSourceManager.inputSources;
-        let groups = [];
+        let groups = []

        for (let i in inputSources) {
            let is = inputSources[i];
--- a/js/ui/layout.js
+++ b/js/ui/layout.js
@@ -1,7 +1,6 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported MonitorConstraint, LayoutManager */

-const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
+const { Clutter, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Signals = imports.signals;

 const Background = imports.ui.background;
@@ -11,17 +10,18 @@ const LoginManager = imports.misc.loginManager;
 const DND = imports.ui.dnd;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;
 const Ripples = imports.ui.ripples;

-var STARTUP_ANIMATION_TIME = 500;
-var KEYBOARD_ANIMATION_TIME = 150;
-var BACKGROUND_FADE_ANIMATION_TIME = 1000;
+var STARTUP_ANIMATION_TIME = 0.5;
+var KEYBOARD_ANIMATION_TIME = 0.15;
+var BACKGROUND_FADE_ANIMATION_TIME = 1.0;

 var HOT_CORNER_PRESSURE_THRESHOLD = 100; // pixels
 var HOT_CORNER_PRESSURE_TIMEOUT = 1000; // ms

 function isPopupMetaWindow(actor) {
-    switch (actor.meta_window.get_window_type()) {
+    switch(actor.meta_window.get_window_type()) {
    case Meta.WindowType.DROPDOWN_MENU:
    case Meta.WindowType.POPUP_MENU:
    case Meta.WindowType.COMBO:
@@ -32,20 +32,18 @@ function isPopupMetaWindow(actor) {
 }

 var MonitorConstraint = GObject.registerClass({
-    Properties: {
-        'primary': GObject.ParamSpec.boolean('primary',
-                                             'Primary', 'Track primary monitor',
-                                             GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                             false),
-        'index': GObject.ParamSpec.int('index',
-                                       'Monitor index', 'Track specific monitor',
-                                       GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                       -1, 64, -1),
-        'work-area': GObject.ParamSpec.boolean('work-area',
-                                               'Work-area', 'Track monitor\'s work-area',
-                                               GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                               false)
-    },
+    Properties: {'primary': GObject.ParamSpec.boolean('primary', 
+                                                      'Primary', 'Track primary monitor',
+                                                      GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
+                                                      false),
+                 'index': GObject.ParamSpec.int('index',
+                                                'Monitor index', 'Track specific monitor',
+                                                GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
+                                                -1, 64, -1),
+                 'work-area': GObject.ParamSpec.boolean('work-area',
+                                                        'Work-area', 'Track monitor\'s work-area',
+                                                        GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
+                                                        false)},
 }, class MonitorConstraint extends Clutter.Constraint {
    _init(props) {
        this._primary = false;
@@ -80,12 +78,10 @@ var MonitorConstraint = GObject.registerClass({
        this.notify('index');
    }

-    // eslint-disable-next-line camelcase
    get work_area() {
        return this._workArea;
    }

-    // eslint-disable-next-line camelcase
    set work_area(v) {
        if (v == this._workArea)
            return;
@@ -151,13 +147,13 @@ var MonitorConstraint = GObject.registerClass({
 });

 var Monitor = class Monitor {
-    constructor(index, geometry, geometryScale) {
+    constructor(index, geometry, geometry_scale) {
        this.index = index;
        this.x = geometry.x;
        this.y = geometry.y;
        this.width = geometry.width;
        this.height = geometry.height;
-        this.geometry_scale = geometryScale;
+        this.geometry_scale = geometry_scale;
    }

    get inFullscreen() {
@@ -167,12 +163,12 @@ var Monitor = class Monitor {

 const UiActor = GObject.registerClass(
 class UiActor extends St.Widget {
-    vfunc_get_preferred_width (_forHeight) {
+    vfunc_get_preferred_width (forHeight) {
        let width = global.stage.width;
        return [width, width];
    }

-    vfunc_get_preferred_height (_forWidth) {
+    vfunc_get_preferred_height (forWidth) {
        let height = global.stage.height;
        return [height, height];
    }
@@ -276,13 +272,6 @@ var LayoutManager = GObject.registerClass({
        this._backgroundGroup.lower_bottom();
        this._bgManagers = [];

-        this._interfaceSettings = new Gio.Settings({
-            schema_id: 'org.gnome.desktop.interface'
-        });
-
-        this._interfaceSettings.connect('changed::enable-hot-corners',
-                                        this._updateHotCorners.bind(this));
-
        // Need to update struts on new workspaces when they are added
        let workspaceManager = global.workspace_manager;
        workspaceManager.connect('notify::n-workspaces',
@@ -386,11 +375,6 @@ var LayoutManager = GObject.registerClass({
        });
        this.hotCorners = [];

-        if (!this._interfaceSettings.get_boolean('enable-hot-corners')) {
-            this.emit('hot-corners-changed');
-            return;
-        }
-
        let size = this.panelBox.height;

        // build new hot corners
@@ -463,11 +447,10 @@ var LayoutManager = GObject.registerClass({
                let backgroundActor = this._bgManagers[i].backgroundActor;
                backgroundActor.show();
                backgroundActor.opacity = 0;
-                backgroundActor.ease({
-                    opacity: 255,
-                    duration: BACKGROUND_FADE_ANIMATION_TIME,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
+                Tweener.addTween(backgroundActor,
+                                 { opacity: 255,
+                                   time: BACKGROUND_FADE_ANIMATION_TIME,
+                                   transition: 'easeOutQuad' });
            }
        }
    }
@@ -698,23 +681,23 @@ var LayoutManager = GObject.registerClass({
    }

    _startupAnimationGreeter() {
-        this.panelBox.ease({
-            translation_y: 0,
-            duration: STARTUP_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete()
-        });
+        Tweener.addTween(this.panelBox,
+                         { translation_y: 0,
+                           time: STARTUP_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._startupAnimationComplete,
+                           onCompleteScope: this });
    }

    _startupAnimationSession() {
-        this.uiGroup.ease({
-            scale_x: 1,
-            scale_y: 1,
-            opacity: 255,
-            duration: STARTUP_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this._startupAnimationComplete()
-        });
+        Tweener.addTween(this.uiGroup,
+                         { scale_x: 1,
+                           scale_y: 1,
+                           opacity: 255,
+                           time: STARTUP_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._startupAnimationComplete,
+                           onCompleteScope: this });
    }

    _startupAnimationComplete() {
@@ -740,15 +723,14 @@ var LayoutManager = GObject.registerClass({

    showKeyboard() {
        this.keyboardBox.show();
-        this.keyboardBox.ease({
-            anchor_y: this.keyboardBox.height,
-            opacity: 255,
-            duration: KEYBOARD_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._showKeyboardComplete();
-            }
-        });
+        Tweener.addTween(this.keyboardBox,
+                         { anchor_y: this.keyboardBox.height,
+                           opacity: 255,
+                           time: KEYBOARD_ANIMATION_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: this._showKeyboardComplete,
+                           onCompleteScope: this
+                         });
        this.emit('keyboard-visible-changed', true);
    }

@@ -767,16 +749,14 @@ var LayoutManager = GObject.registerClass({
            this.keyboardBox.disconnect(this._keyboardHeightNotifyId);
            this._keyboardHeightNotifyId = 0;
        }
-        this.keyboardBox.ease({
-            anchor_y: 0,
-            opacity: 0,
-            duration: immediate ? 0
-                                : KEYBOARD_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_IN_QUAD,
-            onComplete: () => {
-                this._hideKeyboardComplete();
-            }
-        });
+        Tweener.addTween(this.keyboardBox,
+                         { anchor_y: 0,
+                           opacity: 0,
+                           time: immediate ? 0 : KEYBOARD_ANIMATION_TIME,
+                           transition: 'easeInQuad',
+                           onComplete: this._hideKeyboardComplete,
+                           onCompleteScope: this
+                         });

        this.emit('keyboard-visible-changed', false);
    }
@@ -847,7 +827,7 @@ var LayoutManager = GObject.registerClass({
    // @params can have any of the same values as in addChrome(),
    // though some possibilities don't make sense. By default, @actor has
    // the same params as its chrome ancestor.
-    trackChrome(actor, params = {}) {
+    trackChrome(actor, params) {
        let ancestor = actor.get_parent();
        let index = this._findActor(ancestor);
        while (ancestor && index == -1) {
@@ -857,6 +837,8 @@ var LayoutManager = GObject.registerClass({

        let ancestorData = ancestor ? this._trackedActors[index]
                                    : defaultParams;
+        if (!params)
+            params = {};
        // We can't use Params.parse here because we want to drop
        // the extra values like ancestorData.actor
        for (let prop in defaultParams) {
@@ -1085,7 +1067,7 @@ var LayoutManager = GObject.registerClass({
                else
                    continue;

-                let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1 });
+                let strutRect = new Meta.Rectangle({ x: x1, y: y1, width: x2 - x1, height: y2 - y1});
                let strut = new Meta.Strut({ rect: strutRect, side: side });
                struts.push(strut);
            }
@@ -1236,7 +1218,7 @@ var HotCorner = class HotCorner {
        }
    }

-    handleDragOver(source, _actor, _x, _y, _time) {
+    handleDragOver(source, actor, x, y, time) {
        if (source != Main.xdndHandler)
            return DND.DragMotionResult.CONTINUE;

@@ -1337,7 +1319,7 @@ var PressureBarrier = class PressureBarrier {
        let threshold = this._lastTime - this._timeout;

        while (i < this._barrierEvents.length) {
-            let [time, distance_] = this._barrierEvents[i];
+            let [time, distance] = this._barrierEvents[i];
            if (time >= threshold)
                break;
            i++;
@@ -1346,14 +1328,14 @@ var PressureBarrier = class PressureBarrier {
        let firstNewEvent = i;

        for (i = 0; i < firstNewEvent; i++) {
-            let [time_, distance] = this._barrierEvents[i];
+            let [time, distance] = this._barrierEvents[i];
            this._currentPressure -= distance;
        }

        this._barrierEvents = this._barrierEvents.slice(firstNewEvent);
    }

-    _onBarrierLeft(barrier, _event) {
+    _onBarrierLeft(barrier, event) {
        barrier._isHit = false;
        if (this._barriers.every(b => !b._isHit)) {
            this._reset();
--- a/js/ui/lightbox.js
+++ b/js/ui/lightbox.js
@@ -1,10 +1,10 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported Lightbox */

 const { Clutter, GObject, Shell, St } = imports.gi;
 const Signals = imports.signals;

 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 var DEFAULT_FADE_FACTOR = 0.4;
 var VIGNETTE_BRIGHTNESS = 0.2;
@@ -23,31 +23,16 @@ t = clamp(t, 0.0, 1.0);\n\
 float pixel_brightness = mix(1.0, 1.0 - vignette_sharpness, t);\n\
 cogl_color_out.a = cogl_color_out.a * (1 - pixel_brightness * brightness);';

-var RadialShaderEffect = GObject.registerClass({
-    Properties: {
-        'brightness': GObject.ParamSpec.float(
-            'brightness', 'brightness', 'brightness',
-            GObject.ParamFlags.READWRITE,
-            0, 1, 1
-        ),
-        'sharpness': GObject.ParamSpec.float(
-            'sharpness', 'sharpness', 'sharpness',
-            GObject.ParamFlags.READWRITE,
-            0, 1, 0
-        )
-    }
-}, class RadialShaderEffect extends Shell.GLSLEffect {
+var RadialShaderQuad = GObject.registerClass(
+class RadialShaderQuad extends Shell.GLSLQuad {
    _init(params) {
-        this._brightness = undefined;
-        this._sharpness = undefined;
-
        super._init(params);

        this._brightnessLocation = this.get_uniform_location('brightness');
        this._sharpnessLocation = this.get_uniform_location('vignette_sharpness');

        this.brightness = 1.0;
-        this.sharpness = 0.0;
+        this.vignetteSharpness = 0.0;
    }

    vfunc_build_pipeline() {
@@ -60,25 +45,19 @@ var RadialShaderEffect = GObject.registerClass({
    }

    set brightness(v) {
-        if (this._brightness == v)
-            return;
        this._brightness = v;
        this.set_uniform_float(this._brightnessLocation,
                               1, [this._brightness]);
-        this.notify('brightness');
    }

-    get sharpness() {
+    get vignetteSharpness() {
        return this._sharpness;
    }

-    set sharpness(v) {
-        if (this._sharpness == v)
-            return;
+    set vignetteSharpness(v) {
        this._sharpness = v;
        this.set_uniform_float(this._sharpnessLocation,
                               1, [this._sharpness]);
-        this.notify('sharpness');
    }
 });

@@ -89,8 +68,8 @@ var RadialShaderEffect = GObject.registerClass({
 *           - inhibitEvents: whether to inhibit events for @container
 *           - width: shade actor width
 *           - height: shade actor height
- *           - fadeInTime: milliseconds used to fade in
- *           - fadeOutTime: milliseconds used to fade out
+ *           - fadeInTime: seconds used to fade in
+ *           - fadeOutTime: seconds used to fade out
 *
 * Lightbox creates a dark translucent "shade" actor to hide the
 * contents of @container, and allows you to specify particular actors
@@ -119,13 +98,16 @@ var Lightbox = class Lightbox {
        this._children = container.get_children();
        this._fadeFactor = params.fadeFactor;
        this._radialEffect = Clutter.feature_available(Clutter.FeatureFlags.SHADERS_GLSL) && params.radialEffect;
-
-        this.actor = new St.Bin({ reactive: params.inhibitEvents });
-
        if (this._radialEffect)
-            this.actor.add_effect(new RadialShaderEffect({ name: 'radial' }));
+            this.actor = new RadialShaderQuad({ x: 0,
+                                                y: 0,
+                                                reactive: params.inhibitEvents });
        else
-            this.actor.set({ opacity: 0, style_class: 'lightbox' });
+            this.actor = new St.Bin({ x: 0,
+                                      y: 0,
+                                      opacity: 0,
+                                      style_class: 'lightbox',
+                                      reactive: params.inhibitEvents });

        container.add_actor(this.actor);
        this.actor.raise_top();
@@ -174,32 +156,28 @@ var Lightbox = class Lightbox {
    show(fadeInTime) {
        fadeInTime = fadeInTime || 0;

-        this.actor.remove_all_transitions();
-
-        let onComplete = () => {
-            this.shown = true;
-            this.emit('shown');
-        };
-
+        Tweener.removeTweens(this.actor);
        if (this._radialEffect) {
-            this.actor.ease_property(
-                '@effects.radial.brightness', VIGNETTE_BRIGHTNESS, {
-                    duration: fadeInTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-            this.actor.ease_property(
-                '@effects.radial.sharpness', VIGNETTE_SHARPNESS, {
-                    duration: fadeInTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete
-                });
+            Tweener.addTween(this.actor,
+                             { brightness: VIGNETTE_BRIGHTNESS,
+                               vignetteSharpness: VIGNETTE_SHARPNESS,
+                               time: fadeInTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.shown = true;
+                                   this.emit('shown');
+                               }
+                             });
        } else {
-            this.actor.ease({
-                opacity: 255 * this._fadeFactor,
-                duration: fadeInTime,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete
-            });
+            Tweener.addTween(this.actor,
+                             { opacity: 255 * this._fadeFactor,
+                               time: fadeInTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.shown = true;
+                                   this.emit('shown');
+                               }
+                             });
        }

        this.actor.show();
@@ -209,29 +187,27 @@ var Lightbox = class Lightbox {
        fadeOutTime = fadeOutTime || 0;

        this.shown = false;
-        this.actor.remove_all_transitions();
-
-        let onComplete = () => this.actor.hide();
-
+        Tweener.removeTweens(this.actor);
        if (this._radialEffect) {
-            this.actor.ease_property(
-                '@effects.radial.brightness', 1.0, {
-                    duration: fadeOutTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD
-                });
-            this.actor.ease_property(
-                '@effects.radial.sharpness', 0.0, {
-                    duration: fadeOutTime,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete
-                });
+            Tweener.addTween(this.actor,
+                             { brightness: 1.0,
+                               vignetteSharpness: 0.0,
+                               opacity: 0,
+                               time: fadeOutTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.actor.hide();
+                               }
+                             });
        } else {
-            this.actor.ease({
-                opacity: 0,
-                duration: fadeOutTime,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete
-            });
+            Tweener.addTween(this.actor,
+                             { opacity: 0,
+                               time: fadeOutTime,
+                               transition: 'easeOutQuad',
+                               onComplete: () => {
+                                   this.actor.hide();
+                               }
+                             });
        }
    }

--- a/js/ui/locatePointer.js
+++ b/js/ui/locatePointer.js
@@ -1,25 +1,24 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LocatePointer */

-const { Gio } = imports.gi;
+const { Clutter, Gio, GLib, St } = imports.gi;
 const Ripples = imports.ui.ripples;
 const Main = imports.ui.main;

 const LOCATE_POINTER_KEY = "locate-pointer";
-const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface";
+const LOCATE_POINTER_SCHEMA = "org.gnome.desktop.interface"

-var LocatePointer = class {
+var locatePointer = class {
    constructor() {
-        this._settings = new Gio.Settings({ schema_id: LOCATE_POINTER_SCHEMA });
+        this._settings = new Gio.Settings({schema_id: LOCATE_POINTER_SCHEMA});
        this._ripples = new Ripples.Ripples(0.5, 0.5, 'ripple-pointer-location');
        this._ripples.addTo(Main.uiGroup);
    }

    show() {
-        if (!this._settings.get_boolean(LOCATE_POINTER_KEY))
+        if (!this._settings.get_boolean("locate-pointer"))
            return;

-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        this._ripples.playAnimation(x, y);
    }
 };
--- a/js/ui/lookingGlass.js
+++ b/js/ui/lookingGlass.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported LookingGlass */

 const { Clutter, Cogl, Gio, GLib,
        GObject, Meta, Pango, Shell, St } = imports.gi;
@@ -8,19 +7,20 @@ const Signals = imports.signals;
 const System = imports.system;

 const History = imports.misc.history;
+const ExtensionSystem = imports.ui.extensionSystem;
 const ExtensionUtils = imports.misc.extensionUtils;
 const ShellEntry = imports.ui.shellEntry;
+const Tweener = imports.ui.tweener;
 const Main = imports.ui.main;
 const JsParse = imports.misc.jsParse;

-const { ExtensionState } = ExtensionUtils;
-
 const CHEVRON = '>>> ';

 /* Imports...feel free to add here as needed */
 var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi; ' +
                    'const Main = imports.ui.main; ' +
                    'const Mainloop = imports.mainloop; ' +
+                    'const Tweener = imports.ui.tweener; ' +
                    /* Utility functions...we should probably be able to use these
                     * in the shell core code too. */
                    'const stage = global.stage; ' +
@@ -32,11 +32,9 @@ var commandHeader = 'const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = im
 const HISTORY_KEY = 'looking-glass-history';
 // Time between tabs for them to count as a double-tab event
 var AUTO_COMPLETE_DOUBLE_TAB_DELAY = 500;
-var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 200;
+var AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION = 0.2;
 var AUTO_COMPLETE_GLOBAL_KEYWORDS = _getAutoCompleteGlobalKeywords();

-const LG_ANIMATION_TIME = 500;
-
 function _getAutoCompleteGlobalKeywords() {
    const keywords = ['true', 'false', 'null', 'new'];
    // Don't add the private properties of window (i.e., ones starting with '_')
@@ -70,10 +68,10 @@ var AutoComplete = class AutoComplete {
            if (commonPrefix.length > 0) {
                this.additionalCompletionText(commonPrefix, event.attrHead);
                this.emit('completion', { completion: commonPrefix, type: 'prefix' });
-                this.emit('suggest', { completions: event.completions });
+                this.emit('suggest', { completions: event.completions});
            }
        } else if (event.completions.length > 1 && event.tabType === 'double') {
-            this.emit('suggest', { completions: event.completions });
+            this.emit('suggest', { completions: event.completions});
        }
    }

@@ -148,8 +146,8 @@ var Notebook = class Notebook {
        this.actor.add(scrollview, { expand: true });

        let vAdjust = scrollview.vscroll.adjustment;
-        vAdjust.connect('changed', () => this._onAdjustScopeChanged(tabData));
-        vAdjust.connect('notify::value', () => this._onAdjustValueChanged(tabData));
+        vAdjust.connect('changed', () => { this._onAdjustScopeChanged(tabData); });
+        vAdjust.connect('notify::value', () => { this._onAdjustValueChanged(tabData); });

        if (this._selectedIndex == -1)
            this.selectIndex(0);
@@ -187,9 +185,9 @@ var Notebook = class Notebook {
    }

    selectChild(child) {
-        if (child == null) {
+        if (child == null)
            this.selectIndex(-1);
-        } else {
+        else {
            for (let i = 0; i < this._tabs.length; i++) {
                let tabData = this._tabs[i];
                if (tabData.child == child) {
@@ -244,7 +242,7 @@ function objectToString(o) {
        // special case this since the default is way, way too verbose
        return '<js function>';
    } else {
-        return `${o}`;
+        return '' + o;
    }
 }

@@ -268,7 +266,7 @@ var ObjLink = class ObjLink {
        this._lookingGlass = lookingGlass;
    }

-    _onClicked() {
+    _onClicked(link) {
        this._lookingGlass.inspectObject(this._obj, this.actor);
    }
 };
@@ -286,7 +284,7 @@ var Result = class Result {
        this.actor.add(cmdTxt);
        let box = new St.BoxLayout({});
        this.actor.add(box);
-        let resultTxt = new St.Label({ text: `r(${index}) = ` });
+        let resultTxt = new St.Label({ text: 'r(' + index + ') = ' });
        resultTxt.clutter_text.ellipsize = Pango.EllipsizeMode.END;
        box.add(resultTxt);
        let objLink = new ObjLink(this._lookingGlass, o);
@@ -322,7 +320,7 @@ var WindowList = class WindowList {
            box.add(windowLink.actor, { x_align: St.Align.START, x_fill: false });
            let propsBox = new St.BoxLayout({ vertical: true, style: 'padding-left: 6px;' });
            box.add(propsBox);
-            propsBox.add(new St.Label({ text: `wmclass: ${metaWindow.get_wm_class()}` }));
+            propsBox.add(new St.Label({ text: 'wmclass: ' + metaWindow.get_wm_class() }));
            let app = tracker.get_window_app(metaWindow);
            if (app != null && !app.is_window_backed()) {
                let icon = app.create_icon_texture(22);
@@ -396,6 +394,7 @@ var ObjInspector = class ObjInspector {

            for (let i = 0; i < properties.length; i++) {
                let propName = properties[i];
+                let valueStr;
                let link;
                try {
                    let prop = obj[propName];
@@ -404,7 +403,8 @@ var ObjInspector = class ObjInspector {
                    link = new St.Label({ text: '<error>' });
                }
                let hbox = new St.BoxLayout();
-                hbox.add(new St.Label({ text: `${propName}: ` }));
+                let propText = propName + ': ' + valueStr;
+                hbox.add(new St.Label({ text: propName + ': ' }));
                hbox.add(link);
                this._container.add_actor(hbox);
            }
@@ -419,12 +419,9 @@ var ObjInspector = class ObjInspector {
        this.actor.show();
        if (sourceActor) {
            this.actor.set_scale(0, 0);
-            this.actor.ease({
-                scale_x: 1,
-                scale_y: 1,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                time: 200
-            });
+            Tweener.addTween(this.actor, { scale_x: 1, scale_y: 1,
+                                           transition: 'easeOutQuad',
+                                           time: 0.2 });
        } else {
            this.actor.set_scale(1, 1);
        }
@@ -496,13 +493,8 @@ var Inspector = GObject.registerClass({
        eventHandler.connect('button-press-event', this._onButtonPressEvent.bind(this));
        eventHandler.connect('scroll-event', this._onScrollEvent.bind(this));
        eventHandler.connect('motion-event', this._onMotionEvent.bind(this));
-
-        let dm = Clutter.DeviceManager.get_default();
-        this._pointerDevice = dm.get_core_device(Clutter.InputDeviceType.POINTER_DEVICE);
-        this._keyboardDevice = dm.get_core_device(Clutter.InputDeviceType.KEYBOARD_DEVICE);
-
-        this._pointerDevice.grab(eventHandler);
-        this._keyboardDevice.grab(eventHandler);
+        Clutter.grab_pointer(eventHandler);
+        Clutter.grab_keyboard(eventHandler);

        // this._target is the actor currently shown by the inspector.
        // this._pointerTarget is the actor directly under the pointer.
@@ -523,7 +515,7 @@ var Inspector = GObject.registerClass({

        let primary = Main.layoutManager.primaryMonitor;

-        let [, , natWidth, natHeight] =
+        let [minWidth, minHeight, natWidth, natHeight] =
            this._eventHandler.get_preferred_size();

        let childBox = new Clutter.ActorBox();
@@ -535,8 +527,8 @@ var Inspector = GObject.registerClass({
    }

    _close() {
-        this._pointerDevice.ungrab();
-        this._keyboardDevice.ungrab();
+        Clutter.ungrab_pointer();
+        Clutter.ungrab_keyboard();
        this._eventHandler.destroy();
        this._eventHandler = null;
        this.emit('closed');
@@ -559,7 +551,7 @@ var Inspector = GObject.registerClass({

    _onScrollEvent(actor, event) {
        switch (event.get_scroll_direction()) {
-        case Clutter.ScrollDirection.UP: {
+        case Clutter.ScrollDirection.UP:
            // select parent
            let parent = this._target.get_parent();
            if (parent != null) {
@@ -567,7 +559,6 @@ var Inspector = GObject.registerClass({
                this._update(event);
            }
            break;
-        }

        case Clutter.ScrollDirection.DOWN:
            // select child
@@ -607,9 +598,9 @@ var Inspector = GObject.registerClass({
            this._target = target;
        this._pointerTarget = target;

-        let position = `[inspect x: ${stageX} y: ${stageY}]`;
+        let position = '[inspect x: ' + stageX + ' y: ' + stageY + ']';
        this._displayText.text = '';
-        this._displayText.text = `${position} ${this._target}`;
+        this._displayText.text = position + ' ' + this._target;

        this._lookingGlass.setBorderPaintTarget(this._target);
    }
@@ -621,23 +612,22 @@ var Extensions = class Extensions {
        this.actor = new St.BoxLayout({ vertical: true,
                                        name: 'lookingGlassExtensions' });
        this._noExtensions = new St.Label({ style_class: 'lg-extensions-none',
-                                            text: _("No extensions installed") });
+                                             text: _("No extensions installed") });
        this._numExtensions = 0;
        this._extensionsList = new St.BoxLayout({ vertical: true,
                                                  style_class: 'lg-extensions-list' });
        this._extensionsList.add(this._noExtensions);
        this.actor.add(this._extensionsList);

-        Main.extensionManager.getUuids().forEach(uuid => {
+        for (let uuid in ExtensionUtils.extensions)
            this._loadExtension(null, uuid);
-        });

-        Main.extensionManager.connect('extension-loaded',
-                                      this._loadExtension.bind(this));
+        ExtensionSystem.connect('extension-loaded',
+                                this._loadExtension.bind(this));
    }

    _loadExtension(o, uuid) {
-        let extension = Main.extensionManager.lookup(uuid);
+        let extension = ExtensionUtils.extensions[uuid];
        // There can be cases where we create dummy extension metadata
        // that's not really a proper extension. Don't bother with these.
        if (!extension.metadata.name)
@@ -694,17 +684,17 @@ var Extensions = class Extensions {

    _stateToString(extensionState) {
        switch (extensionState) {
-        case ExtensionState.ENABLED:
-            return _("Enabled");
-        case ExtensionState.DISABLED:
-        case ExtensionState.INITIALIZED:
-            return _("Disabled");
-        case ExtensionState.ERROR:
-            return _("Error");
-        case ExtensionState.OUT_OF_DATE:
-            return _("Out of date");
-        case ExtensionState.DOWNLOADING:
-            return _("Downloading");
+            case ExtensionSystem.ExtensionState.ENABLED:
+                return _("Enabled");
+            case ExtensionSystem.ExtensionState.DISABLED:
+            case ExtensionSystem.ExtensionState.INITIALIZED:
+                return _("Disabled");
+            case ExtensionSystem.ExtensionState.ERROR:
+                return _("Error");
+            case ExtensionSystem.ExtensionState.OUT_OF_DATE:
+                return _("Out of date");
+            case ExtensionSystem.ExtensionState.DOWNLOADING:
+                return _("Downloading");
        }
        return 'Unknown'; // Not translated, shouldn't appear
    }
@@ -712,7 +702,7 @@ var Extensions = class Extensions {
    _createExtensionDisplay(extension) {
        let box = new St.BoxLayout({ style_class: 'lg-extension', vertical: true });
        let name = new St.Label({ style_class: 'lg-extension-name',
-                                  text: extension.metadata.name });
+                                   text: extension.metadata.name });
        box.add(name, { expand: true });
        let description = new St.Label({ style_class: 'lg-extension-description',
                                         text: extension.metadata.description || 'No description' });
@@ -720,6 +710,7 @@ var Extensions = class Extensions {

        let metaBox = new St.BoxLayout({ style_class: 'lg-extension-meta' });
        box.add(metaBox);
+        let stateString = this._stateToString(extension.state);
        let state = new St.Label({ style_class: 'lg-extension-state',
                                   text: this._stateToString(extension.state) });
        metaBox.add(state);
@@ -804,7 +795,7 @@ var LookingGlass = class LookingGlass {
        inspectIcon.connect('button-press-event', () => {
            let inspector = new Inspector(this);
            inspector.connect('target', (i, target, stageX, stageY) => {
-                this._pushResult(`inspect(${Math.round(stageX)}, ${Math.round(stageY)})`, target);
+                this._pushResult('inspect(' + Math.round(stageX) + ', ' + Math.round(stageY) + ')', target);
            });
            inspector.connect('closed', () => {
                this.actor.show();
@@ -819,15 +810,15 @@ var LookingGlass = class LookingGlass {
        toolbar.add_actor(gcIcon);
        gcIcon.reactive = true;
        gcIcon.connect('button-press-event', () => {
-            gcIcon.icon_name = 'user-trash';
-            System.gc();
-            this._timeoutId = Mainloop.timeout_add(500, () => {
+           gcIcon.icon_name = 'user-trash';
+           System.gc();
+           this._timeoutId = Mainloop.timeout_add(500, () => {
                gcIcon.icon_name = 'user-trash-full';
                this._timeoutId = 0;
                return GLib.SOURCE_REMOVE;
-            });
-            GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\'');
-            return Clutter.EVENT_PROPAGATE;
+           });
+           GLib.Source.set_name_by_id(this._timeoutId, '[gnome-shell] gcIcon.icon_name = \'user-trash-full\'');
+           return Clutter.EVENT_PROPAGATE;
        });

        let notebook = new Notebook();
@@ -860,7 +851,7 @@ var LookingGlass = class LookingGlass {
        this._extensions = new Extensions(this);
        notebook.appendPage('Extensions', this._extensions.actor);

-        this._entry.clutter_text.connect('activate', (o, _e) => {
+        this._entry.clutter_text.connect('activate', (o, e) => {
            // Hide any completions we are currently showing
            this._hideCompletions();

@@ -898,11 +889,9 @@ var LookingGlass = class LookingGlass {
        let fontDesc = Pango.FontDescription.from_string(fontName);
        // We ignore everything but size and style; you'd be crazy to set your system-wide
        // monospace font to be bold/oblique/etc. Could easily be added here.
-        let size = fontDesc.get_size() / 1024.;
-        let unit = fontDesc.get_size_is_absolute() ? 'px' : 'pt';
-        this.actor.style = `
-            font-size: ${size}${unit};
-            font-family: "${fontDesc.get_family()}";`;
+        this.actor.style =
+            'font-size: ' + fontDesc.get_size() / 1024. + (fontDesc.get_size_is_absolute() ? 'px' : 'pt') + ';'
+            + 'font-family: "' + fontDesc.get_family() + '";';
    }

    setBorderPaintTarget(obj) {
@@ -944,41 +933,35 @@ var LookingGlass = class LookingGlass {
        this._completionActor.set_text(completions.join(', '));

        // Setting the height to -1 allows us to get its actual preferred height rather than
-        // whatever was last set when animating
+        // whatever was last given in set_height by Tweener.
        this._completionActor.set_height(-1);
-        let [, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());
+        let [minHeight, naturalHeight] = this._completionActor.get_preferred_height(this._resultsArea.get_width());

        // Don't reanimate if we are already visible
        if (this._completionActor.visible) {
            this._completionActor.height = naturalHeight;
        } else {
-            let settings = St.Settings.get();
-            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
            this._completionActor.show();
-            this._completionActor.remove_all_transitions();
-            this._completionActor.ease({
-                height: naturalHeight,
-                opacity: 255,
-                duration,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.removeTweens(this._completionActor);
+            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
+                                                      transition: 'easeOutQuad',
+                                                      height: naturalHeight,
+                                                      opacity: 255
+                                                    });
        }
    }

    _hideCompletions() {
        if (this._completionActor) {
-            let settings = St.Settings.get();
-            let duration = AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / settings.slow_down_factor;
-            this._completionActor.remove_all_transitions();
-            this._completionActor.ease({
-                height: 0,
-                opacity: 0,
-                duration,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._completionActor.hide();
-                }
-            });
+            Tweener.removeTweens(this._completionActor);
+            Tweener.addTween(this._completionActor, { time: AUTO_COMPLETE_SHOW_COMPLETION_ANIMATION_DURATION / St.get_slow_down_factor(),
+                                                      transition: 'easeOutQuad',
+                                                      height: 0,
+                                                      opacity: 0,
+                                                      onComplete: () => {
+                                                          this._completionActor.hide();
+                                                      }
+                                                    });
        }
    }

@@ -994,7 +977,7 @@ var LookingGlass = class LookingGlass {
        try {
            resultObj = Function(fullCmd)();
        } catch (e) {
-            resultObj = `<exception ${e}>`;
+            resultObj = '<exception ' + e + '>';
        }

        this._pushResult(command, resultObj);
@@ -1021,10 +1004,7 @@ var LookingGlass = class LookingGlass {
    }

    _queueResize() {
-        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => {
-            this._resize();
-            return GLib.SOURCE_REMOVE;
-        });
+        Meta.later_add(Meta.LaterType.BEFORE_REDRAW, () => { this._resize(); });
    }

    _resize() {
@@ -1087,16 +1067,14 @@ var LookingGlass = class LookingGlass {
        this._open = true;
        this._history.lastItem();

-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        // We inverse compensate for the slow-down so you can change the factor
        // through LookingGlass without long waits.
-        let duration = LG_ANIMATION_TIME / St.Settings.get().slow_down_factor;
-        this.actor.ease({
-            y: this._targetY,
-            duration,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD
-        });
+        Tweener.addTween(this.actor, { time: 0.5 / St.get_slow_down_factor(),
+                                       transition: 'easeOutQuad',
+                                       y: this._targetY
+                                     });
    }

    close() {
@@ -1106,21 +1084,19 @@ var LookingGlass = class LookingGlass {
        this._objInspector.actor.hide();

        this._open = false;
-        this.actor.remove_all_transitions();
+        Tweener.removeTweens(this.actor);

        this.setBorderPaintTarget(null);

        Main.popModal(this._entry);

-        let settings = St.Settings.get();
-        let duration = Math.min(LG_ANIMATION_TIME / settings.slow_down_factor,
-                                LG_ANIMATION_TIME);
-        this.actor.ease({
-            y: this._hiddenY,
-            duration,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.actor.hide()
-        });
+        Tweener.addTween(this.actor, { time: Math.min(0.5 / St.get_slow_down_factor(), 0.5),
+                                       transition: 'easeOutQuad',
+                                       y: this._hiddenY,
+                                       onComplete: () => {
+                                           this.actor.hide();
+                                       }
+                                     });
    }
 };
 Signals.addSignalMethods(LookingGlass.prototype);
--- a/js/ui/magnifier.js
+++ b/js/ui/magnifier.js
@@ -41,8 +41,10 @@ const CROSS_HAIRS_OPACITY_KEY   = 'cross-hairs-opacity';
 const CROSS_HAIRS_LENGTH_KEY    = 'cross-hairs-length';
 const CROSS_HAIRS_CLIP_KEY      = 'cross-hairs-clip';

+let magDBusService = null;
+
 var MouseSpriteContent = GObject.registerClass({
-    Implements: [Clutter.Content],
+    Implements: [ Clutter.Content ],
 }, class MouseSpriteContent extends GObject.Object {
    _init() {
        super._init();
@@ -107,7 +109,8 @@ var Magnifier = class Magnifier {
        // Create the first ZoomRegion and initialize it according to the
        // magnification settings.

-        [this.xMouse, this.yMouse] = global.get_pointer();
+        let mask;
+        [this.xMouse, this.yMouse, mask] = global.get_pointer();

        let aZoomRegion = new ZoomRegion(this, this._cursorRoot);
        this._zoomRegions.push(aZoomRegion);
@@ -119,7 +122,7 @@ var Magnifier = class Magnifier {
        });

        // Export to dbus.
-        (new MagnifierDBus.ShellMagnifier());
+        magDBusService = new MagnifierDBus.ShellMagnifier();
        this.setActive(St.Settings.get().magnifier_active);
    }

@@ -147,7 +150,7 @@ var Magnifier = class Magnifier {
    setActive(activate) {
        let isActive = this.isActive();

-        this._zoomRegions.forEach(zoomRegion => {
+        this._zoomRegions.forEach ((zoomRegion, index, array) => {
            zoomRegion.setActive(activate);
        });

@@ -226,14 +229,14 @@ var Magnifier = class Magnifier {
     * @return      true.
     */
    scrollToMousePos() {
-        let [xMouse, yMouse] = global.get_pointer();
+        let [xMouse, yMouse, mask] = global.get_pointer();

        if (xMouse != this.xMouse || yMouse != this.yMouse) {
            this.xMouse = xMouse;
            this.yMouse = yMouse;

            let sysMouseOverAny = false;
-            this._zoomRegions.forEach(zoomRegion => {
+            this._zoomRegions.forEach((zoomRegion, index, array) => {
                if (zoomRegion.scrollToMousePos())
                    sysMouseOverAny = true;
            });
@@ -281,7 +284,7 @@ var Magnifier = class Magnifier {
     * @zoomRegion:     The zoomRegion to add.
     */
    addZoomRegion(zoomRegion) {
-        if (zoomRegion) {
+        if(zoomRegion) {
            this._zoomRegions.push(zoomRegion);
            if (!this.isTrackingMouse())
                this.startTrackingMouse();
@@ -331,7 +334,7 @@ var Magnifier = class Magnifier {
        this.setCrosshairsClip(clip);

        let theCrossHairs = this._crossHairs;
-        this._zoomRegions.forEach (zoomRegion => {
+        this._zoomRegions.forEach ((zoomRegion, index, array) => {
            zoomRegion.addCrosshairs(theCrossHairs);
        });
    }
@@ -346,7 +349,8 @@ var Magnifier = class Magnifier {
            if (!this._crossHairs)
                this.addCrosshairs();
            this._crossHairs.show();
-        } else {
+        }
+        else {
            if (this._crossHairs)
                this._crossHairs.hide();
        }
@@ -359,7 +363,7 @@ var Magnifier = class Magnifier {
     */
    setCrosshairsColor(color) {
        if (this._crossHairs) {
-            let [res_, clutterColor] = Clutter.Color.from_string(color);
+            let [res, clutterColor] = Clutter.Color.from_string(color);
            this._crossHairs.setColor(clutterColor);
        }
    }
@@ -373,9 +377,9 @@ var Magnifier = class Magnifier {
        if (this._crossHairs) {
            let clutterColor = this._crossHairs.getColor();
            return clutterColor.to_string();
-        } else {
-            return '#00000000';
        }
+        else
+            return '#00000000';
    }

    /**
@@ -455,7 +459,8 @@ var Magnifier = class Magnifier {
        if (clip) {
            if (this._crossHairs)
                this._crossHairs.setClip(CROSSHAIRS_CLIP_SIZE);
-        } else {
+        }
+        else {
            // Setting no clipping on crosshairs means a zero sized clip
            // rectangle.
            if (this._crossHairs)
@@ -468,14 +473,14 @@ var Magnifier = class Magnifier {
     * Get whether the crosshairs are clipped by the mouse image.
     * @return:   Whether the crosshairs are clipped.
     */
-    getCrosshairsClip() {
+     getCrosshairsClip() {
        if (this._crossHairs) {
            let [clipWidth, clipHeight] = this._crossHairs.getClip();
            return (clipWidth > 0 && clipHeight > 0);
-        } else {
-            return false;
        }
-    }
+        else
+            return false;
+     }

    //// Private methods ////

@@ -499,61 +504,61 @@ var Magnifier = class Magnifier {
    _settingsInit(zoomRegion) {
        this._settings = new Gio.Settings({ schema_id: MAGNIFIER_SCHEMA });

-        this._settings.connect(`changed::${SCREEN_POSITION_KEY}`,
+        this._settings.connect('changed::' + SCREEN_POSITION_KEY,
                               this._updateScreenPosition.bind(this));
-        this._settings.connect(`changed::${MAG_FACTOR_KEY}`,
+        this._settings.connect('changed::' + MAG_FACTOR_KEY,
                               this._updateMagFactor.bind(this));
-        this._settings.connect(`changed::${LENS_MODE_KEY}`,
+        this._settings.connect('changed::' + LENS_MODE_KEY,
                               this._updateLensMode.bind(this));
-        this._settings.connect(`changed::${CLAMP_MODE_KEY}`,
+        this._settings.connect('changed::' + CLAMP_MODE_KEY,
                               this._updateClampMode.bind(this));
-        this._settings.connect(`changed::${MOUSE_TRACKING_KEY}`,
+        this._settings.connect('changed::' + MOUSE_TRACKING_KEY,
                               this._updateMouseTrackingMode.bind(this));
-        this._settings.connect(`changed::${FOCUS_TRACKING_KEY}`,
+        this._settings.connect('changed::' + FOCUS_TRACKING_KEY,
                               this._updateFocusTrackingMode.bind(this));
-        this._settings.connect(`changed::${CARET_TRACKING_KEY}`,
+        this._settings.connect('changed::' + CARET_TRACKING_KEY,
                               this._updateCaretTrackingMode.bind(this));

-        this._settings.connect(`changed::${INVERT_LIGHTNESS_KEY}`,
+        this._settings.connect('changed::' + INVERT_LIGHTNESS_KEY,
                               this._updateInvertLightness.bind(this));
-        this._settings.connect(`changed::${COLOR_SATURATION_KEY}`,
+        this._settings.connect('changed::' + COLOR_SATURATION_KEY,
                               this._updateColorSaturation.bind(this));

-        this._settings.connect(`changed::${BRIGHT_RED_KEY}`,
+        this._settings.connect('changed::' + BRIGHT_RED_KEY,
                               this._updateBrightness.bind(this));
-        this._settings.connect(`changed::${BRIGHT_GREEN_KEY}`,
+        this._settings.connect('changed::' + BRIGHT_GREEN_KEY,
                               this._updateBrightness.bind(this));
-        this._settings.connect(`changed::${BRIGHT_BLUE_KEY}`,
+        this._settings.connect('changed::' + BRIGHT_BLUE_KEY,
                               this._updateBrightness.bind(this));

-        this._settings.connect(`changed::${CONTRAST_RED_KEY}`,
+        this._settings.connect('changed::' + CONTRAST_RED_KEY,
                               this._updateContrast.bind(this));
-        this._settings.connect(`changed::${CONTRAST_GREEN_KEY}`,
+        this._settings.connect('changed::' + CONTRAST_GREEN_KEY,
                               this._updateContrast.bind(this));
-        this._settings.connect(`changed::${CONTRAST_BLUE_KEY}`,
+        this._settings.connect('changed::' + CONTRAST_BLUE_KEY,
                               this._updateContrast.bind(this));

-        this._settings.connect(`changed::${SHOW_CROSS_HAIRS_KEY}`, () => {
+        this._settings.connect('changed::' + SHOW_CROSS_HAIRS_KEY, () => {
            this.setCrosshairsVisible(this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY));
        });

-        this._settings.connect(`changed::${CROSS_HAIRS_THICKNESS_KEY}`, () => {
+        this._settings.connect('changed::' + CROSS_HAIRS_THICKNESS_KEY, () => {
            this.setCrosshairsThickness(this._settings.get_int(CROSS_HAIRS_THICKNESS_KEY));
        });

-        this._settings.connect(`changed::${CROSS_HAIRS_COLOR_KEY}`, () => {
+        this._settings.connect('changed::' + CROSS_HAIRS_COLOR_KEY, () => {
            this.setCrosshairsColor(this._settings.get_string(CROSS_HAIRS_COLOR_KEY));
        });

-        this._settings.connect(`changed::${CROSS_HAIRS_OPACITY_KEY}`, () => {
+        this._settings.connect('changed::' + CROSS_HAIRS_OPACITY_KEY, () => {
            this.setCrosshairsOpacity(this._settings.get_double(CROSS_HAIRS_OPACITY_KEY));
        });

-        this._settings.connect(`changed::${CROSS_HAIRS_LENGTH_KEY}`, () => {
+        this._settings.connect('changed::' + CROSS_HAIRS_LENGTH_KEY, () => {
            this.setCrosshairsLength(this._settings.get_int(CROSS_HAIRS_LENGTH_KEY));
        });

-        this._settings.connect(`changed::${CROSS_HAIRS_CLIP_KEY}`, () => {
+        this._settings.connect('changed::' + CROSS_HAIRS_CLIP_KEY, () => {
            this.setCrosshairsClip(this._settings.get_boolean(CROSS_HAIRS_CLIP_KEY));
        });

@@ -605,7 +610,7 @@ var Magnifier = class Magnifier {
        let showCrosshairs = this._settings.get_boolean(SHOW_CROSS_HAIRS_KEY);
        this.addCrosshairs();
        this.setCrosshairsVisible(showCrosshairs);
-    }
+   }

    _updateScreenPosition() {
        // Applies only to the first zoom region.
@@ -795,8 +800,8 @@ var ZoomRegion = class ZoomRegion {
        let extents;
        try {
            extents = component.get_extents(Atspi.CoordType.SCREEN);
-        } catch (e) {
-            log(`Failed to read extents of focused component: ${e.message}`);
+        } catch(e) {
+            log('Failed to read extents of focused component: ' + e.message);
            return;
        }

@@ -812,8 +817,8 @@ var ZoomRegion = class ZoomRegion {
        let extents;
        try {
            extents = text.get_character_extents(text.get_caret_offset(), 0);
-        } catch (e) {
-            log(`Failed to read extents of text caret: ${e.message}`);
+        } catch(e) {
+            log('Failed to read extents of text caret: ' + e.message);
            return;
        }

@@ -1025,7 +1030,7 @@ var ZoomRegion = class ZoomRegion {
        viewPort.x = 0;
        viewPort.y = 0;
        viewPort.width = global.screen_width;
-        viewPort.height = global.screen_height / 2;
+        viewPort.height = global.screen_height/2;
        this._setViewPort(viewPort);
        this._screenPosition = GDesktopEnums.MagnifierScreenPosition.TOP_HALF;
    }
@@ -1037,9 +1042,9 @@ var ZoomRegion = class ZoomRegion {
    setBottomHalf() {
        let viewPort = {};
        viewPort.x = 0;
-        viewPort.y = global.screen_height / 2;
+        viewPort.y = global.screen_height/2;
        viewPort.width = global.screen_width;
-        viewPort.height = global.screen_height / 2;
+        viewPort.height = global.screen_height/2;
        this._setViewPort(viewPort);
        this._screenPosition = GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF;
    }
@@ -1052,7 +1057,7 @@ var ZoomRegion = class ZoomRegion {
        let viewPort = {};
        viewPort.x = 0;
        viewPort.y = 0;
-        viewPort.width = global.screen_width / 2;
+        viewPort.width = global.screen_width/2;
        viewPort.height = global.screen_height;
        this._setViewPort(viewPort);
        this._screenPosition = GDesktopEnums.MagnifierScreenPosition.LEFT_HALF;
@@ -1064,9 +1069,9 @@ var ZoomRegion = class ZoomRegion {
     */
    setRightHalf() {
        let viewPort = {};
-        viewPort.x = global.screen_width / 2;
+        viewPort.x = global.screen_width/2;
        viewPort.y = 0;
-        viewPort.width = global.screen_width / 2;
+        viewPort.width = global.screen_width/2;
        viewPort.height = global.screen_height;
        this._setViewPort(viewPort);
        this._screenPosition = GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF;
@@ -1098,21 +1103,21 @@ var ZoomRegion = class ZoomRegion {
     */
    setScreenPosition(inPosition) {
        switch (inPosition) {
-        case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN:
-            this.setFullScreenMode();
-            break;
-        case GDesktopEnums.MagnifierScreenPosition.TOP_HALF:
-            this.setTopHalf();
-            break;
-        case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF:
-            this.setBottomHalf();
-            break;
-        case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF:
-            this.setLeftHalf();
-            break;
-        case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF:
-            this.setRightHalf();
-            break;
+            case GDesktopEnums.MagnifierScreenPosition.FULL_SCREEN:
+                this.setFullScreenMode();
+                break;
+            case GDesktopEnums.MagnifierScreenPosition.TOP_HALF:
+                this.setTopHalf();
+                break;
+            case GDesktopEnums.MagnifierScreenPosition.BOTTOM_HALF:
+                this.setBottomHalf();
+                break;
+            case GDesktopEnums.MagnifierScreenPosition.LEFT_HALF:
+                this.setLeftHalf();
+                break;
+            case GDesktopEnums.MagnifierScreenPosition.RIGHT_HALF:
+                this.setRightHalf();
+                break;
        }
    }

@@ -1455,9 +1460,11 @@ var ZoomRegion = class ZoomRegion {

        if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PROPORTIONAL) {
            return this._centerFromPointProportional(xMouse, yMouse);
-        } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
+        }
+        else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.PUSH) {
            return this._centerFromPointPush(xMouse, yMouse);
-        } else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
+        }
+        else if (this._mouseTrackingMode == GDesktopEnums.MagnifierMouseTrackingMode.CENTERED) {
            return this._centerFromPointCentered(xMouse, yMouse);
        }

@@ -1514,7 +1521,7 @@ var ZoomRegion = class ZoomRegion {
    }

    _centerFromPointProportional(xPoint, yPoint) {
-        let [xRoi_, yRoi_, widthRoi, heightRoi] = this.getROI();
+        let [xRoi, yRoi, widthRoi, heightRoi] = this.getROI();
        let halfScreenWidth = global.screen_width / 2;
        let halfScreenHeight = global.screen_height / 2;
        // We want to pad with a constant distance after zooming, so divide
@@ -1525,7 +1532,7 @@ var ZoomRegion = class ZoomRegion {
        let xProportion = (xPoint - halfScreenWidth) / halfScreenWidth;   // -1 ... 1
        let yProportion = (yPoint - halfScreenHeight) / halfScreenHeight; // -1 ... 1
        let xPos = xPoint - xProportion * (widthRoi / 2 - xPadding);
-        let yPos = yPoint - yProportion * (heightRoi / 2 - yPadding);
+        let yPos = yPoint - yProportion * (heightRoi /2 - yPadding);

        return [xPos, yPos];
    }
@@ -1627,7 +1634,7 @@ var Crosshairs = class Crosshairs {
        this.reCenter();
    }

-    /**
+   /**
    * addToZoomRegion
    * Either add the crosshairs actor to the given ZoomRegion, or, if it is
    * already part of some other ZoomRegion, create a clone of the crosshairs
@@ -1655,7 +1662,7 @@ var Crosshairs = class Crosshairs {
                container.raise_child(magnifiedMouse, crosshairsActor);
                let [xMouse, yMouse] = magnifiedMouse.get_position();
                let [crosshairsWidth, crosshairsHeight] = crosshairsActor.get_size();
-                crosshairsActor.set_position(xMouse - crosshairsWidth / 2, yMouse - crosshairsHeight / 2);
+                crosshairsActor.set_position(xMouse - crosshairsWidth / 2 , yMouse - crosshairsHeight / 2);
            }
        }
        return crosshairsActor;
@@ -1771,12 +1778,13 @@ var Crosshairs = class Crosshairs {
            // mouse.
            this._clipSize = size;
            this.reCenter();
-        } else {
+        }
+        else {
            // Restore the missing chunk.
            this._clipSize = [0, 0];
            this.reCenter();
        }
-    }
+     }

    /**
     * show:
@@ -1810,7 +1818,9 @@ var Crosshairs = class Crosshairs {
    reCenter(clipSize) {
        let [groupWidth, groupHeight] = this._actor.get_size();
        let leftLength = this._horizLeftHair.get_width();
+        let rightLength = this._horizRightHair.get_width();
        let topLength = this._vertTopHair.get_height();
+        let bottomLength = this._vertBottomHair.get_height();
        let thickness = this._horizLeftHair.get_height();

        // Deal with clip rectangle.
@@ -1917,8 +1927,8 @@ var MagShaderEffects = class MagShaderEffects {
        // a null first argument.
        let [bRed, bGreen, bBlue] = this._brightnessContrast.get_brightness();
        this._brightnessContrast.set_enabled(
-            cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE ||
-            bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE
+             cRed != NO_CHANGE || cGreen != NO_CHANGE || cBlue != NO_CHANGE ||
+             bRed != NO_CHANGE || bGreen != NO_CHANGE || bBlue != NO_CHANGE
        );
    }
 };
--- a/js/ui/magnifierDBus.js
+++ b/js/ui/magnifierDBus.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ShellMagnifier */

 const Gio = imports.gi.Gio;
 const Main = imports.ui.main;
@@ -86,7 +85,7 @@ var ShellMagnifier = class ShellMagnifier {
        let ROI = { x: roi[0], y: roi[1], width: roi[2] - roi[0], height: roi[3] - roi[1] };
        let viewBox = { x: viewPort[0], y: viewPort[1], width: viewPort[2] - viewPort[0], height: viewPort[3] - viewPort[1] };
        let realZoomRegion = Main.magnifier.createZoomRegion(xMagFactor, yMagFactor, ROI, viewBox);
-        let objectPath = `${ZOOM_SERVICE_PATH}/zoomer${_zoomRegionInstanceCount}`;
+        let objectPath = ZOOM_SERVICE_PATH + '/zoomer' + _zoomRegionInstanceCount;
        _zoomRegionInstanceCount++;

        let zoomRegionProxy = new ShellMagnifierZoomRegion(objectPath, realZoomRegion);
@@ -107,9 +106,9 @@ var ShellMagnifier = class ShellMagnifier {
        if (proxyAndZoomRegion && proxyAndZoomRegion.zoomRegion) {
            Main.magnifier.addZoomRegion(proxyAndZoomRegion.zoomRegion);
            return true;
-        } else {
-            return false;
        }
+        else
+            return false;
    }

    /**
@@ -125,7 +124,7 @@ var ShellMagnifier = class ShellMagnifier {
        let zoomRegions = Main.magnifier.getZoomRegions();
        let objectPaths = [];
        let thoseZoomers = this._zoomers;
-        zoomRegions.forEach (aZoomRegion => {
+        zoomRegions.forEach ((aZoomRegion, index, array) => {
            let found = false;
            for (let objectPath in thoseZoomers) {
                let proxyAndZoomRegion = thoseZoomers[objectPath];
@@ -180,74 +179,74 @@ var ShellMagnifier = class ShellMagnifier {
     * Set the crosswire size of all ZoomRegions.
     * @size:   The thickness of each line in the cross wire.
     */
-    setCrosswireSize(size) {
+     setCrosswireSize(size) {
        Main.magnifier.setCrosshairsThickness(size);
-    }
+     }

    /**
     * getCrosswireSize:
     * Get the crosswire size of all ZoomRegions.
     * @return:   The thickness of each line in the cross wire.
     */
-    getCrosswireSize() {
+     getCrosswireSize() {
        return Main.magnifier.getCrosshairsThickness();
-    }
+     }

    /**
     * setCrosswireLength:
     * Set the crosswire length of all zoom-regions..
     * @size:   The length of each line in the cross wire.
     */
-    setCrosswireLength(length) {
+     setCrosswireLength(length) {
        Main.magnifier.setCrosshairsLength(length);
-    }
+     }

    /**
     * setCrosswireSize:
     * Set the crosswire size of all zoom-regions.
     * @size:   The thickness of each line in the cross wire.
     */
-    getCrosswireLength() {
+     getCrosswireLength() {
        return Main.magnifier.getCrosshairsLength();
-    }
+     }

    /**
     * setCrosswireClip:
     * Set if the crosswire will be clipped by the cursor image..
     * @clip:   Flag to indicate whether to clip the crosswire.
     */
-    setCrosswireClip(clip) {
+     setCrosswireClip(clip) {
        Main.magnifier.setCrosshairsClip(clip);
-    }
+     }

    /**
     * getCrosswireClip:
     * Get the crosswire clip value.
     * @return:   Whether the crosswire is clipped by the cursor image.
     */
-    getCrosswireClip() {
+     getCrosswireClip() {
        return Main.magnifier.getCrosshairsClip();
-    }
+     }

    /**
     * setCrosswireColor:
     * Set the crosswire color of all ZoomRegions.
     * @color:   Unsigned int of the form rrggbbaa.
     */
-    setCrosswireColor(color) {
+     setCrosswireColor(color) {
        Main.magnifier.setCrosshairsColor('#%08x'.format(color));
-    }
+     }

    /**
     * getCrosswireClip:
     * Get the crosswire color of all ZoomRegions.
     * @return:   The crosswire color as an unsigned int in the form rrggbbaa.
     */
-    getCrosswireColor() {
+     getCrosswireColor() {
        let colorString = Main.magnifier.getCrosshairsColor();
        // Drop the leading '#'.
        return parseInt(colorString.slice(1), 16);
-    }
+     }
 };

 /**
--- a/js/ui/main.js
+++ b/js/ui/main.js
@@ -1,12 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported componentManager, notificationDaemon, windowAttentionHandler,
-            ctrlAltTabManager, padOsdService, osdWindowManager,
-            osdMonitorLabeler, shellMountOpDBusService, shellDBusService,
-            shellAccessDialogDBusService, shellAudioSelectionDBusService,
-            screenSaverDBus, screencastService, uiGroup, magnifier,
-            xdndHandler, keyboard, kbdA11yDialog, introspectService,
-            start, pushModal, popModal, activateWindow, createLookingGlass,
-            initializeDeferredWork, getThemeStylesheet, setThemeStylesheet */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -54,7 +46,6 @@ const LOG_DOMAIN = 'GNOME Shell';
 const GNOMESHELL_STARTED_MESSAGE_ID = 'f3ea493c22934e26811cd62abe8e203a';

 var componentManager = null;
-var extensionManager = null;
 var panel = null;
 var overview = null;
 var runDialog = null;
@@ -93,6 +84,7 @@ let _cssStylesheet = null;
 let _a11ySettings = null;
 let _themeResource = null;
 let _oskResource = null;
+let pointerA11yTimeout = null;

 function _sessionUpdated() {
    if (sessionMode.isPrimary)
@@ -180,7 +172,7 @@ function _initializeUI() {
    kbdA11yDialog = new KbdA11yDialog.KbdA11yDialog();
    wm = new WindowManager.WindowManager();
    magnifier = new Magnifier.Magnifier();
-    locatePointer = new LocatePointer.LocatePointer();
+    locatePointer = new LocatePointer.locatePointer();

    if (LoginManager.canLock())
        screenShield = new ScreenShield.ScreenShield();
@@ -200,7 +192,7 @@ function _initializeUI() {
    layoutManager.init();
    overview.init();

-    (new PointerA11yTimeout.PointerA11yTimeout());
+    pointerA11yTimeout = new PointerA11yTimeout.PointerA11yTimeout();

    _a11ySettings = new Gio.Settings({ schema_id: A11Y_SCHEMA });

@@ -235,8 +227,7 @@ function _initializeUI() {
    _startDate = new Date();

    ExtensionDownloader.init();
-    extensionManager = new ExtensionSystem.ExtensionManager();
-    extensionManager.init();
+    ExtensionSystem.init();

    if (sessionMode.isGreeter && screenShield) {
        layoutManager.connect('startup-prepared', () => {
@@ -264,7 +255,7 @@ function _initializeUI() {
        let perfModuleName = GLib.getenv("SHELL_PERF_MODULE");
        if (perfModuleName) {
            let perfOutput = GLib.getenv("SHELL_PERF_OUTPUT");
-            let module = eval(`imports.perf.${perfModuleName};`);
+            let module = eval('imports.perf.' + perfModuleName + ';');
            Scripting.runPerfScript(module, perfOutput);
        }
    });
@@ -400,9 +391,9 @@ function notify(msg, details) {
 function notifyError(msg, details) {
    // Also print to stderr so it's logged somewhere
    if (details)
-        log(`error: ${msg}: ${details}`);
+        log('error: ' + msg + ': ' + details);
    else
-        log(`error: ${msg}`);
+        log('error: ' + msg);

    notify(msg, details);
 }
@@ -666,13 +657,13 @@ function _queueBeforeRedraw(workId) {
 *
 * Returns: A string work identifier
 */
-function initializeDeferredWork(actor, callback) {
+function initializeDeferredWork(actor, callback, props) {
    // Turn into a string so we can use as an object property
-    let workId = `${(++_deferredWorkSequence)}`;
+    let workId = '' + (++_deferredWorkSequence);
    _deferredWorkData[workId] = { 'actor': actor,
                                  'callback': callback };
    actor.connect('notify::mapped', () => {
-        if (!(actor.mapped && _deferredWorkQueue.includes(workId)))
+        if (!(actor.mapped && _deferredWorkQueue.indexOf(workId) >= 0))
            return;
        _queueBeforeRedraw(workId);
    });
@@ -702,7 +693,7 @@ function queueDeferredWork(workId) {
        logError(new Error(message), message);
        return;
    }
-    if (!_deferredWorkQueue.includes(workId))
+    if (_deferredWorkQueue.indexOf(workId) < 0)
        _deferredWorkQueue.push(workId);
    if (data.actor.mapped) {
        _queueBeforeRedraw(workId);
--- a/js/ui/messageList.js
+++ b/js/ui/messageList.js
@@ -4,9 +4,10 @@ const MessageTray = imports.ui.messageTray;
 const Signals = imports.signals;

 const Calendar = imports.ui.calendar;
+const Tweener = imports.ui.tweener;
 const Util = imports.misc.util;

-var MESSAGE_ANIMATION_TIME = 100;
+var MESSAGE_ANIMATION_TIME = 0.1;

 var DEFAULT_EXPAND_LINES = 6;

@@ -32,7 +33,9 @@ function _fixMarkup(text, allowMarkup) {
 }

 var URLHighlighter = class URLHighlighter {
-    constructor(text = '', lineWrap, allowMarkup) {
+    constructor(text, lineWrap, allowMarkup) {
+        if (!text)
+            text = '';
        this.actor = new St.Label({ reactive: true, style_class: 'url-highlighter',
                                    x_expand: true, x_align: Clutter.ActorAlign.START });
        this._linkColor = '#ccccff';
@@ -69,7 +72,7 @@ var URLHighlighter = class URLHighlighter {
            let urlId = this._findUrlAtPos(event);
            if (urlId != -1) {
                let url = this._urls[urlId].url;
-                if (!url.includes(':'))
+                if (url.indexOf(':') == -1)
                    url = 'http://' + url;

                Gio.app_info_launch_default_for_uri(url, global.create_app_launch_context(0, -1));
@@ -129,21 +132,21 @@ var URLHighlighter = class URLHighlighter {
    }

    _findUrlAtPos(event) {
-        let success_;
+        let success;
        let [x, y] = event.get_coords();
-        [success_, x, y] = this.actor.transform_stage_point(x, y);
-        let findPos = -1;
+        [success, x, y] = this.actor.transform_stage_point(x, y);
+        let find_pos = -1;
        for (let i = 0; i < this.actor.clutter_text.text.length; i++) {
-            let [success_, px, py, lineHeight] = this.actor.clutter_text.position_to_coords(i);
-            if (py > y || py + lineHeight < y || x < px)
+            let [success, px, py, line_height] = this.actor.clutter_text.position_to_coords(i);
+            if (py > y || py + line_height < y || x < px)
                continue;
-            findPos = i;
+            find_pos = i;
        }
-        if (findPos != -1) {
+        if (find_pos != -1) {
            for (let i = 0; i < this._urls.length; i++)
-                if (findPos >= this._urls[i].pos &&
-                    this._urls[i].pos + this._urls[i].url.length > findPos)
-                    return i;
+            if (find_pos >= this._urls[i].pos &&
+                this._urls[i].pos + this._urls[i].url.length > find_pos)
+                return i;
        }
        return -1;
    }
@@ -194,14 +197,12 @@ class ScaleLayout extends Clutter.BinLayout {
 });

 var LabelExpanderLayout = GObject.registerClass({
-    Properties: {
-        'expansion': GObject.ParamSpec.double('expansion',
-                                              'Expansion',
-                                              'Expansion of the layout, between 0 (collapsed) ' +
-                                              'and 1 (fully expanded',
-                                              GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
-                                              0, 1, 0)
-    },
+    Properties: { 'expansion': GObject.ParamSpec.double('expansion',
+                                                        'Expansion',
+                                                        'Expansion of the layout, between 0 (collapsed) ' +
+                                                        'and 1 (fully expanded',
+                                                         GObject.ParamFlags.READABLE | GObject.ParamFlags.WRITABLE,
+                                                         0, 1, 0)},
 }, class LabelExpanderLayout extends Clutter.LayoutManager {
    _init(params) {
        this._expansion = 0;
@@ -439,17 +440,15 @@ var Message = class Message {
        }

        if (animate) {
-            this._bodyStack.ease_property('@layout.expansion', 1, {
-                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                duration: MessageTray.ANIMATION_TIME,
-            });
-
+            Tweener.addTween(this._bodyStack.layout_manager,
+                             { expansion: 1,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
            this._actionBin.scale_y = 0;
-            this._actionBin.ease({
-                scale_y: 1,
-                duration: MessageTray.ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(this._actionBin,
+                             { scale_y: 1,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
        } else {
            this._bodyStack.layout_manager.expansion = 1;
            this._actionBin.scale_y = 1;
@@ -460,20 +459,19 @@ var Message = class Message {

    unexpand(animate) {
        if (animate) {
-            this._bodyStack.ease_property('@layout.expansion', 0, {
-                progress_mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                duration: MessageTray.ANIMATION_TIME,
-            });
-
-            this._actionBin.ease({
-                scale_y: 0,
-                duration: MessageTray.ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    this._actionBin.hide();
-                    this.expanded = false;
-                }
-            });
+            Tweener.addTween(this._bodyStack.layout_manager,
+                             { expansion: 0,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad' });
+            Tweener.addTween(this._actionBin,
+                             { scale_y: 0,
+                               time: MessageTray.ANIMATION_TIME,
+                               transition: 'easeOutQuad',
+                               onCompleteScope: this,
+                               onComplete() {
+                                   this._actionBin.hide();
+                                   this.expanded = false;
+                               }});
        } else {
            this._bodyStack.layout_manager.expansion = 0;
            this._actionBin.scale_y = 0;
@@ -584,12 +582,10 @@ var MessageListSection = class MessageListSection {
        this._list.insert_child_at_index(obj.container, index);

        if (animate)
-            obj.container.ease({
-                scale_x: 1,
-                scale_y: 1,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(obj.container, { scale_x: 1,
+                                              scale_y: 1,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad' });
    }

    moveMessage(message, index, animate) {
@@ -602,20 +598,16 @@ var MessageListSection = class MessageListSection {

        let onComplete = () => {
            this._list.set_child_at_index(obj.container, index);
-            obj.container.ease({
-                scale_x: 1,
-                scale_y: 1,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD
-            });
+            Tweener.addTween(obj.container, { scale_x: 1,
+                                              scale_y: 1,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad' });
        };
-        obj.container.ease({
-            scale_x: 0,
-            scale_y: 0,
-            duration: MESSAGE_ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete
-        });
+        Tweener.addTween(obj.container, { scale_x: 0,
+                                          scale_y: 0,
+                                          time: MESSAGE_ANIMATION_TIME,
+                                          transition: 'easeOutQuad',
+                                          onComplete: onComplete });
    }

    removeMessage(message, animate) {
@@ -628,16 +620,13 @@ var MessageListSection = class MessageListSection {
        this._messages.delete(message);

        if (animate) {
-            obj.container.ease({
-                scale_x: 0,
-                scale_y: 0,
-                duration: MESSAGE_ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => {
-                    obj.container.destroy();
-                    global.sync_pointer();
-                }
-            });
+            Tweener.addTween(obj.container, { scale_x: 0, scale_y: 0,
+                                              time: MESSAGE_ANIMATION_TIME,
+                                              transition: 'easeOutQuad',
+                                              onComplete() {
+                                                  obj.container.destroy();
+                                                  global.sync_pointer();
+                                              }});
        } else {
            obj.container.destroy();
            global.sync_pointer();
@@ -659,14 +648,15 @@ var MessageListSection = class MessageListSection {
            for (let i = 0; i < messages.length; i++) {
                let message = messages[i];
                let obj = this._messages.get(message);
-                obj.container.ease({
-                    anchor_x: this._list.width,
-                    opacity: 0,
-                    duration: MESSAGE_ANIMATION_TIME,
-                    delay: i * delay,
-                    mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                    onComplete: () => message.close()
-                });
+                Tweener.addTween(obj.container,
+                                 { anchor_x: this._list.width,
+                                   opacity: 0,
+                                   time: MESSAGE_ANIMATION_TIME,
+                                   delay: i * delay,
+                                   transition: 'easeOutQuad',
+                                   onComplete() {
+                                       message.close();
+                                   }});
            }
        }
    }
--- a/js/ui/messageTray.js
+++ b/js/ui/messageTray.js
@@ -1,7 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported NotificationPolicy, NotificationGenericPolicy,
-   NotificationApplicationPolicy, Source, SourceActor, SourceActorWithLabel,
-   SystemNotificationSource, MessageTray */

 const { Clutter, Gio, GLib, GObject, Meta, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -12,14 +9,15 @@ const GnomeSession = imports.misc.gnomeSession;
 const Layout = imports.ui.layout;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

 const SHELL_KEYBINDINGS_SCHEMA = 'org.gnome.shell.keybindings';

-var ANIMATION_TIME = 200;
-var NOTIFICATION_TIMEOUT = 4000;
+var ANIMATION_TIME = 0.2;
+var NOTIFICATION_TIMEOUT = 4;

-var HIDE_TIMEOUT = 200;
-var LONGER_HIDE_TIMEOUT = 600;
+var HIDE_TIMEOUT = 0.2;
+var LONGER_HIDE_TIMEOUT = 0.6;

 var MAX_NOTIFICATIONS_IN_QUEUE = 3;
 var MAX_NOTIFICATIONS_PER_SOURCE = 3;
@@ -220,17 +218,17 @@ class NotificationApplicationPolicy extends NotificationPolicy {

        this._masterSettings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications' });
        this._settings = new Gio.Settings({ schema_id: 'org.gnome.desktop.notifications.application',
-                                            path: `/org/gnome/desktop/notifications/application/${this._canonicalId}/` });
+                                            path: '/org/gnome/desktop/notifications/application/' + this._canonicalId + '/' });

        this._masterSettings.connect('changed', this._changed.bind(this));
        this._settings.connect('changed', this._changed.bind(this));
    }

    store() {
-        this._settings.set_string('application-id', `${this.id}.desktop`);
+        this._settings.set_string('application-id', this.id + '.desktop');

        let apps = this._masterSettings.get_strv('application-children');
-        if (!apps.includes(this._canonicalId)) {
+        if (apps.indexOf(this._canonicalId) < 0) {
            apps.push(this._canonicalId);
            this._masterSettings.set_strv('application-children', apps);
        }
@@ -250,7 +248,7 @@ class NotificationApplicationPolicy extends NotificationPolicy {
    _canonicalizeId(id) {
        // Keys are restricted to lowercase alphanumeric characters and dash,
        // and two dashes cannot be in succession
-        return id.toLowerCase().replace(/[^a-z0-9-]/g, '-').replace(/--+/g, '-');
+        return id.toLowerCase().replace(/[^a-z0-9\-]/g, '-').replace(/--+/g, '-');
    }

    get enable() {
@@ -475,7 +473,9 @@ var Notification = class Notification {
            this.destroy();
    }

-    destroy(reason = NotificationDestroyedReason.DISMISSED) {
+    destroy(reason) {
+        if (!reason)
+            reason = NotificationDestroyedReason.DISMISSED;
        this.emit('destroy', reason);
    }
 };
@@ -590,11 +590,11 @@ class SourceActor extends St.Widget {
        });
        this._actorDestroyed = false;

-        let scaleFactor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
+        let scale_factor = St.ThemeContext.get_for_stage(global.stage).scale_factor;
        this._iconBin = new St.Bin({ x_fill: true,
                                     x_expand: true,
-                                     height: size * scaleFactor,
-                                     width: size * scaleFactor });
+                                     height: size * scale_factor,
+                                     width: size * scale_factor });

        this.add_actor(this._iconBin);

@@ -616,77 +616,6 @@ class SourceActor extends St.Widget {
    }
 });

-var SourceActorWithLabel = GObject.registerClass(
-class SourceActorWithLabel extends SourceActor {
-    _init(source, size) {
-        super._init(source, size);
-
-        this._counterLabel = new St.Label({ x_align: Clutter.ActorAlign.CENTER,
-                                            x_expand: true,
-                                            y_align: Clutter.ActorAlign.CENTER,
-                                            y_expand: true });
-
-        this._counterBin = new St.Bin({ style_class: 'summary-source-counter',
-                                        child: this._counterLabel,
-                                        layout_manager: new Clutter.BinLayout() });
-        this._counterBin.hide();
-
-        this._counterBin.connect('style-changed', () => {
-            let themeNode = this._counterBin.get_theme_node();
-            this._counterBin.translation_x = themeNode.get_length('-shell-counter-overlap-x');
-            this._counterBin.translation_y = themeNode.get_length('-shell-counter-overlap-y');
-        });
-
-        this.add_actor(this._counterBin);
-
-        this._countUpdatedId = this._source.connect('count-updated', this._updateCount.bind(this));
-        this._updateCount();
-
-        this.connect('destroy', () => {
-            this._source.disconnect(this._countUpdatedId);
-        });
-    }
-
-    vfunc_allocate(box, flags) {
-        super.vfunc_allocate(box, flags);
-
-        let childBox = new Clutter.ActorBox();
-
-        let [, , naturalWidth, naturalHeight] = this._counterBin.get_preferred_size();
-        let direction = this.get_text_direction();
-
-        if (direction == Clutter.TextDirection.LTR) {
-            // allocate on the right in LTR
-            childBox.x1 = box.x2 - naturalWidth;
-            childBox.x2 = box.x2;
-        } else {
-            // allocate on the left in RTL
-            childBox.x1 = 0;
-            childBox.x2 = naturalWidth;
-        }
-
-        childBox.y1 = box.y2 - naturalHeight;
-        childBox.y2 = box.y2;
-
-        this._counterBin.allocate(childBox, flags);
-    }
-
-    _updateCount() {
-        if (this._actorDestroyed)
-            return;
-
-        this._counterBin.visible = this._source.countVisible;
-
-        let text;
-        if (this._source.count < 100)
-            text = this._source.count.toString();
-        else
-            text = String.fromCharCode(0x22EF); // midline horizontal ellipsis
-
-        this._counterLabel.set_text(text);
-    }
-});
-
 var Source = class Source {
    constructor(title, iconName) {
        this.SOURCE_ICON_SIZE = 48;
@@ -772,7 +701,7 @@ var Source = class Source {
    }

    pushNotification(notification) {
-        if (this.notifications.includes(notification))
+        if (this.notifications.indexOf(notification) >= 0)
            return;

        while (this.notifications.length >= MAX_NOTIFICATIONS_PER_SOURCE)
@@ -829,7 +758,7 @@ Signals.addSignalMethods(Source.prototype);

 var MessageTray = class MessageTray {
    constructor() {
-        this._presence = new GnomeSession.Presence((proxy, _error) => {
+        this._presence = new GnomeSession.Presence((proxy, error) => {
            this._onStatusChanged(proxy.status);
        });
        this._busy = false;
@@ -988,7 +917,7 @@ var MessageTray = class MessageTray {

    add(source) {
        if (this.contains(source)) {
-            log(`Trying to re-add source ${source.title}`);
+            log('Trying to re-add source ' + source.title);
            return;
        }

@@ -1069,7 +998,7 @@ var MessageTray = class MessageTray {
            // If a new notification is updated while it is being hidden,
            // we stop hiding it and show it again.
            this._updateShowingNotification();
-        } else if (!this._notificationQueue.includes(notification)) {
+        } else if (this._notificationQueue.indexOf(notification) < 0) {
            // If the queue is "full", we skip banner mode and just show a small
            // indicator in the panel; however do make an exception for CRITICAL
            // notifications, as only banner mode allows expansion.
@@ -1129,14 +1058,14 @@ var MessageTray = class MessageTray {
            // this._onNotificationLeftTimeout() to determine if the mouse has moved far enough during the initial timeout for us
            // to consider that the user intended to leave the tray and therefore hide the tray. If the mouse is still
            // close to its previous position, we extend the timeout once.
-            let [x, y] = global.get_pointer();
+            let [x, y, mods] = global.get_pointer();
            this._notificationLeftMouseX = x;
            this._notificationLeftMouseY = y;

            // We wait just a little before hiding the message tray in case the user quickly moves the mouse back into it.
            // We wait for a longer period if the notification popped up where the mouse pointer was already positioned.
            // That gives the user more time to mouse away from the notification and mouse back in in order to expand it.
-            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT : HIDE_TIMEOUT;
+            let timeout = this._useLongerNotificationLeftTimeout ? LONGER_HIDE_TIMEOUT * 1000 : HIDE_TIMEOUT * 1000;
            this._notificationLeftTimeoutId = Mainloop.timeout_add(timeout, this._onNotificationLeftTimeout.bind(this));
            GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
        }
@@ -1158,7 +1087,7 @@ var MessageTray = class MessageTray {
    }

    _onNotificationLeftTimeout() {
-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        // We extend the timeout once if the mouse moved no further than MOUSE_LEFT_ACTOR_THRESHOLD to either side.
        if (this._notificationLeftMouseX > -1 &&
            y < this._notificationLeftMouseY + MOUSE_LEFT_ACTOR_THRESHOLD &&
@@ -1166,8 +1095,8 @@ var MessageTray = class MessageTray {
            x < this._notificationLeftMouseX + MOUSE_LEFT_ACTOR_THRESHOLD &&
            x > this._notificationLeftMouseX - MOUSE_LEFT_ACTOR_THRESHOLD) {
            this._notificationLeftMouseX = -1;
-            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT,
-                                                                   this._onNotificationLeftTimeout.bind(this));
+            this._notificationLeftTimeoutId = Mainloop.timeout_add(LONGER_HIDE_TIMEOUT * 1000,
+                                                             this._onNotificationLeftTimeout.bind(this));
            GLib.Source.set_name_by_id(this._notificationLeftTimeoutId, '[gnome-shell] this._onNotificationLeftTimeout');
        } else {
            this._notificationLeftTimeoutId = 0;
@@ -1248,6 +1177,34 @@ var MessageTray = class MessageTray {
        this._notificationExpired = false;
    }

+    _tween(actor, statevar, value, params) {
+        let onComplete = params.onComplete;
+        let onCompleteScope = params.onCompleteScope;
+        let onCompleteParams = params.onCompleteParams;
+
+        params.onComplete = this._tweenComplete;
+        params.onCompleteScope = this;
+        params.onCompleteParams = [statevar, value, onComplete, onCompleteScope, onCompleteParams];
+
+        // Remove other tweens that could mess with the state machine
+        Tweener.removeTweens(actor);
+        Tweener.addTween(actor, params);
+
+        let valuing = (value == State.SHOWN) ? State.SHOWING : State.HIDING;
+        this[statevar] = valuing;
+    }
+
+    _tweenComplete(statevar, value, onComplete, onCompleteScope, onCompleteParams) {
+        this[statevar] = value;
+        if (onComplete)
+            onComplete.apply(onCompleteScope, onCompleteParams);
+        this._updateState();
+    }
+
+    _clampOpacity() {
+        this._bannerBin.opacity = Math.max(0, Math.min(this._bannerBin._opacity, 255));
+    }
+
    _onIdleMonitorBecameActive() {
        this._userActiveWhileNotificationShown = true;
        this._updateNotificationTimeout(2000);
@@ -1274,6 +1231,7 @@ var MessageTray = class MessageTray {

        this._bannerBin.add_actor(this._banner.actor);

+        this._bannerBin._opacity = 0;
        this._bannerBin.opacity = 0;
        this._bannerBin.y = -this._banner.actor.height;
        this.actor.show();
@@ -1281,7 +1239,7 @@ var MessageTray = class MessageTray {
        Meta.disable_unredirect_for_display(global.display);
        this._updateShowingNotification();

-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        // We save the position of the mouse at the time when we started showing the notification
        // in order to determine if the notification popped up under it. We make that check if
        // the user starts moving the mouse and _onNotificationHoverChanged() gets called. We don't
@@ -1319,28 +1277,22 @@ var MessageTray = class MessageTray {
        // We use this._showNotificationCompleted() onComplete callback to extend the time the updated
        // notification is being shown.

-        this._notificationState = State.SHOWING;
-        this._bannerBin.remove_all_transitions();
-        this._bannerBin.ease({
-            opacity: 255,
-            duration: ANIMATION_TIME,
-            mode: Clutter.AnimationMode.LINEAR
-        });
-        this._bannerBin.ease({
-            y: 0,
-            duration: ANIMATION_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_BACK,
-            onComplete: () => {
-                this._notificationState = State.SHOWN;
-                this._showNotificationCompleted();
-                this._updateState();
-            }
-        });
+        let tweenParams = { y: 0,
+                            _opacity: 255,
+                            time: ANIMATION_TIME,
+                            transition: 'easeOutBack',
+                            onUpdate: this._clampOpacity,
+                            onUpdateScope: this,
+                            onComplete: this._showNotificationCompleted,
+                            onCompleteScope: this
+                          };
+
+        this._tween(this._bannerBin, '_notificationState', State.SHOWN, tweenParams);
    }

    _showNotificationCompleted() {
        if (this._notification.urgency != Urgency.CRITICAL)
-            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT);
+            this._updateNotificationTimeout(NOTIFICATION_TIMEOUT * 1000);
    }

    _updateNotificationTimeout(timeout) {
@@ -1357,7 +1309,7 @@ var MessageTray = class MessageTray {
    }

    _notificationTimeout() {
-        let [x, y] = global.get_pointer();
+        let [x, y, mods] = global.get_pointer();
        if (y < this._lastSeenMouseY - 10 && !this._notificationHovered) {
            // The mouse is moving towards the notification, so don't
            // hide it yet. (We just create a new timeout (and destroy
@@ -1393,26 +1345,20 @@ var MessageTray = class MessageTray {
        }

        this._resetNotificationLeftTimeout();
-        this._bannerBin.remove_all_transitions();

        if (animate) {
-            this._notificationState = State.HIDING;
-            this._bannerBin.ease({
-                opacity: 0,
-                duration: ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_BACK
-            });
-            this._bannerBin.ease({
-                y: -this._bannerBin.height,
-                duration: ANIMATION_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_BACK,
-                onComplete: () => {
-                    this._notificationState = State.HIDDEN;
-                    this._hideNotificationCompleted();
-                    this._updateState();
-                }
-            });
+            this._tween(this._bannerBin, '_notificationState', State.HIDDEN,
+                        { y: -this._bannerBin.height,
+                          _opacity: 0,
+                          time: ANIMATION_TIME,
+                          transition: 'easeOutBack',
+                          onUpdate: this._clampOpacity,
+                          onUpdateScope: this,
+                          onComplete: this._hideNotificationCompleted,
+                          onCompleteScope: this
+                        });
        } else {
+            Tweener.removeTweens(this._bannerBin);
            this._bannerBin.y = -this._bannerBin.height;
            this._bannerBin.opacity = 0;
            this._notificationState = State.HIDDEN;
--- a/js/ui/modalDialog.js
+++ b/js/ui/modalDialog.js
@@ -1,16 +1,17 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported ModalDialog */

 const { Atk, Clutter, GObject, Shell, St } = imports.gi;
+const Signals = imports.signals;

 const Dialog = imports.ui.dialog;
 const Layout = imports.ui.layout;
 const Lightbox = imports.ui.lightbox;
 const Main = imports.ui.main;
 const Params = imports.misc.params;
+const Tweener = imports.ui.tweener;

-var OPEN_AND_CLOSE_TIME = 100;
-var FADE_OUT_DIALOG_TIME = 1000;
+var OPEN_AND_CLOSE_TIME = 0.1;
+var FADE_OUT_DIALOG_TIME = 1.0;

 var State = {
    OPENED: 0,
@@ -21,13 +22,11 @@ var State = {
 };

 var ModalDialog = GObject.registerClass({
-    Properties: {
-        'state': GObject.ParamSpec.int('state', 'Dialog state', 'state',
-                                       GObject.ParamFlags.READABLE,
-                                       Math.min(...Object.values(State)),
-                                       Math.max(...Object.values(State)),
-                                       State.CLOSED)
-    },
+    Properties: { 'state': GObject.ParamSpec.int('state', 'Dialog state', 'state',
+                                                 GObject.ParamFlags.READABLE,
+                                                 Math.min(...Object.values(State)),
+                                                 Math.max(...Object.values(State)),
+                                                 State.CLOSED) },
    Signals: { 'opened': {}, 'closed': {} }
 }, class ModalDialog extends St.Widget {
    _init(params) {
@@ -124,15 +123,15 @@ var ModalDialog = GObject.registerClass({
            this._lightbox.show();
        this.opacity = 0;
        this.show();
-        this.ease({
-            opacity: 255,
-            duration: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => {
-                this._setState(State.OPENED);
-                this.emit('opened');
-            }
-        });
+        Tweener.addTween(this,
+                         { opacity: 255,
+                           time: this._shouldFadeIn ? OPEN_AND_CLOSE_TIME : 0,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this._setState(State.OPENED);
+                               this.emit('opened');
+                           }
+                         });
    }

    setInitialKeyFocus(actor) {
@@ -175,16 +174,15 @@ var ModalDialog = GObject.registerClass({
        this.popModal(timestamp);
        this._savedKeyFocus = null;

-        if (this._shouldFadeOut) {
-            this.ease({
-                opacity: 0,
-                duration: OPEN_AND_CLOSE_TIME,
-                mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-                onComplete: () => this._closeComplete()
-            });
-        } else {
+        if (this._shouldFadeOut)
+            Tweener.addTween(this,
+                             { opacity: 0,
+                               time: OPEN_AND_CLOSE_TIME,
+                               transition: 'easeOutQuad',
+                               onComplete: this._closeComplete.bind(this)
+                             })
+        else
            this._closeComplete();
-        }
    }

    // Drop modal status without closing the dialog; this makes the
@@ -249,11 +247,13 @@ var ModalDialog = GObject.registerClass({
            return;

        this.popModal(timestamp);
-        this.dialogLayout.ease({
-            opacity: 0,
-            duration: FADE_OUT_DIALOG_TIME,
-            mode: Clutter.AnimationMode.EASE_OUT_QUAD,
-            onComplete: () => this.state = State.FADED_OUT
-        });
+        Tweener.addTween(this.dialogLayout,
+                         { opacity: 0,
+                           time:    FADE_OUT_DIALOG_TIME,
+                           transition: 'easeOutQuad',
+                           onComplete: () => {
+                               this._setState(State.FADED_OUT);
+                           }
+                         });
    }
 });
--- a/js/ui/mpris.js
+++ b/js/ui/mpris.js
@@ -1,4 +1,3 @@
-/* exported MediaSection */
 const { Gio, Shell, St } = imports.gi;
 const Signals = imports.signals;

@@ -136,7 +135,7 @@ var MprisPlayer = class MprisPlayer {
        // so prefer activating the app via .desktop file if possible
        let app = null;
        if (this._mprisProxy.DesktopEntry) {
-            let desktopId = `${this._mprisProxy.DesktopEntry}.desktop`;
+            let desktopId = this._mprisProxy.DesktopEntry + '.desktop';
            app = Shell.AppSystem.get_default().lookup_app(desktopId);
        }

--- a/js/ui/notificationDaemon.js
+++ b/js/ui/notificationDaemon.js
@@ -1,5 +1,4 @@
 // -*- mode: js; js-indent-level: 4; indent-tabs-mode: nil -*-
-/* exported NotificationDaemon */

 const { GdkPixbuf, Gio, GLib, Shell, St } = imports.gi;
 const Mainloop = imports.mainloop;
@@ -65,7 +64,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
    _imageForNotificationData(hints) {
        if (hints['image-data']) {
            let [width, height, rowStride, hasAlpha,
-                 bitsPerSample, nChannels_, data] = hints['image-data'];
+                 bitsPerSample, nChannels, data] = hints['image-data'];
            return Shell.util_create_pixbuf_from_data(data, GdkPixbuf.Colorspace.RGB, hasAlpha,
                                                      bitsPerSample, width, height, rowStride);
        } else if (hints['image-path']) {
@@ -77,13 +76,13 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
    _fallbackIconForNotificationData(hints) {
        let stockIcon;
        switch (hints.urgency) {
-        case Urgency.LOW:
-        case Urgency.NORMAL:
-            stockIcon = 'dialog-information';
-            break;
-        case Urgency.CRITICAL:
-            stockIcon = 'dialog-error';
-            break;
+            case Urgency.LOW:
+            case Urgency.NORMAL:
+                stockIcon = 'dialog-information';
+                break;
+            case Urgency.CRITICAL:
+                stockIcon = 'dialog-error';
+                break;
        }
        return new Gio.ThemedIcon({ name: stockIcon });
    }
@@ -171,11 +170,11 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
            // Ignore replacesId since we already sent back a
            // NotificationClosed for that id.
            id = this._nextNotificationId++;
-            let idleId = Mainloop.idle_add(() => {
+            let idle_id = Mainloop.idle_add(() => {
                this._emitNotificationClosed(id, NotificationClosedReason.DISMISSED);
                return GLib.SOURCE_REMOVE;
            });
-            GLib.Source.set_name_by_id(idleId, '[gnome-shell] this._emitNotificationClosed');
+            GLib.Source.set_name_by_id(idle_id, '[gnome-shell] this._emitNotificationClosed');
            return invocation.return_value(GLib.Variant.new('(u)', [id]));
        }

@@ -232,7 +231,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
            // There's already a pending call to GetConnectionUnixProcessID,
            // which will see the new notification data when it finishes,
            // so we don't have to do anything.
-            return invocation.return_value(GLib.Variant.new('(u)', [id]));
+            return invocation.return_value(GLib.Variant.new('(u)', [id]));;
        }

        this._busProxy.GetConnectionUnixProcessIDRemote(sender, (result, excp) => {
@@ -260,7 +259,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
    }

    _notifyForSource(source, ndata) {
-        let [id_, icon, summary, body, actions, hints, notification] =
+        let [id, icon, summary, body, actions, hints, notification] =
            [ndata.id, ndata.icon, ndata.summary, ndata.body,
             ndata.actions, ndata.hints, ndata.notification];

@@ -271,15 +270,15 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
                delete this._notifications[ndata.id];
                let notificationClosedReason;
                switch (reason) {
-                case MessageTray.NotificationDestroyedReason.EXPIRED:
-                    notificationClosedReason = NotificationClosedReason.EXPIRED;
-                    break;
-                case MessageTray.NotificationDestroyedReason.DISMISSED:
-                    notificationClosedReason = NotificationClosedReason.DISMISSED;
-                    break;
-                case MessageTray.NotificationDestroyedReason.SOURCE_CLOSED:
-                    notificationClosedReason = NotificationClosedReason.APP_CLOSED;
-                    break;
+                    case MessageTray.NotificationDestroyedReason.EXPIRED:
+                        notificationClosedReason = NotificationClosedReason.EXPIRED;
+                        break;
+                    case MessageTray.NotificationDestroyedReason.DISMISSED:
+                        notificationClosedReason = NotificationClosedReason.DISMISSED;
+                        break;
+                    case MessageTray.NotificationDestroyedReason.SOURCE_CLOSED:
+                        notificationClosedReason = NotificationClosedReason.APP_CLOSED;
+                        break;
                }
                this._emitNotificationClosed(ndata.id, notificationClosedReason);
            });
@@ -310,7 +309,7 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {

        if (actions.length) {
            for (let i = 0; i < actions.length - 1; i += 2) {
-                let [actionId, label] = [actions[i], actions[i + 1]];
+                let [actionId, label] = [actions[i], actions[i+1]];
                if (actionId == 'default')
                    hasDefaultAction = true;
                else
@@ -331,15 +330,15 @@ var FdoNotificationDaemon = class FdoNotificationDaemon {
        }

        switch (hints.urgency) {
-        case Urgency.LOW:
-            notification.setUrgency(MessageTray.Urgency.LOW);
-            break;
-        case Urgency.NORMAL:
-            notification.setUrgency(MessageTray.Urgency.NORMAL);
-            break;
-        case Urgency.CRITICAL:
-            notification.setUrgency(MessageTray.Urgency.CRITICAL);
-            break;
+            case Urgency.LOW:
+                notification.setUrgency(MessageTray.Urgency.LOW);
+                break;
+            case Urgency.NORMAL:
+                notification.setUrgency(MessageTray.Urgency.NORMAL);
+                break;
+            case Urgency.CRITICAL:
+                notification.setUrgency(MessageTray.Urgency.CRITICAL);
+                break;
        }
        notification.setResident(!!hints.resident);
        // 'transient' is a reserved keyword in JS, so we have to retrieve the value
@@ -438,7 +437,7 @@ class FdoNotificationDaemonSource extends MessageTray.Source {

    _createPolicy() {
        if (this.app && this.app.get_app_info()) {
-            let id = this.app.get_id().replace(/\.desktop$/, '');
+            let id = this.app.get_id().replace(/\.desktop$/,'');
            return new MessageTray.NotificationApplicationPolicy(id);
        } else {
            return new MessageTray.NotificationGenericPolicy();
@@ -475,7 +474,7 @@ class FdoNotificationDaemonSource extends MessageTray.Source {
            return app;

        if (appId) {
-            app = Shell.AppSystem.get_default().lookup_app(`${appId}.desktop`);
+            app = Shell.AppSystem.get_default().lookup_app(appId + '.desktop');
            if (app != null)
                return app;
        }
@@ -574,7 +573,7 @@ class GtkNotificationDaemonNotification extends MessageTray.Notification {

        this.update(title.unpack(), body ? body.unpack() : null,
                    { gicon: gicon ? Gio.icon_deserialize(gicon) : null,
-                      datetime: time ? GLib.DateTime.new_from_unix_local(time.unpack()) : null });
+                      datetime : time ? GLib.DateTime.new_from_unix_local(time.unpack()) : null });
    }

    _activateAction(namespacedActionId, target) {
@@ -611,7 +610,7 @@ function objectPathFromAppId(appId) {
 }

 function getPlatformData() {
-    let startupId = GLib.Variant.new('s', `_TIME${global.get_current_time()}`);
+    let startupId = GLib.Variant.new('s', '_TIME' + global.get_current_time());
    return { "desktop-startup-id": startupId };
 }

@@ -624,7 +623,7 @@ class GtkNotificationDaemonAppSource extends MessageTray.Source {
        if (!GLib.Variant.is_object_path(objectPath))
            throw new InvalidAppError();

-        let app = Shell.AppSystem.get_default().lookup_app(`${appId}.desktop`);
+        let app = Shell.AppSystem.get_default().lookup_app(appId + '.desktop');
        if (!app)
            throw new InvalidAppError();

@@ -750,33 +749,29 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
    _loadNotifications() {
        this._isLoading = true;

-        try {
-            let value = global.get_persistent_state('a(sa(sv))', 'notifications');
-            if (value) {
-                let sources = value.deep_unpack();
-                sources.forEach(([appId, notifications]) => {
-                    if (notifications.length == 0)
+        let value = global.get_persistent_state('a(sa(sv))', 'notifications');
+        if (value) {
+            let sources = value.deep_unpack();
+            sources.forEach(([appId, notifications]) => {
+                if (notifications.length == 0)
+                    return;
+
+                let source;
+                try {
+                    source = this._ensureAppSource(appId);
+                } catch(e) {
+                    if (e instanceof InvalidAppError)
                        return;
+                    throw e;
+                }

-                    let source;
-                    try {
-                        source = this._ensureAppSource(appId);
-                    } catch (e) {
-                        if (e instanceof InvalidAppError)
-                            return;
-                        throw e;
-                    }
-
-                    notifications.forEach(([notificationId, notification]) => {
-                        source.addNotification(notificationId, notification.deep_unpack(), false);
-                    });
+                notifications.forEach(([notificationId, notification]) => {
+                    source.addNotification(notificationId, notification.deep_unpack(), false);
                });
-            }
-        } catch (e) {
-            logError(e, 'Failed to load saved notifications');
-        } finally {
-            this._isLoading = false;
+            });
        }
+
+        this._isLoading = false;
    }

    _saveNotifications() {
@@ -798,7 +793,7 @@ var GtkNotificationDaemon = class GtkNotificationDaemon {
        let source;
        try {
            source = this._ensureAppSource(appId);
-        } catch (e) {
+        } catch(e) {
            if (e instanceof InvalidAppError) {
                invocation.return_dbus_error('org.gtk.Notifications.InvalidApp', 'The app by ID "%s" could not be found'.format(appId));
                return;
--- a/Show More
+++ b/Show More